diff options
Diffstat (limited to 'bzip2')
45 files changed, 49619 insertions, 0 deletions
diff --git a/bzip2/CHANGES b/bzip2/CHANGES new file mode 100644 index 000000000..ecaf4170e --- /dev/null +++ b/bzip2/CHANGES @@ -0,0 +1,167 @@ + + +0.9.0 +~~~~~ +First version. + + +0.9.0a +~~~~~~ +Removed 'ranlib' from Makefile, since most modern Unix-es +don't need it, or even know about it. + + +0.9.0b +~~~~~~ +Fixed a problem with error reporting in bzip2.c. This does not effect +the library in any way. Problem is: versions 0.9.0 and 0.9.0a (of the +program proper) compress and decompress correctly, but give misleading +error messages (internal panics) when an I/O error occurs, instead of +reporting the problem correctly. This shouldn't give any data loss +(as far as I can see), but is confusing. + +Made the inline declarations disappear for non-GCC compilers. + + +0.9.0c +~~~~~~ +Fixed some problems in the library pertaining to some boundary cases. +This makes the library behave more correctly in those situations. The +fixes apply only to features (calls and parameters) not used by +bzip2.c, so the non-fixedness of them in previous versions has no +effect on reliability of bzip2.c. + +In bzlib.c: + * made zero-length BZ_FLUSH work correctly in bzCompress(). + * fixed bzWrite/bzRead to ignore zero-length requests. + * fixed bzread to correctly handle read requests after EOF. + * wrong parameter order in call to bzDecompressInit in + bzBuffToBuffDecompress. Fixed. + +In compress.c: + * changed setting of nGroups in sendMTFValues() so as to + do a bit better on small files. This _does_ effect + bzip2.c. + + +0.9.5a +~~~~~~ +Major change: add a fallback sorting algorithm (blocksort.c) +to give reasonable behaviour even for very repetitive inputs. +Nuked --repetitive-best and --repetitive-fast since they are +no longer useful. + +Minor changes: mostly a whole bunch of small changes/ +bugfixes in the driver (bzip2.c). Changes pertaining to the +user interface are: + + allow decompression of symlink'd files to stdout + decompress/test files even without .bz2 extension + give more accurate error messages for I/O errors + when compressing/decompressing to stdout, don't catch control-C + read flags from BZIP2 and BZIP environment variables + decline to break hard links to a file unless forced with -f + allow -c flag even with no filenames + preserve file ownerships as far as possible + make -s -1 give the expected block size (100k) + add a flag -q --quiet to suppress nonessential warnings + stop decoding flags after --, so files beginning in - can be handled + resolved inconsistent naming: bzcat or bz2cat ? + bzip2 --help now returns 0 + +Programming-level changes are: + + fixed syntax error in GET_LL4 for Borland C++ 5.02 + let bzBuffToBuffDecompress return BZ_DATA_ERROR{_MAGIC} + fix overshoot of mode-string end in bzopen_or_bzdopen + wrapped bzlib.h in #ifdef __cplusplus ... extern "C" { ... } + close file handles under all error conditions + added minor mods so it compiles with DJGPP out of the box + fixed Makefile so it doesn't give problems with BSD make + fix uninitialised memory reads in dlltest.c + +0.9.5b +~~~~~~ +Open stdin/stdout in binary mode for DJGPP. + +0.9.5c +~~~~~~ +Changed BZ_N_OVERSHOOT to be ... + 2 instead of ... + 1. The + 1 +version could cause the sorted order to be wrong in some extremely +obscure cases. Also changed setting of quadrant in blocksort.c. + +0.9.5d +~~~~~~ +The only functional change is to make bzlibVersion() in the library +return the correct string. This has no effect whatsoever on the +functioning of the bzip2 program or library. Added a couple of casts +so the library compiles without warnings at level 3 in MS Visual +Studio 6.0. Included a Y2K statement in the file Y2K_INFO. All other +changes are minor documentation changes. + +1.0 +~~~ +Several minor bugfixes and enhancements: + +* Large file support. The library uses 64-bit counters to + count the volume of data passing through it. bzip2.c + is now compiled with -D_FILE_OFFSET_BITS=64 to get large + file support from the C library. -v correctly prints out + file sizes greater than 4 gigabytes. All these changes have + been made without assuming a 64-bit platform or a C compiler + which supports 64-bit ints, so, except for the C library + aspect, they are fully portable. + +* Decompression robustness. The library/program should be + robust to any corruption of compressed data, detecting and + handling _all_ corruption, instead of merely relying on + the CRCs. What this means is that the program should + never crash, given corrupted data, and the library should + always return BZ_DATA_ERROR. + +* Fixed an obscure race-condition bug only ever observed on + Solaris, in which, if you were very unlucky and issued + control-C at exactly the wrong time, both input and output + files would be deleted. + +* Don't run out of file handles on test/decompression when + large numbers of files have invalid magic numbers. + +* Avoid library namespace pollution. Prefix all exported + symbols with BZ2_. + +* Minor sorting enhancements from my DCC2000 paper. + +* Advance the version number to 1.0, so as to counteract the + (false-in-this-case) impression some people have that programs + with version numbers less than 1.0 are in someway, experimental, + pre-release versions. + +* Create an initial Makefile-libbz2_so to build a shared library. + Yes, I know I should really use libtool et al ... + +* Make the program exit with 2 instead of 0 when decompression + fails due to a bad magic number (ie, an invalid bzip2 header). + Also exit with 1 (as the manual claims :-) whenever a diagnostic + message would have been printed AND the corresponding operation + is aborted, for example + bzip2: Output file xx already exists. + When a diagnostic message is printed but the operation is not + aborted, for example + bzip2: Can't guess original name for wurble -- using wurble.out + then the exit value 0 is returned, unless some other problem is + also detected. + + I think it corresponds more closely to what the manual claims now. + + +1.0.1 +~~~~~ +* Modified dlltest.c so it uses the new BZ2_ naming scheme. +* Modified makefile-msc to fix minor build probs on Win2k. +* Updated README.COMPILATION.PROBLEMS. + +There are no functionality changes or bug fixes relative to version +1.0.0. This is just a documentation update + a fix for minor Win32 +build problems. For almost everyone, upgrading from 1.0.0 to 1.0.1 is +utterly pointless. Don't bother. diff --git a/bzip2/LICENSE b/bzip2/LICENSE new file mode 100644 index 000000000..88fa6d88a --- /dev/null +++ b/bzip2/LICENSE @@ -0,0 +1,39 @@ + +This program, "bzip2" and associated library "libbzip2", are +copyright (C) 1996-2000 Julian R Seward. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: + +1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + +3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + +4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS +OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, +WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Julian Seward, Cambridge, UK. +jseward@acm.org +bzip2/libbzip2 version 1.0 of 21 March 2000 + diff --git a/bzip2/Makefile b/bzip2/Makefile new file mode 100644 index 000000000..ab17f4979 --- /dev/null +++ b/bzip2/Makefile @@ -0,0 +1,141 @@ + +SHELL=/bin/sh +CC=gcc +BIGFILES=-D_FILE_OFFSET_BITS=64 +CFLAGS=-Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce $(BIGFILES) + +OBJS= blocksort.o \ + huffman.o \ + crctable.o \ + randtable.o \ + compress.o \ + decompress.o \ + bzlib.o + +all: libbz2.a bzip2 bzip2recover test + +bzip2: libbz2.a bzip2.o + $(CC) $(CFLAGS) -o bzip2 bzip2.o -L. -lbz2 + +bzip2recover: bzip2recover.o + $(CC) $(CFLAGS) -o bzip2recover bzip2recover.o + +libbz2.a: $(OBJS) + rm -f libbz2.a + ar cq libbz2.a $(OBJS) + @if ( test -f /usr/bin/ranlib -o -f /bin/ranlib -o \ + -f /usr/ccs/bin/ranlib ) ; then \ + echo ranlib libbz2.a ; \ + ranlib libbz2.a ; \ + fi + +test: bzip2 + @cat words1 + ./bzip2 -1 < sample1.ref > sample1.rb2 + ./bzip2 -2 < sample2.ref > sample2.rb2 + ./bzip2 -3 < sample3.ref > sample3.rb2 + ./bzip2 -d < sample1.bz2 > sample1.tst + ./bzip2 -d < sample2.bz2 > sample2.tst + ./bzip2 -ds < sample3.bz2 > sample3.tst + cmp sample1.bz2 sample1.rb2 + cmp sample2.bz2 sample2.rb2 + cmp sample3.bz2 sample3.rb2 + cmp sample1.tst sample1.ref + cmp sample2.tst sample2.ref + cmp sample3.tst sample3.ref + @cat words3 + +PREFIX=/usr + +install: bzip2 bzip2recover + if ( test ! -d $(PREFIX)/bin ) ; then mkdir $(PREFIX)/bin ; fi + if ( test ! -d $(PREFIX)/lib ) ; then mkdir $(PREFIX)/lib ; fi + if ( test ! -d $(PREFIX)/man ) ; then mkdir $(PREFIX)/man ; fi + if ( test ! -d $(PREFIX)/man/man1 ) ; then mkdir $(PREFIX)/man/man1 ; fi + if ( test ! -d $(PREFIX)/include ) ; then mkdir $(PREFIX)/include ; fi + cp -f bzip2 $(PREFIX)/bin/bzip2 + cp -f bzip2 $(PREFIX)/bin/bunzip2 + cp -f bzip2 $(PREFIX)/bin/bzcat + cp -f bzip2recover $(PREFIX)/bin/bzip2recover + chmod a+x $(PREFIX)/bin/bzip2 + chmod a+x $(PREFIX)/bin/bunzip2 + chmod a+x $(PREFIX)/bin/bzcat + chmod a+x $(PREFIX)/bin/bzip2recover + cp -f bzip2.1 $(PREFIX)/man/man1 + chmod a+r $(PREFIX)/man/man1/bzip2.1 + cp -f bzlib.h $(PREFIX)/include + chmod a+r $(PREFIX)/include/bzlib.h + cp -f libbz2.a $(PREFIX)/lib + chmod a+r $(PREFIX)/lib/libbz2.a + +clean: + rm -f *.o libbz2.a bzip2 bzip2recover \ + sample1.rb2 sample2.rb2 sample3.rb2 \ + sample1.tst sample2.tst sample3.tst + +blocksort.o: blocksort.c + @cat words0 + $(CC) $(CFLAGS) -c blocksort.c +huffman.o: huffman.c + $(CC) $(CFLAGS) -c huffman.c +crctable.o: crctable.c + $(CC) $(CFLAGS) -c crctable.c +randtable.o: randtable.c + $(CC) $(CFLAGS) -c randtable.c +compress.o: compress.c + $(CC) $(CFLAGS) -c compress.c +decompress.o: decompress.c + $(CC) $(CFLAGS) -c decompress.c +bzlib.o: bzlib.c + $(CC) $(CFLAGS) -c bzlib.c +bzip2.o: bzip2.c + $(CC) $(CFLAGS) -c bzip2.c +bzip2recover.o: bzip2recover.c + $(CC) $(CFLAGS) -c bzip2recover.c + +DISTNAME=bzip2-1.0.1 +tarfile: + rm -f $(DISTNAME) + ln -sf . $(DISTNAME) + tar cvf $(DISTNAME).tar \ + $(DISTNAME)/blocksort.c \ + $(DISTNAME)/huffman.c \ + $(DISTNAME)/crctable.c \ + $(DISTNAME)/randtable.c \ + $(DISTNAME)/compress.c \ + $(DISTNAME)/decompress.c \ + $(DISTNAME)/bzlib.c \ + $(DISTNAME)/bzip2.c \ + $(DISTNAME)/bzip2recover.c \ + $(DISTNAME)/bzlib.h \ + $(DISTNAME)/bzlib_private.h \ + $(DISTNAME)/Makefile \ + $(DISTNAME)/manual.texi \ + $(DISTNAME)/manual.ps \ + $(DISTNAME)/LICENSE \ + $(DISTNAME)/bzip2.1 \ + $(DISTNAME)/bzip2.1.preformatted \ + $(DISTNAME)/bzip2.txt \ + $(DISTNAME)/words0 \ + $(DISTNAME)/words1 \ + $(DISTNAME)/words2 \ + $(DISTNAME)/words3 \ + $(DISTNAME)/sample1.ref \ + $(DISTNAME)/sample2.ref \ + $(DISTNAME)/sample3.ref \ + $(DISTNAME)/sample1.bz2 \ + $(DISTNAME)/sample2.bz2 \ + $(DISTNAME)/sample3.bz2 \ + $(DISTNAME)/dlltest.c \ + $(DISTNAME)/*.html \ + $(DISTNAME)/README \ + $(DISTNAME)/README.COMPILATION.PROBLEMS \ + $(DISTNAME)/CHANGES \ + $(DISTNAME)/libbz2.def \ + $(DISTNAME)/libbz2.dsp \ + $(DISTNAME)/dlltest.dsp \ + $(DISTNAME)/makefile.msc \ + $(DISTNAME)/Y2K_INFO \ + $(DISTNAME)/unzcrash.c \ + $(DISTNAME)/spewG.c \ + $(DISTNAME)/Makefile-libbz2_so diff --git a/bzip2/Makefile-libbz2_so b/bzip2/Makefile-libbz2_so new file mode 100644 index 000000000..a347c50e9 --- /dev/null +++ b/bzip2/Makefile-libbz2_so @@ -0,0 +1,43 @@ + +# This Makefile builds a shared version of the library, +# libbz2.so.1.0.1, with soname libbz2.so.1.0, +# at least on x86-Linux (RedHat 5.2), +# with gcc-2.7.2.3. Please see the README file for some +# important info about building the library like this. + +SHELL=/bin/sh +CC=gcc +BIGFILES=-D_FILE_OFFSET_BITS=64 +CFLAGS=-fpic -fPIC -Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce $(BIGFILES) + +OBJS= blocksort.o \ + huffman.o \ + crctable.o \ + randtable.o \ + compress.o \ + decompress.o \ + bzlib.o + +all: $(OBJS) + $(CC) -shared -Wl,-soname -Wl,libbz2.so.1.0 -o libbz2.so.1.0.1 $(OBJS) + $(CC) $(CFLAGS) -o bzip2-shared bzip2.c libbz2.so.1.0.1 + rm -f libbz2.so.1.0 + ln -s libbz2.so.1.0.1 libbz2.so.1.0 + +clean: + rm -f $(OBJS) bzip2.o libbz2.so.1.0.1 libbz2.so.1.0 bzip2-shared + +blocksort.o: blocksort.c + $(CC) $(CFLAGS) -c blocksort.c +huffman.o: huffman.c + $(CC) $(CFLAGS) -c huffman.c +crctable.o: crctable.c + $(CC) $(CFLAGS) -c crctable.c +randtable.o: randtable.c + $(CC) $(CFLAGS) -c randtable.c +compress.o: compress.c + $(CC) $(CFLAGS) -c compress.c +decompress.o: decompress.c + $(CC) $(CFLAGS) -c decompress.c +bzlib.o: bzlib.c + $(CC) $(CFLAGS) -c bzlib.c diff --git a/bzip2/README b/bzip2/README new file mode 100644 index 000000000..22945a256 --- /dev/null +++ b/bzip2/README @@ -0,0 +1,166 @@ + +This is the README for bzip2, a block-sorting file compressor, version +1.0. This version is fully compatible with the previous public +releases, bzip2-0.1pl2, bzip2-0.9.0 and bzip2-0.9.5. + +bzip2-1.0 is distributed under a BSD-style license. For details, +see the file LICENSE. + +Complete documentation is available in Postscript form (manual.ps) or +html (manual_toc.html). A plain-text version of the manual page is +available as bzip2.txt. A statement about Y2K issues is now included +in the file Y2K_INFO. + + +HOW TO BUILD -- UNIX + +Type `make'. This builds the library libbz2.a and then the +programs bzip2 and bzip2recover. Six self-tests are run. +If the self-tests complete ok, carry on to installation: + +To install in /usr/bin, /usr/lib, /usr/man and /usr/include, type + make install +To install somewhere else, eg, /xxx/yyy/{bin,lib,man,include}, type + make install PREFIX=/xxx/yyy +If you are (justifiably) paranoid and want to see what 'make install' +is going to do, you can first do + make -n install or + make -n install PREFIX=/xxx/yyy respectively. +The -n instructs make to show the commands it would execute, but +not actually execute them. + + +HOW TO BUILD -- UNIX, shared library libbz2.so. + +Do 'make -f Makefile-libbz2_so'. This Makefile seems to work for +Linux-ELF (RedHat 5.2 on an x86 box), with gcc. I make no claims +that it works for any other platform, though I suspect it probably +will work for most platforms employing both ELF and gcc. + +bzip2-shared, a client of the shared library, is also build, but +not self-tested. So I suggest you also build using the normal +Makefile, since that conducts a self-test. + +Important note for people upgrading .so's from 0.9.0/0.9.5 to +version 1.0. All the functions in the library have been renamed, +from (eg) bzCompress to BZ2_bzCompress, to avoid namespace pollution. +Unfortunately this means that the libbz2.so created by +Makefile-libbz2_so will not work with any program which used an +older version of the library. Sorry. I do encourage library +clients to make the effort to upgrade to use version 1.0, since +it is both faster and more robust than previous versions. + + +HOW TO BUILD -- Windows 95, NT, DOS, Mac, etc. + +It's difficult for me to support compilation on all these platforms. +My approach is to collect binaries for these platforms, and put them +on the master web page (http://sourceware.cygnus.com/bzip2). Look +there. However (FWIW), bzip2-1.0 is very standard ANSI C and should +compile unmodified with MS Visual C. For Win32, there is one +important caveat: in bzip2.c, you must set BZ_UNIX to 0 and +BZ_LCCWIN32 to 1 before building. If you have difficulties building, +you might want to read README.COMPILATION.PROBLEMS. + + +VALIDATION + +Correct operation, in the sense that a compressed file can always be +decompressed to reproduce the original, is obviously of paramount +importance. To validate bzip2, I used a modified version of Mark +Nelson's churn program. Churn is an automated test driver which +recursively traverses a directory structure, using bzip2 to compress +and then decompress each file it encounters, and checking that the +decompressed data is the same as the original. There are more details +in Section 4 of the user guide. + + + +Please read and be aware of the following: + +WARNING: + + This program (attempts to) compress data by performing several + non-trivial transformations on it. Unless you are 100% familiar + with *all* the algorithms contained herein, and with the + consequences of modifying them, you should NOT meddle with the + compression or decompression machinery. Incorrect changes can and + very likely *will* lead to disastrous loss of data. + + +DISCLAIMER: + + I TAKE NO RESPONSIBILITY FOR ANY LOSS OF DATA ARISING FROM THE + USE OF THIS PROGRAM, HOWSOEVER CAUSED. + + Every compression of a file implies an assumption that the + compressed file can be decompressed to reproduce the original. + Great efforts in design, coding and testing have been made to + ensure that this program works correctly. However, the complexity + of the algorithms, and, in particular, the presence of various + special cases in the code which occur with very low but non-zero + probability make it impossible to rule out the possibility of bugs + remaining in the program. DO NOT COMPRESS ANY DATA WITH THIS + PROGRAM UNLESS YOU ARE PREPARED TO ACCEPT THE POSSIBILITY, HOWEVER + SMALL, THAT THE DATA WILL NOT BE RECOVERABLE. + + That is not to say this program is inherently unreliable. Indeed, + I very much hope the opposite is true. bzip2 has been carefully + constructed and extensively tested. + + +PATENTS: + + To the best of my knowledge, bzip2 does not use any patented + algorithms. However, I do not have the resources available to + carry out a full patent search. Therefore I cannot give any + guarantee of the above statement. + +End of legalities. + + +WHAT'S NEW IN 0.9.0 (as compared to 0.1pl2) ? + + * Approx 10% faster compression, 30% faster decompression + * -t (test mode) is a lot quicker + * Can decompress concatenated compressed files + * Programming interface, so programs can directly read/write .bz2 files + * Less restrictive (BSD-style) licensing + * Flag handling more compatible with GNU gzip + * Much more documentation, i.e., a proper user manual + * Hopefully, improved portability (at least of the library) + +WHAT'S NEW IN 0.9.5 ? + + * Compression speed is much less sensitive to the input + data than in previous versions. Specifically, the very + slow performance caused by repetitive data is fixed. + * Many small improvements in file and flag handling. + * A Y2K statement. + +WHAT'S NEW IN 1.0 + + See the CHANGES file. + +I hope you find bzip2 useful. Feel free to contact me at + jseward@acm.org +if you have any suggestions or queries. Many people mailed me with +comments, suggestions and patches after the releases of bzip-0.15, +bzip-0.21, bzip2-0.1pl2 and bzip2-0.9.0, and the changes in bzip2 are +largely a result of this feedback. I thank you for your comments. + +At least for the time being, bzip2's "home" is (or can be reached via) +http://www.muraroa.demon.co.uk. + +Julian Seward +jseward@acm.org + +Cambridge, UK +18 July 1996 (version 0.15) +25 August 1996 (version 0.21) + 7 August 1997 (bzip2, version 0.1) +29 August 1997 (bzip2, version 0.1pl2) +23 August 1998 (bzip2, version 0.9.0) + 8 June 1999 (bzip2, version 0.9.5) + 4 Sept 1999 (bzip2, version 0.9.5d) + 5 May 2000 (bzip2, version 1.0pre8) diff --git a/bzip2/README.COMPILATION.PROBLEMS b/bzip2/README.COMPILATION.PROBLEMS new file mode 100644 index 000000000..d621ad597 --- /dev/null +++ b/bzip2/README.COMPILATION.PROBLEMS @@ -0,0 +1,130 @@ + +bzip2-1.0 should compile without problems on the vast majority of +platforms. Using the supplied Makefile, I've built and tested it +myself for x86-linux, sparc-solaris, alpha-linux, x86-cygwin32 and +alpha-tru64unix. With makefile.msc, Visual C++ 6.0 and nmake, you can +build a native Win32 version too. Large file support seems to work +correctly on at least alpha-tru64unix and x86-cygwin32 (on Windows +2000). + +When I say "large file" I mean a file of size 2,147,483,648 (2^31) +bytes or above. Many older OSs can't handle files above this size, +but many newer ones can. Large files are pretty huge -- most files +you'll encounter are not Large Files. + +Earlier versions of bzip2 (0.1, 0.9.0, 0.9.5) compiled on a wide +variety of platforms without difficulty, and I hope this version will +continue in that tradition. However, in order to support large files, +I've had to include the define -D_FILE_OFFSET_BITS=64 in the Makefile. +This can cause problems. + +The technique of adding -D_FILE_OFFSET_BITS=64 to get large file +support is, as far as I know, the Recommended Way to get correct large +file support. For more details, see the Large File Support +Specification, published by the Large File Summit, at + http://www.sas.com/standard/large.file/ + +As a general comment, if you get compilation errors which you think +are related to large file support, try removing the above define from +the Makefile, ie, delete the line + BIGFILES=-D_FILE_OFFSET_BITS=64 +from the Makefile, and do 'make clean ; make'. This will give you a +version of bzip2 without large file support, which, for most +applications, is probably not a problem. + +Alternatively, try some of the platform-specific hints listed below. + +You can use the spewG.c program to generate huge files to test bzip2's +large file support, if you are feeling paranoid. Be aware though that +any compilation problems which affect bzip2 will also affect spewG.c, +alas. + + +Known problems as of 1.0pre8: +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +* HP/UX 10.20 and 11.00, using gcc (2.7.2.3 and 2.95.2): A large + number of warnings appear, including the following: + + /usr/include/sys/resource.h: In function `getrlimit': + /usr/include/sys/resource.h:168: + warning: implicit declaration of function `__getrlimit64' + /usr/include/sys/resource.h: In function `setrlimit': + /usr/include/sys/resource.h:170: + warning: implicit declaration of function `__setrlimit64' + + This would appear to be a problem with large file support, header + files and gcc. gcc may or may not give up at this point. If it + fails, you might be able to improve matters by adding + -D__STDC_EXT__=1 + to the BIGFILES variable in the Makefile (ie, change its definition + to + BIGFILES=-D_FILE_OFFSET_BITS=64 -D__STDC_EXT__=1 + + Even if gcc does produce a binary which appears to work (ie passes + its self-tests), you might want to test it to see if it works properly + on large files. + + +* HP/UX 10.20 and 11.00, using HP's cc compiler. + + No specific problems for this combination, except that you'll need to + specify the -Ae flag, and zap the gcc-specific stuff + -Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce. + You should retain -D_FILE_OFFSET_BITS=64 in order to get large + file support -- which is reported to work ok for this HP/UX + cc + combination. + + +* SunOS 4.1.X. + + Amazingly, there are still people out there using this venerable old + banger. I shouldn't be too rude -- I started life on SunOS, and + it was a pretty darn good OS, way back then. Anyway: + + SunOS doesn't seem to have strerror(), so you'll have to use + perror(), perhaps by doing adding this (warning: UNTESTED CODE): + + char* strerror ( int errnum ) + { + if (errnum < 0 || errnum >= sys_nerr) + return "Unknown error"; + else + return sys_errlist[errnum]; + } + + Or you could comment out the relevant calls to strerror; they're + not mission-critical. Or you could upgrade to Solaris. Ha ha ha! + (what?? you think I've got Bad Attitude?) + + +* Making a shared library on Solaris. (Not really a compilation + problem, but many people ask ...) + + Firstly, if you have Solaris 8, either you have libbz2.so already + on your system, or you can install it from the Solaris CD. + + Secondly, be aware that there are potential naming conflicts + between the .so file supplied with Solaris 8, and the .so file + which Makefile-libbz2_so will make. Makefile-libbz2_so creates + a .so which has the names which I intend to be "official" as + of version 1.0.0 and onwards. Unfortunately, the .so in + Solaris 8 appeared before I decided on the final names, so + the two libraries are incompatible. We have since communicated + and I hope that the problems will have been solved in the next + version of Solaris, whenever that might appear. + + All that said: you might be able to get somewhere + by finding the line in Makefile-libbz2_so which says + + $(CC) -shared -Wl,-soname -Wl,libbz2.so.1.0 -o libbz2.so.1.0.1 $(OBJS) + + and replacing with + + ($CC) -G -shared -o libbz2.so.1.0.1 -h libbz2.so.1.0 $(OBJS) + + If gcc objects to the combination -fpic -fPIC, get rid of + the second one, leaving just "-fpic". + + +That's the end of the currently known compilation problems. diff --git a/bzip2/Y2K_INFO b/bzip2/Y2K_INFO new file mode 100644 index 000000000..55fd56a2e --- /dev/null +++ b/bzip2/Y2K_INFO @@ -0,0 +1,34 @@ + +Y2K status of bzip2 and libbzip2, versions 0.1, 0.9.0 and 0.9.5 +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +Informally speaking: + bzip2 is a compression program built on top of libbzip2, + a library which does the real work of compression and + decompression. As far as I am aware, libbzip2 does not have + any date-related code at all. + + bzip2 itself copies dates from source to destination files + when compressing or decompressing, using the 'stat' and 'utime' + UNIX system calls. It doesn't examine, manipulate or store the + dates in any way. So as far as I can see, there shouldn't be any + problem with bzip2 providing 'stat' and 'utime' work correctly + on your system. + + On non-unix platforms (those for which BZ_UNIX in bzip2.c is + not set to 1), bzip2 doesn't even do the date copying. + + Overall, informally speaking, I don't think bzip2 or libbzip2 + have a Y2K problem. + +Formally speaking: + I am not prepared to offer you any assurance whatsoever + regarding Y2K issues in my software. You alone assume the + entire risk of using the software. The disclaimer of liability + in the LICENSE file in the bzip2 source distribution continues + to apply on this issue as with every other issue pertaining + to the software. + +Julian Seward +Cambridge, UK +25 August 1999 diff --git a/bzip2/blocksort.c b/bzip2/blocksort.c new file mode 100644 index 000000000..ec426725b --- /dev/null +++ b/bzip2/blocksort.c @@ -0,0 +1,1134 @@ + +/*-------------------------------------------------------------*/ +/*--- Block sorting machinery ---*/ +/*--- blocksort.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. + + To get some idea how the block sorting algorithms in this file + work, read my paper + On the Performance of BWT Sorting Algorithms + in Proceedings of the IEEE Data Compression Conference 2000, + Snowbird, Utah, USA, 27-30 March 2000. The main sort in this + file implements the algorithm called cache in the paper. +--*/ + + +#include "bzlib_private.h" + +/*---------------------------------------------*/ +/*--- Fallback O(N log(N)^2) sorting ---*/ +/*--- algorithm, for repetitive blocks ---*/ +/*---------------------------------------------*/ + +/*---------------------------------------------*/ +static +__inline__ +void fallbackSimpleSort ( UInt32* fmap, + UInt32* eclass, + Int32 lo, + Int32 hi ) +{ + Int32 i, j, tmp; + UInt32 ec_tmp; + + if (lo == hi) return; + + if (hi - lo > 3) { + for ( i = hi-4; i >= lo; i-- ) { + tmp = fmap[i]; + ec_tmp = eclass[tmp]; + for ( j = i+4; j <= hi && ec_tmp > eclass[fmap[j]]; j += 4 ) + fmap[j-4] = fmap[j]; + fmap[j-4] = tmp; + } + } + + for ( i = hi-1; i >= lo; i-- ) { + tmp = fmap[i]; + ec_tmp = eclass[tmp]; + for ( j = i+1; j <= hi && ec_tmp > eclass[fmap[j]]; j++ ) + fmap[j-1] = fmap[j]; + fmap[j-1] = tmp; + } +} + + +/*---------------------------------------------*/ +#define fswap(zz1, zz2) \ + { Int32 zztmp = zz1; zz1 = zz2; zz2 = zztmp; } + +#define fvswap(zzp1, zzp2, zzn) \ +{ \ + Int32 yyp1 = (zzp1); \ + Int32 yyp2 = (zzp2); \ + Int32 yyn = (zzn); \ + while (yyn > 0) { \ + fswap(fmap[yyp1], fmap[yyp2]); \ + yyp1++; yyp2++; yyn--; \ + } \ +} + + +#define fmin(a,b) ((a) < (b)) ? (a) : (b) + +#define fpush(lz,hz) { stackLo[sp] = lz; \ + stackHi[sp] = hz; \ + sp++; } + +#define fpop(lz,hz) { sp--; \ + lz = stackLo[sp]; \ + hz = stackHi[sp]; } + +#define FALLBACK_QSORT_SMALL_THRESH 10 +#define FALLBACK_QSORT_STACK_SIZE 100 + + +static +void fallbackQSort3 ( UInt32* fmap, + UInt32* eclass, + Int32 loSt, + Int32 hiSt ) +{ + Int32 unLo, unHi, ltLo, gtHi, n, m; + Int32 sp, lo, hi; + UInt32 med, r, r3; + Int32 stackLo[FALLBACK_QSORT_STACK_SIZE]; + Int32 stackHi[FALLBACK_QSORT_STACK_SIZE]; + + r = 0; + + sp = 0; + fpush ( loSt, hiSt ); + + while (sp > 0) { + + AssertH ( sp < FALLBACK_QSORT_STACK_SIZE, 1004 ); + + fpop ( lo, hi ); + if (hi - lo < FALLBACK_QSORT_SMALL_THRESH) { + fallbackSimpleSort ( fmap, eclass, lo, hi ); + continue; + } + + /* Random partitioning. Median of 3 sometimes fails to + avoid bad cases. Median of 9 seems to help but + looks rather expensive. This too seems to work but + is cheaper. Guidance for the magic constants + 7621 and 32768 is taken from Sedgewick's algorithms + book, chapter 35. + */ + r = ((r * 7621) + 1) % 32768; + r3 = r % 3; + if (r3 == 0) med = eclass[fmap[lo]]; else + if (r3 == 1) med = eclass[fmap[(lo+hi)>>1]]; else + med = eclass[fmap[hi]]; + + unLo = ltLo = lo; + unHi = gtHi = hi; + + while (1) { + while (1) { + if (unLo > unHi) break; + n = (Int32)eclass[fmap[unLo]] - (Int32)med; + if (n == 0) { + fswap(fmap[unLo], fmap[ltLo]); + ltLo++; unLo++; + continue; + }; + if (n > 0) break; + unLo++; + } + while (1) { + if (unLo > unHi) break; + n = (Int32)eclass[fmap[unHi]] - (Int32)med; + if (n == 0) { + fswap(fmap[unHi], fmap[gtHi]); + gtHi--; unHi--; + continue; + }; + if (n < 0) break; + unHi--; + } + if (unLo > unHi) break; + fswap(fmap[unLo], fmap[unHi]); unLo++; unHi--; + } + + AssertD ( unHi == unLo-1, "fallbackQSort3(2)" ); + + if (gtHi < ltLo) continue; + + n = fmin(ltLo-lo, unLo-ltLo); fvswap(lo, unLo-n, n); + m = fmin(hi-gtHi, gtHi-unHi); fvswap(unLo, hi-m+1, m); + + n = lo + unLo - ltLo - 1; + m = hi - (gtHi - unHi) + 1; + + if (n - lo > hi - m) { + fpush ( lo, n ); + fpush ( m, hi ); + } else { + fpush ( m, hi ); + fpush ( lo, n ); + } + } +} + +#undef fmin +#undef fpush +#undef fpop +#undef fswap +#undef fvswap +#undef FALLBACK_QSORT_SMALL_THRESH +#undef FALLBACK_QSORT_STACK_SIZE + + +/*---------------------------------------------*/ +/* Pre: + nblock > 0 + eclass exists for [0 .. nblock-1] + ((UChar*)eclass) [0 .. nblock-1] holds block + ptr exists for [0 .. nblock-1] + + Post: + ((UChar*)eclass) [0 .. nblock-1] holds block + All other areas of eclass destroyed + fmap [0 .. nblock-1] holds sorted order + bhtab [ 0 .. 2+(nblock/32) ] destroyed +*/ + +#define SET_BH(zz) bhtab[(zz) >> 5] |= (1 << ((zz) & 31)) +#define CLEAR_BH(zz) bhtab[(zz) >> 5] &= ~(1 << ((zz) & 31)) +#define ISSET_BH(zz) (bhtab[(zz) >> 5] & (1 << ((zz) & 31))) +#define WORD_BH(zz) bhtab[(zz) >> 5] +#define UNALIGNED_BH(zz) ((zz) & 0x01f) + +static +void fallbackSort ( UInt32* fmap, + UInt32* eclass, + UInt32* bhtab, + Int32 nblock, + Int32 verb ) +{ + Int32 ftab[257]; + Int32 ftabCopy[256]; + Int32 H, i, j, k, l, r, cc, cc1; + Int32 nNotDone; + Int32 nBhtab; + UChar* eclass8 = (UChar*)eclass; + + /*-- + Initial 1-char radix sort to generate + initial fmap and initial BH bits. + --*/ + if (verb >= 4) + VPrintf0 ( " bucket sorting ...\n" ); + for (i = 0; i < 257; i++) ftab[i] = 0; + for (i = 0; i < nblock; i++) ftab[eclass8[i]]++; + for (i = 0; i < 256; i++) ftabCopy[i] = ftab[i]; + for (i = 1; i < 257; i++) ftab[i] += ftab[i-1]; + + for (i = 0; i < nblock; i++) { + j = eclass8[i]; + k = ftab[j] - 1; + ftab[j] = k; + fmap[k] = i; + } + + nBhtab = 2 + (nblock / 32); + for (i = 0; i < nBhtab; i++) bhtab[i] = 0; + for (i = 0; i < 256; i++) SET_BH(ftab[i]); + + /*-- + Inductively refine the buckets. Kind-of an + "exponential radix sort" (!), inspired by the + Manber-Myers suffix array construction algorithm. + --*/ + + /*-- set sentinel bits for block-end detection --*/ + for (i = 0; i < 32; i++) { + SET_BH(nblock + 2*i); + CLEAR_BH(nblock + 2*i + 1); + } + + /*-- the log(N) loop --*/ + H = 1; + while (1) { + + if (verb >= 4) + VPrintf1 ( " depth %6d has ", H ); + + j = 0; + for (i = 0; i < nblock; i++) { + if (ISSET_BH(i)) j = i; + k = fmap[i] - H; if (k < 0) k += nblock; + eclass[k] = j; + } + + nNotDone = 0; + r = -1; + while (1) { + + /*-- find the next non-singleton bucket --*/ + k = r + 1; + while (ISSET_BH(k) && UNALIGNED_BH(k)) k++; + if (ISSET_BH(k)) { + while (WORD_BH(k) == 0xffffffff) k += 32; + while (ISSET_BH(k)) k++; + } + l = k - 1; + if (l >= nblock) break; + while (!ISSET_BH(k) && UNALIGNED_BH(k)) k++; + if (!ISSET_BH(k)) { + while (WORD_BH(k) == 0x00000000) k += 32; + while (!ISSET_BH(k)) k++; + } + r = k - 1; + if (r >= nblock) break; + + /*-- now [l, r] bracket current bucket --*/ + if (r > l) { + nNotDone += (r - l + 1); + fallbackQSort3 ( fmap, eclass, l, r ); + + /*-- scan bucket and generate header bits-- */ + cc = -1; + for (i = l; i <= r; i++) { + cc1 = eclass[fmap[i]]; + if (cc != cc1) { SET_BH(i); cc = cc1; }; + } + } + } + + if (verb >= 4) + VPrintf1 ( "%6d unresolved strings\n", nNotDone ); + + H *= 2; + if (H > nblock || nNotDone == 0) break; + } + + /*-- + Reconstruct the original block in + eclass8 [0 .. nblock-1], since the + previous phase destroyed it. + --*/ + if (verb >= 4) + VPrintf0 ( " reconstructing block ...\n" ); + j = 0; + for (i = 0; i < nblock; i++) { + while (ftabCopy[j] == 0) j++; + ftabCopy[j]--; + eclass8[fmap[i]] = (UChar)j; + } + AssertH ( j < 256, 1005 ); +} + +#undef SET_BH +#undef CLEAR_BH +#undef ISSET_BH +#undef WORD_BH +#undef UNALIGNED_BH + + +/*---------------------------------------------*/ +/*--- The main, O(N^2 log(N)) sorting ---*/ +/*--- algorithm. Faster for "normal" ---*/ +/*--- non-repetitive blocks. ---*/ +/*---------------------------------------------*/ + +/*---------------------------------------------*/ +static +__inline__ +Bool mainGtU ( UInt32 i1, + UInt32 i2, + UChar* block, + UInt16* quadrant, + UInt32 nblock, + Int32* budget ) +{ + Int32 k; + UChar c1, c2; + UInt16 s1, s2; + + AssertD ( i1 != i2, "mainGtU" ); + /* 1 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 2 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 3 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 4 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 5 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 6 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 7 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 8 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 9 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 10 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 11 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + /* 12 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + i1++; i2++; + + k = nblock + 8; + + do { + /* 1 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 2 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 3 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 4 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 5 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 6 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 7 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + /* 8 */ + c1 = block[i1]; c2 = block[i2]; + if (c1 != c2) return (c1 > c2); + s1 = quadrant[i1]; s2 = quadrant[i2]; + if (s1 != s2) return (s1 > s2); + i1++; i2++; + + if (i1 >= nblock) i1 -= nblock; + if (i2 >= nblock) i2 -= nblock; + + k -= 8; + (*budget)--; + } + while (k >= 0); + + return False; +} + + +/*---------------------------------------------*/ +/*-- + Knuth's increments seem to work better + than Incerpi-Sedgewick here. Possibly + because the number of elems to sort is + usually small, typically <= 20. +--*/ +static +Int32 incs[14] = { 1, 4, 13, 40, 121, 364, 1093, 3280, + 9841, 29524, 88573, 265720, + 797161, 2391484 }; + +static +void mainSimpleSort ( UInt32* ptr, + UChar* block, + UInt16* quadrant, + Int32 nblock, + Int32 lo, + Int32 hi, + Int32 d, + Int32* budget ) +{ + Int32 i, j, h, bigN, hp; + UInt32 v; + + bigN = hi - lo + 1; + if (bigN < 2) return; + + hp = 0; + while (incs[hp] < bigN) hp++; + hp--; + + for (; hp >= 0; hp--) { + h = incs[hp]; + + i = lo + h; + while (True) { + + /*-- copy 1 --*/ + if (i > hi) break; + v = ptr[i]; + j = i; + while ( mainGtU ( + ptr[j-h]+d, v+d, block, quadrant, nblock, budget + ) ) { + ptr[j] = ptr[j-h]; + j = j - h; + if (j <= (lo + h - 1)) break; + } + ptr[j] = v; + i++; + + /*-- copy 2 --*/ + if (i > hi) break; + v = ptr[i]; + j = i; + while ( mainGtU ( + ptr[j-h]+d, v+d, block, quadrant, nblock, budget + ) ) { + ptr[j] = ptr[j-h]; + j = j - h; + if (j <= (lo + h - 1)) break; + } + ptr[j] = v; + i++; + + /*-- copy 3 --*/ + if (i > hi) break; + v = ptr[i]; + j = i; + while ( mainGtU ( + ptr[j-h]+d, v+d, block, quadrant, nblock, budget + ) ) { + ptr[j] = ptr[j-h]; + j = j - h; + if (j <= (lo + h - 1)) break; + } + ptr[j] = v; + i++; + + if (*budget < 0) return; + } + } +} + + +/*---------------------------------------------*/ +/*-- + The following is an implementation of + an elegant 3-way quicksort for strings, + described in a paper "Fast Algorithms for + Sorting and Searching Strings", by Robert + Sedgewick and Jon L. Bentley. +--*/ + +#define mswap(zz1, zz2) \ + { Int32 zztmp = zz1; zz1 = zz2; zz2 = zztmp; } + +#define mvswap(zzp1, zzp2, zzn) \ +{ \ + Int32 yyp1 = (zzp1); \ + Int32 yyp2 = (zzp2); \ + Int32 yyn = (zzn); \ + while (yyn > 0) { \ + mswap(ptr[yyp1], ptr[yyp2]); \ + yyp1++; yyp2++; yyn--; \ + } \ +} + +static +__inline__ +UChar mmed3 ( UChar a, UChar b, UChar c ) +{ + UChar t; + if (a > b) { t = a; a = b; b = t; }; + if (b > c) { + b = c; + if (a > b) b = a; + } + return b; +} + +#define mmin(a,b) ((a) < (b)) ? (a) : (b) + +#define mpush(lz,hz,dz) { stackLo[sp] = lz; \ + stackHi[sp] = hz; \ + stackD [sp] = dz; \ + sp++; } + +#define mpop(lz,hz,dz) { sp--; \ + lz = stackLo[sp]; \ + hz = stackHi[sp]; \ + dz = stackD [sp]; } + + +#define mnextsize(az) (nextHi[az]-nextLo[az]) + +#define mnextswap(az,bz) \ + { Int32 tz; \ + tz = nextLo[az]; nextLo[az] = nextLo[bz]; nextLo[bz] = tz; \ + tz = nextHi[az]; nextHi[az] = nextHi[bz]; nextHi[bz] = tz; \ + tz = nextD [az]; nextD [az] = nextD [bz]; nextD [bz] = tz; } + + +#define MAIN_QSORT_SMALL_THRESH 20 +#define MAIN_QSORT_DEPTH_THRESH (BZ_N_RADIX + BZ_N_QSORT) +#define MAIN_QSORT_STACK_SIZE 100 + +static +void mainQSort3 ( UInt32* ptr, + UChar* block, + UInt16* quadrant, + Int32 nblock, + Int32 loSt, + Int32 hiSt, + Int32 dSt, + Int32* budget ) +{ + Int32 unLo, unHi, ltLo, gtHi, n, m, med; + Int32 sp, lo, hi, d; + + Int32 stackLo[MAIN_QSORT_STACK_SIZE]; + Int32 stackHi[MAIN_QSORT_STACK_SIZE]; + Int32 stackD [MAIN_QSORT_STACK_SIZE]; + + Int32 nextLo[3]; + Int32 nextHi[3]; + Int32 nextD [3]; + + sp = 0; + mpush ( loSt, hiSt, dSt ); + + while (sp > 0) { + + AssertH ( sp < MAIN_QSORT_STACK_SIZE, 1001 ); + + mpop ( lo, hi, d ); + if (hi - lo < MAIN_QSORT_SMALL_THRESH || + d > MAIN_QSORT_DEPTH_THRESH) { + mainSimpleSort ( ptr, block, quadrant, nblock, lo, hi, d, budget ); + if (*budget < 0) return; + continue; + } + + med = (Int32) + mmed3 ( block[ptr[ lo ]+d], + block[ptr[ hi ]+d], + block[ptr[ (lo+hi)>>1 ]+d] ); + + unLo = ltLo = lo; + unHi = gtHi = hi; + + while (True) { + while (True) { + if (unLo > unHi) break; + n = ((Int32)block[ptr[unLo]+d]) - med; + if (n == 0) { + mswap(ptr[unLo], ptr[ltLo]); + ltLo++; unLo++; continue; + }; + if (n > 0) break; + unLo++; + } + while (True) { + if (unLo > unHi) break; + n = ((Int32)block[ptr[unHi]+d]) - med; + if (n == 0) { + mswap(ptr[unHi], ptr[gtHi]); + gtHi--; unHi--; continue; + }; + if (n < 0) break; + unHi--; + } + if (unLo > unHi) break; + mswap(ptr[unLo], ptr[unHi]); unLo++; unHi--; + } + + AssertD ( unHi == unLo-1, "mainQSort3(2)" ); + + if (gtHi < ltLo) { + mpush(lo, hi, d+1 ); + continue; + } + + n = mmin(ltLo-lo, unLo-ltLo); mvswap(lo, unLo-n, n); + m = mmin(hi-gtHi, gtHi-unHi); mvswap(unLo, hi-m+1, m); + + n = lo + unLo - ltLo - 1; + m = hi - (gtHi - unHi) + 1; + + nextLo[0] = lo; nextHi[0] = n; nextD[0] = d; + nextLo[1] = m; nextHi[1] = hi; nextD[1] = d; + nextLo[2] = n+1; nextHi[2] = m-1; nextD[2] = d+1; + + if (mnextsize(0) < mnextsize(1)) mnextswap(0,1); + if (mnextsize(1) < mnextsize(2)) mnextswap(1,2); + if (mnextsize(0) < mnextsize(1)) mnextswap(0,1); + + AssertD (mnextsize(0) >= mnextsize(1), "mainQSort3(8)" ); + AssertD (mnextsize(1) >= mnextsize(2), "mainQSort3(9)" ); + + mpush (nextLo[0], nextHi[0], nextD[0]); + mpush (nextLo[1], nextHi[1], nextD[1]); + mpush (nextLo[2], nextHi[2], nextD[2]); + } +} + +#undef mswap +#undef mvswap +#undef mpush +#undef mpop +#undef mmin +#undef mnextsize +#undef mnextswap +#undef MAIN_QSORT_SMALL_THRESH +#undef MAIN_QSORT_DEPTH_THRESH +#undef MAIN_QSORT_STACK_SIZE + + +/*---------------------------------------------*/ +/* Pre: + nblock > N_OVERSHOOT + block32 exists for [0 .. nblock-1 +N_OVERSHOOT] + ((UChar*)block32) [0 .. nblock-1] holds block + ptr exists for [0 .. nblock-1] + + Post: + ((UChar*)block32) [0 .. nblock-1] holds block + All other areas of block32 destroyed + ftab [0 .. 65536 ] destroyed + ptr [0 .. nblock-1] holds sorted order + if (*budget < 0), sorting was abandoned +*/ + +#define BIGFREQ(b) (ftab[((b)+1) << 8] - ftab[(b) << 8]) +#define SETMASK (1 << 21) +#define CLEARMASK (~(SETMASK)) + +static +void mainSort ( UInt32* ptr, + UChar* block, + UInt16* quadrant, + UInt32* ftab, + Int32 nblock, + Int32 verb, + Int32* budget ) +{ + Int32 i, j, k, ss, sb; + Int32 runningOrder[256]; + Bool bigDone[256]; + Int32 copyStart[256]; + Int32 copyEnd [256]; + UChar c1; + Int32 numQSorted; + UInt16 s; + if (verb >= 4) VPrintf0 ( " main sort initialise ...\n" ); + + /*-- set up the 2-byte frequency table --*/ + for (i = 65536; i >= 0; i--) ftab[i] = 0; + + j = block[0] << 8; + i = nblock-1; + for (; i >= 3; i -= 4) { + quadrant[i] = 0; + j = (j >> 8) | ( ((UInt16)block[i]) << 8); + ftab[j]++; + quadrant[i-1] = 0; + j = (j >> 8) | ( ((UInt16)block[i-1]) << 8); + ftab[j]++; + quadrant[i-2] = 0; + j = (j >> 8) | ( ((UInt16)block[i-2]) << 8); + ftab[j]++; + quadrant[i-3] = 0; + j = (j >> 8) | ( ((UInt16)block[i-3]) << 8); + ftab[j]++; + } + for (; i >= 0; i--) { + quadrant[i] = 0; + j = (j >> 8) | ( ((UInt16)block[i]) << 8); + ftab[j]++; + } + + /*-- (emphasises close relationship of block & quadrant) --*/ + for (i = 0; i < BZ_N_OVERSHOOT; i++) { + block [nblock+i] = block[i]; + quadrant[nblock+i] = 0; + } + + if (verb >= 4) VPrintf0 ( " bucket sorting ...\n" ); + + /*-- Complete the initial radix sort --*/ + for (i = 1; i <= 65536; i++) ftab[i] += ftab[i-1]; + + s = block[0] << 8; + i = nblock-1; + for (; i >= 3; i -= 4) { + s = (s >> 8) | (block[i] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i; + s = (s >> 8) | (block[i-1] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i-1; + s = (s >> 8) | (block[i-2] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i-2; + s = (s >> 8) | (block[i-3] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i-3; + } + for (; i >= 0; i--) { + s = (s >> 8) | (block[i] << 8); + j = ftab[s] -1; + ftab[s] = j; + ptr[j] = i; + } + + /*-- + Now ftab contains the first loc of every small bucket. + Calculate the running order, from smallest to largest + big bucket. + --*/ + for (i = 0; i <= 255; i++) { + bigDone [i] = False; + runningOrder[i] = i; + } + + { + Int32 vv; + Int32 h = 1; + do h = 3 * h + 1; while (h <= 256); + do { + h = h / 3; + for (i = h; i <= 255; i++) { + vv = runningOrder[i]; + j = i; + while ( BIGFREQ(runningOrder[j-h]) > BIGFREQ(vv) ) { + runningOrder[j] = runningOrder[j-h]; + j = j - h; + if (j <= (h - 1)) goto zero; + } + zero: + runningOrder[j] = vv; + } + } while (h != 1); + } + + /*-- + The main sorting loop. + --*/ + + numQSorted = 0; + + for (i = 0; i <= 255; i++) { + + /*-- + Process big buckets, starting with the least full. + Basically this is a 3-step process in which we call + mainQSort3 to sort the small buckets [ss, j], but + also make a big effort to avoid the calls if we can. + --*/ + ss = runningOrder[i]; + + /*-- + Step 1: + Complete the big bucket [ss] by quicksorting + any unsorted small buckets [ss, j], for j != ss. + Hopefully previous pointer-scanning phases have already + completed many of the small buckets [ss, j], so + we don't have to sort them at all. + --*/ + for (j = 0; j <= 255; j++) { + if (j != ss) { + sb = (ss << 8) + j; + if ( ! (ftab[sb] & SETMASK) ) { + Int32 lo = ftab[sb] & CLEARMASK; + Int32 hi = (ftab[sb+1] & CLEARMASK) - 1; + if (hi > lo) { + if (verb >= 4) + VPrintf4 ( " qsort [0x%x, 0x%x] " + "done %d this %d\n", + ss, j, numQSorted, hi - lo + 1 ); + mainQSort3 ( + ptr, block, quadrant, nblock, + lo, hi, BZ_N_RADIX, budget + ); + numQSorted += (hi - lo + 1); + if (*budget < 0) return; + } + } + ftab[sb] |= SETMASK; + } + } + + AssertH ( !bigDone[ss], 1006 ); + + /*-- + Step 2: + Now scan this big bucket [ss] so as to synthesise the + sorted order for small buckets [t, ss] for all t, + including, magically, the bucket [ss,ss] too. + This will avoid doing Real Work in subsequent Step 1's. + --*/ + { + for (j = 0; j <= 255; j++) { + copyStart[j] = ftab[(j << 8) + ss] & CLEARMASK; + copyEnd [j] = (ftab[(j << 8) + ss + 1] & CLEARMASK) - 1; + } + for (j = ftab[ss << 8] & CLEARMASK; j < copyStart[ss]; j++) { + k = ptr[j]-1; if (k < 0) k += nblock; + c1 = block[k]; + if (!bigDone[c1]) + ptr[ copyStart[c1]++ ] = k; + } + for (j = (ftab[(ss+1) << 8] & CLEARMASK) - 1; j > copyEnd[ss]; j--) { + k = ptr[j]-1; if (k < 0) k += nblock; + c1 = block[k]; + if (!bigDone[c1]) + ptr[ copyEnd[c1]-- ] = k; + } + } + + AssertH ( copyStart[ss]-1 == copyEnd[ss], 1007 ); + + for (j = 0; j <= 255; j++) ftab[(j << 8) + ss] |= SETMASK; + + /*-- + Step 3: + The [ss] big bucket is now done. Record this fact, + and update the quadrant descriptors. Remember to + update quadrants in the overshoot area too, if + necessary. The "if (i < 255)" test merely skips + this updating for the last bucket processed, since + updating for the last bucket is pointless. + + The quadrant array provides a way to incrementally + cache sort orderings, as they appear, so as to + make subsequent comparisons in fullGtU() complete + faster. For repetitive blocks this makes a big + difference (but not big enough to be able to avoid + the fallback sorting mechanism, exponential radix sort). + + The precise meaning is: at all times: + + for 0 <= i < nblock and 0 <= j <= nblock + + if block[i] != block[j], + + then the relative values of quadrant[i] and + quadrant[j] are meaningless. + + else { + if quadrant[i] < quadrant[j] + then the string starting at i lexicographically + precedes the string starting at j + + else if quadrant[i] > quadrant[j] + then the string starting at j lexicographically + precedes the string starting at i + + else + the relative ordering of the strings starting + at i and j has not yet been determined. + } + --*/ + bigDone[ss] = True; + + if (i < 255) { + Int32 bbStart = ftab[ss << 8] & CLEARMASK; + Int32 bbSize = (ftab[(ss+1) << 8] & CLEARMASK) - bbStart; + Int32 shifts = 0; + + while ((bbSize >> shifts) > 65534) shifts++; + + for (j = bbSize-1; j >= 0; j--) { + Int32 a2update = ptr[bbStart + j]; + UInt16 qVal = (UInt16)(j >> shifts); + quadrant[a2update] = qVal; + if (a2update < BZ_N_OVERSHOOT) + quadrant[a2update + nblock] = qVal; + } + AssertH ( ((bbSize-1) >> shifts) <= 65535, 1002 ); + } + + } + + if (verb >= 4) + VPrintf3 ( " %d pointers, %d sorted, %d scanned\n", + nblock, numQSorted, nblock - numQSorted ); +} + +#undef BIGFREQ +#undef SETMASK +#undef CLEARMASK + + +/*---------------------------------------------*/ +/* Pre: + nblock > 0 + arr2 exists for [0 .. nblock-1 +N_OVERSHOOT] + ((UChar*)arr2) [0 .. nblock-1] holds block + arr1 exists for [0 .. nblock-1] + + Post: + ((UChar*)arr2) [0 .. nblock-1] holds block + All other areas of block destroyed + ftab [ 0 .. 65536 ] destroyed + arr1 [0 .. nblock-1] holds sorted order +*/ +void BZ2_blockSort ( EState* s ) +{ + UInt32* ptr = s->ptr; + UChar* block = s->block; + UInt32* ftab = s->ftab; + Int32 nblock = s->nblock; + Int32 verb = s->verbosity; + Int32 wfact = s->workFactor; + UInt16* quadrant; + Int32 budget; + Int32 budgetInit; + Int32 i; + + if (nblock < 10000) { + fallbackSort ( s->arr1, s->arr2, ftab, nblock, verb ); + } else { + /* Calculate the location for quadrant, remembering to get + the alignment right. Assumes that &(block[0]) is at least + 2-byte aligned -- this should be ok since block is really + the first section of arr2. + */ + i = nblock+BZ_N_OVERSHOOT; + if (i & 1) i++; + quadrant = (UInt16*)(&(block[i])); + + /* (wfact-1) / 3 puts the default-factor-30 + transition point at very roughly the same place as + with v0.1 and v0.9.0. + Not that it particularly matters any more, since the + resulting compressed stream is now the same regardless + of whether or not we use the main sort or fallback sort. + */ + if (wfact < 1 ) wfact = 1; + if (wfact > 100) wfact = 100; + budgetInit = nblock * ((wfact-1) / 3); + budget = budgetInit; + + mainSort ( ptr, block, quadrant, ftab, nblock, verb, &budget ); + if (verb >= 3) + VPrintf3 ( " %d work, %d block, ratio %5.2f\n", + budgetInit - budget, + nblock, + (float)(budgetInit - budget) / + (float)(nblock==0 ? 1 : nblock) ); + if (budget < 0) { + if (verb >= 2) + VPrintf0 ( " too repetitive; using fallback" + " sorting algorithm\n" ); + fallbackSort ( s->arr1, s->arr2, ftab, nblock, verb ); + } + } + + s->origPtr = -1; + for (i = 0; i < s->nblock; i++) + if (ptr[i] == 0) + { s->origPtr = i; break; }; + + AssertH( s->origPtr != -1, 1003 ); +} + + +/*-------------------------------------------------------------*/ +/*--- end blocksort.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/bzip2.1 b/bzip2/bzip2.1 new file mode 100644 index 000000000..7de54a011 --- /dev/null +++ b/bzip2/bzip2.1 @@ -0,0 +1,439 @@ +.PU +.TH bzip2 1 +.SH NAME +bzip2, bunzip2 \- a block-sorting file compressor, v1.0 +.br +bzcat \- decompresses files to stdout +.br +bzip2recover \- recovers data from damaged bzip2 files + +.SH SYNOPSIS +.ll +8 +.B bzip2 +.RB [ " \-cdfkqstvzVL123456789 " ] +[ +.I "filenames \&..." +] +.ll -8 +.br +.B bunzip2 +.RB [ " \-fkvsVL " ] +[ +.I "filenames \&..." +] +.br +.B bzcat +.RB [ " \-s " ] +[ +.I "filenames \&..." +] +.br +.B bzip2recover +.I "filename" + +.SH DESCRIPTION +.I bzip2 +compresses files using the Burrows-Wheeler block sorting +text compression algorithm, and Huffman coding. Compression is +generally considerably better than that achieved by more conventional +LZ77/LZ78-based compressors, and approaches the performance of the PPM +family of statistical compressors. + +The command-line options are deliberately very similar to +those of +.I GNU gzip, +but they are not identical. + +.I bzip2 +expects a list of file names to accompany the +command-line flags. Each file is replaced by a compressed version of +itself, with the name "original_name.bz2". +Each compressed file +has the same modification date, permissions, and, when possible, +ownership as the corresponding original, so that these properties can +be correctly restored at decompression time. File name handling is +naive in the sense that there is no mechanism for preserving original +file names, permissions, ownerships or dates in filesystems which lack +these concepts, or have serious file name length restrictions, such as +MS-DOS. + +.I bzip2 +and +.I bunzip2 +will by default not overwrite existing +files. If you want this to happen, specify the \-f flag. + +If no file names are specified, +.I bzip2 +compresses from standard +input to standard output. In this case, +.I bzip2 +will decline to +write compressed output to a terminal, as this would be entirely +incomprehensible and therefore pointless. + +.I bunzip2 +(or +.I bzip2 \-d) +decompresses all +specified files. Files which were not created by +.I bzip2 +will be detected and ignored, and a warning issued. +.I bzip2 +attempts to guess the filename for the decompressed file +from that of the compressed file as follows: + + filename.bz2 becomes filename + filename.bz becomes filename + filename.tbz2 becomes filename.tar + filename.tbz becomes filename.tar + anyothername becomes anyothername.out + +If the file does not end in one of the recognised endings, +.I .bz2, +.I .bz, +.I .tbz2 +or +.I .tbz, +.I bzip2 +complains that it cannot +guess the name of the original file, and uses the original name +with +.I .out +appended. + +As with compression, supplying no +filenames causes decompression from +standard input to standard output. + +.I bunzip2 +will correctly decompress a file which is the +concatenation of two or more compressed files. The result is the +concatenation of the corresponding uncompressed files. Integrity +testing (\-t) +of concatenated +compressed files is also supported. + +You can also compress or decompress files to the standard output by +giving the \-c flag. Multiple files may be compressed and +decompressed like this. The resulting outputs are fed sequentially to +stdout. Compression of multiple files +in this manner generates a stream +containing multiple compressed file representations. Such a stream +can be decompressed correctly only by +.I bzip2 +version 0.9.0 or +later. Earlier versions of +.I bzip2 +will stop after decompressing +the first file in the stream. + +.I bzcat +(or +.I bzip2 -dc) +decompresses all specified files to +the standard output. + +.I bzip2 +will read arguments from the environment variables +.I BZIP2 +and +.I BZIP, +in that order, and will process them +before any arguments read from the command line. This gives a +convenient way to supply default arguments. + +Compression is always performed, even if the compressed +file is slightly +larger than the original. Files of less than about one hundred bytes +tend to get larger, since the compression mechanism has a constant +overhead in the region of 50 bytes. Random data (including the output +of most file compressors) is coded at about 8.05 bits per byte, giving +an expansion of around 0.5%. + +As a self-check for your protection, +.I +bzip2 +uses 32-bit CRCs to +make sure that the decompressed version of a file is identical to the +original. This guards against corruption of the compressed data, and +against undetected bugs in +.I bzip2 +(hopefully very unlikely). The +chances of data corruption going undetected is microscopic, about one +chance in four billion for each file processed. Be aware, though, that +the check occurs upon decompression, so it can only tell you that +something is wrong. It can't help you +recover the original uncompressed +data. You can use +.I bzip2recover +to try to recover data from +damaged files. + +Return values: 0 for a normal exit, 1 for environmental problems (file +not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt +compressed file, 3 for an internal consistency error (eg, bug) which +caused +.I bzip2 +to panic. + +.SH OPTIONS +.TP +.B \-c --stdout +Compress or decompress to standard output. +.TP +.B \-d --decompress +Force decompression. +.I bzip2, +.I bunzip2 +and +.I bzcat +are +really the same program, and the decision about what actions to take is +done on the basis of which name is used. This flag overrides that +mechanism, and forces +.I bzip2 +to decompress. +.TP +.B \-z --compress +The complement to \-d: forces compression, regardless of the +invokation name. +.TP +.B \-t --test +Check integrity of the specified file(s), but don't decompress them. +This really performs a trial decompression and throws away the result. +.TP +.B \-f --force +Force overwrite of output files. Normally, +.I bzip2 +will not overwrite +existing output files. Also forces +.I bzip2 +to break hard links +to files, which it otherwise wouldn't do. +.TP +.B \-k --keep +Keep (don't delete) input files during compression +or decompression. +.TP +.B \-s --small +Reduce memory usage, for compression, decompression and testing. Files +are decompressed and tested using a modified algorithm which only +requires 2.5 bytes per block byte. This means any file can be +decompressed in 2300k of memory, albeit at about half the normal speed. + +During compression, \-s selects a block size of 200k, which limits +memory use to around the same figure, at the expense of your compression +ratio. In short, if your machine is low on memory (8 megabytes or +less), use \-s for everything. See MEMORY MANAGEMENT below. +.TP +.B \-q --quiet +Suppress non-essential warning messages. Messages pertaining to +I/O errors and other critical events will not be suppressed. +.TP +.B \-v --verbose +Verbose mode -- show the compression ratio for each file processed. +Further \-v's increase the verbosity level, spewing out lots of +information which is primarily of interest for diagnostic purposes. +.TP +.B \-L --license -V --version +Display the software version, license terms and conditions. +.TP +.B \-1 to \-9 +Set the block size to 100 k, 200 k .. 900 k when compressing. Has no +effect when decompressing. See MEMORY MANAGEMENT below. +.TP +.B \-- +Treats all subsequent arguments as file names, even if they start +with a dash. This is so you can handle files with names beginning +with a dash, for example: bzip2 \-- \-myfilename. +.TP +.B \--repetitive-fast --repetitive-best +These flags are redundant in versions 0.9.5 and above. They provided +some coarse control over the behaviour of the sorting algorithm in +earlier versions, which was sometimes useful. 0.9.5 and above have an +improved algorithm which renders these flags irrelevant. + +.SH MEMORY MANAGEMENT +.I bzip2 +compresses large files in blocks. The block size affects +both the compression ratio achieved, and the amount of memory needed for +compression and decompression. The flags \-1 through \-9 +specify the block size to be 100,000 bytes through 900,000 bytes (the +default) respectively. At decompression time, the block size used for +compression is read from the header of the compressed file, and +.I bunzip2 +then allocates itself just enough memory to decompress +the file. Since block sizes are stored in compressed files, it follows +that the flags \-1 to \-9 are irrelevant to and so ignored +during decompression. + +Compression and decompression requirements, +in bytes, can be estimated as: + + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) + +Larger block sizes give rapidly diminishing marginal returns. Most of +the compression comes from the first two or three hundred k of block +size, a fact worth bearing in mind when using +.I bzip2 +on small machines. +It is also important to appreciate that the decompression memory +requirement is set at compression time by the choice of block size. + +For files compressed with the default 900k block size, +.I bunzip2 +will require about 3700 kbytes to decompress. To support decompression +of any file on a 4 megabyte machine, +.I bunzip2 +has an option to +decompress using approximately half this amount of memory, about 2300 +kbytes. Decompression speed is also halved, so you should use this +option only where necessary. The relevant flag is -s. + +In general, try and use the largest block size memory constraints allow, +since that maximises the compression achieved. Compression and +decompression speed are virtually unaffected by block size. + +Another significant point applies to files which fit in a single block +-- that means most files you'd encounter using a large block size. The +amount of real memory touched is proportional to the size of the file, +since the file is smaller than a block. For example, compressing a file +20,000 bytes long with the flag -9 will cause the compressor to +allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560 +kbytes of it. Similarly, the decompressor will allocate 3700k but only +touch 100k + 20000 * 4 = 180 kbytes. + +Here is a table which summarises the maximum memory usage for different +block sizes. Also recorded is the total compressed size for 14 files of +the Calgary Text Compression Corpus totalling 3,141,622 bytes. This +column gives some feel for how compression varies with block size. +These figures tend to understate the advantage of larger block sizes for +larger files, since the Corpus is dominated by smaller files. + + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 + +.SH RECOVERING DATA FROM DAMAGED FILES +.I bzip2 +compresses files in blocks, usually 900kbytes long. Each +block is handled independently. If a media or transmission error causes +a multi-block .bz2 +file to become damaged, it may be possible to +recover data from the undamaged blocks in the file. + +The compressed representation of each block is delimited by a 48-bit +pattern, which makes it possible to find the block boundaries with +reasonable certainty. Each block also carries its own 32-bit CRC, so +damaged blocks can be distinguished from undamaged ones. + +.I bzip2recover +is a simple program whose purpose is to search for +blocks in .bz2 files, and write each block out into its own .bz2 +file. You can then use +.I bzip2 +\-t +to test the +integrity of the resulting files, and decompress those which are +undamaged. + +.I bzip2recover +takes a single argument, the name of the damaged file, +and writes a number of files "rec0001file.bz2", +"rec0002file.bz2", etc, containing the extracted blocks. +The output filenames are designed so that the use of +wildcards in subsequent processing -- for example, +"bzip2 -dc rec*file.bz2 > recovered_data" -- lists the files in +the correct order. + +.I bzip2recover +should be of most use dealing with large .bz2 +files, as these will contain many blocks. It is clearly +futile to use it on damaged single-block files, since a +damaged block cannot be recovered. If you wish to minimise +any potential data loss through media or transmission errors, +you might consider compressing with a smaller +block size. + +.SH PERFORMANCE NOTES +The sorting phase of compression gathers together similar strings in the +file. Because of this, files containing very long runs of repeated +symbols, like "aabaabaabaab ..." (repeated several hundred times) may +compress more slowly than normal. Versions 0.9.5 and above fare much +better than previous versions in this respect. The ratio between +worst-case and average-case compression time is in the region of 10:1. +For previous versions, this figure was more like 100:1. You can use the +\-vvvv option to monitor progress in great detail, if you want. + +Decompression speed is unaffected by these phenomena. + +.I bzip2 +usually allocates several megabytes of memory to operate +in, and then charges all over it in a fairly random fashion. This means +that performance, both for compressing and decompressing, is largely +determined by the speed at which your machine can service cache misses. +Because of this, small changes to the code to reduce the miss rate have +been observed to give disproportionately large performance improvements. +I imagine +.I bzip2 +will perform best on machines with very large caches. + +.SH CAVEATS +I/O error messages are not as helpful as they could be. +.I bzip2 +tries hard to detect I/O errors and exit cleanly, but the details of +what the problem is sometimes seem rather misleading. + +This manual page pertains to version 1.0 of +.I bzip2. +Compressed +data created by this version is entirely forwards and backwards +compatible with the previous public releases, versions 0.1pl2, 0.9.0 +and 0.9.5, +but with the following exception: 0.9.0 and above can correctly +decompress multiple concatenated compressed files. 0.1pl2 cannot do +this; it will stop after decompressing just the first file in the +stream. + +.I bzip2recover +uses 32-bit integers to represent bit positions in +compressed files, so it cannot handle compressed files more than 512 +megabytes long. This could easily be fixed. + +.SH AUTHOR +Julian Seward, jseward@acm.org. + +http://sourceware.cygnus.com/bzip2 +http://www.muraroa.demon.co.uk + +The ideas embodied in +.I bzip2 +are due to (at least) the following +people: Michael Burrows and David Wheeler (for the block sorting +transformation), David Wheeler (again, for the Huffman coder), Peter +Fenwick (for the structured coding model in the original +.I bzip, +and many refinements), and Alistair Moffat, Radford Neal and Ian Witten +(for the arithmetic coder in the original +.I bzip). +I am much +indebted for their help, support and advice. See the manual in the +source distribution for pointers to sources of documentation. Christian +von Roques encouraged me to look for faster sorting algorithms, so as to +speed up compression. Bela Lubkin encouraged me to improve the +worst-case compression performance. Many people sent patches, helped +with portability problems, lent machines, gave advice and were generally +helpful. diff --git a/bzip2/bzip2.1.preformatted b/bzip2/bzip2.1.preformatted new file mode 100644 index 000000000..9f18339e9 --- /dev/null +++ b/bzip2/bzip2.1.preformatted @@ -0,0 +1,462 @@ + + + +bzip2(1) bzip2(1) + + +NNAAMMEE + bzip2, bunzip2 - a block-sorting file compressor, v1.0 + bzcat - decompresses files to stdout + bzip2recover - recovers data from damaged bzip2 files + + +SSYYNNOOPPSSIISS + bbzziipp22 [ --ccddffkkqqssttvvzzVVLL112233445566778899 ] [ _f_i_l_e_n_a_m_e_s _._._. ] + bbuunnzziipp22 [ --ffkkvvssVVLL ] [ _f_i_l_e_n_a_m_e_s _._._. ] + bbzzccaatt [ --ss ] [ _f_i_l_e_n_a_m_e_s _._._. ] + bbzziipp22rreeccoovveerr _f_i_l_e_n_a_m_e + + +DDEESSCCRRIIPPTTIIOONN + _b_z_i_p_2 compresses files using the Burrows-Wheeler block + sorting text compression algorithm, and Huffman coding. + Compression is generally considerably better than that + achieved by more conventional LZ77/LZ78-based compressors, + and approaches the performance of the PPM family of sta- + tistical compressors. + + The command-line options are deliberately very similar to + those of _G_N_U _g_z_i_p_, but they are not identical. + + _b_z_i_p_2 expects a list of file names to accompany the com- + mand-line flags. Each file is replaced by a compressed + version of itself, with the name "original_name.bz2". + Each compressed file has the same modification date, per- + missions, and, when possible, ownership as the correspond- + ing original, so that these properties can be correctly + restored at decompression time. File name handling is + naive in the sense that there is no mechanism for preserv- + ing original file names, permissions, ownerships or dates + in filesystems which lack these concepts, or have serious + file name length restrictions, such as MS-DOS. + + _b_z_i_p_2 and _b_u_n_z_i_p_2 will by default not overwrite existing + files. If you want this to happen, specify the -f flag. + + If no file names are specified, _b_z_i_p_2 compresses from + standard input to standard output. In this case, _b_z_i_p_2 + will decline to write compressed output to a terminal, as + this would be entirely incomprehensible and therefore + pointless. + + _b_u_n_z_i_p_2 (or _b_z_i_p_2 _-_d_) decompresses all specified files. + Files which were not created by _b_z_i_p_2 will be detected and + ignored, and a warning issued. _b_z_i_p_2 attempts to guess + the filename for the decompressed file from that of the + compressed file as follows: + + filename.bz2 becomes filename + filename.bz becomes filename + filename.tbz2 becomes filename.tar + + + + 1 + + + + + +bzip2(1) bzip2(1) + + + filename.tbz becomes filename.tar + anyothername becomes anyothername.out + + If the file does not end in one of the recognised endings, + _._b_z_2_, _._b_z_, _._t_b_z_2 or _._t_b_z_, _b_z_i_p_2 complains that it cannot + guess the name of the original file, and uses the original + name with _._o_u_t appended. + + As with compression, supplying no filenames causes decom- + pression from standard input to standard output. + + _b_u_n_z_i_p_2 will correctly decompress a file which is the con- + catenation of two or more compressed files. The result is + the concatenation of the corresponding uncompressed files. + Integrity testing (-t) of concatenated compressed files is + also supported. + + You can also compress or decompress files to the standard + output by giving the -c flag. Multiple files may be com- + pressed and decompressed like this. The resulting outputs + are fed sequentially to stdout. Compression of multiple + files in this manner generates a stream containing multi- + ple compressed file representations. Such a stream can be + decompressed correctly only by _b_z_i_p_2 version 0.9.0 or + later. Earlier versions of _b_z_i_p_2 will stop after decom- + pressing the first file in the stream. + + _b_z_c_a_t (or _b_z_i_p_2 _-_d_c_) decompresses all specified files to + the standard output. + + _b_z_i_p_2 will read arguments from the environment variables + _B_Z_I_P_2 and _B_Z_I_P_, in that order, and will process them + before any arguments read from the command line. This + gives a convenient way to supply default arguments. + + Compression is always performed, even if the compressed + file is slightly larger than the original. Files of less + than about one hundred bytes tend to get larger, since the + compression mechanism has a constant overhead in the + region of 50 bytes. Random data (including the output of + most file compressors) is coded at about 8.05 bits per + byte, giving an expansion of around 0.5%. + + As a self-check for your protection, _b_z_i_p_2 uses 32-bit + CRCs to make sure that the decompressed version of a file + is identical to the original. This guards against corrup- + tion of the compressed data, and against undetected bugs + in _b_z_i_p_2 (hopefully very unlikely). The chances of data + corruption going undetected is microscopic, about one + chance in four billion for each file processed. Be aware, + though, that the check occurs upon decompression, so it + can only tell you that something is wrong. It can't help + you recover the original uncompressed data. You can use + _b_z_i_p_2_r_e_c_o_v_e_r to try to recover data from damaged files. + + + + 2 + + + + + +bzip2(1) bzip2(1) + + + Return values: 0 for a normal exit, 1 for environmental + problems (file not found, invalid flags, I/O errors, &c), + 2 to indicate a corrupt compressed file, 3 for an internal + consistency error (eg, bug) which caused _b_z_i_p_2 to panic. + + +OOPPTTIIOONNSS + --cc ----ssttddoouutt + Compress or decompress to standard output. + + --dd ----ddeeccoommpprreessss + Force decompression. _b_z_i_p_2_, _b_u_n_z_i_p_2 and _b_z_c_a_t are + really the same program, and the decision about + what actions to take is done on the basis of which + name is used. This flag overrides that mechanism, + and forces _b_z_i_p_2 to decompress. + + --zz ----ccoommpprreessss + The complement to -d: forces compression, regard- + less of the invokation name. + + --tt ----tteesstt + Check integrity of the specified file(s), but don't + decompress them. This really performs a trial + decompression and throws away the result. + + --ff ----ffoorrccee + Force overwrite of output files. Normally, _b_z_i_p_2 + will not overwrite existing output files. Also + forces _b_z_i_p_2 to break hard links to files, which it + otherwise wouldn't do. + + --kk ----kkeeeepp + Keep (don't delete) input files during compression + or decompression. + + --ss ----ssmmaallll + Reduce memory usage, for compression, decompression + and testing. Files are decompressed and tested + using a modified algorithm which only requires 2.5 + bytes per block byte. This means any file can be + decompressed in 2300k of memory, albeit at about + half the normal speed. + + During compression, -s selects a block size of + 200k, which limits memory use to around the same + figure, at the expense of your compression ratio. + In short, if your machine is low on memory (8 + megabytes or less), use -s for everything. See + MEMORY MANAGEMENT below. + + --qq ----qquuiieett + Suppress non-essential warning messages. Messages + pertaining to I/O errors and other critical events + + + + 3 + + + + + +bzip2(1) bzip2(1) + + + will not be suppressed. + + --vv ----vveerrbboossee + Verbose mode -- show the compression ratio for each + file processed. Further -v's increase the ver- + bosity level, spewing out lots of information which + is primarily of interest for diagnostic purposes. + + --LL ----lliicceennssee --VV ----vveerrssiioonn + Display the software version, license terms and + conditions. + + --11 ttoo --99 + Set the block size to 100 k, 200 k .. 900 k when + compressing. Has no effect when decompressing. + See MEMORY MANAGEMENT below. + + ---- Treats all subsequent arguments as file names, even + if they start with a dash. This is so you can han- + dle files with names beginning with a dash, for + example: bzip2 -- -myfilename. + + ----rreeppeettiittiivvee--ffaasstt ----rreeppeettiittiivvee--bbeesstt + These flags are redundant in versions 0.9.5 and + above. They provided some coarse control over the + behaviour of the sorting algorithm in earlier ver- + sions, which was sometimes useful. 0.9.5 and above + have an improved algorithm which renders these + flags irrelevant. + + +MMEEMMOORRYY MMAANNAAGGEEMMEENNTT + _b_z_i_p_2 compresses large files in blocks. The block size + affects both the compression ratio achieved, and the + amount of memory needed for compression and decompression. + The flags -1 through -9 specify the block size to be + 100,000 bytes through 900,000 bytes (the default) respec- + tively. At decompression time, the block size used for + compression is read from the header of the compressed + file, and _b_u_n_z_i_p_2 then allocates itself just enough memory + to decompress the file. Since block sizes are stored in + compressed files, it follows that the flags -1 to -9 are + irrelevant to and so ignored during decompression. + + Compression and decompression requirements, in bytes, can + be estimated as: + + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) + + Larger block sizes give rapidly diminishing marginal + returns. Most of the compression comes from the first two + + + + 4 + + + + + +bzip2(1) bzip2(1) + + + or three hundred k of block size, a fact worth bearing in + mind when using _b_z_i_p_2 on small machines. It is also + important to appreciate that the decompression memory + requirement is set at compression time by the choice of + block size. + + For files compressed with the default 900k block size, + _b_u_n_z_i_p_2 will require about 3700 kbytes to decompress. To + support decompression of any file on a 4 megabyte machine, + _b_u_n_z_i_p_2 has an option to decompress using approximately + half this amount of memory, about 2300 kbytes. Decompres- + sion speed is also halved, so you should use this option + only where necessary. The relevant flag is -s. + + In general, try and use the largest block size memory con- + straints allow, since that maximises the compression + achieved. Compression and decompression speed are virtu- + ally unaffected by block size. + + Another significant point applies to files which fit in a + single block -- that means most files you'd encounter + using a large block size. The amount of real memory + touched is proportional to the size of the file, since the + file is smaller than a block. For example, compressing a + file 20,000 bytes long with the flag -9 will cause the + compressor to allocate around 7600k of memory, but only + touch 400k + 20000 * 8 = 560 kbytes of it. Similarly, the + decompressor will allocate 3700k but only touch 100k + + 20000 * 4 = 180 kbytes. + + Here is a table which summarises the maximum memory usage + for different block sizes. Also recorded is the total + compressed size for 14 files of the Calgary Text Compres- + sion Corpus totalling 3,141,622 bytes. This column gives + some feel for how compression varies with block size. + These figures tend to understate the advantage of larger + block sizes for larger files, since the Corpus is domi- + nated by smaller files. + + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 + + + + + + + 5 + + + + + +bzip2(1) bzip2(1) + + +RREECCOOVVEERRIINNGG DDAATTAA FFRROOMM DDAAMMAAGGEEDD FFIILLEESS + _b_z_i_p_2 compresses files in blocks, usually 900kbytes long. + Each block is handled independently. If a media or trans- + mission error causes a multi-block .bz2 file to become + damaged, it may be possible to recover data from the + undamaged blocks in the file. + + The compressed representation of each block is delimited + by a 48-bit pattern, which makes it possible to find the + block boundaries with reasonable certainty. Each block + also carries its own 32-bit CRC, so damaged blocks can be + distinguished from undamaged ones. + + _b_z_i_p_2_r_e_c_o_v_e_r is a simple program whose purpose is to + search for blocks in .bz2 files, and write each block out + into its own .bz2 file. You can then use _b_z_i_p_2 -t to test + the integrity of the resulting files, and decompress those + which are undamaged. + + _b_z_i_p_2_r_e_c_o_v_e_r takes a single argument, the name of the dam- + aged file, and writes a number of files "rec0001file.bz2", + "rec0002file.bz2", etc, containing the extracted blocks. + The output filenames are designed so that the use of + wildcards in subsequent processing -- for example, "bzip2 + -dc rec*file.bz2 > recovered_data" -- lists the files in + the correct order. + + _b_z_i_p_2_r_e_c_o_v_e_r should be of most use dealing with large .bz2 + files, as these will contain many blocks. It is clearly + futile to use it on damaged single-block files, since a + damaged block cannot be recovered. If you wish to min- + imise any potential data loss through media or transmis- + sion errors, you might consider compressing with a smaller + block size. + + +PPEERRFFOORRMMAANNCCEE NNOOTTEESS + The sorting phase of compression gathers together similar + strings in the file. Because of this, files containing + very long runs of repeated symbols, like "aabaabaabaab + ..." (repeated several hundred times) may compress more + slowly than normal. Versions 0.9.5 and above fare much + better than previous versions in this respect. The ratio + between worst-case and average-case compression time is in + the region of 10:1. For previous versions, this figure + was more like 100:1. You can use the -vvvv option to mon- + itor progress in great detail, if you want. + + Decompression speed is unaffected by these phenomena. + + _b_z_i_p_2 usually allocates several megabytes of memory to + operate in, and then charges all over it in a fairly ran- + dom fashion. This means that performance, both for com- + pressing and decompressing, is largely determined by the + + + + 6 + + + + + +bzip2(1) bzip2(1) + + + speed at which your machine can service cache misses. + Because of this, small changes to the code to reduce the + miss rate have been observed to give disproportionately + large performance improvements. I imagine _b_z_i_p_2 will per- + form best on machines with very large caches. + + +CCAAVVEEAATTSS + I/O error messages are not as helpful as they could be. + _b_z_i_p_2 tries hard to detect I/O errors and exit cleanly, + but the details of what the problem is sometimes seem + rather misleading. + + This manual page pertains to version 1.0 of _b_z_i_p_2_. Com- + pressed data created by this version is entirely forwards + and backwards compatible with the previous public + releases, versions 0.1pl2, 0.9.0 and 0.9.5, but with the + following exception: 0.9.0 and above can correctly decom- + press multiple concatenated compressed files. 0.1pl2 can- + not do this; it will stop after decompressing just the + first file in the stream. + + _b_z_i_p_2_r_e_c_o_v_e_r uses 32-bit integers to represent bit posi- + tions in compressed files, so it cannot handle compressed + files more than 512 megabytes long. This could easily be + fixed. + + +AAUUTTHHOORR + Julian Seward, jseward@acm.org. + + http://sourceware.cygnus.com/bzip2 + http://www.muraroa.demon.co.uk + + The ideas embodied in _b_z_i_p_2 are due to (at least) the fol- + lowing people: Michael Burrows and David Wheeler (for the + block sorting transformation), David Wheeler (again, for + the Huffman coder), Peter Fenwick (for the structured cod- + ing model in the original _b_z_i_p_, and many refinements), and + Alistair Moffat, Radford Neal and Ian Witten (for the + arithmetic coder in the original _b_z_i_p_)_. I am much + indebted for their help, support and advice. See the man- + ual in the source distribution for pointers to sources of + documentation. Christian von Roques encouraged me to look + for faster sorting algorithms, so as to speed up compres- + sion. Bela Lubkin encouraged me to improve the worst-case + compression performance. Many people sent patches, helped + with portability problems, lent machines, gave advice and + were generally helpful. + + + + + + + + + 7 + + diff --git a/bzip2/bzip2.c b/bzip2/bzip2.c new file mode 100644 index 000000000..56adfdcbc --- /dev/null +++ b/bzip2/bzip2.c @@ -0,0 +1,2044 @@ + +/*-----------------------------------------------------------*/ +/*--- A block-sorting, lossless compressor bzip2.c ---*/ +/*-----------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +/*----------------------------------------------------*/ +/*--- IMPORTANT ---*/ +/*----------------------------------------------------*/ + +/*-- + WARNING: + This program and library (attempts to) compress data by + performing several non-trivial transformations on it. + Unless you are 100% familiar with *all* the algorithms + contained herein, and with the consequences of modifying them, + you should NOT meddle with the compression or decompression + machinery. Incorrect changes can and very likely *will* + lead to disasterous loss of data. + + DISCLAIMER: + I TAKE NO RESPONSIBILITY FOR ANY LOSS OF DATA ARISING FROM THE + USE OF THIS PROGRAM, HOWSOEVER CAUSED. + + Every compression of a file implies an assumption that the + compressed file can be decompressed to reproduce the original. + Great efforts in design, coding and testing have been made to + ensure that this program works correctly. However, the + complexity of the algorithms, and, in particular, the presence + of various special cases in the code which occur with very low + but non-zero probability make it impossible to rule out the + possibility of bugs remaining in the program. DO NOT COMPRESS + ANY DATA WITH THIS PROGRAM AND/OR LIBRARY UNLESS YOU ARE PREPARED + TO ACCEPT THE POSSIBILITY, HOWEVER SMALL, THAT THE DATA WILL + NOT BE RECOVERABLE. + + That is not to say this program is inherently unreliable. + Indeed, I very much hope the opposite is true. bzip2/libbzip2 + has been carefully constructed and extensively tested. + + PATENTS: + To the best of my knowledge, bzip2/libbzip2 does not use any + patented algorithms. However, I do not have the resources + available to carry out a full patent search. Therefore I cannot + give any guarantee of the above statement. +--*/ + + + +/*----------------------------------------------------*/ +/*--- and now for something much more pleasant :-) ---*/ +/*----------------------------------------------------*/ + +/*---------------------------------------------*/ +/*-- + Place a 1 beside your platform, and 0 elsewhere. +--*/ + +/*-- + Generic 32-bit Unix. + Also works on 64-bit Unix boxes. +--*/ +#define BZ_UNIX 1 + +/*-- + Win32, as seen by Jacob Navia's excellent + port of (Chris Fraser & David Hanson)'s excellent + lcc compiler. +--*/ +#define BZ_LCCWIN32 0 + +#if defined(_WIN32) && !defined(__CYGWIN__) +#undef BZ_LCCWIN32 +#define BZ_LCCWIN32 1 +#undef BZ_UNIX +#define BZ_UNIX 0 +#endif + + +/*---------------------------------------------*/ +/*-- + Some stuff for all platforms. +--*/ + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <signal.h> +#include <math.h> +#include <errno.h> +#include <ctype.h> +#include "bzlib.h" + +#define ERROR_IF_EOF(i) { if ((i) == EOF) ioError(); } +#define ERROR_IF_NOT_ZERO(i) { if ((i) != 0) ioError(); } +#define ERROR_IF_MINUS_ONE(i) { if ((i) == (-1)) ioError(); } + + +/*---------------------------------------------*/ +/*-- + Platform-specific stuff. +--*/ + +#if BZ_UNIX +# include <sys/types.h> +# include <utime.h> +# include <unistd.h> +# include <sys/stat.h> +# include <sys/times.h> + +# define PATH_SEP '/' +# define MY_LSTAT lstat +# define MY_S_IFREG S_ISREG +# define MY_STAT stat + +# define APPEND_FILESPEC(root, name) \ + root=snocString((root), (name)) + +# define APPEND_FLAG(root, name) \ + root=snocString((root), (name)) + +# define SET_BINARY_MODE(fd) /**/ + +# ifdef __GNUC__ +# define NORETURN __attribute__ ((noreturn)) +# else +# define NORETURN /**/ +# endif +# ifdef __DJGPP__ +# include <io.h> +# include <fcntl.h> +# undef MY_LSTAT +# define MY_LSTAT stat +# undef SET_BINARY_MODE +# define SET_BINARY_MODE(fd) \ + do { \ + int retVal = setmode ( fileno ( fd ), \ + O_BINARY ); \ + ERROR_IF_MINUS_ONE ( retVal ); \ + } while ( 0 ) +# endif +# ifdef __CYGWIN__ +# include <io.h> +# include <fcntl.h> +# undef SET_BINARY_MODE +# define SET_BINARY_MODE(fd) \ + do { \ + int retVal = setmode ( fileno ( fd ), \ + O_BINARY ); \ + ERROR_IF_MINUS_ONE ( retVal ); \ + } while ( 0 ) +# endif +#endif + + + +#if BZ_LCCWIN32 +# include <io.h> +# include <fcntl.h> +# include <sys\stat.h> + +# define NORETURN /**/ +# define PATH_SEP '\\' +# define MY_LSTAT _stat +# define MY_STAT _stat +# define MY_S_IFREG(x) ((x) & _S_IFREG) + +# define APPEND_FLAG(root, name) \ + root=snocString((root), (name)) + +# if 0 + /*-- lcc-win32 seems to expand wildcards itself --*/ +# define APPEND_FILESPEC(root, spec) \ + do { \ + if ((spec)[0] == '-') { \ + root = snocString((root), (spec)); \ + } else { \ + struct _finddata_t c_file; \ + long hFile; \ + hFile = _findfirst((spec), &c_file); \ + if ( hFile == -1L ) { \ + root = snocString ((root), (spec)); \ + } else { \ + int anInt = 0; \ + while ( anInt == 0 ) { \ + root = snocString((root), \ + &c_file.name[0]); \ + anInt = _findnext(hFile, &c_file); \ + } \ + } \ + } \ + } while ( 0 ) +# else +# define APPEND_FILESPEC(root, name) \ + root = snocString ((root), (name)) +# endif + +# define SET_BINARY_MODE(fd) \ + do { \ + int retVal = setmode ( fileno ( fd ), \ + O_BINARY ); \ + ERROR_IF_MINUS_ONE ( retVal ); \ + } while ( 0 ) + +#endif + + +/*---------------------------------------------*/ +/*-- + Some more stuff for all platforms :-) +--*/ + +typedef char Char; +typedef unsigned char Bool; +typedef unsigned char UChar; +typedef int Int32; +typedef unsigned int UInt32; +typedef short Int16; +typedef unsigned short UInt16; + +#define True ((Bool)1) +#define False ((Bool)0) + +/*-- + IntNative is your platform's `native' int size. + Only here to avoid probs with 64-bit platforms. +--*/ +typedef int IntNative; + + +/*---------------------------------------------------*/ +/*--- Misc (file handling) data decls ---*/ +/*---------------------------------------------------*/ + +Int32 verbosity; +Bool keepInputFiles, smallMode, deleteOutputOnInterrupt; +Bool forceOverwrite, testFailsExist, unzFailsExist, noisy; +Int32 numFileNames, numFilesProcessed, blockSize100k; +Int32 exitValue; + +/*-- source modes; F==file, I==stdin, O==stdout --*/ +#define SM_I2O 1 +#define SM_F2O 2 +#define SM_F2F 3 + +/*-- operation modes --*/ +#define OM_Z 1 +#define OM_UNZ 2 +#define OM_TEST 3 + +Int32 opMode; +Int32 srcMode; + +#define FILE_NAME_LEN 1034 + +Int32 longestFileName; +Char inName [FILE_NAME_LEN]; +Char outName[FILE_NAME_LEN]; +Char tmpName[FILE_NAME_LEN]; +Char *progName; +Char progNameReally[FILE_NAME_LEN]; +FILE *outputHandleJustInCase; +Int32 workFactor; + +static void panic ( Char* ) NORETURN; +static void ioError ( void ) NORETURN; +static void outOfMemory ( void ) NORETURN; +static void configError ( void ) NORETURN; +static void crcError ( void ) NORETURN; +static void cleanUpAndFail ( Int32 ) NORETURN; +static void compressedStreamEOF ( void ) NORETURN; + +static void copyFileName ( Char*, Char* ); +static void* myMalloc ( Int32 ); + + + +/*---------------------------------------------------*/ +/*--- An implementation of 64-bit ints. Sigh. ---*/ +/*--- Roll on widespread deployment of ANSI C9X ! ---*/ +/*---------------------------------------------------*/ + +typedef + struct { UChar b[8]; } + UInt64; + +static +void uInt64_from_UInt32s ( UInt64* n, UInt32 lo32, UInt32 hi32 ) +{ + n->b[7] = (UChar)((hi32 >> 24) & 0xFF); + n->b[6] = (UChar)((hi32 >> 16) & 0xFF); + n->b[5] = (UChar)((hi32 >> 8) & 0xFF); + n->b[4] = (UChar) (hi32 & 0xFF); + n->b[3] = (UChar)((lo32 >> 24) & 0xFF); + n->b[2] = (UChar)((lo32 >> 16) & 0xFF); + n->b[1] = (UChar)((lo32 >> 8) & 0xFF); + n->b[0] = (UChar) (lo32 & 0xFF); +} + +static +double uInt64_to_double ( UInt64* n ) +{ + Int32 i; + double base = 1.0; + double sum = 0.0; + for (i = 0; i < 8; i++) { + sum += base * (double)(n->b[i]); + base *= 256.0; + } + return sum; +} + +static +void uInt64_add ( UInt64* src, UInt64* dst ) +{ + Int32 i; + Int32 carry = 0; + for (i = 0; i < 8; i++) { + carry += ( ((Int32)src->b[i]) + ((Int32)dst->b[i]) ); + dst->b[i] = (UChar)(carry & 0xFF); + carry >>= 8; + } +} + +static +void uInt64_sub ( UInt64* src, UInt64* dst ) +{ + Int32 t, i; + Int32 borrow = 0; + for (i = 0; i < 8; i++) { + t = ((Int32)dst->b[i]) - ((Int32)src->b[i]) - borrow; + if (t < 0) { + dst->b[i] = (UChar)(t + 256); + borrow = 1; + } else { + dst->b[i] = (UChar)t; + borrow = 0; + } + } +} + +static +void uInt64_mul ( UInt64* a, UInt64* b, UInt64* r_hi, UInt64* r_lo ) +{ + UChar sum[16]; + Int32 ia, ib, carry; + for (ia = 0; ia < 16; ia++) sum[ia] = 0; + for (ia = 0; ia < 8; ia++) { + carry = 0; + for (ib = 0; ib < 8; ib++) { + carry += ( ((Int32)sum[ia+ib]) + + ((Int32)a->b[ia]) * ((Int32)b->b[ib]) ); + sum[ia+ib] = (UChar)(carry & 0xFF); + carry >>= 8; + } + sum[ia+8] = (UChar)(carry & 0xFF); + if ((carry >>= 8) != 0) panic ( "uInt64_mul" ); + } + + for (ia = 0; ia < 8; ia++) r_hi->b[ia] = sum[ia+8]; + for (ia = 0; ia < 8; ia++) r_lo->b[ia] = sum[ia]; +} + + +static +void uInt64_shr1 ( UInt64* n ) +{ + Int32 i; + for (i = 0; i < 8; i++) { + n->b[i] >>= 1; + if (i < 7 && (n->b[i+1] & 1)) n->b[i] |= 0x80; + } +} + +static +void uInt64_shl1 ( UInt64* n ) +{ + Int32 i; + for (i = 7; i >= 0; i--) { + n->b[i] <<= 1; + if (i > 0 && (n->b[i-1] & 0x80)) n->b[i]++; + } +} + +static +Bool uInt64_isZero ( UInt64* n ) +{ + Int32 i; + for (i = 0; i < 8; i++) + if (n->b[i] != 0) return 0; + return 1; +} + +static +Int32 uInt64_qrm10 ( UInt64* n ) +{ + /* Divide *n by 10, and return the remainder. Long division + is difficult, so we cheat and instead multiply by + 0xCCCC CCCC CCCC CCCD, which is 0.8 (viz, 0.1 << 3). + */ + Int32 i; + UInt64 tmp1, tmp2, n_orig, zero_point_eight; + + zero_point_eight.b[1] = zero_point_eight.b[2] = + zero_point_eight.b[3] = zero_point_eight.b[4] = + zero_point_eight.b[5] = zero_point_eight.b[6] = + zero_point_eight.b[7] = 0xCC; + zero_point_eight.b[0] = 0xCD; + + n_orig = *n; + + /* divide n by 10, + by multiplying by 0.8 and then shifting right 3 times */ + uInt64_mul ( n, &zero_point_eight, &tmp1, &tmp2 ); + uInt64_shr1(&tmp1); uInt64_shr1(&tmp1); uInt64_shr1(&tmp1); + *n = tmp1; + + /* tmp1 = 8*n, tmp2 = 2*n */ + uInt64_shl1(&tmp1); uInt64_shl1(&tmp1); uInt64_shl1(&tmp1); + tmp2 = *n; uInt64_shl1(&tmp2); + + /* tmp1 = 10*n */ + uInt64_add ( &tmp2, &tmp1 ); + + /* n_orig = n_orig - 10*n */ + uInt64_sub ( &tmp1, &n_orig ); + + /* n_orig should now hold quotient, in range 0 .. 9 */ + for (i = 7; i >= 1; i--) + if (n_orig.b[i] != 0) panic ( "uInt64_qrm10(1)" ); + if (n_orig.b[0] > 9) + panic ( "uInt64_qrm10(2)" ); + + return (int)n_orig.b[0]; +} + +/* ... and the Whole Entire Point of all this UInt64 stuff is + so that we can supply the following function. +*/ +static +void uInt64_toAscii ( char* outbuf, UInt64* n ) +{ + Int32 i, q; + UChar buf[32]; + Int32 nBuf = 0; + UInt64 n_copy = *n; + do { + q = uInt64_qrm10 ( &n_copy ); + buf[nBuf] = q + '0'; + nBuf++; + } while (!uInt64_isZero(&n_copy)); + outbuf[nBuf] = 0; + for (i = 0; i < nBuf; i++) outbuf[i] = buf[nBuf-i-1]; +} + + +/*---------------------------------------------------*/ +/*--- Processing of complete files and streams ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------*/ +static +Bool myfeof ( FILE* f ) +{ + Int32 c = fgetc ( f ); + if (c == EOF) return True; + ungetc ( c, f ); + return False; +} + + +/*---------------------------------------------*/ +static +void compressStream ( FILE *stream, FILE *zStream ) +{ + BZFILE* bzf = NULL; + UChar ibuf[5000]; + Int32 nIbuf; + UInt32 nbytes_in_lo32, nbytes_in_hi32; + UInt32 nbytes_out_lo32, nbytes_out_hi32; + Int32 bzerr, bzerr_dummy, ret; + + SET_BINARY_MODE(stream); + SET_BINARY_MODE(zStream); + + if (ferror(stream)) goto errhandler_io; + if (ferror(zStream)) goto errhandler_io; + + bzf = BZ2_bzWriteOpen ( &bzerr, zStream, + blockSize100k, verbosity, workFactor ); + if (bzerr != BZ_OK) goto errhandler; + + if (verbosity >= 2) fprintf ( stderr, "\n" ); + + while (True) { + + if (myfeof(stream)) break; + nIbuf = fread ( ibuf, sizeof(UChar), 5000, stream ); + if (ferror(stream)) goto errhandler_io; + if (nIbuf > 0) BZ2_bzWrite ( &bzerr, bzf, (void*)ibuf, nIbuf ); + if (bzerr != BZ_OK) goto errhandler; + + } + + BZ2_bzWriteClose64 ( &bzerr, bzf, 0, + &nbytes_in_lo32, &nbytes_in_hi32, + &nbytes_out_lo32, &nbytes_out_hi32 ); + if (bzerr != BZ_OK) goto errhandler; + + if (ferror(zStream)) goto errhandler_io; + ret = fflush ( zStream ); + if (ret == EOF) goto errhandler_io; + if (zStream != stdout) { + ret = fclose ( zStream ); + if (ret == EOF) goto errhandler_io; + } + if (ferror(stream)) goto errhandler_io; + ret = fclose ( stream ); + if (ret == EOF) goto errhandler_io; + + if (nbytes_in_lo32 == 0 && nbytes_in_hi32 == 0) + nbytes_in_lo32 = 1; + + if (verbosity >= 1) { + Char buf_nin[32], buf_nout[32]; + UInt64 nbytes_in, nbytes_out; + double nbytes_in_d, nbytes_out_d; + uInt64_from_UInt32s ( &nbytes_in, + nbytes_in_lo32, nbytes_in_hi32 ); + uInt64_from_UInt32s ( &nbytes_out, + nbytes_out_lo32, nbytes_out_hi32 ); + nbytes_in_d = uInt64_to_double ( &nbytes_in ); + nbytes_out_d = uInt64_to_double ( &nbytes_out ); + uInt64_toAscii ( buf_nin, &nbytes_in ); + uInt64_toAscii ( buf_nout, &nbytes_out ); + fprintf ( stderr, "%6.3f:1, %6.3f bits/byte, " + "%5.2f%% saved, %s in, %s out.\n", + nbytes_in_d / nbytes_out_d, + (8.0 * nbytes_out_d) / nbytes_in_d, + 100.0 * (1.0 - nbytes_out_d / nbytes_in_d), + buf_nin, + buf_nout + ); + } + + return; + + errhandler: + BZ2_bzWriteClose64 ( &bzerr_dummy, bzf, 1, + &nbytes_in_lo32, &nbytes_in_hi32, + &nbytes_out_lo32, &nbytes_out_hi32 ); + switch (bzerr) { + case BZ_CONFIG_ERROR: + configError(); break; + case BZ_MEM_ERROR: + outOfMemory (); break; + case BZ_IO_ERROR: + errhandler_io: + ioError(); break; + default: + panic ( "compress:unexpected error" ); + } + + panic ( "compress:end" ); + /*notreached*/ +} + + + +/*---------------------------------------------*/ +static +Bool uncompressStream ( FILE *zStream, FILE *stream ) +{ + BZFILE* bzf = NULL; + Int32 bzerr, bzerr_dummy, ret, nread, streamNo, i; + UChar obuf[5000]; + UChar unused[BZ_MAX_UNUSED]; + Int32 nUnused; + UChar* unusedTmp; + + nUnused = 0; + streamNo = 0; + + SET_BINARY_MODE(stream); + SET_BINARY_MODE(zStream); + + if (ferror(stream)) goto errhandler_io; + if (ferror(zStream)) goto errhandler_io; + + while (True) { + + bzf = BZ2_bzReadOpen ( + &bzerr, zStream, verbosity, + (int)smallMode, unused, nUnused + ); + if (bzf == NULL || bzerr != BZ_OK) goto errhandler; + streamNo++; + + while (bzerr == BZ_OK) { + nread = BZ2_bzRead ( &bzerr, bzf, obuf, 5000 ); + if (bzerr == BZ_DATA_ERROR_MAGIC) goto errhandler; + if ((bzerr == BZ_OK || bzerr == BZ_STREAM_END) && nread > 0) + fwrite ( obuf, sizeof(UChar), nread, stream ); + if (ferror(stream)) goto errhandler_io; + } + if (bzerr != BZ_STREAM_END) goto errhandler; + + BZ2_bzReadGetUnused ( &bzerr, bzf, (void**)(&unusedTmp), &nUnused ); + if (bzerr != BZ_OK) panic ( "decompress:bzReadGetUnused" ); + + for (i = 0; i < nUnused; i++) unused[i] = unusedTmp[i]; + + BZ2_bzReadClose ( &bzerr, bzf ); + if (bzerr != BZ_OK) panic ( "decompress:bzReadGetUnused" ); + + if (nUnused == 0 && myfeof(zStream)) break; + + } + + if (ferror(zStream)) goto errhandler_io; + ret = fclose ( zStream ); + if (ret == EOF) goto errhandler_io; + + if (ferror(stream)) goto errhandler_io; + ret = fflush ( stream ); + if (ret != 0) goto errhandler_io; + if (stream != stdout) { + ret = fclose ( stream ); + if (ret == EOF) goto errhandler_io; + } + if (verbosity >= 2) fprintf ( stderr, "\n " ); + return True; + + errhandler: + BZ2_bzReadClose ( &bzerr_dummy, bzf ); + switch (bzerr) { + case BZ_CONFIG_ERROR: + configError(); break; + case BZ_IO_ERROR: + errhandler_io: + ioError(); break; + case BZ_DATA_ERROR: + crcError(); + case BZ_MEM_ERROR: + outOfMemory(); + case BZ_UNEXPECTED_EOF: + compressedStreamEOF(); + case BZ_DATA_ERROR_MAGIC: + if (zStream != stdin) fclose(zStream); + if (stream != stdout) fclose(stream); + if (streamNo == 1) { + return False; + } else { + if (noisy) + fprintf ( stderr, + "\n%s: %s: trailing garbage after EOF ignored\n", + progName, inName ); + return True; + } + default: + panic ( "decompress:unexpected error" ); + } + + panic ( "decompress:end" ); + return True; /*notreached*/ +} + + +/*---------------------------------------------*/ +static +Bool testStream ( FILE *zStream ) +{ + BZFILE* bzf = NULL; + Int32 bzerr, bzerr_dummy, ret, nread, streamNo, i; + UChar obuf[5000]; + UChar unused[BZ_MAX_UNUSED]; + Int32 nUnused; + UChar* unusedTmp; + + nUnused = 0; + streamNo = 0; + + SET_BINARY_MODE(zStream); + if (ferror(zStream)) goto errhandler_io; + + while (True) { + + bzf = BZ2_bzReadOpen ( + &bzerr, zStream, verbosity, + (int)smallMode, unused, nUnused + ); + if (bzf == NULL || bzerr != BZ_OK) goto errhandler; + streamNo++; + + while (bzerr == BZ_OK) { + nread = BZ2_bzRead ( &bzerr, bzf, obuf, 5000 ); + if (bzerr == BZ_DATA_ERROR_MAGIC) goto errhandler; + } + if (bzerr != BZ_STREAM_END) goto errhandler; + + BZ2_bzReadGetUnused ( &bzerr, bzf, (void**)(&unusedTmp), &nUnused ); + if (bzerr != BZ_OK) panic ( "test:bzReadGetUnused" ); + + for (i = 0; i < nUnused; i++) unused[i] = unusedTmp[i]; + + BZ2_bzReadClose ( &bzerr, bzf ); + if (bzerr != BZ_OK) panic ( "test:bzReadGetUnused" ); + if (nUnused == 0 && myfeof(zStream)) break; + + } + + if (ferror(zStream)) goto errhandler_io; + ret = fclose ( zStream ); + if (ret == EOF) goto errhandler_io; + + if (verbosity >= 2) fprintf ( stderr, "\n " ); + return True; + + errhandler: + BZ2_bzReadClose ( &bzerr_dummy, bzf ); + if (verbosity == 0) + fprintf ( stderr, "%s: %s: ", progName, inName ); + switch (bzerr) { + case BZ_CONFIG_ERROR: + configError(); break; + case BZ_IO_ERROR: + errhandler_io: + ioError(); break; + case BZ_DATA_ERROR: + fprintf ( stderr, + "data integrity (CRC) error in data\n" ); + return False; + case BZ_MEM_ERROR: + outOfMemory(); + case BZ_UNEXPECTED_EOF: + fprintf ( stderr, + "file ends unexpectedly\n" ); + return False; + case BZ_DATA_ERROR_MAGIC: + if (zStream != stdin) fclose(zStream); + if (streamNo == 1) { + fprintf ( stderr, + "bad magic number (file not created by bzip2)\n" ); + return False; + } else { + if (noisy) + fprintf ( stderr, + "trailing garbage after EOF ignored\n" ); + return True; + } + default: + panic ( "test:unexpected error" ); + } + + panic ( "test:end" ); + return True; /*notreached*/ +} + + +/*---------------------------------------------------*/ +/*--- Error [non-] handling grunge ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------*/ +static +void setExit ( Int32 v ) +{ + if (v > exitValue) exitValue = v; +} + + +/*---------------------------------------------*/ +static +void cadvise ( void ) +{ + if (noisy) + fprintf ( + stderr, + "\nIt is possible that the compressed file(s) have become corrupted.\n" + "You can use the -tvv option to test integrity of such files.\n\n" + "You can use the `bzip2recover' program to *attempt* to recover\n" + "data from undamaged sections of corrupted files.\n\n" + ); +} + + +/*---------------------------------------------*/ +static +void showFileNames ( void ) +{ + if (noisy) + fprintf ( + stderr, + "\tInput file = %s, output file = %s\n", + inName, outName + ); +} + + +/*---------------------------------------------*/ +static +void cleanUpAndFail ( Int32 ec ) +{ + IntNative retVal; + + if ( srcMode == SM_F2F + && opMode != OM_TEST + && deleteOutputOnInterrupt ) { + if (noisy) + fprintf ( stderr, "%s: Deleting output file %s, if it exists.\n", + progName, outName ); + if (outputHandleJustInCase != NULL) + fclose ( outputHandleJustInCase ); + retVal = remove ( outName ); + if (retVal != 0) + fprintf ( stderr, + "%s: WARNING: deletion of output file (apparently) failed.\n", + progName ); + } + if (noisy && numFileNames > 0 && numFilesProcessed < numFileNames) { + fprintf ( stderr, + "%s: WARNING: some files have not been processed:\n" + "\t%d specified on command line, %d not processed yet.\n\n", + progName, numFileNames, + numFileNames - numFilesProcessed ); + } + setExit(ec); + exit(exitValue); +} + + +/*---------------------------------------------*/ +static +void panic ( Char* s ) +{ + fprintf ( stderr, + "\n%s: PANIC -- internal consistency error:\n" + "\t%s\n" + "\tThis is a BUG. Please report it to me at:\n" + "\tjseward@acm.org\n", + progName, s ); + showFileNames(); + cleanUpAndFail( 3 ); +} + + +/*---------------------------------------------*/ +static +void crcError ( void ) +{ + fprintf ( stderr, + "\n%s: Data integrity error when decompressing.\n", + progName ); + showFileNames(); + cadvise(); + cleanUpAndFail( 2 ); +} + + +/*---------------------------------------------*/ +static +void compressedStreamEOF ( void ) +{ + fprintf ( stderr, + "\n%s: Compressed file ends unexpectedly;\n\t" + "perhaps it is corrupted? *Possible* reason follows.\n", + progName ); + perror ( progName ); + showFileNames(); + cadvise(); + cleanUpAndFail( 2 ); +} + + +/*---------------------------------------------*/ +static +void ioError ( void ) +{ + fprintf ( stderr, + "\n%s: I/O or other error, bailing out. " + "Possible reason follows.\n", + progName ); + perror ( progName ); + showFileNames(); + cleanUpAndFail( 1 ); +} + + +/*---------------------------------------------*/ +static +void mySignalCatcher ( IntNative n ) +{ + fprintf ( stderr, + "\n%s: Control-C or similar caught, quitting.\n", + progName ); + cleanUpAndFail(1); +} + + +/*---------------------------------------------*/ +static +void mySIGSEGVorSIGBUScatcher ( IntNative n ) +{ + if (opMode == OM_Z) + fprintf ( + stderr, + "\n%s: Caught a SIGSEGV or SIGBUS whilst compressing.\n" + "\n" + " Possible causes are (most likely first):\n" + " (1) This computer has unreliable memory or cache hardware\n" + " (a surprisingly common problem; try a different machine.)\n" + " (2) A bug in the compiler used to create this executable\n" + " (unlikely, if you didn't compile bzip2 yourself.)\n" + " (3) A real bug in bzip2 -- I hope this should never be the case.\n" + " The user's manual, Section 4.3, has more info on (1) and (2).\n" + " \n" + " If you suspect this is a bug in bzip2, or are unsure about (1)\n" + " or (2), feel free to report it to me at: jseward@acm.org.\n" + " Section 4.3 of the user's manual describes the info a useful\n" + " bug report should have. If the manual is available on your\n" + " system, please try and read it before mailing me. If you don't\n" + " have the manual or can't be bothered to read it, mail me anyway.\n" + "\n", + progName ); + else + fprintf ( + stderr, + "\n%s: Caught a SIGSEGV or SIGBUS whilst decompressing.\n" + "\n" + " Possible causes are (most likely first):\n" + " (1) The compressed data is corrupted, and bzip2's usual checks\n" + " failed to detect this. Try bzip2 -tvv my_file.bz2.\n" + " (2) This computer has unreliable memory or cache hardware\n" + " (a surprisingly common problem; try a different machine.)\n" + " (3) A bug in the compiler used to create this executable\n" + " (unlikely, if you didn't compile bzip2 yourself.)\n" + " (4) A real bug in bzip2 -- I hope this should never be the case.\n" + " The user's manual, Section 4.3, has more info on (2) and (3).\n" + " \n" + " If you suspect this is a bug in bzip2, or are unsure about (2)\n" + " or (3), feel free to report it to me at: jseward@acm.org.\n" + " Section 4.3 of the user's manual describes the info a useful\n" + " bug report should have. If the manual is available on your\n" + " system, please try and read it before mailing me. If you don't\n" + " have the manual or can't be bothered to read it, mail me anyway.\n" + "\n", + progName ); + + showFileNames(); + if (opMode == OM_Z) + cleanUpAndFail( 3 ); else + { cadvise(); cleanUpAndFail( 2 ); } +} + + +/*---------------------------------------------*/ +static +void outOfMemory ( void ) +{ + fprintf ( stderr, + "\n%s: couldn't allocate enough memory\n", + progName ); + showFileNames(); + cleanUpAndFail(1); +} + + +/*---------------------------------------------*/ +static +void configError ( void ) +{ + fprintf ( stderr, + "bzip2: I'm not configured correctly for this platform!\n" + "\tI require Int32, Int16 and Char to have sizes\n" + "\tof 4, 2 and 1 bytes to run properly, and they don't.\n" + "\tProbably you can fix this by defining them correctly,\n" + "\tand recompiling. Bye!\n" ); + setExit(3); + exit(exitValue); +} + + +/*---------------------------------------------------*/ +/*--- The main driver machinery ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------*/ +static +void pad ( Char *s ) +{ + Int32 i; + if ( (Int32)strlen(s) >= longestFileName ) return; + for (i = 1; i <= longestFileName - (Int32)strlen(s); i++) + fprintf ( stderr, " " ); +} + + +/*---------------------------------------------*/ +static +void copyFileName ( Char* to, Char* from ) +{ + if ( strlen(from) > FILE_NAME_LEN-10 ) { + fprintf ( + stderr, + "bzip2: file name\n`%s'\n" + "is suspiciously (more than %d chars) long.\n" + "Try using a reasonable file name instead. Sorry! :-)\n", + from, FILE_NAME_LEN-10 + ); + setExit(1); + exit(exitValue); + } + + strncpy(to,from,FILE_NAME_LEN-10); + to[FILE_NAME_LEN-10]='\0'; +} + + +/*---------------------------------------------*/ +static +Bool fileExists ( Char* name ) +{ + FILE *tmp = fopen ( name, "rb" ); + Bool exists = (tmp != NULL); + if (tmp != NULL) fclose ( tmp ); + return exists; +} + + +/*---------------------------------------------*/ +/*-- + if in doubt, return True +--*/ +static +Bool notAStandardFile ( Char* name ) +{ + IntNative i; + struct MY_STAT statBuf; + + i = MY_LSTAT ( name, &statBuf ); + if (i != 0) return True; + if (MY_S_IFREG(statBuf.st_mode)) return False; + return True; +} + + +/*---------------------------------------------*/ +/*-- + rac 11/21/98 see if file has hard links to it +--*/ +static +Int32 countHardLinks ( Char* name ) +{ + IntNative i; + struct MY_STAT statBuf; + + i = MY_LSTAT ( name, &statBuf ); + if (i != 0) return 0; + return (statBuf.st_nlink - 1); +} + + +/*---------------------------------------------*/ +static +void copyDatePermissionsAndOwner ( Char *srcName, Char *dstName ) +{ +#if BZ_UNIX + IntNative retVal; + struct MY_STAT statBuf; + struct utimbuf uTimBuf; + + retVal = MY_LSTAT ( srcName, &statBuf ); + ERROR_IF_NOT_ZERO ( retVal ); + uTimBuf.actime = statBuf.st_atime; + uTimBuf.modtime = statBuf.st_mtime; + + retVal = chmod ( dstName, statBuf.st_mode ); + ERROR_IF_NOT_ZERO ( retVal ); + + retVal = utime ( dstName, &uTimBuf ); + ERROR_IF_NOT_ZERO ( retVal ); + + retVal = chown ( dstName, statBuf.st_uid, statBuf.st_gid ); + /* chown() will in many cases return with EPERM, which can + be safely ignored. + */ +#endif +} + + +/*---------------------------------------------*/ +static +void setInterimPermissions ( Char *dstName ) +{ +#if BZ_UNIX + IntNative retVal; + retVal = chmod ( dstName, S_IRUSR | S_IWUSR ); + ERROR_IF_NOT_ZERO ( retVal ); +#endif +} + + +/*---------------------------------------------*/ +static +Bool containsDubiousChars ( Char* name ) +{ + Bool cdc = False; + for (; *name != '\0'; name++) + if (*name == '?' || *name == '*') cdc = True; + return cdc; +} + + +/*---------------------------------------------*/ +#define BZ_N_SUFFIX_PAIRS 4 + +Char* zSuffix[BZ_N_SUFFIX_PAIRS] + = { ".bz2", ".bz", ".tbz2", ".tbz" }; +Char* unzSuffix[BZ_N_SUFFIX_PAIRS] + = { "", "", ".tar", ".tar" }; + +static +Bool hasSuffix ( Char* s, Char* suffix ) +{ + Int32 ns = strlen(s); + Int32 nx = strlen(suffix); + if (ns < nx) return False; + if (strcmp(s + ns - nx, suffix) == 0) return True; + return False; +} + +static +Bool mapSuffix ( Char* name, + Char* oldSuffix, Char* newSuffix ) +{ + if (!hasSuffix(name,oldSuffix)) return False; + name[strlen(name)-strlen(oldSuffix)] = 0; + strcat ( name, newSuffix ); + return True; +} + + +/*---------------------------------------------*/ +static +void compress ( Char *name ) +{ + FILE *inStr; + FILE *outStr; + Int32 n, i; + + deleteOutputOnInterrupt = False; + + if (name == NULL && srcMode != SM_I2O) + panic ( "compress: bad modes\n" ); + + switch (srcMode) { + case SM_I2O: + copyFileName ( inName, "(stdin)" ); + copyFileName ( outName, "(stdout)" ); + break; + case SM_F2F: + copyFileName ( inName, name ); + copyFileName ( outName, name ); + strcat ( outName, ".bz2" ); + break; + case SM_F2O: + copyFileName ( inName, name ); + copyFileName ( outName, "(stdout)" ); + break; + } + + if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) { + if (noisy) + fprintf ( stderr, "%s: There are no files matching `%s'.\n", + progName, inName ); + setExit(1); + return; + } + if ( srcMode != SM_I2O && !fileExists ( inName ) ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + } + for (i = 0; i < BZ_N_SUFFIX_PAIRS; i++) { + if (hasSuffix(inName, zSuffix[i])) { + if (noisy) + fprintf ( stderr, + "%s: Input file %s already has %s suffix.\n", + progName, inName, zSuffix[i] ); + setExit(1); + return; + } + } + if ( srcMode == SM_F2F && !forceOverwrite && notAStandardFile ( inName )) { + if (noisy) + fprintf ( stderr, "%s: Input file %s is not a normal file.\n", + progName, inName ); + setExit(1); + return; + } + if ( srcMode == SM_F2F && !forceOverwrite && fileExists ( outName ) ) { + fprintf ( stderr, "%s: Output file %s already exists.\n", + progName, outName ); + setExit(1); + return; + } + if ( srcMode == SM_F2F && !forceOverwrite && + (n=countHardLinks ( inName )) > 0) { + fprintf ( stderr, "%s: Input file %s has %d other link%s.\n", + progName, inName, n, n > 1 ? "s" : "" ); + setExit(1); + return; + } + + switch ( srcMode ) { + + case SM_I2O: + inStr = stdin; + outStr = stdout; + if ( isatty ( fileno ( stdout ) ) ) { + fprintf ( stderr, + "%s: I won't write compressed data to a terminal.\n", + progName ); + fprintf ( stderr, "%s: For help, type: `%s --help'.\n", + progName, progName ); + setExit(1); + return; + }; + break; + + case SM_F2O: + inStr = fopen ( inName, "rb" ); + outStr = stdout; + if ( isatty ( fileno ( stdout ) ) ) { + fprintf ( stderr, + "%s: I won't write compressed data to a terminal.\n", + progName ); + fprintf ( stderr, "%s: For help, type: `%s --help'.\n", + progName, progName ); + if ( inStr != NULL ) fclose ( inStr ); + setExit(1); + return; + }; + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + }; + break; + + case SM_F2F: + inStr = fopen ( inName, "rb" ); + outStr = fopen ( outName, "wb" ); + if ( outStr == NULL) { + fprintf ( stderr, "%s: Can't create output file %s: %s.\n", + progName, outName, strerror(errno) ); + if ( inStr != NULL ) fclose ( inStr ); + setExit(1); + return; + } + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + if ( outStr != NULL ) fclose ( outStr ); + setExit(1); + return; + }; + setInterimPermissions ( outName ); + break; + + default: + panic ( "compress: bad srcMode" ); + break; + } + + if (verbosity >= 1) { + fprintf ( stderr, " %s: ", inName ); + pad ( inName ); + fflush ( stderr ); + } + + /*--- Now the input and output handles are sane. Do the Biz. ---*/ + outputHandleJustInCase = outStr; + deleteOutputOnInterrupt = True; + compressStream ( inStr, outStr ); + outputHandleJustInCase = NULL; + + /*--- If there was an I/O error, we won't get here. ---*/ + if ( srcMode == SM_F2F ) { + copyDatePermissionsAndOwner ( inName, outName ); + deleteOutputOnInterrupt = False; + if ( !keepInputFiles ) { + IntNative retVal = remove ( inName ); + ERROR_IF_NOT_ZERO ( retVal ); + } + } + + deleteOutputOnInterrupt = False; +} + + +/*---------------------------------------------*/ +static +void uncompress ( Char *name ) +{ + FILE *inStr; + FILE *outStr; + Int32 n, i; + Bool magicNumberOK; + Bool cantGuess; + + deleteOutputOnInterrupt = False; + + if (name == NULL && srcMode != SM_I2O) + panic ( "uncompress: bad modes\n" ); + + cantGuess = False; + switch (srcMode) { + case SM_I2O: + copyFileName ( inName, "(stdin)" ); + copyFileName ( outName, "(stdout)" ); + break; + case SM_F2F: + copyFileName ( inName, name ); + copyFileName ( outName, name ); + for (i = 0; i < BZ_N_SUFFIX_PAIRS; i++) + if (mapSuffix(outName,zSuffix[i],unzSuffix[i])) + goto zzz; + cantGuess = True; + strcat ( outName, ".out" ); + break; + case SM_F2O: + copyFileName ( inName, name ); + copyFileName ( outName, "(stdout)" ); + break; + } + + zzz: + if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) { + if (noisy) + fprintf ( stderr, "%s: There are no files matching `%s'.\n", + progName, inName ); + setExit(1); + return; + } + if ( srcMode != SM_I2O && !fileExists ( inName ) ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + } + if ( srcMode == SM_F2F && !forceOverwrite && notAStandardFile ( inName )) { + if (noisy) + fprintf ( stderr, "%s: Input file %s is not a normal file.\n", + progName, inName ); + setExit(1); + return; + } + if ( /* srcMode == SM_F2F implied && */ cantGuess ) { + if (noisy) + fprintf ( stderr, + "%s: Can't guess original name for %s -- using %s\n", + progName, inName, outName ); + /* just a warning, no return */ + } + if ( srcMode == SM_F2F && !forceOverwrite && fileExists ( outName ) ) { + fprintf ( stderr, "%s: Output file %s already exists.\n", + progName, outName ); + setExit(1); + return; + } + if ( srcMode == SM_F2F && !forceOverwrite && + (n=countHardLinks ( inName ) ) > 0) { + fprintf ( stderr, "%s: Input file %s has %d other link%s.\n", + progName, inName, n, n > 1 ? "s" : "" ); + setExit(1); + return; + } + + switch ( srcMode ) { + + case SM_I2O: + inStr = stdin; + outStr = stdout; + if ( isatty ( fileno ( stdin ) ) ) { + fprintf ( stderr, + "%s: I won't read compressed data from a terminal.\n", + progName ); + fprintf ( stderr, "%s: For help, type: `%s --help'.\n", + progName, progName ); + setExit(1); + return; + }; + break; + + case SM_F2O: + inStr = fopen ( inName, "rb" ); + outStr = stdout; + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s:%s.\n", + progName, inName, strerror(errno) ); + if ( inStr != NULL ) fclose ( inStr ); + setExit(1); + return; + }; + break; + + case SM_F2F: + inStr = fopen ( inName, "rb" ); + outStr = fopen ( outName, "wb" ); + if ( outStr == NULL) { + fprintf ( stderr, "%s: Can't create output file %s: %s.\n", + progName, outName, strerror(errno) ); + if ( inStr != NULL ) fclose ( inStr ); + setExit(1); + return; + } + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s: %s.\n", + progName, inName, strerror(errno) ); + if ( outStr != NULL ) fclose ( outStr ); + setExit(1); + return; + }; + setInterimPermissions ( outName ); + break; + + default: + panic ( "uncompress: bad srcMode" ); + break; + } + + if (verbosity >= 1) { + fprintf ( stderr, " %s: ", inName ); + pad ( inName ); + fflush ( stderr ); + } + + /*--- Now the input and output handles are sane. Do the Biz. ---*/ + outputHandleJustInCase = outStr; + deleteOutputOnInterrupt = True; + magicNumberOK = uncompressStream ( inStr, outStr ); + outputHandleJustInCase = NULL; + + /*--- If there was an I/O error, we won't get here. ---*/ + if ( magicNumberOK ) { + if ( srcMode == SM_F2F ) { + copyDatePermissionsAndOwner ( inName, outName ); + deleteOutputOnInterrupt = False; + if ( !keepInputFiles ) { + IntNative retVal = remove ( inName ); + ERROR_IF_NOT_ZERO ( retVal ); + } + } + } else { + unzFailsExist = True; + deleteOutputOnInterrupt = False; + if ( srcMode == SM_F2F ) { + IntNative retVal = remove ( outName ); + ERROR_IF_NOT_ZERO ( retVal ); + } + } + deleteOutputOnInterrupt = False; + + if ( magicNumberOK ) { + if (verbosity >= 1) + fprintf ( stderr, "done\n" ); + } else { + setExit(2); + if (verbosity >= 1) + fprintf ( stderr, "not a bzip2 file.\n" ); else + fprintf ( stderr, + "%s: %s is not a bzip2 file.\n", + progName, inName ); + } + +} + + +/*---------------------------------------------*/ +static +void testf ( Char *name ) +{ + FILE *inStr; + Bool allOK; + + deleteOutputOnInterrupt = False; + + if (name == NULL && srcMode != SM_I2O) + panic ( "testf: bad modes\n" ); + + copyFileName ( outName, "(none)" ); + switch (srcMode) { + case SM_I2O: copyFileName ( inName, "(stdin)" ); break; + case SM_F2F: copyFileName ( inName, name ); break; + case SM_F2O: copyFileName ( inName, name ); break; + } + + if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) { + if (noisy) + fprintf ( stderr, "%s: There are no files matching `%s'.\n", + progName, inName ); + setExit(1); + return; + } + if ( srcMode != SM_I2O && !fileExists ( inName ) ) { + fprintf ( stderr, "%s: Can't open input %s: %s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + } + + switch ( srcMode ) { + + case SM_I2O: + if ( isatty ( fileno ( stdin ) ) ) { + fprintf ( stderr, + "%s: I won't read compressed data from a terminal.\n", + progName ); + fprintf ( stderr, "%s: For help, type: `%s --help'.\n", + progName, progName ); + setExit(1); + return; + }; + inStr = stdin; + break; + + case SM_F2O: case SM_F2F: + inStr = fopen ( inName, "rb" ); + if ( inStr == NULL ) { + fprintf ( stderr, "%s: Can't open input file %s:%s.\n", + progName, inName, strerror(errno) ); + setExit(1); + return; + }; + break; + + default: + panic ( "testf: bad srcMode" ); + break; + } + + if (verbosity >= 1) { + fprintf ( stderr, " %s: ", inName ); + pad ( inName ); + fflush ( stderr ); + } + + /*--- Now the input handle is sane. Do the Biz. ---*/ + allOK = testStream ( inStr ); + + if (allOK && verbosity >= 1) fprintf ( stderr, "ok\n" ); + if (!allOK) testFailsExist = True; +} + + +/*---------------------------------------------*/ +static +void license ( void ) +{ + fprintf ( stderr, + + "bzip2, a block-sorting file compressor. " + "Version %s.\n" + " \n" + " Copyright (C) 1996-2000 by Julian Seward.\n" + " \n" + " This program is free software; you can redistribute it and/or modify\n" + " it under the terms set out in the LICENSE file, which is included\n" + " in the bzip2-1.0 source distribution.\n" + " \n" + " This program is distributed in the hope that it will be useful,\n" + " but WITHOUT ANY WARRANTY; without even the implied warranty of\n" + " MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n" + " LICENSE file for more details.\n" + " \n", + BZ2_bzlibVersion() + ); +} + + +/*---------------------------------------------*/ +static +void usage ( Char *fullProgName ) +{ + fprintf ( + stderr, + "bzip2, a block-sorting file compressor. " + "Version %s.\n" + "\n usage: %s [flags and input files in any order]\n" + "\n" + " -h --help print this message\n" + " -d --decompress force decompression\n" + " -z --compress force compression\n" + " -k --keep keep (don't delete) input files\n" + " -f --force overwrite existing output files\n" + " -t --test test compressed file integrity\n" + " -c --stdout output to standard out\n" + " -q --quiet suppress noncritical error messages\n" + " -v --verbose be verbose (a 2nd -v gives more)\n" + " -L --license display software version & license\n" + " -V --version display software version & license\n" + " -s --small use less memory (at most 2500k)\n" + " -1 .. -9 set block size to 100k .. 900k\n" + "\n" + " If invoked as `bzip2', default action is to compress.\n" + " as `bunzip2', default action is to decompress.\n" + " as `bzcat', default action is to decompress to stdout.\n" + "\n" + " If no file names are given, bzip2 compresses or decompresses\n" + " from standard input to standard output. You can combine\n" + " short flags, so `-v -4' means the same as -v4 or -4v, &c.\n" +#if BZ_UNIX + "\n" +#endif + , + + BZ2_bzlibVersion(), + fullProgName + ); +} + + +/*---------------------------------------------*/ +static +void redundant ( Char* flag ) +{ + fprintf ( + stderr, + "%s: %s is redundant in versions 0.9.5 and above\n", + progName, flag ); +} + + +/*---------------------------------------------*/ +/*-- + All the garbage from here to main() is purely to + implement a linked list of command-line arguments, + into which main() copies argv[1 .. argc-1]. + + The purpose of this exercise is to facilitate + the expansion of wildcard characters * and ? in + filenames for OSs which don't know how to do it + themselves, like MSDOS, Windows 95 and NT. + + The actual Dirty Work is done by the platform- + specific macro APPEND_FILESPEC. +--*/ + +typedef + struct zzzz { + Char *name; + struct zzzz *link; + } + Cell; + + +/*---------------------------------------------*/ +static +void *myMalloc ( Int32 n ) +{ + void* p; + + p = malloc ( (size_t)n ); + if (p == NULL) outOfMemory (); + return p; +} + + +/*---------------------------------------------*/ +static +Cell *mkCell ( void ) +{ + Cell *c; + + c = (Cell*) myMalloc ( sizeof ( Cell ) ); + c->name = NULL; + c->link = NULL; + return c; +} + + +/*---------------------------------------------*/ +static +Cell *snocString ( Cell *root, Char *name ) +{ + if (root == NULL) { + Cell *tmp = mkCell(); + tmp->name = (Char*) myMalloc ( 5 + strlen(name) ); + strcpy ( tmp->name, name ); + return tmp; + } else { + Cell *tmp = root; + while (tmp->link != NULL) tmp = tmp->link; + tmp->link = snocString ( tmp->link, name ); + return root; + } +} + + +/*---------------------------------------------*/ +static +void addFlagsFromEnvVar ( Cell** argList, Char* varName ) +{ + Int32 i, j, k; + Char *envbase, *p; + + envbase = getenv(varName); + if (envbase != NULL) { + p = envbase; + i = 0; + while (True) { + if (p[i] == 0) break; + p += i; + i = 0; + while (isspace((Int32)(p[0]))) p++; + while (p[i] != 0 && !isspace((Int32)(p[i]))) i++; + if (i > 0) { + k = i; if (k > FILE_NAME_LEN-10) k = FILE_NAME_LEN-10; + for (j = 0; j < k; j++) tmpName[j] = p[j]; + tmpName[k] = 0; + APPEND_FLAG(*argList, tmpName); + } + } + } +} + + +/*---------------------------------------------*/ +#define ISFLAG(s) (strcmp(aa->name, (s))==0) + +IntNative main ( IntNative argc, Char *argv[] ) +{ + Int32 i, j; + Char *tmp; + Cell *argList; + Cell *aa; + Bool decode; + + /*-- Be really really really paranoid :-) --*/ + if (sizeof(Int32) != 4 || sizeof(UInt32) != 4 || + sizeof(Int16) != 2 || sizeof(UInt16) != 2 || + sizeof(Char) != 1 || sizeof(UChar) != 1) + configError(); + + /*-- Initialise --*/ + outputHandleJustInCase = NULL; + smallMode = False; + keepInputFiles = False; + forceOverwrite = False; + noisy = True; + verbosity = 0; + blockSize100k = 9; + testFailsExist = False; + unzFailsExist = False; + numFileNames = 0; + numFilesProcessed = 0; + workFactor = 30; + deleteOutputOnInterrupt = False; + exitValue = 0; + i = j = 0; /* avoid bogus warning from egcs-1.1.X */ + + /*-- Set up signal handlers for mem access errors --*/ + signal (SIGSEGV, mySIGSEGVorSIGBUScatcher); +#if BZ_UNIX +#ifndef __DJGPP__ + signal (SIGBUS, mySIGSEGVorSIGBUScatcher); +#endif +#endif + + copyFileName ( inName, "(none)" ); + copyFileName ( outName, "(none)" ); + + copyFileName ( progNameReally, argv[0] ); + progName = &progNameReally[0]; + for (tmp = &progNameReally[0]; *tmp != '\0'; tmp++) + if (*tmp == PATH_SEP) progName = tmp + 1; + + + /*-- Copy flags from env var BZIP2, and + expand filename wildcards in arg list. + --*/ + argList = NULL; + addFlagsFromEnvVar ( &argList, "BZIP2" ); + addFlagsFromEnvVar ( &argList, "BZIP" ); + for (i = 1; i <= argc-1; i++) + APPEND_FILESPEC(argList, argv[i]); + + + /*-- Find the length of the longest filename --*/ + longestFileName = 7; + numFileNames = 0; + decode = True; + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) { decode = False; continue; } + if (aa->name[0] == '-' && decode) continue; + numFileNames++; + if (longestFileName < (Int32)strlen(aa->name) ) + longestFileName = (Int32)strlen(aa->name); + } + + + /*-- Determine source modes; flag handling may change this too. --*/ + if (numFileNames == 0) + srcMode = SM_I2O; else srcMode = SM_F2F; + + + /*-- Determine what to do (compress/uncompress/test/cat). --*/ + /*-- Note that subsequent flag handling may change this. --*/ + opMode = OM_Z; + + if ( (strstr ( progName, "unzip" ) != 0) || + (strstr ( progName, "UNZIP" ) != 0) ) + opMode = OM_UNZ; + + if ( (strstr ( progName, "z2cat" ) != 0) || + (strstr ( progName, "Z2CAT" ) != 0) || + (strstr ( progName, "zcat" ) != 0) || + (strstr ( progName, "ZCAT" ) != 0) ) { + opMode = OM_UNZ; + srcMode = (numFileNames == 0) ? SM_I2O : SM_F2O; + } + + + /*-- Look at the flags. --*/ + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) break; + if (aa->name[0] == '-' && aa->name[1] != '-') { + for (j = 1; aa->name[j] != '\0'; j++) { + switch (aa->name[j]) { + case 'c': srcMode = SM_F2O; break; + case 'd': opMode = OM_UNZ; break; + case 'z': opMode = OM_Z; break; + case 'f': forceOverwrite = True; break; + case 't': opMode = OM_TEST; break; + case 'k': keepInputFiles = True; break; + case 's': smallMode = True; break; + case 'q': noisy = False; break; + case '1': blockSize100k = 1; break; + case '2': blockSize100k = 2; break; + case '3': blockSize100k = 3; break; + case '4': blockSize100k = 4; break; + case '5': blockSize100k = 5; break; + case '6': blockSize100k = 6; break; + case '7': blockSize100k = 7; break; + case '8': blockSize100k = 8; break; + case '9': blockSize100k = 9; break; + case 'V': + case 'L': license(); break; + case 'v': verbosity++; break; + case 'h': usage ( progName ); + exit ( 0 ); + break; + default: fprintf ( stderr, "%s: Bad flag `%s'\n", + progName, aa->name ); + usage ( progName ); + exit ( 1 ); + break; + } + } + } + } + + /*-- And again ... --*/ + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) break; + if (ISFLAG("--stdout")) srcMode = SM_F2O; else + if (ISFLAG("--decompress")) opMode = OM_UNZ; else + if (ISFLAG("--compress")) opMode = OM_Z; else + if (ISFLAG("--force")) forceOverwrite = True; else + if (ISFLAG("--test")) opMode = OM_TEST; else + if (ISFLAG("--keep")) keepInputFiles = True; else + if (ISFLAG("--small")) smallMode = True; else + if (ISFLAG("--quiet")) noisy = False; else + if (ISFLAG("--version")) license(); else + if (ISFLAG("--license")) license(); else + if (ISFLAG("--exponential")) workFactor = 1; else + if (ISFLAG("--repetitive-best")) redundant(aa->name); else + if (ISFLAG("--repetitive-fast")) redundant(aa->name); else + if (ISFLAG("--verbose")) verbosity++; else + if (ISFLAG("--help")) { usage ( progName ); exit ( 0 ); } + else + if (strncmp ( aa->name, "--", 2) == 0) { + fprintf ( stderr, "%s: Bad flag `%s'\n", progName, aa->name ); + usage ( progName ); + exit ( 1 ); + } + } + + if (verbosity > 4) verbosity = 4; + if (opMode == OM_Z && smallMode && blockSize100k > 2) + blockSize100k = 2; + + if (opMode == OM_TEST && srcMode == SM_F2O) { + fprintf ( stderr, "%s: -c and -t cannot be used together.\n", + progName ); + exit ( 1 ); + } + + if (srcMode == SM_F2O && numFileNames == 0) + srcMode = SM_I2O; + + if (opMode != OM_Z) blockSize100k = 0; + + if (srcMode == SM_F2F) { + signal (SIGINT, mySignalCatcher); + signal (SIGTERM, mySignalCatcher); +# if BZ_UNIX + signal (SIGHUP, mySignalCatcher); +# endif + } + + if (opMode == OM_Z) { + if (srcMode == SM_I2O) { + compress ( NULL ); + } else { + decode = True; + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) { decode = False; continue; } + if (aa->name[0] == '-' && decode) continue; + numFilesProcessed++; + compress ( aa->name ); + } + } + } + else + + if (opMode == OM_UNZ) { + unzFailsExist = False; + if (srcMode == SM_I2O) { + uncompress ( NULL ); + } else { + decode = True; + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) { decode = False; continue; } + if (aa->name[0] == '-' && decode) continue; + numFilesProcessed++; + uncompress ( aa->name ); + } + } + if (unzFailsExist) { + setExit(2); + exit(exitValue); + } + } + + else { + testFailsExist = False; + if (srcMode == SM_I2O) { + testf ( NULL ); + } else { + decode = True; + for (aa = argList; aa != NULL; aa = aa->link) { + if (ISFLAG("--")) { decode = False; continue; } + if (aa->name[0] == '-' && decode) continue; + numFilesProcessed++; + testf ( aa->name ); + } + } + if (testFailsExist && noisy) { + fprintf ( stderr, + "\n" + "You can use the `bzip2recover' program to attempt to recover\n" + "data from undamaged sections of corrupted files.\n\n" + ); + setExit(2); + exit(exitValue); + } + } + + /* Free the argument list memory to mollify leak detectors + (eg) Purify, Checker. Serves no other useful purpose. + */ + aa = argList; + while (aa != NULL) { + Cell* aa2 = aa->link; + if (aa->name != NULL) free(aa->name); + free(aa); + aa = aa2; + } + + return exitValue; +} + + +/*-----------------------------------------------------------*/ +/*--- end bzip2.c ---*/ +/*-----------------------------------------------------------*/ diff --git a/bzip2/bzip2.txt b/bzip2/bzip2.txt new file mode 100644 index 000000000..4f1ae8620 --- /dev/null +++ b/bzip2/bzip2.txt @@ -0,0 +1,376 @@ + + +NAME + bzip2, bunzip2 - a block-sorting file compressor, v1.0 + bzcat - decompresses files to stdout + bzip2recover - recovers data from damaged bzip2 files + + +SYNOPSIS + bzip2 [ -cdfkqstvzVL123456789 ] [ filenames ... ] + bunzip2 [ -fkvsVL ] [ filenames ... ] + bzcat [ -s ] [ filenames ... ] + bzip2recover filename + + +DESCRIPTION + bzip2 compresses files using the Burrows-Wheeler block + sorting text compression algorithm, and Huffman coding. + Compression is generally considerably better than that + achieved by more conventional LZ77/LZ78-based compressors, + and approaches the performance of the PPM family of sta- + tistical compressors. + + The command-line options are deliberately very similar to + those of GNU gzip, but they are not identical. + + bzip2 expects a list of file names to accompany the com- + mand-line flags. Each file is replaced by a compressed + version of itself, with the name "original_name.bz2". + Each compressed file has the same modification date, per- + missions, and, when possible, ownership as the correspond- + ing original, so that these properties can be correctly + restored at decompression time. File name handling is + naive in the sense that there is no mechanism for preserv- + ing original file names, permissions, ownerships or dates + in filesystems which lack these concepts, or have serious + file name length restrictions, such as MS-DOS. + + bzip2 and bunzip2 will by default not overwrite existing + files. If you want this to happen, specify the -f flag. + + If no file names are specified, bzip2 compresses from + standard input to standard output. In this case, bzip2 + will decline to write compressed output to a terminal, as + this would be entirely incomprehensible and therefore + pointless. + + bunzip2 (or bzip2 -d) decompresses all specified files. + Files which were not created by bzip2 will be detected and + ignored, and a warning issued. bzip2 attempts to guess + the filename for the decompressed file from that of the + compressed file as follows: + + filename.bz2 becomes filename + filename.bz becomes filename + filename.tbz2 becomes filename.tar + filename.tbz becomes filename.tar + anyothername becomes anyothername.out + + If the file does not end in one of the recognised endings, + .bz2, .bz, .tbz2 or .tbz, bzip2 complains that it cannot + guess the name of the original file, and uses the original + name with .out appended. + + As with compression, supplying no filenames causes decom- + pression from standard input to standard output. + + bunzip2 will correctly decompress a file which is the con- + catenation of two or more compressed files. The result is + the concatenation of the corresponding uncompressed files. + Integrity testing (-t) of concatenated compressed files is + also supported. + + You can also compress or decompress files to the standard + output by giving the -c flag. Multiple files may be com- + pressed and decompressed like this. The resulting outputs + are fed sequentially to stdout. Compression of multiple + files in this manner generates a stream containing multi- + ple compressed file representations. Such a stream can be + decompressed correctly only by bzip2 version 0.9.0 or + later. Earlier versions of bzip2 will stop after decom- + pressing the first file in the stream. + + bzcat (or bzip2 -dc) decompresses all specified files to + the standard output. + + bzip2 will read arguments from the environment variables + BZIP2 and BZIP, in that order, and will process them + before any arguments read from the command line. This + gives a convenient way to supply default arguments. + + Compression is always performed, even if the compressed + file is slightly larger than the original. Files of less + than about one hundred bytes tend to get larger, since the + compression mechanism has a constant overhead in the + region of 50 bytes. Random data (including the output of + most file compressors) is coded at about 8.05 bits per + byte, giving an expansion of around 0.5%. + + As a self-check for your protection, bzip2 uses 32-bit + CRCs to make sure that the decompressed version of a file + is identical to the original. This guards against corrup- + tion of the compressed data, and against undetected bugs + in bzip2 (hopefully very unlikely). The chances of data + corruption going undetected is microscopic, about one + chance in four billion for each file processed. Be aware, + though, that the check occurs upon decompression, so it + can only tell you that something is wrong. It can't help + you recover the original uncompressed data. You can use + bzip2recover to try to recover data from damaged files. + + Return values: 0 for a normal exit, 1 for environmental + problems (file not found, invalid flags, I/O errors, &c), + 2 to indicate a corrupt compressed file, 3 for an internal + consistency error (eg, bug) which caused bzip2 to panic. + + +OPTIONS + -c --stdout + Compress or decompress to standard output. + + -d --decompress + Force decompression. bzip2, bunzip2 and bzcat are + really the same program, and the decision about + what actions to take is done on the basis of which + name is used. This flag overrides that mechanism, + and forces bzip2 to decompress. + + -z --compress + The complement to -d: forces compression, regard- + less of the invokation name. + + -t --test + Check integrity of the specified file(s), but don't + decompress them. This really performs a trial + decompression and throws away the result. + + -f --force + Force overwrite of output files. Normally, bzip2 + will not overwrite existing output files. Also + forces bzip2 to break hard links to files, which it + otherwise wouldn't do. + + -k --keep + Keep (don't delete) input files during compression + or decompression. + + -s --small + Reduce memory usage, for compression, decompression + and testing. Files are decompressed and tested + using a modified algorithm which only requires 2.5 + bytes per block byte. This means any file can be + decompressed in 2300k of memory, albeit at about + half the normal speed. + + During compression, -s selects a block size of + 200k, which limits memory use to around the same + figure, at the expense of your compression ratio. + In short, if your machine is low on memory (8 + megabytes or less), use -s for everything. See + MEMORY MANAGEMENT below. + + -q --quiet + Suppress non-essential warning messages. Messages + pertaining to I/O errors and other critical events + will not be suppressed. + + -v --verbose + Verbose mode -- show the compression ratio for each + file processed. Further -v's increase the ver- + bosity level, spewing out lots of information which + is primarily of interest for diagnostic purposes. + + -L --license -V --version + Display the software version, license terms and + conditions. + + -1 to -9 + Set the block size to 100 k, 200 k .. 900 k when + compressing. Has no effect when decompressing. + See MEMORY MANAGEMENT below. + + -- Treats all subsequent arguments as file names, even + if they start with a dash. This is so you can han- + dle files with names beginning with a dash, for + example: bzip2 -- -myfilename. + + --repetitive-fast --repetitive-best + These flags are redundant in versions 0.9.5 and + above. They provided some coarse control over the + behaviour of the sorting algorithm in earlier ver- + sions, which was sometimes useful. 0.9.5 and above + have an improved algorithm which renders these + flags irrelevant. + + +MEMORY MANAGEMENT + bzip2 compresses large files in blocks. The block size + affects both the compression ratio achieved, and the + amount of memory needed for compression and decompression. + The flags -1 through -9 specify the block size to be + 100,000 bytes through 900,000 bytes (the default) respec- + tively. At decompression time, the block size used for + compression is read from the header of the compressed + file, and bunzip2 then allocates itself just enough memory + to decompress the file. Since block sizes are stored in + compressed files, it follows that the flags -1 to -9 are + irrelevant to and so ignored during decompression. + + Compression and decompression requirements, in bytes, can + be estimated as: + + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) + + Larger block sizes give rapidly diminishing marginal + returns. Most of the compression comes from the first two + or three hundred k of block size, a fact worth bearing in + mind when using bzip2 on small machines. It is also + important to appreciate that the decompression memory + requirement is set at compression time by the choice of + block size. + + For files compressed with the default 900k block size, + bunzip2 will require about 3700 kbytes to decompress. To + support decompression of any file on a 4 megabyte machine, + bunzip2 has an option to decompress using approximately + half this amount of memory, about 2300 kbytes. Decompres- + sion speed is also halved, so you should use this option + only where necessary. The relevant flag is -s. + + In general, try and use the largest block size memory con- + straints allow, since that maximises the compression + achieved. Compression and decompression speed are virtu- + ally unaffected by block size. + + Another significant point applies to files which fit in a + single block -- that means most files you'd encounter + using a large block size. The amount of real memory + touched is proportional to the size of the file, since the + file is smaller than a block. For example, compressing a + file 20,000 bytes long with the flag -9 will cause the + compressor to allocate around 7600k of memory, but only + touch 400k + 20000 * 8 = 560 kbytes of it. Similarly, the + decompressor will allocate 3700k but only touch 100k + + 20000 * 4 = 180 kbytes. + + Here is a table which summarises the maximum memory usage + for different block sizes. Also recorded is the total + compressed size for 14 files of the Calgary Text Compres- + sion Corpus totalling 3,141,622 bytes. This column gives + some feel for how compression varies with block size. + These figures tend to understate the advantage of larger + block sizes for larger files, since the Corpus is domi- + nated by smaller files. + + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 + + +RECOVERING DATA FROM DAMAGED FILES + bzip2 compresses files in blocks, usually 900kbytes long. + Each block is handled independently. If a media or trans- + mission error causes a multi-block .bz2 file to become + damaged, it may be possible to recover data from the + undamaged blocks in the file. + + The compressed representation of each block is delimited + by a 48-bit pattern, which makes it possible to find the + block boundaries with reasonable certainty. Each block + also carries its own 32-bit CRC, so damaged blocks can be + distinguished from undamaged ones. + + bzip2recover is a simple program whose purpose is to + search for blocks in .bz2 files, and write each block out + into its own .bz2 file. You can then use bzip2 -t to test + the integrity of the resulting files, and decompress those + which are undamaged. + + bzip2recover takes a single argument, the name of the dam- + aged file, and writes a number of files "rec0001file.bz2", + "rec0002file.bz2", etc, containing the extracted blocks. + The output filenames are designed so that the use of + wildcards in subsequent processing -- for example, "bzip2 + -dc rec*file.bz2 > recovered_data" -- lists the files in + the correct order. + + bzip2recover should be of most use dealing with large .bz2 + files, as these will contain many blocks. It is clearly + futile to use it on damaged single-block files, since a + damaged block cannot be recovered. If you wish to min- + imise any potential data loss through media or transmis- + sion errors, you might consider compressing with a smaller + block size. + + +PERFORMANCE NOTES + The sorting phase of compression gathers together similar + strings in the file. Because of this, files containing + very long runs of repeated symbols, like "aabaabaabaab + ..." (repeated several hundred times) may compress more + slowly than normal. Versions 0.9.5 and above fare much + better than previous versions in this respect. The ratio + between worst-case and average-case compression time is in + the region of 10:1. For previous versions, this figure + was more like 100:1. You can use the -vvvv option to mon- + itor progress in great detail, if you want. + + Decompression speed is unaffected by these phenomena. + + bzip2 usually allocates several megabytes of memory to + operate in, and then charges all over it in a fairly ran- + dom fashion. This means that performance, both for com- + pressing and decompressing, is largely determined by the + speed at which your machine can service cache misses. + Because of this, small changes to the code to reduce the + miss rate have been observed to give disproportionately + large performance improvements. I imagine bzip2 will per- + form best on machines with very large caches. + + +CAVEATS + I/O error messages are not as helpful as they could be. + bzip2 tries hard to detect I/O errors and exit cleanly, + but the details of what the problem is sometimes seem + rather misleading. + + This manual page pertains to version 1.0 of bzip2. Com- + pressed data created by this version is entirely forwards + and backwards compatible with the previous public + releases, versions 0.1pl2, 0.9.0 and 0.9.5, but with the + following exception: 0.9.0 and above can correctly decom- + press multiple concatenated compressed files. 0.1pl2 can- + not do this; it will stop after decompressing just the + first file in the stream. + + bzip2recover uses 32-bit integers to represent bit posi- + tions in compressed files, so it cannot handle compressed + files more than 512 megabytes long. This could easily be + fixed. + + +AUTHOR + Julian Seward, jseward@acm.org. + + http://sourceware.cygnus.com/bzip2 + http://www.muraroa.demon.co.uk + + The ideas embodied in bzip2 are due to (at least) the fol- + lowing people: Michael Burrows and David Wheeler (for the + block sorting transformation), David Wheeler (again, for + the Huffman coder), Peter Fenwick (for the structured cod- + ing model in the original bzip, and many refinements), and + Alistair Moffat, Radford Neal and Ian Witten (for the + arithmetic coder in the original bzip). I am much + indebted for their help, support and advice. See the man- + ual in the source distribution for pointers to sources of + documentation. Christian von Roques encouraged me to look + for faster sorting algorithms, so as to speed up compres- + sion. Bela Lubkin encouraged me to improve the worst-case + compression performance. Many people sent patches, helped + with portability problems, lent machines, gave advice and + were generally helpful. + diff --git a/bzip2/bzip2recover.c b/bzip2/bzip2recover.c new file mode 100644 index 000000000..ba3d17563 --- /dev/null +++ b/bzip2/bzip2recover.c @@ -0,0 +1,435 @@ + +/*-----------------------------------------------------------*/ +/*--- Block recoverer program for bzip2 ---*/ +/*--- bzip2recover.c ---*/ +/*-----------------------------------------------------------*/ + +/*-- + This program is bzip2recover, a program to attempt data + salvage from damaged files created by the accompanying + bzip2-1.0 program. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 +--*/ + +/*-- + This program is a complete hack and should be rewritten + properly. It isn't very complicated. +--*/ + +#include <stdio.h> +#include <errno.h> +#include <stdlib.h> +#include <string.h> + +typedef unsigned int UInt32; +typedef int Int32; +typedef unsigned char UChar; +typedef char Char; +typedef unsigned char Bool; +#define True ((Bool)1) +#define False ((Bool)0) + + +Char inFileName[2000]; +Char outFileName[2000]; +Char progName[2000]; + +UInt32 bytesOut = 0; +UInt32 bytesIn = 0; + + +/*---------------------------------------------------*/ +/*--- I/O errors ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------*/ +void readError ( void ) +{ + fprintf ( stderr, + "%s: I/O error reading `%s', possible reason follows.\n", + progName, inFileName ); + perror ( progName ); + fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n", + progName ); + exit ( 1 ); +} + + +/*---------------------------------------------*/ +void writeError ( void ) +{ + fprintf ( stderr, + "%s: I/O error reading `%s', possible reason follows.\n", + progName, inFileName ); + perror ( progName ); + fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n", + progName ); + exit ( 1 ); +} + + +/*---------------------------------------------*/ +void mallocFail ( Int32 n ) +{ + fprintf ( stderr, + "%s: malloc failed on request for %d bytes.\n", + progName, n ); + fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n", + progName ); + exit ( 1 ); +} + + +/*---------------------------------------------------*/ +/*--- Bit stream I/O ---*/ +/*---------------------------------------------------*/ + +typedef + struct { + FILE* handle; + Int32 buffer; + Int32 buffLive; + Char mode; + } + BitStream; + + +/*---------------------------------------------*/ +BitStream* bsOpenReadStream ( FILE* stream ) +{ + BitStream *bs = malloc ( sizeof(BitStream) ); + if (bs == NULL) mallocFail ( sizeof(BitStream) ); + bs->handle = stream; + bs->buffer = 0; + bs->buffLive = 0; + bs->mode = 'r'; + return bs; +} + + +/*---------------------------------------------*/ +BitStream* bsOpenWriteStream ( FILE* stream ) +{ + BitStream *bs = malloc ( sizeof(BitStream) ); + if (bs == NULL) mallocFail ( sizeof(BitStream) ); + bs->handle = stream; + bs->buffer = 0; + bs->buffLive = 0; + bs->mode = 'w'; + return bs; +} + + +/*---------------------------------------------*/ +void bsPutBit ( BitStream* bs, Int32 bit ) +{ + if (bs->buffLive == 8) { + Int32 retVal = putc ( (UChar) bs->buffer, bs->handle ); + if (retVal == EOF) writeError(); + bytesOut++; + bs->buffLive = 1; + bs->buffer = bit & 0x1; + } else { + bs->buffer = ( (bs->buffer << 1) | (bit & 0x1) ); + bs->buffLive++; + }; +} + + +/*---------------------------------------------*/ +/*-- + Returns 0 or 1, or 2 to indicate EOF. +--*/ +Int32 bsGetBit ( BitStream* bs ) +{ + if (bs->buffLive > 0) { + bs->buffLive --; + return ( ((bs->buffer) >> (bs->buffLive)) & 0x1 ); + } else { + Int32 retVal = getc ( bs->handle ); + if ( retVal == EOF ) { + if (errno != 0) readError(); + return 2; + } + bs->buffLive = 7; + bs->buffer = retVal; + return ( ((bs->buffer) >> 7) & 0x1 ); + } +} + + +/*---------------------------------------------*/ +void bsClose ( BitStream* bs ) +{ + Int32 retVal; + + if ( bs->mode == 'w' ) { + while ( bs->buffLive < 8 ) { + bs->buffLive++; + bs->buffer <<= 1; + }; + retVal = putc ( (UChar) (bs->buffer), bs->handle ); + if (retVal == EOF) writeError(); + bytesOut++; + retVal = fflush ( bs->handle ); + if (retVal == EOF) writeError(); + } + retVal = fclose ( bs->handle ); + if (retVal == EOF) { + if (bs->mode == 'w') writeError(); else readError(); + } + free ( bs ); +} + + +/*---------------------------------------------*/ +void bsPutUChar ( BitStream* bs, UChar c ) +{ + Int32 i; + for (i = 7; i >= 0; i--) + bsPutBit ( bs, (((UInt32) c) >> i) & 0x1 ); +} + + +/*---------------------------------------------*/ +void bsPutUInt32 ( BitStream* bs, UInt32 c ) +{ + Int32 i; + + for (i = 31; i >= 0; i--) + bsPutBit ( bs, (c >> i) & 0x1 ); +} + + +/*---------------------------------------------*/ +Bool endsInBz2 ( Char* name ) +{ + Int32 n = strlen ( name ); + if (n <= 4) return False; + return + (name[n-4] == '.' && + name[n-3] == 'b' && + name[n-2] == 'z' && + name[n-1] == '2'); +} + + +/*---------------------------------------------------*/ +/*--- ---*/ +/*---------------------------------------------------*/ + +#define BLOCK_HEADER_HI 0x00003141UL +#define BLOCK_HEADER_LO 0x59265359UL + +#define BLOCK_ENDMARK_HI 0x00001772UL +#define BLOCK_ENDMARK_LO 0x45385090UL + + +UInt32 bStart[20000]; +UInt32 bEnd[20000]; +UInt32 rbStart[20000]; +UInt32 rbEnd[20000]; + +Int32 main ( Int32 argc, Char** argv ) +{ + FILE* inFile; + FILE* outFile; + BitStream* bsIn, *bsWr; + Int32 currBlock, b, wrBlock; + UInt32 bitsRead; + Int32 rbCtr; + + + UInt32 buffHi, buffLo, blockCRC; + Char* p; + + strcpy ( progName, argv[0] ); + inFileName[0] = outFileName[0] = 0; + + fprintf ( stderr, "bzip2recover 1.0: extracts blocks from damaged .bz2 files.\n" ); + + if (argc != 2) { + fprintf ( stderr, "%s: usage is `%s damaged_file_name'.\n", + progName, progName ); + exit(1); + } + + strcpy ( inFileName, argv[1] ); + + inFile = fopen ( inFileName, "rb" ); + if (inFile == NULL) { + fprintf ( stderr, "%s: can't read `%s'\n", progName, inFileName ); + exit(1); + } + + bsIn = bsOpenReadStream ( inFile ); + fprintf ( stderr, "%s: searching for block boundaries ...\n", progName ); + + bitsRead = 0; + buffHi = buffLo = 0; + currBlock = 0; + bStart[currBlock] = 0; + + rbCtr = 0; + + while (True) { + b = bsGetBit ( bsIn ); + bitsRead++; + if (b == 2) { + if (bitsRead >= bStart[currBlock] && + (bitsRead - bStart[currBlock]) >= 40) { + bEnd[currBlock] = bitsRead-1; + if (currBlock > 0) + fprintf ( stderr, " block %d runs from %d to %d (incomplete)\n", + currBlock, bStart[currBlock], bEnd[currBlock] ); + } else + currBlock--; + break; + } + buffHi = (buffHi << 1) | (buffLo >> 31); + buffLo = (buffLo << 1) | (b & 1); + if ( ( (buffHi & 0x0000ffff) == BLOCK_HEADER_HI + && buffLo == BLOCK_HEADER_LO) + || + ( (buffHi & 0x0000ffff) == BLOCK_ENDMARK_HI + && buffLo == BLOCK_ENDMARK_LO) + ) { + if (bitsRead > 49) + bEnd[currBlock] = bitsRead-49; else + bEnd[currBlock] = 0; + if (currBlock > 0 && + (bEnd[currBlock] - bStart[currBlock]) >= 130) { + fprintf ( stderr, " block %d runs from %d to %d\n", + rbCtr+1, bStart[currBlock], bEnd[currBlock] ); + rbStart[rbCtr] = bStart[currBlock]; + rbEnd[rbCtr] = bEnd[currBlock]; + rbCtr++; + } + currBlock++; + + bStart[currBlock] = bitsRead; + } + } + + bsClose ( bsIn ); + + /*-- identified blocks run from 1 to rbCtr inclusive. --*/ + + if (rbCtr < 1) { + fprintf ( stderr, + "%s: sorry, I couldn't find any block boundaries.\n", + progName ); + exit(1); + }; + + fprintf ( stderr, "%s: splitting into blocks\n", progName ); + + inFile = fopen ( inFileName, "rb" ); + if (inFile == NULL) { + fprintf ( stderr, "%s: can't open `%s'\n", progName, inFileName ); + exit(1); + } + bsIn = bsOpenReadStream ( inFile ); + + /*-- placate gcc's dataflow analyser --*/ + blockCRC = 0; bsWr = 0; + + bitsRead = 0; + outFile = NULL; + wrBlock = 0; + while (True) { + b = bsGetBit(bsIn); + if (b == 2) break; + buffHi = (buffHi << 1) | (buffLo >> 31); + buffLo = (buffLo << 1) | (b & 1); + if (bitsRead == 47+rbStart[wrBlock]) + blockCRC = (buffHi << 16) | (buffLo >> 16); + + if (outFile != NULL && bitsRead >= rbStart[wrBlock] + && bitsRead <= rbEnd[wrBlock]) { + bsPutBit ( bsWr, b ); + } + + bitsRead++; + + if (bitsRead == rbEnd[wrBlock]+1) { + if (outFile != NULL) { + bsPutUChar ( bsWr, 0x17 ); bsPutUChar ( bsWr, 0x72 ); + bsPutUChar ( bsWr, 0x45 ); bsPutUChar ( bsWr, 0x38 ); + bsPutUChar ( bsWr, 0x50 ); bsPutUChar ( bsWr, 0x90 ); + bsPutUInt32 ( bsWr, blockCRC ); + bsClose ( bsWr ); + } + if (wrBlock >= rbCtr) break; + wrBlock++; + } else + if (bitsRead == rbStart[wrBlock]) { + outFileName[0] = 0; + sprintf ( outFileName, "rec%4d", wrBlock+1 ); + for (p = outFileName; *p != 0; p++) if (*p == ' ') *p = '0'; + strcat ( outFileName, inFileName ); + if ( !endsInBz2(outFileName)) strcat ( outFileName, ".bz2" ); + + fprintf ( stderr, " writing block %d to `%s' ...\n", + wrBlock+1, outFileName ); + + outFile = fopen ( outFileName, "wb" ); + if (outFile == NULL) { + fprintf ( stderr, "%s: can't write `%s'\n", + progName, outFileName ); + exit(1); + } + bsWr = bsOpenWriteStream ( outFile ); + bsPutUChar ( bsWr, 'B' ); bsPutUChar ( bsWr, 'Z' ); + bsPutUChar ( bsWr, 'h' ); bsPutUChar ( bsWr, '9' ); + bsPutUChar ( bsWr, 0x31 ); bsPutUChar ( bsWr, 0x41 ); + bsPutUChar ( bsWr, 0x59 ); bsPutUChar ( bsWr, 0x26 ); + bsPutUChar ( bsWr, 0x53 ); bsPutUChar ( bsWr, 0x59 ); + } + } + + fprintf ( stderr, "%s: finished\n", progName ); + return 0; +} + + + +/*-----------------------------------------------------------*/ +/*--- end bzip2recover.c ---*/ +/*-----------------------------------------------------------*/ diff --git a/bzip2/bzlib.c b/bzip2/bzlib.c new file mode 100644 index 000000000..4a06d9f14 --- /dev/null +++ b/bzip2/bzlib.c @@ -0,0 +1,1564 @@ + +/*-------------------------------------------------------------*/ +/*--- Library top-level functions. ---*/ +/*--- bzlib.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + +/*-- + CHANGES + ~~~~~~~ + 0.9.0 -- original version. + + 0.9.0a/b -- no changes in this file. + + 0.9.0c + * made zero-length BZ_FLUSH work correctly in bzCompress(). + * fixed bzWrite/bzRead to ignore zero-length requests. + * fixed bzread to correctly handle read requests after EOF. + * wrong parameter order in call to bzDecompressInit in + bzBuffToBuffDecompress. Fixed. +--*/ + +#include "bzlib_private.h" + + +/*---------------------------------------------------*/ +/*--- Compression stuff ---*/ +/*---------------------------------------------------*/ + + +/*---------------------------------------------------*/ +#ifndef BZ_NO_STDIO +void BZ2_bz__AssertH__fail ( int errcode ) +{ + fprintf(stderr, + "\n\nbzip2/libbzip2: internal error number %d.\n" + "This is a bug in bzip2/libbzip2, %s.\n" + "Please report it to me at: jseward@acm.org. If this happened\n" + "when you were using some program which uses libbzip2 as a\n" + "component, you should also report this bug to the author(s)\n" + "of that program. Please make an effort to report this bug;\n" + "timely and accurate bug reports eventually lead to higher\n" + "quality software. Thanks. Julian Seward, 21 March 2000.\n\n", + errcode, + BZ2_bzlibVersion() + ); + exit(3); +} +#endif + + +/*---------------------------------------------------*/ +static +int bz_config_ok ( void ) +{ + if (sizeof(int) != 4) return 0; + if (sizeof(short) != 2) return 0; + if (sizeof(char) != 1) return 0; + return 1; +} + + +/*---------------------------------------------------*/ +static +void* default_bzalloc ( void* opaque, Int32 items, Int32 size ) +{ + void* v = malloc ( items * size ); + return v; +} + +static +void default_bzfree ( void* opaque, void* addr ) +{ + if (addr != NULL) free ( addr ); +} + + +/*---------------------------------------------------*/ +static +void prepare_new_block ( EState* s ) +{ + Int32 i; + s->nblock = 0; + s->numZ = 0; + s->state_out_pos = 0; + BZ_INITIALISE_CRC ( s->blockCRC ); + for (i = 0; i < 256; i++) s->inUse[i] = False; + s->blockNo++; +} + + +/*---------------------------------------------------*/ +static +void init_RL ( EState* s ) +{ + s->state_in_ch = 256; + s->state_in_len = 0; +} + + +static +Bool isempty_RL ( EState* s ) +{ + if (s->state_in_ch < 256 && s->state_in_len > 0) + return False; else + return True; +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzCompressInit) + ( bz_stream* strm, + int blockSize100k, + int verbosity, + int workFactor ) +{ + Int32 n; + EState* s; + + if (!bz_config_ok()) return BZ_CONFIG_ERROR; + + if (strm == NULL || + blockSize100k < 1 || blockSize100k > 9 || + workFactor < 0 || workFactor > 250) + return BZ_PARAM_ERROR; + + if (workFactor == 0) workFactor = 30; + if (strm->bzalloc == NULL) strm->bzalloc = default_bzalloc; + if (strm->bzfree == NULL) strm->bzfree = default_bzfree; + + s = BZALLOC( sizeof(EState) ); + if (s == NULL) return BZ_MEM_ERROR; + s->strm = strm; + + s->arr1 = NULL; + s->arr2 = NULL; + s->ftab = NULL; + + n = 100000 * blockSize100k; + s->arr1 = BZALLOC( n * sizeof(UInt32) ); + s->arr2 = BZALLOC( (n+BZ_N_OVERSHOOT) * sizeof(UInt32) ); + s->ftab = BZALLOC( 65537 * sizeof(UInt32) ); + + if (s->arr1 == NULL || s->arr2 == NULL || s->ftab == NULL) { + if (s->arr1 != NULL) BZFREE(s->arr1); + if (s->arr2 != NULL) BZFREE(s->arr2); + if (s->ftab != NULL) BZFREE(s->ftab); + if (s != NULL) BZFREE(s); + return BZ_MEM_ERROR; + } + + s->blockNo = 0; + s->state = BZ_S_INPUT; + s->mode = BZ_M_RUNNING; + s->combinedCRC = 0; + s->blockSize100k = blockSize100k; + s->nblockMAX = 100000 * blockSize100k - 19; + s->verbosity = verbosity; + s->workFactor = workFactor; + + s->block = (UChar*)s->arr2; + s->mtfv = (UInt16*)s->arr1; + s->zbits = NULL; + s->ptr = (UInt32*)s->arr1; + + strm->state = s; + strm->total_in_lo32 = 0; + strm->total_in_hi32 = 0; + strm->total_out_lo32 = 0; + strm->total_out_hi32 = 0; + init_RL ( s ); + prepare_new_block ( s ); + return BZ_OK; +} + + +/*---------------------------------------------------*/ +static +void add_pair_to_block ( EState* s ) +{ + Int32 i; + UChar ch = (UChar)(s->state_in_ch); + for (i = 0; i < s->state_in_len; i++) { + BZ_UPDATE_CRC( s->blockCRC, ch ); + } + s->inUse[s->state_in_ch] = True; + switch (s->state_in_len) { + case 1: + s->block[s->nblock] = (UChar)ch; s->nblock++; + break; + case 2: + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + break; + case 3: + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + break; + default: + s->inUse[s->state_in_len-4] = True; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = (UChar)ch; s->nblock++; + s->block[s->nblock] = ((UChar)(s->state_in_len-4)); + s->nblock++; + break; + } +} + + +/*---------------------------------------------------*/ +static +void flush_RL ( EState* s ) +{ + if (s->state_in_ch < 256) add_pair_to_block ( s ); + init_RL ( s ); +} + + +/*---------------------------------------------------*/ +#define ADD_CHAR_TO_BLOCK(zs,zchh0) \ +{ \ + UInt32 zchh = (UInt32)(zchh0); \ + /*-- fast track the common case --*/ \ + if (zchh != zs->state_in_ch && \ + zs->state_in_len == 1) { \ + UChar ch = (UChar)(zs->state_in_ch); \ + BZ_UPDATE_CRC( zs->blockCRC, ch ); \ + zs->inUse[zs->state_in_ch] = True; \ + zs->block[zs->nblock] = (UChar)ch; \ + zs->nblock++; \ + zs->state_in_ch = zchh; \ + } \ + else \ + /*-- general, uncommon cases --*/ \ + if (zchh != zs->state_in_ch || \ + zs->state_in_len == 255) { \ + if (zs->state_in_ch < 256) \ + add_pair_to_block ( zs ); \ + zs->state_in_ch = zchh; \ + zs->state_in_len = 1; \ + } else { \ + zs->state_in_len++; \ + } \ +} + + +/*---------------------------------------------------*/ +static +Bool copy_input_until_stop ( EState* s ) +{ + Bool progress_in = False; + + if (s->mode == BZ_M_RUNNING) { + + /*-- fast track the common case --*/ + while (True) { + /*-- block full? --*/ + if (s->nblock >= s->nblockMAX) break; + /*-- no input? --*/ + if (s->strm->avail_in == 0) break; + progress_in = True; + ADD_CHAR_TO_BLOCK ( s, (UInt32)(*((UChar*)(s->strm->next_in))) ); + s->strm->next_in++; + s->strm->avail_in--; + s->strm->total_in_lo32++; + if (s->strm->total_in_lo32 == 0) s->strm->total_in_hi32++; + } + + } else { + + /*-- general, uncommon case --*/ + while (True) { + /*-- block full? --*/ + if (s->nblock >= s->nblockMAX) break; + /*-- no input? --*/ + if (s->strm->avail_in == 0) break; + /*-- flush/finish end? --*/ + if (s->avail_in_expect == 0) break; + progress_in = True; + ADD_CHAR_TO_BLOCK ( s, (UInt32)(*((UChar*)(s->strm->next_in))) ); + s->strm->next_in++; + s->strm->avail_in--; + s->strm->total_in_lo32++; + if (s->strm->total_in_lo32 == 0) s->strm->total_in_hi32++; + s->avail_in_expect--; + } + } + return progress_in; +} + + +/*---------------------------------------------------*/ +static +Bool copy_output_until_stop ( EState* s ) +{ + Bool progress_out = False; + + while (True) { + + /*-- no output space? --*/ + if (s->strm->avail_out == 0) break; + + /*-- block done? --*/ + if (s->state_out_pos >= s->numZ) break; + + progress_out = True; + *(s->strm->next_out) = s->zbits[s->state_out_pos]; + s->state_out_pos++; + s->strm->avail_out--; + s->strm->next_out++; + s->strm->total_out_lo32++; + if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++; + } + + return progress_out; +} + + +/*---------------------------------------------------*/ +static +Bool handle_compress ( bz_stream* strm ) +{ + Bool progress_in = False; + Bool progress_out = False; + EState* s = strm->state; + + while (True) { + + if (s->state == BZ_S_OUTPUT) { + progress_out |= copy_output_until_stop ( s ); + if (s->state_out_pos < s->numZ) break; + if (s->mode == BZ_M_FINISHING && + s->avail_in_expect == 0 && + isempty_RL(s)) break; + prepare_new_block ( s ); + s->state = BZ_S_INPUT; + if (s->mode == BZ_M_FLUSHING && + s->avail_in_expect == 0 && + isempty_RL(s)) break; + } + + if (s->state == BZ_S_INPUT) { + progress_in |= copy_input_until_stop ( s ); + if (s->mode != BZ_M_RUNNING && s->avail_in_expect == 0) { + flush_RL ( s ); + BZ2_compressBlock ( s, (Bool)(s->mode == BZ_M_FINISHING) ); + s->state = BZ_S_OUTPUT; + } + else + if (s->nblock >= s->nblockMAX) { + BZ2_compressBlock ( s, False ); + s->state = BZ_S_OUTPUT; + } + else + if (s->strm->avail_in == 0) { + break; + } + } + + } + + return progress_in || progress_out; +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzCompress) ( bz_stream *strm, int action ) +{ + Bool progress; + EState* s; + if (strm == NULL) return BZ_PARAM_ERROR; + s = strm->state; + if (s == NULL) return BZ_PARAM_ERROR; + if (s->strm != strm) return BZ_PARAM_ERROR; + + preswitch: + switch (s->mode) { + + case BZ_M_IDLE: + return BZ_SEQUENCE_ERROR; + + case BZ_M_RUNNING: + if (action == BZ_RUN) { + progress = handle_compress ( strm ); + return progress ? BZ_RUN_OK : BZ_PARAM_ERROR; + } + else + if (action == BZ_FLUSH) { + s->avail_in_expect = strm->avail_in; + s->mode = BZ_M_FLUSHING; + goto preswitch; + } + else + if (action == BZ_FINISH) { + s->avail_in_expect = strm->avail_in; + s->mode = BZ_M_FINISHING; + goto preswitch; + } + else + return BZ_PARAM_ERROR; + + case BZ_M_FLUSHING: + if (action != BZ_FLUSH) return BZ_SEQUENCE_ERROR; + if (s->avail_in_expect != s->strm->avail_in) + return BZ_SEQUENCE_ERROR; + progress = handle_compress ( strm ); + if (s->avail_in_expect > 0 || !isempty_RL(s) || + s->state_out_pos < s->numZ) return BZ_FLUSH_OK; + s->mode = BZ_M_RUNNING; + return BZ_RUN_OK; + + case BZ_M_FINISHING: + if (action != BZ_FINISH) return BZ_SEQUENCE_ERROR; + if (s->avail_in_expect != s->strm->avail_in) + return BZ_SEQUENCE_ERROR; + progress = handle_compress ( strm ); + if (!progress) return BZ_SEQUENCE_ERROR; + if (s->avail_in_expect > 0 || !isempty_RL(s) || + s->state_out_pos < s->numZ) return BZ_FINISH_OK; + s->mode = BZ_M_IDLE; + return BZ_STREAM_END; + } + return BZ_OK; /*--not reached--*/ +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzCompressEnd) ( bz_stream *strm ) +{ + EState* s; + if (strm == NULL) return BZ_PARAM_ERROR; + s = strm->state; + if (s == NULL) return BZ_PARAM_ERROR; + if (s->strm != strm) return BZ_PARAM_ERROR; + + if (s->arr1 != NULL) BZFREE(s->arr1); + if (s->arr2 != NULL) BZFREE(s->arr2); + if (s->ftab != NULL) BZFREE(s->ftab); + BZFREE(strm->state); + + strm->state = NULL; + + return BZ_OK; +} + + +/*---------------------------------------------------*/ +/*--- Decompression stuff ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzDecompressInit) + ( bz_stream* strm, + int verbosity, + int small ) +{ + DState* s; + + if (!bz_config_ok()) return BZ_CONFIG_ERROR; + + if (strm == NULL) return BZ_PARAM_ERROR; + if (small != 0 && small != 1) return BZ_PARAM_ERROR; + if (verbosity < 0 || verbosity > 4) return BZ_PARAM_ERROR; + + if (strm->bzalloc == NULL) strm->bzalloc = default_bzalloc; + if (strm->bzfree == NULL) strm->bzfree = default_bzfree; + + s = BZALLOC( sizeof(DState) ); + if (s == NULL) return BZ_MEM_ERROR; + s->strm = strm; + strm->state = s; + s->state = BZ_X_MAGIC_1; + s->bsLive = 0; + s->bsBuff = 0; + s->calculatedCombinedCRC = 0; + strm->total_in_lo32 = 0; + strm->total_in_hi32 = 0; + strm->total_out_lo32 = 0; + strm->total_out_hi32 = 0; + s->smallDecompress = (Bool)small; + s->ll4 = NULL; + s->ll16 = NULL; + s->tt = NULL; + s->currBlockNo = 0; + s->verbosity = verbosity; + + return BZ_OK; +} + + +/*---------------------------------------------------*/ +static +void unRLE_obuf_to_output_FAST ( DState* s ) +{ + UChar k1; + + if (s->blockRandomised) { + + while (True) { + /* try to finish existing run */ + while (True) { + if (s->strm->avail_out == 0) return; + if (s->state_out_len == 0) break; + *( (UChar*)(s->strm->next_out) ) = s->state_out_ch; + BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch ); + s->state_out_len--; + s->strm->next_out++; + s->strm->avail_out--; + s->strm->total_out_lo32++; + if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++; + } + + /* can a new run be started? */ + if (s->nblock_used == s->save_nblock+1) return; + + + s->state_out_len = 1; + s->state_out_ch = s->k0; + BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 2; + BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 3; + BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + s->state_out_len = ((Int32)k1) + 4; + BZ_GET_FAST(s->k0); BZ_RAND_UPD_MASK; + s->k0 ^= BZ_RAND_MASK; s->nblock_used++; + } + + } else { + + /* restore */ + UInt32 c_calculatedBlockCRC = s->calculatedBlockCRC; + UChar c_state_out_ch = s->state_out_ch; + Int32 c_state_out_len = s->state_out_len; + Int32 c_nblock_used = s->nblock_used; + Int32 c_k0 = s->k0; + UInt32* c_tt = s->tt; + UInt32 c_tPos = s->tPos; + char* cs_next_out = s->strm->next_out; + unsigned int cs_avail_out = s->strm->avail_out; + /* end restore */ + + UInt32 avail_out_INIT = cs_avail_out; + Int32 s_save_nblockPP = s->save_nblock+1; + unsigned int total_out_lo32_old; + + while (True) { + + /* try to finish existing run */ + if (c_state_out_len > 0) { + while (True) { + if (cs_avail_out == 0) goto return_notr; + if (c_state_out_len == 1) break; + *( (UChar*)(cs_next_out) ) = c_state_out_ch; + BZ_UPDATE_CRC ( c_calculatedBlockCRC, c_state_out_ch ); + c_state_out_len--; + cs_next_out++; + cs_avail_out--; + } + s_state_out_len_eq_one: + { + if (cs_avail_out == 0) { + c_state_out_len = 1; goto return_notr; + }; + *( (UChar*)(cs_next_out) ) = c_state_out_ch; + BZ_UPDATE_CRC ( c_calculatedBlockCRC, c_state_out_ch ); + cs_next_out++; + cs_avail_out--; + } + } + /* can a new run be started? */ + if (c_nblock_used == s_save_nblockPP) { + c_state_out_len = 0; goto return_notr; + }; + c_state_out_ch = c_k0; + BZ_GET_FAST_C(k1); c_nblock_used++; + if (k1 != c_k0) { + c_k0 = k1; goto s_state_out_len_eq_one; + }; + if (c_nblock_used == s_save_nblockPP) + goto s_state_out_len_eq_one; + + c_state_out_len = 2; + BZ_GET_FAST_C(k1); c_nblock_used++; + if (c_nblock_used == s_save_nblockPP) continue; + if (k1 != c_k0) { c_k0 = k1; continue; }; + + c_state_out_len = 3; + BZ_GET_FAST_C(k1); c_nblock_used++; + if (c_nblock_used == s_save_nblockPP) continue; + if (k1 != c_k0) { c_k0 = k1; continue; }; + + BZ_GET_FAST_C(k1); c_nblock_used++; + c_state_out_len = ((Int32)k1) + 4; + BZ_GET_FAST_C(c_k0); c_nblock_used++; + } + + return_notr: + total_out_lo32_old = s->strm->total_out_lo32; + s->strm->total_out_lo32 += (avail_out_INIT - cs_avail_out); + if (s->strm->total_out_lo32 < total_out_lo32_old) + s->strm->total_out_hi32++; + + /* save */ + s->calculatedBlockCRC = c_calculatedBlockCRC; + s->state_out_ch = c_state_out_ch; + s->state_out_len = c_state_out_len; + s->nblock_used = c_nblock_used; + s->k0 = c_k0; + s->tt = c_tt; + s->tPos = c_tPos; + s->strm->next_out = cs_next_out; + s->strm->avail_out = cs_avail_out; + /* end save */ + } +} + + + +/*---------------------------------------------------*/ +__inline__ Int32 BZ2_indexIntoF ( Int32 indx, Int32 *cftab ) +{ + Int32 nb, na, mid; + nb = 0; + na = 256; + do { + mid = (nb + na) >> 1; + if (indx >= cftab[mid]) nb = mid; else na = mid; + } + while (na - nb != 1); + return nb; +} + + +/*---------------------------------------------------*/ +static +void unRLE_obuf_to_output_SMALL ( DState* s ) +{ + UChar k1; + + if (s->blockRandomised) { + + while (True) { + /* try to finish existing run */ + while (True) { + if (s->strm->avail_out == 0) return; + if (s->state_out_len == 0) break; + *( (UChar*)(s->strm->next_out) ) = s->state_out_ch; + BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch ); + s->state_out_len--; + s->strm->next_out++; + s->strm->avail_out--; + s->strm->total_out_lo32++; + if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++; + } + + /* can a new run be started? */ + if (s->nblock_used == s->save_nblock+1) return; + + + s->state_out_len = 1; + s->state_out_ch = s->k0; + BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 2; + BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 3; + BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; + k1 ^= BZ_RAND_MASK; s->nblock_used++; + s->state_out_len = ((Int32)k1) + 4; + BZ_GET_SMALL(s->k0); BZ_RAND_UPD_MASK; + s->k0 ^= BZ_RAND_MASK; s->nblock_used++; + } + + } else { + + while (True) { + /* try to finish existing run */ + while (True) { + if (s->strm->avail_out == 0) return; + if (s->state_out_len == 0) break; + *( (UChar*)(s->strm->next_out) ) = s->state_out_ch; + BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch ); + s->state_out_len--; + s->strm->next_out++; + s->strm->avail_out--; + s->strm->total_out_lo32++; + if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++; + } + + /* can a new run be started? */ + if (s->nblock_used == s->save_nblock+1) return; + + s->state_out_len = 1; + s->state_out_ch = s->k0; + BZ_GET_SMALL(k1); s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 2; + BZ_GET_SMALL(k1); s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + s->state_out_len = 3; + BZ_GET_SMALL(k1); s->nblock_used++; + if (s->nblock_used == s->save_nblock+1) continue; + if (k1 != s->k0) { s->k0 = k1; continue; }; + + BZ_GET_SMALL(k1); s->nblock_used++; + s->state_out_len = ((Int32)k1) + 4; + BZ_GET_SMALL(s->k0); s->nblock_used++; + } + + } +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzDecompress) ( bz_stream *strm ) +{ + DState* s; + if (strm == NULL) return BZ_PARAM_ERROR; + s = strm->state; + if (s == NULL) return BZ_PARAM_ERROR; + if (s->strm != strm) return BZ_PARAM_ERROR; + + while (True) { + if (s->state == BZ_X_IDLE) return BZ_SEQUENCE_ERROR; + if (s->state == BZ_X_OUTPUT) { + if (s->smallDecompress) + unRLE_obuf_to_output_SMALL ( s ); else + unRLE_obuf_to_output_FAST ( s ); + if (s->nblock_used == s->save_nblock+1 && s->state_out_len == 0) { + BZ_FINALISE_CRC ( s->calculatedBlockCRC ); + if (s->verbosity >= 3) + VPrintf2 ( " {0x%x, 0x%x}", s->storedBlockCRC, + s->calculatedBlockCRC ); + if (s->verbosity >= 2) VPrintf0 ( "]" ); + if (s->calculatedBlockCRC != s->storedBlockCRC) + return BZ_DATA_ERROR; + s->calculatedCombinedCRC + = (s->calculatedCombinedCRC << 1) | + (s->calculatedCombinedCRC >> 31); + s->calculatedCombinedCRC ^= s->calculatedBlockCRC; + s->state = BZ_X_BLKHDR_1; + } else { + return BZ_OK; + } + } + if (s->state >= BZ_X_MAGIC_1) { + Int32 r = BZ2_decompress ( s ); + if (r == BZ_STREAM_END) { + if (s->verbosity >= 3) + VPrintf2 ( "\n combined CRCs: stored = 0x%x, computed = 0x%x", + s->storedCombinedCRC, s->calculatedCombinedCRC ); + if (s->calculatedCombinedCRC != s->storedCombinedCRC) + return BZ_DATA_ERROR; + return r; + } + if (s->state != BZ_X_OUTPUT) return r; + } + } + + AssertH ( 0, 6001 ); + + return 0; /*NOTREACHED*/ +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzDecompressEnd) ( bz_stream *strm ) +{ + DState* s; + if (strm == NULL) return BZ_PARAM_ERROR; + s = strm->state; + if (s == NULL) return BZ_PARAM_ERROR; + if (s->strm != strm) return BZ_PARAM_ERROR; + + if (s->tt != NULL) BZFREE(s->tt); + if (s->ll16 != NULL) BZFREE(s->ll16); + if (s->ll4 != NULL) BZFREE(s->ll4); + + BZFREE(strm->state); + strm->state = NULL; + + return BZ_OK; +} + + +#ifndef BZ_NO_STDIO +/*---------------------------------------------------*/ +/*--- File I/O stuff ---*/ +/*---------------------------------------------------*/ + +#define BZ_SETERR(eee) \ +{ \ + if (bzerror != NULL) *bzerror = eee; \ + if (bzf != NULL) bzf->lastErr = eee; \ +} + +typedef + struct { + FILE* handle; + Char buf[BZ_MAX_UNUSED]; + Int32 bufN; + Bool writing; + bz_stream strm; + Int32 lastErr; + Bool initialisedOk; + } + bzFile; + + +/*---------------------------------------------*/ +static Bool myfeof ( FILE* f ) +{ + Int32 c = fgetc ( f ); + if (c == EOF) return True; + ungetc ( c, f ); + return False; +} + + +/*---------------------------------------------------*/ +BZFILE* BZ_API(BZ2_bzWriteOpen) + ( int* bzerror, + FILE* f, + int blockSize100k, + int verbosity, + int workFactor ) +{ + Int32 ret; + bzFile* bzf = NULL; + + BZ_SETERR(BZ_OK); + + if (f == NULL || + (blockSize100k < 1 || blockSize100k > 9) || + (workFactor < 0 || workFactor > 250) || + (verbosity < 0 || verbosity > 4)) + { BZ_SETERR(BZ_PARAM_ERROR); return NULL; }; + + if (ferror(f)) + { BZ_SETERR(BZ_IO_ERROR); return NULL; }; + + bzf = malloc ( sizeof(bzFile) ); + if (bzf == NULL) + { BZ_SETERR(BZ_MEM_ERROR); return NULL; }; + + BZ_SETERR(BZ_OK); + bzf->initialisedOk = False; + bzf->bufN = 0; + bzf->handle = f; + bzf->writing = True; + bzf->strm.bzalloc = NULL; + bzf->strm.bzfree = NULL; + bzf->strm.opaque = NULL; + + if (workFactor == 0) workFactor = 30; + ret = BZ2_bzCompressInit ( &(bzf->strm), blockSize100k, + verbosity, workFactor ); + if (ret != BZ_OK) + { BZ_SETERR(ret); free(bzf); return NULL; }; + + bzf->strm.avail_in = 0; + bzf->initialisedOk = True; + return bzf; +} + + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzWrite) + ( int* bzerror, + BZFILE* b, + void* buf, + int len ) +{ + Int32 n, n2, ret; + bzFile* bzf = (bzFile*)b; + + BZ_SETERR(BZ_OK); + if (bzf == NULL || buf == NULL || len < 0) + { BZ_SETERR(BZ_PARAM_ERROR); return; }; + if (!(bzf->writing)) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return; }; + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + + if (len == 0) + { BZ_SETERR(BZ_OK); return; }; + + bzf->strm.avail_in = len; + bzf->strm.next_in = buf; + + while (True) { + bzf->strm.avail_out = BZ_MAX_UNUSED; + bzf->strm.next_out = bzf->buf; + ret = BZ2_bzCompress ( &(bzf->strm), BZ_RUN ); + if (ret != BZ_RUN_OK) + { BZ_SETERR(ret); return; }; + + if (bzf->strm.avail_out < BZ_MAX_UNUSED) { + n = BZ_MAX_UNUSED - bzf->strm.avail_out; + n2 = fwrite ( (void*)(bzf->buf), sizeof(UChar), + n, bzf->handle ); + if (n != n2 || ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + } + + if (bzf->strm.avail_in == 0) + { BZ_SETERR(BZ_OK); return; }; + } +} + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzWriteClose) + ( int* bzerror, + BZFILE* b, + int abandon, + unsigned int* nbytes_in, + unsigned int* nbytes_out ) +{ + BZ2_bzWriteClose64 ( bzerror, b, abandon, + nbytes_in, NULL, nbytes_out, NULL ); +} + + +void BZ_API(BZ2_bzWriteClose64) + ( int* bzerror, + BZFILE* b, + int abandon, + unsigned int* nbytes_in_lo32, + unsigned int* nbytes_in_hi32, + unsigned int* nbytes_out_lo32, + unsigned int* nbytes_out_hi32 ) +{ + Int32 n, n2, ret; + bzFile* bzf = (bzFile*)b; + + if (bzf == NULL) + { BZ_SETERR(BZ_OK); return; }; + if (!(bzf->writing)) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return; }; + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + + if (nbytes_in_lo32 != NULL) *nbytes_in_lo32 = 0; + if (nbytes_in_hi32 != NULL) *nbytes_in_hi32 = 0; + if (nbytes_out_lo32 != NULL) *nbytes_out_lo32 = 0; + if (nbytes_out_hi32 != NULL) *nbytes_out_hi32 = 0; + + if ((!abandon) && bzf->lastErr == BZ_OK) { + while (True) { + bzf->strm.avail_out = BZ_MAX_UNUSED; + bzf->strm.next_out = bzf->buf; + ret = BZ2_bzCompress ( &(bzf->strm), BZ_FINISH ); + if (ret != BZ_FINISH_OK && ret != BZ_STREAM_END) + { BZ_SETERR(ret); return; }; + + if (bzf->strm.avail_out < BZ_MAX_UNUSED) { + n = BZ_MAX_UNUSED - bzf->strm.avail_out; + n2 = fwrite ( (void*)(bzf->buf), sizeof(UChar), + n, bzf->handle ); + if (n != n2 || ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + } + + if (ret == BZ_STREAM_END) break; + } + } + + if ( !abandon && !ferror ( bzf->handle ) ) { + fflush ( bzf->handle ); + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return; }; + } + + if (nbytes_in_lo32 != NULL) + *nbytes_in_lo32 = bzf->strm.total_in_lo32; + if (nbytes_in_hi32 != NULL) + *nbytes_in_hi32 = bzf->strm.total_in_hi32; + if (nbytes_out_lo32 != NULL) + *nbytes_out_lo32 = bzf->strm.total_out_lo32; + if (nbytes_out_hi32 != NULL) + *nbytes_out_hi32 = bzf->strm.total_out_hi32; + + BZ_SETERR(BZ_OK); + BZ2_bzCompressEnd ( &(bzf->strm) ); + free ( bzf ); +} + + +/*---------------------------------------------------*/ +BZFILE* BZ_API(BZ2_bzReadOpen) + ( int* bzerror, + FILE* f, + int verbosity, + int small, + void* unused, + int nUnused ) +{ + bzFile* bzf = NULL; + int ret; + + BZ_SETERR(BZ_OK); + + if (f == NULL || + (small != 0 && small != 1) || + (verbosity < 0 || verbosity > 4) || + (unused == NULL && nUnused != 0) || + (unused != NULL && (nUnused < 0 || nUnused > BZ_MAX_UNUSED))) + { BZ_SETERR(BZ_PARAM_ERROR); return NULL; }; + + if (ferror(f)) + { BZ_SETERR(BZ_IO_ERROR); return NULL; }; + + bzf = malloc ( sizeof(bzFile) ); + if (bzf == NULL) + { BZ_SETERR(BZ_MEM_ERROR); return NULL; }; + + BZ_SETERR(BZ_OK); + + bzf->initialisedOk = False; + bzf->handle = f; + bzf->bufN = 0; + bzf->writing = False; + bzf->strm.bzalloc = NULL; + bzf->strm.bzfree = NULL; + bzf->strm.opaque = NULL; + + while (nUnused > 0) { + bzf->buf[bzf->bufN] = *((UChar*)(unused)); bzf->bufN++; + unused = ((void*)( 1 + ((UChar*)(unused)) )); + nUnused--; + } + + ret = BZ2_bzDecompressInit ( &(bzf->strm), verbosity, small ); + if (ret != BZ_OK) + { BZ_SETERR(ret); free(bzf); return NULL; }; + + bzf->strm.avail_in = bzf->bufN; + bzf->strm.next_in = bzf->buf; + + bzf->initialisedOk = True; + return bzf; +} + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzReadClose) ( int *bzerror, BZFILE *b ) +{ + bzFile* bzf = (bzFile*)b; + + BZ_SETERR(BZ_OK); + if (bzf == NULL) + { BZ_SETERR(BZ_OK); return; }; + + if (bzf->writing) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return; }; + + if (bzf->initialisedOk) + (void)BZ2_bzDecompressEnd ( &(bzf->strm) ); + free ( bzf ); +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzRead) + ( int* bzerror, + BZFILE* b, + void* buf, + int len ) +{ + Int32 n, ret; + bzFile* bzf = (bzFile*)b; + + BZ_SETERR(BZ_OK); + + if (bzf == NULL || buf == NULL || len < 0) + { BZ_SETERR(BZ_PARAM_ERROR); return 0; }; + + if (bzf->writing) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return 0; }; + + if (len == 0) + { BZ_SETERR(BZ_OK); return 0; }; + + bzf->strm.avail_out = len; + bzf->strm.next_out = buf; + + while (True) { + + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return 0; }; + + if (bzf->strm.avail_in == 0 && !myfeof(bzf->handle)) { + n = fread ( bzf->buf, sizeof(UChar), + BZ_MAX_UNUSED, bzf->handle ); + if (ferror(bzf->handle)) + { BZ_SETERR(BZ_IO_ERROR); return 0; }; + bzf->bufN = n; + bzf->strm.avail_in = bzf->bufN; + bzf->strm.next_in = bzf->buf; + } + + ret = BZ2_bzDecompress ( &(bzf->strm) ); + + if (ret != BZ_OK && ret != BZ_STREAM_END) + { BZ_SETERR(ret); return 0; }; + + if (ret == BZ_OK && myfeof(bzf->handle) && + bzf->strm.avail_in == 0 && bzf->strm.avail_out > 0) + { BZ_SETERR(BZ_UNEXPECTED_EOF); return 0; }; + + if (ret == BZ_STREAM_END) + { BZ_SETERR(BZ_STREAM_END); + return len - bzf->strm.avail_out; }; + if (bzf->strm.avail_out == 0) + { BZ_SETERR(BZ_OK); return len; }; + + } + + return 0; /*not reached*/ +} + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzReadGetUnused) + ( int* bzerror, + BZFILE* b, + void** unused, + int* nUnused ) +{ + bzFile* bzf = (bzFile*)b; + if (bzf == NULL) + { BZ_SETERR(BZ_PARAM_ERROR); return; }; + if (bzf->lastErr != BZ_STREAM_END) + { BZ_SETERR(BZ_SEQUENCE_ERROR); return; }; + if (unused == NULL || nUnused == NULL) + { BZ_SETERR(BZ_PARAM_ERROR); return; }; + + BZ_SETERR(BZ_OK); + *nUnused = bzf->strm.avail_in; + *unused = bzf->strm.next_in; +} +#endif + + +/*---------------------------------------------------*/ +/*--- Misc convenience stuff ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzBuffToBuffCompress) + ( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int blockSize100k, + int verbosity, + int workFactor ) +{ + bz_stream strm; + int ret; + + if (dest == NULL || destLen == NULL || + source == NULL || + blockSize100k < 1 || blockSize100k > 9 || + verbosity < 0 || verbosity > 4 || + workFactor < 0 || workFactor > 250) + return BZ_PARAM_ERROR; + + if (workFactor == 0) workFactor = 30; + strm.bzalloc = NULL; + strm.bzfree = NULL; + strm.opaque = NULL; + ret = BZ2_bzCompressInit ( &strm, blockSize100k, + verbosity, workFactor ); + if (ret != BZ_OK) return ret; + + strm.next_in = source; + strm.next_out = dest; + strm.avail_in = sourceLen; + strm.avail_out = *destLen; + + ret = BZ2_bzCompress ( &strm, BZ_FINISH ); + if (ret == BZ_FINISH_OK) goto output_overflow; + if (ret != BZ_STREAM_END) goto errhandler; + + /* normal termination */ + *destLen -= strm.avail_out; + BZ2_bzCompressEnd ( &strm ); + return BZ_OK; + + output_overflow: + BZ2_bzCompressEnd ( &strm ); + return BZ_OUTBUFF_FULL; + + errhandler: + BZ2_bzCompressEnd ( &strm ); + return ret; +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzBuffToBuffDecompress) + ( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int small, + int verbosity ) +{ + bz_stream strm; + int ret; + + if (dest == NULL || destLen == NULL || + source == NULL || + (small != 0 && small != 1) || + verbosity < 0 || verbosity > 4) + return BZ_PARAM_ERROR; + + strm.bzalloc = NULL; + strm.bzfree = NULL; + strm.opaque = NULL; + ret = BZ2_bzDecompressInit ( &strm, verbosity, small ); + if (ret != BZ_OK) return ret; + + strm.next_in = source; + strm.next_out = dest; + strm.avail_in = sourceLen; + strm.avail_out = *destLen; + + ret = BZ2_bzDecompress ( &strm ); + if (ret == BZ_OK) goto output_overflow_or_eof; + if (ret != BZ_STREAM_END) goto errhandler; + + /* normal termination */ + *destLen -= strm.avail_out; + BZ2_bzDecompressEnd ( &strm ); + return BZ_OK; + + output_overflow_or_eof: + if (strm.avail_out > 0) { + BZ2_bzDecompressEnd ( &strm ); + return BZ_UNEXPECTED_EOF; + } else { + BZ2_bzDecompressEnd ( &strm ); + return BZ_OUTBUFF_FULL; + }; + + errhandler: + BZ2_bzDecompressEnd ( &strm ); + return ret; +} + + +/*---------------------------------------------------*/ +/*-- + Code contributed by Yoshioka Tsuneo + (QWF00133@niftyserve.or.jp/tsuneo-y@is.aist-nara.ac.jp), + to support better zlib compatibility. + This code is not _officially_ part of libbzip2 (yet); + I haven't tested it, documented it, or considered the + threading-safeness of it. + If this code breaks, please contact both Yoshioka and me. +--*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +/*-- + return version like "0.9.0c". +--*/ +const char * BZ_API(BZ2_bzlibVersion)(void) +{ + return BZ_VERSION; +} + + +#ifndef BZ_NO_STDIO +/*---------------------------------------------------*/ + +#if defined(_WIN32) || defined(OS2) || defined(MSDOS) +# include <fcntl.h> +# include <io.h> +# define SET_BINARY_MODE(file) setmode(fileno(file),O_BINARY) +#else +# define SET_BINARY_MODE(file) +#endif +static +BZFILE * bzopen_or_bzdopen + ( const char *path, /* no use when bzdopen */ + int fd, /* no use when bzdopen */ + const char *mode, + int open_mode) /* bzopen: 0, bzdopen:1 */ +{ + int bzerr; + char unused[BZ_MAX_UNUSED]; + int blockSize100k = 9; + int writing = 0; + char mode2[10] = ""; + FILE *fp = NULL; + BZFILE *bzfp = NULL; + int verbosity = 0; + int workFactor = 30; + int smallMode = 0; + int nUnused = 0; + + if (mode == NULL) return NULL; + while (*mode) { + switch (*mode) { + case 'r': + writing = 0; break; + case 'w': + writing = 1; break; + case 's': + smallMode = 1; break; + default: + if (isdigit((int)(*mode))) { + blockSize100k = *mode-'0'; + } + } + mode++; + } + strcat(mode2, writing ? "w" : "r" ); + strcat(mode2,"b"); /* binary mode */ + + if (open_mode==0) { + if (path==NULL || strcmp(path,"")==0) { + fp = (writing ? stdout : stdin); + SET_BINARY_MODE(fp); + } else { + fp = fopen(path,mode2); + } + } else { +#ifdef BZ_STRICT_ANSI + fp = NULL; +#else + fp = fdopen(fd,mode2); +#endif + } + if (fp == NULL) return NULL; + + if (writing) { + /* Guard against total chaos and anarchy -- JRS */ + if (blockSize100k < 1) blockSize100k = 1; + if (blockSize100k > 9) blockSize100k = 9; + bzfp = BZ2_bzWriteOpen(&bzerr,fp,blockSize100k, + verbosity,workFactor); + } else { + bzfp = BZ2_bzReadOpen(&bzerr,fp,verbosity,smallMode, + unused,nUnused); + } + if (bzfp == NULL) { + if (fp != stdin && fp != stdout) fclose(fp); + return NULL; + } + return bzfp; +} + + +/*---------------------------------------------------*/ +/*-- + open file for read or write. + ex) bzopen("file","w9") + case path="" or NULL => use stdin or stdout. +--*/ +BZFILE * BZ_API(BZ2_bzopen) + ( const char *path, + const char *mode ) +{ + return bzopen_or_bzdopen(path,-1,mode,/*bzopen*/0); +} + + +/*---------------------------------------------------*/ +BZFILE * BZ_API(BZ2_bzdopen) + ( int fd, + const char *mode ) +{ + return bzopen_or_bzdopen(NULL,fd,mode,/*bzdopen*/1); +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzread) (BZFILE* b, void* buf, int len ) +{ + int bzerr, nread; + if (((bzFile*)b)->lastErr == BZ_STREAM_END) return 0; + nread = BZ2_bzRead(&bzerr,b,buf,len); + if (bzerr == BZ_OK || bzerr == BZ_STREAM_END) { + return nread; + } else { + return -1; + } +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzwrite) (BZFILE* b, void* buf, int len ) +{ + int bzerr; + + BZ2_bzWrite(&bzerr,b,buf,len); + if(bzerr == BZ_OK){ + return len; + }else{ + return -1; + } +} + + +/*---------------------------------------------------*/ +int BZ_API(BZ2_bzflush) (BZFILE *b) +{ + /* do nothing now... */ + return 0; +} + + +/*---------------------------------------------------*/ +void BZ_API(BZ2_bzclose) (BZFILE* b) +{ + int bzerr; + FILE *fp = ((bzFile *)b)->handle; + + if (b==NULL) {return;} + if(((bzFile*)b)->writing){ + BZ2_bzWriteClose(&bzerr,b,0,NULL,NULL); + if(bzerr != BZ_OK){ + BZ2_bzWriteClose(NULL,b,1,NULL,NULL); + } + }else{ + BZ2_bzReadClose(&bzerr,b); + } + if(fp!=stdin && fp!=stdout){ + fclose(fp); + } +} + + +/*---------------------------------------------------*/ +/*-- + return last error code +--*/ +static char *bzerrorstrings[] = { + "OK" + ,"SEQUENCE_ERROR" + ,"PARAM_ERROR" + ,"MEM_ERROR" + ,"DATA_ERROR" + ,"DATA_ERROR_MAGIC" + ,"IO_ERROR" + ,"UNEXPECTED_EOF" + ,"OUTBUFF_FULL" + ,"CONFIG_ERROR" + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ +}; + + +const char * BZ_API(BZ2_bzerror) (BZFILE *b, int *errnum) +{ + int err = ((bzFile *)b)->lastErr; + + if(err>0) err = 0; + *errnum = err; + return bzerrorstrings[err*-1]; +} +#endif + + +/*-------------------------------------------------------------*/ +/*--- end bzlib.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/bzlib.h b/bzip2/bzlib.h new file mode 100644 index 000000000..c9447a295 --- /dev/null +++ b/bzip2/bzlib.h @@ -0,0 +1,319 @@ + +/*-------------------------------------------------------------*/ +/*--- Public header file for the library. ---*/ +/*--- bzlib.h ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#ifndef _BZLIB_H +#define _BZLIB_H + +#ifdef __cplusplus +extern "C" { +#endif + +#define BZ_RUN 0 +#define BZ_FLUSH 1 +#define BZ_FINISH 2 + +#define BZ_OK 0 +#define BZ_RUN_OK 1 +#define BZ_FLUSH_OK 2 +#define BZ_FINISH_OK 3 +#define BZ_STREAM_END 4 +#define BZ_SEQUENCE_ERROR (-1) +#define BZ_PARAM_ERROR (-2) +#define BZ_MEM_ERROR (-3) +#define BZ_DATA_ERROR (-4) +#define BZ_DATA_ERROR_MAGIC (-5) +#define BZ_IO_ERROR (-6) +#define BZ_UNEXPECTED_EOF (-7) +#define BZ_OUTBUFF_FULL (-8) +#define BZ_CONFIG_ERROR (-9) + +typedef + struct { + char *next_in; + unsigned int avail_in; + unsigned int total_in_lo32; + unsigned int total_in_hi32; + + char *next_out; + unsigned int avail_out; + unsigned int total_out_lo32; + unsigned int total_out_hi32; + + void *state; + + void *(*bzalloc)(void *,int,int); + void (*bzfree)(void *,void *); + void *opaque; + } + bz_stream; + + +#ifndef BZ_IMPORT +#define BZ_EXPORT +#endif + +#ifdef _WIN32 +# include <stdio.h> +# include <windows.h> +# ifdef small + /* windows.h define small to char */ +# undef small +# endif +# ifdef BZ_EXPORT +# define BZ_API(func) WINAPI func +# define BZ_EXTERN extern +# else + /* import windows dll dynamically */ +# define BZ_API(func) (WINAPI * func) +# define BZ_EXTERN +# endif +#else +# define BZ_API(func) func +# define BZ_EXTERN extern +#endif + + +/*-- Core (low-level) library functions --*/ + +BZ_EXTERN int BZ_API(BZ2_bzCompressInit) ( + bz_stream* strm, + int blockSize100k, + int verbosity, + int workFactor + ); + +BZ_EXTERN int BZ_API(BZ2_bzCompress) ( + bz_stream* strm, + int action + ); + +BZ_EXTERN int BZ_API(BZ2_bzCompressEnd) ( + bz_stream* strm + ); + +BZ_EXTERN int BZ_API(BZ2_bzDecompressInit) ( + bz_stream *strm, + int verbosity, + int small + ); + +BZ_EXTERN int BZ_API(BZ2_bzDecompress) ( + bz_stream* strm + ); + +BZ_EXTERN int BZ_API(BZ2_bzDecompressEnd) ( + bz_stream *strm + ); + + + +/*-- High(er) level library functions --*/ + +#ifndef BZ_NO_STDIO +#define BZ_MAX_UNUSED 5000 + +typedef void BZFILE; + +BZ_EXTERN BZFILE* BZ_API(BZ2_bzReadOpen) ( + int* bzerror, + FILE* f, + int verbosity, + int small, + void* unused, + int nUnused + ); + +BZ_EXTERN void BZ_API(BZ2_bzReadClose) ( + int* bzerror, + BZFILE* b + ); + +BZ_EXTERN void BZ_API(BZ2_bzReadGetUnused) ( + int* bzerror, + BZFILE* b, + void** unused, + int* nUnused + ); + +BZ_EXTERN int BZ_API(BZ2_bzRead) ( + int* bzerror, + BZFILE* b, + void* buf, + int len + ); + +BZ_EXTERN BZFILE* BZ_API(BZ2_bzWriteOpen) ( + int* bzerror, + FILE* f, + int blockSize100k, + int verbosity, + int workFactor + ); + +BZ_EXTERN void BZ_API(BZ2_bzWrite) ( + int* bzerror, + BZFILE* b, + void* buf, + int len + ); + +BZ_EXTERN void BZ_API(BZ2_bzWriteClose) ( + int* bzerror, + BZFILE* b, + int abandon, + unsigned int* nbytes_in, + unsigned int* nbytes_out + ); + +BZ_EXTERN void BZ_API(BZ2_bzWriteClose64) ( + int* bzerror, + BZFILE* b, + int abandon, + unsigned int* nbytes_in_lo32, + unsigned int* nbytes_in_hi32, + unsigned int* nbytes_out_lo32, + unsigned int* nbytes_out_hi32 + ); +#endif + + +/*-- Utility functions --*/ + +BZ_EXTERN int BZ_API(BZ2_bzBuffToBuffCompress) ( + char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int blockSize100k, + int verbosity, + int workFactor + ); + +BZ_EXTERN int BZ_API(BZ2_bzBuffToBuffDecompress) ( + char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int small, + int verbosity + ); + + +/*-- + Code contributed by Yoshioka Tsuneo + (QWF00133@niftyserve.or.jp/tsuneo-y@is.aist-nara.ac.jp), + to support better zlib compatibility. + This code is not _officially_ part of libbzip2 (yet); + I haven't tested it, documented it, or considered the + threading-safeness of it. + If this code breaks, please contact both Yoshioka and me. +--*/ + +BZ_EXTERN const char * BZ_API(BZ2_bzlibVersion) ( + void + ); + +#ifndef BZ_NO_STDIO +BZ_EXTERN BZFILE * BZ_API(BZ2_bzopen) ( + const char *path, + const char *mode + ); + +BZ_EXTERN BZFILE * BZ_API(BZ2_bzdopen) ( + int fd, + const char *mode + ); + +BZ_EXTERN int BZ_API(BZ2_bzread) ( + BZFILE* b, + void* buf, + int len + ); + +BZ_EXTERN int BZ_API(BZ2_bzwrite) ( + BZFILE* b, + void* buf, + int len + ); + +BZ_EXTERN int BZ_API(BZ2_bzflush) ( + BZFILE* b + ); + +BZ_EXTERN void BZ_API(BZ2_bzclose) ( + BZFILE* b + ); + +BZ_EXTERN const char * BZ_API(BZ2_bzerror) ( + BZFILE *b, + int *errnum + ); +#endif + +#ifdef __cplusplus +} +#endif + +#endif + +/*-------------------------------------------------------------*/ +/*--- end bzlib.h ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/bzlib_private.h b/bzip2/bzlib_private.h new file mode 100644 index 000000000..fb51c7a1d --- /dev/null +++ b/bzip2/bzlib_private.h @@ -0,0 +1,530 @@ + +/*-------------------------------------------------------------*/ +/*--- Private header file for the library. ---*/ +/*--- bzlib_private.h ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#ifndef _BZLIB_PRIVATE_H +#define _BZLIB_PRIVATE_H + +#include <stdlib.h> + +#ifndef BZ_NO_STDIO +#include <stdio.h> +#include <ctype.h> +#include <string.h> +#endif + +#include "bzlib.h" + + + +/*-- General stuff. --*/ + +#define BZ_VERSION "1.0.1, 23-June-2000" + +typedef char Char; +typedef unsigned char Bool; +typedef unsigned char UChar; +typedef int Int32; +typedef unsigned int UInt32; +typedef short Int16; +typedef unsigned short UInt16; + +#define True ((Bool)1) +#define False ((Bool)0) + +#ifndef __GNUC__ +#define __inline__ /* */ +#endif + +#ifndef BZ_NO_STDIO +extern void BZ2_bz__AssertH__fail ( int errcode ); +#define AssertH(cond,errcode) \ + { if (!(cond)) BZ2_bz__AssertH__fail ( errcode ); } +#if BZ_DEBUG +#define AssertD(cond,msg) \ + { if (!(cond)) { \ + fprintf ( stderr, \ + "\n\nlibbzip2(debug build): internal error\n\t%s\n", msg );\ + exit(1); \ + }} +#else +#define AssertD(cond,msg) /* */ +#endif +#define VPrintf0(zf) \ + fprintf(stderr,zf) +#define VPrintf1(zf,za1) \ + fprintf(stderr,zf,za1) +#define VPrintf2(zf,za1,za2) \ + fprintf(stderr,zf,za1,za2) +#define VPrintf3(zf,za1,za2,za3) \ + fprintf(stderr,zf,za1,za2,za3) +#define VPrintf4(zf,za1,za2,za3,za4) \ + fprintf(stderr,zf,za1,za2,za3,za4) +#define VPrintf5(zf,za1,za2,za3,za4,za5) \ + fprintf(stderr,zf,za1,za2,za3,za4,za5) +#else +extern void bz_internal_error ( int errcode ); +#define AssertH(cond,errcode) \ + { if (!(cond)) bz_internal_error ( errcode ); } +#define AssertD(cond,msg) /* */ +#define VPrintf0(zf) /* */ +#define VPrintf1(zf,za1) /* */ +#define VPrintf2(zf,za1,za2) /* */ +#define VPrintf3(zf,za1,za2,za3) /* */ +#define VPrintf4(zf,za1,za2,za3,za4) /* */ +#define VPrintf5(zf,za1,za2,za3,za4,za5) /* */ +#endif + + +#define BZALLOC(nnn) (strm->bzalloc)(strm->opaque,(nnn),1) +#define BZFREE(ppp) (strm->bzfree)(strm->opaque,(ppp)) + + +/*-- Constants for the back end. --*/ + +#define BZ_MAX_ALPHA_SIZE 258 +#define BZ_MAX_CODE_LEN 23 + +#define BZ_RUNA 0 +#define BZ_RUNB 1 + +#define BZ_N_GROUPS 6 +#define BZ_G_SIZE 50 +#define BZ_N_ITERS 4 + +#define BZ_MAX_SELECTORS (2 + (900000 / BZ_G_SIZE)) + + + +/*-- Stuff for randomising repetitive blocks. --*/ + +extern Int32 BZ2_rNums[512]; + +#define BZ_RAND_DECLS \ + Int32 rNToGo; \ + Int32 rTPos \ + +#define BZ_RAND_INIT_MASK \ + s->rNToGo = 0; \ + s->rTPos = 0 \ + +#define BZ_RAND_MASK ((s->rNToGo == 1) ? 1 : 0) + +#define BZ_RAND_UPD_MASK \ + if (s->rNToGo == 0) { \ + s->rNToGo = BZ2_rNums[s->rTPos]; \ + s->rTPos++; \ + if (s->rTPos == 512) s->rTPos = 0; \ + } \ + s->rNToGo--; + + + +/*-- Stuff for doing CRCs. --*/ + +extern UInt32 BZ2_crc32Table[256]; + +#define BZ_INITIALISE_CRC(crcVar) \ +{ \ + crcVar = 0xffffffffL; \ +} + +#define BZ_FINALISE_CRC(crcVar) \ +{ \ + crcVar = ~(crcVar); \ +} + +#define BZ_UPDATE_CRC(crcVar,cha) \ +{ \ + crcVar = (crcVar << 8) ^ \ + BZ2_crc32Table[(crcVar >> 24) ^ \ + ((UChar)cha)]; \ +} + + + +/*-- States and modes for compression. --*/ + +#define BZ_M_IDLE 1 +#define BZ_M_RUNNING 2 +#define BZ_M_FLUSHING 3 +#define BZ_M_FINISHING 4 + +#define BZ_S_OUTPUT 1 +#define BZ_S_INPUT 2 + +#define BZ_N_RADIX 2 +#define BZ_N_QSORT 12 +#define BZ_N_SHELL 18 +#define BZ_N_OVERSHOOT (BZ_N_RADIX + BZ_N_QSORT + BZ_N_SHELL + 2) + + + + +/*-- Structure holding all the compression-side stuff. --*/ + +typedef + struct { + /* pointer back to the struct bz_stream */ + bz_stream* strm; + + /* mode this stream is in, and whether inputting */ + /* or outputting data */ + Int32 mode; + Int32 state; + + /* remembers avail_in when flush/finish requested */ + UInt32 avail_in_expect; + + /* for doing the block sorting */ + UInt32* arr1; + UInt32* arr2; + UInt32* ftab; + Int32 origPtr; + + /* aliases for arr1 and arr2 */ + UInt32* ptr; + UChar* block; + UInt16* mtfv; + UChar* zbits; + + /* for deciding when to use the fallback sorting algorithm */ + Int32 workFactor; + + /* run-length-encoding of the input */ + UInt32 state_in_ch; + Int32 state_in_len; + BZ_RAND_DECLS; + + /* input and output limits and current posns */ + Int32 nblock; + Int32 nblockMAX; + Int32 numZ; + Int32 state_out_pos; + + /* map of bytes used in block */ + Int32 nInUse; + Bool inUse[256]; + UChar unseqToSeq[256]; + + /* the buffer for bit stream creation */ + UInt32 bsBuff; + Int32 bsLive; + + /* block and combined CRCs */ + UInt32 blockCRC; + UInt32 combinedCRC; + + /* misc administratium */ + Int32 verbosity; + Int32 blockNo; + Int32 blockSize100k; + + /* stuff for coding the MTF values */ + Int32 nMTF; + Int32 mtfFreq [BZ_MAX_ALPHA_SIZE]; + UChar selector [BZ_MAX_SELECTORS]; + UChar selectorMtf[BZ_MAX_SELECTORS]; + + UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 code [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 rfreq [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + /* second dimension: only 3 needed; 4 makes index calculations faster */ + UInt32 len_pack[BZ_MAX_ALPHA_SIZE][4]; + + } + EState; + + + +/*-- externs for compression. --*/ + +extern void +BZ2_blockSort ( EState* ); + +extern void +BZ2_compressBlock ( EState*, Bool ); + +extern void +BZ2_bsInitWrite ( EState* ); + +extern void +BZ2_hbAssignCodes ( Int32*, UChar*, Int32, Int32, Int32 ); + +extern void +BZ2_hbMakeCodeLengths ( UChar*, Int32*, Int32, Int32 ); + + + +/*-- states for decompression. --*/ + +#define BZ_X_IDLE 1 +#define BZ_X_OUTPUT 2 + +#define BZ_X_MAGIC_1 10 +#define BZ_X_MAGIC_2 11 +#define BZ_X_MAGIC_3 12 +#define BZ_X_MAGIC_4 13 +#define BZ_X_BLKHDR_1 14 +#define BZ_X_BLKHDR_2 15 +#define BZ_X_BLKHDR_3 16 +#define BZ_X_BLKHDR_4 17 +#define BZ_X_BLKHDR_5 18 +#define BZ_X_BLKHDR_6 19 +#define BZ_X_BCRC_1 20 +#define BZ_X_BCRC_2 21 +#define BZ_X_BCRC_3 22 +#define BZ_X_BCRC_4 23 +#define BZ_X_RANDBIT 24 +#define BZ_X_ORIGPTR_1 25 +#define BZ_X_ORIGPTR_2 26 +#define BZ_X_ORIGPTR_3 27 +#define BZ_X_MAPPING_1 28 +#define BZ_X_MAPPING_2 29 +#define BZ_X_SELECTOR_1 30 +#define BZ_X_SELECTOR_2 31 +#define BZ_X_SELECTOR_3 32 +#define BZ_X_CODING_1 33 +#define BZ_X_CODING_2 34 +#define BZ_X_CODING_3 35 +#define BZ_X_MTF_1 36 +#define BZ_X_MTF_2 37 +#define BZ_X_MTF_3 38 +#define BZ_X_MTF_4 39 +#define BZ_X_MTF_5 40 +#define BZ_X_MTF_6 41 +#define BZ_X_ENDHDR_2 42 +#define BZ_X_ENDHDR_3 43 +#define BZ_X_ENDHDR_4 44 +#define BZ_X_ENDHDR_5 45 +#define BZ_X_ENDHDR_6 46 +#define BZ_X_CCRC_1 47 +#define BZ_X_CCRC_2 48 +#define BZ_X_CCRC_3 49 +#define BZ_X_CCRC_4 50 + + + +/*-- Constants for the fast MTF decoder. --*/ + +#define MTFA_SIZE 4096 +#define MTFL_SIZE 16 + + + +/*-- Structure holding all the decompression-side stuff. --*/ + +typedef + struct { + /* pointer back to the struct bz_stream */ + bz_stream* strm; + + /* state indicator for this stream */ + Int32 state; + + /* for doing the final run-length decoding */ + UChar state_out_ch; + Int32 state_out_len; + Bool blockRandomised; + BZ_RAND_DECLS; + + /* the buffer for bit stream reading */ + UInt32 bsBuff; + Int32 bsLive; + + /* misc administratium */ + Int32 blockSize100k; + Bool smallDecompress; + Int32 currBlockNo; + Int32 verbosity; + + /* for undoing the Burrows-Wheeler transform */ + Int32 origPtr; + UInt32 tPos; + Int32 k0; + Int32 unzftab[256]; + Int32 nblock_used; + Int32 cftab[257]; + Int32 cftabCopy[257]; + + /* for undoing the Burrows-Wheeler transform (FAST) */ + UInt32 *tt; + + /* for undoing the Burrows-Wheeler transform (SMALL) */ + UInt16 *ll16; + UChar *ll4; + + /* stored and calculated CRCs */ + UInt32 storedBlockCRC; + UInt32 storedCombinedCRC; + UInt32 calculatedBlockCRC; + UInt32 calculatedCombinedCRC; + + /* map of bytes used in block */ + Int32 nInUse; + Bool inUse[256]; + Bool inUse16[16]; + UChar seqToUnseq[256]; + + /* for decoding the MTF values */ + UChar mtfa [MTFA_SIZE]; + Int32 mtfbase[256 / MTFL_SIZE]; + UChar selector [BZ_MAX_SELECTORS]; + UChar selectorMtf[BZ_MAX_SELECTORS]; + UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + + Int32 limit [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 base [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 perm [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 minLens[BZ_N_GROUPS]; + + /* save area for scalars in the main decompress code */ + Int32 save_i; + Int32 save_j; + Int32 save_t; + Int32 save_alphaSize; + Int32 save_nGroups; + Int32 save_nSelectors; + Int32 save_EOB; + Int32 save_groupNo; + Int32 save_groupPos; + Int32 save_nextSym; + Int32 save_nblockMAX; + Int32 save_nblock; + Int32 save_es; + Int32 save_N; + Int32 save_curr; + Int32 save_zt; + Int32 save_zn; + Int32 save_zvec; + Int32 save_zj; + Int32 save_gSel; + Int32 save_gMinlen; + Int32* save_gLimit; + Int32* save_gBase; + Int32* save_gPerm; + + } + DState; + + + +/*-- Macros for decompression. --*/ + +#define BZ_GET_FAST(cccc) \ + s->tPos = s->tt[s->tPos]; \ + cccc = (UChar)(s->tPos & 0xff); \ + s->tPos >>= 8; + +#define BZ_GET_FAST_C(cccc) \ + c_tPos = c_tt[c_tPos]; \ + cccc = (UChar)(c_tPos & 0xff); \ + c_tPos >>= 8; + +#define SET_LL4(i,n) \ + { if (((i) & 0x1) == 0) \ + s->ll4[(i) >> 1] = (s->ll4[(i) >> 1] & 0xf0) | (n); else \ + s->ll4[(i) >> 1] = (s->ll4[(i) >> 1] & 0x0f) | ((n) << 4); \ + } + +#define GET_LL4(i) \ + ((((UInt32)(s->ll4[(i) >> 1])) >> (((i) << 2) & 0x4)) & 0xF) + +#define SET_LL(i,n) \ + { s->ll16[i] = (UInt16)(n & 0x0000ffff); \ + SET_LL4(i, n >> 16); \ + } + +#define GET_LL(i) \ + (((UInt32)s->ll16[i]) | (GET_LL4(i) << 16)) + +#define BZ_GET_SMALL(cccc) \ + cccc = BZ2_indexIntoF ( s->tPos, s->cftab ); \ + s->tPos = GET_LL(s->tPos); + + +/*-- externs for decompression. --*/ + +extern Int32 +BZ2_indexIntoF ( Int32, Int32* ); + +extern Int32 +BZ2_decompress ( DState* ); + +extern void +BZ2_hbCreateDecodeTables ( Int32*, Int32*, Int32*, UChar*, + Int32, Int32, Int32 ); + + +#endif + + +/*-- BZ_NO_STDIO seems to make NULL disappear on some platforms. --*/ + +#ifdef BZ_NO_STDIO +#ifndef NULL +#define NULL 0 +#endif +#endif + + +/*-------------------------------------------------------------*/ +/*--- end bzlib_private.h ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/compress.c b/bzip2/compress.c new file mode 100644 index 000000000..cc5e31d6f --- /dev/null +++ b/bzip2/compress.c @@ -0,0 +1,714 @@ + +/*-------------------------------------------------------------*/ +/*--- Compression machinery (not incl block sorting) ---*/ +/*--- compress.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + +/*-- + CHANGES + ~~~~~~~ + 0.9.0 -- original version. + + 0.9.0a/b -- no changes in this file. + + 0.9.0c + * changed setting of nGroups in sendMTFValues() so as to + do a bit better on small files +--*/ + +#include "bzlib_private.h" + + +/*---------------------------------------------------*/ +/*--- Bit stream I/O ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +void BZ2_bsInitWrite ( EState* s ) +{ + s->bsLive = 0; + s->bsBuff = 0; +} + + +/*---------------------------------------------------*/ +static +void bsFinishWrite ( EState* s ) +{ + while (s->bsLive > 0) { + s->zbits[s->numZ] = (UChar)(s->bsBuff >> 24); + s->numZ++; + s->bsBuff <<= 8; + s->bsLive -= 8; + } +} + + +/*---------------------------------------------------*/ +#define bsNEEDW(nz) \ +{ \ + while (s->bsLive >= 8) { \ + s->zbits[s->numZ] \ + = (UChar)(s->bsBuff >> 24); \ + s->numZ++; \ + s->bsBuff <<= 8; \ + s->bsLive -= 8; \ + } \ +} + + +/*---------------------------------------------------*/ +static +__inline__ +void bsW ( EState* s, Int32 n, UInt32 v ) +{ + bsNEEDW ( n ); + s->bsBuff |= (v << (32 - s->bsLive - n)); + s->bsLive += n; +} + + +/*---------------------------------------------------*/ +static +void bsPutUInt32 ( EState* s, UInt32 u ) +{ + bsW ( s, 8, (u >> 24) & 0xffL ); + bsW ( s, 8, (u >> 16) & 0xffL ); + bsW ( s, 8, (u >> 8) & 0xffL ); + bsW ( s, 8, u & 0xffL ); +} + + +/*---------------------------------------------------*/ +static +void bsPutUChar ( EState* s, UChar c ) +{ + bsW( s, 8, (UInt32)c ); +} + + +/*---------------------------------------------------*/ +/*--- The back end proper ---*/ +/*---------------------------------------------------*/ + +/*---------------------------------------------------*/ +static +void makeMaps_e ( EState* s ) +{ + Int32 i; + s->nInUse = 0; + for (i = 0; i < 256; i++) + if (s->inUse[i]) { + s->unseqToSeq[i] = s->nInUse; + s->nInUse++; + } +} + + +/*---------------------------------------------------*/ +static +void generateMTFValues ( EState* s ) +{ + UChar yy[256]; + Int32 i, j; + Int32 zPend; + Int32 wr; + Int32 EOB; + + /* + After sorting (eg, here), + s->arr1 [ 0 .. s->nblock-1 ] holds sorted order, + and + ((UChar*)s->arr2) [ 0 .. s->nblock-1 ] + holds the original block data. + + The first thing to do is generate the MTF values, + and put them in + ((UInt16*)s->arr1) [ 0 .. s->nblock-1 ]. + Because there are strictly fewer or equal MTF values + than block values, ptr values in this area are overwritten + with MTF values only when they are no longer needed. + + The final compressed bitstream is generated into the + area starting at + (UChar*) (&((UChar*)s->arr2)[s->nblock]) + + These storage aliases are set up in bzCompressInit(), + except for the last one, which is arranged in + compressBlock(). + */ + UInt32* ptr = s->ptr; + UChar* block = s->block; + UInt16* mtfv = s->mtfv; + + makeMaps_e ( s ); + EOB = s->nInUse+1; + + for (i = 0; i <= EOB; i++) s->mtfFreq[i] = 0; + + wr = 0; + zPend = 0; + for (i = 0; i < s->nInUse; i++) yy[i] = (UChar) i; + + for (i = 0; i < s->nblock; i++) { + UChar ll_i; + AssertD ( wr <= i, "generateMTFValues(1)" ); + j = ptr[i]-1; if (j < 0) j += s->nblock; + ll_i = s->unseqToSeq[block[j]]; + AssertD ( ll_i < s->nInUse, "generateMTFValues(2a)" ); + + if (yy[0] == ll_i) { + zPend++; + } else { + + if (zPend > 0) { + zPend--; + while (True) { + if (zPend & 1) { + mtfv[wr] = BZ_RUNB; wr++; + s->mtfFreq[BZ_RUNB]++; + } else { + mtfv[wr] = BZ_RUNA; wr++; + s->mtfFreq[BZ_RUNA]++; + } + if (zPend < 2) break; + zPend = (zPend - 2) / 2; + }; + zPend = 0; + } + { + register UChar rtmp; + register UChar* ryy_j; + register UChar rll_i; + rtmp = yy[1]; + yy[1] = yy[0]; + ryy_j = &(yy[1]); + rll_i = ll_i; + while ( rll_i != rtmp ) { + register UChar rtmp2; + ryy_j++; + rtmp2 = rtmp; + rtmp = *ryy_j; + *ryy_j = rtmp2; + }; + yy[0] = rtmp; + j = ryy_j - &(yy[0]); + mtfv[wr] = j+1; wr++; s->mtfFreq[j+1]++; + } + + } + } + + if (zPend > 0) { + zPend--; + while (True) { + if (zPend & 1) { + mtfv[wr] = BZ_RUNB; wr++; + s->mtfFreq[BZ_RUNB]++; + } else { + mtfv[wr] = BZ_RUNA; wr++; + s->mtfFreq[BZ_RUNA]++; + } + if (zPend < 2) break; + zPend = (zPend - 2) / 2; + }; + zPend = 0; + } + + mtfv[wr] = EOB; wr++; s->mtfFreq[EOB]++; + + s->nMTF = wr; +} + + +/*---------------------------------------------------*/ +#define BZ_LESSER_ICOST 0 +#define BZ_GREATER_ICOST 15 + +static +void sendMTFValues ( EState* s ) +{ + Int32 v, t, i, j, gs, ge, totc, bt, bc, iter; + Int32 nSelectors, alphaSize, minLen, maxLen, selCtr; + Int32 nGroups, nBytes; + + /*-- + UChar len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + is a global since the decoder also needs it. + + Int32 code[BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + Int32 rfreq[BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE]; + are also globals only used in this proc. + Made global to keep stack frame size small. + --*/ + + + UInt16 cost[BZ_N_GROUPS]; + Int32 fave[BZ_N_GROUPS]; + + UInt16* mtfv = s->mtfv; + + if (s->verbosity >= 3) + VPrintf3( " %d in block, %d after MTF & 1-2 coding, " + "%d+2 syms in use\n", + s->nblock, s->nMTF, s->nInUse ); + + alphaSize = s->nInUse+2; + for (t = 0; t < BZ_N_GROUPS; t++) + for (v = 0; v < alphaSize; v++) + s->len[t][v] = BZ_GREATER_ICOST; + + /*--- Decide how many coding tables to use ---*/ + AssertH ( s->nMTF > 0, 3001 ); + if (s->nMTF < 200) nGroups = 2; else + if (s->nMTF < 600) nGroups = 3; else + if (s->nMTF < 1200) nGroups = 4; else + if (s->nMTF < 2400) nGroups = 5; else + nGroups = 6; + + /*--- Generate an initial set of coding tables ---*/ + { + Int32 nPart, remF, tFreq, aFreq; + + nPart = nGroups; + remF = s->nMTF; + gs = 0; + while (nPart > 0) { + tFreq = remF / nPart; + ge = gs-1; + aFreq = 0; + while (aFreq < tFreq && ge < alphaSize-1) { + ge++; + aFreq += s->mtfFreq[ge]; + } + + if (ge > gs + && nPart != nGroups && nPart != 1 + && ((nGroups-nPart) % 2 == 1)) { + aFreq -= s->mtfFreq[ge]; + ge--; + } + + if (s->verbosity >= 3) + VPrintf5( " initial group %d, [%d .. %d], " + "has %d syms (%4.1f%%)\n", + nPart, gs, ge, aFreq, + (100.0 * (float)aFreq) / (float)(s->nMTF) ); + + for (v = 0; v < alphaSize; v++) + if (v >= gs && v <= ge) + s->len[nPart-1][v] = BZ_LESSER_ICOST; else + s->len[nPart-1][v] = BZ_GREATER_ICOST; + + nPart--; + gs = ge+1; + remF -= aFreq; + } + } + + /*--- + Iterate up to BZ_N_ITERS times to improve the tables. + ---*/ + for (iter = 0; iter < BZ_N_ITERS; iter++) { + + for (t = 0; t < nGroups; t++) fave[t] = 0; + + for (t = 0; t < nGroups; t++) + for (v = 0; v < alphaSize; v++) + s->rfreq[t][v] = 0; + + /*--- + Set up an auxiliary length table which is used to fast-track + the common case (nGroups == 6). + ---*/ + if (nGroups == 6) { + for (v = 0; v < alphaSize; v++) { + s->len_pack[v][0] = (s->len[1][v] << 16) | s->len[0][v]; + s->len_pack[v][1] = (s->len[3][v] << 16) | s->len[2][v]; + s->len_pack[v][2] = (s->len[5][v] << 16) | s->len[4][v]; + } + } + + nSelectors = 0; + totc = 0; + gs = 0; + while (True) { + + /*--- Set group start & end marks. --*/ + if (gs >= s->nMTF) break; + ge = gs + BZ_G_SIZE - 1; + if (ge >= s->nMTF) ge = s->nMTF-1; + + /*-- + Calculate the cost of this group as coded + by each of the coding tables. + --*/ + for (t = 0; t < nGroups; t++) cost[t] = 0; + + if (nGroups == 6 && 50 == ge-gs+1) { + /*--- fast track the common case ---*/ + register UInt32 cost01, cost23, cost45; + register UInt16 icv; + cost01 = cost23 = cost45 = 0; + +# define BZ_ITER(nn) \ + icv = mtfv[gs+(nn)]; \ + cost01 += s->len_pack[icv][0]; \ + cost23 += s->len_pack[icv][1]; \ + cost45 += s->len_pack[icv][2]; \ + + BZ_ITER(0); BZ_ITER(1); BZ_ITER(2); BZ_ITER(3); BZ_ITER(4); + BZ_ITER(5); BZ_ITER(6); BZ_ITER(7); BZ_ITER(8); BZ_ITER(9); + BZ_ITER(10); BZ_ITER(11); BZ_ITER(12); BZ_ITER(13); BZ_ITER(14); + BZ_ITER(15); BZ_ITER(16); BZ_ITER(17); BZ_ITER(18); BZ_ITER(19); + BZ_ITER(20); BZ_ITER(21); BZ_ITER(22); BZ_ITER(23); BZ_ITER(24); + BZ_ITER(25); BZ_ITER(26); BZ_ITER(27); BZ_ITER(28); BZ_ITER(29); + BZ_ITER(30); BZ_ITER(31); BZ_ITER(32); BZ_ITER(33); BZ_ITER(34); + BZ_ITER(35); BZ_ITER(36); BZ_ITER(37); BZ_ITER(38); BZ_ITER(39); + BZ_ITER(40); BZ_ITER(41); BZ_ITER(42); BZ_ITER(43); BZ_ITER(44); + BZ_ITER(45); BZ_ITER(46); BZ_ITER(47); BZ_ITER(48); BZ_ITER(49); + +# undef BZ_ITER + + cost[0] = cost01 & 0xffff; cost[1] = cost01 >> 16; + cost[2] = cost23 & 0xffff; cost[3] = cost23 >> 16; + cost[4] = cost45 & 0xffff; cost[5] = cost45 >> 16; + + } else { + /*--- slow version which correctly handles all situations ---*/ + for (i = gs; i <= ge; i++) { + UInt16 icv = mtfv[i]; + for (t = 0; t < nGroups; t++) cost[t] += s->len[t][icv]; + } + } + + /*-- + Find the coding table which is best for this group, + and record its identity in the selector table. + --*/ + bc = 999999999; bt = -1; + for (t = 0; t < nGroups; t++) + if (cost[t] < bc) { bc = cost[t]; bt = t; }; + totc += bc; + fave[bt]++; + s->selector[nSelectors] = bt; + nSelectors++; + + /*-- + Increment the symbol frequencies for the selected table. + --*/ + if (nGroups == 6 && 50 == ge-gs+1) { + /*--- fast track the common case ---*/ + +# define BZ_ITUR(nn) s->rfreq[bt][ mtfv[gs+(nn)] ]++ + + BZ_ITUR(0); BZ_ITUR(1); BZ_ITUR(2); BZ_ITUR(3); BZ_ITUR(4); + BZ_ITUR(5); BZ_ITUR(6); BZ_ITUR(7); BZ_ITUR(8); BZ_ITUR(9); + BZ_ITUR(10); BZ_ITUR(11); BZ_ITUR(12); BZ_ITUR(13); BZ_ITUR(14); + BZ_ITUR(15); BZ_ITUR(16); BZ_ITUR(17); BZ_ITUR(18); BZ_ITUR(19); + BZ_ITUR(20); BZ_ITUR(21); BZ_ITUR(22); BZ_ITUR(23); BZ_ITUR(24); + BZ_ITUR(25); BZ_ITUR(26); BZ_ITUR(27); BZ_ITUR(28); BZ_ITUR(29); + BZ_ITUR(30); BZ_ITUR(31); BZ_ITUR(32); BZ_ITUR(33); BZ_ITUR(34); + BZ_ITUR(35); BZ_ITUR(36); BZ_ITUR(37); BZ_ITUR(38); BZ_ITUR(39); + BZ_ITUR(40); BZ_ITUR(41); BZ_ITUR(42); BZ_ITUR(43); BZ_ITUR(44); + BZ_ITUR(45); BZ_ITUR(46); BZ_ITUR(47); BZ_ITUR(48); BZ_ITUR(49); + +# undef BZ_ITUR + + } else { + /*--- slow version which correctly handles all situations ---*/ + for (i = gs; i <= ge; i++) + s->rfreq[bt][ mtfv[i] ]++; + } + + gs = ge+1; + } + if (s->verbosity >= 3) { + VPrintf2 ( " pass %d: size is %d, grp uses are ", + iter+1, totc/8 ); + for (t = 0; t < nGroups; t++) + VPrintf1 ( "%d ", fave[t] ); + VPrintf0 ( "\n" ); + } + + /*-- + Recompute the tables based on the accumulated frequencies. + --*/ + for (t = 0; t < nGroups; t++) + BZ2_hbMakeCodeLengths ( &(s->len[t][0]), &(s->rfreq[t][0]), + alphaSize, 20 ); + } + + + AssertH( nGroups < 8, 3002 ); + AssertH( nSelectors < 32768 && + nSelectors <= (2 + (900000 / BZ_G_SIZE)), + 3003 ); + + + /*--- Compute MTF values for the selectors. ---*/ + { + UChar pos[BZ_N_GROUPS], ll_i, tmp2, tmp; + for (i = 0; i < nGroups; i++) pos[i] = i; + for (i = 0; i < nSelectors; i++) { + ll_i = s->selector[i]; + j = 0; + tmp = pos[j]; + while ( ll_i != tmp ) { + j++; + tmp2 = tmp; + tmp = pos[j]; + pos[j] = tmp2; + }; + pos[0] = tmp; + s->selectorMtf[i] = j; + } + }; + + /*--- Assign actual codes for the tables. --*/ + for (t = 0; t < nGroups; t++) { + minLen = 32; + maxLen = 0; + for (i = 0; i < alphaSize; i++) { + if (s->len[t][i] > maxLen) maxLen = s->len[t][i]; + if (s->len[t][i] < minLen) minLen = s->len[t][i]; + } + AssertH ( !(maxLen > 20), 3004 ); + AssertH ( !(minLen < 1), 3005 ); + BZ2_hbAssignCodes ( &(s->code[t][0]), &(s->len[t][0]), + minLen, maxLen, alphaSize ); + } + + /*--- Transmit the mapping table. ---*/ + { + Bool inUse16[16]; + for (i = 0; i < 16; i++) { + inUse16[i] = False; + for (j = 0; j < 16; j++) + if (s->inUse[i * 16 + j]) inUse16[i] = True; + } + + nBytes = s->numZ; + for (i = 0; i < 16; i++) + if (inUse16[i]) bsW(s,1,1); else bsW(s,1,0); + + for (i = 0; i < 16; i++) + if (inUse16[i]) + for (j = 0; j < 16; j++) { + if (s->inUse[i * 16 + j]) bsW(s,1,1); else bsW(s,1,0); + } + + if (s->verbosity >= 3) + VPrintf1( " bytes: mapping %d, ", s->numZ-nBytes ); + } + + /*--- Now the selectors. ---*/ + nBytes = s->numZ; + bsW ( s, 3, nGroups ); + bsW ( s, 15, nSelectors ); + for (i = 0; i < nSelectors; i++) { + for (j = 0; j < s->selectorMtf[i]; j++) bsW(s,1,1); + bsW(s,1,0); + } + if (s->verbosity >= 3) + VPrintf1( "selectors %d, ", s->numZ-nBytes ); + + /*--- Now the coding tables. ---*/ + nBytes = s->numZ; + + for (t = 0; t < nGroups; t++) { + Int32 curr = s->len[t][0]; + bsW ( s, 5, curr ); + for (i = 0; i < alphaSize; i++) { + while (curr < s->len[t][i]) { bsW(s,2,2); curr++; /* 10 */ }; + while (curr > s->len[t][i]) { bsW(s,2,3); curr--; /* 11 */ }; + bsW ( s, 1, 0 ); + } + } + + if (s->verbosity >= 3) + VPrintf1 ( "code lengths %d, ", s->numZ-nBytes ); + + /*--- And finally, the block data proper ---*/ + nBytes = s->numZ; + selCtr = 0; + gs = 0; + while (True) { + if (gs >= s->nMTF) break; + ge = gs + BZ_G_SIZE - 1; + if (ge >= s->nMTF) ge = s->nMTF-1; + AssertH ( s->selector[selCtr] < nGroups, 3006 ); + + if (nGroups == 6 && 50 == ge-gs+1) { + /*--- fast track the common case ---*/ + UInt16 mtfv_i; + UChar* s_len_sel_selCtr + = &(s->len[s->selector[selCtr]][0]); + Int32* s_code_sel_selCtr + = &(s->code[s->selector[selCtr]][0]); + +# define BZ_ITAH(nn) \ + mtfv_i = mtfv[gs+(nn)]; \ + bsW ( s, \ + s_len_sel_selCtr[mtfv_i], \ + s_code_sel_selCtr[mtfv_i] ) + + BZ_ITAH(0); BZ_ITAH(1); BZ_ITAH(2); BZ_ITAH(3); BZ_ITAH(4); + BZ_ITAH(5); BZ_ITAH(6); BZ_ITAH(7); BZ_ITAH(8); BZ_ITAH(9); + BZ_ITAH(10); BZ_ITAH(11); BZ_ITAH(12); BZ_ITAH(13); BZ_ITAH(14); + BZ_ITAH(15); BZ_ITAH(16); BZ_ITAH(17); BZ_ITAH(18); BZ_ITAH(19); + BZ_ITAH(20); BZ_ITAH(21); BZ_ITAH(22); BZ_ITAH(23); BZ_ITAH(24); + BZ_ITAH(25); BZ_ITAH(26); BZ_ITAH(27); BZ_ITAH(28); BZ_ITAH(29); + BZ_ITAH(30); BZ_ITAH(31); BZ_ITAH(32); BZ_ITAH(33); BZ_ITAH(34); + BZ_ITAH(35); BZ_ITAH(36); BZ_ITAH(37); BZ_ITAH(38); BZ_ITAH(39); + BZ_ITAH(40); BZ_ITAH(41); BZ_ITAH(42); BZ_ITAH(43); BZ_ITAH(44); + BZ_ITAH(45); BZ_ITAH(46); BZ_ITAH(47); BZ_ITAH(48); BZ_ITAH(49); + +# undef BZ_ITAH + + } else { + /*--- slow version which correctly handles all situations ---*/ + for (i = gs; i <= ge; i++) { + bsW ( s, + s->len [s->selector[selCtr]] [mtfv[i]], + s->code [s->selector[selCtr]] [mtfv[i]] ); + } + } + + + gs = ge+1; + selCtr++; + } + AssertH( selCtr == nSelectors, 3007 ); + + if (s->verbosity >= 3) + VPrintf1( "codes %d\n", s->numZ-nBytes ); +} + + +/*---------------------------------------------------*/ +void BZ2_compressBlock ( EState* s, Bool is_last_block ) +{ + if (s->nblock > 0) { + + BZ_FINALISE_CRC ( s->blockCRC ); + s->combinedCRC = (s->combinedCRC << 1) | (s->combinedCRC >> 31); + s->combinedCRC ^= s->blockCRC; + if (s->blockNo > 1) s->numZ = 0; + + if (s->verbosity >= 2) + VPrintf4( " block %d: crc = 0x%8x, " + "combined CRC = 0x%8x, size = %d\n", + s->blockNo, s->blockCRC, s->combinedCRC, s->nblock ); + + BZ2_blockSort ( s ); + } + + s->zbits = (UChar*) (&((UChar*)s->arr2)[s->nblock]); + + /*-- If this is the first block, create the stream header. --*/ + if (s->blockNo == 1) { + BZ2_bsInitWrite ( s ); + bsPutUChar ( s, 'B' ); + bsPutUChar ( s, 'Z' ); + bsPutUChar ( s, 'h' ); + bsPutUChar ( s, (UChar)('0' + s->blockSize100k) ); + } + + if (s->nblock > 0) { + + bsPutUChar ( s, 0x31 ); bsPutUChar ( s, 0x41 ); + bsPutUChar ( s, 0x59 ); bsPutUChar ( s, 0x26 ); + bsPutUChar ( s, 0x53 ); bsPutUChar ( s, 0x59 ); + + /*-- Now the block's CRC, so it is in a known place. --*/ + bsPutUInt32 ( s, s->blockCRC ); + + /*-- + Now a single bit indicating (non-)randomisation. + As of version 0.9.5, we use a better sorting algorithm + which makes randomisation unnecessary. So always set + the randomised bit to 'no'. Of course, the decoder + still needs to be able to handle randomised blocks + so as to maintain backwards compatibility with + older versions of bzip2. + --*/ + bsW(s,1,0); + + bsW ( s, 24, s->origPtr ); + generateMTFValues ( s ); + sendMTFValues ( s ); + } + + + /*-- If this is the last block, add the stream trailer. --*/ + if (is_last_block) { + + bsPutUChar ( s, 0x17 ); bsPutUChar ( s, 0x72 ); + bsPutUChar ( s, 0x45 ); bsPutUChar ( s, 0x38 ); + bsPutUChar ( s, 0x50 ); bsPutUChar ( s, 0x90 ); + bsPutUInt32 ( s, s->combinedCRC ); + if (s->verbosity >= 2) + VPrintf1( " final combined CRC = 0x%x\n ", s->combinedCRC ); + bsFinishWrite ( s ); + } +} + + +/*-------------------------------------------------------------*/ +/*--- end compress.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/crctable.c b/bzip2/crctable.c new file mode 100644 index 000000000..61c040c4f --- /dev/null +++ b/bzip2/crctable.c @@ -0,0 +1,144 @@ + +/*-------------------------------------------------------------*/ +/*--- Table for doing CRCs ---*/ +/*--- crctable.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#include "bzlib_private.h" + +/*-- + I think this is an implementation of the AUTODIN-II, + Ethernet & FDDI 32-bit CRC standard. Vaguely derived + from code by Rob Warnock, in Section 51 of the + comp.compression FAQ. +--*/ + +UInt32 BZ2_crc32Table[256] = { + + /*-- Ugly, innit? --*/ + + 0x00000000L, 0x04c11db7L, 0x09823b6eL, 0x0d4326d9L, + 0x130476dcL, 0x17c56b6bL, 0x1a864db2L, 0x1e475005L, + 0x2608edb8L, 0x22c9f00fL, 0x2f8ad6d6L, 0x2b4bcb61L, + 0x350c9b64L, 0x31cd86d3L, 0x3c8ea00aL, 0x384fbdbdL, + 0x4c11db70L, 0x48d0c6c7L, 0x4593e01eL, 0x4152fda9L, + 0x5f15adacL, 0x5bd4b01bL, 0x569796c2L, 0x52568b75L, + 0x6a1936c8L, 0x6ed82b7fL, 0x639b0da6L, 0x675a1011L, + 0x791d4014L, 0x7ddc5da3L, 0x709f7b7aL, 0x745e66cdL, + 0x9823b6e0L, 0x9ce2ab57L, 0x91a18d8eL, 0x95609039L, + 0x8b27c03cL, 0x8fe6dd8bL, 0x82a5fb52L, 0x8664e6e5L, + 0xbe2b5b58L, 0xbaea46efL, 0xb7a96036L, 0xb3687d81L, + 0xad2f2d84L, 0xa9ee3033L, 0xa4ad16eaL, 0xa06c0b5dL, + 0xd4326d90L, 0xd0f37027L, 0xddb056feL, 0xd9714b49L, + 0xc7361b4cL, 0xc3f706fbL, 0xceb42022L, 0xca753d95L, + 0xf23a8028L, 0xf6fb9d9fL, 0xfbb8bb46L, 0xff79a6f1L, + 0xe13ef6f4L, 0xe5ffeb43L, 0xe8bccd9aL, 0xec7dd02dL, + 0x34867077L, 0x30476dc0L, 0x3d044b19L, 0x39c556aeL, + 0x278206abL, 0x23431b1cL, 0x2e003dc5L, 0x2ac12072L, + 0x128e9dcfL, 0x164f8078L, 0x1b0ca6a1L, 0x1fcdbb16L, + 0x018aeb13L, 0x054bf6a4L, 0x0808d07dL, 0x0cc9cdcaL, + 0x7897ab07L, 0x7c56b6b0L, 0x71159069L, 0x75d48ddeL, + 0x6b93dddbL, 0x6f52c06cL, 0x6211e6b5L, 0x66d0fb02L, + 0x5e9f46bfL, 0x5a5e5b08L, 0x571d7dd1L, 0x53dc6066L, + 0x4d9b3063L, 0x495a2dd4L, 0x44190b0dL, 0x40d816baL, + 0xaca5c697L, 0xa864db20L, 0xa527fdf9L, 0xa1e6e04eL, + 0xbfa1b04bL, 0xbb60adfcL, 0xb6238b25L, 0xb2e29692L, + 0x8aad2b2fL, 0x8e6c3698L, 0x832f1041L, 0x87ee0df6L, + 0x99a95df3L, 0x9d684044L, 0x902b669dL, 0x94ea7b2aL, + 0xe0b41de7L, 0xe4750050L, 0xe9362689L, 0xedf73b3eL, + 0xf3b06b3bL, 0xf771768cL, 0xfa325055L, 0xfef34de2L, + 0xc6bcf05fL, 0xc27dede8L, 0xcf3ecb31L, 0xcbffd686L, + 0xd5b88683L, 0xd1799b34L, 0xdc3abdedL, 0xd8fba05aL, + 0x690ce0eeL, 0x6dcdfd59L, 0x608edb80L, 0x644fc637L, + 0x7a089632L, 0x7ec98b85L, 0x738aad5cL, 0x774bb0ebL, + 0x4f040d56L, 0x4bc510e1L, 0x46863638L, 0x42472b8fL, + 0x5c007b8aL, 0x58c1663dL, 0x558240e4L, 0x51435d53L, + 0x251d3b9eL, 0x21dc2629L, 0x2c9f00f0L, 0x285e1d47L, + 0x36194d42L, 0x32d850f5L, 0x3f9b762cL, 0x3b5a6b9bL, + 0x0315d626L, 0x07d4cb91L, 0x0a97ed48L, 0x0e56f0ffL, + 0x1011a0faL, 0x14d0bd4dL, 0x19939b94L, 0x1d528623L, + 0xf12f560eL, 0xf5ee4bb9L, 0xf8ad6d60L, 0xfc6c70d7L, + 0xe22b20d2L, 0xe6ea3d65L, 0xeba91bbcL, 0xef68060bL, + 0xd727bbb6L, 0xd3e6a601L, 0xdea580d8L, 0xda649d6fL, + 0xc423cd6aL, 0xc0e2d0ddL, 0xcda1f604L, 0xc960ebb3L, + 0xbd3e8d7eL, 0xb9ff90c9L, 0xb4bcb610L, 0xb07daba7L, + 0xae3afba2L, 0xaafbe615L, 0xa7b8c0ccL, 0xa379dd7bL, + 0x9b3660c6L, 0x9ff77d71L, 0x92b45ba8L, 0x9675461fL, + 0x8832161aL, 0x8cf30badL, 0x81b02d74L, 0x857130c3L, + 0x5d8a9099L, 0x594b8d2eL, 0x5408abf7L, 0x50c9b640L, + 0x4e8ee645L, 0x4a4ffbf2L, 0x470cdd2bL, 0x43cdc09cL, + 0x7b827d21L, 0x7f436096L, 0x7200464fL, 0x76c15bf8L, + 0x68860bfdL, 0x6c47164aL, 0x61043093L, 0x65c52d24L, + 0x119b4be9L, 0x155a565eL, 0x18197087L, 0x1cd86d30L, + 0x029f3d35L, 0x065e2082L, 0x0b1d065bL, 0x0fdc1becL, + 0x3793a651L, 0x3352bbe6L, 0x3e119d3fL, 0x3ad08088L, + 0x2497d08dL, 0x2056cd3aL, 0x2d15ebe3L, 0x29d4f654L, + 0xc5a92679L, 0xc1683bceL, 0xcc2b1d17L, 0xc8ea00a0L, + 0xd6ad50a5L, 0xd26c4d12L, 0xdf2f6bcbL, 0xdbee767cL, + 0xe3a1cbc1L, 0xe760d676L, 0xea23f0afL, 0xeee2ed18L, + 0xf0a5bd1dL, 0xf464a0aaL, 0xf9278673L, 0xfde69bc4L, + 0x89b8fd09L, 0x8d79e0beL, 0x803ac667L, 0x84fbdbd0L, + 0x9abc8bd5L, 0x9e7d9662L, 0x933eb0bbL, 0x97ffad0cL, + 0xafb010b1L, 0xab710d06L, 0xa6322bdfL, 0xa2f33668L, + 0xbcb4666dL, 0xb8757bdaL, 0xb5365d03L, 0xb1f740b4L +}; + + +/*-------------------------------------------------------------*/ +/*--- end crctable.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/decompress.c b/bzip2/decompress.c new file mode 100644 index 000000000..cdced1889 --- /dev/null +++ b/bzip2/decompress.c @@ -0,0 +1,660 @@ + +/*-------------------------------------------------------------*/ +/*--- Decompression machinery ---*/ +/*--- decompress.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#include "bzlib_private.h" + + +/*---------------------------------------------------*/ +static +void makeMaps_d ( DState* s ) +{ + Int32 i; + s->nInUse = 0; + for (i = 0; i < 256; i++) + if (s->inUse[i]) { + s->seqToUnseq[s->nInUse] = i; + s->nInUse++; + } +} + + +/*---------------------------------------------------*/ +#define RETURN(rrr) \ + { retVal = rrr; goto save_state_and_return; }; + +#define GET_BITS(lll,vvv,nnn) \ + case lll: s->state = lll; \ + while (True) { \ + if (s->bsLive >= nnn) { \ + UInt32 v; \ + v = (s->bsBuff >> \ + (s->bsLive-nnn)) & ((1 << nnn)-1); \ + s->bsLive -= nnn; \ + vvv = v; \ + break; \ + } \ + if (s->strm->avail_in == 0) RETURN(BZ_OK); \ + s->bsBuff \ + = (s->bsBuff << 8) | \ + ((UInt32) \ + (*((UChar*)(s->strm->next_in)))); \ + s->bsLive += 8; \ + s->strm->next_in++; \ + s->strm->avail_in--; \ + s->strm->total_in_lo32++; \ + if (s->strm->total_in_lo32 == 0) \ + s->strm->total_in_hi32++; \ + } + +#define GET_UCHAR(lll,uuu) \ + GET_BITS(lll,uuu,8) + +#define GET_BIT(lll,uuu) \ + GET_BITS(lll,uuu,1) + +/*---------------------------------------------------*/ +#define GET_MTF_VAL(label1,label2,lval) \ +{ \ + if (groupPos == 0) { \ + groupNo++; \ + if (groupNo >= nSelectors) \ + RETURN(BZ_DATA_ERROR); \ + groupPos = BZ_G_SIZE; \ + gSel = s->selector[groupNo]; \ + gMinlen = s->minLens[gSel]; \ + gLimit = &(s->limit[gSel][0]); \ + gPerm = &(s->perm[gSel][0]); \ + gBase = &(s->base[gSel][0]); \ + } \ + groupPos--; \ + zn = gMinlen; \ + GET_BITS(label1, zvec, zn); \ + while (1) { \ + if (zn > 20 /* the longest code */) \ + RETURN(BZ_DATA_ERROR); \ + if (zvec <= gLimit[zn]) break; \ + zn++; \ + GET_BIT(label2, zj); \ + zvec = (zvec << 1) | zj; \ + }; \ + if (zvec - gBase[zn] < 0 \ + || zvec - gBase[zn] >= BZ_MAX_ALPHA_SIZE) \ + RETURN(BZ_DATA_ERROR); \ + lval = gPerm[zvec - gBase[zn]]; \ +} + + +/*---------------------------------------------------*/ +Int32 BZ2_decompress ( DState* s ) +{ + UChar uc; + Int32 retVal; + Int32 minLen, maxLen; + bz_stream* strm = s->strm; + + /* stuff that needs to be saved/restored */ + Int32 i; + Int32 j; + Int32 t; + Int32 alphaSize; + Int32 nGroups; + Int32 nSelectors; + Int32 EOB; + Int32 groupNo; + Int32 groupPos; + Int32 nextSym; + Int32 nblockMAX; + Int32 nblock; + Int32 es; + Int32 N; + Int32 curr; + Int32 zt; + Int32 zn; + Int32 zvec; + Int32 zj; + Int32 gSel; + Int32 gMinlen; + Int32* gLimit; + Int32* gBase; + Int32* gPerm; + + if (s->state == BZ_X_MAGIC_1) { + /*initialise the save area*/ + s->save_i = 0; + s->save_j = 0; + s->save_t = 0; + s->save_alphaSize = 0; + s->save_nGroups = 0; + s->save_nSelectors = 0; + s->save_EOB = 0; + s->save_groupNo = 0; + s->save_groupPos = 0; + s->save_nextSym = 0; + s->save_nblockMAX = 0; + s->save_nblock = 0; + s->save_es = 0; + s->save_N = 0; + s->save_curr = 0; + s->save_zt = 0; + s->save_zn = 0; + s->save_zvec = 0; + s->save_zj = 0; + s->save_gSel = 0; + s->save_gMinlen = 0; + s->save_gLimit = NULL; + s->save_gBase = NULL; + s->save_gPerm = NULL; + } + + /*restore from the save area*/ + i = s->save_i; + j = s->save_j; + t = s->save_t; + alphaSize = s->save_alphaSize; + nGroups = s->save_nGroups; + nSelectors = s->save_nSelectors; + EOB = s->save_EOB; + groupNo = s->save_groupNo; + groupPos = s->save_groupPos; + nextSym = s->save_nextSym; + nblockMAX = s->save_nblockMAX; + nblock = s->save_nblock; + es = s->save_es; + N = s->save_N; + curr = s->save_curr; + zt = s->save_zt; + zn = s->save_zn; + zvec = s->save_zvec; + zj = s->save_zj; + gSel = s->save_gSel; + gMinlen = s->save_gMinlen; + gLimit = s->save_gLimit; + gBase = s->save_gBase; + gPerm = s->save_gPerm; + + retVal = BZ_OK; + + switch (s->state) { + + GET_UCHAR(BZ_X_MAGIC_1, uc); + if (uc != 'B') RETURN(BZ_DATA_ERROR_MAGIC); + + GET_UCHAR(BZ_X_MAGIC_2, uc); + if (uc != 'Z') RETURN(BZ_DATA_ERROR_MAGIC); + + GET_UCHAR(BZ_X_MAGIC_3, uc) + if (uc != 'h') RETURN(BZ_DATA_ERROR_MAGIC); + + GET_BITS(BZ_X_MAGIC_4, s->blockSize100k, 8) + if (s->blockSize100k < '1' || + s->blockSize100k > '9') RETURN(BZ_DATA_ERROR_MAGIC); + s->blockSize100k -= '0'; + + if (s->smallDecompress) { + s->ll16 = BZALLOC( s->blockSize100k * 100000 * sizeof(UInt16) ); + s->ll4 = BZALLOC( + ((1 + s->blockSize100k * 100000) >> 1) * sizeof(UChar) + ); + if (s->ll16 == NULL || s->ll4 == NULL) RETURN(BZ_MEM_ERROR); + } else { + s->tt = BZALLOC( s->blockSize100k * 100000 * sizeof(Int32) ); + if (s->tt == NULL) RETURN(BZ_MEM_ERROR); + } + + GET_UCHAR(BZ_X_BLKHDR_1, uc); + + if (uc == 0x17) goto endhdr_2; + if (uc != 0x31) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_2, uc); + if (uc != 0x41) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_3, uc); + if (uc != 0x59) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_4, uc); + if (uc != 0x26) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_5, uc); + if (uc != 0x53) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_BLKHDR_6, uc); + if (uc != 0x59) RETURN(BZ_DATA_ERROR); + + s->currBlockNo++; + if (s->verbosity >= 2) + VPrintf1 ( "\n [%d: huff+mtf ", s->currBlockNo ); + + s->storedBlockCRC = 0; + GET_UCHAR(BZ_X_BCRC_1, uc); + s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_BCRC_2, uc); + s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_BCRC_3, uc); + s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_BCRC_4, uc); + s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc); + + GET_BITS(BZ_X_RANDBIT, s->blockRandomised, 1); + + s->origPtr = 0; + GET_UCHAR(BZ_X_ORIGPTR_1, uc); + s->origPtr = (s->origPtr << 8) | ((Int32)uc); + GET_UCHAR(BZ_X_ORIGPTR_2, uc); + s->origPtr = (s->origPtr << 8) | ((Int32)uc); + GET_UCHAR(BZ_X_ORIGPTR_3, uc); + s->origPtr = (s->origPtr << 8) | ((Int32)uc); + + if (s->origPtr < 0) + RETURN(BZ_DATA_ERROR); + if (s->origPtr > 10 + 100000*s->blockSize100k) + RETURN(BZ_DATA_ERROR); + + /*--- Receive the mapping table ---*/ + for (i = 0; i < 16; i++) { + GET_BIT(BZ_X_MAPPING_1, uc); + if (uc == 1) + s->inUse16[i] = True; else + s->inUse16[i] = False; + } + + for (i = 0; i < 256; i++) s->inUse[i] = False; + + for (i = 0; i < 16; i++) + if (s->inUse16[i]) + for (j = 0; j < 16; j++) { + GET_BIT(BZ_X_MAPPING_2, uc); + if (uc == 1) s->inUse[i * 16 + j] = True; + } + makeMaps_d ( s ); + if (s->nInUse == 0) RETURN(BZ_DATA_ERROR); + alphaSize = s->nInUse+2; + + /*--- Now the selectors ---*/ + GET_BITS(BZ_X_SELECTOR_1, nGroups, 3); + if (nGroups < 2 || nGroups > 6) RETURN(BZ_DATA_ERROR); + GET_BITS(BZ_X_SELECTOR_2, nSelectors, 15); + if (nSelectors < 1) RETURN(BZ_DATA_ERROR); + for (i = 0; i < nSelectors; i++) { + j = 0; + while (True) { + GET_BIT(BZ_X_SELECTOR_3, uc); + if (uc == 0) break; + j++; + if (j >= nGroups) RETURN(BZ_DATA_ERROR); + } + s->selectorMtf[i] = j; + } + + /*--- Undo the MTF values for the selectors. ---*/ + { + UChar pos[BZ_N_GROUPS], tmp, v; + for (v = 0; v < nGroups; v++) pos[v] = v; + + for (i = 0; i < nSelectors; i++) { + v = s->selectorMtf[i]; + tmp = pos[v]; + while (v > 0) { pos[v] = pos[v-1]; v--; } + pos[0] = tmp; + s->selector[i] = tmp; + } + } + + /*--- Now the coding tables ---*/ + for (t = 0; t < nGroups; t++) { + GET_BITS(BZ_X_CODING_1, curr, 5); + for (i = 0; i < alphaSize; i++) { + while (True) { + if (curr < 1 || curr > 20) RETURN(BZ_DATA_ERROR); + GET_BIT(BZ_X_CODING_2, uc); + if (uc == 0) break; + GET_BIT(BZ_X_CODING_3, uc); + if (uc == 0) curr++; else curr--; + } + s->len[t][i] = curr; + } + } + + /*--- Create the Huffman decoding tables ---*/ + for (t = 0; t < nGroups; t++) { + minLen = 32; + maxLen = 0; + for (i = 0; i < alphaSize; i++) { + if (s->len[t][i] > maxLen) maxLen = s->len[t][i]; + if (s->len[t][i] < minLen) minLen = s->len[t][i]; + } + BZ2_hbCreateDecodeTables ( + &(s->limit[t][0]), + &(s->base[t][0]), + &(s->perm[t][0]), + &(s->len[t][0]), + minLen, maxLen, alphaSize + ); + s->minLens[t] = minLen; + } + + /*--- Now the MTF values ---*/ + + EOB = s->nInUse+1; + nblockMAX = 100000 * s->blockSize100k; + groupNo = -1; + groupPos = 0; + + for (i = 0; i <= 255; i++) s->unzftab[i] = 0; + + /*-- MTF init --*/ + { + Int32 ii, jj, kk; + kk = MTFA_SIZE-1; + for (ii = 256 / MTFL_SIZE - 1; ii >= 0; ii--) { + for (jj = MTFL_SIZE-1; jj >= 0; jj--) { + s->mtfa[kk] = (UChar)(ii * MTFL_SIZE + jj); + kk--; + } + s->mtfbase[ii] = kk + 1; + } + } + /*-- end MTF init --*/ + + nblock = 0; + GET_MTF_VAL(BZ_X_MTF_1, BZ_X_MTF_2, nextSym); + + while (True) { + + if (nextSym == EOB) break; + + if (nextSym == BZ_RUNA || nextSym == BZ_RUNB) { + + es = -1; + N = 1; + do { + if (nextSym == BZ_RUNA) es = es + (0+1) * N; else + if (nextSym == BZ_RUNB) es = es + (1+1) * N; + N = N * 2; + GET_MTF_VAL(BZ_X_MTF_3, BZ_X_MTF_4, nextSym); + } + while (nextSym == BZ_RUNA || nextSym == BZ_RUNB); + + es++; + uc = s->seqToUnseq[ s->mtfa[s->mtfbase[0]] ]; + s->unzftab[uc] += es; + + if (s->smallDecompress) + while (es > 0) { + if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR); + s->ll16[nblock] = (UInt16)uc; + nblock++; + es--; + } + else + while (es > 0) { + if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR); + s->tt[nblock] = (UInt32)uc; + nblock++; + es--; + }; + + continue; + + } else { + + if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR); + + /*-- uc = MTF ( nextSym-1 ) --*/ + { + Int32 ii, jj, kk, pp, lno, off; + UInt32 nn; + nn = (UInt32)(nextSym - 1); + + if (nn < MTFL_SIZE) { + /* avoid general-case expense */ + pp = s->mtfbase[0]; + uc = s->mtfa[pp+nn]; + while (nn > 3) { + Int32 z = pp+nn; + s->mtfa[(z) ] = s->mtfa[(z)-1]; + s->mtfa[(z)-1] = s->mtfa[(z)-2]; + s->mtfa[(z)-2] = s->mtfa[(z)-3]; + s->mtfa[(z)-3] = s->mtfa[(z)-4]; + nn -= 4; + } + while (nn > 0) { + s->mtfa[(pp+nn)] = s->mtfa[(pp+nn)-1]; nn--; + }; + s->mtfa[pp] = uc; + } else { + /* general case */ + lno = nn / MTFL_SIZE; + off = nn % MTFL_SIZE; + pp = s->mtfbase[lno] + off; + uc = s->mtfa[pp]; + while (pp > s->mtfbase[lno]) { + s->mtfa[pp] = s->mtfa[pp-1]; pp--; + }; + s->mtfbase[lno]++; + while (lno > 0) { + s->mtfbase[lno]--; + s->mtfa[s->mtfbase[lno]] + = s->mtfa[s->mtfbase[lno-1] + MTFL_SIZE - 1]; + lno--; + } + s->mtfbase[0]--; + s->mtfa[s->mtfbase[0]] = uc; + if (s->mtfbase[0] == 0) { + kk = MTFA_SIZE-1; + for (ii = 256 / MTFL_SIZE-1; ii >= 0; ii--) { + for (jj = MTFL_SIZE-1; jj >= 0; jj--) { + s->mtfa[kk] = s->mtfa[s->mtfbase[ii] + jj]; + kk--; + } + s->mtfbase[ii] = kk + 1; + } + } + } + } + /*-- end uc = MTF ( nextSym-1 ) --*/ + + s->unzftab[s->seqToUnseq[uc]]++; + if (s->smallDecompress) + s->ll16[nblock] = (UInt16)(s->seqToUnseq[uc]); else + s->tt[nblock] = (UInt32)(s->seqToUnseq[uc]); + nblock++; + + GET_MTF_VAL(BZ_X_MTF_5, BZ_X_MTF_6, nextSym); + continue; + } + } + + /* Now we know what nblock is, we can do a better sanity + check on s->origPtr. + */ + if (s->origPtr < 0 || s->origPtr >= nblock) + RETURN(BZ_DATA_ERROR); + + s->state_out_len = 0; + s->state_out_ch = 0; + BZ_INITIALISE_CRC ( s->calculatedBlockCRC ); + s->state = BZ_X_OUTPUT; + if (s->verbosity >= 2) VPrintf0 ( "rt+rld" ); + + /*-- Set up cftab to facilitate generation of T^(-1) --*/ + s->cftab[0] = 0; + for (i = 1; i <= 256; i++) s->cftab[i] = s->unzftab[i-1]; + for (i = 1; i <= 256; i++) s->cftab[i] += s->cftab[i-1]; + + if (s->smallDecompress) { + + /*-- Make a copy of cftab, used in generation of T --*/ + for (i = 0; i <= 256; i++) s->cftabCopy[i] = s->cftab[i]; + + /*-- compute the T vector --*/ + for (i = 0; i < nblock; i++) { + uc = (UChar)(s->ll16[i]); + SET_LL(i, s->cftabCopy[uc]); + s->cftabCopy[uc]++; + } + + /*-- Compute T^(-1) by pointer reversal on T --*/ + i = s->origPtr; + j = GET_LL(i); + do { + Int32 tmp = GET_LL(j); + SET_LL(j, i); + i = j; + j = tmp; + } + while (i != s->origPtr); + + s->tPos = s->origPtr; + s->nblock_used = 0; + if (s->blockRandomised) { + BZ_RAND_INIT_MASK; + BZ_GET_SMALL(s->k0); s->nblock_used++; + BZ_RAND_UPD_MASK; s->k0 ^= BZ_RAND_MASK; + } else { + BZ_GET_SMALL(s->k0); s->nblock_used++; + } + + } else { + + /*-- compute the T^(-1) vector --*/ + for (i = 0; i < nblock; i++) { + uc = (UChar)(s->tt[i] & 0xff); + s->tt[s->cftab[uc]] |= (i << 8); + s->cftab[uc]++; + } + + s->tPos = s->tt[s->origPtr] >> 8; + s->nblock_used = 0; + if (s->blockRandomised) { + BZ_RAND_INIT_MASK; + BZ_GET_FAST(s->k0); s->nblock_used++; + BZ_RAND_UPD_MASK; s->k0 ^= BZ_RAND_MASK; + } else { + BZ_GET_FAST(s->k0); s->nblock_used++; + } + + } + + RETURN(BZ_OK); + + + + endhdr_2: + + GET_UCHAR(BZ_X_ENDHDR_2, uc); + if (uc != 0x72) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_ENDHDR_3, uc); + if (uc != 0x45) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_ENDHDR_4, uc); + if (uc != 0x38) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_ENDHDR_5, uc); + if (uc != 0x50) RETURN(BZ_DATA_ERROR); + GET_UCHAR(BZ_X_ENDHDR_6, uc); + if (uc != 0x90) RETURN(BZ_DATA_ERROR); + + s->storedCombinedCRC = 0; + GET_UCHAR(BZ_X_CCRC_1, uc); + s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_CCRC_2, uc); + s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_CCRC_3, uc); + s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc); + GET_UCHAR(BZ_X_CCRC_4, uc); + s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc); + + s->state = BZ_X_IDLE; + RETURN(BZ_STREAM_END); + + default: AssertH ( False, 4001 ); + } + + AssertH ( False, 4002 ); + + save_state_and_return: + + s->save_i = i; + s->save_j = j; + s->save_t = t; + s->save_alphaSize = alphaSize; + s->save_nGroups = nGroups; + s->save_nSelectors = nSelectors; + s->save_EOB = EOB; + s->save_groupNo = groupNo; + s->save_groupPos = groupPos; + s->save_nextSym = nextSym; + s->save_nblockMAX = nblockMAX; + s->save_nblock = nblock; + s->save_es = es; + s->save_N = N; + s->save_curr = curr; + s->save_zt = zt; + s->save_zn = zn; + s->save_zvec = zvec; + s->save_zj = zj; + s->save_gSel = gSel; + s->save_gMinlen = gMinlen; + s->save_gLimit = gLimit; + s->save_gBase = gBase; + s->save_gPerm = gPerm; + + return retVal; +} + + +/*-------------------------------------------------------------*/ +/*--- end decompress.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/dlltest.c b/bzip2/dlltest.c new file mode 100644 index 000000000..f79279cef --- /dev/null +++ b/bzip2/dlltest.c @@ -0,0 +1,176 @@ +/*
+ minibz2
+ libbz2.dll test program.
+ by Yoshioka Tsuneo(QWF00133@nifty.ne.jp/tsuneo-y@is.aist-nara.ac.jp)
+ This file is Public Domain.
+ welcome any email to me.
+
+ usage: minibz2 [-d] [-{1,2,..9}] [[srcfilename] destfilename]
+*/
+
+#define BZ_IMPORT
+#include <stdio.h>
+#include <stdlib.h>
+#include "bzlib.h"
+#ifdef _WIN32
+#include <io.h>
+#endif
+
+
+#ifdef _WIN32
+
+#define BZ2_LIBNAME "libbz2-1.0.0.DLL"
+
+#include <windows.h>
+static int BZ2DLLLoaded = 0;
+static HINSTANCE BZ2DLLhLib;
+int BZ2DLLLoadLibrary(void)
+{
+ HINSTANCE hLib;
+
+ if(BZ2DLLLoaded==1){return 0;}
+ hLib=LoadLibrary(BZ2_LIBNAME);
+ if(hLib == NULL){
+ fprintf(stderr,"Can't load %s\n",BZ2_LIBNAME);
+ return -1;
+ }
+ BZ2_bzlibVersion=GetProcAddress(hLib,"BZ2_bzlibVersion");
+ BZ2_bzopen=GetProcAddress(hLib,"BZ2_bzopen");
+ BZ2_bzdopen=GetProcAddress(hLib,"BZ2_bzdopen");
+ BZ2_bzread=GetProcAddress(hLib,"BZ2_bzread");
+ BZ2_bzwrite=GetProcAddress(hLib,"BZ2_bzwrite");
+ BZ2_bzflush=GetProcAddress(hLib,"BZ2_bzflush");
+ BZ2_bzclose=GetProcAddress(hLib,"BZ2_bzclose");
+ BZ2_bzerror=GetProcAddress(hLib,"BZ2_bzerror");
+
+ if (!BZ2_bzlibVersion || !BZ2_bzopen || !BZ2_bzdopen
+ || !BZ2_bzread || !BZ2_bzwrite || !BZ2_bzflush
+ || !BZ2_bzclose || !BZ2_bzerror) {
+ fprintf(stderr,"GetProcAddress failed.\n");
+ return -1;
+ }
+ BZ2DLLLoaded=1;
+ BZ2DLLhLib=hLib;
+ return 0;
+
+}
+int BZ2DLLFreeLibrary(void)
+{
+ if(BZ2DLLLoaded==0){return 0;}
+ FreeLibrary(BZ2DLLhLib);
+ BZ2DLLLoaded=0;
+}
+#endif /* WIN32 */
+
+void usage(void)
+{
+ puts("usage: minibz2 [-d] [-{1,2,..9}] [[srcfilename] destfilename]");
+}
+
+int main(int argc,char *argv[])
+{
+ int decompress = 0;
+ int level = 9;
+ char *fn_r = NULL;
+ char *fn_w = NULL;
+
+#ifdef _WIN32
+ if(BZ2DLLLoadLibrary()<0){
+ fprintf(stderr,"Loading of %s failed. Giving up.\n", BZ2_LIBNAME);
+ exit(1);
+ }
+ printf("Loading of %s succeeded. Library version is %s.\n",
+ BZ2_LIBNAME, BZ2_bzlibVersion() );
+#endif
+ while(++argv,--argc){
+ if(**argv =='-' || **argv=='/'){
+ char *p;
+
+ for(p=*argv+1;*p;p++){
+ if(*p=='d'){
+ decompress = 1;
+ }else if('1'<=*p && *p<='9'){
+ level = *p - '0';
+ }else{
+ usage();
+ exit(1);
+ }
+ }
+ }else{
+ break;
+ }
+ }
+ if(argc>=1){
+ fn_r = *argv;
+ argc--;argv++;
+ }else{
+ fn_r = NULL;
+ }
+ if(argc>=1){
+ fn_w = *argv;
+ argc--;argv++;
+ }else{
+ fn_w = NULL;
+ }
+ {
+ int len;
+ char buff[0x1000];
+ char mode[10];
+
+ if(decompress){
+ BZFILE *BZ2fp_r = NULL;
+ FILE *fp_w = NULL;
+
+ if(fn_w){
+ if((fp_w = fopen(fn_w,"wb"))==NULL){
+ printf("can't open [%s]\n",fn_w);
+ perror("reason:");
+ exit(1);
+ }
+ }else{
+ fp_w = stdout;
+ }
+ if((BZ2fp_r == NULL && (BZ2fp_r = BZ2_bzdopen(fileno(stdin),"rb"))==NULL)
+ || (BZ2fp_r != NULL && (BZ2fp_r = BZ2_bzopen(fn_r,"rb"))==NULL)){
+ printf("can't bz2openstream\n");
+ exit(1);
+ }
+ while((len=BZ2_bzread(BZ2fp_r,buff,0x1000))>0){
+ fwrite(buff,1,len,fp_w);
+ }
+ BZ2_bzclose(BZ2fp_r);
+ if(fp_w != stdout) fclose(fp_w);
+ }else{
+ BZFILE *BZ2fp_w = NULL;
+ FILE *fp_r = NULL;
+
+ if(fn_r){
+ if((fp_r = fopen(fn_r,"rb"))==NULL){
+ printf("can't open [%s]\n",fn_r);
+ perror("reason:");
+ exit(1);
+ }
+ }else{
+ fp_r = stdin;
+ }
+ mode[0]='w';
+ mode[1] = '0' + level;
+ mode[2] = '\0';
+
+ if((fn_w == NULL && (BZ2fp_w = BZ2_bzdopen(fileno(stdout),mode))==NULL)
+ || (fn_w !=NULL && (BZ2fp_w = BZ2_bzopen(fn_w,mode))==NULL)){
+ printf("can't bz2openstream\n");
+ exit(1);
+ }
+ while((len=fread(buff,1,0x1000,fp_r))>0){
+ BZ2_bzwrite(BZ2fp_w,buff,len);
+ }
+ BZ2_bzclose(BZ2fp_w);
+ if(fp_r!=stdin)fclose(fp_r);
+ }
+ }
+#ifdef _WIN32
+ BZ2DLLFreeLibrary();
+#endif
+ return 0;
+}
diff --git a/bzip2/dlltest.dsp b/bzip2/dlltest.dsp new file mode 100644 index 000000000..4b1615edc --- /dev/null +++ b/bzip2/dlltest.dsp @@ -0,0 +1,93 @@ +# Microsoft Developer Studio Project File - Name="dlltest" - Package Owner=<4>
+# Microsoft Developer Studio Generated Build File, Format Version 5.00
+# ** •ÒW‚µ‚È‚¢‚Å‚‚¾‚³‚¢ **
+
+# TARGTYPE "Win32 (x86) Console Application" 0x0103
+
+CFG=dlltest - Win32 Debug
+!MESSAGE ‚±‚ê‚Í—LŒø‚ÈÒ²¸Ì§²Ù‚Å‚Í‚ ‚è‚Ü‚¹‚ñB ‚±‚ÌÌßÛ¼Þª¸Ä‚ðËÞÙÄÞ‚·‚邽‚ß‚É‚Í NMAKE ‚ðŽg—p‚µ‚Ä‚‚¾‚³‚¢B
+!MESSAGE [Ò²¸Ì§²Ù‚Ì´¸½Îß°Ä] ºÏÝÄÞ‚ðŽg—p‚µ‚ÄŽÀs‚µ‚Ä‚‚¾‚³‚¢
+!MESSAGE
+!MESSAGE NMAKE /f "dlltest.mak".
+!MESSAGE
+!MESSAGE NMAKE ‚ÌŽÀsŽž‚É\¬‚ðŽw’è‚Å‚«‚Ü‚·
+!MESSAGE ºÏÝÄÞ ×²Ýã‚ÅϸۂÌÝ’è‚ð’è‹`‚µ‚Ü‚·B—á:
+!MESSAGE
+!MESSAGE NMAKE /f "dlltest.mak" CFG="dlltest - Win32 Debug"
+!MESSAGE
+!MESSAGE ‘I‘ð‰Â”\‚ÈËÞÙÄÞ Ó°ÄÞ:
+!MESSAGE
+!MESSAGE "dlltest - Win32 Release" ("Win32 (x86) Console Application" —p)
+!MESSAGE "dlltest - Win32 Debug" ("Win32 (x86) Console Application" —p)
+!MESSAGE
+
+# Begin Project
+# PROP Scc_ProjName ""
+# PROP Scc_LocalPath ""
+CPP=cl.exe
+RSC=rc.exe
+
+!IF "$(CFG)" == "dlltest - Win32 Release"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "Release"
+# PROP BASE Intermediate_Dir "Release"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "Release"
+# PROP Intermediate_Dir "Release"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+# ADD BASE CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c
+# ADD CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c
+# ADD BASE RSC /l 0x411 /d "NDEBUG"
+# ADD RSC /l 0x411 /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /machine:I386
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /machine:I386 /out:"minibz2.exe"
+
+!ELSEIF "$(CFG)" == "dlltest - Win32 Debug"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 1
+# PROP BASE Output_Dir "dlltest_"
+# PROP BASE Intermediate_Dir "dlltest_"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 1
+# PROP Output_Dir "dlltest_"
+# PROP Intermediate_Dir "dlltest_"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+# ADD BASE CPP /nologo /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c
+# ADD CPP /nologo /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c
+# ADD BASE RSC /l 0x411 /d "_DEBUG"
+# ADD RSC /l 0x411 /d "_DEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /debug /machine:I386 /pdbtype:sept
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /debug /machine:I386 /out:"minibz2.exe" /pdbtype:sept
+
+!ENDIF
+
+# Begin Target
+
+# Name "dlltest - Win32 Release"
+# Name "dlltest - Win32 Debug"
+# Begin Source File
+
+SOURCE=.\bzlib.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\dlltest.c
+# End Source File
+# End Target
+# End Project
diff --git a/bzip2/huffman.c b/bzip2/huffman.c new file mode 100644 index 000000000..9b446c4b3 --- /dev/null +++ b/bzip2/huffman.c @@ -0,0 +1,228 @@ + +/*-------------------------------------------------------------*/ +/*--- Huffman coding low-level stuff ---*/ +/*--- huffman.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#include "bzlib_private.h" + +/*---------------------------------------------------*/ +#define WEIGHTOF(zz0) ((zz0) & 0xffffff00) +#define DEPTHOF(zz1) ((zz1) & 0x000000ff) +#define MYMAX(zz2,zz3) ((zz2) > (zz3) ? (zz2) : (zz3)) + +#define ADDWEIGHTS(zw1,zw2) \ + (WEIGHTOF(zw1)+WEIGHTOF(zw2)) | \ + (1 + MYMAX(DEPTHOF(zw1),DEPTHOF(zw2))) + +#define UPHEAP(z) \ +{ \ + Int32 zz, tmp; \ + zz = z; tmp = heap[zz]; \ + while (weight[tmp] < weight[heap[zz >> 1]]) { \ + heap[zz] = heap[zz >> 1]; \ + zz >>= 1; \ + } \ + heap[zz] = tmp; \ +} + +#define DOWNHEAP(z) \ +{ \ + Int32 zz, yy, tmp; \ + zz = z; tmp = heap[zz]; \ + while (True) { \ + yy = zz << 1; \ + if (yy > nHeap) break; \ + if (yy < nHeap && \ + weight[heap[yy+1]] < weight[heap[yy]]) \ + yy++; \ + if (weight[tmp] < weight[heap[yy]]) break; \ + heap[zz] = heap[yy]; \ + zz = yy; \ + } \ + heap[zz] = tmp; \ +} + + +/*---------------------------------------------------*/ +void BZ2_hbMakeCodeLengths ( UChar *len, + Int32 *freq, + Int32 alphaSize, + Int32 maxLen ) +{ + /*-- + Nodes and heap entries run from 1. Entry 0 + for both the heap and nodes is a sentinel. + --*/ + Int32 nNodes, nHeap, n1, n2, i, j, k; + Bool tooLong; + + Int32 heap [ BZ_MAX_ALPHA_SIZE + 2 ]; + Int32 weight [ BZ_MAX_ALPHA_SIZE * 2 ]; + Int32 parent [ BZ_MAX_ALPHA_SIZE * 2 ]; + + for (i = 0; i < alphaSize; i++) + weight[i+1] = (freq[i] == 0 ? 1 : freq[i]) << 8; + + while (True) { + + nNodes = alphaSize; + nHeap = 0; + + heap[0] = 0; + weight[0] = 0; + parent[0] = -2; + + for (i = 1; i <= alphaSize; i++) { + parent[i] = -1; + nHeap++; + heap[nHeap] = i; + UPHEAP(nHeap); + } + + AssertH( nHeap < (BZ_MAX_ALPHA_SIZE+2), 2001 ); + + while (nHeap > 1) { + n1 = heap[1]; heap[1] = heap[nHeap]; nHeap--; DOWNHEAP(1); + n2 = heap[1]; heap[1] = heap[nHeap]; nHeap--; DOWNHEAP(1); + nNodes++; + parent[n1] = parent[n2] = nNodes; + weight[nNodes] = ADDWEIGHTS(weight[n1], weight[n2]); + parent[nNodes] = -1; + nHeap++; + heap[nHeap] = nNodes; + UPHEAP(nHeap); + } + + AssertH( nNodes < (BZ_MAX_ALPHA_SIZE * 2), 2002 ); + + tooLong = False; + for (i = 1; i <= alphaSize; i++) { + j = 0; + k = i; + while (parent[k] >= 0) { k = parent[k]; j++; } + len[i-1] = j; + if (j > maxLen) tooLong = True; + } + + if (! tooLong) break; + + for (i = 1; i < alphaSize; i++) { + j = weight[i] >> 8; + j = 1 + (j / 2); + weight[i] = j << 8; + } + } +} + + +/*---------------------------------------------------*/ +void BZ2_hbAssignCodes ( Int32 *code, + UChar *length, + Int32 minLen, + Int32 maxLen, + Int32 alphaSize ) +{ + Int32 n, vec, i; + + vec = 0; + for (n = minLen; n <= maxLen; n++) { + for (i = 0; i < alphaSize; i++) + if (length[i] == n) { code[i] = vec; vec++; }; + vec <<= 1; + } +} + + +/*---------------------------------------------------*/ +void BZ2_hbCreateDecodeTables ( Int32 *limit, + Int32 *base, + Int32 *perm, + UChar *length, + Int32 minLen, + Int32 maxLen, + Int32 alphaSize ) +{ + Int32 pp, i, j, vec; + + pp = 0; + for (i = minLen; i <= maxLen; i++) + for (j = 0; j < alphaSize; j++) + if (length[j] == i) { perm[pp] = j; pp++; }; + + for (i = 0; i < BZ_MAX_CODE_LEN; i++) base[i] = 0; + for (i = 0; i < alphaSize; i++) base[length[i]+1]++; + + for (i = 1; i < BZ_MAX_CODE_LEN; i++) base[i] += base[i-1]; + + for (i = 0; i < BZ_MAX_CODE_LEN; i++) limit[i] = 0; + vec = 0; + + for (i = minLen; i <= maxLen; i++) { + vec += (base[i+1] - base[i]); + limit[i] = vec-1; + vec <<= 1; + } + for (i = minLen + 1; i <= maxLen; i++) + base[i] = ((limit[i-1] + 1) << 1) - base[i]; +} + + +/*-------------------------------------------------------------*/ +/*--- end huffman.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/libbz2.def b/bzip2/libbz2.def new file mode 100644 index 000000000..2dc0dd891 --- /dev/null +++ b/bzip2/libbz2.def @@ -0,0 +1,27 @@ +LIBRARY LIBBZ2
+DESCRIPTION "libbzip2: library for data compression"
+EXPORTS
+ BZ2_bzCompressInit
+ BZ2_bzCompress
+ BZ2_bzCompressEnd
+ BZ2_bzDecompressInit
+ BZ2_bzDecompress
+ BZ2_bzDecompressEnd
+ BZ2_bzReadOpen
+ BZ2_bzReadClose
+ BZ2_bzReadGetUnused
+ BZ2_bzRead
+ BZ2_bzWriteOpen
+ BZ2_bzWrite
+ BZ2_bzWriteClose
+ BZ2_bzWriteClose64
+ BZ2_bzBuffToBuffCompress
+ BZ2_bzBuffToBuffDecompress
+ BZ2_bzlibVersion
+ BZ2_bzopen
+ BZ2_bzdopen
+ BZ2_bzread
+ BZ2_bzwrite
+ BZ2_bzflush
+ BZ2_bzclose
+ BZ2_bzerror
diff --git a/bzip2/libbz2.dsp b/bzip2/libbz2.dsp new file mode 100644 index 000000000..a21a20f75 --- /dev/null +++ b/bzip2/libbz2.dsp @@ -0,0 +1,130 @@ +# Microsoft Developer Studio Project File - Name="libbz2" - Package Owner=<4>
+# Microsoft Developer Studio Generated Build File, Format Version 5.00
+# ** •ÒW‚µ‚È‚¢‚Å‚‚¾‚³‚¢ **
+
+# TARGTYPE "Win32 (x86) Dynamic-Link Library" 0x0102
+
+CFG=libbz2 - Win32 Debug
+!MESSAGE ‚±‚ê‚Í—LŒø‚ÈÒ²¸Ì§²Ù‚Å‚Í‚ ‚è‚Ü‚¹‚ñB ‚±‚ÌÌßÛ¼Þª¸Ä‚ðËÞÙÄÞ‚·‚邽‚ß‚É‚Í NMAKE ‚ðŽg—p‚µ‚Ä‚‚¾‚³‚¢B
+!MESSAGE [Ò²¸Ì§²Ù‚Ì´¸½Îß°Ä] ºÏÝÄÞ‚ðŽg—p‚µ‚ÄŽÀs‚µ‚Ä‚‚¾‚³‚¢
+!MESSAGE
+!MESSAGE NMAKE /f "libbz2.mak".
+!MESSAGE
+!MESSAGE NMAKE ‚ÌŽÀsŽž‚É\¬‚ðŽw’è‚Å‚«‚Ü‚·
+!MESSAGE ºÏÝÄÞ ×²Ýã‚ÅϸۂÌÝ’è‚ð’è‹`‚µ‚Ü‚·B—á:
+!MESSAGE
+!MESSAGE NMAKE /f "libbz2.mak" CFG="libbz2 - Win32 Debug"
+!MESSAGE
+!MESSAGE ‘I‘ð‰Â”\‚ÈËÞÙÄÞ Ó°ÄÞ:
+!MESSAGE
+!MESSAGE "libbz2 - Win32 Release" ("Win32 (x86) Dynamic-Link Library" —p)
+!MESSAGE "libbz2 - Win32 Debug" ("Win32 (x86) Dynamic-Link Library" —p)
+!MESSAGE
+
+# Begin Project
+# PROP Scc_ProjName ""
+# PROP Scc_LocalPath ""
+CPP=cl.exe
+MTL=midl.exe
+RSC=rc.exe
+
+!IF "$(CFG)" == "libbz2 - Win32 Release"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 0
+# PROP BASE Output_Dir "Release"
+# PROP BASE Intermediate_Dir "Release"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 0
+# PROP Output_Dir "Release"
+# PROP Intermediate_Dir "Release"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /FD /c
+# ADD CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /FD /c
+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /o NUL /win32
+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /o NUL /win32
+# ADD BASE RSC /l 0x411 /d "NDEBUG"
+# ADD RSC /l 0x411 /d "NDEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386 /out:"libbz2.dll"
+
+!ELSEIF "$(CFG)" == "libbz2 - Win32 Debug"
+
+# PROP BASE Use_MFC 0
+# PROP BASE Use_Debug_Libraries 1
+# PROP BASE Output_Dir "Debug"
+# PROP BASE Intermediate_Dir "Debug"
+# PROP BASE Target_Dir ""
+# PROP Use_MFC 0
+# PROP Use_Debug_Libraries 1
+# PROP Output_Dir "Debug"
+# PROP Intermediate_Dir "Debug"
+# PROP Ignore_Export_Lib 0
+# PROP Target_Dir ""
+# ADD BASE CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /FD /c
+# ADD CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /FD /c
+# ADD BASE MTL /nologo /D "_DEBUG" /mktyplib203 /o NUL /win32
+# ADD MTL /nologo /D "_DEBUG" /mktyplib203 /o NUL /win32
+# ADD BASE RSC /l 0x411 /d "_DEBUG"
+# ADD RSC /l 0x411 /d "_DEBUG"
+BSC32=bscmake.exe
+# ADD BASE BSC32 /nologo
+# ADD BSC32 /nologo
+LINK32=link.exe
+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 /pdbtype:sept
+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 /out:"libbz2.dll" /pdbtype:sept
+
+!ENDIF
+
+# Begin Target
+
+# Name "libbz2 - Win32 Release"
+# Name "libbz2 - Win32 Debug"
+# Begin Source File
+
+SOURCE=.\blocksort.c
+# End Source File
+# Begin Source File
+
+SOURCE=.\bzlib.c
+# End Source File
+# Begin Source File
+
+SOURCE=.\bzlib.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\bzlib_private.h
+# End Source File
+# Begin Source File
+
+SOURCE=.\compress.c
+# End Source File
+# Begin Source File
+
+SOURCE=.\crctable.c
+# End Source File
+# Begin Source File
+
+SOURCE=.\decompress.c
+# End Source File
+# Begin Source File
+
+SOURCE=.\huffman.c
+# End Source File
+# Begin Source File
+
+SOURCE=.\libbz2.def
+# End Source File
+# Begin Source File
+
+SOURCE=.\randtable.c
+# End Source File
+# End Target
+# End Project
diff --git a/bzip2/makefile.msc b/bzip2/makefile.msc new file mode 100644 index 000000000..3fe42324a --- /dev/null +++ b/bzip2/makefile.msc @@ -0,0 +1,63 @@ +# Makefile for Microsoft Visual C++ 6.0
+# usage: nmake -f makefile.msc
+# K.M. Syring (syring@gsf.de)
+# Fixed up by JRS for bzip2-0.9.5d release.
+
+CC=cl
+CFLAGS= -DWIN32 -MD -Ox -D_FILE_OFFSET_BITS=64
+
+OBJS= blocksort.obj \
+ huffman.obj \
+ crctable.obj \
+ randtable.obj \
+ compress.obj \
+ decompress.obj \
+ bzlib.obj
+
+all: lib bzip2 test
+
+bzip2: lib
+ $(CC) $(CFLAGS) -o bzip2 bzip2.c libbz2.lib setargv.obj
+ $(CC) $(CFLAGS) -o bzip2recover bzip2recover.c
+
+lib: $(OBJS)
+ lib /out:libbz2.lib $(OBJS)
+
+test: bzip2
+ type words1
+ .\\bzip2 -1 < sample1.ref > sample1.rb2
+ .\\bzip2 -2 < sample2.ref > sample2.rb2
+ .\\bzip2 -3 < sample3.ref > sample3.rb2
+ .\\bzip2 -d < sample1.bz2 > sample1.tst
+ .\\bzip2 -d < sample2.bz2 > sample2.tst
+ .\\bzip2 -ds < sample3.bz2 > sample3.tst
+ @echo All six of the fc's should find no differences.
+ @echo If fc finds an error on sample3.bz2, this could be
+ @echo because WinZip's 'TAR file smart CR/LF conversion'
+ @echo is too clever for its own good. Disable this option.
+ @echo The correct size for sample3.ref is 120,244. If it
+ @echo is 150,251, WinZip has messed it up.
+ fc sample1.bz2 sample1.rb2
+ fc sample2.bz2 sample2.rb2
+ fc sample3.bz2 sample3.rb2
+ fc sample1.tst sample1.ref
+ fc sample2.tst sample2.ref
+ fc sample3.tst sample3.ref
+
+
+
+clean:
+ del *.obj
+ del libbz2.lib
+ del bzip2.exe
+ del bzip2recover.exe
+ del sample1.rb2
+ del sample2.rb2
+ del sample3.rb2
+ del sample1.tst
+ del sample2.tst
+ del sample3.tst
+
+.c.obj:
+ $(CC) $(CFLAGS) -c $*.c -o $*.obj
+
diff --git a/bzip2/manual.ps b/bzip2/manual.ps new file mode 100644 index 000000000..1a7dbac85 --- /dev/null +++ b/bzip2/manual.ps @@ -0,0 +1,3808 @@ +%!PS-Adobe-2.0 +%%Creator: dvips(k) 5.78 Copyright 1998 Radical Eye Software (www.radicaleye.com) +%%Title: manual.dvi +%%Pages: 39 +%%PageOrder: Ascend +%%BoundingBox: 0 0 596 842 +%%EndComments +%DVIPSCommandLine: dvips -o manual.ps manual.dvi +%DVIPSParameters: dpi=600, compressed +%DVIPSSource: TeX output 2000.03.23:2343 +%%BeginProcSet: texc.pro +%! +/TeXDict 300 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N +/X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72 +mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1} +ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale +isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div +hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul +TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if} +forall round exch round exch]setmatrix}N /@landscape{/isls true N}B +/@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B +/FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{ +/nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N +string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N +end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{ +/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0] +N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup +length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{ +128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub +get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data +dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N +/rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup +/base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx +0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff +setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff +.1 sub]/id ch-image N /rw ch-width 7 add 8 idiv string N /rc 0 N /gp 0 N +/cp 0 N{rc 0 ne{rc 1 sub /rc X rw}{G}ifelse}imagemask restore}B /G{{id +gp get /gp gp 1 add N dup 18 mod S 18 idiv pl S get exec}loop}B /adv{cp +add /cp X}B /chg{rw cp id gp 4 index getinterval putinterval dup gp add +/gp X adv}B /nd{/cp 0 N rw exit}B /lsh{rw cp 2 copy get dup 0 eq{pop 1}{ +dup 255 eq{pop 254}{dup dup add 255 and S 1 and or}ifelse}ifelse put 1 +adv}B /rsh{rw cp 2 copy get dup 0 eq{pop 128}{dup 255 eq{pop 127}{dup 2 +idiv S 128 and or}ifelse}ifelse put 1 adv}B /clr{rw cp 2 index string +putinterval adv}B /set{rw cp fillstr 0 4 index getinterval putinterval +adv}B /fillstr 18 string 0 1 17{2 copy 255 put pop}for N /pl[{adv 1 chg} +{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{ +adv rsh nd}{1 add adv}{/rc X nd}{1 add set}{1 add clr}{adv 2 chg}{adv 2 +chg nd}{pop nd}]dup{bind pop}forall N /D{/cc X dup type /stringtype ne{] +}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup +length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{ +cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin +0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul +add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore userdict +/eop-hook known{eop-hook}if showpage}N /@start{userdict /start-hook +known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X +/IE 256 array N 2 string 0 1 255{IE S dup 360 add 36 4 index cvrs cvn +put}for pop 65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N +/RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley +X /rulex X V}B /V{}B /RV statusdict begin /product where{pop false[ +(Display)(NeXT)(LaserWriter 16/600)]{dup length product length le{dup +length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse} +forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false +RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1 +false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform +round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg +rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail +{dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M} +B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{ +4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{ +p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p +a}B /bos{/SS save N}B /eos{SS restore}B end + +%%EndProcSet +TeXDict begin 39158280 55380996 1000 600 600 (manual.dvi) +@start +%DVIPSBitmapFont: Fa cmti10 10.95 1 +/Fa 1 47 df<120FEA3FC0127FA212FFA31380EA7F00123C0A0A77891C>46 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fb cmbxti10 14.4 1 +/Fb 1 47 df<13FCEA03FF000F13804813C05AA25AA2B5FCA31480A214006C5A6C5A6C5A +EA0FE0121271912B>46 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fc cmsl10 10.95 25 +/Fc 25 122 df<D901F8160CD907FE161ED91F07163E90263E0380157E017C6D15FC496C +6CEC03F8D801F06DEC07F00003D900FCEC1FE04901EFEC7FC00007913AE3E007EF804901 +E0B5129F000F913A701FF83F0093C7127E48485E604D5A03F01303003F4A495A90C74A5A +4D5A4DC7FC0201143E4B5B17FC4C5A003E4948485A4C5A003F01075C6C4A485A020E131F +021E49C8FC6C6C48137E02385B3A07C0F001F82603E1E05B3A00FF8003E090263E000714 +7E90C73A0FC001FF80923A1F8007C1C0923A3F000F80E0033E90381F00F04B013E137003 +FC4913784A4801FC13384A485B913807E001DA0FC05BDB8003141CEC1F004A495A147E5C +4948163C4948010F14384A5C495A130F4948167849C71570137E017C17F0494B13E01201 +4848EDC0014848020714C04848EE03804848160790C83903E00F00003E170E007E923801 +F03C486F6C5A48EE3FE00070EE0F803F4975C34C>37 D<EA0780EA0FE0EA1FF0123FA512 +1FEA0F301200A213701360A213E013C0120113801203EA07001206120E5A5A5A5A5A0C1C +7A8919>44 D<EC07F8EC3FFF9138FC0FC0903903F003E0903907C001F0D90F8013F849C7 +FC013E14FC017E147C017C147E13FC485AA20003157F5B1207A2120F5BA2121F16FF5BA2 +123FA44848EB01FEA648C7EA03FCA5ED07F8A25A16F0A2150F16E0A3ED1FC0A21680007E +143F1600157E123E003F5C4A5AD81F805B000FEB07E06C6C485A2603F03FC7FC3800FFFC +EB1FE0283F79BC2D>48 D<157015F014011407143F903803FFE0137FEBFFCFEBF80F1300 +141F15C0A5143F1580A5147F1500A55C5CA513015CA513035CA513075CA5130F5CA3131F +497EB612F8A31D3D78BC2D>I<133C137F5B481380A31400A26C5A137890C7FCB3EA0780 +EA0FE0121F123FA5121FEA0F601200A213E05BA212015B120390C7FC5A1206120E5A5A12 +3012705A5A11397AA619>59 D<EC7FC0903803FFF890380FC07E90383E003F496D7E01FF +6D7E82A248140782A26C5A137890C7120FA25EA2EC03FF147F903807FF1FEB1FE0D97F80 +5B3801FE00EA03F8485A4848133F485A003F5D49EC81C048C7FCA2157F48ED03804814FF +A2007F5B913903BF0700903880073F3A3FC00E1F8E260FE03C13FC3A03FFF00FF83A007F +C003E02A2A7CA82D>97 D<EB3F80EA1FFFA3C6FC137FA291C9FCA55B5BA512015BA4EC07 +F80003EB3FFF9039F8F80FC09039FBE003E09039FF8001F891C77E5B4848147E49147F5B +821780A2120F5B17C0A3167F001F16805BA4EEFF00123F5B4B5AA24B5A5E007F4A5AA24B +5A6D495A4BC7FCD87CE0137E39F87001F839F03C07E039E00FFF80260003FCC8FC2A4077 +BE33>I<EC1FF0ECFFFE903903F01F8090390FC003C0D93F0013E0017E130F49131F0001 +15F04848EB3FE0485AA24848EB1FC0001FEC0F004990C7FC123FA2485AA412FF90C9FCA9 +6CEC0380150716006C6C5B151E001F5C6C6C5B6C6C5B6C6C485A3901F80F8026007FFEC7 +FCEB0FF0242A7AA828>I<EE03F8ED01FFA3ED000F1607A217F0A4160FA217E0A4161FA2 +17C0A491380FF03FECFFFC902603F81F138090390FC007BF90391F8003FF90387E000149 +7F0001157F48481500485A120F5B001F5D485A5E5B127FA2150112FF90C75BA41503A25E +A37E1507A26C4A5A7F001F141F6C6C133F6C6CEBFFF83B03F001EFFFC03900F80F8F9038 +3FFE0FD90FF0EBE0002D407ABE33>I<EC3FE0903801FFF8903807E07E90380F801F9039 +3F000F80017E14C049EB07E0485A12034848EB03F0485AA2121F5B123FA248481307A290 +B6FCA2D8FF80C8FC90C9FCA87EED01C015036C15806D1307001FEC0F006D131E000F5C6C +6C5B6C6C485A3900FC07C0D93FFFC7FCEB07F8242A7BA828>I<ED07F0ED3FFCEDFC1E91 +3803F03F4A48B4FC4A481380141FEC3F81DA7F0113008102FE137C93C7FCA213015CA513 +035CA50007B512F8A3260007F0C8FCA3130F5CA5131F5CA5133F5CA5137F91C9FCA55B5B +A4EA03FF007F13FEB5FCA229407DBF1C>I<147FEB3FFFA313017FA25CA513015CA51303 +5CA4ED07F80107EB1FFF9139F0781FC09138F1E00F9139F38007E0ECF70002FE14F0495A +5CA25CA24A130F131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F5B491500 +A300015D486C491380B5D8F87F13FCA32E3F7DBE33>104 D<1478EB01FE130314FFA25B +14FE130314FCEB00F01400ACEB03F8EA01FF14F0A2EA001F130FA314E0A5131F14C0A513 +3F1480A5137F1400A55B5BA4EA03FF007F13F0A2B5FC183E7DBD1A>I<143FEB1FFF5BA2 +13017FA214FEA5130114FCA5130314F8A5130714F0A5130F14E0A5131F14C0A5133F1480 +A5137F1400A55B5BA4EA03FF007F13F8A2B5FC183F7DBE1A>108 +D<902707F007F8EB03FCD803FFD91FFF90380FFF80913CE0781FC03C0FE09126E1E00FEB +F0073E001FE38007E1C003F090260FE700EBE38002EEDAF70013F802FC14FE02D85C14F8 +4A5CA24A5C011F020F14074A4A14F0A5013F021F140F4A4A14E0A5017F023F141F91C749 +14C0A549027F143F4992C71380A300014B147F486C496DEBFFC0B5D8F87FD9FC3F13FEA3 +47287DA74C>I<903907F007F8D803FFEB1FFF9139E0781FC09138E1E00F3B001FE38007 +E090380FE70002EE14F014FC14D814F85CA24A130F131F4A14E0A4161F133F4A14C0A416 +3F137F91C71380A4167F5B491500A300015D486C491380B5D8F87F13FCA32E287DA733> +I<EC0FF0ECFFFE903903F01F8090390FC007C049C66C7E013E6D7E01FC6D7E4848804914 +7C0003157E485A000F157F5B121FA2485AA2007F1680A2170048C85AA54B5AA25E5A6C4A +5A7E4B5A5E6C140F6C6C5C4B5A6C6C013EC7FC6C6C5B6C6C485A3900FC0FE090383FFF80 +D90FF8C8FC292A7BA82D>I<91387F01FE903A7FFF0FFFC09139FE3E03F09238F801F890 +3A01FFE000FE4B137F6D497F4990C713804A15C04A141FA218E0A20103150F5C18F0A317 +1F010716E05CA3173F18C0130F4A147F1880A2EFFF004C5A011F5D16034C5A6E495AEE1F +C06E495AD93FDC017EC7FC91388F01F8913883FFE0028090C8FC92C9FC137FA291CAFCA4 +5BA25BA31201487EB512F8A3343A81A733>I<903907F01F80D803FFEB7FE09138E1E1F0 +9138E387F839001FE707EB0FE614EE02FC13F002D813E09138F801804AC7FCA25C131FA2 +5CA4133F5CA5137F91C8FCA55B5BA31201487EB512FEA325287EA724>114 +D<9138FF81C0010713E390381F807F90397C003F8049131F4848130F5B00031407A24848 +1400A27FA27F6D90C7FCEBFF8014FC6C13FF6C14C015F06C6C7F011F7F13079038007FFE +1403140100381300157EA2123C153E157E007C147CA2007E147815F8007F495A4A5A486C +485A26F9E01FC7FC38E0FFFC38C01FE0222A7DA824>I<EB0380A4130791C7FCA25BA25B +A2133EA2137E13FE12011207001FB512C0B6FCA2D801FCC7FCA312035BA512075BA5120F +5BA41407001F130E13C0A4141E141C1380A26D5AA2000F5B14F03807E1E03801FF80D800 +7EC7FC1A3978B723>I<01FE147F00FFEC7FFF4914FEA20007140300031401A34914FCA4 +150312074914F8A41507120F4914F0A4150F121F4914E0A2151FA3153F4914C0157F15FF +EC01DF3A0FC003BFE09138073FFF3803F01E3801FFF826003FE01380282977A733>I<B5 +39E007FFF05D17E02707FE000313006C48EB01FC6F5A5E00014A5A5EA24B5A6D13070000 +92C7FC5D150E6D5B7F5DA25D1480013F5B14815D14C3011F5B02C7C8FCA214CE14EEEB0F +FCA25CA26D5A5CA25CA26D5A2C2878A630>I<B500C3B53803FFFCA204FE14F8290FFE00 +3FE00013C0D807F86D48EB7F000003173E183C150F18386D5E0001141F705B153F4D5A15 +776D4B5A0000ECE7F04DC7FCEC01C3170E9038FF0383017F5D91380703F85FEC0E01021E +5CD93F9C14F002BC6D5A02B813FDDAF8005B4A13FF5F6D5A94C8FC5C4A137E167C6DC7FC +1678010E14383E2878A642>I<90B539E007FFF05E18E0902707FE000313006D48EB01FC +705A5F01014A5A5F16036E5C0100140794C7FC160E805E805E1678ED8070023F13F05EED +81C015C191381FC38015C793C8FC15EF15EEEC0FFCA25DA26E5AA25DA26E5A5DA24AC9FC +5C140E141E141C5C121C003F5B5A485B495A130300FE5B4848CAFCEA701EEA783CEA3FF0 +EA0FC0343A80A630>121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fd cmtt12 14.4 10 +/Fd 10 123 df<EC3FF80103B57E010F14E0013F14F84914FE48B7FC4816C048D9C01F7F +270FFE00017F49EB007FD81FF0EC1FF848486E7E160748486E7E4914018300FF81A26D16 +80177FA36C5AA26CC9FCCAFCA217FF1800A25E5F16035F16075F160F4C5A163F4C5A5F4C +5A4B90C7FCED07FE4B5A4B5A4B5A4B5A4B5A4A5B4A90C8FCEC0FFE4A5AEC3FF04A5A4A5A +495B4990C9FCEB0FFC495A495A495A4948143F485B4890C8EA7F80EA0FFC485A48B8FC5A +B9FCA36C17007E314A7AC93E>50 D<383FFF805AB57EA37E7EEA003FAEED07FC92383FFF +8092B512E002C314F802CF8002DF8091B7FCDBF80F1380DBC00113C092C713E04A143F4A +EC1FF04A15F84A140F4AEC07FCA217034A15FE1701A318FF83A95F18FEA280170318FC6E +140718F86E140FEF1FF06E143F6EEC7FE06EECFFC0DBC0031380EDF01F92B6120002DF14 +FC02CF5C02C35CD91F8114C090260F807F90C7FC90C7EA0FF8384A7FC83E>98 +D<923803FFF85D4B7FA38181ED0003AEEC1FF0ECFFFE0103EBFF83010F14E34914F3017F +14FB90B7FC48EBF80F48EBC00191C7FC4848143F4848141F5B4848140F491407123F4914 +03127F5BA312FF90C8FCA97F127FA216077F123F6D140FA26C6C141F6D143F000F157F6C +6C14FF01FF5B6C6D5A6CD9F01FEBFFFC6C90B500FB13FE6D02F313FF6D14E3010F14C36D +020113FE010101FC14FC9026003FE0C8FC384A7CC83E>100 D<143E147F4A7E497FA56D +5B6EC8FC143E91C9FCAC003FB57E5A81A47EC7123FB3B3007FB71280B812C0A56C16802A +4A76C93E>105 D<007FB512C0B6FC81A47EC7121FB3B3B3A5007FB712F8B812FCA56C16 +F82E4978C83E>108 D<EC1FF0ECFFFE01036D7E010F14E04980017F14FC90B67E489038 +F01FFFECC00748D90001138048486D13C04848EC7FE049143F4848EC1FF049140F003F16 +F8491407A24848EC03FCA448C8EA01FEAA6D1403007F16FCA26D1407A2003F16F86D140F +6C6CEC1FF0A26C6CEC3FE06D147F6C6CECFFC06D5B6CD9C00713806CD9F01F13006C90B5 +5A6D5C6D5C010F14E001031480010049C7FCEC1FF02F3679B43E>111 +D<ED07FC3B3FFF803FFF804891B512E0B500C314F802CF8002DF806C90B7FC6CDAF80F13 +80D8003FD9C00113C092C713E04A143F4AEC1FF04A15F84A140F4AEC07FCA217034A15FE +1701A318FF83A95F18FEA280170318FC6E140718F86E140FEF1FF06E143F6EEC7FE06EEC +FFC0DBC0031380EDF01F92B6120002DF14FC02CF5C02C35C02C114C0DAC07F90C7FCED0F +F892C9FCB3003FB512C04880B67EA36C5C6C5C384F7FB33E>I<903901FFF00F011F9038 +FE1F8090B612BF000315FF5A5A5A393FFE003F01F01307D87FC0130190C8FC5A48157FA4 +7EEE3F00D87FC091C7FC13F0EA3FFE381FFFF06CEBFFC06C14FE6C6E7EC615E0013F14F8 +010780D9003F7F02007F03071380030013C0003EED3FE0007F151F48150F17F06D1407A3 +7FA26D140F6D15E0161F01FCEC3FC06D14FF9026FFC00F138091B612005E485D013F5C6D +14E0D8FC0714802778007FF8C7FC2C3677B43E>115 D<147C14FC497EAD003FB712FC5A +B87EA36C5EA2260001FEC9FCB3A6173FA2EF7F80A76E14FF6D16006F5A9238C007FE9138 +7FF01F92B55A6E5C6E5C6E5C6E1480020149C7FC9138003FF031437DC13E>I<000FB812 +804817C04817E0A418C001C0C712014C13804C1300EE1FFE4C5AEE7FF06C484A5A4B5BC8 +485B4B90C7FC4B5A4B5A4B5A4B5A4B5A4A5B4A5B4A90C8FC4A5A4A5A4A5A4A5A4A5A495B +495B4990C9FC495A495A4948EC0FC0495A4948EC1FE0485B00075B4890C8FCEA1FFC485A +485A90B8FCB9FCA46C17C07E33337CB23E>122 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fe cmtt12 13.14 31 +/Fe 31 123 df<ECFFE0010713FC011FEBFF80017F14E048B67E48814815FE489038007F +FF01F8130748480101138048489038007FC049EC3FE04848141F90C8120F17F048150717 +F87F1603A36CC8FC123EC9FCA2160717F0A2160F17E0161F17C0163FEE7F80A2EEFF004B +5A15034B5A4B5A4B5AED7FE04B5A4A5B4A90C7FC4A5AEC1FF84A5A4A5A4A5A495BD907FE +C8FC495A495A495A495A2601FF80EB01F04890C7EA03F8485A485A485A48B7FC5AB8FCA3 +7E6C16F02D447BC338>50 D<003FB6FC4815E0B712F882826C816C16802701FC000113C0 +9238007FE0161FEE0FF0A2160717F81603A6160717F0A2160FEE1FE0163FEE7FC0923801 +FF80030F130090B65A5E16F08216FEEEFF8017C001FCC7EA7FE0EE1FF0EE07F8160317FC +EE01FE1600A217FF177FA717FF17FE16011603EE07FC160FEE3FF8EEFFF0003FB7FC4816 +E0B812C01780EEFE006C15F86C15C030437DC238>66 D<DA07FC133C91393FFF807E91B5 +12E00103ECF8FE4914FC4914FF5B90383FFE0390387FF000D9FFC0133F4849131F91C712 +0F48481407485A49140348481401A2485AA248481400A25BA2007F167C90CAFCA35A5AAD +7E7EA37F003F167C17FE7FA26C7EA26C6C140117FC6C7E6D14036C6C15F86C6C14076EEB +0FF06C6D131FD97FF0EB7FE0903A3FFE03FFC06DB612806D15006D5C6D5C010014F0023F +13C0DA07FCC7FC2F457CC338>I<007FB512F8B7FC16C08216F8826C813A03F8001FFF15 +07030113806F13C0167FEE3FE0161FEE0FF0A2EE07F8A2EE03FCA21601A217FE1600A417 +7FAD17FF17FEA4160117FCA2160317F81607A2EE0FF0161FEE3FE0167FEEFFC04B13805D +031F1300007FB65AB75A5E5E16C093C7FC6C14F830437DC238>I<007FB712FCB87EA57E +D801FCC8FCA9177C94C7FCA6ED07C04B7EA590B6FCA79038FC000FA56F5A92C9FCA7EF0F +80EF1FC0AA007FB8FCB9FCA56C178032437DC238>I<91391FF003C091397FFC07E049B5 +FC010714CF4914EF4914FF5B90387FF81F9038FFE00748EB800191C7FC4848147F485A49 +143F485A161F485AA249140F123F5BA2127F90C8EA07C093C7FCA35A5AAA923807FFFC4B +13FE4B13FF7E7E6F13FE6F13FC9238000FE07F003F151FA27F121F7F163F6C7EA26C6C14 +7F7F6C6C14FF6C6C5B6E5A6C6D5A90387FF81F6DB6FC6D14EF6D14CF6D148F0101140F90 +3A007FFC07C0DA1FF0C7FC30457CC338>71 D<007FB612F0B712F8A56C15F0260001FCC7 +FCB3B3B1007FB612F0B712F8A56C15F0254377C238>73 D<90380FFFFE90B612E0000315 +F8488148814881A2273FFE000F138001F01301497F49147F4848EC3FC0A290C8121FA448 +16E0A248150FB3AC6C151FA36C16C0A36D143FA36C6CEC7F806D14FF6D5B01FE130F6CB7 +1200A26C5D6C5D6C5DC615E0010F49C7FC2B457AC338>79 D<003FB512F04814FEB77E16 +E0826C816C813A01FC003FFEED07FF03017F81707E163F161F83160FA7161F5F163F167F +4C5A5D030790C7FCED3FFE90B65A5E5E5EA282829038FC001FED07FC6F7E150115008282 +AA18E0EF01F0EF03F8A31783EE3F87263FFFE0ECC7F0486D14FFB56C7F18E07013C06C49 +6D13806C496D1300CA12FC35447EC238>82 D<003FB8FC481780B9FCA53BFE0007F0003F +A9007CEE1F00C792C7FCB3B3A70107B512F04980A56D5C31437DC238>84 +D<267FFFF090387FFFF0B56C90B512F8A56C496D13F0D801FCC73801FC00B3B3A66D1403 +00005EA36D14076D5D6E130F6D6C495A6E133F6D6C495A6D6C495AECFF076D90B5C7FC6D +5C6D5C6D5C023F13E0020F1380DA03FEC8FC35447FC238>I<D83FFE913803FFE0486C4A +13F0B56C4913F8A36C90C76C13F06C486E13E0D80FC09138001F80A36C6CED3F00A86C6C +157EA86C6C5DEC01FC4A7EA24A7EA4D800FC9038DF01F8020F1381A3158F021F13C1A201 +7C5DA2017E14C31507023F13E3A490263E3E035BA2027E13F3A2EC7C01013F14F7A3011F +5DEC7800A202F813FFA34A137F010F5DA24A133F6D486DC7FC35447FC238>87 +D<001FB712F04816F85AA417F090C8121F17E0EE3FC0167F1780EEFF00A24B5A4B5A123E +C8485A4B5AA24B5A4B5AA24B5A4BC7FCA24A5A14035D4A5A140F5D4A5A143F5D4A5A14FF +92C8FC495A13035C495AA2495A495AA2495A495A17F849C7EA01FC485AA2485A485AA248 +5A121F5B485A127F90B7FCB8FCA56C16F82E437BC238>90 D<003FB712804816C0B812E0 +A46C16C06C16802B087A7D38>95 D<EB1FFF90B512E0000314F84814FE4880824881D9F0 +017F9138003FF0ED0FF815076C486D7E6C481301C87FA21500A4EC03FF147F0107B5FC13 +1F90B6FC5A000714C048EBE0004890C7FCEA3FF813E0EA7F8090C8FC5A5AA415017E6C6C +13036D13076C6CEB3FFFD9FC01B6FC6CB812807E6C816C4A7E6CECF80F6C6CD9C0031300 +D90FFCC9FC31327AB038>97 D<EA3FFE487EB5FCA37E7EC67EACED3FC0913801FFF80207 +13FE021F7F4A804A8091B67E03C07F9139FE001FF802F86D7E4A13034A6D7E5C707E4A80 +188091C8123FA318C0171FA9173F6E1580A2177FA26EECFF00A26E495A6E13034C5A6E49 +5A02FE133F6E6CB45A92B55A6E5C6E5C6E91C7FC6D6C13FCD91E0313F090C7EA7F803244 +7FC238>I<EC3FFF49B512E0010714F8011F8049805B90B7FC48EBE001481300485AEA0F +F8496D5A4848147C93C7FC485A5B127F90CAFCA35A5AA97E7EA27F123F6D141F6DEC3F80 +121F6C7E01FC147F6C6CECFF006C6C6C5A6C9038F00FFE91B55A6C6C5C6D5C6D5C010714 +80010149C7FC9038003FF0293278B038>I<ED1FFF4B7F5DA38181ED003FACEC7F809038 +03FFF0010F13FC013F13FF4914BF90B7FC5A48EBC07F48EB000FD80FFC7F497F48487F49 +7F485A167F485A163F90C8FCA25A5AA97E6C157FA36D14FF123F6D5B6C7E5D6C6C5B01FC +5B6C6C133F2603FFC0B6FC6C90B712806C03BF13C06D143F6D13FC6D01F814800107D9E0 +1F1300010090C9FC32447CC238>I<EC3FE0903801FFFC010713FF011F14C04980498090 +B67E489038E03FFC4890380007FE48481301D80FF86D7E49804848158049143F003F16C0 +49141F127F90C8FC17E0160F5A90B7FCA617C048CAFC7E7EA27FA26C7EEE07C06C6CEC0F +E07F6C7ED807FE141F6DEC3FC06C01C013FF6CD9FC0713806C90B612006D5C6D5C010F5C +010314E001001480DA1FFCC7FC2B327AB038>I<ED1FF8ED7FFE4AB5FC020714804A14C0 +5C5C91387FF07F15809139FF003F804AEB1F00010191C7FC5CA9003FB612FE4881B8FCA4 +6C5D260001FCC8FCB3AF003FB612E04881A56C5D2A447CC338>I<14F0497E497E497EA4 +6D5A6D5A6D5A91C8FCAB383FFFFC487FB5FCA37E7EC7FCB3AF007FB612F0B712F816FCA3 +16F86C15F0264476C338>105 D<387FFFFEB6FCA57EC77EB3B3B1007FB7FCB81280A56C +1600294379C238>108 D<023FEB07E03B3FE0FFC01FF8D87FF39038E07FFCD8FFF76D48 +7E90B500F97F15FB6C91B612806C01C1EBF83F00030100EBE01F4902C013C0A24990387F +800FA2491400A349137EB3A73C3FFF03FFE07FFC4801879038F0FFFEB500C76D13FFA36C +01874913FE6C01039038E07FFC383080AF38>I<ED7FC03A3FFE01FFF8267FFF0713FEB5 +001F7F4A805C6C90B67E6CECC07F3B007FFE001FE002F8130F4A805C16075C5CA391C7FC +B3A6273FFFFE03B512E0486D4814F0B6008F14F8A36C020714F06C496C14E035307FAF38 +>I<EC7FC0903803FFF8010F13FE497F017F14C090B67E4881489038C07FF8489038001F +FC01FC130748486D7E49130148486D7E4980003F168049143F007F16C090C8121FA300FE +ED0FE0A96C151FA26C16C0A26D143FA26C6CEC7F80A26C6CECFF006D5B6C6C495A6D1307 +6CB4EB1FFC6C9038C07FF86C90B55A6C5D6D5C6D5C010F49C7FC010313F89038007FC02B +327AB038>I<ED3FC03A3FFE01FFF8267FFF0713FEB5001F7F4A804A806C90B67E6C02C0 +7F3B007FFE001FF802F86D7E4A13034A6D7E5C707E4A80188091C8123FA318C0171FA917 +3F6E1580A2177FA26EECFF00A26E495A6E13034C5A6E495A02FE133F6E6CB45A92B55A6E +5C6E5C6E91C7FC6E13FC020313F09138007F8092C9FCB0383FFFFE487FB67EA36C91C9FC +6C5B32487FAF38>I<EEFFC0277FFFC00713F8B5D8E01F13FC037F13FE92B5FC02E114FF +14E36C01E713813A000FEFFC019139FFF000FE4B137C0380130092C8FCA25C5CA25CA25C +A45CB2007FB67EB77E82A35E6C5D30307CAF38>114 D<903907FF80F0017FEBF1F848B5 +12FD000714FF5A5A5AEBFC00D87FE0131F0180130F48C71207481403A5007FEC01F001C0 +90C7FCEA3FF013FE381FFFF86CEBFFC0000314F8C614FF013F1480010714E0D9003F13F0 +020013F8ED0FFC1503003CEC01FE007E140000FE15FF167F7EA37F6D14FF16FE01F01303 +6DEB07FC01FF137F91B512F816F016E04815C0D8FC3F1400010F13FCD8780113E0283278 +B038>I<EB01E0497E1307AB003FB712804816C0B8FCA46C1680260007F0C8FCB3A4EE03 +E0EE07F0A66E130F17E06D6C131F6EEB3FC0903901FF81FF92B512806D15006E5B6E5B6E +13F002075B020190C7FC2C3D7DBB38>I<D83FFE903803FFE0486C497FB55BA36C806C80 +C66CEB0007B3A9160FA2161F163F6E137F6D6C13FFDAF007EBFFE091B712F06D16F87F6D +14E76D02C713F00100020313E0DA3FF8C8FC35307FAE38>I<000FB712FC4816FE5AA417 +FC0180C7EA1FF8EE3FF0EE7FE0EEFFC04B13804B13006CC7485AC8485A4B5A4B5A4B5A4B +5A4A5B4A90C7FCEC07FC4A5A4A5A4A5A4A5A49485A4990C8FC495A495A495A495A494814 +7C494814FE485B4890C8FC485A485A485A485A48B7FCB8FCA56C16FC2F2F7DAE38>122 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Ff cmbx12 13.14 53 +/Ff 53 122 df<923807FFE092B512FC020714FF021F81027F9038007FC0902601FFF0EB +0FE04901C0497E4990C7487ED90FFC147F011F824A14FF495AA2137F5CA2715A715A715A +EF078094C8FCA7EF07FCB9FCA526007FF0C7123F171FB3B3A2003FB5D8E00FB512F8A53D +4D7ECC44>12 D<B7FCAA200A7F9D29>45 D<EA07E0EA1FF8EA3FFCEA7FFEA2B5FCA6EA7F +FEA2EA3FFCEA1FF8EA07E01010778F22>I<177817F8EE01FCA21603A2EE07F8A217F016 +0FA217E0161FA2EE3FC0A21780167FA217005EA24B5AA25E1503A24B5AA25E150FA25E15 +1FA24B5AA25E157FA24BC7FCA25D1401A25D1403A24A5AA25D140FA24A5AA25D143FA25D +147FA24AC8FCA25C1301A25C1303A2495AA25C130FA2495AA25C133FA25C137FA249C9FC +A25B1201A2485AA25B1207A25B120FA2485AA25B123FA25B127FA248CAFCA25AA2127CA2 +2E6D79D13D>I<15F014011407141F147FEB03FF137FB6FCA313FC1380C7FCB3B3B2007F +B712E0A52B4777C63D>49 D<ECFFF80107EBFF80013F14F090B612FC4881480101EBFF80 +2707F8003F13C0D80FE0010F13E0D81F806D13F0003F80D87FF06D13F86D15FC6D7F00FF +16FE6D147FA217FF82A36C5A6C5A6C5A6C5AC95A17FEA3EEFFFCA24B13F817F05D17E04B +13C017804B13004B5A4B5A5EED7FE04B5A4A5B4A90C7FCEC07FC4A5A4A5A4B131FEC3F80 +4AC7FC14FE4948143E495AEB07E0495A4948147E49C8FC017E15FE90B7FC4816FC5A5A5A +5A5A5AB8FC17F8A430477AC63D>I<EC3FFE0103B512E0010F14FC013F14FF90267FE01F +7F9026FF000713E0D801FC6D7FD803F07F486C6D7FD80FFE817F486D80167FA3805C16FF +7E91C75B6C5A6C5AD80020495B90C75C5D5F4B5B5F031F90C7FCED3FFC4AB45A49B512E0 +168016E016FC90C7EA3FFF030713C06F7F6F7F6F7F83707E83A2701380A318C0EA07E0EA +1FF8487E487EA2B5FCA31880A25E491600127F494A5A6C485D01E05B001F4A5BD80FFC49 +5B2707FFC03F13C06C90B65AC64BC7FC013F14F8010714E09026007FFEC8FC32487BC63D +>I<EE07E0160FA2161F163F167F16FFA25D5D5DA25D5D5DA2157D15FDEC01F915F1EC03 +E11407EC0FC1EC1F811501143F147E14FC14F8EB01F01303EB07E014C0EB0F80131FEB3F +00133E5B13FC485A485A5B1207485A485A90C7FC123E127E5AB912FCA5C80003EBE000AD +023FB612FCA536487DC73D>I<D8038015E001E0140301FC143F9039FFE003FF91B612C0 +17801700A25E5E16F05E5E93C7FC15FC15F001E790C8FC01E0C9FCAAEC1FFC01E1B512C0 +01E714F001EF14FC9039FFE01FFFDA0007138001FC6D13C001F06D13E04915F0497F17F8 +C913FC167F17FEA417FFA3EA0FC0EA3FF0487EA2487EA317FEA34914FF6C4815FC5B0180 +15F86CC74813F07F6C6C4913E0D80FF04913C0D807FC011F13806CB46CB512006C90B512 +FC6C5D013F14C0010F91C7FC010113F030487AC63D>I<ED7FF8913807FFFE021F6D7E02 +7F80903A01FFF01FE0010790388003F04948486C7E49486D7ED93FF013074948130F01FF +4A7E4849133F5C5A4890C7FCA25A705A48486E5A705A003F92C8FCA3485AA21520913807 +FFE0021F13FC00FF497F4A6D7EDAFC017F9026FDF0007F4A6D7ED9FFC06D7E4A6D7E8391 +C7FC8382491680A318C05BA3127FA6123FA27F001F1780A3000F4B1300A26C6C5DA26C6D +495A6C6D5C6C6D495A6D6C48485A90263FFC075B6DB65A6D4AC7FC01035C010014F0020F +90C8FC32487BC63D>I<121F7F7F13FE90B812E0A45A18C0188018005F5FA25F485E90C8 +EA07E0007E4B5A5F007C151F4CC7FC167E5E485D15014B5A4B5AC8485A4B5AA24BC8FC15 +7EA25D1401A24A5A1407A24A5AA2141FA24A5AA2147FA314FFA3495BA45BA55BAA6D5BA2 +6D90C9FCEB007C334B79C93D>I<EC1FFF49B512F0010714FC011F14FF90263FF00713C0 +49C77F01FCEC3FF04848EC0FF848481407000782491403000F821601A2121F7FA27F13FE +6D140302C05C14F002FC495A6C6D130FDAFF805B9238E01FE06C6E485A9238FCFF806C91 +B5C7FC6C15FC6C5D7F6D14FE6D806D15C06D81011F81017F81D9FFDF804813072603FE01 +8048486C804848133F4848010F1480003F8049130148486D6C13C0161F824848140382A2 +82A2177FA218807F127FEFFF007F6C6C4A5AA2D81FFC4A5A6C6CEC0FF86C6C6CEB3FF06C +9039F003FFE06C90B612806C6C92C7FC011F14FC010714E09026003FFEC8FC32487BC63D +>I<EC1FFE49B512C0010F14F04914FC90397FFC0FFE903AFFE003FF804849C67F48496D +7E4890C7FC486F7E484881161F003F825B007F82A28300FF81A31880A518C0A45E127FA3 +003F5D7F121F5E120F6C6C91B5FC6C90388001EF6CEBC0036C9038E00FCF6DB5128F011F +140F010701FE1480010113F8903800010091C7FCA24C1300A3D803F85D487E487E486C4A +5AA25F4C5AA24C5A49495B6C485D49010790C7FC01E0495AD807F8EB3FFC6CB448B45A6C +90B55A6C15C06D91C8FC011F13FC010313C032487BC63D>I<EE01F8A24C7EA34C7EA24C +7EA34C7FA24C7FA34C7FA293B57EA34B8016F303038016E316E103078016C0030F805E83 +031F814C7E4B81153E83037E81037C7F03FC815D830201824B7F0203825D830207824B7F +020F825D84021F8392B8FC4A83A34A83027CC8120F02FC835C840101844A810103845C84 +0107844A81010F845C85011F85496C82B600C091B712F0A5544D7CCC5D>65 +D<93261FFF80EB01C00307B500F81303033F02FE13074AB7EAC00F0207EEE03F021F903A +FE007FF87F027F01E0903807FCFF91B5C70001B5FC010301FC6E7E4901F0151F4901C081 +4949814990C97E494882494882485B48197F4A173F5A4A171F5A5C48190FA2485B1A07A2 +5AA297C7FC91CDFCA2B5FCAD7EA280A2F207C07EA36C7FA26C190F6E18807E6E171F6C1A +006E5F6C193E6C6D177E6D6C5F6D6C4C5A6D6D15036D6D4B5A6D01F04B5A6D01FCED3FC0 +010001FFEDFF806E01E0D903FEC7FC021F01FEEB3FFC020790B612F002015EDA003F92C8 +FC030714FCDB001F13804A4D79CB59>67 D<B912F0F0FF8019F019FC19FFD8001F902680 +000114C0DD001F7F060713F806017F726C7E737E737F737F737F8587737F8587A2747EA3 +8786A21C80A51CC0A586A462A51C80A51C00A26263A2631AFF636163614F5B634F5B073F +90C7FC4F5A4F5A06035B061F5B4DB512C0BBC8FC19FC19F0198006F0C9FC524B7CCA5E> +I<BB12C0A486D8000F01E0C77E18071801F0007F193F191F190F1907861903A31901A3EF +0F80A2737EA497C7FC171FA2173F177F17FF160392B6FCA5EDE0031600177F173F171FA2 +050FEC0F80A3F21F00A494C8FC621A3EA21A7EA31AFE6219011903A21907190FF13FF819 +FF1803183FBBFCA262A3494A7CC951>I<BBFCA41A80D8001F01C0C7FC181F1803848419 +7F193F191F1AC0190FA31907A4171FF103E0A496C7FCA25FA25F5F5E160792B6FCA5EDC0 +071601828383A283A794C9FCB1B8FCA5434A7CC94D>I<93261FFF80EB01C00307B500F8 +1303033F02FE13074AB7EAC00F0207EEE03F021F903AFE007FF87F027F01E0903807FCFF +91B5C70001B5FC010301FC6E7E4901F0151F4901C0814949814990C97E49488249488248 +5B48197F4A173F5A4A171F5A5C48190FA2485B1A07A25AA297C8FC91CEFCA2B5FCAD6C04 +0FB712C0A280A36C93C7001FEBC000A2807EA27E807E807E806C7F7E6D7E6D7E6D7F6D01 +E05D6D6D5D6D13FC010001FF4AB5FC6E01E0EB07F9021F01FFEB3FF0020791B5EAE07F02 +01EEC01FDA003FED0007030702F81301DB001F018090C8FC524D79CB61>I<B7D8FC01B7 +12F8A5D8001F01C0C8001FEBC000B3AA92B9FCA503C0C8121FB3AEB7D8FC01B712F8A555 +4B7BCA60>I<B712FEA5D8000FEBE000B3B3B3ABB712FEA5274B7DCA2E>I<B8FCA5D8001F +01C0C9FCB3B3A4193EA4197E197CA519FCA31801A2F003F8A21807180F181F183F187FEF +01FF1707173FBA12F0A53F4B7BCA4A>76 D<B600E04DB612806F5FA26F5FA2D8001F09FC +C7FC6FEF0F7FA2DABFFE171EA2DA9FFF173CA3028F6D1678A202876D16F0A202836DED01 +E0A302816DED03C0A202806DED0780A26F6CED0F00A36F6C151EA26F6C5DA26F6D5CA26F +6D5CA36F6D495AA26F6D495AA26F6D495AA3706C49C7FCA2706C131EA2706C5BA3706D5A +A2706D5AA270EBE1E0A370EBF3C0A270EBFF80A27190C8FCA2715AA3715AA2715A497EB6 +00F06D480103B71280A3715A715A694B7BCA74>I<B600E092B612F88181A281D8001F6D +9239001FE0006F705A82A28202BF7F029F7FA2028F7F02877F02837F8214810280806F7F +6F7F83816F7F6F7F6F7F83816F80707F707F8482707F707F707FA2707F7014807113C019 +E0837113F07113F87113FC19FE837113FF71148F7213CF1AEF847213FF8484A284848485 +A2858585A285858585497EB600F8167F1A3F1A1F1A0FA2554B7BCA60>I<EEFFF8031FEB +FFC04AB612FC020715FF021FD9C01F13C091277FFE000313F0902601FFF09038007FFC49 +496E7E490180EC0FFF4990C86C7F49486F7F49486F7F017F8449486F7F4849707EA24849 +707E4885A24849701380A2481AC04A82A2481AE0A34890CA6C13F0A5B519F8AE6C1AF0A2 +6E5EA36C1AE0A26E5E6C1AC0A26C1A806E5E6C1A006E5E6C616E16FF6C616C6D4B5B6D6C +4B5B6E5D6D6D4A5B6D6D4A5B01076D4A90C7FC6D01F8ECFFFE6D01FE01035B9028007FFF +C01F13F0021F90B612C0020793C8FC020115FCDA001F14C0030101FCC9FC4D4D79CB5C> +I<B912C018FCF0FF8019F085D8001F902680000713FE05007F063F1380060F13C07213E0 +1AF0841AF8A27213FCA31AFEA81AFCA34E13F8A21AF0601AE04E13C0063F138095B51200 +050713FC92B75A19E096C7FC18F803C0CAFCB3ABB712FCA5474B7BCA54>I<B9FC18F8F0 +FF8019E019F8D8000F9026C0000713FE9439007FFF80061F7F727F727F727F84868684A2 +86A862A24E5BA2624E5B4E5B4E5B4E5B95B5C8FC050713FC92B712F0198006FCC9FC18FF +9226C0003F13C0050713F0717F717F717F187F85727FA28486A786A71C3E86A28474137E +72157C726D13FCB700FC6D9038FE01F872EBFF8373EBFFF0071F14E007031480CD383FFE +00574C7CCA5C>82 D<DA7FFCEB01C00103B5EAC003011FECF00749ECFC0F90B7121F48D9 +E00F13BF4890C713FFD807FC141F4848804848140382484880177F485A173F171F12FFA2 +170F7FA217077F7F7F6D92C7FC6D7E6C13F014FF15F86CECFF8016F86C15FF6C16C0836C +826C826C826C82013F816D1680010716C01300020F15E01400030714F0ED007F160F1603 +7013F882177F127800F8163FA3171FA27E18F0A27EA26CEE3FE07F18C001E0157F6DEDFF +8001FC160001FF140302E0EB0FFED97FFEEB3FFC486CB612F0D8FC0F5DD8F803158048C6 +6C49C7FC48010313F0354D79CB44>I<003FBB12C0A5DA80019038FC001FD9FC001601D8 +7FF09438007FE001C0183F49181F90C7170FA2007E1907A3007C1903A500FC1AF0481901 +A5C894C7FCB3B3A749B812FCA54C4A7CC955>I<B700F8023FB512F8A5D8001F01C0C938 +0FE000745AB3B3AD6D180F63811A1F6D96C7FC626D7F1A7E6D7F6D606E6C4B5A6E6CED07 +F06E6C4B5A6E01C0EC3FC06E01F049B45A020101FF011F90C8FC6E91B55A033F15F80307 +15E0030092C9FC040713F0554C7CCA5E>I<B700F00203B6FCA5D8001F01E0C93803FC00 +745A6D61811A036D6D5F1A076D6D5F1A0F6D616F161FA26D6D94C7FC626E6D153E1A7E6E +177C7015FC6E5F8219016E6D5D19036E5F7014076E5F82190F6E6D5D191F6E6D92C8FC61 +6F153E83197E6F6D137C19FC6F6D5B18016F5DEFF003A26F01F85B18076F01FC5B180F6F +5DEFFE1F6F92C9FC17FF607013BE18FE705BA2705BA3705BA2705BA2705BA3705BA27090 +CAFCA2177EA2584C7ECA5D>I<B700F84AB6FCA5D8001F01F0C93803FC006F705A6D4E5A +6D6D4C5A816D4E5A6D6D4C5A826D4EC7FC6E6D5D70157E6E5F6E7F704A5A6E4C5A6E7F70 +4A5A6E4C5A6E7F71495A6E4CC8FC6F7F71137E6F5D6F7F71485A6F4A5A6F13FC71485A6F +4A5A6F13FFF09F806F02BFC9FC7013FF60705B8260705B8260B3A7037FB612FEA5584B7E +CA5D>89 D<ECFFFC010FEBFFC0017F14F090B612FC489038803FFE3B03FC0007FF80486C +6D7F6D7F486D6C7F83167F83A2707E6C90C7FC6C5A6C5AC9FCA5ED1FFF021FB5FC49B6FC +130F013FEBC03F9038FFFE00000313F04813C04890C7FC485A485AA2485AA2485AA4167F +A26D14FF007F15EF6D01017F6C6C903907CFFF806C6CD90F8F13FE6C9038E07F076C9038 +FFFE0300014A7ED8003F9038F0007F0103018090C7FC37347CB23C>97 +D<EB7FC0B5FCA512037EB3ED07FF037F13E002C1B512FC02C714FF9126CFF80F7F9126DF +C0017F02FFC77F4AEC3FF002F8814A6E7E717E4A81831980A37113C0A319E0AC19C0A35F +1980A219005F606E141F6E5D4D5A6E4A5A02BF4A5A91261FC0035B9027FE0FF01F5B496C +B548C7FCD9F80114F8496C6C13E0C8D80FFEC8FC3B4D7CCB44>I<91380FFF8091B512F8 +010314FF010F15804948C613C0D97FF8EB1FE0D9FFE0EB3FF04849137F4849EBFFF84890 +C7FCA2485A121FA24848EC7FF0EE3FE0EE1FC0007F92C7FC5BA212FFAC127FA27FA2123F +A26C6C153EA26C6C157E177C6C6D14FC6C6D14F86C6D13036C6DEB07F0D97FFCEB1FE06D +B4EBFFC0010F90B5120001035C010014F0020F13802F347CB237>I<EF1FF0EE3FFFA516 +00177FB3EC0FFF91B512E0010314F8010F14FC013FEB01FF903A7FF8003FFFD9FFE0130F +48497F48497F4890C77E48815B121F5B123FA2127F5BA312FFAC127FA36C7EA3121F6D5C +120F6C6C5C6C6D5B6C5D6C01E0013F7F6D6C49EBFFE090393FFE03FE6DB512F801075C01 +00148091261FFC00EBC0003B4D7CCB44>I<EC0FFF91B512F0010314FC010F14FF90263F +FE077F90267FF0007F49486D7E4801806D7E486F7E4890C7120F484881707E121F491403 +003F82A2127F5B701380A212FFA390B8FCA401F8CAFCA5127FA27FA2123FA26C6CED0F80 +A26C6C151F6C17006E5C6C6D147E6C6D5C6C6D495AD93FFCEB07F0903A1FFF803FE00107 +90B55A010192C7FC6D6C13FC020713C031347DB238>I<ED7FF0913807FFFC023F7F4A7F +902601FFE0138049018113C049484813E0EB0FFCEB1FF8A2EB3FF0A2017F6D13C04A6C13 +80EE7F00163E93C7FCACB77EA526007FF0C8FCB3B3A3003FB512F8A52B4D7DCC26>I<DA +7FFCEB0FE00103B538807FF8010F9138E1FFFC013F02FB13FE903A7FF01FFFF39026FFC0 +07138348D90001130348168348486DEBC1FCEFC0F8000FEEE00049147F001F82A9000F5E +6D14FF00075EA26C6C495B6C93C7FC6C9038C007FE9138F01FFC4890B55A01EF14E0D803 +C314809026C07FFCC8FC000790CAFCA47FA27F13FC90B612FCEEFFC06C16F817FE6C8218 +806C17C06D16E00003B812F0120FD81FFCC7000F13F8D83FF0140049153F4848ED1FFC00 +FF160F491507A56D150F007F17F86D151F6C6CED3FF06C6CED7FE0D80FFE913801FFC06C +6C6C010713806C01F8017F1300C690B612FC013F15F001071580D9003F01F0C7FC37497D +B13D>I<EB7FC0B5FCA512037EB3923801FFC0030F13F8033F7F4B13FFDBFE077F9138C1 +F0039126C3E0017FDAC78080ECCF0014DE02DC6D7F14FC5CA25CA35CB3AAB6D8C07FEBFF +E0A53B4C7BCB44>I<13FCEA03FF487F487FA2487FA66C5BA26C5B6C90C7FCEA00FC90C8 +FCABEB7FC0B5FCA512037EB3B3A2B61280A5194D7BCC22>I<EB7FC0B5FCA512037EB3B3 +B3AAB61280A5194C7BCB22>108 D<90287FC001FFC0EC7FF0B5010F01FC0103B5FC033F +6D010F804B6D4980DBFE079026803F817F9126C1F801903AC07E007FF00003D9C3E0DAE0 +F8806C9026C78000D9F1E06D7E02CFC7EBF3C002DEEDF780DD7FFF6E7E02FC93C7FC4A5D +A24A5DA34A5DB3AAB6D8C03FB5D8F00FB512FCA55E327BB167>I<903A7FC001FFC0B501 +0F13F8033F7F4B13FFDBFE077F9138C1F00300039026C3E0017F6CD9C78080ECCF0014DE +02DC6D7F14FC5CA25CA35CB3AAB6D8C07FEBFFE0A53B327BB144>I<913807FF80027F13 +F80103B6FC010F15C090261FFE017F903A7FF0003FF849486D7E480180EB07FE4890C76C +7E4817804980000F17C048486E13E0A2003F17F0A249157F007F17F8A400FF17FCAB007F +17F8A46C6CEDFFF0A2001F17E0A26C6C4A13C0A26C6C4A13806C6D4913006C5E6C01E0EB +1FFC6D6C495A903A3FFE01FFF0010FB612C0010392C7FCD9007F13F80207138036347DB2 +3D>I<90397FC007FFB5017F13E002C1B512FC02C714FF9126CFF80F7F9126DFC0037F00 +0301FFC77F6C496E7E02F8814A6E7E717E4A81831980A28319C0A37113E0AC19C05FA319 +805F19005F606E143F6E5D4D5A6E4A5A02FF495BDBC0075B9126EFF01F5B02E7B548C7FC +02E114F8DAE07F13E0DB0FFEC8FC92CAFCAFB612C0A53B477CB144>I<9039FF803FE0B5 +EBFFF8028113FE02837FDA87E11380EC8F830003D99F0713C06C139E14BCA214F8A24A6C +13806F13006F5A4A90C7FCA45CB3A8B612E0A52A327CB132>114 +D<903907FF8070017FEBF1F048B6FC1207380FFC01391FE0003F4848130F491307127F90 +C71203A2481401A27FA27F01F090C7FC13FCEBFFC06C13FEECFFE06C14FC6C806CECFF80 +6C15C06C15E06C15F06C7E011F14F8010114FCEB000FEC007FED1FFE0078140F00F81407 +15037E1501A27E16FC7E15036D14F86D13076D14F001F8EB1FE001FFEBFFC04890B51280 +486C1400D8F81F13FCD8E00313C027347CB230>I<14F8A51301A41303A21307A2130FA2 +131F133F137F13FF1203000F90B512F0B7FCA426007FF8C7FCB3A7167CAA013F14F880A2 +90391FFE01F0010F1303903907FF87E06DEBFFC06D14806D6C1300EC0FFC26467EC430> +I<D97FE0EC3FF0B5EC7FFFA5000315016C81B3AC5EA25EA25E7E6EEB0F7F017F021E7F6E +017CEBFFE090393FFE01F86DB512F0010714E0010114C09027003FFE00EBC0003B337BB1 +44>I<B600C090387FFFF0A5C601F0C73803F8006E5D017F5E801707013F5E6E140F011F +5E6E141F6D93C7FC6F5B6D153E81177E6D157C6F13FC6D5DEDF0016D5DEDF803027F5CA2 +EDFC07023F5CEDFE0F021F5CEDFF1F6E91C8FC169F16BF6E13BE16FE6E5BA26E5BA26E5B +A36F5AA26F5AA26F5AA23C327EB041>I<B60081B500FC90387FFFF0A500019026E00003 +90C73801FC006E6F5C6C6F5E6E6F1303017F61A26E6F1307013F4A5E846E49150F011F61 +6E6F131F6D4A93C7FC179F03806E5B6D021F153EEF0FFE6DD9C03F5DEE3E0703E06E13FC +6D027E5DEE7C0303F015816D4A6C5C03F815C3DA7FF95E4C7E03FD15E7DA3FFF5E4C137F +19FF6E496D5BA26E94C8FC4C7FA26E5E93C7120FA26E486E5AA202015E4B1403A26E486E +5A54327EB059>I<007FB500C090387FFFE0A5C601F0C73803F8006E5D017F5E6E140701 +3F5E80170F011F5E6E141F6D93C7FC6F5B6D153E6F137E6D157C6F13FCA26D6D5B16016D +5DEDF803027F5CEDFC07023F5CEDFE0F021F5C15FF161F6E91C8FC16BF6E13BE16FE6E5B +A26E5BA36E5BA26F5AA26F5AA26F5AA393C9FC5D153E157E157CD81F8013FC486C5B387F +E001D8FFF05B14035D14074A5A49485A007F133F4948CAFC383F81FE381FFFF86C5B6C13 +C0C648CBFC3B477EB041>121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fg cmtt12 17.28 6 +/Fg 6 123 df<913803FFC0023F13FC49B67E010715F04981013F15FE498190B812C048 +8348D9FC0180489026E0001F7F480180130391C87F48486F7E49153F4848ED0FFF834848 +178083496F13C012FF8319E07FA2187FA36C5A6C5A6C5ACBFCA218FFA219C05FA219805F +A24D13005F604D5A173F4D5A4D5AA24C5B4C5B4C5B041F90C7FC4C5A4C5A4C5A4B5B4B5B +4B5B031F5B4B90C8FC4B5AEDFFF84A5B4A5B4A5B021F5B4A90C9FCEC7FFC4A5A495B495B +010F5B495B4948CAFC4948ED1F804948ED3FC04849ED7FE0485B000F5B4890C9FC4890B8 +FC5ABAFCA56C18C06C18803B5A79D94A>50 D<383FFFF0487F80B5FCA37EA27EEA000FB0 +EE0FFC93B57E030714E0031F14F84B14FE92B7FC02FD8291B87E85DCE01F7FEE000703FC +01017F4B6D7F03E0143F4B6E7E4B140F8592C87E4A6F1380A34A6F13C0A284A21AE0A219 +7FAA19FFA21AC0A26E5DA24E138080606F1600606F4A5A6F143F6F4A5A6F4A5A6F130303 +FF010F5BDCC03F5B93B65A6102FD93C7FC02FC5D6F5C031F14F0902607F80714C0902603 +F00191C8FC90C8EA3FF043597FD74A>98 D<EC01F0EC07FC4A7EA24A7EA56E5AA26E5AEC +01F091CAFCAE001FB512FC4880815AA37EA27EC71203B3B3A8003FB812C04817E0A2B912 +F0A36C17E0A26C17C0345974D84A>105 D<003FB512FE4880B77EA57E7EC71201B3B3B3 +B0003FB812FC4817FEBAFCA56C17FE6C17FC385877D74A>108 D<EE0FFC263FFFF090B5 +7E48D9F80714E0DAFC1F14F8B54914FE92B7FC02FD826C90B87E856CDBE01F7FD8000FEC +000703FC01017F4B6D7F03E0143F4B6E7E4B140F8592C87E4A6F1380A34A6F13C0A284A2 +1AE0A2197FAA19FFA21AC0A26E5DA24E138080606F1600606F4A5A6F143F6F4A5A6F4A5A +6F130303FF010F5BDCC03F5B93B65A6102FD93C7FC02FC5D6F5C031F14F0030714C00301 +91C8FC9238003FF093CAFCB3A4003FB6FC4881A2B77EA36C5DA26C92CAFC435F7FBE4A> +112 D<000FB912E04818F04818F8A619F001F0C8000313E04D13C04D13804D13004D5A4D +5A4D5A6C484A5B6C484A5BC9000F5B4C5B4C90C7FC4C5A4C5A4B5B4B5B4B5B4B5B4B5B4B +90C8FC4B5A4B5A4A5B4A5B4A5B4A5B4A5B4A90C9FC4A5A4A5A495B495B495B4949EC07E0 +4949EC0FF04948C8EA1FF8495A495A485B485B485B485B4890C9FC485A48B9FCBAFCA66C +18F06C18E03D3E7BBD4A>122 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fh cmbx12 17.28 28 +/Fh 28 120 df<16F04B7E1507151F153FEC01FF1407147F010FB5FCB7FCA41487EBF007 +C7FCB3B3B3B3007FB91280A6395E74DD51>49 D<913801FFF8021FEBFFC091B612F80103 +15FF010F16C0013F8290267FFC0114F89027FFE0003F7F4890C7000F7F48486E7FD807F8 +6E148048486E14C048486E14E048486F13F001FC17F8486C816D17FC6E80B56C16FE8380 +A219FFA283A36C5BA26C5B6C90C8FCD807FC5DEA01F0CA14FEA34D13FCA219F85F19F04D +13E0A294B512C019804C14004C5B604C5B4C5B604C13804C90C7FC4C5A4C5A4B13F05F4B +13804B90C8FC4B5AED1FF84B5A4B5A4B48143F4A5B4A48C8FC4A5A4A48157E4A5A4A5AEC +7F8092C9FC02FE16FE495A495A4948ED01FCD90FC0150749B8FC5B5B90B9FC5A4818F85A +5A5A5A5ABAFCA219F0A4405E78DD51>I<92B5FC020F14F8023F14FF49B712C04916F001 +0FD9C01F13FC90271FFC00077FD93FE001017F49486D8049C86C7F484883486C6F7F14C0 +486D826E806E82487FA4805CA36C5E4A5E6C5B6C5B6C495E011FC85A90C95CA294B55A61 +4C91C7FC604C5B4C5B4C5B4C5B047F138092260FFFFEC8FC020FB512F817E094C9FC17F8 +17FF91C7003F13E0040713F8040113FE707F717F7113E085717FA2717F85A285831A80A3 +1AC0EA03FCEA0FFF487F487F487FA2B57EA31A80A34D14005C7E4A5E5F6C495E49C8485B +D81FF85F000F5ED807FE92B55A6C6C6C4914806C01F0010791C7FC6C9026FF803F5B6D90 +B65A011F16F0010716C001014BC8FCD9001F14F0020149C9FC426079DD51>I<F01F804E +7E187F18FFA25F5F5F5FA25F5F5FA294B5FC5E5E5EA25E5EEE3FBFEE7F3FA216FEED01FC +ED03F8ED07F0A2ED0FE0ED1FC0ED3F8016005D15FE4A5A4A5AA24A5A4A5A4A5A4A5AA24A +C7FC14FE495A5C1303495A495A495A5C133F49C8FC13FE485AA2485A485A485A5B121F48 +5A48C9FC12FEBCFCA6CA6CEBC000B1037FB8FCA6485E7CDD51>I<4DB5ED03C0057F02F0 +14070407B600FE140F047FDBFFC0131F4BB800F0133F030F05FC137F033F9127F8007FFE +13FF92B6C73807FF814A02F0020113C3020702C09138007FE74A91C9001FB5FC023F01FC +16074A01F08291B54882490280824991CB7E49498449498449498449865D49498490B5FC +484A84A2484A84A24891CD127FA25A4A1A3F5AA348491A1FA44899C7FCA25CA3B5FCB07E +A380A27EA2F50FC0A26C7FA37E6E1A1F6C1D80A26C801D3F6C6E1A00A26C6E616D1BFE6D +7F6F4E5A7F6D6D4E5A6D6D4E5A6D6D4E5A6D6E171F6D02E04D5A6E6DEFFF806E01FC4C90 +C7FC020F01FFEE07FE6E02C0ED1FF8020102F8ED7FF06E02FF913803FFE0033F02F8013F +1380030F91B648C8FC030117F86F6C16E004071680DC007F02F8C9FC050191CAFC626677 +E375>67 D<B96C90B91280A6D8000102C0C9000102C0C7FCB3B3A293BBFCA604C0C91201 +B3B3A6B96C90B91280A671627AE17E>72 D<B912E0A6C702E0C7FCB3B3B3B3AEB912E0A6 +33627CE13C>I<B700C0083FB612F070627097B7FCA37061D800010DF8C7FC70F103EFA2 +02FD6DF107CFA202FC6DF10F8FA36F6DF01F0FA26F6D183EA26F6D187CA26F6D18F8A36F +6DEF01F0A26F6DEF03E0A26F6DEF07C0A26F6DEF0F80A3706DEE1F00A2706D163EA2706D +5EA2706D5EA3706D4B5AA2706D4B5AA2706D4B5AA2706D4B5AA3716D4AC7FCA2716D143E +A2716D5CA2716D5CA3716D495AA2716D495AA2716D495AA2716D495AA3726D48C8FCA272 +EBC03EA2726D5AA2726D5AA372EBF9F0A272EBFFE0A2725CA2725CA37390C9FCA2735AA2 +735A90381FFFC0B700F86E480207B812F0A3735AA2735A8C627AE199>77 +D<BB7E1AFCF2FFC01BF81BFE757ED800010280C7001F80070114F0736C7F081F7F747F74 +7F7414807414C0A27414E0A21DF0A27513F8A41DFCA91DF8A498B512F0A21DE0A25014C0 +1D8062501400505B505B087F5B4FB512E0071F5C93B9C7FC1BFC1BF01B8008F0C8FC04C0 +CCFCB3B3A2B97EA65E627AE16E>80 D<001FBEFCA64849C79126E0000F148002E0180091 +C8171F498601F81A0349864986A2491B7FA2491B3F007F1DC090C9181FA4007E1C0FA600 +FE1DE0481C07A5CA95C7FCB3B3B3A3021FBAFCA663617AE070>84 +D<913803FFFE027FEBFFF00103B612FE010F6F7E4916E090273FFE001F7FD97FE001077F +D9FFF801017F486D6D7F717E486D6E7F85717FA2717FA36C496E7FA26C5B6D5AEB1FC090 +C9FCA74BB6FC157F0207B7FC147F49B61207010F14C0013FEBFE004913F048B512C04891 +C7FC485B4813F85A5C485B5A5CA2B55AA45FA25F806C5E806C047D7F6EEB01F96C6DD903 +F1EBFF806C01FED90FE114FF6C9027FFC07FC01580000191B5487E6C6C4B7E011F02FC13 +0F010302F001011400D9001F90CBFC49437CC14E>97 D<903807FF80B6FCA6C6FC7F7FB3 +A8EFFFF8040FEBFF80047F14F00381B612FC038715FF038F010014C0DBBFF0011F7FDBFF +C001077F93C76C7F4B02007F03F8824B6F7E4B6F13804B17C0851BE0A27313F0A21BF8A3 +7313FCA41BFEAE1BFCA44F13F8A31BF0A24F13E0A24F13C06F17804F1300816F4B5A6F4A +5B4AB402075B4A6C6C495B9126F83FE0013F13C09127F00FFC03B55A4A6CB648C7FCDAC0 +0115F84A6C15E091C7001F91C8FC90C8000313E04F657BE35A>I<92380FFFF04AB67E02 +0F15F0023F15FC91B77E01039039FE001FFF4901F8010113804901E0010713C049018049 +13E0017F90C7FC49484A13F0A2485B485B5A5C5A7113E0485B7113C048701380943800FE +0095C7FC485BA4B5FCAE7EA280A27EA2806C18FCA26C6D150119F87E6C6D15036EED07F0 +6C18E06C6D150F6D6DEC1FC06D01E0EC7F806D6DECFF00010701FCEB03FE6D9039FFC03F +FC010091B512F0023F5D020F1580020102FCC7FCDA000F13C03E437BC148>I<F17FF805 +0FB5FCA6EF000F8484B3A892380FFF804AB512F8020F14FE023FECFF8391B712E3010391 +38807FF3499039F8000FFB011F01E00103B5FC494913004990C87E49488148498148834A +815A485BA2485BA25AA3485BA4B5FCAE7EA46C7FA37EA26C7FA26C5F806C5F6C6D5D6C6D +5D017F93B5FC6D6C6C0103806D6D49806D01F0D91FF7EBFFFE6D9039FE01FFE7010190B6 +12876D6CECFE07021F14F8020314E09127003FFE00ECC0004F657BE35A>I<92380FFFC0 +4AB512FC020FECFF80023F15E091B712F80103D9FE037F499039F0007FFF011F01C0011F +7F49496D7F4990C76C7F49486E7F48498048844A804884485B727E5A5C48717EA35A5C72 +1380A2B5FCA391B9FCA41A0002C0CBFCA67EA380A27EA27E6E160FF11F806C183F6C7FF1 +7F006C7F6C6D16FE6C17016D6C4B5A6D6D4A5A6D01E04A5A6D6DEC3FE0010301FC49B45A +6D9026FFC01F90C7FC6D6C90B55A021F15F8020715E0020092C8FC030713F041437CC14A +>I<EE3FFC0307B51280033F14C04AB612F0020715F84A9038F03FFC4AEB807F913A7FFE +00FFFE4A5A4B4813FF4913F05B4913E0A24913C0A27013FE4949EB7FFCEF3FF8EF1FF0EF +07C094C7FCB0B812C0A6D8001F01C0C8FCB3B3B0007FB612FCA638657CE431>I<F107F8 +DB7FFEEC3FFE020FB5D8F001B5FC027FDAFE03148049B7128F49DCDFFD13C0010FD9F00F +EBFFC149D9800114014990C7EBFC0349486E6C7E4948EC3FFF48496E0181138007801300 +48F0C03E97C7FC48496E7FA34884A96C60A36C6D4A5BA26C60A26C6D4A90C8FC6D6C4A5A +6D6C4A5A6D6D485BDBF00F5B4990B612C060D97C7F4AC9FCD9FC0F14F09126007FFECAFC +92CCFC1201A47FA27F8014F091B77E18FE6CEFFFC019F06D17FC19FF6D846D846D846D84 +013F8490BAFC0003854801E0C712014890C9000F7F484816014848EE007F4848717E8512 +FF5B85A56D5F007F616D173F003F616D177F6C6C4D5A6C01C003035B6C6D4B5B6C01F803 +1F5BC601FF92B5C7FC6D01F8011F5B011F90B712F8010717E0010094C8FC020F15F0DA00 +3F01FCC9FC4A607CC151>I<903807FF80B6FCA6C6FC7F7FB3A8EF1FFF94B512F0040714 +FC041F14FF4C8193267FE07F7F922781FE001F7FDB83F86D7FDB87F07FDB8FC0814C7F03 +9FC78015BE03BC8003FC825DA25DA25DA45DB3B2B7D8F007B71280A651647BE35A>I<EB +0FE0EB3FF8497E48B5FCA24880A24880A76C5CA26C91C7FCA238007FFC6D5AEB0FE090C9 +FCAF903807FF80007FB5FCA6C6FC7F7FB3B3AEB712C0A622657BE42C>I<903807FF80B6 +FCA6C6FC7F7FB3B3B3B3ADB712E0A623647BE32C>108 D<902607FF80D91FFFEEFFF8B6 +91B500F00207EBFF80040702FC023F14E0041F02FF91B612F84C6F488193267FE07F6D48 +01037F922781FE001F9027E00FF0007FC6DA83F86D9026F01FC06D7F6DD987F06D4A487F +6DD98FC0DBF87EC7804C6D027C80039FC76E488203BEEEFDF003BC6E4A8003FC04FF834B +5FA24B5FA24B94C8FCA44B5EB3B2B7D8F007B7D8803FB612FCA67E417BC087>I<902607 +FF80EB1FFFB691B512F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FC6DA83 +F86D7F6DD987F07F6DD98FC0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2 +B7D8F007B71280A651417BC05A>I<923807FFE092B6FC020715E0021F15F8027F15FE49 +4848C66C6C7E010701F0010F13E04901C001037F49496D7F4990C87F49486F7E49486F7E +48496F13804819C04A814819E048496F13F0A24819F8A348496F13FCA34819FEA4B518FF +AD6C19FEA46C6D4B13FCA36C19F8A26C6D4B13F0A26C19E06C6D4B13C0A26C6D4B13806C +6D4B13006D6C4B5A6D6D495B6D6D495B010701F0010F13E06D01FE017F5B010090B7C7FC +023F15FC020715E0020092C8FC030713E048437CC151>I<D90FFFEB0FFCB690383FFF80 +93B512E04B14F04B14F8923907FC7FFC92390FE0FFFEC6EC1F806DD93F0113FF6D133E15 +7E157C15F8A215F07013FEA24BEB7FFCEF3FF8EF0FE04B90C7FCA55DB3B0B712F8A63841 +7BC042>114 D<913A3FFF8007800107B5EAF81F011FECFE7F017F91B5FC48B8FC48EBE0 +014890C7121FD80FFC1407D81FF0801600485A007F167F49153FA212FF171FA27F7F7F6D +92C7FC13FF14E014FF6C14F8EDFFC06C15FC16FF6C16C06C16F06C826C826C826C82013F +1680010F16C01303D9007F15E0020315F0EC001F1500041F13F81607007C150100FC8117 +7F6C163FA2171F7EA26D16F0A27F173F6D16E06D157F6D16C001FEEDFF806D0203130002 +C0EB0FFE02FCEB7FFC01DFB65A010F5DD8FE0315C026F8007F49C7FC48010F13E035437B +C140>I<EC07E0A6140FA5141FA3143FA2147FA214FF5BA25B5B5B5B137F48B5FC000F91 +B512FEB8FCA5D8001F01E0C8FCB3AFEF0FC0AC171F6D6D1480A2173F6D16006F5B6D6D13 +7E6D6D5B6DEBFF836EEBFFF86E5C020F14C002035C9126003FFCC7FC325C7DDA3F>I<90 +2607FFC0ED3FFEB60207B5FCA6C6EE00076D826D82B3B3A260A360A2607F60183E6D6D14 +7E4E7F6D6D4948806D6DD907F0ECFF806D01FFEB3FE06D91B55A6E1500021F5C020314F8 +DA003F018002F0C7FC51427BC05A>I<B70081B600FC0103B512FCA6C66C0180C701FCC8 +381FFE006F6FED03F86D047F5F856F6E16076D646F70140F6D705F866F6E161F6D646F4A +6D143F6D99C7FC4E7F6F616D1B7E6F4A6D14FE6D6395B57E7001FC15016E62DCC0016E13 +036EDBF87F5D05038004E0496C14076E62DCF007ED800F6E4B6C5D050F15C004F8496C14 +1F6E62DCFC1FEDE03F6E4B6C92C8FC053F15F004FE496C5C6E197E7048EDF8FE6E027E6D +5C05FE15FC4D6D13FD6F601BFF6F496E5BA24D806F60A26F496E5BA24D806F60A26F496E +90C9FCA294C87E6F5FA26F486F5A047C6F5A6E417DBF75>119 D +E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fi cmsy10 10.95 1 +/Fi 1 16 df<EB0FFCEB3FFF90B512C0000314F04880488048804880A2481580A3B712C0 +AA6C1580A36C1500A26C5C6C5C6C5C6C5CC614C0013F90C7FCEB0FFC22227BA72D>15 +D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fj cmtt10 10.95 89 +/Fj 89 127 df<121C127FEAFF80B3EA7F00B2123EC7FCA8121C127FA2EAFF80A3EA7F00 +A2121C09396DB830>33 D<00101304007C131F00FEEB3F80A26C137FA248133FB2007E14 +00007C7F003C131E00101304191C75B830>I<903907C007C0A2496C487EA8011F131FA2 +02C05BA3007FB7FCA2B81280A36C16006C5D3A007F807F80A2020090C7FCA9495BA2003F +90B512FE4881B81280A36C1600A22701FC01FCC7FCA300031303A201F85BA76C486C5AA2 +29387DB730>I<EB07E0EB1FF8497E137F497E803801FC7F497E810003131F13F0A6143F +92C8FC91387F0FFF9026F87E1F1380000113FEEBF9FC13FB4A6C1300D9FFF013C06C13E0 +151F02C05BEB7F809038FF003F4892C7FC485C48EB807E5A15FE391FDFC0FC383F8FE014 +E1397F07F1F8EB03F300FEEBFBF0EB01FF5D7FEDC006027F130F91393F801F8015C06C13 +7F6CEBFFE049EBF83F018701FC1300263FFFFBB5FC6C01F15B14E06C9038C03FFC000390 +38001FF8D801FCEB07E0293A7DB830>38 D<EA07C0EA0FF0EA1FF8A213FCA213FE120F12 +07EA007EA513FE13FCA2120113F81203EA07F0120FEA1FE0127FEAFFC013801300127C12 +380F1D70B730>I<141E147F14FF5BEB03FEEB07FCEB0FF0EB1FE0EB3FC0EB7F80EBFF00 +485A5B12035B485A120F5BA2485AA2123F5BA2127F90C7FCA412FEAD127FA47F123FA27F +121FA26C7EA27F12076C7E7F12017F6C7EEB7F80EB3FC0EB1FE0EB0FF0EB07FCEB03FEEB +01FF7F147F141E184771BE30>I<127812FE7E7F6C7E6C7EEA0FF06C7E6C7E6C7E6C7EEB +7F80133F14C0131FEB0FE014F01307A2EB03F8A214FC1301A214FE1300A4147FAD14FEA4 +130114FCA2130314F8A2EB07F0A2130F14E0EB1FC0133F1480137FEBFF00485A485A485A +485AEA3FE0485A485A90C7FC5A1278184778BE30>I<14E0497E497EA60038EC0380007E +EC0FC0D8FF83EB3FE001C3137F9038F3F9FF267FFBFB13C06CB61280000FECFE00000314 +F86C5C6C6C13C0011F90C7FC017F13C048B512F04880000F14FE003FECFF80267FFBFB13 +C026FFF3F913E09038C3F87F0183133FD87E03EB0FC00038EC0380000091C7FCA66D5A6D +5A23277AAE30>I<143EA2147FAF007FB7FCA2B81280A36C1600A2C76CC8FCAF143EA229 +297DAF30>I<EA03E0EA0FF0EA1FF813FCEA3FFEA213FFA27EA27E1203EA007FA2137E13 +FEEA01FC1203EA07F8EA3FF0127FEAFFE0EA7F801300123C1019708B30>I<007FB612F0 +A2B712F8A36C15F0A225077B9E30>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0 +EA0F000C0C6E8B30>I<16F01501ED03F8A21507A2ED0FF0A2ED1FE0A2ED3FC0A2ED7F80 +A2EDFF00A24A5AA25D1403A24A5AA24A5AA24A5AA24A5AA24A5AA24AC7FCA2495AA25C13 +03A2495AA2495AA2495AA2495AA2495AA249C8FCA2485AA25B1203A2485AA2485AA2485A +A2485AA2485AA248C9FCA25AA2127CA225477BBE30>I<14FE903807FFC0497F013F13F8 +497F90B57E48EB83FF4848C6138049137F4848EB3FC04848EB1FE049130F001F15F04913 +07A24848EB03F8A290C712014815FCA400FEEC00FEAD6C14016C15FCA36D1303003F15F8 +A26D1307001F15F0A26D130F6C6CEB1FE0A26C6CEB3FC06C6CEB7F806D13FF2601FF8313 +006CEBFFFE6D5B6D5B010F13E06D5BD900FEC7FC273A7CB830>I<EB03C0497EA2130FA2 +131FA2133F137F13FF1203123FB5FCA213EF138FEA7E0F1200B3B0003FB512F84814FCB6 +12FEA26C14FC6C14F81F3977B830>I<EB07FC90383FFFC090B512F00003804814FE4880 +261FF80F1380263FE00113C09038C0007F4848EB3FE090C7121FED0FF04814075A6C15F8 +1503A3127E1218C8FCA2150716F0150F16E0151F16C0153FED7F8015FF4A13005DEC07FC +4A5A4A5A4A5A4A5A4A5A4990C7FC495A495AEB0FF0EB3FE0495A495A4890C8FC4848EB01 +F04848EB03F8485AEA1FE048B6FCB7FCA37E6C15F025397BB830>I<EB03FF013F13E090 +B512F84814FE4880481580260FFE0113C09038F0007F4848EB1FE0150F16F01507A26C5A +6C5AC8FC150F16E0A2151FED3FC0157FEDFF8002071300903807FFFE495B5D8115FF6D14 +80D9000113C09138003FE0ED1FF0ED07F8150316FC150116FE1500A21218127EB4FCA215 +0116FC4814036C15F86C6C13076DEB1FF0D83FF0133F3A1FFE01FFE06CB612C06C15806C +ECFE00C65C013F13F001031380273A7CB830>I<EC03FC4A7E140F141FA2143F147F157E +14FEA2EB01FCEB03F8A2EB07F0A2EB0FE0EB1FC0A2EB3F80A2EB7F0013FEA2485A485AA2 +485AA2485A485AA2485AA248C7FC12FEB8FC1780A46C1600C8007EC7FCAA91387FFFFE91 +B6FCA46E5B29397DB830>I<000FB612804815C05AA316800180C8FCAEEB83FF019F13C0 +90B512F015FC8181D9FE0313809039F0007FC049133F0180EB1FE06CC7120F000E15F0C8 +1207A216F81503A31218127EA2B4FC150716F048140F6C15E06C141F6DEB3FC06D137F3A +3FE001FF80261FFC0F13006CB55A6C5C6C5C6C14E06C6C1380D90FFCC7FC25397BB730> +I<EC0FF8EC7FFF49B51280010714E0131F4914F090387FF80F9039FFC007F84813803803 +FE005B485A4848EB03F0ED01E0484890C7FC5B123F5BA2127FEB000C903803FFE0010F13 +F8D8FF3F13FE48B6FCB7128016C09039FE007FE001F8EB1FF001E0130F49EB07F8ED03FC +5B90C7120116FE1500A37EA46C7E15016D14FC121F6D1303000FEC07F86D130F6C6CEB1F +F06DEB3FE03A03FF81FFC06C90B512806C15006D5B011F13F8010713E001011380273A7C +B830>I<127CB712FC16FEA416FC48C7EA0FF816F0ED1FE0007CEC3FC0C8EA7F80EDFF00 +A24A5A4A5A5D14075D140F5D4A5AA24A5AA24AC7FCA25C5C13015CA213035CA213075CA4 +495AA6131F5CA96D5A6DC8FC273A7CB830>I<49B4FC011F13F0017F13FC90B57E0003EC +FF804815C048010113E03A1FF8003FF049131FD83FC0EB07F8A24848EB03FC90C71201A5 +6D1303003F15F86D13076C6CEB0FF06C6CEB1FE0D807FCEB7FC03A03FF83FF806C90B512 +006C6C13FC011F13F0497F90B512FE48802607FE0013C0D80FF8EB3FE0D81FE0EB0FF048 +48EB07F8491303007F15FC90C712014815FE481400A66C14016C15FC6D1303003F15F86D +1307D81FF0EB1FF06D133F3A0FFF01FFE06C90B512C06C1580C6ECFE006D5B011F13F001 +0190C7FC273A7CB830>I<49B4FC010F13E0013F13F890B57E4880488048010113803A0F +FC007FC0D81FF0EB3FE04848131F49EB0FF048481307A290C7EA03F85A4815FC1501A416 +FEA37E7E6D130315076C7E6C6C130F6D133FD80FFC13FF6CB6FC7E6C14FE6C14F9013FEB +E1FC010F138190380060011400ED03F8A2150716F0150F000F15E0486C131F486CEB3FC0 +157FEDFF804A1300EC07FE391FF01FFC90B55A6C5C6C5C6C1480C649C7FCEB3FF0273A7C +B830>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F00C7FCAF120FEA3FC0EA +7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C276EA630>I<EA03C0EA0FF0EA1FF8A2EA3F +FCA4EA1FF8A2EA0FF0EA03C0C7FCAFEA03C0EA0FF0121F13F8123F13FCA3121FA2120F12 +031200120113F8120313F01207EA1FE0123FEA7FC0EAFF80EA7F00127E12380E3470A630 +>I<16F01503ED07F8151F157FEDFFF014034A13C0021F138091383FFE00ECFFF8495B01 +0713C0495BD93FFEC7FC495A3801FFF0485B000F13804890C8FCEA7FFC5BEAFFE05B7FEA +7FF87FEA1FFF6C7F000313E06C7F38007FFC6D7E90380FFF806D7F010113F06D7FEC3FFE +91381FFF80020713C06E13F01400ED7FF8151F1507ED03F01500252F7BB230>I<007FB7 +FCA2B81280A36C16006C5DCBFCA7003FB612FE4881B81280A36C1600A229157DA530>I< +1278127EB4FC13C07FEA7FF813FEEA1FFF6C13C000037F6C13F86C6C7EEB1FFF6D7F0103 +13E06D7F9038007FFC6E7E91380FFF806E13C0020113F080ED3FF8151F153FEDFFF05C02 +0713C04A138091383FFE004A5A903801FFF0495B010F13804990C7FCEB7FFC48485A4813 +E0000F5B4890C8FCEA7FFE13F8EAFFE05B90C9FC127E1278252F7BB230>I<EC1FE0ECFF +F8010313FE010F7F4914804914C090397FF03FE09038FF800F4890380007F0D803FC1303 +3A07F801FBF89038F007FF380FE01F4A13FCEA1FC0495A003FEBFF0F903800FE07903901 +FC03FE007FEBF801EA7E03ECF000A2EAFE0700FC49137EAA00FE6D13FED87E0314FCA2EC +F801D87F0114F8003FEBFC03903900FE07F0903880FF0F001F90387FFFE06D6C13C0EA0F +E06E13803A07F007FE009038F801F86C6CC7127C6CB414FE6CEB800390387FF01F6DB512 +FC6D14F86D14E0010314C00100EBFE00EC1FF0273A7CB830>64 D<147F4A7EA2497FA449 +7F14F7A401077F14E3A3010F7FA314C1A2011F7FA490383F80FEA590387F007FA4498049 +133F90B6FCA34881A39038FC001F00038149130FA4000781491307A2D87FFFEB7FFFB56C +B51280A46C496C130029397DB830>I<007FB512F0B612FE6F7E82826C813A03F8001FF8 +15076F7E1501A26F7EA615015EA24B5A1507ED1FF0ED7FE090B65A5E4BC7FC6F7E16E082 +9039F8000FF8ED03FC6F7E1500167FA3EE3F80A6167F1700A25E4B5A1503ED1FFC007FB6 +FCB75A5E16C05E6C02FCC7FC29387EB730>I<91387F803C903903FFF03E49EBFC7E011F +13FE49EBFFFE5B9038FFE07F48EB801F3903FE000F484813075B48481303A2484813015B +123F491300A2127F90C8FC167C16005A5AAC7E7EA2167C6D14FE123FA27F121F6D13016C +6C14FCA26C6CEB03F86D13076C6CEB0FF03901FF801F6C9038E07FE06DB512C06D14806D +1400010713FC6D13F09038007FC0273A7CB830>I<003FB512E04814FCB67E6F7E6C816C +813A03F8007FF0ED1FF8150F6F7E6F7E15016F7EA2EE7F80A2163F17C0161FA4EE0FE0AC +161F17C0A3163F1780A2167F17005E4B5A15034B5A150F4B5AED7FF0003FB65A485DB75A +93C7FC6C14FC6C14E02B387FB730>I<007FB7FCB81280A47ED803F8C7123FA8EE1F0093 +C7FCA4157C15FEA490B5FCA6EBF800A4157C92C8FCA5EE07C0EE0FE0A9007FB7FCB8FCA4 +6C16C02B387EB730>I<003FB712804816C0B8FCA27E7ED801FCC7121FA8EE0F8093C7FC +A5153E157FA490B6FCA69038FC007FA4153E92C8FCAE383FFFF8487FB5FCA27E6C5B2A38 +7EB730>I<02FF13F00103EBC0F8010F13F1013F13FD4913FF90B6FC4813C1EC007F4848 +133F4848131F49130F485A491307121F5B123F491303A2127F90C7FC6F5A92C8FC5A5AA8 +92B5FC4A14805CA26C7F6C6D1400ED03F8A27F003F1407A27F121F6D130F120F7F6C6C13 +1FA2D803FE133F6C6C137FECC1FF6C90B5FC7F6D13FB010F13F30103EBC1F0010090C8FC +293A7DB830>I<3B3FFF800FFFE0486D4813F0B56C4813F8A26C496C13F06C496C13E0D8 +03F8C7EAFE00B290B6FCA601F8C7FCB3A23B3FFF800FFFE0486D4813F0B56C4813F8A26C +496C13F06C496C13E02D387FB730>I<007FB6FCB71280A46C1500260007F0C7FCB3B3A8 +007FB6FCB71280A46C1500213879B730>I<49B512F04914F85BA27F6D14F090C7EAFE00 +B3B3123C127EB4FCA24A5A1403EB8007397FF01FF86CB55A5D6C5C00075C000149C7FC38 +003FF025397AB730>I<D83FFF90380FFF80486D4813C0B56C5AA26C497E6C496C1380D8 +03F0903803F8004B5A4B5A151F4B5A5E4BC7FC15FE14014A5A5D4A5A4A5A141F5D4A5A4A +C8FC5C13F18101F37F13F790B57E14EFECC7F01483EC03F8140101FE7F496C7E5B157F49 +7F82151F82150F826F7EA26F7E1501821500D83FFF903803FFC0486D4813E0B56C5AA26C +497E6C496C13C02B387FB730>I<383FFFF8487FB57EA26C5B6C5BD801FCC9FCB3B0EE0F +80EE1FC0A9003FB7FC5AB8FCA27E6C16802A387EB730>I<D83FF8ECFFE0486C4913F048 +6C4913F8A2007F16F06C6C4913E00007160001EF14BFEC800FA39039E7C01F3FA4ECE03F +01E3133EA2ECF07EA201E1137CA2ECF8FCA201E013F8A214FDEC7DF0A3147FEC3FE0A3EC +1FC0A2EC070091C7FCADD83FFC903801FFE0486C4913F0B54913F8A26C486D13F06C486D +13E02D387FB730>I<D83FFC90381FFF80486C4913C0B54913E0A26C6D6C13C06C6E1380 +0003913801F800EBF7C0A3EBF3E0A314F013F1A214F8A213F014FCA2147C147EA2143E14 +3FA2141FA21581A2140F15C1A2140715E1A2140315F1A21401A215F91400A3157DA3153F +EA3FFF481380B5EAC01FA26CEB800F6C496C5A2B387EB730>I<90383FFFE048B512FC00 +0714FF4815804815C04815E0EBF80001E0133FD87F80EB0FF0A290C71207A44815F84814 +03B3A96C1407A26C15F0A36D130FA26D131F6C6CEB3FE001F813FF90B6FC6C15C06C1580 +6C1500000114FCD8003F13E0253A7BB830>I<007FB512F0B612FE6F7E16E0826C813903 +F8003FED0FFCED03FE15016F7EA2821780163FA6167F17005EA24B5A1503ED0FFCED3FF8 +90B6FC5E5E16804BC7FC15F001F8C9FCB0387FFFC0B57EA46C5B29387EB730>I<90383F +FFE048B512FC000714FF4815804815C04815E0EBF80001E0133F4848EB1FF049130F90C7 +1207A44815F8481403B3A8147E14FE6CEBFF076C15F0EC7F87A2EC3FC7018013CF9038C0 +1FFFD83FE014E0EBF80F90B6FC6C15C06C15806C1500000114FCD8003F7FEB00016E7EA2 +1680157F16C0153F16E0151F16F0150FED07E025467BB830>I<003FB57E4814F0B612FC +15FF6C816C812603F8017F9138003FF0151F6F7E15071503821501A515035E1507150F4B +5A153F4AB45A90B65A5E93C7FC5D8182D9F8007FED3FE0151F150F821507A817F8EEF1FC +A53A3FFF8003FB4801C0EBFFF8B56C7E17F06C496C13E06C49EB7FC0C9EA1F002E397FB7 +30>I<90390FF803C0D97FFF13E048B512C74814F74814FF5A381FF80F383FE001497E48 +48137F90C7123F5A48141FA2150FA37EED07C06C91C7FC7F7FEA3FF0EA1FFEEBFFF06C13 +FF6C14E0000114F86C80011F13FF01031480D9003F13C014019138007FE0151FED0FF0A2 +ED07F8A2007C140312FEA56C140716F07F6DEB0FE06D131F01F8EB3FC001FF13FF91B512 +80160000FD5CD8FC7F13F8D8F81F5BD878011380253A7BB830>I<003FB712C04816E0B8 +FCA43AFE003F800FA8007CED07C0C791C7FCB3B1011FB5FC4980A46D91C7FC2B387EB730 +>I<3B7FFFC007FFFCB56C4813FEA46C496C13FCD803F8C7EA3F80B3B16D147F00011600 +A36C6C14FE6D13016D5CEC800390393FE00FF890391FF83FF06DB55A6D5C6D5C6D91C7FC +9038007FFCEC1FF02F3980B730>I<D87FFE90380FFFC0B54913E06E5AA24A7E6C486D13 +C0D807F0903801FC00A26D130300035DA46C6C495AA46C6C495AA46D131F6D5CA3EC803F +013F5CA46D6C48C7FCA490380FE0FEA401075B14F1A301035BA314FB01015BA314FFA26D +5BA46E5A6E5A2B397EB730>I<D83FFC903801FFE0486C4913F000FF16F8A2007F16F06C +486D13E0D81FC09038001FC0000F1680A76D143F00071600A7000390380F803E9039F01F +C07EEC3FE0A3EC7FF0A2147D0001157CA29039F8FDF8FCA314F8A300005D01F913FCA2EC +F07CA201FD137DA2017D5CECE03DA3017F133FA2ECC01FA2013F5CA2EC800F6D486C5A2D +397FB730>I<3A3FFF01FFF84801837F02C77FA202835B6C01015B3A01FC007F806D91C7 +FC00005C6D5BEB7F01EC81FCEB3F8314C3011F5B14E7010F5B14FF6D5BA26D5BA26D5BA2 +6D90C8FCA4497FA2497FA2815B81EB0FE781EB1FC381EB3F8181EB7F0081497F49800001 +143F49800003141F49800007140FD87FFEEB7FFFB590B5128080A25C6C486D130029387D +B730>I<D87FFF90381FFFC0B56C4813E0A46C496C13C0D803F8903803F8006D1307A26C +6C495AA26C6C5C151F6D5CEC803F013F5CECC07F011F91C7FCA290380FE0FEA214F10107 +5BA2903803FBF8A201015B14FF6D5BA26E5AA36E5AB1903803FFF8497F497FA26D5B6D5B +2B387EB730>I<001FB612FC4815FE5AA490C7EA03FCED07F816F0150FED1FE016C0153F +ED7F80003E1500C85A4A5A5D14034A5A5D140F4A5A5D143F4A5A92C7FC5C495A5C130349 +5A5C130F495A5C133F495A91C8FC5B4848147C4914FE1203485A5B120F485A5B123F485A +90B6FCB7FCA46C15FC27387CB730>I<007FB5FCB61280A4150048C8FCB3B3B3A5B6FC15 +80A46C140019476DBE30>I<007FB5FCB61280A47EC7123FB3B3B3A5007FB5FCB6FCA46C +140019477DBE30>93 D<1307EB1FC0EB7FF0497E000313FE000FEBFF80003F14E0D87FFD +13F039FFF07FF8EBC01FEB800F38FE0003007CEB01F00010EB00401D0E77B730>I<007F +B612F0A2B712F8A36C15F0A225077B7D30>I<EB3FFC48B57E4814E04880488048809038 +F00FFE9038E001FF806F7E6C48133F6C4880C8121FA491B5FC130F137F48B6FC12075A48 +EBC01F383FFC00EA7FE0138048C7FC5AA46C143FA26C6C137F9038C001FF263FF80FEBFF +C06CB712E0A2000714F76C14C3C6020013C0D93FF090C7FC2B2A7CA830>97 +D<EA3FFC487E12FFA2127F123F1200AAEC03FE91381FFF80027F13E091B57E90B612FC82 +ECFE079138F001FF4A6C13804A137F4AEB3FC091C7121F4915E0160FA217F01607A8160F +A217E07F161F6EEB3FC0A26EEB7F806E13FFDAF00313009138FC0FFE91B55A5E495CD97E +7F13C0D93C1F90C7FC90380003FC2C3980B730>I<ECFFE0010713FC011F7F017F7F90B6 +12804815C048EB807F3907FC003F485A485A49EB1F804848EB0F004990C7FC127F90C9FC +A25A5AA87E7EA27F003FEC07C06DEB0FE06C7E6D131F6C6C14C0D807FE133F9039FFC0FF +806C90B5FCC615006D5B011F13F801075B01011380232A7AA830>I<913801FFE04A7F5C +A28080EC0007AAEB03FE90381FFF874913E790B6FC5A5A481303380FFC00D81FF0133F49 +131F485A150F4848130790C7FCA25AA25AA87E6C140FA27F003F141F6D133F6C7E6D137F +390FF801FF2607FE07EBFFC06CB712E06C16F06C14F76D01C713E0011F010313C0D907FC +C8FC2C397DB730>I<49B4FC010713E0011F13F8017F7F90B57E488048018113803A07FC +007FC04848133FD81FE0EB1FE0150F484814F0491307127F90C7FCED03F85A5AB7FCA516 +F048C9FC7E7EA27F003FEC01F06DEB03F86C7E6C7E6D1307D807FEEB1FF03A03FFC07FE0 +6C90B5FC6C15C0013F14806DEBFE00010713F8010013C0252A7CA830>I<EDFF80020713 +E0021F13F05C4A13F891B5FC491387903803FE079138FC03F0903907F800C04A1300A800 +3FB612C04815E0B7FCA36C15C0260007F0C7FCB3A9003FB512FE4880B71280A26C15006C +5C25397DB830>I<D903FC13FF90261FFF8713C04913DF90B712E05A5A2607FE07138F90 +3AF801FE07C048486C6CC7FCA2497F001F8149133FA56D137F000F92C7FC6D5BA26C6C48 +5AEBFE0790B55A5D485C15C001DF5BD9C3FCC8FC01C0C9FCA37F7F6CB512F015FF6C15C0 +4815F0488148813A3FE0001FFE0180130148C8127F007E8100FE168048151FA56C153F00 +7FED7F006D5C6C6C495A01F013076CB4EB7FFC6C90B55A6C5D000115C06C6C91C7FC011F +13FC010113C02B3E7DA730>I<EA3FFC487E12FFA2127F123F1200AAEC01FE91380FFF80 +023F13E091B57E90B67EA29138FE07FCECF8039138E001FE14C0EC8000A291C7FCA25BB3 +A23B3FFFF81FFFF8486D4813FCB500FE14FEA26C01FC14FC6C496C13F82F3880B730>I< +14E0EB03F8A2497EA36D5AA2EB00E091C8FCA9381FFFF8487F5AA27E7EEA0001B3A9003F +B612C04815E0B7FCA27E6C15C023397AB830>I<EC01C0EC07F0A2EC0FF8A3EC07F0A2EC +01C091C7FCA990B512F04814F8A47EEB0003B3B3A5EC07F0A2123C007EEB0FE0B4131FEC +3FC0147F90B512806C14005C6C5B000F13F0000313C01D4E7CB830>I<EA7FF8487EA412 +7F1200AB0203B512804A14C017E0A217C06E14809139001FE0004B5A4B5A4BC7FC4A5A4A +5AEC0FF84A5A4A5A4A5A4A5A01FD7F90B57E8114F7ECE3F8ECC1FCEC81FEEC00FF497F49 +6D7E6F7E826F7E15076F7E6F7E3B7FFFF81FFFE0B56C4813F017F8A217F06C496C13E02D +387FB730>I<387FFFF8B57EA47EEA0001B3B3A8007FB612F0B712F8A46C15F025387BB7 +30>I<02FC137E3B7FC3FF01FF80D8FFEF01877F90B500CF7F15DF92B57E6C010F138726 +07FE07EB03F801FC13FE9039F803FC01A201F013F8A301E013F0B3A23C7FFE0FFF07FF80 +B548018F13C0A46C486C01071380322881A730>I<EC01FE3A3FFC0FFF80267FFE3F13E0 +00FF90B57E90B67E7E6C9038FE07FCC6EBF8039138E001FE14C0EC8000A291C7FCA25BB3 +A23B3FFFF81FFFF8486D4813FCB500FE14FEA26C01FC14FC6C496C13F82F2880A730>I< +49B4FC010F13E0013F13F8497F90B57E0003ECFF8014013A07FC007FC04848EB3FE0D81F +E0EB0FF0A24848EB07F8491303007F15FC90C71201A300FEEC00FEA86C14016C15FCA26D +1303003F15F86D13076D130F6C6CEB1FF06C6CEB3FE06D137F3A07FF01FFC06C90B51280 +6C15006C6C13FC6D5B010F13E0010190C7FC272A7CA830>I<EC03FE3A3FFC1FFF80267F +FE7F13E000FF90B57E90B612FC6C816CEBFE07C69038F001FF4A6C13804A137F4AEB3FC0 +91C7121F4915E0160FA217F01607A8160FA217E07F161F6EEB3FC0A26EEB7F806E13FFDA +F00313009138FC0FFE91B55A5E495C6E13C0021F90C7FCEC03FC91C9FCAD383FFFF8487F +B57EA26C5B6C5B2C3C80A730>I<49B413F8010FEBC1FC013F13F14913FD48B6FC5A4813 +81390FFC007F49131F4848130F491307485A491303127F90C7FC15015A5AA77E7E15037F +A26C6C1307150F6C6C131F6C6C133F01FC137F3907FF01FF6C90B5FC6C14FD6C14F9013F +13F1010F13C1903803FE0190C7FCAD92B512F84A14FCA46E14F82E3C7DA730>I<ED07F8 +3A3FFF803FFF486DB51280B512C302CF14C06C13DF6C9038FFFC3FD8001F13E09238801F +809238000F004A90C7FC5C5C5CA25CA45CAF003FB512FC4880B7FCA26C5C6C5C2A287EA7 +30>I<90381FFC1E48B5129F000714FF5A5A5A387FF007EB800100FEC7FC4880A46C143E +007F91C7FC13E06CB4FC6C13FC6CEBFF806C14E0000114F86C6C7F01037F9038000FFF02 +001380007C147F00FEEC1FC0A2150F7EA27F151F6DEB3F806D137F9039FC03FF0090B6FC +5D5D00FC14F0D8F83F13C026780FFEC7FC222A79A830>I<EB0780497E131FA9003FB612 +E04815F0B7FCA36C15E026001FC0C7FCB216F8ED01FCA5ECE003010FEB07F814F09138FC +1FF06DB512E06D14C016806D14009038007FFCEC1FF026337EB130>I<D83FFCEB3FFC48 +6C497E00FF14FFA2007F147F003F143F00001400B3A41501A2150315076D130F903A7FC0 +7FFFF891B612FC6D15FE7F6D4913FC6D9038F87FF8010001C0C7FC2F2880A630>I<3B3F +FFC07FFF80486DB512C0B515E0A26C16C06C496C13803B01F80003F000A26D130700005D +A26D130F017E5CA2017F131F6D5CA2EC803F011F91C7FCA26E5A010F137EA2ECE0FE0107 +5BA214F101035BA3903801FBF0A314FF6D5BA36E5A6E5A2B277EA630>I<3B3FFFC01FFF +E0486D4813F0B515F8A26C16F06C496C13E0D807E0C7EA3F00A26D5C0003157EA56D14FE +00015DEC0F80EC1FC0EC3FE0A33A00FC7FF1F8A2147DA2ECFDF9017C5C14F8A3017E13FB +A290393FF07FE0A3ECE03FA2011F5C90390F800F802D277FA630>I<3A3FFF81FFFC4801 +C37FB580A26C5D6C01815BC648C66CC7FC137FEC80FE90383F81FC90381FC3F8EB0FE3EC +E7F06DB45A6D5B7F6D5B92C8FC147E147F5C497F81903803F7E0EB07E790380FE3F0ECC1 +F890381F81FC90383F80FE90387F007E017E137F01FE6D7E48486D7E267FFF80B5FCB500 +C1148014E3A214C16C0180140029277DA630>I<3B3FFFC07FFF80486DB512C0B515E0A2 +6C16C06C496C13803B01FC0003F000A2000014076D5C137E150F017F5C7F151FD91F805B +A214C0010F49C7FCA214E00107137EA2EB03F0157C15FCEB01F85DA2EB00F9ECFDF0147D +147FA26E5AA36E5AA35DA2143F92C8FCA25C147EA2000F13FE486C5AEA3FC1EBC3F81387 +EB8FF0EBFFE06C5B5C6C90C9FC6C5AEA01F02B3C7EA630>I<001FB612FC4815FE5AA316 +FC90C7EA0FF8ED1FF0ED3FE0ED7FC0EDFF80003E491300C7485A4A5A4A5A4A5A4A5A4A5A +4A5A4990C7FC495A495A495A495A495A495A4948133E4890C7127F485A485A485A485A48 +5A48B7FCB8FCA46C15FE28277DA630>I<ED3FF0913803FFF8140F5C147F16F09138FFF0 +0092C7FC495A5CB3A21303495A133F383FFFF0B55A5C91C8FC14C080003F7F38003FF813 +076D7E1301B3A2806D7E15F091387FFFF016F8141F8014039138003FF025477BBE30>I< +127CA212FEB3B3B3AD127CA207476CBE30>I<EA7FE0EAFFFE6D7E8014F07EC66C7E1307 +6D7E1301B3A2806D7E15E091387FFFE06E13F8801407141F5C4A13E09138FFE00092C7FC +495A5CB3A21303495A137F387FFFF0B5FC14C05C49C8FCEA7FE025477BBE30>I<017C13 +3848B4137C48EB80FE4813C14813C348EBEFFC397FEFFFF0D8FF8713E0010713C0486C13 +80D87C0113003838007C1F0C78B730>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fk cmbx12 14.4 49 +/Fk 49 122 df<EEFFFC031FEBFF804AB612E0020781021F9038C00FF8913A7FFE0003FC +DAFFF0EB00FE4949EB03FF4901805B4990C7487F49485CA2495A4D7F013F6F5B5CA37190 +C7FC715AEF01F894C9FCA90403B512C0BAFCA526003FFCC7120783B3B3A6003FB5D8FC03 +B612C0A542547DD34B>12 D<B712F0AB240B7F9F2D>45 D<EA07F0487E487E487E487EB5 +1280A76C13006C5A6C5A6C5A6C5A1111769025>I<157815FC14031407141F14FF130F00 +07B5FCB6FCA2147F13F0EAF800C7FCB3B3B3A6007FB712FEA52F4E76CD43>49 +D<EC3FFE0103B512E0010F14FC013F14FF90B712C048D9C07F7F2703FE000F13F8D807F8 +01037FD80FE06D7F48486D7F48488001F01680486C6E13C07F486C6E13E07FA27013F0A5 +6C5AA26C5AEA0FF0EA03C0C914E05EA218C05E1880A24C13005F4C5A4B5B5F4B5B5F4B5B +4B90C7FC4B5A5E4B5AED7FE04B5A4A5B4A48C8FC4A5A5D4A48EB01F04A5AEC3F804AC7FC +02FEEC03E0495A495A495A495AD91F80140749C8FC013E150F017FB7FC90B812C05A5A5A +5A5A5A5AB9FC1880A4344E79CD43>I<91380FFFC091B512FC0107ECFF80011F15E09026 +3FF8077F9026FF800113FC4848C76C7ED803F86E7E491680D807FC8048B416C080486D15 +E0A4805CA36C17C06C5B6C90C75AD801FC1680C9FC4C13005FA24C5A4B5B4B5B4B13C04B +5BDBFFFEC7FC91B512F816E016FCEEFF80DA000713E0030113F89238007FFE707E701380 +7013C018E07013F0A218F8A27013FCA218FEA2EA03E0EA0FF8487E487E487EB57EA318FC +A25E18F891C7FC6C17F0495C6C4816E001F04A13C06C484A1380D80FF84A13006CB44A5A +6CD9F0075BC690B612F06D5D011F1580010302FCC7FCD9001F1380374F7ACD43>I<177C +17FEA2160116031607160FA2161F163F167FA216FF5D5DA25D5DED1FBFED3F3F153E157C +15FCEC01F815F0EC03E01407EC0FC01580EC1F005C147E147C5C1301495A495A5C495A13 +1F49C7FC133E5B13FC485A5B485A1207485A485A90C8FC123E127E5ABA12C0A5C96C48C7 +FCAF020FB712C0A53A4F7CCE43>I<D80380150ED807E0157E01FEEC03FED9FFF0137F91 +B65A5F5F5F5F5F94C7FC5E5E16F016C093C8FC15F801E190C9FC01E0CAFCABEC0FFF027F +13F001E3B512FE01E76E7E9026FFF8077FDAC0017F49C713F8496E7E49143F4981496E7E +6C481680C9FC18C08218E0A418F0A3EA0FE0487E487E487E487EA418E0A35B6C484A13C0 +5B491680003EC85A003F17006C6C4A5A6D5D6C6C4A5AD807F8495BD803FE01075B2701FF +C03F5B6C90B65A013F4AC7FC6D14F8010314C09026007FF8C8FC344F79CD43>I<ED0FFF +92B512E0020780021F14FC91397FFE03FE903A01FFF0007F4901C0EB3F804990C7121F49 +48EC7FC0494814FF49484913E049485B01FF5C485BA2485B5AA2486F13C04A6D1380486F +1300177E94C7FC5AA291CAFC5AA21508913801FFF8020713FFB54814C04A14F04AC66C7E +023C6D7E4A6D7E4A6D7E7013804A15C0A24A15E07013F05C18F8A491C714FCA37EA67EA4 +6C17F880A27E18F06C5D18E06C6D15C07E6E4913806C6D15006D6C495A6D6CEB7FFC6DB4 +48485A6D90B55A010315C0010092C7FC023F13FC020713C0364F7ACD43>I<121F7F7FEB +FF8091B81280A45A1900606060A2606060485F0180C86CC7FC007EC95A4C5A007C4B5A5F +4C5A160F4C5A484B5A4C5A94C8FC16FEC812014B5A5E4B5A150F4B5AA24B5AA24B5A15FF +A24A90C9FCA25C5D1407A2140FA25D141FA2143FA4147F5DA314FFA55BAC6D5BA2EC3FC0 +6E5A395279D043>I<913807FFC0027F13FC0103B67E010F15E090261FFC0113F8903A3F +E0003FFCD97F80EB0FFE49C76C7E48488048486E1380000717C04980120F18E0177FA212 +1F7FA27F7F6E14FF02E015C014F802FE4913806C7FDBC00313009238F007FE6C02F85B92 +38FE1FF86C9138FFBFF06CEDFFE017806C4BC7FC6D806D81010F15E06D81010115FC0107 +81011F81491680EBFFE748018115C048D9007F14E04848011F14F048487F484813030300 +14F8484880161F4848020713FC1601824848157F173FA2171FA2170FA218F8A27F007F17 +F06D151FA26C6CED3FE0001F17C06D157F6C6CEDFF806C6C6C010313006C01E0EB0FFE6C +01FCEBFFFC6C6CB612F06D5D010F1580010102FCC7FCD9000F13C0364F7ACD43>I<9138 +0FFF8091B512F8010314FE010F6E7E4901037F90267FF8007F4948EB3FF048496D7E4849 +80486F7E484980824817805A91C714C05A7013E0A218F0B5FCA318F8A618FCA46C5DA37E +A25E6C7F6C5DA26C5D6C7F6C6D137B6C6D13F390387FF803011FB512E36D14C301030283 +13F89039007FFE03EC00401500A218F05EA3D801F816E0487E486C16C0487E486D491380 +A218005E5F4C5A91C7FC6C484A5A494A5A49495B6C48495BD803FC010F5B9027FF807FFE +C7FC6C90B55A6C6C14F06D14C0010F49C8FC010013F0364F7ACD43>I<91B5FC010F14F8 +017F14FF90B712C00003D9C00F7F2707FC00017FD80FE06D7F48486E7E48C87FD87FE06E +7E7F7F486C1680A66C5A18006C485C6C5AC9485A5F4B5B4B5B4B5B4B5B4B90C7FC16FC4B +5A4B5A16C04B5A93C8FC4A5A5D14035D5D14075DA25D140FA25DAB91CAFCAAEC1FC04A7E +ECFFF8497FA2497FA76D5BA26D5BEC3FE06E5A315479D340>63 D<BA7E19FCF1FF801AF0 +1AFCD8000701F0C7000F13FF060014C0071F7F070713F807017F737F747E747F747F8674 +7F747F8886888688A2757EA31D8087A21DC0A51DE0A387A963A31DC0A51D80A2631D00A3 +515AA2646264505B6264505B505B5090C7FCF2FFFE4F5B07075B071F5B96B512C0060F91 +C8FCBB5A1AF01AC007FCC9FC19805B527CD167>68 D<BC1280A5D8000701F8C7000114C0 +F0001F19071901851A7F1A3F1A1FA2F20FE0A21A07A31A03A318F81BF01A01A497C7FC17 +01A317031707170F177F92B6FCA59238F8007F170F170717031701A317001B3EA31B7CA3 +95C8FCA21BFCA21BF8A21A01A31A031BF01A071A0FA21A1F1A3FF27FE0F101FF1907191F +0603B5FCBCFCA21BC0A34F517CD058>I<BB12FEA5D8000701F8C700077FF0007F191F19 +0785858586861B80A21A1FA31A0FA41BC006F81307A497C7FCA31701A317031707170F17 +7F92B6FCA59238F8007F170F170717031701A31700A795C9FCB3B812F8A54A517CD055> +I<B8D8C003B8FCA5D8000701F8C9001FEBE000B3AE92BAFCA503F8C9121FB3B1B8D8C003 +B8FCA560527CD169>72 D<B812C0A5D8000701F8C7FCB3B3B3B2B812C0A52A527CD132> +I<027FB71280A591C76C90C7FCB3B3B3EA07F0EA1FFC487E487EA2B57EA44C5AA34A485B +7E49495BD83FF8495BD81FE05DD80FFC011F5B2707FF807F90C8FC000190B512FC6C6C14 +F0011F14C0010101F8C9FC39537DD145>I<B812F8A5D8000701F8CAFCB3B3A91A7CA41A +FC1AF8A51901A31903A219071AF0190FA2191F193F197F19FF180360183F4DB5FCBB12E0 +A546527CD151>76 D<B600FC073FB512FE6F61A26F96B6FCA2D80007F5C00070EF01EFA2 +02EF6DEF03CFA202E76DEF078FA202E36DEF0F0FA202E16D171EA302E06D173CA26F6C17 +78A26F6C17F0A26F6DED01E0A26F6DED03C0A36F6DED0780A26F6DED0F00A26F6D151EA2 +6F6D5DA3706C5DA2706C5DA2706D495AA2706D495AA2706D495AA3706D49C7FCA2706D13 +1EA2706D5BA2716C5BA3716C5BA271EB81E0A271EBC3C0A271EBE780A27101FFC8FCA371 +5BA2715BA2725AA2725AA2D93FFC6F5AB74DB712FEA2725AA2725A77527CD180>I<BAFC +19F819FF1AE086D8000701F0C7001F13FC060113FF726C13807313C0070F13E01BF08573 +13F81BFCA27313FEA41BFFA81BFEA31BFC61A21BF84F13F04F13E0614F13C04F13004E48 +5A061F5B92B812F01AC04FC7FC19E003F8CBFCB3AEB812C0A550527CD15C>80 +D<B912F0F0FF8019F819FF1AC0D8000701F0C714F0060F7F060113FE727F737F737F8573 +7F87A2737FA387A863A2616363A24F5B4F5B4F90C8FC4F5A06035B060F13F095B512C092 +B8C9FC19F819E019F89226F0000313FE9439007FFF80727F727F727F727F727F8684A286 +84A787A71D1C75133EA38575137E73157C7513FC731401B86C6D9038F803F807039038FE +07F07390B512E0736C14C0080F1400CEEA7FFC5F537CD164>82 D<91260FFF80130791B5 +00F85B010702FF5B011FEDC03F49EDF07F9026FFFC006D5A4801E0EB0FFD4801800101B5 +FC4848C87E48488149150F001F824981123F4981007F82A28412FF84A27FA26D82A27F7F +6D93C7FC14C06C13F014FF15F86CECFF8016FC6CEDFFC017F06C16FC6C16FF6C17C06C83 +6C836D826D82010F821303010082021F16801400030F15C0ED007F040714E01600173F05 +0F13F08383A200788200F882A3187FA27EA219E07EA26CEFFFC0A27F6D4B13806D17006D +5D01FC4B5A01FF4B5A02C04A5A02F8EC7FF0903B1FFFC003FFE0486C90B65AD8FC0393C7 +FC48C66C14FC48010F14F048D9007F90C8FC3C5479D24B>I<003FBC1280A59126C0003F +9038C0007F49C71607D87FF8060113C001E08449197F49193F90C8171FA2007E1A0FA300 +7C1A07A500FC1BE0481A03A6C994C7FCB3B3AC91B912F0A553517BD05E>I<B800C00103 +B612FCA5D8000701F8CAEBF000F31F80B3B3B11B3FA26D97C7FC81637F1B7E6D6D17FE50 +5A6E7E505A6E6D15076E4D5A6E6D4B5A6E6D4B5A6E01F84B5A6E6DDA03FFC8FC6E6CB46C +EB0FFE6F9039F001FFF8030F90B65A030316C0DB007F92C9FC040F14F8DC007F13805E53 +7CD167>I<B700FC017FB600FE91B612F0A5D8003F01C0C8001F01E0C9EBF8006F71EE0F +C06D7161876F1C1F6D7196C7FC6F8373606D1E3E6F836D7160876F1CFC6D666F4B801F01 +6D66704A806E525A88704A17076E059F5F70021F80080F160F6E6570023F806EDC3E074C +C8FC8870027E5F6EDC7C03163E7002FC804F6C167E6E1C7C700101814F6C16FC6E745B70 +010317016E4C6D5D060716C00580496D14036F63DDC00F16E04F6D14076F07F05BDDE01F +170F6F92C76C5D1DF8DDF03E6E141F6F98C9FCDDF87E16FC067C6E5C6FF1FE3EDDFCFC17 +7E6F4A6E147C1DFFDDFFF06E14FC6F62A24E816F62A270496F5BA24E817061A295C97E70 +61A270487090CAFCA37048705AA24D1601040360A27048705A84537DD18B>87 +D<EC7FFF0107B512F0013F14FE90B77E48D9E00F7F2703FE000113F0486C6D7F6EEB3FFC +48826E131F83707FA36C496D7FA26C90C7FC6C5AC9FCA6037FB5FC020FB6FC91B7FC0107 +1487013FEBF0074913803901FFFC004813F0485B485B485B4890C7FC5A5BA2485AA45EA2 +6D5C007F151D163D6C6C02797F6C6D01F113F86C9026C003E1EBFFE06C9026F81FC014F0 +6C90B5487EC6ED001F011F01FC010713E0010101E090C8FC3C387CB641>97 +D<EB3FF0B5FCA51203C6FCB3A4923801FFE0030F13FE033FEBFFC092B612F002F301017F +913AF7F8003FFEDAFFE0EB0FFF03806D7F92C76C7F4A6E7F4A824A6E7FA2727EA285A285 +84A31A80AC1A00A44E5AA36118FF616E4A5BA26E4A5B6E4A5B6F495BDACFC04990C7FCDA +87F0EB7FFC913A03FE03FFF849C6B612E0496D148049011F01FCC8FC90C7000313C04154 +7BD24B>I<913801FFF8021FEBFF8091B612F0010315FC010F9038C00FFE903A1FFE0001 +FFD97FFC491380D9FFF05B4817C048495B5C5A485BA2486F138091C7FC486F1300705A48 +92C8FC5BA312FFAD127F7FA27EA2EF03E06C7F17076C6D15C07E6E140F6CEE1F806C6DEC +3F006C6D147ED97FFE5C6D6CEB03F8010F9038E01FF0010390B55A01001580023F49C7FC +020113E033387CB63C>I<4DB47E0407B5FCA5EE001F1707B3A4913801FFE0021F13FC91 +B6FC010315C7010F9038E03FE74990380007F7D97FFC0101B5FC49487F4849143F484980 +485B83485B5A91C8FC5AA3485AA412FFAC127FA36C7EA37EA26C7F5F6C6D5C7E6C6D5C6C +6D49B5FC6D6C4914E0D93FFED90FEFEBFF80903A0FFFC07FCF6D90B5128F0101ECFE0FD9 +003F13F8020301C049C7FC41547CD24B>I<913803FFC0023F13FC49B6FC010715C04901 +817F903A3FFC007FF849486D7E49486D7E4849130F48496D7E48178048497F18C0488191 +C7FC4817E0A248815B18F0A212FFA490B8FCA318E049CAFCA6127FA27F7EA218E06CEE01 +F06E14037E6C6DEC07E0A26C6DEC0FC06C6D141F6C6DEC3F806D6CECFF00D91FFEEB03FE +903A0FFFC03FF8010390B55A010015C0021F49C7FC020113F034387CB63D>I<ED3FFC02 +03B5FC020F14C0023F14E09139FFF81FF0499038C03FF849EB807F49903800FFFC495A49 +5AA2495AA2EE7FF8495AEE3FF0EE0FC093C7FCAEB712E0A526007FF8C8FCB3B3A7007FB5 +12FEA52E547CD329>I<DA3FFF14FF0103B5D8F00713C0010FDAFC1F13E0013FECFF7F90 +267FFC0F9038FF9FF09026FFE001EBF83F48496C13E0484990387FF01F4890C7D83FF813 +E0489338FC0FC0F0078048486E6CC7FCA2003F82A9001F5EA26C6C4A5AA26C5E6C6D495A +6C6D495A6C6D485BDAFC0F5B4890B6C8FCD803EF14FC01C314F02607C03F90C9FC91CBFC +A2120FA37FA213F813FE90B7FC6C16F817FF18C06C836C836C836D828448B9FC12074848 +C700031480D81FF8EC003F4848150748486F13C083485A83A56D5D007F18806D5D003F18 +006C6C4B5AD80FFEED1FFC6C6C6CEC7FF86C01E049485A6C01FE011F5B6C6CB71280010F +03FCC7FC010115E0D9000F01FCC8FC3C4F7CB543>I<EB3FF0B5FCA51203C6FCB3A4EE1F +FC93B512C0030314F0030F8092391FE07FFC92393F001FFE037C8003F07FDAF1E081ECF3 +C0DAF7807F8502FFC7FC5CA25CA45CB3ACB6D8F807B612C0A542537BD24B>I<137F497E +000313E0487FA2487FA76C5BA26C5BC613806DC7FC90C8FCADEB3FF0B5FCA512017EB3B3 +A6B612E0A51B547BD325>I<EB3FF0B5FCA51203C6FCB3A54CB512F8A59339003FFE00EF +1FF0EF3FC04D5A4DC7FCEE03FEEE07F84C5A4C5AEE7FC04CC8FC4B5A4B5AED0FF8ED1FE0 +4B7E4B7EECF1FF02F37F02F77F91B6FC83159F030F7F02FE80DAF8077F4A7E6F7F6F7F83 +707E82707F84707F707F82707F84707F177F717E4D13C0B6D8F003B6FCA540537CD247> +107 D<EB3FF0B5FCA512017EB3B3B3B1B612F0A51C537BD225>I<D93FF0D91FFCEDFFE0 +B591B500C0010713FE030302F0011F6D7E030F6E017F8092271FE07FFCD9FF037F922A3F +001FFE01F8007F0003027C9126FF03E080C602F06DD90780137FDAF1E0038FC77FDAF3C0 +159EDAF7806D01BC143F07FC8102FFC75C4A5EA24A5EA44A5EB3ACB6D8F807B6D8C03FB5 +12FEA567367BB570>I<D93FF0EB1FFCB591B512C0030314F0030F8092391FE07FFC9239 +3F001FFE0003027C80C602F07FDAF1E081ECF3C0DAF7807F8502FFC7FC5CA25CA45CB3AC +B6D8F807B612C0A542367BB54B>I<913801FFE0021F13FE91B612C0010315F0010F9038 +807FFC903A1FFC000FFED97FF86D6C7E49486D7F48496D7F48496D7F4A147F48834890C8 +6C7EA24883A248486F7EA3007F1880A400FF18C0AC007F1880A3003F18006D5DA26C5FA2 +6C5F6E147F6C5F6C6D4A5A6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0FFF80 +7FFC6D90B55A010015C0023F91C8FC020113E03A387CB643>I<903A3FF001FFE0B5010F +13FE033FEBFFC092B612F002F301017F913AF7F8007FFE0003D9FFE0EB1FFFC602806D7F +92C76C7F4A824A6E7F4A6E7FA2717FA285187F85A4721380AC1A0060A36118FFA2615F61 +6E4A5BA26E4A5B6E4A5B6F495B6F4990C7FC03F0EBFFFC9126FBFE075B02F8B612E06F14 +80031F01FCC8FC030313C092CBFCB1B612F8A5414D7BB54B>I<90397FE003FEB590380F +FF80033F13E04B13F09238FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE78014EF +150014EE02FEEB3FFC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>114 +D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307D81FE0130148487F4980 +127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15F06C +816C816C81C681013F1580010F15C01300020714E0EC003F030713F015010078EC007F00 +F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE9039FF +C00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB635>I<143EA6147EA414 +FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3A9EE +07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B0203 +13802A4D7ECB34>I<D93FF8913801FFC0B50207B5FCA50003ED001FC61607B3AE5FA35F +A2017F5D173B177B6D6C14F3DC01E313F06D6CD907C3EBFFC0903A0FFFC03F836D90B512 +03010114FE6D6C13F8020701E091C7FC42377BB54B>I<B600F00107B5FCA5000101F8C8 +EA7FE06C6DED3F00A2017F163E6E157E013F167C6E15FC6D5E6F13016D5E8117036D5E6F +13076D5E6F130F6D5E6F131F6D93C7FC815F6E6C133E177E023F147C6F13FC6E5C16816E +5C16C3A26EEBE3E016E76E5C16FF6E5CA26E91C8FCA26F5AA36F5AA26F5AA26F5AA26F5A +6F5A40367DB447>I<B6D8E07FB5D8C003B512C0A5000101F0C701F0C7381FF8006E027F +ED07E06C715DA26E023F150F017F705DA26E181F013F4B6C92C7FC6E606D70143E94B5FC +6F177E6D4A6E137C03C001F315FC6D715B160303E001E114016D020702E05B03F013C06D +71485A160F03F8D9807F13076D05F85B93381F003F03FC160F027F4902FC5BDBFE3E011F +131F023F04FE90C8FC167EDBFF7C010F5B6E01FCECFF3E4C6D137E6E5FA24C7F6E5F4C7F +6E5FA24C7F6E5F4C147FA26E5F93C8123F6F5EA2033E6FC9FC5A367DB461>I<B600F001 +07B5FCA5C601F8C8EA7FE06EED3F00A26D6C153E187E013F167C6E15FC6D5E6F13016D5E +6F13036D5E8117076D6D5C170F6D6D5C171F6D93C7FC6F5B027F143E6F137E023F147C6F +13FCA26E6D5A16816EEBC1F016C36E5C16E76E5C16FF6E5CA26E91C8FCA36F5AA26F5AA2 +6F5AA26F5AA26F5AA35E150F5E151F93C9FC5DD81FC0133E486C137E486C137C486C13FC +5D14015D14034A5A6C48485A49485A263FC07FCAFCEB81FE6CB45A6C13F000035BC690CB +FC404D7DB447>121 D E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fl cmr10 10.95 86 +/Fl 86 124 df<4AB4EB0FE0021F9038E03FFC913A7F00F8FC1ED901FC90383FF03FD907 +F090397FE07F80494801FF13FF4948485BD93F805C137F0200ED7F00EF003E01FE6D91C7 +FC82ADB97EA3C648C76CC8FCB3AE486C4A7E007FD9FC3FEBFF80A339407FBF35>11 +D<4AB4FC021F13C091387F01F0903901FC0078D907F0131C4948133E494813FF49485A13 +7F1400A213FE6F5A163893C7FCAA167FB8FCA33900FE00018182B3AC486CECFF80007FD9 +FC3F13FEA32F407FBF33>I<4AB47E021F13F791387F00FFEB01F8903807F001EB0FE0EB +1FC0EB3F80137F14008101FE80AEB8FCA3C648C77EB3AE486CECFF80007FD9FC3F13FEA3 +2F407FBF33>I<4AB4ECFF80021FD9C00F13E0913B7F01F03F80F8903C01F80078FE003C +D907F0D93FF8130E49484948131F49484948EB7F804948484913FF137F02005CA201FE92 +C7FC6FED7F0070141C96C7FCAAF13F80BBFCA3C648C76CC7FC197F193FB3AC486C4A6CEB +7FC0007FD9FC3FD9FE1FB5FCA348407FBF4C>I<121EEA7F80EAFFC0A9EA7F80ACEA3F00 +AC121EAB120CC7FCA8121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A4179C019>33 +D<001E130F397F803FC000FF137F01C013E0A201E013F0A3007F133F391E600F30000013 +00A401E01370491360A3000114E04913C00003130101001380481303000EEB070048130E +0018130C0038131C003013181C1C7DBE2D>I<013F4C7ED9FFC04B7E2601E0E015072607 +C070150F48486C4B5A023E4BC7FC48486C5D48D90FC0EB01FE003ED90EF0EB07FCDA0F3F +133E007E903A070FFFF8F8007C0200EBC1F0EE000300FC6D6C495A604D5A171F95C8FC17 +3E177E177C5F16015F007C4948485A1607007E5E003E49495A020E131F003F93C9FC6C49 +133E260F803C137E0238137C6C6C485B3901E0E0016CB448485AD93F0049133F90C74848 +EBFFC0030F903801E0E093398007C0704B4848487E4B153C033E90381F001C4B497F03FC +133E4B150F4A48017E7F0203147C5D4A4801FCEB0380140F5D4AC7FC5C143E5C14FC5C49 +5A13034948027CEB07005C4948147E011F033E5B91C8140E013E153F017E6F5B017C9238 +0F803C4917380001706C5A49923801E0E0496FB45A6C48043FC7FC41497BC34C>37 +D<EC0FC0EC3FF0ECF878903801F01CEB03E049487E130FEC800F011F7FA2EB3F00A5EC80 +0EA25DA25DA25D6D6C5AECC1C0A2ECC38002E7C7387FFFFCEB0FEE14FC4A020713C06D48 +913801FE006E5DEF00F06D7E4D5A496C5D010F1503D91DFF4A5A013893C7FC496C6C5B01 +E0150E48486C6C131E00036E131C2607801F143C000F6E5B001F6D6C1370263F000714F0 +6F485A48D903FE5B913801FF03486D495A0487C8FCED7FCFED3FFE6F4814386D6D5AA200 +7F6E6C14786D6D6C14704B6C14F06C6C496C6C13E0001F91393E3FC0016C6C903AFC1FF0 +03C03D07FC07F007FC1F800001B5D8C001B512006C6C90C7EA7FFCD90FF8EC0FF03E437C +C047>I<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113801203 +13005A120E5A1218123812300B1C79BE19>I<1430147014E0EB01C0EB03801307EB0F00 +131E133E133C5B13F85B12015B1203A2485AA2120F5BA2121F90C7FCA25AA3123E127EA6 +127C12FCB2127C127EA6123E123FA37EA27F120FA27F1207A26C7EA212017F12007F1378 +7F133E131E7FEB07801303EB01C0EB00E014701430145A77C323>I<12C07E12707E7E12 +1E7E6C7E7F12036C7E7F12007F1378137CA27FA2133F7FA21480130FA214C0A3130714E0 +A6130314F0B214E01307A614C0130FA31480A2131F1400A25B133EA25BA2137813F85B12 +015B485A12075B48C7FC121E121C5A5A5A5A145A7BC323>I<EB03C0A2805CA600F0140F +00FC143F00FE147F00FF14FF393FC3C3FC390FE187F03903F18FC03900FDBF00EB3FFCEB +0FF0EB03C0EB0FF0EB3FFCEBFDBF3903F18FC0390FE187F0393FC3C3FC39FF03C0FF00FE +147F00FC143F00F0140F00001400A6805CA220277AC32D>I<121EEA7F8012FF13C0A213 +E0A3127FEA1E601200A413E013C0A312011380120313005A120E5A1218123812300B1C79 +8919>44 D<B512FEA617067F961E>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A79 +8919>I<ED0180ED03C01507A21680150FA216005DA2151E153EA2153C157CA2157815F8 +A25D1401A25D1403A25D1407A25D140FA24AC7FCA2141E143EA2143C147CA2147814F8A2 +5C1301A25C1303A25C1307A25C130FA291C8FC5BA2131E133EA25BA2137813F8A25B1201 +A25B1203A25B1207A25B120FA290C9FC5AA2121E123EA2123C127CA2127812F8A25A1260 +225B7BC32D>I<EB01FE90380FFFC090383F03F090387C00F849137C48487F48487F4848 +EB0F80A2000F15C04848EB07E0A3003F15F0A290C712034815F8A64815FCB3A26C15F8A5 +6C6CEB07F0A3001F15E0A36C6CEB0FC0A26C6CEB1F80000315006C6C133E6C6C5B017C5B +90383F03F090380FFFC0D901FEC7FC263F7DBC2D>I<EB01C013031307131F137FEA07FF +B5FC139FEAF81F1200B3B3ACEB7FF0B612F8A31D3D78BC2D>I<EB07FC90383FFF8090B5 +12E03903F01FF83907C007FC390F0001FE001E6D7E001C1580003CEC7FC05AED3FE01270 +B4FC6DEB1FF07FA56C5A6CC7FC120CC813E0153FA216C0157F168015FF16004A5A5D4A5A +4A5A5D4A5A4A5A4AC7FC147E147C5C495A495A495A495A49C71270133E133C5B4914E048 +5A485A485A48C7120148B6FCA25A4815C0B7FCA3243D7CBC2D>I<EB07FC90383FFF8090 +38F80FE03901E003F839078001FCD80F007F000E6D7E001E1580D81F80137F486C14C07F +A27F5BA2121F6C5AC8138015FF1600A24A5AA24A5A5DEC07E04A5A023FC7FCEB1FFCECFF +809038000FE0EC07F86E7E6E7E6E7E1680ED7FC0A216E0153FA216F0A2120C123F487E48 +7EA316E0A249137F6CC713C01278EDFF807E6C4913006C495A3907C007FC3903F80FF0C6 +B55A013F1380D907F8C7FC243F7CBC2D>I<150E151E153EA2157EA215FE1401A21403EC +077E1406140E141CA214381470A214E0EB01C0A2EB0380EB0700A2130E5BA25B5BA25B5B +1201485A90C7FC5A120E120C121C5AA25A5AB8FCA3C8EAFE00AC4A7E49B6FCA3283E7EBD +2D>I<00061403D80780131F01F813FE90B5FC5D5D5D15C092C7FC14FCEB3FE090C9FCAC +EB01FE90380FFF8090383E03E090387001F8496C7E49137E497F90C713800006141FC813 +C0A216E0150FA316F0A3120C127F7F12FFA416E090C7121F12FC007015C012780038EC3F +80123C6CEC7F00001F14FE6C6C485A6C6C485A3903F80FE0C6B55A013F90C7FCEB07F824 +3F7CBC2D>I<EC1FE0ECFFF8903803F03E90380FC00F90391F000780133E017EEB1FC049 +133F4848137F12035B12074848EB3F80ED1F00001F91C7FC5BA2123FA3485AA214FE9038 +87FF8039FF8F07E090389C01F09038B800FC01B0137E13F0497F16804914C0A2ED1FE0A3 +4914F0A5127FA6123F6D14E0A2121FED3FC0A26C6C1480A20007EC7F006C6C137E6C6C5B +6C6C485A90387E07F06DB45A010F1380D903FCC7FC243F7CBC2D>I<1238123C123F90B6 +12FCA316F85A16F016E00078C712010070EC03C0ED078016005D48141E151C153C5DC812 +7015F04A5A5D14034A5A92C7FC5C141EA25CA2147C147814F8A213015C1303A31307A313 +0F5CA2131FA6133FAA6D5A0107C8FC26407BBD2D>I<EB03FC90381FFF8090387C07E090 +38F001F83901E0007C48487F48487F48C7FCED0F80121E16C0003E1407A4123FA26DEB0F +807F6C6C131F6D140001FC133E6C6C5B9038FF80786C6D5A6CEBF3E06CEBFF806C91C7FC +133F6D13C06D7F013F13F801787F48486C7E3903E01FFF48486C1380260F800313C04848 +7E489038007FE0003E143F007E141F007CEC0FF01507481403A31501A46C15E0007C1403 +A2007E15C06C14076CEC0F806DEB1F006C6C133ED807F05B3901FC03F86CB512E0011F13 +80D903FCC7FC243F7CBC2D>I<EB03FCEB1FFF90387E07C09038FC03F048486C7E48486C +7E4848137C000F147E4848137F81003F15805B007F15C0A2151F12FF16E0A516F0A5127F +153FA36C7EA2001F147F120F6C6C13FF6D13DF000313013900F8039F90387E0F1FD91FFE +13E0EB07F090C7FCA2ED3FC0A41680157FD80F801400487E486C13FEA24A5A5D49485AEB +8007391E000FE0001F495A260FC07FC7FC3803FFFE6C13F838003FC0243F7CBC2D>I<12 +1EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121EEA7F80A2EAFFC0A4EA7F80A2EA1E00 +0A2779A619>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121E127FEAFF80A213 +C0A4127F121E1200A412011380A3120313005A1206120E120C121C5A1230A20A3979A619 +>I<007FB912E0BA12F0A26C18E0CDFCAE007FB912E0BA12F0A26C18E03C167BA147>61 +D<EB1FF890B5FC3903E01FC0390F0007F0001EEB03F848EB01FC4814FE140000FE14FF7E +7FA46CC7FC123EC7EA01FEA2EC03FCEC07F815F0EC0FC0EC1F80EC3F00143E5C147814F8 +5C13015CA2495AA25CAB91C7FC90C8FCA8EB0780EB1FE0A2497EA46D5AA2EB078020407B +BF2B>63 D<15074B7EA34B7EA34B7EA34B7EA34B7E15E7A2913801C7FC15C3A291380381 +FEA34AC67EA3020E6D7EA34A6D7EA34A6D7EA34A6D7EA34A6D7EA349486D7E91B6FCA249 +819138800001A249C87EA24982010E157FA2011E82011C153FA2013C820138151FA20178 +82170F13FC00034C7ED80FFF4B7EB500F0010FB512F8A33D417DC044>65 +D<B712FCEEFF8017F00001903980000FF86C6CC7EA03FE707E701380EF7FC0EF3FE0A2EF +1FF0A218F8A3170F171FA318F0A2EF3FE0177F18C0EFFF804C1300EE03FCEE0FF8EE7FE0 +91B6C7FC17E091C7EA07FCEE01FE933800FF80EF7FC0EF3FE0EF1FF018F8170F18FC1707 +A218FEA718FC170FA2EF1FF818F0173FEF7FE0EFFFC00403138048486C90380FFE00B85A +17E094C7FC373E7DBD40>I<DB3FF01306912603FFFE130E020F9038FF801E913A3FF007 +E03E9139FF8000F8D903FEC7EA7C7ED907F8EC1EFE4948140FD93FE0140749481403495A +91C812014848150012034848167E5B000F173EA24848161EA2123F5B180E127FA3491600 +12FFAC127F7F180EA2123FA27F001F171E181C6C7EA20007173C6D16386C6C1678000117 +706C6C16F06EEC01E06D6C15C06D6C1403D90FF0EC07806D6CEC1F00D903FE143E902600 +FF8013F891393FF007F0020FB512C0020391C7FC9138003FF037427BBF42>I<B712FCEE +FF8017E000019039C0001FF86C6C48EB03FEEE00FF717E717EEF0FE084717E717E170184 +717EA21980187F19C0A3F03FE0A519F0AB19E0A5F07FC0A21980A218FF19004D5AA24D5A +6017074D5A4D5AEF7FC04DC7FCEE03FE48486CEB1FF8B85A178004FCC8FC3C3E7DBD45> +I<B912E0A300019038C000016C6C48EB001FEF0FF01703A217011700A31870A41838161C +A41800A2163CA2167C16FC150391B5FCA3EC80031500167C163CA2161CA21807A3180E93 +C7FCA4181E181CA2183CA2187CA218F8170117031707171F48486CEB01FFB912F0A3383E +7DBD3E>I<B91280A300019038C000036C6C48EB007FEF1FC0170F1707A21703A31701A4 +EF00E0A21638A31800A31678A216F81501150791B5FCA3EC8007150115001678A21638A6 +93C8FCAF3801FFE0B612F0A3333E7DBD3B>I<DB3FE0130C912603FFFE131C021F9038FF +803C913A7FF00FC07C9139FF0001F0D903FC90380078FC4948143DD91FE0141F4948140F +4948140701FF15034890C8FC491501485A000716005B000F177C5B001F173CA2485AA218 +1C127FA25B95C7FC12FFAB041FB512F0127FA26D9139000FFE00EF03FC123FA27F121FA2 +6C7EA212077F12036C7E7F6C7F6D6C14076D7E6D6C140FD907F8141ED903FEEC3C7C9026 +00FF80EBF83C913A7FF007F01C021FB5EAC00C020391C8FC9138003FF03C427BBF47>I< +B6D8C01FB512F8A3000101E0C7383FFC0026007F80EC0FF0B3A691B7FCA30280C7120FB3 +A92601FFE0EC3FFCB6D8C01FB512F8A33D3E7DBD44>I<B612F0A3C6EBF000EB3FC0B3B3 +B2EBFFF0B612F0A31C3E7EBD21>I<011FB512FCA3D9000713006E5A1401B3B3A6123FEA +7F80EAFFC0A44A5A1380D87F005B007C130700385C003C495A6C495A6C495A2603E07EC7 +FC3800FFF8EB3FC026407CBD2F>I<B600C090387FFFFCA3000101E0C7000F138026007F +80913807FE0018F818E0604D5A4DC7FC173E5F5F4C5A4C5A4C5A4C5A4CC8FC163E5E5E4B +5A4B5AED07804B7E151F4B7E4B7E15FF913881EFF8913883C7FCEC878791388F03FE9138 +9E01FF14BCDAF8007F4A6D7E5C4A6D7E4A6D7EA2707E707EA2707E707EA2707F717E8417 +3F717E717EA2717E848419802601FFE04A13C0B600C090B6FCA3403E7DBD47>I<B612F8 +A3000101E0C9FC38007F80B3B0EF0380A517071800A45FA35FA25F5F5F4C5A160748486C +133FB8FCA3313E7DBD39>I<B500C093383FFFF0A300016D93387FF800D8007F18E0D977 +F016EFA3D973F8ED01CFA2D971FCED038FA3D970FEED070FA26E150E80A26E6C141CA36E +6C1438A26E6C1470A36E6C14E0A26E6CEB01C0A36E6CEB0380A36E6CEB0700A2037F130E +A36F6C5AA26F6C5AA36F6C5AA25FED07F0A2923803F9C0A36FB45AA26F90C7FCA213F848 +6C147ED807FFEF3FF8B500F8013C011FB512F0A34C3E7DBD53>I<B56C91B512F88080D8 +007F030713006EEC01FC6E6E5A1870EB77FCEB73FEA2EB71FF01707FA26E7E6E7EA26E7E +6E7EA26E7E6E7EA26E7E6E7FA26F7E6F7EA26F7E6F7EA26F7E6F7EA26F7E6F1380A2EE7F +C0EE3FE0A2EE1FF0EE0FF8A2EE07FCEE03FEA2EE01FF7013F0A2177F173FA2171F170FA2 +170701F81503487ED807FF1501B500F81400A218703D3E7DBD44>I<ED7FE0913807FFFE +91391FC03F8091397E0007E04948EB03F8D907F0EB00FE4948147F49486E7E49486E7E49 +C86C7E01FE6F7E00018349150300038348486F7EA248486F7EA2001F188049167F003F18 +C0A3007F18E049163FA300FF18F0AC007F18E06D167FA4003F18C0A26C6CEEFF80A36C6C +4B1300A26C6C4B5A00035F6D150700015F6C6C4B5A6D5E6D6C4A5A6D6C4A5A6D6C4AC7FC +6D6C14FED901FCEB03F8D9007FEB0FE091391FC03F80912607FFFEC8FC9138007FE03C42 +7BBF47>I<B712F8EEFF8017E000019039C0003FF86C6C48EB07FCEE01FE707EEF7F80EF +3FC018E0A2EF1FF0A218F8A818F0A2EF3FE0A218C0EF7F80EFFF004C5AEE07FCEE3FF091 +B612C04CC7FC0280C9FCB3A73801FFE0B612C0A3353E7DBD3E>I<ED7FE0913807FFFE91 +391FC03F8091397F000FE0D901FCEB03F8D907F0EB00FE4948147F49486E7E49486E7E49 +C86C7E498248486F7E49150300038348486F7EA2000F834981001F1880A24848EE7FC0A3 +007F18E0A249163FA200FF18F0AC007F18E0A26D167FA3003F18C0A26C6CEEFF80A3000F +18006D5D0007DA0F805B6C6C90393FE003FCED70706C6C496C485A6C6C48486C485A017F +D9800E5BD93F819038061FC0D91FC19038073F80D90FE14AC7FCD907F1EB03FE902601FD +C013F8903A007EE007E091271FF03FC013180207B5FC9139007FE1E0DB00011438837113 +78A2706C13F0EFFF0318FFA27113E0A37113C0711380711300715AEF01F83D527BBF47> +I<B712C016FCEEFF800001D9C00013E06C6C48EB1FF0EE07FCEE01FE707E84717EA2717E +A284A760177F606017FF95C7FCEE01FCEE07F8EE1FE0EEFF8091B500FCC8FC16F0913880 +01FCED003FEE1FC0707E707E83160383160183A383A484A4F0C004190EA28218E0057F13 +1E2601FFE0161CB600C0EB3FF094381FF83805071370CA3801FFE09438003F803F407DBD +43>I<D907FC130C90391FFF801C017FEBF03C3901FC03F83A03F0007E7CD807C0EB1FFC +4848130F001F140748C71203003E1401007E1400A2007C157C12FCA2163CA36C151CA27E +A26C6C14007F7FEA3FF8EBFF806C13F86CEBFF806C14F06C14FC6C14FF6C15C0013F14E0 +010714F0EB007F020713F89138007FFC150FED07FE15031501ED00FFA200E0157FA3163F +A27EA3163E7E167E6C157C6C15FC6C15F86D13016DEB03F06DEB07E0D8F9FCEB0FC03AF0 +7F803F8090391FFFFE00D8E00713F839C0007FC028427BBF33>I<003FB91280A3903AF0 +007FE001018090393FC0003F48C7ED1FC0007E1707127C00781703A300701701A548EF00 +E0A5C81600B3B14B7E4B7E0107B612FEA33B3D7DBC42>I<B600C090B512F8A3000101E0 +C70007130026007F80EC01FC715A1870B3B3A4013F16F06E5DA21701011F5E80010F1503 +6E4A5A010793C7FC6D6C5C6D6C141E6D6C5C027F14F86E6C485A91390FF00FE00203B512 +80020049C8FCED1FF03D407DBD44>I<B691380FFFFEA3000301E0020113E06C01809138 +007F806CEF3F00017F163E181C6E153C013F1638A26E1578011F1670A26D6C5DA26E1401 +01075EA26E140301035EA26D6C4AC7FCA2806D150EA26F131E027F141CA26F133C023F14 +38A26E6C5BA26F13F0020F5CA2EDF80102075CA26E6C485AA2EDFE07020191C8FCA26F5A +6E130EA2ED7F9CA216DCED3FF8A36F5AA36F5AA26F5AA36F5A3F407EBD44>I<B500FE01 +7FB5D88007B5FCA3000301C0010101E0C713F86C90C849EC3FE07148EC0F807E7215006E +143F017F190E84A26D6C60A24D7E6D6C60A2EFE7F86D6C60A2933801C3FC6E18F0010761 +04037F6E0281140101036104077F17006D6C4D5AA2040EEB7F806D6C4DC7FCA24CEB3FC0 +DA7F80160EA24CEB1FE003C0161E023F171C047814F0DBE070010F133C021F173804F014 +F84C1307DA0FF05EA2DBF1C0EB03FCDA07F95EA2DBFB80EB01FEDA03FF6F5AA293C8FCA2 +6E5FA24B157F020094C8FCA24B81037C153EA20378151E0338151C58407EBD5D>I<007F +B5D8C003B512E0A3C649C7EBFC00D93FF8EC3FE06D48EC1F806D6C92C7FC171E6D6C141C +6D6C143C5F6D6C14706D6D13F04C5ADA7FC05B023F13036F485ADA1FF090C8FC020F5BED +F81E913807FC1C163C6E6C5A913801FF7016F06E5B6F5AA26F7E6F7EA28282153FED3BFE +ED71FF15F103E07F913801C07F0203804B6C7EEC07004A6D7E020E6D7E5C023C6D7E0238 +6D7E14784A6D7E4A6D7F130149486E7E4A6E7E130749C86C7E496F7E497ED9FFC04A7E00 +076DEC7FFFB500FC0103B512FEA33F3E7EBD44>I<B66C0103B51280A3000101F0C8EBF8 +006C6C48ED3FC0725A013F041EC7FC6D7E606D6C15386D6C1578606D6C5D6E14016D5E6D +6D1303606E6C49C8FC6E6C5B170E6E6C131E171C6E6C5B6E6C137817706E6C13F06F5B6E +13016EEB83C05FED7FC7DB3FE7C9FC16EFED1FFE5E150F6F5AB3A4ED1FFC020FB512FCA3 +413E7FBD44>I<003FB712F8A391C7EA1FF013F801E0EC3FE00180EC7FC090C8FC003EED +FF80A2003C4A1300007C4A5A12784B5A4B5AA200704A5AA24B5A4B5AA2C8485A4A90C7FC +A24A5A4A5AA24A5AA24A5A4A5AA24A5A4A5AA24990C8FCA2495A4948141CA2495A495AA2 +495A495A173C495AA24890C8FC485A1778485A484815F8A24848140116034848140F4848 +143FED01FFB8FCA32E3E7BBD38>I<EAFFFCA4EAF000B3B3B3B3ABEAFFFCA40E5B77C319> +I<486C13C00003130101001380481303000EEB070048130E0018130C0038131C00301318 +0070133800601330A300E01370481360A400CFEB678039FFC07FE001E013F0A3007F133F +A2003F131F01C013E0390F0007801C1C73BE2D>I<EAFFFCA4EA003CB3B3B3B3ABEAFFFC +A40E5B7FC319>I<EB0FF8EBFFFE3903F01F8039078007E0000F6D7E9038E001F8D81FF0 +7F6E7EA3157F6C5AEA0380C8FCA4EC1FFF0103B5FC90381FF87FEB7F803801FC00EA07F8 +EA0FE0485A485AA248C7FCEE038012FEA315FFA3007F5BEC03BF3B3F80071F8700261FC0 +0E13CF3A07F03C0FFE3A01FFF807FC3A003FC001F0292A7DA82D>97 +D<EA01FC12FFA3120712031201B1EC03FC91381FFF8091387C07E09039FDE001F09039FF +C000FC4A137E91C77E49158049141F17C0EE0FE0A217F0A2160717F8AA17F0A2160FA217 +E0161F17C06D1580EE3F006D5C6E13FE9039F3C001F89039F1E003F09039E0780FC09026 +C03FFFC7FCC7EA07F82D407EBE33>I<49B4FC010F13E090383F00F8017C131E4848131F +4848137F0007ECFF80485A5B121FA24848EB7F00151C007F91C7FCA290C9FC5AAB6C7EA3 +003FEC01C07F001F140316806C6C13076C6C14000003140E6C6C131E6C6C137890383F01 +F090380FFFC0D901FEC7FC222A7DA828>I<ED01FC15FFA3150715031501B114FF010713 +E190381F80F990387E003D49131FD803F81307485A49130348481301121F123F5B127FA2 +90C7FCA25AAA7E7FA2123FA26C7E000F14037F000714076C6C497E6C6C497ED8007C0179 +13F890383F01F190380FFFC1903A01FE01FC002D407DBE33>I<EB01FE90380FFFC09038 +3F03F09038FC01F848486C7E4848137E48487F000F158049131F001F15C04848130FA212 +7F16E090C7FCA25AA290B6FCA290C9FCA67EA27F123F16E06C7E1501000F15C06C6C1303 +6DEB07806C6C1400C66C131E017E5B90381F80F8903807FFE0010090C7FC232A7EA828> +I<EC1FC0EC7FF8903801F83C903807E07E90380FC0FFEB1FC1EB3F811401137FEC00FE01 +FE137C1500AEB6FCA3C648C7FCB3AE487E007F13FFA320407EBF1C>I<167C903903F801 +FF903A1FFF078F8090397E0FDE1F9038F803F83803F001A23B07E000FC0600000F6EC7FC +49137E001F147FA8000F147E6D13FE00075C6C6C485AA23901F803E03903FE0FC026071F +FFC8FCEB03F80006CAFC120EA3120FA27F7F6CB512E015FE6C6E7E6C15E06C810003813A +0FC0001FFC48C7EA01FE003E140048157E825A82A46C5D007C153E007E157E6C5D6C6C49 +5A6C6C495AD803F0EB0FC0D800FE017FC7FC90383FFFFC010313C0293D7EA82D>I<EA01 +FC12FFA3120712031201B1EC01FE913807FFC091381E07E091387803F09138E001F8D9FD +C07F148001FF6D7E91C7FCA25BA25BB3A6486C497EB5D8F87F13FCA32E3F7DBE33>I<EA +01E0EA07F8A2487EA46C5AA2EA01E0C8FCACEA01FC127FA3120712031201B3AC487EB512 +F0A3143E7DBD1A>I<1478EB01FEA2EB03FFA4EB01FEA2EB00781400AC147FEB7FFFA313 +017F147FB3B3A5123E127F38FF807E14FEA214FCEB81F8EA7F01387C03F0381E07C0380F +FF803801FC00185185BD1C>I<EA01FC12FFA3120712031201B292B51280A392383FFC00 +16E0168093C7FC153C5D5D4A5AEC07C04A5A4AC8FC143E147F4A7E13FD9038FFDFC0EC9F +E0140F496C7E01FC7F496C7E1401816E7E81826F7E151F826F7EA282486C14FEB539F07F +FFE0A32B3F7EBE30>I<EA01FC12FFA3120712031201B3B3B1487EB512F8A3153F7DBE1A> +I<2701F801FE14FF00FF902707FFC00313E0913B1E07E00F03F0913B7803F03C01F80007 +903BE001F87000FC2603F9C06D487F000101805C01FBD900FF147F91C75B13FF4992C7FC +A2495CB3A6486C496CECFF80B5D8F87FD9FC3F13FEA347287DA74C>I<3901F801FE00FF +903807FFC091381E07E091387803F000079038E001F82603F9C07F0001138001FB6D7E91 +C7FC13FF5BA25BB3A6486C497EB5D8F87F13FCA32E287DA733>I<14FF010713E090381F +81F890387E007E01F8131F4848EB0F804848EB07C04848EB03E0000F15F04848EB01F8A2 +003F15FCA248C812FEA44815FFA96C15FEA36C6CEB01FCA3001F15F86C6CEB03F0A26C6C +EB07E06C6CEB0FC06C6CEB1F80D8007EEB7E0090383F81FC90380FFFF0010090C7FC282A +7EA82D>I<3901FC03FC00FF90381FFF8091387C0FE09039FDE003F03A03FFC001FC6C49 +6C7E91C7127F49EC3F805BEE1FC017E0A2EE0FF0A3EE07F8AAEE0FF0A4EE1FE0A2EE3FC0 +6D1580EE7F007F6E13FE9138C001F89039FDE007F09039FC780FC0DA3FFFC7FCEC07F891 +C9FCAD487EB512F8A32D3A7EA733>I<02FF131C0107EBC03C90381F80F090397F00387C +01FC131CD803F8130E4848EB0FFC150748481303121F485A1501485AA448C7FCAA6C7EA3 +6C7EA2001F14036C7E15076C6C130F6C7E6C6C133DD8007E137990383F81F190380FFFC1 +903801FE0190C7FCAD4B7E92B512F8A32D3A7DA730>I<3901F807E000FFEB1FF8EC787C +ECE1FE3807F9C100031381EA01FB1401EC00FC01FF1330491300A35BB3A5487EB512FEA3 +1F287EA724>I<90383FC0603901FFF8E03807C03F381F000F003E1307003C1303127C00 +78130112F81400A27E7E7E6D1300EA7FF8EBFFC06C13F86C13FE6C7F6C1480000114C0D8 +003F13E0010313F0EB001FEC0FF800E01303A214017E1400A27E15F07E14016C14E06CEB +03C0903880078039F3E01F0038E0FFFC38C01FE01D2A7DA824>I<131CA6133CA4137CA2 +13FCA2120112031207001FB512C0B6FCA2D801FCC7FCB3A215E0A912009038FE01C0A2EB +7F03013F138090381F8700EB07FEEB01F81B397EB723>I<D801FC14FE00FF147FA30007 +14030003140100011400B3A51501A31503120015076DEB06FF017E010E13806D4913FC90 +381FC078903807FFE00100903880FE002E297DA733>I<B539E00FFFE0A32707FE000313 +006C48EB00FC5E00015D7F00005DA26D13016D5CA26D6C485AA2ECC007011F91C7FCA290 +380FE00EA2ECF01E0107131CA26D6C5AA2ECFC7801011370A2ECFEF001005BA2EC7FC0A3 +6E5AA26EC8FCA3140E2B287EA630>I<B53BC3FFFE03FFF8A3290FFE003FE00013C06C48 +6D48EB3F806C4817006D010F141E00016F131C15076D163C00004A6C1338A2017F5E4B7E +151DD93F805DED3DFC1538D91FC04A5AED78FE9238707E03D90FE0017F5BEDE03F02F014 +0701070387C7FC9138F1C01F02F9148F010315CE9138FB800F02FF14DE6D15FCED00076D +5DA24A1303027E5CA2027C1301023C5C023813003D287EA642>I<B539F01FFFE0A30003 +D9C00F1300C690388007F8D97F0013E002805BD93FC05B011F49C7FC90380FE00EECF01E +6D6C5A01035B6D6C5A6E5AEB00FF6E5A6E5A81141F814A7E81147BECF1FC903801E1FEEC +C0FF01037F49486C7ED90F007F011E6D7E013E130F496D7E01FC80486C80000F4A7EB539 +803FFFF8A32D277FA630>I<B539E00FFFE0A32707FE000313006C48EB01FC6F5A00015D +7F00005DA2017F495AA2EC8003013F5CA26D6C48C7FCA26E5A010F130EA26D6C5AA2ECF8 +3C01031338A26D6C5AA2ECFEF001005BA2EC7FC0A36E5AA36EC8FCA2140EA2141E141C14 +3C1438A2147800181370127EB45BA2495AA248485AD87E07C9FCEA780EEA3C3CEA1FF8EA +07E02B3A7EA630>I<001FB61280A2EBE0000180140049485A001E495A121C4A5A003C49 +5A141F00385C4A5A147F5D4AC7FCC6485AA2495A495A130F5C495A90393FC00380A2EB7F +80EBFF005A5B484813071207491400485A48485BA248485B4848137F00FF495A90B6FCA2 +21277EA628>I<B812F0A22C0280982D>I E +%EndDVIPSBitmapFont +%DVIPSBitmapFont: Fm cmbx12 20.736 9 +/Fm 9 123 df<92380FFFE04AB67E020F15F0027F15FE49B87E4917E0010F17F8013F83 +49D9C01F14FF9027FFFC0001814801E06D6C80480180021F804890C86C8048486F804848 +6F8001FF6F804801C06E8002F081486D18806E816E18C0B5821BE06E81A37214F0A56C5B +A36C5B6C5B6C5B000313C0C690C9FC90CA15E060A34E14C0A21B80601B0060626295B55A +5F624D5C624D5C4D91C7FC614D5B4D13F04D5B6194B55A4C49C8FC4C5B4C5B4C13E04C5B +604C90C9FCEE7FFC4C5A4B5B4B5B4B0180EC0FF04B90C8FC4B5A4B5A4B48ED1FE0EDFFE0 +4A5B4A5B4A90C9FC4A48163F4A5ADA3FF017C05D4A48167F4A5A4990CA12FFD903FC1607 +49BAFC5B4919805B5B90BBFC5A5A5A5A481A005A5ABCFCA462A44C7176F061>50 +D<92383FFFF80207B612E0027F15FC49B87E010717E0011F83499026F0007F13FC4948C7 +000F7F90B502036D7E486E6D806F6D80727F486E6E7F8486727FA28684A26C5C72806C5C +6D90C8FC6D5AEB0FF8EB03E090CAFCA70507B6FC041FB7FC0303B8FC157F0203B9FC021F +ECFE0391B612800103ECF800010F14C04991C7FC017F13FC90B512F04814C0485C4891C8 +FC485B5A485B5C5A5CA2B5FC5CA360A36E5DA26C5F6E5D187E6C6D846E4A48806C6D4A48 +14FC6C6ED90FF0ECFFFC6C02E090263FE07F14FE00019139FC03FFC06C91B6487E013F4B +487E010F4B1307010303F01301D9003F0280D9003F13FC020101F8CBFC57507ACE5E>97 +D<903801FFFCB6FCA8C67E131F7FB3ADF0FFFC050FEBFFE0057F14FE0403B77E040F16E0 +043F16F84CD9007F13FE9226FDFFF001077F92B500C001018094C86C13E004FC6F7F4C6F +7F04E06F7F4C6F7F5E747F93C915804B7014C0A27414E0A21DF087A21DF8A31DFC87A41D +FEAF1DFCA4631DF8A31DF098B5FC1DE0A25014C0A26F1980501400705D705F704B5B505B +704B5B04FC4B5BDBE7FE92B55A9226C3FF8001035C038101E0011F49C7FC9226807FFC90 +B55A4B6CB712F04A010F16C04A010393C8FC4A010015F84A023F14C090C9000301F0C9FC +5F797AF76C>I<97380FFFE00607B6FCA8F00003190086B3AD93383FFF800307B512F803 +3F14FF4AB712C0020716F0021F16FC027F9039FE007FFE91B500F0EB0FFF010302800101 +90B5FC4949C87E49498149498149498149498190B548814884484A8192CAFC5AA2485BA2 +5A5C5AA35A5CA4B5FCAF7EA4807EA37EA2807EA26C7F616C6E5D6C606C80616D6D5D6D6D +5D6D6D92B67E6D6D4A15FC010301FF0207EDFFFE6D02C0EB3FFE6D6C9039FC01FFF86E90 +B65A020F16C002031600DA007F14FC030F14E09226007FFEC749C7FC5F797AF76C>100 +D<EB01FCEB07FF011F13C0497F497F90B57EA24880A24880A76C5CA26C5CA26D5B6D5B6D +5B010790C8FCEB01FC90CAFCB2903801FFFC007FB5FCA8C67E131F7FB3B3B3A5B81280A8 +297979F835>105 D<903801FFFCB6FCA8C67E131F7FB3B3B3B3B3ABB812C0A82A7879F7 +35>108 D<902601FFF891380FFFE0B692B512FE05036E7E050F15E0053F15F84D819327 +01FFF01F7F4CD900077FDC07FC6D80C66CDA0FF06D80011FDA1FC07F6D4A48824CC8FC04 +7E6F7F5EEDF9F85E03FB707F5E15FF5EA25EA293C9FCA45DB3B3A6B8D8E003B81280A861 +4E79CD6C>110 D<902601FFFCEC7FFEB6020FB512F0057F14FE4CB712C0040716F0041F +82047F16FE93B5C66C7F92B500F0010F14C0C66C0380010380011F4AC76C806D4A6E8004 +F06F7F4C6F7F4C6F7F4C8193C915804B7014C0861DE0A27414F0A27414F8A47513FCA575 +13FEAF5113FCA598B512F8A31DF0621DE0621DC0621D806F5E701800704B5B505B704B5B +7092B55A04FC4A5C704A5C706C010F5C05E0013F49C7FC9227FE7FFC01B55A70B712F004 +0F16C0040393C8FC040015F8053F14C0050301F0C9FC94CCFCB3A6B812E0A85F6F7ACD6C +>112 D<0007BA12FC1AFEA503E0C714FC4AC74814F84801F04A14F05C02804A14E091C8 +4814C04D14805B494B14004D5B4992B55AA24C5C494A5C615E4C5C001F4B5C5B4C91C7FC +4C5B93B55AA24B5CC8485C4B5CA24B5C4B5C4B91C8FCA24B5B92B55AA24A5C4A5C4A4A14 +FFA24A5C4A5C4A91C8FC614A4915FE91B55A495CA2495C494A14035E5B495C4991C81207 +A24949ED0FFC90B55A484A151FA2484A153F484A157F484A15FF1803484A140F4891C812 +3F48490207B5FC91B9FCBB12F8A57E484D7BCC56>122 D E +%EndDVIPSBitmapFont +end +%%EndProlog +%%BeginSetup +%%Feature: *Resolution 600dpi +TeXDict begin +%%PaperSize: A4 + +%%EndSetup +%%Page: 1 1 +1 0 bop 150 1318 a Fm(bzip2)64 b(and)g(libbzip2)p 150 +1418 3600 34 v 2010 1515 a Fl(a)31 b(program)f(and)g(library)e(for)i +(data)h(compression)2198 1623 y(cop)m(yrigh)m(t)f(\(C\))h(1996-2000)j +(Julian)28 b(Sew)m(ard)2605 1731 y(v)m(ersion)i(1.0)h(of)g(21)g(Marc)m +(h)g(2000)150 5091 y Fk(Julian)46 b(Sew)l(ard)p 150 5141 +3600 17 v eop +%%Page: 1 2 +1 1 bop 3705 -116 a Fl(1)150 299 y(This)24 b(program,)j +Fj(bzip2)p Fl(,)e(and)g(asso)s(ciated)i(library)c Fj(libbzip2)p +Fl(,)i(are)h(Cop)m(yrigh)m(t)g(\(C\))g(1996-2000)j(Julian)150 +408 y(R)h(Sew)m(ard.)40 b(All)29 b(righ)m(ts)h(reserv)m(ed.)150 +565 y(Redistribution)f(and)i(use)h(in)f(source)h(and)g(binary)e(forms,) +j(with)e(or)h(without)f(mo)s(di\014cation,)g(are)i(p)s(er-)150 +675 y(mitted)d(pro)m(vided)f(that)i(the)f(follo)m(wing)f(conditions)g +(are)i(met:)225 832 y Fi(\017)60 b Fl(Redistributions)26 +b(of)k(source)g(co)s(de)g(m)m(ust)g(retain)f(the)h(ab)s(o)m(v)m(e)h +(cop)m(yrigh)m(t)g(notice,)f(this)f(list)f(of)i(con-)330 +941 y(ditions)e(and)i(the)h(follo)m(wing)e(disclaimer.)225 +1076 y Fi(\017)60 b Fl(The)33 b(origin)f(of)h(this)f(soft)m(w)m(are)j +(m)m(ust)e(not)h(b)s(e)e(misrepresen)m(ted;)i(y)m(ou)g(m)m(ust)f(not)g +(claim)g(that)h(y)m(ou)330 1185 y(wrote)d(the)h(original)d(soft)m(w)m +(are.)44 b(If)31 b(y)m(ou)g(use)g(this)f(soft)m(w)m(are)i(in)e(a)h(pro) +s(duct,)g(an)f(ac)m(kno)m(wledgmen)m(t)330 1295 y(in)f(the)i(pro)s +(duct)e(do)s(cumen)m(tation)h(w)m(ould)f(b)s(e)h(appreciated)g(but)g +(is)f(not)i(required.)225 1429 y Fi(\017)60 b Fl(Altered)21 +b(source)g(v)m(ersions)f(m)m(ust)h(b)s(e)f(plainly)e(mark)m(ed)j(as)g +(suc)m(h,)i(and)d(m)m(ust)h(not)g(b)s(e)f(misrepresen)m(ted)330 +1539 y(as)31 b(b)s(eing)e(the)h(original)f(soft)m(w)m(are.)225 +1674 y Fi(\017)60 b Fl(The)27 b(name)h(of)f(the)h(author)f(ma)m(y)h +(not)g(b)s(e)f(used)g(to)h(endorse)f(or)h(promote)g(pro)s(ducts)e +(deriv)m(ed)g(from)330 1783 y(this)j(soft)m(w)m(are)j(without)d(sp)s +(eci\014c)h(prior)e(written)i(p)s(ermission.)150 1965 +y(THIS)37 b(SOFTW)-10 b(ARE)38 b(IS)f(PR)m(O)m(VIDED)i(BY)g(THE)f(A)m +(UTHOR)g(\\AS)g(IS")g(AND)h(ANY)f(EXPRESS)150 2074 y(OR)31 +b(IMPLIED)h(W)-10 b(ARRANTIES,)31 b(INCLUDING,)i(BUT)f(NOT)f(LIMITED)g +(TO,)h(THE)f(IMPLIED)150 2184 y(W)-10 b(ARRANTIES)27 +b(OF)h(MER)m(CHANT)-8 b(ABILITY)28 b(AND)g(FITNESS)f(F)m(OR)g(A)h(P)-8 +b(AR)g(TICULAR)28 b(PUR-)150 2294 y(POSE)37 b(ARE)g(DISCLAIMED.)h(IN)f +(NO)h(EVENT)f(SHALL)g(THE)g(A)m(UTHOR)h(BE)g(LIABLE)g(F)m(OR)150 +2403 y(ANY)56 b(DIRECT,)f(INDIRECT,)h(INCIDENT)-8 b(AL,)56 +b(SPECIAL,)e(EXEMPLAR)-8 b(Y,)57 b(OR)e(CONSE-)150 2513 +y(QUENTIAL)48 b(D)m(AMA)m(GES)i(\(INCLUDING,)g(BUT)f(NOT)f(LIMITED)g +(TO,)g(PR)m(OCUREMENT)150 2622 y(OF)35 b(SUBSTITUTE)e(GOODS)i(OR)f(SER) +-10 b(VICES;)34 b(LOSS)f(OF)i(USE,)g(D)m(A)-8 b(T)g(A,)36 +b(OR)f(PR)m(OFITS;)f(OR)150 2732 y(BUSINESS)28 b(INTERR)m(UPTION\))g +(HO)m(WEVER)i(CA)m(USED)f(AND)g(ON)g(ANY)g(THEOR)-8 b(Y)29 +b(OF)g(LIA-)150 2842 y(BILITY,)36 b(WHETHER)g(IN)g(CONTRA)m(CT,)g +(STRICT)e(LIABILITY,)i(OR)g(TOR)-8 b(T)35 b(\(INCLUDING)150 +2951 y(NEGLIGENCE)45 b(OR)g(OTHER)-10 b(WISE\))44 b(ARISING)h(IN)g(ANY) +h(W)-10 b(A)i(Y)46 b(OUT)e(OF)i(THE)e(USE)h(OF)150 3061 +y(THIS)29 b(SOFTW)-10 b(ARE,)31 b(EVEN)f(IF)g(AD)m(VISED)i(OF)e(THE)g +(POSSIBILITY)e(OF)j(SUCH)f(D)m(AMA)m(GE.)150 3218 y(Julian)e(Sew)m +(ard,)i(Cam)m(bridge,)g(UK.)150 3374 y Fj(jseward@acm.org)150 +3531 y(http://sourceware.cygnus)o(.com)o(/bzi)o(p2)150 +3688 y(http://www.cacheprof.org)150 3845 y(http://www.muraroa.demon)o +(.co.)o(uk)150 4002 y(bzip2)p Fl(/)p Fj(libbzip2)d Fl(v)m(ersion)j(1.0) +i(of)e(21)h(Marc)m(h)g(2000.)150 4159 y(P)-8 b(A)g(TENTS:)40 +b(T)-8 b(o)40 b(the)g(b)s(est)g(of)g(m)m(y)g(kno)m(wledge,)j +Fj(bzip2)38 b Fl(do)s(es)i(not)g(use)g(an)m(y)g(paten)m(ted)h +(algorithms.)150 4268 y(Ho)m(w)m(ev)m(er,)33 b(I)e(do)f(not)h(ha)m(v)m +(e)h(the)f(resources)g(a)m(v)-5 b(ailable)30 b(to)h(carry)g(out)g(a)g +(full)d(paten)m(t)k(searc)m(h.)42 b(Therefore)150 4378 +y(I)30 b(cannot)h(giv)m(e)g(an)m(y)g(guaran)m(tee)h(of)e(the)h(ab)s(o)m +(v)m(e)g(statemen)m(t.)p eop +%%Page: 2 3 +2 2 bop 150 -116 a Fl(Chapter)30 b(1:)41 b(In)m(tro)s(duction)2591 +b(2)150 299 y Fh(1)80 b(In)l(tro)t(duction)150 555 y +Fj(bzip2)20 b Fl(compresses)h(\014les)f(using)g(the)h(Burro)m +(ws-Wheeler)g(blo)s(c)m(k-sorting)f(text)j(compression)d(algorithm,)150 +665 y(and)33 b(Hu\013man)g(co)s(ding.)50 b(Compression)32 +b(is)h(generally)g(considerably)f(b)s(etter)i(than)f(that)h(ac)m(hiev)m +(ed)h(b)m(y)150 775 y(more)f(con)m(v)m(en)m(tional)g(LZ77/LZ78-based)g +(compressors,)g(and)f(approac)m(hes)h(the)f(p)s(erformance)g(of)h(the) +150 884 y(PPM)c(family)f(of)i(statistical)f(compressors.)150 +1041 y Fj(bzip2)k Fl(is)h(built)e(on)i(top)h(of)g Fj(libbzip2)p +Fl(,)e(a)i(\015exible)e(library)f(for)i(handling)e(compressed)i(data)i +(in)d(the)150 1151 y Fj(bzip2)c Fl(format.)43 b(This)30 +b(man)m(ual)g(describ)s(es)g(b)s(oth)g(ho)m(w)i(to)g(use)f(the)g +(program)g(and)g(ho)m(w)g(to)h(w)m(ork)f(with)150 1260 +y(the)d(library)d(in)m(terface.)41 b(Most)28 b(of)g(the)g(man)m(ual)f +(is)g(dev)m(oted)i(to)f(this)f(library)-8 b(,)26 b(not)i(the)g +(program,)g(whic)m(h)150 1370 y(is)h(go)s(o)s(d)i(news)e(if)h(y)m(our)g +(in)m(terest)h(is)e(only)g(in)h(the)g(program.)150 1527 +y(Chapter)24 b(2)g(describ)s(es)f(ho)m(w)h(to)h(use)f +Fj(bzip2)p Fl(;)h(this)e(is)g(the)i(only)e(part)h(y)m(ou)h(need)f(to)h +(read)f(if)f(y)m(ou)h(just)g(w)m(an)m(t)150 1636 y(to)35 +b(kno)m(w)f(ho)m(w)g(to)g(op)s(erate)h(the)f(program.)51 +b(Chapter)34 b(3)g(describ)s(es)e(the)i(programming)f(in)m(terfaces)h +(in)150 1746 y(detail,)23 b(and)d(Chapter)h(4)h(records)f(some)h +(miscellaneous)e(notes)i(whic)m(h)e(I)h(though)m(t)h(ough)m(t)g(to)g(b) +s(e)f(recorded)150 1855 y(somewhere.)p eop +%%Page: 3 4 +3 3 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(3)150 299 y Fh(2)80 b(Ho)l(w)53 +b(to)g(use)g Fg(bzip2)150 566 y Fl(This)29 b(c)m(hapter)i(con)m(tains)f +(a)h(cop)m(y)g(of)g(the)f Fj(bzip2)f Fl(man)h(page,)h(and)f(nothing)g +(else.)390 818 y Ff(NAME)570 1004 y Fj(bzip2)p Fl(,)f +Fj(bunzip2)g Fl(-)h(a)h(blo)s(c)m(k-sorting)f(\014le)f(compressor,)i +(v1.0)570 1136 y Fj(bzcat)e Fl(-)i(decompresses)f(\014les)f(to)i +(stdout)570 1267 y Fj(bzip2recover)c Fl(-)k(reco)m(v)m(ers)h(data)f +(from)f(damaged)g(bzip2)g(\014les)390 1519 y Ff(SYNOPSIS)570 +1706 y Fj(bzip2)f Fl([)h(-cdfkqstvzVL123456789)35 b(])c([)g +(\014lenames)e(...)41 b(])570 1837 y Fj(bunzip2)28 b +Fl([)j(-fkvsVL)f(])h([)f(\014lenames)g(...)41 b(])570 +1968 y Fj(bzcat)29 b Fl([)h(-s)h(])g([)f(\014lenames)g(...)41 +b(])570 2100 y Fj(bzip2recover)27 b Fl(\014lename)390 +2352 y Ff(DESCRIPTION)390 2538 y Fj(bzip2)i Fl(compresses)i(\014les)f +(using)f(the)i(Burro)m(ws-Wheeler)g(blo)s(c)m(k)f(sorting)g(text)i +(compres-)390 2642 y(sion)40 b(algorithm,)j(and)d(Hu\013man)h(co)s +(ding.)71 b(Compression)40 b(is)g(generally)g(considerably)390 +2746 y(b)s(etter)25 b(than)g(that)h(ac)m(hiev)m(ed)g(b)m(y)f(more)g +(con)m(v)m(en)m(tional)h(LZ77/LZ78-based)g(compressors,)390 +2850 y(and)k(approac)m(hes)h(the)f(p)s(erformance)g(of)h(the)f(PPM)g +(family)f(of)i(statistical)f(compressors.)390 3001 y(The)e +(command-line)e(options)i(are)h(delib)s(erately)d(v)m(ery)i(similar)e +(to)j(those)g(of)f(GNU)h Fj(gzip)p Fl(,)390 3104 y(but)h(they)g(are)h +(not)g(iden)m(tical.)390 3255 y Fj(bzip2)f Fl(exp)s(ects)h(a)g(list)f +(of)h(\014le)f(names)h(to)h(accompan)m(y)h(the)e(command-line)e +(\015ags.)43 b(Eac)m(h)390 3359 y(\014le)e(is)h(replaced)g(b)m(y)g(a)h +(compressed)f(v)m(ersion)g(of)g(itself,)i(with)e(the)g(name)g +Fj(original_)390 3463 y(name.bz2)p Fl(.)49 b(Eac)m(h)34 +b(compressed)g(\014le)f(has)g(the)h(same)g(mo)s(di\014cation)e(date,)k +(p)s(ermissions,)390 3567 y(and,)24 b(when)f(p)s(ossible,)f(o)m +(wnership)f(as)j(the)f(corresp)s(onding)f(original,)h(so)g(that)h +(these)g(prop-)390 3671 y(erties)34 b(can)g(b)s(e)f(correctly)i +(restored)f(at)g(decompression)f(time.)51 b(File)34 b(name)g(handling)d +(is)390 3774 y(naiv)m(e)26 b(in)f(the)i(sense)f(that)h(there)f(is)f(no) +i(mec)m(hanism)e(for)h(preserving)f(original)f(\014le)i(names,)390 +3878 y(p)s(ermissions,)37 b(o)m(wnerships)f(or)h(dates)i(in)d +(\014lesystems)h(whic)m(h)g(lac)m(k)h(these)g(concepts,)j(or)390 +3982 y(ha)m(v)m(e)32 b(serious)d(\014le)g(name)i(length)f +(restrictions,)f(suc)m(h)h(as)h(MS-DOS.)390 4133 y Fj(bzip2)26 +b Fl(and)h Fj(bunzip2)e Fl(will)f(b)m(y)k(default)e(not)i(o)m(v)m +(erwrite)g(existing)e(\014les.)38 b(If)27 b(y)m(ou)h(w)m(an)m(t)g(this) +390 4237 y(to)j(happ)s(en,)e(sp)s(ecify)g(the)i Fj(-f)e +Fl(\015ag.)390 4388 y(If)34 b(no)h(\014le)f(names)g(are)i(sp)s +(eci\014ed,)e Fj(bzip2)f Fl(compresses)i(from)f(standard)g(input)f(to)j +(stan-)390 4491 y(dard)c(output.)49 b(In)32 b(this)g(case,)k +Fj(bzip2)31 b Fl(will)g(decline)h(to)i(write)e(compressed)h(output)g +(to)h(a)390 4595 y(terminal,)29 b(as)i(this)e(w)m(ould)g(b)s(e)h(en)m +(tirely)f(incomprehensible)e(and)j(therefore)h(p)s(oin)m(tless.)390 +4746 y Fj(bunzip2)36 b Fl(\(or)j Fj(bzip2)29 b(-d)p Fl(\))37 +b(decompresses)i(all)e(sp)s(eci\014ed)f(\014les.)63 b(Files)37 +b(whic)m(h)g(w)m(ere)i(not)390 4850 y(created)e(b)m(y)f +Fj(bzip2)f Fl(will)e(b)s(e)i(detected)j(and)d(ignored,)i(and)e(a)i(w)m +(arning)d(issued.)56 b Fj(bzip2)390 4954 y Fl(attempts)31 +b(to)f(guess)g(the)g(\014lename)f(for)h(the)g(decompressed)f(\014le)g +(from)h(that)g(of)g(the)g(com-)390 5058 y(pressed)f(\014le)h(as)h +(follo)m(ws:)570 5209 y Fj(filename.bz2)57 b Fl(b)s(ecomes)31 +b Fj(filename)570 5340 y(filename.bz)58 b Fl(b)s(ecomes)30 +b Fj(filename)p eop +%%Page: 4 5 +4 4 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(4)570 299 y Fj(filename.tbz2)27 +b Fl(b)s(ecomes)j Fj(filename.tar)570 470 y(filename.tbz)57 +b Fl(b)s(ecomes)31 b Fj(filename.tar)570 641 y(anyothername)57 +b Fl(b)s(ecomes)31 b Fj(anyothername.out)390 859 y Fl(If)j(the)h +(\014le)e(do)s(es)i(not)f(end)g(in)f(one)i(of)g(the)g(recognised)f +(endings,)g Fj(.bz2)p Fl(,)h Fj(.bz)p Fl(,)g Fj(.tbz2)e +Fl(or)390 963 y Fj(.tbz)p Fl(,)h Fj(bzip2)f Fl(complains)f(that)j(it)e +(cannot)i(guess)f(the)g(name)h(of)f(the)g(original)e(\014le,)j(and)390 +1067 y(uses)30 b(the)g(original)f(name)h(with)g Fj(.out)f +Fl(app)s(ended.)390 1218 y(As)j(with)f(compression,)h(supplying)c(no)k +(\014lenames)f(causes)i(decompression)e(from)h(stan-)390 +1321 y(dard)d(input)g(to)i(standard)e(output.)390 1472 +y Fj(bunzip2)k Fl(will)g(correctly)j(decompress)e(a)i(\014le)e(whic)m +(h)g(is)h(the)g(concatenation)i(of)e(t)m(w)m(o)i(or)390 +1576 y(more)j(compressed)f(\014les.)67 b(The)39 b(result)g(is)g(the)g +(concatenation)i(of)f(the)g(corresp)s(onding)390 1680 +y(uncompressed)c(\014les.)59 b(In)m(tegrit)m(y)38 b(testing)f(\()p +Fj(-t)p Fl(\))g(of)g(concatenated)i(compressed)e(\014les)f(is)390 +1784 y(also)30 b(supp)s(orted.)390 1935 y(Y)-8 b(ou)40 +b(can)g(also)f(compress)g(or)g(decompress)g(\014les)g(to)h(the)f +(standard)g(output)g(b)m(y)g(giving)390 2039 y(the)30 +b Fj(-c)g Fl(\015ag.)40 b(Multiple)28 b(\014les)h(ma)m(y)i(b)s(e)e +(compressed)h(and)f(decompressed)h(lik)m(e)f(this.)39 +b(The)390 2142 y(resulting)31 b(outputs)i(are)h(fed)f(sequen)m(tially)f +(to)i(stdout.)49 b(Compression)32 b(of)h(m)m(ultiple)e(\014les)390 +2246 y(in)24 b(this)g(manner)h(generates)h(a)g(stream)f(con)m(taining)g +(m)m(ultiple)e(compressed)i(\014le)f(represen-)390 2350 +y(tations.)58 b(Suc)m(h)36 b(a)g(stream)g(can)h(b)s(e)e(decompressed)h +(correctly)h(only)e(b)m(y)h Fj(bzip2)e Fl(v)m(ersion)390 +2454 y(0.9.0)g(or)e(later.)47 b(Earlier)30 b(v)m(ersions)i(of)g +Fj(bzip2)f Fl(will)f(stop)i(after)h(decompressing)e(the)i(\014rst)390 +2558 y(\014le)c(in)h(the)g(stream.)390 2709 y Fj(bzcat)f +Fl(\(or)i Fj(bzip2)e(-dc)p Fl(\))g(decompresses)i(all)e(sp)s(eci\014ed) +g(\014les)g(to)i(the)g(standard)e(output.)390 2860 y +Fj(bzip2)f Fl(will)g(read)i(argumen)m(ts)g(from)f(the)h(en)m(vironmen)m +(t)g(v)-5 b(ariables)28 b Fj(BZIP2)h Fl(and)g Fj(BZIP)p +Fl(,)g(in)390 2963 y(that)24 b(order,)g(and)f(will)e(pro)s(cess)i(them) +g(b)s(efore)g(an)m(y)h(argumen)m(ts)f(read)h(from)f(the)g(command)390 +3067 y(line.)39 b(This)29 b(giv)m(es)h(a)h(con)m(v)m(enien)m(t)h(w)m(a) +m(y)f(to)g(supply)d(default)i(argumen)m(ts.)390 3218 +y(Compression)h(is)h(alw)m(a)m(ys)i(p)s(erformed,)e(ev)m(en)h(if)f(the) +h(compressed)g(\014le)f(is)g(sligh)m(tly)f(larger)390 +3322 y(than)26 b(the)g(original.)38 b(Files)25 b(of)h(less)g(than)g(ab) +s(out)g(one)g(h)m(undred)e(b)m(ytes)j(tend)f(to)h(get)g(larger,)390 +3426 y(since)34 b(the)g(compression)f(mec)m(hanism)h(has)f(a)i(constan) +m(t)g(o)m(v)m(erhead)h(in)d(the)h(region)g(of)g(50)390 +3529 y(b)m(ytes.)54 b(Random)34 b(data)h(\(including)d(the)i(output)h +(of)f(most)h(\014le)f(compressors\))h(is)e(co)s(ded)390 +3633 y(at)e(ab)s(out)f(8.05)i(bits)d(p)s(er)h(b)m(yte,)h(giving)e(an)h +(expansion)g(of)g(around)g(0.5\045.)390 3784 y(As)h(a)g(self-c)m(hec)m +(k)h(for)e(y)m(our)h(protection,)g Fj(bzip2)f Fl(uses)g(32-bit)h(CR)m +(Cs)f(to)i(mak)m(e)f(sure)f(that)390 3888 y(the)45 b(decompressed)f(v)m +(ersion)g(of)g(a)h(\014le)e(is)h(iden)m(tical)f(to)i(the)g(original.)81 +b(This)43 b(guards)390 3992 y(against)i(corruption)e(of)h(the)h +(compressed)f(data,)49 b(and)44 b(against)h(undetected)g(bugs)e(in)390 +4096 y Fj(bzip2)35 b Fl(\(hop)s(efully)e(v)m(ery)k(unlik)m(ely\).)56 +b(The)36 b(c)m(hances)h(of)f(data)h(corruption)e(going)h(unde-)390 +4199 y(tected)g(is)e(microscopic,)h(ab)s(out)f(one)h(c)m(hance)g(in)f +(four)g(billion)d(for)j(eac)m(h)i(\014le)d(pro)s(cessed.)390 +4303 y(Be)38 b(a)m(w)m(are,)k(though,)d(that)f(the)g(c)m(hec)m(k)i(o)s +(ccurs)d(up)s(on)f(decompression,)j(so)f(it)f(can)h(only)390 +4407 y(tell)28 b(y)m(ou)g(that)i(something)d(is)h(wrong.)40 +b(It)28 b(can't)i(help)d(y)m(ou)i(reco)m(v)m(er)h(the)e(original)f +(uncom-)390 4511 y(pressed)h(data.)41 b(Y)-8 b(ou)30 +b(can)f(use)g Fj(bzip2recover)d Fl(to)k(try)f(to)h(reco)m(v)m(er)h +(data)f(from)e(damaged)390 4614 y(\014les.)390 4766 y(Return)22 +b(v)-5 b(alues:)37 b(0)23 b(for)g(a)g(normal)f(exit,)j(1)e(for)g(en)m +(vironmen)m(tal)f(problems)f(\(\014le)i(not)g(found,)390 +4869 y(in)m(v)-5 b(alid)30 b(\015ags,)k(I/O)f(errors,)g(&c\),)h(2)f(to) +g(indicate)f(a)h(corrupt)f(compressed)h(\014le,)f(3)i(for)e(an)390 +4973 y(in)m(ternal)d(consistency)h(error)g(\(eg,)i(bug\))e(whic)m(h)f +(caused)i Fj(bzip2)e Fl(to)i(panic.)390 5304 y Ff(OPTIONS)p +eop +%%Page: 5 6 +5 5 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(5)390 299 y Fj(-c)30 +b(--stdout)870 403 y Fl(Compress)f(or)i(decompress)f(to)h(standard)e +(output.)390 557 y Fj(-d)h(--decompress)870 661 y Fl(F)-8 +b(orce)44 b(decompression.)77 b Fj(bzip2)p Fl(,)44 b +Fj(bunzip2)d Fl(and)h Fj(bzcat)f Fl(are)i(really)f(the)870 +764 y(same)27 b(program,)h(and)e(the)i(decision)d(ab)s(out)i(what)g +(actions)g(to)h(tak)m(e)g(is)e(done)870 868 y(on)k(the)h(basis)e(of)i +(whic)m(h)e(name)h(is)g(used.)40 b(This)28 b(\015ag)j(o)m(v)m(errides)f +(that)h(mec)m(h-)870 972 y(anism,)e(and)h(forces)h(bzip2)e(to)i +(decompress.)390 1126 y Fj(-z)f(--compress)870 1230 y +Fl(The)39 b(complemen)m(t)h(to)g Fj(-d)p Fl(:)59 b(forces)40 +b(compression,)h(regardless)d(of)i(the)g(in-)870 1334 +y(v)m(ok)-5 b(ation)31 b(name.)390 1488 y Fj(-t)f(--test)8 +b Fl(Chec)m(k)33 b(in)m(tegrit)m(y)j(of)f(the)g(sp)s(eci\014ed)e +(\014le\(s\),)k(but)d(don't)h(decompress)g(them.)870 +1591 y(This)40 b(really)g(p)s(erforms)g(a)i(trial)e(decompression)h +(and)g(thro)m(ws)g(a)m(w)m(a)m(y)j(the)870 1695 y(result.)390 +1849 y Fj(-f)30 b(--force)870 1953 y Fl(F)-8 b(orce)31 +b(o)m(v)m(erwrite)f(of)g(output)f(\014les.)40 b(Normally)-8 +b(,)29 b Fj(bzip2)f Fl(will)f(not)j(o)m(v)m(erwrite)870 +2057 y(existing)e(output)g(\014les.)39 b(Also)28 b(forces)h +Fj(bzip2)e Fl(to)i(break)g(hard)e(links)f(to)k(\014les,)870 +2161 y(whic)m(h)f(it)h(otherwise)g(w)m(ouldn't)f(do.)390 +2315 y Fj(-k)h(--keep)8 b Fl(Keep)24 b(\(don't)i(delete\))h(input)d +(\014les)g(during)g(compression)h(or)h(decompression.)390 +2469 y Fj(-s)k(--small)870 2573 y Fl(Reduce)23 b(memory)f(usage,)j(for) +d(compression,)h(decompression)f(and)g(testing.)870 2676 +y(Files)f(are)i(decompressed)e(and)h(tested)h(using)e(a)h(mo)s +(di\014ed)e(algorithm)h(whic)m(h)870 2780 y(only)30 b(requires)g(2.5)j +(b)m(ytes)f(p)s(er)e(blo)s(c)m(k)h(b)m(yte.)44 b(This)30 +b(means)h(an)m(y)h(\014le)e(can)i(b)s(e)870 2884 y(decompressed)d(in)f +(2300k)j(of)e(memory)-8 b(,)30 b(alb)s(eit)e(at)i(ab)s(out)f(half)g +(the)g(normal)870 2988 y(sp)s(eed.)870 3117 y(During)42 +b(compression,)k Fj(-s)d Fl(selects)h(a)g(blo)s(c)m(k)g(size)f(of)h +(200k,)k(whic)m(h)42 b(lim-)870 3220 y(its)33 b(memory)g(use)g(to)h +(around)e(the)i(same)f(\014gure,)h(at)g(the)g(exp)s(ense)f(of)g(y)m +(our)870 3324 y(compression)g(ratio.)50 b(In)33 b(short,)i(if)d(y)m +(our)i(mac)m(hine)f(is)g(lo)m(w)g(on)h(memory)f(\(8)870 +3428 y(megab)m(ytes)42 b(or)e(less\),)j(use)d(-s)g(for)g(ev)m +(erything.)71 b(See)40 b(MEMOR)-8 b(Y)41 b(MAN-)870 3532 +y(A)m(GEMENT)31 b(b)s(elo)m(w.)390 3686 y Fj(-q)f(--quiet)870 +3790 y Fl(Suppress)j(non-essen)m(tial)j(w)m(arning)e(messages.)58 +b(Messages)38 b(p)s(ertaining)33 b(to)870 3893 y(I/O)d(errors)g(and)g +(other)h(critical)e(ev)m(en)m(ts)j(will)27 b(not)k(b)s(e)f(suppressed.) +390 4047 y Fj(-v)g(--verbose)870 4151 y Fl(V)-8 b(erb)s(ose)28 +b(mo)s(de)f({)i(sho)m(w)e(the)h(compression)f(ratio)h(for)f(eac)m(h)i +(\014le)e(pro)s(cessed.)870 4255 y(F)-8 b(urther)30 b +Fj(-v)p Fl('s)g(increase)g(the)g(v)m(erb)s(osit)m(y)g(lev)m(el,)h(sp)s +(ewing)d(out)j(lots)f(of)g(infor-)870 4359 y(mation)g(whic)m(h)f(is)h +(primarily)d(of)j(in)m(terest)h(for)f(diagnostic)g(purp)s(oses.)390 +4513 y Fj(-L)g(--license)e(-V)h(--version)870 4617 y +Fl(Displa)m(y)h(the)g(soft)m(w)m(are)i(v)m(ersion,)e(license)f(terms)i +(and)e(conditions.)390 4771 y Fj(-1)h(to)g(-9)72 b Fl(Set)35 +b(the)g(blo)s(c)m(k)f(size)h(to)g(100)h(k,)g(200)g(k)f(..)53 +b(900)36 b(k)f(when)f(compressing.)53 b(Has)870 4875 +y(no)41 b(e\013ect)h(when)d(decompressing.)71 b(See)41 +b(MEMOR)-8 b(Y)41 b(MANA)m(GEMENT)870 4978 y(b)s(elo)m(w.)390 +5132 y Fj(--)324 b Fl(T)-8 b(reats)25 b(all)e(subsequen)m(t)g(argumen)m +(ts)i(as)f(\014le)g(names,)h(ev)m(en)g(if)e(they)i(start)f(with)870 +5236 y(a)32 b(dash.)43 b(This)29 b(is)h(so)i(y)m(ou)g(can)f(handle)f +(\014les)g(with)g(names)i(b)s(eginning)c(with)870 5340 +y(a)j(dash,)f(for)g(example:)40 b Fj(bzip2)29 b(--)h(-myfilename)p +Fl(.)p eop +%%Page: 6 7 +6 6 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(6)390 299 y Fj(--repetitive-fast)390 +427 y(--repetitive-best)870 530 y Fl(These)34 b(\015ags)g(are)h +(redundan)m(t)e(in)g(v)m(ersions)g(0.9.5)j(and)e(ab)s(o)m(v)m(e.)53 +b(They)34 b(pro-)870 634 y(vided)h(some)i(coarse)g(con)m(trol)g(o)m(v)m +(er)g(the)g(b)s(eha)m(viour)e(of)h(the)g(sorting)g(algo-)870 +738 y(rithm)h(in)h(earlier)g(v)m(ersions,)j(whic)m(h)d(w)m(as)h +(sometimes)h(useful.)65 b(0.9.5)41 b(and)870 842 y(ab)s(o)m(v)m(e)34 +b(ha)m(v)m(e)g(an)f(impro)m(v)m(ed)g(algorithm)f(whic)m(h)f(renders)h +(these)h(\015ags)h(irrel-)870 946 y(ev)-5 b(an)m(t.)390 +1190 y Ff(MEMOR)-10 b(Y)40 b(MANA)m(GEMENT)390 1377 y +Fj(bzip2)25 b Fl(compresses)i(large)g(\014les)e(in)g(blo)s(c)m(ks.)39 +b(The)26 b(blo)s(c)m(k)h(size)f(a\013ects)i(b)s(oth)e(the)h(compres-) +390 1481 y(sion)39 b(ratio)g(ac)m(hiev)m(ed,)k(and)d(the)f(amoun)m(t)i +(of)e(memory)h(needed)f(for)h(compression)f(and)390 1585 +y(decompression.)59 b(The)36 b(\015ags)h Fj(-1)f Fl(through)h +Fj(-9)f Fl(sp)s(ecify)f(the)i(blo)s(c)m(k)g(size)f(to)i(b)s(e)e +(100,000)390 1688 y(b)m(ytes)29 b(through)e(900,000)k(b)m(ytes)d(\(the) +h(default\))e(resp)s(ectiv)m(ely)-8 b(.)40 b(A)m(t)29 +b(decompression)e(time,)390 1792 y(the)32 b(blo)s(c)m(k)g(size)g(used)g +(for)g(compression)f(is)g(read)h(from)g(the)g(header)g(of)h(the)f +(compressed)390 1896 y(\014le,)j(and)f Fj(bunzip2)e Fl(then)i(allo)s +(cates)h(itself)e(just)h(enough)g(memory)g(to)i(decompress)e(the)390 +2000 y(\014le.)39 b(Since)29 b(blo)s(c)m(k)g(sizes)g(are)h(stored)f(in) +f(compressed)h(\014les,)g(it)g(follo)m(ws)f(that)i(the)g(\015ags)g +Fj(-1)390 2103 y Fl(to)h Fj(-9)f Fl(are)h(irrelev)-5 +b(an)m(t)29 b(to)i(and)f(so)h(ignored)e(during)f(decompression.)390 +2255 y(Compression)h(and)g(decompression)h(requiremen)m(ts,)f(in)g(b)m +(ytes,)j(can)e(b)s(e)g(estimated)h(as:)869 2406 y Fj(Compression:)140 +b(400k)46 b(+)i(\()f(8)h(x)f(block)f(size)h(\))869 2613 +y(Decompression:)d(100k)i(+)i(\()f(4)h(x)f(block)f(size)h(\),)g(or)1585 +2717 y(100k)f(+)i(\()f(2.5)g(x)g(block)g(size)f(\))390 +2868 y Fl(Larger)29 b(blo)s(c)m(k)f(sizes)h(giv)m(e)g(rapidly)d +(diminishing)e(marginal)k(returns.)39 b(Most)29 b(of)g(the)g(com-)390 +2972 y(pression)d(comes)j(from)f(the)g(\014rst)g(t)m(w)m(o)h(or)f +(three)h(h)m(undred)d(k)i(of)g(blo)s(c)m(k)g(size,)g(a)h(fact)g(w)m +(orth)390 3075 y(b)s(earing)j(in)f(mind)g(when)h(using)f +Fj(bzip2)h Fl(on)g(small)g(mac)m(hines.)47 b(It)33 b(is)f(also)h(imp)s +(ortan)m(t)f(to)390 3179 y(appreciate)j(that)h(the)f(decompression)f +(memory)h(requiremen)m(t)f(is)h(set)g(at)h(compression)390 +3283 y(time)30 b(b)m(y)g(the)h(c)m(hoice)g(of)g(blo)s(c)m(k)f(size.)390 +3434 y(F)-8 b(or)45 b(\014les)f(compressed)g(with)g(the)g(default)g +(900k)i(blo)s(c)m(k)e(size,)49 b Fj(bunzip2)42 b Fl(will)g(require)390 +3538 y(ab)s(out)29 b(3700)j(kb)m(ytes)e(to)h(decompress.)40 +b(T)-8 b(o)30 b(supp)s(ort)e(decompression)h(of)h(an)m(y)g(\014le)f(on) +g(a)i(4)390 3642 y(megab)m(yte)h(mac)m(hine,)d Fj(bunzip2)f +Fl(has)i(an)g(option)f(to)i(decompress)e(using)g(appro)m(ximately)390 +3745 y(half)k(this)g(amoun)m(t)i(of)f(memory)-8 b(,)36 +b(ab)s(out)e(2300)i(kb)m(ytes.)53 b(Decompression)34 +b(sp)s(eed)g(is)f(also)390 3849 y(halv)m(ed,)i(so)f(y)m(ou)h(should)d +(use)h(this)g(option)h(only)f(where)h(necessary)-8 b(.)53 +b(The)33 b(relev)-5 b(an)m(t)35 b(\015ag)390 3953 y(is)29 +b Fj(-s)p Fl(.)390 4104 y(In)34 b(general,)i(try)f(and)f(use)g(the)h +(largest)h(blo)s(c)m(k)e(size)h(memory)f(constrain)m(ts)h(allo)m(w,)h +(since)390 4208 y(that)45 b(maximises)f(the)h(compression)f(ac)m(hiev)m +(ed.)85 b(Compression)43 b(and)h(decompression)390 4311 +y(sp)s(eed)30 b(are)g(virtually)e(una\013ected)j(b)m(y)f(blo)s(c)m(k)g +(size.)390 4463 y(Another)25 b(signi\014can)m(t)f(p)s(oin)m(t)g +(applies)f(to)j(\014les)e(whic)m(h)g(\014t)h(in)e(a)j(single)d(blo)s(c) +m(k)i({)g(that)h(means)390 4566 y(most)g(\014les)g(y)m(ou'd)g(encoun)m +(ter)h(using)d(a)j(large)f(blo)s(c)m(k)g(size.)39 b(The)25 +b(amoun)m(t)i(of)f(real)g(memory)390 4670 y(touc)m(hed)38 +b(is)e(prop)s(ortional)f(to)j(the)f(size)g(of)h(the)f(\014le,)h(since)f +(the)g(\014le)g(is)f(smaller)g(than)h(a)390 4774 y(blo)s(c)m(k.)49 +b(F)-8 b(or)35 b(example,)f(compressing)e(a)i(\014le)e(20,000)k(b)m +(ytes)e(long)f(with)f(the)i(\015ag)g Fj(-9)f Fl(will)390 +4878 y(cause)28 b(the)f(compressor)g(to)h(allo)s(cate)f(around)f(7600k) +j(of)e(memory)-8 b(,)28 b(but)f(only)f(touc)m(h)i(400k)390 +4981 y Fj(+)h Fl(20000)j(*)e(8)g(=)f(560)i(kb)m(ytes)f(of)g(it.)40 +b(Similarly)-8 b(,)26 b(the)k(decompressor)f(will)e(allo)s(cate)j +(3700k)390 5085 y(but)g(only)f(touc)m(h)i(100k)h Fj(+)e +Fl(20000)i(*)f(4)g(=)f(180)i(kb)m(ytes.)390 5236 y(Here)41 +b(is)f(a)i(table)f(whic)m(h)e(summarises)g(the)j(maxim)m(um)d(memory)i +(usage)h(for)e(di\013eren)m(t)390 5340 y(blo)s(c)m(k)25 +b(sizes.)38 b(Also)25 b(recorded)g(is)f(the)i(total)g(compressed)e +(size)h(for)g(14)h(\014les)e(of)i(the)f(Calgary)p eop +%%Page: 7 8 +7 7 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(7)390 299 y(T)-8 b(ext)38 +b(Compression)d(Corpus)h(totalling)h(3,141,622)k(b)m(ytes.)61 +b(This)36 b(column)g(giv)m(es)i(some)390 403 y(feel)23 +b(for)f(ho)m(w)h(compression)f(v)-5 b(aries)23 b(with)e(blo)s(c)m(k)i +(size.)38 b(These)23 b(\014gures)f(tend)g(to)i(understate)390 +506 y(the)g(adv)-5 b(an)m(tage)26 b(of)e(larger)f(blo)s(c)m(k)h(sizes)f +(for)h(larger)f(\014les,)h(since)g(the)g(Corpus)e(is)h(dominated)390 +610 y(b)m(y)30 b(smaller)f(\014les.)1107 761 y Fj(Compress)141 +b(Decompress)g(Decompress)f(Corpus)773 865 y(Flag)238 +b(usage)285 b(usage)332 b(-s)48 b(usage)237 b(Size)821 +1073 y(-1)286 b(1200k)332 b(500k)429 b(350k)285 b(914704)821 +1176 y(-2)h(2000k)332 b(900k)429 b(600k)285 b(877703)821 +1280 y(-3)h(2800k)f(1300k)428 b(850k)285 b(860338)821 +1384 y(-4)h(3600k)f(1700k)380 b(1100k)285 b(846899)821 +1488 y(-5)h(4400k)f(2100k)380 b(1350k)285 b(845160)821 +1591 y(-6)h(5200k)f(2500k)380 b(1600k)285 b(838626)821 +1695 y(-7)h(6100k)f(2900k)380 b(1850k)285 b(834096)821 +1799 y(-8)h(6800k)f(3300k)380 b(2100k)285 b(828642)821 +1903 y(-9)h(7600k)f(3700k)380 b(2350k)285 b(828642)390 +2147 y Ff(RECO)m(VERING)37 b(D)m(A)-10 b(T)g(A)40 b(FR)m(OM)h(D)m(AMA)m +(GED)e(FILES)390 2333 y Fj(bzip2)25 b Fl(compresses)h(\014les)g(in)f +(blo)s(c)m(ks,)h(usually)e(900kb)m(ytes)29 b(long.)39 +b(Eac)m(h)27 b(blo)s(c)m(k)e(is)h(handled)390 2437 y(indep)s(enden)m +(tly)-8 b(.)47 b(If)32 b(a)i(media)e(or)h(transmission)e(error)i +(causes)h(a)f(m)m(ulti-blo)s(c)m(k)f Fj(.bz2)g Fl(\014le)390 +2541 y(to)k(b)s(ecome)h(damaged,)g(it)e(ma)m(y)i(b)s(e)e(p)s(ossible)e +(to)k(reco)m(v)m(er)g(data)f(from)g(the)f(undamaged)390 +2645 y(blo)s(c)m(ks)30 b(in)f(the)h(\014le.)390 2796 +y(The)j(compressed)h(represen)m(tation)f(of)h(eac)m(h)h(blo)s(c)m(k)e +(is)g(delimited)e(b)m(y)j(a)g(48-bit)g(pattern,)390 2900 +y(whic)m(h)27 b(mak)m(es)j(it)e(p)s(ossible)e(to)j(\014nd)e(the)i(blo)s +(c)m(k)f(b)s(oundaries)e(with)i(reasonable)g(certain)m(t)m(y)-8 +b(.)390 3003 y(Eac)m(h)34 b(blo)s(c)m(k)f(also)g(carries)g(its)g(o)m +(wn)g(32-bit)g(CR)m(C,)h(so)f(damaged)h(blo)s(c)m(ks)f(can)g(b)s(e)g +(distin-)390 3107 y(guished)c(from)h(undamaged)g(ones.)390 +3258 y Fj(bzip2recover)37 b Fl(is)j(a)h(simple)e(program)h(whose)g +(purp)s(ose)f(is)h(to)i(searc)m(h)f(for)f(blo)s(c)m(ks)g(in)390 +3362 y Fj(.bz2)34 b Fl(\014les,)i(and)f(write)f(eac)m(h)j(blo)s(c)m(k)d +(out)i(in)m(to)f(its)g(o)m(wn)g Fj(.bz2)f Fl(\014le.)55 +b(Y)-8 b(ou)36 b(can)f(then)g(use)390 3466 y Fj(bzip2)29 +b(-t)c Fl(to)i(test)f(the)g(in)m(tegrit)m(y)g(of)g(the)g(resulting)e +(\014les,)i(and)f(decompress)h(those)g(whic)m(h)390 3569 +y(are)31 b(undamaged.)390 3721 y Fj(bzip2recover)41 b +Fl(tak)m(es)46 b(a)f(single)e(argumen)m(t,)49 b(the)44 +b(name)h(of)g(the)f(damaged)h(\014le,)j(and)390 3824 +y(writes)33 b(a)i(n)m(um)m(b)s(er)d(of)j(\014les)e Fj(rec0001file.bz2)p +Fl(,)e Fj(rec0002file.bz2)p Fl(,)g(etc,)36 b(con)m(taining)390 +3928 y(the)42 b(extracted)g(blo)s(c)m(ks.)74 b(The)41 +b(output)g(\014lenames)f(are)i(designed)e(so)i(that)g(the)g(use)f(of) +390 4032 y(wildcards)30 b(in)h(subsequen)m(t)h(pro)s(cessing)f({)i(for) +g(example,)g Fj(bzip2)c(-dc)g(rec*file.bz2)e(>)390 4136 +y(recovered_data)f Fl({)31 b(lists)e(the)i(\014les)e(in)g(the)i +(correct)g(order.)390 4287 y Fj(bzip2recover)38 b Fl(should)i(b)s(e)g +(of)i(most)g(use)f(dealing)f(with)g(large)i Fj(.bz2)e +Fl(\014les,)k(as)d(these)390 4390 y(will)29 b(con)m(tain)j(man)m(y)g +(blo)s(c)m(ks.)45 b(It)32 b(is)f(clearly)g(futile)f(to)i(use)g(it)f(on) +h(damaged)g(single-blo)s(c)m(k)390 4494 y(\014les,)g(since)f(a)h +(damaged)h(blo)s(c)m(k)e(cannot)i(b)s(e)e(reco)m(v)m(ered.)47 +b(If)32 b(y)m(ou)g(wish)e(to)j(minimise)c(an)m(y)390 +4598 y(p)s(oten)m(tial)36 b(data)i(loss)e(through)g(media)h(or)f +(transmission)f(errors,)j(y)m(ou)f(migh)m(t)g(consider)390 +4702 y(compressing)29 b(with)g(a)i(smaller)e(blo)s(c)m(k)h(size.)390 +4946 y Ff(PERF)m(ORMANCE)39 b(NOTES)390 5132 y Fl(The)f(sorting)f +(phase)h(of)h(compression)e(gathers)i(together)h(similar)35 +b(strings)i(in)g(the)i(\014le.)390 5236 y(Because)54 +b(of)f(this,)58 b(\014les)52 b(con)m(taining)g(v)m(ery)h(long)g(runs)e +(of)i(rep)s(eated)g(sym)m(b)s(ols,)58 b(lik)m(e)390 5340 +y Fj(")p Fl(aabaabaabaab)e(...)p Fj(")g Fl(\(rep)s(eated)g(sev)m(eral)f +(h)m(undred)e(times\))i(ma)m(y)h(compress)f(more)p eop +%%Page: 8 9 +8 8 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31 +b(to)g(use)f Fj(bzip2)2375 b Fl(8)390 299 y(slo)m(wly)33 +b(than)g(normal.)50 b(V)-8 b(ersions)33 b(0.9.5)i(and)f(ab)s(o)m(v)m(e) +h(fare)e(m)m(uc)m(h)h(b)s(etter)g(than)f(previous)390 +403 y(v)m(ersions)i(in)g(this)f(resp)s(ect.)57 b(The)35 +b(ratio)h(b)s(et)m(w)m(een)h(w)m(orst-case)g(and)e(a)m(v)m(erage-case) +40 b(com-)390 506 y(pression)e(time)h(is)f(in)g(the)h(region)g(of)h +(10:1.)69 b(F)-8 b(or)40 b(previous)e(v)m(ersions,)j(this)d(\014gure)h +(w)m(as)390 610 y(more)f(lik)m(e)g(100:1.)66 b(Y)-8 b(ou)38 +b(can)h(use)e(the)i Fj(-vvvv)d Fl(option)i(to)h(monitor)e(progress)h +(in)f(great)390 714 y(detail,)30 b(if)f(y)m(ou)i(w)m(an)m(t.)390 +865 y(Decompression)f(sp)s(eed)g(is)f(una\013ected)i(b)m(y)f(these)h +(phenomena.)390 1016 y Fj(bzip2)i Fl(usually)g(allo)s(cates)i(sev)m +(eral)f(megab)m(ytes)j(of)d(memory)h(to)g(op)s(erate)h(in,)e(and)g +(then)390 1120 y(c)m(harges)k(all)d(o)m(v)m(er)j(it)f(in)e(a)i(fairly)e +(random)h(fashion.)59 b(This)34 b(means)j(that)g(p)s(erformance,)390 +1224 y(b)s(oth)27 b(for)h(compressing)f(and)g(decompressing,)h(is)f +(largely)g(determined)g(b)m(y)h(the)g(sp)s(eed)f(at)390 +1327 y(whic)m(h)35 b(y)m(our)h(mac)m(hine)g(can)g(service)g(cac)m(he)i +(misses.)57 b(Because)37 b(of)g(this,)f(small)f(c)m(hanges)390 +1431 y(to)f(the)f(co)s(de)h(to)f(reduce)g(the)h(miss)d(rate)j(ha)m(v)m +(e)h(b)s(een)d(observ)m(ed)h(to)h(giv)m(e)g(disprop)s(ortion-)390 +1535 y(ately)i(large)f(p)s(erformance)f(impro)m(v)m(emen)m(ts.)56 +b(I)35 b(imagine)f Fj(bzip2)g Fl(will)e(p)s(erform)i(b)s(est)h(on)390 +1639 y(mac)m(hines)30 b(with)f(v)m(ery)i(large)f(cac)m(hes.)390 +1885 y Ff(CA)-14 b(VEA)k(TS)390 2072 y Fl(I/O)38 b(error)g(messages)h +(are)f(not)h(as)f(helpful)e(as)i(they)g(could)f(b)s(e.)64 +b Fj(bzip2)37 b Fl(tries)g(hard)g(to)390 2176 y(detect)29 +b(I/O)e(errors)g(and)f(exit)i(cleanly)-8 b(,)27 b(but)g(the)h(details)e +(of)h(what)h(the)f(problem)f(is)g(some-)390 2280 y(times)k(seem)h +(rather)f(misleading.)390 2431 y(This)j(man)m(ual)g(page)i(p)s(ertains) +e(to)i(v)m(ersion)f(1.0)i(of)e Fj(bzip2)p Fl(.)51 b(Compressed)34 +b(data)h(created)390 2534 y(b)m(y)25 b(this)e(v)m(ersion)i(is)e(en)m +(tirely)h(forw)m(ards)h(and)f(bac)m(kw)m(ards)h(compatible)f(with)f +(the)i(previous)390 2638 y(public)18 b(releases,)24 b(v)m(ersions)c +(0.1pl2,)k(0.9.0)e(and)f(0.9.5,)k(but)20 b(with)g(the)h(follo)m(wing)e +(exception:)390 2742 y(0.9.0)43 b(and)e(ab)s(o)m(v)m(e)h(can)g +(correctly)f(decompress)g(m)m(ultiple)e(concatenated)k(compressed)390 +2846 y(\014les.)c(0.1pl2)30 b(cannot)g(do)f(this;)f(it)h(will)e(stop)i +(after)h(decompressing)e(just)g(the)i(\014rst)e(\014le)g(in)390 +2949 y(the)j(stream.)390 3100 y Fj(bzip2recover)20 b +Fl(uses)k(32-bit)g(in)m(tegers)f(to)i(represen)m(t)f(bit)e(p)s +(ositions)g(in)g(compressed)i(\014les,)390 3204 y(so)j(it)f(cannot)i +(handle)d(compressed)i(\014les)f(more)h(than)f(512)i(megab)m(ytes)h +(long.)39 b(This)25 b(could)390 3308 y(easily)30 b(b)s(e)f(\014xed.)390 +3555 y Ff(A)m(UTHOR)390 3741 y Fl(Julian)f(Sew)m(ard,)i +Fj(jseward@acm.org)p Fl(.)390 3892 y(The)24 b(ideas)f(em)m(b)s(o)s +(died)f(in)h Fj(bzip2)f Fl(are)j(due)e(to)i(\(at)g(least\))g(the)f +(follo)m(wing)e(p)s(eople:)37 b(Mic)m(hael)390 3996 y(Burro)m(ws)48 +b(and)g(Da)m(vid)h(Wheeler)f(\(for)h(the)g(blo)s(c)m(k)f(sorting)g +(transformation\),)53 b(Da)m(vid)390 4100 y(Wheeler)45 +b(\(again,)50 b(for)45 b(the)g(Hu\013man)g(co)s(der\),)k(P)m(eter)d(F) +-8 b(en)m(wic)m(k)46 b(\(for)g(the)f(structured)390 4204 +y(co)s(ding)26 b(mo)s(del)g(in)f(the)i(original)e Fj(bzip)p +Fl(,)i(and)f(man)m(y)h(re\014nemen)m(ts\),)h(and)e(Alistair)f +(Mo\013at,)390 4307 y(Radford)34 b(Neal)h(and)f(Ian)h(Witten)g(\(for)f +(the)h(arithmetic)g(co)s(der)f(in)g(the)h(original)d +Fj(bzip)p Fl(\).)390 4411 y(I)41 b(am)g(m)m(uc)m(h)h(indebted)e(for)h +(their)f(help,)j(supp)s(ort)c(and)i(advice.)74 b(See)41 +b(the)h(man)m(ual)e(in)390 4515 y(the)28 b(source)g(distribution)23 +b(for)28 b(p)s(oin)m(ters)e(to)j(sources)e(of)h(do)s(cumen)m(tation.)40 +b(Christian)25 b(v)m(on)390 4619 y(Ro)s(ques)31 b(encouraged)h(me)g(to) +g(lo)s(ok)f(for)h(faster)g(sorting)f(algorithms,)f(so)i(as)g(to)g(sp)s +(eed)f(up)390 4723 y(compression.)47 b(Bela)34 b(Lubkin)c(encouraged)k +(me)f(to)g(impro)m(v)m(e)g(the)g(w)m(orst-case)i(compres-)390 +4826 y(sion)25 b(p)s(erformance.)38 b(Man)m(y)26 b(p)s(eople)f(sen)m(t) +h(patc)m(hes,)h(help)s(ed)d(with)g(p)s(ortabilit)m(y)f(problems,)390 +4930 y(len)m(t)30 b(mac)m(hines,)g(ga)m(v)m(e)j(advice)d(and)g(w)m(ere) +h(generally)f(helpful.)p eop +%%Page: 9 10 +9 9 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1927 b Fl(9)150 299 y Fh(3)80 b(Programming)53 +b(with)h Fg(libbzip2)150 568 y Fl(This)29 b(c)m(hapter)i(describ)s(es)d +(the)j(programming)e(in)m(terface)i(to)g Fj(libbzip2)p +Fl(.)150 725 y(F)-8 b(or)36 b(general)e(bac)m(kground)h(information,)f +(particularly)f(ab)s(out)h(memory)h(use)f(and)g(p)s(erformance)g(as-) +150 834 y(p)s(ects,)d(y)m(ou'd)f(b)s(e)g(w)m(ell)f(advised)g(to)j(read) +e(Chapter)g(2)g(as)h(w)m(ell.)150 1124 y Fk(3.1)68 b(T)-11 +b(op-lev)l(el)46 b(structure)150 1316 y Fj(libbzip2)33 +b Fl(is)i(a)h(\015exible)e(library)f(for)j(compressing)f(and)g +(decompressing)f(data)j(in)d(the)i Fj(bzip2)e Fl(data)150 +1426 y(format.)39 b(Although)24 b(pac)m(k)-5 b(aged)26 +b(as)e(a)h(single)e(en)m(tit)m(y)-8 b(,)27 b(it)d(helps)f(to)i(regard)g +(the)g(library)d(as)i(three)h(separate)150 1535 y(parts:)40 +b(the)31 b(lo)m(w)f(lev)m(el)g(in)m(terface,)h(and)f(the)h(high)e(lev)m +(el)h(in)m(terface,)h(and)f(some)h(utilit)m(y)d(functions.)150 +1692 y(The)38 b(structure)g(of)g Fj(libbzip2)p Fl('s)e(in)m(terfaces)j +(is)e(similar)f(to)j(that)g(of)g(Jean-loup)e(Gailly's)g(and)h(Mark)150 +1802 y(Adler's)29 b(excellen)m(t)i Fj(zlib)e Fl(library)-8 +b(.)150 1959 y(All)29 b(externally)g(visible)f(sym)m(b)s(ols)h(ha)m(v)m +(e)i(names)f(b)s(eginning)e Fj(BZ2_)p Fl(.)39 b(This)29 +b(is)g(new)h(in)f(v)m(ersion)h(1.0.)41 b(The)150 2068 +y(in)m(ten)m(tion)30 b(is)f(to)i(minimise)d(p)s(ollution)f(of)k(the)f +(namespaces)h(of)g(library)d(clien)m(ts.)150 2321 y Ff(3.1.1)63 +b(Lo)m(w-lev)m(el)39 b(summary)150 2514 y Fl(This)21 +b(in)m(terface)h(pro)m(vides)g(services)g(for)g(compressing)f(and)h +(decompressing)f(data)i(in)e(memory)-8 b(.)38 b(There's)150 +2623 y(no)43 b(pro)m(vision)e(for)h(dealing)g(with)f(\014les,)k +(streams)e(or)g(an)m(y)g(other)g(I/O)g(mec)m(hanisms,)i(just)e(straigh) +m(t)150 2733 y(memory-to-memory)25 b(w)m(ork.)38 b(In)23 +b(fact,)k(this)22 b(part)i(of)f(the)h(library)d(can)j(b)s(e)f(compiled) +f(without)h(inclusion)150 2843 y(of)31 b Fj(stdio.h)p +Fl(,)d(whic)m(h)h(ma)m(y)i(b)s(e)f(helpful)d(for)k(em)m(b)s(edded)e +(applications.)150 2999 y(The)h(lo)m(w-lev)m(el)g(part)g(of)h(the)f +(library)e(has)i(no)h(global)e(v)-5 b(ariables)29 b(and)h(is)g +(therefore)g(thread-safe.)150 3156 y(Six)d(routines)g(mak)m(e)j(up)d +(the)i(lo)m(w)f(lev)m(el)g(in)m(terface:)41 b Fj(BZ2_bzCompressInit)p +Fl(,)24 b Fj(BZ2_bzCompress)p Fl(,)h(and)150 3266 y Fj +(BZ2_bzCompressEnd)h Fl(for)k(compression,)f(and)h(a)h(corresp)s +(onding)d(trio)i Fj(BZ2_bzDecompressInit)p Fl(,)150 3375 +y Fj(BZ2_bzDecompress)37 b Fl(and)j Fj(BZ2_bzDecompressEnd)c +Fl(for)42 b(decompression.)72 b(The)41 b Fj(*Init)e Fl(functions)150 +3485 y(allo)s(cate)44 b(memory)g(for)f(compression/decompression)f(and) +h(do)h(other)g(initialisations,)f(whilst)f(the)150 3595 +y Fj(*End)29 b Fl(functions)g(close)i(do)m(wn)f(op)s(erations)f(and)h +(release)h(memory)-8 b(.)150 3751 y(The)36 b(real)f(w)m(ork)i(is)e +(done)h(b)m(y)g Fj(BZ2_bzCompress)c Fl(and)j Fj(BZ2_bzDecompress)p +Fl(.)54 b(These)36 b(compress)g(and)150 3861 y(decompress)30 +b(data)h(from)f(a)h(user-supplied)c(input)i(bu\013er)g(to)i(a)g +(user-supplied)c(output)j(bu\013er.)40 b(These)150 3971 +y(bu\013ers)32 b(can)i(b)s(e)e(an)m(y)i(size;)g(arbitrary)e(quan)m +(tities)h(of)g(data)h(are)g(handled)d(b)m(y)i(making)f(rep)s(eated)i +(calls)150 4080 y(to)f(these)f(functions.)44 b(This)30 +b(is)h(a)h(\015exible)e(mec)m(hanism)i(allo)m(wing)e(a)i(consumer-pull) +e(st)m(yle)i(of)g(activit)m(y)-8 b(,)150 4190 y(or)30 +b(pro)s(ducer-push,)e(or)i(a)h(mixture)e(of)i(b)s(oth.)150 +4443 y Ff(3.1.2)63 b(High-lev)m(el)41 b(summary)150 4635 +y Fl(This)d(in)m(terface)j(pro)m(vides)e(some)h(handy)f(wrapp)s(ers)f +(around)h(the)i(lo)m(w-lev)m(el)f(in)m(terface)g(to)h(facilitate)150 +4745 y(reading)26 b(and)g(writing)f Fj(bzip2)g Fl(format)i(\014les)f +(\()p Fj(.bz2)g Fl(\014les\).)38 b(The)27 b(routines)e(pro)m(vide)h(ho) +s(oks)h(to)g(facilitate)150 4854 y(reading)43 b(\014les)f(in)h(whic)m +(h)f(the)i Fj(bzip2)f Fl(data)h(stream)g(is)f(em)m(b)s(edded)f(within)g +(some)i(larger-scale)g(\014le)150 4964 y(structure,)30 +b(or)h(where)e(there)i(are)g(m)m(ultiple)d Fj(bzip2)h +Fl(data)i(streams)f(concatenated)j(end-to-end.)150 5121 +y(F)-8 b(or)31 b(reading)f(\014les,)f Fj(BZ2_bzReadOpen)p +Fl(,)e Fj(BZ2_bzRead)p Fl(,)h Fj(BZ2_bzReadClose)e Fl(and)150 +5230 y Fj(BZ2_bzReadGetUnused)19 b Fl(are)25 b(supplied.)36 +b(F)-8 b(or)25 b(writing)d(\014les,)j Fj(BZ2_bzWriteOpen)p +Fl(,)d Fj(BZ2_bzWrite)g Fl(and)150 5340 y Fj(BZ2_bzWriteFinish)k +Fl(are)k(a)m(v)-5 b(ailable.)p eop +%%Page: 10 11 +10 10 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(10)150 299 y(As)24 b(with)f(the)h(lo)m +(w-lev)m(el)h(library)-8 b(,)23 b(no)h(global)g(v)-5 +b(ariables)23 b(are)h(used)g(so)g(the)h(library)c(is)j(p)s(er)f(se)h +(thread-safe.)150 408 y(Ho)m(w)m(ev)m(er,)32 b(if)c(I/O)h(errors)g(o)s +(ccur)g(whilst)e(reading)i(or)g(writing)e(the)j(underlying)c +(compressed)j(\014les,)g(y)m(ou)150 518 y(ma)m(y)j(ha)m(v)m(e)g(to)g +(consult)e Fj(errno)g Fl(to)h(determine)g(the)g(cause)g(of)h(the)f +(error.)42 b(In)30 b(that)i(case,)h(y)m(ou'd)e(need)g(a)150 +628 y(C)f(library)e(whic)m(h)h(correctly)i(supp)s(orts)d +Fj(errno)h Fl(in)g(a)i(m)m(ultithreaded)e(en)m(vironmen)m(t.)150 +784 y(T)-8 b(o)56 b(mak)m(e)g(the)g(library)d(a)j(little)e(simpler)f +(and)i(more)h(p)s(ortable,)61 b Fj(BZ2_bzReadOpen)51 +b Fl(and)k Fj(BZ2_)150 894 y(bzWriteOpen)34 b Fl(require)j(y)m(ou)g(to) +i(pass)e(them)g(\014le)g(handles)f(\()p Fj(FILE*)p Fl(s\))g(whic)m(h)h +(ha)m(v)m(e)h(previously)e(b)s(een)150 1004 y(op)s(ened)41 +b(for)g(reading)f(or)h(writing)f(resp)s(ectiv)m(ely)-8 +b(.)73 b(That)41 b(a)m(v)m(oids)h(p)s(ortabilit)m(y)d(problems)g(asso)s +(ciated)150 1113 y(with)j(\014le)h(op)s(erations)g(and)g(\014le)g +(attributes,)j(whilst)c(not)i(b)s(eing)e(m)m(uc)m(h)h(of)h(an)g(imp)s +(osition)c(on)k(the)150 1223 y(programmer.)150 1474 y +Ff(3.1.3)63 b(Utilit)m(y)40 b(functions)h(summary)150 +1666 y Fl(F)-8 b(or)45 b(v)m(ery)g(simple)d(needs,)48 +b Fj(BZ2_bzBuffToBuffCompres)o(s)38 b Fl(and)44 b Fj +(BZ2_bzBuffToBuffDecompres)o(s)150 1776 y Fl(are)29 b(pro)m(vided.)38 +b(These)28 b(compress)g(data)h(in)e(memory)h(from)g(one)h(bu\013er)e +(to)i(another)f(bu\013er)g(in)f(a)h(single)150 1885 y(function)38 +b(call.)67 b(Y)-8 b(ou)40 b(should)d(assess)j(whether)f(these)h +(functions)d(ful\014ll)f(y)m(our)k(memory-to-memory)150 +1995 y(compression/decompression)26 b(requiremen)m(ts)h(b)s(efore)g(in) +m(v)m(esting)g(e\013ort)i(in)d(understanding)f(the)j(more)150 +2105 y(general)i(but)g(more)h(complex)f(lo)m(w-lev)m(el)g(in)m +(terface.)150 2261 y(Y)-8 b(oshiok)j(a)47 b(Tsuneo)e(\()p +Fj(QWF00133@niftyserve.or.jp)40 b Fl(/)46 b Fj +(tsuneo-y@is.aist-nara.ac.)o(jp)p Fl(\))40 b(has)150 +2371 y(con)m(tributed)f(some)h(functions)e(to)j(giv)m(e)f(b)s(etter)g +Fj(zlib)f Fl(compatibilit)m(y)-8 b(.)67 b(These)40 b(functions)e(are)i +Fj(BZ2_)150 2481 y(bzopen)p Fl(,)e Fj(BZ2_bzread)p Fl(,)f +Fj(BZ2_bzwrite)p Fl(,)g Fj(BZ2_bzflush)p Fl(,)g Fj(BZ2_bzclose)p +Fl(,)f Fj(BZ2_bzerror)f Fl(and)i Fj(BZ2_)150 2590 y(bzlibVersion)p +Fl(.)49 b(Y)-8 b(ou)35 b(ma)m(y)g(\014nd)e(these)i(functions)d(more)j +(con)m(v)m(enien)m(t)g(for)f(simple)f(\014le)g(reading)h(and)150 +2700 y(writing,)c(than)h(those)h(in)e(the)i(high-lev)m(el)e(in)m +(terface.)45 b(These)31 b(functions)f(are)i(not)g(\(y)m(et\))h +(o\016cially)d(part)150 2809 y(of)k(the)g(library)-8 +b(,)33 b(and)g(are)h(minimally)c(do)s(cumen)m(ted)k(here.)51 +b(If)33 b(they)h(break,)h(y)m(ou)f(get)h(to)g(k)m(eep)f(all)f(the)150 +2919 y(pieces.)40 b(I)31 b(hop)s(e)e(to)i(do)s(cumen)m(t)g(them)f(prop) +s(erly)e(when)h(time)i(p)s(ermits.)150 3076 y(Y)-8 b(oshiok)j(a)27 +b(also)g(con)m(tributed)f(mo)s(di\014cations)f(to)i(allo)m(w)f(the)h +(library)e(to)i(b)s(e)f(built)f(as)i(a)g(Windo)m(ws)f(DLL.)150 +3362 y Fk(3.2)68 b(Error)45 b(handling)150 3554 y Fl(The)23 +b(library)f(is)h(designed)g(to)i(reco)m(v)m(er)g(cleanly)f(in)e(all)h +(situations,)h(including)d(the)j(w)m(orst-case)i(situation)150 +3664 y(of)j(decompressing)e(random)g(data.)41 b(I'm)28 +b(not)h(100\045)g(sure)f(that)h(it)f(can)h(alw)m(a)m(ys)g(do)f(this,)g +(so)g(y)m(ou)h(migh)m(t)150 3774 y(w)m(an)m(t)i(to)g(add)e(a)i(signal)d +(handler)g(to)j(catc)m(h)h(segmen)m(tation)f(violations)e(during)f +(decompression)h(if)g(y)m(ou)150 3883 y(are)g(feeling)f(esp)s(ecially)f +(paranoid.)39 b(I)28 b(w)m(ould)g(b)s(e)g(in)m(terested)h(in)e(hearing) +h(more)h(ab)s(out)f(the)h(robustness)150 3993 y(of)i(the)f(library)e +(to)j(corrupted)f(compressed)g(data.)150 4150 y(V)-8 +b(ersion)39 b(1.0)h(is)f(m)m(uc)m(h)g(more)h(robust)e(in)g(this)g(resp) +s(ect)i(than)f(0.9.0)i(or)e(0.9.5.)70 b(In)m(v)m(estigations)39 +b(with)150 4259 y(Chec)m(k)m(er)21 b(\(a)g(to)s(ol)g(for)f(detecting)h +(problems)d(with)h(memory)h(managemen)m(t,)k(similar)18 +b(to)j(Purify\))e(indicate)150 4369 y(that,)40 b(at)e(least)f(for)g +(the)h(few)e(\014les)h(I)g(tested,)j(all)c(single-bit)f(errors)i(in)e +(the)j(decompressed)f(data)h(are)150 4478 y(caugh)m(t)c(prop)s(erly)-8 +b(,)31 b(with)g(no)i(segmen)m(tation)h(faults,)e(no)g(reads)h(of)g +(uninitialised)27 b(data)34 b(and)e(no)g(out)h(of)150 +4588 y(range)f(reads)g(or)f(writes.)44 b(So)32 b(it's)f(certainly)g(m)m +(uc)m(h)h(impro)m(v)m(ed,)g(although)f(I)g(w)m(ouldn't)g(claim)g(it)g +(to)i(b)s(e)150 4698 y(totally)d(b)s(om)m(bpro)s(of.)150 +4854 y(The)25 b(\014le)g Fj(bzlib.h)f Fl(con)m(tains)i(all)f +(de\014nitions)e(needed)i(to)i(use)e(the)h(library)-8 +b(.)37 b(In)26 b(particular,)f(y)m(ou)h(should)150 4964 +y(de\014nitely)i(not)j(include)d Fj(bzlib_private.h)p +Fl(.)150 5121 y(In)39 b Fj(bzlib.h)p Fl(,)h(the)g(v)-5 +b(arious)39 b(return)f(v)-5 b(alues)39 b(are)h(de\014ned.)68 +b(The)39 b(follo)m(wing)f(list)h(is)f(not)i(in)m(tended)f(as)150 +5230 y(an)c(exhaustiv)m(e)h(description)d(of)i(the)h(circumstances)f +(in)f(whic)m(h)g(a)i(giv)m(en)f(v)-5 b(alue)35 b(ma)m(y)h(b)s(e)e +(returned)h({)150 5340 y(those)h(descriptions)d(are)j(giv)m(en)f +(later.)56 b(Rather,)37 b(it)d(is)h(in)m(tended)f(to)i(con)m(v)m(ey)h +(the)e(rough)g(meaning)g(of)p eop +%%Page: 11 12 +11 11 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(11)150 299 y(eac)m(h)38 +b(return)d(v)-5 b(alue.)59 b(The)36 b(\014rst)g(\014v)m(e)g(actions)h +(are)g(normal)f(and)f(not)i(in)m(tended)f(to)h(denote)g(an)f(error)150 +408 y(situation.)150 592 y Fj(BZ_OK)180 b Fl(The)30 b(requested)g +(action)h(w)m(as)g(completed)f(successfully)-8 b(.)150 +756 y Fj(BZ_RUN_OK)150 866 y(BZ_FLUSH_OK)150 975 y(BZ_FINISH_OK)630 +1085 y Fl(In)24 b Fj(BZ2_bzCompress)p Fl(,)e(the)i(requested)g +(\015ush/\014nish/nothing-sp)s(ecial)c(action)k(w)m(as)h(com-)630 +1194 y(pleted)30 b(successfully)-8 b(.)150 1358 y Fj(BZ_STREAM_END)630 +1468 y Fl(Compression)38 b(of)j(data)f(w)m(as)h(completed,)h(or)f(the)f +(logical)f(stream)i(end)e(w)m(as)i(detected)630 1577 +y(during)28 b(decompression.)150 1761 y(The)i(follo)m(wing)f(return)g +(v)-5 b(alues)30 b(indicate)f(an)h(error)g(of)h(some)g(kind.)150 +1945 y Fj(BZ_CONFIG_ERROR)630 2055 y Fl(Indicates)48 +b(that)h(the)g(library)e(has)h(b)s(een)g(improp)s(erly)d(compiled)j(on) +g(y)m(our)h(platform)630 2164 y({)j(a)g(ma)5 b(jor)51 +b(con\014guration)g(error.)104 b(Sp)s(eci\014cally)-8 +b(,)55 b(it)c(means)g(that)h Fj(sizeof\(char\))p Fl(,)630 +2274 y Fj(sizeof\(short\))44 b Fl(and)i Fj(sizeof\(int\))f +Fl(are)j(not)f(1,)52 b(2)c(and)f(4)h(resp)s(ectiv)m(ely)-8 +b(,)51 b(as)d(they)630 2384 y(should)27 b(b)s(e.)40 b(Note)30 +b(that)g(the)f(library)e(should)g(still)g(w)m(ork)i(prop)s(erly)e(on)i +(64-bit)g(platforms)630 2493 y(whic)m(h)d(follo)m(w)h(the)g(LP64)h +(programming)e(mo)s(del)h({)g(that)h(is,)g(where)e Fj(sizeof\(long\))f +Fl(and)630 2603 y Fj(sizeof\(void*\))e Fl(are)k(8.)40 +b(Under)25 b(LP64,)j Fj(sizeof\(int\))c Fl(is)h(still)f(4,)k(so)f +Fj(libbzip2)p Fl(,)e(whic)m(h)630 2712 y(do)s(esn't)30 +b(use)g(the)h Fj(long)e Fl(t)m(yp)s(e,)i(is)e(OK.)150 +2876 y Fj(BZ_SEQUENCE_ERROR)630 2986 y Fl(When)43 b(using)f(the)i +(library)-8 b(,)45 b(it)e(is)f(imp)s(ortan)m(t)h(to)h(call)e(the)i +(functions)e(in)g(the)i(correct)630 3095 y(sequence)28 +b(and)f(with)f(data)j(structures)e(\(bu\013ers)f(etc\))j(in)e(the)g +(correct)i(states.)41 b Fj(libbzip2)630 3205 y Fl(c)m(hec)m(ks)26 +b(as)e(m)m(uc)m(h)h(as)f(it)g(can)g(to)h(ensure)f(this)f(is)g(happ)s +(ening,)h(and)f(returns)g Fj(BZ_SEQUENCE_)630 3314 y(ERROR)36 +b Fl(if)h(not.)62 b(Co)s(de)37 b(whic)m(h)g(complies)f(precisely)g +(with)h(the)g(function)g(seman)m(tics,)j(as)630 3424 +y(detailed)d(b)s(elo)m(w,)i(should)d(nev)m(er)i(receiv)m(e)h(this)d(v) +-5 b(alue;)41 b(suc)m(h)d(an)g(ev)m(en)m(t)h(denotes)f(buggy)630 +3534 y(co)s(de)31 b(whic)m(h)e(y)m(ou)h(should)f(in)m(v)m(estigate.)150 +3697 y Fj(BZ_PARAM_ERROR)630 3807 y Fl(Returned)43 b(when)f(a)i +(parameter)g(to)h(a)f(function)e(call)h(is)f(out)i(of)g(range)g(or)g +(otherwise)630 3917 y(manifestly)34 b(incorrect.)57 b(As)36 +b(with)e Fj(BZ_SEQUENCE_ERROR)p Fl(,)f(this)i(denotes)h(a)g(bug)f(in)g +(the)630 4026 y(clien)m(t)23 b(co)s(de.)39 b(The)22 b(distinction)f(b)s +(et)m(w)m(een)j Fj(BZ_PARAM_ERROR)c Fl(and)j Fj(BZ_SEQUENCE_ERROR)630 +4136 y Fl(is)29 b(a)i(bit)f(hazy)-8 b(,)31 b(but)f(still)e(w)m(orth)i +(making.)150 4300 y Fj(BZ_MEM_ERROR)630 4409 y Fl(Returned)g(when)f(a)i +(request)f(to)i(allo)s(cate)f(memory)f(failed.)40 b(Note)31 +b(that)g(the)g(quan)m(tit)m(y)g(of)630 4519 y(memory)21 +b(needed)g(to)i(decompress)e(a)g(stream)h(cannot)g(b)s(e)f(determined)f +(un)m(til)g(the)h(stream's)630 4628 y(header)29 b(has)g(b)s(een)g +(read.)40 b(So)29 b Fj(BZ2_bzDecompress)c Fl(and)j Fj(BZ2_bzRead)f +Fl(ma)m(y)j(return)e Fj(BZ_)630 4738 y(MEM_ERROR)d Fl(ev)m(en)k(though) +e(some)h(of)g(the)g(compressed)g(data)g(has)g(b)s(een)f(read.)39 +b(The)28 b(same)630 4847 y(is)38 b(not)i(true)f(for)g(compression;)k +(once)d Fj(BZ2_bzCompressInit)34 b Fl(or)39 b Fj(BZ2_bzWriteOpen)630 +4957 y Fl(ha)m(v)m(e)32 b(successfully)c(completed,)j +Fj(BZ_MEM_ERROR)c Fl(cannot)k(o)s(ccur.)150 5121 y Fj(BZ_DATA_ERROR)630 +5230 y Fl(Returned)h(when)g(a)h(data)g(in)m(tegrit)m(y)g(error)g(is)e +(detected)k(during)30 b(decompression.)47 b(Most)630 +5340 y(imp)s(ortan)m(tly)-8 b(,)31 b(this)f(means)i(when)f(stored)g +(and)g(computed)h(CR)m(Cs)f(for)g(the)h(data)g(do)g(not)p +eop +%%Page: 12 13 +12 12 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(12)630 299 y(matc)m(h.)41 +b(This)28 b(v)-5 b(alue)29 b(is)f(also)i(returned)e(up)s(on)g +(detection)i(of)g(an)m(y)g(other)f(anomaly)h(in)e(the)630 +408 y(compressed)i(data.)150 560 y Fj(BZ_DATA_ERROR_MAGIC)630 +670 y Fl(As)k(a)g(sp)s(ecial)f(case)i(of)f Fj(BZ_DATA_ERROR)p +Fl(,)d(it)i(is)g(sometimes)h(useful)e(to)j(kno)m(w)f(when)f(the)630 +779 y(compressed)d(stream)h(do)s(es)f(not)g(start)h(with)e(the)i +(correct)h(magic)e(b)m(ytes)h(\()p Fj('B')f('Z')f('h')p +Fl(\).)150 931 y Fj(BZ_IO_ERROR)630 1040 y Fl(Returned)k(b)m(y)h +Fj(BZ2_bzRead)d Fl(and)i Fj(BZ2_bzWrite)e Fl(when)i(there)h(is)f(an)g +(error)h(reading)f(or)630 1150 y(writing)28 b(in)h(the)h(compressed)g +(\014le,)f(and)h(b)m(y)g Fj(BZ2_bzReadOpen)c Fl(and)j +Fj(BZ2_bzWriteOpen)630 1259 y Fl(for)i(attempts)i(to)f(use)f(a)h +(\014le)e(for)i(whic)m(h)e(the)h(error)g(indicator)g(\(viz,)g +Fj(ferror\(f\))p Fl(\))f(is)g(set.)630 1369 y(On)h(receipt)g(of)h +Fj(BZ_IO_ERROR)p Fl(,)e(the)h(caller)h(should)d(consult)i +Fj(errno)g Fl(and/or)g Fj(perror)f Fl(to)630 1479 y(acquire)g(op)s +(erating-system)g(sp)s(eci\014c)f(information)g(ab)s(out)h(the)h +(problem.)150 1630 y Fj(BZ_UNEXPECTED_EOF)630 1740 y +Fl(Returned)36 b(b)m(y)g Fj(BZ2_bzRead)e Fl(when)i(the)h(compressed)f +(\014le)g(\014nishes)e(b)s(efore)j(the)f(logical)630 +1849 y(end)30 b(of)g(stream)h(is)e(detected.)150 2001 +y Fj(BZ_OUTBUFF_FULL)630 2110 y Fl(Returned)g(b)m(y)i +Fj(BZ2_bzBuffToBuffCompres)o(s)24 b Fl(and)30 b Fj +(BZ2_bzBuffToBuffDecompres)o(s)630 2220 y Fl(to)h(indicate)f(that)h +(the)f(output)g(data)h(will)d(not)i(\014t)h(in)m(to)f(the)h(output)f +(bu\013er)f(pro)m(vided.)150 2492 y Fk(3.3)68 b(Lo)l(w-lev)l(el)47 +b(in)l(terface)150 2766 y Ff(3.3.1)63 b Fe(BZ2_bzCompressInit)390 +2953 y Fj(typedef)533 3057 y(struct)46 b({)676 3161 y(char)h(*next_in;) +676 3264 y(unsigned)f(int)h(avail_in;)676 3368 y(unsigned)f(int)h +(total_in_lo32;)676 3472 y(unsigned)f(int)h(total_in_hi32;)676 +3680 y(char)g(*next_out;)676 3783 y(unsigned)f(int)h(avail_out;)676 +3887 y(unsigned)f(int)h(total_out_lo32;)676 3991 y(unsigned)f(int)h +(total_out_hi32;)676 4198 y(void)g(*state;)676 4406 y(void)g +(*\(*bzalloc\)\(void)c(*,int,int\);)676 4510 y(void)k +(\(*bzfree\)\(void)d(*,void)i(*\);)676 4614 y(void)h(*opaque;)533 +4717 y(})533 4821 y(bz_stream;)390 5029 y(int)g(BZ2_bzCompressInit)c +(\()k(bz_stream)e(*strm,)1583 5132 y(int)i(blockSize100k,)1583 +5236 y(int)g(verbosity,)1583 5340 y(int)g(workFactor)e(\);)p +eop +%%Page: 13 14 +13 13 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(13)150 456 y(Prepares)32 +b(for)h(compression.)47 b(The)32 b Fj(bz_stream)e Fl(structure)j(holds) +e(all)h(data)h(p)s(ertaining)e(to)i(the)g(com-)150 565 +y(pression)i(activit)m(y)-8 b(.)62 b(A)37 b Fj(bz_stream)e +Fl(structure)h(should)f(b)s(e)i(allo)s(cated)g(and)f(initialised)e +(prior)h(to)j(the)150 675 y(call.)67 b(The)39 b(\014elds)e(of)j +Fj(bz_stream)d Fl(comprise)h(the)i(en)m(tiret)m(y)g(of)f(the)h +(user-visible)c(data.)68 b Fj(state)38 b Fl(is)h(a)150 +784 y(p)s(oin)m(ter)29 b(to)i(the)g(priv)-5 b(ate)30 +b(data)h(structures)f(required)e(for)i(compression.)150 +941 y(Custom)37 b(memory)g(allo)s(cators)g(are)h(supp)s(orted,)f(via)g +(\014elds)f Fj(bzalloc)p Fl(,)h Fj(bzfree)p Fl(,)g(and)g +Fj(opaque)p Fl(.)59 b(The)150 1051 y(v)-5 b(alue)32 b +Fj(opaque)e Fl(is)i(passed)f(to)i(as)g(the)f(\014rst)g(argumen)m(t)h +(to)g(all)e(calls)g(to)i Fj(bzalloc)d Fl(and)i Fj(bzfree)p +Fl(,)f(but)h(is)150 1160 y(otherwise)d(ignored)g(b)m(y)h(the)g(library) +-8 b(.)38 b(The)29 b(call)h Fj(bzalloc)e(\()i(opaque,)e(n,)i(m)g(\))g +Fl(is)e(exp)s(ected)j(to)f(return)150 1270 y(a)g(p)s(oin)m(ter)e +Fj(p)h Fl(to)h Fj(n)g(*)g(m)f Fl(b)m(ytes)h(of)g(memory)-8 +b(,)30 b(and)e Fj(bzfree)h(\()h(opaque,)f(p)h(\))f Fl(should)e(free)i +(that)h(memory)-8 b(.)150 1427 y(If)33 b(y)m(ou)g(don't)h(w)m(an)m(t)g +(to)g(use)f(a)g(custom)h(memory)f(allo)s(cator,)h(set)g +Fj(bzalloc)p Fl(,)e Fj(bzfree)g Fl(and)h Fj(opaque)e +Fl(to)150 1537 y Fj(NULL)p Fl(,)e(and)h(the)h(library)d(will)f(then)k +(use)f(the)g(standard)g Fj(malloc)p Fl(/)p Fj(free)e +Fl(routines.)150 1693 y(Before)39 b(calling)d Fj(BZ2_bzCompressInit)p +Fl(,)f(\014elds)h Fj(bzalloc)p Fl(,)h Fj(bzfree)f Fl(and)h +Fj(opaque)f Fl(should)g(b)s(e)h(\014lled)150 1803 y(appropriately)-8 +b(,)35 b(as)h(just)f(describ)s(ed.)53 b(Up)s(on)34 b(return,)i(the)g +(in)m(ternal)e(state)i(will)d(ha)m(v)m(e)j(b)s(een)f(allo)s(cated)150 +1913 y(and)43 b(initialised,)g(and)g Fj(total_in_lo32)p +Fl(,)h Fj(total_in_hi32)p Fl(,)f Fj(total_out_lo32)d +Fl(and)j Fj(total_out_)150 2022 y(hi32)37 b Fl(will)f(ha)m(v)m(e)j(b)s +(een)f(set)h(to)g(zero.)65 b(These)38 b(four)g(\014elds)e(are)j(used)f +(b)m(y)g(the)g(library)e(to)j(inform)e(the)150 2132 y(caller)j(of)g +(the)h(total)g(amoun)m(t)g(of)g(data)g(passed)f(in)m(to)g(and)g(out)g +(of)h(the)g(library)-8 b(,)41 b(resp)s(ectiv)m(ely)-8 +b(.)70 b(Y)-8 b(ou)150 2241 y(should)34 b(not)j(try)f(to)h(c)m(hange)g +(them.)58 b(As)36 b(of)h(v)m(ersion)f(1.0,)j(64-bit)d(coun)m(ts)h(are)f +(main)m(tained,)h(ev)m(en)g(on)150 2351 y(32-bit)i(platforms,)h(using)d +(the)i Fj(_hi32)e Fl(\014elds)g(to)j(store)f(the)g(upp)s(er)d(32)k +(bits)d(of)i(the)g(coun)m(t.)66 b(So,)41 b(for)150 2460 +y(example,)30 b(the)h(total)g(amoun)m(t)g(of)f(data)h(in)f(is)f +Fj(\(total_in_hi32)d(<<)k(32\))g(+)g(total_in_lo32)p +Fl(.)150 2617 y(P)m(arameter)g Fj(blockSize100k)25 b +Fl(sp)s(eci\014es)i(the)h(blo)s(c)m(k)g(size)h(to)g(b)s(e)f(used)f(for) +h(compression.)40 b(It)28 b(should)f(b)s(e)150 2727 y(a)k(v)-5 +b(alue)30 b(b)s(et)m(w)m(een)i(1)f(and)f(9)h(inclusiv)m(e,)e(and)h(the) +h(actual)g(blo)s(c)m(k)f(size)g(used)g(is)g(100000)j(x)e(this)e +(\014gure.)42 b(9)150 2836 y(giv)m(es)31 b(the)f(b)s(est)g(compression) +g(but)f(tak)m(es)j(most)f(memory)-8 b(.)150 2993 y(P)m(arameter)29 +b Fj(verbosity)c Fl(should)h(b)s(e)h(set)i(to)f(a)h(n)m(um)m(b)s(er)d +(b)s(et)m(w)m(een)j(0)f(and)f(4)h(inclusiv)m(e.)38 b(0)28 +b(is)f(silen)m(t,)h(and)150 3103 y(greater)j(n)m(um)m(b)s(ers)c(giv)m +(e)j(increasingly)d(v)m(erb)s(ose)j(monitoring/debugging)d(output.)40 +b(If)29 b(the)g(library)e(has)150 3212 y(b)s(een)j(compiled)e(with)i +Fj(-DBZ_NO_STDIO)p Fl(,)d(no)j(suc)m(h)g(output)g(will)e(app)s(ear)h +(for)h(an)m(y)h(v)m(erb)s(osit)m(y)f(setting.)150 3369 +y(P)m(arameter)35 b Fj(workFactor)d Fl(con)m(trols)i(ho)m(w)g(the)g +(compression)f(phase)h(b)s(eha)m(v)m(es)g(when)f(presen)m(ted)h(with) +150 3479 y(w)m(orst)40 b(case,)j(highly)37 b(rep)s(etitiv)m(e,)k(input) +d(data.)68 b(If)39 b(compression)g(runs)e(in)m(to)j(di\016culties)d +(caused)i(b)m(y)150 3588 y(rep)s(etitiv)m(e)34 b(data,)j(the)e(library) +d(switc)m(hes)j(from)f(the)h(standard)f(sorting)g(algorithm)g(to)i(a)f +(fallbac)m(k)f(al-)150 3698 y(gorithm.)47 b(The)32 b(fallbac)m(k)g(is)g +(slo)m(w)m(er)g(than)h(the)f(standard)g(algorithm)g(b)m(y)g(p)s(erhaps) +f(a)i(factor)h(of)e(three,)150 3808 y(but)e(alw)m(a)m(ys)h(b)s(eha)m(v) +m(es)f(reasonably)-8 b(,)31 b(no)f(matter)h(ho)m(w)g(bad)f(the)g +(input.)150 3965 y(Lo)m(w)m(er)25 b(v)-5 b(alues)24 b(of)h +Fj(workFactor)d Fl(reduce)i(the)h(amoun)m(t)g(of)g(e\013ort)g(the)g +(standard)f(algorithm)f(will)f(exp)s(end)150 4074 y(b)s(efore)j +(resorting)h(to)g(the)g(fallbac)m(k.)39 b(Y)-8 b(ou)27 +b(should)c(set)k(this)e(parameter)h(carefully;)g(to)s(o)h(lo)m(w,)g +(and)e(man)m(y)150 4184 y(inputs)32 b(will)f(b)s(e)i(handled)f(b)m(y)i +(the)g(fallbac)m(k)g(algorithm)f(and)g(so)h(compress)g(rather)g(slo)m +(wly)-8 b(,)34 b(to)s(o)h(high,)150 4293 y(and)24 b(y)m(our)h(a)m(v)m +(erage-to-w)m(orst)30 b(case)c(compression)e(times)h(can)g(b)s(ecome)g +(v)m(ery)h(large.)39 b(The)24 b(default)g(v)-5 b(alue)150 +4403 y(of)31 b(30)g(giv)m(es)f(reasonable)h(b)s(eha)m(viour)e(o)m(v)m +(er)i(a)g(wide)e(range)i(of)f(circumstances.)150 4560 +y(Allo)m(w)m(able)h(v)-5 b(alues)31 b(range)i(from)e(0)i(to)f(250)h +(inclusiv)m(e.)44 b(0)32 b(is)f(a)h(sp)s(ecial)f(case,)i(equiv)-5 +b(alen)m(t)32 b(to)g(using)f(the)150 4669 y(default)f(v)-5 +b(alue)29 b(of)i(30.)150 4826 y(Note)38 b(that)f(the)g(compressed)f +(output)g(generated)h(is)f(the)g(same)h(regardless)f(of)h(whether)f(or) +g(not)h(the)150 4936 y(fallbac)m(k)30 b(algorithm)f(is)h(used.)150 +5093 y(Be)23 b(a)m(w)m(are)h(also)f(that)g(this)f(parameter)h(ma)m(y)g +(disapp)s(ear)e(en)m(tirely)h(in)f(future)h(v)m(ersions)g(of)h(the)g +(library)-8 b(.)36 b(In)150 5202 y(principle)20 b(it)j(should)e(b)s(e)h +(p)s(ossible)f(to)j(devise)f(a)g(go)s(o)s(d)g(w)m(a)m(y)i(to)f +(automatically)f(c)m(ho)s(ose)h(whic)m(h)e(algorithm)150 +5312 y(to)31 b(use.)41 b(Suc)m(h)29 b(a)i(mec)m(hanism)f(w)m(ould)f +(render)g(the)i(parameter)g(obsolete.)p eop +%%Page: 14 15 +14 14 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(14)150 299 y(P)m(ossible)29 +b(return)h(v)-5 b(alues:)572 450 y Fj(BZ_CONFIG_ERROR)663 +554 y Fl(if)29 b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 +657 y Fj(BZ_PARAM_ERROR)663 761 y Fl(if)g Fj(strm)g Fl(is)h +Fj(NULL)663 865 y Fl(or)g Fj(blockSize)e(<)i Fl(1)h(or)f +Fj(blockSize)e(>)i Fl(9)663 969 y(or)g Fj(verbosity)e(<)i +Fl(0)h(or)f Fj(verbosity)e(>)i Fl(4)663 1073 y(or)g Fj(workFactor)e(<)i +Fl(0)g(or)h Fj(workFactor)c(>)j Fl(250)572 1176 y Fj(BZ_MEM_ERROR)663 +1280 y Fl(if)f(not)i(enough)f(memory)g(is)f(a)m(v)-5 +b(ailable)572 1384 y Fj(BZ_OK)663 1488 y Fl(otherwise)150 +1645 y(Allo)m(w)m(able)30 b(next)g(actions:)572 1796 +y Fj(BZ2_bzCompress)663 1899 y Fl(if)f Fj(BZ_OK)g Fl(is)g(returned)572 +2003 y(no)h(sp)s(eci\014c)f(action)i(needed)f(in)f(case)i(of)g(error) +150 2255 y Ff(3.3.2)63 b Fe(BZ2_bzCompress)533 2441 y +Fj(int)47 b(BZ2_bzCompress)d(\()j(bz_stream)f(*strm,)g(int)h(action)f +(\);)150 2598 y Fl(Pro)m(vides)28 b(more)g(input)f(and/or)h(output)g +(bu\013er)g(space)h(for)f(the)h(library)-8 b(.)38 b(The)28 +b(caller)g(main)m(tains)f(input)150 2708 y(and)j(output)g(bu\013ers,)f +(and)h(calls)g Fj(BZ2_bzCompress)c Fl(to)31 b(transfer)f(data)h(b)s(et) +m(w)m(een)g(them.)150 2865 y(Before)j(eac)m(h)g(call)e(to)i +Fj(BZ2_bzCompress)p Fl(,)c Fj(next_in)h Fl(should)g(p)s(oin)m(t)h(at)h +(the)g(data)h(to)g(b)s(e)e(compressed,)150 2974 y(and)41 +b Fj(avail_in)f Fl(should)g(indicate)h(ho)m(w)h(man)m(y)f(b)m(ytes)i +(the)f(library)d(ma)m(y)k(read.)75 b Fj(BZ2_bzCompress)150 +3084 y Fl(up)s(dates)29 b Fj(next_in)p Fl(,)g Fj(avail_in)f +Fl(and)i Fj(total_in)e Fl(to)j(re\015ect)g(the)g(n)m(um)m(b)s(er)e(of)h +(b)m(ytes)h(it)f(has)g(read.)150 3241 y(Similarly)-8 +b(,)27 b Fj(next_out)h Fl(should)g(p)s(oin)m(t)h(to)i(a)f(bu\013er)f +(in)g(whic)m(h)g(the)h(compressed)g(data)h(is)e(to)i(b)s(e)e(placed,) +150 3350 y(with)i Fj(avail_out)f Fl(indicating)h(ho)m(w)h(m)m(uc)m(h)h +(output)f(space)h(is)f(a)m(v)-5 b(ailable.)46 b Fj(BZ2_bzCompress)29 +b Fl(up)s(dates)150 3460 y Fj(next_out)p Fl(,)f Fj(avail_out)g +Fl(and)i Fj(total_out)e Fl(to)j(re\015ect)g(the)f(n)m(um)m(b)s(er)g(of) +g(b)m(ytes)h(output.)150 3617 y(Y)-8 b(ou)40 b(ma)m(y)g(pro)m(vide)e +(and)h(remo)m(v)m(e)i(as)f(little)e(or)h(as)h(m)m(uc)m(h)f(data)h(as)g +(y)m(ou)f(lik)m(e)g(on)g(eac)m(h)i(call)e(of)g Fj(BZ2_)150 +3726 y(bzCompress)p Fl(.)48 b(In)33 b(the)h(limit,)f(it)h(is)f +(acceptable)h(to)h(supply)c(and)j(remo)m(v)m(e)h(data)g(one)f(b)m(yte)g +(at)h(a)f(time,)150 3836 y(although)28 b(this)f(w)m(ould)g(b)s(e)h +(terribly)e(ine\016cien)m(t.)39 b(Y)-8 b(ou)29 b(should)e(alw)m(a)m(ys) +h(ensure)g(that)h(at)g(least)g(one)f(b)m(yte)150 3946 +y(of)j(output)f(space)g(is)g(a)m(v)-5 b(ailable)30 b(at)h(eac)m(h)g +(call.)150 4102 y(A)38 b(second)h(purp)s(ose)d(of)j Fj(BZ2_bzCompress) +34 b Fl(is)j(to)i(request)f(a)h(c)m(hange)g(of)g(mo)s(de)e(of)i(the)f +(compressed)150 4212 y(stream.)150 4369 y(Conceptually)-8 +b(,)24 b(a)g(compressed)g(stream)g(can)f(b)s(e)g(in)g(one)h(of)f(four)g +(states:)39 b(IDLE,)24 b(R)m(UNNING,)h(FLUSH-)150 4478 +y(ING)37 b(and)g(FINISHING.)g(Before)i(initialisation)33 +b(\()p Fj(BZ2_bzCompressInit)p Fl(\))g(and)j(after)i(termination)150 +4588 y(\()p Fj(BZ2_bzCompressEnd)p Fl(\),)27 b(a)j(stream)h(is)f +(regarded)g(as)g(IDLE.)150 4745 y(Up)s(on)35 b(initialisation)e(\()p +Fj(BZ2_bzCompressInit)p Fl(\),)h(the)i(stream)h(is)e(placed)h(in)e(the) +j(R)m(UNNING)g(state.)150 4854 y(Subsequen)m(t)j(calls)g(to)i +Fj(BZ2_bzCompress)37 b Fl(should)j(pass)g Fj(BZ_RUN)g +Fl(as)h(the)g(requested)h(action;)47 b(other)150 4964 +y(actions)31 b(are)f(illegal)f(and)h(will)d(result)j(in)f +Fj(BZ_SEQUENCE_ERROR)p Fl(.)150 5121 y(A)m(t)38 b(some)f(p)s(oin)m(t,)h +(the)f(calling)e(program)i(will)d(ha)m(v)m(e)k(pro)m(vided)e(all)f(the) +i(input)e(data)j(it)e(w)m(an)m(ts)i(to.)61 b(It)150 5230 +y(will)28 b(then)h(w)m(an)m(t)i(to)g(\014nish)d(up)h({)i(in)d +(e\013ect,)k(asking)e(the)g(library)e(to)j(pro)s(cess)f(an)m(y)g(data)h +(it)f(migh)m(t)g(ha)m(v)m(e)150 5340 y(bu\013ered)25 +b(in)m(ternally)-8 b(.)38 b(In)25 b(this)g(state,)k Fj(BZ2_bzCompress) +22 b Fl(will)i(no)i(longer)g(attempt)h(to)g(read)f(data)h(from)p +eop +%%Page: 15 16 +15 15 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(15)150 299 y Fj(next_in)p +Fl(,)33 b(but)g(it)h(will)d(w)m(an)m(t)k(to)g(write)e(data)h(to)h +Fj(next_out)p Fl(.)49 b(Because)36 b(the)e(output)f(bu\013er)g +(supplied)150 408 y(b)m(y)e(the)h(user)e(can)i(b)s(e)f(arbitrarily)d +(small,)j(the)g(\014nishing-up)d(op)s(eration)i(cannot)i(necessarily)e +(b)s(e)h(done)150 518 y(with)e(a)i(single)e(call)h(of)g +Fj(BZ2_bzCompress)p Fl(.)150 675 y(Instead,)47 b(the)d(calling)f +(program)g(passes)h Fj(BZ_FINISH)d Fl(as)j(an)g(action)g(to)h +Fj(BZ2_bzCompress)p Fl(.)77 b(This)150 784 y(c)m(hanges)30 +b(the)f(stream's)g(state)h(to)f(FINISHING.)g(An)m(y)g(remaining)e +(input)g(\(ie,)i Fj(next_in[0)f(..)i(avail_)150 894 y(in-1])p +Fl(\))36 b(is)f(compressed)i(and)f(transferred)g(to)h(the)g(output)g +(bu\013er.)58 b(T)-8 b(o)38 b(do)e(this,)i Fj(BZ2_bzCompress)150 +1004 y Fl(m)m(ust)h(b)s(e)f(called)g(rep)s(eatedly)h(un)m(til)e(all)h +(the)h(output)f(has)h(b)s(een)f(consumed.)66 b(A)m(t)40 +b(that)g(p)s(oin)m(t,)g Fj(BZ2_)150 1113 y(bzCompress)h +Fl(returns)h Fj(BZ_STREAM_END)p Fl(,)i(and)f(the)h(stream's)g(state)h +(is)d(set)j(bac)m(k)f(to)g(IDLE.)g Fj(BZ2_)150 1223 y(bzCompressEnd)27 +b Fl(should)h(then)i(b)s(e)g(called.)150 1380 y(Just)25 +b(to)i(mak)m(e)g(sure)e(the)i(calling)d(program)i(do)s(es)g(not)g(c)m +(heat,)i(the)f(library)c(mak)m(es)k(a)f(note)h(of)f Fj(avail_in)150 +1489 y Fl(at)g(the)g(time)f(of)g(the)g(\014rst)g(call)g(to)h +Fj(BZ2_bzCompress)21 b Fl(whic)m(h)j(has)h Fj(BZ_FINISH)e +Fl(as)i(an)h(action)f(\(ie,)i(at)f(the)150 1599 y(time)d(the)h(program) +g(has)f(announced)g(its)h(in)m(ten)m(tion)f(to)h(not)g(supply)e(an)m(y) +i(more)g(input\).)37 b(By)24 b(comparing)150 1708 y(this)k(v)-5 +b(alue)28 b(with)g(that)h(of)h Fj(avail_in)c Fl(o)m(v)m(er)k(subsequen) +m(t)f(calls)f(to)h Fj(BZ2_bzCompress)p Fl(,)d(the)j(library)e(can)150 +1818 y(detect)33 b(an)m(y)e(attempts)i(to)f(slip)d(in)h(more)h(data)h +(to)h(compress.)43 b(An)m(y)31 b(calls)g(for)g(whic)m(h)f(this)g(is)h +(detected)150 1928 y(will)j(return)h Fj(BZ_SEQUENCE_ERROR)p +Fl(.)55 b(This)34 b(indicates)i(a)h(programming)e(mistak)m(e)i(whic)m +(h)e(should)g(b)s(e)150 2037 y(corrected.)150 2194 y(Instead)i(of)g +(asking)f(to)h(\014nish,)f(the)h(calling)f(program)g(ma)m(y)h(ask)g +Fj(BZ2_bzCompress)c Fl(to)38 b(tak)m(e)g(all)e(the)150 +2304 y(remaining)j(input,)i(compress)f(it)g(and)g(terminate)h(the)g +(curren)m(t)f(\(Burro)m(ws-Wheeler\))h(compression)150 +2413 y(blo)s(c)m(k.)e(This)26 b(could)h(b)s(e)g(useful)f(for)h(error)h +(con)m(trol)g(purp)s(oses.)38 b(The)27 b(mec)m(hanism)g(is)g(analogous) +h(to)g(that)150 2523 y(for)35 b(\014nishing:)46 b(call)35 +b Fj(BZ2_bzCompress)c Fl(with)i(an)i(action)g(of)g Fj(BZ_FLUSH)p +Fl(,)g(remo)m(v)m(e)h(output)f(data,)i(and)150 2632 y(p)s(ersist)h +(with)g(the)i Fj(BZ_FLUSH)e Fl(action)i(un)m(til)e(the)i(v)-5 +b(alue)39 b Fj(BZ_RUN)f Fl(is)h(returned.)68 b(As)39 +b(with)g(\014nishing,)150 2742 y Fj(BZ2_bzCompress)23 +b Fl(detects)28 b(an)m(y)f(attempt)h(to)f(pro)m(vide)f(more)h(input)e +(data)i(once)g(the)g(\015ush)e(has)i(b)s(egun.)150 2899 +y(Once)j(the)h(\015ush)e(is)g(complete,)i(the)g(stream)f(returns)g(to)h +(the)f(normal)g(R)m(UNNING)h(state.)150 3056 y(This)f(all)h(sounds)g +(prett)m(y)h(complex,)h(but)e(isn't)g(really)-8 b(.)45 +b(Here's)33 b(a)f(table)g(whic)m(h)f(sho)m(ws)h(whic)m(h)f(actions)150 +3165 y(are)e(allo)m(w)m(able)f(in)f(eac)m(h)j(state,)g(what)f(action)g +(will)c(b)s(e)j(tak)m(en,)j(what)d(the)h(next)f(state)i(is,)e(and)g +(what)h(the)150 3275 y(non-error)h(return)f(v)-5 b(alues)29 +b(are.)41 b(Note)32 b(that)e(y)m(ou)h(can't)g(explicitly)d(ask)i(what)g +(state)i(the)e(stream)h(is)e(in,)150 3384 y(but)h(nor)g(do)g(y)m(ou)h +(need)f(to)h({)g(it)e(can)i(b)s(e)f(inferred)e(from)i(the)h(v)-5 +b(alues)29 b(returned)h(b)m(y)g Fj(BZ2_bzCompress)p Fl(.)390 +3535 y(IDLE/)p Fj(any)572 3639 y Fl(Illegal.)60 b(IDLE)30 +b(state)i(only)d(exists)h(after)h Fj(BZ2_bzCompressEnd)26 +b Fl(or)572 3743 y(b)s(efore)k Fj(BZ2_bzCompressInit)p +Fl(.)572 3847 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_SEQUENCE_ERROR)390 +4054 y Fl(R)m(UNNING/)p Fj(BZ_RUN)572 4158 y Fl(Compress)f(from)h +Fj(next_in)f Fl(to)i Fj(next_out)d Fl(as)i(m)m(uc)m(h)h(as)f(p)s +(ossible.)572 4262 y(Next)h(state)h(=)e(R)m(UNNING)572 +4366 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_RUN_OK)390 +4573 y Fl(R)m(UNNING/)p Fj(BZ_FLUSH)572 4677 y Fl(Remem)m(b)s(er)g +(curren)m(t)g(v)-5 b(alue)30 b(of)g Fj(next_in)p Fl(.)59 +b(Compress)30 b(from)g Fj(next_in)572 4781 y Fl(to)h +Fj(next_out)d Fl(as)j(m)m(uc)m(h)f(as)h(p)s(ossible,)d(but)i(do)g(not)g +(accept)i(an)m(y)f(more)f(input.)572 4885 y(Next)h(state)h(=)e +(FLUSHING)572 4988 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_FLUSH_OK)390 +5196 y Fl(R)m(UNNING/)p Fj(BZ_FINISH)572 5300 y Fl(Remem)m(b)s(er)g +(curren)m(t)g(v)-5 b(alue)30 b(of)g Fj(next_in)p Fl(.)59 +b(Compress)30 b(from)g Fj(next_in)p eop +%%Page: 16 17 +16 16 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(16)572 299 y(to)31 b Fj(next_out)d +Fl(as)j(m)m(uc)m(h)f(as)h(p)s(ossible,)d(but)i(do)g(not)g(accept)i(an)m +(y)f(more)f(input.)572 403 y(Next)h(state)h(=)e(FINISHING)572 +506 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_FINISH_OK)390 +714 y Fl(FLUSHING/)p Fj(BZ_FLUSH)572 818 y Fl(Compress)f(from)h +Fj(next_in)f Fl(to)i Fj(next_out)d Fl(as)i(m)m(uc)m(h)h(as)f(p)s +(ossible,)572 922 y(but)f(do)i(not)f(accept)i(an)m(y)f(more)f(input.) +572 1025 y(If)g(all)f(the)i(existing)e(input)f(has)i(b)s(een)g(used)g +(up)f(and)h(all)f(compressed)572 1129 y(output)h(has)g(b)s(een)g(remo)m +(v)m(ed)663 1233 y(Next)h(state)h(=)e(R)m(UNNING;)i(Return)d(v)-5 +b(alue)30 b(=)g Fj(BZ_RUN_OK)572 1337 y Fl(else)663 1440 +y(Next)h(state)h(=)e(FLUSHING;)h(Return)e(v)-5 b(alue)30 +b(=)g Fj(BZ_FLUSH_OK)390 1648 y Fl(FLUSHING/other)572 +1752 y(Illegal.)572 1856 y(Return)f(v)-5 b(alue)30 b(=)g +Fj(BZ_SEQUENCE_ERROR)390 2063 y Fl(FINISHING/)p Fj(BZ_FINISH)572 +2167 y Fl(Compress)f(from)h Fj(next_in)f Fl(to)i Fj(next_out)d +Fl(as)i(m)m(uc)m(h)h(as)f(p)s(ossible,)572 2271 y(but)f(to)j(not)e +(accept)i(an)m(y)f(more)f(input.)572 2374 y(If)g(all)f(the)i(existing)e +(input)f(has)i(b)s(een)g(used)g(up)f(and)h(all)f(compressed)572 +2478 y(output)h(has)g(b)s(een)g(remo)m(v)m(ed)663 2582 +y(Next)h(state)h(=)e(IDLE;)g(Return)g(v)-5 b(alue)30 +b(=)g Fj(BZ_STREAM_END)572 2686 y Fl(else)663 2790 y(Next)h(state)h(=)e +(FINISHING;)g(Return)g(v)-5 b(alue)30 b(=)g Fj(BZ_FINISHING)390 +2997 y Fl(FINISHING/other)572 3101 y(Illegal.)572 3205 +y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_SEQUENCE_ERROR)150 +3361 y Fl(That)24 b(still)f(lo)s(oks)g(complicated?)39 +b(W)-8 b(ell,)25 b(fair)f(enough.)38 b(The)24 b(usual)f(sequence)i(of)f +(calls)g(for)g(compressing)150 3471 y(a)31 b(load)f(of)g(data)h(is:)225 +3628 y Fi(\017)60 b Fl(Get)31 b(started)g(with)e Fj(BZ2_bzCompressInit) +p Fl(.)225 3774 y Fi(\017)60 b Fl(Sho)m(v)m(el)38 b(data)h(in)e(and)g +(shlurp)e(out)k(its)e(compressed)h(form)g(using)e(zero)j(or)f(more)h +(calls)e(of)h Fj(BZ2_)330 3884 y(bzCompress)28 b Fl(with)h(action)h(=)g +Fj(BZ_RUN)p Fl(.)225 4030 y Fi(\017)60 b Fl(Finish)23 +b(up.)38 b(Rep)s(eatedly)25 b(call)f Fj(BZ2_bzCompress)e +Fl(with)i(action)h(=)g Fj(BZ_FINISH)p Fl(,)f(cop)m(ying)h(out)h(the)330 +4139 y(compressed)k(output,)g(un)m(til)f Fj(BZ_STREAM_END)e +Fl(is)i(returned.)225 4285 y Fi(\017)60 b Fl(Close)30 +b(up)f(and)h(go)h(home.)41 b(Call)29 b Fj(BZ2_bzCompressEnd)p +Fl(.)150 4478 y(If)23 b(the)h(data)h(y)m(ou)f(w)m(an)m(t)h(to)f +(compress)g(\014ts)f(in)m(to)h(y)m(our)g(input)e(bu\013er)h(all)f(at)j +(once,)h(y)m(ou)e(can)g(skip)f(the)h(calls)150 4588 y(of)37 +b Fj(BZ2_bzCompress)26 b(\()k(...,)f(BZ_RUN)g(\))36 b +Fl(and)g(just)g(do)h(the)g Fj(BZ2_bzCompress)26 b(\()k(...,)f +(BZ_FINISH)150 4698 y(\))h Fl(calls.)150 4854 y(All)36 +b(required)g(memory)h(is)f(allo)s(cated)i(b)m(y)f Fj +(BZ2_bzCompressInit)p Fl(.)56 b(The)37 b(compression)g(library)e(can) +150 4964 y(accept)g(an)m(y)f(data)h(at)g(all)d(\(ob)m(viously\).)51 +b(So)34 b(y)m(ou)g(shouldn't)e(get)j(an)m(y)f(error)f(return)g(v)-5 +b(alues)33 b(from)h(the)150 5074 y Fj(BZ2_bzCompress)29 +b Fl(calls.)46 b(If)32 b(y)m(ou)h(do,)g(they)g(will)d(b)s(e)i +Fj(BZ_SEQUENCE_ERROR)p Fl(,)d(and)j(indicate)f(a)i(bug)f(in)150 +5183 y(y)m(our)e(programming.)150 5340 y(T)-8 b(rivial)28 +b(other)j(p)s(ossible)d(return)h(v)-5 b(alues:)p eop +%%Page: 17 18 +17 17 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(17)572 299 y Fj(BZ_PARAM_ERROR)663 +403 y Fl(if)29 b Fj(strm)g Fl(is)h Fj(NULL)p Fl(,)f(or)i +Fj(strm->s)d Fl(is)h Fj(NULL)150 652 y Ff(3.3.3)63 b +Fe(BZ2_bzCompressEnd)390 839 y Fj(int)47 b(BZ2_bzCompressEnd)c(\()k +(bz_stream)f(*strm)g(\);)150 996 y Fl(Releases)31 b(all)e(memory)h +(asso)s(ciated)h(with)e(a)i(compression)e(stream.)150 +1153 y(P)m(ossible)g(return)h(v)-5 b(alues:)481 1304 +y Fj(BZ_PARAM_ERROR)117 b Fl(if)30 b Fj(strm)f Fl(is)g +Fj(NULL)g Fl(or)i Fj(strm->s)d Fl(is)i Fj(NULL)481 1408 +y(BZ_OK)120 b Fl(otherwise)150 1657 y Ff(3.3.4)63 b Fe +(BZ2_bzDecompressInit)390 1844 y Fj(int)47 b(BZ2_bzDecompressInit)42 +b(\()48 b(bz_stream)d(*strm,)h(int)h(verbosity,)e(int)i(small)f(\);)150 +2001 y Fl(Prepares)30 b(for)f(decompression.)40 b(As)29 +b(with)g Fj(BZ2_bzCompressInit)p Fl(,)c(a)31 b Fj(bz_stream)c +Fl(record)j(should)e(b)s(e)150 2110 y(allo)s(cated)c(and)f(initialised) +e(b)s(efore)i(the)i(call.)38 b(Fields)22 b Fj(bzalloc)p +Fl(,)i Fj(bzfree)e Fl(and)i Fj(opaque)e Fl(should)g(b)s(e)h(set)i(if) +150 2220 y(a)h(custom)f(memory)g(allo)s(cator)g(is)g(required,)f(or)h +(made)h Fj(NULL)e Fl(for)h(the)g(normal)f Fj(malloc)p +Fl(/)p Fj(free)f Fl(routines.)150 2330 y(Up)s(on)h(return,)h(the)g(in)m +(ternal)f(state)i(will)c(ha)m(v)m(e)k(b)s(een)f(initialised,)d(and)i +Fj(total_in)f Fl(and)h Fj(total_out)f Fl(will)150 2439 +y(b)s(e)30 b(zero.)150 2596 y(F)-8 b(or)31 b(the)g(meaning)e(of)i +(parameter)g Fj(verbosity)p Fl(,)d(see)j Fj(BZ2_bzCompressInit)p +Fl(.)150 2753 y(If)e Fj(small)e Fl(is)h(nonzero,)i(the)f(library)e +(will)f(use)j(an)g(alternativ)m(e)h(decompression)e(algorithm)g(whic)m +(h)f(uses)150 2862 y(less)c(memory)g(but)g(at)h(the)g(cost)h(of)e +(decompressing)g(more)g(slo)m(wly)g(\(roughly)f(sp)s(eaking,)i(half)f +(the)h(sp)s(eed,)150 2972 y(but)34 b(the)i(maxim)m(um)d(memory)i +(requiremen)m(t)g(drops)e(to)j(around)e(2300k\).)57 b(See)35 +b(Chapter)g(2)g(for)g(more)150 3082 y(information)29 +b(on)h(memory)g(managemen)m(t.)150 3238 y(Note)40 b(that)f(the)f(amoun) +m(t)h(of)g(memory)f(needed)g(to)i(decompress)e(a)h(stream)f(cannot)h(b) +s(e)f(determined)150 3348 y(un)m(til)j(the)h(stream's)h(header)f(has)g +(b)s(een)g(read,)j(so)e(ev)m(en)g(if)e Fj(BZ2_bzDecompressInit)c +Fl(succeeds,)46 b(a)150 3458 y(subsequen)m(t)30 b Fj(BZ2_bzDecompress)c +Fl(could)j(fail)g(with)g Fj(BZ_MEM_ERROR)p Fl(.)150 3614 +y(P)m(ossible)g(return)h(v)-5 b(alues:)572 3765 y Fj(BZ_CONFIG_ERROR) +663 3869 y Fl(if)29 b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 +3973 y Fj(BZ_PARAM_ERROR)663 4077 y Fl(if)g Fj(\(small)46 +b(!=)h(0)h(&&)f(small)f(!=)h(1\))663 4181 y Fl(or)30 +b Fj(\(verbosity)45 b(<)j(0)f(||)g(verbosity)e(>)j(4\))572 +4284 y(BZ_MEM_ERROR)663 4388 y Fl(if)29 b(insu\016cien)m(t)g(memory)h +(is)f(a)m(v)-5 b(ailable)150 4545 y(Allo)m(w)m(able)30 +b(next)g(actions:)572 4696 y Fj(BZ2_bzDecompress)663 +4800 y Fl(if)f Fj(BZ_OK)g Fl(w)m(as)i(returned)572 4904 +y(no)f(sp)s(eci\014c)f(action)i(required)e(in)g(case)i(of)g(error)150 +5153 y Ff(3.3.5)63 b Fe(BZ2_bzDecompress)390 5340 y Fj(int)47 +b(BZ2_bzDecompress)c(\()48 b(bz_stream)d(*strm)h(\);)p +eop +%%Page: 18 19 +18 18 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(18)150 299 y(Pro)m(vides)24 +b(more)g(input)f(and/out)h(output)g(bu\013er)g(space)h(for)f(the)g +(library)-8 b(.)37 b(The)24 b(caller)g(main)m(tains)f(input)150 +408 y(and)30 b(output)g(bu\013ers,)f(and)h(uses)g Fj(BZ2_bzDecompress)c +Fl(to)31 b(transfer)f(data)h(b)s(et)m(w)m(een)g(them.)150 +565 y(Before)g(eac)m(h)g(call)f(to)g Fj(BZ2_bzDecompress)p +Fl(,)c Fj(next_in)i Fl(should)h(p)s(oin)m(t)g(at)h(the)h(compressed)e +(data,)j(and)150 675 y Fj(avail_in)h Fl(should)h(indicate)h(ho)m(w)h +(man)m(y)f(b)m(ytes)i(the)e(library)f(ma)m(y)i(read.)56 +b Fj(BZ2_bzDecompress)32 b Fl(up-)150 784 y(dates)f Fj(next_in)p +Fl(,)e Fj(avail_in)f Fl(and)h Fj(total_in)g Fl(to)i(re\015ect)g(the)f +(n)m(um)m(b)s(er)f(of)i(b)m(ytes)g(it)f(has)g(read.)150 +941 y(Similarly)-8 b(,)37 b Fj(next_out)f Fl(should)g(p)s(oin)m(t)i(to) +g(a)h(bu\013er)e(in)g(whic)m(h)g(the)i(uncompressed)e(output)g(is)h(to) +h(b)s(e)150 1051 y(placed,)d(with)e Fj(avail_out)f Fl(indicating)g(ho)m +(w)i(m)m(uc)m(h)g(output)g(space)h(is)e(a)m(v)-5 b(ailable.)55 +b Fj(BZ2_bzCompress)150 1160 y Fl(up)s(dates)29 b Fj(next_out)p +Fl(,)g Fj(avail_out)f Fl(and)h Fj(total_out)f Fl(to)j(re\015ect)g(the)g +(n)m(um)m(b)s(er)e(of)h(b)m(ytes)h(output.)150 1317 y(Y)-8 +b(ou)40 b(ma)m(y)g(pro)m(vide)e(and)h(remo)m(v)m(e)i(as)f(little)e(or)h +(as)h(m)m(uc)m(h)f(data)h(as)g(y)m(ou)f(lik)m(e)g(on)g(eac)m(h)i(call)e +(of)g Fj(BZ2_)150 1427 y(bzDecompress)p Fl(.)e(In)27 +b(the)i(limit,)d(it)i(is)f(acceptable)j(to)f(supply)d(and)h(remo)m(v)m +(e)j(data)f(one)f(b)m(yte)h(at)g(a)g(time,)150 1537 y(although)f(this)f +(w)m(ould)g(b)s(e)h(terribly)e(ine\016cien)m(t.)39 b(Y)-8 +b(ou)29 b(should)e(alw)m(a)m(ys)h(ensure)g(that)h(at)g(least)g(one)f(b) +m(yte)150 1646 y(of)j(output)f(space)g(is)g(a)m(v)-5 +b(ailable)30 b(at)h(eac)m(h)g(call.)150 1803 y(Use)g(of)f +Fj(BZ2_bzDecompress)c Fl(is)k(simpler)e(than)i Fj(BZ2_bzCompress)p +Fl(.)150 1960 y(Y)-8 b(ou)31 b(should)d(pro)m(vide)h(input)f(and)i +(remo)m(v)m(e)i(output)d(as)i(describ)s(ed)d(ab)s(o)m(v)m(e,)k(and)d +(rep)s(eatedly)h(call)f Fj(BZ2_)150 2069 y(bzDecompress)35 +b Fl(un)m(til)i Fj(BZ_STREAM_END)e Fl(is)j(returned.)64 +b(App)s(earance)39 b(of)g Fj(BZ_STREAM_END)c Fl(denotes)150 +2179 y(that)47 b Fj(BZ2_bzDecompress)42 b Fl(has)k(detected)h(the)f +(logical)g(end)g(of)g(the)h(compressed)e(stream.)89 b +Fj(BZ2_)150 2289 y(bzDecompress)28 b Fl(will)g(not)j(pro)s(duce)f +Fj(BZ_STREAM_END)d Fl(un)m(til)j(all)f(output)i(data)h(has)e(b)s(een)h +(placed)f(in)m(to)150 2398 y(the)36 b(output)g(bu\013er,)h(so)g(once)g +Fj(BZ_STREAM_END)32 b Fl(app)s(ears,)38 b(y)m(ou)e(are)h(guaran)m(teed) +g(to)g(ha)m(v)m(e)h(a)m(v)-5 b(ailable)150 2508 y(all)29 +b(the)i(decompressed)f(output,)g(and)g Fj(BZ2_bzDecompressEnd)25 +b Fl(can)31 b(safely)f(b)s(e)f(called.)150 2665 y(If)40 +b(case)h(of)f(an)h(error)e(return)h(v)-5 b(alue,)42 b(y)m(ou)f(should)d +(call)h Fj(BZ2_bzDecompressEnd)c Fl(to)41 b(clean)f(up)g(and)150 +2774 y(release)31 b(memory)-8 b(.)150 2931 y(P)m(ossible)29 +b(return)h(v)-5 b(alues:)572 3082 y Fj(BZ_PARAM_ERROR)663 +3186 y Fl(if)29 b Fj(strm)g Fl(is)h Fj(NULL)f Fl(or)h +Fj(strm->s)f Fl(is)g Fj(NULL)663 3290 y Fl(or)h Fj(strm->avail_out)44 +b(<)j(1)572 3393 y(BZ_DATA_ERROR)663 3497 y Fl(if)29 +b(a)i(data)g(in)m(tegrit)m(y)f(error)g(is)g(detected)h(in)e(the)i +(compressed)f(stream)572 3601 y Fj(BZ_DATA_ERROR_MAGIC)663 +3705 y Fl(if)f(the)i(compressed)f(stream)g(do)s(esn't)h(b)s(egin)e +(with)g(the)h(righ)m(t)g(magic)h(b)m(ytes)572 3808 y +Fj(BZ_MEM_ERROR)663 3912 y Fl(if)e(there)i(w)m(asn't)f(enough)h(memory) +f(a)m(v)-5 b(ailable)572 4016 y Fj(BZ_STREAM_END)663 +4120 y Fl(if)29 b(the)i(logical)e(end)h(of)h(the)f(data)h(stream)g(w)m +(as)g(detected)g(and)f(all)663 4224 y(output)g(in)f(has)h(b)s(een)g +(consumed,)f(eg)j Fj(s->avail_out)44 b(>)k(0)572 4327 +y(BZ_OK)663 4431 y Fl(otherwise)150 4588 y(Allo)m(w)m(able)30 +b(next)g(actions:)572 4739 y Fj(BZ2_bzDecompress)663 +4843 y Fl(if)f Fj(BZ_OK)g Fl(w)m(as)i(returned)572 4946 +y Fj(BZ2_bzDecompressEnd)663 5050 y Fl(otherwise)p eop +%%Page: 19 20 +19 19 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(19)150 299 y Ff(3.3.6)63 +b Fe(BZ2_bzDecompressEnd)390 486 y Fj(int)47 b(BZ2_bzDecompressEnd)42 +b(\()48 b(bz_stream)d(*strm)i(\);)150 643 y Fl(Releases)31 +b(all)e(memory)h(asso)s(ciated)h(with)e(a)i(decompression)e(stream.)150 +799 y(P)m(ossible)g(return)h(v)-5 b(alues:)572 950 y +Fj(BZ_PARAM_ERROR)663 1054 y Fl(if)29 b Fj(strm)g Fl(is)h +Fj(NULL)f Fl(or)h Fj(strm->s)f Fl(is)g Fj(NULL)572 1158 +y(BZ_OK)663 1262 y Fl(otherwise)150 1419 y(Allo)m(w)m(able)h(next)g +(actions:)572 1570 y(None.)150 1857 y Fk(3.4)68 b(High-lev)l(el)47 +b(in)l(terface)150 2050 y Fl(This)35 b(in)m(terface)j(pro)m(vides)d +(functions)h(for)g(reading)g(and)h(writing)e Fj(bzip2)g +Fl(format)i(\014les.)59 b(First,)39 b(some)150 2159 y(general)30 +b(p)s(oin)m(ts.)225 2316 y Fi(\017)60 b Fl(All)35 b(of)h(the)g +(functions)e(tak)m(e)k(an)e Fj(int*)f Fl(\014rst)g(argumen)m(t,)j +Fj(bzerror)p Fl(.)56 b(After)36 b(eac)m(h)h(call,)g Fj(bzerror)330 +2426 y Fl(should)23 b(b)s(e)i(consulted)g(\014rst)g(to)h(determine)e +(the)i(outcome)h(of)e(the)h(call.)38 b(If)25 b Fj(bzerror)f +Fl(is)g Fj(BZ_OK)p Fl(,)i(the)330 2535 y(call)35 b(completed)g +(successfully)-8 b(,)36 b(and)f(only)g(then)g(should)f(the)h(return)g +(v)-5 b(alue)35 b(of)h(the)f(function)g(\(if)330 2645 +y(an)m(y\))30 b(b)s(e)f(consulted.)39 b(If)29 b Fj(bzerror)e +Fl(is)h Fj(BZ_IO_ERROR)p Fl(,)f(there)i(w)m(as)h(an)f(error)g +(reading/writing)e(the)330 2754 y(underlying)32 b(compressed)j(\014le,) +h(and)f(y)m(ou)h(should)d(then)i(consult)g Fj(errno)p +Fl(/)p Fj(perror)e Fl(to)j(determine)330 2864 y(the)i(cause)g(of)g(the) +g(di\016cult)m(y)-8 b(.)61 b Fj(bzerror)36 b Fl(ma)m(y)i(also)g(b)s(e)f +(set)h(to)g(v)-5 b(arious)37 b(other)h(v)-5 b(alues;)41 +b(precise)330 2974 y(details)29 b(are)i(giv)m(en)g(on)f(a)h(p)s +(er-function)d(basis)h(b)s(elo)m(w.)225 3111 y Fi(\017)60 +b Fl(If)40 b Fj(bzerror)f Fl(indicates)g(an)i(error)f(\(ie,)j(an)m +(ything)d(except)h Fj(BZ_OK)f Fl(and)g Fj(BZ_STREAM_END)p +Fl(\),)g(y)m(ou)330 3220 y(should)56 b(immediately)h(call)g +Fj(BZ2_bzReadClose)e Fl(\(or)j Fj(BZ2_bzWriteClose)p +Fl(,)j(dep)s(ending)56 b(on)330 3330 y(whether)50 b(y)m(ou)g(are)h +(attempting)g(to)g(read)f(or)g(to)i(write\))d(to)j(free)e(up)f(all)h +(resources)g(asso)s(ci-)330 3439 y(ated)33 b(with)e(the)i(stream.)47 +b(Once)32 b(an)h(error)f(has)g(b)s(een)g(indicated,)f(b)s(eha)m(viour)g +(of)i(all)e(calls)h(except)330 3549 y Fj(BZ2_bzReadClose)46 +b Fl(\()p Fj(BZ2_bzWriteClose)p Fl(\))h(is)j(unde\014ned.)99 +b(The)50 b(implication)e(is)i(that)h(\(1\))330 3659 y +Fj(bzerror)44 b Fl(should)g(b)s(e)h(c)m(hec)m(k)m(ed)j(after)e(eac)m(h) +h(call,)i(and)c(\(2\))i(if)e Fj(bzerror)f Fl(indicates)g(an)i(error,) +330 3768 y Fj(BZ2_bzReadClose)26 b Fl(\()p Fj(BZ2_bzWriteClose)p +Fl(\))h(should)h(then)i(b)s(e)g(called)g(to)h(clean)f(up.)225 +3905 y Fi(\017)60 b Fl(The)33 b Fj(FILE*)f Fl(argumen)m(ts)h(passed)g +(to)h Fj(BZ2_bzReadOpen)p Fl(/)p Fj(BZ2_bzWriteOp)o(en)27 +b Fl(should)32 b(b)s(e)g(set)i(to)330 4015 y(binary)23 +b(mo)s(de.)38 b(Most)26 b(Unix)d(systems)i(will)d(do)i(this)g(b)m(y)g +(default,)i(but)e(other)g(platforms,)h(including)330 +4124 y(Windo)m(ws)20 b(and)g(Mac,)k(will)19 b(not.)38 +b(If)20 b(y)m(ou)h(omit)g(this,)h(y)m(ou)f(ma)m(y)h(encoun)m(ter)f +(problems)e(when)h(mo)m(ving)330 4234 y(co)s(de)31 b(to)g(new)f +(platforms.)225 4371 y Fi(\017)60 b Fl(Memory)23 b(allo)s(cation)f +(requests)h(are)g(handled)e(b)m(y)i Fj(malloc)p Fl(/)p +Fj(free)p Fl(.)36 b(A)m(t)23 b(presen)m(t)g(there)g(is)f(no)h(facilit)m +(y)330 4481 y(for)40 b(user-de\014ned)e(memory)i(allo)s(cators)g(in)f +(the)h(\014le)g(I/O)g(functions)e(\(could)i(easily)f(b)s(e)g(added,)330 +4590 y(though\).)150 4842 y Ff(3.4.1)63 b Fe(BZ2_bzReadOpen)533 +5029 y Fj(typedef)46 b(void)h(BZFILE;)533 5236 y(BZFILE)f +(*BZ2_bzReadOpen)e(\()j(int)g(*bzerror,)f(FILE)g(*f,)1726 +5340 y(int)h(small,)f(int)h(verbosity,)p eop +%%Page: 20 21 +20 20 bop 150 -116 a Fl(Chapter)30 b(3:)h(Programming)e(with)g +Fj(libbzip2)1891 b Fl(20)1726 299 y Fj(void)47 b(*unused,)f(int)g +(nUnused)g(\);)150 456 y Fl(Prepare)29 b(to)g(read)g(compressed)f(data) +i(from)e(\014le)g(handle)f Fj(f)p Fl(.)40 b Fj(f)29 b +Fl(should)d(refer)j(to)h(a)f(\014le)f(whic)m(h)f(has)i(b)s(een)150 +565 y(op)s(ened)h(for)h(reading,)f(and)h(for)f(whic)m(h)g(the)h(error)g +(indicator)e(\()p Fj(ferror\(f\))p Fl(\)is)f(not)k(set.)42 +b(If)31 b Fj(small)e Fl(is)h(1,)150 675 y(the)h(library)d(will)f(try)j +(to)i(decompress)e(using)f(less)g(memory)-8 b(,)31 b(at)g(the)g(exp)s +(ense)f(of)g(sp)s(eed.)150 832 y(F)-8 b(or)39 b(reasons)f(explained)f +(b)s(elo)m(w,)j Fj(BZ2_bzRead)35 b Fl(will)h(decompress)i(the)g +Fj(nUnused)e Fl(b)m(ytes)j(starting)f(at)150 941 y Fj(unused)p +Fl(,)k(b)s(efore)e(starting)h(to)g(read)g(from)f(the)h(\014le)f +Fj(f)p Fl(.)71 b(A)m(t)42 b(most)f Fj(BZ_MAX_UNUSED)c +Fl(b)m(ytes)k(ma)m(y)h(b)s(e)150 1051 y(supplied)32 b(lik)m(e)k(this.) +55 b(If)36 b(this)e(facilit)m(y)h(is)g(not)h(required,)g(y)m(ou)g +(should)e(pass)h Fj(NULL)g Fl(and)g Fj(0)g Fl(for)h Fj(unused)150 +1160 y Fl(and)30 b(n)p Fj(Unused)e Fl(resp)s(ectiv)m(ely)-8 +b(.)150 1317 y(F)g(or)31 b(the)g(meaning)e(of)i(parameters)g +Fj(small)e Fl(and)g Fj(verbosity)p Fl(,)f(see)j Fj +(BZ2_bzDecompressInit)p Fl(.)150 1474 y(The)k(amoun)m(t)g(of)g(memory)g +(needed)g(to)g(decompress)g(a)h(\014le)e(cannot)h(b)s(e)g(determined)e +(un)m(til)h(the)h(\014le's)150 1584 y(header)22 b(has)f(b)s(een)g +(read.)38 b(So)22 b(it)f(is)g(p)s(ossible)e(that)k Fj(BZ2_bzReadOpen)17 +b Fl(returns)k Fj(BZ_OK)f Fl(but)h(a)i(subsequen)m(t)150 +1693 y(call)30 b(of)g Fj(BZ2_bzRead)e Fl(will)f(return)j +Fj(BZ_MEM_ERROR)p Fl(.)150 1850 y(P)m(ossible)f(assignmen)m(ts)h(to)h +Fj(bzerror)p Fl(:)572 2001 y Fj(BZ_CONFIG_ERROR)663 2105 +y Fl(if)e(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 +2209 y Fj(BZ_PARAM_ERROR)663 2313 y Fl(if)g Fj(f)h Fl(is)g +Fj(NULL)663 2416 y Fl(or)g Fj(small)f Fl(is)g(neither)h +Fj(0)g Fl(nor)g Fj(1)663 2520 y Fl(or)g Fj(\(unused)46 +b(==)h(NULL)g(&&)g(nUnused)f(!=)h(0\))663 2624 y Fl(or)30 +b Fj(\(unused)46 b(!=)h(NULL)g(&&)g(!\(0)g(<=)g(nUnused)f(<=)h +(BZ_MAX_UNUSED\)\))572 2728 y(BZ_IO_ERROR)663 2831 y +Fl(if)29 b Fj(ferror\(f\))f Fl(is)h(nonzero)572 2935 +y Fj(BZ_MEM_ERROR)663 3039 y Fl(if)g(insu\016cien)m(t)g(memory)h(is)f +(a)m(v)-5 b(ailable)572 3143 y Fj(BZ_OK)663 3247 y Fl(otherwise.)150 +3403 y(P)m(ossible)29 b(return)h(v)-5 b(alues:)572 3554 +y(P)m(oin)m(ter)31 b(to)g(an)f(abstract)h Fj(BZFILE)663 +3658 y Fl(if)e Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 3762 +y(NULL)663 3866 y Fl(otherwise)150 4023 y(Allo)m(w)m(able)g(next)g +(actions:)572 4174 y Fj(BZ2_bzRead)663 4277 y Fl(if)f +Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 4381 y(BZ2_bzClose)663 +4485 y Fl(otherwise)150 4887 y Ff(3.4.2)63 b Fe(BZ2_bzRead)533 +5074 y Fj(int)47 b(BZ2_bzRead)e(\()j(int)e(*bzerror,)g(BZFILE)g(*b,)h +(void)f(*buf,)h(int)g(len)g(\);)150 5230 y Fl(Reads)35 +b(up)f(to)h Fj(len)f Fl(\(uncompressed\))h(b)m(ytes)g(from)f(the)h +(compressed)g(\014le)f Fj(b)g Fl(in)m(to)h(the)g(bu\013er)f +Fj(buf)p Fl(.)53 b(If)150 5340 y(the)30 b(read)f(w)m(as)h(successful,)f +Fj(bzerror)e Fl(is)i(set)h(to)g Fj(BZ_OK)e Fl(and)h(the)h(n)m(um)m(b)s +(er)e(of)i(b)m(ytes)g(read)f(is)g(returned.)p eop +%%Page: 21 22 +21 21 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(21)150 299 y(If)33 b(the)g(logical)g +(end-of-stream)h(w)m(as)g(detected,)i Fj(bzerror)31 b +Fl(will)g(b)s(e)h(set)i(to)g Fj(BZ_STREAM_END)p Fl(,)d(and)i(the)150 +408 y(n)m(um)m(b)s(er)c(of)i(b)m(ytes)f(read)h(is)e(returned.)40 +b(All)29 b(other)h Fj(bzerror)f Fl(v)-5 b(alues)29 b(denote)i(an)g +(error.)150 565 y Fj(BZ2_bzRead)37 b Fl(will)f(supply)h +Fj(len)i Fl(b)m(ytes,)j(unless)c(the)i(logical)f(stream)h(end)e(is)h +(detected)i(or)e(an)g(error)150 675 y(o)s(ccurs.)75 b(Because)43 +b(of)f(this,)i(it)d(is)g(p)s(ossible)e(to)k(detect)g(the)f(stream)g +(end)f(b)m(y)h(observing)f(when)g(the)150 784 y(n)m(um)m(b)s(er)29 +b(of)h(b)m(ytes)g(returned)f(is)g(less)g(than)h(the)g(n)m(um)m(b)s(er)f +(requested.)40 b(Nev)m(ertheless,)31 b(this)e(is)g(regarded)150 +894 y(as)38 b(inadvisable;)g(y)m(ou)g(should)d(instead)i(c)m(hec)m(k)i +Fj(bzerror)d Fl(after)i(ev)m(ery)g(call)e(and)h(w)m(atc)m(h)i(out)f +(for)f Fj(BZ_)150 1004 y(STREAM_END)p Fl(.)150 1160 y(In)m(ternally)-8 +b(,)47 b Fj(BZ2_bzRead)41 b Fl(copies)j(data)g(from)g(the)g(compressed) +g(\014le)f(in)f(c)m(h)m(unks)i(of)g(size)g Fj(BZ_MAX_)150 +1270 y(UNUSED)31 b Fl(b)m(ytes)i(b)s(efore)f(decompressing)f(it.)47 +b(If)32 b(the)h(\014le)e(con)m(tains)i(more)g(b)m(ytes)g(than)f +(strictly)f(needed)150 1380 y(to)48 b(reac)m(h)f(the)g(logical)f +(end-of-stream,)52 b Fj(BZ2_bzRead)44 b Fl(will)g(almost)j(certainly)f +(read)h(some)g(of)g(the)150 1489 y(trailing)c(data)j(b)s(efore)e +(signalling)f Fj(BZ_SEQUENCE_END)p Fl(.)80 b(T)-8 b(o)46 +b(collect)f(the)g(read)g(but)g(un)m(used)e(data)150 1599 +y(once)29 b Fj(BZ_SEQUENCE_END)24 b Fl(has)k(app)s(eared,)g(call)f +Fj(BZ2_bzReadGetUnused)c Fl(immediately)j(b)s(efore)i +Fj(BZ2_)150 1708 y(bzReadClose)p Fl(.)150 1865 y(P)m(ossible)h +(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 2016 y Fj(BZ_PARAM_ERROR) +663 2120 y Fl(if)e Fj(b)h Fl(is)g Fj(NULL)f Fl(or)h Fj(buf)g +Fl(is)f Fj(NULL)g Fl(or)i Fj(len)46 b(<)i(0)572 2224 +y(BZ_SEQUENCE_ERROR)663 2328 y Fl(if)29 b Fj(b)h Fl(w)m(as)h(op)s(ened) +e(with)h Fj(BZ2_bzWriteOpen)572 2431 y(BZ_IO_ERROR)663 +2535 y Fl(if)f(there)i(is)e(an)h(error)g(reading)g(from)g(the)g +(compressed)g(\014le)572 2639 y Fj(BZ_UNEXPECTED_EOF)663 +2743 y Fl(if)f(the)i(compressed)f(\014le)f(ended)h(b)s(efore)g(the)g +(logical)g(end-of-stream)h(w)m(as)g(detected)572 2847 +y Fj(BZ_DATA_ERROR)663 2950 y Fl(if)e(a)i(data)g(in)m(tegrit)m(y)f +(error)g(w)m(as)h(detected)h(in)d(the)h(compressed)g(stream)572 +3054 y Fj(BZ_DATA_ERROR_MAGIC)663 3158 y Fl(if)f(the)i(stream)f(do)s +(es)g(not)h(b)s(egin)e(with)g(the)i(requisite)e(header)h(b)m(ytes)h +(\(ie,)f(is)g(not)663 3262 y(a)g Fj(bzip2)f Fl(data)i(\014le\).)61 +b(This)28 b(is)i(really)f(a)i(sp)s(ecial)e(case)i(of)g +Fj(BZ_DATA_ERROR)p Fl(.)572 3365 y Fj(BZ_MEM_ERROR)663 +3469 y Fl(if)e(insu\016cien)m(t)g(memory)h(w)m(as)h(a)m(v)-5 +b(ailable)572 3573 y Fj(BZ_STREAM_END)663 3677 y Fl(if)29 +b(the)i(logical)e(end)h(of)h(stream)f(w)m(as)h(detected.)572 +3781 y Fj(BZ_OK)663 3884 y Fl(otherwise.)150 4041 y(P)m(ossible)e +(return)h(v)-5 b(alues:)572 4192 y(n)m(um)m(b)s(er)29 +b(of)h(b)m(ytes)h(read)663 4296 y(if)e Fj(bzerror)f Fl(is)i +Fj(BZ_OK)f Fl(or)h Fj(BZ_STREAM_END)572 4400 y Fl(unde\014ned)663 +4503 y(otherwise)150 4660 y(Allo)m(w)m(able)g(next)g(actions:)572 +4811 y(collect)h(data)g(from)f Fj(buf)p Fl(,)f(then)h +Fj(BZ2_bzRead)e Fl(or)i Fj(BZ2_bzReadClose)663 4915 y +Fl(if)f Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 5019 y Fl(collect)h(data)g +(from)f Fj(buf)p Fl(,)f(then)h Fj(BZ2_bzReadClose)d Fl(or)j +Fj(BZ2_bzReadGetUnused)663 5123 y Fl(if)f Fj(bzerror)f +Fl(is)i Fj(BZ_SEQUENCE_END)572 5226 y(BZ2_bzReadClose)663 +5330 y Fl(otherwise)p eop +%%Page: 22 23 +22 22 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(22)150 299 y Ff(3.4.3)63 +b Fe(BZ2_bzReadGetUnused)533 486 y Fj(void)47 b(BZ2_bzReadGetUnused)42 +b(\()48 b(int*)e(bzerror,)g(BZFILE)g(*b,)1822 589 y(void**)g(unused,)g +(int*)g(nUnused)g(\);)150 746 y Fl(Returns)36 b(data)i(whic)m(h)d(w)m +(as)j(read)f(from)f(the)h(compressed)g(\014le)f(but)g(w)m(as)h(not)h +(needed)e(to)i(get)g(to)g(the)150 856 y(logical)k(end-of-stream.)78 +b Fj(*unused)41 b Fl(is)h(set)h(to)g(the)g(address)f(of)g(the)h(data,)k +(and)42 b Fj(*nUnused)e Fl(to)k(the)150 965 y(n)m(um)m(b)s(er)29 +b(of)i(b)m(ytes.)41 b Fj(*nUnused)28 b Fl(will)g(b)s(e)h(set)i(to)g(a)g +(v)-5 b(alue)30 b(b)s(et)m(w)m(een)h Fj(0)f Fl(and)g +Fj(BZ_MAX_UNUSED)d Fl(inclusiv)m(e.)150 1122 y(This)d(function)h(ma)m +(y)h(only)g(b)s(e)f(called)g(once)i Fj(BZ2_bzRead)c Fl(has)j(signalled) +e Fj(BZ_STREAM_END)e Fl(but)j(b)s(efore)150 1232 y Fj(BZ2_bzReadClose)p +Fl(.)150 1389 y(P)m(ossible)k(assignmen)m(ts)h(to)h Fj(bzerror)p +Fl(:)572 1540 y Fj(BZ_PARAM_ERROR)663 1644 y Fl(if)e +Fj(b)h Fl(is)g Fj(NULL)663 1747 y Fl(or)g Fj(unused)f +Fl(is)g Fj(NULL)g Fl(or)i Fj(nUnused)d Fl(is)i Fj(NULL)572 +1851 y(BZ_SEQUENCE_ERROR)663 1955 y Fl(if)f Fj(BZ_STREAM_END)e +Fl(has)j(not)h(b)s(een)e(signalled)663 2059 y(or)h(if)f +Fj(b)h Fl(w)m(as)h(op)s(ened)f(with)f Fj(BZ2_bzWriteOpen)542 +2162 y(BZ_OK)663 2266 y Fl(otherwise)150 2423 y(Allo)m(w)m(able)h(next) +g(actions:)572 2574 y Fj(BZ2_bzReadClose)150 2882 y Ff(3.4.4)63 +b Fe(BZ2_bzReadClose)533 3068 y Fj(void)47 b(BZ2_bzReadClose)c(\()48 +b(int)f(*bzerror,)e(BZFILE)h(*b)h(\);)150 3225 y Fl(Releases)36 +b(all)e(memory)h(p)s(ertaining)e(to)i(the)h(compressed)f(\014le)f +Fj(b)p Fl(.)54 b Fj(BZ2_bzReadClose)31 b Fl(do)s(es)k(not)h(call)150 +3335 y Fj(fclose)c Fl(on)h(the)h(underlying)d(\014le)h(handle,)h(so)h +(y)m(ou)g(should)e(do)h(that)h(y)m(ourself)f(if)g(appropriate.)49 +b Fj(BZ2_)150 3445 y(bzReadClose)27 b Fl(should)i(b)s(e)g(called)h(to)h +(clean)f(up)g(after)h(all)e(error)h(situations.)150 3601 +y(P)m(ossible)f(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 +3752 y Fj(BZ_SEQUENCE_ERROR)663 3856 y Fl(if)e Fj(b)h +Fl(w)m(as)h(op)s(ened)e(with)h Fj(BZ2_bzOpenWrite)572 +3960 y(BZ_OK)663 4064 y Fl(otherwise)150 4221 y(Allo)m(w)m(able)g(next) +g(actions:)572 4372 y(none)150 4679 y Ff(3.4.5)63 b Fe(BZ2_bzWriteOpen) +533 4866 y Fj(BZFILE)46 b(*BZ2_bzWriteOpen)e(\()j(int)g(*bzerror,)e +(FILE)i(*f,)1774 4970 y(int)g(blockSize100k,)d(int)j(verbosity,)1774 +5074 y(int)g(workFactor)e(\);)150 5230 y Fl(Prepare)33 +b(to)g(write)f(compressed)h(data)h(to)f(\014le)f(handle)g +Fj(f)p Fl(.)47 b Fj(f)33 b Fl(should)e(refer)i(to)g(a)g(\014le)f(whic)m +(h)g(has)h(b)s(een)150 5340 y(op)s(ened)d(for)g(writing,)e(and)i(for)g +(whic)m(h)f(the)i(error)f(indicator)f(\()p Fj(ferror\(f\))p +Fl(\)is)f(not)i(set.)p eop +%%Page: 23 24 +23 23 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(23)150 299 y(F)-8 b(or)31 +b(the)g(meaning)e(of)i(parameters)g Fj(blockSize100k)p +Fl(,)c Fj(verbosity)g Fl(and)j Fj(workFactor)p Fl(,)e(see)150 +408 y Fj(BZ2_bzCompressInit)p Fl(.)150 565 y(All)d(required)f(memory)i +(is)f(allo)s(cated)i(at)g(this)e(stage,)j(so)f(if)e(the)h(call)g +(completes)g(successfully)-8 b(,)26 b Fj(BZ_MEM_)150 +675 y(ERROR)j Fl(cannot)i(b)s(e)f(signalled)e(b)m(y)i(a)h(subsequen)m +(t)f(call)f(to)i Fj(BZ2_bzWrite)p Fl(.)150 832 y(P)m(ossible)e +(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 983 y Fj(BZ_CONFIG_ERROR) +663 1087 y Fl(if)e(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 +1190 y Fj(BZ_PARAM_ERROR)663 1294 y Fl(if)g Fj(f)h Fl(is)g +Fj(NULL)663 1398 y Fl(or)g Fj(blockSize100k)44 b(<)k(1)30 +b Fl(or)g Fj(blockSize100k)44 b(>)k(9)572 1502 y(BZ_IO_ERROR)663 +1605 y Fl(if)29 b Fj(ferror\(f\))f Fl(is)h(nonzero)572 +1709 y Fj(BZ_MEM_ERROR)663 1813 y Fl(if)g(insu\016cien)m(t)g(memory)h +(is)f(a)m(v)-5 b(ailable)572 1917 y Fj(BZ_OK)663 2021 +y Fl(otherwise)150 2177 y(P)m(ossible)29 b(return)h(v)-5 +b(alues:)572 2328 y(P)m(oin)m(ter)31 b(to)g(an)f(abstract)h +Fj(BZFILE)663 2432 y Fl(if)e Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 +2536 y(NULL)663 2640 y Fl(otherwise)150 2797 y(Allo)m(w)m(able)g(next)g +(actions:)572 2948 y Fj(BZ2_bzWrite)663 3051 y Fl(if)f +Fj(bzerror)f Fl(is)i Fj(BZ_OK)604 3155 y Fl(\(y)m(ou)25 +b(could)e(go)h(directly)f(to)h Fj(BZ2_bzWriteClose)p +Fl(,)c(but)j(this)g(w)m(ould)g(b)s(e)g(prett)m(y)h(p)s(oin)m(tless\)) +572 3259 y Fj(BZ2_bzWriteClose)663 3363 y Fl(otherwise)150 +3639 y Ff(3.4.6)63 b Fe(BZ2_bzWrite)533 3826 y Fj(void)47 +b(BZ2_bzWrite)e(\()i(int)g(*bzerror,)e(BZFILE)h(*b,)h(void)g(*buf,)f +(int)h(len)g(\);)150 3983 y Fl(Absorbs)26 b Fj(len)g +Fl(b)m(ytes)i(from)e(the)i(bu\013er)e Fj(buf)p Fl(,)h(ev)m(en)m(tually) +g(to)h(b)s(e)e(compressed)h(and)f(written)g(to)i(the)g(\014le.)150 +4140 y(P)m(ossible)h(assignmen)m(ts)h(to)h Fj(bzerror)p +Fl(:)572 4291 y Fj(BZ_PARAM_ERROR)663 4395 y Fl(if)e +Fj(b)h Fl(is)g Fj(NULL)f Fl(or)h Fj(buf)g Fl(is)f Fj(NULL)g +Fl(or)i Fj(len)46 b(<)i(0)572 4498 y(BZ_SEQUENCE_ERROR)663 +4602 y Fl(if)29 b(b)h(w)m(as)h(op)s(ened)e(with)g Fj(BZ2_bzReadOpen)572 +4706 y(BZ_IO_ERROR)663 4810 y Fl(if)g(there)i(is)e(an)h(error)g +(writing)f(the)h(compressed)g(\014le.)572 4914 y Fj(BZ_OK)663 +5017 y Fl(otherwise)150 5294 y Ff(3.4.7)63 b Fe(BZ2_bzWriteClose)p +eop +%%Page: 24 25 +24 24 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(24)533 299 y Fj(void)47 +b(BZ2_bzWriteClose)c(\()48 b(int)f(*bzerror,)e(BZFILE*)h(f,)1679 +403 y(int)h(abandon,)1679 506 y(unsigned)e(int*)i(nbytes_in,)1679 +610 y(unsigned)e(int*)i(nbytes_out)e(\);)533 818 y(void)i +(BZ2_bzWriteClose64)c(\()k(int)g(*bzerror,)e(BZFILE*)h(f,)1774 +922 y(int)h(abandon,)1774 1025 y(unsigned)f(int*)g(nbytes_in_lo32,)1774 +1129 y(unsigned)g(int*)g(nbytes_in_hi32,)1774 1233 y(unsigned)g(int*)g +(nbytes_out_lo32,)1774 1337 y(unsigned)g(int*)g(nbytes_out_hi32)e(\);) +150 1493 y Fl(Compresses)39 b(and)g(\015ushes)g(to)h(the)g(compressed)g +(\014le)f(all)f(data)j(so)f(far)g(supplied)c(b)m(y)k +Fj(BZ2_bzWrite)p Fl(.)150 1603 y(The)27 b(logical)g(end-of-stream)h +(mark)m(ers)g(are)g(also)f(written,)h(so)f(subsequen)m(t)g(calls)g(to)h +Fj(BZ2_bzWrite)d Fl(are)150 1713 y(illegal.)50 b(All)33 +b(memory)h(asso)s(ciated)g(with)f(the)i(compressed)e(\014le)h +Fj(b)f Fl(is)g(released.)52 b Fj(fflush)33 b Fl(is)g(called)g(on)150 +1822 y(the)e(compressed)f(\014le,)f(but)h(it)g(is)f(not)i +Fj(fclose)p Fl('d.)150 1979 y(If)i Fj(BZ2_bzWriteClose)c +Fl(is)k(called)f(to)j(clean)e(up)f(after)i(an)g(error,)g(the)g(only)e +(action)i(is)f(to)h(release)g(the)150 2089 y(memory)-8 +b(.)42 b(The)30 b(library)e(records)j(the)g(error)f(co)s(des)h(issued)e +(b)m(y)h(previous)f(calls,)i(so)f(this)g(situation)g(will)150 +2198 y(b)s(e)c(detected)h(automatically)-8 b(.)40 b(There)26 +b(is)g(no)g(attempt)h(to)h(complete)e(the)h(compression)f(op)s +(eration,)g(nor)150 2308 y(to)32 b Fj(fflush)d Fl(the)i(compressed)g +(\014le.)42 b(Y)-8 b(ou)32 b(can)f(force)h(this)e(b)s(eha)m(viour)g(to) +h(happ)s(en)f(ev)m(en)i(in)d(the)j(case)g(of)150 2417 +y(no)e(error,)g(b)m(y)h(passing)e(a)i(nonzero)f(v)-5 +b(alue)30 b(to)h Fj(abandon)p Fl(.)150 2574 y(If)j Fj(nbytes_in)d +Fl(is)j(non-n)m(ull,)f Fj(*nbytes_in)e Fl(will)h(b)s(e)h(set)i(to)g(b)s +(e)f(the)g(total)h(v)m(olume)f(of)g(uncompressed)150 +2684 y(data)k(handled.)60 b(Similarly)-8 b(,)35 b Fj(nbytes_out)g +Fl(will)g(b)s(e)h(set)i(to)g(the)g(total)g(v)m(olume)f(of)g(compressed) +g(data)150 2793 y(written.)h(F)-8 b(or)27 b(compatibilit)m(y)d(with)h +(older)g(v)m(ersions)h(of)g(the)g(library)-8 b(,)25 b +Fj(BZ2_bzWriteClose)d Fl(only)j(yields)150 2903 y(the)40 +b(lo)m(w)m(er)g(32)h(bits)d(of)i(these)h(coun)m(ts.)69 +b(Use)40 b Fj(BZ2_bzWriteClose64)35 b Fl(if)k(y)m(ou)h(w)m(an)m(t)h +(the)f(full)d(64)k(bit)150 3013 y(coun)m(ts.)g(These)30 +b(t)m(w)m(o)i(functions)d(are)i(otherwise)f(absolutely)f(iden)m(tical.) +150 3169 y(P)m(ossible)g(assignmen)m(ts)h(to)h Fj(bzerror)p +Fl(:)572 3320 y Fj(BZ_SEQUENCE_ERROR)663 3424 y Fl(if)e +Fj(b)h Fl(w)m(as)h(op)s(ened)e(with)h Fj(BZ2_bzReadOpen)572 +3528 y(BZ_IO_ERROR)663 3632 y Fl(if)f(there)i(is)e(an)h(error)g +(writing)f(the)h(compressed)g(\014le)572 3736 y Fj(BZ_OK)663 +3839 y Fl(otherwise)150 4161 y Ff(3.4.8)63 b(Handling)41 +b(em)m(b)s(edded)g(compressed)h(data)e(streams)150 4354 +y Fl(The)i(high-lev)m(el)g(library)f(facilitates)h(use)h(of)g +Fj(bzip2)e Fl(data)j(streams)f(whic)m(h)f(form)g(some)i(part)e(of)i(a) +150 4463 y(surrounding,)27 b(larger)j(data)h(stream.)225 +4620 y Fi(\017)60 b Fl(F)-8 b(or)22 b(writing,)f(the)g(library)e(tak)m +(es)k(an)e(op)s(en)f(\014le)g(handle,)i(writes)e(compressed)h(data)h +(to)g(it,)g Fj(fflush)p Fl(es)330 4730 y(it)34 b(but)f(do)s(es)h(not)h +Fj(fclose)d Fl(it.)52 b(The)34 b(calling)f(application)g(can)h(write)g +(its)f(o)m(wn)i(data)g(b)s(efore)f(and)330 4839 y(after)d(the)f +(compressed)h(data)g(stream,)g(using)d(that)j(same)g(\014le)f(handle.) +225 5011 y Fi(\017)60 b Fl(Reading)34 b(is)f(more)i(complex,)g(and)f +(the)h(facilities)d(are)j(not)g(as)g(general)f(as)h(they)f(could)g(b)s +(e)g(since)330 5121 y(generalit)m(y)e(is)f(hard)f(to)j(reconcile)e +(with)f(e\016ciency)-8 b(.)46 b Fj(BZ2_bzRead)29 b Fl(reads)i(from)g +(the)h(compressed)330 5230 y(\014le)39 b(in)g(blo)s(c)m(ks)g(of)h(size) +g Fj(BZ_MAX_UNUSED)c Fl(b)m(ytes,)44 b(and)39 b(in)g(doing)g(so)h +(probably)e(will)f(o)m(v)m(ersho)s(ot)330 5340 y(the)i(logical)g(end)f +(of)h(compressed)f(stream.)67 b(T)-8 b(o)40 b(reco)m(v)m(er)g(this)e +(data)i(once)f(decompression)f(has)p eop +%%Page: 25 26 +25 25 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(25)330 299 y(ended,)28 +b(call)g Fj(BZ2_bzReadGetUnused)23 b Fl(after)29 b(the)g(last)f(call)g +(of)g Fj(BZ2_bzRead)e Fl(\(the)j(one)g(returning)330 +408 y Fj(BZ_STREAM_END)p Fl(\))e(but)j(b)s(efore)g(calling)f +Fj(BZ2_bzReadClose)p Fl(.)150 596 y(This)51 b(mec)m(hanism)g(mak)m(es)j +(it)e(easy)h(to)g(decompress)f(m)m(ultiple)e Fj(bzip2)i +Fl(streams)g(placed)g(end-to-)150 706 y(end.)90 b(As)48 +b(the)f(end)f(of)i(one)f(stream,)52 b(when)46 b Fj(BZ2_bzRead)f +Fl(returns)h Fj(BZ_STREAM_END)p Fl(,)i(call)e Fj(BZ2_)150 +816 y(bzReadGetUnused)36 b Fl(to)41 b(collect)g(the)g(un)m(used)e(data) +i(\(cop)m(y)g(it)f(in)m(to)g(y)m(our)h(o)m(wn)f(bu\013er)f +(somewhere\).)150 925 y(That)25 b(data)g(forms)f(the)h(start)h(of)e +(the)h(next)g(compressed)g(stream.)39 b(T)-8 b(o)25 b(start)h +(uncompressing)c(that)k(next)150 1035 y(stream,)40 b(call)d +Fj(BZ2_bzReadOpen)d Fl(again,)40 b(feeding)d(in)g(the)h(un)m(used)e +(data)j(via)e(the)h Fj(unused)p Fl(/)p Fj(nUnused)150 +1144 y Fl(parameters.)54 b(Keep)34 b(doing)g(this)f(un)m(til)g +Fj(BZ_STREAM_END)e Fl(return)j(coincides)f(with)h(the)g(ph)m(ysical)g +(end)150 1254 y(of)d(\014le)e(\()p Fj(feof\(f\))p Fl(\).)39 +b(In)30 b(this)f(situation)h Fj(BZ2_bzReadGetUnused)25 +b Fl(will)i(of)k(course)g(return)e(no)h(data.)150 1411 +y(This)c(should)f(giv)m(e)j(some)g(feel)f(for)g(ho)m(w)h(the)g +(high-lev)m(el)e(in)m(terface)i(can)f(b)s(e)g(used.)39 +b(If)27 b(y)m(ou)h(require)e(extra)150 1520 y(\015exibilit)m(y)-8 +b(,)28 b(y)m(ou'll)i(ha)m(v)m(e)h(to)g(bite)f(the)h(bullet)d(and)i(get) +i(to)f(grips)e(with)g(the)h(lo)m(w-lev)m(el)h(in)m(terface.)150 +1779 y Ff(3.4.9)63 b(Standard)40 b(\014le-reading/writing)j(co)s(de)150 +1972 y Fl(Here's)31 b(ho)m(w)f(y)m(ou'd)h(write)e(data)j(to)f(a)f +(compressed)g(\014le:)390 2330 y Fj(FILE*)142 b(f;)390 +2434 y(BZFILE*)46 b(b;)390 2538 y(int)238 b(nBuf;)390 +2642 y(char)190 b(buf[)46 b(/*)i(whatever)d(size)i(you)g(like)f(*/)i +(];)390 2746 y(int)238 b(bzerror;)390 2849 y(int)g(nWritten;)390 +3057 y(f)47 b(=)h(fopen)e(\()i("myfile.bz2",)c("w")j(\);)390 +3161 y(if)g(\(!f\))g({)533 3264 y(/*)g(handle)f(error)h(*/)390 +3368 y(})390 3472 y(b)g(=)h(BZ2_bzWriteOpen)c(\()j(&bzerror,)e(f,)i(9)h +(\);)390 3576 y(if)f(\(bzerror)f(!=)h(BZ_OK\))f({)533 +3680 y(BZ2_bzWriteClose)e(\()j(b)g(\);)533 3783 y(/*)g(handle)f(error)h +(*/)390 3887 y(})390 4095 y(while)f(\()i(/*)f(condition)e(*/)i(\))h({) +533 4198 y(/*)f(get)g(data)g(to)g(write)f(into)h(buf,)g(and)g(set)g +(nBuf)f(appropriately)e(*/)533 4302 y(nWritten)i(=)h(BZ2_bzWrite)e(\()i +(&bzerror,)f(b,)h(buf,)f(nBuf)h(\);)533 4406 y(if)g(\(bzerror)f(==)h +(BZ_IO_ERROR\))e({)676 4510 y(BZ2_bzWriteClose)f(\()j(&bzerror,)e(b)j +(\);)676 4614 y(/*)g(handle)e(error)g(*/)533 4717 y(})390 +4821 y(})390 5029 y(BZ2_bzWriteClose)d(\()48 b(&bzerror,)d(b)j(\);)390 +5132 y(if)f(\(bzerror)f(==)h(BZ_IO_ERROR\))d({)533 5236 +y(/*)j(handle)f(error)h(*/)390 5340 y(})p eop +%%Page: 26 27 +26 26 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(26)150 299 y(And)29 b(to)j(read)e(from)g +(a)h(compressed)f(\014le:)390 450 y Fj(FILE*)142 b(f;)390 +554 y(BZFILE*)46 b(b;)390 657 y(int)238 b(nBuf;)390 761 +y(char)190 b(buf[)46 b(/*)i(whatever)d(size)i(you)g(like)f(*/)i(];)390 +865 y(int)238 b(bzerror;)390 969 y(int)g(nWritten;)390 +1176 y(f)47 b(=)h(fopen)e(\()i("myfile.bz2",)c("r")j(\);)390 +1280 y(if)g(\(!f\))g({)533 1384 y(/*)g(handle)f(error)h(*/)390 +1488 y(})390 1591 y(b)g(=)h(BZ2_bzReadOpen)c(\()j(&bzerror,)f(f,)h(0,)g +(NULL,)f(0)i(\);)390 1695 y(if)f(\(bzerror)f(!=)h(BZ_OK\))f({)533 +1799 y(BZ2_bzReadClose)e(\()j(&bzerror,)f(b)h(\);)533 +1903 y(/*)g(handle)f(error)h(*/)390 2007 y(})390 2214 +y(bzerror)f(=)h(BZ_OK;)390 2318 y(while)f(\(bzerror)g(==)h(BZ_OK)f(&&)i +(/*)f(arbitrary)e(other)h(conditions)f(*/\))i({)533 2422 +y(nBuf)g(=)g(BZ2_bzRead)e(\()j(&bzerror,)d(b,)i(buf,)g(/*)g(size)g(of)g +(buf)g(*/)g(\);)533 2525 y(if)g(\(bzerror)f(==)h(BZ_OK\))f({)676 +2629 y(/*)i(do)f(something)e(with)i(buf[0)f(..)h(nBuf-1])f(*/)533 +2733 y(})390 2837 y(})390 2941 y(if)h(\(bzerror)f(!=)h(BZ_STREAM_END\)) +d({)533 3044 y(BZ2_bzReadClose)g(\()j(&bzerror,)f(b)h(\);)533 +3148 y(/*)g(handle)f(error)h(*/)390 3252 y(})g(else)g({)533 +3356 y(BZ2_bzReadClose)d(\()j(&bzerror)f(\);)390 3459 +y(})150 3753 y Fk(3.5)68 b(Utilit)l(y)47 b(functions)150 +4045 y Ff(3.5.1)63 b Fe(BZ2_bzBuffToBuffCompress)533 +4232 y Fj(int)47 b(BZ2_bzBuffToBuffCompress\()41 b(char*)428 +b(dest,)1965 4335 y(unsigned)46 b(int*)g(destLen,)1965 +4439 y(char*)428 b(source,)1965 4543 y(unsigned)46 b(int)94 +b(sourceLen,)1965 4647 y(int)524 b(blockSize100k,)1965 +4751 y(int)g(verbosity,)1965 4854 y(int)g(workFactor)45 +b(\);)150 5011 y Fl(A)m(ttempts)33 b(to)g(compress)f(the)g(data)h(in)e +Fj(source[0)d(..)i(sourceLen-1])e Fl(in)m(to)k(the)h(destination)e +(bu\013er,)150 5121 y Fj(dest[0)e(..)g(*destLen-1])p +Fl(.)37 b(If)26 b(the)g(destination)g(bu\013er)f(is)h(big)f(enough,)j +Fj(*destLen)c Fl(is)h(set)i(to)g(the)g(size)150 5230 +y(of)i(the)f(compressed)h(data,)g(and)f Fj(BZ_OK)f Fl(is)h(returned.)39 +b(If)28 b(the)h(compressed)f(data)h(w)m(on't)g(\014t,)g +Fj(*destLen)150 5340 y Fl(is)g(unc)m(hanged,)i(and)e +Fj(BZ_OUTBUFF_FULL)e Fl(is)i(returned.)p eop +%%Page: 27 28 +27 27 bop 150 -116 a Fl(Chapter)30 b(3:)h(Programming)e(with)g +Fj(libbzip2)1891 b Fl(27)150 299 y(Compression)22 b(in)g(this)h(manner) +g(is)g(a)h(one-shot)g(ev)m(en)m(t,)j(done)c(with)g(a)h(single)e(call)h +(to)i(this)d(function.)37 b(The)150 408 y(resulting)25 +b(compressed)i(data)i(is)d(a)i(complete)f Fj(bzip2)f +Fl(format)i(data)g(stream.)40 b(There)27 b(is)f(no)i(mec)m(hanism)150 +518 y(for)23 b(making)g(additional)e(calls)i(to)h(pro)m(vide)f(extra)h +(input)e(data.)39 b(If)23 b(y)m(ou)h(w)m(an)m(t)g(that)g(kind)e(of)h +(mec)m(hanism,)150 628 y(use)30 b(the)h(lo)m(w-lev)m(el)f(in)m +(terface.)150 784 y(F)-8 b(or)31 b(the)g(meaning)e(of)i(parameters)g +Fj(blockSize100k)p Fl(,)c Fj(verbosity)g Fl(and)j Fj(workFactor)p +Fl(,)150 894 y(see)h Fj(BZ2_bzCompressInit)p Fl(.)150 +1051 y(T)-8 b(o)27 b(guaran)m(tee)h(that)e(the)h(compressed)f(data)h +(will)d(\014t)i(in)f(its)g(bu\013er,)i(allo)s(cate)f(an)g(output)g +(bu\013er)g(of)g(size)150 1160 y(1\045)31 b(larger)f(than)g(the)g +(uncompressed)f(data,)j(plus)c(six)h(h)m(undred)g(extra)i(b)m(ytes.)150 +1317 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)25 b Fl(will)k(not)j(write)e +(data)j(at)f(or)f(b)s(ey)m(ond)g Fj(dest[*destLen])p +Fl(,)d(ev)m(en)k(in)150 1427 y(case)f(of)g(bu\013er)e(o)m(v)m(er\015o)m +(w.)150 1584 y(P)m(ossible)g(return)h(v)-5 b(alues:)572 +1735 y Fj(BZ_CONFIG_ERROR)663 1839 y Fl(if)29 b(the)i(library)d(has)i +(b)s(een)f(mis-compiled)572 1942 y Fj(BZ_PARAM_ERROR)663 +2046 y Fl(if)g Fj(dest)g Fl(is)h Fj(NULL)f Fl(or)h Fj(destLen)f +Fl(is)g Fj(NULL)663 2150 y Fl(or)h Fj(blockSize100k)44 +b(<)k(1)30 b Fl(or)g Fj(blockSize100k)44 b(>)k(9)663 +2254 y Fl(or)30 b Fj(verbosity)45 b(<)j(0)30 b Fl(or)g +Fj(verbosity)45 b(>)j(4)663 2357 y Fl(or)30 b Fj(workFactor)45 +b(<)j(0)30 b Fl(or)g Fj(workFactor)45 b(>)i(250)572 2461 +y(BZ_MEM_ERROR)663 2565 y Fl(if)29 b(insu\016cien)m(t)g(memory)h(is)f +(a)m(v)-5 b(ailable)572 2669 y Fj(BZ_OUTBUFF_FULL)663 +2773 y Fl(if)29 b(the)i(size)f(of)g(the)h(compressed)f(data)h(exceeds)g +Fj(*destLen)572 2876 y(BZ_OK)663 2980 y Fl(otherwise)150 +3349 y Ff(3.5.2)63 b Fe(BZ2_bzBuffToBuffDecompress)533 +3536 y Fj(int)47 b(BZ2_bzBuffToBuffDecompres)o(s)42 b(\()47 +b(char*)428 b(dest,)2108 3640 y(unsigned)46 b(int*)g(destLen,)2108 +3744 y(char*)428 b(source,)2108 3848 y(unsigned)46 b(int)94 +b(sourceLen,)2108 3951 y(int)524 b(small,)2108 4055 y(int)g(verbosity) +46 b(\);)150 4212 y Fl(A)m(ttempts)24 b(to)g(decompress)f(the)g(data)g +(in)f Fj(source[0)28 b(..)i(sourceLen-1])20 b Fl(in)m(to)j(the)g +(destination)f(bu\013er,)150 4322 y Fj(dest[0)29 b(..)g(*destLen-1])p +Fl(.)37 b(If)26 b(the)g(destination)g(bu\013er)f(is)h(big)f(enough,)j +Fj(*destLen)c Fl(is)h(set)i(to)g(the)g(size)150 4431 +y(of)21 b(the)g(uncompressed)e(data,)24 b(and)c Fj(BZ_OK)f +Fl(is)h(returned.)36 b(If)20 b(the)h(compressed)g(data)g(w)m(on't)h +(\014t,)g Fj(*destLen)150 4541 y Fl(is)29 b(unc)m(hanged,)i(and)e +Fj(BZ_OUTBUFF_FULL)e Fl(is)i(returned.)150 4698 y Fj(source)g +Fl(is)g(assumed)h(to)h(hold)e(a)i(complete)f Fj(bzip2)f +Fl(format)i(data)g(stream.)150 4807 y Fj(BZ2_bzBuffToBuffDecompre)o(ss) +22 b Fl(tries)28 b(to)i(decompress)e(the)h(en)m(tiret)m(y)g(of)g(the)f +(stream)h(in)m(to)g(the)f(out-)150 4917 y(put)i(bu\013er.)150 +5074 y(F)-8 b(or)31 b(the)g(meaning)e(of)i(parameters)g +Fj(small)e Fl(and)g Fj(verbosity)p Fl(,)f(see)j Fj +(BZ2_bzDecompressInit)p Fl(.)150 5230 y(Because)j(the)f(compression)e +(ratio)i(of)g(the)g(compressed)f(data)h(cannot)g(b)s(e)f(kno)m(wn)g(in) +g(adv)-5 b(ance,)34 b(there)150 5340 y(is)d(no)h(easy)g(w)m(a)m(y)h(to) +f(guaran)m(tee)i(that)e(the)g(output)f(bu\013er)g(will)e(b)s(e)i(big)g +(enough.)45 b(Y)-8 b(ou)32 b(ma)m(y)h(of)f(course)p eop +%%Page: 28 29 +28 28 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(28)150 299 y(mak)m(e)36 +b(arrangemen)m(ts)f(in)e(y)m(our)i(co)s(de)g(to)g(record)g(the)g(size)f +(of)h(the)g(uncompressed)f(data,)i(but)e(suc)m(h)h(a)150 +408 y(mec)m(hanism)30 b(is)f(b)s(ey)m(ond)h(the)g(scop)s(e)h(of)f(this) +g(library)-8 b(.)150 565 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)25 +b Fl(will)k(not)j(write)e(data)j(at)f(or)f(b)s(ey)m(ond)g +Fj(dest[*destLen])p Fl(,)d(ev)m(en)k(in)150 675 y(case)f(of)g(bu\013er) +e(o)m(v)m(er\015o)m(w.)150 832 y(P)m(ossible)g(return)h(v)-5 +b(alues:)572 983 y Fj(BZ_CONFIG_ERROR)663 1087 y Fl(if)29 +b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 1190 +y Fj(BZ_PARAM_ERROR)663 1294 y Fl(if)g Fj(dest)g Fl(is)h +Fj(NULL)f Fl(or)h Fj(destLen)f Fl(is)g Fj(NULL)663 1398 +y Fl(or)h Fj(small)46 b(!=)i(0)f(&&)g(small)g(!=)g(1)663 +1502 y Fl(or)30 b Fj(verbosity)45 b(<)j(0)30 b Fl(or)g +Fj(verbosity)45 b(>)j(4)572 1605 y(BZ_MEM_ERROR)663 1709 +y Fl(if)29 b(insu\016cien)m(t)g(memory)h(is)f(a)m(v)-5 +b(ailable)572 1813 y Fj(BZ_OUTBUFF_FULL)663 1917 y Fl(if)29 +b(the)i(size)f(of)g(the)h(compressed)f(data)h(exceeds)g +Fj(*destLen)572 2021 y(BZ_DATA_ERROR)663 2124 y Fl(if)e(a)i(data)g(in)m +(tegrit)m(y)f(error)g(w)m(as)h(detected)h(in)d(the)h(compressed)g(data) +572 2228 y Fj(BZ_DATA_ERROR_MAGIC)663 2332 y Fl(if)f(the)i(compressed)f +(data)h(do)s(esn't)f(b)s(egin)f(with)g(the)i(righ)m(t)e(magic)i(b)m +(ytes)572 2436 y Fj(BZ_UNEXPECTED_EOF)663 2539 y Fl(if)e(the)i +(compressed)f(data)h(ends)e(unexp)s(ectedly)572 2643 +y Fj(BZ_OK)663 2747 y Fl(otherwise)150 3116 y Fk(3.6)68 +b Fd(zlib)43 b Fk(compatibilit)l(y)k(functions)150 3308 +y Fl(Y)-8 b(oshiok)j(a)33 b(Tsuneo)e(has)h(con)m(tributed)g(some)g +(functions)f(to)i(giv)m(e)g(b)s(etter)f Fj(zlib)f Fl(compatibilit)m(y) +-8 b(.)45 b(These)150 3418 y(functions)36 b(are)i Fj(BZ2_bzopen)p +Fl(,)e Fj(BZ2_bzread)p Fl(,)h Fj(BZ2_bzwrite)p Fl(,)f +Fj(BZ2_bzflush)p Fl(,)h Fj(BZ2_bzclose)p Fl(,)f Fj(BZ2_)150 +3527 y(bzerror)23 b Fl(and)h Fj(BZ2_bzlibVersion)p Fl(.)34 +b(These)25 b(functions)e(are)j(not)f(\(y)m(et\))h(o\016cially)e(part)h +(of)g(the)g(library)-8 b(.)150 3637 y(If)30 b(they)g(break,)h(y)m(ou)g +(get)g(to)g(k)m(eep)g(all)f(the)g(pieces.)41 b(Nev)m(ertheless,)31 +b(I)f(think)f(they)i(w)m(ork)f(ok.)390 3788 y Fj(typedef)46 +b(void)g(BZFILE;)390 3995 y(const)g(char)h(*)g(BZ2_bzlibVersion)d(\()j +(void)g(\);)150 4152 y Fl(Returns)29 b(a)i(string)f(indicating)e(the)i +(library)e(v)m(ersion.)390 4303 y Fj(BZFILE)46 b(*)i(BZ2_bzopen)92 +b(\()48 b(const)e(char)h(*path,)f(const)g(char)h(*mode)f(\);)390 +4407 y(BZFILE)g(*)i(BZ2_bzdopen)c(\()k(int)381 b(fd,)190 +b(const)46 b(char)h(*mode)f(\);)150 4564 y Fl(Op)s(ens)19 +b(a)j Fj(.bz2)e Fl(\014le)g(for)g(reading)g(or)h(writing,)g(using)f +(either)g(its)h(name)g(or)g(a)g(pre-existing)f(\014le)g(descriptor.)150 +4674 y(Analogous)30 b(to)i Fj(fopen)c Fl(and)i Fj(fdopen)p +Fl(.)390 4825 y Fj(int)47 b(BZ2_bzread)93 b(\()47 b(BZFILE*)f(b,)h +(void*)f(buf,)h(int)g(len)g(\);)390 4928 y(int)g(BZ2_bzwrite)e(\()i +(BZFILE*)f(b,)h(void*)f(buf,)h(int)g(len)g(\);)150 5085 +y Fl(Reads/writes)30 b(data)h(from/to)g(a)g(previously)d(op)s(ened)i +Fj(BZFILE)p Fl(.)39 b(Analogous)30 b(to)h Fj(fread)e +Fl(and)h Fj(fwrite)p Fl(.)390 5236 y Fj(int)95 b(BZ2_bzflush)44 +b(\()k(BZFILE*)e(b)h(\);)390 5340 y(void)g(BZ2_bzclose)d(\()k(BZFILE*)e +(b)h(\);)p eop +%%Page: 29 30 +29 29 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(29)150 299 y(Flushes/closes)27 +b(a)h Fj(BZFILE)p Fl(.)39 b Fj(BZ2_bzflush)24 b Fl(do)s(esn't)k +(actually)f(do)h(an)m(ything.)39 b(Analogous)28 b(to)h +Fj(fflush)150 408 y Fl(and)h Fj(fclose)p Fl(.)390 559 +y Fj(const)46 b(char)h(*)g(BZ2_bzerror)e(\()j(BZFILE)e(*b,)h(int)g +(*errnum)e(\))150 716 y Fl(Returns)31 b(a)i(string)e(describing)f(the)i +(more)g(recen)m(t)h(error)f(status)h(of)f Fj(b)p Fl(,)g(and)g(also)g +(sets)h Fj(*errnum)d Fl(to)j(its)150 826 y(n)m(umerical)c(v)-5 +b(alue.)150 1242 y Fk(3.7)68 b(Using)46 b(the)f(library)g(in)g(a)g +Fd(stdio)p Fk(-free)f(en)l(vironmen)l(t)150 1615 y Ff(3.7.1)63 +b(Getting)40 b(rid)h(of)g Fe(stdio)150 1807 y Fl(In)i(a)g(deeply)g(em)m +(b)s(edded)f(application,)j(y)m(ou)f(migh)m(t)f(w)m(an)m(t)h(to)g(use)f +(just)g(the)h(memory-to-memory)150 1917 y(functions.)39 +b(Y)-8 b(ou)30 b(can)f(do)g(this)g(con)m(v)m(enien)m(tly)g(b)m(y)g +(compiling)e(the)j(library)d(with)h(prepro)s(cessor)g(sym)m(b)s(ol)150 +2026 y Fj(BZ_NO_STDIO)35 b Fl(de\014ned.)63 b(Doing)39 +b(this)e(giv)m(es)h(y)m(ou)h(a)f(library)e(con)m(taining)i(only)f(the)i +(follo)m(wing)e(eigh)m(t)150 2136 y(functions:)150 2293 +y Fj(BZ2_bzCompressInit)p Fl(,)26 b Fj(BZ2_bzCompress)p +Fl(,)g Fj(BZ2_bzCompressEnd)150 2402 y(BZ2_bzDecompressInit)p +Fl(,)f Fj(BZ2_bzDecompress)p Fl(,)h Fj(BZ2_bzDecompressEnd)150 +2512 y(BZ2_bzBuffToBuffCompress)o Fl(,)f Fj(BZ2_bzBuffToBuffDecompre)o +(ss)150 2669 y Fl(When)30 b(compiled)f(lik)m(e)h(this,)f(all)g +(functions)g(will)f(ignore)i Fj(verbosity)e Fl(settings.)150 +3006 y Ff(3.7.2)63 b(Critical)40 b(error)h(handling)150 +3199 y Fj(libbzip2)20 b Fl(con)m(tains)j(a)g(n)m(um)m(b)s(er)f(of)g(in) +m(ternal)g(assertion)g(c)m(hec)m(ks)i(whic)m(h)d(should,)i(needless)f +(to)h(sa)m(y)-8 b(,)26 b(nev)m(er)150 3308 y(b)s(e)g(activ)-5 +b(ated.)40 b(Nev)m(ertheless,)28 b(if)d(an)i(assertion)f(should)e +(fail,)i(b)s(eha)m(viour)f(dep)s(ends)f(on)j(whether)e(or)i(not)150 +3418 y(the)k(library)d(w)m(as)i(compiled)f(with)g Fj(BZ_NO_STDIO)e +Fl(set.)150 3575 y(F)-8 b(or)31 b(a)g(normal)e(compile,)h(an)g +(assertion)g(failure)f(yields)f(the)j(message)533 3726 +y Fj(bzip2/libbzip2:)44 b(internal)h(error)i(number)f(N.)533 +3829 y(This)h(is)g(a)g(bug)g(in)h(bzip2/libbzip2,)43 +b(1.0)k(of)g(21-Mar-2000.)533 3933 y(Please)f(report)g(it)i(to)f(me)g +(at:)g(jseward@acm.org.)91 b(If)47 b(this)g(happened)533 +4037 y(when)g(you)g(were)f(using)h(some)f(program)g(which)h(uses)f +(libbzip2)g(as)h(a)533 4141 y(component,)e(you)i(should)f(also)h +(report)f(this)h(bug)f(to)i(the)f(author\(s\))533 4244 +y(of)g(that)g(program.)93 b(Please)46 b(make)h(an)g(effort)f(to)h +(report)g(this)f(bug;)533 4348 y(timely)g(and)h(accurate)f(bug)h +(reports)e(eventually)g(lead)i(to)g(higher)533 4452 y(quality)f +(software.)93 b(Thanks.)h(Julian)46 b(Seward,)f(21)j(March)e(2000.)150 +4609 y Fl(where)30 b Fj(N)g Fl(is)f(some)i(error)f(co)s(de)h(n)m(um)m +(b)s(er.)39 b Fj(exit\(3\))28 b Fl(is)i(then)g(called.)150 +4766 y(F)-8 b(or)31 b(a)g Fj(stdio)p Fl(-free)e(library)-8 +b(,)29 b(assertion)h(failures)e(result)i(in)f(a)i(call)e(to)i(a)g +(function)e(declared)h(as:)533 4917 y Fj(extern)46 b(void)h +(bz_internal_error)c(\()k(int)g(errcode)f(\);)150 5074 +y Fl(The)30 b(relev)-5 b(an)m(t)31 b(co)s(de)f(is)g(passed)f(as)i(a)g +(parameter.)41 b(Y)-8 b(ou)31 b(should)d(supply)g(suc)m(h)i(a)h +(function.)150 5230 y(In)g(either)g(case,)j(once)e(an)g(assertion)g +(failure)e(has)h(o)s(ccurred,)h(an)m(y)g Fj(bz_stream)e +Fl(records)h(in)m(v)m(olv)m(ed)h(can)150 5340 y(b)s(e)e(regarded)g(as)h +(in)m(v)-5 b(alid.)38 b(Y)-8 b(ou)31 b(should)d(not)j(attempt)g(to)g +(resume)f(normal)g(op)s(eration)f(with)g(them.)p eop +%%Page: 30 31 +30 30 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29 +b(with)g Fj(libbzip2)1881 b Fl(30)150 299 y(Y)-8 b(ou)22 +b(ma)m(y)-8 b(,)25 b(of)d(course,)h(c)m(hange)g(critical)e(error)g +(handling)e(to)j(suit)f(y)m(our)g(needs.)38 b(As)21 b(I)h(said)e(ab)s +(o)m(v)m(e,)25 b(critical)150 408 y(errors)30 b(indicate)g(bugs)g(in)g +(the)h(library)d(and)i(should)f(not)i(o)s(ccur.)42 b(All)29 +b Fj(")p Fl(normal)p Fj(")h Fl(error)g(situations)g(are)150 +518 y(indicated)f(via)h(error)g(return)f(co)s(des)i(from)f(functions,)f +(and)g(can)i(b)s(e)f(reco)m(v)m(ered)i(from.)150 798 +y Fk(3.8)68 b(Making)45 b(a)g(Windo)l(ws)h(DLL)150 990 +y Fl(Ev)m(erything)30 b(related)g(to)h(Windo)m(ws)f(has)g(b)s(een)f +(con)m(tributed)h(b)m(y)g(Y)-8 b(oshiok)j(a)31 b(Tsuneo)150 +1100 y(\()p Fj(QWF00133@niftyserve.or.jp)46 b Fl(/)52 +b Fj(tsuneo-y@is.aist-nara.ac.j)o(p)p Fl(\),)g(so)h(y)m(ou)f(should)f +(send)150 1210 y(y)m(our)30 b(queries)g(to)h(him)e(\(but)h(p)s(erhaps)e +(Cc:)41 b(me,)31 b Fj(jseward@acm.org)p Fl(\).)150 1366 +y(My)43 b(v)-5 b(ague)44 b(understanding)d(of)i(what)g(to)h(do)f(is:)65 +b(using)41 b(Visual)h(C)p Fj(++)g Fl(5.0,)48 b(op)s(en)42 +b(the)h(pro)5 b(ject)44 b(\014le)150 1476 y Fj(libbz2.dsp)p +Fl(,)28 b(and)i(build.)37 b(That's)31 b(all.)150 1633 +y(If)41 b(y)m(ou)g(can't)h(op)s(en)e(the)h(pro)5 b(ject)42 +b(\014le)e(for)h(some)g(reason,)j(mak)m(e)e(a)g(new)e(one,)k(naming)c +(these)i(\014les:)150 1742 y Fj(blocksort.c)p Fl(,)28 +b Fj(bzlib.c)p Fl(,)g Fj(compress.c)p Fl(,)g Fj(crctable.c)p +Fl(,)g Fj(decompress.c)p Fl(,)f Fj(huffman.c)p Fl(,)150 +1852 y Fj(randtable.c)32 b Fl(and)j Fj(libbz2.def)p Fl(.)53 +b(Y)-8 b(ou)36 b(will)d(also)i(need)g(to)h(name)g(the)g(header)f +(\014les)f Fj(bzlib.h)g Fl(and)150 1962 y Fj(bzlib_private.h)p +Fl(.)150 2118 y(If)c(y)m(ou)h(don't)f(use)g(V)m(C)p Fj(++)p +Fl(,)g(y)m(ou)h(ma)m(y)g(need)f(to)h(de\014ne)f(the)h(propro)s(cessor)e +(sym)m(b)s(ol)g Fj(_WIN32)p Fl(.)150 2275 y(Finally)-8 +b(,)28 b Fj(dlltest.c)e Fl(is)h(a)i(sample)f(program)g(using)g(the)g +(DLL.)h(It)g(has)f(a)h(pro)5 b(ject)29 b(\014le,)g Fj(dlltest.dsp)p +Fl(.)150 2432 y(If)h(y)m(ou)h(just)e(w)m(an)m(t)j(a)e(mak)m(e\014le)h +(for)f(Visual)f(C,)h(ha)m(v)m(e)i(a)e(lo)s(ok)g(at)i +Fj(makefile.msc)p Fl(.)150 2589 y(Be)k(a)m(w)m(are)g(that)g(if)e(y)m +(ou)h(compile)f Fj(bzip2)g Fl(itself)g(on)h(Win32,)h(y)m(ou)g(m)m(ust)f +(set)g Fj(BZ_UNIX)e Fl(to)j(0)f(and)g Fj(BZ_)150 2698 +y(LCCWIN32)27 b Fl(to)j(1,)g(in)f(the)g(\014le)g Fj(bzip2.c)p +Fl(,)e(b)s(efore)i(compiling.)39 b(Otherwise)28 b(the)h(resulting)f +(binary)f(w)m(on't)150 2808 y(w)m(ork)j(correctly)-8 +b(.)150 2965 y(I)30 b(ha)m(v)m(en't)i(tried)d(an)m(y)i(of)g(this)e +(stu\013)h(m)m(yself,)g(but)g(it)f(all)h(lo)s(oks)g(plausible.)p +eop +%%Page: 31 32 +31 31 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(31)150 299 y Fh(4)80 b(Miscellanea)150 583 y Fl(These)30 +b(are)h(just)f(some)g(random)g(though)m(ts)h(of)f(mine.)40 +b(Y)-8 b(our)30 b(mileage)h(ma)m(y)g(v)-5 b(ary)d(.)150 +884 y Fk(4.1)68 b(Limitations)47 b(of)e(the)g(compressed)g(\014le)h +(format)150 1077 y Fj(bzip2-1.0)p Fl(,)e Fj(0.9.5)e Fl(and)g +Fj(0.9.0)g Fl(use)h(exactly)h(the)f(same)h(\014le)e(format)i(as)f(the)h +(previous)d(v)m(ersion,)150 1186 y Fj(bzip2-0.1)p Fl(.)75 +b(This)41 b(decision)g(w)m(as)i(made)g(in)e(the)i(in)m(terests)g(of)g +(stabilit)m(y)-8 b(.)77 b(Creating)42 b(y)m(et)i(another)150 +1296 y(incompatible)21 b(compressed)i(\014le)f(format)i(w)m(ould)e +(create)i(further)e(confusion)g(and)h(disruption)d(for)j(users.)150 +1453 y(Nev)m(ertheless,)31 b(this)e(is)g(not)h(a)g(painless)e +(decision.)39 b(Dev)m(elopmen)m(t)31 b(w)m(ork)f(since)f(the)h(release) +h(of)f Fj(bzip2-)150 1562 y(0.1)19 b Fl(in)g(August)i(1997)h(has)e(sho) +m(wn)f(complexities)h(in)f(the)h(\014le)g(format)g(whic)m(h)f(slo)m(w)h +(do)m(wn)g(decompression)150 1672 y(and,)30 b(in)f(retrosp)s(ect,)i +(are)g(unnecessary)-8 b(.)40 b(These)31 b(are:)225 1829 +y Fi(\017)60 b Fl(The)20 b(run-length)g(enco)s(der,)i(whic)m(h)e(is)g +(the)h(\014rst)f(of)h(the)g(compression)f(transformations,)i(is)e(en)m +(tirely)330 1938 y(irrelev)-5 b(an)m(t.)63 b(The)38 b(original)e(purp)s +(ose)g(w)m(as)j(to)g(protect)g(the)f(sorting)g(algorithm)f(from)g(the)i +(v)m(ery)330 2048 y(w)m(orst)h(case)h(input:)58 b(a)41 +b(string)e(of)h(rep)s(eated)g(sym)m(b)s(ols.)68 b(But)40 +b(algorithm)f(steps)h(Q6a)h(and)e(Q6b)330 2157 y(in)30 +b(the)i(original)e(Burro)m(ws-Wheeler)i(tec)m(hnical)g(rep)s(ort)f +(\(SR)m(C-124\))i(sho)m(w)f(ho)m(w)g(rep)s(eats)g(can)g(b)s(e)330 +2267 y(handled)c(without)i(di\016cult)m(y)f(in)g(blo)s(c)m(k)h +(sorting.)225 2409 y Fi(\017)60 b Fl(The)30 b(randomisation)e(mec)m +(hanism)i(do)s(esn't)g(really)f(need)h(to)g(b)s(e)g(there.)41 +b(Udi)29 b(Man)m(b)s(er)h(and)f(Gene)330 2518 y(My)m(ers)j(published)c +(a)33 b(su\016x)e(arra)m(y)h(construction)f(algorithm)g(a)h(few)g(y)m +(ears)h(bac)m(k,)g(whic)m(h)d(can)j(b)s(e)330 2628 y(emplo)m(y)m(ed)27 +b(to)h(sort)g(an)m(y)f(blo)s(c)m(k,)h(no)f(matter)h(ho)m(w)f(rep)s +(etitiv)m(e,)h(in)d(O\(N)j(log)f(N\))h(time.)39 b(Subsequen)m(t)330 +2737 y(w)m(ork)25 b(b)m(y)f(Kunihik)m(o)f(Sadak)-5 b(ane)24 +b(has)h(pro)s(duced)e(a)i(deriv)-5 b(ativ)m(e)24 b(O\(N)h(\(log)g(N\))p +Fj(^)p Fl(2\))h(algorithm)d(whic)m(h)330 2847 y(usually)28 +b(outp)s(erforms)h(the)i(Man)m(b)s(er-My)m(ers)g(algorithm.)330 +2988 y(I)g(could)g(ha)m(v)m(e)i(c)m(hanged)f(to)g(Sadak)-5 +b(ane's)32 b(algorithm,)f(but)g(I)g(\014nd)f(it)h(to)h(b)s(e)f(slo)m(w) +m(er)h(than)f Fj(bzip2)p Fl('s)330 3098 y(existing)38 +b(algorithm)g(for)h(most)h(inputs,)f(and)g(the)g(randomisation)f(mec)m +(hanism)g(protects)i(ade-)330 3208 y(quately)34 b(against)f(bad)g +(cases.)52 b(I)33 b(didn't)f(think)g(it)i(w)m(as)g(a)g(go)s(o)s(d)f +(tradeo\013)i(to)f(mak)m(e.)51 b(P)m(artly)34 b(this)330 +3317 y(is)39 b(due)h(to)h(the)f(fact)h(that)g(I)f(w)m(as)g(not)h(\015o) +s(o)s(ded)e(with)g(email)g(complain)m(ts)g(ab)s(out)h +Fj(bzip2-0.1)p Fl('s)330 3427 y(p)s(erformance)30 b(on)g(rep)s(etitiv)m +(e)g(data,)h(so)g(p)s(erhaps)d(it)i(isn't)g(a)h(problem)d(for)j(real)f +(inputs.)330 3568 y(Probably)i(the)h(b)s(est)g(long-term)g(solution,)g +(and)g(the)g(one)h(I)f(ha)m(v)m(e)h(incorp)s(orated)e(in)m(to)i(0.9.5)h +(and)330 3678 y(ab)s(o)m(v)m(e,)42 b(is)c(to)h(use)f(the)h(existing)f +(sorting)g(algorithm)f(initially)-8 b(,)38 b(and)g(fall)f(bac)m(k)i(to) +h(a)f(O\(N)f(\(log)330 3787 y(N\))p Fj(^)p Fl(2\))31 +b(algorithm)f(if)f(the)i(standard)e(algorithm)h(gets)h(in)m(to)f +(di\016culties.)225 3929 y Fi(\017)60 b Fl(The)31 b(compressed)f +(\014le)g(format)i(w)m(as)f(nev)m(er)h(designed)d(to)j(b)s(e)f(handled) +e(b)m(y)i(a)g(library)-8 b(,)29 b(and)i(I)g(ha)m(v)m(e)330 +4039 y(had)d(to)i(jump)e(though)g(some)i(ho)s(ops)e(to)i(pro)s(duce)e +(an)h(e\016cien)m(t)g(implemen)m(tation)f(of)h(decompres-)330 +4148 y(sion.)38 b(It's)26 b(a)h(bit)e(hairy)-8 b(.)38 +b(T)-8 b(ry)26 b(passing)f Fj(decompress.c)d Fl(through)k(the)g(C)f +(prepro)s(cessor)g(and)h(y)m(ou'll)330 4258 y(see)32 +b(what)g(I)f(mean.)45 b(Muc)m(h)32 b(of)g(this)e(complexit)m(y)i(could) +f(ha)m(v)m(e)i(b)s(een)e(a)m(v)m(oided)h(if)e(the)i(compressed)330 +4367 y(size)e(of)h(eac)m(h)g(blo)s(c)m(k)f(of)h(data)g(w)m(as)g +(recorded)f(in)f(the)h(data)h(stream.)225 4509 y Fi(\017)60 +b Fl(An)30 b(Adler-32)g(c)m(hec)m(ksum,)i(rather)e(than)g(a)h(CR)m(C32) +g(c)m(hec)m(ksum,)g(w)m(ould)e(b)s(e)h(faster)h(to)g(compute.)150 +4698 y(It)e(w)m(ould)f(b)s(e)g(fair)g(to)h(sa)m(y)h(that)g(the)f +Fj(bzip2)e Fl(format)i(w)m(as)h(frozen)f(b)s(efore)f(I)h(prop)s(erly)d +(and)j(fully)d(under-)150 4807 y(sto)s(o)s(d)k(the)h(p)s(erformance)e +(consequences)i(of)g(doing)e(so.)150 4964 y(Impro)m(v)m(emen)m(ts)d +(whic)m(h)e(I)i(w)m(as)g(able)f(to)h(incorp)s(orate)f(in)m(to)g(0.9.0,) +k(despite)24 b(using)g(the)i(same)g(\014le)e(format,)150 +5074 y(are:)225 5230 y Fi(\017)60 b Fl(Single)30 b(arra)m(y)i(implemen) +m(tation)e(of)h(the)h(in)m(v)m(erse)f(BWT.)h(This)e(signi\014can)m(tly) +f(sp)s(eeds)i(up)f(decom-)330 5340 y(pression,)f(presumably)f(b)s +(ecause)i(it)g(reduces)g(the)h(n)m(um)m(b)s(er)e(of)i(cac)m(he)h +(misses.)p eop +%%Page: 32 33 +32 32 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(32)225 299 y Fi(\017)60 b Fl(F)-8 b(aster)27 b(in)m(v)m(erse)e(MTF)h +(transform)f(for)g(large)h(MTF)f(v)-5 b(alues.)39 b(The)25 +b(new)g(implemen)m(tation)f(is)g(based)330 408 y(on)30 +b(the)h(notion)f(of)g(sliding)e(blo)s(c)m(ks)h(of)i(v)-5 +b(alues.)225 544 y Fi(\017)60 b Fj(bzip2-0.9.0)24 b Fl(no)m(w)k(reads)f +(and)f(writes)h(\014les)f(with)g Fj(fread)g Fl(and)h +Fj(fwrite)p Fl(;)f(v)m(ersion)h(0.1)i(used)d Fj(putc)330 +653 y Fl(and)k Fj(getc)p Fl(.)39 b(Duh!)h(W)-8 b(ell,)31 +b(y)m(ou)f(liv)m(e)g(and)g(learn.)150 836 y(F)-8 b(urther)30 +b(ahead,)g(it)f(w)m(ould)g(b)s(e)g(nice)h(to)g(b)s(e)g(able)f(to)i(do)e +(random)g(access)j(in)m(to)d(\014les.)40 b(This)28 b(will)f(require)150 +945 y(some)k(careful)e(design)h(of)g(compressed)g(\014le)g(formats.)150 +1227 y Fk(4.2)68 b(P)l(ortabilit)l(y)47 b(issues)150 +1419 y Fl(After)36 b(some)g(consideration,)g(I)f(ha)m(v)m(e)i(decided)d +(not)i(to)g(use)g(GNU)g Fj(autoconf)d Fl(to)j(con\014gure)g(0.9.5)h(or) +150 1529 y(1.0.)150 1686 y Fj(autoconf)p Fl(,)31 b(admirable)g(and)h(w) +m(onderful)f(though)i(it)f(is,)h(mainly)d(assists)j(with)e(p)s +(ortabilit)m(y)g(problems)150 1795 y(b)s(et)m(w)m(een)f(Unix-lik)m(e)d +(platforms.)40 b(But)29 b Fj(bzip2)f Fl(do)s(esn't)h(ha)m(v)m(e)h(m)m +(uc)m(h)f(in)f(the)h(w)m(a)m(y)h(of)g(p)s(ortabilit)m(y)d(prob-)150 +1905 y(lems)35 b(on)h(Unix;)j(most)d(of)g(the)h(di\016culties)d(app)s +(ear)h(when)g(p)s(orting)g(to)i(the)f(Mac,)j(or)d(to)h(Microsoft's)150 +2015 y(op)s(erating)26 b(systems.)40 b Fj(autoconf)25 +b Fl(do)s(esn't)h(help)g(in)f(those)j(cases,)h(and)d(brings)f(in)g(a)j +(whole)e(load)g(of)h(new)150 2124 y(complexit)m(y)-8 +b(.)150 2281 y(Most)28 b(p)s(eople)f(should)f(b)s(e)h(able)g(to)h +(compile)e(the)i(library)d(and)i(program)h(under)e(Unix)g(straigh)m(t)i +(out-of-)150 2391 y(the-b)s(o)m(x,)j(so)g(to)g(sp)s(eak,)f(esp)s +(ecially)f(if)g(y)m(ou)i(ha)m(v)m(e)g(a)g(v)m(ersion)f(of)g(GNU)h(C)f +(a)m(v)-5 b(ailable.)150 2547 y(There)32 b(are)h(a)g(couple)f(of)h +Fj(__inline__)d Fl(directiv)m(es)i(in)f(the)i(co)s(de.)48 +b(GNU)33 b(C)f(\()p Fj(gcc)p Fl(\))g(should)f(b)s(e)h(able)g(to)150 +2657 y(handle)24 b(them.)39 b(If)25 b(y)m(ou're)i(not)e(using)g(GNU)h +(C,)f(y)m(our)h(C)f(compiler)f(shouldn't)g(see)i(them)f(at)i(all.)38 +b(If)25 b(y)m(our)150 2767 y(compiler)k(do)s(es,)i(for)g(some)g +(reason,)h(see)f(them)g(and)f(do)s(esn't)h(lik)m(e)f(them,)i(just)e +Fj(#define)f(__inline__)150 2876 y Fl(to)37 b(b)s(e)f +Fj(/*)30 b(*/)p Fl(.)58 b(One)36 b(easy)h(w)m(a)m(y)g(to)h(do)e(this)f +(is)h(to)h(compile)e(with)g(the)i(\015ag)g Fj(-D__inline__=)p +Fl(,)d(whic)m(h)150 2986 y(should)28 b(b)s(e)i(understo)s(o)s(d)f(b)m +(y)h(most)h(Unix)e(compilers.)150 3143 y(If)35 b(y)m(ou)g(still)e(ha)m +(v)m(e)j(di\016culties,)e(try)h(compiling)e(with)g(the)j(macro)f +Fj(BZ_STRICT_ANSI)c Fl(de\014ned.)54 b(This)150 3252 +y(should)28 b(enable)i(y)m(ou)h(to)g(build)d(the)i(library)e(in)h(a)i +(strictly)f(ANSI)g(complian)m(t)f(en)m(vironmen)m(t.)41 +b(Building)150 3362 y(the)25 b(program)f(itself)f(lik)m(e)g(this)h(is)f +(dangerous)h(and)g(not)g(supp)s(orted,)g(since)g(y)m(ou)h(remo)m(v)m(e) +g Fj(bzip2)p Fl('s)e(c)m(hec)m(ks)150 3471 y(against)30 +b(compressing)f(directories,)g(sym)m(b)s(olic)g(links,)f(devices,)i +(and)f(other)h(not-really-a-\014le)g(en)m(tities.)150 +3581 y(This)f(could)g(cause)i(\014lesystem)f(corruption!)150 +3738 y(One)e(other)i(thing:)39 b(if)27 b(y)m(ou)j(create)g(a)f +Fj(bzip2)f Fl(binary)f(for)i(public)d(distribution,)g(please)i(try)h +(and)g(link)d(it)150 3847 y(statically)g(\()p Fj(gcc)k(-s)p +Fl(\).)39 b(This)25 b(a)m(v)m(oids)i(all)f(sorts)h(of)g(library-v)m +(ersion)d(issues)h(that)i(others)g(ma)m(y)g(encoun)m(ter)150 +3957 y(later)j(on.)150 4114 y(If)f(y)m(ou)g(build)e Fj(bzip2)h +Fl(on)h(Win32,)h(y)m(ou)f(m)m(ust)g(set)h Fj(BZ_UNIX)e +Fl(to)i(0)f(and)g Fj(BZ_LCCWIN32)d Fl(to)k(1,)g(in)e(the)i(\014le)150 +4223 y Fj(bzip2.c)p Fl(,)f(b)s(efore)h(compiling.)38 +b(Otherwise)29 b(the)i(resulting)d(binary)h(w)m(on't)i(w)m(ork)f +(correctly)-8 b(.)150 4505 y Fk(4.3)68 b(Rep)t(orting)46 +b(bugs)150 4698 y Fl(I)25 b(tried)f(prett)m(y)i(hard)e(to)i(mak)m(e)g +(sure)f Fj(bzip2)e Fl(is)i(bug)f(free,)j(b)s(oth)d(b)m(y)h(design)f +(and)h(b)m(y)g(testing.)39 b(Hop)s(efully)150 4807 y(y)m(ou'll)29 +b(nev)m(er)i(need)f(to)h(read)g(this)e(section)h(for)h(real.)150 +4964 y(Nev)m(ertheless,)36 b(if)c Fj(bzip2)h Fl(dies)g(with)f(a)i +(segmen)m(tation)h(fault,)g(a)f(bus)f(error)g(or)h(an)g(in)m(ternal)e +(assertion)150 5074 y(failure,)i(it)h(will)d(ask)j(y)m(ou)g(to)g(email) +f(me)h(a)g(bug)f(rep)s(ort.)54 b(Exp)s(erience)33 b(with)h(v)m(ersion)g +(0.1)i(sho)m(ws)e(that)150 5183 y(almost)c(all)g(these)h(problems)d +(can)j(b)s(e)f(traced)h(to)g(either)f(compiler)e(bugs)i(or)g(hardw)m +(are)g(problems.)225 5340 y Fi(\017)60 b Fl(Recompile)22 +b(the)h(program)g(with)f(no)h(optimisation,)g(and)f(see)i(if)e(it)g(w)m +(orks.)39 b(And/or)22 b(try)h(a)g(di\013eren)m(t)p eop +%%Page: 33 34 +33 33 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(33)330 299 y(compiler.)77 b(I)43 b(heard)f(all)g(sorts)h(of)h +(stories)e(ab)s(out)h(v)-5 b(arious)42 b(\015a)m(v)m(ours)h(of)h(GNU)f +(C)g(\(and)g(other)330 408 y(compilers\))20 b(generating)i(bad)e(co)s +(de)i(for)f Fj(bzip2)p Fl(,)h(and)f(I'v)m(e)h(run)e(across)i(t)m(w)m(o) +g(suc)m(h)f(examples)g(m)m(yself.)330 606 y(2.7.X)35 +b(v)m(ersions)e(of)g(GNU)h(C)f(are)h(kno)m(wn)f(to)h(generate)h(bad)d +(co)s(de)i(from)f(time)g(to)h(time,)g(at)g(high)330 716 +y(optimisation)20 b(lev)m(els.)37 b(If)21 b(y)m(ou)g(get)i(problems,)e +(try)g(using)f(the)i(\015ags)f Fj(-O2)f(-fomit-frame-pointer)330 +825 y(-fno-strength-reduce)p Fl(.)35 b(Y)-8 b(ou)31 b(should)d(sp)s +(eci\014cally)h Fc(not)j Fl(use)e Fj(-funroll-loops)p +Fl(.)330 1023 y(Y)-8 b(ou)38 b(ma)m(y)g(notice)g(that)g(the)g(Mak)m +(e\014le)g(runs)e(six)g(tests)i(as)g(part)f(of)h(the)g(build)c(pro)s +(cess.)62 b(If)37 b(the)330 1132 y(program)43 b(passes)g(all)f(of)h +(these,)k(it's)c(a)h(prett)m(y)f(go)s(o)s(d)g(\(but)g(not)g(100\045\))i +(indication)c(that)j(the)330 1242 y(compiler)29 b(has)h(done)g(its)g +(job)g(correctly)-8 b(.)225 1440 y Fi(\017)60 b Fl(If)33 +b Fj(bzip2)f Fl(crashes)i(randomly)-8 b(,)33 b(and)g(the)h(crashes)g +(are)g(not)g(rep)s(eatable,)g(y)m(ou)g(ma)m(y)g(ha)m(v)m(e)h(a)f +(\015aky)330 1549 y(memory)k(subsystem.)64 b Fj(bzip2)37 +b Fl(really)g(hammers)h(y)m(our)g(memory)g(hierarc)m(h)m(y)-8 +b(,)41 b(and)d(if)f(it's)h(a)h(bit)330 1659 y(marginal,)33 +b(y)m(ou)h(ma)m(y)g(get)h(these)f(problems.)49 b(Ditto)34 +b(if)f(y)m(our)h(disk)e(or)h(I/O)h(subsystem)e(is)h(slo)m(wly)330 +1768 y(failing.)39 b(Y)-8 b(up,)30 b(this)f(really)g(do)s(es)h(happ)s +(en.)330 1966 y(T)-8 b(ry)28 b(using)f(a)i(di\013eren)m(t)f(mac)m(hine) +g(of)h(the)g(same)f(t)m(yp)s(e,)i(and)e(see)h(if)e(y)m(ou)i(can)g(rep)s +(eat)g(the)f(problem.)225 2163 y Fi(\017)60 b Fl(This)21 +b(isn't)i(really)f(a)h(bug,)i(but)d(...)39 b(If)23 b +Fj(bzip2)f Fl(tells)g(y)m(ou)h(y)m(our)h(\014le)e(is)g(corrupted)h(on)g +(decompression,)330 2273 y(and)29 b(y)m(ou)g(obtained)f(the)i(\014le)e +(via)h(FTP)-8 b(,)29 b(there)h(is)e(a)h(p)s(ossibilit)m(y)d(that)k(y)m +(ou)f(forgot)h(to)g(tell)e(FTP)h(to)330 2383 y(do)23 +b(a)g(binary)e(mo)s(de)i(transfer.)38 b(That)23 b(absolutely)f(will)e +(cause)j(the)h(\014le)e(to)h(b)s(e)g(non-decompressible.)330 +2492 y(Y)-8 b(ou'll)30 b(ha)m(v)m(e)h(to)g(transfer)f(it)g(again.)150 +2737 y(If)i(y)m(ou'v)m(e)h(incorp)s(orated)e Fj(libbzip2)f +Fl(in)m(to)i(y)m(our)g(o)m(wn)g(program)g(and)g(are)g(getting)h +(problems,)e(please,)150 2847 y(please,)d(please,)h(c)m(hec)m(k)g(that) +f(the)g(parameters)g(y)m(ou)g(are)g(passing)f(in)f(calls)h(to)h(the)g +(library)-8 b(,)26 b(are)j(correct,)150 2956 y(and)e(in)f(accordance)k +(with)c(what)i(the)g(do)s(cumen)m(tation)f(sa)m(ys)h(is)f(allo)m(w)m +(able.)39 b(I)28 b(ha)m(v)m(e)h(tried)e(to)h(mak)m(e)h(the)150 +3066 y(library)f(robust)i(against)g(suc)m(h)g(problems,)f(but)h(I'm)g +(sure)g(I)g(ha)m(v)m(en't)h(succeeded.)150 3223 y(Finally)-8 +b(,)32 b(if)g(the)h(ab)s(o)m(v)m(e)i(commen)m(ts)e(don't)g(help,)g(y)m +(ou'll)f(ha)m(v)m(e)i(to)g(send)e(me)h(a)g(bug)g(rep)s(ort.)48 +b(No)m(w,)34 b(it's)150 3332 y(just)c(amazing)g(ho)m(w)h(man)m(y)f(p)s +(eople)g(will)d(send)j(me)g(a)h(bug)f(rep)s(ort)g(sa)m(ying)g +(something)g(lik)m(e)481 3483 y(bzip2)f(crashed)h(with)f(segmen)m +(tation)j(fault)e(on)g(m)m(y)g(mac)m(hine)150 3640 y(and)h(absolutely)f +(nothing)h(else.)44 b(Needless)32 b(to)g(sa)m(y)-8 b(,)33 +b(a)f(suc)m(h)f(a)h(rep)s(ort)f(is)g Fc(totally)-8 b(,)32 +b(utterly)-8 b(,)32 b(completely)150 3750 y(and)40 b(comprehensiv)m +(ely)g(100\045)h(useless;)46 b(a)41 b(w)m(aste)g(of)g(y)m(our)g(time,)i +(m)m(y)e(time,)i(and)e(net)g(bandwidth)p Fl(.)150 3859 +y(With)31 b(no)h(details)f(at)i(all,)e(there's)h(no)g(w)m(a)m(y)h(I)f +(can)g(p)s(ossibly)d(b)s(egin)h(to)j(\014gure)e(out)i(what)e(the)i +(problem)150 3969 y(is.)150 4126 y(The)d(rules)e(of)i(the)g(game)h +(are:)41 b(facts,)32 b(facts,)f(facts.)41 b(Don't)31 +b(omit)f(them)g(b)s(ecause)g Fj(")p Fl(oh,)g(they)g(w)m(on't)h(b)s(e) +150 4235 y(relev)-5 b(an)m(t)p Fj(")p Fl(.)41 b(A)m(t)31 +b(the)g(bare)f(minim)m(um:)481 4386 y(Mac)m(hine)h(t)m(yp)s(e.)61 +b(Op)s(erating)29 b(system)h(v)m(ersion.)481 4490 y(Exact)h(v)m(ersion) +f(of)h Fj(bzip2)e Fl(\(do)h Fj(bzip2)47 b(-V)p Fl(\).)481 +4594 y(Exact)31 b(v)m(ersion)f(of)h(the)f(compiler)f(used.)481 +4698 y(Flags)i(passed)e(to)j(the)e(compiler.)150 4854 +y(Ho)m(w)m(ev)m(er,)i(the)d(most)h(imp)s(ortan)m(t)f(single)f(thing)g +(that)i(will)d(help)h(me)h(is)f(the)i(\014le)e(that)i(y)m(ou)g(w)m(ere) +g(trying)150 4964 y(to)f(compress)f(or)g(decompress)g(at)h(the)f(time)g +(the)g(problem)f(happ)s(ened.)38 b(Without)28 b(that,)h(m)m(y)g(abilit) +m(y)d(to)150 5074 y(do)k(an)m(ything)g(more)h(than)f(sp)s(eculate)g(ab) +s(out)g(the)g(cause,)i(is)d(limited.)150 5230 y(Please)34 +b(remem)m(b)s(er)f(that)h(I)f(connect)i(to)f(the)g(In)m(ternet)g(with)e +(a)i(mo)s(dem,)g(so)f(y)m(ou)h(should)e(con)m(tact)k(me)150 +5340 y(b)s(efore)30 b(mailing)e(me)j(h)m(uge)f(\014les.)p +eop +%%Page: 34 35 +34 34 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(34)150 299 y Fk(4.4)68 b(Did)45 b(y)l(ou)g(get)h(the)f(righ)l(t)h +(pac)l(k)-7 b(age?)150 491 y Fj(bzip2)34 b Fl(is)h(a)h(resource)g(hog.) +56 b(It)36 b(soaks)g(up)f(large)g(amoun)m(ts)h(of)g(CPU)f(cycles)h(and) +f(memory)-8 b(.)57 b(Also,)36 b(it)150 601 y(giv)m(es)26 +b(v)m(ery)h(large)f(latencies.)39 b(In)25 b(the)h(w)m(orst)g(case,)i(y) +m(ou)f(can)f(feed)g(man)m(y)g(megab)m(ytes)h(of)f(uncompressed)150 +711 y(data)45 b(in)m(to)e(the)i(library)c(b)s(efore)j(getting)g(an)m(y) +g(compressed)g(output,)j(so)d(this)f(probably)f(rules)h(out)150 +820 y(applications)29 b(requiring)e(in)m(teractiv)m(e)32 +b(b)s(eha)m(viour.)150 977 y(These)38 b(aren't)h(faults)e(of)h(m)m(y)g +(implemen)m(tation,)h(I)f(hop)s(e,)i(but)d(more)h(an)g(in)m(trinsic)e +(prop)s(ert)m(y)h(of)i(the)150 1087 y(Burro)m(ws-Wheeler)30 +b(transform)g(\(unfortunately\).)40 b(Ma)m(yb)s(e)31 +b(this)e(isn't)h(what)g(y)m(ou)h(w)m(an)m(t.)150 1244 +y(If)h(y)m(ou)h(w)m(an)m(t)g(a)g(compressor)g(and/or)f(library)e(whic)m +(h)h(is)h(faster,)i(uses)e(less)g(memory)g(but)g(gets)h(prett)m(y)150 +1353 y(go)s(o)s(d)e(compression,)g(and)g(has)h(minimal)c(latency)-8 +b(,)33 b(consider)e(Jean-loup)f(Gailly's)g(and)h(Mark)h(Adler's)150 +1463 y(w)m(ork,)f Fj(zlib-1.1.2)c Fl(and)j Fj(gzip-1.2.4)p +Fl(.)38 b(Lo)s(ok)31 b(for)f(them)g(at)150 1620 y Fj +(http://www.cdrom.com/pub)o(/inf)o(ozip)o(/zl)o(ib)24 +b Fl(and)30 b Fj(http://www.gzip.org)25 b Fl(resp)s(ectiv)m(ely)-8 +b(.)150 1776 y(F)g(or)32 b(something)f(faster)i(and)e(ligh)m(ter)f +(still,)h(y)m(ou)g(migh)m(t)h(try)f(Markus)h(F)g(X)f(J)h(Ob)s(erh)m +(umer's)d Fj(LZO)i Fl(real-)150 1886 y(time)f +(compression/decompression)f(library)-8 b(,)28 b(at)150 +1996 y Fj(http://wildsau.idv.uni-l)o(inz.)o(ac.a)o(t/m)o(fx/l)o(zo.h)o +(tml)o Fl(.)150 2152 y(If)38 b(y)m(ou)h(w)m(an)m(t)g(to)h(use)e(the)g +Fj(bzip2)g Fl(algorithms)f(to)i(compress)f(small)g(blo)s(c)m(ks)f(of)i +(data,)j(64k)d(b)m(ytes)g(or)150 2262 y(smaller,)i(for)e(example)g(on)h +(an)f(on-the-\015y)h(disk)e(compressor,)k(y)m(ou'd)e(b)s(e)f(w)m(ell)g +(advised)f(not)i(to)g(use)150 2372 y(this)i(library)-8 +b(.)77 b(Instead,)47 b(I'v)m(e)d(made)f(a)h(sp)s(ecial)e(library)f +(tuned)h(for)h(that)h(kind)d(of)j(use.)79 b(It's)43 b(part)150 +2481 y(of)d Fj(e2compr-0.40)p Fl(,)f(an)g(on-the-\015y)h(disk)e +(compressor)h(for)h(the)f(Lin)m(ux)f Fj(ext2)h Fl(\014lesystem.)67 +b(Lo)s(ok)40 b(at)150 2591 y Fj(http://www.netspace.net.)o(au/~)o(reit) +o(er/)o(e2co)o(mpr)p Fl(.)150 2880 y Fk(4.5)68 b(T)-11 +b(esting)150 3072 y Fl(A)30 b(record)h(of)f(the)h(tests)g(I'v)m(e)g +(done.)150 3229 y(First,)f(some)h(data)g(sets:)225 3386 +y Fi(\017)60 b Fl(B:)32 b(a)f(directory)f(con)m(taining)h(6001)i +(\014les,)d(one)h(for)g(ev)m(ery)h(length)e(in)g(the)h(range)g(0)h(to)f +(6000)i(b)m(ytes.)330 3496 y(The)d(\014les)f(con)m(tain)i(random)e(lo)m +(w)m(ercase)j(letters.)41 b(18.7)32 b(megab)m(ytes.)225 +3633 y Fi(\017)60 b Fl(H:)36 b(m)m(y)f(home)h(directory)f(tree.)56 +b(Do)s(cumen)m(ts,)38 b(source)d(co)s(de,)i(mail)d(\014les,)i +(compressed)f(data.)57 b(H)330 3743 y(con)m(tains)39 +b(B,)h(and)f(also)g(a)g(directory)g(of)g(\014les)f(designed)g(as)i(b)s +(oundary)d(cases)j(for)f(the)g(sorting;)330 3853 y(mostly)30 +b(v)m(ery)h(rep)s(etitiv)m(e,)f(nast)m(y)h(\014les.)39 +b(565)32 b(megab)m(ytes.)225 3990 y Fi(\017)60 b Fl(A:)43 +b(directory)f(tree)i(holding)d(v)-5 b(arious)41 b(applications)g(built) +g(from)h(source:)66 b Fj(egcs)p Fl(,)45 b Fj(gcc-2.8.1)p +Fl(,)330 4100 y(KDE,)31 b(GTK,)f(Octa)m(v)m(e,)j(etc.)41 +b(2200)33 b(megab)m(ytes.)150 4285 y(The)i(tests)g(conducted)g(are)h +(as)f(follo)m(ws.)54 b(Eac)m(h)36 b(test)g(means)f(compressing)f(\(a)h +(cop)m(y)h(of)7 b(\))36 b(eac)m(h)g(\014le)e(in)150 4394 +y(the)d(data)g(set,)g(decompressing)e(it)h(and)g(comparing)f(it)h +(against)h(the)g(original.)150 4551 y(First,)26 b(a)g(bunc)m(h)f(of)h +(tests)h(with)d(blo)s(c)m(k)h(sizes)h(and)f(in)m(ternal)g(bu\013er)f +(sizes)i(set)g(v)m(ery)g(small,)g(to)g(detect)i(an)m(y)150 +4661 y(problems)g(with)g(the)i(blo)s(c)m(king)f(and)g(bu\013ering)e +(mec)m(hanisms.)40 b(This)28 b(required)g(mo)s(difying)f(the)j(source) +150 4770 y(co)s(de)h(so)f(as)h(to)g(try)f(to)h(break)g(it.)199 +4927 y(1.)61 b(Data)32 b(set)f(H,)g(with)e(bu\013er)g(size)h(of)h(1)g +(b)m(yte,)g(and)f(blo)s(c)m(k)g(size)g(of)g(23)i(b)m(ytes.)199 +5065 y(2.)61 b(Data)32 b(set)f(B,)g(bu\013er)e(sizes)h(1)h(b)m(yte,)g +(blo)s(c)m(k)f(size)g(1)h(b)m(yte.)199 5202 y(3.)61 b(As)30 +b(\(2\))i(but)d(small-mo)s(de)g(decompression.)199 5340 +y(4.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)g(2)h(b)m(ytes.)p +eop +%%Page: 35 36 +35 35 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(35)199 299 y(5.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)g(3)h +(b)m(ytes.)199 431 y(6.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size) +g(4)h(b)m(ytes.)199 564 y(7.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h +(size)g(5)h(b)m(ytes.)199 697 y(8.)61 b(As)30 b(\(2\))i(with)d(blo)s(c) +m(k)h(size)g(6)h(b)m(ytes)g(and)e(small-mo)s(de)g(decompression.)199 +829 y(9.)61 b(H)30 b(with)g(bu\013er)f(size)h(of)h(1)f(b)m(yte,)i(but)d +(normal)h(blo)s(c)m(k)g(size)g(\(up)f(to)j(900000)h(b)m(ytes\).)150 +1009 y(Then)c(some)i(tests)g(with)e(unmo)s(di\014ed)f(source)i(co)s +(de.)199 1166 y(1.)61 b(H,)31 b(all)e(settings)h(normal.)199 +1299 y(2.)61 b(As)30 b(\(1\),)i(with)d(small-mo)s(de)g(decompress.)199 +1431 y(3.)61 b(H,)31 b(compress)f(with)f(\015ag)i Fj(-1)p +Fl(.)199 1564 y(4.)61 b(H,)31 b(compress)f(with)f(\015ag)i +Fj(-s)p Fl(,)f(decompress)g(with)f(\015ag)i Fj(-s)p Fl(.)199 +1697 y(5.)61 b(F)-8 b(orw)m(ards)33 b(compatibilit)m(y:)45 +b(H,)33 b Fj(bzip2-0.1pl2)d Fl(compressing,)j Fj(bzip2-0.9.5)d +Fl(decompressing,)330 1806 y(all)f(settings)i(normal.)199 +1939 y(6.)61 b(Bac)m(kw)m(ards)23 b(compatibilit)m(y:)35 +b(H,)23 b Fj(bzip2-0.9.5)c Fl(compressing,)k Fj(bzip2-0.1pl2)c +Fl(decompressing,)330 2048 y(all)29 b(settings)i(normal.)199 +2181 y(7.)61 b(Bigger)31 b(tests:)41 b(A,)31 b(all)e(settings)i +(normal.)199 2314 y(8.)61 b(As)30 b(\(7\),)i(using)d(the)i(fallbac)m(k) +e(\(Sadak)-5 b(ane-lik)m(e\))31 b(sorting)f(algorithm.)199 +2446 y(9.)61 b(As)30 b(\(8\),)i(compress)e(with)f(\015ag)i +Fj(-1)p Fl(,)f(decompress)g(with)f(\015ag)i Fj(-s)p Fl(.)154 +2579 y(10.)61 b(H,)31 b(using)e(the)h(fallbac)m(k)g(sorting)g +(algorithm.)154 2711 y(11.)61 b(F)-8 b(orw)m(ards)33 +b(compatibilit)m(y:)45 b(A,)33 b Fj(bzip2-0.1pl2)d Fl(compressing,)j +Fj(bzip2-0.9.5)d Fl(decompressing,)330 2821 y(all)f(settings)i(normal.) +154 2954 y(12.)61 b(Bac)m(kw)m(ards)23 b(compatibilit)m(y:)35 +b(A,)23 b Fj(bzip2-0.9.5)c Fl(compressing,)k Fj(bzip2-0.1pl2)c +Fl(decompressing,)330 3063 y(all)29 b(settings)i(normal.)154 +3196 y(13.)61 b(Misc)39 b(test:)58 b(ab)s(out)39 b(400)h(megab)m(ytes)h +(of)e Fj(.tar)f Fl(\014les)f(with)h Fj(bzip2)f Fl(compiled)h(with)f +(Chec)m(k)m(er)j(\(a)330 3305 y(memory)30 b(access)i(error)e(detector,) +i(lik)m(e)e(Purify\).)154 3438 y(14.)61 b(Misc)30 b(tests)h(to)g(mak)m +(e)h(sure)d(it)h(builds)e(and)h(runs)g(ok)i(on)f(non-Lin)m(ux/x86)g +(platforms.)150 3618 y(These)35 b(tests)h(w)m(ere)f(conducted)g(on)g(a) +h(225)g(MHz)g(IDT)f(WinChip)d(mac)m(hine,)k(running)d(Lin)m(ux)g +(2.0.36.)150 3728 y(They)d(represen)m(t)g(nearly)g(a)h(w)m(eek)g(of)f +(con)m(tin)m(uous)g(computation.)41 b(All)29 b(tests)i(completed)f +(successfully)-8 b(.)150 4003 y Fk(4.6)68 b(F)-11 b(urther)44 +b(reading)150 4196 y Fj(bzip2)28 b Fl(is)h(not)h(researc)m(h)g(w)m +(ork,)g(in)e(the)i(sense)g(that)g(it)f(do)s(esn't)g(presen)m(t)h(an)m +(y)g(new)f(ideas.)40 b(Rather,)30 b(it's)150 4306 y(an)g(engineering)f +(exercise)i(based)f(on)g(existing)g(ideas.)150 4463 y(F)-8 +b(our)31 b(do)s(cumen)m(ts)f(describ)s(e)e(essen)m(tially)i(all)f(the)i +(ideas)e(b)s(ehind)f Fj(bzip2)p Fl(:)390 4614 y Fj(Michael)46 +b(Burrows)g(and)h(D.)g(J.)g(Wheeler:)485 4717 y("A)h(block-sorting)c +(lossless)h(data)i(compression)e(algorithm")533 4821 +y(10th)i(May)g(1994.)533 4925 y(Digital)f(SRC)h(Research)e(Report)i +(124.)533 5029 y(ftp://ftp.digital.com/pub)o(/DEC)o(/SR)o(C/re)o(sear)o +(ch-)o(repo)o(rts/)o(SRC)o(-124)o(.ps.)o(gz)533 5132 +y(If)g(you)g(have)g(trouble)f(finding)g(it,)g(try)h(searching)f(at)h +(the)533 5236 y(New)g(Zealand)f(Digital)g(Library,)f +(http://www.nzdl.org.)p eop +%%Page: 36 37 +36 36 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586 +b(36)390 299 y Fj(Daniel)46 b(S.)h(Hirschberg)e(and)i(Debra)g(A.)g +(LeLewer)485 403 y("Efficient)e(Decoding)h(of)h(Prefix)f(Codes")533 +506 y(Communications)e(of)j(the)g(ACM,)g(April)f(1990,)h(Vol)f(33,)h +(Number)f(4.)533 610 y(You)h(might)f(be)i(able)e(to)h(get)g(an)h +(electronic)d(copy)h(of)h(this)676 714 y(from)g(the)g(ACM)g(Digital)f +(Library.)390 922 y(David)g(J.)i(Wheeler)533 1025 y(Program)e(bred3.c)g +(and)h(accompanying)d(document)i(bred3.ps.)533 1129 y(This)h(contains)e +(the)i(idea)g(behind)f(the)h(multi-table)e(Huffman)533 +1233 y(coding)h(scheme.)533 1337 y(ftp://ftp.cl.cam.ac.uk/us)o(ers/)o +(djw)o(3/)390 1544 y(Jon)h(L.)g(Bentley)f(and)h(Robert)f(Sedgewick)485 +1648 y("Fast)h(Algorithms)e(for)i(Sorting)f(and)g(Searching)g(Strings") +533 1752 y(Available)f(from)i(Sedgewick's)e(web)i(page,)533 +1856 y(www.cs.princeton.edu/~rs)150 2012 y Fl(The)29 +b(follo)m(wing)f(pap)s(er)g(giv)m(es)h(v)-5 b(aluable)28 +b(additional)g(insigh)m(ts)f(in)m(to)j(the)f(algorithm,)g(but)g(is)f +(not)i(imme-)150 2122 y(diately)g(the)g(basis)f(of)i(an)m(y)g(co)s(de)f +(used)g(in)f(bzip2.)390 2273 y Fj(Peter)46 b(Fenwick:)533 +2377 y(Block)h(Sorting)e(Text)i(Compression)533 2481 +y(Proceedings)e(of)i(the)g(19th)g(Australasian)d(Computer)i(Science)f +(Conference,)629 2584 y(Melbourne,)g(Australia.)92 b(Jan)47 +b(31)g(-)h(Feb)f(2,)g(1996.)533 2688 y(ftp://ftp.cs.auckland.ac.)o +(nz/p)o(ub/)o(pete)o(r-f/)o(ACS)o(C96p)o(aper)o(.ps)150 +2845 y Fl(Kunihik)m(o)28 b(Sadak)-5 b(ane's)31 b(sorting)e(algorithm,)h +(men)m(tioned)g(ab)s(o)m(v)m(e,)i(is)d(a)m(v)-5 b(ailable)30 +b(from:)390 2996 y Fj(http://naomi.is.s.u-toky)o(o.ac)o(.jp/)o(~sa)o +(da/p)o(aper)o(s/S)o(ada9)o(8b.p)o(s.g)o(z)150 3153 y +Fl(The)41 b(Man)m(b)s(er-My)m(ers)g(su\016x)g(arra)m(y)g(construction)g +(algorithm)f(is)g(describ)s(ed)f(in)h(a)i(pap)s(er)e(a)m(v)-5 +b(ailable)150 3262 y(from:)390 3413 y Fj(http://www.cs.arizona.ed)o +(u/pe)o(ople)o(/ge)o(ne/P)o(APER)o(S/s)o(uffi)o(x.ps)150 +3570 y Fl(Finally)d(,)33 b(the)h(follo)m(wing)e(pap)s(er)h(do)s(cumen)m +(ts)g(some)h(recen)m(t)h(in)m(v)m(estigations)e(I)h(made)f(in)m(to)h +(the)g(p)s(erfor-)150 3680 y(mance)d(of)f(sorting)g(algorithms:)390 +3831 y Fj(Julian)46 b(Seward:)533 3935 y(On)h(the)g(Performance)e(of)i +(BWT)g(Sorting)f(Algorithms)533 4038 y(Proceedings)f(of)i(the)g(IEEE)g +(Data)f(Compression)f(Conference)g(2000)629 4142 y(Snowbird,)g(Utah.)94 +b(28-30)46 b(March)h(2000.)p eop +%%Page: -1 38 +-1 37 bop 3725 -116 a Fl(i)150 299 y Fh(T)-13 b(able)54 +b(of)g(Con)l(ten)l(ts)150 641 y Fk(1)135 b(In)l(tro)t(duction)15 +b Fb(.)20 b(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f +(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)60 +b Fk(2)150 911 y(2)135 b(Ho)l(w)45 b(to)h(use)f Fd(bzip2)31 +b Fb(.)19 b(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g +(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)78 b Fk(3)1047 +1048 y Fl(NAME)20 b Fa(.)c(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50 b Fl(3)1047 +1157 y(SYNOPSIS)21 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)h(.)f(.)g(.)50 b Fl(3)1047 1267 y(DESCRIPTION)10 +b Fa(.)j(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 +b Fl(3)1047 1377 y(OPTIONS)16 b Fa(.)d(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)45 b Fl(4)1047 +1486 y(MEMOR)-8 b(Y)31 b(MANA)m(GEMENT)14 b Fa(.)j(.)e(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44 +b Fl(6)1047 1596 y(RECO)m(VERING)30 b(D)m(A)-8 b(T)g(A)32 +b(FR)m(OM)f(D)m(AMA)m(GED)i(FILES)1256 1705 y Fa(.)15 +b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)57 b Fl(7)1047 1815 y(PERF)m(ORMANCE)30 +b(NOTES)9 b Fa(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)38 b Fl(7)1047 1924 +y(CA)-10 b(VEA)i(TS)10 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 b Fl(8)1047 2034 +y(A)m(UTHOR)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 b Fl(8)150 2276 y Fk(3)135 +b(Programming)46 b(with)f Fd(libbzip2)29 b Fb(.)16 b(.)j(.)h(.)f(.)h(.) +f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)74 b Fk(9)449 +2413 y Fl(3.1)92 b(T)-8 b(op-lev)m(el)30 b(structure)24 +b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)54 b Fl(9)748 2523 y(3.1.1)93 b(Lo)m(w-lev)m(el)30 +b(summary)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)53 +b Fl(9)748 2633 y(3.1.2)93 b(High-lev)m(el)29 b(summary)12 +b Fa(.)i(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)41 b +Fl(9)748 2742 y(3.1.3)93 b(Utilit)m(y)29 b(functions)g(summary)12 +b Fa(.)h(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)41 b Fl(10)449 2852 y(3.2)92 b(Error)29 +b(handling)18 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(10)449 +2961 y(3.3)92 b(Lo)m(w-lev)m(el)31 b(in)m(terface)d Fa(.)15 +b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)57 b Fl(12)748 3071 y(3.3.1)93 b Fj(BZ2_bzCompressInit)21 +b Fa(.)9 b(.)15 b(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50 b Fl(12)748 +3181 y(3.3.2)93 b Fj(BZ2_bzCompress)9 b Fa(.)h(.)15 b(.)g(.)g(.)g(.)g +(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 b Fl(14)748 3290 y(3.3.3)93 +b Fj(BZ2_bzCompressEnd)23 b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g +(.)52 b Fl(17)748 3400 y(3.3.4)93 b Fj(BZ2_bzDecompressInit)16 +b Fa(.)9 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 b Fl(17)748 3509 +y(3.3.5)93 b Fj(BZ2_bzDecompress)21 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)55 b Fl(17)748 3619 y(3.3.6)93 b Fj(BZ2_bzDecompressEnd)18 +b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(19)449 +3729 y(3.4)92 b(High-lev)m(el)30 b(in)m(terface)16 b +Fa(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)45 b Fl(19)748 3838 y(3.4.1)93 b Fj(BZ2_bzReadOpen)9 +b Fa(.)h(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 +b Fl(19)748 3948 y(3.4.2)93 b Fj(BZ2_bzRead)18 b Fa(.)12 +b(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 +b Fl(20)748 4057 y(3.4.3)93 b Fj(BZ2_bzReadGetUnused)18 +b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(22)748 +4167 y(3.4.4)93 b Fj(BZ2_bzReadClose)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)57 b Fl(22)748 4276 y(3.4.5)93 b +Fj(BZ2_bzWriteOpen)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)57 b Fl(22)748 4386 y(3.4.6)93 b Fj(BZ2_bzWrite)16 +b Fa(.)11 b(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +45 b Fl(23)748 4496 y(3.4.7)93 b Fj(BZ2_bzWriteClose)21 +b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Fl(23)748 +4605 y(3.4.8)93 b(Handling)28 b(em)m(b)s(edded)h(compressed)h(data)h +(streams)17 b Fa(.)f(.)f(.)g(.)46 b Fl(24)748 4715 y(3.4.9)93 +b(Standard)29 b(\014le-reading/writing)e(co)s(de)22 b +Fa(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52 +b Fl(25)449 4824 y(3.5)92 b(Utilit)m(y)29 b(functions)f +Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)59 b Fl(26)748 4934 y(3.5.1)93 b +Fj(BZ2_bzBuffToBuffCompres)o(s)22 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)57 b Fl(26)748 +5044 y(3.5.2)93 b Fj(BZ2_bzBuffToBuffDecompr)o(ess)17 +b Fa(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +53 b Fl(27)449 5153 y(3.6)92 b Fj(zlib)29 b Fl(compatibilit)m(y)g +(functions)23 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52 +b Fl(28)449 5263 y(3.7)92 b(Using)30 b(the)g(library)e(in)h(a)i +Fj(stdio)p Fl(-free)e(en)m(vironmen)m(t)23 b Fa(.)15 +b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)52 b Fl(29)p +eop +%%Page: -2 39 +-2 38 bop 3699 -116 a Fl(ii)748 83 y(3.7.1)93 b(Getting)31 +b(rid)d(of)j Fj(stdio)20 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49 +b Fl(29)748 193 y(3.7.2)93 b(Critical)28 b(error)i(handling)22 +b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Fl(29)449 302 +y(3.8)92 b(Making)30 b(a)h(Windo)m(ws)e(DLL)15 b Fa(.)h(.)f(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)44 b Fl(30)150 545 +y Fk(4)135 b(Miscellanea)11 b Fb(.)21 b(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)h +(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.) +h(.)f(.)g(.)h(.)56 b Fk(31)449 682 y Fl(4.1)92 b(Limitations)29 +b(of)h(the)h(compressed)f(\014le)f(format)9 b Fa(.)15 +b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 +b Fl(31)449 791 y(4.2)92 b(P)m(ortabilit)m(y)30 b(issues)14 +b Fa(.)f(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)h(.)f(.)g(.)43 b Fl(32)449 901 y(4.3)92 b(Rep)s(orting)29 +b(bugs)f Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Fl(32)449 1010 y(4.4)92 +b(Did)29 b(y)m(ou)i(get)h(the)e(righ)m(t)g(pac)m(k)-5 +b(age?)22 b Fa(.)17 b(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h +(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51 +b Fl(34)449 1120 y(4.5)92 b(T)-8 b(esting)16 b Fa(.)f(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)45 b Fl(34)449 1230 y(4.6)92 +b(F)-8 b(urther)30 b(reading)22 b Fa(.)14 b(.)h(.)g(.)h(.)f(.)g(.)g(.)g +(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) +g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)51 +b Fl(35)p eop +%%Trailer +end +userdict /end-hook known{end-hook}if +%%EOF diff --git a/bzip2/manual.texi b/bzip2/manual.texi new file mode 100644 index 000000000..336776ab8 --- /dev/null +++ b/bzip2/manual.texi @@ -0,0 +1,2215 @@ +\input texinfo @c -*- Texinfo -*- +@setfilename bzip2.info + +@ignore +This file documents bzip2 version 1.0, and associated library +libbzip2, written by Julian Seward (jseward@acm.org). + +Copyright (C) 1996-2000 Julian R Seward + +Permission is granted to make and distribute verbatim copies of +this manual provided the copyright notice and this permission notice +are preserved on all copies. + +Permission is granted to copy and distribute translations of this manual +into another language, under the above conditions for verbatim copies. +@end ignore + +@ifinfo +@format +START-INFO-DIR-ENTRY +* Bzip2: (bzip2). A program and library for data compression. +END-INFO-DIR-ENTRY +@end format + +@end ifinfo + +@iftex +@c @finalout +@settitle bzip2 and libbzip2 +@titlepage +@title bzip2 and libbzip2 +@subtitle a program and library for data compression +@subtitle copyright (C) 1996-2000 Julian Seward +@subtitle version 1.0 of 21 March 2000 +@author Julian Seward + +@end titlepage + +@parindent 0mm +@parskip 2mm + +@end iftex +@node Top, Overview, (dir), (dir) + +This program, @code{bzip2}, +and associated library @code{libbzip2}, are +Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +@itemize @bullet +@item + Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. +@item + The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. +@item + Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. +@item + The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. +@end itemize +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS +OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, +WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Julian Seward, Cambridge, UK. + +@code{jseward@@acm.org} + +@code{http://sourceware.cygnus.com/bzip2} + +@code{http://www.cacheprof.org} + +@code{http://www.muraroa.demon.co.uk} + +@code{bzip2}/@code{libbzip2} version 1.0 of 21 March 2000. + +PATENTS: To the best of my knowledge, @code{bzip2} does not use any patented +algorithms. However, I do not have the resources available to carry out +a full patent search. Therefore I cannot give any guarantee of the +above statement. + + + + + + + +@node Overview, Implementation, Top, Top +@chapter Introduction + +@code{bzip2} compresses files using the Burrows-Wheeler +block-sorting text compression algorithm, and Huffman coding. +Compression is generally considerably better than that +achieved by more conventional LZ77/LZ78-based compressors, +and approaches the performance of the PPM family of statistical compressors. + +@code{bzip2} is built on top of @code{libbzip2}, a flexible library +for handling compressed data in the @code{bzip2} format. This manual +describes both how to use the program and +how to work with the library interface. Most of the +manual is devoted to this library, not the program, +which is good news if your interest is only in the program. + +Chapter 2 describes how to use @code{bzip2}; this is the only part +you need to read if you just want to know how to operate the program. +Chapter 3 describes the programming interfaces in detail, and +Chapter 4 records some miscellaneous notes which I thought +ought to be recorded somewhere. + + +@chapter How to use @code{bzip2} + +This chapter contains a copy of the @code{bzip2} man page, +and nothing else. + +@quotation + +@unnumberedsubsubsec NAME +@itemize +@item @code{bzip2}, @code{bunzip2} +- a block-sorting file compressor, v1.0 +@item @code{bzcat} +- decompresses files to stdout +@item @code{bzip2recover} +- recovers data from damaged bzip2 files +@end itemize + +@unnumberedsubsubsec SYNOPSIS +@itemize +@item @code{bzip2} [ -cdfkqstvzVL123456789 ] [ filenames ... ] +@item @code{bunzip2} [ -fkvsVL ] [ filenames ... ] +@item @code{bzcat} [ -s ] [ filenames ... ] +@item @code{bzip2recover} filename +@end itemize + +@unnumberedsubsubsec DESCRIPTION + +@code{bzip2} compresses files using the Burrows-Wheeler block sorting +text compression algorithm, and Huffman coding. Compression is +generally considerably better than that achieved by more conventional +LZ77/LZ78-based compressors, and approaches the performance of the PPM +family of statistical compressors. + +The command-line options are deliberately very similar to those of GNU +@code{gzip}, but they are not identical. + +@code{bzip2} expects a list of file names to accompany the command-line +flags. Each file is replaced by a compressed version of itself, with +the name @code{original_name.bz2}. Each compressed file has the same +modification date, permissions, and, when possible, ownership as the +corresponding original, so that these properties can be correctly +restored at decompression time. File name handling is naive in the +sense that there is no mechanism for preserving original file names, +permissions, ownerships or dates in filesystems which lack these +concepts, or have serious file name length restrictions, such as MS-DOS. + +@code{bzip2} and @code{bunzip2} will by default not overwrite existing +files. If you want this to happen, specify the @code{-f} flag. + +If no file names are specified, @code{bzip2} compresses from standard +input to standard output. In this case, @code{bzip2} will decline to +write compressed output to a terminal, as this would be entirely +incomprehensible and therefore pointless. + +@code{bunzip2} (or @code{bzip2 -d}) decompresses all +specified files. Files which were not created by @code{bzip2} +will be detected and ignored, and a warning issued. +@code{bzip2} attempts to guess the filename for the decompressed file +from that of the compressed file as follows: +@itemize +@item @code{filename.bz2 } becomes @code{filename} +@item @code{filename.bz } becomes @code{filename} +@item @code{filename.tbz2} becomes @code{filename.tar} +@item @code{filename.tbz } becomes @code{filename.tar} +@item @code{anyothername } becomes @code{anyothername.out} +@end itemize +If the file does not end in one of the recognised endings, +@code{.bz2}, @code{.bz}, +@code{.tbz2} or @code{.tbz}, @code{bzip2} complains that it cannot +guess the name of the original file, and uses the original name +with @code{.out} appended. + +As with compression, supplying no +filenames causes decompression from standard input to standard output. + +@code{bunzip2} will correctly decompress a file which is the +concatenation of two or more compressed files. The result is the +concatenation of the corresponding uncompressed files. Integrity +testing (@code{-t}) of concatenated compressed files is also supported. + +You can also compress or decompress files to the standard output by +giving the @code{-c} flag. Multiple files may be compressed and +decompressed like this. The resulting outputs are fed sequentially to +stdout. Compression of multiple files in this manner generates a stream +containing multiple compressed file representations. Such a stream +can be decompressed correctly only by @code{bzip2} version 0.9.0 or +later. Earlier versions of @code{bzip2} will stop after decompressing +the first file in the stream. + +@code{bzcat} (or @code{bzip2 -dc}) decompresses all specified files to +the standard output. + +@code{bzip2} will read arguments from the environment variables +@code{BZIP2} and @code{BZIP}, in that order, and will process them +before any arguments read from the command line. This gives a +convenient way to supply default arguments. + +Compression is always performed, even if the compressed file is slightly +larger than the original. Files of less than about one hundred bytes +tend to get larger, since the compression mechanism has a constant +overhead in the region of 50 bytes. Random data (including the output +of most file compressors) is coded at about 8.05 bits per byte, giving +an expansion of around 0.5%. + +As a self-check for your protection, @code{bzip2} uses 32-bit CRCs to +make sure that the decompressed version of a file is identical to the +original. This guards against corruption of the compressed data, and +against undetected bugs in @code{bzip2} (hopefully very unlikely). The +chances of data corruption going undetected is microscopic, about one +chance in four billion for each file processed. Be aware, though, that +the check occurs upon decompression, so it can only tell you that +something is wrong. It can't help you recover the original uncompressed +data. You can use @code{bzip2recover} to try to recover data from +damaged files. + +Return values: 0 for a normal exit, 1 for environmental problems (file +not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt +compressed file, 3 for an internal consistency error (eg, bug) which +caused @code{bzip2} to panic. + + +@unnumberedsubsubsec OPTIONS +@table @code +@item -c --stdout +Compress or decompress to standard output. +@item -d --decompress +Force decompression. @code{bzip2}, @code{bunzip2} and @code{bzcat} are +really the same program, and the decision about what actions to take is +done on the basis of which name is used. This flag overrides that +mechanism, and forces bzip2 to decompress. +@item -z --compress +The complement to @code{-d}: forces compression, regardless of the +invokation name. +@item -t --test +Check integrity of the specified file(s), but don't decompress them. +This really performs a trial decompression and throws away the result. +@item -f --force +Force overwrite of output files. Normally, @code{bzip2} will not overwrite +existing output files. Also forces @code{bzip2} to break hard links +to files, which it otherwise wouldn't do. +@item -k --keep +Keep (don't delete) input files during compression +or decompression. +@item -s --small +Reduce memory usage, for compression, decompression and testing. Files +are decompressed and tested using a modified algorithm which only +requires 2.5 bytes per block byte. This means any file can be +decompressed in 2300k of memory, albeit at about half the normal speed. + +During compression, @code{-s} selects a block size of 200k, which limits +memory use to around the same figure, at the expense of your compression +ratio. In short, if your machine is low on memory (8 megabytes or +less), use -s for everything. See MEMORY MANAGEMENT below. +@item -q --quiet +Suppress non-essential warning messages. Messages pertaining to +I/O errors and other critical events will not be suppressed. +@item -v --verbose +Verbose mode -- show the compression ratio for each file processed. +Further @code{-v}'s increase the verbosity level, spewing out lots of +information which is primarily of interest for diagnostic purposes. +@item -L --license -V --version +Display the software version, license terms and conditions. +@item -1 to -9 +Set the block size to 100 k, 200 k .. 900 k when compressing. Has no +effect when decompressing. See MEMORY MANAGEMENT below. +@item -- +Treats all subsequent arguments as file names, even if they start +with a dash. This is so you can handle files with names beginning +with a dash, for example: @code{bzip2 -- -myfilename}. +@item --repetitive-fast +@item --repetitive-best +These flags are redundant in versions 0.9.5 and above. They provided +some coarse control over the behaviour of the sorting algorithm in +earlier versions, which was sometimes useful. 0.9.5 and above have an +improved algorithm which renders these flags irrelevant. +@end table + + +@unnumberedsubsubsec MEMORY MANAGEMENT + +@code{bzip2} compresses large files in blocks. The block size affects +both the compression ratio achieved, and the amount of memory needed for +compression and decompression. The flags @code{-1} through @code{-9} +specify the block size to be 100,000 bytes through 900,000 bytes (the +default) respectively. At decompression time, the block size used for +compression is read from the header of the compressed file, and +@code{bunzip2} then allocates itself just enough memory to decompress +the file. Since block sizes are stored in compressed files, it follows +that the flags @code{-1} to @code{-9} are irrelevant to and so ignored +during decompression. + +Compression and decompression requirements, in bytes, can be estimated +as: +@example + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) +@end example +Larger block sizes give rapidly diminishing marginal returns. Most of +the compression comes from the first two or three hundred k of block +size, a fact worth bearing in mind when using @code{bzip2} on small machines. +It is also important to appreciate that the decompression memory +requirement is set at compression time by the choice of block size. + +For files compressed with the default 900k block size, @code{bunzip2} +will require about 3700 kbytes to decompress. To support decompression +of any file on a 4 megabyte machine, @code{bunzip2} has an option to +decompress using approximately half this amount of memory, about 2300 +kbytes. Decompression speed is also halved, so you should use this +option only where necessary. The relevant flag is @code{-s}. + +In general, try and use the largest block size memory constraints allow, +since that maximises the compression achieved. Compression and +decompression speed are virtually unaffected by block size. + +Another significant point applies to files which fit in a single block +-- that means most files you'd encounter using a large block size. The +amount of real memory touched is proportional to the size of the file, +since the file is smaller than a block. For example, compressing a file +20,000 bytes long with the flag @code{-9} will cause the compressor to +allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560 +kbytes of it. Similarly, the decompressor will allocate 3700k but only +touch 100k + 20000 * 4 = 180 kbytes. + +Here is a table which summarises the maximum memory usage for different +block sizes. Also recorded is the total compressed size for 14 files of +the Calgary Text Compression Corpus totalling 3,141,622 bytes. This +column gives some feel for how compression varies with block size. +These figures tend to understate the advantage of larger block sizes for +larger files, since the Corpus is dominated by smaller files. +@example + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 +@end example + +@unnumberedsubsubsec RECOVERING DATA FROM DAMAGED FILES + +@code{bzip2} compresses files in blocks, usually 900kbytes long. Each +block is handled independently. If a media or transmission error causes +a multi-block @code{.bz2} file to become damaged, it may be possible to +recover data from the undamaged blocks in the file. + +The compressed representation of each block is delimited by a 48-bit +pattern, which makes it possible to find the block boundaries with +reasonable certainty. Each block also carries its own 32-bit CRC, so +damaged blocks can be distinguished from undamaged ones. + +@code{bzip2recover} is a simple program whose purpose is to search for +blocks in @code{.bz2} files, and write each block out into its own +@code{.bz2} file. You can then use @code{bzip2 -t} to test the +integrity of the resulting files, and decompress those which are +undamaged. + +@code{bzip2recover} +takes a single argument, the name of the damaged file, +and writes a number of files @code{rec0001file.bz2}, + @code{rec0002file.bz2}, etc, containing the extracted blocks. + The output filenames are designed so that the use of + wildcards in subsequent processing -- for example, +@code{bzip2 -dc rec*file.bz2 > recovered_data} -- lists the files in + the correct order. + +@code{bzip2recover} should be of most use dealing with large @code{.bz2} + files, as these will contain many blocks. It is clearly + futile to use it on damaged single-block files, since a + damaged block cannot be recovered. If you wish to minimise +any potential data loss through media or transmission errors, +you might consider compressing with a smaller + block size. + + +@unnumberedsubsubsec PERFORMANCE NOTES + +The sorting phase of compression gathers together similar strings in the +file. Because of this, files containing very long runs of repeated +symbols, like "aabaabaabaab ..." (repeated several hundred times) may +compress more slowly than normal. Versions 0.9.5 and above fare much +better than previous versions in this respect. The ratio between +worst-case and average-case compression time is in the region of 10:1. +For previous versions, this figure was more like 100:1. You can use the +@code{-vvvv} option to monitor progress in great detail, if you want. + +Decompression speed is unaffected by these phenomena. + +@code{bzip2} usually allocates several megabytes of memory to operate +in, and then charges all over it in a fairly random fashion. This means +that performance, both for compressing and decompressing, is largely +determined by the speed at which your machine can service cache misses. +Because of this, small changes to the code to reduce the miss rate have +been observed to give disproportionately large performance improvements. +I imagine @code{bzip2} will perform best on machines with very large +caches. + + +@unnumberedsubsubsec CAVEATS + +I/O error messages are not as helpful as they could be. @code{bzip2} +tries hard to detect I/O errors and exit cleanly, but the details of +what the problem is sometimes seem rather misleading. + +This manual page pertains to version 1.0 of @code{bzip2}. Compressed +data created by this version is entirely forwards and backwards +compatible with the previous public releases, versions 0.1pl2, 0.9.0 and +0.9.5, but with the following exception: 0.9.0 and above can correctly +decompress multiple concatenated compressed files. 0.1pl2 cannot do +this; it will stop after decompressing just the first file in the +stream. + +@code{bzip2recover} uses 32-bit integers to represent bit positions in +compressed files, so it cannot handle compressed files more than 512 +megabytes long. This could easily be fixed. + + +@unnumberedsubsubsec AUTHOR +Julian Seward, @code{jseward@@acm.org}. + +The ideas embodied in @code{bzip2} are due to (at least) the following +people: Michael Burrows and David Wheeler (for the block sorting +transformation), David Wheeler (again, for the Huffman coder), Peter +Fenwick (for the structured coding model in the original @code{bzip}, +and many refinements), and Alistair Moffat, Radford Neal and Ian Witten +(for the arithmetic coder in the original @code{bzip}). I am much +indebted for their help, support and advice. See the manual in the +source distribution for pointers to sources of documentation. Christian +von Roques encouraged me to look for faster sorting algorithms, so as to +speed up compression. Bela Lubkin encouraged me to improve the +worst-case compression performance. Many people sent patches, helped +with portability problems, lent machines, gave advice and were generally +helpful. + +@end quotation + + + + +@chapter Programming with @code{libbzip2} + +This chapter describes the programming interface to @code{libbzip2}. + +For general background information, particularly about memory +use and performance aspects, you'd be well advised to read Chapter 2 +as well. + +@section Top-level structure + +@code{libbzip2} is a flexible library for compressing and decompressing +data in the @code{bzip2} data format. Although packaged as a single +entity, it helps to regard the library as three separate parts: the low +level interface, and the high level interface, and some utility +functions. + +The structure of @code{libbzip2}'s interfaces is similar to +that of Jean-loup Gailly's and Mark Adler's excellent @code{zlib} +library. + +All externally visible symbols have names beginning @code{BZ2_}. +This is new in version 1.0. The intention is to minimise pollution +of the namespaces of library clients. + +@subsection Low-level summary + +This interface provides services for compressing and decompressing +data in memory. There's no provision for dealing with files, streams +or any other I/O mechanisms, just straight memory-to-memory work. +In fact, this part of the library can be compiled without inclusion +of @code{stdio.h}, which may be helpful for embedded applications. + +The low-level part of the library has no global variables and +is therefore thread-safe. + +Six routines make up the low level interface: +@code{BZ2_bzCompressInit}, @code{BZ2_bzCompress}, and @* @code{BZ2_bzCompressEnd} +for compression, +and a corresponding trio @code{BZ2_bzDecompressInit}, @* @code{BZ2_bzDecompress} +and @code{BZ2_bzDecompressEnd} for decompression. +The @code{*Init} functions allocate +memory for compression/decompression and do other +initialisations, whilst the @code{*End} functions close down operations +and release memory. + +The real work is done by @code{BZ2_bzCompress} and @code{BZ2_bzDecompress}. +These compress and decompress data from a user-supplied input buffer +to a user-supplied output buffer. These buffers can be any size; +arbitrary quantities of data are handled by making repeated calls +to these functions. This is a flexible mechanism allowing a +consumer-pull style of activity, or producer-push, or a mixture of +both. + + + +@subsection High-level summary + +This interface provides some handy wrappers around the low-level +interface to facilitate reading and writing @code{bzip2} format +files (@code{.bz2} files). The routines provide hooks to facilitate +reading files in which the @code{bzip2} data stream is embedded +within some larger-scale file structure, or where there are +multiple @code{bzip2} data streams concatenated end-to-end. + +For reading files, @code{BZ2_bzReadOpen}, @code{BZ2_bzRead}, +@code{BZ2_bzReadClose} and @* @code{BZ2_bzReadGetUnused} are supplied. For +writing files, @code{BZ2_bzWriteOpen}, @code{BZ2_bzWrite} and +@code{BZ2_bzWriteFinish} are available. + +As with the low-level library, no global variables are used +so the library is per se thread-safe. However, if I/O errors +occur whilst reading or writing the underlying compressed files, +you may have to consult @code{errno} to determine the cause of +the error. In that case, you'd need a C library which correctly +supports @code{errno} in a multithreaded environment. + +To make the library a little simpler and more portable, +@code{BZ2_bzReadOpen} and @code{BZ2_bzWriteOpen} require you to pass them file +handles (@code{FILE*}s) which have previously been opened for reading or +writing respectively. That avoids portability problems associated with +file operations and file attributes, whilst not being much of an +imposition on the programmer. + + + +@subsection Utility functions summary +For very simple needs, @code{BZ2_bzBuffToBuffCompress} and +@code{BZ2_bzBuffToBuffDecompress} are provided. These compress +data in memory from one buffer to another buffer in a single +function call. You should assess whether these functions +fulfill your memory-to-memory compression/decompression +requirements before investing effort in understanding the more +general but more complex low-level interface. + +Yoshioka Tsuneo (@code{QWF00133@@niftyserve.or.jp} / +@code{tsuneo-y@@is.aist-nara.ac.jp}) has contributed some functions to +give better @code{zlib} compatibility. These functions are +@code{BZ2_bzopen}, @code{BZ2_bzread}, @code{BZ2_bzwrite}, @code{BZ2_bzflush}, +@code{BZ2_bzclose}, +@code{BZ2_bzerror} and @code{BZ2_bzlibVersion}. You may find these functions +more convenient for simple file reading and writing, than those in the +high-level interface. These functions are not (yet) officially part of +the library, and are minimally documented here. If they break, you +get to keep all the pieces. I hope to document them properly when time +permits. + +Yoshioka also contributed modifications to allow the library to be +built as a Windows DLL. + + +@section Error handling + +The library is designed to recover cleanly in all situations, including +the worst-case situation of decompressing random data. I'm not +100% sure that it can always do this, so you might want to add +a signal handler to catch segmentation violations during decompression +if you are feeling especially paranoid. I would be interested in +hearing more about the robustness of the library to corrupted +compressed data. + +Version 1.0 is much more robust in this respect than +0.9.0 or 0.9.5. Investigations with Checker (a tool for +detecting problems with memory management, similar to Purify) +indicate that, at least for the few files I tested, all single-bit +errors in the decompressed data are caught properly, with no +segmentation faults, no reads of uninitialised data and no +out of range reads or writes. So it's certainly much improved, +although I wouldn't claim it to be totally bombproof. + +The file @code{bzlib.h} contains all definitions needed to use +the library. In particular, you should definitely not include +@code{bzlib_private.h}. + +In @code{bzlib.h}, the various return values are defined. The following +list is not intended as an exhaustive description of the circumstances +in which a given value may be returned -- those descriptions are given +later. Rather, it is intended to convey the rough meaning of each +return value. The first five actions are normal and not intended to +denote an error situation. +@table @code +@item BZ_OK +The requested action was completed successfully. +@item BZ_RUN_OK +@itemx BZ_FLUSH_OK +@itemx BZ_FINISH_OK +In @code{BZ2_bzCompress}, the requested flush/finish/nothing-special action +was completed successfully. +@item BZ_STREAM_END +Compression of data was completed, or the logical stream end was +detected during decompression. +@end table + +The following return values indicate an error of some kind. +@table @code +@item BZ_CONFIG_ERROR +Indicates that the library has been improperly compiled on your +platform -- a major configuration error. Specifically, it means +that @code{sizeof(char)}, @code{sizeof(short)} and @code{sizeof(int)} +are not 1, 2 and 4 respectively, as they should be. Note that the +library should still work properly on 64-bit platforms which follow +the LP64 programming model -- that is, where @code{sizeof(long)} +and @code{sizeof(void*)} are 8. Under LP64, @code{sizeof(int)} is +still 4, so @code{libbzip2}, which doesn't use the @code{long} type, +is OK. +@item BZ_SEQUENCE_ERROR +When using the library, it is important to call the functions in the +correct sequence and with data structures (buffers etc) in the correct +states. @code{libbzip2} checks as much as it can to ensure this is +happening, and returns @code{BZ_SEQUENCE_ERROR} if not. Code which +complies precisely with the function semantics, as detailed below, +should never receive this value; such an event denotes buggy code +which you should investigate. +@item BZ_PARAM_ERROR +Returned when a parameter to a function call is out of range +or otherwise manifestly incorrect. As with @code{BZ_SEQUENCE_ERROR}, +this denotes a bug in the client code. The distinction between +@code{BZ_PARAM_ERROR} and @code{BZ_SEQUENCE_ERROR} is a bit hazy, but still worth +making. +@item BZ_MEM_ERROR +Returned when a request to allocate memory failed. Note that the +quantity of memory needed to decompress a stream cannot be determined +until the stream's header has been read. So @code{BZ2_bzDecompress} and +@code{BZ2_bzRead} may return @code{BZ_MEM_ERROR} even though some of +the compressed data has been read. The same is not true for +compression; once @code{BZ2_bzCompressInit} or @code{BZ2_bzWriteOpen} have +successfully completed, @code{BZ_MEM_ERROR} cannot occur. +@item BZ_DATA_ERROR +Returned when a data integrity error is detected during decompression. +Most importantly, this means when stored and computed CRCs for the +data do not match. This value is also returned upon detection of any +other anomaly in the compressed data. +@item BZ_DATA_ERROR_MAGIC +As a special case of @code{BZ_DATA_ERROR}, it is sometimes useful to +know when the compressed stream does not start with the correct +magic bytes (@code{'B' 'Z' 'h'}). +@item BZ_IO_ERROR +Returned by @code{BZ2_bzRead} and @code{BZ2_bzWrite} when there is an error +reading or writing in the compressed file, and by @code{BZ2_bzReadOpen} +and @code{BZ2_bzWriteOpen} for attempts to use a file for which the +error indicator (viz, @code{ferror(f)}) is set. +On receipt of @code{BZ_IO_ERROR}, the caller should consult +@code{errno} and/or @code{perror} to acquire operating-system +specific information about the problem. +@item BZ_UNEXPECTED_EOF +Returned by @code{BZ2_bzRead} when the compressed file finishes +before the logical end of stream is detected. +@item BZ_OUTBUFF_FULL +Returned by @code{BZ2_bzBuffToBuffCompress} and +@code{BZ2_bzBuffToBuffDecompress} to indicate that the output data +will not fit into the output buffer provided. +@end table + + + +@section Low-level interface + +@subsection @code{BZ2_bzCompressInit} +@example +typedef + struct @{ + char *next_in; + unsigned int avail_in; + unsigned int total_in_lo32; + unsigned int total_in_hi32; + + char *next_out; + unsigned int avail_out; + unsigned int total_out_lo32; + unsigned int total_out_hi32; + + void *state; + + void *(*bzalloc)(void *,int,int); + void (*bzfree)(void *,void *); + void *opaque; + @} + bz_stream; + +int BZ2_bzCompressInit ( bz_stream *strm, + int blockSize100k, + int verbosity, + int workFactor ); + +@end example + +Prepares for compression. The @code{bz_stream} structure +holds all data pertaining to the compression activity. +A @code{bz_stream} structure should be allocated and initialised +prior to the call. +The fields of @code{bz_stream} +comprise the entirety of the user-visible data. @code{state} +is a pointer to the private data structures required for compression. + +Custom memory allocators are supported, via fields @code{bzalloc}, +@code{bzfree}, +and @code{opaque}. The value +@code{opaque} is passed to as the first argument to +all calls to @code{bzalloc} and @code{bzfree}, but is +otherwise ignored by the library. +The call @code{bzalloc ( opaque, n, m )} is expected to return a +pointer @code{p} to +@code{n * m} bytes of memory, and @code{bzfree ( opaque, p )} +should free +that memory. + +If you don't want to use a custom memory allocator, set @code{bzalloc}, +@code{bzfree} and +@code{opaque} to @code{NULL}, +and the library will then use the standard @code{malloc}/@code{free} +routines. + +Before calling @code{BZ2_bzCompressInit}, fields @code{bzalloc}, +@code{bzfree} and @code{opaque} should +be filled appropriately, as just described. Upon return, the internal +state will have been allocated and initialised, and @code{total_in_lo32}, +@code{total_in_hi32}, @code{total_out_lo32} and +@code{total_out_hi32} will have been set to zero. +These four fields are used by the library +to inform the caller of the total amount of data passed into and out of +the library, respectively. You should not try to change them. +As of version 1.0, 64-bit counts are maintained, even on 32-bit +platforms, using the @code{_hi32} fields to store the upper 32 bits +of the count. So, for example, the total amount of data in +is @code{(total_in_hi32 << 32) + total_in_lo32}. + +Parameter @code{blockSize100k} specifies the block size to be used for +compression. It should be a value between 1 and 9 inclusive, and the +actual block size used is 100000 x this figure. 9 gives the best +compression but takes most memory. + +Parameter @code{verbosity} should be set to a number between 0 and 4 +inclusive. 0 is silent, and greater numbers give increasingly verbose +monitoring/debugging output. If the library has been compiled with +@code{-DBZ_NO_STDIO}, no such output will appear for any verbosity +setting. + +Parameter @code{workFactor} controls how the compression phase behaves +when presented with worst case, highly repetitive, input data. If +compression runs into difficulties caused by repetitive data, the +library switches from the standard sorting algorithm to a fallback +algorithm. The fallback is slower than the standard algorithm by +perhaps a factor of three, but always behaves reasonably, no matter how +bad the input. + +Lower values of @code{workFactor} reduce the amount of effort the +standard algorithm will expend before resorting to the fallback. You +should set this parameter carefully; too low, and many inputs will be +handled by the fallback algorithm and so compress rather slowly, too +high, and your average-to-worst case compression times can become very +large. The default value of 30 gives reasonable behaviour over a wide +range of circumstances. + +Allowable values range from 0 to 250 inclusive. 0 is a special case, +equivalent to using the default value of 30. + +Note that the compressed output generated is the same regardless of +whether or not the fallback algorithm is used. + +Be aware also that this parameter may disappear entirely in future +versions of the library. In principle it should be possible to devise a +good way to automatically choose which algorithm to use. Such a +mechanism would render the parameter obsolete. + +Possible return values: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{strm} is @code{NULL} + or @code{blockSize} < 1 or @code{blockSize} > 9 + or @code{verbosity} < 0 or @code{verbosity} > 4 + or @code{workFactor} < 0 or @code{workFactor} > 250 + @code{BZ_MEM_ERROR} + if not enough memory is available + @code{BZ_OK} + otherwise +@end display +Allowable next actions: +@display + @code{BZ2_bzCompress} + if @code{BZ_OK} is returned + no specific action needed in case of error +@end display + +@subsection @code{BZ2_bzCompress} +@example + int BZ2_bzCompress ( bz_stream *strm, int action ); +@end example +Provides more input and/or output buffer space for the library. The +caller maintains input and output buffers, and calls @code{BZ2_bzCompress} to +transfer data between them. + +Before each call to @code{BZ2_bzCompress}, @code{next_in} should point at +the data to be compressed, and @code{avail_in} should indicate how many +bytes the library may read. @code{BZ2_bzCompress} updates @code{next_in}, +@code{avail_in} and @code{total_in} to reflect the number of bytes it +has read. + +Similarly, @code{next_out} should point to a buffer in which the +compressed data is to be placed, with @code{avail_out} indicating how +much output space is available. @code{BZ2_bzCompress} updates +@code{next_out}, @code{avail_out} and @code{total_out} to reflect the +number of bytes output. + +You may provide and remove as little or as much data as you like on each +call of @code{BZ2_bzCompress}. In the limit, it is acceptable to supply and +remove data one byte at a time, although this would be terribly +inefficient. You should always ensure that at least one byte of output +space is available at each call. + +A second purpose of @code{BZ2_bzCompress} is to request a change of mode of the +compressed stream. + +Conceptually, a compressed stream can be in one of four states: IDLE, +RUNNING, FLUSHING and FINISHING. Before initialisation +(@code{BZ2_bzCompressInit}) and after termination (@code{BZ2_bzCompressEnd}), a +stream is regarded as IDLE. + +Upon initialisation (@code{BZ2_bzCompressInit}), the stream is placed in the +RUNNING state. Subsequent calls to @code{BZ2_bzCompress} should pass +@code{BZ_RUN} as the requested action; other actions are illegal and +will result in @code{BZ_SEQUENCE_ERROR}. + +At some point, the calling program will have provided all the input data +it wants to. It will then want to finish up -- in effect, asking the +library to process any data it might have buffered internally. In this +state, @code{BZ2_bzCompress} will no longer attempt to read data from +@code{next_in}, but it will want to write data to @code{next_out}. +Because the output buffer supplied by the user can be arbitrarily small, +the finishing-up operation cannot necessarily be done with a single call +of @code{BZ2_bzCompress}. + +Instead, the calling program passes @code{BZ_FINISH} as an action to +@code{BZ2_bzCompress}. This changes the stream's state to FINISHING. Any +remaining input (ie, @code{next_in[0 .. avail_in-1]}) is compressed and +transferred to the output buffer. To do this, @code{BZ2_bzCompress} must be +called repeatedly until all the output has been consumed. At that +point, @code{BZ2_bzCompress} returns @code{BZ_STREAM_END}, and the stream's +state is set back to IDLE. @code{BZ2_bzCompressEnd} should then be +called. + +Just to make sure the calling program does not cheat, the library makes +a note of @code{avail_in} at the time of the first call to +@code{BZ2_bzCompress} which has @code{BZ_FINISH} as an action (ie, at the +time the program has announced its intention to not supply any more +input). By comparing this value with that of @code{avail_in} over +subsequent calls to @code{BZ2_bzCompress}, the library can detect any +attempts to slip in more data to compress. Any calls for which this is +detected will return @code{BZ_SEQUENCE_ERROR}. This indicates a +programming mistake which should be corrected. + +Instead of asking to finish, the calling program may ask +@code{BZ2_bzCompress} to take all the remaining input, compress it and +terminate the current (Burrows-Wheeler) compression block. This could +be useful for error control purposes. The mechanism is analogous to +that for finishing: call @code{BZ2_bzCompress} with an action of +@code{BZ_FLUSH}, remove output data, and persist with the +@code{BZ_FLUSH} action until the value @code{BZ_RUN} is returned. As +with finishing, @code{BZ2_bzCompress} detects any attempt to provide more +input data once the flush has begun. + +Once the flush is complete, the stream returns to the normal RUNNING +state. + +This all sounds pretty complex, but isn't really. Here's a table +which shows which actions are allowable in each state, what action +will be taken, what the next state is, and what the non-error return +values are. Note that you can't explicitly ask what state the +stream is in, but nor do you need to -- it can be inferred from the +values returned by @code{BZ2_bzCompress}. +@display +IDLE/@code{any} + Illegal. IDLE state only exists after @code{BZ2_bzCompressEnd} or + before @code{BZ2_bzCompressInit}. + Return value = @code{BZ_SEQUENCE_ERROR} + +RUNNING/@code{BZ_RUN} + Compress from @code{next_in} to @code{next_out} as much as possible. + Next state = RUNNING + Return value = @code{BZ_RUN_OK} + +RUNNING/@code{BZ_FLUSH} + Remember current value of @code{next_in}. Compress from @code{next_in} + to @code{next_out} as much as possible, but do not accept any more input. + Next state = FLUSHING + Return value = @code{BZ_FLUSH_OK} + +RUNNING/@code{BZ_FINISH} + Remember current value of @code{next_in}. Compress from @code{next_in} + to @code{next_out} as much as possible, but do not accept any more input. + Next state = FINISHING + Return value = @code{BZ_FINISH_OK} + +FLUSHING/@code{BZ_FLUSH} + Compress from @code{next_in} to @code{next_out} as much as possible, + but do not accept any more input. + If all the existing input has been used up and all compressed + output has been removed + Next state = RUNNING; Return value = @code{BZ_RUN_OK} + else + Next state = FLUSHING; Return value = @code{BZ_FLUSH_OK} + +FLUSHING/other + Illegal. + Return value = @code{BZ_SEQUENCE_ERROR} + +FINISHING/@code{BZ_FINISH} + Compress from @code{next_in} to @code{next_out} as much as possible, + but to not accept any more input. + If all the existing input has been used up and all compressed + output has been removed + Next state = IDLE; Return value = @code{BZ_STREAM_END} + else + Next state = FINISHING; Return value = @code{BZ_FINISHING} + +FINISHING/other + Illegal. + Return value = @code{BZ_SEQUENCE_ERROR} +@end display + +That still looks complicated? Well, fair enough. The usual sequence +of calls for compressing a load of data is: +@itemize @bullet +@item Get started with @code{BZ2_bzCompressInit}. +@item Shovel data in and shlurp out its compressed form using zero or more +calls of @code{BZ2_bzCompress} with action = @code{BZ_RUN}. +@item Finish up. +Repeatedly call @code{BZ2_bzCompress} with action = @code{BZ_FINISH}, +copying out the compressed output, until @code{BZ_STREAM_END} is returned. +@item Close up and go home. Call @code{BZ2_bzCompressEnd}. +@end itemize +If the data you want to compress fits into your input buffer all +at once, you can skip the calls of @code{BZ2_bzCompress ( ..., BZ_RUN )} and +just do the @code{BZ2_bzCompress ( ..., BZ_FINISH )} calls. + +All required memory is allocated by @code{BZ2_bzCompressInit}. The +compression library can accept any data at all (obviously). So you +shouldn't get any error return values from the @code{BZ2_bzCompress} calls. +If you do, they will be @code{BZ_SEQUENCE_ERROR}, and indicate a bug in +your programming. + +Trivial other possible return values: +@display + @code{BZ_PARAM_ERROR} + if @code{strm} is @code{NULL}, or @code{strm->s} is @code{NULL} +@end display + +@subsection @code{BZ2_bzCompressEnd} +@example +int BZ2_bzCompressEnd ( bz_stream *strm ); +@end example +Releases all memory associated with a compression stream. + +Possible return values: +@display + @code{BZ_PARAM_ERROR} if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL} + @code{BZ_OK} otherwise +@end display + + +@subsection @code{BZ2_bzDecompressInit} +@example +int BZ2_bzDecompressInit ( bz_stream *strm, int verbosity, int small ); +@end example +Prepares for decompression. As with @code{BZ2_bzCompressInit}, a +@code{bz_stream} record should be allocated and initialised before the +call. Fields @code{bzalloc}, @code{bzfree} and @code{opaque} should be +set if a custom memory allocator is required, or made @code{NULL} for +the normal @code{malloc}/@code{free} routines. Upon return, the internal +state will have been initialised, and @code{total_in} and +@code{total_out} will be zero. + +For the meaning of parameter @code{verbosity}, see @code{BZ2_bzCompressInit}. + +If @code{small} is nonzero, the library will use an alternative +decompression algorithm which uses less memory but at the cost of +decompressing more slowly (roughly speaking, half the speed, but the +maximum memory requirement drops to around 2300k). See Chapter 2 for +more information on memory management. + +Note that the amount of memory needed to decompress +a stream cannot be determined until the stream's header has been read, +so even if @code{BZ2_bzDecompressInit} succeeds, a subsequent +@code{BZ2_bzDecompress} could fail with @code{BZ_MEM_ERROR}. + +Possible return values: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{(small != 0 && small != 1)} + or @code{(verbosity < 0 || verbosity > 4)} + @code{BZ_MEM_ERROR} + if insufficient memory is available +@end display + +Allowable next actions: +@display + @code{BZ2_bzDecompress} + if @code{BZ_OK} was returned + no specific action required in case of error +@end display + + + +@subsection @code{BZ2_bzDecompress} +@example +int BZ2_bzDecompress ( bz_stream *strm ); +@end example +Provides more input and/out output buffer space for the library. The +caller maintains input and output buffers, and uses @code{BZ2_bzDecompress} +to transfer data between them. + +Before each call to @code{BZ2_bzDecompress}, @code{next_in} +should point at the compressed data, +and @code{avail_in} should indicate how many bytes the library +may read. @code{BZ2_bzDecompress} updates @code{next_in}, @code{avail_in} +and @code{total_in} +to reflect the number of bytes it has read. + +Similarly, @code{next_out} should point to a buffer in which the uncompressed +output is to be placed, with @code{avail_out} indicating how much output space +is available. @code{BZ2_bzCompress} updates @code{next_out}, +@code{avail_out} and @code{total_out} to reflect +the number of bytes output. + +You may provide and remove as little or as much data as you like on +each call of @code{BZ2_bzDecompress}. +In the limit, it is acceptable to +supply and remove data one byte at a time, although this would be +terribly inefficient. You should always ensure that at least one +byte of output space is available at each call. + +Use of @code{BZ2_bzDecompress} is simpler than @code{BZ2_bzCompress}. + +You should provide input and remove output as described above, and +repeatedly call @code{BZ2_bzDecompress} until @code{BZ_STREAM_END} is +returned. Appearance of @code{BZ_STREAM_END} denotes that +@code{BZ2_bzDecompress} has detected the logical end of the compressed +stream. @code{BZ2_bzDecompress} will not produce @code{BZ_STREAM_END} until +all output data has been placed into the output buffer, so once +@code{BZ_STREAM_END} appears, you are guaranteed to have available all +the decompressed output, and @code{BZ2_bzDecompressEnd} can safely be +called. + +If case of an error return value, you should call @code{BZ2_bzDecompressEnd} +to clean up and release memory. + +Possible return values: +@display + @code{BZ_PARAM_ERROR} + if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL} + or @code{strm->avail_out < 1} + @code{BZ_DATA_ERROR} + if a data integrity error is detected in the compressed stream + @code{BZ_DATA_ERROR_MAGIC} + if the compressed stream doesn't begin with the right magic bytes + @code{BZ_MEM_ERROR} + if there wasn't enough memory available + @code{BZ_STREAM_END} + if the logical end of the data stream was detected and all + output in has been consumed, eg @code{s->avail_out > 0} + @code{BZ_OK} + otherwise +@end display +Allowable next actions: +@display + @code{BZ2_bzDecompress} + if @code{BZ_OK} was returned + @code{BZ2_bzDecompressEnd} + otherwise +@end display + + +@subsection @code{BZ2_bzDecompressEnd} +@example +int BZ2_bzDecompressEnd ( bz_stream *strm ); +@end example +Releases all memory associated with a decompression stream. + +Possible return values: +@display + @code{BZ_PARAM_ERROR} + if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL} + @code{BZ_OK} + otherwise +@end display + +Allowable next actions: +@display + None. +@end display + + +@section High-level interface + +This interface provides functions for reading and writing +@code{bzip2} format files. First, some general points. + +@itemize @bullet +@item All of the functions take an @code{int*} first argument, + @code{bzerror}. + After each call, @code{bzerror} should be consulted first to determine + the outcome of the call. If @code{bzerror} is @code{BZ_OK}, + the call completed + successfully, and only then should the return value of the function + (if any) be consulted. If @code{bzerror} is @code{BZ_IO_ERROR}, + there was an error + reading/writing the underlying compressed file, and you should + then consult @code{errno}/@code{perror} to determine the + cause of the difficulty. + @code{bzerror} may also be set to various other values; precise details are + given on a per-function basis below. +@item If @code{bzerror} indicates an error + (ie, anything except @code{BZ_OK} and @code{BZ_STREAM_END}), + you should immediately call @code{BZ2_bzReadClose} (or @code{BZ2_bzWriteClose}, + depending on whether you are attempting to read or to write) + to free up all resources associated + with the stream. Once an error has been indicated, behaviour of all calls + except @code{BZ2_bzReadClose} (@code{BZ2_bzWriteClose}) is undefined. + The implication is that (1) @code{bzerror} should + be checked after each call, and (2) if @code{bzerror} indicates an error, + @code{BZ2_bzReadClose} (@code{BZ2_bzWriteClose}) should then be called to clean up. +@item The @code{FILE*} arguments passed to + @code{BZ2_bzReadOpen}/@code{BZ2_bzWriteOpen} + should be set to binary mode. + Most Unix systems will do this by default, but other platforms, + including Windows and Mac, will not. If you omit this, you may + encounter problems when moving code to new platforms. +@item Memory allocation requests are handled by + @code{malloc}/@code{free}. + At present + there is no facility for user-defined memory allocators in the file I/O + functions (could easily be added, though). +@end itemize + + + +@subsection @code{BZ2_bzReadOpen} +@example + typedef void BZFILE; + + BZFILE *BZ2_bzReadOpen ( int *bzerror, FILE *f, + int small, int verbosity, + void *unused, int nUnused ); +@end example +Prepare to read compressed data from file handle @code{f}. @code{f} +should refer to a file which has been opened for reading, and for which +the error indicator (@code{ferror(f)})is not set. If @code{small} is 1, +the library will try to decompress using less memory, at the expense of +speed. + +For reasons explained below, @code{BZ2_bzRead} will decompress the +@code{nUnused} bytes starting at @code{unused}, before starting to read +from the file @code{f}. At most @code{BZ_MAX_UNUSED} bytes may be +supplied like this. If this facility is not required, you should pass +@code{NULL} and @code{0} for @code{unused} and n@code{Unused} +respectively. + +For the meaning of parameters @code{small} and @code{verbosity}, +see @code{BZ2_bzDecompressInit}. + +The amount of memory needed to decompress a file cannot be determined +until the file's header has been read. So it is possible that +@code{BZ2_bzReadOpen} returns @code{BZ_OK} but a subsequent call of +@code{BZ2_bzRead} will return @code{BZ_MEM_ERROR}. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{f} is @code{NULL} + or @code{small} is neither @code{0} nor @code{1} + or @code{(unused == NULL && nUnused != 0)} + or @code{(unused != NULL && !(0 <= nUnused <= BZ_MAX_UNUSED))} + @code{BZ_IO_ERROR} + if @code{ferror(f)} is nonzero + @code{BZ_MEM_ERROR} + if insufficient memory is available + @code{BZ_OK} + otherwise. +@end display + +Possible return values: +@display + Pointer to an abstract @code{BZFILE} + if @code{bzerror} is @code{BZ_OK} + @code{NULL} + otherwise +@end display + +Allowable next actions: +@display + @code{BZ2_bzRead} + if @code{bzerror} is @code{BZ_OK} + @code{BZ2_bzClose} + otherwise +@end display + + +@subsection @code{BZ2_bzRead} +@example + int BZ2_bzRead ( int *bzerror, BZFILE *b, void *buf, int len ); +@end example +Reads up to @code{len} (uncompressed) bytes from the compressed file +@code{b} into +the buffer @code{buf}. If the read was successful, +@code{bzerror} is set to @code{BZ_OK} +and the number of bytes read is returned. If the logical end-of-stream +was detected, @code{bzerror} will be set to @code{BZ_STREAM_END}, +and the number +of bytes read is returned. All other @code{bzerror} values denote an error. + +@code{BZ2_bzRead} will supply @code{len} bytes, +unless the logical stream end is detected +or an error occurs. Because of this, it is possible to detect the +stream end by observing when the number of bytes returned is +less than the number +requested. Nevertheless, this is regarded as inadvisable; you should +instead check @code{bzerror} after every call and watch out for +@code{BZ_STREAM_END}. + +Internally, @code{BZ2_bzRead} copies data from the compressed file in chunks +of size @code{BZ_MAX_UNUSED} bytes +before decompressing it. If the file contains more bytes than strictly +needed to reach the logical end-of-stream, @code{BZ2_bzRead} will almost certainly +read some of the trailing data before signalling @code{BZ_SEQUENCE_END}. +To collect the read but unused data once @code{BZ_SEQUENCE_END} has +appeared, call @code{BZ2_bzReadGetUnused} immediately before @code{BZ2_bzReadClose}. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_PARAM_ERROR} + if @code{b} is @code{NULL} or @code{buf} is @code{NULL} or @code{len < 0} + @code{BZ_SEQUENCE_ERROR} + if @code{b} was opened with @code{BZ2_bzWriteOpen} + @code{BZ_IO_ERROR} + if there is an error reading from the compressed file + @code{BZ_UNEXPECTED_EOF} + if the compressed file ended before the logical end-of-stream was detected + @code{BZ_DATA_ERROR} + if a data integrity error was detected in the compressed stream + @code{BZ_DATA_ERROR_MAGIC} + if the stream does not begin with the requisite header bytes (ie, is not + a @code{bzip2} data file). This is really a special case of @code{BZ_DATA_ERROR}. + @code{BZ_MEM_ERROR} + if insufficient memory was available + @code{BZ_STREAM_END} + if the logical end of stream was detected. + @code{BZ_OK} + otherwise. +@end display + +Possible return values: +@display + number of bytes read + if @code{bzerror} is @code{BZ_OK} or @code{BZ_STREAM_END} + undefined + otherwise +@end display + +Allowable next actions: +@display + collect data from @code{buf}, then @code{BZ2_bzRead} or @code{BZ2_bzReadClose} + if @code{bzerror} is @code{BZ_OK} + collect data from @code{buf}, then @code{BZ2_bzReadClose} or @code{BZ2_bzReadGetUnused} + if @code{bzerror} is @code{BZ_SEQUENCE_END} + @code{BZ2_bzReadClose} + otherwise +@end display + + + +@subsection @code{BZ2_bzReadGetUnused} +@example + void BZ2_bzReadGetUnused ( int* bzerror, BZFILE *b, + void** unused, int* nUnused ); +@end example +Returns data which was read from the compressed file but was not needed +to get to the logical end-of-stream. @code{*unused} is set to the address +of the data, and @code{*nUnused} to the number of bytes. @code{*nUnused} will +be set to a value between @code{0} and @code{BZ_MAX_UNUSED} inclusive. + +This function may only be called once @code{BZ2_bzRead} has signalled +@code{BZ_STREAM_END} but before @code{BZ2_bzReadClose}. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_PARAM_ERROR} + if @code{b} is @code{NULL} + or @code{unused} is @code{NULL} or @code{nUnused} is @code{NULL} + @code{BZ_SEQUENCE_ERROR} + if @code{BZ_STREAM_END} has not been signalled + or if @code{b} was opened with @code{BZ2_bzWriteOpen} + @code{BZ_OK} + otherwise +@end display + +Allowable next actions: +@display + @code{BZ2_bzReadClose} +@end display + + +@subsection @code{BZ2_bzReadClose} +@example + void BZ2_bzReadClose ( int *bzerror, BZFILE *b ); +@end example +Releases all memory pertaining to the compressed file @code{b}. +@code{BZ2_bzReadClose} does not call @code{fclose} on the underlying file +handle, so you should do that yourself if appropriate. +@code{BZ2_bzReadClose} should be called to clean up after all error +situations. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_SEQUENCE_ERROR} + if @code{b} was opened with @code{BZ2_bzOpenWrite} + @code{BZ_OK} + otherwise +@end display + +Allowable next actions: +@display + none +@end display + + + +@subsection @code{BZ2_bzWriteOpen} +@example + BZFILE *BZ2_bzWriteOpen ( int *bzerror, FILE *f, + int blockSize100k, int verbosity, + int workFactor ); +@end example +Prepare to write compressed data to file handle @code{f}. +@code{f} should refer to +a file which has been opened for writing, and for which the error +indicator (@code{ferror(f)})is not set. + +For the meaning of parameters @code{blockSize100k}, +@code{verbosity} and @code{workFactor}, see +@* @code{BZ2_bzCompressInit}. + +All required memory is allocated at this stage, so if the call +completes successfully, @code{BZ_MEM_ERROR} cannot be signalled by a +subsequent call to @code{BZ2_bzWrite}. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{f} is @code{NULL} + or @code{blockSize100k < 1} or @code{blockSize100k > 9} + @code{BZ_IO_ERROR} + if @code{ferror(f)} is nonzero + @code{BZ_MEM_ERROR} + if insufficient memory is available + @code{BZ_OK} + otherwise +@end display + +Possible return values: +@display + Pointer to an abstract @code{BZFILE} + if @code{bzerror} is @code{BZ_OK} + @code{NULL} + otherwise +@end display + +Allowable next actions: +@display + @code{BZ2_bzWrite} + if @code{bzerror} is @code{BZ_OK} + (you could go directly to @code{BZ2_bzWriteClose}, but this would be pretty pointless) + @code{BZ2_bzWriteClose} + otherwise +@end display + + + +@subsection @code{BZ2_bzWrite} +@example + void BZ2_bzWrite ( int *bzerror, BZFILE *b, void *buf, int len ); +@end example +Absorbs @code{len} bytes from the buffer @code{buf}, eventually to be +compressed and written to the file. + +Possible assignments to @code{bzerror}: +@display + @code{BZ_PARAM_ERROR} + if @code{b} is @code{NULL} or @code{buf} is @code{NULL} or @code{len < 0} + @code{BZ_SEQUENCE_ERROR} + if b was opened with @code{BZ2_bzReadOpen} + @code{BZ_IO_ERROR} + if there is an error writing the compressed file. + @code{BZ_OK} + otherwise +@end display + + + + +@subsection @code{BZ2_bzWriteClose} +@example + void BZ2_bzWriteClose ( int *bzerror, BZFILE* f, + int abandon, + unsigned int* nbytes_in, + unsigned int* nbytes_out ); + + void BZ2_bzWriteClose64 ( int *bzerror, BZFILE* f, + int abandon, + unsigned int* nbytes_in_lo32, + unsigned int* nbytes_in_hi32, + unsigned int* nbytes_out_lo32, + unsigned int* nbytes_out_hi32 ); +@end example + +Compresses and flushes to the compressed file all data so far supplied +by @code{BZ2_bzWrite}. The logical end-of-stream markers are also written, so +subsequent calls to @code{BZ2_bzWrite} are illegal. All memory associated +with the compressed file @code{b} is released. +@code{fflush} is called on the +compressed file, but it is not @code{fclose}'d. + +If @code{BZ2_bzWriteClose} is called to clean up after an error, the only +action is to release the memory. The library records the error codes +issued by previous calls, so this situation will be detected +automatically. There is no attempt to complete the compression +operation, nor to @code{fflush} the compressed file. You can force this +behaviour to happen even in the case of no error, by passing a nonzero +value to @code{abandon}. + +If @code{nbytes_in} is non-null, @code{*nbytes_in} will be set to be the +total volume of uncompressed data handled. Similarly, @code{nbytes_out} +will be set to the total volume of compressed data written. For +compatibility with older versions of the library, @code{BZ2_bzWriteClose} +only yields the lower 32 bits of these counts. Use +@code{BZ2_bzWriteClose64} if you want the full 64 bit counts. These +two functions are otherwise absolutely identical. + + +Possible assignments to @code{bzerror}: +@display + @code{BZ_SEQUENCE_ERROR} + if @code{b} was opened with @code{BZ2_bzReadOpen} + @code{BZ_IO_ERROR} + if there is an error writing the compressed file + @code{BZ_OK} + otherwise +@end display + +@subsection Handling embedded compressed data streams + +The high-level library facilitates use of +@code{bzip2} data streams which form some part of a surrounding, larger +data stream. +@itemize @bullet +@item For writing, the library takes an open file handle, writes +compressed data to it, @code{fflush}es it but does not @code{fclose} it. +The calling application can write its own data before and after the +compressed data stream, using that same file handle. +@item Reading is more complex, and the facilities are not as general +as they could be since generality is hard to reconcile with efficiency. +@code{BZ2_bzRead} reads from the compressed file in blocks of size +@code{BZ_MAX_UNUSED} bytes, and in doing so probably will overshoot +the logical end of compressed stream. +To recover this data once decompression has +ended, call @code{BZ2_bzReadGetUnused} after the last call of @code{BZ2_bzRead} +(the one returning @code{BZ_STREAM_END}) but before calling +@code{BZ2_bzReadClose}. +@end itemize + +This mechanism makes it easy to decompress multiple @code{bzip2} +streams placed end-to-end. As the end of one stream, when @code{BZ2_bzRead} +returns @code{BZ_STREAM_END}, call @code{BZ2_bzReadGetUnused} to collect the +unused data (copy it into your own buffer somewhere). +That data forms the start of the next compressed stream. +To start uncompressing that next stream, call @code{BZ2_bzReadOpen} again, +feeding in the unused data via the @code{unused}/@code{nUnused} +parameters. +Keep doing this until @code{BZ_STREAM_END} return coincides with the +physical end of file (@code{feof(f)}). In this situation +@code{BZ2_bzReadGetUnused} +will of course return no data. + +This should give some feel for how the high-level interface can be used. +If you require extra flexibility, you'll have to bite the bullet and get +to grips with the low-level interface. + +@subsection Standard file-reading/writing code +Here's how you'd write data to a compressed file: +@example @code +FILE* f; +BZFILE* b; +int nBuf; +char buf[ /* whatever size you like */ ]; +int bzerror; +int nWritten; + +f = fopen ( "myfile.bz2", "w" ); +if (!f) @{ + /* handle error */ +@} +b = BZ2_bzWriteOpen ( &bzerror, f, 9 ); +if (bzerror != BZ_OK) @{ + BZ2_bzWriteClose ( b ); + /* handle error */ +@} + +while ( /* condition */ ) @{ + /* get data to write into buf, and set nBuf appropriately */ + nWritten = BZ2_bzWrite ( &bzerror, b, buf, nBuf ); + if (bzerror == BZ_IO_ERROR) @{ + BZ2_bzWriteClose ( &bzerror, b ); + /* handle error */ + @} +@} + +BZ2_bzWriteClose ( &bzerror, b ); +if (bzerror == BZ_IO_ERROR) @{ + /* handle error */ +@} +@end example +And to read from a compressed file: +@example +FILE* f; +BZFILE* b; +int nBuf; +char buf[ /* whatever size you like */ ]; +int bzerror; +int nWritten; + +f = fopen ( "myfile.bz2", "r" ); +if (!f) @{ + /* handle error */ +@} +b = BZ2_bzReadOpen ( &bzerror, f, 0, NULL, 0 ); +if (bzerror != BZ_OK) @{ + BZ2_bzReadClose ( &bzerror, b ); + /* handle error */ +@} + +bzerror = BZ_OK; +while (bzerror == BZ_OK && /* arbitrary other conditions */) @{ + nBuf = BZ2_bzRead ( &bzerror, b, buf, /* size of buf */ ); + if (bzerror == BZ_OK) @{ + /* do something with buf[0 .. nBuf-1] */ + @} +@} +if (bzerror != BZ_STREAM_END) @{ + BZ2_bzReadClose ( &bzerror, b ); + /* handle error */ +@} else @{ + BZ2_bzReadClose ( &bzerror ); +@} +@end example + + + +@section Utility functions +@subsection @code{BZ2_bzBuffToBuffCompress} +@example + int BZ2_bzBuffToBuffCompress( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int blockSize100k, + int verbosity, + int workFactor ); +@end example +Attempts to compress the data in @code{source[0 .. sourceLen-1]} +into the destination buffer, @code{dest[0 .. *destLen-1]}. +If the destination buffer is big enough, @code{*destLen} is +set to the size of the compressed data, and @code{BZ_OK} is +returned. If the compressed data won't fit, @code{*destLen} +is unchanged, and @code{BZ_OUTBUFF_FULL} is returned. + +Compression in this manner is a one-shot event, done with a single call +to this function. The resulting compressed data is a complete +@code{bzip2} format data stream. There is no mechanism for making +additional calls to provide extra input data. If you want that kind of +mechanism, use the low-level interface. + +For the meaning of parameters @code{blockSize100k}, @code{verbosity} +and @code{workFactor}, @* see @code{BZ2_bzCompressInit}. + +To guarantee that the compressed data will fit in its buffer, allocate +an output buffer of size 1% larger than the uncompressed data, plus +six hundred extra bytes. + +@code{BZ2_bzBuffToBuffDecompress} will not write data at or +beyond @code{dest[*destLen]}, even in case of buffer overflow. + +Possible return values: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{dest} is @code{NULL} or @code{destLen} is @code{NULL} + or @code{blockSize100k < 1} or @code{blockSize100k > 9} + or @code{verbosity < 0} or @code{verbosity > 4} + or @code{workFactor < 0} or @code{workFactor > 250} + @code{BZ_MEM_ERROR} + if insufficient memory is available + @code{BZ_OUTBUFF_FULL} + if the size of the compressed data exceeds @code{*destLen} + @code{BZ_OK} + otherwise +@end display + + + +@subsection @code{BZ2_bzBuffToBuffDecompress} +@example + int BZ2_bzBuffToBuffDecompress ( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int small, + int verbosity ); +@end example +Attempts to decompress the data in @code{source[0 .. sourceLen-1]} +into the destination buffer, @code{dest[0 .. *destLen-1]}. +If the destination buffer is big enough, @code{*destLen} is +set to the size of the uncompressed data, and @code{BZ_OK} is +returned. If the compressed data won't fit, @code{*destLen} +is unchanged, and @code{BZ_OUTBUFF_FULL} is returned. + +@code{source} is assumed to hold a complete @code{bzip2} format +data stream. @* @code{BZ2_bzBuffToBuffDecompress} tries to decompress +the entirety of the stream into the output buffer. + +For the meaning of parameters @code{small} and @code{verbosity}, +see @code{BZ2_bzDecompressInit}. + +Because the compression ratio of the compressed data cannot be known in +advance, there is no easy way to guarantee that the output buffer will +be big enough. You may of course make arrangements in your code to +record the size of the uncompressed data, but such a mechanism is beyond +the scope of this library. + +@code{BZ2_bzBuffToBuffDecompress} will not write data at or +beyond @code{dest[*destLen]}, even in case of buffer overflow. + +Possible return values: +@display + @code{BZ_CONFIG_ERROR} + if the library has been mis-compiled + @code{BZ_PARAM_ERROR} + if @code{dest} is @code{NULL} or @code{destLen} is @code{NULL} + or @code{small != 0 && small != 1} + or @code{verbosity < 0} or @code{verbosity > 4} + @code{BZ_MEM_ERROR} + if insufficient memory is available + @code{BZ_OUTBUFF_FULL} + if the size of the compressed data exceeds @code{*destLen} + @code{BZ_DATA_ERROR} + if a data integrity error was detected in the compressed data + @code{BZ_DATA_ERROR_MAGIC} + if the compressed data doesn't begin with the right magic bytes + @code{BZ_UNEXPECTED_EOF} + if the compressed data ends unexpectedly + @code{BZ_OK} + otherwise +@end display + + + +@section @code{zlib} compatibility functions +Yoshioka Tsuneo has contributed some functions to +give better @code{zlib} compatibility. These functions are +@code{BZ2_bzopen}, @code{BZ2_bzread}, @code{BZ2_bzwrite}, @code{BZ2_bzflush}, +@code{BZ2_bzclose}, +@code{BZ2_bzerror} and @code{BZ2_bzlibVersion}. +These functions are not (yet) officially part of +the library. If they break, you get to keep all the pieces. +Nevertheless, I think they work ok. +@example +typedef void BZFILE; + +const char * BZ2_bzlibVersion ( void ); +@end example +Returns a string indicating the library version. +@example +BZFILE * BZ2_bzopen ( const char *path, const char *mode ); +BZFILE * BZ2_bzdopen ( int fd, const char *mode ); +@end example +Opens a @code{.bz2} file for reading or writing, using either its name +or a pre-existing file descriptor. +Analogous to @code{fopen} and @code{fdopen}. +@example +int BZ2_bzread ( BZFILE* b, void* buf, int len ); +int BZ2_bzwrite ( BZFILE* b, void* buf, int len ); +@end example +Reads/writes data from/to a previously opened @code{BZFILE}. +Analogous to @code{fread} and @code{fwrite}. +@example +int BZ2_bzflush ( BZFILE* b ); +void BZ2_bzclose ( BZFILE* b ); +@end example +Flushes/closes a @code{BZFILE}. @code{BZ2_bzflush} doesn't actually do +anything. Analogous to @code{fflush} and @code{fclose}. + +@example +const char * BZ2_bzerror ( BZFILE *b, int *errnum ) +@end example +Returns a string describing the more recent error status of +@code{b}, and also sets @code{*errnum} to its numerical value. + + +@section Using the library in a @code{stdio}-free environment + +@subsection Getting rid of @code{stdio} + +In a deeply embedded application, you might want to use just +the memory-to-memory functions. You can do this conveniently +by compiling the library with preprocessor symbol @code{BZ_NO_STDIO} +defined. Doing this gives you a library containing only the following +eight functions: + +@code{BZ2_bzCompressInit}, @code{BZ2_bzCompress}, @code{BZ2_bzCompressEnd} @* +@code{BZ2_bzDecompressInit}, @code{BZ2_bzDecompress}, @code{BZ2_bzDecompressEnd} @* +@code{BZ2_bzBuffToBuffCompress}, @code{BZ2_bzBuffToBuffDecompress} + +When compiled like this, all functions will ignore @code{verbosity} +settings. + +@subsection Critical error handling +@code{libbzip2} contains a number of internal assertion checks which +should, needless to say, never be activated. Nevertheless, if an +assertion should fail, behaviour depends on whether or not the library +was compiled with @code{BZ_NO_STDIO} set. + +For a normal compile, an assertion failure yields the message +@example + bzip2/libbzip2: internal error number N. + This is a bug in bzip2/libbzip2, 1.0 of 21-Mar-2000. + Please report it to me at: jseward@@acm.org. If this happened + when you were using some program which uses libbzip2 as a + component, you should also report this bug to the author(s) + of that program. Please make an effort to report this bug; + timely and accurate bug reports eventually lead to higher + quality software. Thanks. Julian Seward, 21 March 2000. +@end example +where @code{N} is some error code number. @code{exit(3)} +is then called. + +For a @code{stdio}-free library, assertion failures result +in a call to a function declared as: +@example + extern void bz_internal_error ( int errcode ); +@end example +The relevant code is passed as a parameter. You should supply +such a function. + +In either case, once an assertion failure has occurred, any +@code{bz_stream} records involved can be regarded as invalid. +You should not attempt to resume normal operation with them. + +You may, of course, change critical error handling to suit +your needs. As I said above, critical errors indicate bugs +in the library and should not occur. All "normal" error +situations are indicated via error return codes from functions, +and can be recovered from. + + +@section Making a Windows DLL +Everything related to Windows has been contributed by Yoshioka Tsuneo +@* (@code{QWF00133@@niftyserve.or.jp} / +@code{tsuneo-y@@is.aist-nara.ac.jp}), so you should send your queries to +him (but perhaps Cc: me, @code{jseward@@acm.org}). + +My vague understanding of what to do is: using Visual C++ 5.0, +open the project file @code{libbz2.dsp}, and build. That's all. + +If you can't +open the project file for some reason, make a new one, naming these files: +@code{blocksort.c}, @code{bzlib.c}, @code{compress.c}, +@code{crctable.c}, @code{decompress.c}, @code{huffman.c}, @* +@code{randtable.c} and @code{libbz2.def}. You will also need +to name the header files @code{bzlib.h} and @code{bzlib_private.h}. + +If you don't use VC++, you may need to define the proprocessor symbol +@code{_WIN32}. + +Finally, @code{dlltest.c} is a sample program using the DLL. It has a +project file, @code{dlltest.dsp}. + +If you just want a makefile for Visual C, have a look at +@code{makefile.msc}. + +Be aware that if you compile @code{bzip2} itself on Win32, you must set +@code{BZ_UNIX} to 0 and @code{BZ_LCCWIN32} to 1, in the file +@code{bzip2.c}, before compiling. Otherwise the resulting binary won't +work correctly. + +I haven't tried any of this stuff myself, but it all looks plausible. + + + +@chapter Miscellanea + +These are just some random thoughts of mine. Your mileage may +vary. + +@section Limitations of the compressed file format +@code{bzip2-1.0}, @code{0.9.5} and @code{0.9.0} +use exactly the same file format as the previous +version, @code{bzip2-0.1}. This decision was made in the interests of +stability. Creating yet another incompatible compressed file format +would create further confusion and disruption for users. + +Nevertheless, this is not a painless decision. Development +work since the release of @code{bzip2-0.1} in August 1997 +has shown complexities in the file format which slow down +decompression and, in retrospect, are unnecessary. These are: +@itemize @bullet +@item The run-length encoder, which is the first of the + compression transformations, is entirely irrelevant. + The original purpose was to protect the sorting algorithm + from the very worst case input: a string of repeated + symbols. But algorithm steps Q6a and Q6b in the original + Burrows-Wheeler technical report (SRC-124) show how + repeats can be handled without difficulty in block + sorting. +@item The randomisation mechanism doesn't really need to be + there. Udi Manber and Gene Myers published a suffix + array construction algorithm a few years back, which + can be employed to sort any block, no matter how + repetitive, in O(N log N) time. Subsequent work by + Kunihiko Sadakane has produced a derivative O(N (log N)^2) + algorithm which usually outperforms the Manber-Myers + algorithm. + + I could have changed to Sadakane's algorithm, but I find + it to be slower than @code{bzip2}'s existing algorithm for + most inputs, and the randomisation mechanism protects + adequately against bad cases. I didn't think it was + a good tradeoff to make. Partly this is due to the fact + that I was not flooded with email complaints about + @code{bzip2-0.1}'s performance on repetitive data, so + perhaps it isn't a problem for real inputs. + + Probably the best long-term solution, + and the one I have incorporated into 0.9.5 and above, + is to use the existing sorting + algorithm initially, and fall back to a O(N (log N)^2) + algorithm if the standard algorithm gets into difficulties. +@item The compressed file format was never designed to be + handled by a library, and I have had to jump though + some hoops to produce an efficient implementation of + decompression. It's a bit hairy. Try passing + @code{decompress.c} through the C preprocessor + and you'll see what I mean. Much of this complexity + could have been avoided if the compressed size of + each block of data was recorded in the data stream. +@item An Adler-32 checksum, rather than a CRC32 checksum, + would be faster to compute. +@end itemize +It would be fair to say that the @code{bzip2} format was frozen +before I properly and fully understood the performance +consequences of doing so. + +Improvements which I was able to incorporate into +0.9.0, despite using the same file format, are: +@itemize @bullet +@item Single array implementation of the inverse BWT. This + significantly speeds up decompression, presumably + because it reduces the number of cache misses. +@item Faster inverse MTF transform for large MTF values. The + new implementation is based on the notion of sliding blocks + of values. +@item @code{bzip2-0.9.0} now reads and writes files with @code{fread} + and @code{fwrite}; version 0.1 used @code{putc} and @code{getc}. + Duh! Well, you live and learn. + +@end itemize +Further ahead, it would be nice +to be able to do random access into files. This will +require some careful design of compressed file formats. + + + +@section Portability issues +After some consideration, I have decided not to use +GNU @code{autoconf} to configure 0.9.5 or 1.0. + +@code{autoconf}, admirable and wonderful though it is, +mainly assists with portability problems between Unix-like +platforms. But @code{bzip2} doesn't have much in the way +of portability problems on Unix; most of the difficulties appear +when porting to the Mac, or to Microsoft's operating systems. +@code{autoconf} doesn't help in those cases, and brings in a +whole load of new complexity. + +Most people should be able to compile the library and program +under Unix straight out-of-the-box, so to speak, especially +if you have a version of GNU C available. + +There are a couple of @code{__inline__} directives in the code. GNU C +(@code{gcc}) should be able to handle them. If you're not using +GNU C, your C compiler shouldn't see them at all. +If your compiler does, for some reason, see them and doesn't +like them, just @code{#define} @code{__inline__} to be @code{/* */}. One +easy way to do this is to compile with the flag @code{-D__inline__=}, +which should be understood by most Unix compilers. + +If you still have difficulties, try compiling with the macro +@code{BZ_STRICT_ANSI} defined. This should enable you to build the +library in a strictly ANSI compliant environment. Building the program +itself like this is dangerous and not supported, since you remove +@code{bzip2}'s checks against compressing directories, symbolic links, +devices, and other not-really-a-file entities. This could cause +filesystem corruption! + +One other thing: if you create a @code{bzip2} binary for public +distribution, please try and link it statically (@code{gcc -s}). This +avoids all sorts of library-version issues that others may encounter +later on. + +If you build @code{bzip2} on Win32, you must set @code{BZ_UNIX} to 0 and +@code{BZ_LCCWIN32} to 1, in the file @code{bzip2.c}, before compiling. +Otherwise the resulting binary won't work correctly. + + + +@section Reporting bugs +I tried pretty hard to make sure @code{bzip2} is +bug free, both by design and by testing. Hopefully +you'll never need to read this section for real. + +Nevertheless, if @code{bzip2} dies with a segmentation +fault, a bus error or an internal assertion failure, it +will ask you to email me a bug report. Experience with +version 0.1 shows that almost all these problems can +be traced to either compiler bugs or hardware problems. +@itemize @bullet +@item +Recompile the program with no optimisation, and see if it +works. And/or try a different compiler. +I heard all sorts of stories about various flavours +of GNU C (and other compilers) generating bad code for +@code{bzip2}, and I've run across two such examples myself. + +2.7.X versions of GNU C are known to generate bad code from +time to time, at high optimisation levels. +If you get problems, try using the flags +@code{-O2} @code{-fomit-frame-pointer} @code{-fno-strength-reduce}. +You should specifically @emph{not} use @code{-funroll-loops}. + +You may notice that the Makefile runs six tests as part of +the build process. If the program passes all of these, it's +a pretty good (but not 100%) indication that the compiler has +done its job correctly. +@item +If @code{bzip2} crashes randomly, and the crashes are not +repeatable, you may have a flaky memory subsystem. @code{bzip2} +really hammers your memory hierarchy, and if it's a bit marginal, +you may get these problems. Ditto if your disk or I/O subsystem +is slowly failing. Yup, this really does happen. + +Try using a different machine of the same type, and see if +you can repeat the problem. +@item This isn't really a bug, but ... If @code{bzip2} tells +you your file is corrupted on decompression, and you +obtained the file via FTP, there is a possibility that you +forgot to tell FTP to do a binary mode transfer. That absolutely +will cause the file to be non-decompressible. You'll have to transfer +it again. +@end itemize + +If you've incorporated @code{libbzip2} into your own program +and are getting problems, please, please, please, check that the +parameters you are passing in calls to the library, are +correct, and in accordance with what the documentation says +is allowable. I have tried to make the library robust against +such problems, but I'm sure I haven't succeeded. + +Finally, if the above comments don't help, you'll have to send +me a bug report. Now, it's just amazing how many people will +send me a bug report saying something like +@display + bzip2 crashed with segmentation fault on my machine +@end display +and absolutely nothing else. Needless to say, a such a report +is @emph{totally, utterly, completely and comprehensively 100% useless; +a waste of your time, my time, and net bandwidth}. +With no details at all, there's no way I can possibly begin +to figure out what the problem is. + +The rules of the game are: facts, facts, facts. Don't omit +them because "oh, they won't be relevant". At the bare +minimum: +@display + Machine type. Operating system version. + Exact version of @code{bzip2} (do @code{bzip2 -V}). + Exact version of the compiler used. + Flags passed to the compiler. +@end display +However, the most important single thing that will help me is +the file that you were trying to compress or decompress at the +time the problem happened. Without that, my ability to do anything +more than speculate about the cause, is limited. + +Please remember that I connect to the Internet with a modem, so +you should contact me before mailing me huge files. + + +@section Did you get the right package? + +@code{bzip2} is a resource hog. It soaks up large amounts of CPU cycles +and memory. Also, it gives very large latencies. In the worst case, you +can feed many megabytes of uncompressed data into the library before +getting any compressed output, so this probably rules out applications +requiring interactive behaviour. + +These aren't faults of my implementation, I hope, but more +an intrinsic property of the Burrows-Wheeler transform (unfortunately). +Maybe this isn't what you want. + +If you want a compressor and/or library which is faster, uses less +memory but gets pretty good compression, and has minimal latency, +consider Jean-loup +Gailly's and Mark Adler's work, @code{zlib-1.1.2} and +@code{gzip-1.2.4}. Look for them at + +@code{http://www.cdrom.com/pub/infozip/zlib} and +@code{http://www.gzip.org} respectively. + +For something faster and lighter still, you might try Markus F X J +Oberhumer's @code{LZO} real-time compression/decompression library, at +@* @code{http://wildsau.idv.uni-linz.ac.at/mfx/lzo.html}. + +If you want to use the @code{bzip2} algorithms to compress small blocks +of data, 64k bytes or smaller, for example on an on-the-fly disk +compressor, you'd be well advised not to use this library. Instead, +I've made a special library tuned for that kind of use. It's part of +@code{e2compr-0.40}, an on-the-fly disk compressor for the Linux +@code{ext2} filesystem. Look at +@code{http://www.netspace.net.au/~reiter/e2compr}. + + + +@section Testing + +A record of the tests I've done. + +First, some data sets: +@itemize @bullet +@item B: a directory containing 6001 files, one for every length in the + range 0 to 6000 bytes. The files contain random lowercase + letters. 18.7 megabytes. +@item H: my home directory tree. Documents, source code, mail files, + compressed data. H contains B, and also a directory of + files designed as boundary cases for the sorting; mostly very + repetitive, nasty files. 565 megabytes. +@item A: directory tree holding various applications built from source: + @code{egcs}, @code{gcc-2.8.1}, KDE, GTK, Octave, etc. + 2200 megabytes. +@end itemize +The tests conducted are as follows. Each test means compressing +(a copy of) each file in the data set, decompressing it and +comparing it against the original. + +First, a bunch of tests with block sizes and internal buffer +sizes set very small, +to detect any problems with the +blocking and buffering mechanisms. +This required modifying the source code so as to try to +break it. +@enumerate +@item Data set H, with + buffer size of 1 byte, and block size of 23 bytes. +@item Data set B, buffer sizes 1 byte, block size 1 byte. +@item As (2) but small-mode decompression. +@item As (2) with block size 2 bytes. +@item As (2) with block size 3 bytes. +@item As (2) with block size 4 bytes. +@item As (2) with block size 5 bytes. +@item As (2) with block size 6 bytes and small-mode decompression. +@item H with buffer size of 1 byte, but normal block + size (up to 900000 bytes). +@end enumerate +Then some tests with unmodified source code. +@enumerate +@item H, all settings normal. +@item As (1), with small-mode decompress. +@item H, compress with flag @code{-1}. +@item H, compress with flag @code{-s}, decompress with flag @code{-s}. +@item Forwards compatibility: H, @code{bzip2-0.1pl2} compressing, + @code{bzip2-0.9.5} decompressing, all settings normal. +@item Backwards compatibility: H, @code{bzip2-0.9.5} compressing, + @code{bzip2-0.1pl2} decompressing, all settings normal. +@item Bigger tests: A, all settings normal. +@item As (7), using the fallback (Sadakane-like) sorting algorithm. +@item As (8), compress with flag @code{-1}, decompress with flag + @code{-s}. +@item H, using the fallback sorting algorithm. +@item Forwards compatibility: A, @code{bzip2-0.1pl2} compressing, + @code{bzip2-0.9.5} decompressing, all settings normal. +@item Backwards compatibility: A, @code{bzip2-0.9.5} compressing, + @code{bzip2-0.1pl2} decompressing, all settings normal. +@item Misc test: about 400 megabytes of @code{.tar} files with + @code{bzip2} compiled with Checker (a memory access error + detector, like Purify). +@item Misc tests to make sure it builds and runs ok on non-Linux/x86 + platforms. +@end enumerate +These tests were conducted on a 225 MHz IDT WinChip machine, running +Linux 2.0.36. They represent nearly a week of continuous computation. +All tests completed successfully. + + +@section Further reading +@code{bzip2} is not research work, in the sense that it doesn't present +any new ideas. Rather, it's an engineering exercise based on existing +ideas. + +Four documents describe essentially all the ideas behind @code{bzip2}: +@example +Michael Burrows and D. J. Wheeler: + "A block-sorting lossless data compression algorithm" + 10th May 1994. + Digital SRC Research Report 124. + ftp://ftp.digital.com/pub/DEC/SRC/research-reports/SRC-124.ps.gz + If you have trouble finding it, try searching at the + New Zealand Digital Library, http://www.nzdl.org. + +Daniel S. Hirschberg and Debra A. LeLewer + "Efficient Decoding of Prefix Codes" + Communications of the ACM, April 1990, Vol 33, Number 4. + You might be able to get an electronic copy of this + from the ACM Digital Library. + +David J. Wheeler + Program bred3.c and accompanying document bred3.ps. + This contains the idea behind the multi-table Huffman + coding scheme. + ftp://ftp.cl.cam.ac.uk/users/djw3/ + +Jon L. Bentley and Robert Sedgewick + "Fast Algorithms for Sorting and Searching Strings" + Available from Sedgewick's web page, + www.cs.princeton.edu/~rs +@end example +The following paper gives valuable additional insights into the +algorithm, but is not immediately the basis of any code +used in bzip2. +@example +Peter Fenwick: + Block Sorting Text Compression + Proceedings of the 19th Australasian Computer Science Conference, + Melbourne, Australia. Jan 31 - Feb 2, 1996. + ftp://ftp.cs.auckland.ac.nz/pub/peter-f/ACSC96paper.ps +@end example +Kunihiko Sadakane's sorting algorithm, mentioned above, +is available from: +@example +http://naomi.is.s.u-tokyo.ac.jp/~sada/papers/Sada98b.ps.gz +@end example +The Manber-Myers suffix array construction +algorithm is described in a paper +available from: +@example +http://www.cs.arizona.edu/people/gene/PAPERS/suffix.ps +@end example +Finally, the following paper documents some recent investigations +I made into the performance of sorting algorithms: +@example +Julian Seward: + On the Performance of BWT Sorting Algorithms + Proceedings of the IEEE Data Compression Conference 2000 + Snowbird, Utah. 28-30 March 2000. +@end example + + +@contents + +@bye + diff --git a/bzip2/manual_1.html b/bzip2/manual_1.html new file mode 100644 index 000000000..92ba7c6df --- /dev/null +++ b/bzip2/manual_1.html @@ -0,0 +1,47 @@ +<HTML> +<HEAD> +<!-- This HTML file has been created by texi2html 1.54 + from manual.texi on 23 March 2000 --> + +<TITLE>bzip2 and libbzip2 - Introduction</TITLE> +<link href="manual_2.html" rel=Next> +<link href="manual_toc.html" rel=ToC> + +</HEAD> +<BODY> +<p>Go to the first, previous, <A HREF="manual_2.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>. +<P><HR><P> + + +<H1><A NAME="SEC1" HREF="manual_toc.html#TOC1">Introduction</A></H1> + +<P> +<CODE>bzip2</CODE> compresses files using the Burrows-Wheeler +block-sorting text compression algorithm, and Huffman coding. +Compression is generally considerably better than that +achieved by more conventional LZ77/LZ78-based compressors, +and approaches the performance of the PPM family of statistical compressors. + +</P> +<P> +<CODE>bzip2</CODE> is built on top of <CODE>libbzip2</CODE>, a flexible library +for handling compressed data in the <CODE>bzip2</CODE> format. This manual +describes both how to use the program and +how to work with the library interface. Most of the +manual is devoted to this library, not the program, +which is good news if your interest is only in the program. + +</P> +<P> +Chapter 2 describes how to use <CODE>bzip2</CODE>; this is the only part +you need to read if you just want to know how to operate the program. +Chapter 3 describes the programming interfaces in detail, and +Chapter 4 records some miscellaneous notes which I thought +ought to be recorded somewhere. + +</P> + +<P><HR><P> +<p>Go to the first, previous, <A HREF="manual_2.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>. +</BODY> +</HTML> diff --git a/bzip2/manual_2.html b/bzip2/manual_2.html new file mode 100644 index 000000000..39453c42d --- /dev/null +++ b/bzip2/manual_2.html @@ -0,0 +1,484 @@ +<HTML> +<HEAD> +<!-- This HTML file has been created by texi2html 1.54 + from manual.texi on 23 March 2000 --> + +<TITLE>bzip2 and libbzip2 - How to use bzip2</TITLE> +<link href="manual_3.html" rel=Next> +<link href="manual_1.html" rel=Previous> +<link href="manual_toc.html" rel=ToC> + +</HEAD> +<BODY> +<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_1.html">previous</A>, <A HREF="manual_3.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>. +<P><HR><P> + + +<H1><A NAME="SEC2" HREF="manual_toc.html#TOC2">How to use <CODE>bzip2</CODE></A></H1> + +<P> +This chapter contains a copy of the <CODE>bzip2</CODE> man page, +and nothing else. + +</P> + +<BLOCKQUOTE> + + + +<H4><A NAME="SEC3" HREF="manual_toc.html#TOC3">NAME</A></H4> + +<UL> +<LI><CODE>bzip2</CODE>, <CODE>bunzip2</CODE> + +- a block-sorting file compressor, v1.0 +<LI><CODE>bzcat</CODE> + +- decompresses files to stdout +<LI><CODE>bzip2recover</CODE> + +- recovers data from damaged bzip2 files +</UL> + + + +<H4><A NAME="SEC4" HREF="manual_toc.html#TOC4">SYNOPSIS</A></H4> + +<UL> +<LI><CODE>bzip2</CODE> [ -cdfkqstvzVL123456789 ] [ filenames ... ] + +<LI><CODE>bunzip2</CODE> [ -fkvsVL ] [ filenames ... ] + +<LI><CODE>bzcat</CODE> [ -s ] [ filenames ... ] + +<LI><CODE>bzip2recover</CODE> filename + +</UL> + + + +<H4><A NAME="SEC5" HREF="manual_toc.html#TOC5">DESCRIPTION</A></H4> + +<P> +<CODE>bzip2</CODE> compresses files using the Burrows-Wheeler block sorting +text compression algorithm, and Huffman coding. Compression is +generally considerably better than that achieved by more conventional +LZ77/LZ78-based compressors, and approaches the performance of the PPM +family of statistical compressors. + +</P> +<P> +The command-line options are deliberately very similar to those of GNU +<CODE>gzip</CODE>, but they are not identical. + +</P> +<P> +<CODE>bzip2</CODE> expects a list of file names to accompany the command-line +flags. Each file is replaced by a compressed version of itself, with +the name <CODE>original_name.bz2</CODE>. Each compressed file has the same +modification date, permissions, and, when possible, ownership as the +corresponding original, so that these properties can be correctly +restored at decompression time. File name handling is naive in the +sense that there is no mechanism for preserving original file names, +permissions, ownerships or dates in filesystems which lack these +concepts, or have serious file name length restrictions, such as MS-DOS. + +</P> +<P> +<CODE>bzip2</CODE> and <CODE>bunzip2</CODE> will by default not overwrite existing +files. If you want this to happen, specify the <CODE>-f</CODE> flag. + +</P> +<P> +If no file names are specified, <CODE>bzip2</CODE> compresses from standard +input to standard output. In this case, <CODE>bzip2</CODE> will decline to +write compressed output to a terminal, as this would be entirely +incomprehensible and therefore pointless. + +</P> +<P> +<CODE>bunzip2</CODE> (or <CODE>bzip2 -d</CODE>) decompresses all +specified files. Files which were not created by <CODE>bzip2</CODE> +will be detected and ignored, and a warning issued. +<CODE>bzip2</CODE> attempts to guess the filename for the decompressed file +from that of the compressed file as follows: + +<UL> +<LI><CODE>filename.bz2 </CODE> becomes <CODE>filename</CODE> + +<LI><CODE>filename.bz </CODE> becomes <CODE>filename</CODE> + +<LI><CODE>filename.tbz2</CODE> becomes <CODE>filename.tar</CODE> + +<LI><CODE>filename.tbz </CODE> becomes <CODE>filename.tar</CODE> + +<LI><CODE>anyothername </CODE> becomes <CODE>anyothername.out</CODE> + +</UL> + +<P> +If the file does not end in one of the recognised endings, +<CODE>.bz2</CODE>, <CODE>.bz</CODE>, +<CODE>.tbz2</CODE> or <CODE>.tbz</CODE>, <CODE>bzip2</CODE> complains that it cannot +guess the name of the original file, and uses the original name +with <CODE>.out</CODE> appended. + +</P> +<P> +As with compression, supplying no +filenames causes decompression from standard input to standard output. + +</P> +<P> +<CODE>bunzip2</CODE> will correctly decompress a file which is the +concatenation of two or more compressed files. The result is the +concatenation of the corresponding uncompressed files. Integrity +testing (<CODE>-t</CODE>) of concatenated compressed files is also supported. + +</P> +<P> +You can also compress or decompress files to the standard output by +giving the <CODE>-c</CODE> flag. Multiple files may be compressed and +decompressed like this. The resulting outputs are fed sequentially to +stdout. Compression of multiple files in this manner generates a stream +containing multiple compressed file representations. Such a stream +can be decompressed correctly only by <CODE>bzip2</CODE> version 0.9.0 or +later. Earlier versions of <CODE>bzip2</CODE> will stop after decompressing +the first file in the stream. + +</P> +<P> +<CODE>bzcat</CODE> (or <CODE>bzip2 -dc</CODE>) decompresses all specified files to +the standard output. + +</P> +<P> +<CODE>bzip2</CODE> will read arguments from the environment variables +<CODE>BZIP2</CODE> and <CODE>BZIP</CODE>, in that order, and will process them +before any arguments read from the command line. This gives a +convenient way to supply default arguments. + +</P> +<P> +Compression is always performed, even if the compressed file is slightly +larger than the original. Files of less than about one hundred bytes +tend to get larger, since the compression mechanism has a constant +overhead in the region of 50 bytes. Random data (including the output +of most file compressors) is coded at about 8.05 bits per byte, giving +an expansion of around 0.5%. + +</P> +<P> +As a self-check for your protection, <CODE>bzip2</CODE> uses 32-bit CRCs to +make sure that the decompressed version of a file is identical to the +original. This guards against corruption of the compressed data, and +against undetected bugs in <CODE>bzip2</CODE> (hopefully very unlikely). The +chances of data corruption going undetected is microscopic, about one +chance in four billion for each file processed. Be aware, though, that +the check occurs upon decompression, so it can only tell you that +something is wrong. It can't help you recover the original uncompressed +data. You can use <CODE>bzip2recover</CODE> to try to recover data from +damaged files. + +</P> +<P> +Return values: 0 for a normal exit, 1 for environmental problems (file +not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt +compressed file, 3 for an internal consistency error (eg, bug) which +caused <CODE>bzip2</CODE> to panic. + +</P> + + + +<H4><A NAME="SEC6" HREF="manual_toc.html#TOC6">OPTIONS</A></H4> +<DL COMPACT> + +<DT><CODE>-c --stdout</CODE> +<DD> +Compress or decompress to standard output. +<DT><CODE>-d --decompress</CODE> +<DD> +Force decompression. <CODE>bzip2</CODE>, <CODE>bunzip2</CODE> and <CODE>bzcat</CODE> are +really the same program, and the decision about what actions to take is +done on the basis of which name is used. This flag overrides that +mechanism, and forces bzip2 to decompress. +<DT><CODE>-z --compress</CODE> +<DD> +The complement to <CODE>-d</CODE>: forces compression, regardless of the +invokation name. +<DT><CODE>-t --test</CODE> +<DD> +Check integrity of the specified file(s), but don't decompress them. +This really performs a trial decompression and throws away the result. +<DT><CODE>-f --force</CODE> +<DD> +Force overwrite of output files. Normally, <CODE>bzip2</CODE> will not overwrite +existing output files. Also forces <CODE>bzip2</CODE> to break hard links +to files, which it otherwise wouldn't do. +<DT><CODE>-k --keep</CODE> +<DD> +Keep (don't delete) input files during compression +or decompression. +<DT><CODE>-s --small</CODE> +<DD> +Reduce memory usage, for compression, decompression and testing. Files +are decompressed and tested using a modified algorithm which only +requires 2.5 bytes per block byte. This means any file can be +decompressed in 2300k of memory, albeit at about half the normal speed. + +During compression, <CODE>-s</CODE> selects a block size of 200k, which limits +memory use to around the same figure, at the expense of your compression +ratio. In short, if your machine is low on memory (8 megabytes or +less), use -s for everything. See MEMORY MANAGEMENT below. +<DT><CODE>-q --quiet</CODE> +<DD> +Suppress non-essential warning messages. Messages pertaining to +I/O errors and other critical events will not be suppressed. +<DT><CODE>-v --verbose</CODE> +<DD> +Verbose mode -- show the compression ratio for each file processed. +Further <CODE>-v</CODE>'s increase the verbosity level, spewing out lots of +information which is primarily of interest for diagnostic purposes. +<DT><CODE>-L --license -V --version</CODE> +<DD> +Display the software version, license terms and conditions. +<DT><CODE>-1 to -9</CODE> +<DD> +Set the block size to 100 k, 200 k .. 900 k when compressing. Has no +effect when decompressing. See MEMORY MANAGEMENT below. +<DT><CODE>--</CODE> +<DD> +Treats all subsequent arguments as file names, even if they start +with a dash. This is so you can handle files with names beginning +with a dash, for example: <CODE>bzip2 -- -myfilename</CODE>. +<DT><CODE>--repetitive-fast</CODE> +<DD> +<DT><CODE>--repetitive-best</CODE> +<DD> +These flags are redundant in versions 0.9.5 and above. They provided +some coarse control over the behaviour of the sorting algorithm in +earlier versions, which was sometimes useful. 0.9.5 and above have an +improved algorithm which renders these flags irrelevant. +</DL> + + + +<H4><A NAME="SEC7" HREF="manual_toc.html#TOC7">MEMORY MANAGEMENT</A></H4> + +<P> +<CODE>bzip2</CODE> compresses large files in blocks. The block size affects +both the compression ratio achieved, and the amount of memory needed for +compression and decompression. The flags <CODE>-1</CODE> through <CODE>-9</CODE> +specify the block size to be 100,000 bytes through 900,000 bytes (the +default) respectively. At decompression time, the block size used for +compression is read from the header of the compressed file, and +<CODE>bunzip2</CODE> then allocates itself just enough memory to decompress +the file. Since block sizes are stored in compressed files, it follows +that the flags <CODE>-1</CODE> to <CODE>-9</CODE> are irrelevant to and so ignored +during decompression. + +</P> +<P> +Compression and decompression requirements, in bytes, can be estimated +as: + +<PRE> + Compression: 400k + ( 8 x block size ) + + Decompression: 100k + ( 4 x block size ), or + 100k + ( 2.5 x block size ) +</PRE> + +<P> +Larger block sizes give rapidly diminishing marginal returns. Most of +the compression comes from the first two or three hundred k of block +size, a fact worth bearing in mind when using <CODE>bzip2</CODE> on small machines. +It is also important to appreciate that the decompression memory +requirement is set at compression time by the choice of block size. + +</P> +<P> +For files compressed with the default 900k block size, <CODE>bunzip2</CODE> +will require about 3700 kbytes to decompress. To support decompression +of any file on a 4 megabyte machine, <CODE>bunzip2</CODE> has an option to +decompress using approximately half this amount of memory, about 2300 +kbytes. Decompression speed is also halved, so you should use this +option only where necessary. The relevant flag is <CODE>-s</CODE>. + +</P> +<P> +In general, try and use the largest block size memory constraints allow, +since that maximises the compression achieved. Compression and +decompression speed are virtually unaffected by block size. + +</P> +<P> +Another significant point applies to files which fit in a single block +-- that means most files you'd encounter using a large block size. The +amount of real memory touched is proportional to the size of the file, +since the file is smaller than a block. For example, compressing a file +20,000 bytes long with the flag <CODE>-9</CODE> will cause the compressor to +allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560 +kbytes of it. Similarly, the decompressor will allocate 3700k but only +touch 100k + 20000 * 4 = 180 kbytes. + +</P> +<P> +Here is a table which summarises the maximum memory usage for different +block sizes. Also recorded is the total compressed size for 14 files of +the Calgary Text Compression Corpus totalling 3,141,622 bytes. This +column gives some feel for how compression varies with block size. +These figures tend to understate the advantage of larger block sizes for +larger files, since the Corpus is dominated by smaller files. + +<PRE> + Compress Decompress Decompress Corpus + Flag usage usage -s usage Size + + -1 1200k 500k 350k 914704 + -2 2000k 900k 600k 877703 + -3 2800k 1300k 850k 860338 + -4 3600k 1700k 1100k 846899 + -5 4400k 2100k 1350k 845160 + -6 5200k 2500k 1600k 838626 + -7 6100k 2900k 1850k 834096 + -8 6800k 3300k 2100k 828642 + -9 7600k 3700k 2350k 828642 +</PRE> + + + +<H4><A NAME="SEC8" HREF="manual_toc.html#TOC8">RECOVERING DATA FROM DAMAGED FILES</A></H4> + +<P> +<CODE>bzip2</CODE> compresses files in blocks, usually 900kbytes long. Each +block is handled independently. If a media or transmission error causes +a multi-block <CODE>.bz2</CODE> file to become damaged, it may be possible to +recover data from the undamaged blocks in the file. + +</P> +<P> +The compressed representation of each block is delimited by a 48-bit +pattern, which makes it possible to find the block boundaries with +reasonable certainty. Each block also carries its own 32-bit CRC, so +damaged blocks can be distinguished from undamaged ones. + +</P> +<P> +<CODE>bzip2recover</CODE> is a simple program whose purpose is to search for +blocks in <CODE>.bz2</CODE> files, and write each block out into its own +<CODE>.bz2</CODE> file. You can then use <CODE>bzip2 -t</CODE> to test the +integrity of the resulting files, and decompress those which are +undamaged. + +</P> +<P> +<CODE>bzip2recover</CODE> +takes a single argument, the name of the damaged file, +and writes a number of files <CODE>rec0001file.bz2</CODE>, + <CODE>rec0002file.bz2</CODE>, etc, containing the extracted blocks. + The output filenames are designed so that the use of + wildcards in subsequent processing -- for example, +<CODE>bzip2 -dc rec*file.bz2 > recovered_data</CODE> -- lists the files in + the correct order. + +</P> +<P> +<CODE>bzip2recover</CODE> should be of most use dealing with large <CODE>.bz2</CODE> + files, as these will contain many blocks. It is clearly + futile to use it on damaged single-block files, since a + damaged block cannot be recovered. If you wish to minimise +any potential data loss through media or transmission errors, +you might consider compressing with a smaller + block size. + +</P> + + + +<H4><A NAME="SEC9" HREF="manual_toc.html#TOC9">PERFORMANCE NOTES</A></H4> + +<P> +The sorting phase of compression gathers together similar strings in the +file. Because of this, files containing very long runs of repeated +symbols, like "aabaabaabaab ..." (repeated several hundred times) may +compress more slowly than normal. Versions 0.9.5 and above fare much +better than previous versions in this respect. The ratio between +worst-case and average-case compression time is in the region of 10:1. +For previous versions, this figure was more like 100:1. You can use the +<CODE>-vvvv</CODE> option to monitor progress in great detail, if you want. + +</P> +<P> +Decompression speed is unaffected by these phenomena. + +</P> +<P> +<CODE>bzip2</CODE> usually allocates several megabytes of memory to operate +in, and then charges all over it in a fairly random fashion. This means +that performance, both for compressing and decompressing, is largely +determined by the speed at which your machine can service cache misses. +Because of this, small changes to the code to reduce the miss rate have +been observed to give disproportionately large performance improvements. +I imagine <CODE>bzip2</CODE> will perform best on machines with very large +caches. + +</P> + + + +<H4><A NAME="SEC10" HREF="manual_toc.html#TOC10">CAVEATS</A></H4> + +<P> +I/O error messages are not as helpful as they could be. <CODE>bzip2</CODE> +tries hard to detect I/O errors and exit cleanly, but the details of +what the problem is sometimes seem rather misleading. + +</P> +<P> +This manual page pertains to version 1.0 of <CODE>bzip2</CODE>. Compressed +data created by this version is entirely forwards and backwards +compatible with the previous public releases, versions 0.1pl2, 0.9.0 and +0.9.5, but with the following exception: 0.9.0 and above can correctly +decompress multiple concatenated compressed files. 0.1pl2 cannot do +this; it will stop after decompressing just the first file in the +stream. + +</P> +<P> +<CODE>bzip2recover</CODE> uses 32-bit integers to represent bit positions in +compressed files, so it cannot handle compressed files more than 512 +megabytes long. This could easily be fixed. + +</P> + + + +<H4><A NAME="SEC11" HREF="manual_toc.html#TOC11">AUTHOR</A></H4> +<P> +Julian Seward, <CODE>jseward@acm.org</CODE>. + +</P> +<P> +The ideas embodied in <CODE>bzip2</CODE> are due to (at least) the following +people: Michael Burrows and David Wheeler (for the block sorting +transformation), David Wheeler (again, for the Huffman coder), Peter +Fenwick (for the structured coding model in the original <CODE>bzip</CODE>, +and many refinements), and Alistair Moffat, Radford Neal and Ian Witten +(for the arithmetic coder in the original <CODE>bzip</CODE>). I am much +indebted for their help, support and advice. See the manual in the +source distribution for pointers to sources of documentation. Christian +von Roques encouraged me to look for faster sorting algorithms, so as to +speed up compression. Bela Lubkin encouraged me to improve the +worst-case compression performance. Many people sent patches, helped +with portability problems, lent machines, gave advice and were generally +helpful. + +</P> +</BLOCKQUOTE> + +<P><HR><P> +<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_1.html">previous</A>, <A HREF="manual_3.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>. +</BODY> +</HTML> diff --git a/bzip2/manual_3.html b/bzip2/manual_3.html new file mode 100644 index 000000000..a8fa7e682 --- /dev/null +++ b/bzip2/manual_3.html @@ -0,0 +1,1773 @@ +<HTML> +<HEAD> +<!-- This HTML file has been created by texi2html 1.54 + from manual.texi on 23 March 2000 --> + +<TITLE>bzip2 and libbzip2 - Programming with libbzip2</TITLE> +<link href="manual_4.html" rel=Next> +<link href="manual_2.html" rel=Previous> +<link href="manual_toc.html" rel=ToC> + +</HEAD> +<BODY> +<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_2.html">previous</A>, <A HREF="manual_4.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>. +<P><HR><P> + + +<H1><A NAME="SEC12" HREF="manual_toc.html#TOC12">Programming with <CODE>libbzip2</CODE></A></H1> + +<P> +This chapter describes the programming interface to <CODE>libbzip2</CODE>. + +</P> +<P> +For general background information, particularly about memory +use and performance aspects, you'd be well advised to read Chapter 2 +as well. + +</P> + + +<H2><A NAME="SEC13" HREF="manual_toc.html#TOC13">Top-level structure</A></H2> + +<P> +<CODE>libbzip2</CODE> is a flexible library for compressing and decompressing +data in the <CODE>bzip2</CODE> data format. Although packaged as a single +entity, it helps to regard the library as three separate parts: the low +level interface, and the high level interface, and some utility +functions. + +</P> +<P> +The structure of <CODE>libbzip2</CODE>'s interfaces is similar to +that of Jean-loup Gailly's and Mark Adler's excellent <CODE>zlib</CODE> +library. + +</P> +<P> +All externally visible symbols have names beginning <CODE>BZ2_</CODE>. +This is new in version 1.0. The intention is to minimise pollution +of the namespaces of library clients. + +</P> + + +<H3><A NAME="SEC14" HREF="manual_toc.html#TOC14">Low-level summary</A></H3> + +<P> +This interface provides services for compressing and decompressing +data in memory. There's no provision for dealing with files, streams +or any other I/O mechanisms, just straight memory-to-memory work. +In fact, this part of the library can be compiled without inclusion +of <CODE>stdio.h</CODE>, which may be helpful for embedded applications. + +</P> +<P> +The low-level part of the library has no global variables and +is therefore thread-safe. + +</P> +<P> +Six routines make up the low level interface: +<CODE>BZ2_bzCompressInit</CODE>, <CODE>BZ2_bzCompress</CODE>, and <BR> <CODE>BZ2_bzCompressEnd</CODE> +for compression, +and a corresponding trio <CODE>BZ2_bzDecompressInit</CODE>, <BR> <CODE>BZ2_bzDecompress</CODE> +and <CODE>BZ2_bzDecompressEnd</CODE> for decompression. +The <CODE>*Init</CODE> functions allocate +memory for compression/decompression and do other +initialisations, whilst the <CODE>*End</CODE> functions close down operations +and release memory. + +</P> +<P> +The real work is done by <CODE>BZ2_bzCompress</CODE> and <CODE>BZ2_bzDecompress</CODE>. +These compress and decompress data from a user-supplied input buffer +to a user-supplied output buffer. These buffers can be any size; +arbitrary quantities of data are handled by making repeated calls +to these functions. This is a flexible mechanism allowing a +consumer-pull style of activity, or producer-push, or a mixture of +both. + +</P> + + + +<H3><A NAME="SEC15" HREF="manual_toc.html#TOC15">High-level summary</A></H3> + +<P> +This interface provides some handy wrappers around the low-level +interface to facilitate reading and writing <CODE>bzip2</CODE> format +files (<CODE>.bz2</CODE> files). The routines provide hooks to facilitate +reading files in which the <CODE>bzip2</CODE> data stream is embedded +within some larger-scale file structure, or where there are +multiple <CODE>bzip2</CODE> data streams concatenated end-to-end. + +</P> +<P> +For reading files, <CODE>BZ2_bzReadOpen</CODE>, <CODE>BZ2_bzRead</CODE>, +<CODE>BZ2_bzReadClose</CODE> and <BR> <CODE>BZ2_bzReadGetUnused</CODE> are supplied. For +writing files, <CODE>BZ2_bzWriteOpen</CODE>, <CODE>BZ2_bzWrite</CODE> and +<CODE>BZ2_bzWriteFinish</CODE> are available. + +</P> +<P> +As with the low-level library, no global variables are used +so the library is per se thread-safe. However, if I/O errors +occur whilst reading or writing the underlying compressed files, +you may have to consult <CODE>errno</CODE> to determine the cause of +the error. In that case, you'd need a C library which correctly +supports <CODE>errno</CODE> in a multithreaded environment. + +</P> +<P> +To make the library a little simpler and more portable, +<CODE>BZ2_bzReadOpen</CODE> and <CODE>BZ2_bzWriteOpen</CODE> require you to pass them file +handles (<CODE>FILE*</CODE>s) which have previously been opened for reading or +writing respectively. That avoids portability problems associated with +file operations and file attributes, whilst not being much of an +imposition on the programmer. + +</P> + + + +<H3><A NAME="SEC16" HREF="manual_toc.html#TOC16">Utility functions summary</A></H3> +<P> +For very simple needs, <CODE>BZ2_bzBuffToBuffCompress</CODE> and +<CODE>BZ2_bzBuffToBuffDecompress</CODE> are provided. These compress +data in memory from one buffer to another buffer in a single +function call. You should assess whether these functions +fulfill your memory-to-memory compression/decompression +requirements before investing effort in understanding the more +general but more complex low-level interface. + +</P> +<P> +Yoshioka Tsuneo (<CODE>QWF00133@niftyserve.or.jp</CODE> / +<CODE>tsuneo-y@is.aist-nara.ac.jp</CODE>) has contributed some functions to +give better <CODE>zlib</CODE> compatibility. These functions are +<CODE>BZ2_bzopen</CODE>, <CODE>BZ2_bzread</CODE>, <CODE>BZ2_bzwrite</CODE>, <CODE>BZ2_bzflush</CODE>, +<CODE>BZ2_bzclose</CODE>, +<CODE>BZ2_bzerror</CODE> and <CODE>BZ2_bzlibVersion</CODE>. You may find these functions +more convenient for simple file reading and writing, than those in the +high-level interface. These functions are not (yet) officially part of +the library, and are minimally documented here. If they break, you +get to keep all the pieces. I hope to document them properly when time +permits. + +</P> +<P> +Yoshioka also contributed modifications to allow the library to be +built as a Windows DLL. + +</P> + + + +<H2><A NAME="SEC17" HREF="manual_toc.html#TOC17">Error handling</A></H2> + +<P> +The library is designed to recover cleanly in all situations, including +the worst-case situation of decompressing random data. I'm not +100% sure that it can always do this, so you might want to add +a signal handler to catch segmentation violations during decompression +if you are feeling especially paranoid. I would be interested in +hearing more about the robustness of the library to corrupted +compressed data. + +</P> +<P> +Version 1.0 is much more robust in this respect than +0.9.0 or 0.9.5. Investigations with Checker (a tool for +detecting problems with memory management, similar to Purify) +indicate that, at least for the few files I tested, all single-bit +errors in the decompressed data are caught properly, with no +segmentation faults, no reads of uninitialised data and no +out of range reads or writes. So it's certainly much improved, +although I wouldn't claim it to be totally bombproof. + +</P> +<P> +The file <CODE>bzlib.h</CODE> contains all definitions needed to use +the library. In particular, you should definitely not include +<CODE>bzlib_private.h</CODE>. + +</P> +<P> +In <CODE>bzlib.h</CODE>, the various return values are defined. The following +list is not intended as an exhaustive description of the circumstances +in which a given value may be returned -- those descriptions are given +later. Rather, it is intended to convey the rough meaning of each +return value. The first five actions are normal and not intended to +denote an error situation. +<DL COMPACT> + +<DT><CODE>BZ_OK</CODE> +<DD> +The requested action was completed successfully. +<DT><CODE>BZ_RUN_OK</CODE> +<DD> +<DT><CODE>BZ_FLUSH_OK</CODE> +<DD> +<DT><CODE>BZ_FINISH_OK</CODE> +<DD> +In <CODE>BZ2_bzCompress</CODE>, the requested flush/finish/nothing-special action +was completed successfully. +<DT><CODE>BZ_STREAM_END</CODE> +<DD> +Compression of data was completed, or the logical stream end was +detected during decompression. +</DL> + +<P> +The following return values indicate an error of some kind. +<DL COMPACT> + +<DT><CODE>BZ_CONFIG_ERROR</CODE> +<DD> +Indicates that the library has been improperly compiled on your +platform -- a major configuration error. Specifically, it means +that <CODE>sizeof(char)</CODE>, <CODE>sizeof(short)</CODE> and <CODE>sizeof(int)</CODE> +are not 1, 2 and 4 respectively, as they should be. Note that the +library should still work properly on 64-bit platforms which follow +the LP64 programming model -- that is, where <CODE>sizeof(long)</CODE> +and <CODE>sizeof(void*)</CODE> are 8. Under LP64, <CODE>sizeof(int)</CODE> is +still 4, so <CODE>libbzip2</CODE>, which doesn't use the <CODE>long</CODE> type, +is OK. +<DT><CODE>BZ_SEQUENCE_ERROR</CODE> +<DD> +When using the library, it is important to call the functions in the +correct sequence and with data structures (buffers etc) in the correct +states. <CODE>libbzip2</CODE> checks as much as it can to ensure this is +happening, and returns <CODE>BZ_SEQUENCE_ERROR</CODE> if not. Code which +complies precisely with the function semantics, as detailed below, +should never receive this value; such an event denotes buggy code +which you should investigate. +<DT><CODE>BZ_PARAM_ERROR</CODE> +<DD> +Returned when a parameter to a function call is out of range +or otherwise manifestly incorrect. As with <CODE>BZ_SEQUENCE_ERROR</CODE>, +this denotes a bug in the client code. The distinction between +<CODE>BZ_PARAM_ERROR</CODE> and <CODE>BZ_SEQUENCE_ERROR</CODE> is a bit hazy, but still worth +making. +<DT><CODE>BZ_MEM_ERROR</CODE> +<DD> +Returned when a request to allocate memory failed. Note that the +quantity of memory needed to decompress a stream cannot be determined +until the stream's header has been read. So <CODE>BZ2_bzDecompress</CODE> and +<CODE>BZ2_bzRead</CODE> may return <CODE>BZ_MEM_ERROR</CODE> even though some of +the compressed data has been read. The same is not true for +compression; once <CODE>BZ2_bzCompressInit</CODE> or <CODE>BZ2_bzWriteOpen</CODE> have +successfully completed, <CODE>BZ_MEM_ERROR</CODE> cannot occur. +<DT><CODE>BZ_DATA_ERROR</CODE> +<DD> +Returned when a data integrity error is detected during decompression. +Most importantly, this means when stored and computed CRCs for the +data do not match. This value is also returned upon detection of any +other anomaly in the compressed data. +<DT><CODE>BZ_DATA_ERROR_MAGIC</CODE> +<DD> +As a special case of <CODE>BZ_DATA_ERROR</CODE>, it is sometimes useful to +know when the compressed stream does not start with the correct +magic bytes (<CODE>'B' 'Z' 'h'</CODE>). +<DT><CODE>BZ_IO_ERROR</CODE> +<DD> +Returned by <CODE>BZ2_bzRead</CODE> and <CODE>BZ2_bzWrite</CODE> when there is an error +reading or writing in the compressed file, and by <CODE>BZ2_bzReadOpen</CODE> +and <CODE>BZ2_bzWriteOpen</CODE> for attempts to use a file for which the +error indicator (viz, <CODE>ferror(f)</CODE>) is set. +On receipt of <CODE>BZ_IO_ERROR</CODE>, the caller should consult +<CODE>errno</CODE> and/or <CODE>perror</CODE> to acquire operating-system +specific information about the problem. +<DT><CODE>BZ_UNEXPECTED_EOF</CODE> +<DD> +Returned by <CODE>BZ2_bzRead</CODE> when the compressed file finishes +before the logical end of stream is detected. +<DT><CODE>BZ_OUTBUFF_FULL</CODE> +<DD> +Returned by <CODE>BZ2_bzBuffToBuffCompress</CODE> and +<CODE>BZ2_bzBuffToBuffDecompress</CODE> to indicate that the output data +will not fit into the output buffer provided. +</DL> + + + +<H2><A NAME="SEC18" HREF="manual_toc.html#TOC18">Low-level interface</A></H2> + + + +<H3><A NAME="SEC19" HREF="manual_toc.html#TOC19"><CODE>BZ2_bzCompressInit</CODE></A></H3> + +<PRE> +typedef + struct { + char *next_in; + unsigned int avail_in; + unsigned int total_in_lo32; + unsigned int total_in_hi32; + + char *next_out; + unsigned int avail_out; + unsigned int total_out_lo32; + unsigned int total_out_hi32; + + void *state; + + void *(*bzalloc)(void *,int,int); + void (*bzfree)(void *,void *); + void *opaque; + } + bz_stream; + +int BZ2_bzCompressInit ( bz_stream *strm, + int blockSize100k, + int verbosity, + int workFactor ); + +</PRE> + +<P> +Prepares for compression. The <CODE>bz_stream</CODE> structure +holds all data pertaining to the compression activity. +A <CODE>bz_stream</CODE> structure should be allocated and initialised +prior to the call. +The fields of <CODE>bz_stream</CODE> +comprise the entirety of the user-visible data. <CODE>state</CODE> +is a pointer to the private data structures required for compression. + +</P> +<P> +Custom memory allocators are supported, via fields <CODE>bzalloc</CODE>, +<CODE>bzfree</CODE>, +and <CODE>opaque</CODE>. The value +<CODE>opaque</CODE> is passed to as the first argument to +all calls to <CODE>bzalloc</CODE> and <CODE>bzfree</CODE>, but is +otherwise ignored by the library. +The call <CODE>bzalloc ( opaque, n, m )</CODE> is expected to return a +pointer <CODE>p</CODE> to +<CODE>n * m</CODE> bytes of memory, and <CODE>bzfree ( opaque, p )</CODE> +should free +that memory. + +</P> +<P> +If you don't want to use a custom memory allocator, set <CODE>bzalloc</CODE>, +<CODE>bzfree</CODE> and +<CODE>opaque</CODE> to <CODE>NULL</CODE>, +and the library will then use the standard <CODE>malloc</CODE>/<CODE>free</CODE> +routines. + +</P> +<P> +Before calling <CODE>BZ2_bzCompressInit</CODE>, fields <CODE>bzalloc</CODE>, +<CODE>bzfree</CODE> and <CODE>opaque</CODE> should +be filled appropriately, as just described. Upon return, the internal +state will have been allocated and initialised, and <CODE>total_in_lo32</CODE>, +<CODE>total_in_hi32</CODE>, <CODE>total_out_lo32</CODE> and +<CODE>total_out_hi32</CODE> will have been set to zero. +These four fields are used by the library +to inform the caller of the total amount of data passed into and out of +the library, respectively. You should not try to change them. +As of version 1.0, 64-bit counts are maintained, even on 32-bit +platforms, using the <CODE>_hi32</CODE> fields to store the upper 32 bits +of the count. So, for example, the total amount of data in +is <CODE>(total_in_hi32 << 32) + total_in_lo32</CODE>. + +</P> +<P> +Parameter <CODE>blockSize100k</CODE> specifies the block size to be used for +compression. It should be a value between 1 and 9 inclusive, and the +actual block size used is 100000 x this figure. 9 gives the best +compression but takes most memory. + +</P> +<P> +Parameter <CODE>verbosity</CODE> should be set to a number between 0 and 4 +inclusive. 0 is silent, and greater numbers give increasingly verbose +monitoring/debugging output. If the library has been compiled with +<CODE>-DBZ_NO_STDIO</CODE>, no such output will appear for any verbosity +setting. + +</P> +<P> +Parameter <CODE>workFactor</CODE> controls how the compression phase behaves +when presented with worst case, highly repetitive, input data. If +compression runs into difficulties caused by repetitive data, the +library switches from the standard sorting algorithm to a fallback +algorithm. The fallback is slower than the standard algorithm by +perhaps a factor of three, but always behaves reasonably, no matter how +bad the input. + +</P> +<P> +Lower values of <CODE>workFactor</CODE> reduce the amount of effort the +standard algorithm will expend before resorting to the fallback. You +should set this parameter carefully; too low, and many inputs will be +handled by the fallback algorithm and so compress rather slowly, too +high, and your average-to-worst case compression times can become very +large. The default value of 30 gives reasonable behaviour over a wide +range of circumstances. + +</P> +<P> +Allowable values range from 0 to 250 inclusive. 0 is a special case, +equivalent to using the default value of 30. + +</P> +<P> +Note that the compressed output generated is the same regardless of +whether or not the fallback algorithm is used. + +</P> +<P> +Be aware also that this parameter may disappear entirely in future +versions of the library. In principle it should be possible to devise a +good way to automatically choose which algorithm to use. Such a +mechanism would render the parameter obsolete. + +</P> +<P> +Possible return values: + +<PRE> + <CODE>BZ_CONFIG_ERROR</CODE> + if the library has been mis-compiled + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>strm</CODE> is <CODE>NULL</CODE> + or <CODE>blockSize</CODE> < 1 or <CODE>blockSize</CODE> > 9 + or <CODE>verbosity</CODE> < 0 or <CODE>verbosity</CODE> > 4 + or <CODE>workFactor</CODE> < 0 or <CODE>workFactor</CODE> > 250 + <CODE>BZ_MEM_ERROR</CODE> + if not enough memory is available + <CODE>BZ_OK</CODE> + otherwise +</PRE> + +<P> +Allowable next actions: + +<PRE> + <CODE>BZ2_bzCompress</CODE> + if <CODE>BZ_OK</CODE> is returned + no specific action needed in case of error +</PRE> + + + +<H3><A NAME="SEC20" HREF="manual_toc.html#TOC20"><CODE>BZ2_bzCompress</CODE></A></H3> + +<PRE> + int BZ2_bzCompress ( bz_stream *strm, int action ); +</PRE> + +<P> +Provides more input and/or output buffer space for the library. The +caller maintains input and output buffers, and calls <CODE>BZ2_bzCompress</CODE> to +transfer data between them. + +</P> +<P> +Before each call to <CODE>BZ2_bzCompress</CODE>, <CODE>next_in</CODE> should point at +the data to be compressed, and <CODE>avail_in</CODE> should indicate how many +bytes the library may read. <CODE>BZ2_bzCompress</CODE> updates <CODE>next_in</CODE>, +<CODE>avail_in</CODE> and <CODE>total_in</CODE> to reflect the number of bytes it +has read. + +</P> +<P> +Similarly, <CODE>next_out</CODE> should point to a buffer in which the +compressed data is to be placed, with <CODE>avail_out</CODE> indicating how +much output space is available. <CODE>BZ2_bzCompress</CODE> updates +<CODE>next_out</CODE>, <CODE>avail_out</CODE> and <CODE>total_out</CODE> to reflect the +number of bytes output. + +</P> +<P> +You may provide and remove as little or as much data as you like on each +call of <CODE>BZ2_bzCompress</CODE>. In the limit, it is acceptable to supply and +remove data one byte at a time, although this would be terribly +inefficient. You should always ensure that at least one byte of output +space is available at each call. + +</P> +<P> +A second purpose of <CODE>BZ2_bzCompress</CODE> is to request a change of mode of the +compressed stream. + +</P> +<P> +Conceptually, a compressed stream can be in one of four states: IDLE, +RUNNING, FLUSHING and FINISHING. Before initialisation +(<CODE>BZ2_bzCompressInit</CODE>) and after termination (<CODE>BZ2_bzCompressEnd</CODE>), a +stream is regarded as IDLE. + +</P> +<P> +Upon initialisation (<CODE>BZ2_bzCompressInit</CODE>), the stream is placed in the +RUNNING state. Subsequent calls to <CODE>BZ2_bzCompress</CODE> should pass +<CODE>BZ_RUN</CODE> as the requested action; other actions are illegal and +will result in <CODE>BZ_SEQUENCE_ERROR</CODE>. + +</P> +<P> +At some point, the calling program will have provided all the input data +it wants to. It will then want to finish up -- in effect, asking the +library to process any data it might have buffered internally. In this +state, <CODE>BZ2_bzCompress</CODE> will no longer attempt to read data from +<CODE>next_in</CODE>, but it will want to write data to <CODE>next_out</CODE>. +Because the output buffer supplied by the user can be arbitrarily small, +the finishing-up operation cannot necessarily be done with a single call +of <CODE>BZ2_bzCompress</CODE>. + +</P> +<P> +Instead, the calling program passes <CODE>BZ_FINISH</CODE> as an action to +<CODE>BZ2_bzCompress</CODE>. This changes the stream's state to FINISHING. Any +remaining input (ie, <CODE>next_in[0 .. avail_in-1]</CODE>) is compressed and +transferred to the output buffer. To do this, <CODE>BZ2_bzCompress</CODE> must be +called repeatedly until all the output has been consumed. At that +point, <CODE>BZ2_bzCompress</CODE> returns <CODE>BZ_STREAM_END</CODE>, and the stream's +state is set back to IDLE. <CODE>BZ2_bzCompressEnd</CODE> should then be +called. + +</P> +<P> +Just to make sure the calling program does not cheat, the library makes +a note of <CODE>avail_in</CODE> at the time of the first call to +<CODE>BZ2_bzCompress</CODE> which has <CODE>BZ_FINISH</CODE> as an action (ie, at the +time the program has announced its intention to not supply any more +input). By comparing this value with that of <CODE>avail_in</CODE> over +subsequent calls to <CODE>BZ2_bzCompress</CODE>, the library can detect any +attempts to slip in more data to compress. Any calls for which this is +detected will return <CODE>BZ_SEQUENCE_ERROR</CODE>. This indicates a +programming mistake which should be corrected. + +</P> +<P> +Instead of asking to finish, the calling program may ask +<CODE>BZ2_bzCompress</CODE> to take all the remaining input, compress it and +terminate the current (Burrows-Wheeler) compression block. This could +be useful for error control purposes. The mechanism is analogous to +that for finishing: call <CODE>BZ2_bzCompress</CODE> with an action of +<CODE>BZ_FLUSH</CODE>, remove output data, and persist with the +<CODE>BZ_FLUSH</CODE> action until the value <CODE>BZ_RUN</CODE> is returned. As +with finishing, <CODE>BZ2_bzCompress</CODE> detects any attempt to provide more +input data once the flush has begun. + +</P> +<P> +Once the flush is complete, the stream returns to the normal RUNNING +state. + +</P> +<P> +This all sounds pretty complex, but isn't really. Here's a table +which shows which actions are allowable in each state, what action +will be taken, what the next state is, and what the non-error return +values are. Note that you can't explicitly ask what state the +stream is in, but nor do you need to -- it can be inferred from the +values returned by <CODE>BZ2_bzCompress</CODE>. + +<PRE> +IDLE/<CODE>any</CODE> + Illegal. IDLE state only exists after <CODE>BZ2_bzCompressEnd</CODE> or + before <CODE>BZ2_bzCompressInit</CODE>. + Return value = <CODE>BZ_SEQUENCE_ERROR</CODE> + +RUNNING/<CODE>BZ_RUN</CODE> + Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible. + Next state = RUNNING + Return value = <CODE>BZ_RUN_OK</CODE> + +RUNNING/<CODE>BZ_FLUSH</CODE> + Remember current value of <CODE>next_in</CODE>. Compress from <CODE>next_in</CODE> + to <CODE>next_out</CODE> as much as possible, but do not accept any more input. + Next state = FLUSHING + Return value = <CODE>BZ_FLUSH_OK</CODE> + +RUNNING/<CODE>BZ_FINISH</CODE> + Remember current value of <CODE>next_in</CODE>. Compress from <CODE>next_in</CODE> + to <CODE>next_out</CODE> as much as possible, but do not accept any more input. + Next state = FINISHING + Return value = <CODE>BZ_FINISH_OK</CODE> + +FLUSHING/<CODE>BZ_FLUSH</CODE> + Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible, + but do not accept any more input. + If all the existing input has been used up and all compressed + output has been removed + Next state = RUNNING; Return value = <CODE>BZ_RUN_OK</CODE> + else + Next state = FLUSHING; Return value = <CODE>BZ_FLUSH_OK</CODE> + +FLUSHING/other + Illegal. + Return value = <CODE>BZ_SEQUENCE_ERROR</CODE> + +FINISHING/<CODE>BZ_FINISH</CODE> + Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible, + but to not accept any more input. + If all the existing input has been used up and all compressed + output has been removed + Next state = IDLE; Return value = <CODE>BZ_STREAM_END</CODE> + else + Next state = FINISHING; Return value = <CODE>BZ_FINISHING</CODE> + +FINISHING/other + Illegal. + Return value = <CODE>BZ_SEQUENCE_ERROR</CODE> +</PRE> + +<P> +That still looks complicated? Well, fair enough. The usual sequence +of calls for compressing a load of data is: + +<UL> +<LI>Get started with <CODE>BZ2_bzCompressInit</CODE>. + +<LI>Shovel data in and shlurp out its compressed form using zero or more + +calls of <CODE>BZ2_bzCompress</CODE> with action = <CODE>BZ_RUN</CODE>. +<LI>Finish up. + +Repeatedly call <CODE>BZ2_bzCompress</CODE> with action = <CODE>BZ_FINISH</CODE>, +copying out the compressed output, until <CODE>BZ_STREAM_END</CODE> is returned. +<LI>Close up and go home. Call <CODE>BZ2_bzCompressEnd</CODE>. + +</UL> + +<P> +If the data you want to compress fits into your input buffer all +at once, you can skip the calls of <CODE>BZ2_bzCompress ( ..., BZ_RUN )</CODE> and +just do the <CODE>BZ2_bzCompress ( ..., BZ_FINISH )</CODE> calls. + +</P> +<P> +All required memory is allocated by <CODE>BZ2_bzCompressInit</CODE>. The +compression library can accept any data at all (obviously). So you +shouldn't get any error return values from the <CODE>BZ2_bzCompress</CODE> calls. +If you do, they will be <CODE>BZ_SEQUENCE_ERROR</CODE>, and indicate a bug in +your programming. + +</P> +<P> +Trivial other possible return values: + +<PRE> + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>strm</CODE> is <CODE>NULL</CODE>, or <CODE>strm->s</CODE> is <CODE>NULL</CODE> +</PRE> + + + +<H3><A NAME="SEC21" HREF="manual_toc.html#TOC21"><CODE>BZ2_bzCompressEnd</CODE></A></H3> + +<PRE> +int BZ2_bzCompressEnd ( bz_stream *strm ); +</PRE> + +<P> +Releases all memory associated with a compression stream. + +</P> +<P> +Possible return values: + +<PRE> + <CODE>BZ_PARAM_ERROR</CODE> if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm->s</CODE> is <CODE>NULL</CODE> + <CODE>BZ_OK</CODE> otherwise +</PRE> + + + +<H3><A NAME="SEC22" HREF="manual_toc.html#TOC22"><CODE>BZ2_bzDecompressInit</CODE></A></H3> + +<PRE> +int BZ2_bzDecompressInit ( bz_stream *strm, int verbosity, int small ); +</PRE> + +<P> +Prepares for decompression. As with <CODE>BZ2_bzCompressInit</CODE>, a +<CODE>bz_stream</CODE> record should be allocated and initialised before the +call. Fields <CODE>bzalloc</CODE>, <CODE>bzfree</CODE> and <CODE>opaque</CODE> should be +set if a custom memory allocator is required, or made <CODE>NULL</CODE> for +the normal <CODE>malloc</CODE>/<CODE>free</CODE> routines. Upon return, the internal +state will have been initialised, and <CODE>total_in</CODE> and +<CODE>total_out</CODE> will be zero. + +</P> +<P> +For the meaning of parameter <CODE>verbosity</CODE>, see <CODE>BZ2_bzCompressInit</CODE>. + +</P> +<P> +If <CODE>small</CODE> is nonzero, the library will use an alternative +decompression algorithm which uses less memory but at the cost of +decompressing more slowly (roughly speaking, half the speed, but the +maximum memory requirement drops to around 2300k). See Chapter 2 for +more information on memory management. + +</P> +<P> +Note that the amount of memory needed to decompress +a stream cannot be determined until the stream's header has been read, +so even if <CODE>BZ2_bzDecompressInit</CODE> succeeds, a subsequent +<CODE>BZ2_bzDecompress</CODE> could fail with <CODE>BZ_MEM_ERROR</CODE>. + +</P> +<P> +Possible return values: + +<PRE> + <CODE>BZ_CONFIG_ERROR</CODE> + if the library has been mis-compiled + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>(small != 0 && small != 1)</CODE> + or <CODE>(verbosity < 0 || verbosity > 4)</CODE> + <CODE>BZ_MEM_ERROR</CODE> + if insufficient memory is available +</PRE> + +<P> +Allowable next actions: + +<PRE> + <CODE>BZ2_bzDecompress</CODE> + if <CODE>BZ_OK</CODE> was returned + no specific action required in case of error +</PRE> + +<P> + + +</P> + + +<H3><A NAME="SEC23" HREF="manual_toc.html#TOC23"><CODE>BZ2_bzDecompress</CODE></A></H3> + +<PRE> +int BZ2_bzDecompress ( bz_stream *strm ); +</PRE> + +<P> +Provides more input and/out output buffer space for the library. The +caller maintains input and output buffers, and uses <CODE>BZ2_bzDecompress</CODE> +to transfer data between them. + +</P> +<P> +Before each call to <CODE>BZ2_bzDecompress</CODE>, <CODE>next_in</CODE> +should point at the compressed data, +and <CODE>avail_in</CODE> should indicate how many bytes the library +may read. <CODE>BZ2_bzDecompress</CODE> updates <CODE>next_in</CODE>, <CODE>avail_in</CODE> +and <CODE>total_in</CODE> +to reflect the number of bytes it has read. + +</P> +<P> +Similarly, <CODE>next_out</CODE> should point to a buffer in which the uncompressed +output is to be placed, with <CODE>avail_out</CODE> indicating how much output space +is available. <CODE>BZ2_bzCompress</CODE> updates <CODE>next_out</CODE>, +<CODE>avail_out</CODE> and <CODE>total_out</CODE> to reflect +the number of bytes output. + +</P> +<P> +You may provide and remove as little or as much data as you like on +each call of <CODE>BZ2_bzDecompress</CODE>. +In the limit, it is acceptable to +supply and remove data one byte at a time, although this would be +terribly inefficient. You should always ensure that at least one +byte of output space is available at each call. + +</P> +<P> +Use of <CODE>BZ2_bzDecompress</CODE> is simpler than <CODE>BZ2_bzCompress</CODE>. + +</P> +<P> +You should provide input and remove output as described above, and +repeatedly call <CODE>BZ2_bzDecompress</CODE> until <CODE>BZ_STREAM_END</CODE> is +returned. Appearance of <CODE>BZ_STREAM_END</CODE> denotes that +<CODE>BZ2_bzDecompress</CODE> has detected the logical end of the compressed +stream. <CODE>BZ2_bzDecompress</CODE> will not produce <CODE>BZ_STREAM_END</CODE> until +all output data has been placed into the output buffer, so once +<CODE>BZ_STREAM_END</CODE> appears, you are guaranteed to have available all +the decompressed output, and <CODE>BZ2_bzDecompressEnd</CODE> can safely be +called. + +</P> +<P> +If case of an error return value, you should call <CODE>BZ2_bzDecompressEnd</CODE> +to clean up and release memory. + +</P> +<P> +Possible return values: + +<PRE> + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm->s</CODE> is <CODE>NULL</CODE> + or <CODE>strm->avail_out < 1</CODE> + <CODE>BZ_DATA_ERROR</CODE> + if a data integrity error is detected in the compressed stream + <CODE>BZ_DATA_ERROR_MAGIC</CODE> + if the compressed stream doesn't begin with the right magic bytes + <CODE>BZ_MEM_ERROR</CODE> + if there wasn't enough memory available + <CODE>BZ_STREAM_END</CODE> + if the logical end of the data stream was detected and all + output in has been consumed, eg <CODE>s->avail_out > 0</CODE> + <CODE>BZ_OK</CODE> + otherwise +</PRE> + +<P> +Allowable next actions: + +<PRE> + <CODE>BZ2_bzDecompress</CODE> + if <CODE>BZ_OK</CODE> was returned + <CODE>BZ2_bzDecompressEnd</CODE> + otherwise +</PRE> + + + +<H3><A NAME="SEC24" HREF="manual_toc.html#TOC24"><CODE>BZ2_bzDecompressEnd</CODE></A></H3> + +<PRE> +int BZ2_bzDecompressEnd ( bz_stream *strm ); +</PRE> + +<P> +Releases all memory associated with a decompression stream. + +</P> +<P> +Possible return values: + +<PRE> + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm->s</CODE> is <CODE>NULL</CODE> + <CODE>BZ_OK</CODE> + otherwise +</PRE> + +<P> +Allowable next actions: + +<PRE> + None. +</PRE> + + + +<H2><A NAME="SEC25" HREF="manual_toc.html#TOC25">High-level interface</A></H2> + +<P> +This interface provides functions for reading and writing +<CODE>bzip2</CODE> format files. First, some general points. + +</P> + +<UL> +<LI>All of the functions take an <CODE>int*</CODE> first argument, + + <CODE>bzerror</CODE>. + After each call, <CODE>bzerror</CODE> should be consulted first to determine + the outcome of the call. If <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>, + the call completed + successfully, and only then should the return value of the function + (if any) be consulted. If <CODE>bzerror</CODE> is <CODE>BZ_IO_ERROR</CODE>, + there was an error + reading/writing the underlying compressed file, and you should + then consult <CODE>errno</CODE>/<CODE>perror</CODE> to determine the + cause of the difficulty. + <CODE>bzerror</CODE> may also be set to various other values; precise details are + given on a per-function basis below. +<LI>If <CODE>bzerror</CODE> indicates an error + + (ie, anything except <CODE>BZ_OK</CODE> and <CODE>BZ_STREAM_END</CODE>), + you should immediately call <CODE>BZ2_bzReadClose</CODE> (or <CODE>BZ2_bzWriteClose</CODE>, + depending on whether you are attempting to read or to write) + to free up all resources associated + with the stream. Once an error has been indicated, behaviour of all calls + except <CODE>BZ2_bzReadClose</CODE> (<CODE>BZ2_bzWriteClose</CODE>) is undefined. + The implication is that (1) <CODE>bzerror</CODE> should + be checked after each call, and (2) if <CODE>bzerror</CODE> indicates an error, + <CODE>BZ2_bzReadClose</CODE> (<CODE>BZ2_bzWriteClose</CODE>) should then be called to clean up. +<LI>The <CODE>FILE*</CODE> arguments passed to + + <CODE>BZ2_bzReadOpen</CODE>/<CODE>BZ2_bzWriteOpen</CODE> + should be set to binary mode. + Most Unix systems will do this by default, but other platforms, + including Windows and Mac, will not. If you omit this, you may + encounter problems when moving code to new platforms. +<LI>Memory allocation requests are handled by + + <CODE>malloc</CODE>/<CODE>free</CODE>. + At present + there is no facility for user-defined memory allocators in the file I/O + functions (could easily be added, though). +</UL> + + + +<H3><A NAME="SEC26" HREF="manual_toc.html#TOC26"><CODE>BZ2_bzReadOpen</CODE></A></H3> + +<PRE> + typedef void BZFILE; + + BZFILE *BZ2_bzReadOpen ( int *bzerror, FILE *f, + int small, int verbosity, + void *unused, int nUnused ); +</PRE> + +<P> +Prepare to read compressed data from file handle <CODE>f</CODE>. <CODE>f</CODE> +should refer to a file which has been opened for reading, and for which +the error indicator (<CODE>ferror(f)</CODE>)is not set. If <CODE>small</CODE> is 1, +the library will try to decompress using less memory, at the expense of +speed. + +</P> +<P> +For reasons explained below, <CODE>BZ2_bzRead</CODE> will decompress the +<CODE>nUnused</CODE> bytes starting at <CODE>unused</CODE>, before starting to read +from the file <CODE>f</CODE>. At most <CODE>BZ_MAX_UNUSED</CODE> bytes may be +supplied like this. If this facility is not required, you should pass +<CODE>NULL</CODE> and <CODE>0</CODE> for <CODE>unused</CODE> and n<CODE>Unused</CODE> +respectively. + +</P> +<P> +For the meaning of parameters <CODE>small</CODE> and <CODE>verbosity</CODE>, +see <CODE>BZ2_bzDecompressInit</CODE>. + +</P> +<P> +The amount of memory needed to decompress a file cannot be determined +until the file's header has been read. So it is possible that +<CODE>BZ2_bzReadOpen</CODE> returns <CODE>BZ_OK</CODE> but a subsequent call of +<CODE>BZ2_bzRead</CODE> will return <CODE>BZ_MEM_ERROR</CODE>. + +</P> +<P> +Possible assignments to <CODE>bzerror</CODE>: + +<PRE> + <CODE>BZ_CONFIG_ERROR</CODE> + if the library has been mis-compiled + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>f</CODE> is <CODE>NULL</CODE> + or <CODE>small</CODE> is neither <CODE>0</CODE> nor <CODE>1</CODE> + or <CODE>(unused == NULL && nUnused != 0)</CODE> + or <CODE>(unused != NULL && !(0 <= nUnused <= BZ_MAX_UNUSED))</CODE> + <CODE>BZ_IO_ERROR</CODE> + if <CODE>ferror(f)</CODE> is nonzero + <CODE>BZ_MEM_ERROR</CODE> + if insufficient memory is available + <CODE>BZ_OK</CODE> + otherwise. +</PRE> + +<P> +Possible return values: + +<PRE> + Pointer to an abstract <CODE>BZFILE</CODE> + if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> + <CODE>NULL</CODE> + otherwise +</PRE> + +<P> +Allowable next actions: + +<PRE> + <CODE>BZ2_bzRead</CODE> + if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> + <CODE>BZ2_bzClose</CODE> + otherwise +</PRE> + + + +<H3><A NAME="SEC27" HREF="manual_toc.html#TOC27"><CODE>BZ2_bzRead</CODE></A></H3> + +<PRE> + int BZ2_bzRead ( int *bzerror, BZFILE *b, void *buf, int len ); +</PRE> + +<P> +Reads up to <CODE>len</CODE> (uncompressed) bytes from the compressed file +<CODE>b</CODE> into +the buffer <CODE>buf</CODE>. If the read was successful, +<CODE>bzerror</CODE> is set to <CODE>BZ_OK</CODE> +and the number of bytes read is returned. If the logical end-of-stream +was detected, <CODE>bzerror</CODE> will be set to <CODE>BZ_STREAM_END</CODE>, +and the number +of bytes read is returned. All other <CODE>bzerror</CODE> values denote an error. + +</P> +<P> +<CODE>BZ2_bzRead</CODE> will supply <CODE>len</CODE> bytes, +unless the logical stream end is detected +or an error occurs. Because of this, it is possible to detect the +stream end by observing when the number of bytes returned is +less than the number +requested. Nevertheless, this is regarded as inadvisable; you should +instead check <CODE>bzerror</CODE> after every call and watch out for +<CODE>BZ_STREAM_END</CODE>. + +</P> +<P> +Internally, <CODE>BZ2_bzRead</CODE> copies data from the compressed file in chunks +of size <CODE>BZ_MAX_UNUSED</CODE> bytes +before decompressing it. If the file contains more bytes than strictly +needed to reach the logical end-of-stream, <CODE>BZ2_bzRead</CODE> will almost certainly +read some of the trailing data before signalling <CODE>BZ_SEQUENCE_END</CODE>. +To collect the read but unused data once <CODE>BZ_SEQUENCE_END</CODE> has +appeared, call <CODE>BZ2_bzReadGetUnused</CODE> immediately before <CODE>BZ2_bzReadClose</CODE>. + +</P> +<P> +Possible assignments to <CODE>bzerror</CODE>: + +<PRE> + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>b</CODE> is <CODE>NULL</CODE> or <CODE>buf</CODE> is <CODE>NULL</CODE> or <CODE>len < 0</CODE> + <CODE>BZ_SEQUENCE_ERROR</CODE> + if <CODE>b</CODE> was opened with <CODE>BZ2_bzWriteOpen</CODE> + <CODE>BZ_IO_ERROR</CODE> + if there is an error reading from the compressed file + <CODE>BZ_UNEXPECTED_EOF</CODE> + if the compressed file ended before the logical end-of-stream was detected + <CODE>BZ_DATA_ERROR</CODE> + if a data integrity error was detected in the compressed stream + <CODE>BZ_DATA_ERROR_MAGIC</CODE> + if the stream does not begin with the requisite header bytes (ie, is not + a <CODE>bzip2</CODE> data file). This is really a special case of <CODE>BZ_DATA_ERROR</CODE>. + <CODE>BZ_MEM_ERROR</CODE> + if insufficient memory was available + <CODE>BZ_STREAM_END</CODE> + if the logical end of stream was detected. + <CODE>BZ_OK</CODE> + otherwise. +</PRE> + +<P> +Possible return values: + +<PRE> + number of bytes read + if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> or <CODE>BZ_STREAM_END</CODE> + undefined + otherwise +</PRE> + +<P> +Allowable next actions: + +<PRE> + collect data from <CODE>buf</CODE>, then <CODE>BZ2_bzRead</CODE> or <CODE>BZ2_bzReadClose</CODE> + if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> + collect data from <CODE>buf</CODE>, then <CODE>BZ2_bzReadClose</CODE> or <CODE>BZ2_bzReadGetUnused</CODE> + if <CODE>bzerror</CODE> is <CODE>BZ_SEQUENCE_END</CODE> + <CODE>BZ2_bzReadClose</CODE> + otherwise +</PRE> + + + +<H3><A NAME="SEC28" HREF="manual_toc.html#TOC28"><CODE>BZ2_bzReadGetUnused</CODE></A></H3> + +<PRE> + void BZ2_bzReadGetUnused ( int* bzerror, BZFILE *b, + void** unused, int* nUnused ); +</PRE> + +<P> +Returns data which was read from the compressed file but was not needed +to get to the logical end-of-stream. <CODE>*unused</CODE> is set to the address +of the data, and <CODE>*nUnused</CODE> to the number of bytes. <CODE>*nUnused</CODE> will +be set to a value between <CODE>0</CODE> and <CODE>BZ_MAX_UNUSED</CODE> inclusive. + +</P> +<P> +This function may only be called once <CODE>BZ2_bzRead</CODE> has signalled +<CODE>BZ_STREAM_END</CODE> but before <CODE>BZ2_bzReadClose</CODE>. + +</P> +<P> +Possible assignments to <CODE>bzerror</CODE>: + +<PRE> + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>b</CODE> is <CODE>NULL</CODE> + or <CODE>unused</CODE> is <CODE>NULL</CODE> or <CODE>nUnused</CODE> is <CODE>NULL</CODE> + <CODE>BZ_SEQUENCE_ERROR</CODE> + if <CODE>BZ_STREAM_END</CODE> has not been signalled + or if <CODE>b</CODE> was opened with <CODE>BZ2_bzWriteOpen</CODE> + <CODE>BZ_OK</CODE> + otherwise +</PRE> + +<P> +Allowable next actions: + +<PRE> + <CODE>BZ2_bzReadClose</CODE> +</PRE> + + + +<H3><A NAME="SEC29" HREF="manual_toc.html#TOC29"><CODE>BZ2_bzReadClose</CODE></A></H3> + +<PRE> + void BZ2_bzReadClose ( int *bzerror, BZFILE *b ); +</PRE> + +<P> +Releases all memory pertaining to the compressed file <CODE>b</CODE>. +<CODE>BZ2_bzReadClose</CODE> does not call <CODE>fclose</CODE> on the underlying file +handle, so you should do that yourself if appropriate. +<CODE>BZ2_bzReadClose</CODE> should be called to clean up after all error +situations. + +</P> +<P> +Possible assignments to <CODE>bzerror</CODE>: + +<PRE> + <CODE>BZ_SEQUENCE_ERROR</CODE> + if <CODE>b</CODE> was opened with <CODE>BZ2_bzOpenWrite</CODE> + <CODE>BZ_OK</CODE> + otherwise +</PRE> + +<P> +Allowable next actions: + +<PRE> + none +</PRE> + + + +<H3><A NAME="SEC30" HREF="manual_toc.html#TOC30"><CODE>BZ2_bzWriteOpen</CODE></A></H3> + +<PRE> + BZFILE *BZ2_bzWriteOpen ( int *bzerror, FILE *f, + int blockSize100k, int verbosity, + int workFactor ); +</PRE> + +<P> +Prepare to write compressed data to file handle <CODE>f</CODE>. +<CODE>f</CODE> should refer to +a file which has been opened for writing, and for which the error +indicator (<CODE>ferror(f)</CODE>)is not set. + +</P> +<P> +For the meaning of parameters <CODE>blockSize100k</CODE>, +<CODE>verbosity</CODE> and <CODE>workFactor</CODE>, see +<BR> <CODE>BZ2_bzCompressInit</CODE>. + +</P> +<P> +All required memory is allocated at this stage, so if the call +completes successfully, <CODE>BZ_MEM_ERROR</CODE> cannot be signalled by a +subsequent call to <CODE>BZ2_bzWrite</CODE>. + +</P> +<P> +Possible assignments to <CODE>bzerror</CODE>: + +<PRE> + <CODE>BZ_CONFIG_ERROR</CODE> + if the library has been mis-compiled + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>f</CODE> is <CODE>NULL</CODE> + or <CODE>blockSize100k < 1</CODE> or <CODE>blockSize100k > 9</CODE> + <CODE>BZ_IO_ERROR</CODE> + if <CODE>ferror(f)</CODE> is nonzero + <CODE>BZ_MEM_ERROR</CODE> + if insufficient memory is available + <CODE>BZ_OK</CODE> + otherwise +</PRE> + +<P> +Possible return values: + +<PRE> + Pointer to an abstract <CODE>BZFILE</CODE> + if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> + <CODE>NULL</CODE> + otherwise +</PRE> + +<P> +Allowable next actions: + +<PRE> + <CODE>BZ2_bzWrite</CODE> + if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> + (you could go directly to <CODE>BZ2_bzWriteClose</CODE>, but this would be pretty pointless) + <CODE>BZ2_bzWriteClose</CODE> + otherwise +</PRE> + + + +<H3><A NAME="SEC31" HREF="manual_toc.html#TOC31"><CODE>BZ2_bzWrite</CODE></A></H3> + +<PRE> + void BZ2_bzWrite ( int *bzerror, BZFILE *b, void *buf, int len ); +</PRE> + +<P> +Absorbs <CODE>len</CODE> bytes from the buffer <CODE>buf</CODE>, eventually to be +compressed and written to the file. + +</P> +<P> +Possible assignments to <CODE>bzerror</CODE>: + +<PRE> + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>b</CODE> is <CODE>NULL</CODE> or <CODE>buf</CODE> is <CODE>NULL</CODE> or <CODE>len < 0</CODE> + <CODE>BZ_SEQUENCE_ERROR</CODE> + if b was opened with <CODE>BZ2_bzReadOpen</CODE> + <CODE>BZ_IO_ERROR</CODE> + if there is an error writing the compressed file. + <CODE>BZ_OK</CODE> + otherwise +</PRE> + + + +<H3><A NAME="SEC32" HREF="manual_toc.html#TOC32"><CODE>BZ2_bzWriteClose</CODE></A></H3> + +<PRE> + void BZ2_bzWriteClose ( int *bzerror, BZFILE* f, + int abandon, + unsigned int* nbytes_in, + unsigned int* nbytes_out ); + + void BZ2_bzWriteClose64 ( int *bzerror, BZFILE* f, + int abandon, + unsigned int* nbytes_in_lo32, + unsigned int* nbytes_in_hi32, + unsigned int* nbytes_out_lo32, + unsigned int* nbytes_out_hi32 ); +</PRE> + +<P> +Compresses and flushes to the compressed file all data so far supplied +by <CODE>BZ2_bzWrite</CODE>. The logical end-of-stream markers are also written, so +subsequent calls to <CODE>BZ2_bzWrite</CODE> are illegal. All memory associated +with the compressed file <CODE>b</CODE> is released. +<CODE>fflush</CODE> is called on the +compressed file, but it is not <CODE>fclose</CODE>'d. + +</P> +<P> +If <CODE>BZ2_bzWriteClose</CODE> is called to clean up after an error, the only +action is to release the memory. The library records the error codes +issued by previous calls, so this situation will be detected +automatically. There is no attempt to complete the compression +operation, nor to <CODE>fflush</CODE> the compressed file. You can force this +behaviour to happen even in the case of no error, by passing a nonzero +value to <CODE>abandon</CODE>. + +</P> +<P> +If <CODE>nbytes_in</CODE> is non-null, <CODE>*nbytes_in</CODE> will be set to be the +total volume of uncompressed data handled. Similarly, <CODE>nbytes_out</CODE> +will be set to the total volume of compressed data written. For +compatibility with older versions of the library, <CODE>BZ2_bzWriteClose</CODE> +only yields the lower 32 bits of these counts. Use +<CODE>BZ2_bzWriteClose64</CODE> if you want the full 64 bit counts. These +two functions are otherwise absolutely identical. + +</P> + +<P> +Possible assignments to <CODE>bzerror</CODE>: + +<PRE> + <CODE>BZ_SEQUENCE_ERROR</CODE> + if <CODE>b</CODE> was opened with <CODE>BZ2_bzReadOpen</CODE> + <CODE>BZ_IO_ERROR</CODE> + if there is an error writing the compressed file + <CODE>BZ_OK</CODE> + otherwise +</PRE> + + + +<H3><A NAME="SEC33" HREF="manual_toc.html#TOC33">Handling embedded compressed data streams</A></H3> + +<P> +The high-level library facilitates use of +<CODE>bzip2</CODE> data streams which form some part of a surrounding, larger +data stream. + +<UL> +<LI>For writing, the library takes an open file handle, writes + +compressed data to it, <CODE>fflush</CODE>es it but does not <CODE>fclose</CODE> it. +The calling application can write its own data before and after the +compressed data stream, using that same file handle. +<LI>Reading is more complex, and the facilities are not as general + +as they could be since generality is hard to reconcile with efficiency. +<CODE>BZ2_bzRead</CODE> reads from the compressed file in blocks of size +<CODE>BZ_MAX_UNUSED</CODE> bytes, and in doing so probably will overshoot +the logical end of compressed stream. +To recover this data once decompression has +ended, call <CODE>BZ2_bzReadGetUnused</CODE> after the last call of <CODE>BZ2_bzRead</CODE> +(the one returning <CODE>BZ_STREAM_END</CODE>) but before calling +<CODE>BZ2_bzReadClose</CODE>. +</UL> + +<P> +This mechanism makes it easy to decompress multiple <CODE>bzip2</CODE> +streams placed end-to-end. As the end of one stream, when <CODE>BZ2_bzRead</CODE> +returns <CODE>BZ_STREAM_END</CODE>, call <CODE>BZ2_bzReadGetUnused</CODE> to collect the +unused data (copy it into your own buffer somewhere). +That data forms the start of the next compressed stream. +To start uncompressing that next stream, call <CODE>BZ2_bzReadOpen</CODE> again, +feeding in the unused data via the <CODE>unused</CODE>/<CODE>nUnused</CODE> +parameters. +Keep doing this until <CODE>BZ_STREAM_END</CODE> return coincides with the +physical end of file (<CODE>feof(f)</CODE>). In this situation +<CODE>BZ2_bzReadGetUnused</CODE> +will of course return no data. + +</P> +<P> +This should give some feel for how the high-level interface can be used. +If you require extra flexibility, you'll have to bite the bullet and get +to grips with the low-level interface. + +</P> + + +<H3><A NAME="SEC34" HREF="manual_toc.html#TOC34">Standard file-reading/writing code</A></H3> +<P> +Here's how you'd write data to a compressed file: + +<PRE> +FILE* f; +BZFILE* b; +int nBuf; +char buf[ /* whatever size you like */ ]; +int bzerror; +int nWritten; + +f = fopen ( "myfile.bz2", "w" ); +if (!f) { + /* handle error */ +} +b = BZ2_bzWriteOpen ( &bzerror, f, 9 ); +if (bzerror != BZ_OK) { + BZ2_bzWriteClose ( b ); + /* handle error */ +} + +while ( /* condition */ ) { + /* get data to write into buf, and set nBuf appropriately */ + nWritten = BZ2_bzWrite ( &bzerror, b, buf, nBuf ); + if (bzerror == BZ_IO_ERROR) { + BZ2_bzWriteClose ( &bzerror, b ); + /* handle error */ + } +} + +BZ2_bzWriteClose ( &bzerror, b ); +if (bzerror == BZ_IO_ERROR) { + /* handle error */ +} +</PRE> + +<P> +And to read from a compressed file: + +<PRE> +FILE* f; +BZFILE* b; +int nBuf; +char buf[ /* whatever size you like */ ]; +int bzerror; +int nWritten; + +f = fopen ( "myfile.bz2", "r" ); +if (!f) { + /* handle error */ +} +b = BZ2_bzReadOpen ( &bzerror, f, 0, NULL, 0 ); +if (bzerror != BZ_OK) { + BZ2_bzReadClose ( &bzerror, b ); + /* handle error */ +} + +bzerror = BZ_OK; +while (bzerror == BZ_OK && /* arbitrary other conditions */) { + nBuf = BZ2_bzRead ( &bzerror, b, buf, /* size of buf */ ); + if (bzerror == BZ_OK) { + /* do something with buf[0 .. nBuf-1] */ + } +} +if (bzerror != BZ_STREAM_END) { + BZ2_bzReadClose ( &bzerror, b ); + /* handle error */ +} else { + BZ2_bzReadClose ( &bzerror ); +} +</PRE> + + + +<H2><A NAME="SEC35" HREF="manual_toc.html#TOC35">Utility functions</A></H2> + + +<H3><A NAME="SEC36" HREF="manual_toc.html#TOC36"><CODE>BZ2_bzBuffToBuffCompress</CODE></A></H3> + +<PRE> + int BZ2_bzBuffToBuffCompress( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int blockSize100k, + int verbosity, + int workFactor ); +</PRE> + +<P> +Attempts to compress the data in <CODE>source[0 .. sourceLen-1]</CODE> +into the destination buffer, <CODE>dest[0 .. *destLen-1]</CODE>. +If the destination buffer is big enough, <CODE>*destLen</CODE> is +set to the size of the compressed data, and <CODE>BZ_OK</CODE> is +returned. If the compressed data won't fit, <CODE>*destLen</CODE> +is unchanged, and <CODE>BZ_OUTBUFF_FULL</CODE> is returned. + +</P> +<P> +Compression in this manner is a one-shot event, done with a single call +to this function. The resulting compressed data is a complete +<CODE>bzip2</CODE> format data stream. There is no mechanism for making +additional calls to provide extra input data. If you want that kind of +mechanism, use the low-level interface. + +</P> +<P> +For the meaning of parameters <CODE>blockSize100k</CODE>, <CODE>verbosity</CODE> +and <CODE>workFactor</CODE>, <BR> see <CODE>BZ2_bzCompressInit</CODE>. + +</P> +<P> +To guarantee that the compressed data will fit in its buffer, allocate +an output buffer of size 1% larger than the uncompressed data, plus +six hundred extra bytes. + +</P> +<P> +<CODE>BZ2_bzBuffToBuffDecompress</CODE> will not write data at or +beyond <CODE>dest[*destLen]</CODE>, even in case of buffer overflow. + +</P> +<P> +Possible return values: + +<PRE> + <CODE>BZ_CONFIG_ERROR</CODE> + if the library has been mis-compiled + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>dest</CODE> is <CODE>NULL</CODE> or <CODE>destLen</CODE> is <CODE>NULL</CODE> + or <CODE>blockSize100k < 1</CODE> or <CODE>blockSize100k > 9</CODE> + or <CODE>verbosity < 0</CODE> or <CODE>verbosity > 4</CODE> + or <CODE>workFactor < 0</CODE> or <CODE>workFactor > 250</CODE> + <CODE>BZ_MEM_ERROR</CODE> + if insufficient memory is available + <CODE>BZ_OUTBUFF_FULL</CODE> + if the size of the compressed data exceeds <CODE>*destLen</CODE> + <CODE>BZ_OK</CODE> + otherwise +</PRE> + + + +<H3><A NAME="SEC37" HREF="manual_toc.html#TOC37"><CODE>BZ2_bzBuffToBuffDecompress</CODE></A></H3> + +<PRE> + int BZ2_bzBuffToBuffDecompress ( char* dest, + unsigned int* destLen, + char* source, + unsigned int sourceLen, + int small, + int verbosity ); +</PRE> + +<P> +Attempts to decompress the data in <CODE>source[0 .. sourceLen-1]</CODE> +into the destination buffer, <CODE>dest[0 .. *destLen-1]</CODE>. +If the destination buffer is big enough, <CODE>*destLen</CODE> is +set to the size of the uncompressed data, and <CODE>BZ_OK</CODE> is +returned. If the compressed data won't fit, <CODE>*destLen</CODE> +is unchanged, and <CODE>BZ_OUTBUFF_FULL</CODE> is returned. + +</P> +<P> +<CODE>source</CODE> is assumed to hold a complete <CODE>bzip2</CODE> format +data stream. <BR> <CODE>BZ2_bzBuffToBuffDecompress</CODE> tries to decompress +the entirety of the stream into the output buffer. + +</P> +<P> +For the meaning of parameters <CODE>small</CODE> and <CODE>verbosity</CODE>, +see <CODE>BZ2_bzDecompressInit</CODE>. + +</P> +<P> +Because the compression ratio of the compressed data cannot be known in +advance, there is no easy way to guarantee that the output buffer will +be big enough. You may of course make arrangements in your code to +record the size of the uncompressed data, but such a mechanism is beyond +the scope of this library. + +</P> +<P> +<CODE>BZ2_bzBuffToBuffDecompress</CODE> will not write data at or +beyond <CODE>dest[*destLen]</CODE>, even in case of buffer overflow. + +</P> +<P> +Possible return values: + +<PRE> + <CODE>BZ_CONFIG_ERROR</CODE> + if the library has been mis-compiled + <CODE>BZ_PARAM_ERROR</CODE> + if <CODE>dest</CODE> is <CODE>NULL</CODE> or <CODE>destLen</CODE> is <CODE>NULL</CODE> + or <CODE>small != 0 && small != 1</CODE> + or <CODE>verbosity < 0</CODE> or <CODE>verbosity > 4</CODE> + <CODE>BZ_MEM_ERROR</CODE> + if insufficient memory is available + <CODE>BZ_OUTBUFF_FULL</CODE> + if the size of the compressed data exceeds <CODE>*destLen</CODE> + <CODE>BZ_DATA_ERROR</CODE> + if a data integrity error was detected in the compressed data + <CODE>BZ_DATA_ERROR_MAGIC</CODE> + if the compressed data doesn't begin with the right magic bytes + <CODE>BZ_UNEXPECTED_EOF</CODE> + if the compressed data ends unexpectedly + <CODE>BZ_OK</CODE> + otherwise +</PRE> + + + +<H2><A NAME="SEC38" HREF="manual_toc.html#TOC38"><CODE>zlib</CODE> compatibility functions</A></H2> +<P> +Yoshioka Tsuneo has contributed some functions to +give better <CODE>zlib</CODE> compatibility. These functions are +<CODE>BZ2_bzopen</CODE>, <CODE>BZ2_bzread</CODE>, <CODE>BZ2_bzwrite</CODE>, <CODE>BZ2_bzflush</CODE>, +<CODE>BZ2_bzclose</CODE>, +<CODE>BZ2_bzerror</CODE> and <CODE>BZ2_bzlibVersion</CODE>. +These functions are not (yet) officially part of +the library. If they break, you get to keep all the pieces. +Nevertheless, I think they work ok. + +<PRE> +typedef void BZFILE; + +const char * BZ2_bzlibVersion ( void ); +</PRE> + +<P> +Returns a string indicating the library version. + +<PRE> +BZFILE * BZ2_bzopen ( const char *path, const char *mode ); +BZFILE * BZ2_bzdopen ( int fd, const char *mode ); +</PRE> + +<P> +Opens a <CODE>.bz2</CODE> file for reading or writing, using either its name +or a pre-existing file descriptor. +Analogous to <CODE>fopen</CODE> and <CODE>fdopen</CODE>. + +<PRE> +int BZ2_bzread ( BZFILE* b, void* buf, int len ); +int BZ2_bzwrite ( BZFILE* b, void* buf, int len ); +</PRE> + +<P> +Reads/writes data from/to a previously opened <CODE>BZFILE</CODE>. +Analogous to <CODE>fread</CODE> and <CODE>fwrite</CODE>. + +<PRE> +int BZ2_bzflush ( BZFILE* b ); +void BZ2_bzclose ( BZFILE* b ); +</PRE> + +<P> +Flushes/closes a <CODE>BZFILE</CODE>. <CODE>BZ2_bzflush</CODE> doesn't actually do +anything. Analogous to <CODE>fflush</CODE> and <CODE>fclose</CODE>. + +</P> + +<PRE> +const char * BZ2_bzerror ( BZFILE *b, int *errnum ) +</PRE> + +<P> +Returns a string describing the more recent error status of +<CODE>b</CODE>, and also sets <CODE>*errnum</CODE> to its numerical value. + +</P> + + + +<H2><A NAME="SEC39" HREF="manual_toc.html#TOC39">Using the library in a <CODE>stdio</CODE>-free environment</A></H2> + + + +<H3><A NAME="SEC40" HREF="manual_toc.html#TOC40">Getting rid of <CODE>stdio</CODE></A></H3> + +<P> +In a deeply embedded application, you might want to use just +the memory-to-memory functions. You can do this conveniently +by compiling the library with preprocessor symbol <CODE>BZ_NO_STDIO</CODE> +defined. Doing this gives you a library containing only the following +eight functions: + +</P> +<P> +<CODE>BZ2_bzCompressInit</CODE>, <CODE>BZ2_bzCompress</CODE>, <CODE>BZ2_bzCompressEnd</CODE> <BR> +<CODE>BZ2_bzDecompressInit</CODE>, <CODE>BZ2_bzDecompress</CODE>, <CODE>BZ2_bzDecompressEnd</CODE> <BR> +<CODE>BZ2_bzBuffToBuffCompress</CODE>, <CODE>BZ2_bzBuffToBuffDecompress</CODE> + +</P> +<P> +When compiled like this, all functions will ignore <CODE>verbosity</CODE> +settings. + +</P> + + +<H3><A NAME="SEC41" HREF="manual_toc.html#TOC41">Critical error handling</A></H3> +<P> +<CODE>libbzip2</CODE> contains a number of internal assertion checks which +should, needless to say, never be activated. Nevertheless, if an +assertion should fail, behaviour depends on whether or not the library +was compiled with <CODE>BZ_NO_STDIO</CODE> set. + +</P> +<P> +For a normal compile, an assertion failure yields the message + +<PRE> + bzip2/libbzip2: internal error number N. + This is a bug in bzip2/libbzip2, 1.0 of 21-Mar-2000. + Please report it to me at: jseward@acm.org. If this happened + when you were using some program which uses libbzip2 as a + component, you should also report this bug to the author(s) + of that program. Please make an effort to report this bug; + timely and accurate bug reports eventually lead to higher + quality software. Thanks. Julian Seward, 21 March 2000. +</PRE> + +<P> +where <CODE>N</CODE> is some error code number. <CODE>exit(3)</CODE> +is then called. + +</P> +<P> +For a <CODE>stdio</CODE>-free library, assertion failures result +in a call to a function declared as: + +<PRE> + extern void bz_internal_error ( int errcode ); +</PRE> + +<P> +The relevant code is passed as a parameter. You should supply +such a function. + +</P> +<P> +In either case, once an assertion failure has occurred, any +<CODE>bz_stream</CODE> records involved can be regarded as invalid. +You should not attempt to resume normal operation with them. + +</P> +<P> +You may, of course, change critical error handling to suit +your needs. As I said above, critical errors indicate bugs +in the library and should not occur. All "normal" error +situations are indicated via error return codes from functions, +and can be recovered from. + +</P> + + + +<H2><A NAME="SEC42" HREF="manual_toc.html#TOC42">Making a Windows DLL</A></H2> +<P> +Everything related to Windows has been contributed by Yoshioka Tsuneo +<BR> (<CODE>QWF00133@niftyserve.or.jp</CODE> / +<CODE>tsuneo-y@is.aist-nara.ac.jp</CODE>), so you should send your queries to +him (but perhaps Cc: me, <CODE>jseward@acm.org</CODE>). + +</P> +<P> +My vague understanding of what to do is: using Visual C++ 5.0, +open the project file <CODE>libbz2.dsp</CODE>, and build. That's all. + +</P> +<P> +If you can't +open the project file for some reason, make a new one, naming these files: +<CODE>blocksort.c</CODE>, <CODE>bzlib.c</CODE>, <CODE>compress.c</CODE>, +<CODE>crctable.c</CODE>, <CODE>decompress.c</CODE>, <CODE>huffman.c</CODE>, <BR> +<CODE>randtable.c</CODE> and <CODE>libbz2.def</CODE>. You will also need +to name the header files <CODE>bzlib.h</CODE> and <CODE>bzlib_private.h</CODE>. + +</P> +<P> +If you don't use VC++, you may need to define the proprocessor symbol +<CODE>_WIN32</CODE>. + +</P> +<P> +Finally, <CODE>dlltest.c</CODE> is a sample program using the DLL. It has a +project file, <CODE>dlltest.dsp</CODE>. + +</P> +<P> +If you just want a makefile for Visual C, have a look at +<CODE>makefile.msc</CODE>. + +</P> +<P> +Be aware that if you compile <CODE>bzip2</CODE> itself on Win32, you must set +<CODE>BZ_UNIX</CODE> to 0 and <CODE>BZ_LCCWIN32</CODE> to 1, in the file +<CODE>bzip2.c</CODE>, before compiling. Otherwise the resulting binary won't +work correctly. + +</P> +<P> +I haven't tried any of this stuff myself, but it all looks plausible. + +</P> + +<P><HR><P> +<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_2.html">previous</A>, <A HREF="manual_4.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>. +</BODY> +</HTML> diff --git a/bzip2/manual_4.html b/bzip2/manual_4.html new file mode 100644 index 000000000..9ab7fb24f --- /dev/null +++ b/bzip2/manual_4.html @@ -0,0 +1,528 @@ +<HTML> +<HEAD> +<!-- This HTML file has been created by texi2html 1.54 + from manual.texi on 23 March 2000 --> + +<TITLE>bzip2 and libbzip2 - Miscellanea</TITLE> +<link href="manual_3.html" rel=Previous> +<link href="manual_toc.html" rel=ToC> + +</HEAD> +<BODY> +<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_3.html">previous</A>, next, last section, <A HREF="manual_toc.html">table of contents</A>. +<P><HR><P> + + +<H1><A NAME="SEC43" HREF="manual_toc.html#TOC43">Miscellanea</A></H1> + +<P> +These are just some random thoughts of mine. Your mileage may +vary. + +</P> + + +<H2><A NAME="SEC44" HREF="manual_toc.html#TOC44">Limitations of the compressed file format</A></H2> +<P> +<CODE>bzip2-1.0</CODE>, <CODE>0.9.5</CODE> and <CODE>0.9.0</CODE> +use exactly the same file format as the previous +version, <CODE>bzip2-0.1</CODE>. This decision was made in the interests of +stability. Creating yet another incompatible compressed file format +would create further confusion and disruption for users. + +</P> +<P> +Nevertheless, this is not a painless decision. Development +work since the release of <CODE>bzip2-0.1</CODE> in August 1997 +has shown complexities in the file format which slow down +decompression and, in retrospect, are unnecessary. These are: + +<UL> +<LI>The run-length encoder, which is the first of the + + compression transformations, is entirely irrelevant. + The original purpose was to protect the sorting algorithm + from the very worst case input: a string of repeated + symbols. But algorithm steps Q6a and Q6b in the original + Burrows-Wheeler technical report (SRC-124) show how + repeats can be handled without difficulty in block + sorting. +<LI>The randomisation mechanism doesn't really need to be + + there. Udi Manber and Gene Myers published a suffix + array construction algorithm a few years back, which + can be employed to sort any block, no matter how + repetitive, in O(N log N) time. Subsequent work by + Kunihiko Sadakane has produced a derivative O(N (log N)^2) + algorithm which usually outperforms the Manber-Myers + algorithm. + + I could have changed to Sadakane's algorithm, but I find + it to be slower than <CODE>bzip2</CODE>'s existing algorithm for + most inputs, and the randomisation mechanism protects + adequately against bad cases. I didn't think it was + a good tradeoff to make. Partly this is due to the fact + that I was not flooded with email complaints about + <CODE>bzip2-0.1</CODE>'s performance on repetitive data, so + perhaps it isn't a problem for real inputs. + + Probably the best long-term solution, + and the one I have incorporated into 0.9.5 and above, + is to use the existing sorting + algorithm initially, and fall back to a O(N (log N)^2) + algorithm if the standard algorithm gets into difficulties. +<LI>The compressed file format was never designed to be + + handled by a library, and I have had to jump though + some hoops to produce an efficient implementation of + decompression. It's a bit hairy. Try passing + <CODE>decompress.c</CODE> through the C preprocessor + and you'll see what I mean. Much of this complexity + could have been avoided if the compressed size of + each block of data was recorded in the data stream. +<LI>An Adler-32 checksum, rather than a CRC32 checksum, + + would be faster to compute. +</UL> + +<P> +It would be fair to say that the <CODE>bzip2</CODE> format was frozen +before I properly and fully understood the performance +consequences of doing so. + +</P> +<P> +Improvements which I was able to incorporate into +0.9.0, despite using the same file format, are: + +<UL> +<LI>Single array implementation of the inverse BWT. This + + significantly speeds up decompression, presumably + because it reduces the number of cache misses. +<LI>Faster inverse MTF transform for large MTF values. The + + new implementation is based on the notion of sliding blocks + of values. +<LI><CODE>bzip2-0.9.0</CODE> now reads and writes files with <CODE>fread</CODE> + + and <CODE>fwrite</CODE>; version 0.1 used <CODE>putc</CODE> and <CODE>getc</CODE>. + Duh! Well, you live and learn. + +</UL> + +<P> +Further ahead, it would be nice +to be able to do random access into files. This will +require some careful design of compressed file formats. + +</P> + + + +<H2><A NAME="SEC45" HREF="manual_toc.html#TOC45">Portability issues</A></H2> +<P> +After some consideration, I have decided not to use +GNU <CODE>autoconf</CODE> to configure 0.9.5 or 1.0. + +</P> +<P> +<CODE>autoconf</CODE>, admirable and wonderful though it is, +mainly assists with portability problems between Unix-like +platforms. But <CODE>bzip2</CODE> doesn't have much in the way +of portability problems on Unix; most of the difficulties appear +when porting to the Mac, or to Microsoft's operating systems. +<CODE>autoconf</CODE> doesn't help in those cases, and brings in a +whole load of new complexity. + +</P> +<P> +Most people should be able to compile the library and program +under Unix straight out-of-the-box, so to speak, especially +if you have a version of GNU C available. + +</P> +<P> +There are a couple of <CODE>__inline__</CODE> directives in the code. GNU C +(<CODE>gcc</CODE>) should be able to handle them. If you're not using +GNU C, your C compiler shouldn't see them at all. +If your compiler does, for some reason, see them and doesn't +like them, just <CODE>#define</CODE> <CODE>__inline__</CODE> to be <CODE>/* */</CODE>. One +easy way to do this is to compile with the flag <CODE>-D__inline__=</CODE>, +which should be understood by most Unix compilers. + +</P> +<P> +If you still have difficulties, try compiling with the macro +<CODE>BZ_STRICT_ANSI</CODE> defined. This should enable you to build the +library in a strictly ANSI compliant environment. Building the program +itself like this is dangerous and not supported, since you remove +<CODE>bzip2</CODE>'s checks against compressing directories, symbolic links, +devices, and other not-really-a-file entities. This could cause +filesystem corruption! + +</P> +<P> +One other thing: if you create a <CODE>bzip2</CODE> binary for public +distribution, please try and link it statically (<CODE>gcc -s</CODE>). This +avoids all sorts of library-version issues that others may encounter +later on. + +</P> +<P> +If you build <CODE>bzip2</CODE> on Win32, you must set <CODE>BZ_UNIX</CODE> to 0 and +<CODE>BZ_LCCWIN32</CODE> to 1, in the file <CODE>bzip2.c</CODE>, before compiling. +Otherwise the resulting binary won't work correctly. + +</P> + + + +<H2><A NAME="SEC46" HREF="manual_toc.html#TOC46">Reporting bugs</A></H2> +<P> +I tried pretty hard to make sure <CODE>bzip2</CODE> is +bug free, both by design and by testing. Hopefully +you'll never need to read this section for real. + +</P> +<P> +Nevertheless, if <CODE>bzip2</CODE> dies with a segmentation +fault, a bus error or an internal assertion failure, it +will ask you to email me a bug report. Experience with +version 0.1 shows that almost all these problems can +be traced to either compiler bugs or hardware problems. + +<UL> +<LI> + +Recompile the program with no optimisation, and see if it +works. And/or try a different compiler. +I heard all sorts of stories about various flavours +of GNU C (and other compilers) generating bad code for +<CODE>bzip2</CODE>, and I've run across two such examples myself. + +2.7.X versions of GNU C are known to generate bad code from +time to time, at high optimisation levels. +If you get problems, try using the flags +<CODE>-O2</CODE> <CODE>-fomit-frame-pointer</CODE> <CODE>-fno-strength-reduce</CODE>. +You should specifically <EM>not</EM> use <CODE>-funroll-loops</CODE>. + +You may notice that the Makefile runs six tests as part of +the build process. If the program passes all of these, it's +a pretty good (but not 100%) indication that the compiler has +done its job correctly. +<LI> + +If <CODE>bzip2</CODE> crashes randomly, and the crashes are not +repeatable, you may have a flaky memory subsystem. <CODE>bzip2</CODE> +really hammers your memory hierarchy, and if it's a bit marginal, +you may get these problems. Ditto if your disk or I/O subsystem +is slowly failing. Yup, this really does happen. + +Try using a different machine of the same type, and see if +you can repeat the problem. +<LI>This isn't really a bug, but ... If <CODE>bzip2</CODE> tells + +you your file is corrupted on decompression, and you +obtained the file via FTP, there is a possibility that you +forgot to tell FTP to do a binary mode transfer. That absolutely +will cause the file to be non-decompressible. You'll have to transfer +it again. +</UL> + +<P> +If you've incorporated <CODE>libbzip2</CODE> into your own program +and are getting problems, please, please, please, check that the +parameters you are passing in calls to the library, are +correct, and in accordance with what the documentation says +is allowable. I have tried to make the library robust against +such problems, but I'm sure I haven't succeeded. + +</P> +<P> +Finally, if the above comments don't help, you'll have to send +me a bug report. Now, it's just amazing how many people will +send me a bug report saying something like + +<PRE> + bzip2 crashed with segmentation fault on my machine +</PRE> + +<P> +and absolutely nothing else. Needless to say, a such a report +is <EM>totally, utterly, completely and comprehensively 100% useless; +a waste of your time, my time, and net bandwidth</EM>. +With no details at all, there's no way I can possibly begin +to figure out what the problem is. + +</P> +<P> +The rules of the game are: facts, facts, facts. Don't omit +them because "oh, they won't be relevant". At the bare +minimum: + +<PRE> + Machine type. Operating system version. + Exact version of <CODE>bzip2</CODE> (do <CODE>bzip2 -V</CODE>). + Exact version of the compiler used. + Flags passed to the compiler. +</PRE> + +<P> +However, the most important single thing that will help me is +the file that you were trying to compress or decompress at the +time the problem happened. Without that, my ability to do anything +more than speculate about the cause, is limited. + +</P> +<P> +Please remember that I connect to the Internet with a modem, so +you should contact me before mailing me huge files. + +</P> + + + +<H2><A NAME="SEC47" HREF="manual_toc.html#TOC47">Did you get the right package?</A></H2> + +<P> +<CODE>bzip2</CODE> is a resource hog. It soaks up large amounts of CPU cycles +and memory. Also, it gives very large latencies. In the worst case, you +can feed many megabytes of uncompressed data into the library before +getting any compressed output, so this probably rules out applications +requiring interactive behaviour. + +</P> +<P> +These aren't faults of my implementation, I hope, but more +an intrinsic property of the Burrows-Wheeler transform (unfortunately). +Maybe this isn't what you want. + +</P> +<P> +If you want a compressor and/or library which is faster, uses less +memory but gets pretty good compression, and has minimal latency, +consider Jean-loup +Gailly's and Mark Adler's work, <CODE>zlib-1.1.2</CODE> and +<CODE>gzip-1.2.4</CODE>. Look for them at + +</P> +<P> +<CODE>http://www.cdrom.com/pub/infozip/zlib</CODE> and +<CODE>http://www.gzip.org</CODE> respectively. + +</P> +<P> +For something faster and lighter still, you might try Markus F X J +Oberhumer's <CODE>LZO</CODE> real-time compression/decompression library, at +<BR> <CODE>http://wildsau.idv.uni-linz.ac.at/mfx/lzo.html</CODE>. + +</P> +<P> +If you want to use the <CODE>bzip2</CODE> algorithms to compress small blocks +of data, 64k bytes or smaller, for example on an on-the-fly disk +compressor, you'd be well advised not to use this library. Instead, +I've made a special library tuned for that kind of use. It's part of +<CODE>e2compr-0.40</CODE>, an on-the-fly disk compressor for the Linux +<CODE>ext2</CODE> filesystem. Look at +<CODE>http://www.netspace.net.au/~reiter/e2compr</CODE>. + +</P> + + + +<H2><A NAME="SEC48" HREF="manual_toc.html#TOC48">Testing</A></H2> + +<P> +A record of the tests I've done. + +</P> +<P> +First, some data sets: + +<UL> +<LI>B: a directory containing 6001 files, one for every length in the + + range 0 to 6000 bytes. The files contain random lowercase + letters. 18.7 megabytes. +<LI>H: my home directory tree. Documents, source code, mail files, + + compressed data. H contains B, and also a directory of + files designed as boundary cases for the sorting; mostly very + repetitive, nasty files. 565 megabytes. +<LI>A: directory tree holding various applications built from source: + + <CODE>egcs</CODE>, <CODE>gcc-2.8.1</CODE>, KDE, GTK, Octave, etc. + 2200 megabytes. +</UL> + +<P> +The tests conducted are as follows. Each test means compressing +(a copy of) each file in the data set, decompressing it and +comparing it against the original. + +</P> +<P> +First, a bunch of tests with block sizes and internal buffer +sizes set very small, +to detect any problems with the +blocking and buffering mechanisms. +This required modifying the source code so as to try to +break it. + +<OL> +<LI>Data set H, with + + buffer size of 1 byte, and block size of 23 bytes. +<LI>Data set B, buffer sizes 1 byte, block size 1 byte. + +<LI>As (2) but small-mode decompression. + +<LI>As (2) with block size 2 bytes. + +<LI>As (2) with block size 3 bytes. + +<LI>As (2) with block size 4 bytes. + +<LI>As (2) with block size 5 bytes. + +<LI>As (2) with block size 6 bytes and small-mode decompression. + +<LI>H with buffer size of 1 byte, but normal block + + size (up to 900000 bytes). +</OL> + +<P> +Then some tests with unmodified source code. + +<OL> +<LI>H, all settings normal. + +<LI>As (1), with small-mode decompress. + +<LI>H, compress with flag <CODE>-1</CODE>. + +<LI>H, compress with flag <CODE>-s</CODE>, decompress with flag <CODE>-s</CODE>. + +<LI>Forwards compatibility: H, <CODE>bzip2-0.1pl2</CODE> compressing, + + <CODE>bzip2-0.9.5</CODE> decompressing, all settings normal. +<LI>Backwards compatibility: H, <CODE>bzip2-0.9.5</CODE> compressing, + + <CODE>bzip2-0.1pl2</CODE> decompressing, all settings normal. +<LI>Bigger tests: A, all settings normal. + +<LI>As (7), using the fallback (Sadakane-like) sorting algorithm. + +<LI>As (8), compress with flag <CODE>-1</CODE>, decompress with flag + + <CODE>-s</CODE>. +<LI>H, using the fallback sorting algorithm. + +<LI>Forwards compatibility: A, <CODE>bzip2-0.1pl2</CODE> compressing, + + <CODE>bzip2-0.9.5</CODE> decompressing, all settings normal. +<LI>Backwards compatibility: A, <CODE>bzip2-0.9.5</CODE> compressing, + + <CODE>bzip2-0.1pl2</CODE> decompressing, all settings normal. +<LI>Misc test: about 400 megabytes of <CODE>.tar</CODE> files with + + <CODE>bzip2</CODE> compiled with Checker (a memory access error + detector, like Purify). +<LI>Misc tests to make sure it builds and runs ok on non-Linux/x86 + + platforms. +</OL> + +<P> +These tests were conducted on a 225 MHz IDT WinChip machine, running +Linux 2.0.36. They represent nearly a week of continuous computation. +All tests completed successfully. + +</P> + + + +<H2><A NAME="SEC49" HREF="manual_toc.html#TOC49">Further reading</A></H2> +<P> +<CODE>bzip2</CODE> is not research work, in the sense that it doesn't present +any new ideas. Rather, it's an engineering exercise based on existing +ideas. + +</P> +<P> +Four documents describe essentially all the ideas behind <CODE>bzip2</CODE>: + +<PRE> +Michael Burrows and D. J. Wheeler: + "A block-sorting lossless data compression algorithm" + 10th May 1994. + Digital SRC Research Report 124. + ftp://ftp.digital.com/pub/DEC/SRC/research-reports/SRC-124.ps.gz + If you have trouble finding it, try searching at the + New Zealand Digital Library, http://www.nzdl.org. + +Daniel S. Hirschberg and Debra A. LeLewer + "Efficient Decoding of Prefix Codes" + Communications of the ACM, April 1990, Vol 33, Number 4. + You might be able to get an electronic copy of this + from the ACM Digital Library. + +David J. Wheeler + Program bred3.c and accompanying document bred3.ps. + This contains the idea behind the multi-table Huffman + coding scheme. + ftp://ftp.cl.cam.ac.uk/users/djw3/ + +Jon L. Bentley and Robert Sedgewick + "Fast Algorithms for Sorting and Searching Strings" + Available from Sedgewick's web page, + www.cs.princeton.edu/~rs +</PRE> + +<P> +The following paper gives valuable additional insights into the +algorithm, but is not immediately the basis of any code +used in bzip2. + +<PRE> +Peter Fenwick: + Block Sorting Text Compression + Proceedings of the 19th Australasian Computer Science Conference, + Melbourne, Australia. Jan 31 - Feb 2, 1996. + ftp://ftp.cs.auckland.ac.nz/pub/peter-f/ACSC96paper.ps +</PRE> + +<P> +Kunihiko Sadakane's sorting algorithm, mentioned above, +is available from: + +<PRE> +http://naomi.is.s.u-tokyo.ac.jp/~sada/papers/Sada98b.ps.gz +</PRE> + +<P> +The Manber-Myers suffix array construction +algorithm is described in a paper +available from: + +<PRE> +http://www.cs.arizona.edu/people/gene/PAPERS/suffix.ps +</PRE> + +<P> +Finally, the following paper documents some recent investigations +I made into the performance of sorting algorithms: + +<PRE> +Julian Seward: + On the Performance of BWT Sorting Algorithms + Proceedings of the IEEE Data Compression Conference 2000 + Snowbird, Utah. 28-30 March 2000. +</PRE> + +<P><HR><P> +<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_3.html">previous</A>, next, last section, <A HREF="manual_toc.html">table of contents</A>. +</BODY> +</HTML> diff --git a/bzip2/manual_toc.html b/bzip2/manual_toc.html new file mode 100644 index 000000000..d4132c435 --- /dev/null +++ b/bzip2/manual_toc.html @@ -0,0 +1,173 @@ +<HTML> +<HEAD> +<!-- This HTML file has been created by texi2html 1.54 + from manual.texi on 23 March 2000 --> + +<TITLE>bzip2 and libbzip2 - Table of Contents</TITLE> + +</HEAD> +<BODY> +<H1>bzip2 and libbzip2</H1> +<H2>a program and library for data compression</H2> +<H2>copyright (C) 1996-2000 Julian Seward</H2> +<H2>version 1.0 of 21 March 2000</H2> +<ADDRESS>Julian Seward</ADDRESS> +<P> +<P><HR><P> + +<P> +This program, <CODE>bzip2</CODE>, +and associated library <CODE>libbzip2</CODE>, are +Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + +</P> +<P> +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: + +<UL> +<LI> + + Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. +<LI> + + The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. +<LI> + + Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. +<LI> + + The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. +</UL> + +<P> +THIS SOFTWARE IS PROVIDED BY THE AUTHOR "AS IS" AND ANY EXPRESS +OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, +WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +</P> +<P> +Julian Seward, Cambridge, UK. + +</P> +<P> +<CODE>jseward@acm.org</CODE> + +</P> +<P> +<CODE>http://sourceware.cygnus.com/bzip2</CODE> + +</P> +<P> +<CODE>http://www.cacheprof.org</CODE> + +</P> +<P> +<CODE>http://www.muraroa.demon.co.uk</CODE> + +</P> +<P> +<CODE>bzip2</CODE>/<CODE>libbzip2</CODE> version 1.0 of 21 March 2000. + +</P> +<P> +PATENTS: To the best of my knowledge, <CODE>bzip2</CODE> does not use any patented +algorithms. However, I do not have the resources available to carry out +a full patent search. Therefore I cannot give any guarantee of the +above statement. + +</P> + +<UL> +<LI><A NAME="TOC1" HREF="manual_1.html#SEC1">Introduction</A> +<LI><A NAME="TOC2" HREF="manual_2.html#SEC2">How to use <CODE>bzip2</CODE></A> +<UL> +<UL> +<UL> +<LI><A NAME="TOC3" HREF="manual_2.html#SEC3">NAME</A> +<LI><A NAME="TOC4" HREF="manual_2.html#SEC4">SYNOPSIS</A> +<LI><A NAME="TOC5" HREF="manual_2.html#SEC5">DESCRIPTION</A> +<LI><A NAME="TOC6" HREF="manual_2.html#SEC6">OPTIONS</A> +<LI><A NAME="TOC7" HREF="manual_2.html#SEC7">MEMORY MANAGEMENT</A> +<LI><A NAME="TOC8" HREF="manual_2.html#SEC8">RECOVERING DATA FROM DAMAGED FILES</A> +<LI><A NAME="TOC9" HREF="manual_2.html#SEC9">PERFORMANCE NOTES</A> +<LI><A NAME="TOC10" HREF="manual_2.html#SEC10">CAVEATS</A> +<LI><A NAME="TOC11" HREF="manual_2.html#SEC11">AUTHOR</A> +</UL> +</UL> +</UL> +<LI><A NAME="TOC12" HREF="manual_3.html#SEC12">Programming with <CODE>libbzip2</CODE></A> +<UL> +<LI><A NAME="TOC13" HREF="manual_3.html#SEC13">Top-level structure</A> +<UL> +<LI><A NAME="TOC14" HREF="manual_3.html#SEC14">Low-level summary</A> +<LI><A NAME="TOC15" HREF="manual_3.html#SEC15">High-level summary</A> +<LI><A NAME="TOC16" HREF="manual_3.html#SEC16">Utility functions summary</A> +</UL> +<LI><A NAME="TOC17" HREF="manual_3.html#SEC17">Error handling</A> +<LI><A NAME="TOC18" HREF="manual_3.html#SEC18">Low-level interface</A> +<UL> +<LI><A NAME="TOC19" HREF="manual_3.html#SEC19"><CODE>BZ2_bzCompressInit</CODE></A> +<LI><A NAME="TOC20" HREF="manual_3.html#SEC20"><CODE>BZ2_bzCompress</CODE></A> +<LI><A NAME="TOC21" HREF="manual_3.html#SEC21"><CODE>BZ2_bzCompressEnd</CODE></A> +<LI><A NAME="TOC22" HREF="manual_3.html#SEC22"><CODE>BZ2_bzDecompressInit</CODE></A> +<LI><A NAME="TOC23" HREF="manual_3.html#SEC23"><CODE>BZ2_bzDecompress</CODE></A> +<LI><A NAME="TOC24" HREF="manual_3.html#SEC24"><CODE>BZ2_bzDecompressEnd</CODE></A> +</UL> +<LI><A NAME="TOC25" HREF="manual_3.html#SEC25">High-level interface</A> +<UL> +<LI><A NAME="TOC26" HREF="manual_3.html#SEC26"><CODE>BZ2_bzReadOpen</CODE></A> +<LI><A NAME="TOC27" HREF="manual_3.html#SEC27"><CODE>BZ2_bzRead</CODE></A> +<LI><A NAME="TOC28" HREF="manual_3.html#SEC28"><CODE>BZ2_bzReadGetUnused</CODE></A> +<LI><A NAME="TOC29" HREF="manual_3.html#SEC29"><CODE>BZ2_bzReadClose</CODE></A> +<LI><A NAME="TOC30" HREF="manual_3.html#SEC30"><CODE>BZ2_bzWriteOpen</CODE></A> +<LI><A NAME="TOC31" HREF="manual_3.html#SEC31"><CODE>BZ2_bzWrite</CODE></A> +<LI><A NAME="TOC32" HREF="manual_3.html#SEC32"><CODE>BZ2_bzWriteClose</CODE></A> +<LI><A NAME="TOC33" HREF="manual_3.html#SEC33">Handling embedded compressed data streams</A> +<LI><A NAME="TOC34" HREF="manual_3.html#SEC34">Standard file-reading/writing code</A> +</UL> +<LI><A NAME="TOC35" HREF="manual_3.html#SEC35">Utility functions</A> +<UL> +<LI><A NAME="TOC36" HREF="manual_3.html#SEC36"><CODE>BZ2_bzBuffToBuffCompress</CODE></A> +<LI><A NAME="TOC37" HREF="manual_3.html#SEC37"><CODE>BZ2_bzBuffToBuffDecompress</CODE></A> +</UL> +<LI><A NAME="TOC38" HREF="manual_3.html#SEC38"><CODE>zlib</CODE> compatibility functions</A> +<LI><A NAME="TOC39" HREF="manual_3.html#SEC39">Using the library in a <CODE>stdio</CODE>-free environment</A> +<UL> +<LI><A NAME="TOC40" HREF="manual_3.html#SEC40">Getting rid of <CODE>stdio</CODE></A> +<LI><A NAME="TOC41" HREF="manual_3.html#SEC41">Critical error handling</A> +</UL> +<LI><A NAME="TOC42" HREF="manual_3.html#SEC42">Making a Windows DLL</A> +</UL> +<LI><A NAME="TOC43" HREF="manual_4.html#SEC43">Miscellanea</A> +<UL> +<LI><A NAME="TOC44" HREF="manual_4.html#SEC44">Limitations of the compressed file format</A> +<LI><A NAME="TOC45" HREF="manual_4.html#SEC45">Portability issues</A> +<LI><A NAME="TOC46" HREF="manual_4.html#SEC46">Reporting bugs</A> +<LI><A NAME="TOC47" HREF="manual_4.html#SEC47">Did you get the right package?</A> +<LI><A NAME="TOC48" HREF="manual_4.html#SEC48">Testing</A> +<LI><A NAME="TOC49" HREF="manual_4.html#SEC49">Further reading</A> +</UL> +</UL> +<P><HR><P> +This document was generated on 23 March 2000 using the +<A HREF="http://wwwcn.cern.ch/dci/texi2html/">texi2html</A> +translator version 1.51a.</P> +</BODY> +</HTML> diff --git a/bzip2/randtable.c b/bzip2/randtable.c new file mode 100644 index 000000000..983089d46 --- /dev/null +++ b/bzip2/randtable.c @@ -0,0 +1,124 @@ + +/*-------------------------------------------------------------*/ +/*--- Table for randomising repetitive blocks ---*/ +/*--- randtable.c ---*/ +/*-------------------------------------------------------------*/ + +/*-- + This file is a part of bzip2 and/or libbzip2, a program and + library for lossless, block-sorting data compression. + + Copyright (C) 1996-2000 Julian R Seward. All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. The origin of this software must not be misrepresented; you must + not claim that you wrote the original software. If you use this + software in a product, an acknowledgment in the product + documentation would be appreciated but is not required. + + 3. Altered source versions must be plainly marked as such, and must + not be misrepresented as being the original software. + + 4. The name of the author may not be used to endorse or promote + products derived from this software without specific prior written + permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS + OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY + DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, + WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS + SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + Julian Seward, Cambridge, UK. + jseward@acm.org + bzip2/libbzip2 version 1.0 of 21 March 2000 + + This program is based on (at least) the work of: + Mike Burrows + David Wheeler + Peter Fenwick + Alistair Moffat + Radford Neal + Ian H. Witten + Robert Sedgewick + Jon L. Bentley + + For more information on these sources, see the manual. +--*/ + + +#include "bzlib_private.h" + + +/*---------------------------------------------*/ +Int32 BZ2_rNums[512] = { + 619, 720, 127, 481, 931, 816, 813, 233, 566, 247, + 985, 724, 205, 454, 863, 491, 741, 242, 949, 214, + 733, 859, 335, 708, 621, 574, 73, 654, 730, 472, + 419, 436, 278, 496, 867, 210, 399, 680, 480, 51, + 878, 465, 811, 169, 869, 675, 611, 697, 867, 561, + 862, 687, 507, 283, 482, 129, 807, 591, 733, 623, + 150, 238, 59, 379, 684, 877, 625, 169, 643, 105, + 170, 607, 520, 932, 727, 476, 693, 425, 174, 647, + 73, 122, 335, 530, 442, 853, 695, 249, 445, 515, + 909, 545, 703, 919, 874, 474, 882, 500, 594, 612, + 641, 801, 220, 162, 819, 984, 589, 513, 495, 799, + 161, 604, 958, 533, 221, 400, 386, 867, 600, 782, + 382, 596, 414, 171, 516, 375, 682, 485, 911, 276, + 98, 553, 163, 354, 666, 933, 424, 341, 533, 870, + 227, 730, 475, 186, 263, 647, 537, 686, 600, 224, + 469, 68, 770, 919, 190, 373, 294, 822, 808, 206, + 184, 943, 795, 384, 383, 461, 404, 758, 839, 887, + 715, 67, 618, 276, 204, 918, 873, 777, 604, 560, + 951, 160, 578, 722, 79, 804, 96, 409, 713, 940, + 652, 934, 970, 447, 318, 353, 859, 672, 112, 785, + 645, 863, 803, 350, 139, 93, 354, 99, 820, 908, + 609, 772, 154, 274, 580, 184, 79, 626, 630, 742, + 653, 282, 762, 623, 680, 81, 927, 626, 789, 125, + 411, 521, 938, 300, 821, 78, 343, 175, 128, 250, + 170, 774, 972, 275, 999, 639, 495, 78, 352, 126, + 857, 956, 358, 619, 580, 124, 737, 594, 701, 612, + 669, 112, 134, 694, 363, 992, 809, 743, 168, 974, + 944, 375, 748, 52, 600, 747, 642, 182, 862, 81, + 344, 805, 988, 739, 511, 655, 814, 334, 249, 515, + 897, 955, 664, 981, 649, 113, 974, 459, 893, 228, + 433, 837, 553, 268, 926, 240, 102, 654, 459, 51, + 686, 754, 806, 760, 493, 403, 415, 394, 687, 700, + 946, 670, 656, 610, 738, 392, 760, 799, 887, 653, + 978, 321, 576, 617, 626, 502, 894, 679, 243, 440, + 680, 879, 194, 572, 640, 724, 926, 56, 204, 700, + 707, 151, 457, 449, 797, 195, 791, 558, 945, 679, + 297, 59, 87, 824, 713, 663, 412, 693, 342, 606, + 134, 108, 571, 364, 631, 212, 174, 643, 304, 329, + 343, 97, 430, 751, 497, 314, 983, 374, 822, 928, + 140, 206, 73, 263, 980, 736, 876, 478, 430, 305, + 170, 514, 364, 692, 829, 82, 855, 953, 676, 246, + 369, 970, 294, 750, 807, 827, 150, 790, 288, 923, + 804, 378, 215, 828, 592, 281, 565, 555, 710, 82, + 896, 831, 547, 261, 524, 462, 293, 465, 502, 56, + 661, 821, 976, 991, 658, 869, 905, 758, 745, 193, + 768, 550, 608, 933, 378, 286, 215, 979, 792, 961, + 61, 688, 793, 644, 986, 403, 106, 366, 905, 644, + 372, 567, 466, 434, 645, 210, 389, 550, 919, 135, + 780, 773, 635, 389, 707, 100, 626, 958, 165, 504, + 920, 176, 193, 713, 857, 265, 203, 50, 668, 108, + 645, 990, 626, 197, 510, 357, 358, 850, 858, 364, + 936, 638 +}; + + +/*-------------------------------------------------------------*/ +/*--- end randtable.c ---*/ +/*-------------------------------------------------------------*/ diff --git a/bzip2/sample1.bz2 b/bzip2/sample1.bz2 Binary files differnew file mode 100644 index 000000000..18dea6004 --- /dev/null +++ b/bzip2/sample1.bz2 diff --git a/bzip2/sample1.ref b/bzip2/sample1.ref Binary files differnew file mode 100644 index 000000000..a56e52b77 --- /dev/null +++ b/bzip2/sample1.ref diff --git a/bzip2/sample2.bz2 b/bzip2/sample2.bz2 Binary files differnew file mode 100644 index 000000000..d5a6160ba --- /dev/null +++ b/bzip2/sample2.bz2 diff --git a/bzip2/sample2.ref b/bzip2/sample2.ref Binary files differnew file mode 100644 index 000000000..34af95839 --- /dev/null +++ b/bzip2/sample2.ref diff --git a/bzip2/sample3.bz2 b/bzip2/sample3.bz2 Binary files differnew file mode 100644 index 000000000..d90cff920 --- /dev/null +++ b/bzip2/sample3.bz2 diff --git a/bzip2/sample3.ref b/bzip2/sample3.ref new file mode 100644 index 000000000..775a2f68e --- /dev/null +++ b/bzip2/sample3.ref @@ -0,0 +1,30007 @@ +This file is exceedingly boring. If you find yourself +reading it, please (1) take it from me that you can safely +guess what the rest of the file says, and (2) seek professional +help. + +ps. there are no further sarcastic remarks in this file. + +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh +ugh diff --git a/bzip2/spewG.c b/bzip2/spewG.c new file mode 100644 index 000000000..7934e7658 --- /dev/null +++ b/bzip2/spewG.c @@ -0,0 +1,39 @@ + +/* spew out a thoroughly gigantic file designed so that bzip2 + can compress it reasonably rapidly. This is to help test + support for large files (> 2GB) in a reasonable amount of time. + I suggest you use the undocumented --exponential option to + bzip2 when compressing the resulting file; this saves a bit of + time. Note: *don't* bother with --exponential when compressing + Real Files; it'll just waste a lot of CPU time :-) + (but is otherwise harmless). +*/ + +#define _FILE_OFFSET_BITS 64 + +#include <stdio.h> +#include <stdlib.h> + +/* The number of megabytes of junk to spew out (roughly) */ +#define MEGABYTES 5000 + +#define N_BUF 1000000 +char buf[N_BUF]; + +int main ( int argc, char** argv ) +{ + int ii, kk, p; + srandom(1); + setbuffer ( stdout, buf, N_BUF ); + for (kk = 0; kk < MEGABYTES * 515; kk+=3) { + p = 25+random()%50; + for (ii = 0; ii < p; ii++) + printf ( "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" ); + for (ii = 0; ii < p-1; ii++) + printf ( "bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb" ); + for (ii = 0; ii < p+1; ii++) + printf ( "ccccccccccccccccccccccccccccccccccccc" ); + } + fflush(stdout); + return 0; +} diff --git a/bzip2/unzcrash.c b/bzip2/unzcrash.c new file mode 100644 index 000000000..f0f17fcca --- /dev/null +++ b/bzip2/unzcrash.c @@ -0,0 +1,126 @@ + +/* A test program written to test robustness to decompression of + corrupted data. Usage is + unzcrash filename + and the program will read the specified file, compress it (in memory), + and then repeatedly decompress it, each time with a different bit of + the compressed data inverted, so as to test all possible one-bit errors. + This should not cause any invalid memory accesses. If it does, + I want to know about it! + + p.s. As you can see from the above description, the process is + incredibly slow. A file of size eg 5KB will cause it to run for + many hours. +*/ + +#include <stdio.h> +#include <assert.h> +#include "bzlib.h" + +#define M_BLOCK 1000000 + +typedef unsigned char uchar; + +#define M_BLOCK_OUT (M_BLOCK + 1000000) +uchar inbuf[M_BLOCK]; +uchar outbuf[M_BLOCK_OUT]; +uchar zbuf[M_BLOCK + 600 + (M_BLOCK / 100)]; + +int nIn, nOut, nZ; + +static char *bzerrorstrings[] = { + "OK" + ,"SEQUENCE_ERROR" + ,"PARAM_ERROR" + ,"MEM_ERROR" + ,"DATA_ERROR" + ,"DATA_ERROR_MAGIC" + ,"IO_ERROR" + ,"UNEXPECTED_EOF" + ,"OUTBUFF_FULL" + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ + ,"???" /* for future */ +}; + +void flip_bit ( int bit ) +{ + int byteno = bit / 8; + int bitno = bit % 8; + uchar mask = 1 << bitno; + //fprintf ( stderr, "(byte %d bit %d mask %d)", + // byteno, bitno, (int)mask ); + zbuf[byteno] ^= mask; +} + +int main ( int argc, char** argv ) +{ + FILE* f; + int r; + int bit; + int i; + + if (argc != 2) { + fprintf ( stderr, "usage: unzcrash filename\n" ); + return 1; + } + + f = fopen ( argv[1], "r" ); + if (!f) { + fprintf ( stderr, "unzcrash: can't open %s\n", argv[1] ); + return 1; + } + + nIn = fread ( inbuf, 1, M_BLOCK, f ); + fprintf ( stderr, "%d bytes read\n", nIn ); + + nZ = M_BLOCK; + r = BZ2_bzBuffToBuffCompress ( + zbuf, &nZ, inbuf, nIn, 9, 0, 30 ); + + assert (r == BZ_OK); + fprintf ( stderr, "%d after compression\n", nZ ); + + for (bit = 0; bit < nZ*8; bit++) { + fprintf ( stderr, "bit %d ", bit ); + flip_bit ( bit ); + nOut = M_BLOCK_OUT; + r = BZ2_bzBuffToBuffDecompress ( + outbuf, &nOut, zbuf, nZ, 0, 0 ); + fprintf ( stderr, " %d %s ", r, bzerrorstrings[-r] ); + + if (r != BZ_OK) { + fprintf ( stderr, "\n" ); + } else { + if (nOut != nIn) { + fprintf(stderr, "nIn/nOut mismatch %d %d\n", nIn, nOut ); + return 1; + } else { + for (i = 0; i < nOut; i++) + if (inbuf[i] != outbuf[i]) { + fprintf(stderr, "mismatch at %d\n", i ); + return 1; + } + if (i == nOut) fprintf(stderr, "really ok!\n" ); + } + } + + flip_bit ( bit ); + } + +#if 0 + assert (nOut == nIn); + for (i = 0; i < nOut; i++) { + if (inbuf[i] != outbuf[i]) { + fprintf ( stderr, "difference at %d !\n", i ); + return 1; + } + } +#endif + + fprintf ( stderr, "all ok\n" ); + return 0; +} diff --git a/bzip2/words0 b/bzip2/words0 new file mode 100644 index 000000000..164a8ed28 --- /dev/null +++ b/bzip2/words0 @@ -0,0 +1,5 @@ + +If compilation produces errors, or a large number of warnings, +please read README.COMPILATION.PROBLEMS -- you might be able to +adjust the flags in this Makefile to improve matters. + diff --git a/bzip2/words1 b/bzip2/words1 new file mode 100644 index 000000000..2e83de9f0 --- /dev/null +++ b/bzip2/words1 @@ -0,0 +1,4 @@ + +Doing 6 tests (3 compress, 3 uncompress) ... +If there's a problem, things might stop at this point. + diff --git a/bzip2/words2 b/bzip2/words2 new file mode 100644 index 000000000..203ee39c4 --- /dev/null +++ b/bzip2/words2 @@ -0,0 +1,5 @@ + +Checking test results. If any of the four "cmp"s which follow +report any differences, something is wrong. If you can't easily +figure out what, please let me know (jseward@acm.org). + diff --git a/bzip2/words3 b/bzip2/words3 new file mode 100644 index 000000000..8486a84c8 --- /dev/null +++ b/bzip2/words3 @@ -0,0 +1,23 @@ + +If you got this far and the "cmp"s didn't complain, it looks +like you're in business. + +To install in /usr/bin, /usr/lib, /usr/man and /usr/include, type + make install +To install somewhere else, eg, /xxx/yyy/{bin,lib,man,include}, type + make install PREFIX=/xxx/yyy +If you are (justifiably) paranoid and want to see what 'make install' +is going to do, you can first do + make -n install or + make -n install PREFIX=/xxx/yyy respectively. +The -n instructs make to show the commands it would execute, but +not actually execute them. + +Instructions for use are in the preformatted manual page, in the file +bzip2.txt. For more detailed documentation, read the full manual. +It is available in Postscript form (manual.ps) and HTML form +(manual_toc.html). + +You can also do "bzip2 --help" to see some helpful information. +"bzip2 -L" displays the software license. + |