Initial revision

CVS patchset: 5197
CVS date: 2001/11/21 19:43:12

45 files changed, 49619 insertions, 0 deletions

diff --git a/bzip2/CHANGES b/bzip2/CHANGES
new file mode 100644
index 000000000..ecaf4170e
--- /dev/null
+++ b/bzip2/CHANGES
@@ -0,0 +1,167 @@
+
+
+0.9.0
+~~~~~
+First version.
+
+
+0.9.0a
+~~~~~~
+Removed 'ranlib' from Makefile, since most modern Unix-es 
+don't need it, or even know about it.
+
+
+0.9.0b
+~~~~~~
+Fixed a problem with error reporting in bzip2.c.  This does not effect
+the library in any way.  Problem is: versions 0.9.0 and 0.9.0a (of the
+program proper) compress and decompress correctly, but give misleading
+error messages (internal panics) when an I/O error occurs, instead of
+reporting the problem correctly.  This shouldn't give any data loss
+(as far as I can see), but is confusing.
+
+Made the inline declarations disappear for non-GCC compilers.
+
+
+0.9.0c
+~~~~~~
+Fixed some problems in the library pertaining to some boundary cases.
+This makes the library behave more correctly in those situations.  The
+fixes apply only to features (calls and parameters) not used by
+bzip2.c, so the non-fixedness of them in previous versions has no
+effect on reliability of bzip2.c.
+
+In bzlib.c:
+   * made zero-length BZ_FLUSH work correctly in bzCompress().
+   * fixed bzWrite/bzRead to ignore zero-length requests.
+   * fixed bzread to correctly handle read requests after EOF.
+   * wrong parameter order in call to bzDecompressInit in
+     bzBuffToBuffDecompress.  Fixed.
+
+In compress.c:
+   * changed setting of nGroups in sendMTFValues() so as to 
+     do a bit better on small files.  This _does_ effect
+     bzip2.c.
+
+
+0.9.5a
+~~~~~~
+Major change: add a fallback sorting algorithm (blocksort.c)
+to give reasonable behaviour even for very repetitive inputs.
+Nuked --repetitive-best and --repetitive-fast since they are
+no longer useful.
+
+Minor changes: mostly a whole bunch of small changes/
+bugfixes in the driver (bzip2.c).  Changes pertaining to the
+user interface are:
+
+   allow decompression of symlink'd files to stdout
+   decompress/test files even without .bz2 extension
+   give more accurate error messages for I/O errors
+   when compressing/decompressing to stdout, don't catch control-C
+   read flags from BZIP2 and BZIP environment variables
+   decline to break hard links to a file unless forced with -f
+   allow -c flag even with no filenames
+   preserve file ownerships as far as possible
+   make -s -1 give the expected block size (100k)
+   add a flag -q --quiet to suppress nonessential warnings
+   stop decoding flags after --, so files beginning in - can be handled
+   resolved inconsistent naming: bzcat or bz2cat ?
+   bzip2 --help now returns 0
+
+Programming-level changes are:
+
+   fixed syntax error in GET_LL4 for Borland C++ 5.02
+   let bzBuffToBuffDecompress return BZ_DATA_ERROR{_MAGIC}
+   fix overshoot of mode-string end in bzopen_or_bzdopen
+   wrapped bzlib.h in #ifdef __cplusplus ... extern "C" { ... }
+   close file handles under all error conditions
+   added minor mods so it compiles with DJGPP out of the box
+   fixed Makefile so it doesn't give problems with BSD make
+   fix uninitialised memory reads in dlltest.c
+
+0.9.5b
+~~~~~~
+Open stdin/stdout in binary mode for DJGPP.
+
+0.9.5c
+~~~~~~
+Changed BZ_N_OVERSHOOT to be ... + 2 instead of ... + 1.  The + 1
+version could cause the sorted order to be wrong in some extremely
+obscure cases.  Also changed setting of quadrant in blocksort.c.
+
+0.9.5d
+~~~~~~
+The only functional change is to make bzlibVersion() in the library
+return the correct string.  This has no effect whatsoever on the
+functioning of the bzip2 program or library.  Added a couple of casts
+so the library compiles without warnings at level 3 in MS Visual
+Studio 6.0.  Included a Y2K statement in the file Y2K_INFO.  All other
+changes are minor documentation changes.
+
+1.0
+~~~
+Several minor bugfixes and enhancements:
+
+* Large file support.  The library uses 64-bit counters to
+  count the volume of data passing through it.  bzip2.c 
+  is now compiled with -D_FILE_OFFSET_BITS=64 to get large
+  file support from the C library.  -v correctly prints out
+  file sizes greater than 4 gigabytes.  All these changes have
+  been made without assuming a 64-bit platform or a C compiler
+  which supports 64-bit ints, so, except for the C library
+  aspect, they are fully portable.
+
+* Decompression robustness.  The library/program should be
+  robust to any corruption of compressed data, detecting and
+  handling _all_ corruption, instead of merely relying on
+  the CRCs.  What this means is that the program should 
+  never crash, given corrupted data, and the library should
+  always return BZ_DATA_ERROR.
+
+* Fixed an obscure race-condition bug only ever observed on
+  Solaris, in which, if you were very unlucky and issued
+  control-C at exactly the wrong time, both input and output
+  files would be deleted.
+
+* Don't run out of file handles on test/decompression when
+  large numbers of files have invalid magic numbers.
+
+* Avoid library namespace pollution.  Prefix all exported 
+  symbols with BZ2_.
+
+* Minor sorting enhancements from my DCC2000 paper.
+
+* Advance the version number to 1.0, so as to counteract the
+  (false-in-this-case) impression some people have that programs 
+  with version numbers less than 1.0 are in someway, experimental,
+  pre-release versions.
+
+* Create an initial Makefile-libbz2_so to build a shared library.
+  Yes, I know I should really use libtool et al ...
+
+* Make the program exit with 2 instead of 0 when decompression
+  fails due to a bad magic number (ie, an invalid bzip2 header).
+  Also exit with 1 (as the manual claims :-) whenever a diagnostic
+  message would have been printed AND the corresponding operation 
+  is aborted, for example
+     bzip2: Output file xx already exists.
+  When a diagnostic message is printed but the operation is not 
+  aborted, for example
+     bzip2: Can't guess original name for wurble -- using wurble.out
+  then the exit value 0 is returned, unless some other problem is
+  also detected.
+
+  I think it corresponds more closely to what the manual claims now.
+
+
+1.0.1
+~~~~~
+* Modified dlltest.c so it uses the new BZ2_ naming scheme.
+* Modified makefile-msc to fix minor build probs on Win2k.
+* Updated README.COMPILATION.PROBLEMS.
+
+There are no functionality changes or bug fixes relative to version
+1.0.0.  This is just a documentation update + a fix for minor Win32
+build problems.  For almost everyone, upgrading from 1.0.0 to 1.0.1 is
+utterly pointless.  Don't bother.
diff --git a/bzip2/LICENSE b/bzip2/LICENSE
new file mode 100644
index 000000000..88fa6d88a
--- /dev/null
+++ b/bzip2/LICENSE
@@ -0,0 +1,39 @@
+
+This program, "bzip2" and associated library "libbzip2", are
+copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+
+1. Redistributions of source code must retain the above copyright
+   notice, this list of conditions and the following disclaimer.
+
+2. The origin of this software must not be misrepresented; you must 
+   not claim that you wrote the original software.  If you use this 
+   software in a product, an acknowledgment in the product 
+   documentation would be appreciated but is not required.
+
+3. Altered source versions must be plainly marked as such, and must
+   not be misrepresented as being the original software.
+
+4. The name of the author may not be used to endorse or promote 
+   products derived from this software without specific prior written 
+   permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+Julian Seward, Cambridge, UK.
+jseward@acm.org
+bzip2/libbzip2 version 1.0 of 21 March 2000
+
diff --git a/bzip2/Makefile b/bzip2/Makefile
new file mode 100644
index 000000000..ab17f4979
--- /dev/null
+++ b/bzip2/Makefile
@@ -0,0 +1,141 @@
+
+SHELL=/bin/sh
+CC=gcc
+BIGFILES=-D_FILE_OFFSET_BITS=64
+CFLAGS=-Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce $(BIGFILES)
+
+OBJS= blocksort.o  \
+      huffman.o    \
+      crctable.o   \
+      randtable.o  \
+      compress.o   \
+      decompress.o \
+      bzlib.o
+
+all: libbz2.a bzip2 bzip2recover test
+
+bzip2: libbz2.a bzip2.o
+	$(CC) $(CFLAGS) -o bzip2 bzip2.o -L. -lbz2
+
+bzip2recover: bzip2recover.o
+	$(CC) $(CFLAGS) -o bzip2recover bzip2recover.o
+
+libbz2.a: $(OBJS)
+	rm -f libbz2.a
+	ar cq libbz2.a $(OBJS)
+	@if ( test -f /usr/bin/ranlib -o -f /bin/ranlib -o \
+		-f /usr/ccs/bin/ranlib ) ; then \
+		echo ranlib libbz2.a ; \
+		ranlib libbz2.a ; \
+	fi
+
+test: bzip2
+	@cat words1
+	./bzip2 -1  < sample1.ref > sample1.rb2
+	./bzip2 -2  < sample2.ref > sample2.rb2
+	./bzip2 -3  < sample3.ref > sample3.rb2
+	./bzip2 -d  < sample1.bz2 > sample1.tst
+	./bzip2 -d  < sample2.bz2 > sample2.tst
+	./bzip2 -ds < sample3.bz2 > sample3.tst
+	cmp sample1.bz2 sample1.rb2 
+	cmp sample2.bz2 sample2.rb2
+	cmp sample3.bz2 sample3.rb2
+	cmp sample1.tst sample1.ref
+	cmp sample2.tst sample2.ref
+	cmp sample3.tst sample3.ref
+	@cat words3
+
+PREFIX=/usr
+
+install: bzip2 bzip2recover
+	if ( test ! -d $(PREFIX)/bin ) ; then mkdir $(PREFIX)/bin ; fi
+	if ( test ! -d $(PREFIX)/lib ) ; then mkdir $(PREFIX)/lib ; fi
+	if ( test ! -d $(PREFIX)/man ) ; then mkdir $(PREFIX)/man ; fi
+	if ( test ! -d $(PREFIX)/man/man1 ) ; then mkdir $(PREFIX)/man/man1 ; fi
+	if ( test ! -d $(PREFIX)/include ) ; then mkdir $(PREFIX)/include ; fi
+	cp -f bzip2 $(PREFIX)/bin/bzip2
+	cp -f bzip2 $(PREFIX)/bin/bunzip2
+	cp -f bzip2 $(PREFIX)/bin/bzcat
+	cp -f bzip2recover $(PREFIX)/bin/bzip2recover
+	chmod a+x $(PREFIX)/bin/bzip2
+	chmod a+x $(PREFIX)/bin/bunzip2
+	chmod a+x $(PREFIX)/bin/bzcat
+	chmod a+x $(PREFIX)/bin/bzip2recover
+	cp -f bzip2.1 $(PREFIX)/man/man1
+	chmod a+r $(PREFIX)/man/man1/bzip2.1
+	cp -f bzlib.h $(PREFIX)/include
+	chmod a+r $(PREFIX)/include/bzlib.h
+	cp -f libbz2.a $(PREFIX)/lib
+	chmod a+r $(PREFIX)/lib/libbz2.a
+
+clean: 
+	rm -f *.o libbz2.a bzip2 bzip2recover \
+	sample1.rb2 sample2.rb2 sample3.rb2 \
+	sample1.tst sample2.tst sample3.tst
+
+blocksort.o: blocksort.c
+	@cat words0
+	$(CC) $(CFLAGS) -c blocksort.c
+huffman.o: huffman.c
+	$(CC) $(CFLAGS) -c huffman.c
+crctable.o: crctable.c
+	$(CC) $(CFLAGS) -c crctable.c
+randtable.o: randtable.c
+	$(CC) $(CFLAGS) -c randtable.c
+compress.o: compress.c
+	$(CC) $(CFLAGS) -c compress.c
+decompress.o: decompress.c
+	$(CC) $(CFLAGS) -c decompress.c
+bzlib.o: bzlib.c
+	$(CC) $(CFLAGS) -c bzlib.c
+bzip2.o: bzip2.c
+	$(CC) $(CFLAGS) -c bzip2.c
+bzip2recover.o: bzip2recover.c
+	$(CC) $(CFLAGS) -c bzip2recover.c
+
+DISTNAME=bzip2-1.0.1
+tarfile:
+	rm -f $(DISTNAME)
+	ln -sf . $(DISTNAME)
+	tar cvf $(DISTNAME).tar \
+	   $(DISTNAME)/blocksort.c \
+	   $(DISTNAME)/huffman.c \
+	   $(DISTNAME)/crctable.c \
+	   $(DISTNAME)/randtable.c \
+	   $(DISTNAME)/compress.c \
+	   $(DISTNAME)/decompress.c \
+	   $(DISTNAME)/bzlib.c \
+	   $(DISTNAME)/bzip2.c \
+	   $(DISTNAME)/bzip2recover.c \
+	   $(DISTNAME)/bzlib.h \
+	   $(DISTNAME)/bzlib_private.h \
+	   $(DISTNAME)/Makefile \
+	   $(DISTNAME)/manual.texi \
+	   $(DISTNAME)/manual.ps \
+	   $(DISTNAME)/LICENSE \
+	   $(DISTNAME)/bzip2.1 \
+	   $(DISTNAME)/bzip2.1.preformatted \
+	   $(DISTNAME)/bzip2.txt \
+	   $(DISTNAME)/words0 \
+	   $(DISTNAME)/words1 \
+	   $(DISTNAME)/words2 \
+	   $(DISTNAME)/words3 \
+	   $(DISTNAME)/sample1.ref \
+	   $(DISTNAME)/sample2.ref \
+	   $(DISTNAME)/sample3.ref \
+	   $(DISTNAME)/sample1.bz2 \
+	   $(DISTNAME)/sample2.bz2 \
+	   $(DISTNAME)/sample3.bz2 \
+	   $(DISTNAME)/dlltest.c \
+	   $(DISTNAME)/*.html \
+	   $(DISTNAME)/README \
+	   $(DISTNAME)/README.COMPILATION.PROBLEMS \
+	   $(DISTNAME)/CHANGES \
+	   $(DISTNAME)/libbz2.def \
+	   $(DISTNAME)/libbz2.dsp \
+	   $(DISTNAME)/dlltest.dsp \
+	   $(DISTNAME)/makefile.msc \
+	   $(DISTNAME)/Y2K_INFO \
+	   $(DISTNAME)/unzcrash.c \
+	   $(DISTNAME)/spewG.c \
+	   $(DISTNAME)/Makefile-libbz2_so
diff --git a/bzip2/Makefile-libbz2_so b/bzip2/Makefile-libbz2_so
new file mode 100644
index 000000000..a347c50e9
--- /dev/null
+++ b/bzip2/Makefile-libbz2_so
@@ -0,0 +1,43 @@
+
+# This Makefile builds a shared version of the library, 
+# libbz2.so.1.0.1, with soname libbz2.so.1.0,
+# at least on x86-Linux (RedHat 5.2), 
+# with gcc-2.7.2.3.  Please see the README file for some 
+# important info about building the library like this.
+
+SHELL=/bin/sh
+CC=gcc
+BIGFILES=-D_FILE_OFFSET_BITS=64
+CFLAGS=-fpic -fPIC -Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce $(BIGFILES)
+
+OBJS= blocksort.o  \
+      huffman.o    \
+      crctable.o   \
+      randtable.o  \
+      compress.o   \
+      decompress.o \
+      bzlib.o
+
+all: $(OBJS)
+	$(CC) -shared -Wl,-soname -Wl,libbz2.so.1.0 -o libbz2.so.1.0.1 $(OBJS)
+	$(CC) $(CFLAGS) -o bzip2-shared bzip2.c libbz2.so.1.0.1
+	rm -f libbz2.so.1.0
+	ln -s libbz2.so.1.0.1 libbz2.so.1.0
+
+clean: 
+	rm -f $(OBJS) bzip2.o libbz2.so.1.0.1 libbz2.so.1.0 bzip2-shared
+
+blocksort.o: blocksort.c
+	$(CC) $(CFLAGS) -c blocksort.c
+huffman.o: huffman.c
+	$(CC) $(CFLAGS) -c huffman.c
+crctable.o: crctable.c
+	$(CC) $(CFLAGS) -c crctable.c
+randtable.o: randtable.c
+	$(CC) $(CFLAGS) -c randtable.c
+compress.o: compress.c
+	$(CC) $(CFLAGS) -c compress.c
+decompress.o: decompress.c
+	$(CC) $(CFLAGS) -c decompress.c
+bzlib.o: bzlib.c
+	$(CC) $(CFLAGS) -c bzlib.c
diff --git a/bzip2/README b/bzip2/README
new file mode 100644
index 000000000..22945a256
--- /dev/null
+++ b/bzip2/README
@@ -0,0 +1,166 @@
+
+This is the README for bzip2, a block-sorting file compressor, version
+1.0.  This version is fully compatible with the previous public
+releases, bzip2-0.1pl2, bzip2-0.9.0 and bzip2-0.9.5.
+
+bzip2-1.0 is distributed under a BSD-style license.  For details,
+see the file LICENSE.
+
+Complete documentation is available in Postscript form (manual.ps) or
+html (manual_toc.html).  A plain-text version of the manual page is
+available as bzip2.txt.  A statement about Y2K issues is now included
+in the file Y2K_INFO.
+
+
+HOW TO BUILD -- UNIX
+
+Type `make'.  This builds the library libbz2.a and then the
+programs bzip2 and bzip2recover.  Six self-tests are run.
+If the self-tests complete ok, carry on to installation:
+
+To install in /usr/bin, /usr/lib, /usr/man and /usr/include, type
+   make install
+To install somewhere else, eg, /xxx/yyy/{bin,lib,man,include}, type 
+   make install PREFIX=/xxx/yyy
+If you are (justifiably) paranoid and want to see what 'make install'
+is going to do, you can first do
+   make -n install                      or
+   make -n install PREFIX=/xxx/yyy      respectively.
+The -n instructs make to show the commands it would execute, but
+not actually execute them.
+
+
+HOW TO BUILD -- UNIX, shared library libbz2.so.
+
+Do 'make -f Makefile-libbz2_so'.  This Makefile seems to work for
+Linux-ELF (RedHat 5.2 on an x86 box), with gcc.  I make no claims
+that it works for any other platform, though I suspect it probably
+will work for most platforms employing both ELF and gcc.
+
+bzip2-shared, a client of the shared library, is also build, but
+not self-tested.  So I suggest you also build using the normal
+Makefile, since that conducts a self-test.
+
+Important note for people upgrading .so's from 0.9.0/0.9.5 to
+version 1.0.  All the functions in the library have been renamed,
+from (eg) bzCompress to BZ2_bzCompress, to avoid namespace pollution.
+Unfortunately this means that the libbz2.so created by
+Makefile-libbz2_so will not work with any program which used an
+older version of the library.  Sorry.  I do encourage library
+clients to make the effort to upgrade to use version 1.0, since
+it is both faster and more robust than previous versions.
+
+
+HOW TO BUILD -- Windows 95, NT, DOS, Mac, etc.
+
+It's difficult for me to support compilation on all these platforms.
+My approach is to collect binaries for these platforms, and put them
+on the master web page (http://sourceware.cygnus.com/bzip2).  Look
+there.  However (FWIW), bzip2-1.0 is very standard ANSI C and should
+compile unmodified with MS Visual C.  For Win32, there is one
+important caveat: in bzip2.c, you must set BZ_UNIX to 0 and
+BZ_LCCWIN32 to 1 before building.  If you have difficulties building,
+you might want to read README.COMPILATION.PROBLEMS.
+
+
+VALIDATION
+
+Correct operation, in the sense that a compressed file can always be
+decompressed to reproduce the original, is obviously of paramount
+importance.  To validate bzip2, I used a modified version of Mark
+Nelson's churn program.  Churn is an automated test driver which
+recursively traverses a directory structure, using bzip2 to compress
+and then decompress each file it encounters, and checking that the
+decompressed data is the same as the original.  There are more details
+in Section 4 of the user guide.
+
+
+
+Please read and be aware of the following:
+
+WARNING:
+
+   This program (attempts to) compress data by performing several
+   non-trivial transformations on it.  Unless you are 100% familiar
+   with *all* the algorithms contained herein, and with the
+   consequences of modifying them, you should NOT meddle with the
+   compression or decompression machinery.  Incorrect changes can and
+   very likely *will* lead to disastrous loss of data.
+
+
+DISCLAIMER:
+
+   I TAKE NO RESPONSIBILITY FOR ANY LOSS OF DATA ARISING FROM THE
+   USE OF THIS PROGRAM, HOWSOEVER CAUSED.
+
+   Every compression of a file implies an assumption that the
+   compressed file can be decompressed to reproduce the original.
+   Great efforts in design, coding and testing have been made to
+   ensure that this program works correctly.  However, the complexity
+   of the algorithms, and, in particular, the presence of various
+   special cases in the code which occur with very low but non-zero
+   probability make it impossible to rule out the possibility of bugs
+   remaining in the program.  DO NOT COMPRESS ANY DATA WITH THIS
+   PROGRAM UNLESS YOU ARE PREPARED TO ACCEPT THE POSSIBILITY, HOWEVER
+   SMALL, THAT THE DATA WILL NOT BE RECOVERABLE.
+
+   That is not to say this program is inherently unreliable.  Indeed,
+   I very much hope the opposite is true.  bzip2 has been carefully
+   constructed and extensively tested.
+
+
+PATENTS:
+
+   To the best of my knowledge, bzip2 does not use any patented
+   algorithms.  However, I do not have the resources available to
+   carry out a full patent search.  Therefore I cannot give any
+   guarantee of the above statement.
+
+End of legalities.
+
+
+WHAT'S NEW IN 0.9.0 (as compared to 0.1pl2) ?
+
+   * Approx 10% faster compression, 30% faster decompression
+   * -t (test mode) is a lot quicker
+   * Can decompress concatenated compressed files
+   * Programming interface, so programs can directly read/write .bz2 files
+   * Less restrictive (BSD-style) licensing
+   * Flag handling more compatible with GNU gzip
+   * Much more documentation, i.e., a proper user manual
+   * Hopefully, improved portability (at least of the library)
+
+WHAT'S NEW IN 0.9.5 ?
+
+   * Compression speed is much less sensitive to the input
+     data than in previous versions.  Specifically, the very
+     slow performance caused by repetitive data is fixed.
+   * Many small improvements in file and flag handling.
+   * A Y2K statement.
+
+WHAT'S NEW IN 1.0
+
+   See the CHANGES file.
+
+I hope you find bzip2 useful.  Feel free to contact me at
+   jseward@acm.org
+if you have any suggestions or queries.  Many people mailed me with
+comments, suggestions and patches after the releases of bzip-0.15,
+bzip-0.21, bzip2-0.1pl2 and bzip2-0.9.0, and the changes in bzip2 are
+largely a result of this feedback.  I thank you for your comments.
+
+At least for the time being, bzip2's "home" is (or can be reached via)
+http://www.muraroa.demon.co.uk.
+
+Julian Seward
+jseward@acm.org
+
+Cambridge, UK
+18   July 1996 (version 0.15)
+25 August 1996 (version 0.21)
+ 7 August 1997 (bzip2, version 0.1)
+29 August 1997 (bzip2, version 0.1pl2)
+23 August 1998 (bzip2, version 0.9.0)
+ 8   June 1999 (bzip2, version 0.9.5)
+ 4   Sept 1999 (bzip2, version 0.9.5d)
+ 5    May 2000 (bzip2, version 1.0pre8)
diff --git a/bzip2/README.COMPILATION.PROBLEMS b/bzip2/README.COMPILATION.PROBLEMS
new file mode 100644
index 000000000..d621ad597
--- /dev/null
+++ b/bzip2/README.COMPILATION.PROBLEMS
@@ -0,0 +1,130 @@
+
+bzip2-1.0 should compile without problems on the vast majority of
+platforms.  Using the supplied Makefile, I've built and tested it
+myself for x86-linux, sparc-solaris, alpha-linux, x86-cygwin32 and
+alpha-tru64unix.  With makefile.msc, Visual C++ 6.0 and nmake, you can
+build a native Win32 version too.  Large file support seems to work
+correctly on at least alpha-tru64unix and x86-cygwin32 (on Windows
+2000).
+
+When I say "large file" I mean a file of size 2,147,483,648 (2^31)
+bytes or above.  Many older OSs can't handle files above this size,
+but many newer ones can.  Large files are pretty huge -- most files
+you'll encounter are not Large Files.
+
+Earlier versions of bzip2 (0.1, 0.9.0, 0.9.5) compiled on a wide
+variety of platforms without difficulty, and I hope this version will
+continue in that tradition.  However, in order to support large files,
+I've had to include the define -D_FILE_OFFSET_BITS=64 in the Makefile.
+This can cause problems.
+
+The technique of adding -D_FILE_OFFSET_BITS=64 to get large file
+support is, as far as I know, the Recommended Way to get correct large
+file support.  For more details, see the Large File Support
+Specification, published by the Large File Summit, at
+   http://www.sas.com/standard/large.file/
+
+As a general comment, if you get compilation errors which you think
+are related to large file support, try removing the above define from
+the Makefile, ie, delete the line
+   BIGFILES=-D_FILE_OFFSET_BITS=64 
+from the Makefile, and do 'make clean ; make'.  This will give you a
+version of bzip2 without large file support, which, for most
+applications, is probably not a problem.  
+
+Alternatively, try some of the platform-specific hints listed below.
+
+You can use the spewG.c program to generate huge files to test bzip2's
+large file support, if you are feeling paranoid.  Be aware though that
+any compilation problems which affect bzip2 will also affect spewG.c,
+alas.
+
+
+Known problems as of 1.0pre8:
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+* HP/UX 10.20 and 11.00, using gcc (2.7.2.3 and 2.95.2):  A large
+  number of warnings appear, including the following:
+
+     /usr/include/sys/resource.h: In function `getrlimit':
+     /usr/include/sys/resource.h:168: 
+        warning: implicit declaration of function `__getrlimit64'
+     /usr/include/sys/resource.h: In function `setrlimit':
+     /usr/include/sys/resource.h:170: 
+        warning: implicit declaration of function `__setrlimit64'
+
+  This would appear to be a problem with large file support, header
+  files and gcc.  gcc may or may not give up at this point.  If it
+  fails, you might be able to improve matters by adding 
+     -D__STDC_EXT__=1
+  to the BIGFILES variable in the Makefile (ie, change its definition
+  to
+     BIGFILES=-D_FILE_OFFSET_BITS=64 -D__STDC_EXT__=1
+
+  Even if gcc does produce a binary which appears to work (ie passes
+  its self-tests), you might want to test it to see if it works properly
+  on large files.
+
+
+* HP/UX 10.20 and 11.00, using HP's cc compiler.
+
+  No specific problems for this combination, except that you'll need to
+  specify the -Ae flag, and zap the gcc-specific stuff
+  -Wall -Winline -O2 -fomit-frame-pointer -fno-strength-reduce.
+  You should retain -D_FILE_OFFSET_BITS=64 in order to get large
+  file support -- which is reported to work ok for this HP/UX + cc
+  combination.
+
+
+* SunOS 4.1.X.
+
+  Amazingly, there are still people out there using this venerable old
+  banger.  I shouldn't be too rude -- I started life on SunOS, and
+  it was a pretty darn good OS, way back then.  Anyway:
+
+     SunOS doesn't seem to have strerror(), so you'll have to use
+     perror(), perhaps by doing adding this (warning: UNTESTED CODE):
+
+     char* strerror ( int errnum )
+     {
+        if (errnum < 0 || errnum >= sys_nerr)
+           return "Unknown error"; 
+        else
+           return sys_errlist[errnum];
+     }
+
+   Or you could comment out the relevant calls to strerror; they're
+   not mission-critical.  Or you could upgrade to Solaris.  Ha ha ha!
+   (what??  you think I've got Bad Attitude?) 
+
+
+* Making a shared library on Solaris.  (Not really a compilation
+  problem, but many people ask ...)  
+
+  Firstly, if you have Solaris 8, either you have libbz2.so already
+  on your system, or you can install it from the Solaris CD.  
+
+  Secondly, be aware that there are potential naming conflicts
+  between the .so file supplied with Solaris 8, and the .so file
+  which Makefile-libbz2_so will make.  Makefile-libbz2_so creates
+  a .so which has the names which I intend to be "official" as
+  of version 1.0.0 and onwards.  Unfortunately, the .so in
+  Solaris 8 appeared before I decided on the final names, so
+  the two libraries are incompatible.  We have since communicated
+  and I hope that the problems will have been solved in the next
+  version of Solaris, whenever that might appear.
+
+  All that said: you might be able to get somewhere
+  by finding the line in Makefile-libbz2_so which says
+
+  $(CC) -shared -Wl,-soname -Wl,libbz2.so.1.0 -o libbz2.so.1.0.1 $(OBJS)
+
+  and replacing with 
+
+  ($CC) -G -shared -o libbz2.so.1.0.1 -h libbz2.so.1.0 $(OBJS)
+  
+  If gcc objects to the combination -fpic -fPIC, get rid of
+  the second one, leaving just "-fpic".
+
+
+That's the end of the currently known compilation problems.
diff --git a/bzip2/Y2K_INFO b/bzip2/Y2K_INFO
new file mode 100644
index 000000000..55fd56a2e
--- /dev/null
+++ b/bzip2/Y2K_INFO
@@ -0,0 +1,34 @@
+
+Y2K status of bzip2 and libbzip2, versions 0.1, 0.9.0 and 0.9.5
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+Informally speaking:
+   bzip2 is a compression program built on top of libbzip2, 
+   a library which does the real work of compression and 
+   decompression.  As far as I am aware, libbzip2 does not have 
+   any date-related code at all.
+
+   bzip2 itself copies dates from source to destination files 
+   when compressing or decompressing, using the 'stat' and 'utime' 
+   UNIX system calls.  It doesn't examine, manipulate or store the 
+   dates in any way.  So as far as I can see, there shouldn't be any 
+   problem with bzip2 providing 'stat' and 'utime' work correctly 
+   on your system.
+
+   On non-unix platforms (those for which BZ_UNIX in bzip2.c is
+   not set to 1), bzip2 doesn't even do the date copying.
+
+   Overall, informally speaking, I don't think bzip2 or libbzip2 
+   have a Y2K problem.
+
+Formally speaking:
+   I am not prepared to offer you any assurance whatsoever 
+   regarding Y2K issues in my software.  You alone assume the 
+   entire risk of using the software.  The disclaimer of liability 
+   in the LICENSE file in the bzip2 source distribution continues 
+   to apply on this issue as with every other issue pertaining 
+   to the software.
+
+Julian Seward
+Cambridge, UK
+25 August 1999
diff --git a/bzip2/blocksort.c b/bzip2/blocksort.c
new file mode 100644
index 000000000..ec426725b
--- /dev/null
+++ b/bzip2/blocksort.c
@@ -0,0 +1,1134 @@
+
+/*-------------------------------------------------------------*/
+/*--- Block sorting machinery                               ---*/
+/*---                                           blocksort.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+
+  To get some idea how the block sorting algorithms in this file 
+  work, read my paper 
+     On the Performance of BWT Sorting Algorithms
+  in Proceedings of the IEEE Data Compression Conference 2000,
+  Snowbird, Utah, USA, 27-30 March 2000.  The main sort in this
+  file implements the algorithm called  cache  in the paper.
+--*/
+
+
+#include "bzlib_private.h"
+
+/*---------------------------------------------*/
+/*--- Fallback O(N log(N)^2) sorting        ---*/
+/*--- algorithm, for repetitive blocks      ---*/
+/*---------------------------------------------*/
+
+/*---------------------------------------------*/
+static 
+__inline__
+void fallbackSimpleSort ( UInt32* fmap, 
+                          UInt32* eclass, 
+                          Int32   lo, 
+                          Int32   hi )
+{
+   Int32 i, j, tmp;
+   UInt32 ec_tmp;
+
+   if (lo == hi) return;
+
+   if (hi - lo > 3) {
+      for ( i = hi-4; i >= lo; i-- ) {
+         tmp = fmap[i];
+         ec_tmp = eclass[tmp];
+         for ( j = i+4; j <= hi && ec_tmp > eclass[fmap[j]]; j += 4 )
+            fmap[j-4] = fmap[j];
+         fmap[j-4] = tmp;
+      }
+   }
+
+   for ( i = hi-1; i >= lo; i-- ) {
+      tmp = fmap[i];
+      ec_tmp = eclass[tmp];
+      for ( j = i+1; j <= hi && ec_tmp > eclass[fmap[j]]; j++ )
+         fmap[j-1] = fmap[j];
+      fmap[j-1] = tmp;
+   }
+}
+
+
+/*---------------------------------------------*/
+#define fswap(zz1, zz2) \
+   { Int32 zztmp = zz1; zz1 = zz2; zz2 = zztmp; }
+
+#define fvswap(zzp1, zzp2, zzn)       \
+{                                     \
+   Int32 yyp1 = (zzp1);               \
+   Int32 yyp2 = (zzp2);               \
+   Int32 yyn  = (zzn);                \
+   while (yyn > 0) {                  \
+      fswap(fmap[yyp1], fmap[yyp2]);  \
+      yyp1++; yyp2++; yyn--;          \
+   }                                  \
+}
+
+
+#define fmin(a,b) ((a) < (b)) ? (a) : (b)
+
+#define fpush(lz,hz) { stackLo[sp] = lz; \
+                       stackHi[sp] = hz; \
+                       sp++; }
+
+#define fpop(lz,hz) { sp--;              \
+                      lz = stackLo[sp];  \
+                      hz = stackHi[sp]; }
+
+#define FALLBACK_QSORT_SMALL_THRESH 10
+#define FALLBACK_QSORT_STACK_SIZE   100
+
+
+static
+void fallbackQSort3 ( UInt32* fmap, 
+                      UInt32* eclass,
+                      Int32   loSt, 
+                      Int32   hiSt )
+{
+   Int32 unLo, unHi, ltLo, gtHi, n, m;
+   Int32 sp, lo, hi;
+   UInt32 med, r, r3;
+   Int32 stackLo[FALLBACK_QSORT_STACK_SIZE];
+   Int32 stackHi[FALLBACK_QSORT_STACK_SIZE];
+
+   r = 0;
+
+   sp = 0;
+   fpush ( loSt, hiSt );
+
+   while (sp > 0) {
+
+      AssertH ( sp < FALLBACK_QSORT_STACK_SIZE, 1004 );
+
+      fpop ( lo, hi );
+      if (hi - lo < FALLBACK_QSORT_SMALL_THRESH) {
+         fallbackSimpleSort ( fmap, eclass, lo, hi );
+         continue;
+      }
+
+      /* Random partitioning.  Median of 3 sometimes fails to
+         avoid bad cases.  Median of 9 seems to help but 
+         looks rather expensive.  This too seems to work but
+         is cheaper.  Guidance for the magic constants 
+         7621 and 32768 is taken from Sedgewick's algorithms
+         book, chapter 35.
+      */
+      r = ((r * 7621) + 1) % 32768;
+      r3 = r % 3;
+      if (r3 == 0) med = eclass[fmap[lo]]; else
+      if (r3 == 1) med = eclass[fmap[(lo+hi)>>1]]; else
+                   med = eclass[fmap[hi]];
+
+      unLo = ltLo = lo;
+      unHi = gtHi = hi;
+
+      while (1) {
+         while (1) {
+            if (unLo > unHi) break;
+            n = (Int32)eclass[fmap[unLo]] - (Int32)med;
+            if (n == 0) { 
+               fswap(fmap[unLo], fmap[ltLo]); 
+               ltLo++; unLo++; 
+               continue; 
+            };
+            if (n > 0) break;
+            unLo++;
+         }
+         while (1) {
+            if (unLo > unHi) break;
+            n = (Int32)eclass[fmap[unHi]] - (Int32)med;
+            if (n == 0) { 
+               fswap(fmap[unHi], fmap[gtHi]); 
+               gtHi--; unHi--; 
+               continue; 
+            };
+            if (n < 0) break;
+            unHi--;
+         }
+         if (unLo > unHi) break;
+         fswap(fmap[unLo], fmap[unHi]); unLo++; unHi--;
+      }
+
+      AssertD ( unHi == unLo-1, "fallbackQSort3(2)" );
+
+      if (gtHi < ltLo) continue;
+
+      n = fmin(ltLo-lo, unLo-ltLo); fvswap(lo, unLo-n, n);
+      m = fmin(hi-gtHi, gtHi-unHi); fvswap(unLo, hi-m+1, m);
+
+      n = lo + unLo - ltLo - 1;
+      m = hi - (gtHi - unHi) + 1;
+
+      if (n - lo > hi - m) {
+         fpush ( lo, n );
+         fpush ( m, hi );
+      } else {
+         fpush ( m, hi );
+         fpush ( lo, n );
+      }
+   }
+}
+
+#undef fmin
+#undef fpush
+#undef fpop
+#undef fswap
+#undef fvswap
+#undef FALLBACK_QSORT_SMALL_THRESH
+#undef FALLBACK_QSORT_STACK_SIZE
+
+
+/*---------------------------------------------*/
+/* Pre:
+      nblock > 0
+      eclass exists for [0 .. nblock-1]
+      ((UChar*)eclass) [0 .. nblock-1] holds block
+      ptr exists for [0 .. nblock-1]
+
+   Post:
+      ((UChar*)eclass) [0 .. nblock-1] holds block
+      All other areas of eclass destroyed
+      fmap [0 .. nblock-1] holds sorted order
+      bhtab [ 0 .. 2+(nblock/32) ] destroyed
+*/
+
+#define       SET_BH(zz)  bhtab[(zz) >> 5] |= (1 << ((zz) & 31))
+#define     CLEAR_BH(zz)  bhtab[(zz) >> 5] &= ~(1 << ((zz) & 31))
+#define     ISSET_BH(zz)  (bhtab[(zz) >> 5] & (1 << ((zz) & 31)))
+#define      WORD_BH(zz)  bhtab[(zz) >> 5]
+#define UNALIGNED_BH(zz)  ((zz) & 0x01f)
+
+static
+void fallbackSort ( UInt32* fmap, 
+                    UInt32* eclass, 
+                    UInt32* bhtab,
+                    Int32   nblock,
+                    Int32   verb )
+{
+   Int32 ftab[257];
+   Int32 ftabCopy[256];
+   Int32 H, i, j, k, l, r, cc, cc1;
+   Int32 nNotDone;
+   Int32 nBhtab;
+   UChar* eclass8 = (UChar*)eclass;
+
+   /*--
+      Initial 1-char radix sort to generate
+      initial fmap and initial BH bits.
+   --*/
+   if (verb >= 4)
+      VPrintf0 ( "        bucket sorting ...\n" );
+   for (i = 0; i < 257;    i++) ftab[i] = 0;
+   for (i = 0; i < nblock; i++) ftab[eclass8[i]]++;
+   for (i = 0; i < 256;    i++) ftabCopy[i] = ftab[i];
+   for (i = 1; i < 257;    i++) ftab[i] += ftab[i-1];
+
+   for (i = 0; i < nblock; i++) {
+      j = eclass8[i];
+      k = ftab[j] - 1;
+      ftab[j] = k;
+      fmap[k] = i;
+   }
+
+   nBhtab = 2 + (nblock / 32);
+   for (i = 0; i < nBhtab; i++) bhtab[i] = 0;
+   for (i = 0; i < 256; i++) SET_BH(ftab[i]);
+
+   /*--
+      Inductively refine the buckets.  Kind-of an
+      "exponential radix sort" (!), inspired by the
+      Manber-Myers suffix array construction algorithm.
+   --*/
+
+   /*-- set sentinel bits for block-end detection --*/
+   for (i = 0; i < 32; i++) { 
+      SET_BH(nblock + 2*i);
+      CLEAR_BH(nblock + 2*i + 1);
+   }
+
+   /*-- the log(N) loop --*/
+   H = 1;
+   while (1) {
+
+      if (verb >= 4) 
+         VPrintf1 ( "        depth %6d has ", H );
+
+      j = 0;
+      for (i = 0; i < nblock; i++) {
+         if (ISSET_BH(i)) j = i;
+         k = fmap[i] - H; if (k < 0) k += nblock;
+         eclass[k] = j;
+      }
+
+      nNotDone = 0;
+      r = -1;
+      while (1) {
+
+	 /*-- find the next non-singleton bucket --*/
+         k = r + 1;
+         while (ISSET_BH(k) && UNALIGNED_BH(k)) k++;
+         if (ISSET_BH(k)) {
+            while (WORD_BH(k) == 0xffffffff) k += 32;
+            while (ISSET_BH(k)) k++;
+         }
+         l = k - 1;
+         if (l >= nblock) break;
+         while (!ISSET_BH(k) && UNALIGNED_BH(k)) k++;
+         if (!ISSET_BH(k)) {
+            while (WORD_BH(k) == 0x00000000) k += 32;
+            while (!ISSET_BH(k)) k++;
+         }
+         r = k - 1;
+         if (r >= nblock) break;
+
+         /*-- now [l, r] bracket current bucket --*/
+         if (r > l) {
+            nNotDone += (r - l + 1);
+            fallbackQSort3 ( fmap, eclass, l, r );
+
+            /*-- scan bucket and generate header bits-- */
+            cc = -1;
+            for (i = l; i <= r; i++) {
+               cc1 = eclass[fmap[i]];
+               if (cc != cc1) { SET_BH(i); cc = cc1; };
+            }
+         }
+      }
+
+      if (verb >= 4) 
+         VPrintf1 ( "%6d unresolved strings\n", nNotDone );
+
+      H *= 2;
+      if (H > nblock || nNotDone == 0) break;
+   }
+
+   /*-- 
+      Reconstruct the original block in
+      eclass8 [0 .. nblock-1], since the
+      previous phase destroyed it.
+   --*/
+   if (verb >= 4)
+      VPrintf0 ( "        reconstructing block ...\n" );
+   j = 0;
+   for (i = 0; i < nblock; i++) {
+      while (ftabCopy[j] == 0) j++;
+      ftabCopy[j]--;
+      eclass8[fmap[i]] = (UChar)j;
+   }
+   AssertH ( j < 256, 1005 );
+}
+
+#undef       SET_BH
+#undef     CLEAR_BH
+#undef     ISSET_BH
+#undef      WORD_BH
+#undef UNALIGNED_BH
+
+
+/*---------------------------------------------*/
+/*--- The main, O(N^2 log(N)) sorting       ---*/
+/*--- algorithm.  Faster for "normal"       ---*/
+/*--- non-repetitive blocks.                ---*/
+/*---------------------------------------------*/
+
+/*---------------------------------------------*/
+static
+__inline__
+Bool mainGtU ( UInt32  i1, 
+               UInt32  i2,
+               UChar*  block, 
+               UInt16* quadrant,
+               UInt32  nblock,
+               Int32*  budget )
+{
+   Int32  k;
+   UChar  c1, c2;
+   UInt16 s1, s2;
+
+   AssertD ( i1 != i2, "mainGtU" );
+   /* 1 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 2 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 3 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 4 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 5 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 6 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 7 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 8 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 9 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 10 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 11 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+   /* 12 */
+   c1 = block[i1]; c2 = block[i2];
+   if (c1 != c2) return (c1 > c2);
+   i1++; i2++;
+
+   k = nblock + 8;
+
+   do {
+      /* 1 */
+      c1 = block[i1]; c2 = block[i2];
+      if (c1 != c2) return (c1 > c2);
+      s1 = quadrant[i1]; s2 = quadrant[i2];
+      if (s1 != s2) return (s1 > s2);
+      i1++; i2++;
+      /* 2 */
+      c1 = block[i1]; c2 = block[i2];
+      if (c1 != c2) return (c1 > c2);
+      s1 = quadrant[i1]; s2 = quadrant[i2];
+      if (s1 != s2) return (s1 > s2);
+      i1++; i2++;
+      /* 3 */
+      c1 = block[i1]; c2 = block[i2];
+      if (c1 != c2) return (c1 > c2);
+      s1 = quadrant[i1]; s2 = quadrant[i2];
+      if (s1 != s2) return (s1 > s2);
+      i1++; i2++;
+      /* 4 */
+      c1 = block[i1]; c2 = block[i2];
+      if (c1 != c2) return (c1 > c2);
+      s1 = quadrant[i1]; s2 = quadrant[i2];
+      if (s1 != s2) return (s1 > s2);
+      i1++; i2++;
+      /* 5 */
+      c1 = block[i1]; c2 = block[i2];
+      if (c1 != c2) return (c1 > c2);
+      s1 = quadrant[i1]; s2 = quadrant[i2];
+      if (s1 != s2) return (s1 > s2);
+      i1++; i2++;
+      /* 6 */
+      c1 = block[i1]; c2 = block[i2];
+      if (c1 != c2) return (c1 > c2);
+      s1 = quadrant[i1]; s2 = quadrant[i2];
+      if (s1 != s2) return (s1 > s2);
+      i1++; i2++;
+      /* 7 */
+      c1 = block[i1]; c2 = block[i2];
+      if (c1 != c2) return (c1 > c2);
+      s1 = quadrant[i1]; s2 = quadrant[i2];
+      if (s1 != s2) return (s1 > s2);
+      i1++; i2++;
+      /* 8 */
+      c1 = block[i1]; c2 = block[i2];
+      if (c1 != c2) return (c1 > c2);
+      s1 = quadrant[i1]; s2 = quadrant[i2];
+      if (s1 != s2) return (s1 > s2);
+      i1++; i2++;
+
+      if (i1 >= nblock) i1 -= nblock;
+      if (i2 >= nblock) i2 -= nblock;
+
+      k -= 8;
+      (*budget)--;
+   }
+      while (k >= 0);
+
+   return False;
+}
+
+
+/*---------------------------------------------*/
+/*--
+   Knuth's increments seem to work better
+   than Incerpi-Sedgewick here.  Possibly
+   because the number of elems to sort is
+   usually small, typically <= 20.
+--*/
+static
+Int32 incs[14] = { 1, 4, 13, 40, 121, 364, 1093, 3280,
+                   9841, 29524, 88573, 265720,
+                   797161, 2391484 };
+
+static
+void mainSimpleSort ( UInt32* ptr,
+                      UChar*  block,
+                      UInt16* quadrant,
+                      Int32   nblock,
+                      Int32   lo, 
+                      Int32   hi, 
+                      Int32   d,
+                      Int32*  budget )
+{
+   Int32 i, j, h, bigN, hp;
+   UInt32 v;
+
+   bigN = hi - lo + 1;
+   if (bigN < 2) return;
+
+   hp = 0;
+   while (incs[hp] < bigN) hp++;
+   hp--;
+
+   for (; hp >= 0; hp--) {
+      h = incs[hp];
+
+      i = lo + h;
+      while (True) {
+
+         /*-- copy 1 --*/
+         if (i > hi) break;
+         v = ptr[i];
+         j = i;
+         while ( mainGtU ( 
+                    ptr[j-h]+d, v+d, block, quadrant, nblock, budget 
+                 ) ) {
+            ptr[j] = ptr[j-h];
+            j = j - h;
+            if (j <= (lo + h - 1)) break;
+         }
+         ptr[j] = v;
+         i++;
+
+         /*-- copy 2 --*/
+         if (i > hi) break;
+         v = ptr[i];
+         j = i;
+         while ( mainGtU ( 
+                    ptr[j-h]+d, v+d, block, quadrant, nblock, budget 
+                 ) ) {
+            ptr[j] = ptr[j-h];
+            j = j - h;
+            if (j <= (lo + h - 1)) break;
+         }
+         ptr[j] = v;
+         i++;
+
+         /*-- copy 3 --*/
+         if (i > hi) break;
+         v = ptr[i];
+         j = i;
+         while ( mainGtU ( 
+                    ptr[j-h]+d, v+d, block, quadrant, nblock, budget 
+                 ) ) {
+            ptr[j] = ptr[j-h];
+            j = j - h;
+            if (j <= (lo + h - 1)) break;
+         }
+         ptr[j] = v;
+         i++;
+
+         if (*budget < 0) return;
+      }
+   }
+}
+
+
+/*---------------------------------------------*/
+/*--
+   The following is an implementation of
+   an elegant 3-way quicksort for strings,
+   described in a paper "Fast Algorithms for
+   Sorting and Searching Strings", by Robert
+   Sedgewick and Jon L. Bentley.
+--*/
+
+#define mswap(zz1, zz2) \
+   { Int32 zztmp = zz1; zz1 = zz2; zz2 = zztmp; }
+
+#define mvswap(zzp1, zzp2, zzn)       \
+{                                     \
+   Int32 yyp1 = (zzp1);               \
+   Int32 yyp2 = (zzp2);               \
+   Int32 yyn  = (zzn);                \
+   while (yyn > 0) {                  \
+      mswap(ptr[yyp1], ptr[yyp2]);    \
+      yyp1++; yyp2++; yyn--;          \
+   }                                  \
+}
+
+static 
+__inline__
+UChar mmed3 ( UChar a, UChar b, UChar c )
+{
+   UChar t;
+   if (a > b) { t = a; a = b; b = t; };
+   if (b > c) { 
+      b = c;
+      if (a > b) b = a;
+   }
+   return b;
+}
+
+#define mmin(a,b) ((a) < (b)) ? (a) : (b)
+
+#define mpush(lz,hz,dz) { stackLo[sp] = lz; \
+                          stackHi[sp] = hz; \
+                          stackD [sp] = dz; \
+                          sp++; }
+
+#define mpop(lz,hz,dz) { sp--;             \
+                         lz = stackLo[sp]; \
+                         hz = stackHi[sp]; \
+                         dz = stackD [sp]; }
+
+
+#define mnextsize(az) (nextHi[az]-nextLo[az])
+
+#define mnextswap(az,bz)                                        \
+   { Int32 tz;                                                  \
+     tz = nextLo[az]; nextLo[az] = nextLo[bz]; nextLo[bz] = tz; \
+     tz = nextHi[az]; nextHi[az] = nextHi[bz]; nextHi[bz] = tz; \
+     tz = nextD [az]; nextD [az] = nextD [bz]; nextD [bz] = tz; }
+
+
+#define MAIN_QSORT_SMALL_THRESH 20
+#define MAIN_QSORT_DEPTH_THRESH (BZ_N_RADIX + BZ_N_QSORT)
+#define MAIN_QSORT_STACK_SIZE 100
+
+static
+void mainQSort3 ( UInt32* ptr,
+                  UChar*  block,
+                  UInt16* quadrant,
+                  Int32   nblock,
+                  Int32   loSt, 
+                  Int32   hiSt, 
+                  Int32   dSt,
+                  Int32*  budget )
+{
+   Int32 unLo, unHi, ltLo, gtHi, n, m, med;
+   Int32 sp, lo, hi, d;
+
+   Int32 stackLo[MAIN_QSORT_STACK_SIZE];
+   Int32 stackHi[MAIN_QSORT_STACK_SIZE];
+   Int32 stackD [MAIN_QSORT_STACK_SIZE];
+
+   Int32 nextLo[3];
+   Int32 nextHi[3];
+   Int32 nextD [3];
+
+   sp = 0;
+   mpush ( loSt, hiSt, dSt );
+
+   while (sp > 0) {
+
+      AssertH ( sp < MAIN_QSORT_STACK_SIZE, 1001 );
+
+      mpop ( lo, hi, d );
+      if (hi - lo < MAIN_QSORT_SMALL_THRESH || 
+          d > MAIN_QSORT_DEPTH_THRESH) {
+         mainSimpleSort ( ptr, block, quadrant, nblock, lo, hi, d, budget );
+         if (*budget < 0) return;
+         continue;
+      }
+
+      med = (Int32) 
+            mmed3 ( block[ptr[ lo         ]+d],
+                    block[ptr[ hi         ]+d],
+                    block[ptr[ (lo+hi)>>1 ]+d] );
+
+      unLo = ltLo = lo;
+      unHi = gtHi = hi;
+
+      while (True) {
+         while (True) {
+            if (unLo > unHi) break;
+            n = ((Int32)block[ptr[unLo]+d]) - med;
+            if (n == 0) { 
+               mswap(ptr[unLo], ptr[ltLo]); 
+               ltLo++; unLo++; continue; 
+            };
+            if (n >  0) break;
+            unLo++;
+         }
+         while (True) {
+            if (unLo > unHi) break;
+            n = ((Int32)block[ptr[unHi]+d]) - med;
+            if (n == 0) { 
+               mswap(ptr[unHi], ptr[gtHi]); 
+               gtHi--; unHi--; continue; 
+            };
+            if (n <  0) break;
+            unHi--;
+         }
+         if (unLo > unHi) break;
+         mswap(ptr[unLo], ptr[unHi]); unLo++; unHi--;
+      }
+
+      AssertD ( unHi == unLo-1, "mainQSort3(2)" );
+
+      if (gtHi < ltLo) {
+         mpush(lo, hi, d+1 );
+         continue;
+      }
+
+      n = mmin(ltLo-lo, unLo-ltLo); mvswap(lo, unLo-n, n);
+      m = mmin(hi-gtHi, gtHi-unHi); mvswap(unLo, hi-m+1, m);
+
+      n = lo + unLo - ltLo - 1;
+      m = hi - (gtHi - unHi) + 1;
+
+      nextLo[0] = lo;  nextHi[0] = n;   nextD[0] = d;
+      nextLo[1] = m;   nextHi[1] = hi;  nextD[1] = d;
+      nextLo[2] = n+1; nextHi[2] = m-1; nextD[2] = d+1;
+
+      if (mnextsize(0) < mnextsize(1)) mnextswap(0,1);
+      if (mnextsize(1) < mnextsize(2)) mnextswap(1,2);
+      if (mnextsize(0) < mnextsize(1)) mnextswap(0,1);
+
+      AssertD (mnextsize(0) >= mnextsize(1), "mainQSort3(8)" );
+      AssertD (mnextsize(1) >= mnextsize(2), "mainQSort3(9)" );
+
+      mpush (nextLo[0], nextHi[0], nextD[0]);
+      mpush (nextLo[1], nextHi[1], nextD[1]);
+      mpush (nextLo[2], nextHi[2], nextD[2]);
+   }
+}
+
+#undef mswap
+#undef mvswap
+#undef mpush
+#undef mpop
+#undef mmin
+#undef mnextsize
+#undef mnextswap
+#undef MAIN_QSORT_SMALL_THRESH
+#undef MAIN_QSORT_DEPTH_THRESH
+#undef MAIN_QSORT_STACK_SIZE
+
+
+/*---------------------------------------------*/
+/* Pre:
+      nblock > N_OVERSHOOT
+      block32 exists for [0 .. nblock-1 +N_OVERSHOOT]
+      ((UChar*)block32) [0 .. nblock-1] holds block
+      ptr exists for [0 .. nblock-1]
+
+   Post:
+      ((UChar*)block32) [0 .. nblock-1] holds block
+      All other areas of block32 destroyed
+      ftab [0 .. 65536 ] destroyed
+      ptr [0 .. nblock-1] holds sorted order
+      if (*budget < 0), sorting was abandoned
+*/
+
+#define BIGFREQ(b) (ftab[((b)+1) << 8] - ftab[(b) << 8])
+#define SETMASK (1 << 21)
+#define CLEARMASK (~(SETMASK))
+
+static
+void mainSort ( UInt32* ptr, 
+                UChar*  block,
+                UInt16* quadrant, 
+                UInt32* ftab,
+                Int32   nblock,
+                Int32   verb,
+                Int32*  budget )
+{
+   Int32  i, j, k, ss, sb;
+   Int32  runningOrder[256];
+   Bool   bigDone[256];
+   Int32  copyStart[256];
+   Int32  copyEnd  [256];
+   UChar  c1;
+   Int32  numQSorted;
+   UInt16 s;
+   if (verb >= 4) VPrintf0 ( "        main sort initialise ...\n" );
+
+   /*-- set up the 2-byte frequency table --*/
+   for (i = 65536; i >= 0; i--) ftab[i] = 0;
+
+   j = block[0] << 8;
+   i = nblock-1;
+   for (; i >= 3; i -= 4) {
+      quadrant[i] = 0;
+      j = (j >> 8) | ( ((UInt16)block[i]) << 8);
+      ftab[j]++;
+      quadrant[i-1] = 0;
+      j = (j >> 8) | ( ((UInt16)block[i-1]) << 8);
+      ftab[j]++;
+      quadrant[i-2] = 0;
+      j = (j >> 8) | ( ((UInt16)block[i-2]) << 8);
+      ftab[j]++;
+      quadrant[i-3] = 0;
+      j = (j >> 8) | ( ((UInt16)block[i-3]) << 8);
+      ftab[j]++;
+   }
+   for (; i >= 0; i--) {
+      quadrant[i] = 0;
+      j = (j >> 8) | ( ((UInt16)block[i]) << 8);
+      ftab[j]++;
+   }
+
+   /*-- (emphasises close relationship of block & quadrant) --*/
+   for (i = 0; i < BZ_N_OVERSHOOT; i++) {
+      block   [nblock+i] = block[i];
+      quadrant[nblock+i] = 0;
+   }
+
+   if (verb >= 4) VPrintf0 ( "        bucket sorting ...\n" );
+
+   /*-- Complete the initial radix sort --*/
+   for (i = 1; i <= 65536; i++) ftab[i] += ftab[i-1];
+
+   s = block[0] << 8;
+   i = nblock-1;
+   for (; i >= 3; i -= 4) {
+      s = (s >> 8) | (block[i] << 8);
+      j = ftab[s] -1;
+      ftab[s] = j;
+      ptr[j] = i;
+      s = (s >> 8) | (block[i-1] << 8);
+      j = ftab[s] -1;
+      ftab[s] = j;
+      ptr[j] = i-1;
+      s = (s >> 8) | (block[i-2] << 8);
+      j = ftab[s] -1;
+      ftab[s] = j;
+      ptr[j] = i-2;
+      s = (s >> 8) | (block[i-3] << 8);
+      j = ftab[s] -1;
+      ftab[s] = j;
+      ptr[j] = i-3;
+   }
+   for (; i >= 0; i--) {
+      s = (s >> 8) | (block[i] << 8);
+      j = ftab[s] -1;
+      ftab[s] = j;
+      ptr[j] = i;
+   }
+
+   /*--
+      Now ftab contains the first loc of every small bucket.
+      Calculate the running order, from smallest to largest
+      big bucket.
+   --*/
+   for (i = 0; i <= 255; i++) {
+      bigDone     [i] = False;
+      runningOrder[i] = i;
+   }
+
+   {
+      Int32 vv;
+      Int32 h = 1;
+      do h = 3 * h + 1; while (h <= 256);
+      do {
+         h = h / 3;
+         for (i = h; i <= 255; i++) {
+            vv = runningOrder[i];
+            j = i;
+            while ( BIGFREQ(runningOrder[j-h]) > BIGFREQ(vv) ) {
+               runningOrder[j] = runningOrder[j-h];
+               j = j - h;
+               if (j <= (h - 1)) goto zero;
+            }
+            zero:
+            runningOrder[j] = vv;
+         }
+      } while (h != 1);
+   }
+
+   /*--
+      The main sorting loop.
+   --*/
+
+   numQSorted = 0;
+
+   for (i = 0; i <= 255; i++) {
+
+      /*--
+         Process big buckets, starting with the least full.
+         Basically this is a 3-step process in which we call
+         mainQSort3 to sort the small buckets [ss, j], but
+         also make a big effort to avoid the calls if we can.
+      --*/
+      ss = runningOrder[i];
+
+      /*--
+         Step 1:
+         Complete the big bucket [ss] by quicksorting
+         any unsorted small buckets [ss, j], for j != ss.  
+         Hopefully previous pointer-scanning phases have already
+         completed many of the small buckets [ss, j], so
+         we don't have to sort them at all.
+      --*/
+      for (j = 0; j <= 255; j++) {
+         if (j != ss) {
+            sb = (ss << 8) + j;
+            if ( ! (ftab[sb] & SETMASK) ) {
+               Int32 lo = ftab[sb]   & CLEARMASK;
+               Int32 hi = (ftab[sb+1] & CLEARMASK) - 1;
+               if (hi > lo) {
+                  if (verb >= 4)
+                     VPrintf4 ( "        qsort [0x%x, 0x%x]   "
+                                "done %d   this %d\n",
+                                ss, j, numQSorted, hi - lo + 1 );
+                  mainQSort3 ( 
+                     ptr, block, quadrant, nblock, 
+                     lo, hi, BZ_N_RADIX, budget 
+                  );   
+                  numQSorted += (hi - lo + 1);
+                  if (*budget < 0) return;
+               }
+            }
+            ftab[sb] |= SETMASK;
+         }
+      }
+
+      AssertH ( !bigDone[ss], 1006 );
+
+      /*--
+         Step 2:
+         Now scan this big bucket [ss] so as to synthesise the
+         sorted order for small buckets [t, ss] for all t,
+         including, magically, the bucket [ss,ss] too.
+         This will avoid doing Real Work in subsequent Step 1's.
+      --*/
+      {
+         for (j = 0; j <= 255; j++) {
+            copyStart[j] =  ftab[(j << 8) + ss]     & CLEARMASK;
+            copyEnd  [j] = (ftab[(j << 8) + ss + 1] & CLEARMASK) - 1;
+         }
+         for (j = ftab[ss << 8] & CLEARMASK; j < copyStart[ss]; j++) {
+            k = ptr[j]-1; if (k < 0) k += nblock;
+            c1 = block[k];
+            if (!bigDone[c1])
+               ptr[ copyStart[c1]++ ] = k;
+         }
+         for (j = (ftab[(ss+1) << 8] & CLEARMASK) - 1; j > copyEnd[ss]; j--) {
+            k = ptr[j]-1; if (k < 0) k += nblock;
+            c1 = block[k];
+            if (!bigDone[c1]) 
+               ptr[ copyEnd[c1]-- ] = k;
+         }
+      }
+
+      AssertH ( copyStart[ss]-1 == copyEnd[ss], 1007 );
+
+      for (j = 0; j <= 255; j++) ftab[(j << 8) + ss] |= SETMASK;
+
+      /*--
+         Step 3:
+         The [ss] big bucket is now done.  Record this fact,
+         and update the quadrant descriptors.  Remember to
+         update quadrants in the overshoot area too, if
+         necessary.  The "if (i < 255)" test merely skips
+         this updating for the last bucket processed, since
+         updating for the last bucket is pointless.
+
+         The quadrant array provides a way to incrementally
+         cache sort orderings, as they appear, so as to 
+         make subsequent comparisons in fullGtU() complete
+         faster.  For repetitive blocks this makes a big
+         difference (but not big enough to be able to avoid
+         the fallback sorting mechanism, exponential radix sort).
+
+         The precise meaning is: at all times:
+
+            for 0 <= i < nblock and 0 <= j <= nblock
+
+            if block[i] != block[j], 
+
+               then the relative values of quadrant[i] and 
+                    quadrant[j] are meaningless.
+
+               else {
+                  if quadrant[i] < quadrant[j]
+                     then the string starting at i lexicographically
+                     precedes the string starting at j
+
+                  else if quadrant[i] > quadrant[j]
+                     then the string starting at j lexicographically
+                     precedes the string starting at i
+
+                  else
+                     the relative ordering of the strings starting
+                     at i and j has not yet been determined.
+               }
+      --*/
+      bigDone[ss] = True;
+
+      if (i < 255) {
+         Int32 bbStart  = ftab[ss << 8] & CLEARMASK;
+         Int32 bbSize   = (ftab[(ss+1) << 8] & CLEARMASK) - bbStart;
+         Int32 shifts   = 0;
+
+         while ((bbSize >> shifts) > 65534) shifts++;
+
+         for (j = bbSize-1; j >= 0; j--) {
+            Int32 a2update     = ptr[bbStart + j];
+            UInt16 qVal        = (UInt16)(j >> shifts);
+            quadrant[a2update] = qVal;
+            if (a2update < BZ_N_OVERSHOOT)
+               quadrant[a2update + nblock] = qVal;
+         }
+         AssertH ( ((bbSize-1) >> shifts) <= 65535, 1002 );
+      }
+
+   }
+
+   if (verb >= 4)
+      VPrintf3 ( "        %d pointers, %d sorted, %d scanned\n",
+                 nblock, numQSorted, nblock - numQSorted );
+}
+
+#undef BIGFREQ
+#undef SETMASK
+#undef CLEARMASK
+
+
+/*---------------------------------------------*/
+/* Pre:
+      nblock > 0
+      arr2 exists for [0 .. nblock-1 +N_OVERSHOOT]
+      ((UChar*)arr2)  [0 .. nblock-1] holds block
+      arr1 exists for [0 .. nblock-1]
+
+   Post:
+      ((UChar*)arr2) [0 .. nblock-1] holds block
+      All other areas of block destroyed
+      ftab [ 0 .. 65536 ] destroyed
+      arr1 [0 .. nblock-1] holds sorted order
+*/
+void BZ2_blockSort ( EState* s )
+{
+   UInt32* ptr    = s->ptr; 
+   UChar*  block  = s->block;
+   UInt32* ftab   = s->ftab;
+   Int32   nblock = s->nblock;
+   Int32   verb   = s->verbosity;
+   Int32   wfact  = s->workFactor;
+   UInt16* quadrant;
+   Int32   budget;
+   Int32   budgetInit;
+   Int32   i;
+
+   if (nblock < 10000) {
+      fallbackSort ( s->arr1, s->arr2, ftab, nblock, verb );
+   } else {
+      /* Calculate the location for quadrant, remembering to get
+         the alignment right.  Assumes that &(block[0]) is at least
+         2-byte aligned -- this should be ok since block is really
+         the first section of arr2.
+      */
+      i = nblock+BZ_N_OVERSHOOT;
+      if (i & 1) i++;
+      quadrant = (UInt16*)(&(block[i]));
+
+      /* (wfact-1) / 3 puts the default-factor-30
+         transition point at very roughly the same place as 
+         with v0.1 and v0.9.0.  
+         Not that it particularly matters any more, since the
+         resulting compressed stream is now the same regardless
+         of whether or not we use the main sort or fallback sort.
+      */
+      if (wfact < 1  ) wfact = 1;
+      if (wfact > 100) wfact = 100;
+      budgetInit = nblock * ((wfact-1) / 3);
+      budget = budgetInit;
+
+      mainSort ( ptr, block, quadrant, ftab, nblock, verb, &budget );
+      if (verb >= 3) 
+         VPrintf3 ( "      %d work, %d block, ratio %5.2f\n",
+                    budgetInit - budget,
+                    nblock, 
+                    (float)(budgetInit - budget) /
+                    (float)(nblock==0 ? 1 : nblock) ); 
+      if (budget < 0) {
+         if (verb >= 2) 
+            VPrintf0 ( "    too repetitive; using fallback"
+                       " sorting algorithm\n" );
+         fallbackSort ( s->arr1, s->arr2, ftab, nblock, verb );
+      }
+   }
+
+   s->origPtr = -1;
+   for (i = 0; i < s->nblock; i++)
+      if (ptr[i] == 0)
+         { s->origPtr = i; break; };
+
+   AssertH( s->origPtr != -1, 1003 );
+}
+
+
+/*-------------------------------------------------------------*/
+/*--- end                                       blocksort.c ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/bzip2.1 b/bzip2/bzip2.1
new file mode 100644
index 000000000..7de54a011
--- /dev/null
+++ b/bzip2/bzip2.1
@@ -0,0 +1,439 @@
+.PU
+.TH bzip2 1
+.SH NAME
+bzip2, bunzip2 \- a block-sorting file compressor, v1.0
+.br
+bzcat \- decompresses files to stdout
+.br
+bzip2recover \- recovers data from damaged bzip2 files
+
+.SH SYNOPSIS
+.ll +8
+.B bzip2
+.RB [ " \-cdfkqstvzVL123456789 " ]
+[
+.I "filenames \&..."
+]
+.ll -8
+.br
+.B bunzip2
+.RB [ " \-fkvsVL " ]
+[ 
+.I "filenames \&..."
+]
+.br
+.B bzcat
+.RB [ " \-s " ]
+[ 
+.I "filenames \&..."
+]
+.br
+.B bzip2recover
+.I "filename"
+
+.SH DESCRIPTION
+.I bzip2
+compresses files using the Burrows-Wheeler block sorting
+text compression algorithm, and Huffman coding.  Compression is
+generally considerably better than that achieved by more conventional
+LZ77/LZ78-based compressors, and approaches the performance of the PPM
+family of statistical compressors.
+
+The command-line options are deliberately very similar to 
+those of 
+.I GNU gzip, 
+but they are not identical.
+
+.I bzip2
+expects a list of file names to accompany the
+command-line flags.  Each file is replaced by a compressed version of
+itself, with the name "original_name.bz2".  
+Each compressed file
+has the same modification date, permissions, and, when possible,
+ownership as the corresponding original, so that these properties can
+be correctly restored at decompression time.  File name handling is
+naive in the sense that there is no mechanism for preserving original
+file names, permissions, ownerships or dates in filesystems which lack
+these concepts, or have serious file name length restrictions, such as
+MS-DOS.
+
+.I bzip2
+and
+.I bunzip2
+will by default not overwrite existing
+files.  If you want this to happen, specify the \-f flag.
+
+If no file names are specified,
+.I bzip2
+compresses from standard
+input to standard output.  In this case,
+.I bzip2
+will decline to
+write compressed output to a terminal, as this would be entirely
+incomprehensible and therefore pointless.
+
+.I bunzip2
+(or
+.I bzip2 \-d) 
+decompresses all
+specified files.  Files which were not created by 
+.I bzip2
+will be detected and ignored, and a warning issued.  
+.I bzip2
+attempts to guess the filename for the decompressed file 
+from that of the compressed file as follows:
+
+       filename.bz2    becomes   filename
+       filename.bz     becomes   filename
+       filename.tbz2   becomes   filename.tar
+       filename.tbz    becomes   filename.tar
+       anyothername    becomes   anyothername.out
+
+If the file does not end in one of the recognised endings, 
+.I .bz2, 
+.I .bz, 
+.I .tbz2
+or
+.I .tbz, 
+.I bzip2 
+complains that it cannot
+guess the name of the original file, and uses the original name
+with
+.I .out
+appended.
+
+As with compression, supplying no
+filenames causes decompression from 
+standard input to standard output.
+
+.I bunzip2 
+will correctly decompress a file which is the
+concatenation of two or more compressed files.  The result is the
+concatenation of the corresponding uncompressed files.  Integrity
+testing (\-t) 
+of concatenated 
+compressed files is also supported.
+
+You can also compress or decompress files to the standard output by
+giving the \-c flag.  Multiple files may be compressed and
+decompressed like this.  The resulting outputs are fed sequentially to
+stdout.  Compression of multiple files 
+in this manner generates a stream
+containing multiple compressed file representations.  Such a stream
+can be decompressed correctly only by
+.I bzip2 
+version 0.9.0 or
+later.  Earlier versions of
+.I bzip2
+will stop after decompressing
+the first file in the stream.
+
+.I bzcat
+(or
+.I bzip2 -dc) 
+decompresses all specified files to
+the standard output.
+
+.I bzip2
+will read arguments from the environment variables
+.I BZIP2
+and
+.I BZIP,
+in that order, and will process them
+before any arguments read from the command line.  This gives a 
+convenient way to supply default arguments.
+
+Compression is always performed, even if the compressed 
+file is slightly
+larger than the original.  Files of less than about one hundred bytes
+tend to get larger, since the compression mechanism has a constant
+overhead in the region of 50 bytes.  Random data (including the output
+of most file compressors) is coded at about 8.05 bits per byte, giving
+an expansion of around 0.5%.
+
+As a self-check for your protection, 
+.I 
+bzip2
+uses 32-bit CRCs to
+make sure that the decompressed version of a file is identical to the
+original.  This guards against corruption of the compressed data, and
+against undetected bugs in
+.I bzip2
+(hopefully very unlikely).  The
+chances of data corruption going undetected is microscopic, about one
+chance in four billion for each file processed.  Be aware, though, that
+the check occurs upon decompression, so it can only tell you that
+something is wrong.  It can't help you 
+recover the original uncompressed
+data.  You can use 
+.I bzip2recover
+to try to recover data from
+damaged files.
+
+Return values: 0 for a normal exit, 1 for environmental problems (file
+not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt
+compressed file, 3 for an internal consistency error (eg, bug) which
+caused
+.I bzip2
+to panic.
+
+.SH OPTIONS
+.TP
+.B \-c --stdout
+Compress or decompress to standard output.
+.TP
+.B \-d --decompress
+Force decompression.  
+.I bzip2, 
+.I bunzip2 
+and
+.I bzcat 
+are
+really the same program, and the decision about what actions to take is
+done on the basis of which name is used.  This flag overrides that
+mechanism, and forces 
+.I bzip2
+to decompress.
+.TP
+.B \-z --compress
+The complement to \-d: forces compression, regardless of the
+invokation name.
+.TP
+.B \-t --test
+Check integrity of the specified file(s), but don't decompress them.
+This really performs a trial decompression and throws away the result.
+.TP
+.B \-f --force
+Force overwrite of output files.  Normally,
+.I bzip2 
+will not overwrite
+existing output files.  Also forces 
+.I bzip2 
+to break hard links
+to files, which it otherwise wouldn't do.
+.TP
+.B \-k --keep
+Keep (don't delete) input files during compression
+or decompression.
+.TP
+.B \-s --small
+Reduce memory usage, for compression, decompression and testing.  Files
+are decompressed and tested using a modified algorithm which only
+requires 2.5 bytes per block byte.  This means any file can be
+decompressed in 2300k of memory, albeit at about half the normal speed.
+
+During compression, \-s selects a block size of 200k, which limits
+memory use to around the same figure, at the expense of your compression
+ratio.  In short, if your machine is low on memory (8 megabytes or
+less), use \-s for everything.  See MEMORY MANAGEMENT below.
+.TP
+.B \-q --quiet
+Suppress non-essential warning messages.  Messages pertaining to
+I/O errors and other critical events will not be suppressed.
+.TP
+.B \-v --verbose
+Verbose mode -- show the compression ratio for each file processed.
+Further \-v's increase the verbosity level, spewing out lots of
+information which is primarily of interest for diagnostic purposes.
+.TP
+.B \-L --license -V --version
+Display the software version, license terms and conditions.
+.TP
+.B \-1 to \-9
+Set the block size to 100 k, 200 k ..  900 k when compressing.  Has no
+effect when decompressing.  See MEMORY MANAGEMENT below.
+.TP
+.B \--
+Treats all subsequent arguments as file names, even if they start
+with a dash.  This is so you can handle files with names beginning
+with a dash, for example: bzip2 \-- \-myfilename.
+.TP
+.B \--repetitive-fast --repetitive-best
+These flags are redundant in versions 0.9.5 and above.  They provided
+some coarse control over the behaviour of the sorting algorithm in
+earlier versions, which was sometimes useful.  0.9.5 and above have an
+improved algorithm which renders these flags irrelevant.
+
+.SH MEMORY MANAGEMENT
+.I bzip2 
+compresses large files in blocks.  The block size affects
+both the compression ratio achieved, and the amount of memory needed for
+compression and decompression.  The flags \-1 through \-9
+specify the block size to be 100,000 bytes through 900,000 bytes (the
+default) respectively.  At decompression time, the block size used for
+compression is read from the header of the compressed file, and
+.I bunzip2
+then allocates itself just enough memory to decompress
+the file.  Since block sizes are stored in compressed files, it follows
+that the flags \-1 to \-9 are irrelevant to and so ignored
+during decompression.
+
+Compression and decompression requirements, 
+in bytes, can be estimated as:
+
+       Compression:   400k + ( 8 x block size )
+
+       Decompression: 100k + ( 4 x block size ), or
+                      100k + ( 2.5 x block size )
+
+Larger block sizes give rapidly diminishing marginal returns.  Most of
+the compression comes from the first two or three hundred k of block
+size, a fact worth bearing in mind when using
+.I bzip2
+on small machines.
+It is also important to appreciate that the decompression memory
+requirement is set at compression time by the choice of block size.
+
+For files compressed with the default 900k block size,
+.I bunzip2
+will require about 3700 kbytes to decompress.  To support decompression
+of any file on a 4 megabyte machine, 
+.I bunzip2
+has an option to
+decompress using approximately half this amount of memory, about 2300
+kbytes.  Decompression speed is also halved, so you should use this
+option only where necessary.  The relevant flag is -s.
+
+In general, try and use the largest block size memory constraints allow,
+since that maximises the compression achieved.  Compression and
+decompression speed are virtually unaffected by block size.
+
+Another significant point applies to files which fit in a single block
+-- that means most files you'd encounter using a large block size.  The
+amount of real memory touched is proportional to the size of the file,
+since the file is smaller than a block.  For example, compressing a file
+20,000 bytes long with the flag -9 will cause the compressor to
+allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560
+kbytes of it.  Similarly, the decompressor will allocate 3700k but only
+touch 100k + 20000 * 4 = 180 kbytes.
+
+Here is a table which summarises the maximum memory usage for different
+block sizes.  Also recorded is the total compressed size for 14 files of
+the Calgary Text Compression Corpus totalling 3,141,622 bytes.  This
+column gives some feel for how compression varies with block size.
+These figures tend to understate the advantage of larger block sizes for
+larger files, since the Corpus is dominated by smaller files.
+
+           Compress   Decompress   Decompress   Corpus
+    Flag     usage      usage       -s usage     Size
+
+     -1      1200k       500k         350k      914704
+     -2      2000k       900k         600k      877703
+     -3      2800k      1300k         850k      860338
+     -4      3600k      1700k        1100k      846899
+     -5      4400k      2100k        1350k      845160
+     -6      5200k      2500k        1600k      838626
+     -7      6100k      2900k        1850k      834096
+     -8      6800k      3300k        2100k      828642
+     -9      7600k      3700k        2350k      828642
+
+.SH RECOVERING DATA FROM DAMAGED FILES
+.I bzip2
+compresses files in blocks, usually 900kbytes long.  Each
+block is handled independently.  If a media or transmission error causes
+a multi-block .bz2
+file to become damaged, it may be possible to
+recover data from the undamaged blocks in the file.
+
+The compressed representation of each block is delimited by a 48-bit
+pattern, which makes it possible to find the block boundaries with
+reasonable certainty.  Each block also carries its own 32-bit CRC, so
+damaged blocks can be distinguished from undamaged ones.
+
+.I bzip2recover
+is a simple program whose purpose is to search for
+blocks in .bz2 files, and write each block out into its own .bz2 
+file.  You can then use
+.I bzip2 
+\-t
+to test the
+integrity of the resulting files, and decompress those which are
+undamaged.
+
+.I bzip2recover
+takes a single argument, the name of the damaged file, 
+and writes a number of files "rec0001file.bz2",
+"rec0002file.bz2", etc, containing the  extracted  blocks.
+The  output  filenames  are  designed  so  that the use of
+wildcards in subsequent processing -- for example,  
+"bzip2 -dc  rec*file.bz2 > recovered_data" -- lists the files in
+the correct order.
+
+.I bzip2recover
+should be of most use dealing with large .bz2
+files,  as  these will contain many blocks.  It is clearly
+futile to use it on damaged single-block  files,  since  a
+damaged  block  cannot  be recovered.  If you wish to minimise 
+any potential data loss through media  or  transmission errors, 
+you might consider compressing with a smaller
+block size.
+
+.SH PERFORMANCE NOTES
+The sorting phase of compression gathers together similar strings in the
+file.  Because of this, files containing very long runs of repeated
+symbols, like "aabaabaabaab ..."  (repeated several hundred times) may
+compress more slowly than normal.  Versions 0.9.5 and above fare much
+better than previous versions in this respect.  The ratio between
+worst-case and average-case compression time is in the region of 10:1.
+For previous versions, this figure was more like 100:1.  You can use the
+\-vvvv option to monitor progress in great detail, if you want.
+
+Decompression speed is unaffected by these phenomena.
+
+.I bzip2
+usually allocates several megabytes of memory to operate
+in, and then charges all over it in a fairly random fashion.  This means
+that performance, both for compressing and decompressing, is largely
+determined by the speed at which your machine can service cache misses.
+Because of this, small changes to the code to reduce the miss rate have
+been observed to give disproportionately large performance improvements.
+I imagine 
+.I bzip2
+will perform best on machines with very large caches.
+
+.SH CAVEATS
+I/O error messages are not as helpful as they could be.
+.I bzip2
+tries hard to detect I/O errors and exit cleanly, but the details of
+what the problem is sometimes seem rather misleading.
+
+This manual page pertains to version 1.0 of
+.I bzip2.  
+Compressed
+data created by this version is entirely forwards and backwards
+compatible with the previous public releases, versions 0.1pl2, 0.9.0
+and 0.9.5,
+but with the following exception: 0.9.0 and above can correctly
+decompress multiple concatenated compressed files.  0.1pl2 cannot do
+this; it will stop after decompressing just the first file in the
+stream.
+
+.I bzip2recover
+uses 32-bit integers to represent bit positions in
+compressed files, so it cannot handle compressed files more than 512
+megabytes long.  This could easily be fixed.
+
+.SH AUTHOR
+Julian Seward, jseward@acm.org.
+
+http://sourceware.cygnus.com/bzip2
+http://www.muraroa.demon.co.uk
+
+The ideas embodied in
+.I bzip2
+are due to (at least) the following
+people: Michael Burrows and David Wheeler (for the block sorting
+transformation), David Wheeler (again, for the Huffman coder), Peter
+Fenwick (for the structured coding model in the original
+.I bzip,
+and many refinements), and Alistair Moffat, Radford Neal and Ian Witten
+(for the arithmetic coder in the original
+.I bzip).  
+I am much
+indebted for their help, support and advice.  See the manual in the
+source distribution for pointers to sources of documentation.  Christian
+von Roques encouraged me to look for faster sorting algorithms, so as to
+speed up compression.  Bela Lubkin encouraged me to improve the
+worst-case compression performance.  Many people sent patches, helped
+with portability problems, lent machines, gave advice and were generally
+helpful.
diff --git a/bzip2/bzip2.1.preformatted b/bzip2/bzip2.1.preformatted
new file mode 100644
index 000000000..9f18339e9
--- /dev/null
+++ b/bzip2/bzip2.1.preformatted
@@ -0,0 +1,462 @@
+
+
+
+bzip2(1)                                                 bzip2(1)
+
+
+NNAAMMEE
+       bzip2, bunzip2 - a block-sorting file compressor, v1.0
+       bzcat - decompresses files to stdout
+       bzip2recover - recovers data from damaged bzip2 files
+
+
+SSYYNNOOPPSSIISS
+       bbzziipp22 [ --ccddffkkqqssttvvzzVVLL112233445566778899 ] [ _f_i_l_e_n_a_m_e_s _._._.  ]
+       bbuunnzziipp22 [ --ffkkvvssVVLL ] [ _f_i_l_e_n_a_m_e_s _._._.  ]
+       bbzzccaatt [ --ss ] [ _f_i_l_e_n_a_m_e_s _._._.  ]
+       bbzziipp22rreeccoovveerr _f_i_l_e_n_a_m_e
+
+
+DDEESSCCRRIIPPTTIIOONN
+       _b_z_i_p_2  compresses  files  using  the Burrows-Wheeler block
+       sorting text compression algorithm,  and  Huffman  coding.
+       Compression  is  generally  considerably  better than that
+       achieved by more conventional LZ77/LZ78-based compressors,
+       and  approaches  the performance of the PPM family of sta-
+       tistical compressors.
+
+       The command-line options are deliberately very similar  to
+       those of _G_N_U _g_z_i_p_, but they are not identical.
+
+       _b_z_i_p_2  expects  a list of file names to accompany the com-
+       mand-line flags.  Each file is replaced  by  a  compressed
+       version  of  itself,  with  the  name "original_name.bz2".
+       Each compressed file has the same modification date,  per-
+       missions, and, when possible, ownership as the correspond-
+       ing original, so that these properties  can  be  correctly
+       restored  at  decompression  time.   File name handling is
+       naive in the sense that there is no mechanism for preserv-
+       ing  original file names, permissions, ownerships or dates
+       in filesystems which lack these concepts, or have  serious
+       file name length restrictions, such as MS-DOS.
+
+       _b_z_i_p_2  and  _b_u_n_z_i_p_2 will by default not overwrite existing
+       files.  If you want this to happen, specify the -f flag.
+
+       If no file names  are  specified,  _b_z_i_p_2  compresses  from
+       standard  input  to  standard output.  In this case, _b_z_i_p_2
+       will decline to write compressed output to a terminal,  as
+       this  would  be  entirely  incomprehensible  and therefore
+       pointless.
+
+       _b_u_n_z_i_p_2 (or _b_z_i_p_2 _-_d_) decompresses  all  specified  files.
+       Files which were not created by _b_z_i_p_2 will be detected and
+       ignored, and a warning issued.  _b_z_i_p_2  attempts  to  guess
+       the  filename  for  the decompressed file from that of the
+       compressed file as follows:
+
+              filename.bz2    becomes   filename
+              filename.bz     becomes   filename
+              filename.tbz2   becomes   filename.tar
+
+
+
+                                                                1
+
+
+
+
+
+bzip2(1)                                                 bzip2(1)
+
+
+              filename.tbz    becomes   filename.tar
+              anyothername    becomes   anyothername.out
+
+       If the file does not end in one of the recognised endings,
+       _._b_z_2_,  _._b_z_,  _._t_b_z_2 or _._t_b_z_, _b_z_i_p_2 complains that it cannot
+       guess the name of the original file, and uses the original
+       name with _._o_u_t appended.
+
+       As  with compression, supplying no filenames causes decom-
+       pression from standard input to standard output.
+
+       _b_u_n_z_i_p_2 will correctly decompress a file which is the con-
+       catenation of two or more compressed files.  The result is
+       the concatenation of the corresponding uncompressed files.
+       Integrity testing (-t) of concatenated compressed files is
+       also supported.
+
+       You can also compress or decompress files to the  standard
+       output  by giving the -c flag.  Multiple files may be com-
+       pressed and decompressed like this.  The resulting outputs
+       are  fed  sequentially to stdout.  Compression of multiple
+       files in this manner generates a stream containing  multi-
+       ple compressed file representations.  Such a stream can be
+       decompressed correctly only  by  _b_z_i_p_2  version  0.9.0  or
+       later.   Earlier  versions of _b_z_i_p_2 will stop after decom-
+       pressing the first file in the stream.
+
+       _b_z_c_a_t (or _b_z_i_p_2 _-_d_c_) decompresses all specified  files  to
+       the standard output.
+
+       _b_z_i_p_2  will  read arguments from the environment variables
+       _B_Z_I_P_2 and _B_Z_I_P_, in  that  order,  and  will  process  them
+       before  any  arguments  read  from the command line.  This
+       gives a convenient way to supply default arguments.
+
+       Compression is always performed, even  if  the  compressed
+       file  is slightly larger than the original.  Files of less
+       than about one hundred bytes tend to get larger, since the
+       compression  mechanism  has  a  constant  overhead  in the
+       region of 50 bytes.  Random data (including the output  of
+       most  file  compressors)  is  coded at about 8.05 bits per
+       byte, giving an expansion of around 0.5%.
+
+       As a self-check for your  protection,  _b_z_i_p_2  uses  32-bit
+       CRCs  to make sure that the decompressed version of a file
+       is identical to the original.  This guards against corrup-
+       tion  of  the compressed data, and against undetected bugs
+       in _b_z_i_p_2 (hopefully very unlikely).  The chances  of  data
+       corruption  going  undetected  is  microscopic,  about one
+       chance in four billion for each file processed.  Be aware,
+       though,  that  the  check occurs upon decompression, so it
+       can only tell you that something is wrong.  It can't  help
+       you  recover  the original uncompressed data.  You can use
+       _b_z_i_p_2_r_e_c_o_v_e_r to try to recover data from damaged files.
+
+
+
+                                                                2
+
+
+
+
+
+bzip2(1)                                                 bzip2(1)
+
+
+       Return values: 0 for a normal exit,  1  for  environmental
+       problems  (file not found, invalid flags, I/O errors, &c),
+       2 to indicate a corrupt compressed file, 3 for an internal
+       consistency error (eg, bug) which caused _b_z_i_p_2 to panic.
+
+
+OOPPTTIIOONNSS
+       --cc ----ssttddoouutt
+              Compress or decompress to standard output.
+
+       --dd ----ddeeccoommpprreessss
+              Force  decompression.  _b_z_i_p_2_, _b_u_n_z_i_p_2 and _b_z_c_a_t are
+              really the same program,  and  the  decision  about
+              what  actions to take is done on the basis of which
+              name is used.  This flag overrides that  mechanism,
+              and forces _b_z_i_p_2 to decompress.
+
+       --zz ----ccoommpprreessss
+              The  complement  to -d: forces compression, regard-
+              less of the invokation name.
+
+       --tt ----tteesstt
+              Check integrity of the specified file(s), but don't
+              decompress  them.   This  really  performs  a trial
+              decompression and throws away the result.
+
+       --ff ----ffoorrccee
+              Force overwrite of output files.   Normally,  _b_z_i_p_2
+              will  not  overwrite  existing  output files.  Also
+              forces _b_z_i_p_2 to break hard links to files, which it
+              otherwise wouldn't do.
+
+       --kk ----kkeeeepp
+              Keep  (don't delete) input files during compression
+              or decompression.
+
+       --ss ----ssmmaallll
+              Reduce memory usage, for compression, decompression
+              and  testing.   Files  are  decompressed and tested
+              using a modified algorithm which only requires  2.5
+              bytes  per  block byte.  This means any file can be
+              decompressed in 2300k of memory,  albeit  at  about
+              half the normal speed.
+
+              During  compression,  -s  selects  a  block size of
+              200k, which limits memory use to  around  the  same
+              figure,  at  the expense of your compression ratio.
+              In short, if your  machine  is  low  on  memory  (8
+              megabytes  or  less),  use  -s for everything.  See
+              MEMORY MANAGEMENT below.
+
+       --qq ----qquuiieett
+              Suppress non-essential warning messages.   Messages
+              pertaining  to I/O errors and other critical events
+
+
+
+                                                                3
+
+
+
+
+
+bzip2(1)                                                 bzip2(1)
+
+
+              will not be suppressed.
+
+       --vv ----vveerrbboossee
+              Verbose mode -- show the compression ratio for each
+              file  processed.   Further  -v's  increase the ver-
+              bosity level, spewing out lots of information which
+              is primarily of interest for diagnostic purposes.
+
+       --LL ----lliicceennssee --VV ----vveerrssiioonn
+              Display  the  software  version,  license terms and
+              conditions.
+
+       --11 ttoo --99
+              Set the block size to 100 k, 200 k ..  900  k  when
+              compressing.   Has  no  effect  when decompressing.
+              See MEMORY MANAGEMENT below.
+
+       ----     Treats all subsequent arguments as file names, even
+              if they start with a dash.  This is so you can han-
+              dle files with names beginning  with  a  dash,  for
+              example: bzip2 -- -myfilename.
+
+       ----rreeppeettiittiivvee--ffaasstt ----rreeppeettiittiivvee--bbeesstt
+              These  flags  are  redundant  in versions 0.9.5 and
+              above.  They provided some coarse control over  the
+              behaviour  of the sorting algorithm in earlier ver-
+              sions, which was sometimes useful.  0.9.5 and above
+              have  an  improved  algorithm  which  renders these
+              flags irrelevant.
+
+
+MMEEMMOORRYY MMAANNAAGGEEMMEENNTT
+       _b_z_i_p_2 compresses large files in blocks.   The  block  size
+       affects  both  the  compression  ratio  achieved,  and the
+       amount of memory needed for compression and decompression.
+       The  flags  -1  through  -9  specify  the block size to be
+       100,000 bytes through 900,000 bytes (the default)  respec-
+       tively.   At  decompression  time, the block size used for
+       compression is read from  the  header  of  the  compressed
+       file, and _b_u_n_z_i_p_2 then allocates itself just enough memory
+       to decompress the file.  Since block sizes are  stored  in
+       compressed  files,  it follows that the flags -1 to -9 are
+       irrelevant to and so ignored during decompression.
+
+       Compression and decompression requirements, in bytes,  can
+       be estimated as:
+
+              Compression:   400k + ( 8 x block size )
+
+              Decompression: 100k + ( 4 x block size ), or
+                             100k + ( 2.5 x block size )
+
+       Larger  block  sizes  give  rapidly  diminishing  marginal
+       returns.  Most of the compression comes from the first two
+
+
+
+                                                                4
+
+
+
+
+
+bzip2(1)                                                 bzip2(1)
+
+
+       or  three hundred k of block size, a fact worth bearing in
+       mind when using _b_z_i_p_2  on  small  machines.   It  is  also
+       important  to  appreciate  that  the  decompression memory
+       requirement is set at compression time by  the  choice  of
+       block size.
+
+       For  files  compressed  with  the default 900k block size,
+       _b_u_n_z_i_p_2 will require about 3700 kbytes to decompress.   To
+       support decompression of any file on a 4 megabyte machine,
+       _b_u_n_z_i_p_2 has an option to  decompress  using  approximately
+       half this amount of memory, about 2300 kbytes.  Decompres-
+       sion speed is also halved, so you should use  this  option
+       only where necessary.  The relevant flag is -s.
+
+       In general, try and use the largest block size memory con-
+       straints  allow,  since  that  maximises  the  compression
+       achieved.   Compression and decompression speed are virtu-
+       ally unaffected by block size.
+
+       Another significant point applies to files which fit in  a
+       single  block  --  that  means  most files you'd encounter
+       using a large block  size.   The  amount  of  real  memory
+       touched is proportional to the size of the file, since the
+       file is smaller than a block.  For example, compressing  a
+       file  20,000  bytes  long  with the flag -9 will cause the
+       compressor to allocate around 7600k of  memory,  but  only
+       touch 400k + 20000 * 8 = 560 kbytes of it.  Similarly, the
+       decompressor will allocate 3700k but  only  touch  100k  +
+       20000 * 4 = 180 kbytes.
+
+       Here  is a table which summarises the maximum memory usage
+       for different block sizes.  Also  recorded  is  the  total
+       compressed  size for 14 files of the Calgary Text Compres-
+       sion Corpus totalling 3,141,622 bytes.  This column  gives
+       some  feel  for  how  compression  varies with block size.
+       These figures tend to understate the advantage  of  larger
+       block  sizes  for  larger files, since the Corpus is domi-
+       nated by smaller files.
+
+                  Compress   Decompress   Decompress   Corpus
+           Flag     usage      usage       -s usage     Size
+
+            -1      1200k       500k         350k      914704
+            -2      2000k       900k         600k      877703
+            -3      2800k      1300k         850k      860338
+            -4      3600k      1700k        1100k      846899
+            -5      4400k      2100k        1350k      845160
+            -6      5200k      2500k        1600k      838626
+            -7      6100k      2900k        1850k      834096
+            -8      6800k      3300k        2100k      828642
+            -9      7600k      3700k        2350k      828642
+
+
+
+
+
+
+                                                                5
+
+
+
+
+
+bzip2(1)                                                 bzip2(1)
+
+
+RREECCOOVVEERRIINNGG DDAATTAA FFRROOMM DDAAMMAAGGEEDD FFIILLEESS
+       _b_z_i_p_2 compresses files in blocks, usually 900kbytes  long.
+       Each block is handled independently.  If a media or trans-
+       mission error causes a multi-block  .bz2  file  to  become
+       damaged,  it  may  be  possible  to  recover data from the
+       undamaged blocks in the file.
+
+       The compressed representation of each block  is  delimited
+       by  a  48-bit pattern, which makes it possible to find the
+       block boundaries with reasonable  certainty.   Each  block
+       also  carries its own 32-bit CRC, so damaged blocks can be
+       distinguished from undamaged ones.
+
+       _b_z_i_p_2_r_e_c_o_v_e_r is a  simple  program  whose  purpose  is  to
+       search  for blocks in .bz2 files, and write each block out
+       into its own .bz2 file.  You can then use _b_z_i_p_2 -t to test
+       the integrity of the resulting files, and decompress those
+       which are undamaged.
+
+       _b_z_i_p_2_r_e_c_o_v_e_r takes a single argument, the name of the dam-
+       aged file, and writes a number of files "rec0001file.bz2",
+       "rec0002file.bz2", etc, containing the  extracted  blocks.
+       The  output  filenames  are  designed  so  that the use of
+       wildcards in subsequent processing -- for example,  "bzip2
+       -dc   rec*file.bz2 > recovered_data" -- lists the files in
+       the correct order.
+
+       _b_z_i_p_2_r_e_c_o_v_e_r should be of most use dealing with large .bz2
+       files,  as  these will contain many blocks.  It is clearly
+       futile to use it on damaged single-block  files,  since  a
+       damaged  block  cannot  be recovered.  If you wish to min-
+       imise any potential data loss through media  or  transmis-
+       sion errors, you might consider compressing with a smaller
+       block size.
+
+
+PPEERRFFOORRMMAANNCCEE NNOOTTEESS
+       The sorting phase of compression gathers together  similar
+       strings  in  the  file.  Because of this, files containing
+       very long runs of  repeated  symbols,  like  "aabaabaabaab
+       ..."   (repeated  several hundred times) may compress more
+       slowly than normal.  Versions 0.9.5 and  above  fare  much
+       better  than previous versions in this respect.  The ratio
+       between worst-case and average-case compression time is in
+       the  region  of  10:1.  For previous versions, this figure
+       was more like 100:1.  You can use the -vvvv option to mon-
+       itor progress in great detail, if you want.
+
+       Decompression speed is unaffected by these phenomena.
+
+       _b_z_i_p_2  usually  allocates  several  megabytes of memory to
+       operate in, and then charges all over it in a fairly  ran-
+       dom  fashion.   This means that performance, both for com-
+       pressing and decompressing, is largely determined  by  the
+
+
+
+                                                                6
+
+
+
+
+
+bzip2(1)                                                 bzip2(1)
+
+
+       speed  at  which  your  machine  can service cache misses.
+       Because of this, small changes to the code to  reduce  the
+       miss  rate  have  been observed to give disproportionately
+       large performance improvements.  I imagine _b_z_i_p_2 will per-
+       form best on machines with very large caches.
+
+
+CCAAVVEEAATTSS
+       I/O  error  messages  are not as helpful as they could be.
+       _b_z_i_p_2 tries hard to detect I/O errors  and  exit  cleanly,
+       but  the  details  of  what  the problem is sometimes seem
+       rather misleading.
+
+       This manual page pertains to version 1.0 of  _b_z_i_p_2_.   Com-
+       pressed  data created by this version is entirely forwards
+       and  backwards  compatible  with   the   previous   public
+       releases,  versions  0.1pl2, 0.9.0 and 0.9.5, but with the
+       following exception: 0.9.0 and above can correctly  decom-
+       press multiple concatenated compressed files.  0.1pl2 can-
+       not do this; it will stop  after  decompressing  just  the
+       first file in the stream.
+
+       _b_z_i_p_2_r_e_c_o_v_e_r  uses  32-bit integers to represent bit posi-
+       tions in compressed files, so it cannot handle  compressed
+       files  more than 512 megabytes long.  This could easily be
+       fixed.
+
+
+AAUUTTHHOORR
+       Julian Seward, jseward@acm.org.
+
+       http://sourceware.cygnus.com/bzip2
+       http://www.muraroa.demon.co.uk
+
+       The ideas embodied in _b_z_i_p_2 are due to (at least) the fol-
+       lowing people: Michael Burrows and David Wheeler (for  the
+       block  sorting  transformation), David Wheeler (again, for
+       the Huffman coder), Peter Fenwick (for the structured cod-
+       ing model in the original _b_z_i_p_, and many refinements), and
+       Alistair Moffat, Radford Neal  and  Ian  Witten  (for  the
+       arithmetic  coder  in  the  original  _b_z_i_p_)_.   I  am  much
+       indebted for their help, support and advice.  See the man-
+       ual  in the source distribution for pointers to sources of
+       documentation.  Christian von Roques encouraged me to look
+       for  faster sorting algorithms, so as to speed up compres-
+       sion.  Bela Lubkin encouraged me to improve the worst-case
+       compression performance.  Many people sent patches, helped
+       with portability problems, lent machines, gave advice  and
+       were generally helpful.
+
+
+
+
+
+
+
+
+                                                                7
+
+
diff --git a/bzip2/bzip2.c b/bzip2/bzip2.c
new file mode 100644
index 000000000..56adfdcbc
--- /dev/null
+++ b/bzip2/bzip2.c
@@ -0,0 +1,2044 @@
+
+/*-----------------------------------------------------------*/
+/*--- A block-sorting, lossless compressor        bzip2.c ---*/
+/*-----------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+
+/*----------------------------------------------------*/
+/*--- IMPORTANT                                    ---*/
+/*----------------------------------------------------*/
+
+/*--
+   WARNING:
+      This program and library (attempts to) compress data by 
+      performing several non-trivial transformations on it.  
+      Unless you are 100% familiar with *all* the algorithms 
+      contained herein, and with the consequences of modifying them, 
+      you should NOT meddle with the compression or decompression 
+      machinery.  Incorrect changes can and very likely *will* 
+      lead to disasterous loss of data.
+
+   DISCLAIMER:
+      I TAKE NO RESPONSIBILITY FOR ANY LOSS OF DATA ARISING FROM THE
+      USE OF THIS PROGRAM, HOWSOEVER CAUSED.
+
+      Every compression of a file implies an assumption that the
+      compressed file can be decompressed to reproduce the original.
+      Great efforts in design, coding and testing have been made to
+      ensure that this program works correctly.  However, the
+      complexity of the algorithms, and, in particular, the presence
+      of various special cases in the code which occur with very low
+      but non-zero probability make it impossible to rule out the
+      possibility of bugs remaining in the program.  DO NOT COMPRESS
+      ANY DATA WITH THIS PROGRAM AND/OR LIBRARY UNLESS YOU ARE PREPARED 
+      TO ACCEPT THE POSSIBILITY, HOWEVER SMALL, THAT THE DATA WILL 
+      NOT BE RECOVERABLE.
+
+      That is not to say this program is inherently unreliable.
+      Indeed, I very much hope the opposite is true.  bzip2/libbzip2
+      has been carefully constructed and extensively tested.
+
+   PATENTS:
+      To the best of my knowledge, bzip2/libbzip2 does not use any 
+      patented algorithms.  However, I do not have the resources 
+      available to carry out a full patent search.  Therefore I cannot 
+      give any guarantee of the above statement.
+--*/
+
+
+
+/*----------------------------------------------------*/
+/*--- and now for something much more pleasant :-) ---*/
+/*----------------------------------------------------*/
+
+/*---------------------------------------------*/
+/*--
+  Place a 1 beside your platform, and 0 elsewhere.
+--*/
+
+/*--
+  Generic 32-bit Unix.
+  Also works on 64-bit Unix boxes.
+--*/
+#define BZ_UNIX      1
+
+/*--
+  Win32, as seen by Jacob Navia's excellent
+  port of (Chris Fraser & David Hanson)'s excellent
+  lcc compiler.
+--*/
+#define BZ_LCCWIN32  0
+
+#if defined(_WIN32) && !defined(__CYGWIN__)
+#undef  BZ_LCCWIN32
+#define BZ_LCCWIN32 1
+#undef  BZ_UNIX
+#define BZ_UNIX 0
+#endif
+
+
+/*---------------------------------------------*/
+/*--
+  Some stuff for all platforms.
+--*/
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <signal.h>
+#include <math.h>
+#include <errno.h>
+#include <ctype.h>
+#include "bzlib.h"
+
+#define ERROR_IF_EOF(i)       { if ((i) == EOF)  ioError(); }
+#define ERROR_IF_NOT_ZERO(i)  { if ((i) != 0)    ioError(); }
+#define ERROR_IF_MINUS_ONE(i) { if ((i) == (-1)) ioError(); }
+
+
+/*---------------------------------------------*/
+/*--
+   Platform-specific stuff.
+--*/
+
+#if BZ_UNIX
+#   include <sys/types.h>
+#   include <utime.h>
+#   include <unistd.h>
+#   include <sys/stat.h>
+#   include <sys/times.h>
+
+#   define PATH_SEP    '/'
+#   define MY_LSTAT    lstat
+#   define MY_S_IFREG  S_ISREG
+#   define MY_STAT     stat
+
+#   define APPEND_FILESPEC(root, name) \
+      root=snocString((root), (name))
+
+#   define APPEND_FLAG(root, name) \
+      root=snocString((root), (name))
+
+#   define SET_BINARY_MODE(fd) /**/
+
+#   ifdef __GNUC__
+#      define NORETURN __attribute__ ((noreturn))
+#   else
+#      define NORETURN /**/
+#   endif
+#   ifdef __DJGPP__
+#     include <io.h>
+#     include <fcntl.h>
+#     undef MY_LSTAT
+#     define MY_LSTAT stat
+#     undef SET_BINARY_MODE
+#     define SET_BINARY_MODE(fd)                        \
+        do {                                            \
+           int retVal = setmode ( fileno ( fd ),        \
+                                 O_BINARY );            \
+           ERROR_IF_MINUS_ONE ( retVal );               \
+        } while ( 0 )
+#   endif
+#   ifdef __CYGWIN__
+#     include <io.h>
+#     include <fcntl.h>
+#     undef SET_BINARY_MODE
+#     define SET_BINARY_MODE(fd)                        \
+        do {                                            \
+           int retVal = setmode ( fileno ( fd ),        \
+                                 O_BINARY );            \
+           ERROR_IF_MINUS_ONE ( retVal );               \
+        } while ( 0 )
+#   endif
+#endif
+
+
+
+#if BZ_LCCWIN32
+#   include <io.h>
+#   include <fcntl.h>
+#   include <sys\stat.h>
+
+#   define NORETURN       /**/
+#   define PATH_SEP       '\\'
+#   define MY_LSTAT       _stat
+#   define MY_STAT        _stat
+#   define MY_S_IFREG(x)  ((x) & _S_IFREG)
+
+#   define APPEND_FLAG(root, name) \
+      root=snocString((root), (name))
+
+#   if 0
+   /*-- lcc-win32 seems to expand wildcards itself --*/
+#   define APPEND_FILESPEC(root, spec)                \
+      do {                                            \
+         if ((spec)[0] == '-') {                      \
+            root = snocString((root), (spec));        \
+         } else {                                     \
+            struct _finddata_t c_file;                \
+            long hFile;                               \
+            hFile = _findfirst((spec), &c_file);      \
+            if ( hFile == -1L ) {                     \
+               root = snocString ((root), (spec));    \
+            } else {                                  \
+               int anInt = 0;                         \
+               while ( anInt == 0 ) {                 \
+                  root = snocString((root),           \
+                            &c_file.name[0]);         \
+                  anInt = _findnext(hFile, &c_file);  \
+               }                                      \
+            }                                         \
+         }                                            \
+      } while ( 0 )
+#   else
+#   define APPEND_FILESPEC(root, name)                \
+      root = snocString ((root), (name))
+#   endif
+
+#   define SET_BINARY_MODE(fd)                        \
+      do {                                            \
+         int retVal = setmode ( fileno ( fd ),        \
+                               O_BINARY );            \
+         ERROR_IF_MINUS_ONE ( retVal );               \
+      } while ( 0 )
+
+#endif
+
+
+/*---------------------------------------------*/
+/*--
+  Some more stuff for all platforms :-)
+--*/
+
+typedef char            Char;
+typedef unsigned char   Bool;
+typedef unsigned char   UChar;
+typedef int             Int32;
+typedef unsigned int    UInt32;
+typedef short           Int16;
+typedef unsigned short  UInt16;
+                                       
+#define True  ((Bool)1)
+#define False ((Bool)0)
+
+/*--
+  IntNative is your platform's `native' int size.
+  Only here to avoid probs with 64-bit platforms.
+--*/
+typedef int IntNative;
+
+
+/*---------------------------------------------------*/
+/*--- Misc (file handling) data decls             ---*/
+/*---------------------------------------------------*/
+
+Int32   verbosity;
+Bool    keepInputFiles, smallMode, deleteOutputOnInterrupt;
+Bool    forceOverwrite, testFailsExist, unzFailsExist, noisy;
+Int32   numFileNames, numFilesProcessed, blockSize100k;
+Int32   exitValue;
+
+/*-- source modes; F==file, I==stdin, O==stdout --*/
+#define SM_I2O           1
+#define SM_F2O           2
+#define SM_F2F           3
+
+/*-- operation modes --*/
+#define OM_Z             1
+#define OM_UNZ           2
+#define OM_TEST          3
+
+Int32   opMode;
+Int32   srcMode;
+
+#define FILE_NAME_LEN 1034
+
+Int32   longestFileName;
+Char    inName [FILE_NAME_LEN];
+Char    outName[FILE_NAME_LEN];
+Char    tmpName[FILE_NAME_LEN];
+Char    *progName;
+Char    progNameReally[FILE_NAME_LEN];
+FILE    *outputHandleJustInCase;
+Int32   workFactor;
+
+static void    panic                 ( Char* )   NORETURN;
+static void    ioError               ( void )    NORETURN;
+static void    outOfMemory           ( void )    NORETURN;
+static void    configError           ( void )    NORETURN;
+static void    crcError              ( void )    NORETURN;
+static void    cleanUpAndFail        ( Int32 )   NORETURN;
+static void    compressedStreamEOF   ( void )    NORETURN;
+
+static void    copyFileName ( Char*, Char* );
+static void*   myMalloc     ( Int32 );
+
+
+
+/*---------------------------------------------------*/
+/*--- An implementation of 64-bit ints.  Sigh.    ---*/
+/*--- Roll on widespread deployment of ANSI C9X ! ---*/
+/*---------------------------------------------------*/
+
+typedef
+   struct { UChar b[8]; } 
+   UInt64;
+
+static
+void uInt64_from_UInt32s ( UInt64* n, UInt32 lo32, UInt32 hi32 )
+{
+   n->b[7] = (UChar)((hi32 >> 24) & 0xFF);
+   n->b[6] = (UChar)((hi32 >> 16) & 0xFF);
+   n->b[5] = (UChar)((hi32 >> 8)  & 0xFF);
+   n->b[4] = (UChar) (hi32        & 0xFF);
+   n->b[3] = (UChar)((lo32 >> 24) & 0xFF);
+   n->b[2] = (UChar)((lo32 >> 16) & 0xFF);
+   n->b[1] = (UChar)((lo32 >> 8)  & 0xFF);
+   n->b[0] = (UChar) (lo32        & 0xFF);
+}
+
+static
+double uInt64_to_double ( UInt64* n )
+{
+   Int32  i;
+   double base = 1.0;
+   double sum  = 0.0;
+   for (i = 0; i < 8; i++) {
+      sum  += base * (double)(n->b[i]);
+      base *= 256.0;
+   }
+   return sum;
+}
+
+static
+void uInt64_add ( UInt64* src, UInt64* dst )
+{
+   Int32 i;
+   Int32 carry = 0;
+   for (i = 0; i < 8; i++) {
+      carry += ( ((Int32)src->b[i]) + ((Int32)dst->b[i]) );
+      dst->b[i] = (UChar)(carry & 0xFF);
+      carry >>= 8;
+   }
+}
+
+static
+void uInt64_sub ( UInt64* src, UInt64* dst )
+{
+   Int32 t, i;
+   Int32 borrow = 0;
+   for (i = 0; i < 8; i++) {
+      t = ((Int32)dst->b[i]) - ((Int32)src->b[i]) - borrow;
+      if (t < 0) {
+         dst->b[i] = (UChar)(t + 256);
+         borrow = 1;
+      } else {
+         dst->b[i] = (UChar)t;
+         borrow = 0;
+      }
+   }
+}
+
+static
+void uInt64_mul ( UInt64* a, UInt64* b, UInt64* r_hi, UInt64* r_lo )
+{
+   UChar sum[16];
+   Int32 ia, ib, carry;
+   for (ia = 0; ia < 16; ia++) sum[ia] = 0;
+   for (ia = 0; ia < 8; ia++) {
+      carry = 0;
+      for (ib = 0; ib < 8; ib++) {
+         carry += ( ((Int32)sum[ia+ib]) 
+                    + ((Int32)a->b[ia]) * ((Int32)b->b[ib]) );
+         sum[ia+ib] = (UChar)(carry & 0xFF);
+         carry >>= 8;
+      }
+      sum[ia+8] = (UChar)(carry & 0xFF);
+      if ((carry >>= 8) != 0) panic ( "uInt64_mul" );
+   }
+
+   for (ia = 0; ia < 8; ia++) r_hi->b[ia] = sum[ia+8];
+   for (ia = 0; ia < 8; ia++) r_lo->b[ia] = sum[ia];
+}
+
+
+static
+void uInt64_shr1 ( UInt64* n )
+{
+   Int32 i;
+   for (i = 0; i < 8; i++) {
+      n->b[i] >>= 1;
+      if (i < 7 && (n->b[i+1] & 1)) n->b[i] |= 0x80;
+   }
+}
+
+static
+void uInt64_shl1 ( UInt64* n )
+{
+   Int32 i;
+   for (i = 7; i >= 0; i--) {
+      n->b[i] <<= 1;
+      if (i > 0 && (n->b[i-1] & 0x80)) n->b[i]++;
+   }
+}
+
+static
+Bool uInt64_isZero ( UInt64* n )
+{
+   Int32 i;
+   for (i = 0; i < 8; i++)
+      if (n->b[i] != 0) return 0;
+   return 1;
+}
+
+static
+Int32 uInt64_qrm10 ( UInt64* n )
+{
+   /* Divide *n by 10, and return the remainder.  Long division
+      is difficult, so we cheat and instead multiply by
+      0xCCCC CCCC CCCC CCCD, which is 0.8 (viz, 0.1 << 3).
+   */
+   Int32  i;
+   UInt64 tmp1, tmp2, n_orig, zero_point_eight;
+
+   zero_point_eight.b[1] = zero_point_eight.b[2] = 
+   zero_point_eight.b[3] = zero_point_eight.b[4] = 
+   zero_point_eight.b[5] = zero_point_eight.b[6] = 
+   zero_point_eight.b[7] = 0xCC;
+   zero_point_eight.b[0] = 0xCD;
+
+   n_orig = *n;
+
+   /* divide n by 10, 
+      by multiplying by 0.8 and then shifting right 3 times */
+   uInt64_mul ( n, &zero_point_eight, &tmp1, &tmp2 );
+   uInt64_shr1(&tmp1); uInt64_shr1(&tmp1); uInt64_shr1(&tmp1); 
+   *n = tmp1;
+   
+   /* tmp1 = 8*n, tmp2 = 2*n */
+   uInt64_shl1(&tmp1); uInt64_shl1(&tmp1); uInt64_shl1(&tmp1);
+   tmp2 = *n; uInt64_shl1(&tmp2);
+
+   /* tmp1 = 10*n */
+   uInt64_add ( &tmp2, &tmp1 );
+
+   /* n_orig = n_orig - 10*n */
+   uInt64_sub ( &tmp1, &n_orig );
+
+   /* n_orig should now hold quotient, in range 0 .. 9 */
+   for (i = 7; i >= 1; i--) 
+      if (n_orig.b[i] != 0) panic ( "uInt64_qrm10(1)" );
+   if (n_orig.b[0] > 9)
+      panic ( "uInt64_qrm10(2)" );
+
+   return (int)n_orig.b[0];
+}
+
+/* ... and the Whole Entire Point of all this UInt64 stuff is
+   so that we can supply the following function.
+*/
+static
+void uInt64_toAscii ( char* outbuf, UInt64* n )
+{
+   Int32  i, q;
+   UChar  buf[32];
+   Int32  nBuf   = 0;
+   UInt64 n_copy = *n;
+   do {
+      q = uInt64_qrm10 ( &n_copy );
+      buf[nBuf] = q + '0';
+      nBuf++;
+   } while (!uInt64_isZero(&n_copy));
+   outbuf[nBuf] = 0;
+   for (i = 0; i < nBuf; i++) outbuf[i] = buf[nBuf-i-1];
+}
+
+
+/*---------------------------------------------------*/
+/*--- Processing of complete files and streams    ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------*/
+static 
+Bool myfeof ( FILE* f )
+{
+   Int32 c = fgetc ( f );
+   if (c == EOF) return True;
+   ungetc ( c, f );
+   return False;
+}
+
+
+/*---------------------------------------------*/
+static 
+void compressStream ( FILE *stream, FILE *zStream )
+{
+   BZFILE* bzf = NULL;
+   UChar   ibuf[5000];
+   Int32   nIbuf;
+   UInt32  nbytes_in_lo32, nbytes_in_hi32;
+   UInt32  nbytes_out_lo32, nbytes_out_hi32;
+   Int32   bzerr, bzerr_dummy, ret;
+
+   SET_BINARY_MODE(stream);
+   SET_BINARY_MODE(zStream);
+
+   if (ferror(stream)) goto errhandler_io;
+   if (ferror(zStream)) goto errhandler_io;
+
+   bzf = BZ2_bzWriteOpen ( &bzerr, zStream, 
+                           blockSize100k, verbosity, workFactor );   
+   if (bzerr != BZ_OK) goto errhandler;
+
+   if (verbosity >= 2) fprintf ( stderr, "\n" );
+
+   while (True) {
+
+      if (myfeof(stream)) break;
+      nIbuf = fread ( ibuf, sizeof(UChar), 5000, stream );
+      if (ferror(stream)) goto errhandler_io;
+      if (nIbuf > 0) BZ2_bzWrite ( &bzerr, bzf, (void*)ibuf, nIbuf );
+      if (bzerr != BZ_OK) goto errhandler;
+
+   }
+
+   BZ2_bzWriteClose64 ( &bzerr, bzf, 0, 
+                        &nbytes_in_lo32, &nbytes_in_hi32,
+                        &nbytes_out_lo32, &nbytes_out_hi32 );
+   if (bzerr != BZ_OK) goto errhandler;
+
+   if (ferror(zStream)) goto errhandler_io;
+   ret = fflush ( zStream );
+   if (ret == EOF) goto errhandler_io;
+   if (zStream != stdout) {
+      ret = fclose ( zStream );
+      if (ret == EOF) goto errhandler_io;
+   }
+   if (ferror(stream)) goto errhandler_io;
+   ret = fclose ( stream );
+   if (ret == EOF) goto errhandler_io;
+
+   if (nbytes_in_lo32 == 0 && nbytes_in_hi32 == 0) 
+      nbytes_in_lo32 = 1;
+
+   if (verbosity >= 1) {
+      Char   buf_nin[32], buf_nout[32];
+      UInt64 nbytes_in,   nbytes_out;
+      double nbytes_in_d, nbytes_out_d;
+      uInt64_from_UInt32s ( &nbytes_in, 
+                            nbytes_in_lo32, nbytes_in_hi32 );
+      uInt64_from_UInt32s ( &nbytes_out, 
+                            nbytes_out_lo32, nbytes_out_hi32 );
+      nbytes_in_d  = uInt64_to_double ( &nbytes_in );
+      nbytes_out_d = uInt64_to_double ( &nbytes_out );
+      uInt64_toAscii ( buf_nin, &nbytes_in );
+      uInt64_toAscii ( buf_nout, &nbytes_out );
+      fprintf ( stderr, "%6.3f:1, %6.3f bits/byte, "
+                        "%5.2f%% saved, %s in, %s out.\n",
+                nbytes_in_d / nbytes_out_d,
+                (8.0 * nbytes_out_d) / nbytes_in_d,
+                100.0 * (1.0 - nbytes_out_d / nbytes_in_d),
+                buf_nin,
+                buf_nout
+              );
+   }
+
+   return;
+
+   errhandler:
+   BZ2_bzWriteClose64 ( &bzerr_dummy, bzf, 1, 
+                        &nbytes_in_lo32, &nbytes_in_hi32,
+                        &nbytes_out_lo32, &nbytes_out_hi32 );
+   switch (bzerr) {
+      case BZ_CONFIG_ERROR:
+         configError(); break;
+      case BZ_MEM_ERROR:
+         outOfMemory (); break;
+      case BZ_IO_ERROR:
+         errhandler_io:
+         ioError(); break;
+      default:
+         panic ( "compress:unexpected error" );
+   }
+
+   panic ( "compress:end" );
+   /*notreached*/
+}
+
+
+
+/*---------------------------------------------*/
+static 
+Bool uncompressStream ( FILE *zStream, FILE *stream )
+{
+   BZFILE* bzf = NULL;
+   Int32   bzerr, bzerr_dummy, ret, nread, streamNo, i;
+   UChar   obuf[5000];
+   UChar   unused[BZ_MAX_UNUSED];
+   Int32   nUnused;
+   UChar*  unusedTmp;
+
+   nUnused = 0;
+   streamNo = 0;
+
+   SET_BINARY_MODE(stream);
+   SET_BINARY_MODE(zStream);
+
+   if (ferror(stream)) goto errhandler_io;
+   if (ferror(zStream)) goto errhandler_io;
+
+   while (True) {
+
+      bzf = BZ2_bzReadOpen ( 
+               &bzerr, zStream, verbosity, 
+               (int)smallMode, unused, nUnused
+            );
+      if (bzf == NULL || bzerr != BZ_OK) goto errhandler;
+      streamNo++;
+
+      while (bzerr == BZ_OK) {
+         nread = BZ2_bzRead ( &bzerr, bzf, obuf, 5000 );
+         if (bzerr == BZ_DATA_ERROR_MAGIC) goto errhandler;
+         if ((bzerr == BZ_OK || bzerr == BZ_STREAM_END) && nread > 0)
+            fwrite ( obuf, sizeof(UChar), nread, stream );
+         if (ferror(stream)) goto errhandler_io;
+      }
+      if (bzerr != BZ_STREAM_END) goto errhandler;
+
+      BZ2_bzReadGetUnused ( &bzerr, bzf, (void**)(&unusedTmp), &nUnused );
+      if (bzerr != BZ_OK) panic ( "decompress:bzReadGetUnused" );
+
+      for (i = 0; i < nUnused; i++) unused[i] = unusedTmp[i];
+
+      BZ2_bzReadClose ( &bzerr, bzf );
+      if (bzerr != BZ_OK) panic ( "decompress:bzReadGetUnused" );
+
+      if (nUnused == 0 && myfeof(zStream)) break;
+
+   }
+
+   if (ferror(zStream)) goto errhandler_io;
+   ret = fclose ( zStream );
+   if (ret == EOF) goto errhandler_io;
+
+   if (ferror(stream)) goto errhandler_io;
+   ret = fflush ( stream );
+   if (ret != 0) goto errhandler_io;
+   if (stream != stdout) {
+      ret = fclose ( stream );
+      if (ret == EOF) goto errhandler_io;
+   }
+   if (verbosity >= 2) fprintf ( stderr, "\n    " );
+   return True;
+
+   errhandler:
+   BZ2_bzReadClose ( &bzerr_dummy, bzf );
+   switch (bzerr) {
+      case BZ_CONFIG_ERROR:
+         configError(); break;
+      case BZ_IO_ERROR:
+         errhandler_io:
+         ioError(); break;
+      case BZ_DATA_ERROR:
+         crcError();
+      case BZ_MEM_ERROR:
+         outOfMemory();
+      case BZ_UNEXPECTED_EOF:
+         compressedStreamEOF();
+      case BZ_DATA_ERROR_MAGIC:
+         if (zStream != stdin) fclose(zStream);
+         if (stream != stdout) fclose(stream);
+         if (streamNo == 1) {
+            return False;
+         } else {
+            if (noisy)
+            fprintf ( stderr, 
+                      "\n%s: %s: trailing garbage after EOF ignored\n",
+                      progName, inName );
+            return True;       
+         }
+      default:
+         panic ( "decompress:unexpected error" );
+   }
+
+   panic ( "decompress:end" );
+   return True; /*notreached*/
+}
+
+
+/*---------------------------------------------*/
+static 
+Bool testStream ( FILE *zStream )
+{
+   BZFILE* bzf = NULL;
+   Int32   bzerr, bzerr_dummy, ret, nread, streamNo, i;
+   UChar   obuf[5000];
+   UChar   unused[BZ_MAX_UNUSED];
+   Int32   nUnused;
+   UChar*  unusedTmp;
+
+   nUnused = 0;
+   streamNo = 0;
+
+   SET_BINARY_MODE(zStream);
+   if (ferror(zStream)) goto errhandler_io;
+
+   while (True) {
+
+      bzf = BZ2_bzReadOpen ( 
+               &bzerr, zStream, verbosity, 
+               (int)smallMode, unused, nUnused
+            );
+      if (bzf == NULL || bzerr != BZ_OK) goto errhandler;
+      streamNo++;
+
+      while (bzerr == BZ_OK) {
+         nread = BZ2_bzRead ( &bzerr, bzf, obuf, 5000 );
+         if (bzerr == BZ_DATA_ERROR_MAGIC) goto errhandler;
+      }
+      if (bzerr != BZ_STREAM_END) goto errhandler;
+
+      BZ2_bzReadGetUnused ( &bzerr, bzf, (void**)(&unusedTmp), &nUnused );
+      if (bzerr != BZ_OK) panic ( "test:bzReadGetUnused" );
+
+      for (i = 0; i < nUnused; i++) unused[i] = unusedTmp[i];
+
+      BZ2_bzReadClose ( &bzerr, bzf );
+      if (bzerr != BZ_OK) panic ( "test:bzReadGetUnused" );
+      if (nUnused == 0 && myfeof(zStream)) break;
+
+   }
+
+   if (ferror(zStream)) goto errhandler_io;
+   ret = fclose ( zStream );
+   if (ret == EOF) goto errhandler_io;
+
+   if (verbosity >= 2) fprintf ( stderr, "\n    " );
+   return True;
+
+   errhandler:
+   BZ2_bzReadClose ( &bzerr_dummy, bzf );
+   if (verbosity == 0) 
+      fprintf ( stderr, "%s: %s: ", progName, inName );
+   switch (bzerr) {
+      case BZ_CONFIG_ERROR:
+         configError(); break;
+      case BZ_IO_ERROR:
+         errhandler_io:
+         ioError(); break;
+      case BZ_DATA_ERROR:
+         fprintf ( stderr,
+                   "data integrity (CRC) error in data\n" );
+         return False;
+      case BZ_MEM_ERROR:
+         outOfMemory();
+      case BZ_UNEXPECTED_EOF:
+         fprintf ( stderr,
+                   "file ends unexpectedly\n" );
+         return False;
+      case BZ_DATA_ERROR_MAGIC:
+         if (zStream != stdin) fclose(zStream);
+         if (streamNo == 1) {
+          fprintf ( stderr, 
+                    "bad magic number (file not created by bzip2)\n" );
+            return False;
+         } else {
+            if (noisy)
+            fprintf ( stderr, 
+                      "trailing garbage after EOF ignored\n" );
+            return True;       
+         }
+      default:
+         panic ( "test:unexpected error" );
+   }
+
+   panic ( "test:end" );
+   return True; /*notreached*/
+}
+
+
+/*---------------------------------------------------*/
+/*--- Error [non-] handling grunge                ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------*/
+static
+void setExit ( Int32 v )
+{
+   if (v > exitValue) exitValue = v;
+}
+
+
+/*---------------------------------------------*/
+static 
+void cadvise ( void )
+{
+   if (noisy)
+   fprintf (
+      stderr,
+      "\nIt is possible that the compressed file(s) have become corrupted.\n"
+        "You can use the -tvv option to test integrity of such files.\n\n"
+        "You can use the `bzip2recover' program to *attempt* to recover\n"
+        "data from undamaged sections of corrupted files.\n\n"
+    );
+}
+
+
+/*---------------------------------------------*/
+static 
+void showFileNames ( void )
+{
+   if (noisy)
+   fprintf (
+      stderr,
+      "\tInput file = %s, output file = %s\n",
+      inName, outName 
+   );
+}
+
+
+/*---------------------------------------------*/
+static 
+void cleanUpAndFail ( Int32 ec )
+{
+   IntNative retVal;
+
+   if ( srcMode == SM_F2F 
+        && opMode != OM_TEST
+        && deleteOutputOnInterrupt ) {
+      if (noisy)
+      fprintf ( stderr, "%s: Deleting output file %s, if it exists.\n",
+                progName, outName );
+      if (outputHandleJustInCase != NULL)
+         fclose ( outputHandleJustInCase );
+      retVal = remove ( outName );
+      if (retVal != 0)
+         fprintf ( stderr,
+                   "%s: WARNING: deletion of output file (apparently) failed.\n",
+                   progName );
+   }
+   if (noisy && numFileNames > 0 && numFilesProcessed < numFileNames) {
+      fprintf ( stderr, 
+                "%s: WARNING: some files have not been processed:\n"
+                "\t%d specified on command line, %d not processed yet.\n\n",
+                progName, numFileNames, 
+                          numFileNames - numFilesProcessed );
+   }
+   setExit(ec);
+   exit(exitValue);
+}
+
+
+/*---------------------------------------------*/
+static 
+void panic ( Char* s )
+{
+   fprintf ( stderr,
+             "\n%s: PANIC -- internal consistency error:\n"
+             "\t%s\n"
+             "\tThis is a BUG.  Please report it to me at:\n"
+             "\tjseward@acm.org\n",
+             progName, s );
+   showFileNames();
+   cleanUpAndFail( 3 );
+}
+
+
+/*---------------------------------------------*/
+static 
+void crcError ( void )
+{
+   fprintf ( stderr,
+             "\n%s: Data integrity error when decompressing.\n",
+             progName );
+   showFileNames();
+   cadvise();
+   cleanUpAndFail( 2 );
+}
+
+
+/*---------------------------------------------*/
+static 
+void compressedStreamEOF ( void )
+{
+   fprintf ( stderr,
+             "\n%s: Compressed file ends unexpectedly;\n\t"
+             "perhaps it is corrupted?  *Possible* reason follows.\n",
+             progName );
+   perror ( progName );
+   showFileNames();
+   cadvise();
+   cleanUpAndFail( 2 );
+}
+
+
+/*---------------------------------------------*/
+static 
+void ioError ( void )
+{
+   fprintf ( stderr,
+             "\n%s: I/O or other error, bailing out.  "
+             "Possible reason follows.\n",
+             progName );
+   perror ( progName );
+   showFileNames();
+   cleanUpAndFail( 1 );
+}
+
+
+/*---------------------------------------------*/
+static 
+void mySignalCatcher ( IntNative n )
+{
+   fprintf ( stderr,
+             "\n%s: Control-C or similar caught, quitting.\n",
+             progName );
+   cleanUpAndFail(1);
+}
+
+
+/*---------------------------------------------*/
+static 
+void mySIGSEGVorSIGBUScatcher ( IntNative n )
+{
+   if (opMode == OM_Z)
+      fprintf ( 
+      stderr,
+      "\n%s: Caught a SIGSEGV or SIGBUS whilst compressing.\n"
+      "\n"
+      "   Possible causes are (most likely first):\n"
+      "   (1) This computer has unreliable memory or cache hardware\n"
+      "       (a surprisingly common problem; try a different machine.)\n"
+      "   (2) A bug in the compiler used to create this executable\n"
+      "       (unlikely, if you didn't compile bzip2 yourself.)\n"
+      "   (3) A real bug in bzip2 -- I hope this should never be the case.\n"
+      "   The user's manual, Section 4.3, has more info on (1) and (2).\n"
+      "   \n"
+      "   If you suspect this is a bug in bzip2, or are unsure about (1)\n"
+      "   or (2), feel free to report it to me at: jseward@acm.org.\n"
+      "   Section 4.3 of the user's manual describes the info a useful\n"
+      "   bug report should have.  If the manual is available on your\n"
+      "   system, please try and read it before mailing me.  If you don't\n"
+      "   have the manual or can't be bothered to read it, mail me anyway.\n"
+      "\n",
+      progName );
+      else
+      fprintf ( 
+      stderr,
+      "\n%s: Caught a SIGSEGV or SIGBUS whilst decompressing.\n"
+      "\n"
+      "   Possible causes are (most likely first):\n"
+      "   (1) The compressed data is corrupted, and bzip2's usual checks\n"
+      "       failed to detect this.  Try bzip2 -tvv my_file.bz2.\n"
+      "   (2) This computer has unreliable memory or cache hardware\n"
+      "       (a surprisingly common problem; try a different machine.)\n"
+      "   (3) A bug in the compiler used to create this executable\n"
+      "       (unlikely, if you didn't compile bzip2 yourself.)\n"
+      "   (4) A real bug in bzip2 -- I hope this should never be the case.\n"
+      "   The user's manual, Section 4.3, has more info on (2) and (3).\n"
+      "   \n"
+      "   If you suspect this is a bug in bzip2, or are unsure about (2)\n"
+      "   or (3), feel free to report it to me at: jseward@acm.org.\n"
+      "   Section 4.3 of the user's manual describes the info a useful\n"
+      "   bug report should have.  If the manual is available on your\n"
+      "   system, please try and read it before mailing me.  If you don't\n"
+      "   have the manual or can't be bothered to read it, mail me anyway.\n"
+      "\n",
+      progName );
+
+   showFileNames();
+   if (opMode == OM_Z)
+      cleanUpAndFail( 3 ); else
+      { cadvise(); cleanUpAndFail( 2 ); }
+}
+
+
+/*---------------------------------------------*/
+static 
+void outOfMemory ( void )
+{
+   fprintf ( stderr,
+             "\n%s: couldn't allocate enough memory\n",
+             progName );
+   showFileNames();
+   cleanUpAndFail(1);
+}
+
+
+/*---------------------------------------------*/
+static 
+void configError ( void )
+{
+   fprintf ( stderr,
+             "bzip2: I'm not configured correctly for this platform!\n"
+             "\tI require Int32, Int16 and Char to have sizes\n"
+             "\tof 4, 2 and 1 bytes to run properly, and they don't.\n"
+             "\tProbably you can fix this by defining them correctly,\n"
+             "\tand recompiling.  Bye!\n" );
+   setExit(3);
+   exit(exitValue);
+}
+
+
+/*---------------------------------------------------*/
+/*--- The main driver machinery                   ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------*/
+static 
+void pad ( Char *s )
+{
+   Int32 i;
+   if ( (Int32)strlen(s) >= longestFileName ) return;
+   for (i = 1; i <= longestFileName - (Int32)strlen(s); i++)
+      fprintf ( stderr, " " );
+}
+
+
+/*---------------------------------------------*/
+static 
+void copyFileName ( Char* to, Char* from ) 
+{
+   if ( strlen(from) > FILE_NAME_LEN-10 )  {
+      fprintf (
+         stderr,
+         "bzip2: file name\n`%s'\n"
+         "is suspiciously (more than %d chars) long.\n"
+         "Try using a reasonable file name instead.  Sorry! :-)\n",
+         from, FILE_NAME_LEN-10
+      );
+      setExit(1);
+      exit(exitValue);
+   }
+
+  strncpy(to,from,FILE_NAME_LEN-10);
+  to[FILE_NAME_LEN-10]='\0';
+}
+
+
+/*---------------------------------------------*/
+static 
+Bool fileExists ( Char* name )
+{
+   FILE *tmp   = fopen ( name, "rb" );
+   Bool exists = (tmp != NULL);
+   if (tmp != NULL) fclose ( tmp );
+   return exists;
+}
+
+
+/*---------------------------------------------*/
+/*--
+  if in doubt, return True
+--*/
+static 
+Bool notAStandardFile ( Char* name )
+{
+   IntNative      i;
+   struct MY_STAT statBuf;
+
+   i = MY_LSTAT ( name, &statBuf );
+   if (i != 0) return True;
+   if (MY_S_IFREG(statBuf.st_mode)) return False;
+   return True;
+}
+
+
+/*---------------------------------------------*/
+/*--
+  rac 11/21/98 see if file has hard links to it
+--*/
+static 
+Int32 countHardLinks ( Char* name )
+{  
+   IntNative      i;
+   struct MY_STAT statBuf;
+
+   i = MY_LSTAT ( name, &statBuf );
+   if (i != 0) return 0;
+   return (statBuf.st_nlink - 1);
+}
+
+
+/*---------------------------------------------*/
+static 
+void copyDatePermissionsAndOwner ( Char *srcName, Char *dstName )
+{
+#if BZ_UNIX
+   IntNative      retVal;
+   struct MY_STAT statBuf;
+   struct utimbuf uTimBuf;
+
+   retVal = MY_LSTAT ( srcName, &statBuf );
+   ERROR_IF_NOT_ZERO ( retVal );
+   uTimBuf.actime = statBuf.st_atime;
+   uTimBuf.modtime = statBuf.st_mtime;
+
+   retVal = chmod ( dstName, statBuf.st_mode );
+   ERROR_IF_NOT_ZERO ( retVal );
+
+   retVal = utime ( dstName, &uTimBuf );
+   ERROR_IF_NOT_ZERO ( retVal );
+
+   retVal = chown ( dstName, statBuf.st_uid, statBuf.st_gid );
+   /* chown() will in many cases return with EPERM, which can
+      be safely ignored.
+   */
+#endif
+}
+
+
+/*---------------------------------------------*/
+static 
+void setInterimPermissions ( Char *dstName )
+{
+#if BZ_UNIX
+   IntNative      retVal;
+   retVal = chmod ( dstName, S_IRUSR | S_IWUSR );
+   ERROR_IF_NOT_ZERO ( retVal );
+#endif
+}
+
+
+/*---------------------------------------------*/
+static 
+Bool containsDubiousChars ( Char* name )
+{
+   Bool cdc = False;
+   for (; *name != '\0'; name++)
+      if (*name == '?' || *name == '*') cdc = True;
+   return cdc;
+}
+
+
+/*---------------------------------------------*/
+#define BZ_N_SUFFIX_PAIRS 4
+
+Char* zSuffix[BZ_N_SUFFIX_PAIRS] 
+   = { ".bz2", ".bz", ".tbz2", ".tbz" };
+Char* unzSuffix[BZ_N_SUFFIX_PAIRS] 
+   = { "", "", ".tar", ".tar" };
+
+static 
+Bool hasSuffix ( Char* s, Char* suffix )
+{
+   Int32 ns = strlen(s);
+   Int32 nx = strlen(suffix);
+   if (ns < nx) return False;
+   if (strcmp(s + ns - nx, suffix) == 0) return True;
+   return False;
+}
+
+static 
+Bool mapSuffix ( Char* name, 
+                 Char* oldSuffix, Char* newSuffix )
+{
+   if (!hasSuffix(name,oldSuffix)) return False;
+   name[strlen(name)-strlen(oldSuffix)] = 0;
+   strcat ( name, newSuffix );
+   return True;
+}
+
+
+/*---------------------------------------------*/
+static 
+void compress ( Char *name )
+{
+   FILE  *inStr;
+   FILE  *outStr;
+   Int32 n, i;
+
+   deleteOutputOnInterrupt = False;
+
+   if (name == NULL && srcMode != SM_I2O)
+      panic ( "compress: bad modes\n" );
+
+   switch (srcMode) {
+      case SM_I2O: 
+         copyFileName ( inName, "(stdin)" );
+         copyFileName ( outName, "(stdout)" ); 
+         break;
+      case SM_F2F: 
+         copyFileName ( inName, name );
+         copyFileName ( outName, name );
+         strcat ( outName, ".bz2" ); 
+         break;
+      case SM_F2O: 
+         copyFileName ( inName, name );
+         copyFileName ( outName, "(stdout)" ); 
+         break;
+   }
+
+   if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) {
+      if (noisy)
+      fprintf ( stderr, "%s: There are no files matching `%s'.\n",
+                progName, inName );
+      setExit(1);
+      return;
+   }
+   if ( srcMode != SM_I2O && !fileExists ( inName ) ) {
+      fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+                progName, inName, strerror(errno) );
+      setExit(1);
+      return;
+   }
+   for (i = 0; i < BZ_N_SUFFIX_PAIRS; i++) {
+      if (hasSuffix(inName, zSuffix[i])) {
+         if (noisy)
+         fprintf ( stderr, 
+                   "%s: Input file %s already has %s suffix.\n",
+                   progName, inName, zSuffix[i] );
+         setExit(1);
+         return;
+      }
+   }
+   if ( srcMode == SM_F2F && !forceOverwrite && notAStandardFile ( inName )) {
+      if (noisy)
+      fprintf ( stderr, "%s: Input file %s is not a normal file.\n",
+                progName, inName );
+      setExit(1);
+      return;
+   }
+   if ( srcMode == SM_F2F && !forceOverwrite && fileExists ( outName ) ) {
+      fprintf ( stderr, "%s: Output file %s already exists.\n",
+                progName, outName );
+      setExit(1);
+      return;
+   }
+   if ( srcMode == SM_F2F && !forceOverwrite &&
+        (n=countHardLinks ( inName )) > 0) {
+      fprintf ( stderr, "%s: Input file %s has %d other link%s.\n",
+                progName, inName, n, n > 1 ? "s" : "" );
+      setExit(1);
+      return;
+   }
+
+   switch ( srcMode ) {
+
+      case SM_I2O:
+         inStr = stdin;
+         outStr = stdout;
+         if ( isatty ( fileno ( stdout ) ) ) {
+            fprintf ( stderr,
+                      "%s: I won't write compressed data to a terminal.\n",
+                      progName );
+            fprintf ( stderr, "%s: For help, type: `%s --help'.\n",
+                              progName, progName );
+            setExit(1);
+            return;
+         };
+         break;
+
+      case SM_F2O:
+         inStr = fopen ( inName, "rb" );
+         outStr = stdout;
+         if ( isatty ( fileno ( stdout ) ) ) {
+            fprintf ( stderr,
+                      "%s: I won't write compressed data to a terminal.\n",
+                      progName );
+            fprintf ( stderr, "%s: For help, type: `%s --help'.\n",
+                              progName, progName );
+            if ( inStr != NULL ) fclose ( inStr );
+            setExit(1);
+            return;
+         };
+         if ( inStr == NULL ) {
+            fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+                      progName, inName, strerror(errno) );
+            setExit(1);
+            return;
+         };
+         break;
+
+      case SM_F2F:
+         inStr = fopen ( inName, "rb" );
+         outStr = fopen ( outName, "wb" );
+         if ( outStr == NULL) {
+            fprintf ( stderr, "%s: Can't create output file %s: %s.\n",
+                      progName, outName, strerror(errno) );
+            if ( inStr != NULL ) fclose ( inStr );
+            setExit(1);
+            return;
+         }
+         if ( inStr == NULL ) {
+            fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+                      progName, inName, strerror(errno) );
+            if ( outStr != NULL ) fclose ( outStr );
+            setExit(1);
+            return;
+         };
+         setInterimPermissions ( outName );
+         break;
+
+      default:
+         panic ( "compress: bad srcMode" );
+         break;
+   }
+
+   if (verbosity >= 1) {
+      fprintf ( stderr,  "  %s: ", inName );
+      pad ( inName );
+      fflush ( stderr );
+   }
+
+   /*--- Now the input and output handles are sane.  Do the Biz. ---*/
+   outputHandleJustInCase = outStr;
+   deleteOutputOnInterrupt = True;
+   compressStream ( inStr, outStr );
+   outputHandleJustInCase = NULL;
+
+   /*--- If there was an I/O error, we won't get here. ---*/
+   if ( srcMode == SM_F2F ) {
+      copyDatePermissionsAndOwner ( inName, outName );
+      deleteOutputOnInterrupt = False;
+      if ( !keepInputFiles ) {
+         IntNative retVal = remove ( inName );
+         ERROR_IF_NOT_ZERO ( retVal );
+      }
+   }
+
+   deleteOutputOnInterrupt = False;
+}
+
+
+/*---------------------------------------------*/
+static 
+void uncompress ( Char *name )
+{
+   FILE  *inStr;
+   FILE  *outStr;
+   Int32 n, i;
+   Bool  magicNumberOK;
+   Bool  cantGuess;
+
+   deleteOutputOnInterrupt = False;
+
+   if (name == NULL && srcMode != SM_I2O)
+      panic ( "uncompress: bad modes\n" );
+
+   cantGuess = False;
+   switch (srcMode) {
+      case SM_I2O: 
+         copyFileName ( inName, "(stdin)" );
+         copyFileName ( outName, "(stdout)" ); 
+         break;
+      case SM_F2F: 
+         copyFileName ( inName, name );
+         copyFileName ( outName, name );
+         for (i = 0; i < BZ_N_SUFFIX_PAIRS; i++)
+            if (mapSuffix(outName,zSuffix[i],unzSuffix[i]))
+               goto zzz; 
+         cantGuess = True;
+         strcat ( outName, ".out" );
+         break;
+      case SM_F2O: 
+         copyFileName ( inName, name );
+         copyFileName ( outName, "(stdout)" ); 
+         break;
+   }
+
+   zzz:
+   if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) {
+      if (noisy)
+      fprintf ( stderr, "%s: There are no files matching `%s'.\n",
+                progName, inName );
+      setExit(1);
+      return;
+   }
+   if ( srcMode != SM_I2O && !fileExists ( inName ) ) {
+      fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+                progName, inName, strerror(errno) );
+      setExit(1);
+      return;
+   }
+   if ( srcMode == SM_F2F && !forceOverwrite && notAStandardFile ( inName )) {
+      if (noisy)
+      fprintf ( stderr, "%s: Input file %s is not a normal file.\n",
+                progName, inName );
+      setExit(1);
+      return;
+   }
+   if ( /* srcMode == SM_F2F implied && */ cantGuess ) {
+      if (noisy)
+      fprintf ( stderr, 
+                "%s: Can't guess original name for %s -- using %s\n",
+                progName, inName, outName );
+      /* just a warning, no return */
+   }   
+   if ( srcMode == SM_F2F && !forceOverwrite && fileExists ( outName ) ) {
+      fprintf ( stderr, "%s: Output file %s already exists.\n",
+                progName, outName );
+      setExit(1);
+      return;
+   }
+   if ( srcMode == SM_F2F && !forceOverwrite &&
+        (n=countHardLinks ( inName ) ) > 0) {
+      fprintf ( stderr, "%s: Input file %s has %d other link%s.\n",
+                progName, inName, n, n > 1 ? "s" : "" );
+      setExit(1);
+      return;
+   }
+
+   switch ( srcMode ) {
+
+      case SM_I2O:
+         inStr = stdin;
+         outStr = stdout;
+         if ( isatty ( fileno ( stdin ) ) ) {
+            fprintf ( stderr,
+                      "%s: I won't read compressed data from a terminal.\n",
+                      progName );
+            fprintf ( stderr, "%s: For help, type: `%s --help'.\n",
+                              progName, progName );
+            setExit(1);
+            return;
+         };
+         break;
+
+      case SM_F2O:
+         inStr = fopen ( inName, "rb" );
+         outStr = stdout;
+         if ( inStr == NULL ) {
+            fprintf ( stderr, "%s: Can't open input file %s:%s.\n",
+                      progName, inName, strerror(errno) );
+            if ( inStr != NULL ) fclose ( inStr );
+            setExit(1);
+            return;
+         };
+         break;
+
+      case SM_F2F:
+         inStr = fopen ( inName, "rb" );
+         outStr = fopen ( outName, "wb" );
+         if ( outStr == NULL) {
+            fprintf ( stderr, "%s: Can't create output file %s: %s.\n",
+                      progName, outName, strerror(errno) );
+            if ( inStr != NULL ) fclose ( inStr );
+            setExit(1);
+            return;
+         }
+         if ( inStr == NULL ) {
+            fprintf ( stderr, "%s: Can't open input file %s: %s.\n",
+                      progName, inName, strerror(errno) );
+            if ( outStr != NULL ) fclose ( outStr );
+            setExit(1);
+            return;
+         };
+         setInterimPermissions ( outName );
+         break;
+
+      default:
+         panic ( "uncompress: bad srcMode" );
+         break;
+   }
+
+   if (verbosity >= 1) {
+      fprintf ( stderr, "  %s: ", inName );
+      pad ( inName );
+      fflush ( stderr );
+   }
+
+   /*--- Now the input and output handles are sane.  Do the Biz. ---*/
+   outputHandleJustInCase = outStr;
+   deleteOutputOnInterrupt = True;
+   magicNumberOK = uncompressStream ( inStr, outStr );
+   outputHandleJustInCase = NULL;
+
+   /*--- If there was an I/O error, we won't get here. ---*/
+   if ( magicNumberOK ) {
+      if ( srcMode == SM_F2F ) {
+         copyDatePermissionsAndOwner ( inName, outName );
+         deleteOutputOnInterrupt = False;
+         if ( !keepInputFiles ) {
+            IntNative retVal = remove ( inName );
+            ERROR_IF_NOT_ZERO ( retVal );
+         }
+      }
+   } else {
+      unzFailsExist = True;
+      deleteOutputOnInterrupt = False;
+      if ( srcMode == SM_F2F ) {
+         IntNative retVal = remove ( outName );
+         ERROR_IF_NOT_ZERO ( retVal );
+      }
+   }
+   deleteOutputOnInterrupt = False;
+
+   if ( magicNumberOK ) {
+      if (verbosity >= 1)
+         fprintf ( stderr, "done\n" );
+   } else {
+      setExit(2);
+      if (verbosity >= 1)
+         fprintf ( stderr, "not a bzip2 file.\n" ); else
+         fprintf ( stderr,
+                   "%s: %s is not a bzip2 file.\n",
+                   progName, inName );
+   }
+
+}
+
+
+/*---------------------------------------------*/
+static 
+void testf ( Char *name )
+{
+   FILE *inStr;
+   Bool allOK;
+
+   deleteOutputOnInterrupt = False;
+
+   if (name == NULL && srcMode != SM_I2O)
+      panic ( "testf: bad modes\n" );
+
+   copyFileName ( outName, "(none)" );
+   switch (srcMode) {
+      case SM_I2O: copyFileName ( inName, "(stdin)" ); break;
+      case SM_F2F: copyFileName ( inName, name ); break;
+      case SM_F2O: copyFileName ( inName, name ); break;
+   }
+
+   if ( srcMode != SM_I2O && containsDubiousChars ( inName ) ) {
+      if (noisy)
+      fprintf ( stderr, "%s: There are no files matching `%s'.\n",
+                progName, inName );
+      setExit(1);
+      return;
+   }
+   if ( srcMode != SM_I2O && !fileExists ( inName ) ) {
+      fprintf ( stderr, "%s: Can't open input %s: %s.\n",
+                progName, inName, strerror(errno) );
+      setExit(1);
+      return;
+   }
+
+   switch ( srcMode ) {
+
+      case SM_I2O:
+         if ( isatty ( fileno ( stdin ) ) ) {
+            fprintf ( stderr,
+                      "%s: I won't read compressed data from a terminal.\n",
+                      progName );
+            fprintf ( stderr, "%s: For help, type: `%s --help'.\n",
+                              progName, progName );
+            setExit(1);
+            return;
+         };
+         inStr = stdin;
+         break;
+
+      case SM_F2O: case SM_F2F:
+         inStr = fopen ( inName, "rb" );
+         if ( inStr == NULL ) {
+            fprintf ( stderr, "%s: Can't open input file %s:%s.\n",
+                      progName, inName, strerror(errno) );
+            setExit(1);
+            return;
+         };
+         break;
+
+      default:
+         panic ( "testf: bad srcMode" );
+         break;
+   }
+
+   if (verbosity >= 1) {
+      fprintf ( stderr, "  %s: ", inName );
+      pad ( inName );
+      fflush ( stderr );
+   }
+
+   /*--- Now the input handle is sane.  Do the Biz. ---*/
+   allOK = testStream ( inStr );
+
+   if (allOK && verbosity >= 1) fprintf ( stderr, "ok\n" );
+   if (!allOK) testFailsExist = True;
+}
+
+
+/*---------------------------------------------*/
+static 
+void license ( void )
+{
+   fprintf ( stderr,
+
+    "bzip2, a block-sorting file compressor.  "
+    "Version %s.\n"
+    "   \n"
+    "   Copyright (C) 1996-2000 by Julian Seward.\n"
+    "   \n"
+    "   This program is free software; you can redistribute it and/or modify\n"
+    "   it under the terms set out in the LICENSE file, which is included\n"
+    "   in the bzip2-1.0 source distribution.\n"
+    "   \n"
+    "   This program is distributed in the hope that it will be useful,\n"
+    "   but WITHOUT ANY WARRANTY; without even the implied warranty of\n"
+    "   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the\n"
+    "   LICENSE file for more details.\n"
+    "   \n",
+    BZ2_bzlibVersion()
+   );
+}
+
+
+/*---------------------------------------------*/
+static 
+void usage ( Char *fullProgName )
+{
+   fprintf (
+      stderr,
+      "bzip2, a block-sorting file compressor.  "
+      "Version %s.\n"
+      "\n   usage: %s [flags and input files in any order]\n"
+      "\n"
+      "   -h --help           print this message\n"
+      "   -d --decompress     force decompression\n"
+      "   -z --compress       force compression\n"
+      "   -k --keep           keep (don't delete) input files\n"
+      "   -f --force          overwrite existing output files\n"
+      "   -t --test           test compressed file integrity\n"
+      "   -c --stdout         output to standard out\n"
+      "   -q --quiet          suppress noncritical error messages\n"
+      "   -v --verbose        be verbose (a 2nd -v gives more)\n"
+      "   -L --license        display software version & license\n"
+      "   -V --version        display software version & license\n"
+      "   -s --small          use less memory (at most 2500k)\n"
+      "   -1 .. -9            set block size to 100k .. 900k\n"
+      "\n"
+      "   If invoked as `bzip2', default action is to compress.\n"
+      "              as `bunzip2',  default action is to decompress.\n"
+      "              as `bzcat', default action is to decompress to stdout.\n"
+      "\n"
+      "   If no file names are given, bzip2 compresses or decompresses\n"
+      "   from standard input to standard output.  You can combine\n"
+      "   short flags, so `-v -4' means the same as -v4 or -4v, &c.\n"
+#if BZ_UNIX
+      "\n"
+#endif
+      ,
+
+      BZ2_bzlibVersion(),
+      fullProgName
+   );
+}
+
+
+/*---------------------------------------------*/
+static 
+void redundant ( Char* flag )
+{
+   fprintf ( 
+      stderr, 
+      "%s: %s is redundant in versions 0.9.5 and above\n",
+      progName, flag );
+}
+
+
+/*---------------------------------------------*/
+/*--
+  All the garbage from here to main() is purely to
+  implement a linked list of command-line arguments,
+  into which main() copies argv[1 .. argc-1].
+
+  The purpose of this exercise is to facilitate 
+  the expansion of wildcard characters * and ? in 
+  filenames for OSs which don't know how to do it
+  themselves, like MSDOS, Windows 95 and NT.
+
+  The actual Dirty Work is done by the platform-
+  specific macro APPEND_FILESPEC.
+--*/
+
+typedef
+   struct zzzz {
+      Char        *name;
+      struct zzzz *link;
+   }
+   Cell;
+
+
+/*---------------------------------------------*/
+static 
+void *myMalloc ( Int32 n )
+{
+   void* p;
+
+   p = malloc ( (size_t)n );
+   if (p == NULL) outOfMemory ();
+   return p;
+}
+
+
+/*---------------------------------------------*/
+static 
+Cell *mkCell ( void )
+{
+   Cell *c;
+
+   c = (Cell*) myMalloc ( sizeof ( Cell ) );
+   c->name = NULL;
+   c->link = NULL;
+   return c;
+}
+
+
+/*---------------------------------------------*/
+static 
+Cell *snocString ( Cell *root, Char *name )
+{
+   if (root == NULL) {
+      Cell *tmp = mkCell();
+      tmp->name = (Char*) myMalloc ( 5 + strlen(name) );
+      strcpy ( tmp->name, name );
+      return tmp;
+   } else {
+      Cell *tmp = root;
+      while (tmp->link != NULL) tmp = tmp->link;
+      tmp->link = snocString ( tmp->link, name );
+      return root;
+   }
+}
+
+
+/*---------------------------------------------*/
+static 
+void addFlagsFromEnvVar ( Cell** argList, Char* varName ) 
+{
+   Int32 i, j, k;
+   Char *envbase, *p;
+
+   envbase = getenv(varName);
+   if (envbase != NULL) {
+      p = envbase;
+      i = 0;
+      while (True) {
+         if (p[i] == 0) break;
+         p += i;
+         i = 0;
+         while (isspace((Int32)(p[0]))) p++;
+         while (p[i] != 0 && !isspace((Int32)(p[i]))) i++;
+         if (i > 0) {
+            k = i; if (k > FILE_NAME_LEN-10) k = FILE_NAME_LEN-10;
+            for (j = 0; j < k; j++) tmpName[j] = p[j];
+            tmpName[k] = 0;
+            APPEND_FLAG(*argList, tmpName);
+         }
+      }
+   }
+}
+
+
+/*---------------------------------------------*/
+#define ISFLAG(s) (strcmp(aa->name, (s))==0)
+
+IntNative main ( IntNative argc, Char *argv[] )
+{
+   Int32  i, j;
+   Char   *tmp;
+   Cell   *argList;
+   Cell   *aa;
+   Bool   decode;
+
+   /*-- Be really really really paranoid :-) --*/
+   if (sizeof(Int32) != 4 || sizeof(UInt32) != 4  ||
+       sizeof(Int16) != 2 || sizeof(UInt16) != 2  ||
+       sizeof(Char)  != 1 || sizeof(UChar)  != 1)
+      configError();
+
+   /*-- Initialise --*/
+   outputHandleJustInCase  = NULL;
+   smallMode               = False;
+   keepInputFiles          = False;
+   forceOverwrite          = False;
+   noisy                   = True;
+   verbosity               = 0;
+   blockSize100k           = 9;
+   testFailsExist          = False;
+   unzFailsExist           = False;
+   numFileNames            = 0;
+   numFilesProcessed       = 0;
+   workFactor              = 30;
+   deleteOutputOnInterrupt = False;
+   exitValue               = 0;
+   i = j = 0; /* avoid bogus warning from egcs-1.1.X */
+
+   /*-- Set up signal handlers for mem access errors --*/
+   signal (SIGSEGV, mySIGSEGVorSIGBUScatcher);
+#if BZ_UNIX
+#ifndef __DJGPP__
+   signal (SIGBUS,  mySIGSEGVorSIGBUScatcher);
+#endif
+#endif
+
+   copyFileName ( inName,  "(none)" );
+   copyFileName ( outName, "(none)" );
+
+   copyFileName ( progNameReally, argv[0] );
+   progName = &progNameReally[0];
+   for (tmp = &progNameReally[0]; *tmp != '\0'; tmp++)
+      if (*tmp == PATH_SEP) progName = tmp + 1;
+
+
+   /*-- Copy flags from env var BZIP2, and 
+        expand filename wildcards in arg list.
+   --*/
+   argList = NULL;
+   addFlagsFromEnvVar ( &argList,  "BZIP2" );
+   addFlagsFromEnvVar ( &argList,  "BZIP" );
+   for (i = 1; i <= argc-1; i++)
+      APPEND_FILESPEC(argList, argv[i]);
+
+
+   /*-- Find the length of the longest filename --*/
+   longestFileName = 7;
+   numFileNames    = 0;
+   decode          = True;
+   for (aa = argList; aa != NULL; aa = aa->link) {
+      if (ISFLAG("--")) { decode = False; continue; }
+      if (aa->name[0] == '-' && decode) continue;
+      numFileNames++;
+      if (longestFileName < (Int32)strlen(aa->name) )
+         longestFileName = (Int32)strlen(aa->name);
+   }
+
+
+   /*-- Determine source modes; flag handling may change this too. --*/
+   if (numFileNames == 0)
+      srcMode = SM_I2O; else srcMode = SM_F2F;
+
+
+   /*-- Determine what to do (compress/uncompress/test/cat). --*/
+   /*-- Note that subsequent flag handling may change this. --*/
+   opMode = OM_Z;
+
+   if ( (strstr ( progName, "unzip" ) != 0) ||
+        (strstr ( progName, "UNZIP" ) != 0) )
+      opMode = OM_UNZ;
+
+   if ( (strstr ( progName, "z2cat" ) != 0) ||
+        (strstr ( progName, "Z2CAT" ) != 0) ||
+        (strstr ( progName, "zcat" ) != 0)  ||
+        (strstr ( progName, "ZCAT" ) != 0) )  {
+      opMode = OM_UNZ;
+      srcMode = (numFileNames == 0) ? SM_I2O : SM_F2O;
+   }
+
+
+   /*-- Look at the flags. --*/
+   for (aa = argList; aa != NULL; aa = aa->link) {
+      if (ISFLAG("--")) break;
+      if (aa->name[0] == '-' && aa->name[1] != '-') {
+         for (j = 1; aa->name[j] != '\0'; j++) {
+            switch (aa->name[j]) {
+               case 'c': srcMode          = SM_F2O; break;
+               case 'd': opMode           = OM_UNZ; break;
+               case 'z': opMode           = OM_Z; break;
+               case 'f': forceOverwrite   = True; break;
+               case 't': opMode           = OM_TEST; break;
+               case 'k': keepInputFiles   = True; break;
+               case 's': smallMode        = True; break;
+               case 'q': noisy            = False; break;
+               case '1': blockSize100k    = 1; break;
+               case '2': blockSize100k    = 2; break;
+               case '3': blockSize100k    = 3; break;
+               case '4': blockSize100k    = 4; break;
+               case '5': blockSize100k    = 5; break;
+               case '6': blockSize100k    = 6; break;
+               case '7': blockSize100k    = 7; break;
+               case '8': blockSize100k    = 8; break;
+               case '9': blockSize100k    = 9; break;
+               case 'V':
+               case 'L': license();            break;
+               case 'v': verbosity++; break;
+               case 'h': usage ( progName );
+                         exit ( 0 );
+                         break;
+               default:  fprintf ( stderr, "%s: Bad flag `%s'\n",
+                                   progName, aa->name );
+                         usage ( progName );
+                         exit ( 1 );
+                         break;
+            }
+         }
+      }
+   }
+   
+   /*-- And again ... --*/
+   for (aa = argList; aa != NULL; aa = aa->link) {
+      if (ISFLAG("--")) break;
+      if (ISFLAG("--stdout"))            srcMode          = SM_F2O;  else
+      if (ISFLAG("--decompress"))        opMode           = OM_UNZ;  else
+      if (ISFLAG("--compress"))          opMode           = OM_Z;    else
+      if (ISFLAG("--force"))             forceOverwrite   = True;    else
+      if (ISFLAG("--test"))              opMode           = OM_TEST; else
+      if (ISFLAG("--keep"))              keepInputFiles   = True;    else
+      if (ISFLAG("--small"))             smallMode        = True;    else
+      if (ISFLAG("--quiet"))             noisy            = False;   else
+      if (ISFLAG("--version"))           license();                  else
+      if (ISFLAG("--license"))           license();                  else
+      if (ISFLAG("--exponential"))       workFactor = 1;             else 
+      if (ISFLAG("--repetitive-best"))   redundant(aa->name);        else
+      if (ISFLAG("--repetitive-fast"))   redundant(aa->name);        else
+      if (ISFLAG("--verbose"))           verbosity++;                else
+      if (ISFLAG("--help"))              { usage ( progName ); exit ( 0 ); }
+         else
+         if (strncmp ( aa->name, "--", 2) == 0) {
+            fprintf ( stderr, "%s: Bad flag `%s'\n", progName, aa->name );
+            usage ( progName );
+            exit ( 1 );
+         }
+   }
+
+   if (verbosity > 4) verbosity = 4;
+   if (opMode == OM_Z && smallMode && blockSize100k > 2) 
+      blockSize100k = 2;
+
+   if (opMode == OM_TEST && srcMode == SM_F2O) {
+      fprintf ( stderr, "%s: -c and -t cannot be used together.\n",
+                progName );
+      exit ( 1 );
+   }
+
+   if (srcMode == SM_F2O && numFileNames == 0)
+      srcMode = SM_I2O;
+
+   if (opMode != OM_Z) blockSize100k = 0;
+
+   if (srcMode == SM_F2F) {
+      signal (SIGINT,  mySignalCatcher);
+      signal (SIGTERM, mySignalCatcher);
+#     if BZ_UNIX
+      signal (SIGHUP,  mySignalCatcher);
+#     endif
+   }
+
+   if (opMode == OM_Z) {
+     if (srcMode == SM_I2O) {
+        compress ( NULL );
+     } else {
+        decode = True;
+        for (aa = argList; aa != NULL; aa = aa->link) {
+           if (ISFLAG("--")) { decode = False; continue; }
+           if (aa->name[0] == '-' && decode) continue;
+           numFilesProcessed++;
+           compress ( aa->name );
+        }
+     }
+   } 
+   else
+
+   if (opMode == OM_UNZ) {
+      unzFailsExist = False;
+      if (srcMode == SM_I2O) {
+         uncompress ( NULL );
+      } else {
+         decode = True;
+         for (aa = argList; aa != NULL; aa = aa->link) {
+            if (ISFLAG("--")) { decode = False; continue; }
+            if (aa->name[0] == '-' && decode) continue;
+            numFilesProcessed++;
+            uncompress ( aa->name );
+         }      
+      }
+      if (unzFailsExist) { 
+         setExit(2); 
+         exit(exitValue);
+      }
+   } 
+
+   else {
+      testFailsExist = False;
+      if (srcMode == SM_I2O) {
+         testf ( NULL );
+      } else {
+         decode = True;
+         for (aa = argList; aa != NULL; aa = aa->link) {
+	    if (ISFLAG("--")) { decode = False; continue; }
+            if (aa->name[0] == '-' && decode) continue;
+            numFilesProcessed++;
+            testf ( aa->name );
+	 }
+      }
+      if (testFailsExist && noisy) {
+         fprintf ( stderr,
+           "\n"
+           "You can use the `bzip2recover' program to attempt to recover\n"
+           "data from undamaged sections of corrupted files.\n\n"
+         );
+         setExit(2);
+         exit(exitValue);
+      }
+   }
+
+   /* Free the argument list memory to mollify leak detectors 
+      (eg) Purify, Checker.  Serves no other useful purpose.
+   */
+   aa = argList;
+   while (aa != NULL) {
+      Cell* aa2 = aa->link;
+      if (aa->name != NULL) free(aa->name);
+      free(aa);
+      aa = aa2;
+   }
+
+   return exitValue;
+}
+
+
+/*-----------------------------------------------------------*/
+/*--- end                                         bzip2.c ---*/
+/*-----------------------------------------------------------*/
diff --git a/bzip2/bzip2.txt b/bzip2/bzip2.txt
new file mode 100644
index 000000000..4f1ae8620
--- /dev/null
+++ b/bzip2/bzip2.txt
@@ -0,0 +1,376 @@
+
+
+NAME
+       bzip2, bunzip2 - a block-sorting file compressor, v1.0
+       bzcat - decompresses files to stdout
+       bzip2recover - recovers data from damaged bzip2 files
+
+
+SYNOPSIS
+       bzip2 [ -cdfkqstvzVL123456789 ] [ filenames ...  ]
+       bunzip2 [ -fkvsVL ] [ filenames ...  ]
+       bzcat [ -s ] [ filenames ...  ]
+       bzip2recover filename
+
+
+DESCRIPTION
+       bzip2  compresses  files  using  the Burrows-Wheeler block
+       sorting text compression algorithm,  and  Huffman  coding.
+       Compression  is  generally  considerably  better than that
+       achieved by more conventional LZ77/LZ78-based compressors,
+       and  approaches  the performance of the PPM family of sta-
+       tistical compressors.
+
+       The command-line options are deliberately very similar  to
+       those of GNU gzip, but they are not identical.
+
+       bzip2  expects  a list of file names to accompany the com-
+       mand-line flags.  Each file is replaced  by  a  compressed
+       version  of  itself,  with  the  name "original_name.bz2".
+       Each compressed file has the same modification date,  per-
+       missions, and, when possible, ownership as the correspond-
+       ing original, so that these properties  can  be  correctly
+       restored  at  decompression  time.   File name handling is
+       naive in the sense that there is no mechanism for preserv-
+       ing  original file names, permissions, ownerships or dates
+       in filesystems which lack these concepts, or have  serious
+       file name length restrictions, such as MS-DOS.
+
+       bzip2  and  bunzip2 will by default not overwrite existing
+       files.  If you want this to happen, specify the -f flag.
+
+       If no file names  are  specified,  bzip2  compresses  from
+       standard  input  to  standard output.  In this case, bzip2
+       will decline to write compressed output to a terminal,  as
+       this  would  be  entirely  incomprehensible  and therefore
+       pointless.
+
+       bunzip2 (or bzip2 -d) decompresses  all  specified  files.
+       Files which were not created by bzip2 will be detected and
+       ignored, and a warning issued.  bzip2  attempts  to  guess
+       the  filename  for  the decompressed file from that of the
+       compressed file as follows:
+
+              filename.bz2    becomes   filename
+              filename.bz     becomes   filename
+              filename.tbz2   becomes   filename.tar
+              filename.tbz    becomes   filename.tar
+              anyothername    becomes   anyothername.out
+
+       If the file does not end in one of the recognised endings,
+       .bz2,  .bz,  .tbz2 or .tbz, bzip2 complains that it cannot
+       guess the name of the original file, and uses the original
+       name with .out appended.
+
+       As  with compression, supplying no filenames causes decom-
+       pression from standard input to standard output.
+
+       bunzip2 will correctly decompress a file which is the con-
+       catenation of two or more compressed files.  The result is
+       the concatenation of the corresponding uncompressed files.
+       Integrity testing (-t) of concatenated compressed files is
+       also supported.
+
+       You can also compress or decompress files to the  standard
+       output  by giving the -c flag.  Multiple files may be com-
+       pressed and decompressed like this.  The resulting outputs
+       are  fed  sequentially to stdout.  Compression of multiple
+       files in this manner generates a stream containing  multi-
+       ple compressed file representations.  Such a stream can be
+       decompressed correctly only  by  bzip2  version  0.9.0  or
+       later.   Earlier  versions of bzip2 will stop after decom-
+       pressing the first file in the stream.
+
+       bzcat (or bzip2 -dc) decompresses all specified  files  to
+       the standard output.
+
+       bzip2  will  read arguments from the environment variables
+       BZIP2 and BZIP, in  that  order,  and  will  process  them
+       before  any  arguments  read  from the command line.  This
+       gives a convenient way to supply default arguments.
+
+       Compression is always performed, even  if  the  compressed
+       file  is slightly larger than the original.  Files of less
+       than about one hundred bytes tend to get larger, since the
+       compression  mechanism  has  a  constant  overhead  in the
+       region of 50 bytes.  Random data (including the output  of
+       most  file  compressors)  is  coded at about 8.05 bits per
+       byte, giving an expansion of around 0.5%.
+
+       As a self-check for your  protection,  bzip2  uses  32-bit
+       CRCs  to make sure that the decompressed version of a file
+       is identical to the original.  This guards against corrup-
+       tion  of  the compressed data, and against undetected bugs
+       in bzip2 (hopefully very unlikely).  The chances  of  data
+       corruption  going  undetected  is  microscopic,  about one
+       chance in four billion for each file processed.  Be aware,
+       though,  that  the  check occurs upon decompression, so it
+       can only tell you that something is wrong.  It can't  help
+       you  recover  the original uncompressed data.  You can use
+       bzip2recover to try to recover data from damaged files.
+
+       Return values: 0 for a normal exit,  1  for  environmental
+       problems  (file not found, invalid flags, I/O errors, &c),
+       2 to indicate a corrupt compressed file, 3 for an internal
+       consistency error (eg, bug) which caused bzip2 to panic.
+
+
+OPTIONS
+       -c --stdout
+              Compress or decompress to standard output.
+
+       -d --decompress
+              Force  decompression.  bzip2, bunzip2 and bzcat are
+              really the same program,  and  the  decision  about
+              what  actions to take is done on the basis of which
+              name is used.  This flag overrides that  mechanism,
+              and forces bzip2 to decompress.
+
+       -z --compress
+              The  complement  to -d: forces compression, regard-
+              less of the invokation name.
+
+       -t --test
+              Check integrity of the specified file(s), but don't
+              decompress  them.   This  really  performs  a trial
+              decompression and throws away the result.
+
+       -f --force
+              Force overwrite of output files.   Normally,  bzip2
+              will  not  overwrite  existing  output files.  Also
+              forces bzip2 to break hard links to files, which it
+              otherwise wouldn't do.
+
+       -k --keep
+              Keep  (don't delete) input files during compression
+              or decompression.
+
+       -s --small
+              Reduce memory usage, for compression, decompression
+              and  testing.   Files  are  decompressed and tested
+              using a modified algorithm which only requires  2.5
+              bytes  per  block byte.  This means any file can be
+              decompressed in 2300k of memory,  albeit  at  about
+              half the normal speed.
+
+              During  compression,  -s  selects  a  block size of
+              200k, which limits memory use to  around  the  same
+              figure,  at  the expense of your compression ratio.
+              In short, if your  machine  is  low  on  memory  (8
+              megabytes  or  less),  use  -s for everything.  See
+              MEMORY MANAGEMENT below.
+
+       -q --quiet
+              Suppress non-essential warning messages.   Messages
+              pertaining  to I/O errors and other critical events
+              will not be suppressed.
+
+       -v --verbose
+              Verbose mode -- show the compression ratio for each
+              file  processed.   Further  -v's  increase the ver-
+              bosity level, spewing out lots of information which
+              is primarily of interest for diagnostic purposes.
+
+       -L --license -V --version
+              Display  the  software  version,  license terms and
+              conditions.
+
+       -1 to -9
+              Set the block size to 100 k, 200 k ..  900  k  when
+              compressing.   Has  no  effect  when decompressing.
+              See MEMORY MANAGEMENT below.
+
+       --     Treats all subsequent arguments as file names, even
+              if they start with a dash.  This is so you can han-
+              dle files with names beginning  with  a  dash,  for
+              example: bzip2 -- -myfilename.
+
+       --repetitive-fast --repetitive-best
+              These  flags  are  redundant  in versions 0.9.5 and
+              above.  They provided some coarse control over  the
+              behaviour  of the sorting algorithm in earlier ver-
+              sions, which was sometimes useful.  0.9.5 and above
+              have  an  improved  algorithm  which  renders these
+              flags irrelevant.
+
+
+MEMORY MANAGEMENT
+       bzip2 compresses large files in blocks.   The  block  size
+       affects  both  the  compression  ratio  achieved,  and the
+       amount of memory needed for compression and decompression.
+       The  flags  -1  through  -9  specify  the block size to be
+       100,000 bytes through 900,000 bytes (the default)  respec-
+       tively.   At  decompression  time, the block size used for
+       compression is read from  the  header  of  the  compressed
+       file, and bunzip2 then allocates itself just enough memory
+       to decompress the file.  Since block sizes are  stored  in
+       compressed  files,  it follows that the flags -1 to -9 are
+       irrelevant to and so ignored during decompression.
+
+       Compression and decompression requirements, in bytes,  can
+       be estimated as:
+
+              Compression:   400k + ( 8 x block size )
+
+              Decompression: 100k + ( 4 x block size ), or
+                             100k + ( 2.5 x block size )
+
+       Larger  block  sizes  give  rapidly  diminishing  marginal
+       returns.  Most of the compression comes from the first two
+       or  three hundred k of block size, a fact worth bearing in
+       mind when using bzip2  on  small  machines.   It  is  also
+       important  to  appreciate  that  the  decompression memory
+       requirement is set at compression time by  the  choice  of
+       block size.
+
+       For  files  compressed  with  the default 900k block size,
+       bunzip2 will require about 3700 kbytes to decompress.   To
+       support decompression of any file on a 4 megabyte machine,
+       bunzip2 has an option to  decompress  using  approximately
+       half this amount of memory, about 2300 kbytes.  Decompres-
+       sion speed is also halved, so you should use  this  option
+       only where necessary.  The relevant flag is -s.
+
+       In general, try and use the largest block size memory con-
+       straints  allow,  since  that  maximises  the  compression
+       achieved.   Compression and decompression speed are virtu-
+       ally unaffected by block size.
+
+       Another significant point applies to files which fit in  a
+       single  block  --  that  means  most files you'd encounter
+       using a large block  size.   The  amount  of  real  memory
+       touched is proportional to the size of the file, since the
+       file is smaller than a block.  For example, compressing  a
+       file  20,000  bytes  long  with the flag -9 will cause the
+       compressor to allocate around 7600k of  memory,  but  only
+       touch 400k + 20000 * 8 = 560 kbytes of it.  Similarly, the
+       decompressor will allocate 3700k but  only  touch  100k  +
+       20000 * 4 = 180 kbytes.
+
+       Here  is a table which summarises the maximum memory usage
+       for different block sizes.  Also  recorded  is  the  total
+       compressed  size for 14 files of the Calgary Text Compres-
+       sion Corpus totalling 3,141,622 bytes.  This column  gives
+       some  feel  for  how  compression  varies with block size.
+       These figures tend to understate the advantage  of  larger
+       block  sizes  for  larger files, since the Corpus is domi-
+       nated by smaller files.
+
+                  Compress   Decompress   Decompress   Corpus
+           Flag     usage      usage       -s usage     Size
+
+            -1      1200k       500k         350k      914704
+            -2      2000k       900k         600k      877703
+            -3      2800k      1300k         850k      860338
+            -4      3600k      1700k        1100k      846899
+            -5      4400k      2100k        1350k      845160
+            -6      5200k      2500k        1600k      838626
+            -7      6100k      2900k        1850k      834096
+            -8      6800k      3300k        2100k      828642
+            -9      7600k      3700k        2350k      828642
+
+
+RECOVERING DATA FROM DAMAGED FILES
+       bzip2 compresses files in blocks, usually 900kbytes  long.
+       Each block is handled independently.  If a media or trans-
+       mission error causes a multi-block  .bz2  file  to  become
+       damaged,  it  may  be  possible  to  recover data from the
+       undamaged blocks in the file.
+
+       The compressed representation of each block  is  delimited
+       by  a  48-bit pattern, which makes it possible to find the
+       block boundaries with reasonable  certainty.   Each  block
+       also  carries its own 32-bit CRC, so damaged blocks can be
+       distinguished from undamaged ones.
+
+       bzip2recover is a  simple  program  whose  purpose  is  to
+       search  for blocks in .bz2 files, and write each block out
+       into its own .bz2 file.  You can then use bzip2 -t to test
+       the integrity of the resulting files, and decompress those
+       which are undamaged.
+
+       bzip2recover takes a single argument, the name of the dam-
+       aged file, and writes a number of files "rec0001file.bz2",
+       "rec0002file.bz2", etc, containing the  extracted  blocks.
+       The  output  filenames  are  designed  so  that the use of
+       wildcards in subsequent processing -- for example,  "bzip2
+       -dc   rec*file.bz2 > recovered_data" -- lists the files in
+       the correct order.
+
+       bzip2recover should be of most use dealing with large .bz2
+       files,  as  these will contain many blocks.  It is clearly
+       futile to use it on damaged single-block  files,  since  a
+       damaged  block  cannot  be recovered.  If you wish to min-
+       imise any potential data loss through media  or  transmis-
+       sion errors, you might consider compressing with a smaller
+       block size.
+
+
+PERFORMANCE NOTES
+       The sorting phase of compression gathers together  similar
+       strings  in  the  file.  Because of this, files containing
+       very long runs of  repeated  symbols,  like  "aabaabaabaab
+       ..."   (repeated  several hundred times) may compress more
+       slowly than normal.  Versions 0.9.5 and  above  fare  much
+       better  than previous versions in this respect.  The ratio
+       between worst-case and average-case compression time is in
+       the  region  of  10:1.  For previous versions, this figure
+       was more like 100:1.  You can use the -vvvv option to mon-
+       itor progress in great detail, if you want.
+
+       Decompression speed is unaffected by these phenomena.
+
+       bzip2  usually  allocates  several  megabytes of memory to
+       operate in, and then charges all over it in a fairly  ran-
+       dom  fashion.   This means that performance, both for com-
+       pressing and decompressing, is largely determined  by  the
+       speed  at  which  your  machine  can service cache misses.
+       Because of this, small changes to the code to  reduce  the
+       miss  rate  have  been observed to give disproportionately
+       large performance improvements.  I imagine bzip2 will per-
+       form best on machines with very large caches.
+
+
+CAVEATS
+       I/O  error  messages  are not as helpful as they could be.
+       bzip2 tries hard to detect I/O errors  and  exit  cleanly,
+       but  the  details  of  what  the problem is sometimes seem
+       rather misleading.
+
+       This manual page pertains to version 1.0 of bzip2.  Com-
+       pressed  data created by this version is entirely forwards
+       and  backwards  compatible  with   the   previous   public
+       releases,  versions  0.1pl2, 0.9.0 and 0.9.5, but with the
+       following exception: 0.9.0 and above can correctly  decom-
+       press multiple concatenated compressed files.  0.1pl2 can-
+       not do this; it will stop  after  decompressing  just  the
+       first file in the stream.
+
+       bzip2recover  uses  32-bit integers to represent bit posi-
+       tions in compressed files, so it cannot handle  compressed
+       files  more than 512 megabytes long.  This could easily be
+       fixed.
+
+
+AUTHOR
+       Julian Seward, jseward@acm.org.
+
+       http://sourceware.cygnus.com/bzip2
+       http://www.muraroa.demon.co.uk
+
+       The ideas embodied in bzip2 are due to (at least) the fol-
+       lowing  people: Michael Burrows and David Wheeler (for the
+       block sorting transformation), David Wheeler  (again,  for
+       the Huffman coder), Peter Fenwick (for the structured cod-
+       ing model in the original bzip, and many refinements), and
+       Alistair  Moffat,  Radford  Neal  and  Ian Witten (for the
+       arithmetic  coder  in  the  original  bzip).   I  am  much
+       indebted for their help, support and advice.  See the man-
+       ual in the source distribution for pointers to sources  of
+       documentation.  Christian von Roques encouraged me to look
+       for faster sorting algorithms, so as to speed up  compres-
+       sion.  Bela Lubkin encouraged me to improve the worst-case
+       compression performance.  Many people sent patches, helped
+       with  portability problems, lent machines, gave advice and
+       were generally helpful.
+
diff --git a/bzip2/bzip2recover.c b/bzip2/bzip2recover.c
new file mode 100644
index 000000000..ba3d17563
--- /dev/null
+++ b/bzip2/bzip2recover.c
@@ -0,0 +1,435 @@
+
+/*-----------------------------------------------------------*/
+/*--- Block recoverer program for bzip2                   ---*/
+/*---                                      bzip2recover.c ---*/
+/*-----------------------------------------------------------*/
+
+/*--
+  This program is bzip2recover, a program to attempt data 
+  salvage from damaged files created by the accompanying
+  bzip2-1.0 program.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+--*/
+
+/*--
+  This program is a complete hack and should be rewritten
+  properly.  It isn't very complicated.
+--*/
+
+#include <stdio.h>
+#include <errno.h>
+#include <stdlib.h>
+#include <string.h>
+
+typedef  unsigned int   UInt32;
+typedef  int            Int32;
+typedef  unsigned char  UChar;
+typedef  char           Char;
+typedef  unsigned char  Bool;
+#define True    ((Bool)1)
+#define False   ((Bool)0)
+
+
+Char inFileName[2000];
+Char outFileName[2000];
+Char progName[2000];
+
+UInt32 bytesOut = 0;
+UInt32 bytesIn  = 0;
+
+
+/*---------------------------------------------------*/
+/*--- I/O errors                                  ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------*/
+void readError ( void )
+{
+   fprintf ( stderr,
+             "%s: I/O error reading `%s', possible reason follows.\n",
+            progName, inFileName );
+   perror ( progName );
+   fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n",
+             progName );
+   exit ( 1 );
+}
+
+
+/*---------------------------------------------*/
+void writeError ( void )
+{
+   fprintf ( stderr,
+             "%s: I/O error reading `%s', possible reason follows.\n",
+            progName, inFileName );
+   perror ( progName );
+   fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n",
+             progName );
+   exit ( 1 );
+}
+
+
+/*---------------------------------------------*/
+void mallocFail ( Int32 n )
+{
+   fprintf ( stderr,
+             "%s: malloc failed on request for %d bytes.\n",
+            progName, n );
+   fprintf ( stderr, "%s: warning: output file(s) may be incomplete.\n",
+             progName );
+   exit ( 1 );
+}
+
+
+/*---------------------------------------------------*/
+/*--- Bit stream I/O                              ---*/
+/*---------------------------------------------------*/
+
+typedef
+   struct {
+      FILE*  handle;
+      Int32  buffer;
+      Int32  buffLive;
+      Char   mode;
+   }
+   BitStream;
+
+
+/*---------------------------------------------*/
+BitStream* bsOpenReadStream ( FILE* stream )
+{
+   BitStream *bs = malloc ( sizeof(BitStream) );
+   if (bs == NULL) mallocFail ( sizeof(BitStream) );
+   bs->handle = stream;
+   bs->buffer = 0;
+   bs->buffLive = 0;
+   bs->mode = 'r';
+   return bs;
+}
+
+
+/*---------------------------------------------*/
+BitStream* bsOpenWriteStream ( FILE* stream )
+{
+   BitStream *bs = malloc ( sizeof(BitStream) );
+   if (bs == NULL) mallocFail ( sizeof(BitStream) );
+   bs->handle = stream;
+   bs->buffer = 0;
+   bs->buffLive = 0;
+   bs->mode = 'w';
+   return bs;
+}
+
+
+/*---------------------------------------------*/
+void bsPutBit ( BitStream* bs, Int32 bit )
+{
+   if (bs->buffLive == 8) {
+      Int32 retVal = putc ( (UChar) bs->buffer, bs->handle );
+      if (retVal == EOF) writeError();
+      bytesOut++;
+      bs->buffLive = 1;
+      bs->buffer = bit & 0x1;
+   } else {
+      bs->buffer = ( (bs->buffer << 1) | (bit & 0x1) );
+      bs->buffLive++;
+   };
+}
+
+
+/*---------------------------------------------*/
+/*--
+   Returns 0 or 1, or 2 to indicate EOF.
+--*/
+Int32 bsGetBit ( BitStream* bs )
+{
+   if (bs->buffLive > 0) {
+      bs->buffLive --;
+      return ( ((bs->buffer) >> (bs->buffLive)) & 0x1 );
+   } else {
+      Int32 retVal = getc ( bs->handle );
+      if ( retVal == EOF ) {
+         if (errno != 0) readError();
+         return 2;
+      }
+      bs->buffLive = 7;
+      bs->buffer = retVal;
+      return ( ((bs->buffer) >> 7) & 0x1 );
+   }
+}
+
+
+/*---------------------------------------------*/
+void bsClose ( BitStream* bs )
+{
+   Int32 retVal;
+
+   if ( bs->mode == 'w' ) {
+      while ( bs->buffLive < 8 ) {
+         bs->buffLive++;
+         bs->buffer <<= 1;
+      };
+      retVal = putc ( (UChar) (bs->buffer), bs->handle );
+      if (retVal == EOF) writeError();
+      bytesOut++;
+      retVal = fflush ( bs->handle );
+      if (retVal == EOF) writeError();
+   }
+   retVal = fclose ( bs->handle );
+   if (retVal == EOF) {
+      if (bs->mode == 'w') writeError(); else readError();
+   }
+   free ( bs );
+}
+
+
+/*---------------------------------------------*/
+void bsPutUChar ( BitStream* bs, UChar c )
+{
+   Int32 i;
+   for (i = 7; i >= 0; i--)
+      bsPutBit ( bs, (((UInt32) c) >> i) & 0x1 );
+}
+
+
+/*---------------------------------------------*/
+void bsPutUInt32 ( BitStream* bs, UInt32 c )
+{
+   Int32 i;
+
+   for (i = 31; i >= 0; i--)
+      bsPutBit ( bs, (c >> i) & 0x1 );
+}
+
+
+/*---------------------------------------------*/
+Bool endsInBz2 ( Char* name )
+{
+   Int32 n = strlen ( name );
+   if (n <= 4) return False;
+   return
+      (name[n-4] == '.' &&
+       name[n-3] == 'b' &&
+       name[n-2] == 'z' &&
+       name[n-1] == '2');
+}
+
+
+/*---------------------------------------------------*/
+/*---                                             ---*/
+/*---------------------------------------------------*/
+
+#define BLOCK_HEADER_HI  0x00003141UL
+#define BLOCK_HEADER_LO  0x59265359UL
+
+#define BLOCK_ENDMARK_HI 0x00001772UL
+#define BLOCK_ENDMARK_LO 0x45385090UL
+
+
+UInt32 bStart[20000];
+UInt32 bEnd[20000];
+UInt32 rbStart[20000];
+UInt32 rbEnd[20000];
+
+Int32 main ( Int32 argc, Char** argv )
+{
+   FILE*       inFile;
+   FILE*       outFile;
+   BitStream*  bsIn, *bsWr;
+   Int32       currBlock, b, wrBlock;
+   UInt32      bitsRead;
+   Int32       rbCtr;
+
+
+   UInt32      buffHi, buffLo, blockCRC;
+   Char*       p;
+
+   strcpy ( progName, argv[0] );
+   inFileName[0] = outFileName[0] = 0;
+
+   fprintf ( stderr, "bzip2recover 1.0: extracts blocks from damaged .bz2 files.\n" );
+
+   if (argc != 2) {
+      fprintf ( stderr, "%s: usage is `%s damaged_file_name'.\n",
+                        progName, progName );
+      exit(1);
+   }
+
+   strcpy ( inFileName, argv[1] );
+
+   inFile = fopen ( inFileName, "rb" );
+   if (inFile == NULL) {
+      fprintf ( stderr, "%s: can't read `%s'\n", progName, inFileName );
+      exit(1);
+   }
+
+   bsIn = bsOpenReadStream ( inFile );
+   fprintf ( stderr, "%s: searching for block boundaries ...\n", progName );
+
+   bitsRead = 0;
+   buffHi = buffLo = 0;
+   currBlock = 0;
+   bStart[currBlock] = 0;
+
+   rbCtr = 0;
+
+   while (True) {
+      b = bsGetBit ( bsIn );
+      bitsRead++;
+      if (b == 2) {
+         if (bitsRead >= bStart[currBlock] &&
+            (bitsRead - bStart[currBlock]) >= 40) {
+            bEnd[currBlock] = bitsRead-1;
+            if (currBlock > 0)
+               fprintf ( stderr, "   block %d runs from %d to %d (incomplete)\n",
+                         currBlock,  bStart[currBlock], bEnd[currBlock] );
+         } else
+            currBlock--;
+         break;
+      }
+      buffHi = (buffHi << 1) | (buffLo >> 31);
+      buffLo = (buffLo << 1) | (b & 1);
+      if ( ( (buffHi & 0x0000ffff) == BLOCK_HEADER_HI 
+             && buffLo == BLOCK_HEADER_LO)
+           || 
+           ( (buffHi & 0x0000ffff) == BLOCK_ENDMARK_HI 
+             && buffLo == BLOCK_ENDMARK_LO)
+         ) {
+         if (bitsRead > 49)
+            bEnd[currBlock] = bitsRead-49; else
+            bEnd[currBlock] = 0;
+         if (currBlock > 0 &&
+	     (bEnd[currBlock] - bStart[currBlock]) >= 130) {
+            fprintf ( stderr, "   block %d runs from %d to %d\n",
+                      rbCtr+1,  bStart[currBlock], bEnd[currBlock] );
+            rbStart[rbCtr] = bStart[currBlock];
+            rbEnd[rbCtr] = bEnd[currBlock];
+            rbCtr++;
+         }
+         currBlock++;
+
+         bStart[currBlock] = bitsRead;
+      }
+   }
+
+   bsClose ( bsIn );
+
+   /*-- identified blocks run from 1 to rbCtr inclusive. --*/
+
+   if (rbCtr < 1) {
+      fprintf ( stderr,
+                "%s: sorry, I couldn't find any block boundaries.\n",
+                progName );
+      exit(1);
+   };
+
+   fprintf ( stderr, "%s: splitting into blocks\n", progName );
+
+   inFile = fopen ( inFileName, "rb" );
+   if (inFile == NULL) {
+      fprintf ( stderr, "%s: can't open `%s'\n", progName, inFileName );
+      exit(1);
+   }
+   bsIn = bsOpenReadStream ( inFile );
+
+   /*-- placate gcc's dataflow analyser --*/
+   blockCRC = 0; bsWr = 0;
+
+   bitsRead = 0;
+   outFile = NULL;
+   wrBlock = 0;
+   while (True) {
+      b = bsGetBit(bsIn);
+      if (b == 2) break;
+      buffHi = (buffHi << 1) | (buffLo >> 31);
+      buffLo = (buffLo << 1) | (b & 1);
+      if (bitsRead == 47+rbStart[wrBlock]) 
+         blockCRC = (buffHi << 16) | (buffLo >> 16);
+
+      if (outFile != NULL && bitsRead >= rbStart[wrBlock]
+                          && bitsRead <= rbEnd[wrBlock]) {
+         bsPutBit ( bsWr, b );
+      }
+
+      bitsRead++;
+
+      if (bitsRead == rbEnd[wrBlock]+1) {
+         if (outFile != NULL) {
+            bsPutUChar ( bsWr, 0x17 ); bsPutUChar ( bsWr, 0x72 );
+            bsPutUChar ( bsWr, 0x45 ); bsPutUChar ( bsWr, 0x38 );
+            bsPutUChar ( bsWr, 0x50 ); bsPutUChar ( bsWr, 0x90 );
+            bsPutUInt32 ( bsWr, blockCRC );
+            bsClose ( bsWr );
+         }
+         if (wrBlock >= rbCtr) break;
+         wrBlock++;
+      } else
+      if (bitsRead == rbStart[wrBlock]) {
+         outFileName[0] = 0;
+         sprintf ( outFileName, "rec%4d", wrBlock+1 );
+         for (p = outFileName; *p != 0; p++) if (*p == ' ') *p = '0';
+         strcat ( outFileName, inFileName );
+         if ( !endsInBz2(outFileName)) strcat ( outFileName, ".bz2" );
+
+         fprintf ( stderr, "   writing block %d to `%s' ...\n",
+                           wrBlock+1, outFileName );
+
+         outFile = fopen ( outFileName, "wb" );
+         if (outFile == NULL) {
+            fprintf ( stderr, "%s: can't write `%s'\n",
+                      progName, outFileName );
+            exit(1);
+         }
+         bsWr = bsOpenWriteStream ( outFile );
+         bsPutUChar ( bsWr, 'B' ); bsPutUChar ( bsWr, 'Z' );
+         bsPutUChar ( bsWr, 'h' ); bsPutUChar ( bsWr, '9' );
+         bsPutUChar ( bsWr, 0x31 ); bsPutUChar ( bsWr, 0x41 );
+         bsPutUChar ( bsWr, 0x59 ); bsPutUChar ( bsWr, 0x26 );
+         bsPutUChar ( bsWr, 0x53 ); bsPutUChar ( bsWr, 0x59 );
+      }
+   }
+
+   fprintf ( stderr, "%s: finished\n", progName );
+   return 0;
+}
+
+
+
+/*-----------------------------------------------------------*/
+/*--- end                                  bzip2recover.c ---*/
+/*-----------------------------------------------------------*/
diff --git a/bzip2/bzlib.c b/bzip2/bzlib.c
new file mode 100644
index 000000000..4a06d9f14
--- /dev/null
+++ b/bzip2/bzlib.c
@@ -0,0 +1,1564 @@
+
+/*-------------------------------------------------------------*/
+/*--- Library top-level functions.                          ---*/
+/*---                                               bzlib.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+/*--
+   CHANGES
+   ~~~~~~~
+   0.9.0 -- original version.
+
+   0.9.0a/b -- no changes in this file.
+
+   0.9.0c
+      * made zero-length BZ_FLUSH work correctly in bzCompress().
+      * fixed bzWrite/bzRead to ignore zero-length requests.
+      * fixed bzread to correctly handle read requests after EOF.
+      * wrong parameter order in call to bzDecompressInit in
+        bzBuffToBuffDecompress.  Fixed.
+--*/
+
+#include "bzlib_private.h"
+
+
+/*---------------------------------------------------*/
+/*--- Compression stuff                           ---*/
+/*---------------------------------------------------*/
+
+
+/*---------------------------------------------------*/
+#ifndef BZ_NO_STDIO
+void BZ2_bz__AssertH__fail ( int errcode )
+{
+   fprintf(stderr, 
+      "\n\nbzip2/libbzip2: internal error number %d.\n"
+      "This is a bug in bzip2/libbzip2, %s.\n"
+      "Please report it to me at: jseward@acm.org.  If this happened\n"
+      "when you were using some program which uses libbzip2 as a\n"
+      "component, you should also report this bug to the author(s)\n"
+      "of that program.  Please make an effort to report this bug;\n"
+      "timely and accurate bug reports eventually lead to higher\n"
+      "quality software.  Thanks.  Julian Seward, 21 March 2000.\n\n",
+      errcode,
+      BZ2_bzlibVersion()
+   );
+   exit(3);
+}
+#endif
+
+
+/*---------------------------------------------------*/
+static
+int bz_config_ok ( void )
+{
+   if (sizeof(int)   != 4) return 0;
+   if (sizeof(short) != 2) return 0;
+   if (sizeof(char)  != 1) return 0;
+   return 1;
+}
+
+
+/*---------------------------------------------------*/
+static
+void* default_bzalloc ( void* opaque, Int32 items, Int32 size )
+{
+   void* v = malloc ( items * size );
+   return v;
+}
+
+static
+void default_bzfree ( void* opaque, void* addr )
+{
+   if (addr != NULL) free ( addr );
+}
+
+
+/*---------------------------------------------------*/
+static
+void prepare_new_block ( EState* s )
+{
+   Int32 i;
+   s->nblock = 0;
+   s->numZ = 0;
+   s->state_out_pos = 0;
+   BZ_INITIALISE_CRC ( s->blockCRC );
+   for (i = 0; i < 256; i++) s->inUse[i] = False;
+   s->blockNo++;
+}
+
+
+/*---------------------------------------------------*/
+static
+void init_RL ( EState* s )
+{
+   s->state_in_ch  = 256;
+   s->state_in_len = 0;
+}
+
+
+static
+Bool isempty_RL ( EState* s )
+{
+   if (s->state_in_ch < 256 && s->state_in_len > 0)
+      return False; else
+      return True;
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzCompressInit) 
+                    ( bz_stream* strm, 
+                     int        blockSize100k,
+                     int        verbosity,
+                     int        workFactor )
+{
+   Int32   n;
+   EState* s;
+
+   if (!bz_config_ok()) return BZ_CONFIG_ERROR;
+
+   if (strm == NULL || 
+       blockSize100k < 1 || blockSize100k > 9 ||
+       workFactor < 0 || workFactor > 250)
+     return BZ_PARAM_ERROR;
+
+   if (workFactor == 0) workFactor = 30;
+   if (strm->bzalloc == NULL) strm->bzalloc = default_bzalloc;
+   if (strm->bzfree == NULL) strm->bzfree = default_bzfree;
+
+   s = BZALLOC( sizeof(EState) );
+   if (s == NULL) return BZ_MEM_ERROR;
+   s->strm = strm;
+
+   s->arr1 = NULL;
+   s->arr2 = NULL;
+   s->ftab = NULL;
+
+   n       = 100000 * blockSize100k;
+   s->arr1 = BZALLOC( n                  * sizeof(UInt32) );
+   s->arr2 = BZALLOC( (n+BZ_N_OVERSHOOT) * sizeof(UInt32) );
+   s->ftab = BZALLOC( 65537              * sizeof(UInt32) );
+
+   if (s->arr1 == NULL || s->arr2 == NULL || s->ftab == NULL) {
+      if (s->arr1 != NULL) BZFREE(s->arr1);
+      if (s->arr2 != NULL) BZFREE(s->arr2);
+      if (s->ftab != NULL) BZFREE(s->ftab);
+      if (s       != NULL) BZFREE(s);
+      return BZ_MEM_ERROR;
+   }
+
+   s->blockNo           = 0;
+   s->state             = BZ_S_INPUT;
+   s->mode              = BZ_M_RUNNING;
+   s->combinedCRC       = 0;
+   s->blockSize100k     = blockSize100k;
+   s->nblockMAX         = 100000 * blockSize100k - 19;
+   s->verbosity         = verbosity;
+   s->workFactor        = workFactor;
+
+   s->block             = (UChar*)s->arr2;
+   s->mtfv              = (UInt16*)s->arr1;
+   s->zbits             = NULL;
+   s->ptr               = (UInt32*)s->arr1;
+
+   strm->state          = s;
+   strm->total_in_lo32  = 0;
+   strm->total_in_hi32  = 0;
+   strm->total_out_lo32 = 0;
+   strm->total_out_hi32 = 0;
+   init_RL ( s );
+   prepare_new_block ( s );
+   return BZ_OK;
+}
+
+
+/*---------------------------------------------------*/
+static
+void add_pair_to_block ( EState* s )
+{
+   Int32 i;
+   UChar ch = (UChar)(s->state_in_ch);
+   for (i = 0; i < s->state_in_len; i++) {
+      BZ_UPDATE_CRC( s->blockCRC, ch );
+   }
+   s->inUse[s->state_in_ch] = True;
+   switch (s->state_in_len) {
+      case 1:
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         break;
+      case 2:
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         break;
+      case 3:
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         break;
+      default:
+         s->inUse[s->state_in_len-4] = True;
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         s->block[s->nblock] = (UChar)ch; s->nblock++;
+         s->block[s->nblock] = ((UChar)(s->state_in_len-4));
+         s->nblock++;
+         break;
+   }
+}
+
+
+/*---------------------------------------------------*/
+static
+void flush_RL ( EState* s )
+{
+   if (s->state_in_ch < 256) add_pair_to_block ( s );
+   init_RL ( s );
+}
+
+
+/*---------------------------------------------------*/
+#define ADD_CHAR_TO_BLOCK(zs,zchh0)               \
+{                                                 \
+   UInt32 zchh = (UInt32)(zchh0);                 \
+   /*-- fast track the common case --*/           \
+   if (zchh != zs->state_in_ch &&                 \
+       zs->state_in_len == 1) {                   \
+      UChar ch = (UChar)(zs->state_in_ch);        \
+      BZ_UPDATE_CRC( zs->blockCRC, ch );          \
+      zs->inUse[zs->state_in_ch] = True;          \
+      zs->block[zs->nblock] = (UChar)ch;          \
+      zs->nblock++;                               \
+      zs->state_in_ch = zchh;                     \
+   }                                              \
+   else                                           \
+   /*-- general, uncommon cases --*/              \
+   if (zchh != zs->state_in_ch ||                 \
+      zs->state_in_len == 255) {                  \
+      if (zs->state_in_ch < 256)                  \
+         add_pair_to_block ( zs );                \
+      zs->state_in_ch = zchh;                     \
+      zs->state_in_len = 1;                       \
+   } else {                                       \
+      zs->state_in_len++;                         \
+   }                                              \
+}
+
+
+/*---------------------------------------------------*/
+static
+Bool copy_input_until_stop ( EState* s )
+{
+   Bool progress_in = False;
+
+   if (s->mode == BZ_M_RUNNING) {
+
+      /*-- fast track the common case --*/
+      while (True) {
+         /*-- block full? --*/
+         if (s->nblock >= s->nblockMAX) break;
+         /*-- no input? --*/
+         if (s->strm->avail_in == 0) break;
+         progress_in = True;
+         ADD_CHAR_TO_BLOCK ( s, (UInt32)(*((UChar*)(s->strm->next_in))) ); 
+         s->strm->next_in++;
+         s->strm->avail_in--;
+         s->strm->total_in_lo32++;
+         if (s->strm->total_in_lo32 == 0) s->strm->total_in_hi32++;
+      }
+
+   } else {
+
+      /*-- general, uncommon case --*/
+      while (True) {
+         /*-- block full? --*/
+         if (s->nblock >= s->nblockMAX) break;
+         /*-- no input? --*/
+         if (s->strm->avail_in == 0) break;
+         /*-- flush/finish end? --*/
+         if (s->avail_in_expect == 0) break;
+         progress_in = True;
+         ADD_CHAR_TO_BLOCK ( s, (UInt32)(*((UChar*)(s->strm->next_in))) ); 
+         s->strm->next_in++;
+         s->strm->avail_in--;
+         s->strm->total_in_lo32++;
+         if (s->strm->total_in_lo32 == 0) s->strm->total_in_hi32++;
+         s->avail_in_expect--;
+      }
+   }
+   return progress_in;
+}
+
+
+/*---------------------------------------------------*/
+static
+Bool copy_output_until_stop ( EState* s )
+{
+   Bool progress_out = False;
+
+   while (True) {
+
+      /*-- no output space? --*/
+      if (s->strm->avail_out == 0) break;
+
+      /*-- block done? --*/
+      if (s->state_out_pos >= s->numZ) break;
+
+      progress_out = True;
+      *(s->strm->next_out) = s->zbits[s->state_out_pos];
+      s->state_out_pos++;
+      s->strm->avail_out--;
+      s->strm->next_out++;
+      s->strm->total_out_lo32++;
+      if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++;
+   }
+
+   return progress_out;
+}
+
+
+/*---------------------------------------------------*/
+static
+Bool handle_compress ( bz_stream* strm )
+{
+   Bool progress_in  = False;
+   Bool progress_out = False;
+   EState* s = strm->state;
+   
+   while (True) {
+
+      if (s->state == BZ_S_OUTPUT) {
+         progress_out |= copy_output_until_stop ( s );
+         if (s->state_out_pos < s->numZ) break;
+         if (s->mode == BZ_M_FINISHING && 
+             s->avail_in_expect == 0 &&
+             isempty_RL(s)) break;
+         prepare_new_block ( s );
+         s->state = BZ_S_INPUT;
+         if (s->mode == BZ_M_FLUSHING && 
+             s->avail_in_expect == 0 &&
+             isempty_RL(s)) break;
+      }
+
+      if (s->state == BZ_S_INPUT) {
+         progress_in |= copy_input_until_stop ( s );
+         if (s->mode != BZ_M_RUNNING && s->avail_in_expect == 0) {
+            flush_RL ( s );
+            BZ2_compressBlock ( s, (Bool)(s->mode == BZ_M_FINISHING) );
+            s->state = BZ_S_OUTPUT;
+         }
+         else
+         if (s->nblock >= s->nblockMAX) {
+            BZ2_compressBlock ( s, False );
+            s->state = BZ_S_OUTPUT;
+         }
+         else
+         if (s->strm->avail_in == 0) {
+            break;
+         }
+      }
+
+   }
+
+   return progress_in || progress_out;
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzCompress) ( bz_stream *strm, int action )
+{
+   Bool progress;
+   EState* s;
+   if (strm == NULL) return BZ_PARAM_ERROR;
+   s = strm->state;
+   if (s == NULL) return BZ_PARAM_ERROR;
+   if (s->strm != strm) return BZ_PARAM_ERROR;
+
+   preswitch:
+   switch (s->mode) {
+
+      case BZ_M_IDLE:
+         return BZ_SEQUENCE_ERROR;
+
+      case BZ_M_RUNNING:
+         if (action == BZ_RUN) {
+            progress = handle_compress ( strm );
+            return progress ? BZ_RUN_OK : BZ_PARAM_ERROR;
+         } 
+         else
+	 if (action == BZ_FLUSH) {
+            s->avail_in_expect = strm->avail_in;
+            s->mode = BZ_M_FLUSHING;
+            goto preswitch;
+         }
+         else
+         if (action == BZ_FINISH) {
+            s->avail_in_expect = strm->avail_in;
+            s->mode = BZ_M_FINISHING;
+            goto preswitch;
+         }
+         else 
+            return BZ_PARAM_ERROR;
+
+      case BZ_M_FLUSHING:
+         if (action != BZ_FLUSH) return BZ_SEQUENCE_ERROR;
+         if (s->avail_in_expect != s->strm->avail_in) 
+            return BZ_SEQUENCE_ERROR;
+         progress = handle_compress ( strm );
+         if (s->avail_in_expect > 0 || !isempty_RL(s) ||
+             s->state_out_pos < s->numZ) return BZ_FLUSH_OK;
+         s->mode = BZ_M_RUNNING;
+         return BZ_RUN_OK;
+
+      case BZ_M_FINISHING:
+         if (action != BZ_FINISH) return BZ_SEQUENCE_ERROR;
+         if (s->avail_in_expect != s->strm->avail_in) 
+            return BZ_SEQUENCE_ERROR;
+         progress = handle_compress ( strm );
+         if (!progress) return BZ_SEQUENCE_ERROR;
+         if (s->avail_in_expect > 0 || !isempty_RL(s) ||
+             s->state_out_pos < s->numZ) return BZ_FINISH_OK;
+         s->mode = BZ_M_IDLE;
+         return BZ_STREAM_END;
+   }
+   return BZ_OK; /*--not reached--*/
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzCompressEnd)  ( bz_stream *strm )
+{
+   EState* s;
+   if (strm == NULL) return BZ_PARAM_ERROR;
+   s = strm->state;
+   if (s == NULL) return BZ_PARAM_ERROR;
+   if (s->strm != strm) return BZ_PARAM_ERROR;
+
+   if (s->arr1 != NULL) BZFREE(s->arr1);
+   if (s->arr2 != NULL) BZFREE(s->arr2);
+   if (s->ftab != NULL) BZFREE(s->ftab);
+   BZFREE(strm->state);
+
+   strm->state = NULL;   
+
+   return BZ_OK;
+}
+
+
+/*---------------------------------------------------*/
+/*--- Decompression stuff                         ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzDecompressInit) 
+                     ( bz_stream* strm, 
+                       int        verbosity,
+                       int        small )
+{
+   DState* s;
+
+   if (!bz_config_ok()) return BZ_CONFIG_ERROR;
+
+   if (strm == NULL) return BZ_PARAM_ERROR;
+   if (small != 0 && small != 1) return BZ_PARAM_ERROR;
+   if (verbosity < 0 || verbosity > 4) return BZ_PARAM_ERROR;
+
+   if (strm->bzalloc == NULL) strm->bzalloc = default_bzalloc;
+   if (strm->bzfree == NULL) strm->bzfree = default_bzfree;
+
+   s = BZALLOC( sizeof(DState) );
+   if (s == NULL) return BZ_MEM_ERROR;
+   s->strm                  = strm;
+   strm->state              = s;
+   s->state                 = BZ_X_MAGIC_1;
+   s->bsLive                = 0;
+   s->bsBuff                = 0;
+   s->calculatedCombinedCRC = 0;
+   strm->total_in_lo32      = 0;
+   strm->total_in_hi32      = 0;
+   strm->total_out_lo32     = 0;
+   strm->total_out_hi32     = 0;
+   s->smallDecompress       = (Bool)small;
+   s->ll4                   = NULL;
+   s->ll16                  = NULL;
+   s->tt                    = NULL;
+   s->currBlockNo           = 0;
+   s->verbosity             = verbosity;
+
+   return BZ_OK;
+}
+
+
+/*---------------------------------------------------*/
+static
+void unRLE_obuf_to_output_FAST ( DState* s )
+{
+   UChar k1;
+
+   if (s->blockRandomised) {
+
+      while (True) {
+         /* try to finish existing run */
+         while (True) {
+            if (s->strm->avail_out == 0) return;
+            if (s->state_out_len == 0) break;
+            *( (UChar*)(s->strm->next_out) ) = s->state_out_ch;
+            BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch );
+            s->state_out_len--;
+            s->strm->next_out++;
+            s->strm->avail_out--;
+            s->strm->total_out_lo32++;
+            if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++;
+         }
+   
+         /* can a new run be started? */
+         if (s->nblock_used == s->save_nblock+1) return;
+               
+   
+         s->state_out_len = 1;
+         s->state_out_ch = s->k0;
+         BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; 
+         k1 ^= BZ_RAND_MASK; s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         s->state_out_len = 2;
+         BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; 
+         k1 ^= BZ_RAND_MASK; s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         s->state_out_len = 3;
+         BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; 
+         k1 ^= BZ_RAND_MASK; s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         BZ_GET_FAST(k1); BZ_RAND_UPD_MASK; 
+         k1 ^= BZ_RAND_MASK; s->nblock_used++;
+         s->state_out_len = ((Int32)k1) + 4;
+         BZ_GET_FAST(s->k0); BZ_RAND_UPD_MASK; 
+         s->k0 ^= BZ_RAND_MASK; s->nblock_used++;
+      }
+
+   } else {
+
+      /* restore */
+      UInt32        c_calculatedBlockCRC = s->calculatedBlockCRC;
+      UChar         c_state_out_ch       = s->state_out_ch;
+      Int32         c_state_out_len      = s->state_out_len;
+      Int32         c_nblock_used        = s->nblock_used;
+      Int32         c_k0                 = s->k0;
+      UInt32*       c_tt                 = s->tt;
+      UInt32        c_tPos               = s->tPos;
+      char*         cs_next_out          = s->strm->next_out;
+      unsigned int  cs_avail_out         = s->strm->avail_out;
+      /* end restore */
+
+      UInt32       avail_out_INIT = cs_avail_out;
+      Int32        s_save_nblockPP = s->save_nblock+1;
+      unsigned int total_out_lo32_old;
+
+      while (True) {
+
+         /* try to finish existing run */
+         if (c_state_out_len > 0) {
+            while (True) {
+               if (cs_avail_out == 0) goto return_notr;
+               if (c_state_out_len == 1) break;
+               *( (UChar*)(cs_next_out) ) = c_state_out_ch;
+               BZ_UPDATE_CRC ( c_calculatedBlockCRC, c_state_out_ch );
+               c_state_out_len--;
+               cs_next_out++;
+               cs_avail_out--;
+            }
+            s_state_out_len_eq_one:
+            {
+               if (cs_avail_out == 0) { 
+                  c_state_out_len = 1; goto return_notr;
+               };
+               *( (UChar*)(cs_next_out) ) = c_state_out_ch;
+               BZ_UPDATE_CRC ( c_calculatedBlockCRC, c_state_out_ch );
+               cs_next_out++;
+               cs_avail_out--;
+            }
+         }   
+         /* can a new run be started? */
+         if (c_nblock_used == s_save_nblockPP) {
+            c_state_out_len = 0; goto return_notr;
+         };   
+         c_state_out_ch = c_k0;
+         BZ_GET_FAST_C(k1); c_nblock_used++;
+         if (k1 != c_k0) { 
+            c_k0 = k1; goto s_state_out_len_eq_one; 
+         };
+         if (c_nblock_used == s_save_nblockPP) 
+            goto s_state_out_len_eq_one;
+   
+         c_state_out_len = 2;
+         BZ_GET_FAST_C(k1); c_nblock_used++;
+         if (c_nblock_used == s_save_nblockPP) continue;
+         if (k1 != c_k0) { c_k0 = k1; continue; };
+   
+         c_state_out_len = 3;
+         BZ_GET_FAST_C(k1); c_nblock_used++;
+         if (c_nblock_used == s_save_nblockPP) continue;
+         if (k1 != c_k0) { c_k0 = k1; continue; };
+   
+         BZ_GET_FAST_C(k1); c_nblock_used++;
+         c_state_out_len = ((Int32)k1) + 4;
+         BZ_GET_FAST_C(c_k0); c_nblock_used++;
+      }
+
+      return_notr:
+      total_out_lo32_old = s->strm->total_out_lo32;
+      s->strm->total_out_lo32 += (avail_out_INIT - cs_avail_out);
+      if (s->strm->total_out_lo32 < total_out_lo32_old)
+         s->strm->total_out_hi32++;
+
+      /* save */
+      s->calculatedBlockCRC = c_calculatedBlockCRC;
+      s->state_out_ch       = c_state_out_ch;
+      s->state_out_len      = c_state_out_len;
+      s->nblock_used        = c_nblock_used;
+      s->k0                 = c_k0;
+      s->tt                 = c_tt;
+      s->tPos               = c_tPos;
+      s->strm->next_out     = cs_next_out;
+      s->strm->avail_out    = cs_avail_out;
+      /* end save */
+   }
+}
+
+
+
+/*---------------------------------------------------*/
+__inline__ Int32 BZ2_indexIntoF ( Int32 indx, Int32 *cftab )
+{
+   Int32 nb, na, mid;
+   nb = 0;
+   na = 256;
+   do {
+      mid = (nb + na) >> 1;
+      if (indx >= cftab[mid]) nb = mid; else na = mid;
+   }
+   while (na - nb != 1);
+   return nb;
+}
+
+
+/*---------------------------------------------------*/
+static
+void unRLE_obuf_to_output_SMALL ( DState* s )
+{
+   UChar k1;
+
+   if (s->blockRandomised) {
+
+      while (True) {
+         /* try to finish existing run */
+         while (True) {
+            if (s->strm->avail_out == 0) return;
+            if (s->state_out_len == 0) break;
+            *( (UChar*)(s->strm->next_out) ) = s->state_out_ch;
+            BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch );
+            s->state_out_len--;
+            s->strm->next_out++;
+            s->strm->avail_out--;
+            s->strm->total_out_lo32++;
+            if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++;
+         }
+   
+         /* can a new run be started? */
+         if (s->nblock_used == s->save_nblock+1) return;
+               
+   
+         s->state_out_len = 1;
+         s->state_out_ch = s->k0;
+         BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; 
+         k1 ^= BZ_RAND_MASK; s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         s->state_out_len = 2;
+         BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; 
+         k1 ^= BZ_RAND_MASK; s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         s->state_out_len = 3;
+         BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; 
+         k1 ^= BZ_RAND_MASK; s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         BZ_GET_SMALL(k1); BZ_RAND_UPD_MASK; 
+         k1 ^= BZ_RAND_MASK; s->nblock_used++;
+         s->state_out_len = ((Int32)k1) + 4;
+         BZ_GET_SMALL(s->k0); BZ_RAND_UPD_MASK; 
+         s->k0 ^= BZ_RAND_MASK; s->nblock_used++;
+      }
+
+   } else {
+
+      while (True) {
+         /* try to finish existing run */
+         while (True) {
+            if (s->strm->avail_out == 0) return;
+            if (s->state_out_len == 0) break;
+            *( (UChar*)(s->strm->next_out) ) = s->state_out_ch;
+            BZ_UPDATE_CRC ( s->calculatedBlockCRC, s->state_out_ch );
+            s->state_out_len--;
+            s->strm->next_out++;
+            s->strm->avail_out--;
+            s->strm->total_out_lo32++;
+            if (s->strm->total_out_lo32 == 0) s->strm->total_out_hi32++;
+         }
+   
+         /* can a new run be started? */
+         if (s->nblock_used == s->save_nblock+1) return;
+   
+         s->state_out_len = 1;
+         s->state_out_ch = s->k0;
+         BZ_GET_SMALL(k1); s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         s->state_out_len = 2;
+         BZ_GET_SMALL(k1); s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         s->state_out_len = 3;
+         BZ_GET_SMALL(k1); s->nblock_used++;
+         if (s->nblock_used == s->save_nblock+1) continue;
+         if (k1 != s->k0) { s->k0 = k1; continue; };
+   
+         BZ_GET_SMALL(k1); s->nblock_used++;
+         s->state_out_len = ((Int32)k1) + 4;
+         BZ_GET_SMALL(s->k0); s->nblock_used++;
+      }
+
+   }
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzDecompress) ( bz_stream *strm )
+{
+   DState* s;
+   if (strm == NULL) return BZ_PARAM_ERROR;
+   s = strm->state;
+   if (s == NULL) return BZ_PARAM_ERROR;
+   if (s->strm != strm) return BZ_PARAM_ERROR;
+
+   while (True) {
+      if (s->state == BZ_X_IDLE) return BZ_SEQUENCE_ERROR;
+      if (s->state == BZ_X_OUTPUT) {
+         if (s->smallDecompress)
+            unRLE_obuf_to_output_SMALL ( s ); else
+            unRLE_obuf_to_output_FAST  ( s );
+         if (s->nblock_used == s->save_nblock+1 && s->state_out_len == 0) {
+            BZ_FINALISE_CRC ( s->calculatedBlockCRC );
+            if (s->verbosity >= 3) 
+               VPrintf2 ( " {0x%x, 0x%x}", s->storedBlockCRC, 
+                          s->calculatedBlockCRC );
+            if (s->verbosity >= 2) VPrintf0 ( "]" );
+            if (s->calculatedBlockCRC != s->storedBlockCRC)
+               return BZ_DATA_ERROR;
+            s->calculatedCombinedCRC 
+               = (s->calculatedCombinedCRC << 1) | 
+                    (s->calculatedCombinedCRC >> 31);
+            s->calculatedCombinedCRC ^= s->calculatedBlockCRC;
+            s->state = BZ_X_BLKHDR_1;
+         } else {
+            return BZ_OK;
+         }
+      }
+      if (s->state >= BZ_X_MAGIC_1) {
+         Int32 r = BZ2_decompress ( s );
+         if (r == BZ_STREAM_END) {
+            if (s->verbosity >= 3)
+               VPrintf2 ( "\n    combined CRCs: stored = 0x%x, computed = 0x%x", 
+                          s->storedCombinedCRC, s->calculatedCombinedCRC );
+            if (s->calculatedCombinedCRC != s->storedCombinedCRC)
+               return BZ_DATA_ERROR;
+            return r;
+         }
+         if (s->state != BZ_X_OUTPUT) return r;
+      }
+   }
+
+   AssertH ( 0, 6001 );
+
+   return 0;  /*NOTREACHED*/
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzDecompressEnd)  ( bz_stream *strm )
+{
+   DState* s;
+   if (strm == NULL) return BZ_PARAM_ERROR;
+   s = strm->state;
+   if (s == NULL) return BZ_PARAM_ERROR;
+   if (s->strm != strm) return BZ_PARAM_ERROR;
+
+   if (s->tt   != NULL) BZFREE(s->tt);
+   if (s->ll16 != NULL) BZFREE(s->ll16);
+   if (s->ll4  != NULL) BZFREE(s->ll4);
+
+   BZFREE(strm->state);
+   strm->state = NULL;
+
+   return BZ_OK;
+}
+
+
+#ifndef BZ_NO_STDIO
+/*---------------------------------------------------*/
+/*--- File I/O stuff                              ---*/
+/*---------------------------------------------------*/
+
+#define BZ_SETERR(eee)                    \
+{                                         \
+   if (bzerror != NULL) *bzerror = eee;   \
+   if (bzf != NULL) bzf->lastErr = eee;   \
+}
+
+typedef 
+   struct {
+      FILE*     handle;
+      Char      buf[BZ_MAX_UNUSED];
+      Int32     bufN;
+      Bool      writing;
+      bz_stream strm;
+      Int32     lastErr;
+      Bool      initialisedOk;
+   }
+   bzFile;
+
+
+/*---------------------------------------------*/
+static Bool myfeof ( FILE* f )
+{
+   Int32 c = fgetc ( f );
+   if (c == EOF) return True;
+   ungetc ( c, f );
+   return False;
+}
+
+
+/*---------------------------------------------------*/
+BZFILE* BZ_API(BZ2_bzWriteOpen) 
+                    ( int*  bzerror,      
+                      FILE* f, 
+                      int   blockSize100k, 
+                      int   verbosity,
+                      int   workFactor )
+{
+   Int32   ret;
+   bzFile* bzf = NULL;
+
+   BZ_SETERR(BZ_OK);
+
+   if (f == NULL ||
+       (blockSize100k < 1 || blockSize100k > 9) ||
+       (workFactor < 0 || workFactor > 250) ||
+       (verbosity < 0 || verbosity > 4))
+      { BZ_SETERR(BZ_PARAM_ERROR); return NULL; };
+
+   if (ferror(f))
+      { BZ_SETERR(BZ_IO_ERROR); return NULL; };
+
+   bzf = malloc ( sizeof(bzFile) );
+   if (bzf == NULL)
+      { BZ_SETERR(BZ_MEM_ERROR); return NULL; };
+
+   BZ_SETERR(BZ_OK);
+   bzf->initialisedOk = False;
+   bzf->bufN          = 0;
+   bzf->handle        = f;
+   bzf->writing       = True;
+   bzf->strm.bzalloc  = NULL;
+   bzf->strm.bzfree   = NULL;
+   bzf->strm.opaque   = NULL;
+
+   if (workFactor == 0) workFactor = 30;
+   ret = BZ2_bzCompressInit ( &(bzf->strm), blockSize100k, 
+                              verbosity, workFactor );
+   if (ret != BZ_OK)
+      { BZ_SETERR(ret); free(bzf); return NULL; };
+
+   bzf->strm.avail_in = 0;
+   bzf->initialisedOk = True;
+   return bzf;   
+}
+
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzWrite)
+             ( int*    bzerror, 
+               BZFILE* b, 
+               void*   buf, 
+               int     len )
+{
+   Int32 n, n2, ret;
+   bzFile* bzf = (bzFile*)b;
+
+   BZ_SETERR(BZ_OK);
+   if (bzf == NULL || buf == NULL || len < 0)
+      { BZ_SETERR(BZ_PARAM_ERROR); return; };
+   if (!(bzf->writing))
+      { BZ_SETERR(BZ_SEQUENCE_ERROR); return; };
+   if (ferror(bzf->handle))
+      { BZ_SETERR(BZ_IO_ERROR); return; };
+
+   if (len == 0)
+      { BZ_SETERR(BZ_OK); return; };
+
+   bzf->strm.avail_in = len;
+   bzf->strm.next_in  = buf;
+
+   while (True) {
+      bzf->strm.avail_out = BZ_MAX_UNUSED;
+      bzf->strm.next_out = bzf->buf;
+      ret = BZ2_bzCompress ( &(bzf->strm), BZ_RUN );
+      if (ret != BZ_RUN_OK)
+         { BZ_SETERR(ret); return; };
+
+      if (bzf->strm.avail_out < BZ_MAX_UNUSED) {
+         n = BZ_MAX_UNUSED - bzf->strm.avail_out;
+         n2 = fwrite ( (void*)(bzf->buf), sizeof(UChar), 
+                       n, bzf->handle );
+         if (n != n2 || ferror(bzf->handle))
+            { BZ_SETERR(BZ_IO_ERROR); return; };
+      }
+
+      if (bzf->strm.avail_in == 0)
+         { BZ_SETERR(BZ_OK); return; };
+   }
+}
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzWriteClose)
+                  ( int*          bzerror, 
+                    BZFILE*       b, 
+                    int           abandon,
+                    unsigned int* nbytes_in,
+                    unsigned int* nbytes_out )
+{
+   BZ2_bzWriteClose64 ( bzerror, b, abandon, 
+                        nbytes_in, NULL, nbytes_out, NULL );
+}
+
+
+void BZ_API(BZ2_bzWriteClose64)
+                  ( int*          bzerror, 
+                    BZFILE*       b, 
+                    int           abandon,
+                    unsigned int* nbytes_in_lo32,
+                    unsigned int* nbytes_in_hi32,
+                    unsigned int* nbytes_out_lo32,
+                    unsigned int* nbytes_out_hi32 )
+{
+   Int32   n, n2, ret;
+   bzFile* bzf = (bzFile*)b;
+
+   if (bzf == NULL)
+      { BZ_SETERR(BZ_OK); return; };
+   if (!(bzf->writing))
+      { BZ_SETERR(BZ_SEQUENCE_ERROR); return; };
+   if (ferror(bzf->handle))
+      { BZ_SETERR(BZ_IO_ERROR); return; };
+
+   if (nbytes_in_lo32 != NULL) *nbytes_in_lo32 = 0;
+   if (nbytes_in_hi32 != NULL) *nbytes_in_hi32 = 0;
+   if (nbytes_out_lo32 != NULL) *nbytes_out_lo32 = 0;
+   if (nbytes_out_hi32 != NULL) *nbytes_out_hi32 = 0;
+
+   if ((!abandon) && bzf->lastErr == BZ_OK) {
+      while (True) {
+         bzf->strm.avail_out = BZ_MAX_UNUSED;
+         bzf->strm.next_out = bzf->buf;
+         ret = BZ2_bzCompress ( &(bzf->strm), BZ_FINISH );
+         if (ret != BZ_FINISH_OK && ret != BZ_STREAM_END)
+            { BZ_SETERR(ret); return; };
+
+         if (bzf->strm.avail_out < BZ_MAX_UNUSED) {
+            n = BZ_MAX_UNUSED - bzf->strm.avail_out;
+            n2 = fwrite ( (void*)(bzf->buf), sizeof(UChar), 
+                          n, bzf->handle );
+            if (n != n2 || ferror(bzf->handle))
+               { BZ_SETERR(BZ_IO_ERROR); return; };
+         }
+
+         if (ret == BZ_STREAM_END) break;
+      }
+   }
+
+   if ( !abandon && !ferror ( bzf->handle ) ) {
+      fflush ( bzf->handle );
+      if (ferror(bzf->handle))
+         { BZ_SETERR(BZ_IO_ERROR); return; };
+   }
+
+   if (nbytes_in_lo32 != NULL)
+      *nbytes_in_lo32 = bzf->strm.total_in_lo32;
+   if (nbytes_in_hi32 != NULL)
+      *nbytes_in_hi32 = bzf->strm.total_in_hi32;
+   if (nbytes_out_lo32 != NULL)
+      *nbytes_out_lo32 = bzf->strm.total_out_lo32;
+   if (nbytes_out_hi32 != NULL)
+      *nbytes_out_hi32 = bzf->strm.total_out_hi32;
+
+   BZ_SETERR(BZ_OK);
+   BZ2_bzCompressEnd ( &(bzf->strm) );
+   free ( bzf );
+}
+
+
+/*---------------------------------------------------*/
+BZFILE* BZ_API(BZ2_bzReadOpen) 
+                   ( int*  bzerror, 
+                     FILE* f, 
+                     int   verbosity,
+                     int   small,
+                     void* unused,
+                     int   nUnused )
+{
+   bzFile* bzf = NULL;
+   int     ret;
+
+   BZ_SETERR(BZ_OK);
+
+   if (f == NULL || 
+       (small != 0 && small != 1) ||
+       (verbosity < 0 || verbosity > 4) ||
+       (unused == NULL && nUnused != 0) ||
+       (unused != NULL && (nUnused < 0 || nUnused > BZ_MAX_UNUSED)))
+      { BZ_SETERR(BZ_PARAM_ERROR); return NULL; };
+
+   if (ferror(f))
+      { BZ_SETERR(BZ_IO_ERROR); return NULL; };
+
+   bzf = malloc ( sizeof(bzFile) );
+   if (bzf == NULL) 
+      { BZ_SETERR(BZ_MEM_ERROR); return NULL; };
+
+   BZ_SETERR(BZ_OK);
+
+   bzf->initialisedOk = False;
+   bzf->handle        = f;
+   bzf->bufN          = 0;
+   bzf->writing       = False;
+   bzf->strm.bzalloc  = NULL;
+   bzf->strm.bzfree   = NULL;
+   bzf->strm.opaque   = NULL;
+   
+   while (nUnused > 0) {
+      bzf->buf[bzf->bufN] = *((UChar*)(unused)); bzf->bufN++;
+      unused = ((void*)( 1 + ((UChar*)(unused))  ));
+      nUnused--;
+   }
+
+   ret = BZ2_bzDecompressInit ( &(bzf->strm), verbosity, small );
+   if (ret != BZ_OK)
+      { BZ_SETERR(ret); free(bzf); return NULL; };
+
+   bzf->strm.avail_in = bzf->bufN;
+   bzf->strm.next_in  = bzf->buf;
+
+   bzf->initialisedOk = True;
+   return bzf;   
+}
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzReadClose) ( int *bzerror, BZFILE *b )
+{
+   bzFile* bzf = (bzFile*)b;
+
+   BZ_SETERR(BZ_OK);
+   if (bzf == NULL)
+      { BZ_SETERR(BZ_OK); return; };
+
+   if (bzf->writing)
+      { BZ_SETERR(BZ_SEQUENCE_ERROR); return; };
+
+   if (bzf->initialisedOk)
+      (void)BZ2_bzDecompressEnd ( &(bzf->strm) );
+   free ( bzf );
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzRead) 
+           ( int*    bzerror, 
+             BZFILE* b, 
+             void*   buf, 
+             int     len )
+{
+   Int32   n, ret;
+   bzFile* bzf = (bzFile*)b;
+
+   BZ_SETERR(BZ_OK);
+
+   if (bzf == NULL || buf == NULL || len < 0)
+      { BZ_SETERR(BZ_PARAM_ERROR); return 0; };
+
+   if (bzf->writing)
+      { BZ_SETERR(BZ_SEQUENCE_ERROR); return 0; };
+
+   if (len == 0)
+      { BZ_SETERR(BZ_OK); return 0; };
+
+   bzf->strm.avail_out = len;
+   bzf->strm.next_out = buf;
+
+   while (True) {
+
+      if (ferror(bzf->handle)) 
+         { BZ_SETERR(BZ_IO_ERROR); return 0; };
+
+      if (bzf->strm.avail_in == 0 && !myfeof(bzf->handle)) {
+         n = fread ( bzf->buf, sizeof(UChar), 
+                     BZ_MAX_UNUSED, bzf->handle );
+         if (ferror(bzf->handle))
+            { BZ_SETERR(BZ_IO_ERROR); return 0; };
+         bzf->bufN = n;
+         bzf->strm.avail_in = bzf->bufN;
+         bzf->strm.next_in = bzf->buf;
+      }
+
+      ret = BZ2_bzDecompress ( &(bzf->strm) );
+
+      if (ret != BZ_OK && ret != BZ_STREAM_END)
+         { BZ_SETERR(ret); return 0; };
+
+      if (ret == BZ_OK && myfeof(bzf->handle) && 
+          bzf->strm.avail_in == 0 && bzf->strm.avail_out > 0)
+         { BZ_SETERR(BZ_UNEXPECTED_EOF); return 0; };
+
+      if (ret == BZ_STREAM_END)
+         { BZ_SETERR(BZ_STREAM_END);
+           return len - bzf->strm.avail_out; };
+      if (bzf->strm.avail_out == 0)
+         { BZ_SETERR(BZ_OK); return len; };
+      
+   }
+
+   return 0; /*not reached*/
+}
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzReadGetUnused) 
+                     ( int*    bzerror, 
+                       BZFILE* b, 
+                       void**  unused, 
+                       int*    nUnused )
+{
+   bzFile* bzf = (bzFile*)b;
+   if (bzf == NULL)
+      { BZ_SETERR(BZ_PARAM_ERROR); return; };
+   if (bzf->lastErr != BZ_STREAM_END)
+      { BZ_SETERR(BZ_SEQUENCE_ERROR); return; };
+   if (unused == NULL || nUnused == NULL)
+      { BZ_SETERR(BZ_PARAM_ERROR); return; };
+
+   BZ_SETERR(BZ_OK);
+   *nUnused = bzf->strm.avail_in;
+   *unused = bzf->strm.next_in;
+}
+#endif
+
+
+/*---------------------------------------------------*/
+/*--- Misc convenience stuff                      ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzBuffToBuffCompress) 
+                         ( char*         dest, 
+                           unsigned int* destLen,
+                           char*         source, 
+                           unsigned int  sourceLen,
+                           int           blockSize100k, 
+                           int           verbosity, 
+                           int           workFactor )
+{
+   bz_stream strm;
+   int ret;
+
+   if (dest == NULL || destLen == NULL || 
+       source == NULL ||
+       blockSize100k < 1 || blockSize100k > 9 ||
+       verbosity < 0 || verbosity > 4 ||
+       workFactor < 0 || workFactor > 250) 
+      return BZ_PARAM_ERROR;
+
+   if (workFactor == 0) workFactor = 30;
+   strm.bzalloc = NULL;
+   strm.bzfree = NULL;
+   strm.opaque = NULL;
+   ret = BZ2_bzCompressInit ( &strm, blockSize100k, 
+                              verbosity, workFactor );
+   if (ret != BZ_OK) return ret;
+
+   strm.next_in = source;
+   strm.next_out = dest;
+   strm.avail_in = sourceLen;
+   strm.avail_out = *destLen;
+
+   ret = BZ2_bzCompress ( &strm, BZ_FINISH );
+   if (ret == BZ_FINISH_OK) goto output_overflow;
+   if (ret != BZ_STREAM_END) goto errhandler;
+
+   /* normal termination */
+   *destLen -= strm.avail_out;   
+   BZ2_bzCompressEnd ( &strm );
+   return BZ_OK;
+
+   output_overflow:
+   BZ2_bzCompressEnd ( &strm );
+   return BZ_OUTBUFF_FULL;
+
+   errhandler:
+   BZ2_bzCompressEnd ( &strm );
+   return ret;
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzBuffToBuffDecompress) 
+                           ( char*         dest, 
+                             unsigned int* destLen,
+                             char*         source, 
+                             unsigned int  sourceLen,
+                             int           small,
+                             int           verbosity )
+{
+   bz_stream strm;
+   int ret;
+
+   if (dest == NULL || destLen == NULL || 
+       source == NULL ||
+       (small != 0 && small != 1) ||
+       verbosity < 0 || verbosity > 4) 
+          return BZ_PARAM_ERROR;
+
+   strm.bzalloc = NULL;
+   strm.bzfree = NULL;
+   strm.opaque = NULL;
+   ret = BZ2_bzDecompressInit ( &strm, verbosity, small );
+   if (ret != BZ_OK) return ret;
+
+   strm.next_in = source;
+   strm.next_out = dest;
+   strm.avail_in = sourceLen;
+   strm.avail_out = *destLen;
+
+   ret = BZ2_bzDecompress ( &strm );
+   if (ret == BZ_OK) goto output_overflow_or_eof;
+   if (ret != BZ_STREAM_END) goto errhandler;
+
+   /* normal termination */
+   *destLen -= strm.avail_out;
+   BZ2_bzDecompressEnd ( &strm );
+   return BZ_OK;
+
+   output_overflow_or_eof:
+   if (strm.avail_out > 0) {
+      BZ2_bzDecompressEnd ( &strm );
+      return BZ_UNEXPECTED_EOF;
+   } else {
+      BZ2_bzDecompressEnd ( &strm );
+      return BZ_OUTBUFF_FULL;
+   };      
+
+   errhandler:
+   BZ2_bzDecompressEnd ( &strm );
+   return ret; 
+}
+
+
+/*---------------------------------------------------*/
+/*--
+   Code contributed by Yoshioka Tsuneo
+   (QWF00133@niftyserve.or.jp/tsuneo-y@is.aist-nara.ac.jp),
+   to support better zlib compatibility.
+   This code is not _officially_ part of libbzip2 (yet);
+   I haven't tested it, documented it, or considered the
+   threading-safeness of it.
+   If this code breaks, please contact both Yoshioka and me.
+--*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+/*--
+   return version like "0.9.0c".
+--*/
+const char * BZ_API(BZ2_bzlibVersion)(void)
+{
+   return BZ_VERSION;
+}
+
+
+#ifndef BZ_NO_STDIO
+/*---------------------------------------------------*/
+
+#if defined(_WIN32) || defined(OS2) || defined(MSDOS)
+#   include <fcntl.h>
+#   include <io.h>
+#   define SET_BINARY_MODE(file) setmode(fileno(file),O_BINARY)
+#else
+#   define SET_BINARY_MODE(file)
+#endif
+static
+BZFILE * bzopen_or_bzdopen
+               ( const char *path,   /* no use when bzdopen */
+                 int fd,             /* no use when bzdopen */
+                 const char *mode,
+                 int open_mode)      /* bzopen: 0, bzdopen:1 */
+{
+   int    bzerr;
+   char   unused[BZ_MAX_UNUSED];
+   int    blockSize100k = 9;
+   int    writing       = 0;
+   char   mode2[10]     = "";
+   FILE   *fp           = NULL;
+   BZFILE *bzfp         = NULL;
+   int    verbosity     = 0;
+   int    workFactor    = 30;
+   int    smallMode     = 0;
+   int    nUnused       = 0; 
+
+   if (mode == NULL) return NULL;
+   while (*mode) {
+      switch (*mode) {
+      case 'r':
+         writing = 0; break;
+      case 'w':
+         writing = 1; break;
+      case 's':
+         smallMode = 1; break;
+      default:
+         if (isdigit((int)(*mode))) {
+            blockSize100k = *mode-'0';
+         }
+      }
+      mode++;
+   }
+   strcat(mode2, writing ? "w" : "r" );
+   strcat(mode2,"b");   /* binary mode */
+
+   if (open_mode==0) {
+      if (path==NULL || strcmp(path,"")==0) {
+        fp = (writing ? stdout : stdin);
+        SET_BINARY_MODE(fp);
+      } else {
+        fp = fopen(path,mode2);
+      }
+   } else {
+#ifdef BZ_STRICT_ANSI
+      fp = NULL;
+#else
+      fp = fdopen(fd,mode2);
+#endif
+   }
+   if (fp == NULL) return NULL;
+
+   if (writing) {
+      /* Guard against total chaos and anarchy -- JRS */
+      if (blockSize100k < 1) blockSize100k = 1;
+      if (blockSize100k > 9) blockSize100k = 9; 
+      bzfp = BZ2_bzWriteOpen(&bzerr,fp,blockSize100k,
+                             verbosity,workFactor);
+   } else {
+      bzfp = BZ2_bzReadOpen(&bzerr,fp,verbosity,smallMode,
+                            unused,nUnused);
+   }
+   if (bzfp == NULL) {
+      if (fp != stdin && fp != stdout) fclose(fp);
+      return NULL;
+   }
+   return bzfp;
+}
+
+
+/*---------------------------------------------------*/
+/*--
+   open file for read or write.
+      ex) bzopen("file","w9")
+      case path="" or NULL => use stdin or stdout.
+--*/
+BZFILE * BZ_API(BZ2_bzopen)
+               ( const char *path,
+                 const char *mode )
+{
+   return bzopen_or_bzdopen(path,-1,mode,/*bzopen*/0);
+}
+
+
+/*---------------------------------------------------*/
+BZFILE * BZ_API(BZ2_bzdopen)
+               ( int fd,
+                 const char *mode )
+{
+   return bzopen_or_bzdopen(NULL,fd,mode,/*bzdopen*/1);
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzread) (BZFILE* b, void* buf, int len )
+{
+   int bzerr, nread;
+   if (((bzFile*)b)->lastErr == BZ_STREAM_END) return 0;
+   nread = BZ2_bzRead(&bzerr,b,buf,len);
+   if (bzerr == BZ_OK || bzerr == BZ_STREAM_END) {
+      return nread;
+   } else {
+      return -1;
+   }
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzwrite) (BZFILE* b, void* buf, int len )
+{
+   int bzerr;
+
+   BZ2_bzWrite(&bzerr,b,buf,len);
+   if(bzerr == BZ_OK){
+      return len;
+   }else{
+      return -1;
+   }
+}
+
+
+/*---------------------------------------------------*/
+int BZ_API(BZ2_bzflush) (BZFILE *b)
+{
+   /* do nothing now... */
+   return 0;
+}
+
+
+/*---------------------------------------------------*/
+void BZ_API(BZ2_bzclose) (BZFILE* b)
+{
+   int bzerr;
+   FILE *fp = ((bzFile *)b)->handle;
+   
+   if (b==NULL) {return;}
+   if(((bzFile*)b)->writing){
+      BZ2_bzWriteClose(&bzerr,b,0,NULL,NULL);
+      if(bzerr != BZ_OK){
+         BZ2_bzWriteClose(NULL,b,1,NULL,NULL);
+      }
+   }else{
+      BZ2_bzReadClose(&bzerr,b);
+   }
+   if(fp!=stdin && fp!=stdout){
+      fclose(fp);
+   }
+}
+
+
+/*---------------------------------------------------*/
+/*--
+   return last error code 
+--*/
+static char *bzerrorstrings[] = {
+       "OK"
+      ,"SEQUENCE_ERROR"
+      ,"PARAM_ERROR"
+      ,"MEM_ERROR"
+      ,"DATA_ERROR"
+      ,"DATA_ERROR_MAGIC"
+      ,"IO_ERROR"
+      ,"UNEXPECTED_EOF"
+      ,"OUTBUFF_FULL"
+      ,"CONFIG_ERROR"
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+};
+
+
+const char * BZ_API(BZ2_bzerror) (BZFILE *b, int *errnum)
+{
+   int err = ((bzFile *)b)->lastErr;
+
+   if(err>0) err = 0;
+   *errnum = err;
+   return bzerrorstrings[err*-1];
+}
+#endif
+
+
+/*-------------------------------------------------------------*/
+/*--- end                                           bzlib.c ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/bzlib.h b/bzip2/bzlib.h
new file mode 100644
index 000000000..c9447a295
--- /dev/null
+++ b/bzip2/bzlib.h
@@ -0,0 +1,319 @@
+
+/*-------------------------------------------------------------*/
+/*--- Public header file for the library.                   ---*/
+/*---                                               bzlib.h ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+
+#ifndef _BZLIB_H
+#define _BZLIB_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#define BZ_RUN               0
+#define BZ_FLUSH             1
+#define BZ_FINISH            2
+
+#define BZ_OK                0
+#define BZ_RUN_OK            1
+#define BZ_FLUSH_OK          2
+#define BZ_FINISH_OK         3
+#define BZ_STREAM_END        4
+#define BZ_SEQUENCE_ERROR    (-1)
+#define BZ_PARAM_ERROR       (-2)
+#define BZ_MEM_ERROR         (-3)
+#define BZ_DATA_ERROR        (-4)
+#define BZ_DATA_ERROR_MAGIC  (-5)
+#define BZ_IO_ERROR          (-6)
+#define BZ_UNEXPECTED_EOF    (-7)
+#define BZ_OUTBUFF_FULL      (-8)
+#define BZ_CONFIG_ERROR      (-9)
+
+typedef 
+   struct {
+      char *next_in;
+      unsigned int avail_in;
+      unsigned int total_in_lo32;
+      unsigned int total_in_hi32;
+
+      char *next_out;
+      unsigned int avail_out;
+      unsigned int total_out_lo32;
+      unsigned int total_out_hi32;
+
+      void *state;
+
+      void *(*bzalloc)(void *,int,int);
+      void (*bzfree)(void *,void *);
+      void *opaque;
+   } 
+   bz_stream;
+
+
+#ifndef BZ_IMPORT
+#define BZ_EXPORT
+#endif
+
+#ifdef _WIN32
+#   include <stdio.h>
+#   include <windows.h>
+#   ifdef small
+      /* windows.h define small to char */
+#      undef small
+#   endif
+#   ifdef BZ_EXPORT
+#   define BZ_API(func) WINAPI func
+#   define BZ_EXTERN extern
+#   else
+   /* import windows dll dynamically */
+#   define BZ_API(func) (WINAPI * func)
+#   define BZ_EXTERN
+#   endif
+#else
+#   define BZ_API(func) func
+#   define BZ_EXTERN extern
+#endif
+
+
+/*-- Core (low-level) library functions --*/
+
+BZ_EXTERN int BZ_API(BZ2_bzCompressInit) ( 
+      bz_stream* strm, 
+      int        blockSize100k, 
+      int        verbosity, 
+      int        workFactor 
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzCompress) ( 
+      bz_stream* strm, 
+      int action 
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzCompressEnd) ( 
+      bz_stream* strm 
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzDecompressInit) ( 
+      bz_stream *strm, 
+      int       verbosity, 
+      int       small
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzDecompress) ( 
+      bz_stream* strm 
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzDecompressEnd) ( 
+      bz_stream *strm 
+   );
+
+
+
+/*-- High(er) level library functions --*/
+
+#ifndef BZ_NO_STDIO
+#define BZ_MAX_UNUSED 5000
+
+typedef void BZFILE;
+
+BZ_EXTERN BZFILE* BZ_API(BZ2_bzReadOpen) ( 
+      int*  bzerror,   
+      FILE* f, 
+      int   verbosity, 
+      int   small,
+      void* unused,    
+      int   nUnused 
+   );
+
+BZ_EXTERN void BZ_API(BZ2_bzReadClose) ( 
+      int*    bzerror, 
+      BZFILE* b 
+   );
+
+BZ_EXTERN void BZ_API(BZ2_bzReadGetUnused) ( 
+      int*    bzerror, 
+      BZFILE* b, 
+      void**  unused,  
+      int*    nUnused 
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzRead) ( 
+      int*    bzerror, 
+      BZFILE* b, 
+      void*   buf, 
+      int     len 
+   );
+
+BZ_EXTERN BZFILE* BZ_API(BZ2_bzWriteOpen) ( 
+      int*  bzerror,      
+      FILE* f, 
+      int   blockSize100k, 
+      int   verbosity, 
+      int   workFactor 
+   );
+
+BZ_EXTERN void BZ_API(BZ2_bzWrite) ( 
+      int*    bzerror, 
+      BZFILE* b, 
+      void*   buf, 
+      int     len 
+   );
+
+BZ_EXTERN void BZ_API(BZ2_bzWriteClose) ( 
+      int*          bzerror, 
+      BZFILE*       b, 
+      int           abandon, 
+      unsigned int* nbytes_in, 
+      unsigned int* nbytes_out 
+   );
+
+BZ_EXTERN void BZ_API(BZ2_bzWriteClose64) ( 
+      int*          bzerror, 
+      BZFILE*       b, 
+      int           abandon, 
+      unsigned int* nbytes_in_lo32, 
+      unsigned int* nbytes_in_hi32, 
+      unsigned int* nbytes_out_lo32, 
+      unsigned int* nbytes_out_hi32
+   );
+#endif
+
+
+/*-- Utility functions --*/
+
+BZ_EXTERN int BZ_API(BZ2_bzBuffToBuffCompress) ( 
+      char*         dest, 
+      unsigned int* destLen,
+      char*         source, 
+      unsigned int  sourceLen,
+      int           blockSize100k, 
+      int           verbosity, 
+      int           workFactor 
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzBuffToBuffDecompress) ( 
+      char*         dest, 
+      unsigned int* destLen,
+      char*         source, 
+      unsigned int  sourceLen,
+      int           small, 
+      int           verbosity 
+   );
+
+
+/*--
+   Code contributed by Yoshioka Tsuneo
+   (QWF00133@niftyserve.or.jp/tsuneo-y@is.aist-nara.ac.jp),
+   to support better zlib compatibility.
+   This code is not _officially_ part of libbzip2 (yet);
+   I haven't tested it, documented it, or considered the
+   threading-safeness of it.
+   If this code breaks, please contact both Yoshioka and me.
+--*/
+
+BZ_EXTERN const char * BZ_API(BZ2_bzlibVersion) (
+      void
+   );
+
+#ifndef BZ_NO_STDIO
+BZ_EXTERN BZFILE * BZ_API(BZ2_bzopen) (
+      const char *path,
+      const char *mode
+   );
+
+BZ_EXTERN BZFILE * BZ_API(BZ2_bzdopen) (
+      int        fd,
+      const char *mode
+   );
+         
+BZ_EXTERN int BZ_API(BZ2_bzread) (
+      BZFILE* b, 
+      void* buf, 
+      int len 
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzwrite) (
+      BZFILE* b, 
+      void*   buf, 
+      int     len 
+   );
+
+BZ_EXTERN int BZ_API(BZ2_bzflush) (
+      BZFILE* b
+   );
+
+BZ_EXTERN void BZ_API(BZ2_bzclose) (
+      BZFILE* b
+   );
+
+BZ_EXTERN const char * BZ_API(BZ2_bzerror) (
+      BZFILE *b, 
+      int    *errnum
+   );
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif
+
+/*-------------------------------------------------------------*/
+/*--- end                                           bzlib.h ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/bzlib_private.h b/bzip2/bzlib_private.h
new file mode 100644
index 000000000..fb51c7a1d
--- /dev/null
+++ b/bzip2/bzlib_private.h
@@ -0,0 +1,530 @@
+
+/*-------------------------------------------------------------*/
+/*--- Private header file for the library.                  ---*/
+/*---                                       bzlib_private.h ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+
+#ifndef _BZLIB_PRIVATE_H
+#define _BZLIB_PRIVATE_H
+
+#include <stdlib.h>
+
+#ifndef BZ_NO_STDIO
+#include <stdio.h>
+#include <ctype.h>
+#include <string.h>
+#endif
+
+#include "bzlib.h"
+
+
+
+/*-- General stuff. --*/
+
+#define BZ_VERSION  "1.0.1, 23-June-2000"
+
+typedef char            Char;
+typedef unsigned char   Bool;
+typedef unsigned char   UChar;
+typedef int             Int32;
+typedef unsigned int    UInt32;
+typedef short           Int16;
+typedef unsigned short  UInt16;
+
+#define True  ((Bool)1)
+#define False ((Bool)0)
+
+#ifndef __GNUC__
+#define __inline__  /* */
+#endif 
+
+#ifndef BZ_NO_STDIO
+extern void BZ2_bz__AssertH__fail ( int errcode );
+#define AssertH(cond,errcode) \
+   { if (!(cond)) BZ2_bz__AssertH__fail ( errcode ); }
+#if BZ_DEBUG
+#define AssertD(cond,msg) \
+   { if (!(cond)) {       \
+      fprintf ( stderr,   \
+        "\n\nlibbzip2(debug build): internal error\n\t%s\n", msg );\
+      exit(1); \
+   }}
+#else
+#define AssertD(cond,msg) /* */
+#endif
+#define VPrintf0(zf) \
+   fprintf(stderr,zf)
+#define VPrintf1(zf,za1) \
+   fprintf(stderr,zf,za1)
+#define VPrintf2(zf,za1,za2) \
+   fprintf(stderr,zf,za1,za2)
+#define VPrintf3(zf,za1,za2,za3) \
+   fprintf(stderr,zf,za1,za2,za3)
+#define VPrintf4(zf,za1,za2,za3,za4) \
+   fprintf(stderr,zf,za1,za2,za3,za4)
+#define VPrintf5(zf,za1,za2,za3,za4,za5) \
+   fprintf(stderr,zf,za1,za2,za3,za4,za5)
+#else
+extern void bz_internal_error ( int errcode );
+#define AssertH(cond,errcode) \
+   { if (!(cond)) bz_internal_error ( errcode ); }
+#define AssertD(cond,msg) /* */
+#define VPrintf0(zf) /* */
+#define VPrintf1(zf,za1) /* */
+#define VPrintf2(zf,za1,za2) /* */
+#define VPrintf3(zf,za1,za2,za3) /* */
+#define VPrintf4(zf,za1,za2,za3,za4) /* */
+#define VPrintf5(zf,za1,za2,za3,za4,za5) /* */
+#endif
+
+
+#define BZALLOC(nnn) (strm->bzalloc)(strm->opaque,(nnn),1)
+#define BZFREE(ppp)  (strm->bzfree)(strm->opaque,(ppp))
+
+
+/*-- Constants for the back end. --*/
+
+#define BZ_MAX_ALPHA_SIZE 258
+#define BZ_MAX_CODE_LEN    23
+
+#define BZ_RUNA 0
+#define BZ_RUNB 1
+
+#define BZ_N_GROUPS 6
+#define BZ_G_SIZE   50
+#define BZ_N_ITERS  4
+
+#define BZ_MAX_SELECTORS (2 + (900000 / BZ_G_SIZE))
+
+
+
+/*-- Stuff for randomising repetitive blocks. --*/
+
+extern Int32 BZ2_rNums[512];
+
+#define BZ_RAND_DECLS                          \
+   Int32 rNToGo;                               \
+   Int32 rTPos                                 \
+
+#define BZ_RAND_INIT_MASK                      \
+   s->rNToGo = 0;                              \
+   s->rTPos  = 0                               \
+
+#define BZ_RAND_MASK ((s->rNToGo == 1) ? 1 : 0)
+
+#define BZ_RAND_UPD_MASK                       \
+   if (s->rNToGo == 0) {                       \
+      s->rNToGo = BZ2_rNums[s->rTPos];         \
+      s->rTPos++;                              \
+      if (s->rTPos == 512) s->rTPos = 0;       \
+   }                                           \
+   s->rNToGo--;
+
+
+
+/*-- Stuff for doing CRCs. --*/
+
+extern UInt32 BZ2_crc32Table[256];
+
+#define BZ_INITIALISE_CRC(crcVar)              \
+{                                              \
+   crcVar = 0xffffffffL;                       \
+}
+
+#define BZ_FINALISE_CRC(crcVar)                \
+{                                              \
+   crcVar = ~(crcVar);                         \
+}
+
+#define BZ_UPDATE_CRC(crcVar,cha)              \
+{                                              \
+   crcVar = (crcVar << 8) ^                    \
+            BZ2_crc32Table[(crcVar >> 24) ^    \
+                           ((UChar)cha)];      \
+}
+
+
+
+/*-- States and modes for compression. --*/
+
+#define BZ_M_IDLE      1
+#define BZ_M_RUNNING   2
+#define BZ_M_FLUSHING  3
+#define BZ_M_FINISHING 4
+
+#define BZ_S_OUTPUT    1
+#define BZ_S_INPUT     2
+
+#define BZ_N_RADIX 2
+#define BZ_N_QSORT 12
+#define BZ_N_SHELL 18
+#define BZ_N_OVERSHOOT (BZ_N_RADIX + BZ_N_QSORT + BZ_N_SHELL + 2)
+
+
+
+
+/*-- Structure holding all the compression-side stuff. --*/
+
+typedef
+   struct {
+      /* pointer back to the struct bz_stream */
+      bz_stream* strm;
+
+      /* mode this stream is in, and whether inputting */
+      /* or outputting data */
+      Int32    mode;
+      Int32    state;
+
+      /* remembers avail_in when flush/finish requested */
+      UInt32   avail_in_expect;
+
+      /* for doing the block sorting */
+      UInt32*  arr1;
+      UInt32*  arr2;
+      UInt32*  ftab;
+      Int32    origPtr;
+
+      /* aliases for arr1 and arr2 */
+      UInt32*  ptr;
+      UChar*   block;
+      UInt16*  mtfv;
+      UChar*   zbits;
+
+      /* for deciding when to use the fallback sorting algorithm */
+      Int32    workFactor;
+
+      /* run-length-encoding of the input */
+      UInt32   state_in_ch;
+      Int32    state_in_len;
+      BZ_RAND_DECLS;
+
+      /* input and output limits and current posns */
+      Int32    nblock;
+      Int32    nblockMAX;
+      Int32    numZ;
+      Int32    state_out_pos;
+
+      /* map of bytes used in block */
+      Int32    nInUse;
+      Bool     inUse[256];
+      UChar    unseqToSeq[256];
+
+      /* the buffer for bit stream creation */
+      UInt32   bsBuff;
+      Int32    bsLive;
+
+      /* block and combined CRCs */
+      UInt32   blockCRC;
+      UInt32   combinedCRC;
+
+      /* misc administratium */
+      Int32    verbosity;
+      Int32    blockNo;
+      Int32    blockSize100k;
+
+      /* stuff for coding the MTF values */
+      Int32    nMTF;
+      Int32    mtfFreq    [BZ_MAX_ALPHA_SIZE];
+      UChar    selector   [BZ_MAX_SELECTORS];
+      UChar    selectorMtf[BZ_MAX_SELECTORS];
+
+      UChar    len     [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+      Int32    code    [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+      Int32    rfreq   [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+      /* second dimension: only 3 needed; 4 makes index calculations faster */
+      UInt32   len_pack[BZ_MAX_ALPHA_SIZE][4];
+
+   }
+   EState;
+
+
+
+/*-- externs for compression. --*/
+
+extern void 
+BZ2_blockSort ( EState* );
+
+extern void 
+BZ2_compressBlock ( EState*, Bool );
+
+extern void 
+BZ2_bsInitWrite ( EState* );
+
+extern void 
+BZ2_hbAssignCodes ( Int32*, UChar*, Int32, Int32, Int32 );
+
+extern void 
+BZ2_hbMakeCodeLengths ( UChar*, Int32*, Int32, Int32 );
+
+
+
+/*-- states for decompression. --*/
+
+#define BZ_X_IDLE        1
+#define BZ_X_OUTPUT      2
+
+#define BZ_X_MAGIC_1     10
+#define BZ_X_MAGIC_2     11
+#define BZ_X_MAGIC_3     12
+#define BZ_X_MAGIC_4     13
+#define BZ_X_BLKHDR_1    14
+#define BZ_X_BLKHDR_2    15
+#define BZ_X_BLKHDR_3    16
+#define BZ_X_BLKHDR_4    17
+#define BZ_X_BLKHDR_5    18
+#define BZ_X_BLKHDR_6    19
+#define BZ_X_BCRC_1      20
+#define BZ_X_BCRC_2      21
+#define BZ_X_BCRC_3      22
+#define BZ_X_BCRC_4      23
+#define BZ_X_RANDBIT     24
+#define BZ_X_ORIGPTR_1   25
+#define BZ_X_ORIGPTR_2   26
+#define BZ_X_ORIGPTR_3   27
+#define BZ_X_MAPPING_1   28
+#define BZ_X_MAPPING_2   29
+#define BZ_X_SELECTOR_1  30
+#define BZ_X_SELECTOR_2  31
+#define BZ_X_SELECTOR_3  32
+#define BZ_X_CODING_1    33
+#define BZ_X_CODING_2    34
+#define BZ_X_CODING_3    35
+#define BZ_X_MTF_1       36
+#define BZ_X_MTF_2       37
+#define BZ_X_MTF_3       38
+#define BZ_X_MTF_4       39
+#define BZ_X_MTF_5       40
+#define BZ_X_MTF_6       41
+#define BZ_X_ENDHDR_2    42
+#define BZ_X_ENDHDR_3    43
+#define BZ_X_ENDHDR_4    44
+#define BZ_X_ENDHDR_5    45
+#define BZ_X_ENDHDR_6    46
+#define BZ_X_CCRC_1      47
+#define BZ_X_CCRC_2      48
+#define BZ_X_CCRC_3      49
+#define BZ_X_CCRC_4      50
+
+
+
+/*-- Constants for the fast MTF decoder. --*/
+
+#define MTFA_SIZE 4096
+#define MTFL_SIZE 16
+
+
+
+/*-- Structure holding all the decompression-side stuff. --*/
+
+typedef
+   struct {
+      /* pointer back to the struct bz_stream */
+      bz_stream* strm;
+
+      /* state indicator for this stream */
+      Int32    state;
+
+      /* for doing the final run-length decoding */
+      UChar    state_out_ch;
+      Int32    state_out_len;
+      Bool     blockRandomised;
+      BZ_RAND_DECLS;
+
+      /* the buffer for bit stream reading */
+      UInt32   bsBuff;
+      Int32    bsLive;
+
+      /* misc administratium */
+      Int32    blockSize100k;
+      Bool     smallDecompress;
+      Int32    currBlockNo;
+      Int32    verbosity;
+
+      /* for undoing the Burrows-Wheeler transform */
+      Int32    origPtr;
+      UInt32   tPos;
+      Int32    k0;
+      Int32    unzftab[256];
+      Int32    nblock_used;
+      Int32    cftab[257];
+      Int32    cftabCopy[257];
+
+      /* for undoing the Burrows-Wheeler transform (FAST) */
+      UInt32   *tt;
+
+      /* for undoing the Burrows-Wheeler transform (SMALL) */
+      UInt16   *ll16;
+      UChar    *ll4;
+
+      /* stored and calculated CRCs */
+      UInt32   storedBlockCRC;
+      UInt32   storedCombinedCRC;
+      UInt32   calculatedBlockCRC;
+      UInt32   calculatedCombinedCRC;
+
+      /* map of bytes used in block */
+      Int32    nInUse;
+      Bool     inUse[256];
+      Bool     inUse16[16];
+      UChar    seqToUnseq[256];
+
+      /* for decoding the MTF values */
+      UChar    mtfa   [MTFA_SIZE];
+      Int32    mtfbase[256 / MTFL_SIZE];
+      UChar    selector   [BZ_MAX_SELECTORS];
+      UChar    selectorMtf[BZ_MAX_SELECTORS];
+      UChar    len  [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+
+      Int32    limit  [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+      Int32    base   [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+      Int32    perm   [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+      Int32    minLens[BZ_N_GROUPS];
+
+      /* save area for scalars in the main decompress code */
+      Int32    save_i;
+      Int32    save_j;
+      Int32    save_t;
+      Int32    save_alphaSize;
+      Int32    save_nGroups;
+      Int32    save_nSelectors;
+      Int32    save_EOB;
+      Int32    save_groupNo;
+      Int32    save_groupPos;
+      Int32    save_nextSym;
+      Int32    save_nblockMAX;
+      Int32    save_nblock;
+      Int32    save_es;
+      Int32    save_N;
+      Int32    save_curr;
+      Int32    save_zt;
+      Int32    save_zn; 
+      Int32    save_zvec;
+      Int32    save_zj;
+      Int32    save_gSel;
+      Int32    save_gMinlen;
+      Int32*   save_gLimit;
+      Int32*   save_gBase;
+      Int32*   save_gPerm;
+
+   }
+   DState;
+
+
+
+/*-- Macros for decompression. --*/
+
+#define BZ_GET_FAST(cccc)                     \
+    s->tPos = s->tt[s->tPos];                 \
+    cccc = (UChar)(s->tPos & 0xff);           \
+    s->tPos >>= 8;
+
+#define BZ_GET_FAST_C(cccc)                   \
+    c_tPos = c_tt[c_tPos];                    \
+    cccc = (UChar)(c_tPos & 0xff);            \
+    c_tPos >>= 8;
+
+#define SET_LL4(i,n)                                          \
+   { if (((i) & 0x1) == 0)                                    \
+        s->ll4[(i) >> 1] = (s->ll4[(i) >> 1] & 0xf0) | (n); else    \
+        s->ll4[(i) >> 1] = (s->ll4[(i) >> 1] & 0x0f) | ((n) << 4);  \
+   }
+
+#define GET_LL4(i)                             \
+   ((((UInt32)(s->ll4[(i) >> 1])) >> (((i) << 2) & 0x4)) & 0xF)
+
+#define SET_LL(i,n)                          \
+   { s->ll16[i] = (UInt16)(n & 0x0000ffff);  \
+     SET_LL4(i, n >> 16);                    \
+   }
+
+#define GET_LL(i) \
+   (((UInt32)s->ll16[i]) | (GET_LL4(i) << 16))
+
+#define BZ_GET_SMALL(cccc)                            \
+      cccc = BZ2_indexIntoF ( s->tPos, s->cftab );    \
+      s->tPos = GET_LL(s->tPos);
+
+
+/*-- externs for decompression. --*/
+
+extern Int32 
+BZ2_indexIntoF ( Int32, Int32* );
+
+extern Int32 
+BZ2_decompress ( DState* );
+
+extern void 
+BZ2_hbCreateDecodeTables ( Int32*, Int32*, Int32*, UChar*,
+                           Int32,  Int32, Int32 );
+
+
+#endif
+
+
+/*-- BZ_NO_STDIO seems to make NULL disappear on some platforms. --*/
+
+#ifdef BZ_NO_STDIO
+#ifndef NULL
+#define NULL 0
+#endif
+#endif
+
+
+/*-------------------------------------------------------------*/
+/*--- end                                   bzlib_private.h ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/compress.c b/bzip2/compress.c
new file mode 100644
index 000000000..cc5e31d6f
--- /dev/null
+++ b/bzip2/compress.c
@@ -0,0 +1,714 @@
+
+/*-------------------------------------------------------------*/
+/*--- Compression machinery (not incl block sorting)        ---*/
+/*---                                            compress.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+/*--
+   CHANGES
+   ~~~~~~~
+   0.9.0 -- original version.
+
+   0.9.0a/b -- no changes in this file.
+
+   0.9.0c
+      * changed setting of nGroups in sendMTFValues() so as to 
+        do a bit better on small files
+--*/
+
+#include "bzlib_private.h"
+
+
+/*---------------------------------------------------*/
+/*--- Bit stream I/O                              ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+void BZ2_bsInitWrite ( EState* s )
+{
+   s->bsLive = 0;
+   s->bsBuff = 0;
+}
+
+
+/*---------------------------------------------------*/
+static
+void bsFinishWrite ( EState* s )
+{
+   while (s->bsLive > 0) {
+      s->zbits[s->numZ] = (UChar)(s->bsBuff >> 24);
+      s->numZ++;
+      s->bsBuff <<= 8;
+      s->bsLive -= 8;
+   }
+}
+
+
+/*---------------------------------------------------*/
+#define bsNEEDW(nz)                           \
+{                                             \
+   while (s->bsLive >= 8) {                   \
+      s->zbits[s->numZ]                       \
+         = (UChar)(s->bsBuff >> 24);          \
+      s->numZ++;                              \
+      s->bsBuff <<= 8;                        \
+      s->bsLive -= 8;                         \
+   }                                          \
+}
+
+
+/*---------------------------------------------------*/
+static
+__inline__
+void bsW ( EState* s, Int32 n, UInt32 v )
+{
+   bsNEEDW ( n );
+   s->bsBuff |= (v << (32 - s->bsLive - n));
+   s->bsLive += n;
+}
+
+
+/*---------------------------------------------------*/
+static
+void bsPutUInt32 ( EState* s, UInt32 u )
+{
+   bsW ( s, 8, (u >> 24) & 0xffL );
+   bsW ( s, 8, (u >> 16) & 0xffL );
+   bsW ( s, 8, (u >>  8) & 0xffL );
+   bsW ( s, 8,  u        & 0xffL );
+}
+
+
+/*---------------------------------------------------*/
+static
+void bsPutUChar ( EState* s, UChar c )
+{
+   bsW( s, 8, (UInt32)c );
+}
+
+
+/*---------------------------------------------------*/
+/*--- The back end proper                         ---*/
+/*---------------------------------------------------*/
+
+/*---------------------------------------------------*/
+static
+void makeMaps_e ( EState* s )
+{
+   Int32 i;
+   s->nInUse = 0;
+   for (i = 0; i < 256; i++)
+      if (s->inUse[i]) {
+         s->unseqToSeq[i] = s->nInUse;
+         s->nInUse++;
+      }
+}
+
+
+/*---------------------------------------------------*/
+static
+void generateMTFValues ( EState* s )
+{
+   UChar   yy[256];
+   Int32   i, j;
+   Int32   zPend;
+   Int32   wr;
+   Int32   EOB;
+
+   /* 
+      After sorting (eg, here),
+         s->arr1 [ 0 .. s->nblock-1 ] holds sorted order,
+         and
+         ((UChar*)s->arr2) [ 0 .. s->nblock-1 ] 
+         holds the original block data.
+
+      The first thing to do is generate the MTF values,
+      and put them in
+         ((UInt16*)s->arr1) [ 0 .. s->nblock-1 ].
+      Because there are strictly fewer or equal MTF values
+      than block values, ptr values in this area are overwritten
+      with MTF values only when they are no longer needed.
+
+      The final compressed bitstream is generated into the
+      area starting at
+         (UChar*) (&((UChar*)s->arr2)[s->nblock])
+
+      These storage aliases are set up in bzCompressInit(),
+      except for the last one, which is arranged in 
+      compressBlock().
+   */
+   UInt32* ptr   = s->ptr;
+   UChar* block  = s->block;
+   UInt16* mtfv  = s->mtfv;
+
+   makeMaps_e ( s );
+   EOB = s->nInUse+1;
+
+   for (i = 0; i <= EOB; i++) s->mtfFreq[i] = 0;
+
+   wr = 0;
+   zPend = 0;
+   for (i = 0; i < s->nInUse; i++) yy[i] = (UChar) i;
+
+   for (i = 0; i < s->nblock; i++) {
+      UChar ll_i;
+      AssertD ( wr <= i, "generateMTFValues(1)" );
+      j = ptr[i]-1; if (j < 0) j += s->nblock;
+      ll_i = s->unseqToSeq[block[j]];
+      AssertD ( ll_i < s->nInUse, "generateMTFValues(2a)" );
+
+      if (yy[0] == ll_i) { 
+         zPend++;
+      } else {
+
+         if (zPend > 0) {
+            zPend--;
+            while (True) {
+               if (zPend & 1) {
+                  mtfv[wr] = BZ_RUNB; wr++; 
+                  s->mtfFreq[BZ_RUNB]++; 
+               } else {
+                  mtfv[wr] = BZ_RUNA; wr++; 
+                  s->mtfFreq[BZ_RUNA]++; 
+               }
+               if (zPend < 2) break;
+               zPend = (zPend - 2) / 2;
+            };
+            zPend = 0;
+         }
+         {
+            register UChar  rtmp;
+            register UChar* ryy_j;
+            register UChar  rll_i;
+            rtmp  = yy[1];
+            yy[1] = yy[0];
+            ryy_j = &(yy[1]);
+            rll_i = ll_i;
+            while ( rll_i != rtmp ) {
+               register UChar rtmp2;
+               ryy_j++;
+               rtmp2  = rtmp;
+               rtmp   = *ryy_j;
+               *ryy_j = rtmp2;
+            };
+            yy[0] = rtmp;
+            j = ryy_j - &(yy[0]);
+            mtfv[wr] = j+1; wr++; s->mtfFreq[j+1]++;
+         }
+
+      }
+   }
+
+   if (zPend > 0) {
+      zPend--;
+      while (True) {
+         if (zPend & 1) {
+            mtfv[wr] = BZ_RUNB; wr++; 
+            s->mtfFreq[BZ_RUNB]++; 
+         } else {
+            mtfv[wr] = BZ_RUNA; wr++; 
+            s->mtfFreq[BZ_RUNA]++; 
+         }
+         if (zPend < 2) break;
+         zPend = (zPend - 2) / 2;
+      };
+      zPend = 0;
+   }
+
+   mtfv[wr] = EOB; wr++; s->mtfFreq[EOB]++;
+
+   s->nMTF = wr;
+}
+
+
+/*---------------------------------------------------*/
+#define BZ_LESSER_ICOST  0
+#define BZ_GREATER_ICOST 15
+
+static
+void sendMTFValues ( EState* s )
+{
+   Int32 v, t, i, j, gs, ge, totc, bt, bc, iter;
+   Int32 nSelectors, alphaSize, minLen, maxLen, selCtr;
+   Int32 nGroups, nBytes;
+
+   /*--
+   UChar  len [BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+   is a global since the decoder also needs it.
+
+   Int32  code[BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+   Int32  rfreq[BZ_N_GROUPS][BZ_MAX_ALPHA_SIZE];
+   are also globals only used in this proc.
+   Made global to keep stack frame size small.
+   --*/
+
+
+   UInt16 cost[BZ_N_GROUPS];
+   Int32  fave[BZ_N_GROUPS];
+
+   UInt16* mtfv = s->mtfv;
+
+   if (s->verbosity >= 3)
+      VPrintf3( "      %d in block, %d after MTF & 1-2 coding, "
+                "%d+2 syms in use\n", 
+                s->nblock, s->nMTF, s->nInUse );
+
+   alphaSize = s->nInUse+2;
+   for (t = 0; t < BZ_N_GROUPS; t++)
+      for (v = 0; v < alphaSize; v++)
+         s->len[t][v] = BZ_GREATER_ICOST;
+
+   /*--- Decide how many coding tables to use ---*/
+   AssertH ( s->nMTF > 0, 3001 );
+   if (s->nMTF < 200)  nGroups = 2; else
+   if (s->nMTF < 600)  nGroups = 3; else
+   if (s->nMTF < 1200) nGroups = 4; else
+   if (s->nMTF < 2400) nGroups = 5; else
+                       nGroups = 6;
+
+   /*--- Generate an initial set of coding tables ---*/
+   { 
+      Int32 nPart, remF, tFreq, aFreq;
+
+      nPart = nGroups;
+      remF  = s->nMTF;
+      gs = 0;
+      while (nPart > 0) {
+         tFreq = remF / nPart;
+         ge = gs-1;
+         aFreq = 0;
+         while (aFreq < tFreq && ge < alphaSize-1) {
+            ge++;
+            aFreq += s->mtfFreq[ge];
+         }
+
+         if (ge > gs 
+             && nPart != nGroups && nPart != 1 
+             && ((nGroups-nPart) % 2 == 1)) {
+            aFreq -= s->mtfFreq[ge];
+            ge--;
+         }
+
+         if (s->verbosity >= 3)
+            VPrintf5( "      initial group %d, [%d .. %d], "
+                      "has %d syms (%4.1f%%)\n",
+                      nPart, gs, ge, aFreq, 
+                      (100.0 * (float)aFreq) / (float)(s->nMTF) );
+ 
+         for (v = 0; v < alphaSize; v++)
+            if (v >= gs && v <= ge) 
+               s->len[nPart-1][v] = BZ_LESSER_ICOST; else
+               s->len[nPart-1][v] = BZ_GREATER_ICOST;
+ 
+         nPart--;
+         gs = ge+1;
+         remF -= aFreq;
+      }
+   }
+
+   /*--- 
+      Iterate up to BZ_N_ITERS times to improve the tables.
+   ---*/
+   for (iter = 0; iter < BZ_N_ITERS; iter++) {
+
+      for (t = 0; t < nGroups; t++) fave[t] = 0;
+
+      for (t = 0; t < nGroups; t++)
+         for (v = 0; v < alphaSize; v++)
+            s->rfreq[t][v] = 0;
+
+      /*---
+        Set up an auxiliary length table which is used to fast-track
+	the common case (nGroups == 6). 
+      ---*/
+      if (nGroups == 6) {
+         for (v = 0; v < alphaSize; v++) {
+            s->len_pack[v][0] = (s->len[1][v] << 16) | s->len[0][v];
+            s->len_pack[v][1] = (s->len[3][v] << 16) | s->len[2][v];
+            s->len_pack[v][2] = (s->len[5][v] << 16) | s->len[4][v];
+	 }
+      }
+
+      nSelectors = 0;
+      totc = 0;
+      gs = 0;
+      while (True) {
+
+         /*--- Set group start & end marks. --*/
+         if (gs >= s->nMTF) break;
+         ge = gs + BZ_G_SIZE - 1; 
+         if (ge >= s->nMTF) ge = s->nMTF-1;
+
+         /*-- 
+            Calculate the cost of this group as coded
+            by each of the coding tables.
+         --*/
+         for (t = 0; t < nGroups; t++) cost[t] = 0;
+
+         if (nGroups == 6 && 50 == ge-gs+1) {
+            /*--- fast track the common case ---*/
+            register UInt32 cost01, cost23, cost45;
+            register UInt16 icv;
+            cost01 = cost23 = cost45 = 0;
+
+#           define BZ_ITER(nn)                \
+               icv = mtfv[gs+(nn)];           \
+               cost01 += s->len_pack[icv][0]; \
+               cost23 += s->len_pack[icv][1]; \
+               cost45 += s->len_pack[icv][2]; \
+
+            BZ_ITER(0);  BZ_ITER(1);  BZ_ITER(2);  BZ_ITER(3);  BZ_ITER(4);
+            BZ_ITER(5);  BZ_ITER(6);  BZ_ITER(7);  BZ_ITER(8);  BZ_ITER(9);
+            BZ_ITER(10); BZ_ITER(11); BZ_ITER(12); BZ_ITER(13); BZ_ITER(14);
+            BZ_ITER(15); BZ_ITER(16); BZ_ITER(17); BZ_ITER(18); BZ_ITER(19);
+            BZ_ITER(20); BZ_ITER(21); BZ_ITER(22); BZ_ITER(23); BZ_ITER(24);
+            BZ_ITER(25); BZ_ITER(26); BZ_ITER(27); BZ_ITER(28); BZ_ITER(29);
+            BZ_ITER(30); BZ_ITER(31); BZ_ITER(32); BZ_ITER(33); BZ_ITER(34);
+            BZ_ITER(35); BZ_ITER(36); BZ_ITER(37); BZ_ITER(38); BZ_ITER(39);
+            BZ_ITER(40); BZ_ITER(41); BZ_ITER(42); BZ_ITER(43); BZ_ITER(44);
+            BZ_ITER(45); BZ_ITER(46); BZ_ITER(47); BZ_ITER(48); BZ_ITER(49);
+
+#           undef BZ_ITER
+
+            cost[0] = cost01 & 0xffff; cost[1] = cost01 >> 16;
+            cost[2] = cost23 & 0xffff; cost[3] = cost23 >> 16;
+            cost[4] = cost45 & 0xffff; cost[5] = cost45 >> 16;
+
+         } else {
+	    /*--- slow version which correctly handles all situations ---*/
+            for (i = gs; i <= ge; i++) { 
+               UInt16 icv = mtfv[i];
+               for (t = 0; t < nGroups; t++) cost[t] += s->len[t][icv];
+            }
+         }
+ 
+         /*-- 
+            Find the coding table which is best for this group,
+            and record its identity in the selector table.
+         --*/
+         bc = 999999999; bt = -1;
+         for (t = 0; t < nGroups; t++)
+            if (cost[t] < bc) { bc = cost[t]; bt = t; };
+         totc += bc;
+         fave[bt]++;
+         s->selector[nSelectors] = bt;
+         nSelectors++;
+
+         /*-- 
+            Increment the symbol frequencies for the selected table.
+          --*/
+         if (nGroups == 6 && 50 == ge-gs+1) {
+            /*--- fast track the common case ---*/
+
+#           define BZ_ITUR(nn) s->rfreq[bt][ mtfv[gs+(nn)] ]++
+
+            BZ_ITUR(0);  BZ_ITUR(1);  BZ_ITUR(2);  BZ_ITUR(3);  BZ_ITUR(4);
+            BZ_ITUR(5);  BZ_ITUR(6);  BZ_ITUR(7);  BZ_ITUR(8);  BZ_ITUR(9);
+            BZ_ITUR(10); BZ_ITUR(11); BZ_ITUR(12); BZ_ITUR(13); BZ_ITUR(14);
+            BZ_ITUR(15); BZ_ITUR(16); BZ_ITUR(17); BZ_ITUR(18); BZ_ITUR(19);
+            BZ_ITUR(20); BZ_ITUR(21); BZ_ITUR(22); BZ_ITUR(23); BZ_ITUR(24);
+            BZ_ITUR(25); BZ_ITUR(26); BZ_ITUR(27); BZ_ITUR(28); BZ_ITUR(29);
+            BZ_ITUR(30); BZ_ITUR(31); BZ_ITUR(32); BZ_ITUR(33); BZ_ITUR(34);
+            BZ_ITUR(35); BZ_ITUR(36); BZ_ITUR(37); BZ_ITUR(38); BZ_ITUR(39);
+            BZ_ITUR(40); BZ_ITUR(41); BZ_ITUR(42); BZ_ITUR(43); BZ_ITUR(44);
+            BZ_ITUR(45); BZ_ITUR(46); BZ_ITUR(47); BZ_ITUR(48); BZ_ITUR(49);
+
+#           undef BZ_ITUR
+
+         } else {
+	    /*--- slow version which correctly handles all situations ---*/
+            for (i = gs; i <= ge; i++)
+               s->rfreq[bt][ mtfv[i] ]++;
+         }
+
+         gs = ge+1;
+      }
+      if (s->verbosity >= 3) {
+         VPrintf2 ( "      pass %d: size is %d, grp uses are ", 
+                   iter+1, totc/8 );
+         for (t = 0; t < nGroups; t++)
+            VPrintf1 ( "%d ", fave[t] );
+         VPrintf0 ( "\n" );
+      }
+
+      /*--
+        Recompute the tables based on the accumulated frequencies.
+      --*/
+      for (t = 0; t < nGroups; t++)
+         BZ2_hbMakeCodeLengths ( &(s->len[t][0]), &(s->rfreq[t][0]), 
+                                 alphaSize, 20 );
+   }
+
+
+   AssertH( nGroups < 8, 3002 );
+   AssertH( nSelectors < 32768 &&
+            nSelectors <= (2 + (900000 / BZ_G_SIZE)),
+            3003 );
+
+
+   /*--- Compute MTF values for the selectors. ---*/
+   {
+      UChar pos[BZ_N_GROUPS], ll_i, tmp2, tmp;
+      for (i = 0; i < nGroups; i++) pos[i] = i;
+      for (i = 0; i < nSelectors; i++) {
+         ll_i = s->selector[i];
+         j = 0;
+         tmp = pos[j];
+         while ( ll_i != tmp ) {
+            j++;
+            tmp2 = tmp;
+            tmp = pos[j];
+            pos[j] = tmp2;
+         };
+         pos[0] = tmp;
+         s->selectorMtf[i] = j;
+      }
+   };
+
+   /*--- Assign actual codes for the tables. --*/
+   for (t = 0; t < nGroups; t++) {
+      minLen = 32;
+      maxLen = 0;
+      for (i = 0; i < alphaSize; i++) {
+         if (s->len[t][i] > maxLen) maxLen = s->len[t][i];
+         if (s->len[t][i] < minLen) minLen = s->len[t][i];
+      }
+      AssertH ( !(maxLen > 20), 3004 );
+      AssertH ( !(minLen < 1),  3005 );
+      BZ2_hbAssignCodes ( &(s->code[t][0]), &(s->len[t][0]), 
+                          minLen, maxLen, alphaSize );
+   }
+
+   /*--- Transmit the mapping table. ---*/
+   { 
+      Bool inUse16[16];
+      for (i = 0; i < 16; i++) {
+          inUse16[i] = False;
+          for (j = 0; j < 16; j++)
+             if (s->inUse[i * 16 + j]) inUse16[i] = True;
+      }
+     
+      nBytes = s->numZ;
+      for (i = 0; i < 16; i++)
+         if (inUse16[i]) bsW(s,1,1); else bsW(s,1,0);
+
+      for (i = 0; i < 16; i++)
+         if (inUse16[i])
+            for (j = 0; j < 16; j++) {
+               if (s->inUse[i * 16 + j]) bsW(s,1,1); else bsW(s,1,0);
+            }
+
+      if (s->verbosity >= 3) 
+         VPrintf1( "      bytes: mapping %d, ", s->numZ-nBytes );
+   }
+
+   /*--- Now the selectors. ---*/
+   nBytes = s->numZ;
+   bsW ( s, 3, nGroups );
+   bsW ( s, 15, nSelectors );
+   for (i = 0; i < nSelectors; i++) { 
+      for (j = 0; j < s->selectorMtf[i]; j++) bsW(s,1,1);
+      bsW(s,1,0);
+   }
+   if (s->verbosity >= 3)
+      VPrintf1( "selectors %d, ", s->numZ-nBytes );
+
+   /*--- Now the coding tables. ---*/
+   nBytes = s->numZ;
+
+   for (t = 0; t < nGroups; t++) {
+      Int32 curr = s->len[t][0];
+      bsW ( s, 5, curr );
+      for (i = 0; i < alphaSize; i++) {
+         while (curr < s->len[t][i]) { bsW(s,2,2); curr++; /* 10 */ };
+         while (curr > s->len[t][i]) { bsW(s,2,3); curr--; /* 11 */ };
+         bsW ( s, 1, 0 );
+      }
+   }
+
+   if (s->verbosity >= 3)
+      VPrintf1 ( "code lengths %d, ", s->numZ-nBytes );
+
+   /*--- And finally, the block data proper ---*/
+   nBytes = s->numZ;
+   selCtr = 0;
+   gs = 0;
+   while (True) {
+      if (gs >= s->nMTF) break;
+      ge = gs + BZ_G_SIZE - 1; 
+      if (ge >= s->nMTF) ge = s->nMTF-1;
+      AssertH ( s->selector[selCtr] < nGroups, 3006 );
+
+      if (nGroups == 6 && 50 == ge-gs+1) {
+            /*--- fast track the common case ---*/
+            UInt16 mtfv_i;
+            UChar* s_len_sel_selCtr 
+               = &(s->len[s->selector[selCtr]][0]);
+            Int32* s_code_sel_selCtr
+               = &(s->code[s->selector[selCtr]][0]);
+
+#           define BZ_ITAH(nn)                      \
+               mtfv_i = mtfv[gs+(nn)];              \
+               bsW ( s,                             \
+                     s_len_sel_selCtr[mtfv_i],      \
+                     s_code_sel_selCtr[mtfv_i] )
+
+            BZ_ITAH(0);  BZ_ITAH(1);  BZ_ITAH(2);  BZ_ITAH(3);  BZ_ITAH(4);
+            BZ_ITAH(5);  BZ_ITAH(6);  BZ_ITAH(7);  BZ_ITAH(8);  BZ_ITAH(9);
+            BZ_ITAH(10); BZ_ITAH(11); BZ_ITAH(12); BZ_ITAH(13); BZ_ITAH(14);
+            BZ_ITAH(15); BZ_ITAH(16); BZ_ITAH(17); BZ_ITAH(18); BZ_ITAH(19);
+            BZ_ITAH(20); BZ_ITAH(21); BZ_ITAH(22); BZ_ITAH(23); BZ_ITAH(24);
+            BZ_ITAH(25); BZ_ITAH(26); BZ_ITAH(27); BZ_ITAH(28); BZ_ITAH(29);
+            BZ_ITAH(30); BZ_ITAH(31); BZ_ITAH(32); BZ_ITAH(33); BZ_ITAH(34);
+            BZ_ITAH(35); BZ_ITAH(36); BZ_ITAH(37); BZ_ITAH(38); BZ_ITAH(39);
+            BZ_ITAH(40); BZ_ITAH(41); BZ_ITAH(42); BZ_ITAH(43); BZ_ITAH(44);
+            BZ_ITAH(45); BZ_ITAH(46); BZ_ITAH(47); BZ_ITAH(48); BZ_ITAH(49);
+
+#           undef BZ_ITAH
+
+      } else {
+	 /*--- slow version which correctly handles all situations ---*/
+         for (i = gs; i <= ge; i++) {
+            bsW ( s, 
+                  s->len  [s->selector[selCtr]] [mtfv[i]],
+                  s->code [s->selector[selCtr]] [mtfv[i]] );
+         }
+      }
+
+
+      gs = ge+1;
+      selCtr++;
+   }
+   AssertH( selCtr == nSelectors, 3007 );
+
+   if (s->verbosity >= 3)
+      VPrintf1( "codes %d\n", s->numZ-nBytes );
+}
+
+
+/*---------------------------------------------------*/
+void BZ2_compressBlock ( EState* s, Bool is_last_block )
+{
+   if (s->nblock > 0) {
+
+      BZ_FINALISE_CRC ( s->blockCRC );
+      s->combinedCRC = (s->combinedCRC << 1) | (s->combinedCRC >> 31);
+      s->combinedCRC ^= s->blockCRC;
+      if (s->blockNo > 1) s->numZ = 0;
+
+      if (s->verbosity >= 2)
+         VPrintf4( "    block %d: crc = 0x%8x, "
+                   "combined CRC = 0x%8x, size = %d\n",
+                   s->blockNo, s->blockCRC, s->combinedCRC, s->nblock );
+
+      BZ2_blockSort ( s );
+   }
+
+   s->zbits = (UChar*) (&((UChar*)s->arr2)[s->nblock]);
+
+   /*-- If this is the first block, create the stream header. --*/
+   if (s->blockNo == 1) {
+      BZ2_bsInitWrite ( s );
+      bsPutUChar ( s, 'B' );
+      bsPutUChar ( s, 'Z' );
+      bsPutUChar ( s, 'h' );
+      bsPutUChar ( s, (UChar)('0' + s->blockSize100k) );
+   }
+
+   if (s->nblock > 0) {
+
+      bsPutUChar ( s, 0x31 ); bsPutUChar ( s, 0x41 );
+      bsPutUChar ( s, 0x59 ); bsPutUChar ( s, 0x26 );
+      bsPutUChar ( s, 0x53 ); bsPutUChar ( s, 0x59 );
+
+      /*-- Now the block's CRC, so it is in a known place. --*/
+      bsPutUInt32 ( s, s->blockCRC );
+
+      /*-- 
+         Now a single bit indicating (non-)randomisation. 
+         As of version 0.9.5, we use a better sorting algorithm
+         which makes randomisation unnecessary.  So always set
+         the randomised bit to 'no'.  Of course, the decoder
+         still needs to be able to handle randomised blocks
+         so as to maintain backwards compatibility with
+         older versions of bzip2.
+      --*/
+      bsW(s,1,0);
+
+      bsW ( s, 24, s->origPtr );
+      generateMTFValues ( s );
+      sendMTFValues ( s );
+   }
+
+
+   /*-- If this is the last block, add the stream trailer. --*/
+   if (is_last_block) {
+
+      bsPutUChar ( s, 0x17 ); bsPutUChar ( s, 0x72 );
+      bsPutUChar ( s, 0x45 ); bsPutUChar ( s, 0x38 );
+      bsPutUChar ( s, 0x50 ); bsPutUChar ( s, 0x90 );
+      bsPutUInt32 ( s, s->combinedCRC );
+      if (s->verbosity >= 2)
+         VPrintf1( "    final combined CRC = 0x%x\n   ", s->combinedCRC );
+      bsFinishWrite ( s );
+   }
+}
+
+
+/*-------------------------------------------------------------*/
+/*--- end                                        compress.c ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/crctable.c b/bzip2/crctable.c
new file mode 100644
index 000000000..61c040c4f
--- /dev/null
+++ b/bzip2/crctable.c
@@ -0,0 +1,144 @@
+
+/*-------------------------------------------------------------*/
+/*--- Table for doing CRCs                                  ---*/
+/*---                                            crctable.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+
+#include "bzlib_private.h"
+
+/*--
+  I think this is an implementation of the AUTODIN-II,
+  Ethernet & FDDI 32-bit CRC standard.  Vaguely derived
+  from code by Rob Warnock, in Section 51 of the
+  comp.compression FAQ.
+--*/
+
+UInt32 BZ2_crc32Table[256] = {
+
+   /*-- Ugly, innit? --*/
+
+   0x00000000L, 0x04c11db7L, 0x09823b6eL, 0x0d4326d9L,
+   0x130476dcL, 0x17c56b6bL, 0x1a864db2L, 0x1e475005L,
+   0x2608edb8L, 0x22c9f00fL, 0x2f8ad6d6L, 0x2b4bcb61L,
+   0x350c9b64L, 0x31cd86d3L, 0x3c8ea00aL, 0x384fbdbdL,
+   0x4c11db70L, 0x48d0c6c7L, 0x4593e01eL, 0x4152fda9L,
+   0x5f15adacL, 0x5bd4b01bL, 0x569796c2L, 0x52568b75L,
+   0x6a1936c8L, 0x6ed82b7fL, 0x639b0da6L, 0x675a1011L,
+   0x791d4014L, 0x7ddc5da3L, 0x709f7b7aL, 0x745e66cdL,
+   0x9823b6e0L, 0x9ce2ab57L, 0x91a18d8eL, 0x95609039L,
+   0x8b27c03cL, 0x8fe6dd8bL, 0x82a5fb52L, 0x8664e6e5L,
+   0xbe2b5b58L, 0xbaea46efL, 0xb7a96036L, 0xb3687d81L,
+   0xad2f2d84L, 0xa9ee3033L, 0xa4ad16eaL, 0xa06c0b5dL,
+   0xd4326d90L, 0xd0f37027L, 0xddb056feL, 0xd9714b49L,
+   0xc7361b4cL, 0xc3f706fbL, 0xceb42022L, 0xca753d95L,
+   0xf23a8028L, 0xf6fb9d9fL, 0xfbb8bb46L, 0xff79a6f1L,
+   0xe13ef6f4L, 0xe5ffeb43L, 0xe8bccd9aL, 0xec7dd02dL,
+   0x34867077L, 0x30476dc0L, 0x3d044b19L, 0x39c556aeL,
+   0x278206abL, 0x23431b1cL, 0x2e003dc5L, 0x2ac12072L,
+   0x128e9dcfL, 0x164f8078L, 0x1b0ca6a1L, 0x1fcdbb16L,
+   0x018aeb13L, 0x054bf6a4L, 0x0808d07dL, 0x0cc9cdcaL,
+   0x7897ab07L, 0x7c56b6b0L, 0x71159069L, 0x75d48ddeL,
+   0x6b93dddbL, 0x6f52c06cL, 0x6211e6b5L, 0x66d0fb02L,
+   0x5e9f46bfL, 0x5a5e5b08L, 0x571d7dd1L, 0x53dc6066L,
+   0x4d9b3063L, 0x495a2dd4L, 0x44190b0dL, 0x40d816baL,
+   0xaca5c697L, 0xa864db20L, 0xa527fdf9L, 0xa1e6e04eL,
+   0xbfa1b04bL, 0xbb60adfcL, 0xb6238b25L, 0xb2e29692L,
+   0x8aad2b2fL, 0x8e6c3698L, 0x832f1041L, 0x87ee0df6L,
+   0x99a95df3L, 0x9d684044L, 0x902b669dL, 0x94ea7b2aL,
+   0xe0b41de7L, 0xe4750050L, 0xe9362689L, 0xedf73b3eL,
+   0xf3b06b3bL, 0xf771768cL, 0xfa325055L, 0xfef34de2L,
+   0xc6bcf05fL, 0xc27dede8L, 0xcf3ecb31L, 0xcbffd686L,
+   0xd5b88683L, 0xd1799b34L, 0xdc3abdedL, 0xd8fba05aL,
+   0x690ce0eeL, 0x6dcdfd59L, 0x608edb80L, 0x644fc637L,
+   0x7a089632L, 0x7ec98b85L, 0x738aad5cL, 0x774bb0ebL,
+   0x4f040d56L, 0x4bc510e1L, 0x46863638L, 0x42472b8fL,
+   0x5c007b8aL, 0x58c1663dL, 0x558240e4L, 0x51435d53L,
+   0x251d3b9eL, 0x21dc2629L, 0x2c9f00f0L, 0x285e1d47L,
+   0x36194d42L, 0x32d850f5L, 0x3f9b762cL, 0x3b5a6b9bL,
+   0x0315d626L, 0x07d4cb91L, 0x0a97ed48L, 0x0e56f0ffL,
+   0x1011a0faL, 0x14d0bd4dL, 0x19939b94L, 0x1d528623L,
+   0xf12f560eL, 0xf5ee4bb9L, 0xf8ad6d60L, 0xfc6c70d7L,
+   0xe22b20d2L, 0xe6ea3d65L, 0xeba91bbcL, 0xef68060bL,
+   0xd727bbb6L, 0xd3e6a601L, 0xdea580d8L, 0xda649d6fL,
+   0xc423cd6aL, 0xc0e2d0ddL, 0xcda1f604L, 0xc960ebb3L,
+   0xbd3e8d7eL, 0xb9ff90c9L, 0xb4bcb610L, 0xb07daba7L,
+   0xae3afba2L, 0xaafbe615L, 0xa7b8c0ccL, 0xa379dd7bL,
+   0x9b3660c6L, 0x9ff77d71L, 0x92b45ba8L, 0x9675461fL,
+   0x8832161aL, 0x8cf30badL, 0x81b02d74L, 0x857130c3L,
+   0x5d8a9099L, 0x594b8d2eL, 0x5408abf7L, 0x50c9b640L,
+   0x4e8ee645L, 0x4a4ffbf2L, 0x470cdd2bL, 0x43cdc09cL,
+   0x7b827d21L, 0x7f436096L, 0x7200464fL, 0x76c15bf8L,
+   0x68860bfdL, 0x6c47164aL, 0x61043093L, 0x65c52d24L,
+   0x119b4be9L, 0x155a565eL, 0x18197087L, 0x1cd86d30L,
+   0x029f3d35L, 0x065e2082L, 0x0b1d065bL, 0x0fdc1becL,
+   0x3793a651L, 0x3352bbe6L, 0x3e119d3fL, 0x3ad08088L,
+   0x2497d08dL, 0x2056cd3aL, 0x2d15ebe3L, 0x29d4f654L,
+   0xc5a92679L, 0xc1683bceL, 0xcc2b1d17L, 0xc8ea00a0L,
+   0xd6ad50a5L, 0xd26c4d12L, 0xdf2f6bcbL, 0xdbee767cL,
+   0xe3a1cbc1L, 0xe760d676L, 0xea23f0afL, 0xeee2ed18L,
+   0xf0a5bd1dL, 0xf464a0aaL, 0xf9278673L, 0xfde69bc4L,
+   0x89b8fd09L, 0x8d79e0beL, 0x803ac667L, 0x84fbdbd0L,
+   0x9abc8bd5L, 0x9e7d9662L, 0x933eb0bbL, 0x97ffad0cL,
+   0xafb010b1L, 0xab710d06L, 0xa6322bdfL, 0xa2f33668L,
+   0xbcb4666dL, 0xb8757bdaL, 0xb5365d03L, 0xb1f740b4L
+};
+
+
+/*-------------------------------------------------------------*/
+/*--- end                                        crctable.c ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/decompress.c b/bzip2/decompress.c
new file mode 100644
index 000000000..cdced1889
--- /dev/null
+++ b/bzip2/decompress.c
@@ -0,0 +1,660 @@
+
+/*-------------------------------------------------------------*/
+/*--- Decompression machinery                               ---*/
+/*---                                          decompress.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+
+#include "bzlib_private.h"
+
+
+/*---------------------------------------------------*/
+static
+void makeMaps_d ( DState* s )
+{
+   Int32 i;
+   s->nInUse = 0;
+   for (i = 0; i < 256; i++)
+      if (s->inUse[i]) {
+         s->seqToUnseq[s->nInUse] = i;
+         s->nInUse++;
+      }
+}
+
+
+/*---------------------------------------------------*/
+#define RETURN(rrr)                               \
+   { retVal = rrr; goto save_state_and_return; };
+
+#define GET_BITS(lll,vvv,nnn)                     \
+   case lll: s->state = lll;                      \
+   while (True) {                                 \
+      if (s->bsLive >= nnn) {                     \
+         UInt32 v;                                \
+         v = (s->bsBuff >>                        \
+             (s->bsLive-nnn)) & ((1 << nnn)-1);   \
+         s->bsLive -= nnn;                        \
+         vvv = v;                                 \
+         break;                                   \
+      }                                           \
+      if (s->strm->avail_in == 0) RETURN(BZ_OK);  \
+      s->bsBuff                                   \
+         = (s->bsBuff << 8) |                     \
+           ((UInt32)                              \
+              (*((UChar*)(s->strm->next_in))));   \
+      s->bsLive += 8;                             \
+      s->strm->next_in++;                         \
+      s->strm->avail_in--;                        \
+      s->strm->total_in_lo32++;                   \
+      if (s->strm->total_in_lo32 == 0)            \
+         s->strm->total_in_hi32++;                \
+   }
+
+#define GET_UCHAR(lll,uuu)                        \
+   GET_BITS(lll,uuu,8)
+
+#define GET_BIT(lll,uuu)                          \
+   GET_BITS(lll,uuu,1)
+
+/*---------------------------------------------------*/
+#define GET_MTF_VAL(label1,label2,lval)           \
+{                                                 \
+   if (groupPos == 0) {                           \
+      groupNo++;                                  \
+      if (groupNo >= nSelectors)                  \
+         RETURN(BZ_DATA_ERROR);                   \
+      groupPos = BZ_G_SIZE;                       \
+      gSel = s->selector[groupNo];                \
+      gMinlen = s->minLens[gSel];                 \
+      gLimit = &(s->limit[gSel][0]);              \
+      gPerm = &(s->perm[gSel][0]);                \
+      gBase = &(s->base[gSel][0]);                \
+   }                                              \
+   groupPos--;                                    \
+   zn = gMinlen;                                  \
+   GET_BITS(label1, zvec, zn);                    \
+   while (1) {                                    \
+      if (zn > 20 /* the longest code */)         \
+         RETURN(BZ_DATA_ERROR);                   \
+      if (zvec <= gLimit[zn]) break;              \
+      zn++;                                       \
+      GET_BIT(label2, zj);                        \
+      zvec = (zvec << 1) | zj;                    \
+   };                                             \
+   if (zvec - gBase[zn] < 0                       \
+       || zvec - gBase[zn] >= BZ_MAX_ALPHA_SIZE)  \
+      RETURN(BZ_DATA_ERROR);                      \
+   lval = gPerm[zvec - gBase[zn]];                \
+}
+
+
+/*---------------------------------------------------*/
+Int32 BZ2_decompress ( DState* s )
+{
+   UChar      uc;
+   Int32      retVal;
+   Int32      minLen, maxLen;
+   bz_stream* strm = s->strm;
+
+   /* stuff that needs to be saved/restored */
+   Int32  i;
+   Int32  j;
+   Int32  t;
+   Int32  alphaSize;
+   Int32  nGroups;
+   Int32  nSelectors;
+   Int32  EOB;
+   Int32  groupNo;
+   Int32  groupPos;
+   Int32  nextSym;
+   Int32  nblockMAX;
+   Int32  nblock;
+   Int32  es;
+   Int32  N;
+   Int32  curr;
+   Int32  zt;
+   Int32  zn; 
+   Int32  zvec;
+   Int32  zj;
+   Int32  gSel;
+   Int32  gMinlen;
+   Int32* gLimit;
+   Int32* gBase;
+   Int32* gPerm;
+
+   if (s->state == BZ_X_MAGIC_1) {
+      /*initialise the save area*/
+      s->save_i           = 0;
+      s->save_j           = 0;
+      s->save_t           = 0;
+      s->save_alphaSize   = 0;
+      s->save_nGroups     = 0;
+      s->save_nSelectors  = 0;
+      s->save_EOB         = 0;
+      s->save_groupNo     = 0;
+      s->save_groupPos    = 0;
+      s->save_nextSym     = 0;
+      s->save_nblockMAX   = 0;
+      s->save_nblock      = 0;
+      s->save_es          = 0;
+      s->save_N           = 0;
+      s->save_curr        = 0;
+      s->save_zt          = 0;
+      s->save_zn          = 0;
+      s->save_zvec        = 0;
+      s->save_zj          = 0;
+      s->save_gSel        = 0;
+      s->save_gMinlen     = 0;
+      s->save_gLimit      = NULL;
+      s->save_gBase       = NULL;
+      s->save_gPerm       = NULL;
+   }
+
+   /*restore from the save area*/
+   i           = s->save_i;
+   j           = s->save_j;
+   t           = s->save_t;
+   alphaSize   = s->save_alphaSize;
+   nGroups     = s->save_nGroups;
+   nSelectors  = s->save_nSelectors;
+   EOB         = s->save_EOB;
+   groupNo     = s->save_groupNo;
+   groupPos    = s->save_groupPos;
+   nextSym     = s->save_nextSym;
+   nblockMAX   = s->save_nblockMAX;
+   nblock      = s->save_nblock;
+   es          = s->save_es;
+   N           = s->save_N;
+   curr        = s->save_curr;
+   zt          = s->save_zt;
+   zn          = s->save_zn; 
+   zvec        = s->save_zvec;
+   zj          = s->save_zj;
+   gSel        = s->save_gSel;
+   gMinlen     = s->save_gMinlen;
+   gLimit      = s->save_gLimit;
+   gBase       = s->save_gBase;
+   gPerm       = s->save_gPerm;
+
+   retVal = BZ_OK;
+
+   switch (s->state) {
+
+      GET_UCHAR(BZ_X_MAGIC_1, uc);
+      if (uc != 'B') RETURN(BZ_DATA_ERROR_MAGIC);
+
+      GET_UCHAR(BZ_X_MAGIC_2, uc);
+      if (uc != 'Z') RETURN(BZ_DATA_ERROR_MAGIC);
+
+      GET_UCHAR(BZ_X_MAGIC_3, uc)
+      if (uc != 'h') RETURN(BZ_DATA_ERROR_MAGIC);
+
+      GET_BITS(BZ_X_MAGIC_4, s->blockSize100k, 8)
+      if (s->blockSize100k < '1' || 
+          s->blockSize100k > '9') RETURN(BZ_DATA_ERROR_MAGIC);
+      s->blockSize100k -= '0';
+
+      if (s->smallDecompress) {
+         s->ll16 = BZALLOC( s->blockSize100k * 100000 * sizeof(UInt16) );
+         s->ll4  = BZALLOC( 
+                      ((1 + s->blockSize100k * 100000) >> 1) * sizeof(UChar) 
+                   );
+         if (s->ll16 == NULL || s->ll4 == NULL) RETURN(BZ_MEM_ERROR);
+      } else {
+         s->tt  = BZALLOC( s->blockSize100k * 100000 * sizeof(Int32) );
+         if (s->tt == NULL) RETURN(BZ_MEM_ERROR);
+      }
+
+      GET_UCHAR(BZ_X_BLKHDR_1, uc);
+
+      if (uc == 0x17) goto endhdr_2;
+      if (uc != 0x31) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_BLKHDR_2, uc);
+      if (uc != 0x41) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_BLKHDR_3, uc);
+      if (uc != 0x59) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_BLKHDR_4, uc);
+      if (uc != 0x26) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_BLKHDR_5, uc);
+      if (uc != 0x53) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_BLKHDR_6, uc);
+      if (uc != 0x59) RETURN(BZ_DATA_ERROR);
+
+      s->currBlockNo++;
+      if (s->verbosity >= 2)
+         VPrintf1 ( "\n    [%d: huff+mtf ", s->currBlockNo );
+ 
+      s->storedBlockCRC = 0;
+      GET_UCHAR(BZ_X_BCRC_1, uc);
+      s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc);
+      GET_UCHAR(BZ_X_BCRC_2, uc);
+      s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc);
+      GET_UCHAR(BZ_X_BCRC_3, uc);
+      s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc);
+      GET_UCHAR(BZ_X_BCRC_4, uc);
+      s->storedBlockCRC = (s->storedBlockCRC << 8) | ((UInt32)uc);
+
+      GET_BITS(BZ_X_RANDBIT, s->blockRandomised, 1);
+
+      s->origPtr = 0;
+      GET_UCHAR(BZ_X_ORIGPTR_1, uc);
+      s->origPtr = (s->origPtr << 8) | ((Int32)uc);
+      GET_UCHAR(BZ_X_ORIGPTR_2, uc);
+      s->origPtr = (s->origPtr << 8) | ((Int32)uc);
+      GET_UCHAR(BZ_X_ORIGPTR_3, uc);
+      s->origPtr = (s->origPtr << 8) | ((Int32)uc);
+
+      if (s->origPtr < 0)
+         RETURN(BZ_DATA_ERROR);
+      if (s->origPtr > 10 + 100000*s->blockSize100k) 
+         RETURN(BZ_DATA_ERROR);
+
+      /*--- Receive the mapping table ---*/
+      for (i = 0; i < 16; i++) {
+         GET_BIT(BZ_X_MAPPING_1, uc);
+         if (uc == 1) 
+            s->inUse16[i] = True; else 
+            s->inUse16[i] = False;
+      }
+
+      for (i = 0; i < 256; i++) s->inUse[i] = False;
+
+      for (i = 0; i < 16; i++)
+         if (s->inUse16[i])
+            for (j = 0; j < 16; j++) {
+               GET_BIT(BZ_X_MAPPING_2, uc);
+               if (uc == 1) s->inUse[i * 16 + j] = True;
+            }
+      makeMaps_d ( s );
+      if (s->nInUse == 0) RETURN(BZ_DATA_ERROR);
+      alphaSize = s->nInUse+2;
+
+      /*--- Now the selectors ---*/
+      GET_BITS(BZ_X_SELECTOR_1, nGroups, 3);
+      if (nGroups < 2 || nGroups > 6) RETURN(BZ_DATA_ERROR);
+      GET_BITS(BZ_X_SELECTOR_2, nSelectors, 15);
+      if (nSelectors < 1) RETURN(BZ_DATA_ERROR);
+      for (i = 0; i < nSelectors; i++) {
+         j = 0;
+         while (True) {
+            GET_BIT(BZ_X_SELECTOR_3, uc);
+            if (uc == 0) break;
+            j++;
+            if (j >= nGroups) RETURN(BZ_DATA_ERROR);
+         }
+         s->selectorMtf[i] = j;
+      }
+
+      /*--- Undo the MTF values for the selectors. ---*/
+      {
+         UChar pos[BZ_N_GROUPS], tmp, v;
+         for (v = 0; v < nGroups; v++) pos[v] = v;
+   
+         for (i = 0; i < nSelectors; i++) {
+            v = s->selectorMtf[i];
+            tmp = pos[v];
+            while (v > 0) { pos[v] = pos[v-1]; v--; }
+            pos[0] = tmp;
+            s->selector[i] = tmp;
+         }
+      }
+
+      /*--- Now the coding tables ---*/
+      for (t = 0; t < nGroups; t++) {
+         GET_BITS(BZ_X_CODING_1, curr, 5);
+         for (i = 0; i < alphaSize; i++) {
+            while (True) {
+               if (curr < 1 || curr > 20) RETURN(BZ_DATA_ERROR);
+               GET_BIT(BZ_X_CODING_2, uc);
+               if (uc == 0) break;
+               GET_BIT(BZ_X_CODING_3, uc);
+               if (uc == 0) curr++; else curr--;
+            }
+            s->len[t][i] = curr;
+         }
+      }
+
+      /*--- Create the Huffman decoding tables ---*/
+      for (t = 0; t < nGroups; t++) {
+         minLen = 32;
+         maxLen = 0;
+         for (i = 0; i < alphaSize; i++) {
+            if (s->len[t][i] > maxLen) maxLen = s->len[t][i];
+            if (s->len[t][i] < minLen) minLen = s->len[t][i];
+         }
+         BZ2_hbCreateDecodeTables ( 
+            &(s->limit[t][0]), 
+            &(s->base[t][0]), 
+            &(s->perm[t][0]), 
+            &(s->len[t][0]),
+            minLen, maxLen, alphaSize
+         );
+         s->minLens[t] = minLen;
+      }
+
+      /*--- Now the MTF values ---*/
+
+      EOB      = s->nInUse+1;
+      nblockMAX = 100000 * s->blockSize100k;
+      groupNo  = -1;
+      groupPos = 0;
+
+      for (i = 0; i <= 255; i++) s->unzftab[i] = 0;
+
+      /*-- MTF init --*/
+      {
+         Int32 ii, jj, kk;
+         kk = MTFA_SIZE-1;
+         for (ii = 256 / MTFL_SIZE - 1; ii >= 0; ii--) {
+            for (jj = MTFL_SIZE-1; jj >= 0; jj--) {
+               s->mtfa[kk] = (UChar)(ii * MTFL_SIZE + jj);
+               kk--;
+            }
+            s->mtfbase[ii] = kk + 1;
+         }
+      }
+      /*-- end MTF init --*/
+
+      nblock = 0;
+      GET_MTF_VAL(BZ_X_MTF_1, BZ_X_MTF_2, nextSym);
+
+      while (True) {
+
+         if (nextSym == EOB) break;
+
+         if (nextSym == BZ_RUNA || nextSym == BZ_RUNB) {
+
+            es = -1;
+            N = 1;
+            do {
+               if (nextSym == BZ_RUNA) es = es + (0+1) * N; else
+               if (nextSym == BZ_RUNB) es = es + (1+1) * N;
+               N = N * 2;
+               GET_MTF_VAL(BZ_X_MTF_3, BZ_X_MTF_4, nextSym);
+            }
+               while (nextSym == BZ_RUNA || nextSym == BZ_RUNB);
+
+            es++;
+            uc = s->seqToUnseq[ s->mtfa[s->mtfbase[0]] ];
+            s->unzftab[uc] += es;
+
+            if (s->smallDecompress)
+               while (es > 0) {
+                  if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR);
+                  s->ll16[nblock] = (UInt16)uc;
+                  nblock++;
+                  es--;
+               }
+            else
+               while (es > 0) {
+                  if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR);
+                  s->tt[nblock] = (UInt32)uc;
+                  nblock++;
+                  es--;
+               };
+
+            continue;
+
+         } else {
+
+            if (nblock >= nblockMAX) RETURN(BZ_DATA_ERROR);
+
+            /*-- uc = MTF ( nextSym-1 ) --*/
+            {
+               Int32 ii, jj, kk, pp, lno, off;
+               UInt32 nn;
+               nn = (UInt32)(nextSym - 1);
+
+               if (nn < MTFL_SIZE) {
+                  /* avoid general-case expense */
+                  pp = s->mtfbase[0];
+                  uc = s->mtfa[pp+nn];
+                  while (nn > 3) {
+                     Int32 z = pp+nn;
+                     s->mtfa[(z)  ] = s->mtfa[(z)-1];
+                     s->mtfa[(z)-1] = s->mtfa[(z)-2];
+                     s->mtfa[(z)-2] = s->mtfa[(z)-3];
+                     s->mtfa[(z)-3] = s->mtfa[(z)-4];
+                     nn -= 4;
+                  }
+                  while (nn > 0) { 
+                     s->mtfa[(pp+nn)] = s->mtfa[(pp+nn)-1]; nn--; 
+                  };
+                  s->mtfa[pp] = uc;
+               } else { 
+                  /* general case */
+                  lno = nn / MTFL_SIZE;
+                  off = nn % MTFL_SIZE;
+                  pp = s->mtfbase[lno] + off;
+                  uc = s->mtfa[pp];
+                  while (pp > s->mtfbase[lno]) { 
+                     s->mtfa[pp] = s->mtfa[pp-1]; pp--; 
+                  };
+                  s->mtfbase[lno]++;
+                  while (lno > 0) {
+                     s->mtfbase[lno]--;
+                     s->mtfa[s->mtfbase[lno]] 
+                        = s->mtfa[s->mtfbase[lno-1] + MTFL_SIZE - 1];
+                     lno--;
+                  }
+                  s->mtfbase[0]--;
+                  s->mtfa[s->mtfbase[0]] = uc;
+                  if (s->mtfbase[0] == 0) {
+                     kk = MTFA_SIZE-1;
+                     for (ii = 256 / MTFL_SIZE-1; ii >= 0; ii--) {
+                        for (jj = MTFL_SIZE-1; jj >= 0; jj--) {
+                           s->mtfa[kk] = s->mtfa[s->mtfbase[ii] + jj];
+                           kk--;
+                        }
+                        s->mtfbase[ii] = kk + 1;
+                     }
+                  }
+               }
+            }
+            /*-- end uc = MTF ( nextSym-1 ) --*/
+
+            s->unzftab[s->seqToUnseq[uc]]++;
+            if (s->smallDecompress)
+               s->ll16[nblock] = (UInt16)(s->seqToUnseq[uc]); else
+               s->tt[nblock]   = (UInt32)(s->seqToUnseq[uc]);
+            nblock++;
+
+            GET_MTF_VAL(BZ_X_MTF_5, BZ_X_MTF_6, nextSym);
+            continue;
+         }
+      }
+
+      /* Now we know what nblock is, we can do a better sanity
+         check on s->origPtr.
+      */
+      if (s->origPtr < 0 || s->origPtr >= nblock)
+         RETURN(BZ_DATA_ERROR);
+
+      s->state_out_len = 0;
+      s->state_out_ch  = 0;
+      BZ_INITIALISE_CRC ( s->calculatedBlockCRC );
+      s->state = BZ_X_OUTPUT;
+      if (s->verbosity >= 2) VPrintf0 ( "rt+rld" );
+
+      /*-- Set up cftab to facilitate generation of T^(-1) --*/
+      s->cftab[0] = 0;
+      for (i = 1; i <= 256; i++) s->cftab[i] = s->unzftab[i-1];
+      for (i = 1; i <= 256; i++) s->cftab[i] += s->cftab[i-1];
+
+      if (s->smallDecompress) {
+
+         /*-- Make a copy of cftab, used in generation of T --*/
+         for (i = 0; i <= 256; i++) s->cftabCopy[i] = s->cftab[i];
+
+         /*-- compute the T vector --*/
+         for (i = 0; i < nblock; i++) {
+            uc = (UChar)(s->ll16[i]);
+            SET_LL(i, s->cftabCopy[uc]);
+            s->cftabCopy[uc]++;
+         }
+
+         /*-- Compute T^(-1) by pointer reversal on T --*/
+         i = s->origPtr;
+         j = GET_LL(i);
+         do {
+            Int32 tmp = GET_LL(j);
+            SET_LL(j, i);
+            i = j;
+            j = tmp;
+         }
+            while (i != s->origPtr);
+
+         s->tPos = s->origPtr;
+         s->nblock_used = 0;
+         if (s->blockRandomised) {
+            BZ_RAND_INIT_MASK;
+            BZ_GET_SMALL(s->k0); s->nblock_used++;
+            BZ_RAND_UPD_MASK; s->k0 ^= BZ_RAND_MASK; 
+         } else {
+            BZ_GET_SMALL(s->k0); s->nblock_used++;
+         }
+
+      } else {
+
+         /*-- compute the T^(-1) vector --*/
+         for (i = 0; i < nblock; i++) {
+            uc = (UChar)(s->tt[i] & 0xff);
+            s->tt[s->cftab[uc]] |= (i << 8);
+            s->cftab[uc]++;
+         }
+
+         s->tPos = s->tt[s->origPtr] >> 8;
+         s->nblock_used = 0;
+         if (s->blockRandomised) {
+            BZ_RAND_INIT_MASK;
+            BZ_GET_FAST(s->k0); s->nblock_used++;
+            BZ_RAND_UPD_MASK; s->k0 ^= BZ_RAND_MASK; 
+         } else {
+            BZ_GET_FAST(s->k0); s->nblock_used++;
+         }
+
+      }
+
+      RETURN(BZ_OK);
+
+
+
+    endhdr_2:
+
+      GET_UCHAR(BZ_X_ENDHDR_2, uc);
+      if (uc != 0x72) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_ENDHDR_3, uc);
+      if (uc != 0x45) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_ENDHDR_4, uc);
+      if (uc != 0x38) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_ENDHDR_5, uc);
+      if (uc != 0x50) RETURN(BZ_DATA_ERROR);
+      GET_UCHAR(BZ_X_ENDHDR_6, uc);
+      if (uc != 0x90) RETURN(BZ_DATA_ERROR);
+
+      s->storedCombinedCRC = 0;
+      GET_UCHAR(BZ_X_CCRC_1, uc);
+      s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc);
+      GET_UCHAR(BZ_X_CCRC_2, uc);
+      s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc);
+      GET_UCHAR(BZ_X_CCRC_3, uc);
+      s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc);
+      GET_UCHAR(BZ_X_CCRC_4, uc);
+      s->storedCombinedCRC = (s->storedCombinedCRC << 8) | ((UInt32)uc);
+
+      s->state = BZ_X_IDLE;
+      RETURN(BZ_STREAM_END);
+
+      default: AssertH ( False, 4001 );
+   }
+
+   AssertH ( False, 4002 );
+
+   save_state_and_return:
+
+   s->save_i           = i;
+   s->save_j           = j;
+   s->save_t           = t;
+   s->save_alphaSize   = alphaSize;
+   s->save_nGroups     = nGroups;
+   s->save_nSelectors  = nSelectors;
+   s->save_EOB         = EOB;
+   s->save_groupNo     = groupNo;
+   s->save_groupPos    = groupPos;
+   s->save_nextSym     = nextSym;
+   s->save_nblockMAX   = nblockMAX;
+   s->save_nblock      = nblock;
+   s->save_es          = es;
+   s->save_N           = N;
+   s->save_curr        = curr;
+   s->save_zt          = zt;
+   s->save_zn          = zn;
+   s->save_zvec        = zvec;
+   s->save_zj          = zj;
+   s->save_gSel        = gSel;
+   s->save_gMinlen     = gMinlen;
+   s->save_gLimit      = gLimit;
+   s->save_gBase       = gBase;
+   s->save_gPerm       = gPerm;
+
+   return retVal;   
+}
+
+
+/*-------------------------------------------------------------*/
+/*--- end                                      decompress.c ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/dlltest.c b/bzip2/dlltest.c
new file mode 100644
index 000000000..f79279cef
--- /dev/null
+++ b/bzip2/dlltest.c
@@ -0,0 +1,176 @@
+/*

+   minibz2

+      libbz2.dll test program.

+      by Yoshioka Tsuneo(QWF00133@nifty.ne.jp/tsuneo-y@is.aist-nara.ac.jp)

+      This file is Public Domain.

+      welcome any email to me.

+

+   usage: minibz2 [-d] [-{1,2,..9}] [[srcfilename] destfilename]

+*/

+

+#define BZ_IMPORT

+#include <stdio.h>

+#include <stdlib.h>

+#include "bzlib.h"

+#ifdef _WIN32

+#include <io.h>

+#endif

+

+

+#ifdef _WIN32

+

+#define BZ2_LIBNAME "libbz2-1.0.0.DLL" 

+

+#include <windows.h>

+static int BZ2DLLLoaded = 0;

+static HINSTANCE BZ2DLLhLib;

+int BZ2DLLLoadLibrary(void)

+{

+   HINSTANCE hLib;

+

+   if(BZ2DLLLoaded==1){return 0;}

+   hLib=LoadLibrary(BZ2_LIBNAME);

+   if(hLib == NULL){

+      fprintf(stderr,"Can't load %s\n",BZ2_LIBNAME);

+      return -1;

+   }

+   BZ2_bzlibVersion=GetProcAddress(hLib,"BZ2_bzlibVersion");

+   BZ2_bzopen=GetProcAddress(hLib,"BZ2_bzopen");

+   BZ2_bzdopen=GetProcAddress(hLib,"BZ2_bzdopen");

+   BZ2_bzread=GetProcAddress(hLib,"BZ2_bzread");

+   BZ2_bzwrite=GetProcAddress(hLib,"BZ2_bzwrite");

+   BZ2_bzflush=GetProcAddress(hLib,"BZ2_bzflush");

+   BZ2_bzclose=GetProcAddress(hLib,"BZ2_bzclose");

+   BZ2_bzerror=GetProcAddress(hLib,"BZ2_bzerror");

+

+   if (!BZ2_bzlibVersion || !BZ2_bzopen || !BZ2_bzdopen

+       || !BZ2_bzread || !BZ2_bzwrite || !BZ2_bzflush

+       || !BZ2_bzclose || !BZ2_bzerror) {

+      fprintf(stderr,"GetProcAddress failed.\n");

+      return -1;

+   }

+   BZ2DLLLoaded=1;

+   BZ2DLLhLib=hLib;

+   return 0;

+

+}

+int BZ2DLLFreeLibrary(void)

+{

+   if(BZ2DLLLoaded==0){return 0;}

+   FreeLibrary(BZ2DLLhLib);

+   BZ2DLLLoaded=0;

+}

+#endif /* WIN32 */

+

+void usage(void)

+{

+   puts("usage: minibz2 [-d] [-{1,2,..9}] [[srcfilename] destfilename]");

+}

+

+int main(int argc,char *argv[])

+{

+   int decompress = 0;

+   int level = 9;

+   char *fn_r = NULL;

+   char *fn_w = NULL;

+

+#ifdef _WIN32

+   if(BZ2DLLLoadLibrary()<0){

+      fprintf(stderr,"Loading of %s failed.  Giving up.\n", BZ2_LIBNAME);

+      exit(1);

+   }

+   printf("Loading of %s succeeded.  Library version is %s.\n",

+          BZ2_LIBNAME, BZ2_bzlibVersion() );

+#endif

+   while(++argv,--argc){

+      if(**argv =='-' || **argv=='/'){

+         char *p;

+

+         for(p=*argv+1;*p;p++){

+            if(*p=='d'){

+               decompress = 1;

+            }else if('1'<=*p && *p<='9'){

+               level = *p - '0';

+            }else{

+               usage();

+               exit(1);

+            }

+         }

+      }else{

+         break;

+      }

+   }

+   if(argc>=1){

+      fn_r = *argv;

+      argc--;argv++;

+   }else{

+      fn_r = NULL;

+   }

+   if(argc>=1){

+      fn_w = *argv;

+      argc--;argv++;

+   }else{

+      fn_w = NULL;

+   }

+   {

+      int len;

+      char buff[0x1000];

+      char mode[10];

+

+      if(decompress){

+         BZFILE *BZ2fp_r = NULL;

+         FILE *fp_w = NULL;

+

+         if(fn_w){

+            if((fp_w = fopen(fn_w,"wb"))==NULL){

+               printf("can't open [%s]\n",fn_w);

+               perror("reason:");

+               exit(1);

+            }

+         }else{

+            fp_w = stdout;

+         }

+         if((BZ2fp_r == NULL && (BZ2fp_r = BZ2_bzdopen(fileno(stdin),"rb"))==NULL)

+            || (BZ2fp_r != NULL && (BZ2fp_r = BZ2_bzopen(fn_r,"rb"))==NULL)){

+            printf("can't bz2openstream\n");

+            exit(1);

+         }

+         while((len=BZ2_bzread(BZ2fp_r,buff,0x1000))>0){

+            fwrite(buff,1,len,fp_w);

+         }

+         BZ2_bzclose(BZ2fp_r);

+         if(fp_w != stdout) fclose(fp_w);

+      }else{

+         BZFILE *BZ2fp_w = NULL;

+         FILE *fp_r = NULL;

+

+         if(fn_r){

+            if((fp_r = fopen(fn_r,"rb"))==NULL){

+               printf("can't open [%s]\n",fn_r);

+               perror("reason:");

+               exit(1);

+            }

+         }else{

+            fp_r = stdin;

+         }

+         mode[0]='w';

+         mode[1] = '0' + level;

+         mode[2] = '\0';

+

+         if((fn_w == NULL && (BZ2fp_w = BZ2_bzdopen(fileno(stdout),mode))==NULL)

+            || (fn_w !=NULL && (BZ2fp_w = BZ2_bzopen(fn_w,mode))==NULL)){

+            printf("can't bz2openstream\n");

+            exit(1);

+         }

+         while((len=fread(buff,1,0x1000,fp_r))>0){

+            BZ2_bzwrite(BZ2fp_w,buff,len);

+         }

+         BZ2_bzclose(BZ2fp_w);

+         if(fp_r!=stdin)fclose(fp_r);

+      }

+   }

+#ifdef _WIN32

+   BZ2DLLFreeLibrary();

+#endif

+   return 0;

+}

diff --git a/bzip2/dlltest.dsp b/bzip2/dlltest.dsp
new file mode 100644
index 000000000..4b1615edc
--- /dev/null
+++ b/bzip2/dlltest.dsp
@@ -0,0 +1,93 @@
+# Microsoft Developer Studio Project File - Name="dlltest" - Package Owner=<4>

+# Microsoft Developer Studio Generated Build File, Format Version 5.00

+# ** •Ò�W‚µ‚È‚¢‚Å‚­‚¾‚³‚¢ **

+

+# TARGTYPE "Win32 (x86) Console Application" 0x0103

+

+CFG=dlltest - Win32 Debug

+!MESSAGE ‚±‚ê‚Í—LŒø‚ÈÒ²¸Ì§²Ù‚Å‚Í‚ ‚è‚Ü‚¹‚ñ�B ‚±‚ÌÌßÛ¼Þª¸Ä‚ðËÞÙÄÞ‚·‚邽‚ß‚É‚Í NMAKE ‚ðŽg—p‚µ‚Ä‚­‚¾‚³‚¢�B

+!MESSAGE [Ò²¸Ì§²Ù‚Ì´¸½Îß°Ä] ºÏÝÄÞ‚ðŽg—p‚µ‚ÄŽÀ�s‚µ‚Ä‚­‚¾‚³‚¢

+!MESSAGE 

+!MESSAGE NMAKE /f "dlltest.mak".

+!MESSAGE 

+!MESSAGE NMAKE ‚ÌŽÀ�sŽž‚É�\�¬‚ðŽw’è‚Å‚«‚Ü‚·

+!MESSAGE ºÏÝÄÞ ×²Ý�ã‚ÅϸۂÌ�Ý’è‚ð’è‹`‚µ‚Ü‚·�B—á:

+!MESSAGE 

+!MESSAGE NMAKE /f "dlltest.mak" CFG="dlltest - Win32 Debug"

+!MESSAGE 

+!MESSAGE ‘I‘ð‰Â”\‚ÈËÞÙÄÞ Ó°ÄÞ:

+!MESSAGE 

+!MESSAGE "dlltest - Win32 Release" ("Win32 (x86) Console Application" —p)

+!MESSAGE "dlltest - Win32 Debug" ("Win32 (x86) Console Application" —p)

+!MESSAGE 

+

+# Begin Project

+# PROP Scc_ProjName ""

+# PROP Scc_LocalPath ""

+CPP=cl.exe

+RSC=rc.exe

+

+!IF  "$(CFG)" == "dlltest - Win32 Release"

+

+# PROP BASE Use_MFC 0

+# PROP BASE Use_Debug_Libraries 0

+# PROP BASE Output_Dir "Release"

+# PROP BASE Intermediate_Dir "Release"

+# PROP BASE Target_Dir ""

+# PROP Use_MFC 0

+# PROP Use_Debug_Libraries 0

+# PROP Output_Dir "Release"

+# PROP Intermediate_Dir "Release"

+# PROP Ignore_Export_Lib 0

+# PROP Target_Dir ""

+# ADD BASE CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c

+# ADD CPP /nologo /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c

+# ADD BASE RSC /l 0x411 /d "NDEBUG"

+# ADD RSC /l 0x411 /d "NDEBUG"

+BSC32=bscmake.exe

+# ADD BASE BSC32 /nologo

+# ADD BSC32 /nologo

+LINK32=link.exe

+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /machine:I386

+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /machine:I386 /out:"minibz2.exe"

+

+!ELSEIF  "$(CFG)" == "dlltest - Win32 Debug"

+

+# PROP BASE Use_MFC 0

+# PROP BASE Use_Debug_Libraries 1

+# PROP BASE Output_Dir "dlltest_"

+# PROP BASE Intermediate_Dir "dlltest_"

+# PROP BASE Target_Dir ""

+# PROP Use_MFC 0

+# PROP Use_Debug_Libraries 1

+# PROP Output_Dir "dlltest_"

+# PROP Intermediate_Dir "dlltest_"

+# PROP Ignore_Export_Lib 0

+# PROP Target_Dir ""

+# ADD BASE CPP /nologo /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c

+# ADD CPP /nologo /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_CONSOLE" /D "_MBCS" /YX /FD /c

+# ADD BASE RSC /l 0x411 /d "_DEBUG"

+# ADD RSC /l 0x411 /d "_DEBUG"

+BSC32=bscmake.exe

+# ADD BASE BSC32 /nologo

+# ADD BSC32 /nologo

+LINK32=link.exe

+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /debug /machine:I386 /pdbtype:sept

+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:console /debug /machine:I386 /out:"minibz2.exe" /pdbtype:sept

+

+!ENDIF 

+

+# Begin Target

+

+# Name "dlltest - Win32 Release"

+# Name "dlltest - Win32 Debug"

+# Begin Source File

+

+SOURCE=.\bzlib.h

+# End Source File

+# Begin Source File

+

+SOURCE=.\dlltest.c

+# End Source File

+# End Target

+# End Project

diff --git a/bzip2/huffman.c b/bzip2/huffman.c
new file mode 100644
index 000000000..9b446c4b3
--- /dev/null
+++ b/bzip2/huffman.c
@@ -0,0 +1,228 @@
+
+/*-------------------------------------------------------------*/
+/*--- Huffman coding low-level stuff                        ---*/
+/*---                                             huffman.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+
+#include "bzlib_private.h"
+
+/*---------------------------------------------------*/
+#define WEIGHTOF(zz0)  ((zz0) & 0xffffff00)
+#define DEPTHOF(zz1)   ((zz1) & 0x000000ff)
+#define MYMAX(zz2,zz3) ((zz2) > (zz3) ? (zz2) : (zz3))
+
+#define ADDWEIGHTS(zw1,zw2)                           \
+   (WEIGHTOF(zw1)+WEIGHTOF(zw2)) |                    \
+   (1 + MYMAX(DEPTHOF(zw1),DEPTHOF(zw2)))
+
+#define UPHEAP(z)                                     \
+{                                                     \
+   Int32 zz, tmp;                                     \
+   zz = z; tmp = heap[zz];                            \
+   while (weight[tmp] < weight[heap[zz >> 1]]) {      \
+      heap[zz] = heap[zz >> 1];                       \
+      zz >>= 1;                                       \
+   }                                                  \
+   heap[zz] = tmp;                                    \
+}
+
+#define DOWNHEAP(z)                                   \
+{                                                     \
+   Int32 zz, yy, tmp;                                 \
+   zz = z; tmp = heap[zz];                            \
+   while (True) {                                     \
+      yy = zz << 1;                                   \
+      if (yy > nHeap) break;                          \
+      if (yy < nHeap &&                               \
+          weight[heap[yy+1]] < weight[heap[yy]])      \
+         yy++;                                        \
+      if (weight[tmp] < weight[heap[yy]]) break;      \
+      heap[zz] = heap[yy];                            \
+      zz = yy;                                        \
+   }                                                  \
+   heap[zz] = tmp;                                    \
+}
+
+
+/*---------------------------------------------------*/
+void BZ2_hbMakeCodeLengths ( UChar *len, 
+                             Int32 *freq,
+                             Int32 alphaSize,
+                             Int32 maxLen )
+{
+   /*--
+      Nodes and heap entries run from 1.  Entry 0
+      for both the heap and nodes is a sentinel.
+   --*/
+   Int32 nNodes, nHeap, n1, n2, i, j, k;
+   Bool  tooLong;
+
+   Int32 heap   [ BZ_MAX_ALPHA_SIZE + 2 ];
+   Int32 weight [ BZ_MAX_ALPHA_SIZE * 2 ];
+   Int32 parent [ BZ_MAX_ALPHA_SIZE * 2 ]; 
+
+   for (i = 0; i < alphaSize; i++)
+      weight[i+1] = (freq[i] == 0 ? 1 : freq[i]) << 8;
+
+   while (True) {
+
+      nNodes = alphaSize;
+      nHeap = 0;
+
+      heap[0] = 0;
+      weight[0] = 0;
+      parent[0] = -2;
+
+      for (i = 1; i <= alphaSize; i++) {
+         parent[i] = -1;
+         nHeap++;
+         heap[nHeap] = i;
+         UPHEAP(nHeap);
+      }
+
+      AssertH( nHeap < (BZ_MAX_ALPHA_SIZE+2), 2001 );
+   
+      while (nHeap > 1) {
+         n1 = heap[1]; heap[1] = heap[nHeap]; nHeap--; DOWNHEAP(1);
+         n2 = heap[1]; heap[1] = heap[nHeap]; nHeap--; DOWNHEAP(1);
+         nNodes++;
+         parent[n1] = parent[n2] = nNodes;
+         weight[nNodes] = ADDWEIGHTS(weight[n1], weight[n2]);
+         parent[nNodes] = -1;
+         nHeap++;
+         heap[nHeap] = nNodes;
+         UPHEAP(nHeap);
+      }
+
+      AssertH( nNodes < (BZ_MAX_ALPHA_SIZE * 2), 2002 );
+
+      tooLong = False;
+      for (i = 1; i <= alphaSize; i++) {
+         j = 0;
+         k = i;
+         while (parent[k] >= 0) { k = parent[k]; j++; }
+         len[i-1] = j;
+         if (j > maxLen) tooLong = True;
+      }
+      
+      if (! tooLong) break;
+
+      for (i = 1; i < alphaSize; i++) {
+         j = weight[i] >> 8;
+         j = 1 + (j / 2);
+         weight[i] = j << 8;
+      }
+   }
+}
+
+
+/*---------------------------------------------------*/
+void BZ2_hbAssignCodes ( Int32 *code,
+                         UChar *length,
+                         Int32 minLen,
+                         Int32 maxLen,
+                         Int32 alphaSize )
+{
+   Int32 n, vec, i;
+
+   vec = 0;
+   for (n = minLen; n <= maxLen; n++) {
+      for (i = 0; i < alphaSize; i++)
+         if (length[i] == n) { code[i] = vec; vec++; };
+      vec <<= 1;
+   }
+}
+
+
+/*---------------------------------------------------*/
+void BZ2_hbCreateDecodeTables ( Int32 *limit,
+                                Int32 *base,
+                                Int32 *perm,
+                                UChar *length,
+                                Int32 minLen,
+                                Int32 maxLen,
+                                Int32 alphaSize )
+{
+   Int32 pp, i, j, vec;
+
+   pp = 0;
+   for (i = minLen; i <= maxLen; i++)
+      for (j = 0; j < alphaSize; j++)
+         if (length[j] == i) { perm[pp] = j; pp++; };
+
+   for (i = 0; i < BZ_MAX_CODE_LEN; i++) base[i] = 0;
+   for (i = 0; i < alphaSize; i++) base[length[i]+1]++;
+
+   for (i = 1; i < BZ_MAX_CODE_LEN; i++) base[i] += base[i-1];
+
+   for (i = 0; i < BZ_MAX_CODE_LEN; i++) limit[i] = 0;
+   vec = 0;
+
+   for (i = minLen; i <= maxLen; i++) {
+      vec += (base[i+1] - base[i]);
+      limit[i] = vec-1;
+      vec <<= 1;
+   }
+   for (i = minLen + 1; i <= maxLen; i++)
+      base[i] = ((limit[i-1] + 1) << 1) - base[i];
+}
+
+
+/*-------------------------------------------------------------*/
+/*--- end                                         huffman.c ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/libbz2.def b/bzip2/libbz2.def
new file mode 100644
index 000000000..2dc0dd891
--- /dev/null
+++ b/bzip2/libbz2.def
@@ -0,0 +1,27 @@
+LIBRARY			LIBBZ2

+DESCRIPTION		"libbzip2: library for data compression"

+EXPORTS

+	BZ2_bzCompressInit

+	BZ2_bzCompress

+	BZ2_bzCompressEnd

+	BZ2_bzDecompressInit

+	BZ2_bzDecompress

+	BZ2_bzDecompressEnd

+	BZ2_bzReadOpen

+	BZ2_bzReadClose

+	BZ2_bzReadGetUnused

+	BZ2_bzRead

+	BZ2_bzWriteOpen

+	BZ2_bzWrite

+	BZ2_bzWriteClose

+	BZ2_bzWriteClose64

+	BZ2_bzBuffToBuffCompress

+	BZ2_bzBuffToBuffDecompress

+	BZ2_bzlibVersion

+	BZ2_bzopen

+	BZ2_bzdopen

+	BZ2_bzread

+	BZ2_bzwrite

+	BZ2_bzflush

+	BZ2_bzclose

+	BZ2_bzerror

diff --git a/bzip2/libbz2.dsp b/bzip2/libbz2.dsp
new file mode 100644
index 000000000..a21a20f75
--- /dev/null
+++ b/bzip2/libbz2.dsp
@@ -0,0 +1,130 @@
+# Microsoft Developer Studio Project File - Name="libbz2" - Package Owner=<4>

+# Microsoft Developer Studio Generated Build File, Format Version 5.00

+# ** •Ò�W‚µ‚È‚¢‚Å‚­‚¾‚³‚¢ **

+

+# TARGTYPE "Win32 (x86) Dynamic-Link Library" 0x0102

+

+CFG=libbz2 - Win32 Debug

+!MESSAGE ‚±‚ê‚Í—LŒø‚ÈÒ²¸Ì§²Ù‚Å‚Í‚ ‚è‚Ü‚¹‚ñ�B ‚±‚ÌÌßÛ¼Þª¸Ä‚ðËÞÙÄÞ‚·‚邽‚ß‚É‚Í NMAKE ‚ðŽg—p‚µ‚Ä‚­‚¾‚³‚¢�B

+!MESSAGE [Ò²¸Ì§²Ù‚Ì´¸½Îß°Ä] ºÏÝÄÞ‚ðŽg—p‚µ‚ÄŽÀ�s‚µ‚Ä‚­‚¾‚³‚¢

+!MESSAGE 

+!MESSAGE NMAKE /f "libbz2.mak".

+!MESSAGE 

+!MESSAGE NMAKE ‚ÌŽÀ�sŽž‚É�\�¬‚ðŽw’è‚Å‚«‚Ü‚·

+!MESSAGE ºÏÝÄÞ ×²Ý�ã‚ÅϸۂÌ�Ý’è‚ð’è‹`‚µ‚Ü‚·�B—á:

+!MESSAGE 

+!MESSAGE NMAKE /f "libbz2.mak" CFG="libbz2 - Win32 Debug"

+!MESSAGE 

+!MESSAGE ‘I‘ð‰Â”\‚ÈËÞÙÄÞ Ó°ÄÞ:

+!MESSAGE 

+!MESSAGE "libbz2 - Win32 Release" ("Win32 (x86) Dynamic-Link Library" —p)

+!MESSAGE "libbz2 - Win32 Debug" ("Win32 (x86) Dynamic-Link Library" —p)

+!MESSAGE 

+

+# Begin Project

+# PROP Scc_ProjName ""

+# PROP Scc_LocalPath ""

+CPP=cl.exe

+MTL=midl.exe

+RSC=rc.exe

+

+!IF  "$(CFG)" == "libbz2 - Win32 Release"

+

+# PROP BASE Use_MFC 0

+# PROP BASE Use_Debug_Libraries 0

+# PROP BASE Output_Dir "Release"

+# PROP BASE Intermediate_Dir "Release"

+# PROP BASE Target_Dir ""

+# PROP Use_MFC 0

+# PROP Use_Debug_Libraries 0

+# PROP Output_Dir "Release"

+# PROP Intermediate_Dir "Release"

+# PROP Ignore_Export_Lib 0

+# PROP Target_Dir ""

+# ADD BASE CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /FD /c

+# ADD CPP /nologo /MT /W3 /GX /O2 /D "WIN32" /D "NDEBUG" /D "_WINDOWS" /YX /FD /c

+# ADD BASE MTL /nologo /D "NDEBUG" /mktyplib203 /o NUL /win32

+# ADD MTL /nologo /D "NDEBUG" /mktyplib203 /o NUL /win32

+# ADD BASE RSC /l 0x411 /d "NDEBUG"

+# ADD RSC /l 0x411 /d "NDEBUG"

+BSC32=bscmake.exe

+# ADD BASE BSC32 /nologo

+# ADD BSC32 /nologo

+LINK32=link.exe

+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386

+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /machine:I386 /out:"libbz2.dll"

+

+!ELSEIF  "$(CFG)" == "libbz2 - Win32 Debug"

+

+# PROP BASE Use_MFC 0

+# PROP BASE Use_Debug_Libraries 1

+# PROP BASE Output_Dir "Debug"

+# PROP BASE Intermediate_Dir "Debug"

+# PROP BASE Target_Dir ""

+# PROP Use_MFC 0

+# PROP Use_Debug_Libraries 1

+# PROP Output_Dir "Debug"

+# PROP Intermediate_Dir "Debug"

+# PROP Ignore_Export_Lib 0

+# PROP Target_Dir ""

+# ADD BASE CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /FD /c

+# ADD CPP /nologo /MTd /W3 /Gm /GX /Zi /Od /D "WIN32" /D "_DEBUG" /D "_WINDOWS" /YX /FD /c

+# ADD BASE MTL /nologo /D "_DEBUG" /mktyplib203 /o NUL /win32

+# ADD MTL /nologo /D "_DEBUG" /mktyplib203 /o NUL /win32

+# ADD BASE RSC /l 0x411 /d "_DEBUG"

+# ADD RSC /l 0x411 /d "_DEBUG"

+BSC32=bscmake.exe

+# ADD BASE BSC32 /nologo

+# ADD BSC32 /nologo

+LINK32=link.exe

+# ADD BASE LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 /pdbtype:sept

+# ADD LINK32 kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib odbc32.lib odbccp32.lib /nologo /subsystem:windows /dll /debug /machine:I386 /out:"libbz2.dll" /pdbtype:sept

+

+!ENDIF 

+

+# Begin Target

+

+# Name "libbz2 - Win32 Release"

+# Name "libbz2 - Win32 Debug"

+# Begin Source File

+

+SOURCE=.\blocksort.c

+# End Source File

+# Begin Source File

+

+SOURCE=.\bzlib.c

+# End Source File

+# Begin Source File

+

+SOURCE=.\bzlib.h

+# End Source File

+# Begin Source File

+

+SOURCE=.\bzlib_private.h

+# End Source File

+# Begin Source File

+

+SOURCE=.\compress.c

+# End Source File

+# Begin Source File

+

+SOURCE=.\crctable.c

+# End Source File

+# Begin Source File

+

+SOURCE=.\decompress.c

+# End Source File

+# Begin Source File

+

+SOURCE=.\huffman.c

+# End Source File

+# Begin Source File

+

+SOURCE=.\libbz2.def

+# End Source File

+# Begin Source File

+

+SOURCE=.\randtable.c

+# End Source File

+# End Target

+# End Project

diff --git a/bzip2/makefile.msc b/bzip2/makefile.msc
new file mode 100644
index 000000000..3fe42324a
--- /dev/null
+++ b/bzip2/makefile.msc
@@ -0,0 +1,63 @@
+# Makefile for Microsoft Visual C++ 6.0

+# usage: nmake -f makefile.msc

+# K.M. Syring (syring@gsf.de)

+# Fixed up by JRS for bzip2-0.9.5d release.

+

+CC=cl

+CFLAGS= -DWIN32 -MD -Ox -D_FILE_OFFSET_BITS=64

+

+OBJS= blocksort.obj  \

+      huffman.obj    \

+      crctable.obj   \

+      randtable.obj  \

+      compress.obj   \

+      decompress.obj \

+      bzlib.obj

+

+all: lib bzip2 test

+

+bzip2: lib

+	$(CC) $(CFLAGS) -o bzip2 bzip2.c libbz2.lib setargv.obj

+	$(CC) $(CFLAGS) -o bzip2recover bzip2recover.c

+

+lib: $(OBJS)

+	lib /out:libbz2.lib $(OBJS)

+

+test: bzip2

+	type words1

+	.\\bzip2 -1  < sample1.ref > sample1.rb2

+	.\\bzip2 -2  < sample2.ref > sample2.rb2

+	.\\bzip2 -3  < sample3.ref > sample3.rb2

+	.\\bzip2 -d  < sample1.bz2 > sample1.tst

+	.\\bzip2 -d  < sample2.bz2 > sample2.tst

+	.\\bzip2 -ds < sample3.bz2 > sample3.tst

+	@echo All six of the fc's should find no differences.

+	@echo If fc finds an error on sample3.bz2, this could be

+	@echo because WinZip's 'TAR file smart CR/LF conversion'

+	@echo is too clever for its own good.  Disable this option.

+	@echo The correct size for sample3.ref is 120,244.  If it

+	@echo is 150,251, WinZip has messed it up.

+	fc sample1.bz2 sample1.rb2 

+	fc sample2.bz2 sample2.rb2

+	fc sample3.bz2 sample3.rb2

+	fc sample1.tst sample1.ref

+	fc sample2.tst sample2.ref

+	fc sample3.tst sample3.ref

+

+

+

+clean: 

+	del *.obj

+	del libbz2.lib 

+	del bzip2.exe

+	del bzip2recover.exe

+	del sample1.rb2 

+	del sample2.rb2 

+	del sample3.rb2

+	del sample1.tst 

+	del sample2.tst

+	del sample3.tst

+

+.c.obj: 

+	$(CC) $(CFLAGS) -c $*.c -o $*.obj

+

diff --git a/bzip2/manual.ps b/bzip2/manual.ps
new file mode 100644
index 000000000..1a7dbac85
--- /dev/null
+++ b/bzip2/manual.ps
@@ -0,0 +1,3808 @@
+%!PS-Adobe-2.0
+%%Creator: dvips(k) 5.78 Copyright 1998 Radical Eye Software (www.radicaleye.com)
+%%Title: manual.dvi
+%%Pages: 39
+%%PageOrder: Ascend
+%%BoundingBox: 0 0 596 842
+%%EndComments
+%DVIPSCommandLine: dvips -o manual.ps manual.dvi
+%DVIPSParameters: dpi=600, compressed
+%DVIPSSource:  TeX output 2000.03.23:2343
+%%BeginProcSet: texc.pro
+%!
+/TeXDict 300 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N
+/X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72
+mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1}
+ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale
+isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div
+hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul
+TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if}
+forall round exch round exch]setmatrix}N /@landscape{/isls true N}B
+/@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B
+/FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{
+/nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N
+string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N
+end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{
+/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0]
+N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup
+length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{
+128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub
+get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data
+dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N
+/rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup
+/base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx
+0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff
+setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff
+.1 sub]/id ch-image N /rw ch-width 7 add 8 idiv string N /rc 0 N /gp 0 N
+/cp 0 N{rc 0 ne{rc 1 sub /rc X rw}{G}ifelse}imagemask restore}B /G{{id
+gp get /gp gp 1 add N dup 18 mod S 18 idiv pl S get exec}loop}B /adv{cp
+add /cp X}B /chg{rw cp id gp 4 index getinterval putinterval dup gp add
+/gp X adv}B /nd{/cp 0 N rw exit}B /lsh{rw cp 2 copy get dup 0 eq{pop 1}{
+dup 255 eq{pop 254}{dup dup add 255 and S 1 and or}ifelse}ifelse put 1
+adv}B /rsh{rw cp 2 copy get dup 0 eq{pop 128}{dup 255 eq{pop 127}{dup 2
+idiv S 128 and or}ifelse}ifelse put 1 adv}B /clr{rw cp 2 index string
+putinterval adv}B /set{rw cp fillstr 0 4 index getinterval putinterval
+adv}B /fillstr 18 string 0 1 17{2 copy 255 put pop}for N /pl[{adv 1 chg}
+{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{
+adv rsh nd}{1 add adv}{/rc X nd}{1 add set}{1 add clr}{adv 2 chg}{adv 2
+chg nd}{pop nd}]dup{bind pop}forall N /D{/cc X dup type /stringtype ne{]
+}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup
+length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{
+cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin
+0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul
+add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore userdict
+/eop-hook known{eop-hook}if showpage}N /@start{userdict /start-hook
+known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X
+/IE 256 array N 2 string 0 1 255{IE S dup 360 add 36 4 index cvrs cvn
+put}for pop 65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N
+/RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley
+X /rulex X V}B /V{}B /RV statusdict begin /product where{pop false[
+(Display)(NeXT)(LaserWriter 16/600)]{dup length product length le{dup
+length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}
+forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false
+RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1
+false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform
+round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg
+rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail
+{dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M}
+B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{
+4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{
+p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p
+a}B /bos{/SS save N}B /eos{SS restore}B end
+
+%%EndProcSet
+TeXDict begin 39158280 55380996 1000 600 600 (manual.dvi)
+@start
+%DVIPSBitmapFont: Fa cmti10 10.95 1
+/Fa 1 47 df<120FEA3FC0127FA212FFA31380EA7F00123C0A0A77891C>46
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fb cmbxti10 14.4 1
+/Fb 1 47 df<13FCEA03FF000F13804813C05AA25AA2B5FCA31480A214006C5A6C5A6C5A
+EA0FE0121271912B>46 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fc cmsl10 10.95 25
+/Fc 25 122 df<D901F8160CD907FE161ED91F07163E90263E0380157E017C6D15FC496C
+6CEC03F8D801F06DEC07F00003D900FCEC1FE04901EFEC7FC00007913AE3E007EF804901
+E0B5129F000F913A701FF83F0093C7127E48485E604D5A03F01303003F4A495A90C74A5A
+4D5A4DC7FC0201143E4B5B17FC4C5A003E4948485A4C5A003F01075C6C4A485A020E131F
+021E49C8FC6C6C48137E02385B3A07C0F001F82603E1E05B3A00FF8003E090263E000714
+7E90C73A0FC001FF80923A1F8007C1C0923A3F000F80E0033E90381F00F04B013E137003
+FC4913784A4801FC13384A485B913807E001DA0FC05BDB8003141CEC1F004A495A147E5C
+4948163C4948010F14384A5C495A130F4948167849C71570137E017C17F0494B13E01201
+4848EDC0014848020714C04848EE03804848160790C83903E00F00003E170E007E923801
+F03C486F6C5A48EE3FE00070EE0F803F4975C34C>37 D<EA0780EA0FE0EA1FF0123FA512
+1FEA0F301200A213701360A213E013C0120113801203EA07001206120E5A5A5A5A5A0C1C
+7A8919>44 D<EC07F8EC3FFF9138FC0FC0903903F003E0903907C001F0D90F8013F849C7
+FC013E14FC017E147C017C147E13FC485AA20003157F5B1207A2120F5BA2121F16FF5BA2
+123FA44848EB01FEA648C7EA03FCA5ED07F8A25A16F0A2150F16E0A3ED1FC0A21680007E
+143F1600157E123E003F5C4A5AD81F805B000FEB07E06C6C485A2603F03FC7FC3800FFFC
+EB1FE0283F79BC2D>48 D<157015F014011407143F903803FFE0137FEBFFCFEBF80F1300
+141F15C0A5143F1580A5147F1500A55C5CA513015CA513035CA513075CA5130F5CA3131F
+497EB612F8A31D3D78BC2D>I<133C137F5B481380A31400A26C5A137890C7FCB3EA0780
+EA0FE0121F123FA5121FEA0F601200A213E05BA212015B120390C7FC5A1206120E5A5A12
+3012705A5A11397AA619>59 D<EC7FC0903803FFF890380FC07E90383E003F496D7E01FF
+6D7E82A248140782A26C5A137890C7120FA25EA2EC03FF147F903807FF1FEB1FE0D97F80
+5B3801FE00EA03F8485A4848133F485A003F5D49EC81C048C7FCA2157F48ED03804814FF
+A2007F5B913903BF0700903880073F3A3FC00E1F8E260FE03C13FC3A03FFF00FF83A007F
+C003E02A2A7CA82D>97 D<EB3F80EA1FFFA3C6FC137FA291C9FCA55B5BA512015BA4EC07
+F80003EB3FFF9039F8F80FC09039FBE003E09039FF8001F891C77E5B4848147E49147F5B
+821780A2120F5B17C0A3167F001F16805BA4EEFF00123F5B4B5AA24B5A5E007F4A5AA24B
+5A6D495A4BC7FCD87CE0137E39F87001F839F03C07E039E00FFF80260003FCC8FC2A4077
+BE33>I<EC1FF0ECFFFE903903F01F8090390FC003C0D93F0013E0017E130F49131F0001
+15F04848EB3FE0485AA24848EB1FC0001FEC0F004990C7FC123FA2485AA412FF90C9FCA9
+6CEC0380150716006C6C5B151E001F5C6C6C5B6C6C5B6C6C485A3901F80F8026007FFEC7
+FCEB0FF0242A7AA828>I<EE03F8ED01FFA3ED000F1607A217F0A4160FA217E0A4161FA2
+17C0A491380FF03FECFFFC902603F81F138090390FC007BF90391F8003FF90387E000149
+7F0001157F48481500485A120F5B001F5D485A5E5B127FA2150112FF90C75BA41503A25E
+A37E1507A26C4A5A7F001F141F6C6C133F6C6CEBFFF83B03F001EFFFC03900F80F8F9038
+3FFE0FD90FF0EBE0002D407ABE33>I<EC3FE0903801FFF8903807E07E90380F801F9039
+3F000F80017E14C049EB07E0485A12034848EB03F0485AA2121F5B123FA248481307A290
+B6FCA2D8FF80C8FC90C9FCA87EED01C015036C15806D1307001FEC0F006D131E000F5C6C
+6C5B6C6C485A3900FC07C0D93FFFC7FCEB07F8242A7BA828>I<ED07F0ED3FFCEDFC1E91
+3803F03F4A48B4FC4A481380141FEC3F81DA7F0113008102FE137C93C7FCA213015CA513
+035CA50007B512F8A3260007F0C8FCA3130F5CA5131F5CA5133F5CA5137F91C9FCA55B5B
+A4EA03FF007F13FEB5FCA229407DBF1C>I<147FEB3FFFA313017FA25CA513015CA51303
+5CA4ED07F80107EB1FFF9139F0781FC09138F1E00F9139F38007E0ECF70002FE14F0495A
+5CA25CA24A130F131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F5B491500
+A300015D486C491380B5D8F87F13FCA32E3F7DBE33>104 D<1478EB01FE130314FFA25B
+14FE130314FCEB00F01400ACEB03F8EA01FF14F0A2EA001F130FA314E0A5131F14C0A513
+3F1480A5137F1400A55B5BA4EA03FF007F13F0A2B5FC183E7DBD1A>I<143FEB1FFF5BA2
+13017FA214FEA5130114FCA5130314F8A5130714F0A5130F14E0A5131F14C0A5133F1480
+A5137F1400A55B5BA4EA03FF007F13F8A2B5FC183F7DBE1A>108
+D<902707F007F8EB03FCD803FFD91FFF90380FFF80913CE0781FC03C0FE09126E1E00FEB
+F0073E001FE38007E1C003F090260FE700EBE38002EEDAF70013F802FC14FE02D85C14F8
+4A5CA24A5C011F020F14074A4A14F0A5013F021F140F4A4A14E0A5017F023F141F91C749
+14C0A549027F143F4992C71380A300014B147F486C496DEBFFC0B5D8F87FD9FC3F13FEA3
+47287DA74C>I<903907F007F8D803FFEB1FFF9139E0781FC09138E1E00F3B001FE38007
+E090380FE70002EE14F014FC14D814F85CA24A130F131F4A14E0A4161F133F4A14C0A416
+3F137F91C71380A4167F5B491500A300015D486C491380B5D8F87F13FCA32E287DA733>
+I<EC0FF0ECFFFE903903F01F8090390FC007C049C66C7E013E6D7E01FC6D7E4848804914
+7C0003157E485A000F157F5B121FA2485AA2007F1680A2170048C85AA54B5AA25E5A6C4A
+5A7E4B5A5E6C140F6C6C5C4B5A6C6C013EC7FC6C6C5B6C6C485A3900FC0FE090383FFF80
+D90FF8C8FC292A7BA82D>I<91387F01FE903A7FFF0FFFC09139FE3E03F09238F801F890
+3A01FFE000FE4B137F6D497F4990C713804A15C04A141FA218E0A20103150F5C18F0A317
+1F010716E05CA3173F18C0130F4A147F1880A2EFFF004C5A011F5D16034C5A6E495AEE1F
+C06E495AD93FDC017EC7FC91388F01F8913883FFE0028090C8FC92C9FC137FA291CAFCA4
+5BA25BA31201487EB512F8A3343A81A733>I<903907F01F80D803FFEB7FE09138E1E1F0
+9138E387F839001FE707EB0FE614EE02FC13F002D813E09138F801804AC7FCA25C131FA2
+5CA4133F5CA5137F91C8FCA55B5BA31201487EB512FEA325287EA724>114
+D<9138FF81C0010713E390381F807F90397C003F8049131F4848130F5B00031407A24848
+1400A27FA27F6D90C7FCEBFF8014FC6C13FF6C14C015F06C6C7F011F7F13079038007FFE
+1403140100381300157EA2123C153E157E007C147CA2007E147815F8007F495A4A5A486C
+485A26F9E01FC7FC38E0FFFC38C01FE0222A7DA824>I<EB0380A4130791C7FCA25BA25B
+A2133EA2137E13FE12011207001FB512C0B6FCA2D801FCC7FCA312035BA512075BA5120F
+5BA41407001F130E13C0A4141E141C1380A26D5AA2000F5B14F03807E1E03801FF80D800
+7EC7FC1A3978B723>I<01FE147F00FFEC7FFF4914FEA20007140300031401A34914FCA4
+150312074914F8A41507120F4914F0A4150F121F4914E0A2151FA3153F4914C0157F15FF
+EC01DF3A0FC003BFE09138073FFF3803F01E3801FFF826003FE01380282977A733>I<B5
+39E007FFF05D17E02707FE000313006C48EB01FC6F5A5E00014A5A5EA24B5A6D13070000
+92C7FC5D150E6D5B7F5DA25D1480013F5B14815D14C3011F5B02C7C8FCA214CE14EEEB0F
+FCA25CA26D5A5CA25CA26D5A2C2878A630>I<B500C3B53803FFFCA204FE14F8290FFE00
+3FE00013C0D807F86D48EB7F000003173E183C150F18386D5E0001141F705B153F4D5A15
+776D4B5A0000ECE7F04DC7FCEC01C3170E9038FF0383017F5D91380703F85FEC0E01021E
+5CD93F9C14F002BC6D5A02B813FDDAF8005B4A13FF5F6D5A94C8FC5C4A137E167C6DC7FC
+1678010E14383E2878A642>I<90B539E007FFF05E18E0902707FE000313006D48EB01FC
+705A5F01014A5A5F16036E5C0100140794C7FC160E805E805E1678ED8070023F13F05EED
+81C015C191381FC38015C793C8FC15EF15EEEC0FFCA25DA26E5AA25DA26E5A5DA24AC9FC
+5C140E141E141C5C121C003F5B5A485B495A130300FE5B4848CAFCEA701EEA783CEA3FF0
+EA0FC0343A80A630>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fd cmtt12 14.4 10
+/Fd 10 123 df<EC3FF80103B57E010F14E0013F14F84914FE48B7FC4816C048D9C01F7F
+270FFE00017F49EB007FD81FF0EC1FF848486E7E160748486E7E4914018300FF81A26D16
+80177FA36C5AA26CC9FCCAFCA217FF1800A25E5F16035F16075F160F4C5A163F4C5A5F4C
+5A4B90C7FCED07FE4B5A4B5A4B5A4B5A4B5A4A5B4A90C8FCEC0FFE4A5AEC3FF04A5A4A5A
+495B4990C9FCEB0FFC495A495A495A4948143F485B4890C8EA7F80EA0FFC485A48B8FC5A
+B9FCA36C17007E314A7AC93E>50 D<383FFF805AB57EA37E7EEA003FAEED07FC92383FFF
+8092B512E002C314F802CF8002DF8091B7FCDBF80F1380DBC00113C092C713E04A143F4A
+EC1FF04A15F84A140F4AEC07FCA217034A15FE1701A318FF83A95F18FEA280170318FC6E
+140718F86E140FEF1FF06E143F6EEC7FE06EECFFC0DBC0031380EDF01F92B6120002DF14
+FC02CF5C02C35CD91F8114C090260F807F90C7FC90C7EA0FF8384A7FC83E>98
+D<923803FFF85D4B7FA38181ED0003AEEC1FF0ECFFFE0103EBFF83010F14E34914F3017F
+14FB90B7FC48EBF80F48EBC00191C7FC4848143F4848141F5B4848140F491407123F4914
+03127F5BA312FF90C8FCA97F127FA216077F123F6D140FA26C6C141F6D143F000F157F6C
+6C14FF01FF5B6C6D5A6CD9F01FEBFFFC6C90B500FB13FE6D02F313FF6D14E3010F14C36D
+020113FE010101FC14FC9026003FE0C8FC384A7CC83E>100 D<143E147F4A7E497FA56D
+5B6EC8FC143E91C9FCAC003FB57E5A81A47EC7123FB3B3007FB71280B812C0A56C16802A
+4A76C93E>105 D<007FB512C0B6FC81A47EC7121FB3B3B3A5007FB712F8B812FCA56C16
+F82E4978C83E>108 D<EC1FF0ECFFFE01036D7E010F14E04980017F14FC90B67E489038
+F01FFFECC00748D90001138048486D13C04848EC7FE049143F4848EC1FF049140F003F16
+F8491407A24848EC03FCA448C8EA01FEAA6D1403007F16FCA26D1407A2003F16F86D140F
+6C6CEC1FF0A26C6CEC3FE06D147F6C6CECFFC06D5B6CD9C00713806CD9F01F13006C90B5
+5A6D5C6D5C010F14E001031480010049C7FCEC1FF02F3679B43E>111
+D<ED07FC3B3FFF803FFF804891B512E0B500C314F802CF8002DF806C90B7FC6CDAF80F13
+80D8003FD9C00113C092C713E04A143F4AEC1FF04A15F84A140F4AEC07FCA217034A15FE
+1701A318FF83A95F18FEA280170318FC6E140718F86E140FEF1FF06E143F6EEC7FE06EEC
+FFC0DBC0031380EDF01F92B6120002DF14FC02CF5C02C35C02C114C0DAC07F90C7FCED0F
+F892C9FCB3003FB512C04880B67EA36C5C6C5C384F7FB33E>I<903901FFF00F011F9038
+FE1F8090B612BF000315FF5A5A5A393FFE003F01F01307D87FC0130190C8FC5A48157FA4
+7EEE3F00D87FC091C7FC13F0EA3FFE381FFFF06CEBFFC06C14FE6C6E7EC615E0013F14F8
+010780D9003F7F02007F03071380030013C0003EED3FE0007F151F48150F17F06D1407A3
+7FA26D140F6D15E0161F01FCEC3FC06D14FF9026FFC00F138091B612005E485D013F5C6D
+14E0D8FC0714802778007FF8C7FC2C3677B43E>115 D<147C14FC497EAD003FB712FC5A
+B87EA36C5EA2260001FEC9FCB3A6173FA2EF7F80A76E14FF6D16006F5A9238C007FE9138
+7FF01F92B55A6E5C6E5C6E5C6E1480020149C7FC9138003FF031437DC13E>I<000FB812
+804817C04817E0A418C001C0C712014C13804C1300EE1FFE4C5AEE7FF06C484A5A4B5BC8
+485B4B90C7FC4B5A4B5A4B5A4B5A4B5A4A5B4A5B4A90C8FC4A5A4A5A4A5A4A5A4A5A495B
+495B4990C9FC495A495A4948EC0FC0495A4948EC1FE0485B00075B4890C8FCEA1FFC485A
+485A90B8FCB9FCA46C17C07E33337CB23E>122 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fe cmtt12 13.14 31
+/Fe 31 123 df<ECFFE0010713FC011FEBFF80017F14E048B67E48814815FE489038007F
+FF01F8130748480101138048489038007FC049EC3FE04848141F90C8120F17F048150717
+F87F1603A36CC8FC123EC9FCA2160717F0A2160F17E0161F17C0163FEE7F80A2EEFF004B
+5A15034B5A4B5A4B5AED7FE04B5A4A5B4A90C7FC4A5AEC1FF84A5A4A5A4A5A495BD907FE
+C8FC495A495A495A495A2601FF80EB01F04890C7EA03F8485A485A485A48B7FC5AB8FCA3
+7E6C16F02D447BC338>50 D<003FB6FC4815E0B712F882826C816C16802701FC000113C0
+9238007FE0161FEE0FF0A2160717F81603A6160717F0A2160FEE1FE0163FEE7FC0923801
+FF80030F130090B65A5E16F08216FEEEFF8017C001FCC7EA7FE0EE1FF0EE07F8160317FC
+EE01FE1600A217FF177FA717FF17FE16011603EE07FC160FEE3FF8EEFFF0003FB7FC4816
+E0B812C01780EEFE006C15F86C15C030437DC238>66 D<DA07FC133C91393FFF807E91B5
+12E00103ECF8FE4914FC4914FF5B90383FFE0390387FF000D9FFC0133F4849131F91C712
+0F48481407485A49140348481401A2485AA248481400A25BA2007F167C90CAFCA35A5AAD
+7E7EA37F003F167C17FE7FA26C7EA26C6C140117FC6C7E6D14036C6C15F86C6C14076EEB
+0FF06C6D131FD97FF0EB7FE0903A3FFE03FFC06DB612806D15006D5C6D5C010014F0023F
+13C0DA07FCC7FC2F457CC338>I<007FB512F8B7FC16C08216F8826C813A03F8001FFF15
+07030113806F13C0167FEE3FE0161FEE0FF0A2EE07F8A2EE03FCA21601A217FE1600A417
+7FAD17FF17FEA4160117FCA2160317F81607A2EE0FF0161FEE3FE0167FEEFFC04B13805D
+031F1300007FB65AB75A5E5E16C093C7FC6C14F830437DC238>I<007FB712FCB87EA57E
+D801FCC8FCA9177C94C7FCA6ED07C04B7EA590B6FCA79038FC000FA56F5A92C9FCA7EF0F
+80EF1FC0AA007FB8FCB9FCA56C178032437DC238>I<91391FF003C091397FFC07E049B5
+FC010714CF4914EF4914FF5B90387FF81F9038FFE00748EB800191C7FC4848147F485A49
+143F485A161F485AA249140F123F5BA2127F90C8EA07C093C7FCA35A5AAA923807FFFC4B
+13FE4B13FF7E7E6F13FE6F13FC9238000FE07F003F151FA27F121F7F163F6C7EA26C6C14
+7F7F6C6C14FF6C6C5B6E5A6C6D5A90387FF81F6DB6FC6D14EF6D14CF6D148F0101140F90
+3A007FFC07C0DA1FF0C7FC30457CC338>71 D<007FB612F0B712F8A56C15F0260001FCC7
+FCB3B3B1007FB612F0B712F8A56C15F0254377C238>73 D<90380FFFFE90B612E0000315
+F8488148814881A2273FFE000F138001F01301497F49147F4848EC3FC0A290C8121FA448
+16E0A248150FB3AC6C151FA36C16C0A36D143FA36C6CEC7F806D14FF6D5B01FE130F6CB7
+1200A26C5D6C5D6C5DC615E0010F49C7FC2B457AC338>79 D<003FB512F04814FEB77E16
+E0826C816C813A01FC003FFEED07FF03017F81707E163F161F83160FA7161F5F163F167F
+4C5A5D030790C7FCED3FFE90B65A5E5E5EA282829038FC001FED07FC6F7E150115008282
+AA18E0EF01F0EF03F8A31783EE3F87263FFFE0ECC7F0486D14FFB56C7F18E07013C06C49
+6D13806C496D1300CA12FC35447EC238>82 D<003FB8FC481780B9FCA53BFE0007F0003F
+A9007CEE1F00C792C7FCB3B3A70107B512F04980A56D5C31437DC238>84
+D<267FFFF090387FFFF0B56C90B512F8A56C496D13F0D801FCC73801FC00B3B3A66D1403
+00005EA36D14076D5D6E130F6D6C495A6E133F6D6C495A6D6C495AECFF076D90B5C7FC6D
+5C6D5C6D5C023F13E0020F1380DA03FEC8FC35447FC238>I<D83FFE913803FFE0486C4A
+13F0B56C4913F8A36C90C76C13F06C486E13E0D80FC09138001F80A36C6CED3F00A86C6C
+157EA86C6C5DEC01FC4A7EA24A7EA4D800FC9038DF01F8020F1381A3158F021F13C1A201
+7C5DA2017E14C31507023F13E3A490263E3E035BA2027E13F3A2EC7C01013F14F7A3011F
+5DEC7800A202F813FFA34A137F010F5DA24A133F6D486DC7FC35447FC238>87
+D<001FB712F04816F85AA417F090C8121F17E0EE3FC0167F1780EEFF00A24B5A4B5A123E
+C8485A4B5AA24B5A4B5AA24B5A4BC7FCA24A5A14035D4A5A140F5D4A5A143F5D4A5A14FF
+92C8FC495A13035C495AA2495A495AA2495A495A17F849C7EA01FC485AA2485A485AA248
+5A121F5B485A127F90B7FCB8FCA56C16F82E437BC238>90 D<003FB712804816C0B812E0
+A46C16C06C16802B087A7D38>95 D<EB1FFF90B512E0000314F84814FE4880824881D9F0
+017F9138003FF0ED0FF815076C486D7E6C481301C87FA21500A4EC03FF147F0107B5FC13
+1F90B6FC5A000714C048EBE0004890C7FCEA3FF813E0EA7F8090C8FC5A5AA415017E6C6C
+13036D13076C6CEB3FFFD9FC01B6FC6CB812807E6C816C4A7E6CECF80F6C6CD9C0031300
+D90FFCC9FC31327AB038>97 D<EA3FFE487EB5FCA37E7EC67EACED3FC0913801FFF80207
+13FE021F7F4A804A8091B67E03C07F9139FE001FF802F86D7E4A13034A6D7E5C707E4A80
+188091C8123FA318C0171FA9173F6E1580A2177FA26EECFF00A26E495A6E13034C5A6E49
+5A02FE133F6E6CB45A92B55A6E5C6E5C6E91C7FC6D6C13FCD91E0313F090C7EA7F803244
+7FC238>I<EC3FFF49B512E0010714F8011F8049805B90B7FC48EBE001481300485AEA0F
+F8496D5A4848147C93C7FC485A5B127F90CAFCA35A5AA97E7EA27F123F6D141F6DEC3F80
+121F6C7E01FC147F6C6CECFF006C6C6C5A6C9038F00FFE91B55A6C6C5C6D5C6D5C010714
+80010149C7FC9038003FF0293278B038>I<ED1FFF4B7F5DA38181ED003FACEC7F809038
+03FFF0010F13FC013F13FF4914BF90B7FC5A48EBC07F48EB000FD80FFC7F497F48487F49
+7F485A167F485A163F90C8FCA25A5AA97E6C157FA36D14FF123F6D5B6C7E5D6C6C5B01FC
+5B6C6C133F2603FFC0B6FC6C90B712806C03BF13C06D143F6D13FC6D01F814800107D9E0
+1F1300010090C9FC32447CC238>I<EC3FE0903801FFFC010713FF011F14C04980498090
+B67E489038E03FFC4890380007FE48481301D80FF86D7E49804848158049143F003F16C0
+49141F127F90C8FC17E0160F5A90B7FCA617C048CAFC7E7EA27FA26C7EEE07C06C6CEC0F
+E07F6C7ED807FE141F6DEC3FC06C01C013FF6CD9FC0713806C90B612006D5C6D5C010F5C
+010314E001001480DA1FFCC7FC2B327AB038>I<ED1FF8ED7FFE4AB5FC020714804A14C0
+5C5C91387FF07F15809139FF003F804AEB1F00010191C7FC5CA9003FB612FE4881B8FCA4
+6C5D260001FCC8FCB3AF003FB612E04881A56C5D2A447CC338>I<14F0497E497E497EA4
+6D5A6D5A6D5A91C8FCAB383FFFFC487FB5FCA37E7EC7FCB3AF007FB612F0B712F816FCA3
+16F86C15F0264476C338>105 D<387FFFFEB6FCA57EC77EB3B3B1007FB7FCB81280A56C
+1600294379C238>108 D<023FEB07E03B3FE0FFC01FF8D87FF39038E07FFCD8FFF76D48
+7E90B500F97F15FB6C91B612806C01C1EBF83F00030100EBE01F4902C013C0A24990387F
+800FA2491400A349137EB3A73C3FFF03FFE07FFC4801879038F0FFFEB500C76D13FFA36C
+01874913FE6C01039038E07FFC383080AF38>I<ED7FC03A3FFE01FFF8267FFF0713FEB5
+001F7F4A805C6C90B67E6CECC07F3B007FFE001FE002F8130F4A805C16075C5CA391C7FC
+B3A6273FFFFE03B512E0486D4814F0B6008F14F8A36C020714F06C496C14E035307FAF38
+>I<EC7FC0903803FFF8010F13FE497F017F14C090B67E4881489038C07FF8489038001F
+FC01FC130748486D7E49130148486D7E4980003F168049143F007F16C090C8121FA300FE
+ED0FE0A96C151FA26C16C0A26D143FA26C6CEC7F80A26C6CECFF006D5B6C6C495A6D1307
+6CB4EB1FFC6C9038C07FF86C90B55A6C5D6D5C6D5C010F49C7FC010313F89038007FC02B
+327AB038>I<ED3FC03A3FFE01FFF8267FFF0713FEB5001F7F4A804A806C90B67E6C02C0
+7F3B007FFE001FF802F86D7E4A13034A6D7E5C707E4A80188091C8123FA318C0171FA917
+3F6E1580A2177FA26EECFF00A26E495A6E13034C5A6E495A02FE133F6E6CB45A92B55A6E
+5C6E5C6E91C7FC6E13FC020313F09138007F8092C9FCB0383FFFFE487FB67EA36C91C9FC
+6C5B32487FAF38>I<EEFFC0277FFFC00713F8B5D8E01F13FC037F13FE92B5FC02E114FF
+14E36C01E713813A000FEFFC019139FFF000FE4B137C0380130092C8FCA25C5CA25CA25C
+A45CB2007FB67EB77E82A35E6C5D30307CAF38>114 D<903907FF80F0017FEBF1F848B5
+12FD000714FF5A5A5AEBFC00D87FE0131F0180130F48C71207481403A5007FEC01F001C0
+90C7FCEA3FF013FE381FFFF86CEBFFC0000314F8C614FF013F1480010714E0D9003F13F0
+020013F8ED0FFC1503003CEC01FE007E140000FE15FF167F7EA37F6D14FF16FE01F01303
+6DEB07FC01FF137F91B512F816F016E04815C0D8FC3F1400010F13FCD8780113E0283278
+B038>I<EB01E0497E1307AB003FB712804816C0B8FCA46C1680260007F0C8FCB3A4EE03
+E0EE07F0A66E130F17E06D6C131F6EEB3FC0903901FF81FF92B512806D15006E5B6E5B6E
+13F002075B020190C7FC2C3D7DBB38>I<D83FFE903803FFE0486C497FB55BA36C806C80
+C66CEB0007B3A9160FA2161F163F6E137F6D6C13FFDAF007EBFFE091B712F06D16F87F6D
+14E76D02C713F00100020313E0DA3FF8C8FC35307FAE38>I<000FB712FC4816FE5AA417
+FC0180C7EA1FF8EE3FF0EE7FE0EEFFC04B13804B13006CC7485AC8485A4B5A4B5A4B5A4B
+5A4A5B4A90C7FCEC07FC4A5A4A5A4A5A4A5A49485A4990C8FC495A495A495A495A494814
+7C494814FE485B4890C8FC485A485A485A485A48B7FCB8FCA56C16FC2F2F7DAE38>122
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Ff cmbx12 13.14 53
+/Ff 53 122 df<923807FFE092B512FC020714FF021F81027F9038007FC0902601FFF0EB
+0FE04901C0497E4990C7487ED90FFC147F011F824A14FF495AA2137F5CA2715A715A715A
+EF078094C8FCA7EF07FCB9FCA526007FF0C7123F171FB3B3A2003FB5D8E00FB512F8A53D
+4D7ECC44>12 D<B7FCAA200A7F9D29>45 D<EA07E0EA1FF8EA3FFCEA7FFEA2B5FCA6EA7F
+FEA2EA3FFCEA1FF8EA07E01010778F22>I<177817F8EE01FCA21603A2EE07F8A217F016
+0FA217E0161FA2EE3FC0A21780167FA217005EA24B5AA25E1503A24B5AA25E150FA25E15
+1FA24B5AA25E157FA24BC7FCA25D1401A25D1403A24A5AA25D140FA24A5AA25D143FA25D
+147FA24AC8FCA25C1301A25C1303A2495AA25C130FA2495AA25C133FA25C137FA249C9FC
+A25B1201A2485AA25B1207A25B120FA2485AA25B123FA25B127FA248CAFCA25AA2127CA2
+2E6D79D13D>I<15F014011407141F147FEB03FF137FB6FCA313FC1380C7FCB3B3B2007F
+B712E0A52B4777C63D>49 D<ECFFF80107EBFF80013F14F090B612FC4881480101EBFF80
+2707F8003F13C0D80FE0010F13E0D81F806D13F0003F80D87FF06D13F86D15FC6D7F00FF
+16FE6D147FA217FF82A36C5A6C5A6C5A6C5AC95A17FEA3EEFFFCA24B13F817F05D17E04B
+13C017804B13004B5A4B5A5EED7FE04B5A4A5B4A90C7FCEC07FC4A5A4A5A4B131FEC3F80
+4AC7FC14FE4948143E495AEB07E0495A4948147E49C8FC017E15FE90B7FC4816FC5A5A5A
+5A5A5AB8FC17F8A430477AC63D>I<EC3FFE0103B512E0010F14FC013F14FF90267FE01F
+7F9026FF000713E0D801FC6D7FD803F07F486C6D7FD80FFE817F486D80167FA3805C16FF
+7E91C75B6C5A6C5AD80020495B90C75C5D5F4B5B5F031F90C7FCED3FFC4AB45A49B512E0
+168016E016FC90C7EA3FFF030713C06F7F6F7F6F7F83707E83A2701380A318C0EA07E0EA
+1FF8487E487EA2B5FCA31880A25E491600127F494A5A6C485D01E05B001F4A5BD80FFC49
+5B2707FFC03F13C06C90B65AC64BC7FC013F14F8010714E09026007FFEC8FC32487BC63D
+>I<EE07E0160FA2161F163F167F16FFA25D5D5DA25D5D5DA2157D15FDEC01F915F1EC03
+E11407EC0FC1EC1F811501143F147E14FC14F8EB01F01303EB07E014C0EB0F80131FEB3F
+00133E5B13FC485A485A5B1207485A485A90C7FC123E127E5AB912FCA5C80003EBE000AD
+023FB612FCA536487DC73D>I<D8038015E001E0140301FC143F9039FFE003FF91B612C0
+17801700A25E5E16F05E5E93C7FC15FC15F001E790C8FC01E0C9FCAAEC1FFC01E1B512C0
+01E714F001EF14FC9039FFE01FFFDA0007138001FC6D13C001F06D13E04915F0497F17F8
+C913FC167F17FEA417FFA3EA0FC0EA3FF0487EA2487EA317FEA34914FF6C4815FC5B0180
+15F86CC74813F07F6C6C4913E0D80FF04913C0D807FC011F13806CB46CB512006C90B512
+FC6C5D013F14C0010F91C7FC010113F030487AC63D>I<ED7FF8913807FFFE021F6D7E02
+7F80903A01FFF01FE0010790388003F04948486C7E49486D7ED93FF013074948130F01FF
+4A7E4849133F5C5A4890C7FCA25A705A48486E5A705A003F92C8FCA3485AA21520913807
+FFE0021F13FC00FF497F4A6D7EDAFC017F9026FDF0007F4A6D7ED9FFC06D7E4A6D7E8391
+C7FC8382491680A318C05BA3127FA6123FA27F001F1780A3000F4B1300A26C6C5DA26C6D
+495A6C6D5C6C6D495A6D6C48485A90263FFC075B6DB65A6D4AC7FC01035C010014F0020F
+90C8FC32487BC63D>I<121F7F7F13FE90B812E0A45A18C0188018005F5FA25F485E90C8
+EA07E0007E4B5A5F007C151F4CC7FC167E5E485D15014B5A4B5AC8485A4B5AA24BC8FC15
+7EA25D1401A24A5A1407A24A5AA2141FA24A5AA2147FA314FFA3495BA45BA55BAA6D5BA2
+6D90C9FCEB007C334B79C93D>I<EC1FFF49B512F0010714FC011F14FF90263FF00713C0
+49C77F01FCEC3FF04848EC0FF848481407000782491403000F821601A2121F7FA27F13FE
+6D140302C05C14F002FC495A6C6D130FDAFF805B9238E01FE06C6E485A9238FCFF806C91
+B5C7FC6C15FC6C5D7F6D14FE6D806D15C06D81011F81017F81D9FFDF804813072603FE01
+8048486C804848133F4848010F1480003F8049130148486D6C13C0161F824848140382A2
+82A2177FA218807F127FEFFF007F6C6C4A5AA2D81FFC4A5A6C6CEC0FF86C6C6CEB3FF06C
+9039F003FFE06C90B612806C6C92C7FC011F14FC010714E09026003FFEC8FC32487BC63D
+>I<EC1FFE49B512C0010F14F04914FC90397FFC0FFE903AFFE003FF804849C67F48496D
+7E4890C7FC486F7E484881161F003F825B007F82A28300FF81A31880A518C0A45E127FA3
+003F5D7F121F5E120F6C6C91B5FC6C90388001EF6CEBC0036C9038E00FCF6DB5128F011F
+140F010701FE1480010113F8903800010091C7FCA24C1300A3D803F85D487E487E486C4A
+5AA25F4C5AA24C5A49495B6C485D49010790C7FC01E0495AD807F8EB3FFC6CB448B45A6C
+90B55A6C15C06D91C8FC011F13FC010313C032487BC63D>I<EE01F8A24C7EA34C7EA24C
+7EA34C7FA24C7FA34C7FA293B57EA34B8016F303038016E316E103078016C0030F805E83
+031F814C7E4B81153E83037E81037C7F03FC815D830201824B7F0203825D830207824B7F
+020F825D84021F8392B8FC4A83A34A83027CC8120F02FC835C840101844A810103845C84
+0107844A81010F845C85011F85496C82B600C091B712F0A5544D7CCC5D>65
+D<93261FFF80EB01C00307B500F81303033F02FE13074AB7EAC00F0207EEE03F021F903A
+FE007FF87F027F01E0903807FCFF91B5C70001B5FC010301FC6E7E4901F0151F4901C081
+4949814990C97E494882494882485B48197F4A173F5A4A171F5A5C48190FA2485B1A07A2
+5AA297C7FC91CDFCA2B5FCAD7EA280A2F207C07EA36C7FA26C190F6E18807E6E171F6C1A
+006E5F6C193E6C6D177E6D6C5F6D6C4C5A6D6D15036D6D4B5A6D01F04B5A6D01FCED3FC0
+010001FFEDFF806E01E0D903FEC7FC021F01FEEB3FFC020790B612F002015EDA003F92C8
+FC030714FCDB001F13804A4D79CB59>67 D<B912F0F0FF8019F019FC19FFD8001F902680
+000114C0DD001F7F060713F806017F726C7E737E737F737F737F8587737F8587A2747EA3
+8786A21C80A51CC0A586A462A51C80A51C00A26263A2631AFF636163614F5B634F5B073F
+90C7FC4F5A4F5A06035B061F5B4DB512C0BBC8FC19FC19F0198006F0C9FC524B7CCA5E>
+I<BB12C0A486D8000F01E0C77E18071801F0007F193F191F190F1907861903A31901A3EF
+0F80A2737EA497C7FC171FA2173F177F17FF160392B6FCA5EDE0031600177F173F171FA2
+050FEC0F80A3F21F00A494C8FC621A3EA21A7EA31AFE6219011903A21907190FF13FF819
+FF1803183FBBFCA262A3494A7CC951>I<BBFCA41A80D8001F01C0C7FC181F1803848419
+7F193F191F1AC0190FA31907A4171FF103E0A496C7FCA25FA25F5F5E160792B6FCA5EDC0
+071601828383A283A794C9FCB1B8FCA5434A7CC94D>I<93261FFF80EB01C00307B500F8
+1303033F02FE13074AB7EAC00F0207EEE03F021F903AFE007FF87F027F01E0903807FCFF
+91B5C70001B5FC010301FC6E7E4901F0151F4901C0814949814990C97E49488249488248
+5B48197F4A173F5A4A171F5A5C48190FA2485B1A07A25AA297C8FC91CEFCA2B5FCAD6C04
+0FB712C0A280A36C93C7001FEBC000A2807EA27E807E807E806C7F7E6D7E6D7E6D7F6D01
+E05D6D6D5D6D13FC010001FF4AB5FC6E01E0EB07F9021F01FFEB3FF0020791B5EAE07F02
+01EEC01FDA003FED0007030702F81301DB001F018090C8FC524D79CB61>I<B7D8FC01B7
+12F8A5D8001F01C0C8001FEBC000B3AA92B9FCA503C0C8121FB3AEB7D8FC01B712F8A555
+4B7BCA60>I<B712FEA5D8000FEBE000B3B3B3ABB712FEA5274B7DCA2E>I<B8FCA5D8001F
+01C0C9FCB3B3A4193EA4197E197CA519FCA31801A2F003F8A21807180F181F183F187FEF
+01FF1707173FBA12F0A53F4B7BCA4A>76 D<B600E04DB612806F5FA26F5FA2D8001F09FC
+C7FC6FEF0F7FA2DABFFE171EA2DA9FFF173CA3028F6D1678A202876D16F0A202836DED01
+E0A302816DED03C0A202806DED0780A26F6CED0F00A36F6C151EA26F6C5DA26F6D5CA26F
+6D5CA36F6D495AA26F6D495AA26F6D495AA3706C49C7FCA2706C131EA2706C5BA3706D5A
+A2706D5AA270EBE1E0A370EBF3C0A270EBFF80A27190C8FCA2715AA3715AA2715A497EB6
+00F06D480103B71280A3715A715A694B7BCA74>I<B600E092B612F88181A281D8001F6D
+9239001FE0006F705A82A28202BF7F029F7FA2028F7F02877F02837F8214810280806F7F
+6F7F83816F7F6F7F6F7F83816F80707F707F8482707F707F707FA2707F7014807113C019
+E0837113F07113F87113FC19FE837113FF71148F7213CF1AEF847213FF8484A284848485
+A2858585A285858585497EB600F8167F1A3F1A1F1A0FA2554B7BCA60>I<EEFFF8031FEB
+FFC04AB612FC020715FF021FD9C01F13C091277FFE000313F0902601FFF09038007FFC49
+496E7E490180EC0FFF4990C86C7F49486F7F49486F7F017F8449486F7F4849707EA24849
+707E4885A24849701380A2481AC04A82A2481AE0A34890CA6C13F0A5B519F8AE6C1AF0A2
+6E5EA36C1AE0A26E5E6C1AC0A26C1A806E5E6C1A006E5E6C616E16FF6C616C6D4B5B6D6C
+4B5B6E5D6D6D4A5B6D6D4A5B01076D4A90C7FC6D01F8ECFFFE6D01FE01035B9028007FFF
+C01F13F0021F90B612C0020793C8FC020115FCDA001F14C0030101FCC9FC4D4D79CB5C>
+I<B912C018FCF0FF8019F085D8001F902680000713FE05007F063F1380060F13C07213E0
+1AF0841AF8A27213FCA31AFEA81AFCA34E13F8A21AF0601AE04E13C0063F138095B51200
+050713FC92B75A19E096C7FC18F803C0CAFCB3ABB712FCA5474B7BCA54>I<B9FC18F8F0
+FF8019E019F8D8000F9026C0000713FE9439007FFF80061F7F727F727F727F84868684A2
+86A862A24E5BA2624E5B4E5B4E5B4E5B95B5C8FC050713FC92B712F0198006FCC9FC18FF
+9226C0003F13C0050713F0717F717F717F187F85727FA28486A786A71C3E86A28474137E
+72157C726D13FCB700FC6D9038FE01F872EBFF8373EBFFF0071F14E007031480CD383FFE
+00574C7CCA5C>82 D<DA7FFCEB01C00103B5EAC003011FECF00749ECFC0F90B7121F48D9
+E00F13BF4890C713FFD807FC141F4848804848140382484880177F485A173F171F12FFA2
+170F7FA217077F7F7F6D92C7FC6D7E6C13F014FF15F86CECFF8016F86C15FF6C16C0836C
+826C826C826C82013F816D1680010716C01300020F15E01400030714F0ED007F160F1603
+7013F882177F127800F8163FA3171FA27E18F0A27EA26CEE3FE07F18C001E0157F6DEDFF
+8001FC160001FF140302E0EB0FFED97FFEEB3FFC486CB612F0D8FC0F5DD8F803158048C6
+6C49C7FC48010313F0354D79CB44>I<003FBB12C0A5DA80019038FC001FD9FC001601D8
+7FF09438007FE001C0183F49181F90C7170FA2007E1907A3007C1903A500FC1AF0481901
+A5C894C7FCB3B3A749B812FCA54C4A7CC955>I<B700F8023FB512F8A5D8001F01C0C938
+0FE000745AB3B3AD6D180F63811A1F6D96C7FC626D7F1A7E6D7F6D606E6C4B5A6E6CED07
+F06E6C4B5A6E01C0EC3FC06E01F049B45A020101FF011F90C8FC6E91B55A033F15F80307
+15E0030092C9FC040713F0554C7CCA5E>I<B700F00203B6FCA5D8001F01E0C93803FC00
+745A6D61811A036D6D5F1A076D6D5F1A0F6D616F161FA26D6D94C7FC626E6D153E1A7E6E
+177C7015FC6E5F8219016E6D5D19036E5F7014076E5F82190F6E6D5D191F6E6D92C8FC61
+6F153E83197E6F6D137C19FC6F6D5B18016F5DEFF003A26F01F85B18076F01FC5B180F6F
+5DEFFE1F6F92C9FC17FF607013BE18FE705BA2705BA3705BA2705BA2705BA3705BA27090
+CAFCA2177EA2584C7ECA5D>I<B700F84AB6FCA5D8001F01F0C93803FC006F705A6D4E5A
+6D6D4C5A816D4E5A6D6D4C5A826D4EC7FC6E6D5D70157E6E5F6E7F704A5A6E4C5A6E7F70
+4A5A6E4C5A6E7F71495A6E4CC8FC6F7F71137E6F5D6F7F71485A6F4A5A6F13FC71485A6F
+4A5A6F13FFF09F806F02BFC9FC7013FF60705B8260705B8260B3A7037FB612FEA5584B7E
+CA5D>89 D<ECFFFC010FEBFFC0017F14F090B612FC489038803FFE3B03FC0007FF80486C
+6D7F6D7F486D6C7F83167F83A2707E6C90C7FC6C5A6C5AC9FCA5ED1FFF021FB5FC49B6FC
+130F013FEBC03F9038FFFE00000313F04813C04890C7FC485A485AA2485AA2485AA4167F
+A26D14FF007F15EF6D01017F6C6C903907CFFF806C6CD90F8F13FE6C9038E07F076C9038
+FFFE0300014A7ED8003F9038F0007F0103018090C7FC37347CB23C>97
+D<EB7FC0B5FCA512037EB3ED07FF037F13E002C1B512FC02C714FF9126CFF80F7F9126DF
+C0017F02FFC77F4AEC3FF002F8814A6E7E717E4A81831980A37113C0A319E0AC19C0A35F
+1980A219005F606E141F6E5D4D5A6E4A5A02BF4A5A91261FC0035B9027FE0FF01F5B496C
+B548C7FCD9F80114F8496C6C13E0C8D80FFEC8FC3B4D7CCB44>I<91380FFF8091B512F8
+010314FF010F15804948C613C0D97FF8EB1FE0D9FFE0EB3FF04849137F4849EBFFF84890
+C7FCA2485A121FA24848EC7FF0EE3FE0EE1FC0007F92C7FC5BA212FFAC127FA27FA2123F
+A26C6C153EA26C6C157E177C6C6D14FC6C6D14F86C6D13036C6DEB07F0D97FFCEB1FE06D
+B4EBFFC0010F90B5120001035C010014F0020F13802F347CB237>I<EF1FF0EE3FFFA516
+00177FB3EC0FFF91B512E0010314F8010F14FC013FEB01FF903A7FF8003FFFD9FFE0130F
+48497F48497F4890C77E48815B121F5B123FA2127F5BA312FFAC127FA36C7EA3121F6D5C
+120F6C6C5C6C6D5B6C5D6C01E0013F7F6D6C49EBFFE090393FFE03FE6DB512F801075C01
+00148091261FFC00EBC0003B4D7CCB44>I<EC0FFF91B512F0010314FC010F14FF90263F
+FE077F90267FF0007F49486D7E4801806D7E486F7E4890C7120F484881707E121F491403
+003F82A2127F5B701380A212FFA390B8FCA401F8CAFCA5127FA27FA2123FA26C6CED0F80
+A26C6C151F6C17006E5C6C6D147E6C6D5C6C6D495AD93FFCEB07F0903A1FFF803FE00107
+90B55A010192C7FC6D6C13FC020713C031347DB238>I<ED7FF0913807FFFC023F7F4A7F
+902601FFE0138049018113C049484813E0EB0FFCEB1FF8A2EB3FF0A2017F6D13C04A6C13
+80EE7F00163E93C7FCACB77EA526007FF0C8FCB3B3A3003FB512F8A52B4D7DCC26>I<DA
+7FFCEB0FE00103B538807FF8010F9138E1FFFC013F02FB13FE903A7FF01FFFF39026FFC0
+07138348D90001130348168348486DEBC1FCEFC0F8000FEEE00049147F001F82A9000F5E
+6D14FF00075EA26C6C495B6C93C7FC6C9038C007FE9138F01FFC4890B55A01EF14E0D803
+C314809026C07FFCC8FC000790CAFCA47FA27F13FC90B612FCEEFFC06C16F817FE6C8218
+806C17C06D16E00003B812F0120FD81FFCC7000F13F8D83FF0140049153F4848ED1FFC00
+FF160F491507A56D150F007F17F86D151F6C6CED3FF06C6CED7FE0D80FFE913801FFC06C
+6C6C010713806C01F8017F1300C690B612FC013F15F001071580D9003F01F0C7FC37497D
+B13D>I<EB7FC0B5FCA512037EB3923801FFC0030F13F8033F7F4B13FFDBFE077F9138C1
+F0039126C3E0017FDAC78080ECCF0014DE02DC6D7F14FC5CA25CA35CB3AAB6D8C07FEBFF
+E0A53B4C7BCB44>I<13FCEA03FF487F487FA2487FA66C5BA26C5B6C90C7FCEA00FC90C8
+FCABEB7FC0B5FCA512037EB3B3A2B61280A5194D7BCC22>I<EB7FC0B5FCA512037EB3B3
+B3AAB61280A5194C7BCB22>108 D<90287FC001FFC0EC7FF0B5010F01FC0103B5FC033F
+6D010F804B6D4980DBFE079026803F817F9126C1F801903AC07E007FF00003D9C3E0DAE0
+F8806C9026C78000D9F1E06D7E02CFC7EBF3C002DEEDF780DD7FFF6E7E02FC93C7FC4A5D
+A24A5DA34A5DB3AAB6D8C03FB5D8F00FB512FCA55E327BB167>I<903A7FC001FFC0B501
+0F13F8033F7F4B13FFDBFE077F9138C1F00300039026C3E0017F6CD9C78080ECCF0014DE
+02DC6D7F14FC5CA25CA35CB3AAB6D8C07FEBFFE0A53B327BB144>I<913807FF80027F13
+F80103B6FC010F15C090261FFE017F903A7FF0003FF849486D7E480180EB07FE4890C76C
+7E4817804980000F17C048486E13E0A2003F17F0A249157F007F17F8A400FF17FCAB007F
+17F8A46C6CEDFFF0A2001F17E0A26C6C4A13C0A26C6C4A13806C6D4913006C5E6C01E0EB
+1FFC6D6C495A903A3FFE01FFF0010FB612C0010392C7FCD9007F13F80207138036347DB2
+3D>I<90397FC007FFB5017F13E002C1B512FC02C714FF9126CFF80F7F9126DFC0037F00
+0301FFC77F6C496E7E02F8814A6E7E717E4A81831980A28319C0A37113E0AC19C05FA319
+805F19005F606E143F6E5D4D5A6E4A5A02FF495BDBC0075B9126EFF01F5B02E7B548C7FC
+02E114F8DAE07F13E0DB0FFEC8FC92CAFCAFB612C0A53B477CB144>I<9039FF803FE0B5
+EBFFF8028113FE02837FDA87E11380EC8F830003D99F0713C06C139E14BCA214F8A24A6C
+13806F13006F5A4A90C7FCA45CB3A8B612E0A52A327CB132>114
+D<903907FF8070017FEBF1F048B6FC1207380FFC01391FE0003F4848130F491307127F90
+C71203A2481401A27FA27F01F090C7FC13FCEBFFC06C13FEECFFE06C14FC6C806CECFF80
+6C15C06C15E06C15F06C7E011F14F8010114FCEB000FEC007FED1FFE0078140F00F81407
+15037E1501A27E16FC7E15036D14F86D13076D14F001F8EB1FE001FFEBFFC04890B51280
+486C1400D8F81F13FCD8E00313C027347CB230>I<14F8A51301A41303A21307A2130FA2
+131F133F137F13FF1203000F90B512F0B7FCA426007FF8C7FCB3A7167CAA013F14F880A2
+90391FFE01F0010F1303903907FF87E06DEBFFC06D14806D6C1300EC0FFC26467EC430>
+I<D97FE0EC3FF0B5EC7FFFA5000315016C81B3AC5EA25EA25E7E6EEB0F7F017F021E7F6E
+017CEBFFE090393FFE01F86DB512F0010714E0010114C09027003FFE00EBC0003B337BB1
+44>I<B600C090387FFFF0A5C601F0C73803F8006E5D017F5E801707013F5E6E140F011F
+5E6E141F6D93C7FC6F5B6D153E81177E6D157C6F13FC6D5DEDF0016D5DEDF803027F5CA2
+EDFC07023F5CEDFE0F021F5CEDFF1F6E91C8FC169F16BF6E13BE16FE6E5BA26E5BA26E5B
+A36F5AA26F5AA26F5AA23C327EB041>I<B60081B500FC90387FFFF0A500019026E00003
+90C73801FC006E6F5C6C6F5E6E6F1303017F61A26E6F1307013F4A5E846E49150F011F61
+6E6F131F6D4A93C7FC179F03806E5B6D021F153EEF0FFE6DD9C03F5DEE3E0703E06E13FC
+6D027E5DEE7C0303F015816D4A6C5C03F815C3DA7FF95E4C7E03FD15E7DA3FFF5E4C137F
+19FF6E496D5BA26E94C8FC4C7FA26E5E93C7120FA26E486E5AA202015E4B1403A26E486E
+5A54327EB059>I<007FB500C090387FFFE0A5C601F0C73803F8006E5D017F5E6E140701
+3F5E80170F011F5E6E141F6D93C7FC6F5B6D153E6F137E6D157C6F13FCA26D6D5B16016D
+5DEDF803027F5CEDFC07023F5CEDFE0F021F5C15FF161F6E91C8FC16BF6E13BE16FE6E5B
+A26E5BA36E5BA26F5AA26F5AA26F5AA393C9FC5D153E157E157CD81F8013FC486C5B387F
+E001D8FFF05B14035D14074A5A49485A007F133F4948CAFC383F81FE381FFFF86C5B6C13
+C0C648CBFC3B477EB041>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fg cmtt12 17.28 6
+/Fg 6 123 df<913803FFC0023F13FC49B67E010715F04981013F15FE498190B812C048
+8348D9FC0180489026E0001F7F480180130391C87F48486F7E49153F4848ED0FFF834848
+178083496F13C012FF8319E07FA2187FA36C5A6C5A6C5ACBFCA218FFA219C05FA219805F
+A24D13005F604D5A173F4D5A4D5AA24C5B4C5B4C5B041F90C7FC4C5A4C5A4C5A4B5B4B5B
+4B5B031F5B4B90C8FC4B5AEDFFF84A5B4A5B4A5B021F5B4A90C9FCEC7FFC4A5A495B495B
+010F5B495B4948CAFC4948ED1F804948ED3FC04849ED7FE0485B000F5B4890C9FC4890B8
+FC5ABAFCA56C18C06C18803B5A79D94A>50 D<383FFFF0487F80B5FCA37EA27EEA000FB0
+EE0FFC93B57E030714E0031F14F84B14FE92B7FC02FD8291B87E85DCE01F7FEE000703FC
+01017F4B6D7F03E0143F4B6E7E4B140F8592C87E4A6F1380A34A6F13C0A284A21AE0A219
+7FAA19FFA21AC0A26E5DA24E138080606F1600606F4A5A6F143F6F4A5A6F4A5A6F130303
+FF010F5BDCC03F5B93B65A6102FD93C7FC02FC5D6F5C031F14F0902607F80714C0902603
+F00191C8FC90C8EA3FF043597FD74A>98 D<EC01F0EC07FC4A7EA24A7EA56E5AA26E5AEC
+01F091CAFCAE001FB512FC4880815AA37EA27EC71203B3B3A8003FB812C04817E0A2B912
+F0A36C17E0A26C17C0345974D84A>105 D<003FB512FE4880B77EA57E7EC71201B3B3B3
+B0003FB812FC4817FEBAFCA56C17FE6C17FC385877D74A>108 D<EE0FFC263FFFF090B5
+7E48D9F80714E0DAFC1F14F8B54914FE92B7FC02FD826C90B87E856CDBE01F7FD8000FEC
+000703FC01017F4B6D7F03E0143F4B6E7E4B140F8592C87E4A6F1380A34A6F13C0A284A2
+1AE0A2197FAA19FFA21AC0A26E5DA24E138080606F1600606F4A5A6F143F6F4A5A6F4A5A
+6F130303FF010F5BDCC03F5B93B65A6102FD93C7FC02FC5D6F5C031F14F0030714C00301
+91C8FC9238003FF093CAFCB3A4003FB6FC4881A2B77EA36C5DA26C92CAFC435F7FBE4A>
+112 D<000FB912E04818F04818F8A619F001F0C8000313E04D13C04D13804D13004D5A4D
+5A4D5A6C484A5B6C484A5BC9000F5B4C5B4C90C7FC4C5A4C5A4B5B4B5B4B5B4B5B4B5B4B
+90C8FC4B5A4B5A4A5B4A5B4A5B4A5B4A5B4A90C9FC4A5A4A5A495B495B495B4949EC07E0
+4949EC0FF04948C8EA1FF8495A495A485B485B485B485B4890C9FC485A48B9FCBAFCA66C
+18F06C18E03D3E7BBD4A>122 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fh cmbx12 17.28 28
+/Fh 28 120 df<16F04B7E1507151F153FEC01FF1407147F010FB5FCB7FCA41487EBF007
+C7FCB3B3B3B3007FB91280A6395E74DD51>49 D<913801FFF8021FEBFFC091B612F80103
+15FF010F16C0013F8290267FFC0114F89027FFE0003F7F4890C7000F7F48486E7FD807F8
+6E148048486E14C048486E14E048486F13F001FC17F8486C816D17FC6E80B56C16FE8380
+A219FFA283A36C5BA26C5B6C90C8FCD807FC5DEA01F0CA14FEA34D13FCA219F85F19F04D
+13E0A294B512C019804C14004C5B604C5B4C5B604C13804C90C7FC4C5A4C5A4B13F05F4B
+13804B90C8FC4B5AED1FF84B5A4B5A4B48143F4A5B4A48C8FC4A5A4A48157E4A5A4A5AEC
+7F8092C9FC02FE16FE495A495A4948ED01FCD90FC0150749B8FC5B5B90B9FC5A4818F85A
+5A5A5A5ABAFCA219F0A4405E78DD51>I<92B5FC020F14F8023F14FF49B712C04916F001
+0FD9C01F13FC90271FFC00077FD93FE001017F49486D8049C86C7F484883486C6F7F14C0
+486D826E806E82487FA4805CA36C5E4A5E6C5B6C5B6C495E011FC85A90C95CA294B55A61
+4C91C7FC604C5B4C5B4C5B4C5B047F138092260FFFFEC8FC020FB512F817E094C9FC17F8
+17FF91C7003F13E0040713F8040113FE707F717F7113E085717FA2717F85A285831A80A3
+1AC0EA03FCEA0FFF487F487F487FA2B57EA31A80A34D14005C7E4A5E5F6C495E49C8485B
+D81FF85F000F5ED807FE92B55A6C6C6C4914806C01F0010791C7FC6C9026FF803F5B6D90
+B65A011F16F0010716C001014BC8FCD9001F14F0020149C9FC426079DD51>I<F01F804E
+7E187F18FFA25F5F5F5FA25F5F5FA294B5FC5E5E5EA25E5EEE3FBFEE7F3FA216FEED01FC
+ED03F8ED07F0A2ED0FE0ED1FC0ED3F8016005D15FE4A5A4A5AA24A5A4A5A4A5A4A5AA24A
+C7FC14FE495A5C1303495A495A495A5C133F49C8FC13FE485AA2485A485A485A5B121F48
+5A48C9FC12FEBCFCA6CA6CEBC000B1037FB8FCA6485E7CDD51>I<4DB5ED03C0057F02F0
+14070407B600FE140F047FDBFFC0131F4BB800F0133F030F05FC137F033F9127F8007FFE
+13FF92B6C73807FF814A02F0020113C3020702C09138007FE74A91C9001FB5FC023F01FC
+16074A01F08291B54882490280824991CB7E49498449498449498449865D49498490B5FC
+484A84A2484A84A24891CD127FA25A4A1A3F5AA348491A1FA44899C7FCA25CA3B5FCB07E
+A380A27EA2F50FC0A26C7FA37E6E1A1F6C1D80A26C801D3F6C6E1A00A26C6E616D1BFE6D
+7F6F4E5A7F6D6D4E5A6D6D4E5A6D6D4E5A6D6E171F6D02E04D5A6E6DEFFF806E01FC4C90
+C7FC020F01FFEE07FE6E02C0ED1FF8020102F8ED7FF06E02FF913803FFE0033F02F8013F
+1380030F91B648C8FC030117F86F6C16E004071680DC007F02F8C9FC050191CAFC626677
+E375>67 D<B96C90B91280A6D8000102C0C9000102C0C7FCB3B3A293BBFCA604C0C91201
+B3B3A6B96C90B91280A671627AE17E>72 D<B912E0A6C702E0C7FCB3B3B3B3AEB912E0A6
+33627CE13C>I<B700C0083FB612F070627097B7FCA37061D800010DF8C7FC70F103EFA2
+02FD6DF107CFA202FC6DF10F8FA36F6DF01F0FA26F6D183EA26F6D187CA26F6D18F8A36F
+6DEF01F0A26F6DEF03E0A26F6DEF07C0A26F6DEF0F80A3706DEE1F00A2706D163EA2706D
+5EA2706D5EA3706D4B5AA2706D4B5AA2706D4B5AA2706D4B5AA3716D4AC7FCA2716D143E
+A2716D5CA2716D5CA3716D495AA2716D495AA2716D495AA2716D495AA3726D48C8FCA272
+EBC03EA2726D5AA2726D5AA372EBF9F0A272EBFFE0A2725CA2725CA37390C9FCA2735AA2
+735A90381FFFC0B700F86E480207B812F0A3735AA2735A8C627AE199>77
+D<BB7E1AFCF2FFC01BF81BFE757ED800010280C7001F80070114F0736C7F081F7F747F74
+7F7414807414C0A27414E0A21DF0A27513F8A41DFCA91DF8A498B512F0A21DE0A25014C0
+1D8062501400505B505B087F5B4FB512E0071F5C93B9C7FC1BFC1BF01B8008F0C8FC04C0
+CCFCB3B3A2B97EA65E627AE16E>80 D<001FBEFCA64849C79126E0000F148002E0180091
+C8171F498601F81A0349864986A2491B7FA2491B3F007F1DC090C9181FA4007E1C0FA600
+FE1DE0481C07A5CA95C7FCB3B3B3A3021FBAFCA663617AE070>84
+D<913803FFFE027FEBFFF00103B612FE010F6F7E4916E090273FFE001F7FD97FE001077F
+D9FFF801017F486D6D7F717E486D6E7F85717FA2717FA36C496E7FA26C5B6D5AEB1FC090
+C9FCA74BB6FC157F0207B7FC147F49B61207010F14C0013FEBFE004913F048B512C04891
+C7FC485B4813F85A5C485B5A5CA2B55AA45FA25F806C5E806C047D7F6EEB01F96C6DD903
+F1EBFF806C01FED90FE114FF6C9027FFC07FC01580000191B5487E6C6C4B7E011F02FC13
+0F010302F001011400D9001F90CBFC49437CC14E>97 D<903807FF80B6FCA6C6FC7F7FB3
+A8EFFFF8040FEBFF80047F14F00381B612FC038715FF038F010014C0DBBFF0011F7FDBFF
+C001077F93C76C7F4B02007F03F8824B6F7E4B6F13804B17C0851BE0A27313F0A21BF8A3
+7313FCA41BFEAE1BFCA44F13F8A31BF0A24F13E0A24F13C06F17804F1300816F4B5A6F4A
+5B4AB402075B4A6C6C495B9126F83FE0013F13C09127F00FFC03B55A4A6CB648C7FCDAC0
+0115F84A6C15E091C7001F91C8FC90C8000313E04F657BE35A>I<92380FFFF04AB67E02
+0F15F0023F15FC91B77E01039039FE001FFF4901F8010113804901E0010713C049018049
+13E0017F90C7FC49484A13F0A2485B485B5A5C5A7113E0485B7113C048701380943800FE
+0095C7FC485BA4B5FCAE7EA280A27EA2806C18FCA26C6D150119F87E6C6D15036EED07F0
+6C18E06C6D150F6D6DEC1FC06D01E0EC7F806D6DECFF00010701FCEB03FE6D9039FFC03F
+FC010091B512F0023F5D020F1580020102FCC7FCDA000F13C03E437BC148>I<F17FF805
+0FB5FCA6EF000F8484B3A892380FFF804AB512F8020F14FE023FECFF8391B712E3010391
+38807FF3499039F8000FFB011F01E00103B5FC494913004990C87E49488148498148834A
+815A485BA2485BA25AA3485BA4B5FCAE7EA46C7FA37EA26C7FA26C5F806C5F6C6D5D6C6D
+5D017F93B5FC6D6C6C0103806D6D49806D01F0D91FF7EBFFFE6D9039FE01FFE7010190B6
+12876D6CECFE07021F14F8020314E09127003FFE00ECC0004F657BE35A>I<92380FFFC0
+4AB512FC020FECFF80023F15E091B712F80103D9FE037F499039F0007FFF011F01C0011F
+7F49496D7F4990C76C7F49486E7F48498048844A804884485B727E5A5C48717EA35A5C72
+1380A2B5FCA391B9FCA41A0002C0CBFCA67EA380A27EA27E6E160FF11F806C183F6C7FF1
+7F006C7F6C6D16FE6C17016D6C4B5A6D6D4A5A6D01E04A5A6D6DEC3FE0010301FC49B45A
+6D9026FFC01F90C7FC6D6C90B55A021F15F8020715E0020092C8FC030713F041437CC14A
+>I<EE3FFC0307B51280033F14C04AB612F0020715F84A9038F03FFC4AEB807F913A7FFE
+00FFFE4A5A4B4813FF4913F05B4913E0A24913C0A27013FE4949EB7FFCEF3FF8EF1FF0EF
+07C094C7FCB0B812C0A6D8001F01C0C8FCB3B3B0007FB612FCA638657CE431>I<F107F8
+DB7FFEEC3FFE020FB5D8F001B5FC027FDAFE03148049B7128F49DCDFFD13C0010FD9F00F
+EBFFC149D9800114014990C7EBFC0349486E6C7E4948EC3FFF48496E0181138007801300
+48F0C03E97C7FC48496E7FA34884A96C60A36C6D4A5BA26C60A26C6D4A90C8FC6D6C4A5A
+6D6C4A5A6D6D485BDBF00F5B4990B612C060D97C7F4AC9FCD9FC0F14F09126007FFECAFC
+92CCFC1201A47FA27F8014F091B77E18FE6CEFFFC019F06D17FC19FF6D846D846D846D84
+013F8490BAFC0003854801E0C712014890C9000F7F484816014848EE007F4848717E8512
+FF5B85A56D5F007F616D173F003F616D177F6C6C4D5A6C01C003035B6C6D4B5B6C01F803
+1F5BC601FF92B5C7FC6D01F8011F5B011F90B712F8010717E0010094C8FC020F15F0DA00
+3F01FCC9FC4A607CC151>I<903807FF80B6FCA6C6FC7F7FB3A8EF1FFF94B512F0040714
+FC041F14FF4C8193267FE07F7F922781FE001F7FDB83F86D7FDB87F07FDB8FC0814C7F03
+9FC78015BE03BC8003FC825DA25DA25DA45DB3B2B7D8F007B71280A651647BE35A>I<EB
+0FE0EB3FF8497E48B5FCA24880A24880A76C5CA26C91C7FCA238007FFC6D5AEB0FE090C9
+FCAF903807FF80007FB5FCA6C6FC7F7FB3B3AEB712C0A622657BE42C>I<903807FF80B6
+FCA6C6FC7F7FB3B3B3B3ADB712E0A623647BE32C>108 D<902607FF80D91FFFEEFFF8B6
+91B500F00207EBFF80040702FC023F14E0041F02FF91B612F84C6F488193267FE07F6D48
+01037F922781FE001F9027E00FF0007FC6DA83F86D9026F01FC06D7F6DD987F06D4A487F
+6DD98FC0DBF87EC7804C6D027C80039FC76E488203BEEEFDF003BC6E4A8003FC04FF834B
+5FA24B5FA24B94C8FCA44B5EB3B2B7D8F007B7D8803FB612FCA67E417BC087>I<902607
+FF80EB1FFFB691B512F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FC6DA83
+F86D7F6DD987F07F6DD98FC0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2
+B7D8F007B71280A651417BC05A>I<923807FFE092B6FC020715E0021F15F8027F15FE49
+4848C66C6C7E010701F0010F13E04901C001037F49496D7F4990C87F49486F7E49486F7E
+48496F13804819C04A814819E048496F13F0A24819F8A348496F13FCA34819FEA4B518FF
+AD6C19FEA46C6D4B13FCA36C19F8A26C6D4B13F0A26C19E06C6D4B13C0A26C6D4B13806C
+6D4B13006D6C4B5A6D6D495B6D6D495B010701F0010F13E06D01FE017F5B010090B7C7FC
+023F15FC020715E0020092C8FC030713E048437CC151>I<D90FFFEB0FFCB690383FFF80
+93B512E04B14F04B14F8923907FC7FFC92390FE0FFFEC6EC1F806DD93F0113FF6D133E15
+7E157C15F8A215F07013FEA24BEB7FFCEF3FF8EF0FE04B90C7FCA55DB3B0B712F8A63841
+7BC042>114 D<913A3FFF8007800107B5EAF81F011FECFE7F017F91B5FC48B8FC48EBE0
+014890C7121FD80FFC1407D81FF0801600485A007F167F49153FA212FF171FA27F7F7F6D
+92C7FC13FF14E014FF6C14F8EDFFC06C15FC16FF6C16C06C16F06C826C826C826C82013F
+1680010F16C01303D9007F15E0020315F0EC001F1500041F13F81607007C150100FC8117
+7F6C163FA2171F7EA26D16F0A27F173F6D16E06D157F6D16C001FEEDFF806D0203130002
+C0EB0FFE02FCEB7FFC01DFB65A010F5DD8FE0315C026F8007F49C7FC48010F13E035437B
+C140>I<EC07E0A6140FA5141FA3143FA2147FA214FF5BA25B5B5B5B137F48B5FC000F91
+B512FEB8FCA5D8001F01E0C8FCB3AFEF0FC0AC171F6D6D1480A2173F6D16006F5B6D6D13
+7E6D6D5B6DEBFF836EEBFFF86E5C020F14C002035C9126003FFCC7FC325C7DDA3F>I<90
+2607FFC0ED3FFEB60207B5FCA6C6EE00076D826D82B3B3A260A360A2607F60183E6D6D14
+7E4E7F6D6D4948806D6DD907F0ECFF806D01FFEB3FE06D91B55A6E1500021F5C020314F8
+DA003F018002F0C7FC51427BC05A>I<B70081B600FC0103B512FCA6C66C0180C701FCC8
+381FFE006F6FED03F86D047F5F856F6E16076D646F70140F6D705F866F6E161F6D646F4A
+6D143F6D99C7FC4E7F6F616D1B7E6F4A6D14FE6D6395B57E7001FC15016E62DCC0016E13
+036EDBF87F5D05038004E0496C14076E62DCF007ED800F6E4B6C5D050F15C004F8496C14
+1F6E62DCFC1FEDE03F6E4B6C92C8FC053F15F004FE496C5C6E197E7048EDF8FE6E027E6D
+5C05FE15FC4D6D13FD6F601BFF6F496E5BA24D806F60A26F496E5BA24D806F60A26F496E
+90C9FCA294C87E6F5FA26F486F5A047C6F5A6E417DBF75>119 D
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fi cmsy10 10.95 1
+/Fi 1 16 df<EB0FFCEB3FFF90B512C0000314F04880488048804880A2481580A3B712C0
+AA6C1580A36C1500A26C5C6C5C6C5C6C5CC614C0013F90C7FCEB0FFC22227BA72D>15
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fj cmtt10 10.95 89
+/Fj 89 127 df<121C127FEAFF80B3EA7F00B2123EC7FCA8121C127FA2EAFF80A3EA7F00
+A2121C09396DB830>33 D<00101304007C131F00FEEB3F80A26C137FA248133FB2007E14
+00007C7F003C131E00101304191C75B830>I<903907C007C0A2496C487EA8011F131FA2
+02C05BA3007FB7FCA2B81280A36C16006C5D3A007F807F80A2020090C7FCA9495BA2003F
+90B512FE4881B81280A36C1600A22701FC01FCC7FCA300031303A201F85BA76C486C5AA2
+29387DB730>I<EB07E0EB1FF8497E137F497E803801FC7F497E810003131F13F0A6143F
+92C8FC91387F0FFF9026F87E1F1380000113FEEBF9FC13FB4A6C1300D9FFF013C06C13E0
+151F02C05BEB7F809038FF003F4892C7FC485C48EB807E5A15FE391FDFC0FC383F8FE014
+E1397F07F1F8EB03F300FEEBFBF0EB01FF5D7FEDC006027F130F91393F801F8015C06C13
+7F6CEBFFE049EBF83F018701FC1300263FFFFBB5FC6C01F15B14E06C9038C03FFC000390
+38001FF8D801FCEB07E0293A7DB830>38 D<EA07C0EA0FF0EA1FF8A213FCA213FE120F12
+07EA007EA513FE13FCA2120113F81203EA07F0120FEA1FE0127FEAFFC013801300127C12
+380F1D70B730>I<141E147F14FF5BEB03FEEB07FCEB0FF0EB1FE0EB3FC0EB7F80EBFF00
+485A5B12035B485A120F5BA2485AA2123F5BA2127F90C7FCA412FEAD127FA47F123FA27F
+121FA26C7EA27F12076C7E7F12017F6C7EEB7F80EB3FC0EB1FE0EB0FF0EB07FCEB03FEEB
+01FF7F147F141E184771BE30>I<127812FE7E7F6C7E6C7EEA0FF06C7E6C7E6C7E6C7EEB
+7F80133F14C0131FEB0FE014F01307A2EB03F8A214FC1301A214FE1300A4147FAD14FEA4
+130114FCA2130314F8A2EB07F0A2130F14E0EB1FC0133F1480137FEBFF00485A485A485A
+485AEA3FE0485A485A90C7FC5A1278184778BE30>I<14E0497E497EA60038EC0380007E
+EC0FC0D8FF83EB3FE001C3137F9038F3F9FF267FFBFB13C06CB61280000FECFE00000314
+F86C5C6C6C13C0011F90C7FC017F13C048B512F04880000F14FE003FECFF80267FFBFB13
+C026FFF3F913E09038C3F87F0183133FD87E03EB0FC00038EC0380000091C7FCA66D5A6D
+5A23277AAE30>I<143EA2147FAF007FB7FCA2B81280A36C1600A2C76CC8FCAF143EA229
+297DAF30>I<EA03E0EA0FF0EA1FF813FCEA3FFEA213FFA27EA27E1203EA007FA2137E13
+FEEA01FC1203EA07F8EA3FF0127FEAFFE0EA7F801300123C1019708B30>I<007FB612F0
+A2B712F8A36C15F0A225077B9E30>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0
+EA0F000C0C6E8B30>I<16F01501ED03F8A21507A2ED0FF0A2ED1FE0A2ED3FC0A2ED7F80
+A2EDFF00A24A5AA25D1403A24A5AA24A5AA24A5AA24A5AA24A5AA24AC7FCA2495AA25C13
+03A2495AA2495AA2495AA2495AA2495AA249C8FCA2485AA25B1203A2485AA2485AA2485A
+A2485AA2485AA248C9FCA25AA2127CA225477BBE30>I<14FE903807FFC0497F013F13F8
+497F90B57E48EB83FF4848C6138049137F4848EB3FC04848EB1FE049130F001F15F04913
+07A24848EB03F8A290C712014815FCA400FEEC00FEAD6C14016C15FCA36D1303003F15F8
+A26D1307001F15F0A26D130F6C6CEB1FE0A26C6CEB3FC06C6CEB7F806D13FF2601FF8313
+006CEBFFFE6D5B6D5B010F13E06D5BD900FEC7FC273A7CB830>I<EB03C0497EA2130FA2
+131FA2133F137F13FF1203123FB5FCA213EF138FEA7E0F1200B3B0003FB512F84814FCB6
+12FEA26C14FC6C14F81F3977B830>I<EB07FC90383FFFC090B512F00003804814FE4880
+261FF80F1380263FE00113C09038C0007F4848EB3FE090C7121FED0FF04814075A6C15F8
+1503A3127E1218C8FCA2150716F0150F16E0151F16C0153FED7F8015FF4A13005DEC07FC
+4A5A4A5A4A5A4A5A4A5A4990C7FC495A495AEB0FF0EB3FE0495A495A4890C8FC4848EB01
+F04848EB03F8485AEA1FE048B6FCB7FCA37E6C15F025397BB830>I<EB03FF013F13E090
+B512F84814FE4880481580260FFE0113C09038F0007F4848EB1FE0150F16F01507A26C5A
+6C5AC8FC150F16E0A2151FED3FC0157FEDFF8002071300903807FFFE495B5D8115FF6D14
+80D9000113C09138003FE0ED1FF0ED07F8150316FC150116FE1500A21218127EB4FCA215
+0116FC4814036C15F86C6C13076DEB1FF0D83FF0133F3A1FFE01FFE06CB612C06C15806C
+ECFE00C65C013F13F001031380273A7CB830>I<EC03FC4A7E140F141FA2143F147F157E
+14FEA2EB01FCEB03F8A2EB07F0A2EB0FE0EB1FC0A2EB3F80A2EB7F0013FEA2485A485AA2
+485AA2485A485AA2485AA248C7FC12FEB8FC1780A46C1600C8007EC7FCAA91387FFFFE91
+B6FCA46E5B29397DB830>I<000FB612804815C05AA316800180C8FCAEEB83FF019F13C0
+90B512F015FC8181D9FE0313809039F0007FC049133F0180EB1FE06CC7120F000E15F0C8
+1207A216F81503A31218127EA2B4FC150716F048140F6C15E06C141F6DEB3FC06D137F3A
+3FE001FF80261FFC0F13006CB55A6C5C6C5C6C14E06C6C1380D90FFCC7FC25397BB730>
+I<EC0FF8EC7FFF49B51280010714E0131F4914F090387FF80F9039FFC007F84813803803
+FE005B485A4848EB03F0ED01E0484890C7FC5B123F5BA2127FEB000C903803FFE0010F13
+F8D8FF3F13FE48B6FCB7128016C09039FE007FE001F8EB1FF001E0130F49EB07F8ED03FC
+5B90C7120116FE1500A37EA46C7E15016D14FC121F6D1303000FEC07F86D130F6C6CEB1F
+F06DEB3FE03A03FF81FFC06C90B512806C15006D5B011F13F8010713E001011380273A7C
+B830>I<127CB712FC16FEA416FC48C7EA0FF816F0ED1FE0007CEC3FC0C8EA7F80EDFF00
+A24A5A4A5A5D14075D140F5D4A5AA24A5AA24AC7FCA25C5C13015CA213035CA213075CA4
+495AA6131F5CA96D5A6DC8FC273A7CB830>I<49B4FC011F13F0017F13FC90B57E0003EC
+FF804815C048010113E03A1FF8003FF049131FD83FC0EB07F8A24848EB03FC90C71201A5
+6D1303003F15F86D13076C6CEB0FF06C6CEB1FE0D807FCEB7FC03A03FF83FF806C90B512
+006C6C13FC011F13F0497F90B512FE48802607FE0013C0D80FF8EB3FE0D81FE0EB0FF048
+48EB07F8491303007F15FC90C712014815FE481400A66C14016C15FC6D1303003F15F86D
+1307D81FF0EB1FF06D133F3A0FFF01FFE06C90B512C06C1580C6ECFE006D5B011F13F001
+0190C7FC273A7CB830>I<49B4FC010F13E0013F13F890B57E4880488048010113803A0F
+FC007FC0D81FF0EB3FE04848131F49EB0FF048481307A290C7EA03F85A4815FC1501A416
+FEA37E7E6D130315076C7E6C6C130F6D133FD80FFC13FF6CB6FC7E6C14FE6C14F9013FEB
+E1FC010F138190380060011400ED03F8A2150716F0150F000F15E0486C131F486CEB3FC0
+157FEDFF804A1300EC07FE391FF01FFC90B55A6C5C6C5C6C1480C649C7FCEB3FF0273A7C
+B830>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F00C7FCAF120FEA3FC0EA
+7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C276EA630>I<EA03C0EA0FF0EA1FF8A2EA3F
+FCA4EA1FF8A2EA0FF0EA03C0C7FCAFEA03C0EA0FF0121F13F8123F13FCA3121FA2120F12
+031200120113F8120313F01207EA1FE0123FEA7FC0EAFF80EA7F00127E12380E3470A630
+>I<16F01503ED07F8151F157FEDFFF014034A13C0021F138091383FFE00ECFFF8495B01
+0713C0495BD93FFEC7FC495A3801FFF0485B000F13804890C8FCEA7FFC5BEAFFE05B7FEA
+7FF87FEA1FFF6C7F000313E06C7F38007FFC6D7E90380FFF806D7F010113F06D7FEC3FFE
+91381FFF80020713C06E13F01400ED7FF8151F1507ED03F01500252F7BB230>I<007FB7
+FCA2B81280A36C16006C5DCBFCA7003FB612FE4881B81280A36C1600A229157DA530>I<
+1278127EB4FC13C07FEA7FF813FEEA1FFF6C13C000037F6C13F86C6C7EEB1FFF6D7F0103
+13E06D7F9038007FFC6E7E91380FFF806E13C0020113F080ED3FF8151F153FEDFFF05C02
+0713C04A138091383FFE004A5A903801FFF0495B010F13804990C7FCEB7FFC48485A4813
+E0000F5B4890C8FCEA7FFE13F8EAFFE05B90C9FC127E1278252F7BB230>I<EC1FE0ECFF
+F8010313FE010F7F4914804914C090397FF03FE09038FF800F4890380007F0D803FC1303
+3A07F801FBF89038F007FF380FE01F4A13FCEA1FC0495A003FEBFF0F903800FE07903901
+FC03FE007FEBF801EA7E03ECF000A2EAFE0700FC49137EAA00FE6D13FED87E0314FCA2EC
+F801D87F0114F8003FEBFC03903900FE07F0903880FF0F001F90387FFFE06D6C13C0EA0F
+E06E13803A07F007FE009038F801F86C6CC7127C6CB414FE6CEB800390387FF01F6DB512
+FC6D14F86D14E0010314C00100EBFE00EC1FF0273A7CB830>64 D<147F4A7EA2497FA449
+7F14F7A401077F14E3A3010F7FA314C1A2011F7FA490383F80FEA590387F007FA4498049
+133F90B6FCA34881A39038FC001F00038149130FA4000781491307A2D87FFFEB7FFFB56C
+B51280A46C496C130029397DB830>I<007FB512F0B612FE6F7E82826C813A03F8001FF8
+15076F7E1501A26F7EA615015EA24B5A1507ED1FF0ED7FE090B65A5E4BC7FC6F7E16E082
+9039F8000FF8ED03FC6F7E1500167FA3EE3F80A6167F1700A25E4B5A1503ED1FFC007FB6
+FCB75A5E16C05E6C02FCC7FC29387EB730>I<91387F803C903903FFF03E49EBFC7E011F
+13FE49EBFFFE5B9038FFE07F48EB801F3903FE000F484813075B48481303A2484813015B
+123F491300A2127F90C8FC167C16005A5AAC7E7EA2167C6D14FE123FA27F121F6D13016C
+6C14FCA26C6CEB03F86D13076C6CEB0FF03901FF801F6C9038E07FE06DB512C06D14806D
+1400010713FC6D13F09038007FC0273A7CB830>I<003FB512E04814FCB67E6F7E6C816C
+813A03F8007FF0ED1FF8150F6F7E6F7E15016F7EA2EE7F80A2163F17C0161FA4EE0FE0AC
+161F17C0A3163F1780A2167F17005E4B5A15034B5A150F4B5AED7FF0003FB65A485DB75A
+93C7FC6C14FC6C14E02B387FB730>I<007FB7FCB81280A47ED803F8C7123FA8EE1F0093
+C7FCA4157C15FEA490B5FCA6EBF800A4157C92C8FCA5EE07C0EE0FE0A9007FB7FCB8FCA4
+6C16C02B387EB730>I<003FB712804816C0B8FCA27E7ED801FCC7121FA8EE0F8093C7FC
+A5153E157FA490B6FCA69038FC007FA4153E92C8FCAE383FFFF8487FB5FCA27E6C5B2A38
+7EB730>I<02FF13F00103EBC0F8010F13F1013F13FD4913FF90B6FC4813C1EC007F4848
+133F4848131F49130F485A491307121F5B123F491303A2127F90C7FC6F5A92C8FC5A5AA8
+92B5FC4A14805CA26C7F6C6D1400ED03F8A27F003F1407A27F121F6D130F120F7F6C6C13
+1FA2D803FE133F6C6C137FECC1FF6C90B5FC7F6D13FB010F13F30103EBC1F0010090C8FC
+293A7DB830>I<3B3FFF800FFFE0486D4813F0B56C4813F8A26C496C13F06C496C13E0D8
+03F8C7EAFE00B290B6FCA601F8C7FCB3A23B3FFF800FFFE0486D4813F0B56C4813F8A26C
+496C13F06C496C13E02D387FB730>I<007FB6FCB71280A46C1500260007F0C7FCB3B3A8
+007FB6FCB71280A46C1500213879B730>I<49B512F04914F85BA27F6D14F090C7EAFE00
+B3B3123C127EB4FCA24A5A1403EB8007397FF01FF86CB55A5D6C5C00075C000149C7FC38
+003FF025397AB730>I<D83FFF90380FFF80486D4813C0B56C5AA26C497E6C496C1380D8
+03F0903803F8004B5A4B5A151F4B5A5E4BC7FC15FE14014A5A5D4A5A4A5A141F5D4A5A4A
+C8FC5C13F18101F37F13F790B57E14EFECC7F01483EC03F8140101FE7F496C7E5B157F49
+7F82151F82150F826F7EA26F7E1501821500D83FFF903803FFC0486D4813E0B56C5AA26C
+497E6C496C13C02B387FB730>I<383FFFF8487FB57EA26C5B6C5BD801FCC9FCB3B0EE0F
+80EE1FC0A9003FB7FC5AB8FCA27E6C16802A387EB730>I<D83FF8ECFFE0486C4913F048
+6C4913F8A2007F16F06C6C4913E00007160001EF14BFEC800FA39039E7C01F3FA4ECE03F
+01E3133EA2ECF07EA201E1137CA2ECF8FCA201E013F8A214FDEC7DF0A3147FEC3FE0A3EC
+1FC0A2EC070091C7FCADD83FFC903801FFE0486C4913F0B54913F8A26C486D13F06C486D
+13E02D387FB730>I<D83FFC90381FFF80486C4913C0B54913E0A26C6D6C13C06C6E1380
+0003913801F800EBF7C0A3EBF3E0A314F013F1A214F8A213F014FCA2147C147EA2143E14
+3FA2141FA21581A2140F15C1A2140715E1A2140315F1A21401A215F91400A3157DA3153F
+EA3FFF481380B5EAC01FA26CEB800F6C496C5A2B387EB730>I<90383FFFE048B512FC00
+0714FF4815804815C04815E0EBF80001E0133FD87F80EB0FF0A290C71207A44815F84814
+03B3A96C1407A26C15F0A36D130FA26D131F6C6CEB3FE001F813FF90B6FC6C15C06C1580
+6C1500000114FCD8003F13E0253A7BB830>I<007FB512F0B612FE6F7E16E0826C813903
+F8003FED0FFCED03FE15016F7EA2821780163FA6167F17005EA24B5A1503ED0FFCED3FF8
+90B6FC5E5E16804BC7FC15F001F8C9FCB0387FFFC0B57EA46C5B29387EB730>I<90383F
+FFE048B512FC000714FF4815804815C04815E0EBF80001E0133F4848EB1FF049130F90C7
+1207A44815F8481403B3A8147E14FE6CEBFF076C15F0EC7F87A2EC3FC7018013CF9038C0
+1FFFD83FE014E0EBF80F90B6FC6C15C06C15806C1500000114FCD8003F7FEB00016E7EA2
+1680157F16C0153F16E0151F16F0150FED07E025467BB830>I<003FB57E4814F0B612FC
+15FF6C816C812603F8017F9138003FF0151F6F7E15071503821501A515035E1507150F4B
+5A153F4AB45A90B65A5E93C7FC5D8182D9F8007FED3FE0151F150F821507A817F8EEF1FC
+A53A3FFF8003FB4801C0EBFFF8B56C7E17F06C496C13E06C49EB7FC0C9EA1F002E397FB7
+30>I<90390FF803C0D97FFF13E048B512C74814F74814FF5A381FF80F383FE001497E48
+48137F90C7123F5A48141FA2150FA37EED07C06C91C7FC7F7FEA3FF0EA1FFEEBFFF06C13
+FF6C14E0000114F86C80011F13FF01031480D9003F13C014019138007FE0151FED0FF0A2
+ED07F8A2007C140312FEA56C140716F07F6DEB0FE06D131F01F8EB3FC001FF13FF91B512
+80160000FD5CD8FC7F13F8D8F81F5BD878011380253A7BB830>I<003FB712C04816E0B8
+FCA43AFE003F800FA8007CED07C0C791C7FCB3B1011FB5FC4980A46D91C7FC2B387EB730
+>I<3B7FFFC007FFFCB56C4813FEA46C496C13FCD803F8C7EA3F80B3B16D147F00011600
+A36C6C14FE6D13016D5CEC800390393FE00FF890391FF83FF06DB55A6D5C6D5C6D91C7FC
+9038007FFCEC1FF02F3980B730>I<D87FFE90380FFFC0B54913E06E5AA24A7E6C486D13
+C0D807F0903801FC00A26D130300035DA46C6C495AA46C6C495AA46D131F6D5CA3EC803F
+013F5CA46D6C48C7FCA490380FE0FEA401075B14F1A301035BA314FB01015BA314FFA26D
+5BA46E5A6E5A2B397EB730>I<D83FFC903801FFE0486C4913F000FF16F8A2007F16F06C
+486D13E0D81FC09038001FC0000F1680A76D143F00071600A7000390380F803E9039F01F
+C07EEC3FE0A3EC7FF0A2147D0001157CA29039F8FDF8FCA314F8A300005D01F913FCA2EC
+F07CA201FD137DA2017D5CECE03DA3017F133FA2ECC01FA2013F5CA2EC800F6D486C5A2D
+397FB730>I<3A3FFF01FFF84801837F02C77FA202835B6C01015B3A01FC007F806D91C7
+FC00005C6D5BEB7F01EC81FCEB3F8314C3011F5B14E7010F5B14FF6D5BA26D5BA26D5BA2
+6D90C8FCA4497FA2497FA2815B81EB0FE781EB1FC381EB3F8181EB7F0081497F49800001
+143F49800003141F49800007140FD87FFEEB7FFFB590B5128080A25C6C486D130029387D
+B730>I<D87FFF90381FFFC0B56C4813E0A46C496C13C0D803F8903803F8006D1307A26C
+6C495AA26C6C5C151F6D5CEC803F013F5CECC07F011F91C7FCA290380FE0FEA214F10107
+5BA2903803FBF8A201015B14FF6D5BA26E5AA36E5AB1903803FFF8497F497FA26D5B6D5B
+2B387EB730>I<001FB612FC4815FE5AA490C7EA03FCED07F816F0150FED1FE016C0153F
+ED7F80003E1500C85A4A5A5D14034A5A5D140F4A5A5D143F4A5A92C7FC5C495A5C130349
+5A5C130F495A5C133F495A91C8FC5B4848147C4914FE1203485A5B120F485A5B123F485A
+90B6FCB7FCA46C15FC27387CB730>I<007FB5FCB61280A4150048C8FCB3B3B3A5B6FC15
+80A46C140019476DBE30>I<007FB5FCB61280A47EC7123FB3B3B3A5007FB5FCB6FCA46C
+140019477DBE30>93 D<1307EB1FC0EB7FF0497E000313FE000FEBFF80003F14E0D87FFD
+13F039FFF07FF8EBC01FEB800F38FE0003007CEB01F00010EB00401D0E77B730>I<007F
+B612F0A2B712F8A36C15F0A225077B7D30>I<EB3FFC48B57E4814E04880488048809038
+F00FFE9038E001FF806F7E6C48133F6C4880C8121FA491B5FC130F137F48B6FC12075A48
+EBC01F383FFC00EA7FE0138048C7FC5AA46C143FA26C6C137F9038C001FF263FF80FEBFF
+C06CB712E0A2000714F76C14C3C6020013C0D93FF090C7FC2B2A7CA830>97
+D<EA3FFC487E12FFA2127F123F1200AAEC03FE91381FFF80027F13E091B57E90B612FC82
+ECFE079138F001FF4A6C13804A137F4AEB3FC091C7121F4915E0160FA217F01607A8160F
+A217E07F161F6EEB3FC0A26EEB7F806E13FFDAF00313009138FC0FFE91B55A5E495CD97E
+7F13C0D93C1F90C7FC90380003FC2C3980B730>I<ECFFE0010713FC011F7F017F7F90B6
+12804815C048EB807F3907FC003F485A485A49EB1F804848EB0F004990C7FC127F90C9FC
+A25A5AA87E7EA27F003FEC07C06DEB0FE06C7E6D131F6C6C14C0D807FE133F9039FFC0FF
+806C90B5FCC615006D5B011F13F801075B01011380232A7AA830>I<913801FFE04A7F5C
+A28080EC0007AAEB03FE90381FFF874913E790B6FC5A5A481303380FFC00D81FF0133F49
+131F485A150F4848130790C7FCA25AA25AA87E6C140FA27F003F141F6D133F6C7E6D137F
+390FF801FF2607FE07EBFFC06CB712E06C16F06C14F76D01C713E0011F010313C0D907FC
+C8FC2C397DB730>I<49B4FC010713E0011F13F8017F7F90B57E488048018113803A07FC
+007FC04848133FD81FE0EB1FE0150F484814F0491307127F90C7FCED03F85A5AB7FCA516
+F048C9FC7E7EA27F003FEC01F06DEB03F86C7E6C7E6D1307D807FEEB1FF03A03FFC07FE0
+6C90B5FC6C15C0013F14806DEBFE00010713F8010013C0252A7CA830>I<EDFF80020713
+E0021F13F05C4A13F891B5FC491387903803FE079138FC03F0903907F800C04A1300A800
+3FB612C04815E0B7FCA36C15C0260007F0C7FCB3A9003FB512FE4880B71280A26C15006C
+5C25397DB830>I<D903FC13FF90261FFF8713C04913DF90B712E05A5A2607FE07138F90
+3AF801FE07C048486C6CC7FCA2497F001F8149133FA56D137F000F92C7FC6D5BA26C6C48
+5AEBFE0790B55A5D485C15C001DF5BD9C3FCC8FC01C0C9FCA37F7F6CB512F015FF6C15C0
+4815F0488148813A3FE0001FFE0180130148C8127F007E8100FE168048151FA56C153F00
+7FED7F006D5C6C6C495A01F013076CB4EB7FFC6C90B55A6C5D000115C06C6C91C7FC011F
+13FC010113C02B3E7DA730>I<EA3FFC487E12FFA2127F123F1200AAEC01FE91380FFF80
+023F13E091B57E90B67EA29138FE07FCECF8039138E001FE14C0EC8000A291C7FCA25BB3
+A23B3FFFF81FFFF8486D4813FCB500FE14FEA26C01FC14FC6C496C13F82F3880B730>I<
+14E0EB03F8A2497EA36D5AA2EB00E091C8FCA9381FFFF8487F5AA27E7EEA0001B3A9003F
+B612C04815E0B7FCA27E6C15C023397AB830>I<EC01C0EC07F0A2EC0FF8A3EC07F0A2EC
+01C091C7FCA990B512F04814F8A47EEB0003B3B3A5EC07F0A2123C007EEB0FE0B4131FEC
+3FC0147F90B512806C14005C6C5B000F13F0000313C01D4E7CB830>I<EA7FF8487EA412
+7F1200AB0203B512804A14C017E0A217C06E14809139001FE0004B5A4B5A4BC7FC4A5A4A
+5AEC0FF84A5A4A5A4A5A4A5A01FD7F90B57E8114F7ECE3F8ECC1FCEC81FEEC00FF497F49
+6D7E6F7E826F7E15076F7E6F7E3B7FFFF81FFFE0B56C4813F017F8A217F06C496C13E02D
+387FB730>I<387FFFF8B57EA47EEA0001B3B3A8007FB612F0B712F8A46C15F025387BB7
+30>I<02FC137E3B7FC3FF01FF80D8FFEF01877F90B500CF7F15DF92B57E6C010F138726
+07FE07EB03F801FC13FE9039F803FC01A201F013F8A301E013F0B3A23C7FFE0FFF07FF80
+B548018F13C0A46C486C01071380322881A730>I<EC01FE3A3FFC0FFF80267FFE3F13E0
+00FF90B57E90B67E7E6C9038FE07FCC6EBF8039138E001FE14C0EC8000A291C7FCA25BB3
+A23B3FFFF81FFFF8486D4813FCB500FE14FEA26C01FC14FC6C496C13F82F2880A730>I<
+49B4FC010F13E0013F13F8497F90B57E0003ECFF8014013A07FC007FC04848EB3FE0D81F
+E0EB0FF0A24848EB07F8491303007F15FC90C71201A300FEEC00FEA86C14016C15FCA26D
+1303003F15F86D13076D130F6C6CEB1FF06C6CEB3FE06D137F3A07FF01FFC06C90B51280
+6C15006C6C13FC6D5B010F13E0010190C7FC272A7CA830>I<EC03FE3A3FFC1FFF80267F
+FE7F13E000FF90B57E90B612FC6C816CEBFE07C69038F001FF4A6C13804A137F4AEB3FC0
+91C7121F4915E0160FA217F01607A8160FA217E07F161F6EEB3FC0A26EEB7F806E13FFDA
+F00313009138FC0FFE91B55A5E495C6E13C0021F90C7FCEC03FC91C9FCAD383FFFF8487F
+B57EA26C5B6C5B2C3C80A730>I<49B413F8010FEBC1FC013F13F14913FD48B6FC5A4813
+81390FFC007F49131F4848130F491307485A491303127F90C7FC15015A5AA77E7E15037F
+A26C6C1307150F6C6C131F6C6C133F01FC137F3907FF01FF6C90B5FC6C14FD6C14F9013F
+13F1010F13C1903803FE0190C7FCAD92B512F84A14FCA46E14F82E3C7DA730>I<ED07F8
+3A3FFF803FFF486DB51280B512C302CF14C06C13DF6C9038FFFC3FD8001F13E09238801F
+809238000F004A90C7FC5C5C5CA25CA45CAF003FB512FC4880B7FCA26C5C6C5C2A287EA7
+30>I<90381FFC1E48B5129F000714FF5A5A5A387FF007EB800100FEC7FC4880A46C143E
+007F91C7FC13E06CB4FC6C13FC6CEBFF806C14E0000114F86C6C7F01037F9038000FFF02
+001380007C147F00FEEC1FC0A2150F7EA27F151F6DEB3F806D137F9039FC03FF0090B6FC
+5D5D00FC14F0D8F83F13C026780FFEC7FC222A79A830>I<EB0780497E131FA9003FB612
+E04815F0B7FCA36C15E026001FC0C7FCB216F8ED01FCA5ECE003010FEB07F814F09138FC
+1FF06DB512E06D14C016806D14009038007FFCEC1FF026337EB130>I<D83FFCEB3FFC48
+6C497E00FF14FFA2007F147F003F143F00001400B3A41501A2150315076D130F903A7FC0
+7FFFF891B612FC6D15FE7F6D4913FC6D9038F87FF8010001C0C7FC2F2880A630>I<3B3F
+FFC07FFF80486DB512C0B515E0A26C16C06C496C13803B01F80003F000A26D130700005D
+A26D130F017E5CA2017F131F6D5CA2EC803F011F91C7FCA26E5A010F137EA2ECE0FE0107
+5BA214F101035BA3903801FBF0A314FF6D5BA36E5A6E5A2B277EA630>I<3B3FFFC01FFF
+E0486D4813F0B515F8A26C16F06C496C13E0D807E0C7EA3F00A26D5C0003157EA56D14FE
+00015DEC0F80EC1FC0EC3FE0A33A00FC7FF1F8A2147DA2ECFDF9017C5C14F8A3017E13FB
+A290393FF07FE0A3ECE03FA2011F5C90390F800F802D277FA630>I<3A3FFF81FFFC4801
+C37FB580A26C5D6C01815BC648C66CC7FC137FEC80FE90383F81FC90381FC3F8EB0FE3EC
+E7F06DB45A6D5B7F6D5B92C8FC147E147F5C497F81903803F7E0EB07E790380FE3F0ECC1
+F890381F81FC90383F80FE90387F007E017E137F01FE6D7E48486D7E267FFF80B5FCB500
+C1148014E3A214C16C0180140029277DA630>I<3B3FFFC07FFF80486DB512C0B515E0A2
+6C16C06C496C13803B01FC0003F000A2000014076D5C137E150F017F5C7F151FD91F805B
+A214C0010F49C7FCA214E00107137EA2EB03F0157C15FCEB01F85DA2EB00F9ECFDF0147D
+147FA26E5AA36E5AA35DA2143F92C8FCA25C147EA2000F13FE486C5AEA3FC1EBC3F81387
+EB8FF0EBFFE06C5B5C6C90C9FC6C5AEA01F02B3C7EA630>I<001FB612FC4815FE5AA316
+FC90C7EA0FF8ED1FF0ED3FE0ED7FC0EDFF80003E491300C7485A4A5A4A5A4A5A4A5A4A5A
+4A5A4990C7FC495A495A495A495A495A495A4948133E4890C7127F485A485A485A485A48
+5A48B7FCB8FCA46C15FE28277DA630>I<ED3FF0913803FFF8140F5C147F16F09138FFF0
+0092C7FC495A5CB3A21303495A133F383FFFF0B55A5C91C8FC14C080003F7F38003FF813
+076D7E1301B3A2806D7E15F091387FFFF016F8141F8014039138003FF025477BBE30>I<
+127CA212FEB3B3B3AD127CA207476CBE30>I<EA7FE0EAFFFE6D7E8014F07EC66C7E1307
+6D7E1301B3A2806D7E15E091387FFFE06E13F8801407141F5C4A13E09138FFE00092C7FC
+495A5CB3A21303495A137F387FFFF0B5FC14C05C49C8FCEA7FE025477BBE30>I<017C13
+3848B4137C48EB80FE4813C14813C348EBEFFC397FEFFFF0D8FF8713E0010713C0486C13
+80D87C0113003838007C1F0C78B730>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fk cmbx12 14.4 49
+/Fk 49 122 df<EEFFFC031FEBFF804AB612E0020781021F9038C00FF8913A7FFE0003FC
+DAFFF0EB00FE4949EB03FF4901805B4990C7487F49485CA2495A4D7F013F6F5B5CA37190
+C7FC715AEF01F894C9FCA90403B512C0BAFCA526003FFCC7120783B3B3A6003FB5D8FC03
+B612C0A542547DD34B>12 D<B712F0AB240B7F9F2D>45 D<EA07F0487E487E487E487EB5
+1280A76C13006C5A6C5A6C5A6C5A1111769025>I<157815FC14031407141F14FF130F00
+07B5FCB6FCA2147F13F0EAF800C7FCB3B3B3A6007FB712FEA52F4E76CD43>49
+D<EC3FFE0103B512E0010F14FC013F14FF90B712C048D9C07F7F2703FE000F13F8D807F8
+01037FD80FE06D7F48486D7F48488001F01680486C6E13C07F486C6E13E07FA27013F0A5
+6C5AA26C5AEA0FF0EA03C0C914E05EA218C05E1880A24C13005F4C5A4B5B5F4B5B5F4B5B
+4B90C7FC4B5A5E4B5AED7FE04B5A4A5B4A48C8FC4A5A5D4A48EB01F04A5AEC3F804AC7FC
+02FEEC03E0495A495A495A495AD91F80140749C8FC013E150F017FB7FC90B812C05A5A5A
+5A5A5A5AB9FC1880A4344E79CD43>I<91380FFFC091B512FC0107ECFF80011F15E09026
+3FF8077F9026FF800113FC4848C76C7ED803F86E7E491680D807FC8048B416C080486D15
+E0A4805CA36C17C06C5B6C90C75AD801FC1680C9FC4C13005FA24C5A4B5B4B5B4B13C04B
+5BDBFFFEC7FC91B512F816E016FCEEFF80DA000713E0030113F89238007FFE707E701380
+7013C018E07013F0A218F8A27013FCA218FEA2EA03E0EA0FF8487E487E487EB57EA318FC
+A25E18F891C7FC6C17F0495C6C4816E001F04A13C06C484A1380D80FF84A13006CB44A5A
+6CD9F0075BC690B612F06D5D011F1580010302FCC7FCD9001F1380374F7ACD43>I<177C
+17FEA2160116031607160FA2161F163F167FA216FF5D5DA25D5DED1FBFED3F3F153E157C
+15FCEC01F815F0EC03E01407EC0FC01580EC1F005C147E147C5C1301495A495A5C495A13
+1F49C7FC133E5B13FC485A5B485A1207485A485A90C8FC123E127E5ABA12C0A5C96C48C7
+FCAF020FB712C0A53A4F7CCE43>I<D80380150ED807E0157E01FEEC03FED9FFF0137F91
+B65A5F5F5F5F5F94C7FC5E5E16F016C093C8FC15F801E190C9FC01E0CAFCABEC0FFF027F
+13F001E3B512FE01E76E7E9026FFF8077FDAC0017F49C713F8496E7E49143F4981496E7E
+6C481680C9FC18C08218E0A418F0A3EA0FE0487E487E487E487EA418E0A35B6C484A13C0
+5B491680003EC85A003F17006C6C4A5A6D5D6C6C4A5AD807F8495BD803FE01075B2701FF
+C03F5B6C90B65A013F4AC7FC6D14F8010314C09026007FF8C8FC344F79CD43>I<ED0FFF
+92B512E0020780021F14FC91397FFE03FE903A01FFF0007F4901C0EB3F804990C7121F49
+48EC7FC0494814FF49484913E049485B01FF5C485BA2485B5AA2486F13C04A6D1380486F
+1300177E94C7FC5AA291CAFC5AA21508913801FFF8020713FFB54814C04A14F04AC66C7E
+023C6D7E4A6D7E4A6D7E7013804A15C0A24A15E07013F05C18F8A491C714FCA37EA67EA4
+6C17F880A27E18F06C5D18E06C6D15C07E6E4913806C6D15006D6C495A6D6CEB7FFC6DB4
+48485A6D90B55A010315C0010092C7FC023F13FC020713C0364F7ACD43>I<121F7F7FEB
+FF8091B81280A45A1900606060A2606060485F0180C86CC7FC007EC95A4C5A007C4B5A5F
+4C5A160F4C5A484B5A4C5A94C8FC16FEC812014B5A5E4B5A150F4B5AA24B5AA24B5A15FF
+A24A90C9FCA25C5D1407A2140FA25D141FA2143FA4147F5DA314FFA55BAC6D5BA2EC3FC0
+6E5A395279D043>I<913807FFC0027F13FC0103B67E010F15E090261FFC0113F8903A3F
+E0003FFCD97F80EB0FFE49C76C7E48488048486E1380000717C04980120F18E0177FA212
+1F7FA27F7F6E14FF02E015C014F802FE4913806C7FDBC00313009238F007FE6C02F85B92
+38FE1FF86C9138FFBFF06CEDFFE017806C4BC7FC6D806D81010F15E06D81010115FC0107
+81011F81491680EBFFE748018115C048D9007F14E04848011F14F048487F484813030300
+14F8484880161F4848020713FC1601824848157F173FA2171FA2170FA218F8A27F007F17
+F06D151FA26C6CED3FE0001F17C06D157F6C6CEDFF806C6C6C010313006C01E0EB0FFE6C
+01FCEBFFFC6C6CB612F06D5D010F1580010102FCC7FCD9000F13C0364F7ACD43>I<9138
+0FFF8091B512F8010314FE010F6E7E4901037F90267FF8007F4948EB3FF048496D7E4849
+80486F7E484980824817805A91C714C05A7013E0A218F0B5FCA318F8A618FCA46C5DA37E
+A25E6C7F6C5DA26C5D6C7F6C6D137B6C6D13F390387FF803011FB512E36D14C301030283
+13F89039007FFE03EC00401500A218F05EA3D801F816E0487E486C16C0487E486D491380
+A218005E5F4C5A91C7FC6C484A5A494A5A49495B6C48495BD803FC010F5B9027FF807FFE
+C7FC6C90B55A6C6C14F06D14C0010F49C8FC010013F0364F7ACD43>I<91B5FC010F14F8
+017F14FF90B712C00003D9C00F7F2707FC00017FD80FE06D7F48486E7E48C87FD87FE06E
+7E7F7F486C1680A66C5A18006C485C6C5AC9485A5F4B5B4B5B4B5B4B5B4B90C7FC16FC4B
+5A4B5A16C04B5A93C8FC4A5A5D14035D5D14075DA25D140FA25DAB91CAFCAAEC1FC04A7E
+ECFFF8497FA2497FA76D5BA26D5BEC3FE06E5A315479D340>63 D<BA7E19FCF1FF801AF0
+1AFCD8000701F0C7000F13FF060014C0071F7F070713F807017F737F747E747F747F8674
+7F747F8886888688A2757EA31D8087A21DC0A51DE0A387A963A31DC0A51D80A2631D00A3
+515AA2646264505B6264505B505B5090C7FCF2FFFE4F5B07075B071F5B96B512C0060F91
+C8FCBB5A1AF01AC007FCC9FC19805B527CD167>68 D<BC1280A5D8000701F8C7000114C0
+F0001F19071901851A7F1A3F1A1FA2F20FE0A21A07A31A03A318F81BF01A01A497C7FC17
+01A317031707170F177F92B6FCA59238F8007F170F170717031701A317001B3EA31B7CA3
+95C8FCA21BFCA21BF8A21A01A31A031BF01A071A0FA21A1F1A3FF27FE0F101FF1907191F
+0603B5FCBCFCA21BC0A34F517CD058>I<BB12FEA5D8000701F8C700077FF0007F191F19
+0785858586861B80A21A1FA31A0FA41BC006F81307A497C7FCA31701A317031707170F17
+7F92B6FCA59238F8007F170F170717031701A31700A795C9FCB3B812F8A54A517CD055>
+I<B8D8C003B8FCA5D8000701F8C9001FEBE000B3AE92BAFCA503F8C9121FB3B1B8D8C003
+B8FCA560527CD169>72 D<B812C0A5D8000701F8C7FCB3B3B3B2B812C0A52A527CD132>
+I<027FB71280A591C76C90C7FCB3B3B3EA07F0EA1FFC487E487EA2B57EA44C5AA34A485B
+7E49495BD83FF8495BD81FE05DD80FFC011F5B2707FF807F90C8FC000190B512FC6C6C14
+F0011F14C0010101F8C9FC39537DD145>I<B812F8A5D8000701F8CAFCB3B3A91A7CA41A
+FC1AF8A51901A31903A219071AF0190FA2191F193F197F19FF180360183F4DB5FCBB12E0
+A546527CD151>76 D<B600FC073FB512FE6F61A26F96B6FCA2D80007F5C00070EF01EFA2
+02EF6DEF03CFA202E76DEF078FA202E36DEF0F0FA202E16D171EA302E06D173CA26F6C17
+78A26F6C17F0A26F6DED01E0A26F6DED03C0A36F6DED0780A26F6DED0F00A26F6D151EA2
+6F6D5DA3706C5DA2706C5DA2706D495AA2706D495AA2706D495AA3706D49C7FCA2706D13
+1EA2706D5BA2716C5BA3716C5BA271EB81E0A271EBC3C0A271EBE780A27101FFC8FCA371
+5BA2715BA2725AA2725AA2D93FFC6F5AB74DB712FEA2725AA2725A77527CD180>I<BAFC
+19F819FF1AE086D8000701F0C7001F13FC060113FF726C13807313C0070F13E01BF08573
+13F81BFCA27313FEA41BFFA81BFEA31BFC61A21BF84F13F04F13E0614F13C04F13004E48
+5A061F5B92B812F01AC04FC7FC19E003F8CBFCB3AEB812C0A550527CD15C>80
+D<B912F0F0FF8019F819FF1AC0D8000701F0C714F0060F7F060113FE727F737F737F8573
+7F87A2737FA387A863A2616363A24F5B4F5B4F90C8FC4F5A06035B060F13F095B512C092
+B8C9FC19F819E019F89226F0000313FE9439007FFF80727F727F727F727F727F8684A286
+84A787A71D1C75133EA38575137E73157C7513FC731401B86C6D9038F803F807039038FE
+07F07390B512E0736C14C0080F1400CEEA7FFC5F537CD164>82 D<91260FFF80130791B5
+00F85B010702FF5B011FEDC03F49EDF07F9026FFFC006D5A4801E0EB0FFD4801800101B5
+FC4848C87E48488149150F001F824981123F4981007F82A28412FF84A27FA26D82A27F7F
+6D93C7FC14C06C13F014FF15F86CECFF8016FC6CEDFFC017F06C16FC6C16FF6C17C06C83
+6C836D826D82010F821303010082021F16801400030F15C0ED007F040714E01600173F05
+0F13F08383A200788200F882A3187FA27EA219E07EA26CEFFFC0A27F6D4B13806D17006D
+5D01FC4B5A01FF4B5A02C04A5A02F8EC7FF0903B1FFFC003FFE0486C90B65AD8FC0393C7
+FC48C66C14FC48010F14F048D9007F90C8FC3C5479D24B>I<003FBC1280A59126C0003F
+9038C0007F49C71607D87FF8060113C001E08449197F49193F90C8171FA2007E1A0FA300
+7C1A07A500FC1BE0481A03A6C994C7FCB3B3AC91B912F0A553517BD05E>I<B800C00103
+B612FCA5D8000701F8CAEBF000F31F80B3B3B11B3FA26D97C7FC81637F1B7E6D6D17FE50
+5A6E7E505A6E6D15076E4D5A6E6D4B5A6E6D4B5A6E01F84B5A6E6DDA03FFC8FC6E6CB46C
+EB0FFE6F9039F001FFF8030F90B65A030316C0DB007F92C9FC040F14F8DC007F13805E53
+7CD167>I<B700FC017FB600FE91B612F0A5D8003F01C0C8001F01E0C9EBF8006F71EE0F
+C06D7161876F1C1F6D7196C7FC6F8373606D1E3E6F836D7160876F1CFC6D666F4B801F01
+6D66704A806E525A88704A17076E059F5F70021F80080F160F6E6570023F806EDC3E074C
+C8FC8870027E5F6EDC7C03163E7002FC804F6C167E6E1C7C700101814F6C16FC6E745B70
+010317016E4C6D5D060716C00580496D14036F63DDC00F16E04F6D14076F07F05BDDE01F
+170F6F92C76C5D1DF8DDF03E6E141F6F98C9FCDDF87E16FC067C6E5C6FF1FE3EDDFCFC17
+7E6F4A6E147C1DFFDDFFF06E14FC6F62A24E816F62A270496F5BA24E817061A295C97E70
+61A270487090CAFCA37048705AA24D1601040360A27048705A84537DD18B>87
+D<EC7FFF0107B512F0013F14FE90B77E48D9E00F7F2703FE000113F0486C6D7F6EEB3FFC
+48826E131F83707FA36C496D7FA26C90C7FC6C5AC9FCA6037FB5FC020FB6FC91B7FC0107
+1487013FEBF0074913803901FFFC004813F0485B485B485B4890C7FC5A5BA2485AA45EA2
+6D5C007F151D163D6C6C02797F6C6D01F113F86C9026C003E1EBFFE06C9026F81FC014F0
+6C90B5487EC6ED001F011F01FC010713E0010101E090C8FC3C387CB641>97
+D<EB3FF0B5FCA51203C6FCB3A4923801FFE0030F13FE033FEBFFC092B612F002F301017F
+913AF7F8003FFEDAFFE0EB0FFF03806D7F92C76C7F4A6E7F4A824A6E7FA2727EA285A285
+84A31A80AC1A00A44E5AA36118FF616E4A5BA26E4A5B6E4A5B6F495BDACFC04990C7FCDA
+87F0EB7FFC913A03FE03FFF849C6B612E0496D148049011F01FCC8FC90C7000313C04154
+7BD24B>I<913801FFF8021FEBFF8091B612F0010315FC010F9038C00FFE903A1FFE0001
+FFD97FFC491380D9FFF05B4817C048495B5C5A485BA2486F138091C7FC486F1300705A48
+92C8FC5BA312FFAD127F7FA27EA2EF03E06C7F17076C6D15C07E6E140F6CEE1F806C6DEC
+3F006C6D147ED97FFE5C6D6CEB03F8010F9038E01FF0010390B55A01001580023F49C7FC
+020113E033387CB63C>I<4DB47E0407B5FCA5EE001F1707B3A4913801FFE0021F13FC91
+B6FC010315C7010F9038E03FE74990380007F7D97FFC0101B5FC49487F4849143F484980
+485B83485B5A91C8FC5AA3485AA412FFAC127FA36C7EA37EA26C7F5F6C6D5C7E6C6D5C6C
+6D49B5FC6D6C4914E0D93FFED90FEFEBFF80903A0FFFC07FCF6D90B5128F0101ECFE0FD9
+003F13F8020301C049C7FC41547CD24B>I<913803FFC0023F13FC49B6FC010715C04901
+817F903A3FFC007FF849486D7E49486D7E4849130F48496D7E48178048497F18C0488191
+C7FC4817E0A248815B18F0A212FFA490B8FCA318E049CAFCA6127FA27F7EA218E06CEE01
+F06E14037E6C6DEC07E0A26C6DEC0FC06C6D141F6C6DEC3F806D6CECFF00D91FFEEB03FE
+903A0FFFC03FF8010390B55A010015C0021F49C7FC020113F034387CB63D>I<ED3FFC02
+03B5FC020F14C0023F14E09139FFF81FF0499038C03FF849EB807F49903800FFFC495A49
+5AA2495AA2EE7FF8495AEE3FF0EE0FC093C7FCAEB712E0A526007FF8C8FCB3B3A7007FB5
+12FEA52E547CD329>I<DA3FFF14FF0103B5D8F00713C0010FDAFC1F13E0013FECFF7F90
+267FFC0F9038FF9FF09026FFE001EBF83F48496C13E0484990387FF01F4890C7D83FF813
+E0489338FC0FC0F0078048486E6CC7FCA2003F82A9001F5EA26C6C4A5AA26C5E6C6D495A
+6C6D495A6C6D485BDAFC0F5B4890B6C8FCD803EF14FC01C314F02607C03F90C9FC91CBFC
+A2120FA37FA213F813FE90B7FC6C16F817FF18C06C836C836C836D828448B9FC12074848
+C700031480D81FF8EC003F4848150748486F13C083485A83A56D5D007F18806D5D003F18
+006C6C4B5AD80FFEED1FFC6C6C6CEC7FF86C01E049485A6C01FE011F5B6C6CB71280010F
+03FCC7FC010115E0D9000F01FCC8FC3C4F7CB543>I<EB3FF0B5FCA51203C6FCB3A4EE1F
+FC93B512C0030314F0030F8092391FE07FFC92393F001FFE037C8003F07FDAF1E081ECF3
+C0DAF7807F8502FFC7FC5CA25CA45CB3ACB6D8F807B612C0A542537BD24B>I<137F497E
+000313E0487FA2487FA76C5BA26C5BC613806DC7FC90C8FCADEB3FF0B5FCA512017EB3B3
+A6B612E0A51B547BD325>I<EB3FF0B5FCA51203C6FCB3A54CB512F8A59339003FFE00EF
+1FF0EF3FC04D5A4DC7FCEE03FEEE07F84C5A4C5AEE7FC04CC8FC4B5A4B5AED0FF8ED1FE0
+4B7E4B7EECF1FF02F37F02F77F91B6FC83159F030F7F02FE80DAF8077F4A7E6F7F6F7F83
+707E82707F84707F707F82707F84707F177F717E4D13C0B6D8F003B6FCA540537CD247>
+107 D<EB3FF0B5FCA512017EB3B3B3B1B612F0A51C537BD225>I<D93FF0D91FFCEDFFE0
+B591B500C0010713FE030302F0011F6D7E030F6E017F8092271FE07FFCD9FF037F922A3F
+001FFE01F8007F0003027C9126FF03E080C602F06DD90780137FDAF1E0038FC77FDAF3C0
+159EDAF7806D01BC143F07FC8102FFC75C4A5EA24A5EA44A5EB3ACB6D8F807B6D8C03FB5
+12FEA567367BB570>I<D93FF0EB1FFCB591B512C0030314F0030F8092391FE07FFC9239
+3F001FFE0003027C80C602F07FDAF1E081ECF3C0DAF7807F8502FFC7FC5CA25CA45CB3AC
+B6D8F807B612C0A542367BB54B>I<913801FFE0021F13FE91B612C0010315F0010F9038
+807FFC903A1FFC000FFED97FF86D6C7E49486D7F48496D7F48496D7F4A147F48834890C8
+6C7EA24883A248486F7EA3007F1880A400FF18C0AC007F1880A3003F18006D5DA26C5FA2
+6C5F6E147F6C5F6C6D4A5A6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0FFF80
+7FFC6D90B55A010015C0023F91C8FC020113E03A387CB643>I<903A3FF001FFE0B5010F
+13FE033FEBFFC092B612F002F301017F913AF7F8007FFE0003D9FFE0EB1FFFC602806D7F
+92C76C7F4A824A6E7F4A6E7FA2717FA285187F85A4721380AC1A0060A36118FFA2615F61
+6E4A5BA26E4A5B6E4A5B6F495B6F4990C7FC03F0EBFFFC9126FBFE075B02F8B612E06F14
+80031F01FCC8FC030313C092CBFCB1B612F8A5414D7BB54B>I<90397FE003FEB590380F
+FF80033F13E04B13F09238FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE78014EF
+150014EE02FEEB3FFC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>114
+D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307D81FE0130148487F4980
+127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15F06C
+816C816C81C681013F1580010F15C01300020714E0EC003F030713F015010078EC007F00
+F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE9039FF
+C00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB635>I<143EA6147EA414
+FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3A9EE
+07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B0203
+13802A4D7ECB34>I<D93FF8913801FFC0B50207B5FCA50003ED001FC61607B3AE5FA35F
+A2017F5D173B177B6D6C14F3DC01E313F06D6CD907C3EBFFC0903A0FFFC03F836D90B512
+03010114FE6D6C13F8020701E091C7FC42377BB54B>I<B600F00107B5FCA5000101F8C8
+EA7FE06C6DED3F00A2017F163E6E157E013F167C6E15FC6D5E6F13016D5E8117036D5E6F
+13076D5E6F130F6D5E6F131F6D93C7FC815F6E6C133E177E023F147C6F13FC6E5C16816E
+5C16C3A26EEBE3E016E76E5C16FF6E5CA26E91C8FCA26F5AA36F5AA26F5AA26F5AA26F5A
+6F5A40367DB447>I<B6D8E07FB5D8C003B512C0A5000101F0C701F0C7381FF8006E027F
+ED07E06C715DA26E023F150F017F705DA26E181F013F4B6C92C7FC6E606D70143E94B5FC
+6F177E6D4A6E137C03C001F315FC6D715B160303E001E114016D020702E05B03F013C06D
+71485A160F03F8D9807F13076D05F85B93381F003F03FC160F027F4902FC5BDBFE3E011F
+131F023F04FE90C8FC167EDBFF7C010F5B6E01FCECFF3E4C6D137E6E5FA24C7F6E5F4C7F
+6E5FA24C7F6E5F4C147FA26E5F93C8123F6F5EA2033E6FC9FC5A367DB461>I<B600F001
+07B5FCA5C601F8C8EA7FE06EED3F00A26D6C153E187E013F167C6E15FC6D5E6F13016D5E
+6F13036D5E8117076D6D5C170F6D6D5C171F6D93C7FC6F5B027F143E6F137E023F147C6F
+13FCA26E6D5A16816EEBC1F016C36E5C16E76E5C16FF6E5CA26E91C8FCA36F5AA26F5AA2
+6F5AA26F5AA26F5AA35E150F5E151F93C9FC5DD81FC0133E486C137E486C137C486C13FC
+5D14015D14034A5A6C48485A49485A263FC07FCAFCEB81FE6CB45A6C13F000035BC690CB
+FC404D7DB447>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fl cmr10 10.95 86
+/Fl 86 124 df<4AB4EB0FE0021F9038E03FFC913A7F00F8FC1ED901FC90383FF03FD907
+F090397FE07F80494801FF13FF4948485BD93F805C137F0200ED7F00EF003E01FE6D91C7
+FC82ADB97EA3C648C76CC8FCB3AE486C4A7E007FD9FC3FEBFF80A339407FBF35>11
+D<4AB4FC021F13C091387F01F0903901FC0078D907F0131C4948133E494813FF49485A13
+7F1400A213FE6F5A163893C7FCAA167FB8FCA33900FE00018182B3AC486CECFF80007FD9
+FC3F13FEA32F407FBF33>I<4AB47E021F13F791387F00FFEB01F8903807F001EB0FE0EB
+1FC0EB3F80137F14008101FE80AEB8FCA3C648C77EB3AE486CECFF80007FD9FC3F13FEA3
+2F407FBF33>I<4AB4ECFF80021FD9C00F13E0913B7F01F03F80F8903C01F80078FE003C
+D907F0D93FF8130E49484948131F49484948EB7F804948484913FF137F02005CA201FE92
+C7FC6FED7F0070141C96C7FCAAF13F80BBFCA3C648C76CC7FC197F193FB3AC486C4A6CEB
+7FC0007FD9FC3FD9FE1FB5FCA348407FBF4C>I<121EEA7F80EAFFC0A9EA7F80ACEA3F00
+AC121EAB120CC7FCA8121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A4179C019>33
+D<001E130F397F803FC000FF137F01C013E0A201E013F0A3007F133F391E600F30000013
+00A401E01370491360A3000114E04913C00003130101001380481303000EEB070048130E
+0018130C0038131C003013181C1C7DBE2D>I<013F4C7ED9FFC04B7E2601E0E015072607
+C070150F48486C4B5A023E4BC7FC48486C5D48D90FC0EB01FE003ED90EF0EB07FCDA0F3F
+133E007E903A070FFFF8F8007C0200EBC1F0EE000300FC6D6C495A604D5A171F95C8FC17
+3E177E177C5F16015F007C4948485A1607007E5E003E49495A020E131F003F93C9FC6C49
+133E260F803C137E0238137C6C6C485B3901E0E0016CB448485AD93F0049133F90C74848
+EBFFC0030F903801E0E093398007C0704B4848487E4B153C033E90381F001C4B497F03FC
+133E4B150F4A48017E7F0203147C5D4A4801FCEB0380140F5D4AC7FC5C143E5C14FC5C49
+5A13034948027CEB07005C4948147E011F033E5B91C8140E013E153F017E6F5B017C9238
+0F803C4917380001706C5A49923801E0E0496FB45A6C48043FC7FC41497BC34C>37
+D<EC0FC0EC3FF0ECF878903801F01CEB03E049487E130FEC800F011F7FA2EB3F00A5EC80
+0EA25DA25DA25D6D6C5AECC1C0A2ECC38002E7C7387FFFFCEB0FEE14FC4A020713C06D48
+913801FE006E5DEF00F06D7E4D5A496C5D010F1503D91DFF4A5A013893C7FC496C6C5B01
+E0150E48486C6C131E00036E131C2607801F143C000F6E5B001F6D6C1370263F000714F0
+6F485A48D903FE5B913801FF03486D495A0487C8FCED7FCFED3FFE6F4814386D6D5AA200
+7F6E6C14786D6D6C14704B6C14F06C6C496C6C13E0001F91393E3FC0016C6C903AFC1FF0
+03C03D07FC07F007FC1F800001B5D8C001B512006C6C90C7EA7FFCD90FF8EC0FF03E437C
+C047>I<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113801203
+13005A120E5A1218123812300B1C79BE19>I<1430147014E0EB01C0EB03801307EB0F00
+131E133E133C5B13F85B12015B1203A2485AA2120F5BA2121F90C7FCA25AA3123E127EA6
+127C12FCB2127C127EA6123E123FA37EA27F120FA27F1207A26C7EA212017F12007F1378
+7F133E131E7FEB07801303EB01C0EB00E014701430145A77C323>I<12C07E12707E7E12
+1E7E6C7E7F12036C7E7F12007F1378137CA27FA2133F7FA21480130FA214C0A3130714E0
+A6130314F0B214E01307A614C0130FA31480A2131F1400A25B133EA25BA2137813F85B12
+015B485A12075B48C7FC121E121C5A5A5A5A145A7BC323>I<EB03C0A2805CA600F0140F
+00FC143F00FE147F00FF14FF393FC3C3FC390FE187F03903F18FC03900FDBF00EB3FFCEB
+0FF0EB03C0EB0FF0EB3FFCEBFDBF3903F18FC0390FE187F0393FC3C3FC39FF03C0FF00FE
+147F00FC143F00F0140F00001400A6805CA220277AC32D>I<121EEA7F8012FF13C0A213
+E0A3127FEA1E601200A413E013C0A312011380120313005A120E5A1218123812300B1C79
+8919>44 D<B512FEA617067F961E>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A79
+8919>I<ED0180ED03C01507A21680150FA216005DA2151E153EA2153C157CA2157815F8
+A25D1401A25D1403A25D1407A25D140FA24AC7FCA2141E143EA2143C147CA2147814F8A2
+5C1301A25C1303A25C1307A25C130FA291C8FC5BA2131E133EA25BA2137813F8A25B1201
+A25B1203A25B1207A25B120FA290C9FC5AA2121E123EA2123C127CA2127812F8A25A1260
+225B7BC32D>I<EB01FE90380FFFC090383F03F090387C00F849137C48487F48487F4848
+EB0F80A2000F15C04848EB07E0A3003F15F0A290C712034815F8A64815FCB3A26C15F8A5
+6C6CEB07F0A3001F15E0A36C6CEB0FC0A26C6CEB1F80000315006C6C133E6C6C5B017C5B
+90383F03F090380FFFC0D901FEC7FC263F7DBC2D>I<EB01C013031307131F137FEA07FF
+B5FC139FEAF81F1200B3B3ACEB7FF0B612F8A31D3D78BC2D>I<EB07FC90383FFF8090B5
+12E03903F01FF83907C007FC390F0001FE001E6D7E001C1580003CEC7FC05AED3FE01270
+B4FC6DEB1FF07FA56C5A6CC7FC120CC813E0153FA216C0157F168015FF16004A5A5D4A5A
+4A5A5D4A5A4A5A4AC7FC147E147C5C495A495A495A495A49C71270133E133C5B4914E048
+5A485A485A48C7120148B6FCA25A4815C0B7FCA3243D7CBC2D>I<EB07FC90383FFF8090
+38F80FE03901E003F839078001FCD80F007F000E6D7E001E1580D81F80137F486C14C07F
+A27F5BA2121F6C5AC8138015FF1600A24A5AA24A5A5DEC07E04A5A023FC7FCEB1FFCECFF
+809038000FE0EC07F86E7E6E7E6E7E1680ED7FC0A216E0153FA216F0A2120C123F487E48
+7EA316E0A249137F6CC713C01278EDFF807E6C4913006C495A3907C007FC3903F80FF0C6
+B55A013F1380D907F8C7FC243F7CBC2D>I<150E151E153EA2157EA215FE1401A21403EC
+077E1406140E141CA214381470A214E0EB01C0A2EB0380EB0700A2130E5BA25B5BA25B5B
+1201485A90C7FC5A120E120C121C5AA25A5AB8FCA3C8EAFE00AC4A7E49B6FCA3283E7EBD
+2D>I<00061403D80780131F01F813FE90B5FC5D5D5D15C092C7FC14FCEB3FE090C9FCAC
+EB01FE90380FFF8090383E03E090387001F8496C7E49137E497F90C713800006141FC813
+C0A216E0150FA316F0A3120C127F7F12FFA416E090C7121F12FC007015C012780038EC3F
+80123C6CEC7F00001F14FE6C6C485A6C6C485A3903F80FE0C6B55A013F90C7FCEB07F824
+3F7CBC2D>I<EC1FE0ECFFF8903803F03E90380FC00F90391F000780133E017EEB1FC049
+133F4848137F12035B12074848EB3F80ED1F00001F91C7FC5BA2123FA3485AA214FE9038
+87FF8039FF8F07E090389C01F09038B800FC01B0137E13F0497F16804914C0A2ED1FE0A3
+4914F0A5127FA6123F6D14E0A2121FED3FC0A26C6C1480A20007EC7F006C6C137E6C6C5B
+6C6C485A90387E07F06DB45A010F1380D903FCC7FC243F7CBC2D>I<1238123C123F90B6
+12FCA316F85A16F016E00078C712010070EC03C0ED078016005D48141E151C153C5DC812
+7015F04A5A5D14034A5A92C7FC5C141EA25CA2147C147814F8A213015C1303A31307A313
+0F5CA2131FA6133FAA6D5A0107C8FC26407BBD2D>I<EB03FC90381FFF8090387C07E090
+38F001F83901E0007C48487F48487F48C7FCED0F80121E16C0003E1407A4123FA26DEB0F
+807F6C6C131F6D140001FC133E6C6C5B9038FF80786C6D5A6CEBF3E06CEBFF806C91C7FC
+133F6D13C06D7F013F13F801787F48486C7E3903E01FFF48486C1380260F800313C04848
+7E489038007FE0003E143F007E141F007CEC0FF01507481403A31501A46C15E0007C1403
+A2007E15C06C14076CEC0F806DEB1F006C6C133ED807F05B3901FC03F86CB512E0011F13
+80D903FCC7FC243F7CBC2D>I<EB03FCEB1FFF90387E07C09038FC03F048486C7E48486C
+7E4848137C000F147E4848137F81003F15805B007F15C0A2151F12FF16E0A516F0A5127F
+153FA36C7EA2001F147F120F6C6C13FF6D13DF000313013900F8039F90387E0F1FD91FFE
+13E0EB07F090C7FCA2ED3FC0A41680157FD80F801400487E486C13FEA24A5A5D49485AEB
+8007391E000FE0001F495A260FC07FC7FC3803FFFE6C13F838003FC0243F7CBC2D>I<12
+1EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121EEA7F80A2EAFFC0A4EA7F80A2EA1E00
+0A2779A619>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3121E127FEAFF80A213
+C0A4127F121E1200A412011380A3120313005A1206120E120C121C5A1230A20A3979A619
+>I<007FB912E0BA12F0A26C18E0CDFCAE007FB912E0BA12F0A26C18E03C167BA147>61
+D<EB1FF890B5FC3903E01FC0390F0007F0001EEB03F848EB01FC4814FE140000FE14FF7E
+7FA46CC7FC123EC7EA01FEA2EC03FCEC07F815F0EC0FC0EC1F80EC3F00143E5C147814F8
+5C13015CA2495AA25CAB91C7FC90C8FCA8EB0780EB1FE0A2497EA46D5AA2EB078020407B
+BF2B>63 D<15074B7EA34B7EA34B7EA34B7EA34B7E15E7A2913801C7FC15C3A291380381
+FEA34AC67EA3020E6D7EA34A6D7EA34A6D7EA34A6D7EA34A6D7EA349486D7E91B6FCA249
+819138800001A249C87EA24982010E157FA2011E82011C153FA2013C820138151FA20178
+82170F13FC00034C7ED80FFF4B7EB500F0010FB512F8A33D417DC044>65
+D<B712FCEEFF8017F00001903980000FF86C6CC7EA03FE707E701380EF7FC0EF3FE0A2EF
+1FF0A218F8A3170F171FA318F0A2EF3FE0177F18C0EFFF804C1300EE03FCEE0FF8EE7FE0
+91B6C7FC17E091C7EA07FCEE01FE933800FF80EF7FC0EF3FE0EF1FF018F8170F18FC1707
+A218FEA718FC170FA2EF1FF818F0173FEF7FE0EFFFC00403138048486C90380FFE00B85A
+17E094C7FC373E7DBD40>I<DB3FF01306912603FFFE130E020F9038FF801E913A3FF007
+E03E9139FF8000F8D903FEC7EA7C7ED907F8EC1EFE4948140FD93FE0140749481403495A
+91C812014848150012034848167E5B000F173EA24848161EA2123F5B180E127FA3491600
+12FFAC127F7F180EA2123FA27F001F171E181C6C7EA20007173C6D16386C6C1678000117
+706C6C16F06EEC01E06D6C15C06D6C1403D90FF0EC07806D6CEC1F00D903FE143E902600
+FF8013F891393FF007F0020FB512C0020391C7FC9138003FF037427BBF42>I<B712FCEE
+FF8017E000019039C0001FF86C6C48EB03FEEE00FF717E717EEF0FE084717E717E170184
+717EA21980187F19C0A3F03FE0A519F0AB19E0A5F07FC0A21980A218FF19004D5AA24D5A
+6017074D5A4D5AEF7FC04DC7FCEE03FE48486CEB1FF8B85A178004FCC8FC3C3E7DBD45>
+I<B912E0A300019038C000016C6C48EB001FEF0FF01703A217011700A31870A41838161C
+A41800A2163CA2167C16FC150391B5FCA3EC80031500167C163CA2161CA21807A3180E93
+C7FCA4181E181CA2183CA2187CA218F8170117031707171F48486CEB01FFB912F0A3383E
+7DBD3E>I<B91280A300019038C000036C6C48EB007FEF1FC0170F1707A21703A31701A4
+EF00E0A21638A31800A31678A216F81501150791B5FCA3EC8007150115001678A21638A6
+93C8FCAF3801FFE0B612F0A3333E7DBD3B>I<DB3FE0130C912603FFFE131C021F9038FF
+803C913A7FF00FC07C9139FF0001F0D903FC90380078FC4948143DD91FE0141F4948140F
+4948140701FF15034890C8FC491501485A000716005B000F177C5B001F173CA2485AA218
+1C127FA25B95C7FC12FFAB041FB512F0127FA26D9139000FFE00EF03FC123FA27F121FA2
+6C7EA212077F12036C7E7F6C7F6D6C14076D7E6D6C140FD907F8141ED903FEEC3C7C9026
+00FF80EBF83C913A7FF007F01C021FB5EAC00C020391C8FC9138003FF03C427BBF47>I<
+B6D8C01FB512F8A3000101E0C7383FFC0026007F80EC0FF0B3A691B7FCA30280C7120FB3
+A92601FFE0EC3FFCB6D8C01FB512F8A33D3E7DBD44>I<B612F0A3C6EBF000EB3FC0B3B3
+B2EBFFF0B612F0A31C3E7EBD21>I<011FB512FCA3D9000713006E5A1401B3B3A6123FEA
+7F80EAFFC0A44A5A1380D87F005B007C130700385C003C495A6C495A6C495A2603E07EC7
+FC3800FFF8EB3FC026407CBD2F>I<B600C090387FFFFCA3000101E0C7000F138026007F
+80913807FE0018F818E0604D5A4DC7FC173E5F5F4C5A4C5A4C5A4C5A4CC8FC163E5E5E4B
+5A4B5AED07804B7E151F4B7E4B7E15FF913881EFF8913883C7FCEC878791388F03FE9138
+9E01FF14BCDAF8007F4A6D7E5C4A6D7E4A6D7EA2707E707EA2707E707EA2707F717E8417
+3F717E717EA2717E848419802601FFE04A13C0B600C090B6FCA3403E7DBD47>I<B612F8
+A3000101E0C9FC38007F80B3B0EF0380A517071800A45FA35FA25F5F5F4C5A160748486C
+133FB8FCA3313E7DBD39>I<B500C093383FFFF0A300016D93387FF800D8007F18E0D977
+F016EFA3D973F8ED01CFA2D971FCED038FA3D970FEED070FA26E150E80A26E6C141CA36E
+6C1438A26E6C1470A36E6C14E0A26E6CEB01C0A36E6CEB0380A36E6CEB0700A2037F130E
+A36F6C5AA26F6C5AA36F6C5AA25FED07F0A2923803F9C0A36FB45AA26F90C7FCA213F848
+6C147ED807FFEF3FF8B500F8013C011FB512F0A34C3E7DBD53>I<B56C91B512F88080D8
+007F030713006EEC01FC6E6E5A1870EB77FCEB73FEA2EB71FF01707FA26E7E6E7EA26E7E
+6E7EA26E7E6E7EA26E7E6E7FA26F7E6F7EA26F7E6F7EA26F7E6F7EA26F7E6F1380A2EE7F
+C0EE3FE0A2EE1FF0EE0FF8A2EE07FCEE03FEA2EE01FF7013F0A2177F173FA2171F170FA2
+170701F81503487ED807FF1501B500F81400A218703D3E7DBD44>I<ED7FE0913807FFFE
+91391FC03F8091397E0007E04948EB03F8D907F0EB00FE4948147F49486E7E49486E7E49
+C86C7E01FE6F7E00018349150300038348486F7EA248486F7EA2001F188049167F003F18
+C0A3007F18E049163FA300FF18F0AC007F18E06D167FA4003F18C0A26C6CEEFF80A36C6C
+4B1300A26C6C4B5A00035F6D150700015F6C6C4B5A6D5E6D6C4A5A6D6C4A5A6D6C4AC7FC
+6D6C14FED901FCEB03F8D9007FEB0FE091391FC03F80912607FFFEC8FC9138007FE03C42
+7BBF47>I<B712F8EEFF8017E000019039C0003FF86C6C48EB07FCEE01FE707EEF7F80EF
+3FC018E0A2EF1FF0A218F8A818F0A2EF3FE0A218C0EF7F80EFFF004C5AEE07FCEE3FF091
+B612C04CC7FC0280C9FCB3A73801FFE0B612C0A3353E7DBD3E>I<ED7FE0913807FFFE91
+391FC03F8091397F000FE0D901FCEB03F8D907F0EB00FE4948147F49486E7E49486E7E49
+C86C7E498248486F7E49150300038348486F7EA2000F834981001F1880A24848EE7FC0A3
+007F18E0A249163FA200FF18F0AC007F18E0A26D167FA3003F18C0A26C6CEEFF80A3000F
+18006D5D0007DA0F805B6C6C90393FE003FCED70706C6C496C485A6C6C48486C485A017F
+D9800E5BD93F819038061FC0D91FC19038073F80D90FE14AC7FCD907F1EB03FE902601FD
+C013F8903A007EE007E091271FF03FC013180207B5FC9139007FE1E0DB00011438837113
+78A2706C13F0EFFF0318FFA27113E0A37113C0711380711300715AEF01F83D527BBF47>
+I<B712C016FCEEFF800001D9C00013E06C6C48EB1FF0EE07FCEE01FE707E84717EA2717E
+A284A760177F606017FF95C7FCEE01FCEE07F8EE1FE0EEFF8091B500FCC8FC16F0913880
+01FCED003FEE1FC0707E707E83160383160183A383A484A4F0C004190EA28218E0057F13
+1E2601FFE0161CB600C0EB3FF094381FF83805071370CA3801FFE09438003F803F407DBD
+43>I<D907FC130C90391FFF801C017FEBF03C3901FC03F83A03F0007E7CD807C0EB1FFC
+4848130F001F140748C71203003E1401007E1400A2007C157C12FCA2163CA36C151CA27E
+A26C6C14007F7FEA3FF8EBFF806C13F86CEBFF806C14F06C14FC6C14FF6C15C0013F14E0
+010714F0EB007F020713F89138007FFC150FED07FE15031501ED00FFA200E0157FA3163F
+A27EA3163E7E167E6C157C6C15FC6C15F86D13016DEB03F06DEB07E0D8F9FCEB0FC03AF0
+7F803F8090391FFFFE00D8E00713F839C0007FC028427BBF33>I<003FB91280A3903AF0
+007FE001018090393FC0003F48C7ED1FC0007E1707127C00781703A300701701A548EF00
+E0A5C81600B3B14B7E4B7E0107B612FEA33B3D7DBC42>I<B600C090B512F8A3000101E0
+C70007130026007F80EC01FC715A1870B3B3A4013F16F06E5DA21701011F5E80010F1503
+6E4A5A010793C7FC6D6C5C6D6C141E6D6C5C027F14F86E6C485A91390FF00FE00203B512
+80020049C8FCED1FF03D407DBD44>I<B691380FFFFEA3000301E0020113E06C01809138
+007F806CEF3F00017F163E181C6E153C013F1638A26E1578011F1670A26D6C5DA26E1401
+01075EA26E140301035EA26D6C4AC7FCA2806D150EA26F131E027F141CA26F133C023F14
+38A26E6C5BA26F13F0020F5CA2EDF80102075CA26E6C485AA2EDFE07020191C8FCA26F5A
+6E130EA2ED7F9CA216DCED3FF8A36F5AA36F5AA26F5AA36F5A3F407EBD44>I<B500FE01
+7FB5D88007B5FCA3000301C0010101E0C713F86C90C849EC3FE07148EC0F807E7215006E
+143F017F190E84A26D6C60A24D7E6D6C60A2EFE7F86D6C60A2933801C3FC6E18F0010761
+04037F6E0281140101036104077F17006D6C4D5AA2040EEB7F806D6C4DC7FCA24CEB3FC0
+DA7F80160EA24CEB1FE003C0161E023F171C047814F0DBE070010F133C021F173804F014
+F84C1307DA0FF05EA2DBF1C0EB03FCDA07F95EA2DBFB80EB01FEDA03FF6F5AA293C8FCA2
+6E5FA24B157F020094C8FCA24B81037C153EA20378151E0338151C58407EBD5D>I<007F
+B5D8C003B512E0A3C649C7EBFC00D93FF8EC3FE06D48EC1F806D6C92C7FC171E6D6C141C
+6D6C143C5F6D6C14706D6D13F04C5ADA7FC05B023F13036F485ADA1FF090C8FC020F5BED
+F81E913807FC1C163C6E6C5A913801FF7016F06E5B6F5AA26F7E6F7EA28282153FED3BFE
+ED71FF15F103E07F913801C07F0203804B6C7EEC07004A6D7E020E6D7E5C023C6D7E0238
+6D7E14784A6D7E4A6D7F130149486E7E4A6E7E130749C86C7E496F7E497ED9FFC04A7E00
+076DEC7FFFB500FC0103B512FEA33F3E7EBD44>I<B66C0103B51280A3000101F0C8EBF8
+006C6C48ED3FC0725A013F041EC7FC6D7E606D6C15386D6C1578606D6C5D6E14016D5E6D
+6D1303606E6C49C8FC6E6C5B170E6E6C131E171C6E6C5B6E6C137817706E6C13F06F5B6E
+13016EEB83C05FED7FC7DB3FE7C9FC16EFED1FFE5E150F6F5AB3A4ED1FFC020FB512FCA3
+413E7FBD44>I<003FB712F8A391C7EA1FF013F801E0EC3FE00180EC7FC090C8FC003EED
+FF80A2003C4A1300007C4A5A12784B5A4B5AA200704A5AA24B5A4B5AA2C8485A4A90C7FC
+A24A5A4A5AA24A5AA24A5A4A5AA24A5A4A5AA24990C8FCA2495A4948141CA2495A495AA2
+495A495A173C495AA24890C8FC485A1778485A484815F8A24848140116034848140F4848
+143FED01FFB8FCA32E3E7BBD38>I<EAFFFCA4EAF000B3B3B3B3ABEAFFFCA40E5B77C319>
+I<486C13C00003130101001380481303000EEB070048130E0018130C0038131C00301318
+0070133800601330A300E01370481360A400CFEB678039FFC07FE001E013F0A3007F133F
+A2003F131F01C013E0390F0007801C1C73BE2D>I<EAFFFCA4EA003CB3B3B3B3ABEAFFFC
+A40E5B7FC319>I<EB0FF8EBFFFE3903F01F8039078007E0000F6D7E9038E001F8D81FF0
+7F6E7EA3157F6C5AEA0380C8FCA4EC1FFF0103B5FC90381FF87FEB7F803801FC00EA07F8
+EA0FE0485A485AA248C7FCEE038012FEA315FFA3007F5BEC03BF3B3F80071F8700261FC0
+0E13CF3A07F03C0FFE3A01FFF807FC3A003FC001F0292A7DA82D>97
+D<EA01FC12FFA3120712031201B1EC03FC91381FFF8091387C07E09039FDE001F09039FF
+C000FC4A137E91C77E49158049141F17C0EE0FE0A217F0A2160717F8AA17F0A2160FA217
+E0161F17C06D1580EE3F006D5C6E13FE9039F3C001F89039F1E003F09039E0780FC09026
+C03FFFC7FCC7EA07F82D407EBE33>I<49B4FC010F13E090383F00F8017C131E4848131F
+4848137F0007ECFF80485A5B121FA24848EB7F00151C007F91C7FCA290C9FC5AAB6C7EA3
+003FEC01C07F001F140316806C6C13076C6C14000003140E6C6C131E6C6C137890383F01
+F090380FFFC0D901FEC7FC222A7DA828>I<ED01FC15FFA3150715031501B114FF010713
+E190381F80F990387E003D49131FD803F81307485A49130348481301121F123F5B127FA2
+90C7FCA25AAA7E7FA2123FA26C7E000F14037F000714076C6C497E6C6C497ED8007C0179
+13F890383F01F190380FFFC1903A01FE01FC002D407DBE33>I<EB01FE90380FFFC09038
+3F03F09038FC01F848486C7E4848137E48487F000F158049131F001F15C04848130FA212
+7F16E090C7FCA25AA290B6FCA290C9FCA67EA27F123F16E06C7E1501000F15C06C6C1303
+6DEB07806C6C1400C66C131E017E5B90381F80F8903807FFE0010090C7FC232A7EA828>
+I<EC1FC0EC7FF8903801F83C903807E07E90380FC0FFEB1FC1EB3F811401137FEC00FE01
+FE137C1500AEB6FCA3C648C7FCB3AE487E007F13FFA320407EBF1C>I<167C903903F801
+FF903A1FFF078F8090397E0FDE1F9038F803F83803F001A23B07E000FC0600000F6EC7FC
+49137E001F147FA8000F147E6D13FE00075C6C6C485AA23901F803E03903FE0FC026071F
+FFC8FCEB03F80006CAFC120EA3120FA27F7F6CB512E015FE6C6E7E6C15E06C810003813A
+0FC0001FFC48C7EA01FE003E140048157E825A82A46C5D007C153E007E157E6C5D6C6C49
+5A6C6C495AD803F0EB0FC0D800FE017FC7FC90383FFFFC010313C0293D7EA82D>I<EA01
+FC12FFA3120712031201B1EC01FE913807FFC091381E07E091387803F09138E001F8D9FD
+C07F148001FF6D7E91C7FCA25BA25BB3A6486C497EB5D8F87F13FCA32E3F7DBE33>I<EA
+01E0EA07F8A2487EA46C5AA2EA01E0C8FCACEA01FC127FA3120712031201B3AC487EB512
+F0A3143E7DBD1A>I<1478EB01FEA2EB03FFA4EB01FEA2EB00781400AC147FEB7FFFA313
+017F147FB3B3A5123E127F38FF807E14FEA214FCEB81F8EA7F01387C03F0381E07C0380F
+FF803801FC00185185BD1C>I<EA01FC12FFA3120712031201B292B51280A392383FFC00
+16E0168093C7FC153C5D5D4A5AEC07C04A5A4AC8FC143E147F4A7E13FD9038FFDFC0EC9F
+E0140F496C7E01FC7F496C7E1401816E7E81826F7E151F826F7EA282486C14FEB539F07F
+FFE0A32B3F7EBE30>I<EA01FC12FFA3120712031201B3B3B1487EB512F8A3153F7DBE1A>
+I<2701F801FE14FF00FF902707FFC00313E0913B1E07E00F03F0913B7803F03C01F80007
+903BE001F87000FC2603F9C06D487F000101805C01FBD900FF147F91C75B13FF4992C7FC
+A2495CB3A6486C496CECFF80B5D8F87FD9FC3F13FEA347287DA74C>I<3901F801FE00FF
+903807FFC091381E07E091387803F000079038E001F82603F9C07F0001138001FB6D7E91
+C7FC13FF5BA25BB3A6486C497EB5D8F87F13FCA32E287DA733>I<14FF010713E090381F
+81F890387E007E01F8131F4848EB0F804848EB07C04848EB03E0000F15F04848EB01F8A2
+003F15FCA248C812FEA44815FFA96C15FEA36C6CEB01FCA3001F15F86C6CEB03F0A26C6C
+EB07E06C6CEB0FC06C6CEB1F80D8007EEB7E0090383F81FC90380FFFF0010090C7FC282A
+7EA82D>I<3901FC03FC00FF90381FFF8091387C0FE09039FDE003F03A03FFC001FC6C49
+6C7E91C7127F49EC3F805BEE1FC017E0A2EE0FF0A3EE07F8AAEE0FF0A4EE1FE0A2EE3FC0
+6D1580EE7F007F6E13FE9138C001F89039FDE007F09039FC780FC0DA3FFFC7FCEC07F891
+C9FCAD487EB512F8A32D3A7EA733>I<02FF131C0107EBC03C90381F80F090397F00387C
+01FC131CD803F8130E4848EB0FFC150748481303121F485A1501485AA448C7FCAA6C7EA3
+6C7EA2001F14036C7E15076C6C130F6C7E6C6C133DD8007E137990383F81F190380FFFC1
+903801FE0190C7FCAD4B7E92B512F8A32D3A7DA730>I<3901F807E000FFEB1FF8EC787C
+ECE1FE3807F9C100031381EA01FB1401EC00FC01FF1330491300A35BB3A5487EB512FEA3
+1F287EA724>I<90383FC0603901FFF8E03807C03F381F000F003E1307003C1303127C00
+78130112F81400A27E7E7E6D1300EA7FF8EBFFC06C13F86C13FE6C7F6C1480000114C0D8
+003F13E0010313F0EB001FEC0FF800E01303A214017E1400A27E15F07E14016C14E06CEB
+03C0903880078039F3E01F0038E0FFFC38C01FE01D2A7DA824>I<131CA6133CA4137CA2
+13FCA2120112031207001FB512C0B6FCA2D801FCC7FCB3A215E0A912009038FE01C0A2EB
+7F03013F138090381F8700EB07FEEB01F81B397EB723>I<D801FC14FE00FF147FA30007
+14030003140100011400B3A51501A31503120015076DEB06FF017E010E13806D4913FC90
+381FC078903807FFE00100903880FE002E297DA733>I<B539E00FFFE0A32707FE000313
+006C48EB00FC5E00015D7F00005DA26D13016D5CA26D6C485AA2ECC007011F91C7FCA290
+380FE00EA2ECF01E0107131CA26D6C5AA2ECFC7801011370A2ECFEF001005BA2EC7FC0A3
+6E5AA26EC8FCA3140E2B287EA630>I<B53BC3FFFE03FFF8A3290FFE003FE00013C06C48
+6D48EB3F806C4817006D010F141E00016F131C15076D163C00004A6C1338A2017F5E4B7E
+151DD93F805DED3DFC1538D91FC04A5AED78FE9238707E03D90FE0017F5BEDE03F02F014
+0701070387C7FC9138F1C01F02F9148F010315CE9138FB800F02FF14DE6D15FCED00076D
+5DA24A1303027E5CA2027C1301023C5C023813003D287EA642>I<B539F01FFFE0A30003
+D9C00F1300C690388007F8D97F0013E002805BD93FC05B011F49C7FC90380FE00EECF01E
+6D6C5A01035B6D6C5A6E5AEB00FF6E5A6E5A81141F814A7E81147BECF1FC903801E1FEEC
+C0FF01037F49486C7ED90F007F011E6D7E013E130F496D7E01FC80486C80000F4A7EB539
+803FFFF8A32D277FA630>I<B539E00FFFE0A32707FE000313006C48EB01FC6F5A00015D
+7F00005DA2017F495AA2EC8003013F5CA26D6C48C7FCA26E5A010F130EA26D6C5AA2ECF8
+3C01031338A26D6C5AA2ECFEF001005BA2EC7FC0A36E5AA36EC8FCA2140EA2141E141C14
+3C1438A2147800181370127EB45BA2495AA248485AD87E07C9FCEA780EEA3C3CEA1FF8EA
+07E02B3A7EA630>I<001FB61280A2EBE0000180140049485A001E495A121C4A5A003C49
+5A141F00385C4A5A147F5D4AC7FCC6485AA2495A495A130F5C495A90393FC00380A2EB7F
+80EBFF005A5B484813071207491400485A48485BA248485B4848137F00FF495A90B6FCA2
+21277EA628>I<B812F0A22C0280982D>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fm cmbx12 20.736 9
+/Fm 9 123 df<92380FFFE04AB67E020F15F0027F15FE49B87E4917E0010F17F8013F83
+49D9C01F14FF9027FFFC0001814801E06D6C80480180021F804890C86C8048486F804848
+6F8001FF6F804801C06E8002F081486D18806E816E18C0B5821BE06E81A37214F0A56C5B
+A36C5B6C5B6C5B000313C0C690C9FC90CA15E060A34E14C0A21B80601B0060626295B55A
+5F624D5C624D5C4D91C7FC614D5B4D13F04D5B6194B55A4C49C8FC4C5B4C5B4C13E04C5B
+604C90C9FCEE7FFC4C5A4B5B4B5B4B0180EC0FF04B90C8FC4B5A4B5A4B48ED1FE0EDFFE0
+4A5B4A5B4A90C9FC4A48163F4A5ADA3FF017C05D4A48167F4A5A4990CA12FFD903FC1607
+49BAFC5B4919805B5B90BBFC5A5A5A5A481A005A5ABCFCA462A44C7176F061>50
+D<92383FFFF80207B612E0027F15FC49B87E010717E0011F83499026F0007F13FC4948C7
+000F7F90B502036D7E486E6D806F6D80727F486E6E7F8486727FA28684A26C5C72806C5C
+6D90C8FC6D5AEB0FF8EB03E090CAFCA70507B6FC041FB7FC0303B8FC157F0203B9FC021F
+ECFE0391B612800103ECF800010F14C04991C7FC017F13FC90B512F04814C0485C4891C8
+FC485B5A485B5C5A5CA2B5FC5CA360A36E5DA26C5F6E5D187E6C6D846E4A48806C6D4A48
+14FC6C6ED90FF0ECFFFC6C02E090263FE07F14FE00019139FC03FFC06C91B6487E013F4B
+487E010F4B1307010303F01301D9003F0280D9003F13FC020101F8CBFC57507ACE5E>97
+D<903801FFFCB6FCA8C67E131F7FB3ADF0FFFC050FEBFFE0057F14FE0403B77E040F16E0
+043F16F84CD9007F13FE9226FDFFF001077F92B500C001018094C86C13E004FC6F7F4C6F
+7F04E06F7F4C6F7F5E747F93C915804B7014C0A27414E0A21DF087A21DF8A31DFC87A41D
+FEAF1DFCA4631DF8A31DF098B5FC1DE0A25014C0A26F1980501400705D705F704B5B505B
+704B5B04FC4B5BDBE7FE92B55A9226C3FF8001035C038101E0011F49C7FC9226807FFC90
+B55A4B6CB712F04A010F16C04A010393C8FC4A010015F84A023F14C090C9000301F0C9FC
+5F797AF76C>I<97380FFFE00607B6FCA8F00003190086B3AD93383FFF800307B512F803
+3F14FF4AB712C0020716F0021F16FC027F9039FE007FFE91B500F0EB0FFF010302800101
+90B5FC4949C87E49498149498149498149498190B548814884484A8192CAFC5AA2485BA2
+5A5C5AA35A5CA4B5FCAF7EA4807EA37EA2807EA26C7F616C6E5D6C606C80616D6D5D6D6D
+5D6D6D92B67E6D6D4A15FC010301FF0207EDFFFE6D02C0EB3FFE6D6C9039FC01FFF86E90
+B65A020F16C002031600DA007F14FC030F14E09226007FFEC749C7FC5F797AF76C>100
+D<EB01FCEB07FF011F13C0497F497F90B57EA24880A24880A76C5CA26C5CA26D5B6D5B6D
+5B010790C8FCEB01FC90CAFCB2903801FFFC007FB5FCA8C67E131F7FB3B3B3A5B81280A8
+297979F835>105 D<903801FFFCB6FCA8C67E131F7FB3B3B3B3B3ABB812C0A82A7879F7
+35>108 D<902601FFF891380FFFE0B692B512FE05036E7E050F15E0053F15F84D819327
+01FFF01F7F4CD900077FDC07FC6D80C66CDA0FF06D80011FDA1FC07F6D4A48824CC8FC04
+7E6F7F5EEDF9F85E03FB707F5E15FF5EA25EA293C9FCA45DB3B3A6B8D8E003B81280A861
+4E79CD6C>110 D<902601FFFCEC7FFEB6020FB512F0057F14FE4CB712C0040716F0041F
+82047F16FE93B5C66C7F92B500F0010F14C0C66C0380010380011F4AC76C806D4A6E8004
+F06F7F4C6F7F4C6F7F4C8193C915804B7014C0861DE0A27414F0A27414F8A47513FCA575
+13FEAF5113FCA598B512F8A31DF0621DE0621DC0621D806F5E701800704B5B505B704B5B
+7092B55A04FC4A5C704A5C706C010F5C05E0013F49C7FC9227FE7FFC01B55A70B712F004
+0F16C0040393C8FC040015F8053F14C0050301F0C9FC94CCFCB3A6B812E0A85F6F7ACD6C
+>112 D<0007BA12FC1AFEA503E0C714FC4AC74814F84801F04A14F05C02804A14E091C8
+4814C04D14805B494B14004D5B4992B55AA24C5C494A5C615E4C5C001F4B5C5B4C91C7FC
+4C5B93B55AA24B5CC8485C4B5CA24B5C4B5C4B91C8FCA24B5B92B55AA24A5C4A5C4A4A14
+FFA24A5C4A5C4A91C8FC614A4915FE91B55A495CA2495C494A14035E5B495C4991C81207
+A24949ED0FFC90B55A484A151FA2484A153F484A157F484A15FF1803484A140F4891C812
+3F48490207B5FC91B9FCBB12F8A57E484D7BCC56>122 D E
+%EndDVIPSBitmapFont
+end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+%%PaperSize: A4
+
+%%EndSetup
+%%Page: 1 1
+1 0 bop 150 1318 a Fm(bzip2)64 b(and)g(libbzip2)p 150
+1418 3600 34 v 2010 1515 a Fl(a)31 b(program)f(and)g(library)e(for)i
+(data)h(compression)2198 1623 y(cop)m(yrigh)m(t)f(\(C\))h(1996-2000)j
+(Julian)28 b(Sew)m(ard)2605 1731 y(v)m(ersion)i(1.0)h(of)g(21)g(Marc)m
+(h)g(2000)150 5091 y Fk(Julian)46 b(Sew)l(ard)p 150 5141
+3600 17 v eop
+%%Page: 1 2
+1 1 bop 3705 -116 a Fl(1)150 299 y(This)24 b(program,)j
+Fj(bzip2)p Fl(,)e(and)g(asso)s(ciated)i(library)c Fj(libbzip2)p
+Fl(,)i(are)h(Cop)m(yrigh)m(t)g(\(C\))g(1996-2000)j(Julian)150
+408 y(R)h(Sew)m(ard.)40 b(All)29 b(righ)m(ts)h(reserv)m(ed.)150
+565 y(Redistribution)f(and)i(use)h(in)f(source)h(and)g(binary)e(forms,)
+j(with)e(or)h(without)f(mo)s(di\014cation,)g(are)i(p)s(er-)150
+675 y(mitted)d(pro)m(vided)f(that)i(the)f(follo)m(wing)f(conditions)g
+(are)i(met:)225 832 y Fi(\017)60 b Fl(Redistributions)26
+b(of)k(source)g(co)s(de)g(m)m(ust)g(retain)f(the)h(ab)s(o)m(v)m(e)h
+(cop)m(yrigh)m(t)g(notice,)f(this)f(list)f(of)i(con-)330
+941 y(ditions)e(and)i(the)h(follo)m(wing)e(disclaimer.)225
+1076 y Fi(\017)60 b Fl(The)33 b(origin)f(of)h(this)f(soft)m(w)m(are)j
+(m)m(ust)e(not)h(b)s(e)e(misrepresen)m(ted;)i(y)m(ou)g(m)m(ust)f(not)g
+(claim)g(that)h(y)m(ou)330 1185 y(wrote)d(the)h(original)d(soft)m(w)m
+(are.)44 b(If)31 b(y)m(ou)g(use)g(this)f(soft)m(w)m(are)i(in)e(a)h(pro)
+s(duct,)g(an)f(ac)m(kno)m(wledgmen)m(t)330 1295 y(in)f(the)i(pro)s
+(duct)e(do)s(cumen)m(tation)h(w)m(ould)f(b)s(e)h(appreciated)g(but)g
+(is)f(not)i(required.)225 1429 y Fi(\017)60 b Fl(Altered)21
+b(source)g(v)m(ersions)f(m)m(ust)h(b)s(e)f(plainly)e(mark)m(ed)j(as)g
+(suc)m(h,)i(and)d(m)m(ust)h(not)g(b)s(e)f(misrepresen)m(ted)330
+1539 y(as)31 b(b)s(eing)e(the)h(original)f(soft)m(w)m(are.)225
+1674 y Fi(\017)60 b Fl(The)27 b(name)h(of)f(the)h(author)f(ma)m(y)h
+(not)g(b)s(e)f(used)g(to)h(endorse)f(or)h(promote)g(pro)s(ducts)e
+(deriv)m(ed)g(from)330 1783 y(this)j(soft)m(w)m(are)j(without)d(sp)s
+(eci\014c)h(prior)e(written)i(p)s(ermission.)150 1965
+y(THIS)37 b(SOFTW)-10 b(ARE)38 b(IS)f(PR)m(O)m(VIDED)i(BY)g(THE)f(A)m
+(UTHOR)g(\\AS)g(IS")g(AND)h(ANY)f(EXPRESS)150 2074 y(OR)31
+b(IMPLIED)h(W)-10 b(ARRANTIES,)31 b(INCLUDING,)i(BUT)f(NOT)f(LIMITED)g
+(TO,)h(THE)f(IMPLIED)150 2184 y(W)-10 b(ARRANTIES)27
+b(OF)h(MER)m(CHANT)-8 b(ABILITY)28 b(AND)g(FITNESS)f(F)m(OR)g(A)h(P)-8
+b(AR)g(TICULAR)28 b(PUR-)150 2294 y(POSE)37 b(ARE)g(DISCLAIMED.)h(IN)f
+(NO)h(EVENT)f(SHALL)g(THE)g(A)m(UTHOR)h(BE)g(LIABLE)g(F)m(OR)150
+2403 y(ANY)56 b(DIRECT,)f(INDIRECT,)h(INCIDENT)-8 b(AL,)56
+b(SPECIAL,)e(EXEMPLAR)-8 b(Y,)57 b(OR)e(CONSE-)150 2513
+y(QUENTIAL)48 b(D)m(AMA)m(GES)i(\(INCLUDING,)g(BUT)f(NOT)f(LIMITED)g
+(TO,)g(PR)m(OCUREMENT)150 2622 y(OF)35 b(SUBSTITUTE)e(GOODS)i(OR)f(SER)
+-10 b(VICES;)34 b(LOSS)f(OF)i(USE,)g(D)m(A)-8 b(T)g(A,)36
+b(OR)f(PR)m(OFITS;)f(OR)150 2732 y(BUSINESS)28 b(INTERR)m(UPTION\))g
+(HO)m(WEVER)i(CA)m(USED)f(AND)g(ON)g(ANY)g(THEOR)-8 b(Y)29
+b(OF)g(LIA-)150 2842 y(BILITY,)36 b(WHETHER)g(IN)g(CONTRA)m(CT,)g
+(STRICT)e(LIABILITY,)i(OR)g(TOR)-8 b(T)35 b(\(INCLUDING)150
+2951 y(NEGLIGENCE)45 b(OR)g(OTHER)-10 b(WISE\))44 b(ARISING)h(IN)g(ANY)
+h(W)-10 b(A)i(Y)46 b(OUT)e(OF)i(THE)e(USE)h(OF)150 3061
+y(THIS)29 b(SOFTW)-10 b(ARE,)31 b(EVEN)f(IF)g(AD)m(VISED)i(OF)e(THE)g
+(POSSIBILITY)e(OF)j(SUCH)f(D)m(AMA)m(GE.)150 3218 y(Julian)e(Sew)m
+(ard,)i(Cam)m(bridge,)g(UK.)150 3374 y Fj(jseward@acm.org)150
+3531 y(http://sourceware.cygnus)o(.com)o(/bzi)o(p2)150
+3688 y(http://www.cacheprof.org)150 3845 y(http://www.muraroa.demon)o
+(.co.)o(uk)150 4002 y(bzip2)p Fl(/)p Fj(libbzip2)d Fl(v)m(ersion)j(1.0)
+i(of)e(21)h(Marc)m(h)g(2000.)150 4159 y(P)-8 b(A)g(TENTS:)40
+b(T)-8 b(o)40 b(the)g(b)s(est)g(of)g(m)m(y)g(kno)m(wledge,)j
+Fj(bzip2)38 b Fl(do)s(es)i(not)g(use)g(an)m(y)g(paten)m(ted)h
+(algorithms.)150 4268 y(Ho)m(w)m(ev)m(er,)33 b(I)e(do)f(not)h(ha)m(v)m
+(e)h(the)f(resources)g(a)m(v)-5 b(ailable)30 b(to)h(carry)g(out)g(a)g
+(full)d(paten)m(t)k(searc)m(h.)42 b(Therefore)150 4378
+y(I)30 b(cannot)h(giv)m(e)g(an)m(y)g(guaran)m(tee)h(of)e(the)h(ab)s(o)m
+(v)m(e)g(statemen)m(t.)p eop
+%%Page: 2 3
+2 2 bop 150 -116 a Fl(Chapter)30 b(1:)41 b(In)m(tro)s(duction)2591
+b(2)150 299 y Fh(1)80 b(In)l(tro)t(duction)150 555 y
+Fj(bzip2)20 b Fl(compresses)h(\014les)f(using)g(the)h(Burro)m
+(ws-Wheeler)g(blo)s(c)m(k-sorting)f(text)j(compression)d(algorithm,)150
+665 y(and)33 b(Hu\013man)g(co)s(ding.)50 b(Compression)32
+b(is)h(generally)g(considerably)f(b)s(etter)i(than)f(that)h(ac)m(hiev)m
+(ed)h(b)m(y)150 775 y(more)f(con)m(v)m(en)m(tional)g(LZ77/LZ78-based)g
+(compressors,)g(and)f(approac)m(hes)h(the)f(p)s(erformance)g(of)h(the)
+150 884 y(PPM)c(family)f(of)i(statistical)f(compressors.)150
+1041 y Fj(bzip2)k Fl(is)h(built)e(on)i(top)h(of)g Fj(libbzip2)p
+Fl(,)e(a)i(\015exible)e(library)f(for)i(handling)e(compressed)i(data)i
+(in)d(the)150 1151 y Fj(bzip2)c Fl(format.)43 b(This)30
+b(man)m(ual)g(describ)s(es)g(b)s(oth)g(ho)m(w)i(to)g(use)f(the)g
+(program)g(and)g(ho)m(w)g(to)h(w)m(ork)f(with)150 1260
+y(the)d(library)d(in)m(terface.)41 b(Most)28 b(of)g(the)g(man)m(ual)f
+(is)g(dev)m(oted)i(to)f(this)f(library)-8 b(,)26 b(not)i(the)g
+(program,)g(whic)m(h)150 1370 y(is)h(go)s(o)s(d)i(news)e(if)h(y)m(our)g
+(in)m(terest)h(is)e(only)g(in)h(the)g(program.)150 1527
+y(Chapter)24 b(2)g(describ)s(es)f(ho)m(w)h(to)h(use)f
+Fj(bzip2)p Fl(;)h(this)e(is)g(the)i(only)e(part)h(y)m(ou)h(need)f(to)h
+(read)f(if)f(y)m(ou)h(just)g(w)m(an)m(t)150 1636 y(to)35
+b(kno)m(w)f(ho)m(w)g(to)g(op)s(erate)h(the)f(program.)51
+b(Chapter)34 b(3)g(describ)s(es)e(the)i(programming)f(in)m(terfaces)h
+(in)150 1746 y(detail,)23 b(and)d(Chapter)h(4)h(records)f(some)h
+(miscellaneous)e(notes)i(whic)m(h)e(I)h(though)m(t)h(ough)m(t)g(to)g(b)
+s(e)f(recorded)150 1855 y(somewhere.)p eop
+%%Page: 3 4
+3 3 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(3)150 299 y Fh(2)80 b(Ho)l(w)53
+b(to)g(use)g Fg(bzip2)150 566 y Fl(This)29 b(c)m(hapter)i(con)m(tains)f
+(a)h(cop)m(y)g(of)g(the)f Fj(bzip2)f Fl(man)h(page,)h(and)f(nothing)g
+(else.)390 818 y Ff(NAME)570 1004 y Fj(bzip2)p Fl(,)f
+Fj(bunzip2)g Fl(-)h(a)h(blo)s(c)m(k-sorting)f(\014le)f(compressor,)i
+(v1.0)570 1136 y Fj(bzcat)e Fl(-)i(decompresses)f(\014les)f(to)i
+(stdout)570 1267 y Fj(bzip2recover)c Fl(-)k(reco)m(v)m(ers)h(data)f
+(from)f(damaged)g(bzip2)g(\014les)390 1519 y Ff(SYNOPSIS)570
+1706 y Fj(bzip2)f Fl([)h(-cdfkqstvzVL123456789)35 b(])c([)g
+(\014lenames)e(...)41 b(])570 1837 y Fj(bunzip2)28 b
+Fl([)j(-fkvsVL)f(])h([)f(\014lenames)g(...)41 b(])570
+1968 y Fj(bzcat)29 b Fl([)h(-s)h(])g([)f(\014lenames)g(...)41
+b(])570 2100 y Fj(bzip2recover)27 b Fl(\014lename)390
+2352 y Ff(DESCRIPTION)390 2538 y Fj(bzip2)i Fl(compresses)i(\014les)f
+(using)f(the)i(Burro)m(ws-Wheeler)g(blo)s(c)m(k)f(sorting)g(text)i
+(compres-)390 2642 y(sion)40 b(algorithm,)j(and)d(Hu\013man)h(co)s
+(ding.)71 b(Compression)40 b(is)g(generally)g(considerably)390
+2746 y(b)s(etter)25 b(than)g(that)h(ac)m(hiev)m(ed)g(b)m(y)f(more)g
+(con)m(v)m(en)m(tional)h(LZ77/LZ78-based)g(compressors,)390
+2850 y(and)k(approac)m(hes)h(the)f(p)s(erformance)g(of)h(the)f(PPM)g
+(family)f(of)i(statistical)f(compressors.)390 3001 y(The)e
+(command-line)e(options)i(are)h(delib)s(erately)d(v)m(ery)i(similar)e
+(to)j(those)g(of)f(GNU)h Fj(gzip)p Fl(,)390 3104 y(but)h(they)g(are)h
+(not)g(iden)m(tical.)390 3255 y Fj(bzip2)f Fl(exp)s(ects)h(a)g(list)f
+(of)h(\014le)f(names)h(to)h(accompan)m(y)h(the)e(command-line)e
+(\015ags.)43 b(Eac)m(h)390 3359 y(\014le)e(is)h(replaced)g(b)m(y)g(a)h
+(compressed)f(v)m(ersion)g(of)g(itself,)i(with)e(the)g(name)g
+Fj(original_)390 3463 y(name.bz2)p Fl(.)49 b(Eac)m(h)34
+b(compressed)g(\014le)f(has)g(the)h(same)g(mo)s(di\014cation)e(date,)k
+(p)s(ermissions,)390 3567 y(and,)24 b(when)f(p)s(ossible,)f(o)m
+(wnership)f(as)j(the)f(corresp)s(onding)f(original,)h(so)g(that)h
+(these)g(prop-)390 3671 y(erties)34 b(can)g(b)s(e)f(correctly)i
+(restored)f(at)g(decompression)f(time.)51 b(File)34 b(name)g(handling)d
+(is)390 3774 y(naiv)m(e)26 b(in)f(the)i(sense)f(that)h(there)f(is)f(no)
+i(mec)m(hanism)e(for)h(preserving)f(original)f(\014le)i(names,)390
+3878 y(p)s(ermissions,)37 b(o)m(wnerships)f(or)h(dates)i(in)d
+(\014lesystems)h(whic)m(h)g(lac)m(k)h(these)g(concepts,)j(or)390
+3982 y(ha)m(v)m(e)32 b(serious)d(\014le)g(name)i(length)f
+(restrictions,)f(suc)m(h)h(as)h(MS-DOS.)390 4133 y Fj(bzip2)26
+b Fl(and)h Fj(bunzip2)e Fl(will)f(b)m(y)k(default)e(not)i(o)m(v)m
+(erwrite)g(existing)e(\014les.)38 b(If)27 b(y)m(ou)h(w)m(an)m(t)g(this)
+390 4237 y(to)j(happ)s(en,)e(sp)s(ecify)g(the)i Fj(-f)e
+Fl(\015ag.)390 4388 y(If)34 b(no)h(\014le)f(names)g(are)i(sp)s
+(eci\014ed,)e Fj(bzip2)f Fl(compresses)i(from)f(standard)g(input)f(to)j
+(stan-)390 4491 y(dard)c(output.)49 b(In)32 b(this)g(case,)k
+Fj(bzip2)31 b Fl(will)g(decline)h(to)i(write)e(compressed)h(output)g
+(to)h(a)390 4595 y(terminal,)29 b(as)i(this)e(w)m(ould)g(b)s(e)h(en)m
+(tirely)f(incomprehensible)e(and)j(therefore)h(p)s(oin)m(tless.)390
+4746 y Fj(bunzip2)36 b Fl(\(or)j Fj(bzip2)29 b(-d)p Fl(\))37
+b(decompresses)i(all)e(sp)s(eci\014ed)f(\014les.)63 b(Files)37
+b(whic)m(h)g(w)m(ere)i(not)390 4850 y(created)e(b)m(y)f
+Fj(bzip2)f Fl(will)e(b)s(e)i(detected)j(and)d(ignored,)i(and)e(a)i(w)m
+(arning)d(issued.)56 b Fj(bzip2)390 4954 y Fl(attempts)31
+b(to)f(guess)g(the)g(\014lename)f(for)h(the)g(decompressed)f(\014le)g
+(from)h(that)g(of)g(the)g(com-)390 5058 y(pressed)f(\014le)h(as)h
+(follo)m(ws:)570 5209 y Fj(filename.bz2)57 b Fl(b)s(ecomes)31
+b Fj(filename)570 5340 y(filename.bz)58 b Fl(b)s(ecomes)30
+b Fj(filename)p eop
+%%Page: 4 5
+4 4 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(4)570 299 y Fj(filename.tbz2)27
+b Fl(b)s(ecomes)j Fj(filename.tar)570 470 y(filename.tbz)57
+b Fl(b)s(ecomes)31 b Fj(filename.tar)570 641 y(anyothername)57
+b Fl(b)s(ecomes)31 b Fj(anyothername.out)390 859 y Fl(If)j(the)h
+(\014le)e(do)s(es)i(not)f(end)g(in)f(one)i(of)g(the)g(recognised)f
+(endings,)g Fj(.bz2)p Fl(,)h Fj(.bz)p Fl(,)g Fj(.tbz2)e
+Fl(or)390 963 y Fj(.tbz)p Fl(,)h Fj(bzip2)f Fl(complains)f(that)j(it)e
+(cannot)i(guess)f(the)g(name)h(of)f(the)g(original)e(\014le,)j(and)390
+1067 y(uses)30 b(the)g(original)f(name)h(with)g Fj(.out)f
+Fl(app)s(ended.)390 1218 y(As)j(with)f(compression,)h(supplying)c(no)k
+(\014lenames)f(causes)i(decompression)e(from)h(stan-)390
+1321 y(dard)d(input)g(to)i(standard)e(output.)390 1472
+y Fj(bunzip2)k Fl(will)g(correctly)j(decompress)e(a)i(\014le)e(whic)m
+(h)g(is)h(the)g(concatenation)i(of)e(t)m(w)m(o)i(or)390
+1576 y(more)j(compressed)f(\014les.)67 b(The)39 b(result)g(is)g(the)g
+(concatenation)i(of)f(the)g(corresp)s(onding)390 1680
+y(uncompressed)c(\014les.)59 b(In)m(tegrit)m(y)38 b(testing)f(\()p
+Fj(-t)p Fl(\))g(of)g(concatenated)i(compressed)e(\014les)f(is)390
+1784 y(also)30 b(supp)s(orted.)390 1935 y(Y)-8 b(ou)40
+b(can)g(also)f(compress)g(or)g(decompress)g(\014les)g(to)h(the)f
+(standard)g(output)g(b)m(y)g(giving)390 2039 y(the)30
+b Fj(-c)g Fl(\015ag.)40 b(Multiple)28 b(\014les)h(ma)m(y)i(b)s(e)e
+(compressed)h(and)f(decompressed)h(lik)m(e)f(this.)39
+b(The)390 2142 y(resulting)31 b(outputs)i(are)h(fed)f(sequen)m(tially)f
+(to)i(stdout.)49 b(Compression)32 b(of)h(m)m(ultiple)e(\014les)390
+2246 y(in)24 b(this)g(manner)h(generates)h(a)g(stream)f(con)m(taining)g
+(m)m(ultiple)e(compressed)i(\014le)f(represen-)390 2350
+y(tations.)58 b(Suc)m(h)36 b(a)g(stream)g(can)h(b)s(e)e(decompressed)h
+(correctly)h(only)e(b)m(y)h Fj(bzip2)e Fl(v)m(ersion)390
+2454 y(0.9.0)g(or)e(later.)47 b(Earlier)30 b(v)m(ersions)i(of)g
+Fj(bzip2)f Fl(will)f(stop)i(after)h(decompressing)e(the)i(\014rst)390
+2558 y(\014le)c(in)h(the)g(stream.)390 2709 y Fj(bzcat)f
+Fl(\(or)i Fj(bzip2)e(-dc)p Fl(\))g(decompresses)i(all)e(sp)s(eci\014ed)
+g(\014les)g(to)i(the)g(standard)e(output.)390 2860 y
+Fj(bzip2)f Fl(will)g(read)i(argumen)m(ts)g(from)f(the)h(en)m(vironmen)m
+(t)g(v)-5 b(ariables)28 b Fj(BZIP2)h Fl(and)g Fj(BZIP)p
+Fl(,)g(in)390 2963 y(that)24 b(order,)g(and)f(will)e(pro)s(cess)i(them)
+g(b)s(efore)g(an)m(y)h(argumen)m(ts)f(read)h(from)f(the)g(command)390
+3067 y(line.)39 b(This)29 b(giv)m(es)h(a)h(con)m(v)m(enien)m(t)h(w)m(a)
+m(y)f(to)g(supply)d(default)i(argumen)m(ts.)390 3218
+y(Compression)h(is)h(alw)m(a)m(ys)i(p)s(erformed,)e(ev)m(en)h(if)f(the)
+h(compressed)g(\014le)f(is)g(sligh)m(tly)f(larger)390
+3322 y(than)26 b(the)g(original.)38 b(Files)25 b(of)h(less)g(than)g(ab)
+s(out)g(one)g(h)m(undred)e(b)m(ytes)j(tend)f(to)h(get)g(larger,)390
+3426 y(since)34 b(the)g(compression)f(mec)m(hanism)h(has)f(a)i(constan)
+m(t)g(o)m(v)m(erhead)h(in)d(the)h(region)g(of)g(50)390
+3529 y(b)m(ytes.)54 b(Random)34 b(data)h(\(including)d(the)i(output)h
+(of)f(most)h(\014le)f(compressors\))h(is)e(co)s(ded)390
+3633 y(at)e(ab)s(out)f(8.05)i(bits)d(p)s(er)h(b)m(yte,)h(giving)e(an)h
+(expansion)g(of)g(around)g(0.5\045.)390 3784 y(As)h(a)g(self-c)m(hec)m
+(k)h(for)e(y)m(our)h(protection,)g Fj(bzip2)f Fl(uses)g(32-bit)h(CR)m
+(Cs)f(to)i(mak)m(e)f(sure)f(that)390 3888 y(the)45 b(decompressed)f(v)m
+(ersion)g(of)g(a)h(\014le)e(is)h(iden)m(tical)f(to)i(the)g(original.)81
+b(This)43 b(guards)390 3992 y(against)i(corruption)e(of)h(the)h
+(compressed)f(data,)49 b(and)44 b(against)h(undetected)g(bugs)e(in)390
+4096 y Fj(bzip2)35 b Fl(\(hop)s(efully)e(v)m(ery)k(unlik)m(ely\).)56
+b(The)36 b(c)m(hances)h(of)f(data)h(corruption)e(going)h(unde-)390
+4199 y(tected)g(is)e(microscopic,)h(ab)s(out)f(one)h(c)m(hance)g(in)f
+(four)g(billion)d(for)j(eac)m(h)i(\014le)d(pro)s(cessed.)390
+4303 y(Be)38 b(a)m(w)m(are,)k(though,)d(that)f(the)g(c)m(hec)m(k)i(o)s
+(ccurs)d(up)s(on)f(decompression,)j(so)f(it)f(can)h(only)390
+4407 y(tell)28 b(y)m(ou)g(that)i(something)d(is)h(wrong.)40
+b(It)28 b(can't)i(help)d(y)m(ou)i(reco)m(v)m(er)h(the)e(original)f
+(uncom-)390 4511 y(pressed)h(data.)41 b(Y)-8 b(ou)30
+b(can)f(use)g Fj(bzip2recover)d Fl(to)k(try)f(to)h(reco)m(v)m(er)h
+(data)f(from)e(damaged)390 4614 y(\014les.)390 4766 y(Return)22
+b(v)-5 b(alues:)37 b(0)23 b(for)g(a)g(normal)f(exit,)j(1)e(for)g(en)m
+(vironmen)m(tal)f(problems)f(\(\014le)i(not)g(found,)390
+4869 y(in)m(v)-5 b(alid)30 b(\015ags,)k(I/O)f(errors,)g(&c\),)h(2)f(to)
+g(indicate)f(a)h(corrupt)f(compressed)h(\014le,)f(3)i(for)e(an)390
+4973 y(in)m(ternal)d(consistency)h(error)g(\(eg,)i(bug\))e(whic)m(h)f
+(caused)i Fj(bzip2)e Fl(to)i(panic.)390 5304 y Ff(OPTIONS)p
+eop
+%%Page: 5 6
+5 5 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(5)390 299 y Fj(-c)30
+b(--stdout)870 403 y Fl(Compress)f(or)i(decompress)f(to)h(standard)e
+(output.)390 557 y Fj(-d)h(--decompress)870 661 y Fl(F)-8
+b(orce)44 b(decompression.)77 b Fj(bzip2)p Fl(,)44 b
+Fj(bunzip2)d Fl(and)h Fj(bzcat)f Fl(are)i(really)f(the)870
+764 y(same)27 b(program,)h(and)e(the)i(decision)d(ab)s(out)i(what)g
+(actions)g(to)h(tak)m(e)g(is)e(done)870 868 y(on)k(the)h(basis)e(of)i
+(whic)m(h)e(name)h(is)g(used.)40 b(This)28 b(\015ag)j(o)m(v)m(errides)f
+(that)h(mec)m(h-)870 972 y(anism,)e(and)h(forces)h(bzip2)e(to)i
+(decompress.)390 1126 y Fj(-z)f(--compress)870 1230 y
+Fl(The)39 b(complemen)m(t)h(to)g Fj(-d)p Fl(:)59 b(forces)40
+b(compression,)h(regardless)d(of)i(the)g(in-)870 1334
+y(v)m(ok)-5 b(ation)31 b(name.)390 1488 y Fj(-t)f(--test)8
+b Fl(Chec)m(k)33 b(in)m(tegrit)m(y)j(of)f(the)g(sp)s(eci\014ed)e
+(\014le\(s\),)k(but)d(don't)h(decompress)g(them.)870
+1591 y(This)40 b(really)g(p)s(erforms)g(a)i(trial)e(decompression)h
+(and)g(thro)m(ws)g(a)m(w)m(a)m(y)j(the)870 1695 y(result.)390
+1849 y Fj(-f)30 b(--force)870 1953 y Fl(F)-8 b(orce)31
+b(o)m(v)m(erwrite)f(of)g(output)f(\014les.)40 b(Normally)-8
+b(,)29 b Fj(bzip2)f Fl(will)f(not)j(o)m(v)m(erwrite)870
+2057 y(existing)e(output)g(\014les.)39 b(Also)28 b(forces)h
+Fj(bzip2)e Fl(to)i(break)g(hard)e(links)f(to)k(\014les,)870
+2161 y(whic)m(h)f(it)h(otherwise)g(w)m(ouldn't)f(do.)390
+2315 y Fj(-k)h(--keep)8 b Fl(Keep)24 b(\(don't)i(delete\))h(input)d
+(\014les)g(during)g(compression)h(or)h(decompression.)390
+2469 y Fj(-s)k(--small)870 2573 y Fl(Reduce)23 b(memory)f(usage,)j(for)
+d(compression,)h(decompression)f(and)g(testing.)870 2676
+y(Files)f(are)i(decompressed)e(and)h(tested)h(using)e(a)h(mo)s
+(di\014ed)e(algorithm)h(whic)m(h)870 2780 y(only)30 b(requires)g(2.5)j
+(b)m(ytes)f(p)s(er)e(blo)s(c)m(k)h(b)m(yte.)44 b(This)30
+b(means)h(an)m(y)h(\014le)e(can)i(b)s(e)870 2884 y(decompressed)d(in)f
+(2300k)j(of)e(memory)-8 b(,)30 b(alb)s(eit)e(at)i(ab)s(out)f(half)g
+(the)g(normal)870 2988 y(sp)s(eed.)870 3117 y(During)42
+b(compression,)k Fj(-s)d Fl(selects)h(a)g(blo)s(c)m(k)g(size)f(of)h
+(200k,)k(whic)m(h)42 b(lim-)870 3220 y(its)33 b(memory)g(use)g(to)h
+(around)e(the)i(same)f(\014gure,)h(at)g(the)g(exp)s(ense)f(of)g(y)m
+(our)870 3324 y(compression)g(ratio.)50 b(In)33 b(short,)i(if)d(y)m
+(our)i(mac)m(hine)f(is)g(lo)m(w)g(on)h(memory)f(\(8)870
+3428 y(megab)m(ytes)42 b(or)e(less\),)j(use)d(-s)g(for)g(ev)m
+(erything.)71 b(See)40 b(MEMOR)-8 b(Y)41 b(MAN-)870 3532
+y(A)m(GEMENT)31 b(b)s(elo)m(w.)390 3686 y Fj(-q)f(--quiet)870
+3790 y Fl(Suppress)j(non-essen)m(tial)j(w)m(arning)e(messages.)58
+b(Messages)38 b(p)s(ertaining)33 b(to)870 3893 y(I/O)d(errors)g(and)g
+(other)h(critical)e(ev)m(en)m(ts)j(will)27 b(not)k(b)s(e)f(suppressed.)
+390 4047 y Fj(-v)g(--verbose)870 4151 y Fl(V)-8 b(erb)s(ose)28
+b(mo)s(de)f({)i(sho)m(w)e(the)h(compression)f(ratio)h(for)f(eac)m(h)i
+(\014le)e(pro)s(cessed.)870 4255 y(F)-8 b(urther)30 b
+Fj(-v)p Fl('s)g(increase)g(the)g(v)m(erb)s(osit)m(y)g(lev)m(el,)h(sp)s
+(ewing)d(out)j(lots)f(of)g(infor-)870 4359 y(mation)g(whic)m(h)f(is)h
+(primarily)d(of)j(in)m(terest)h(for)f(diagnostic)g(purp)s(oses.)390
+4513 y Fj(-L)g(--license)e(-V)h(--version)870 4617 y
+Fl(Displa)m(y)h(the)g(soft)m(w)m(are)i(v)m(ersion,)e(license)f(terms)i
+(and)e(conditions.)390 4771 y Fj(-1)h(to)g(-9)72 b Fl(Set)35
+b(the)g(blo)s(c)m(k)f(size)h(to)g(100)h(k,)g(200)g(k)f(..)53
+b(900)36 b(k)f(when)f(compressing.)53 b(Has)870 4875
+y(no)41 b(e\013ect)h(when)d(decompressing.)71 b(See)41
+b(MEMOR)-8 b(Y)41 b(MANA)m(GEMENT)870 4978 y(b)s(elo)m(w.)390
+5132 y Fj(--)324 b Fl(T)-8 b(reats)25 b(all)e(subsequen)m(t)g(argumen)m
+(ts)i(as)f(\014le)g(names,)h(ev)m(en)g(if)e(they)i(start)f(with)870
+5236 y(a)32 b(dash.)43 b(This)29 b(is)h(so)i(y)m(ou)g(can)f(handle)f
+(\014les)g(with)g(names)i(b)s(eginning)c(with)870 5340
+y(a)j(dash,)f(for)g(example:)40 b Fj(bzip2)29 b(--)h(-myfilename)p
+Fl(.)p eop
+%%Page: 6 7
+6 6 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(6)390 299 y Fj(--repetitive-fast)390
+427 y(--repetitive-best)870 530 y Fl(These)34 b(\015ags)g(are)h
+(redundan)m(t)e(in)g(v)m(ersions)g(0.9.5)j(and)e(ab)s(o)m(v)m(e.)53
+b(They)34 b(pro-)870 634 y(vided)h(some)i(coarse)g(con)m(trol)g(o)m(v)m
+(er)g(the)g(b)s(eha)m(viour)e(of)h(the)g(sorting)g(algo-)870
+738 y(rithm)h(in)h(earlier)g(v)m(ersions,)j(whic)m(h)d(w)m(as)h
+(sometimes)h(useful.)65 b(0.9.5)41 b(and)870 842 y(ab)s(o)m(v)m(e)34
+b(ha)m(v)m(e)g(an)f(impro)m(v)m(ed)g(algorithm)f(whic)m(h)f(renders)h
+(these)h(\015ags)h(irrel-)870 946 y(ev)-5 b(an)m(t.)390
+1190 y Ff(MEMOR)-10 b(Y)40 b(MANA)m(GEMENT)390 1377 y
+Fj(bzip2)25 b Fl(compresses)i(large)g(\014les)e(in)g(blo)s(c)m(ks.)39
+b(The)26 b(blo)s(c)m(k)h(size)f(a\013ects)i(b)s(oth)e(the)h(compres-)
+390 1481 y(sion)39 b(ratio)g(ac)m(hiev)m(ed,)k(and)d(the)f(amoun)m(t)i
+(of)e(memory)h(needed)f(for)h(compression)f(and)390 1585
+y(decompression.)59 b(The)36 b(\015ags)h Fj(-1)f Fl(through)h
+Fj(-9)f Fl(sp)s(ecify)f(the)i(blo)s(c)m(k)g(size)f(to)i(b)s(e)e
+(100,000)390 1688 y(b)m(ytes)29 b(through)e(900,000)k(b)m(ytes)d(\(the)
+h(default\))e(resp)s(ectiv)m(ely)-8 b(.)40 b(A)m(t)29
+b(decompression)e(time,)390 1792 y(the)32 b(blo)s(c)m(k)g(size)g(used)g
+(for)g(compression)f(is)g(read)h(from)g(the)g(header)g(of)h(the)f
+(compressed)390 1896 y(\014le,)j(and)f Fj(bunzip2)e Fl(then)i(allo)s
+(cates)h(itself)e(just)h(enough)g(memory)g(to)i(decompress)e(the)390
+2000 y(\014le.)39 b(Since)29 b(blo)s(c)m(k)g(sizes)g(are)h(stored)f(in)
+f(compressed)h(\014les,)g(it)g(follo)m(ws)f(that)i(the)g(\015ags)g
+Fj(-1)390 2103 y Fl(to)h Fj(-9)f Fl(are)h(irrelev)-5
+b(an)m(t)29 b(to)i(and)f(so)h(ignored)e(during)f(decompression.)390
+2255 y(Compression)h(and)g(decompression)h(requiremen)m(ts,)f(in)g(b)m
+(ytes,)j(can)e(b)s(e)g(estimated)h(as:)869 2406 y Fj(Compression:)140
+b(400k)46 b(+)i(\()f(8)h(x)f(block)f(size)h(\))869 2613
+y(Decompression:)d(100k)i(+)i(\()f(4)h(x)f(block)f(size)h(\),)g(or)1585
+2717 y(100k)f(+)i(\()f(2.5)g(x)g(block)g(size)f(\))390
+2868 y Fl(Larger)29 b(blo)s(c)m(k)f(sizes)h(giv)m(e)g(rapidly)d
+(diminishing)e(marginal)k(returns.)39 b(Most)29 b(of)g(the)g(com-)390
+2972 y(pression)d(comes)j(from)f(the)g(\014rst)g(t)m(w)m(o)h(or)f
+(three)h(h)m(undred)d(k)i(of)g(blo)s(c)m(k)g(size,)g(a)h(fact)g(w)m
+(orth)390 3075 y(b)s(earing)j(in)f(mind)g(when)h(using)f
+Fj(bzip2)h Fl(on)g(small)g(mac)m(hines.)47 b(It)33 b(is)f(also)h(imp)s
+(ortan)m(t)f(to)390 3179 y(appreciate)j(that)h(the)f(decompression)f
+(memory)h(requiremen)m(t)f(is)h(set)g(at)h(compression)390
+3283 y(time)30 b(b)m(y)g(the)h(c)m(hoice)g(of)g(blo)s(c)m(k)f(size.)390
+3434 y(F)-8 b(or)45 b(\014les)f(compressed)g(with)g(the)g(default)g
+(900k)i(blo)s(c)m(k)e(size,)49 b Fj(bunzip2)42 b Fl(will)g(require)390
+3538 y(ab)s(out)29 b(3700)j(kb)m(ytes)e(to)h(decompress.)40
+b(T)-8 b(o)30 b(supp)s(ort)e(decompression)h(of)h(an)m(y)g(\014le)f(on)
+g(a)i(4)390 3642 y(megab)m(yte)h(mac)m(hine,)d Fj(bunzip2)f
+Fl(has)i(an)g(option)f(to)i(decompress)e(using)g(appro)m(ximately)390
+3745 y(half)k(this)g(amoun)m(t)i(of)f(memory)-8 b(,)36
+b(ab)s(out)e(2300)i(kb)m(ytes.)53 b(Decompression)34
+b(sp)s(eed)g(is)f(also)390 3849 y(halv)m(ed,)i(so)f(y)m(ou)h(should)d
+(use)h(this)g(option)h(only)f(where)h(necessary)-8 b(.)53
+b(The)33 b(relev)-5 b(an)m(t)35 b(\015ag)390 3953 y(is)29
+b Fj(-s)p Fl(.)390 4104 y(In)34 b(general,)i(try)f(and)f(use)g(the)h
+(largest)h(blo)s(c)m(k)e(size)h(memory)f(constrain)m(ts)h(allo)m(w,)h
+(since)390 4208 y(that)45 b(maximises)f(the)h(compression)f(ac)m(hiev)m
+(ed.)85 b(Compression)43 b(and)h(decompression)390 4311
+y(sp)s(eed)30 b(are)g(virtually)e(una\013ected)j(b)m(y)f(blo)s(c)m(k)g
+(size.)390 4463 y(Another)25 b(signi\014can)m(t)f(p)s(oin)m(t)g
+(applies)f(to)j(\014les)e(whic)m(h)g(\014t)h(in)e(a)j(single)d(blo)s(c)
+m(k)i({)g(that)h(means)390 4566 y(most)g(\014les)g(y)m(ou'd)g(encoun)m
+(ter)h(using)d(a)j(large)f(blo)s(c)m(k)g(size.)39 b(The)25
+b(amoun)m(t)i(of)f(real)g(memory)390 4670 y(touc)m(hed)38
+b(is)e(prop)s(ortional)f(to)j(the)f(size)g(of)h(the)f(\014le,)h(since)f
+(the)g(\014le)g(is)f(smaller)g(than)h(a)390 4774 y(blo)s(c)m(k.)49
+b(F)-8 b(or)35 b(example,)f(compressing)e(a)i(\014le)e(20,000)k(b)m
+(ytes)e(long)f(with)f(the)i(\015ag)g Fj(-9)f Fl(will)390
+4878 y(cause)28 b(the)f(compressor)g(to)h(allo)s(cate)f(around)f(7600k)
+j(of)e(memory)-8 b(,)28 b(but)f(only)f(touc)m(h)i(400k)390
+4981 y Fj(+)h Fl(20000)j(*)e(8)g(=)f(560)i(kb)m(ytes)f(of)g(it.)40
+b(Similarly)-8 b(,)26 b(the)k(decompressor)f(will)e(allo)s(cate)j
+(3700k)390 5085 y(but)g(only)f(touc)m(h)i(100k)h Fj(+)e
+Fl(20000)i(*)f(4)g(=)f(180)i(kb)m(ytes.)390 5236 y(Here)41
+b(is)f(a)i(table)f(whic)m(h)e(summarises)g(the)j(maxim)m(um)d(memory)i
+(usage)h(for)e(di\013eren)m(t)390 5340 y(blo)s(c)m(k)25
+b(sizes.)38 b(Also)25 b(recorded)g(is)f(the)i(total)g(compressed)e
+(size)h(for)g(14)h(\014les)e(of)i(the)f(Calgary)p eop
+%%Page: 7 8
+7 7 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(7)390 299 y(T)-8 b(ext)38
+b(Compression)d(Corpus)h(totalling)h(3,141,622)k(b)m(ytes.)61
+b(This)36 b(column)g(giv)m(es)i(some)390 403 y(feel)23
+b(for)f(ho)m(w)h(compression)f(v)-5 b(aries)23 b(with)e(blo)s(c)m(k)i
+(size.)38 b(These)23 b(\014gures)f(tend)g(to)i(understate)390
+506 y(the)g(adv)-5 b(an)m(tage)26 b(of)e(larger)f(blo)s(c)m(k)h(sizes)f
+(for)h(larger)f(\014les,)h(since)g(the)g(Corpus)e(is)h(dominated)390
+610 y(b)m(y)30 b(smaller)f(\014les.)1107 761 y Fj(Compress)141
+b(Decompress)g(Decompress)f(Corpus)773 865 y(Flag)238
+b(usage)285 b(usage)332 b(-s)48 b(usage)237 b(Size)821
+1073 y(-1)286 b(1200k)332 b(500k)429 b(350k)285 b(914704)821
+1176 y(-2)h(2000k)332 b(900k)429 b(600k)285 b(877703)821
+1280 y(-3)h(2800k)f(1300k)428 b(850k)285 b(860338)821
+1384 y(-4)h(3600k)f(1700k)380 b(1100k)285 b(846899)821
+1488 y(-5)h(4400k)f(2100k)380 b(1350k)285 b(845160)821
+1591 y(-6)h(5200k)f(2500k)380 b(1600k)285 b(838626)821
+1695 y(-7)h(6100k)f(2900k)380 b(1850k)285 b(834096)821
+1799 y(-8)h(6800k)f(3300k)380 b(2100k)285 b(828642)821
+1903 y(-9)h(7600k)f(3700k)380 b(2350k)285 b(828642)390
+2147 y Ff(RECO)m(VERING)37 b(D)m(A)-10 b(T)g(A)40 b(FR)m(OM)h(D)m(AMA)m
+(GED)e(FILES)390 2333 y Fj(bzip2)25 b Fl(compresses)h(\014les)g(in)f
+(blo)s(c)m(ks,)h(usually)e(900kb)m(ytes)29 b(long.)39
+b(Eac)m(h)27 b(blo)s(c)m(k)e(is)h(handled)390 2437 y(indep)s(enden)m
+(tly)-8 b(.)47 b(If)32 b(a)i(media)e(or)h(transmission)e(error)i
+(causes)h(a)f(m)m(ulti-blo)s(c)m(k)f Fj(.bz2)g Fl(\014le)390
+2541 y(to)k(b)s(ecome)h(damaged,)g(it)e(ma)m(y)i(b)s(e)e(p)s(ossible)e
+(to)k(reco)m(v)m(er)g(data)f(from)g(the)f(undamaged)390
+2645 y(blo)s(c)m(ks)30 b(in)f(the)h(\014le.)390 2796
+y(The)j(compressed)h(represen)m(tation)f(of)h(eac)m(h)h(blo)s(c)m(k)e
+(is)g(delimited)e(b)m(y)j(a)g(48-bit)g(pattern,)390 2900
+y(whic)m(h)27 b(mak)m(es)j(it)e(p)s(ossible)e(to)j(\014nd)e(the)i(blo)s
+(c)m(k)f(b)s(oundaries)e(with)i(reasonable)g(certain)m(t)m(y)-8
+b(.)390 3003 y(Eac)m(h)34 b(blo)s(c)m(k)f(also)g(carries)g(its)g(o)m
+(wn)g(32-bit)g(CR)m(C,)h(so)f(damaged)h(blo)s(c)m(ks)f(can)g(b)s(e)g
+(distin-)390 3107 y(guished)c(from)h(undamaged)g(ones.)390
+3258 y Fj(bzip2recover)37 b Fl(is)j(a)h(simple)e(program)h(whose)g
+(purp)s(ose)f(is)h(to)i(searc)m(h)f(for)f(blo)s(c)m(ks)g(in)390
+3362 y Fj(.bz2)34 b Fl(\014les,)i(and)f(write)f(eac)m(h)j(blo)s(c)m(k)d
+(out)i(in)m(to)f(its)g(o)m(wn)g Fj(.bz2)f Fl(\014le.)55
+b(Y)-8 b(ou)36 b(can)f(then)g(use)390 3466 y Fj(bzip2)29
+b(-t)c Fl(to)i(test)f(the)g(in)m(tegrit)m(y)g(of)g(the)g(resulting)e
+(\014les,)i(and)f(decompress)h(those)g(whic)m(h)390 3569
+y(are)31 b(undamaged.)390 3721 y Fj(bzip2recover)41 b
+Fl(tak)m(es)46 b(a)f(single)e(argumen)m(t,)49 b(the)44
+b(name)h(of)g(the)f(damaged)h(\014le,)j(and)390 3824
+y(writes)33 b(a)i(n)m(um)m(b)s(er)d(of)j(\014les)e Fj(rec0001file.bz2)p
+Fl(,)e Fj(rec0002file.bz2)p Fl(,)g(etc,)36 b(con)m(taining)390
+3928 y(the)42 b(extracted)g(blo)s(c)m(ks.)74 b(The)41
+b(output)g(\014lenames)f(are)i(designed)e(so)i(that)g(the)g(use)f(of)
+390 4032 y(wildcards)30 b(in)h(subsequen)m(t)h(pro)s(cessing)f({)i(for)
+g(example,)g Fj(bzip2)c(-dc)g(rec*file.bz2)e(>)390 4136
+y(recovered_data)f Fl({)31 b(lists)e(the)i(\014les)e(in)g(the)i
+(correct)g(order.)390 4287 y Fj(bzip2recover)38 b Fl(should)i(b)s(e)g
+(of)i(most)g(use)f(dealing)f(with)g(large)i Fj(.bz2)e
+Fl(\014les,)k(as)d(these)390 4390 y(will)29 b(con)m(tain)j(man)m(y)g
+(blo)s(c)m(ks.)45 b(It)32 b(is)f(clearly)g(futile)f(to)i(use)g(it)f(on)
+h(damaged)g(single-blo)s(c)m(k)390 4494 y(\014les,)g(since)f(a)h
+(damaged)h(blo)s(c)m(k)e(cannot)i(b)s(e)e(reco)m(v)m(ered.)47
+b(If)32 b(y)m(ou)g(wish)e(to)j(minimise)c(an)m(y)390
+4598 y(p)s(oten)m(tial)36 b(data)i(loss)e(through)g(media)h(or)f
+(transmission)f(errors,)j(y)m(ou)f(migh)m(t)g(consider)390
+4702 y(compressing)29 b(with)g(a)i(smaller)e(blo)s(c)m(k)h(size.)390
+4946 y Ff(PERF)m(ORMANCE)39 b(NOTES)390 5132 y Fl(The)f(sorting)f
+(phase)h(of)h(compression)e(gathers)i(together)h(similar)35
+b(strings)i(in)g(the)i(\014le.)390 5236 y(Because)54
+b(of)f(this,)58 b(\014les)52 b(con)m(taining)g(v)m(ery)h(long)g(runs)e
+(of)i(rep)s(eated)g(sym)m(b)s(ols,)58 b(lik)m(e)390 5340
+y Fj(")p Fl(aabaabaabaab)e(...)p Fj(")g Fl(\(rep)s(eated)g(sev)m(eral)f
+(h)m(undred)e(times\))i(ma)m(y)h(compress)f(more)p eop
+%%Page: 8 9
+8 8 bop 150 -116 a Fl(Chapter)30 b(2:)41 b(Ho)m(w)31
+b(to)g(use)f Fj(bzip2)2375 b Fl(8)390 299 y(slo)m(wly)33
+b(than)g(normal.)50 b(V)-8 b(ersions)33 b(0.9.5)i(and)f(ab)s(o)m(v)m(e)
+h(fare)e(m)m(uc)m(h)h(b)s(etter)g(than)f(previous)390
+403 y(v)m(ersions)i(in)g(this)f(resp)s(ect.)57 b(The)35
+b(ratio)h(b)s(et)m(w)m(een)h(w)m(orst-case)g(and)e(a)m(v)m(erage-case)
+40 b(com-)390 506 y(pression)e(time)h(is)f(in)g(the)h(region)g(of)h
+(10:1.)69 b(F)-8 b(or)40 b(previous)e(v)m(ersions,)j(this)d(\014gure)h
+(w)m(as)390 610 y(more)f(lik)m(e)g(100:1.)66 b(Y)-8 b(ou)38
+b(can)h(use)e(the)i Fj(-vvvv)d Fl(option)i(to)h(monitor)e(progress)h
+(in)f(great)390 714 y(detail,)30 b(if)f(y)m(ou)i(w)m(an)m(t.)390
+865 y(Decompression)f(sp)s(eed)g(is)f(una\013ected)i(b)m(y)f(these)h
+(phenomena.)390 1016 y Fj(bzip2)i Fl(usually)g(allo)s(cates)i(sev)m
+(eral)f(megab)m(ytes)j(of)d(memory)h(to)g(op)s(erate)h(in,)e(and)g
+(then)390 1120 y(c)m(harges)k(all)d(o)m(v)m(er)j(it)f(in)e(a)i(fairly)e
+(random)h(fashion.)59 b(This)34 b(means)j(that)g(p)s(erformance,)390
+1224 y(b)s(oth)27 b(for)h(compressing)f(and)g(decompressing,)h(is)f
+(largely)g(determined)g(b)m(y)h(the)g(sp)s(eed)f(at)390
+1327 y(whic)m(h)35 b(y)m(our)h(mac)m(hine)g(can)g(service)g(cac)m(he)i
+(misses.)57 b(Because)37 b(of)g(this,)f(small)f(c)m(hanges)390
+1431 y(to)f(the)f(co)s(de)h(to)f(reduce)g(the)h(miss)d(rate)j(ha)m(v)m
+(e)h(b)s(een)d(observ)m(ed)h(to)h(giv)m(e)g(disprop)s(ortion-)390
+1535 y(ately)i(large)f(p)s(erformance)f(impro)m(v)m(emen)m(ts.)56
+b(I)35 b(imagine)f Fj(bzip2)g Fl(will)e(p)s(erform)i(b)s(est)h(on)390
+1639 y(mac)m(hines)30 b(with)f(v)m(ery)i(large)f(cac)m(hes.)390
+1885 y Ff(CA)-14 b(VEA)k(TS)390 2072 y Fl(I/O)38 b(error)g(messages)h
+(are)f(not)h(as)f(helpful)e(as)i(they)g(could)f(b)s(e.)64
+b Fj(bzip2)37 b Fl(tries)g(hard)g(to)390 2176 y(detect)29
+b(I/O)e(errors)g(and)f(exit)i(cleanly)-8 b(,)27 b(but)g(the)h(details)e
+(of)h(what)h(the)f(problem)f(is)g(some-)390 2280 y(times)k(seem)h
+(rather)f(misleading.)390 2431 y(This)j(man)m(ual)g(page)i(p)s(ertains)
+e(to)i(v)m(ersion)f(1.0)i(of)e Fj(bzip2)p Fl(.)51 b(Compressed)34
+b(data)h(created)390 2534 y(b)m(y)25 b(this)e(v)m(ersion)i(is)e(en)m
+(tirely)h(forw)m(ards)h(and)f(bac)m(kw)m(ards)h(compatible)f(with)f
+(the)i(previous)390 2638 y(public)18 b(releases,)24 b(v)m(ersions)c
+(0.1pl2,)k(0.9.0)e(and)f(0.9.5,)k(but)20 b(with)g(the)h(follo)m(wing)e
+(exception:)390 2742 y(0.9.0)43 b(and)e(ab)s(o)m(v)m(e)h(can)g
+(correctly)f(decompress)g(m)m(ultiple)e(concatenated)k(compressed)390
+2846 y(\014les.)c(0.1pl2)30 b(cannot)g(do)f(this;)f(it)h(will)e(stop)i
+(after)h(decompressing)e(just)g(the)i(\014rst)e(\014le)g(in)390
+2949 y(the)j(stream.)390 3100 y Fj(bzip2recover)20 b
+Fl(uses)k(32-bit)g(in)m(tegers)f(to)i(represen)m(t)f(bit)e(p)s
+(ositions)g(in)g(compressed)i(\014les,)390 3204 y(so)j(it)f(cannot)i
+(handle)d(compressed)i(\014les)f(more)h(than)f(512)i(megab)m(ytes)h
+(long.)39 b(This)25 b(could)390 3308 y(easily)30 b(b)s(e)f(\014xed.)390
+3555 y Ff(A)m(UTHOR)390 3741 y Fl(Julian)f(Sew)m(ard,)i
+Fj(jseward@acm.org)p Fl(.)390 3892 y(The)24 b(ideas)f(em)m(b)s(o)s
+(died)f(in)h Fj(bzip2)f Fl(are)j(due)e(to)i(\(at)g(least\))g(the)f
+(follo)m(wing)e(p)s(eople:)37 b(Mic)m(hael)390 3996 y(Burro)m(ws)48
+b(and)g(Da)m(vid)h(Wheeler)f(\(for)h(the)g(blo)s(c)m(k)f(sorting)g
+(transformation\),)53 b(Da)m(vid)390 4100 y(Wheeler)45
+b(\(again,)50 b(for)45 b(the)g(Hu\013man)g(co)s(der\),)k(P)m(eter)d(F)
+-8 b(en)m(wic)m(k)46 b(\(for)g(the)f(structured)390 4204
+y(co)s(ding)26 b(mo)s(del)g(in)f(the)i(original)e Fj(bzip)p
+Fl(,)i(and)f(man)m(y)h(re\014nemen)m(ts\),)h(and)e(Alistair)f
+(Mo\013at,)390 4307 y(Radford)34 b(Neal)h(and)f(Ian)h(Witten)g(\(for)f
+(the)h(arithmetic)g(co)s(der)f(in)g(the)h(original)d
+Fj(bzip)p Fl(\).)390 4411 y(I)41 b(am)g(m)m(uc)m(h)h(indebted)e(for)h
+(their)f(help,)j(supp)s(ort)c(and)i(advice.)74 b(See)41
+b(the)h(man)m(ual)e(in)390 4515 y(the)28 b(source)g(distribution)23
+b(for)28 b(p)s(oin)m(ters)e(to)j(sources)e(of)h(do)s(cumen)m(tation.)40
+b(Christian)25 b(v)m(on)390 4619 y(Ro)s(ques)31 b(encouraged)h(me)g(to)
+g(lo)s(ok)f(for)h(faster)g(sorting)f(algorithms,)f(so)i(as)g(to)g(sp)s
+(eed)f(up)390 4723 y(compression.)47 b(Bela)34 b(Lubkin)c(encouraged)k
+(me)f(to)g(impro)m(v)m(e)g(the)g(w)m(orst-case)i(compres-)390
+4826 y(sion)25 b(p)s(erformance.)38 b(Man)m(y)26 b(p)s(eople)f(sen)m(t)
+h(patc)m(hes,)h(help)s(ed)d(with)g(p)s(ortabilit)m(y)f(problems,)390
+4930 y(len)m(t)30 b(mac)m(hines,)g(ga)m(v)m(e)j(advice)d(and)g(w)m(ere)
+h(generally)f(helpful.)p eop
+%%Page: 9 10
+9 9 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1927 b Fl(9)150 299 y Fh(3)80 b(Programming)53
+b(with)h Fg(libbzip2)150 568 y Fl(This)29 b(c)m(hapter)i(describ)s(es)d
+(the)j(programming)e(in)m(terface)i(to)g Fj(libbzip2)p
+Fl(.)150 725 y(F)-8 b(or)36 b(general)e(bac)m(kground)h(information,)f
+(particularly)f(ab)s(out)h(memory)h(use)f(and)g(p)s(erformance)g(as-)
+150 834 y(p)s(ects,)d(y)m(ou'd)f(b)s(e)g(w)m(ell)f(advised)g(to)j(read)
+e(Chapter)g(2)g(as)h(w)m(ell.)150 1124 y Fk(3.1)68 b(T)-11
+b(op-lev)l(el)46 b(structure)150 1316 y Fj(libbzip2)33
+b Fl(is)i(a)h(\015exible)e(library)f(for)j(compressing)f(and)g
+(decompressing)f(data)j(in)d(the)i Fj(bzip2)e Fl(data)150
+1426 y(format.)39 b(Although)24 b(pac)m(k)-5 b(aged)26
+b(as)e(a)h(single)e(en)m(tit)m(y)-8 b(,)27 b(it)d(helps)f(to)i(regard)g
+(the)g(library)d(as)i(three)h(separate)150 1535 y(parts:)40
+b(the)31 b(lo)m(w)f(lev)m(el)g(in)m(terface,)h(and)f(the)h(high)e(lev)m
+(el)h(in)m(terface,)h(and)f(some)h(utilit)m(y)d(functions.)150
+1692 y(The)38 b(structure)g(of)g Fj(libbzip2)p Fl('s)e(in)m(terfaces)j
+(is)e(similar)f(to)j(that)g(of)g(Jean-loup)e(Gailly's)g(and)h(Mark)150
+1802 y(Adler's)29 b(excellen)m(t)i Fj(zlib)e Fl(library)-8
+b(.)150 1959 y(All)29 b(externally)g(visible)f(sym)m(b)s(ols)h(ha)m(v)m
+(e)i(names)f(b)s(eginning)e Fj(BZ2_)p Fl(.)39 b(This)29
+b(is)g(new)h(in)f(v)m(ersion)h(1.0.)41 b(The)150 2068
+y(in)m(ten)m(tion)30 b(is)f(to)i(minimise)d(p)s(ollution)f(of)k(the)f
+(namespaces)h(of)g(library)d(clien)m(ts.)150 2321 y Ff(3.1.1)63
+b(Lo)m(w-lev)m(el)39 b(summary)150 2514 y Fl(This)21
+b(in)m(terface)h(pro)m(vides)g(services)g(for)g(compressing)f(and)h
+(decompressing)f(data)i(in)e(memory)-8 b(.)38 b(There's)150
+2623 y(no)43 b(pro)m(vision)e(for)h(dealing)g(with)f(\014les,)k
+(streams)e(or)g(an)m(y)g(other)g(I/O)g(mec)m(hanisms,)i(just)e(straigh)
+m(t)150 2733 y(memory-to-memory)25 b(w)m(ork.)38 b(In)23
+b(fact,)k(this)22 b(part)i(of)f(the)h(library)d(can)j(b)s(e)f(compiled)
+f(without)h(inclusion)150 2843 y(of)31 b Fj(stdio.h)p
+Fl(,)d(whic)m(h)h(ma)m(y)i(b)s(e)f(helpful)d(for)k(em)m(b)s(edded)e
+(applications.)150 2999 y(The)h(lo)m(w-lev)m(el)g(part)g(of)h(the)f
+(library)e(has)i(no)h(global)e(v)-5 b(ariables)29 b(and)h(is)g
+(therefore)g(thread-safe.)150 3156 y(Six)d(routines)g(mak)m(e)j(up)d
+(the)i(lo)m(w)f(lev)m(el)g(in)m(terface:)41 b Fj(BZ2_bzCompressInit)p
+Fl(,)24 b Fj(BZ2_bzCompress)p Fl(,)h(and)150 3266 y Fj
+(BZ2_bzCompressEnd)h Fl(for)k(compression,)f(and)h(a)h(corresp)s
+(onding)d(trio)i Fj(BZ2_bzDecompressInit)p Fl(,)150 3375
+y Fj(BZ2_bzDecompress)37 b Fl(and)j Fj(BZ2_bzDecompressEnd)c
+Fl(for)42 b(decompression.)72 b(The)41 b Fj(*Init)e Fl(functions)150
+3485 y(allo)s(cate)44 b(memory)g(for)f(compression/decompression)f(and)
+h(do)h(other)g(initialisations,)f(whilst)f(the)150 3595
+y Fj(*End)29 b Fl(functions)g(close)i(do)m(wn)f(op)s(erations)f(and)h
+(release)h(memory)-8 b(.)150 3751 y(The)36 b(real)f(w)m(ork)i(is)e
+(done)h(b)m(y)g Fj(BZ2_bzCompress)c Fl(and)j Fj(BZ2_bzDecompress)p
+Fl(.)54 b(These)36 b(compress)g(and)150 3861 y(decompress)30
+b(data)h(from)f(a)h(user-supplied)c(input)i(bu\013er)g(to)i(a)g
+(user-supplied)c(output)j(bu\013er.)40 b(These)150 3971
+y(bu\013ers)32 b(can)i(b)s(e)e(an)m(y)i(size;)g(arbitrary)e(quan)m
+(tities)h(of)g(data)h(are)g(handled)d(b)m(y)i(making)f(rep)s(eated)i
+(calls)150 4080 y(to)f(these)f(functions.)44 b(This)30
+b(is)h(a)h(\015exible)e(mec)m(hanism)i(allo)m(wing)e(a)i(consumer-pull)
+e(st)m(yle)i(of)g(activit)m(y)-8 b(,)150 4190 y(or)30
+b(pro)s(ducer-push,)e(or)i(a)h(mixture)e(of)i(b)s(oth.)150
+4443 y Ff(3.1.2)63 b(High-lev)m(el)41 b(summary)150 4635
+y Fl(This)d(in)m(terface)j(pro)m(vides)e(some)h(handy)f(wrapp)s(ers)f
+(around)h(the)i(lo)m(w-lev)m(el)f(in)m(terface)g(to)h(facilitate)150
+4745 y(reading)26 b(and)g(writing)f Fj(bzip2)g Fl(format)i(\014les)f
+(\()p Fj(.bz2)g Fl(\014les\).)38 b(The)27 b(routines)e(pro)m(vide)h(ho)
+s(oks)h(to)g(facilitate)150 4854 y(reading)43 b(\014les)f(in)h(whic)m
+(h)f(the)i Fj(bzip2)f Fl(data)h(stream)g(is)f(em)m(b)s(edded)f(within)g
+(some)i(larger-scale)g(\014le)150 4964 y(structure,)30
+b(or)h(where)e(there)i(are)g(m)m(ultiple)d Fj(bzip2)h
+Fl(data)i(streams)f(concatenated)j(end-to-end.)150 5121
+y(F)-8 b(or)31 b(reading)f(\014les,)f Fj(BZ2_bzReadOpen)p
+Fl(,)e Fj(BZ2_bzRead)p Fl(,)h Fj(BZ2_bzReadClose)e Fl(and)150
+5230 y Fj(BZ2_bzReadGetUnused)19 b Fl(are)25 b(supplied.)36
+b(F)-8 b(or)25 b(writing)d(\014les,)j Fj(BZ2_bzWriteOpen)p
+Fl(,)d Fj(BZ2_bzWrite)g Fl(and)150 5340 y Fj(BZ2_bzWriteFinish)k
+Fl(are)k(a)m(v)-5 b(ailable.)p eop
+%%Page: 10 11
+10 10 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(10)150 299 y(As)24 b(with)f(the)h(lo)m
+(w-lev)m(el)h(library)-8 b(,)23 b(no)h(global)g(v)-5
+b(ariables)23 b(are)h(used)g(so)g(the)h(library)c(is)j(p)s(er)f(se)h
+(thread-safe.)150 408 y(Ho)m(w)m(ev)m(er,)32 b(if)c(I/O)h(errors)g(o)s
+(ccur)g(whilst)e(reading)i(or)g(writing)e(the)j(underlying)c
+(compressed)j(\014les,)g(y)m(ou)150 518 y(ma)m(y)j(ha)m(v)m(e)g(to)g
+(consult)e Fj(errno)g Fl(to)h(determine)g(the)g(cause)g(of)h(the)f
+(error.)42 b(In)30 b(that)i(case,)h(y)m(ou'd)e(need)g(a)150
+628 y(C)f(library)e(whic)m(h)h(correctly)i(supp)s(orts)d
+Fj(errno)h Fl(in)g(a)i(m)m(ultithreaded)e(en)m(vironmen)m(t.)150
+784 y(T)-8 b(o)56 b(mak)m(e)g(the)g(library)d(a)j(little)e(simpler)f
+(and)i(more)h(p)s(ortable,)61 b Fj(BZ2_bzReadOpen)51
+b Fl(and)k Fj(BZ2_)150 894 y(bzWriteOpen)34 b Fl(require)j(y)m(ou)g(to)
+i(pass)e(them)g(\014le)g(handles)f(\()p Fj(FILE*)p Fl(s\))g(whic)m(h)h
+(ha)m(v)m(e)h(previously)e(b)s(een)150 1004 y(op)s(ened)41
+b(for)g(reading)f(or)h(writing)f(resp)s(ectiv)m(ely)-8
+b(.)73 b(That)41 b(a)m(v)m(oids)h(p)s(ortabilit)m(y)d(problems)g(asso)s
+(ciated)150 1113 y(with)j(\014le)h(op)s(erations)g(and)g(\014le)g
+(attributes,)j(whilst)c(not)i(b)s(eing)e(m)m(uc)m(h)h(of)h(an)g(imp)s
+(osition)c(on)k(the)150 1223 y(programmer.)150 1474 y
+Ff(3.1.3)63 b(Utilit)m(y)40 b(functions)h(summary)150
+1666 y Fl(F)-8 b(or)45 b(v)m(ery)g(simple)d(needs,)48
+b Fj(BZ2_bzBuffToBuffCompres)o(s)38 b Fl(and)44 b Fj
+(BZ2_bzBuffToBuffDecompres)o(s)150 1776 y Fl(are)29 b(pro)m(vided.)38
+b(These)28 b(compress)g(data)h(in)e(memory)h(from)g(one)h(bu\013er)e
+(to)i(another)f(bu\013er)g(in)f(a)h(single)150 1885 y(function)38
+b(call.)67 b(Y)-8 b(ou)40 b(should)d(assess)j(whether)f(these)h
+(functions)d(ful\014ll)f(y)m(our)k(memory-to-memory)150
+1995 y(compression/decompression)26 b(requiremen)m(ts)h(b)s(efore)g(in)
+m(v)m(esting)g(e\013ort)i(in)d(understanding)f(the)j(more)150
+2105 y(general)i(but)g(more)h(complex)f(lo)m(w-lev)m(el)g(in)m
+(terface.)150 2261 y(Y)-8 b(oshiok)j(a)47 b(Tsuneo)e(\()p
+Fj(QWF00133@niftyserve.or.jp)40 b Fl(/)46 b Fj
+(tsuneo-y@is.aist-nara.ac.)o(jp)p Fl(\))40 b(has)150
+2371 y(con)m(tributed)f(some)h(functions)e(to)j(giv)m(e)f(b)s(etter)g
+Fj(zlib)f Fl(compatibilit)m(y)-8 b(.)67 b(These)40 b(functions)e(are)i
+Fj(BZ2_)150 2481 y(bzopen)p Fl(,)e Fj(BZ2_bzread)p Fl(,)f
+Fj(BZ2_bzwrite)p Fl(,)g Fj(BZ2_bzflush)p Fl(,)g Fj(BZ2_bzclose)p
+Fl(,)f Fj(BZ2_bzerror)f Fl(and)i Fj(BZ2_)150 2590 y(bzlibVersion)p
+Fl(.)49 b(Y)-8 b(ou)35 b(ma)m(y)g(\014nd)e(these)i(functions)d(more)j
+(con)m(v)m(enien)m(t)g(for)f(simple)f(\014le)g(reading)h(and)150
+2700 y(writing,)c(than)h(those)h(in)e(the)i(high-lev)m(el)e(in)m
+(terface.)45 b(These)31 b(functions)f(are)i(not)g(\(y)m(et\))h
+(o\016cially)d(part)150 2809 y(of)k(the)g(library)-8
+b(,)33 b(and)g(are)h(minimally)c(do)s(cumen)m(ted)k(here.)51
+b(If)33 b(they)h(break,)h(y)m(ou)f(get)h(to)g(k)m(eep)f(all)f(the)150
+2919 y(pieces.)40 b(I)31 b(hop)s(e)e(to)i(do)s(cumen)m(t)g(them)f(prop)
+s(erly)e(when)h(time)i(p)s(ermits.)150 3076 y(Y)-8 b(oshiok)j(a)27
+b(also)g(con)m(tributed)f(mo)s(di\014cations)f(to)i(allo)m(w)f(the)h
+(library)e(to)i(b)s(e)f(built)f(as)i(a)g(Windo)m(ws)f(DLL.)150
+3362 y Fk(3.2)68 b(Error)45 b(handling)150 3554 y Fl(The)23
+b(library)f(is)h(designed)g(to)i(reco)m(v)m(er)g(cleanly)f(in)e(all)h
+(situations,)h(including)d(the)j(w)m(orst-case)i(situation)150
+3664 y(of)j(decompressing)e(random)g(data.)41 b(I'm)28
+b(not)h(100\045)g(sure)f(that)h(it)f(can)h(alw)m(a)m(ys)g(do)f(this,)g
+(so)g(y)m(ou)h(migh)m(t)150 3774 y(w)m(an)m(t)i(to)g(add)e(a)i(signal)d
+(handler)g(to)j(catc)m(h)h(segmen)m(tation)f(violations)e(during)f
+(decompression)h(if)g(y)m(ou)150 3883 y(are)g(feeling)f(esp)s(ecially)f
+(paranoid.)39 b(I)28 b(w)m(ould)g(b)s(e)g(in)m(terested)h(in)e(hearing)
+h(more)h(ab)s(out)f(the)h(robustness)150 3993 y(of)i(the)f(library)e
+(to)j(corrupted)f(compressed)g(data.)150 4150 y(V)-8
+b(ersion)39 b(1.0)h(is)f(m)m(uc)m(h)g(more)h(robust)e(in)g(this)g(resp)
+s(ect)i(than)f(0.9.0)i(or)e(0.9.5.)70 b(In)m(v)m(estigations)39
+b(with)150 4259 y(Chec)m(k)m(er)21 b(\(a)g(to)s(ol)g(for)f(detecting)h
+(problems)d(with)h(memory)h(managemen)m(t,)k(similar)18
+b(to)j(Purify\))e(indicate)150 4369 y(that,)40 b(at)e(least)f(for)g
+(the)h(few)e(\014les)h(I)g(tested,)j(all)c(single-bit)f(errors)i(in)e
+(the)j(decompressed)f(data)h(are)150 4478 y(caugh)m(t)c(prop)s(erly)-8
+b(,)31 b(with)g(no)i(segmen)m(tation)h(faults,)e(no)g(reads)h(of)g
+(uninitialised)27 b(data)34 b(and)e(no)g(out)h(of)150
+4588 y(range)f(reads)g(or)f(writes.)44 b(So)32 b(it's)f(certainly)g(m)m
+(uc)m(h)h(impro)m(v)m(ed,)g(although)f(I)g(w)m(ouldn't)g(claim)g(it)g
+(to)i(b)s(e)150 4698 y(totally)d(b)s(om)m(bpro)s(of.)150
+4854 y(The)25 b(\014le)g Fj(bzlib.h)f Fl(con)m(tains)i(all)f
+(de\014nitions)e(needed)i(to)i(use)e(the)h(library)-8
+b(.)37 b(In)26 b(particular,)f(y)m(ou)h(should)150 4964
+y(de\014nitely)i(not)j(include)d Fj(bzlib_private.h)p
+Fl(.)150 5121 y(In)39 b Fj(bzlib.h)p Fl(,)h(the)g(v)-5
+b(arious)39 b(return)f(v)-5 b(alues)39 b(are)h(de\014ned.)68
+b(The)39 b(follo)m(wing)f(list)h(is)f(not)i(in)m(tended)f(as)150
+5230 y(an)c(exhaustiv)m(e)h(description)d(of)i(the)h(circumstances)f
+(in)f(whic)m(h)g(a)i(giv)m(en)f(v)-5 b(alue)35 b(ma)m(y)h(b)s(e)e
+(returned)h({)150 5340 y(those)h(descriptions)d(are)j(giv)m(en)f
+(later.)56 b(Rather,)37 b(it)d(is)h(in)m(tended)f(to)i(con)m(v)m(ey)h
+(the)e(rough)g(meaning)g(of)p eop
+%%Page: 11 12
+11 11 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(11)150 299 y(eac)m(h)38
+b(return)d(v)-5 b(alue.)59 b(The)36 b(\014rst)g(\014v)m(e)g(actions)h
+(are)g(normal)f(and)f(not)i(in)m(tended)f(to)h(denote)g(an)f(error)150
+408 y(situation.)150 592 y Fj(BZ_OK)180 b Fl(The)30 b(requested)g
+(action)h(w)m(as)g(completed)f(successfully)-8 b(.)150
+756 y Fj(BZ_RUN_OK)150 866 y(BZ_FLUSH_OK)150 975 y(BZ_FINISH_OK)630
+1085 y Fl(In)24 b Fj(BZ2_bzCompress)p Fl(,)e(the)i(requested)g
+(\015ush/\014nish/nothing-sp)s(ecial)c(action)k(w)m(as)h(com-)630
+1194 y(pleted)30 b(successfully)-8 b(.)150 1358 y Fj(BZ_STREAM_END)630
+1468 y Fl(Compression)38 b(of)j(data)f(w)m(as)h(completed,)h(or)f(the)f
+(logical)f(stream)i(end)e(w)m(as)i(detected)630 1577
+y(during)28 b(decompression.)150 1761 y(The)i(follo)m(wing)f(return)g
+(v)-5 b(alues)30 b(indicate)f(an)h(error)g(of)h(some)g(kind.)150
+1945 y Fj(BZ_CONFIG_ERROR)630 2055 y Fl(Indicates)48
+b(that)h(the)g(library)e(has)h(b)s(een)g(improp)s(erly)d(compiled)j(on)
+g(y)m(our)h(platform)630 2164 y({)j(a)g(ma)5 b(jor)51
+b(con\014guration)g(error.)104 b(Sp)s(eci\014cally)-8
+b(,)55 b(it)c(means)g(that)h Fj(sizeof\(char\))p Fl(,)630
+2274 y Fj(sizeof\(short\))44 b Fl(and)i Fj(sizeof\(int\))f
+Fl(are)j(not)f(1,)52 b(2)c(and)f(4)h(resp)s(ectiv)m(ely)-8
+b(,)51 b(as)d(they)630 2384 y(should)27 b(b)s(e.)40 b(Note)30
+b(that)g(the)f(library)e(should)g(still)g(w)m(ork)i(prop)s(erly)e(on)i
+(64-bit)g(platforms)630 2493 y(whic)m(h)d(follo)m(w)h(the)g(LP64)h
+(programming)e(mo)s(del)h({)g(that)h(is,)g(where)e Fj(sizeof\(long\))f
+Fl(and)630 2603 y Fj(sizeof\(void*\))e Fl(are)k(8.)40
+b(Under)25 b(LP64,)j Fj(sizeof\(int\))c Fl(is)h(still)f(4,)k(so)f
+Fj(libbzip2)p Fl(,)e(whic)m(h)630 2712 y(do)s(esn't)30
+b(use)g(the)h Fj(long)e Fl(t)m(yp)s(e,)i(is)e(OK.)150
+2876 y Fj(BZ_SEQUENCE_ERROR)630 2986 y Fl(When)43 b(using)f(the)i
+(library)-8 b(,)45 b(it)e(is)f(imp)s(ortan)m(t)h(to)h(call)e(the)i
+(functions)e(in)g(the)i(correct)630 3095 y(sequence)28
+b(and)f(with)f(data)j(structures)e(\(bu\013ers)f(etc\))j(in)e(the)g
+(correct)i(states.)41 b Fj(libbzip2)630 3205 y Fl(c)m(hec)m(ks)26
+b(as)e(m)m(uc)m(h)h(as)f(it)g(can)g(to)h(ensure)f(this)f(is)g(happ)s
+(ening,)h(and)f(returns)g Fj(BZ_SEQUENCE_)630 3314 y(ERROR)36
+b Fl(if)h(not.)62 b(Co)s(de)37 b(whic)m(h)g(complies)f(precisely)g
+(with)h(the)g(function)g(seman)m(tics,)j(as)630 3424
+y(detailed)d(b)s(elo)m(w,)i(should)d(nev)m(er)i(receiv)m(e)h(this)d(v)
+-5 b(alue;)41 b(suc)m(h)d(an)g(ev)m(en)m(t)h(denotes)f(buggy)630
+3534 y(co)s(de)31 b(whic)m(h)e(y)m(ou)h(should)f(in)m(v)m(estigate.)150
+3697 y Fj(BZ_PARAM_ERROR)630 3807 y Fl(Returned)43 b(when)f(a)i
+(parameter)g(to)h(a)f(function)e(call)h(is)f(out)i(of)g(range)g(or)g
+(otherwise)630 3917 y(manifestly)34 b(incorrect.)57 b(As)36
+b(with)e Fj(BZ_SEQUENCE_ERROR)p Fl(,)f(this)i(denotes)h(a)g(bug)f(in)g
+(the)630 4026 y(clien)m(t)23 b(co)s(de.)39 b(The)22 b(distinction)f(b)s
+(et)m(w)m(een)j Fj(BZ_PARAM_ERROR)c Fl(and)j Fj(BZ_SEQUENCE_ERROR)630
+4136 y Fl(is)29 b(a)i(bit)f(hazy)-8 b(,)31 b(but)f(still)e(w)m(orth)i
+(making.)150 4300 y Fj(BZ_MEM_ERROR)630 4409 y Fl(Returned)g(when)f(a)i
+(request)f(to)i(allo)s(cate)f(memory)f(failed.)40 b(Note)31
+b(that)g(the)g(quan)m(tit)m(y)g(of)630 4519 y(memory)21
+b(needed)g(to)i(decompress)e(a)g(stream)h(cannot)g(b)s(e)f(determined)f
+(un)m(til)g(the)h(stream's)630 4628 y(header)29 b(has)g(b)s(een)g
+(read.)40 b(So)29 b Fj(BZ2_bzDecompress)c Fl(and)j Fj(BZ2_bzRead)f
+Fl(ma)m(y)j(return)e Fj(BZ_)630 4738 y(MEM_ERROR)d Fl(ev)m(en)k(though)
+e(some)h(of)g(the)g(compressed)g(data)g(has)g(b)s(een)f(read.)39
+b(The)28 b(same)630 4847 y(is)38 b(not)i(true)f(for)g(compression;)k
+(once)d Fj(BZ2_bzCompressInit)34 b Fl(or)39 b Fj(BZ2_bzWriteOpen)630
+4957 y Fl(ha)m(v)m(e)32 b(successfully)c(completed,)j
+Fj(BZ_MEM_ERROR)c Fl(cannot)k(o)s(ccur.)150 5121 y Fj(BZ_DATA_ERROR)630
+5230 y Fl(Returned)h(when)g(a)h(data)g(in)m(tegrit)m(y)g(error)g(is)e
+(detected)k(during)30 b(decompression.)47 b(Most)630
+5340 y(imp)s(ortan)m(tly)-8 b(,)31 b(this)f(means)i(when)f(stored)g
+(and)g(computed)h(CR)m(Cs)f(for)g(the)h(data)g(do)g(not)p
+eop
+%%Page: 12 13
+12 12 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(12)630 299 y(matc)m(h.)41
+b(This)28 b(v)-5 b(alue)29 b(is)f(also)i(returned)e(up)s(on)g
+(detection)i(of)g(an)m(y)g(other)f(anomaly)h(in)e(the)630
+408 y(compressed)i(data.)150 560 y Fj(BZ_DATA_ERROR_MAGIC)630
+670 y Fl(As)k(a)g(sp)s(ecial)f(case)i(of)f Fj(BZ_DATA_ERROR)p
+Fl(,)d(it)i(is)g(sometimes)h(useful)e(to)j(kno)m(w)f(when)f(the)630
+779 y(compressed)d(stream)h(do)s(es)f(not)g(start)h(with)e(the)i
+(correct)h(magic)e(b)m(ytes)h(\()p Fj('B')f('Z')f('h')p
+Fl(\).)150 931 y Fj(BZ_IO_ERROR)630 1040 y Fl(Returned)k(b)m(y)h
+Fj(BZ2_bzRead)d Fl(and)i Fj(BZ2_bzWrite)e Fl(when)i(there)h(is)f(an)g
+(error)h(reading)f(or)630 1150 y(writing)28 b(in)h(the)h(compressed)g
+(\014le,)f(and)h(b)m(y)g Fj(BZ2_bzReadOpen)c Fl(and)j
+Fj(BZ2_bzWriteOpen)630 1259 y Fl(for)i(attempts)i(to)f(use)f(a)h
+(\014le)e(for)i(whic)m(h)e(the)h(error)g(indicator)g(\(viz,)g
+Fj(ferror\(f\))p Fl(\))f(is)g(set.)630 1369 y(On)h(receipt)g(of)h
+Fj(BZ_IO_ERROR)p Fl(,)e(the)h(caller)h(should)d(consult)i
+Fj(errno)g Fl(and/or)g Fj(perror)f Fl(to)630 1479 y(acquire)g(op)s
+(erating-system)g(sp)s(eci\014c)f(information)g(ab)s(out)h(the)h
+(problem.)150 1630 y Fj(BZ_UNEXPECTED_EOF)630 1740 y
+Fl(Returned)36 b(b)m(y)g Fj(BZ2_bzRead)e Fl(when)i(the)h(compressed)f
+(\014le)g(\014nishes)e(b)s(efore)j(the)f(logical)630
+1849 y(end)30 b(of)g(stream)h(is)e(detected.)150 2001
+y Fj(BZ_OUTBUFF_FULL)630 2110 y Fl(Returned)g(b)m(y)i
+Fj(BZ2_bzBuffToBuffCompres)o(s)24 b Fl(and)30 b Fj
+(BZ2_bzBuffToBuffDecompres)o(s)630 2220 y Fl(to)h(indicate)f(that)h
+(the)f(output)g(data)h(will)d(not)i(\014t)h(in)m(to)f(the)h(output)f
+(bu\013er)f(pro)m(vided.)150 2492 y Fk(3.3)68 b(Lo)l(w-lev)l(el)47
+b(in)l(terface)150 2766 y Ff(3.3.1)63 b Fe(BZ2_bzCompressInit)390
+2953 y Fj(typedef)533 3057 y(struct)46 b({)676 3161 y(char)h(*next_in;)
+676 3264 y(unsigned)f(int)h(avail_in;)676 3368 y(unsigned)f(int)h
+(total_in_lo32;)676 3472 y(unsigned)f(int)h(total_in_hi32;)676
+3680 y(char)g(*next_out;)676 3783 y(unsigned)f(int)h(avail_out;)676
+3887 y(unsigned)f(int)h(total_out_lo32;)676 3991 y(unsigned)f(int)h
+(total_out_hi32;)676 4198 y(void)g(*state;)676 4406 y(void)g
+(*\(*bzalloc\)\(void)c(*,int,int\);)676 4510 y(void)k
+(\(*bzfree\)\(void)d(*,void)i(*\);)676 4614 y(void)h(*opaque;)533
+4717 y(})533 4821 y(bz_stream;)390 5029 y(int)g(BZ2_bzCompressInit)c
+(\()k(bz_stream)e(*strm,)1583 5132 y(int)i(blockSize100k,)1583
+5236 y(int)g(verbosity,)1583 5340 y(int)g(workFactor)e(\);)p
+eop
+%%Page: 13 14
+13 13 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(13)150 456 y(Prepares)32
+b(for)h(compression.)47 b(The)32 b Fj(bz_stream)e Fl(structure)j(holds)
+e(all)h(data)h(p)s(ertaining)e(to)i(the)g(com-)150 565
+y(pression)i(activit)m(y)-8 b(.)62 b(A)37 b Fj(bz_stream)e
+Fl(structure)h(should)f(b)s(e)i(allo)s(cated)g(and)f(initialised)e
+(prior)h(to)j(the)150 675 y(call.)67 b(The)39 b(\014elds)e(of)j
+Fj(bz_stream)d Fl(comprise)h(the)i(en)m(tiret)m(y)g(of)f(the)h
+(user-visible)c(data.)68 b Fj(state)38 b Fl(is)h(a)150
+784 y(p)s(oin)m(ter)29 b(to)i(the)g(priv)-5 b(ate)30
+b(data)h(structures)f(required)e(for)i(compression.)150
+941 y(Custom)37 b(memory)g(allo)s(cators)g(are)h(supp)s(orted,)f(via)g
+(\014elds)f Fj(bzalloc)p Fl(,)h Fj(bzfree)p Fl(,)g(and)g
+Fj(opaque)p Fl(.)59 b(The)150 1051 y(v)-5 b(alue)32 b
+Fj(opaque)e Fl(is)i(passed)f(to)i(as)g(the)f(\014rst)g(argumen)m(t)h
+(to)g(all)e(calls)g(to)i Fj(bzalloc)d Fl(and)i Fj(bzfree)p
+Fl(,)f(but)h(is)150 1160 y(otherwise)d(ignored)g(b)m(y)h(the)g(library)
+-8 b(.)38 b(The)29 b(call)h Fj(bzalloc)e(\()i(opaque,)e(n,)i(m)g(\))g
+Fl(is)e(exp)s(ected)j(to)f(return)150 1270 y(a)g(p)s(oin)m(ter)e
+Fj(p)h Fl(to)h Fj(n)g(*)g(m)f Fl(b)m(ytes)h(of)g(memory)-8
+b(,)30 b(and)e Fj(bzfree)h(\()h(opaque,)f(p)h(\))f Fl(should)e(free)i
+(that)h(memory)-8 b(.)150 1427 y(If)33 b(y)m(ou)g(don't)h(w)m(an)m(t)g
+(to)g(use)f(a)g(custom)h(memory)f(allo)s(cator,)h(set)g
+Fj(bzalloc)p Fl(,)e Fj(bzfree)g Fl(and)h Fj(opaque)e
+Fl(to)150 1537 y Fj(NULL)p Fl(,)e(and)h(the)h(library)d(will)f(then)k
+(use)f(the)g(standard)g Fj(malloc)p Fl(/)p Fj(free)e
+Fl(routines.)150 1693 y(Before)39 b(calling)d Fj(BZ2_bzCompressInit)p
+Fl(,)f(\014elds)h Fj(bzalloc)p Fl(,)h Fj(bzfree)f Fl(and)h
+Fj(opaque)f Fl(should)g(b)s(e)h(\014lled)150 1803 y(appropriately)-8
+b(,)35 b(as)h(just)f(describ)s(ed.)53 b(Up)s(on)34 b(return,)i(the)g
+(in)m(ternal)e(state)i(will)d(ha)m(v)m(e)j(b)s(een)f(allo)s(cated)150
+1913 y(and)43 b(initialised,)g(and)g Fj(total_in_lo32)p
+Fl(,)h Fj(total_in_hi32)p Fl(,)f Fj(total_out_lo32)d
+Fl(and)j Fj(total_out_)150 2022 y(hi32)37 b Fl(will)f(ha)m(v)m(e)j(b)s
+(een)f(set)h(to)g(zero.)65 b(These)38 b(four)g(\014elds)e(are)j(used)f
+(b)m(y)g(the)g(library)e(to)j(inform)e(the)150 2132 y(caller)j(of)g
+(the)h(total)g(amoun)m(t)g(of)g(data)g(passed)f(in)m(to)g(and)g(out)g
+(of)h(the)g(library)-8 b(,)41 b(resp)s(ectiv)m(ely)-8
+b(.)70 b(Y)-8 b(ou)150 2241 y(should)34 b(not)j(try)f(to)h(c)m(hange)g
+(them.)58 b(As)36 b(of)h(v)m(ersion)f(1.0,)j(64-bit)d(coun)m(ts)h(are)f
+(main)m(tained,)h(ev)m(en)g(on)150 2351 y(32-bit)i(platforms,)h(using)d
+(the)i Fj(_hi32)e Fl(\014elds)g(to)j(store)f(the)g(upp)s(er)d(32)k
+(bits)d(of)i(the)g(coun)m(t.)66 b(So,)41 b(for)150 2460
+y(example,)30 b(the)h(total)g(amoun)m(t)g(of)f(data)h(in)f(is)f
+Fj(\(total_in_hi32)d(<<)k(32\))g(+)g(total_in_lo32)p
+Fl(.)150 2617 y(P)m(arameter)g Fj(blockSize100k)25 b
+Fl(sp)s(eci\014es)i(the)h(blo)s(c)m(k)g(size)h(to)g(b)s(e)f(used)f(for)
+h(compression.)40 b(It)28 b(should)f(b)s(e)150 2727 y(a)k(v)-5
+b(alue)30 b(b)s(et)m(w)m(een)i(1)f(and)f(9)h(inclusiv)m(e,)e(and)h(the)
+h(actual)g(blo)s(c)m(k)f(size)g(used)g(is)g(100000)j(x)e(this)e
+(\014gure.)42 b(9)150 2836 y(giv)m(es)31 b(the)f(b)s(est)g(compression)
+g(but)f(tak)m(es)j(most)f(memory)-8 b(.)150 2993 y(P)m(arameter)29
+b Fj(verbosity)c Fl(should)h(b)s(e)h(set)i(to)f(a)h(n)m(um)m(b)s(er)d
+(b)s(et)m(w)m(een)j(0)f(and)f(4)h(inclusiv)m(e.)38 b(0)28
+b(is)f(silen)m(t,)h(and)150 3103 y(greater)j(n)m(um)m(b)s(ers)c(giv)m
+(e)j(increasingly)d(v)m(erb)s(ose)j(monitoring/debugging)d(output.)40
+b(If)29 b(the)g(library)e(has)150 3212 y(b)s(een)j(compiled)e(with)i
+Fj(-DBZ_NO_STDIO)p Fl(,)d(no)j(suc)m(h)g(output)g(will)e(app)s(ear)h
+(for)h(an)m(y)h(v)m(erb)s(osit)m(y)f(setting.)150 3369
+y(P)m(arameter)35 b Fj(workFactor)d Fl(con)m(trols)i(ho)m(w)g(the)g
+(compression)f(phase)h(b)s(eha)m(v)m(es)g(when)f(presen)m(ted)h(with)
+150 3479 y(w)m(orst)40 b(case,)j(highly)37 b(rep)s(etitiv)m(e,)k(input)
+d(data.)68 b(If)39 b(compression)g(runs)e(in)m(to)j(di\016culties)d
+(caused)i(b)m(y)150 3588 y(rep)s(etitiv)m(e)34 b(data,)j(the)e(library)
+d(switc)m(hes)j(from)f(the)h(standard)f(sorting)g(algorithm)g(to)i(a)f
+(fallbac)m(k)f(al-)150 3698 y(gorithm.)47 b(The)32 b(fallbac)m(k)g(is)g
+(slo)m(w)m(er)g(than)h(the)f(standard)g(algorithm)g(b)m(y)g(p)s(erhaps)
+f(a)i(factor)h(of)e(three,)150 3808 y(but)e(alw)m(a)m(ys)h(b)s(eha)m(v)
+m(es)f(reasonably)-8 b(,)31 b(no)f(matter)h(ho)m(w)g(bad)f(the)g
+(input.)150 3965 y(Lo)m(w)m(er)25 b(v)-5 b(alues)24 b(of)h
+Fj(workFactor)d Fl(reduce)i(the)h(amoun)m(t)g(of)g(e\013ort)g(the)g
+(standard)f(algorithm)f(will)f(exp)s(end)150 4074 y(b)s(efore)j
+(resorting)h(to)g(the)g(fallbac)m(k.)39 b(Y)-8 b(ou)27
+b(should)c(set)k(this)e(parameter)h(carefully;)g(to)s(o)h(lo)m(w,)g
+(and)e(man)m(y)150 4184 y(inputs)32 b(will)f(b)s(e)i(handled)f(b)m(y)i
+(the)g(fallbac)m(k)g(algorithm)f(and)g(so)h(compress)g(rather)g(slo)m
+(wly)-8 b(,)34 b(to)s(o)h(high,)150 4293 y(and)24 b(y)m(our)h(a)m(v)m
+(erage-to-w)m(orst)30 b(case)c(compression)e(times)h(can)g(b)s(ecome)g
+(v)m(ery)h(large.)39 b(The)24 b(default)g(v)-5 b(alue)150
+4403 y(of)31 b(30)g(giv)m(es)f(reasonable)h(b)s(eha)m(viour)e(o)m(v)m
+(er)i(a)g(wide)e(range)i(of)f(circumstances.)150 4560
+y(Allo)m(w)m(able)h(v)-5 b(alues)31 b(range)i(from)e(0)i(to)f(250)h
+(inclusiv)m(e.)44 b(0)32 b(is)f(a)h(sp)s(ecial)f(case,)i(equiv)-5
+b(alen)m(t)32 b(to)g(using)f(the)150 4669 y(default)f(v)-5
+b(alue)29 b(of)i(30.)150 4826 y(Note)38 b(that)f(the)g(compressed)f
+(output)g(generated)h(is)f(the)g(same)h(regardless)f(of)h(whether)f(or)
+g(not)h(the)150 4936 y(fallbac)m(k)30 b(algorithm)f(is)h(used.)150
+5093 y(Be)23 b(a)m(w)m(are)h(also)f(that)g(this)f(parameter)h(ma)m(y)g
+(disapp)s(ear)e(en)m(tirely)h(in)f(future)h(v)m(ersions)g(of)h(the)g
+(library)-8 b(.)36 b(In)150 5202 y(principle)20 b(it)j(should)e(b)s(e)h
+(p)s(ossible)f(to)j(devise)f(a)g(go)s(o)s(d)g(w)m(a)m(y)i(to)f
+(automatically)f(c)m(ho)s(ose)h(whic)m(h)e(algorithm)150
+5312 y(to)31 b(use.)41 b(Suc)m(h)29 b(a)i(mec)m(hanism)f(w)m(ould)f
+(render)g(the)i(parameter)g(obsolete.)p eop
+%%Page: 14 15
+14 14 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(14)150 299 y(P)m(ossible)29
+b(return)h(v)-5 b(alues:)572 450 y Fj(BZ_CONFIG_ERROR)663
+554 y Fl(if)29 b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572
+657 y Fj(BZ_PARAM_ERROR)663 761 y Fl(if)g Fj(strm)g Fl(is)h
+Fj(NULL)663 865 y Fl(or)g Fj(blockSize)e(<)i Fl(1)h(or)f
+Fj(blockSize)e(>)i Fl(9)663 969 y(or)g Fj(verbosity)e(<)i
+Fl(0)h(or)f Fj(verbosity)e(>)i Fl(4)663 1073 y(or)g Fj(workFactor)e(<)i
+Fl(0)g(or)h Fj(workFactor)c(>)j Fl(250)572 1176 y Fj(BZ_MEM_ERROR)663
+1280 y Fl(if)f(not)i(enough)f(memory)g(is)f(a)m(v)-5
+b(ailable)572 1384 y Fj(BZ_OK)663 1488 y Fl(otherwise)150
+1645 y(Allo)m(w)m(able)30 b(next)g(actions:)572 1796
+y Fj(BZ2_bzCompress)663 1899 y Fl(if)f Fj(BZ_OK)g Fl(is)g(returned)572
+2003 y(no)h(sp)s(eci\014c)f(action)i(needed)f(in)f(case)i(of)g(error)
+150 2255 y Ff(3.3.2)63 b Fe(BZ2_bzCompress)533 2441 y
+Fj(int)47 b(BZ2_bzCompress)d(\()j(bz_stream)f(*strm,)g(int)h(action)f
+(\);)150 2598 y Fl(Pro)m(vides)28 b(more)g(input)f(and/or)h(output)g
+(bu\013er)g(space)h(for)f(the)h(library)-8 b(.)38 b(The)28
+b(caller)g(main)m(tains)f(input)150 2708 y(and)j(output)g(bu\013ers,)f
+(and)h(calls)g Fj(BZ2_bzCompress)c Fl(to)31 b(transfer)f(data)h(b)s(et)
+m(w)m(een)g(them.)150 2865 y(Before)j(eac)m(h)g(call)e(to)i
+Fj(BZ2_bzCompress)p Fl(,)c Fj(next_in)h Fl(should)g(p)s(oin)m(t)h(at)h
+(the)g(data)h(to)g(b)s(e)e(compressed,)150 2974 y(and)41
+b Fj(avail_in)f Fl(should)g(indicate)h(ho)m(w)h(man)m(y)f(b)m(ytes)i
+(the)f(library)d(ma)m(y)k(read.)75 b Fj(BZ2_bzCompress)150
+3084 y Fl(up)s(dates)29 b Fj(next_in)p Fl(,)g Fj(avail_in)f
+Fl(and)i Fj(total_in)e Fl(to)j(re\015ect)g(the)g(n)m(um)m(b)s(er)e(of)h
+(b)m(ytes)h(it)f(has)g(read.)150 3241 y(Similarly)-8
+b(,)27 b Fj(next_out)h Fl(should)g(p)s(oin)m(t)h(to)i(a)f(bu\013er)f
+(in)g(whic)m(h)g(the)h(compressed)g(data)h(is)e(to)i(b)s(e)e(placed,)
+150 3350 y(with)i Fj(avail_out)f Fl(indicating)h(ho)m(w)h(m)m(uc)m(h)h
+(output)f(space)h(is)f(a)m(v)-5 b(ailable.)46 b Fj(BZ2_bzCompress)29
+b Fl(up)s(dates)150 3460 y Fj(next_out)p Fl(,)f Fj(avail_out)g
+Fl(and)i Fj(total_out)e Fl(to)j(re\015ect)g(the)f(n)m(um)m(b)s(er)g(of)
+g(b)m(ytes)h(output.)150 3617 y(Y)-8 b(ou)40 b(ma)m(y)g(pro)m(vide)e
+(and)h(remo)m(v)m(e)i(as)f(little)e(or)h(as)h(m)m(uc)m(h)f(data)h(as)g
+(y)m(ou)f(lik)m(e)g(on)g(eac)m(h)i(call)e(of)g Fj(BZ2_)150
+3726 y(bzCompress)p Fl(.)48 b(In)33 b(the)h(limit,)f(it)h(is)f
+(acceptable)h(to)h(supply)c(and)j(remo)m(v)m(e)h(data)g(one)f(b)m(yte)g
+(at)h(a)f(time,)150 3836 y(although)28 b(this)f(w)m(ould)g(b)s(e)h
+(terribly)e(ine\016cien)m(t.)39 b(Y)-8 b(ou)29 b(should)e(alw)m(a)m(ys)
+h(ensure)g(that)h(at)g(least)g(one)f(b)m(yte)150 3946
+y(of)j(output)f(space)g(is)g(a)m(v)-5 b(ailable)30 b(at)h(eac)m(h)g
+(call.)150 4102 y(A)38 b(second)h(purp)s(ose)d(of)j Fj(BZ2_bzCompress)
+34 b Fl(is)j(to)i(request)f(a)h(c)m(hange)g(of)g(mo)s(de)e(of)i(the)f
+(compressed)150 4212 y(stream.)150 4369 y(Conceptually)-8
+b(,)24 b(a)g(compressed)g(stream)g(can)f(b)s(e)g(in)g(one)h(of)f(four)g
+(states:)39 b(IDLE,)24 b(R)m(UNNING,)h(FLUSH-)150 4478
+y(ING)37 b(and)g(FINISHING.)g(Before)i(initialisation)33
+b(\()p Fj(BZ2_bzCompressInit)p Fl(\))g(and)j(after)i(termination)150
+4588 y(\()p Fj(BZ2_bzCompressEnd)p Fl(\),)27 b(a)j(stream)h(is)f
+(regarded)g(as)g(IDLE.)150 4745 y(Up)s(on)35 b(initialisation)e(\()p
+Fj(BZ2_bzCompressInit)p Fl(\),)h(the)i(stream)h(is)e(placed)h(in)e(the)
+j(R)m(UNNING)g(state.)150 4854 y(Subsequen)m(t)j(calls)g(to)i
+Fj(BZ2_bzCompress)37 b Fl(should)j(pass)g Fj(BZ_RUN)g
+Fl(as)h(the)g(requested)h(action;)47 b(other)150 4964
+y(actions)31 b(are)f(illegal)f(and)h(will)d(result)j(in)f
+Fj(BZ_SEQUENCE_ERROR)p Fl(.)150 5121 y(A)m(t)38 b(some)f(p)s(oin)m(t,)h
+(the)f(calling)e(program)i(will)d(ha)m(v)m(e)k(pro)m(vided)e(all)f(the)
+i(input)e(data)j(it)e(w)m(an)m(ts)i(to.)61 b(It)150 5230
+y(will)28 b(then)h(w)m(an)m(t)i(to)g(\014nish)d(up)h({)i(in)d
+(e\013ect,)k(asking)e(the)g(library)e(to)j(pro)s(cess)f(an)m(y)g(data)h
+(it)f(migh)m(t)g(ha)m(v)m(e)150 5340 y(bu\013ered)25
+b(in)m(ternally)-8 b(.)38 b(In)25 b(this)g(state,)k Fj(BZ2_bzCompress)
+22 b Fl(will)i(no)i(longer)g(attempt)h(to)g(read)f(data)h(from)p
+eop
+%%Page: 15 16
+15 15 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(15)150 299 y Fj(next_in)p
+Fl(,)33 b(but)g(it)h(will)d(w)m(an)m(t)k(to)g(write)e(data)h(to)h
+Fj(next_out)p Fl(.)49 b(Because)36 b(the)e(output)f(bu\013er)g
+(supplied)150 408 y(b)m(y)e(the)h(user)e(can)i(b)s(e)f(arbitrarily)d
+(small,)j(the)g(\014nishing-up)d(op)s(eration)i(cannot)i(necessarily)e
+(b)s(e)h(done)150 518 y(with)e(a)i(single)e(call)h(of)g
+Fj(BZ2_bzCompress)p Fl(.)150 675 y(Instead,)47 b(the)d(calling)f
+(program)g(passes)h Fj(BZ_FINISH)d Fl(as)j(an)g(action)g(to)h
+Fj(BZ2_bzCompress)p Fl(.)77 b(This)150 784 y(c)m(hanges)30
+b(the)f(stream's)g(state)h(to)f(FINISHING.)g(An)m(y)g(remaining)e
+(input)g(\(ie,)i Fj(next_in[0)f(..)i(avail_)150 894 y(in-1])p
+Fl(\))36 b(is)f(compressed)i(and)f(transferred)g(to)h(the)g(output)g
+(bu\013er.)58 b(T)-8 b(o)38 b(do)e(this,)i Fj(BZ2_bzCompress)150
+1004 y Fl(m)m(ust)h(b)s(e)f(called)g(rep)s(eatedly)h(un)m(til)e(all)h
+(the)h(output)f(has)h(b)s(een)f(consumed.)66 b(A)m(t)40
+b(that)g(p)s(oin)m(t,)g Fj(BZ2_)150 1113 y(bzCompress)h
+Fl(returns)h Fj(BZ_STREAM_END)p Fl(,)i(and)f(the)h(stream's)g(state)h
+(is)d(set)j(bac)m(k)f(to)g(IDLE.)g Fj(BZ2_)150 1223 y(bzCompressEnd)27
+b Fl(should)h(then)i(b)s(e)g(called.)150 1380 y(Just)25
+b(to)i(mak)m(e)g(sure)e(the)i(calling)d(program)i(do)s(es)g(not)g(c)m
+(heat,)i(the)f(library)c(mak)m(es)k(a)f(note)h(of)f Fj(avail_in)150
+1489 y Fl(at)g(the)g(time)f(of)g(the)g(\014rst)g(call)g(to)h
+Fj(BZ2_bzCompress)21 b Fl(whic)m(h)j(has)h Fj(BZ_FINISH)e
+Fl(as)i(an)h(action)f(\(ie,)i(at)f(the)150 1599 y(time)d(the)h(program)
+g(has)f(announced)g(its)h(in)m(ten)m(tion)f(to)h(not)g(supply)e(an)m(y)
+i(more)g(input\).)37 b(By)24 b(comparing)150 1708 y(this)k(v)-5
+b(alue)28 b(with)g(that)h(of)h Fj(avail_in)c Fl(o)m(v)m(er)k(subsequen)
+m(t)f(calls)f(to)h Fj(BZ2_bzCompress)p Fl(,)d(the)j(library)e(can)150
+1818 y(detect)33 b(an)m(y)e(attempts)i(to)f(slip)d(in)h(more)h(data)h
+(to)h(compress.)43 b(An)m(y)31 b(calls)g(for)g(whic)m(h)f(this)g(is)h
+(detected)150 1928 y(will)j(return)h Fj(BZ_SEQUENCE_ERROR)p
+Fl(.)55 b(This)34 b(indicates)i(a)h(programming)e(mistak)m(e)i(whic)m
+(h)e(should)g(b)s(e)150 2037 y(corrected.)150 2194 y(Instead)i(of)g
+(asking)f(to)h(\014nish,)f(the)h(calling)f(program)g(ma)m(y)h(ask)g
+Fj(BZ2_bzCompress)c Fl(to)38 b(tak)m(e)g(all)e(the)150
+2304 y(remaining)j(input,)i(compress)f(it)g(and)g(terminate)h(the)g
+(curren)m(t)f(\(Burro)m(ws-Wheeler\))h(compression)150
+2413 y(blo)s(c)m(k.)e(This)26 b(could)h(b)s(e)g(useful)f(for)h(error)h
+(con)m(trol)g(purp)s(oses.)38 b(The)27 b(mec)m(hanism)g(is)g(analogous)
+h(to)g(that)150 2523 y(for)35 b(\014nishing:)46 b(call)35
+b Fj(BZ2_bzCompress)c Fl(with)i(an)i(action)g(of)g Fj(BZ_FLUSH)p
+Fl(,)g(remo)m(v)m(e)h(output)f(data,)i(and)150 2632 y(p)s(ersist)h
+(with)g(the)i Fj(BZ_FLUSH)e Fl(action)i(un)m(til)e(the)i(v)-5
+b(alue)39 b Fj(BZ_RUN)f Fl(is)h(returned.)68 b(As)39
+b(with)g(\014nishing,)150 2742 y Fj(BZ2_bzCompress)23
+b Fl(detects)28 b(an)m(y)f(attempt)h(to)f(pro)m(vide)f(more)h(input)e
+(data)i(once)g(the)g(\015ush)e(has)i(b)s(egun.)150 2899
+y(Once)j(the)h(\015ush)e(is)g(complete,)i(the)g(stream)f(returns)g(to)h
+(the)f(normal)g(R)m(UNNING)h(state.)150 3056 y(This)f(all)h(sounds)g
+(prett)m(y)h(complex,)h(but)e(isn't)g(really)-8 b(.)45
+b(Here's)33 b(a)f(table)g(whic)m(h)f(sho)m(ws)h(whic)m(h)f(actions)150
+3165 y(are)e(allo)m(w)m(able)f(in)f(eac)m(h)j(state,)g(what)f(action)g
+(will)c(b)s(e)j(tak)m(en,)j(what)d(the)h(next)f(state)i(is,)e(and)g
+(what)h(the)150 3275 y(non-error)h(return)f(v)-5 b(alues)29
+b(are.)41 b(Note)32 b(that)e(y)m(ou)h(can't)g(explicitly)d(ask)i(what)g
+(state)i(the)e(stream)h(is)e(in,)150 3384 y(but)h(nor)g(do)g(y)m(ou)h
+(need)f(to)h({)g(it)e(can)i(b)s(e)f(inferred)e(from)i(the)h(v)-5
+b(alues)29 b(returned)h(b)m(y)g Fj(BZ2_bzCompress)p Fl(.)390
+3535 y(IDLE/)p Fj(any)572 3639 y Fl(Illegal.)60 b(IDLE)30
+b(state)i(only)d(exists)h(after)h Fj(BZ2_bzCompressEnd)26
+b Fl(or)572 3743 y(b)s(efore)k Fj(BZ2_bzCompressInit)p
+Fl(.)572 3847 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_SEQUENCE_ERROR)390
+4054 y Fl(R)m(UNNING/)p Fj(BZ_RUN)572 4158 y Fl(Compress)f(from)h
+Fj(next_in)f Fl(to)i Fj(next_out)d Fl(as)i(m)m(uc)m(h)h(as)f(p)s
+(ossible.)572 4262 y(Next)h(state)h(=)e(R)m(UNNING)572
+4366 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_RUN_OK)390
+4573 y Fl(R)m(UNNING/)p Fj(BZ_FLUSH)572 4677 y Fl(Remem)m(b)s(er)g
+(curren)m(t)g(v)-5 b(alue)30 b(of)g Fj(next_in)p Fl(.)59
+b(Compress)30 b(from)g Fj(next_in)572 4781 y Fl(to)h
+Fj(next_out)d Fl(as)j(m)m(uc)m(h)f(as)h(p)s(ossible,)d(but)i(do)g(not)g
+(accept)i(an)m(y)f(more)f(input.)572 4885 y(Next)h(state)h(=)e
+(FLUSHING)572 4988 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_FLUSH_OK)390
+5196 y Fl(R)m(UNNING/)p Fj(BZ_FINISH)572 5300 y Fl(Remem)m(b)s(er)g
+(curren)m(t)g(v)-5 b(alue)30 b(of)g Fj(next_in)p Fl(.)59
+b(Compress)30 b(from)g Fj(next_in)p eop
+%%Page: 16 17
+16 16 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(16)572 299 y(to)31 b Fj(next_out)d
+Fl(as)j(m)m(uc)m(h)f(as)h(p)s(ossible,)d(but)i(do)g(not)g(accept)i(an)m
+(y)f(more)f(input.)572 403 y(Next)h(state)h(=)e(FINISHING)572
+506 y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_FINISH_OK)390
+714 y Fl(FLUSHING/)p Fj(BZ_FLUSH)572 818 y Fl(Compress)f(from)h
+Fj(next_in)f Fl(to)i Fj(next_out)d Fl(as)i(m)m(uc)m(h)h(as)f(p)s
+(ossible,)572 922 y(but)f(do)i(not)f(accept)i(an)m(y)f(more)f(input.)
+572 1025 y(If)g(all)f(the)i(existing)e(input)f(has)i(b)s(een)g(used)g
+(up)f(and)h(all)f(compressed)572 1129 y(output)h(has)g(b)s(een)g(remo)m
+(v)m(ed)663 1233 y(Next)h(state)h(=)e(R)m(UNNING;)i(Return)d(v)-5
+b(alue)30 b(=)g Fj(BZ_RUN_OK)572 1337 y Fl(else)663 1440
+y(Next)h(state)h(=)e(FLUSHING;)h(Return)e(v)-5 b(alue)30
+b(=)g Fj(BZ_FLUSH_OK)390 1648 y Fl(FLUSHING/other)572
+1752 y(Illegal.)572 1856 y(Return)f(v)-5 b(alue)30 b(=)g
+Fj(BZ_SEQUENCE_ERROR)390 2063 y Fl(FINISHING/)p Fj(BZ_FINISH)572
+2167 y Fl(Compress)f(from)h Fj(next_in)f Fl(to)i Fj(next_out)d
+Fl(as)i(m)m(uc)m(h)h(as)f(p)s(ossible,)572 2271 y(but)f(to)j(not)e
+(accept)i(an)m(y)f(more)f(input.)572 2374 y(If)g(all)f(the)i(existing)e
+(input)f(has)i(b)s(een)g(used)g(up)f(and)h(all)f(compressed)572
+2478 y(output)h(has)g(b)s(een)g(remo)m(v)m(ed)663 2582
+y(Next)h(state)h(=)e(IDLE;)g(Return)g(v)-5 b(alue)30
+b(=)g Fj(BZ_STREAM_END)572 2686 y Fl(else)663 2790 y(Next)h(state)h(=)e
+(FINISHING;)g(Return)g(v)-5 b(alue)30 b(=)g Fj(BZ_FINISHING)390
+2997 y Fl(FINISHING/other)572 3101 y(Illegal.)572 3205
+y(Return)f(v)-5 b(alue)30 b(=)g Fj(BZ_SEQUENCE_ERROR)150
+3361 y Fl(That)24 b(still)f(lo)s(oks)g(complicated?)39
+b(W)-8 b(ell,)25 b(fair)f(enough.)38 b(The)24 b(usual)f(sequence)i(of)f
+(calls)g(for)g(compressing)150 3471 y(a)31 b(load)f(of)g(data)h(is:)225
+3628 y Fi(\017)60 b Fl(Get)31 b(started)g(with)e Fj(BZ2_bzCompressInit)
+p Fl(.)225 3774 y Fi(\017)60 b Fl(Sho)m(v)m(el)38 b(data)h(in)e(and)g
+(shlurp)e(out)k(its)e(compressed)h(form)g(using)e(zero)j(or)f(more)h
+(calls)e(of)h Fj(BZ2_)330 3884 y(bzCompress)28 b Fl(with)h(action)h(=)g
+Fj(BZ_RUN)p Fl(.)225 4030 y Fi(\017)60 b Fl(Finish)23
+b(up.)38 b(Rep)s(eatedly)25 b(call)f Fj(BZ2_bzCompress)e
+Fl(with)i(action)h(=)g Fj(BZ_FINISH)p Fl(,)f(cop)m(ying)h(out)h(the)330
+4139 y(compressed)k(output,)g(un)m(til)f Fj(BZ_STREAM_END)e
+Fl(is)i(returned.)225 4285 y Fi(\017)60 b Fl(Close)30
+b(up)f(and)h(go)h(home.)41 b(Call)29 b Fj(BZ2_bzCompressEnd)p
+Fl(.)150 4478 y(If)23 b(the)h(data)h(y)m(ou)f(w)m(an)m(t)h(to)f
+(compress)g(\014ts)f(in)m(to)h(y)m(our)g(input)e(bu\013er)h(all)f(at)j
+(once,)h(y)m(ou)e(can)g(skip)f(the)h(calls)150 4588 y(of)37
+b Fj(BZ2_bzCompress)26 b(\()k(...,)f(BZ_RUN)g(\))36 b
+Fl(and)g(just)g(do)h(the)g Fj(BZ2_bzCompress)26 b(\()k(...,)f
+(BZ_FINISH)150 4698 y(\))h Fl(calls.)150 4854 y(All)36
+b(required)g(memory)h(is)f(allo)s(cated)i(b)m(y)f Fj
+(BZ2_bzCompressInit)p Fl(.)56 b(The)37 b(compression)g(library)e(can)
+150 4964 y(accept)g(an)m(y)f(data)h(at)g(all)d(\(ob)m(viously\).)51
+b(So)34 b(y)m(ou)g(shouldn't)e(get)j(an)m(y)f(error)f(return)g(v)-5
+b(alues)33 b(from)h(the)150 5074 y Fj(BZ2_bzCompress)29
+b Fl(calls.)46 b(If)32 b(y)m(ou)h(do,)g(they)g(will)d(b)s(e)i
+Fj(BZ_SEQUENCE_ERROR)p Fl(,)d(and)j(indicate)f(a)i(bug)f(in)150
+5183 y(y)m(our)e(programming.)150 5340 y(T)-8 b(rivial)28
+b(other)j(p)s(ossible)d(return)h(v)-5 b(alues:)p eop
+%%Page: 17 18
+17 17 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(17)572 299 y Fj(BZ_PARAM_ERROR)663
+403 y Fl(if)29 b Fj(strm)g Fl(is)h Fj(NULL)p Fl(,)f(or)i
+Fj(strm->s)d Fl(is)h Fj(NULL)150 652 y Ff(3.3.3)63 b
+Fe(BZ2_bzCompressEnd)390 839 y Fj(int)47 b(BZ2_bzCompressEnd)c(\()k
+(bz_stream)f(*strm)g(\);)150 996 y Fl(Releases)31 b(all)e(memory)h
+(asso)s(ciated)h(with)e(a)i(compression)e(stream.)150
+1153 y(P)m(ossible)g(return)h(v)-5 b(alues:)481 1304
+y Fj(BZ_PARAM_ERROR)117 b Fl(if)30 b Fj(strm)f Fl(is)g
+Fj(NULL)g Fl(or)i Fj(strm->s)d Fl(is)i Fj(NULL)481 1408
+y(BZ_OK)120 b Fl(otherwise)150 1657 y Ff(3.3.4)63 b Fe
+(BZ2_bzDecompressInit)390 1844 y Fj(int)47 b(BZ2_bzDecompressInit)42
+b(\()48 b(bz_stream)d(*strm,)h(int)h(verbosity,)e(int)i(small)f(\);)150
+2001 y Fl(Prepares)30 b(for)f(decompression.)40 b(As)29
+b(with)g Fj(BZ2_bzCompressInit)p Fl(,)c(a)31 b Fj(bz_stream)c
+Fl(record)j(should)e(b)s(e)150 2110 y(allo)s(cated)c(and)f(initialised)
+e(b)s(efore)i(the)i(call.)38 b(Fields)22 b Fj(bzalloc)p
+Fl(,)i Fj(bzfree)e Fl(and)i Fj(opaque)e Fl(should)g(b)s(e)h(set)i(if)
+150 2220 y(a)h(custom)f(memory)g(allo)s(cator)g(is)g(required,)f(or)h
+(made)h Fj(NULL)e Fl(for)h(the)g(normal)f Fj(malloc)p
+Fl(/)p Fj(free)f Fl(routines.)150 2330 y(Up)s(on)h(return,)h(the)g(in)m
+(ternal)f(state)i(will)c(ha)m(v)m(e)k(b)s(een)f(initialised,)d(and)i
+Fj(total_in)f Fl(and)h Fj(total_out)f Fl(will)150 2439
+y(b)s(e)30 b(zero.)150 2596 y(F)-8 b(or)31 b(the)g(meaning)e(of)i
+(parameter)g Fj(verbosity)p Fl(,)d(see)j Fj(BZ2_bzCompressInit)p
+Fl(.)150 2753 y(If)e Fj(small)e Fl(is)h(nonzero,)i(the)f(library)e
+(will)f(use)j(an)g(alternativ)m(e)h(decompression)e(algorithm)g(whic)m
+(h)f(uses)150 2862 y(less)c(memory)g(but)g(at)h(the)g(cost)h(of)e
+(decompressing)g(more)g(slo)m(wly)g(\(roughly)f(sp)s(eaking,)i(half)f
+(the)h(sp)s(eed,)150 2972 y(but)34 b(the)i(maxim)m(um)d(memory)i
+(requiremen)m(t)g(drops)e(to)j(around)e(2300k\).)57 b(See)35
+b(Chapter)g(2)g(for)g(more)150 3082 y(information)29
+b(on)h(memory)g(managemen)m(t.)150 3238 y(Note)40 b(that)f(the)f(amoun)
+m(t)h(of)g(memory)f(needed)g(to)i(decompress)e(a)h(stream)f(cannot)h(b)
+s(e)f(determined)150 3348 y(un)m(til)j(the)h(stream's)h(header)f(has)g
+(b)s(een)g(read,)j(so)e(ev)m(en)g(if)e Fj(BZ2_bzDecompressInit)c
+Fl(succeeds,)46 b(a)150 3458 y(subsequen)m(t)30 b Fj(BZ2_bzDecompress)c
+Fl(could)j(fail)g(with)g Fj(BZ_MEM_ERROR)p Fl(.)150 3614
+y(P)m(ossible)g(return)h(v)-5 b(alues:)572 3765 y Fj(BZ_CONFIG_ERROR)
+663 3869 y Fl(if)29 b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572
+3973 y Fj(BZ_PARAM_ERROR)663 4077 y Fl(if)g Fj(\(small)46
+b(!=)h(0)h(&&)f(small)f(!=)h(1\))663 4181 y Fl(or)30
+b Fj(\(verbosity)45 b(<)j(0)f(||)g(verbosity)e(>)j(4\))572
+4284 y(BZ_MEM_ERROR)663 4388 y Fl(if)29 b(insu\016cien)m(t)g(memory)h
+(is)f(a)m(v)-5 b(ailable)150 4545 y(Allo)m(w)m(able)30
+b(next)g(actions:)572 4696 y Fj(BZ2_bzDecompress)663
+4800 y Fl(if)f Fj(BZ_OK)g Fl(w)m(as)i(returned)572 4904
+y(no)f(sp)s(eci\014c)f(action)i(required)e(in)g(case)i(of)g(error)150
+5153 y Ff(3.3.5)63 b Fe(BZ2_bzDecompress)390 5340 y Fj(int)47
+b(BZ2_bzDecompress)c(\()48 b(bz_stream)d(*strm)h(\);)p
+eop
+%%Page: 18 19
+18 18 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(18)150 299 y(Pro)m(vides)24
+b(more)g(input)f(and/out)h(output)g(bu\013er)g(space)h(for)f(the)g
+(library)-8 b(.)37 b(The)24 b(caller)g(main)m(tains)f(input)150
+408 y(and)30 b(output)g(bu\013ers,)f(and)h(uses)g Fj(BZ2_bzDecompress)c
+Fl(to)31 b(transfer)f(data)h(b)s(et)m(w)m(een)g(them.)150
+565 y(Before)g(eac)m(h)g(call)f(to)g Fj(BZ2_bzDecompress)p
+Fl(,)c Fj(next_in)i Fl(should)h(p)s(oin)m(t)g(at)h(the)h(compressed)e
+(data,)j(and)150 675 y Fj(avail_in)h Fl(should)h(indicate)h(ho)m(w)h
+(man)m(y)f(b)m(ytes)i(the)e(library)f(ma)m(y)i(read.)56
+b Fj(BZ2_bzDecompress)32 b Fl(up-)150 784 y(dates)f Fj(next_in)p
+Fl(,)e Fj(avail_in)f Fl(and)h Fj(total_in)g Fl(to)i(re\015ect)g(the)f
+(n)m(um)m(b)s(er)f(of)i(b)m(ytes)g(it)f(has)g(read.)150
+941 y(Similarly)-8 b(,)37 b Fj(next_out)f Fl(should)g(p)s(oin)m(t)i(to)
+g(a)h(bu\013er)e(in)g(whic)m(h)g(the)i(uncompressed)e(output)g(is)h(to)
+h(b)s(e)150 1051 y(placed,)d(with)e Fj(avail_out)f Fl(indicating)g(ho)m
+(w)i(m)m(uc)m(h)g(output)g(space)h(is)e(a)m(v)-5 b(ailable.)55
+b Fj(BZ2_bzCompress)150 1160 y Fl(up)s(dates)29 b Fj(next_out)p
+Fl(,)g Fj(avail_out)f Fl(and)h Fj(total_out)f Fl(to)j(re\015ect)g(the)g
+(n)m(um)m(b)s(er)e(of)h(b)m(ytes)h(output.)150 1317 y(Y)-8
+b(ou)40 b(ma)m(y)g(pro)m(vide)e(and)h(remo)m(v)m(e)i(as)f(little)e(or)h
+(as)h(m)m(uc)m(h)f(data)h(as)g(y)m(ou)f(lik)m(e)g(on)g(eac)m(h)i(call)e
+(of)g Fj(BZ2_)150 1427 y(bzDecompress)p Fl(.)e(In)27
+b(the)i(limit,)d(it)i(is)f(acceptable)j(to)f(supply)d(and)h(remo)m(v)m
+(e)j(data)f(one)f(b)m(yte)h(at)g(a)g(time,)150 1537 y(although)f(this)f
+(w)m(ould)g(b)s(e)h(terribly)e(ine\016cien)m(t.)39 b(Y)-8
+b(ou)29 b(should)e(alw)m(a)m(ys)h(ensure)g(that)h(at)g(least)g(one)f(b)
+m(yte)150 1646 y(of)j(output)f(space)g(is)g(a)m(v)-5
+b(ailable)30 b(at)h(eac)m(h)g(call.)150 1803 y(Use)g(of)f
+Fj(BZ2_bzDecompress)c Fl(is)k(simpler)e(than)i Fj(BZ2_bzCompress)p
+Fl(.)150 1960 y(Y)-8 b(ou)31 b(should)d(pro)m(vide)h(input)f(and)i
+(remo)m(v)m(e)i(output)d(as)i(describ)s(ed)d(ab)s(o)m(v)m(e,)k(and)d
+(rep)s(eatedly)h(call)f Fj(BZ2_)150 2069 y(bzDecompress)35
+b Fl(un)m(til)i Fj(BZ_STREAM_END)e Fl(is)j(returned.)64
+b(App)s(earance)39 b(of)g Fj(BZ_STREAM_END)c Fl(denotes)150
+2179 y(that)47 b Fj(BZ2_bzDecompress)42 b Fl(has)k(detected)h(the)f
+(logical)g(end)g(of)g(the)h(compressed)e(stream.)89 b
+Fj(BZ2_)150 2289 y(bzDecompress)28 b Fl(will)g(not)j(pro)s(duce)f
+Fj(BZ_STREAM_END)d Fl(un)m(til)j(all)f(output)i(data)h(has)e(b)s(een)h
+(placed)f(in)m(to)150 2398 y(the)36 b(output)g(bu\013er,)h(so)g(once)g
+Fj(BZ_STREAM_END)32 b Fl(app)s(ears,)38 b(y)m(ou)e(are)h(guaran)m(teed)
+g(to)g(ha)m(v)m(e)h(a)m(v)-5 b(ailable)150 2508 y(all)29
+b(the)i(decompressed)f(output,)g(and)g Fj(BZ2_bzDecompressEnd)25
+b Fl(can)31 b(safely)f(b)s(e)f(called.)150 2665 y(If)40
+b(case)h(of)f(an)h(error)e(return)h(v)-5 b(alue,)42 b(y)m(ou)f(should)d
+(call)h Fj(BZ2_bzDecompressEnd)c Fl(to)41 b(clean)f(up)g(and)150
+2774 y(release)31 b(memory)-8 b(.)150 2931 y(P)m(ossible)29
+b(return)h(v)-5 b(alues:)572 3082 y Fj(BZ_PARAM_ERROR)663
+3186 y Fl(if)29 b Fj(strm)g Fl(is)h Fj(NULL)f Fl(or)h
+Fj(strm->s)f Fl(is)g Fj(NULL)663 3290 y Fl(or)h Fj(strm->avail_out)44
+b(<)j(1)572 3393 y(BZ_DATA_ERROR)663 3497 y Fl(if)29
+b(a)i(data)g(in)m(tegrit)m(y)f(error)g(is)g(detected)h(in)e(the)i
+(compressed)f(stream)572 3601 y Fj(BZ_DATA_ERROR_MAGIC)663
+3705 y Fl(if)f(the)i(compressed)f(stream)g(do)s(esn't)h(b)s(egin)e
+(with)g(the)h(righ)m(t)g(magic)h(b)m(ytes)572 3808 y
+Fj(BZ_MEM_ERROR)663 3912 y Fl(if)e(there)i(w)m(asn't)f(enough)h(memory)
+f(a)m(v)-5 b(ailable)572 4016 y Fj(BZ_STREAM_END)663
+4120 y Fl(if)29 b(the)i(logical)e(end)h(of)h(the)f(data)h(stream)g(w)m
+(as)g(detected)g(and)f(all)663 4224 y(output)g(in)f(has)h(b)s(een)g
+(consumed,)f(eg)j Fj(s->avail_out)44 b(>)k(0)572 4327
+y(BZ_OK)663 4431 y Fl(otherwise)150 4588 y(Allo)m(w)m(able)30
+b(next)g(actions:)572 4739 y Fj(BZ2_bzDecompress)663
+4843 y Fl(if)f Fj(BZ_OK)g Fl(w)m(as)i(returned)572 4946
+y Fj(BZ2_bzDecompressEnd)663 5050 y Fl(otherwise)p eop
+%%Page: 19 20
+19 19 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(19)150 299 y Ff(3.3.6)63
+b Fe(BZ2_bzDecompressEnd)390 486 y Fj(int)47 b(BZ2_bzDecompressEnd)42
+b(\()48 b(bz_stream)d(*strm)i(\);)150 643 y Fl(Releases)31
+b(all)e(memory)h(asso)s(ciated)h(with)e(a)i(decompression)e(stream.)150
+799 y(P)m(ossible)g(return)h(v)-5 b(alues:)572 950 y
+Fj(BZ_PARAM_ERROR)663 1054 y Fl(if)29 b Fj(strm)g Fl(is)h
+Fj(NULL)f Fl(or)h Fj(strm->s)f Fl(is)g Fj(NULL)572 1158
+y(BZ_OK)663 1262 y Fl(otherwise)150 1419 y(Allo)m(w)m(able)h(next)g
+(actions:)572 1570 y(None.)150 1857 y Fk(3.4)68 b(High-lev)l(el)47
+b(in)l(terface)150 2050 y Fl(This)35 b(in)m(terface)j(pro)m(vides)d
+(functions)h(for)g(reading)g(and)h(writing)e Fj(bzip2)g
+Fl(format)i(\014les.)59 b(First,)39 b(some)150 2159 y(general)30
+b(p)s(oin)m(ts.)225 2316 y Fi(\017)60 b Fl(All)35 b(of)h(the)g
+(functions)e(tak)m(e)k(an)e Fj(int*)f Fl(\014rst)g(argumen)m(t,)j
+Fj(bzerror)p Fl(.)56 b(After)36 b(eac)m(h)h(call,)g Fj(bzerror)330
+2426 y Fl(should)23 b(b)s(e)i(consulted)g(\014rst)g(to)h(determine)e
+(the)i(outcome)h(of)e(the)h(call.)38 b(If)25 b Fj(bzerror)f
+Fl(is)g Fj(BZ_OK)p Fl(,)i(the)330 2535 y(call)35 b(completed)g
+(successfully)-8 b(,)36 b(and)f(only)g(then)g(should)f(the)h(return)g
+(v)-5 b(alue)35 b(of)h(the)f(function)g(\(if)330 2645
+y(an)m(y\))30 b(b)s(e)f(consulted.)39 b(If)29 b Fj(bzerror)e
+Fl(is)h Fj(BZ_IO_ERROR)p Fl(,)f(there)i(w)m(as)h(an)f(error)g
+(reading/writing)e(the)330 2754 y(underlying)32 b(compressed)j(\014le,)
+h(and)f(y)m(ou)h(should)d(then)i(consult)g Fj(errno)p
+Fl(/)p Fj(perror)e Fl(to)j(determine)330 2864 y(the)i(cause)g(of)g(the)
+g(di\016cult)m(y)-8 b(.)61 b Fj(bzerror)36 b Fl(ma)m(y)i(also)g(b)s(e)f
+(set)h(to)g(v)-5 b(arious)37 b(other)h(v)-5 b(alues;)41
+b(precise)330 2974 y(details)29 b(are)i(giv)m(en)g(on)f(a)h(p)s
+(er-function)d(basis)h(b)s(elo)m(w.)225 3111 y Fi(\017)60
+b Fl(If)40 b Fj(bzerror)f Fl(indicates)g(an)i(error)f(\(ie,)j(an)m
+(ything)d(except)h Fj(BZ_OK)f Fl(and)g Fj(BZ_STREAM_END)p
+Fl(\),)g(y)m(ou)330 3220 y(should)56 b(immediately)h(call)g
+Fj(BZ2_bzReadClose)e Fl(\(or)j Fj(BZ2_bzWriteClose)p
+Fl(,)j(dep)s(ending)56 b(on)330 3330 y(whether)50 b(y)m(ou)g(are)h
+(attempting)g(to)g(read)f(or)g(to)i(write\))d(to)j(free)e(up)f(all)h
+(resources)g(asso)s(ci-)330 3439 y(ated)33 b(with)e(the)i(stream.)47
+b(Once)32 b(an)h(error)f(has)g(b)s(een)g(indicated,)f(b)s(eha)m(viour)g
+(of)i(all)e(calls)h(except)330 3549 y Fj(BZ2_bzReadClose)46
+b Fl(\()p Fj(BZ2_bzWriteClose)p Fl(\))h(is)j(unde\014ned.)99
+b(The)50 b(implication)e(is)i(that)h(\(1\))330 3659 y
+Fj(bzerror)44 b Fl(should)g(b)s(e)h(c)m(hec)m(k)m(ed)j(after)e(eac)m(h)
+h(call,)i(and)c(\(2\))i(if)e Fj(bzerror)f Fl(indicates)g(an)i(error,)
+330 3768 y Fj(BZ2_bzReadClose)26 b Fl(\()p Fj(BZ2_bzWriteClose)p
+Fl(\))h(should)h(then)i(b)s(e)g(called)g(to)h(clean)f(up.)225
+3905 y Fi(\017)60 b Fl(The)33 b Fj(FILE*)f Fl(argumen)m(ts)h(passed)g
+(to)h Fj(BZ2_bzReadOpen)p Fl(/)p Fj(BZ2_bzWriteOp)o(en)27
+b Fl(should)32 b(b)s(e)g(set)i(to)330 4015 y(binary)23
+b(mo)s(de.)38 b(Most)26 b(Unix)d(systems)i(will)d(do)i(this)g(b)m(y)g
+(default,)i(but)e(other)g(platforms,)h(including)330
+4124 y(Windo)m(ws)20 b(and)g(Mac,)k(will)19 b(not.)38
+b(If)20 b(y)m(ou)h(omit)g(this,)h(y)m(ou)f(ma)m(y)h(encoun)m(ter)f
+(problems)e(when)h(mo)m(ving)330 4234 y(co)s(de)31 b(to)g(new)f
+(platforms.)225 4371 y Fi(\017)60 b Fl(Memory)23 b(allo)s(cation)f
+(requests)h(are)g(handled)e(b)m(y)i Fj(malloc)p Fl(/)p
+Fj(free)p Fl(.)36 b(A)m(t)23 b(presen)m(t)g(there)g(is)f(no)h(facilit)m
+(y)330 4481 y(for)40 b(user-de\014ned)e(memory)i(allo)s(cators)g(in)f
+(the)h(\014le)g(I/O)g(functions)e(\(could)i(easily)f(b)s(e)g(added,)330
+4590 y(though\).)150 4842 y Ff(3.4.1)63 b Fe(BZ2_bzReadOpen)533
+5029 y Fj(typedef)46 b(void)h(BZFILE;)533 5236 y(BZFILE)f
+(*BZ2_bzReadOpen)e(\()j(int)g(*bzerror,)f(FILE)g(*f,)1726
+5340 y(int)h(small,)f(int)h(verbosity,)p eop
+%%Page: 20 21
+20 20 bop 150 -116 a Fl(Chapter)30 b(3:)h(Programming)e(with)g
+Fj(libbzip2)1891 b Fl(20)1726 299 y Fj(void)47 b(*unused,)f(int)g
+(nUnused)g(\);)150 456 y Fl(Prepare)29 b(to)g(read)g(compressed)f(data)
+i(from)e(\014le)g(handle)f Fj(f)p Fl(.)40 b Fj(f)29 b
+Fl(should)d(refer)j(to)h(a)f(\014le)f(whic)m(h)f(has)i(b)s(een)150
+565 y(op)s(ened)h(for)h(reading,)f(and)h(for)f(whic)m(h)g(the)h(error)g
+(indicator)e(\()p Fj(ferror\(f\))p Fl(\)is)f(not)k(set.)42
+b(If)31 b Fj(small)e Fl(is)h(1,)150 675 y(the)h(library)d(will)f(try)j
+(to)i(decompress)e(using)f(less)g(memory)-8 b(,)31 b(at)g(the)g(exp)s
+(ense)f(of)g(sp)s(eed.)150 832 y(F)-8 b(or)39 b(reasons)f(explained)f
+(b)s(elo)m(w,)j Fj(BZ2_bzRead)35 b Fl(will)h(decompress)i(the)g
+Fj(nUnused)e Fl(b)m(ytes)j(starting)f(at)150 941 y Fj(unused)p
+Fl(,)k(b)s(efore)e(starting)h(to)g(read)g(from)f(the)h(\014le)f
+Fj(f)p Fl(.)71 b(A)m(t)42 b(most)f Fj(BZ_MAX_UNUSED)c
+Fl(b)m(ytes)k(ma)m(y)h(b)s(e)150 1051 y(supplied)32 b(lik)m(e)k(this.)
+55 b(If)36 b(this)e(facilit)m(y)h(is)g(not)h(required,)g(y)m(ou)g
+(should)e(pass)h Fj(NULL)g Fl(and)g Fj(0)g Fl(for)h Fj(unused)150
+1160 y Fl(and)30 b(n)p Fj(Unused)e Fl(resp)s(ectiv)m(ely)-8
+b(.)150 1317 y(F)g(or)31 b(the)g(meaning)e(of)i(parameters)g
+Fj(small)e Fl(and)g Fj(verbosity)p Fl(,)f(see)j Fj
+(BZ2_bzDecompressInit)p Fl(.)150 1474 y(The)k(amoun)m(t)g(of)g(memory)g
+(needed)g(to)g(decompress)g(a)h(\014le)e(cannot)h(b)s(e)g(determined)e
+(un)m(til)h(the)h(\014le's)150 1584 y(header)22 b(has)f(b)s(een)g
+(read.)38 b(So)22 b(it)f(is)g(p)s(ossible)e(that)k Fj(BZ2_bzReadOpen)17
+b Fl(returns)k Fj(BZ_OK)f Fl(but)h(a)i(subsequen)m(t)150
+1693 y(call)30 b(of)g Fj(BZ2_bzRead)e Fl(will)f(return)j
+Fj(BZ_MEM_ERROR)p Fl(.)150 1850 y(P)m(ossible)f(assignmen)m(ts)h(to)h
+Fj(bzerror)p Fl(:)572 2001 y Fj(BZ_CONFIG_ERROR)663 2105
+y Fl(if)e(the)i(library)d(has)i(b)s(een)f(mis-compiled)572
+2209 y Fj(BZ_PARAM_ERROR)663 2313 y Fl(if)g Fj(f)h Fl(is)g
+Fj(NULL)663 2416 y Fl(or)g Fj(small)f Fl(is)g(neither)h
+Fj(0)g Fl(nor)g Fj(1)663 2520 y Fl(or)g Fj(\(unused)46
+b(==)h(NULL)g(&&)g(nUnused)f(!=)h(0\))663 2624 y Fl(or)30
+b Fj(\(unused)46 b(!=)h(NULL)g(&&)g(!\(0)g(<=)g(nUnused)f(<=)h
+(BZ_MAX_UNUSED\)\))572 2728 y(BZ_IO_ERROR)663 2831 y
+Fl(if)29 b Fj(ferror\(f\))f Fl(is)h(nonzero)572 2935
+y Fj(BZ_MEM_ERROR)663 3039 y Fl(if)g(insu\016cien)m(t)g(memory)h(is)f
+(a)m(v)-5 b(ailable)572 3143 y Fj(BZ_OK)663 3247 y Fl(otherwise.)150
+3403 y(P)m(ossible)29 b(return)h(v)-5 b(alues:)572 3554
+y(P)m(oin)m(ter)31 b(to)g(an)f(abstract)h Fj(BZFILE)663
+3658 y Fl(if)e Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 3762
+y(NULL)663 3866 y Fl(otherwise)150 4023 y(Allo)m(w)m(able)g(next)g
+(actions:)572 4174 y Fj(BZ2_bzRead)663 4277 y Fl(if)f
+Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 4381 y(BZ2_bzClose)663
+4485 y Fl(otherwise)150 4887 y Ff(3.4.2)63 b Fe(BZ2_bzRead)533
+5074 y Fj(int)47 b(BZ2_bzRead)e(\()j(int)e(*bzerror,)g(BZFILE)g(*b,)h
+(void)f(*buf,)h(int)g(len)g(\);)150 5230 y Fl(Reads)35
+b(up)f(to)h Fj(len)f Fl(\(uncompressed\))h(b)m(ytes)g(from)f(the)h
+(compressed)g(\014le)f Fj(b)g Fl(in)m(to)h(the)g(bu\013er)f
+Fj(buf)p Fl(.)53 b(If)150 5340 y(the)30 b(read)f(w)m(as)h(successful,)f
+Fj(bzerror)e Fl(is)i(set)h(to)g Fj(BZ_OK)e Fl(and)h(the)h(n)m(um)m(b)s
+(er)e(of)i(b)m(ytes)g(read)f(is)g(returned.)p eop
+%%Page: 21 22
+21 21 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(21)150 299 y(If)33 b(the)g(logical)g
+(end-of-stream)h(w)m(as)g(detected,)i Fj(bzerror)31 b
+Fl(will)g(b)s(e)h(set)i(to)g Fj(BZ_STREAM_END)p Fl(,)d(and)i(the)150
+408 y(n)m(um)m(b)s(er)c(of)i(b)m(ytes)f(read)h(is)e(returned.)40
+b(All)29 b(other)h Fj(bzerror)f Fl(v)-5 b(alues)29 b(denote)i(an)g
+(error.)150 565 y Fj(BZ2_bzRead)37 b Fl(will)f(supply)h
+Fj(len)i Fl(b)m(ytes,)j(unless)c(the)i(logical)f(stream)h(end)e(is)h
+(detected)i(or)e(an)g(error)150 675 y(o)s(ccurs.)75 b(Because)43
+b(of)f(this,)i(it)d(is)g(p)s(ossible)e(to)k(detect)g(the)f(stream)g
+(end)f(b)m(y)h(observing)f(when)g(the)150 784 y(n)m(um)m(b)s(er)29
+b(of)h(b)m(ytes)g(returned)f(is)g(less)g(than)h(the)g(n)m(um)m(b)s(er)f
+(requested.)40 b(Nev)m(ertheless,)31 b(this)e(is)g(regarded)150
+894 y(as)38 b(inadvisable;)g(y)m(ou)g(should)d(instead)i(c)m(hec)m(k)i
+Fj(bzerror)d Fl(after)i(ev)m(ery)g(call)e(and)h(w)m(atc)m(h)i(out)f
+(for)f Fj(BZ_)150 1004 y(STREAM_END)p Fl(.)150 1160 y(In)m(ternally)-8
+b(,)47 b Fj(BZ2_bzRead)41 b Fl(copies)j(data)g(from)g(the)g(compressed)
+g(\014le)f(in)f(c)m(h)m(unks)i(of)g(size)g Fj(BZ_MAX_)150
+1270 y(UNUSED)31 b Fl(b)m(ytes)i(b)s(efore)f(decompressing)f(it.)47
+b(If)32 b(the)h(\014le)e(con)m(tains)i(more)g(b)m(ytes)g(than)f
+(strictly)f(needed)150 1380 y(to)48 b(reac)m(h)f(the)g(logical)f
+(end-of-stream,)52 b Fj(BZ2_bzRead)44 b Fl(will)g(almost)j(certainly)f
+(read)h(some)g(of)g(the)150 1489 y(trailing)c(data)j(b)s(efore)e
+(signalling)f Fj(BZ_SEQUENCE_END)p Fl(.)80 b(T)-8 b(o)46
+b(collect)f(the)g(read)g(but)g(un)m(used)e(data)150 1599
+y(once)29 b Fj(BZ_SEQUENCE_END)24 b Fl(has)k(app)s(eared,)g(call)f
+Fj(BZ2_bzReadGetUnused)c Fl(immediately)j(b)s(efore)i
+Fj(BZ2_)150 1708 y(bzReadClose)p Fl(.)150 1865 y(P)m(ossible)h
+(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 2016 y Fj(BZ_PARAM_ERROR)
+663 2120 y Fl(if)e Fj(b)h Fl(is)g Fj(NULL)f Fl(or)h Fj(buf)g
+Fl(is)f Fj(NULL)g Fl(or)i Fj(len)46 b(<)i(0)572 2224
+y(BZ_SEQUENCE_ERROR)663 2328 y Fl(if)29 b Fj(b)h Fl(w)m(as)h(op)s(ened)
+e(with)h Fj(BZ2_bzWriteOpen)572 2431 y(BZ_IO_ERROR)663
+2535 y Fl(if)f(there)i(is)e(an)h(error)g(reading)g(from)g(the)g
+(compressed)g(\014le)572 2639 y Fj(BZ_UNEXPECTED_EOF)663
+2743 y Fl(if)f(the)i(compressed)f(\014le)f(ended)h(b)s(efore)g(the)g
+(logical)g(end-of-stream)h(w)m(as)g(detected)572 2847
+y Fj(BZ_DATA_ERROR)663 2950 y Fl(if)e(a)i(data)g(in)m(tegrit)m(y)f
+(error)g(w)m(as)h(detected)h(in)d(the)h(compressed)g(stream)572
+3054 y Fj(BZ_DATA_ERROR_MAGIC)663 3158 y Fl(if)f(the)i(stream)f(do)s
+(es)g(not)h(b)s(egin)e(with)g(the)i(requisite)e(header)h(b)m(ytes)h
+(\(ie,)f(is)g(not)663 3262 y(a)g Fj(bzip2)f Fl(data)i(\014le\).)61
+b(This)28 b(is)i(really)f(a)i(sp)s(ecial)e(case)i(of)g
+Fj(BZ_DATA_ERROR)p Fl(.)572 3365 y Fj(BZ_MEM_ERROR)663
+3469 y Fl(if)e(insu\016cien)m(t)g(memory)h(w)m(as)h(a)m(v)-5
+b(ailable)572 3573 y Fj(BZ_STREAM_END)663 3677 y Fl(if)29
+b(the)i(logical)e(end)h(of)h(stream)f(w)m(as)h(detected.)572
+3781 y Fj(BZ_OK)663 3884 y Fl(otherwise.)150 4041 y(P)m(ossible)e
+(return)h(v)-5 b(alues:)572 4192 y(n)m(um)m(b)s(er)29
+b(of)h(b)m(ytes)h(read)663 4296 y(if)e Fj(bzerror)f Fl(is)i
+Fj(BZ_OK)f Fl(or)h Fj(BZ_STREAM_END)572 4400 y Fl(unde\014ned)663
+4503 y(otherwise)150 4660 y(Allo)m(w)m(able)g(next)g(actions:)572
+4811 y(collect)h(data)g(from)f Fj(buf)p Fl(,)f(then)h
+Fj(BZ2_bzRead)e Fl(or)i Fj(BZ2_bzReadClose)663 4915 y
+Fl(if)f Fj(bzerror)f Fl(is)i Fj(BZ_OK)572 5019 y Fl(collect)h(data)g
+(from)f Fj(buf)p Fl(,)f(then)h Fj(BZ2_bzReadClose)d Fl(or)j
+Fj(BZ2_bzReadGetUnused)663 5123 y Fl(if)f Fj(bzerror)f
+Fl(is)i Fj(BZ_SEQUENCE_END)572 5226 y(BZ2_bzReadClose)663
+5330 y Fl(otherwise)p eop
+%%Page: 22 23
+22 22 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(22)150 299 y Ff(3.4.3)63
+b Fe(BZ2_bzReadGetUnused)533 486 y Fj(void)47 b(BZ2_bzReadGetUnused)42
+b(\()48 b(int*)e(bzerror,)g(BZFILE)g(*b,)1822 589 y(void**)g(unused,)g
+(int*)g(nUnused)g(\);)150 746 y Fl(Returns)36 b(data)i(whic)m(h)d(w)m
+(as)j(read)f(from)f(the)h(compressed)g(\014le)f(but)g(w)m(as)h(not)h
+(needed)e(to)i(get)g(to)g(the)150 856 y(logical)k(end-of-stream.)78
+b Fj(*unused)41 b Fl(is)h(set)h(to)g(the)g(address)f(of)g(the)h(data,)k
+(and)42 b Fj(*nUnused)e Fl(to)k(the)150 965 y(n)m(um)m(b)s(er)29
+b(of)i(b)m(ytes.)41 b Fj(*nUnused)28 b Fl(will)g(b)s(e)h(set)i(to)g(a)g
+(v)-5 b(alue)30 b(b)s(et)m(w)m(een)h Fj(0)f Fl(and)g
+Fj(BZ_MAX_UNUSED)d Fl(inclusiv)m(e.)150 1122 y(This)d(function)h(ma)m
+(y)h(only)g(b)s(e)f(called)g(once)i Fj(BZ2_bzRead)c Fl(has)j(signalled)
+e Fj(BZ_STREAM_END)e Fl(but)j(b)s(efore)150 1232 y Fj(BZ2_bzReadClose)p
+Fl(.)150 1389 y(P)m(ossible)k(assignmen)m(ts)h(to)h Fj(bzerror)p
+Fl(:)572 1540 y Fj(BZ_PARAM_ERROR)663 1644 y Fl(if)e
+Fj(b)h Fl(is)g Fj(NULL)663 1747 y Fl(or)g Fj(unused)f
+Fl(is)g Fj(NULL)g Fl(or)i Fj(nUnused)d Fl(is)i Fj(NULL)572
+1851 y(BZ_SEQUENCE_ERROR)663 1955 y Fl(if)f Fj(BZ_STREAM_END)e
+Fl(has)j(not)h(b)s(een)e(signalled)663 2059 y(or)h(if)f
+Fj(b)h Fl(w)m(as)h(op)s(ened)f(with)f Fj(BZ2_bzWriteOpen)542
+2162 y(BZ_OK)663 2266 y Fl(otherwise)150 2423 y(Allo)m(w)m(able)h(next)
+g(actions:)572 2574 y Fj(BZ2_bzReadClose)150 2882 y Ff(3.4.4)63
+b Fe(BZ2_bzReadClose)533 3068 y Fj(void)47 b(BZ2_bzReadClose)c(\()48
+b(int)f(*bzerror,)e(BZFILE)h(*b)h(\);)150 3225 y Fl(Releases)36
+b(all)e(memory)h(p)s(ertaining)e(to)i(the)h(compressed)f(\014le)f
+Fj(b)p Fl(.)54 b Fj(BZ2_bzReadClose)31 b Fl(do)s(es)k(not)h(call)150
+3335 y Fj(fclose)c Fl(on)h(the)h(underlying)d(\014le)h(handle,)h(so)h
+(y)m(ou)g(should)e(do)h(that)h(y)m(ourself)f(if)g(appropriate.)49
+b Fj(BZ2_)150 3445 y(bzReadClose)27 b Fl(should)i(b)s(e)g(called)h(to)h
+(clean)f(up)g(after)h(all)e(error)h(situations.)150 3601
+y(P)m(ossible)f(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572
+3752 y Fj(BZ_SEQUENCE_ERROR)663 3856 y Fl(if)e Fj(b)h
+Fl(w)m(as)h(op)s(ened)e(with)h Fj(BZ2_bzOpenWrite)572
+3960 y(BZ_OK)663 4064 y Fl(otherwise)150 4221 y(Allo)m(w)m(able)g(next)
+g(actions:)572 4372 y(none)150 4679 y Ff(3.4.5)63 b Fe(BZ2_bzWriteOpen)
+533 4866 y Fj(BZFILE)46 b(*BZ2_bzWriteOpen)e(\()j(int)g(*bzerror,)e
+(FILE)i(*f,)1774 4970 y(int)g(blockSize100k,)d(int)j(verbosity,)1774
+5074 y(int)g(workFactor)e(\);)150 5230 y Fl(Prepare)33
+b(to)g(write)f(compressed)h(data)h(to)f(\014le)f(handle)g
+Fj(f)p Fl(.)47 b Fj(f)33 b Fl(should)e(refer)i(to)g(a)g(\014le)f(whic)m
+(h)g(has)h(b)s(een)150 5340 y(op)s(ened)d(for)g(writing,)e(and)i(for)g
+(whic)m(h)f(the)i(error)f(indicator)f(\()p Fj(ferror\(f\))p
+Fl(\)is)f(not)i(set.)p eop
+%%Page: 23 24
+23 23 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(23)150 299 y(F)-8 b(or)31
+b(the)g(meaning)e(of)i(parameters)g Fj(blockSize100k)p
+Fl(,)c Fj(verbosity)g Fl(and)j Fj(workFactor)p Fl(,)e(see)150
+408 y Fj(BZ2_bzCompressInit)p Fl(.)150 565 y(All)d(required)f(memory)i
+(is)f(allo)s(cated)i(at)g(this)e(stage,)j(so)f(if)e(the)h(call)g
+(completes)g(successfully)-8 b(,)26 b Fj(BZ_MEM_)150
+675 y(ERROR)j Fl(cannot)i(b)s(e)f(signalled)e(b)m(y)i(a)h(subsequen)m
+(t)f(call)f(to)i Fj(BZ2_bzWrite)p Fl(.)150 832 y(P)m(ossible)e
+(assignmen)m(ts)h(to)h Fj(bzerror)p Fl(:)572 983 y Fj(BZ_CONFIG_ERROR)
+663 1087 y Fl(if)e(the)i(library)d(has)i(b)s(een)f(mis-compiled)572
+1190 y Fj(BZ_PARAM_ERROR)663 1294 y Fl(if)g Fj(f)h Fl(is)g
+Fj(NULL)663 1398 y Fl(or)g Fj(blockSize100k)44 b(<)k(1)30
+b Fl(or)g Fj(blockSize100k)44 b(>)k(9)572 1502 y(BZ_IO_ERROR)663
+1605 y Fl(if)29 b Fj(ferror\(f\))f Fl(is)h(nonzero)572
+1709 y Fj(BZ_MEM_ERROR)663 1813 y Fl(if)g(insu\016cien)m(t)g(memory)h
+(is)f(a)m(v)-5 b(ailable)572 1917 y Fj(BZ_OK)663 2021
+y Fl(otherwise)150 2177 y(P)m(ossible)29 b(return)h(v)-5
+b(alues:)572 2328 y(P)m(oin)m(ter)31 b(to)g(an)f(abstract)h
+Fj(BZFILE)663 2432 y Fl(if)e Fj(bzerror)f Fl(is)i Fj(BZ_OK)572
+2536 y(NULL)663 2640 y Fl(otherwise)150 2797 y(Allo)m(w)m(able)g(next)g
+(actions:)572 2948 y Fj(BZ2_bzWrite)663 3051 y Fl(if)f
+Fj(bzerror)f Fl(is)i Fj(BZ_OK)604 3155 y Fl(\(y)m(ou)25
+b(could)e(go)h(directly)f(to)h Fj(BZ2_bzWriteClose)p
+Fl(,)c(but)j(this)g(w)m(ould)g(b)s(e)g(prett)m(y)h(p)s(oin)m(tless\))
+572 3259 y Fj(BZ2_bzWriteClose)663 3363 y Fl(otherwise)150
+3639 y Ff(3.4.6)63 b Fe(BZ2_bzWrite)533 3826 y Fj(void)47
+b(BZ2_bzWrite)e(\()i(int)g(*bzerror,)e(BZFILE)h(*b,)h(void)g(*buf,)f
+(int)h(len)g(\);)150 3983 y Fl(Absorbs)26 b Fj(len)g
+Fl(b)m(ytes)i(from)e(the)i(bu\013er)e Fj(buf)p Fl(,)h(ev)m(en)m(tually)
+g(to)h(b)s(e)e(compressed)h(and)f(written)g(to)i(the)g(\014le.)150
+4140 y(P)m(ossible)h(assignmen)m(ts)h(to)h Fj(bzerror)p
+Fl(:)572 4291 y Fj(BZ_PARAM_ERROR)663 4395 y Fl(if)e
+Fj(b)h Fl(is)g Fj(NULL)f Fl(or)h Fj(buf)g Fl(is)f Fj(NULL)g
+Fl(or)i Fj(len)46 b(<)i(0)572 4498 y(BZ_SEQUENCE_ERROR)663
+4602 y Fl(if)29 b(b)h(w)m(as)h(op)s(ened)e(with)g Fj(BZ2_bzReadOpen)572
+4706 y(BZ_IO_ERROR)663 4810 y Fl(if)g(there)i(is)e(an)h(error)g
+(writing)f(the)h(compressed)g(\014le.)572 4914 y Fj(BZ_OK)663
+5017 y Fl(otherwise)150 5294 y Ff(3.4.7)63 b Fe(BZ2_bzWriteClose)p
+eop
+%%Page: 24 25
+24 24 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(24)533 299 y Fj(void)47
+b(BZ2_bzWriteClose)c(\()48 b(int)f(*bzerror,)e(BZFILE*)h(f,)1679
+403 y(int)h(abandon,)1679 506 y(unsigned)e(int*)i(nbytes_in,)1679
+610 y(unsigned)e(int*)i(nbytes_out)e(\);)533 818 y(void)i
+(BZ2_bzWriteClose64)c(\()k(int)g(*bzerror,)e(BZFILE*)h(f,)1774
+922 y(int)h(abandon,)1774 1025 y(unsigned)f(int*)g(nbytes_in_lo32,)1774
+1129 y(unsigned)g(int*)g(nbytes_in_hi32,)1774 1233 y(unsigned)g(int*)g
+(nbytes_out_lo32,)1774 1337 y(unsigned)g(int*)g(nbytes_out_hi32)e(\);)
+150 1493 y Fl(Compresses)39 b(and)g(\015ushes)g(to)h(the)g(compressed)g
+(\014le)f(all)f(data)j(so)f(far)g(supplied)c(b)m(y)k
+Fj(BZ2_bzWrite)p Fl(.)150 1603 y(The)27 b(logical)g(end-of-stream)h
+(mark)m(ers)g(are)g(also)f(written,)h(so)f(subsequen)m(t)g(calls)g(to)h
+Fj(BZ2_bzWrite)d Fl(are)150 1713 y(illegal.)50 b(All)33
+b(memory)h(asso)s(ciated)g(with)f(the)i(compressed)e(\014le)h
+Fj(b)f Fl(is)g(released.)52 b Fj(fflush)33 b Fl(is)g(called)g(on)150
+1822 y(the)e(compressed)f(\014le,)f(but)h(it)g(is)f(not)i
+Fj(fclose)p Fl('d.)150 1979 y(If)i Fj(BZ2_bzWriteClose)c
+Fl(is)k(called)f(to)j(clean)e(up)f(after)i(an)g(error,)g(the)g(only)e
+(action)i(is)f(to)h(release)g(the)150 2089 y(memory)-8
+b(.)42 b(The)30 b(library)e(records)j(the)g(error)f(co)s(des)h(issued)e
+(b)m(y)h(previous)f(calls,)i(so)f(this)g(situation)g(will)150
+2198 y(b)s(e)c(detected)h(automatically)-8 b(.)40 b(There)26
+b(is)g(no)g(attempt)h(to)h(complete)e(the)h(compression)f(op)s
+(eration,)g(nor)150 2308 y(to)32 b Fj(fflush)d Fl(the)i(compressed)g
+(\014le.)42 b(Y)-8 b(ou)32 b(can)f(force)h(this)e(b)s(eha)m(viour)g(to)
+h(happ)s(en)f(ev)m(en)i(in)d(the)j(case)g(of)150 2417
+y(no)e(error,)g(b)m(y)h(passing)e(a)i(nonzero)f(v)-5
+b(alue)30 b(to)h Fj(abandon)p Fl(.)150 2574 y(If)j Fj(nbytes_in)d
+Fl(is)j(non-n)m(ull,)f Fj(*nbytes_in)e Fl(will)h(b)s(e)h(set)i(to)g(b)s
+(e)f(the)g(total)h(v)m(olume)f(of)g(uncompressed)150
+2684 y(data)k(handled.)60 b(Similarly)-8 b(,)35 b Fj(nbytes_out)g
+Fl(will)g(b)s(e)h(set)i(to)g(the)g(total)g(v)m(olume)f(of)g(compressed)
+g(data)150 2793 y(written.)h(F)-8 b(or)27 b(compatibilit)m(y)d(with)h
+(older)g(v)m(ersions)h(of)g(the)g(library)-8 b(,)25 b
+Fj(BZ2_bzWriteClose)d Fl(only)j(yields)150 2903 y(the)40
+b(lo)m(w)m(er)g(32)h(bits)d(of)i(these)h(coun)m(ts.)69
+b(Use)40 b Fj(BZ2_bzWriteClose64)35 b Fl(if)k(y)m(ou)h(w)m(an)m(t)h
+(the)f(full)d(64)k(bit)150 3013 y(coun)m(ts.)g(These)30
+b(t)m(w)m(o)i(functions)d(are)i(otherwise)f(absolutely)f(iden)m(tical.)
+150 3169 y(P)m(ossible)g(assignmen)m(ts)h(to)h Fj(bzerror)p
+Fl(:)572 3320 y Fj(BZ_SEQUENCE_ERROR)663 3424 y Fl(if)e
+Fj(b)h Fl(w)m(as)h(op)s(ened)e(with)h Fj(BZ2_bzReadOpen)572
+3528 y(BZ_IO_ERROR)663 3632 y Fl(if)f(there)i(is)e(an)h(error)g
+(writing)f(the)h(compressed)g(\014le)572 3736 y Fj(BZ_OK)663
+3839 y Fl(otherwise)150 4161 y Ff(3.4.8)63 b(Handling)41
+b(em)m(b)s(edded)g(compressed)h(data)e(streams)150 4354
+y Fl(The)i(high-lev)m(el)g(library)f(facilitates)h(use)h(of)g
+Fj(bzip2)e Fl(data)j(streams)f(whic)m(h)f(form)g(some)i(part)e(of)i(a)
+150 4463 y(surrounding,)27 b(larger)j(data)h(stream.)225
+4620 y Fi(\017)60 b Fl(F)-8 b(or)22 b(writing,)f(the)g(library)e(tak)m
+(es)k(an)e(op)s(en)f(\014le)g(handle,)i(writes)e(compressed)h(data)h
+(to)g(it,)g Fj(fflush)p Fl(es)330 4730 y(it)34 b(but)f(do)s(es)h(not)h
+Fj(fclose)d Fl(it.)52 b(The)34 b(calling)f(application)g(can)h(write)g
+(its)f(o)m(wn)i(data)g(b)s(efore)f(and)330 4839 y(after)d(the)f
+(compressed)h(data)g(stream,)g(using)d(that)j(same)g(\014le)f(handle.)
+225 5011 y Fi(\017)60 b Fl(Reading)34 b(is)f(more)i(complex,)g(and)f
+(the)h(facilities)d(are)j(not)g(as)g(general)f(as)h(they)f(could)g(b)s
+(e)g(since)330 5121 y(generalit)m(y)e(is)f(hard)f(to)j(reconcile)e
+(with)f(e\016ciency)-8 b(.)46 b Fj(BZ2_bzRead)29 b Fl(reads)i(from)g
+(the)h(compressed)330 5230 y(\014le)39 b(in)g(blo)s(c)m(ks)g(of)h(size)
+g Fj(BZ_MAX_UNUSED)c Fl(b)m(ytes,)44 b(and)39 b(in)g(doing)g(so)h
+(probably)e(will)f(o)m(v)m(ersho)s(ot)330 5340 y(the)i(logical)g(end)f
+(of)h(compressed)f(stream.)67 b(T)-8 b(o)40 b(reco)m(v)m(er)g(this)e
+(data)i(once)f(decompression)f(has)p eop
+%%Page: 25 26
+25 25 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(25)330 299 y(ended,)28
+b(call)g Fj(BZ2_bzReadGetUnused)23 b Fl(after)29 b(the)g(last)f(call)g
+(of)g Fj(BZ2_bzRead)e Fl(\(the)j(one)g(returning)330
+408 y Fj(BZ_STREAM_END)p Fl(\))e(but)j(b)s(efore)g(calling)f
+Fj(BZ2_bzReadClose)p Fl(.)150 596 y(This)51 b(mec)m(hanism)g(mak)m(es)j
+(it)e(easy)h(to)g(decompress)f(m)m(ultiple)e Fj(bzip2)i
+Fl(streams)g(placed)g(end-to-)150 706 y(end.)90 b(As)48
+b(the)f(end)f(of)i(one)f(stream,)52 b(when)46 b Fj(BZ2_bzRead)f
+Fl(returns)h Fj(BZ_STREAM_END)p Fl(,)i(call)e Fj(BZ2_)150
+816 y(bzReadGetUnused)36 b Fl(to)41 b(collect)g(the)g(un)m(used)e(data)
+i(\(cop)m(y)g(it)f(in)m(to)g(y)m(our)h(o)m(wn)f(bu\013er)f
+(somewhere\).)150 925 y(That)25 b(data)g(forms)f(the)h(start)h(of)e
+(the)h(next)g(compressed)g(stream.)39 b(T)-8 b(o)25 b(start)h
+(uncompressing)c(that)k(next)150 1035 y(stream,)40 b(call)d
+Fj(BZ2_bzReadOpen)d Fl(again,)40 b(feeding)d(in)g(the)h(un)m(used)e
+(data)j(via)e(the)h Fj(unused)p Fl(/)p Fj(nUnused)150
+1144 y Fl(parameters.)54 b(Keep)34 b(doing)g(this)f(un)m(til)g
+Fj(BZ_STREAM_END)e Fl(return)j(coincides)f(with)h(the)g(ph)m(ysical)g
+(end)150 1254 y(of)d(\014le)e(\()p Fj(feof\(f\))p Fl(\).)39
+b(In)30 b(this)f(situation)h Fj(BZ2_bzReadGetUnused)25
+b Fl(will)i(of)k(course)g(return)e(no)h(data.)150 1411
+y(This)c(should)f(giv)m(e)j(some)g(feel)f(for)g(ho)m(w)h(the)g
+(high-lev)m(el)e(in)m(terface)i(can)f(b)s(e)g(used.)39
+b(If)27 b(y)m(ou)h(require)e(extra)150 1520 y(\015exibilit)m(y)-8
+b(,)28 b(y)m(ou'll)i(ha)m(v)m(e)h(to)g(bite)f(the)h(bullet)d(and)i(get)
+i(to)f(grips)e(with)g(the)h(lo)m(w-lev)m(el)h(in)m(terface.)150
+1779 y Ff(3.4.9)63 b(Standard)40 b(\014le-reading/writing)j(co)s(de)150
+1972 y Fl(Here's)31 b(ho)m(w)f(y)m(ou'd)h(write)e(data)j(to)f(a)f
+(compressed)g(\014le:)390 2330 y Fj(FILE*)142 b(f;)390
+2434 y(BZFILE*)46 b(b;)390 2538 y(int)238 b(nBuf;)390
+2642 y(char)190 b(buf[)46 b(/*)i(whatever)d(size)i(you)g(like)f(*/)i
+(];)390 2746 y(int)238 b(bzerror;)390 2849 y(int)g(nWritten;)390
+3057 y(f)47 b(=)h(fopen)e(\()i("myfile.bz2",)c("w")j(\);)390
+3161 y(if)g(\(!f\))g({)533 3264 y(/*)g(handle)f(error)h(*/)390
+3368 y(})390 3472 y(b)g(=)h(BZ2_bzWriteOpen)c(\()j(&bzerror,)e(f,)i(9)h
+(\);)390 3576 y(if)f(\(bzerror)f(!=)h(BZ_OK\))f({)533
+3680 y(BZ2_bzWriteClose)e(\()j(b)g(\);)533 3783 y(/*)g(handle)f(error)h
+(*/)390 3887 y(})390 4095 y(while)f(\()i(/*)f(condition)e(*/)i(\))h({)
+533 4198 y(/*)f(get)g(data)g(to)g(write)f(into)h(buf,)g(and)g(set)g
+(nBuf)f(appropriately)e(*/)533 4302 y(nWritten)i(=)h(BZ2_bzWrite)e(\()i
+(&bzerror,)f(b,)h(buf,)f(nBuf)h(\);)533 4406 y(if)g(\(bzerror)f(==)h
+(BZ_IO_ERROR\))e({)676 4510 y(BZ2_bzWriteClose)f(\()j(&bzerror,)e(b)j
+(\);)676 4614 y(/*)g(handle)e(error)g(*/)533 4717 y(})390
+4821 y(})390 5029 y(BZ2_bzWriteClose)d(\()48 b(&bzerror,)d(b)j(\);)390
+5132 y(if)f(\(bzerror)f(==)h(BZ_IO_ERROR\))d({)533 5236
+y(/*)j(handle)f(error)h(*/)390 5340 y(})p eop
+%%Page: 26 27
+26 26 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(26)150 299 y(And)29 b(to)j(read)e(from)g
+(a)h(compressed)f(\014le:)390 450 y Fj(FILE*)142 b(f;)390
+554 y(BZFILE*)46 b(b;)390 657 y(int)238 b(nBuf;)390 761
+y(char)190 b(buf[)46 b(/*)i(whatever)d(size)i(you)g(like)f(*/)i(];)390
+865 y(int)238 b(bzerror;)390 969 y(int)g(nWritten;)390
+1176 y(f)47 b(=)h(fopen)e(\()i("myfile.bz2",)c("r")j(\);)390
+1280 y(if)g(\(!f\))g({)533 1384 y(/*)g(handle)f(error)h(*/)390
+1488 y(})390 1591 y(b)g(=)h(BZ2_bzReadOpen)c(\()j(&bzerror,)f(f,)h(0,)g
+(NULL,)f(0)i(\);)390 1695 y(if)f(\(bzerror)f(!=)h(BZ_OK\))f({)533
+1799 y(BZ2_bzReadClose)e(\()j(&bzerror,)f(b)h(\);)533
+1903 y(/*)g(handle)f(error)h(*/)390 2007 y(})390 2214
+y(bzerror)f(=)h(BZ_OK;)390 2318 y(while)f(\(bzerror)g(==)h(BZ_OK)f(&&)i
+(/*)f(arbitrary)e(other)h(conditions)f(*/\))i({)533 2422
+y(nBuf)g(=)g(BZ2_bzRead)e(\()j(&bzerror,)d(b,)i(buf,)g(/*)g(size)g(of)g
+(buf)g(*/)g(\);)533 2525 y(if)g(\(bzerror)f(==)h(BZ_OK\))f({)676
+2629 y(/*)i(do)f(something)e(with)i(buf[0)f(..)h(nBuf-1])f(*/)533
+2733 y(})390 2837 y(})390 2941 y(if)h(\(bzerror)f(!=)h(BZ_STREAM_END\))
+d({)533 3044 y(BZ2_bzReadClose)g(\()j(&bzerror,)f(b)h(\);)533
+3148 y(/*)g(handle)f(error)h(*/)390 3252 y(})g(else)g({)533
+3356 y(BZ2_bzReadClose)d(\()j(&bzerror)f(\);)390 3459
+y(})150 3753 y Fk(3.5)68 b(Utilit)l(y)47 b(functions)150
+4045 y Ff(3.5.1)63 b Fe(BZ2_bzBuffToBuffCompress)533
+4232 y Fj(int)47 b(BZ2_bzBuffToBuffCompress\()41 b(char*)428
+b(dest,)1965 4335 y(unsigned)46 b(int*)g(destLen,)1965
+4439 y(char*)428 b(source,)1965 4543 y(unsigned)46 b(int)94
+b(sourceLen,)1965 4647 y(int)524 b(blockSize100k,)1965
+4751 y(int)g(verbosity,)1965 4854 y(int)g(workFactor)45
+b(\);)150 5011 y Fl(A)m(ttempts)33 b(to)g(compress)f(the)g(data)h(in)e
+Fj(source[0)d(..)i(sourceLen-1])e Fl(in)m(to)k(the)h(destination)e
+(bu\013er,)150 5121 y Fj(dest[0)e(..)g(*destLen-1])p
+Fl(.)37 b(If)26 b(the)g(destination)g(bu\013er)f(is)h(big)f(enough,)j
+Fj(*destLen)c Fl(is)h(set)i(to)g(the)g(size)150 5230
+y(of)i(the)f(compressed)h(data,)g(and)f Fj(BZ_OK)f Fl(is)h(returned.)39
+b(If)28 b(the)h(compressed)f(data)h(w)m(on't)g(\014t,)g
+Fj(*destLen)150 5340 y Fl(is)g(unc)m(hanged,)i(and)e
+Fj(BZ_OUTBUFF_FULL)e Fl(is)i(returned.)p eop
+%%Page: 27 28
+27 27 bop 150 -116 a Fl(Chapter)30 b(3:)h(Programming)e(with)g
+Fj(libbzip2)1891 b Fl(27)150 299 y(Compression)22 b(in)g(this)h(manner)
+g(is)g(a)h(one-shot)g(ev)m(en)m(t,)j(done)c(with)g(a)h(single)e(call)h
+(to)i(this)d(function.)37 b(The)150 408 y(resulting)25
+b(compressed)i(data)i(is)d(a)i(complete)f Fj(bzip2)f
+Fl(format)i(data)g(stream.)40 b(There)27 b(is)f(no)i(mec)m(hanism)150
+518 y(for)23 b(making)g(additional)e(calls)i(to)h(pro)m(vide)f(extra)h
+(input)e(data.)39 b(If)23 b(y)m(ou)h(w)m(an)m(t)g(that)g(kind)e(of)h
+(mec)m(hanism,)150 628 y(use)30 b(the)h(lo)m(w-lev)m(el)f(in)m
+(terface.)150 784 y(F)-8 b(or)31 b(the)g(meaning)e(of)i(parameters)g
+Fj(blockSize100k)p Fl(,)c Fj(verbosity)g Fl(and)j Fj(workFactor)p
+Fl(,)150 894 y(see)h Fj(BZ2_bzCompressInit)p Fl(.)150
+1051 y(T)-8 b(o)27 b(guaran)m(tee)h(that)e(the)h(compressed)f(data)h
+(will)d(\014t)i(in)f(its)g(bu\013er,)i(allo)s(cate)f(an)g(output)g
+(bu\013er)g(of)g(size)150 1160 y(1\045)31 b(larger)f(than)g(the)g
+(uncompressed)f(data,)j(plus)c(six)h(h)m(undred)g(extra)i(b)m(ytes.)150
+1317 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)25 b Fl(will)k(not)j(write)e
+(data)j(at)f(or)f(b)s(ey)m(ond)g Fj(dest[*destLen])p
+Fl(,)d(ev)m(en)k(in)150 1427 y(case)f(of)g(bu\013er)e(o)m(v)m(er\015o)m
+(w.)150 1584 y(P)m(ossible)g(return)h(v)-5 b(alues:)572
+1735 y Fj(BZ_CONFIG_ERROR)663 1839 y Fl(if)29 b(the)i(library)d(has)i
+(b)s(een)f(mis-compiled)572 1942 y Fj(BZ_PARAM_ERROR)663
+2046 y Fl(if)g Fj(dest)g Fl(is)h Fj(NULL)f Fl(or)h Fj(destLen)f
+Fl(is)g Fj(NULL)663 2150 y Fl(or)h Fj(blockSize100k)44
+b(<)k(1)30 b Fl(or)g Fj(blockSize100k)44 b(>)k(9)663
+2254 y Fl(or)30 b Fj(verbosity)45 b(<)j(0)30 b Fl(or)g
+Fj(verbosity)45 b(>)j(4)663 2357 y Fl(or)30 b Fj(workFactor)45
+b(<)j(0)30 b Fl(or)g Fj(workFactor)45 b(>)i(250)572 2461
+y(BZ_MEM_ERROR)663 2565 y Fl(if)29 b(insu\016cien)m(t)g(memory)h(is)f
+(a)m(v)-5 b(ailable)572 2669 y Fj(BZ_OUTBUFF_FULL)663
+2773 y Fl(if)29 b(the)i(size)f(of)g(the)h(compressed)f(data)h(exceeds)g
+Fj(*destLen)572 2876 y(BZ_OK)663 2980 y Fl(otherwise)150
+3349 y Ff(3.5.2)63 b Fe(BZ2_bzBuffToBuffDecompress)533
+3536 y Fj(int)47 b(BZ2_bzBuffToBuffDecompres)o(s)42 b(\()47
+b(char*)428 b(dest,)2108 3640 y(unsigned)46 b(int*)g(destLen,)2108
+3744 y(char*)428 b(source,)2108 3848 y(unsigned)46 b(int)94
+b(sourceLen,)2108 3951 y(int)524 b(small,)2108 4055 y(int)g(verbosity)
+46 b(\);)150 4212 y Fl(A)m(ttempts)24 b(to)g(decompress)f(the)g(data)g
+(in)f Fj(source[0)28 b(..)i(sourceLen-1])20 b Fl(in)m(to)j(the)g
+(destination)f(bu\013er,)150 4322 y Fj(dest[0)29 b(..)g(*destLen-1])p
+Fl(.)37 b(If)26 b(the)g(destination)g(bu\013er)f(is)h(big)f(enough,)j
+Fj(*destLen)c Fl(is)h(set)i(to)g(the)g(size)150 4431
+y(of)21 b(the)g(uncompressed)e(data,)24 b(and)c Fj(BZ_OK)f
+Fl(is)h(returned.)36 b(If)20 b(the)h(compressed)g(data)g(w)m(on't)h
+(\014t,)g Fj(*destLen)150 4541 y Fl(is)29 b(unc)m(hanged,)i(and)e
+Fj(BZ_OUTBUFF_FULL)e Fl(is)i(returned.)150 4698 y Fj(source)g
+Fl(is)g(assumed)h(to)h(hold)e(a)i(complete)f Fj(bzip2)f
+Fl(format)i(data)g(stream.)150 4807 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)
+22 b Fl(tries)28 b(to)i(decompress)e(the)h(en)m(tiret)m(y)g(of)g(the)f
+(stream)h(in)m(to)g(the)f(out-)150 4917 y(put)i(bu\013er.)150
+5074 y(F)-8 b(or)31 b(the)g(meaning)e(of)i(parameters)g
+Fj(small)e Fl(and)g Fj(verbosity)p Fl(,)f(see)j Fj
+(BZ2_bzDecompressInit)p Fl(.)150 5230 y(Because)j(the)f(compression)e
+(ratio)i(of)g(the)g(compressed)f(data)h(cannot)g(b)s(e)f(kno)m(wn)g(in)
+g(adv)-5 b(ance,)34 b(there)150 5340 y(is)d(no)h(easy)g(w)m(a)m(y)h(to)
+f(guaran)m(tee)i(that)e(the)g(output)f(bu\013er)g(will)e(b)s(e)i(big)g
+(enough.)45 b(Y)-8 b(ou)32 b(ma)m(y)h(of)f(course)p eop
+%%Page: 28 29
+28 28 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(28)150 299 y(mak)m(e)36
+b(arrangemen)m(ts)f(in)e(y)m(our)i(co)s(de)g(to)g(record)g(the)g(size)f
+(of)h(the)g(uncompressed)f(data,)i(but)e(suc)m(h)h(a)150
+408 y(mec)m(hanism)30 b(is)f(b)s(ey)m(ond)h(the)g(scop)s(e)h(of)f(this)
+g(library)-8 b(.)150 565 y Fj(BZ2_bzBuffToBuffDecompre)o(ss)25
+b Fl(will)k(not)j(write)e(data)j(at)f(or)f(b)s(ey)m(ond)g
+Fj(dest[*destLen])p Fl(,)d(ev)m(en)k(in)150 675 y(case)f(of)g(bu\013er)
+e(o)m(v)m(er\015o)m(w.)150 832 y(P)m(ossible)g(return)h(v)-5
+b(alues:)572 983 y Fj(BZ_CONFIG_ERROR)663 1087 y Fl(if)29
+b(the)i(library)d(has)i(b)s(een)f(mis-compiled)572 1190
+y Fj(BZ_PARAM_ERROR)663 1294 y Fl(if)g Fj(dest)g Fl(is)h
+Fj(NULL)f Fl(or)h Fj(destLen)f Fl(is)g Fj(NULL)663 1398
+y Fl(or)h Fj(small)46 b(!=)i(0)f(&&)g(small)g(!=)g(1)663
+1502 y Fl(or)30 b Fj(verbosity)45 b(<)j(0)30 b Fl(or)g
+Fj(verbosity)45 b(>)j(4)572 1605 y(BZ_MEM_ERROR)663 1709
+y Fl(if)29 b(insu\016cien)m(t)g(memory)h(is)f(a)m(v)-5
+b(ailable)572 1813 y Fj(BZ_OUTBUFF_FULL)663 1917 y Fl(if)29
+b(the)i(size)f(of)g(the)h(compressed)f(data)h(exceeds)g
+Fj(*destLen)572 2021 y(BZ_DATA_ERROR)663 2124 y Fl(if)e(a)i(data)g(in)m
+(tegrit)m(y)f(error)g(w)m(as)h(detected)h(in)d(the)h(compressed)g(data)
+572 2228 y Fj(BZ_DATA_ERROR_MAGIC)663 2332 y Fl(if)f(the)i(compressed)f
+(data)h(do)s(esn't)f(b)s(egin)f(with)g(the)i(righ)m(t)e(magic)i(b)m
+(ytes)572 2436 y Fj(BZ_UNEXPECTED_EOF)663 2539 y Fl(if)e(the)i
+(compressed)f(data)h(ends)e(unexp)s(ectedly)572 2643
+y Fj(BZ_OK)663 2747 y Fl(otherwise)150 3116 y Fk(3.6)68
+b Fd(zlib)43 b Fk(compatibilit)l(y)k(functions)150 3308
+y Fl(Y)-8 b(oshiok)j(a)33 b(Tsuneo)e(has)h(con)m(tributed)g(some)g
+(functions)f(to)i(giv)m(e)g(b)s(etter)f Fj(zlib)f Fl(compatibilit)m(y)
+-8 b(.)45 b(These)150 3418 y(functions)36 b(are)i Fj(BZ2_bzopen)p
+Fl(,)e Fj(BZ2_bzread)p Fl(,)h Fj(BZ2_bzwrite)p Fl(,)f
+Fj(BZ2_bzflush)p Fl(,)h Fj(BZ2_bzclose)p Fl(,)f Fj(BZ2_)150
+3527 y(bzerror)23 b Fl(and)h Fj(BZ2_bzlibVersion)p Fl(.)34
+b(These)25 b(functions)e(are)j(not)f(\(y)m(et\))h(o\016cially)e(part)h
+(of)g(the)g(library)-8 b(.)150 3637 y(If)30 b(they)g(break,)h(y)m(ou)g
+(get)g(to)g(k)m(eep)g(all)f(the)g(pieces.)41 b(Nev)m(ertheless,)31
+b(I)f(think)f(they)i(w)m(ork)f(ok.)390 3788 y Fj(typedef)46
+b(void)g(BZFILE;)390 3995 y(const)g(char)h(*)g(BZ2_bzlibVersion)d(\()j
+(void)g(\);)150 4152 y Fl(Returns)29 b(a)i(string)f(indicating)e(the)i
+(library)e(v)m(ersion.)390 4303 y Fj(BZFILE)46 b(*)i(BZ2_bzopen)92
+b(\()48 b(const)e(char)h(*path,)f(const)g(char)h(*mode)f(\);)390
+4407 y(BZFILE)g(*)i(BZ2_bzdopen)c(\()k(int)381 b(fd,)190
+b(const)46 b(char)h(*mode)f(\);)150 4564 y Fl(Op)s(ens)19
+b(a)j Fj(.bz2)e Fl(\014le)g(for)g(reading)g(or)h(writing,)g(using)f
+(either)g(its)h(name)g(or)g(a)g(pre-existing)f(\014le)g(descriptor.)150
+4674 y(Analogous)30 b(to)i Fj(fopen)c Fl(and)i Fj(fdopen)p
+Fl(.)390 4825 y Fj(int)47 b(BZ2_bzread)93 b(\()47 b(BZFILE*)f(b,)h
+(void*)f(buf,)h(int)g(len)g(\);)390 4928 y(int)g(BZ2_bzwrite)e(\()i
+(BZFILE*)f(b,)h(void*)f(buf,)h(int)g(len)g(\);)150 5085
+y Fl(Reads/writes)30 b(data)h(from/to)g(a)g(previously)d(op)s(ened)i
+Fj(BZFILE)p Fl(.)39 b(Analogous)30 b(to)h Fj(fread)e
+Fl(and)h Fj(fwrite)p Fl(.)390 5236 y Fj(int)95 b(BZ2_bzflush)44
+b(\()k(BZFILE*)e(b)h(\);)390 5340 y(void)g(BZ2_bzclose)d(\()k(BZFILE*)e
+(b)h(\);)p eop
+%%Page: 29 30
+29 29 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(29)150 299 y(Flushes/closes)27
+b(a)h Fj(BZFILE)p Fl(.)39 b Fj(BZ2_bzflush)24 b Fl(do)s(esn't)k
+(actually)f(do)h(an)m(ything.)39 b(Analogous)28 b(to)h
+Fj(fflush)150 408 y Fl(and)h Fj(fclose)p Fl(.)390 559
+y Fj(const)46 b(char)h(*)g(BZ2_bzerror)e(\()j(BZFILE)e(*b,)h(int)g
+(*errnum)e(\))150 716 y Fl(Returns)31 b(a)i(string)e(describing)f(the)i
+(more)g(recen)m(t)h(error)f(status)h(of)f Fj(b)p Fl(,)g(and)g(also)g
+(sets)h Fj(*errnum)d Fl(to)j(its)150 826 y(n)m(umerical)c(v)-5
+b(alue.)150 1242 y Fk(3.7)68 b(Using)46 b(the)f(library)g(in)g(a)g
+Fd(stdio)p Fk(-free)f(en)l(vironmen)l(t)150 1615 y Ff(3.7.1)63
+b(Getting)40 b(rid)h(of)g Fe(stdio)150 1807 y Fl(In)i(a)g(deeply)g(em)m
+(b)s(edded)f(application,)j(y)m(ou)f(migh)m(t)f(w)m(an)m(t)h(to)g(use)f
+(just)g(the)h(memory-to-memory)150 1917 y(functions.)39
+b(Y)-8 b(ou)30 b(can)f(do)g(this)g(con)m(v)m(enien)m(tly)g(b)m(y)g
+(compiling)e(the)j(library)d(with)h(prepro)s(cessor)g(sym)m(b)s(ol)150
+2026 y Fj(BZ_NO_STDIO)35 b Fl(de\014ned.)63 b(Doing)39
+b(this)e(giv)m(es)h(y)m(ou)h(a)f(library)e(con)m(taining)i(only)f(the)i
+(follo)m(wing)e(eigh)m(t)150 2136 y(functions:)150 2293
+y Fj(BZ2_bzCompressInit)p Fl(,)26 b Fj(BZ2_bzCompress)p
+Fl(,)g Fj(BZ2_bzCompressEnd)150 2402 y(BZ2_bzDecompressInit)p
+Fl(,)f Fj(BZ2_bzDecompress)p Fl(,)h Fj(BZ2_bzDecompressEnd)150
+2512 y(BZ2_bzBuffToBuffCompress)o Fl(,)f Fj(BZ2_bzBuffToBuffDecompre)o
+(ss)150 2669 y Fl(When)30 b(compiled)f(lik)m(e)h(this,)f(all)g
+(functions)g(will)f(ignore)i Fj(verbosity)e Fl(settings.)150
+3006 y Ff(3.7.2)63 b(Critical)40 b(error)h(handling)150
+3199 y Fj(libbzip2)20 b Fl(con)m(tains)j(a)g(n)m(um)m(b)s(er)f(of)g(in)
+m(ternal)g(assertion)g(c)m(hec)m(ks)i(whic)m(h)d(should,)i(needless)f
+(to)h(sa)m(y)-8 b(,)26 b(nev)m(er)150 3308 y(b)s(e)g(activ)-5
+b(ated.)40 b(Nev)m(ertheless,)28 b(if)d(an)i(assertion)f(should)e
+(fail,)i(b)s(eha)m(viour)f(dep)s(ends)f(on)j(whether)e(or)i(not)150
+3418 y(the)k(library)d(w)m(as)i(compiled)f(with)g Fj(BZ_NO_STDIO)e
+Fl(set.)150 3575 y(F)-8 b(or)31 b(a)g(normal)e(compile,)h(an)g
+(assertion)g(failure)f(yields)f(the)j(message)533 3726
+y Fj(bzip2/libbzip2:)44 b(internal)h(error)i(number)f(N.)533
+3829 y(This)h(is)g(a)g(bug)g(in)h(bzip2/libbzip2,)43
+b(1.0)k(of)g(21-Mar-2000.)533 3933 y(Please)f(report)g(it)i(to)f(me)g
+(at:)g(jseward@acm.org.)91 b(If)47 b(this)g(happened)533
+4037 y(when)g(you)g(were)f(using)h(some)f(program)g(which)h(uses)f
+(libbzip2)g(as)h(a)533 4141 y(component,)e(you)i(should)f(also)h
+(report)f(this)h(bug)f(to)i(the)f(author\(s\))533 4244
+y(of)g(that)g(program.)93 b(Please)46 b(make)h(an)g(effort)f(to)h
+(report)g(this)f(bug;)533 4348 y(timely)g(and)h(accurate)f(bug)h
+(reports)e(eventually)g(lead)i(to)g(higher)533 4452 y(quality)f
+(software.)93 b(Thanks.)h(Julian)46 b(Seward,)f(21)j(March)e(2000.)150
+4609 y Fl(where)30 b Fj(N)g Fl(is)f(some)i(error)f(co)s(de)h(n)m(um)m
+(b)s(er.)39 b Fj(exit\(3\))28 b Fl(is)i(then)g(called.)150
+4766 y(F)-8 b(or)31 b(a)g Fj(stdio)p Fl(-free)e(library)-8
+b(,)29 b(assertion)h(failures)e(result)i(in)f(a)i(call)e(to)i(a)g
+(function)e(declared)h(as:)533 4917 y Fj(extern)46 b(void)h
+(bz_internal_error)c(\()k(int)g(errcode)f(\);)150 5074
+y Fl(The)30 b(relev)-5 b(an)m(t)31 b(co)s(de)f(is)g(passed)f(as)i(a)g
+(parameter.)41 b(Y)-8 b(ou)31 b(should)d(supply)g(suc)m(h)i(a)h
+(function.)150 5230 y(In)g(either)g(case,)j(once)e(an)g(assertion)g
+(failure)e(has)h(o)s(ccurred,)h(an)m(y)g Fj(bz_stream)e
+Fl(records)h(in)m(v)m(olv)m(ed)h(can)150 5340 y(b)s(e)e(regarded)g(as)h
+(in)m(v)-5 b(alid.)38 b(Y)-8 b(ou)31 b(should)d(not)j(attempt)g(to)g
+(resume)f(normal)g(op)s(eration)f(with)g(them.)p eop
+%%Page: 30 31
+30 30 bop 150 -116 a Fl(Chapter)30 b(3:)41 b(Programming)29
+b(with)g Fj(libbzip2)1881 b Fl(30)150 299 y(Y)-8 b(ou)22
+b(ma)m(y)-8 b(,)25 b(of)d(course,)h(c)m(hange)g(critical)e(error)g
+(handling)e(to)j(suit)f(y)m(our)g(needs.)38 b(As)21 b(I)h(said)e(ab)s
+(o)m(v)m(e,)25 b(critical)150 408 y(errors)30 b(indicate)g(bugs)g(in)g
+(the)h(library)d(and)i(should)f(not)i(o)s(ccur.)42 b(All)29
+b Fj(")p Fl(normal)p Fj(")h Fl(error)g(situations)g(are)150
+518 y(indicated)f(via)h(error)g(return)f(co)s(des)i(from)f(functions,)f
+(and)g(can)i(b)s(e)f(reco)m(v)m(ered)i(from.)150 798
+y Fk(3.8)68 b(Making)45 b(a)g(Windo)l(ws)h(DLL)150 990
+y Fl(Ev)m(erything)30 b(related)g(to)h(Windo)m(ws)f(has)g(b)s(een)f
+(con)m(tributed)h(b)m(y)g(Y)-8 b(oshiok)j(a)31 b(Tsuneo)150
+1100 y(\()p Fj(QWF00133@niftyserve.or.jp)46 b Fl(/)52
+b Fj(tsuneo-y@is.aist-nara.ac.j)o(p)p Fl(\),)g(so)h(y)m(ou)f(should)f
+(send)150 1210 y(y)m(our)30 b(queries)g(to)h(him)e(\(but)h(p)s(erhaps)e
+(Cc:)41 b(me,)31 b Fj(jseward@acm.org)p Fl(\).)150 1366
+y(My)43 b(v)-5 b(ague)44 b(understanding)d(of)i(what)g(to)h(do)f(is:)65
+b(using)41 b(Visual)h(C)p Fj(++)g Fl(5.0,)48 b(op)s(en)42
+b(the)h(pro)5 b(ject)44 b(\014le)150 1476 y Fj(libbz2.dsp)p
+Fl(,)28 b(and)i(build.)37 b(That's)31 b(all.)150 1633
+y(If)41 b(y)m(ou)g(can't)h(op)s(en)e(the)h(pro)5 b(ject)42
+b(\014le)e(for)h(some)g(reason,)j(mak)m(e)e(a)g(new)e(one,)k(naming)c
+(these)i(\014les:)150 1742 y Fj(blocksort.c)p Fl(,)28
+b Fj(bzlib.c)p Fl(,)g Fj(compress.c)p Fl(,)g Fj(crctable.c)p
+Fl(,)g Fj(decompress.c)p Fl(,)f Fj(huffman.c)p Fl(,)150
+1852 y Fj(randtable.c)32 b Fl(and)j Fj(libbz2.def)p Fl(.)53
+b(Y)-8 b(ou)36 b(will)d(also)i(need)g(to)h(name)g(the)g(header)f
+(\014les)f Fj(bzlib.h)g Fl(and)150 1962 y Fj(bzlib_private.h)p
+Fl(.)150 2118 y(If)c(y)m(ou)h(don't)f(use)g(V)m(C)p Fj(++)p
+Fl(,)g(y)m(ou)h(ma)m(y)g(need)f(to)h(de\014ne)f(the)h(propro)s(cessor)e
+(sym)m(b)s(ol)g Fj(_WIN32)p Fl(.)150 2275 y(Finally)-8
+b(,)28 b Fj(dlltest.c)e Fl(is)h(a)i(sample)f(program)g(using)g(the)g
+(DLL.)h(It)g(has)f(a)h(pro)5 b(ject)29 b(\014le,)g Fj(dlltest.dsp)p
+Fl(.)150 2432 y(If)h(y)m(ou)h(just)e(w)m(an)m(t)j(a)e(mak)m(e\014le)h
+(for)f(Visual)f(C,)h(ha)m(v)m(e)i(a)e(lo)s(ok)g(at)i
+Fj(makefile.msc)p Fl(.)150 2589 y(Be)k(a)m(w)m(are)g(that)g(if)e(y)m
+(ou)h(compile)f Fj(bzip2)g Fl(itself)g(on)h(Win32,)h(y)m(ou)g(m)m(ust)f
+(set)g Fj(BZ_UNIX)e Fl(to)j(0)f(and)g Fj(BZ_)150 2698
+y(LCCWIN32)27 b Fl(to)j(1,)g(in)f(the)g(\014le)g Fj(bzip2.c)p
+Fl(,)e(b)s(efore)i(compiling.)39 b(Otherwise)28 b(the)h(resulting)f
+(binary)f(w)m(on't)150 2808 y(w)m(ork)j(correctly)-8
+b(.)150 2965 y(I)30 b(ha)m(v)m(en't)i(tried)d(an)m(y)i(of)g(this)e
+(stu\013)h(m)m(yself,)g(but)g(it)f(all)h(lo)s(oks)g(plausible.)p
+eop
+%%Page: 31 32
+31 31 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(31)150 299 y Fh(4)80 b(Miscellanea)150 583 y Fl(These)30
+b(are)h(just)f(some)g(random)g(though)m(ts)h(of)f(mine.)40
+b(Y)-8 b(our)30 b(mileage)h(ma)m(y)g(v)-5 b(ary)d(.)150
+884 y Fk(4.1)68 b(Limitations)47 b(of)e(the)g(compressed)g(\014le)h
+(format)150 1077 y Fj(bzip2-1.0)p Fl(,)e Fj(0.9.5)e Fl(and)g
+Fj(0.9.0)g Fl(use)h(exactly)h(the)f(same)h(\014le)e(format)i(as)f(the)h
+(previous)d(v)m(ersion,)150 1186 y Fj(bzip2-0.1)p Fl(.)75
+b(This)41 b(decision)g(w)m(as)i(made)g(in)e(the)i(in)m(terests)g(of)g
+(stabilit)m(y)-8 b(.)77 b(Creating)42 b(y)m(et)i(another)150
+1296 y(incompatible)21 b(compressed)i(\014le)f(format)i(w)m(ould)e
+(create)i(further)e(confusion)g(and)h(disruption)d(for)j(users.)150
+1453 y(Nev)m(ertheless,)31 b(this)e(is)g(not)h(a)g(painless)e
+(decision.)39 b(Dev)m(elopmen)m(t)31 b(w)m(ork)f(since)f(the)h(release)
+h(of)f Fj(bzip2-)150 1562 y(0.1)19 b Fl(in)g(August)i(1997)h(has)e(sho)
+m(wn)f(complexities)h(in)f(the)h(\014le)g(format)g(whic)m(h)f(slo)m(w)h
+(do)m(wn)g(decompression)150 1672 y(and,)30 b(in)f(retrosp)s(ect,)i
+(are)g(unnecessary)-8 b(.)40 b(These)31 b(are:)225 1829
+y Fi(\017)60 b Fl(The)20 b(run-length)g(enco)s(der,)i(whic)m(h)e(is)g
+(the)h(\014rst)f(of)h(the)g(compression)f(transformations,)i(is)e(en)m
+(tirely)330 1938 y(irrelev)-5 b(an)m(t.)63 b(The)38 b(original)e(purp)s
+(ose)g(w)m(as)j(to)g(protect)g(the)f(sorting)g(algorithm)f(from)g(the)i
+(v)m(ery)330 2048 y(w)m(orst)h(case)h(input:)58 b(a)41
+b(string)e(of)h(rep)s(eated)g(sym)m(b)s(ols.)68 b(But)40
+b(algorithm)f(steps)h(Q6a)h(and)e(Q6b)330 2157 y(in)30
+b(the)i(original)e(Burro)m(ws-Wheeler)i(tec)m(hnical)g(rep)s(ort)f
+(\(SR)m(C-124\))i(sho)m(w)f(ho)m(w)g(rep)s(eats)g(can)g(b)s(e)330
+2267 y(handled)c(without)i(di\016cult)m(y)f(in)g(blo)s(c)m(k)h
+(sorting.)225 2409 y Fi(\017)60 b Fl(The)30 b(randomisation)e(mec)m
+(hanism)i(do)s(esn't)g(really)f(need)h(to)g(b)s(e)g(there.)41
+b(Udi)29 b(Man)m(b)s(er)h(and)f(Gene)330 2518 y(My)m(ers)j(published)c
+(a)33 b(su\016x)e(arra)m(y)h(construction)f(algorithm)g(a)h(few)g(y)m
+(ears)h(bac)m(k,)g(whic)m(h)d(can)j(b)s(e)330 2628 y(emplo)m(y)m(ed)27
+b(to)h(sort)g(an)m(y)f(blo)s(c)m(k,)h(no)f(matter)h(ho)m(w)f(rep)s
+(etitiv)m(e,)h(in)d(O\(N)j(log)f(N\))h(time.)39 b(Subsequen)m(t)330
+2737 y(w)m(ork)25 b(b)m(y)f(Kunihik)m(o)f(Sadak)-5 b(ane)24
+b(has)h(pro)s(duced)e(a)i(deriv)-5 b(ativ)m(e)24 b(O\(N)h(\(log)g(N\))p
+Fj(^)p Fl(2\))h(algorithm)d(whic)m(h)330 2847 y(usually)28
+b(outp)s(erforms)h(the)i(Man)m(b)s(er-My)m(ers)g(algorithm.)330
+2988 y(I)g(could)g(ha)m(v)m(e)i(c)m(hanged)f(to)g(Sadak)-5
+b(ane's)32 b(algorithm,)f(but)g(I)g(\014nd)f(it)h(to)h(b)s(e)f(slo)m(w)
+m(er)h(than)f Fj(bzip2)p Fl('s)330 3098 y(existing)38
+b(algorithm)g(for)h(most)h(inputs,)f(and)g(the)g(randomisation)f(mec)m
+(hanism)g(protects)i(ade-)330 3208 y(quately)34 b(against)f(bad)g
+(cases.)52 b(I)33 b(didn't)f(think)g(it)i(w)m(as)g(a)g(go)s(o)s(d)f
+(tradeo\013)i(to)f(mak)m(e.)51 b(P)m(artly)34 b(this)330
+3317 y(is)39 b(due)h(to)h(the)f(fact)h(that)g(I)f(w)m(as)g(not)h(\015o)
+s(o)s(ded)e(with)g(email)g(complain)m(ts)g(ab)s(out)h
+Fj(bzip2-0.1)p Fl('s)330 3427 y(p)s(erformance)30 b(on)g(rep)s(etitiv)m
+(e)g(data,)h(so)g(p)s(erhaps)d(it)i(isn't)g(a)h(problem)d(for)j(real)f
+(inputs.)330 3568 y(Probably)i(the)h(b)s(est)g(long-term)g(solution,)g
+(and)g(the)g(one)h(I)f(ha)m(v)m(e)h(incorp)s(orated)e(in)m(to)i(0.9.5)h
+(and)330 3678 y(ab)s(o)m(v)m(e,)42 b(is)c(to)h(use)f(the)h(existing)f
+(sorting)g(algorithm)f(initially)-8 b(,)38 b(and)g(fall)f(bac)m(k)i(to)
+h(a)f(O\(N)f(\(log)330 3787 y(N\))p Fj(^)p Fl(2\))31
+b(algorithm)f(if)f(the)i(standard)e(algorithm)h(gets)h(in)m(to)f
+(di\016culties.)225 3929 y Fi(\017)60 b Fl(The)31 b(compressed)f
+(\014le)g(format)i(w)m(as)f(nev)m(er)h(designed)d(to)j(b)s(e)f(handled)
+e(b)m(y)i(a)g(library)-8 b(,)29 b(and)i(I)g(ha)m(v)m(e)330
+4039 y(had)d(to)i(jump)e(though)g(some)i(ho)s(ops)e(to)i(pro)s(duce)e
+(an)h(e\016cien)m(t)g(implemen)m(tation)f(of)h(decompres-)330
+4148 y(sion.)38 b(It's)26 b(a)h(bit)e(hairy)-8 b(.)38
+b(T)-8 b(ry)26 b(passing)f Fj(decompress.c)d Fl(through)k(the)g(C)f
+(prepro)s(cessor)g(and)h(y)m(ou'll)330 4258 y(see)32
+b(what)g(I)f(mean.)45 b(Muc)m(h)32 b(of)g(this)e(complexit)m(y)i(could)
+f(ha)m(v)m(e)i(b)s(een)e(a)m(v)m(oided)h(if)e(the)i(compressed)330
+4367 y(size)e(of)h(eac)m(h)g(blo)s(c)m(k)f(of)h(data)g(w)m(as)g
+(recorded)f(in)f(the)h(data)h(stream.)225 4509 y Fi(\017)60
+b Fl(An)30 b(Adler-32)g(c)m(hec)m(ksum,)i(rather)e(than)g(a)h(CR)m(C32)
+g(c)m(hec)m(ksum,)g(w)m(ould)e(b)s(e)h(faster)h(to)g(compute.)150
+4698 y(It)e(w)m(ould)f(b)s(e)g(fair)g(to)h(sa)m(y)h(that)g(the)f
+Fj(bzip2)e Fl(format)i(w)m(as)h(frozen)f(b)s(efore)f(I)h(prop)s(erly)d
+(and)j(fully)d(under-)150 4807 y(sto)s(o)s(d)k(the)h(p)s(erformance)e
+(consequences)i(of)g(doing)e(so.)150 4964 y(Impro)m(v)m(emen)m(ts)d
+(whic)m(h)e(I)i(w)m(as)g(able)f(to)h(incorp)s(orate)f(in)m(to)g(0.9.0,)
+k(despite)24 b(using)g(the)i(same)g(\014le)e(format,)150
+5074 y(are:)225 5230 y Fi(\017)60 b Fl(Single)30 b(arra)m(y)i(implemen)
+m(tation)e(of)h(the)h(in)m(v)m(erse)f(BWT.)h(This)e(signi\014can)m(tly)
+f(sp)s(eeds)i(up)f(decom-)330 5340 y(pression,)f(presumably)f(b)s
+(ecause)i(it)g(reduces)g(the)h(n)m(um)m(b)s(er)e(of)i(cac)m(he)h
+(misses.)p eop
+%%Page: 32 33
+32 32 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(32)225 299 y Fi(\017)60 b Fl(F)-8 b(aster)27 b(in)m(v)m(erse)e(MTF)h
+(transform)f(for)g(large)h(MTF)f(v)-5 b(alues.)39 b(The)25
+b(new)g(implemen)m(tation)f(is)g(based)330 408 y(on)30
+b(the)h(notion)f(of)g(sliding)e(blo)s(c)m(ks)h(of)i(v)-5
+b(alues.)225 544 y Fi(\017)60 b Fj(bzip2-0.9.0)24 b Fl(no)m(w)k(reads)f
+(and)f(writes)h(\014les)f(with)g Fj(fread)g Fl(and)h
+Fj(fwrite)p Fl(;)f(v)m(ersion)h(0.1)i(used)d Fj(putc)330
+653 y Fl(and)k Fj(getc)p Fl(.)39 b(Duh!)h(W)-8 b(ell,)31
+b(y)m(ou)f(liv)m(e)g(and)g(learn.)150 836 y(F)-8 b(urther)30
+b(ahead,)g(it)f(w)m(ould)g(b)s(e)g(nice)h(to)g(b)s(e)g(able)f(to)i(do)e
+(random)g(access)j(in)m(to)d(\014les.)40 b(This)28 b(will)f(require)150
+945 y(some)k(careful)e(design)h(of)g(compressed)g(\014le)g(formats.)150
+1227 y Fk(4.2)68 b(P)l(ortabilit)l(y)47 b(issues)150
+1419 y Fl(After)36 b(some)g(consideration,)g(I)f(ha)m(v)m(e)i(decided)d
+(not)i(to)g(use)g(GNU)g Fj(autoconf)d Fl(to)j(con\014gure)g(0.9.5)h(or)
+150 1529 y(1.0.)150 1686 y Fj(autoconf)p Fl(,)31 b(admirable)g(and)h(w)
+m(onderful)f(though)i(it)f(is,)h(mainly)d(assists)j(with)e(p)s
+(ortabilit)m(y)g(problems)150 1795 y(b)s(et)m(w)m(een)f(Unix-lik)m(e)d
+(platforms.)40 b(But)29 b Fj(bzip2)f Fl(do)s(esn't)h(ha)m(v)m(e)h(m)m
+(uc)m(h)f(in)f(the)h(w)m(a)m(y)h(of)g(p)s(ortabilit)m(y)d(prob-)150
+1905 y(lems)35 b(on)h(Unix;)j(most)d(of)g(the)h(di\016culties)d(app)s
+(ear)h(when)g(p)s(orting)g(to)i(the)f(Mac,)j(or)d(to)h(Microsoft's)150
+2015 y(op)s(erating)26 b(systems.)40 b Fj(autoconf)25
+b Fl(do)s(esn't)h(help)g(in)f(those)j(cases,)h(and)d(brings)f(in)g(a)j
+(whole)e(load)g(of)h(new)150 2124 y(complexit)m(y)-8
+b(.)150 2281 y(Most)28 b(p)s(eople)f(should)f(b)s(e)h(able)g(to)h
+(compile)e(the)i(library)d(and)i(program)h(under)e(Unix)g(straigh)m(t)i
+(out-of-)150 2391 y(the-b)s(o)m(x,)j(so)g(to)g(sp)s(eak,)f(esp)s
+(ecially)f(if)g(y)m(ou)i(ha)m(v)m(e)g(a)g(v)m(ersion)f(of)g(GNU)h(C)f
+(a)m(v)-5 b(ailable.)150 2547 y(There)32 b(are)h(a)g(couple)f(of)h
+Fj(__inline__)d Fl(directiv)m(es)i(in)f(the)i(co)s(de.)48
+b(GNU)33 b(C)f(\()p Fj(gcc)p Fl(\))g(should)f(b)s(e)h(able)g(to)150
+2657 y(handle)24 b(them.)39 b(If)25 b(y)m(ou're)i(not)e(using)g(GNU)h
+(C,)f(y)m(our)h(C)f(compiler)f(shouldn't)g(see)i(them)f(at)i(all.)38
+b(If)25 b(y)m(our)150 2767 y(compiler)k(do)s(es,)i(for)g(some)g
+(reason,)h(see)f(them)g(and)f(do)s(esn't)h(lik)m(e)f(them,)i(just)e
+Fj(#define)f(__inline__)150 2876 y Fl(to)37 b(b)s(e)f
+Fj(/*)30 b(*/)p Fl(.)58 b(One)36 b(easy)h(w)m(a)m(y)g(to)h(do)e(this)f
+(is)h(to)h(compile)e(with)g(the)i(\015ag)g Fj(-D__inline__=)p
+Fl(,)d(whic)m(h)150 2986 y(should)28 b(b)s(e)i(understo)s(o)s(d)f(b)m
+(y)h(most)h(Unix)e(compilers.)150 3143 y(If)35 b(y)m(ou)g(still)e(ha)m
+(v)m(e)j(di\016culties,)e(try)h(compiling)e(with)g(the)j(macro)f
+Fj(BZ_STRICT_ANSI)c Fl(de\014ned.)54 b(This)150 3252
+y(should)28 b(enable)i(y)m(ou)h(to)g(build)d(the)i(library)e(in)h(a)i
+(strictly)f(ANSI)g(complian)m(t)f(en)m(vironmen)m(t.)41
+b(Building)150 3362 y(the)25 b(program)f(itself)f(lik)m(e)g(this)h(is)f
+(dangerous)h(and)g(not)g(supp)s(orted,)g(since)g(y)m(ou)h(remo)m(v)m(e)
+g Fj(bzip2)p Fl('s)e(c)m(hec)m(ks)150 3471 y(against)30
+b(compressing)f(directories,)g(sym)m(b)s(olic)g(links,)f(devices,)i
+(and)f(other)h(not-really-a-\014le)g(en)m(tities.)150
+3581 y(This)f(could)g(cause)i(\014lesystem)f(corruption!)150
+3738 y(One)e(other)i(thing:)39 b(if)27 b(y)m(ou)j(create)g(a)f
+Fj(bzip2)f Fl(binary)f(for)i(public)d(distribution,)g(please)i(try)h
+(and)g(link)d(it)150 3847 y(statically)g(\()p Fj(gcc)k(-s)p
+Fl(\).)39 b(This)25 b(a)m(v)m(oids)i(all)f(sorts)h(of)g(library-v)m
+(ersion)d(issues)h(that)i(others)g(ma)m(y)g(encoun)m(ter)150
+3957 y(later)j(on.)150 4114 y(If)f(y)m(ou)g(build)e Fj(bzip2)h
+Fl(on)h(Win32,)h(y)m(ou)f(m)m(ust)g(set)h Fj(BZ_UNIX)e
+Fl(to)i(0)f(and)g Fj(BZ_LCCWIN32)d Fl(to)k(1,)g(in)e(the)i(\014le)150
+4223 y Fj(bzip2.c)p Fl(,)f(b)s(efore)h(compiling.)38
+b(Otherwise)29 b(the)i(resulting)d(binary)h(w)m(on't)i(w)m(ork)f
+(correctly)-8 b(.)150 4505 y Fk(4.3)68 b(Rep)t(orting)46
+b(bugs)150 4698 y Fl(I)25 b(tried)f(prett)m(y)i(hard)e(to)i(mak)m(e)g
+(sure)f Fj(bzip2)e Fl(is)i(bug)f(free,)j(b)s(oth)d(b)m(y)h(design)f
+(and)h(b)m(y)g(testing.)39 b(Hop)s(efully)150 4807 y(y)m(ou'll)29
+b(nev)m(er)i(need)f(to)h(read)g(this)e(section)h(for)h(real.)150
+4964 y(Nev)m(ertheless,)36 b(if)c Fj(bzip2)h Fl(dies)g(with)f(a)i
+(segmen)m(tation)h(fault,)g(a)f(bus)f(error)g(or)h(an)g(in)m(ternal)e
+(assertion)150 5074 y(failure,)i(it)h(will)d(ask)j(y)m(ou)g(to)g(email)
+f(me)h(a)g(bug)f(rep)s(ort.)54 b(Exp)s(erience)33 b(with)h(v)m(ersion)g
+(0.1)i(sho)m(ws)e(that)150 5183 y(almost)c(all)g(these)h(problems)d
+(can)j(b)s(e)f(traced)h(to)g(either)f(compiler)e(bugs)i(or)g(hardw)m
+(are)g(problems.)225 5340 y Fi(\017)60 b Fl(Recompile)22
+b(the)h(program)g(with)f(no)h(optimisation,)g(and)f(see)i(if)e(it)g(w)m
+(orks.)39 b(And/or)22 b(try)h(a)g(di\013eren)m(t)p eop
+%%Page: 33 34
+33 33 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(33)330 299 y(compiler.)77 b(I)43 b(heard)f(all)g(sorts)h(of)h
+(stories)e(ab)s(out)h(v)-5 b(arious)42 b(\015a)m(v)m(ours)h(of)h(GNU)f
+(C)g(\(and)g(other)330 408 y(compilers\))20 b(generating)i(bad)e(co)s
+(de)i(for)f Fj(bzip2)p Fl(,)h(and)f(I'v)m(e)h(run)e(across)i(t)m(w)m(o)
+g(suc)m(h)f(examples)g(m)m(yself.)330 606 y(2.7.X)35
+b(v)m(ersions)e(of)g(GNU)h(C)f(are)h(kno)m(wn)f(to)h(generate)h(bad)d
+(co)s(de)i(from)f(time)g(to)h(time,)g(at)g(high)330 716
+y(optimisation)20 b(lev)m(els.)37 b(If)21 b(y)m(ou)g(get)i(problems,)e
+(try)g(using)f(the)i(\015ags)f Fj(-O2)f(-fomit-frame-pointer)330
+825 y(-fno-strength-reduce)p Fl(.)35 b(Y)-8 b(ou)31 b(should)d(sp)s
+(eci\014cally)h Fc(not)j Fl(use)e Fj(-funroll-loops)p
+Fl(.)330 1023 y(Y)-8 b(ou)38 b(ma)m(y)g(notice)g(that)g(the)g(Mak)m
+(e\014le)g(runs)e(six)g(tests)i(as)g(part)f(of)h(the)g(build)c(pro)s
+(cess.)62 b(If)37 b(the)330 1132 y(program)43 b(passes)g(all)f(of)h
+(these,)k(it's)c(a)h(prett)m(y)f(go)s(o)s(d)g(\(but)g(not)g(100\045\))i
+(indication)c(that)j(the)330 1242 y(compiler)29 b(has)h(done)g(its)g
+(job)g(correctly)-8 b(.)225 1440 y Fi(\017)60 b Fl(If)33
+b Fj(bzip2)f Fl(crashes)i(randomly)-8 b(,)33 b(and)g(the)h(crashes)g
+(are)g(not)g(rep)s(eatable,)g(y)m(ou)g(ma)m(y)g(ha)m(v)m(e)h(a)f
+(\015aky)330 1549 y(memory)k(subsystem.)64 b Fj(bzip2)37
+b Fl(really)g(hammers)h(y)m(our)g(memory)g(hierarc)m(h)m(y)-8
+b(,)41 b(and)d(if)f(it's)h(a)h(bit)330 1659 y(marginal,)33
+b(y)m(ou)h(ma)m(y)g(get)h(these)f(problems.)49 b(Ditto)34
+b(if)f(y)m(our)h(disk)e(or)h(I/O)h(subsystem)e(is)h(slo)m(wly)330
+1768 y(failing.)39 b(Y)-8 b(up,)30 b(this)f(really)g(do)s(es)h(happ)s
+(en.)330 1966 y(T)-8 b(ry)28 b(using)f(a)i(di\013eren)m(t)f(mac)m(hine)
+g(of)h(the)g(same)f(t)m(yp)s(e,)i(and)e(see)h(if)e(y)m(ou)i(can)g(rep)s
+(eat)g(the)f(problem.)225 2163 y Fi(\017)60 b Fl(This)21
+b(isn't)i(really)f(a)h(bug,)i(but)d(...)39 b(If)23 b
+Fj(bzip2)f Fl(tells)g(y)m(ou)h(y)m(our)h(\014le)e(is)g(corrupted)h(on)g
+(decompression,)330 2273 y(and)29 b(y)m(ou)g(obtained)f(the)i(\014le)e
+(via)h(FTP)-8 b(,)29 b(there)h(is)e(a)h(p)s(ossibilit)m(y)d(that)k(y)m
+(ou)f(forgot)h(to)g(tell)e(FTP)h(to)330 2383 y(do)23
+b(a)g(binary)e(mo)s(de)i(transfer.)38 b(That)23 b(absolutely)f(will)e
+(cause)j(the)h(\014le)e(to)h(b)s(e)g(non-decompressible.)330
+2492 y(Y)-8 b(ou'll)30 b(ha)m(v)m(e)h(to)g(transfer)f(it)g(again.)150
+2737 y(If)i(y)m(ou'v)m(e)h(incorp)s(orated)e Fj(libbzip2)f
+Fl(in)m(to)i(y)m(our)g(o)m(wn)g(program)g(and)g(are)g(getting)h
+(problems,)e(please,)150 2847 y(please,)d(please,)h(c)m(hec)m(k)g(that)
+f(the)g(parameters)g(y)m(ou)g(are)g(passing)f(in)f(calls)h(to)h(the)g
+(library)-8 b(,)26 b(are)j(correct,)150 2956 y(and)e(in)f(accordance)k
+(with)c(what)i(the)g(do)s(cumen)m(tation)f(sa)m(ys)h(is)f(allo)m(w)m
+(able.)39 b(I)28 b(ha)m(v)m(e)h(tried)e(to)h(mak)m(e)h(the)150
+3066 y(library)f(robust)i(against)g(suc)m(h)g(problems,)f(but)h(I'm)g
+(sure)g(I)g(ha)m(v)m(en't)h(succeeded.)150 3223 y(Finally)-8
+b(,)32 b(if)g(the)h(ab)s(o)m(v)m(e)i(commen)m(ts)e(don't)g(help,)g(y)m
+(ou'll)f(ha)m(v)m(e)i(to)g(send)e(me)h(a)g(bug)g(rep)s(ort.)48
+b(No)m(w,)34 b(it's)150 3332 y(just)c(amazing)g(ho)m(w)h(man)m(y)f(p)s
+(eople)g(will)d(send)j(me)g(a)h(bug)f(rep)s(ort)g(sa)m(ying)g
+(something)g(lik)m(e)481 3483 y(bzip2)f(crashed)h(with)f(segmen)m
+(tation)j(fault)e(on)g(m)m(y)g(mac)m(hine)150 3640 y(and)h(absolutely)f
+(nothing)h(else.)44 b(Needless)32 b(to)g(sa)m(y)-8 b(,)33
+b(a)f(suc)m(h)f(a)h(rep)s(ort)f(is)g Fc(totally)-8 b(,)32
+b(utterly)-8 b(,)32 b(completely)150 3750 y(and)40 b(comprehensiv)m
+(ely)g(100\045)h(useless;)46 b(a)41 b(w)m(aste)g(of)g(y)m(our)g(time,)i
+(m)m(y)e(time,)i(and)e(net)g(bandwidth)p Fl(.)150 3859
+y(With)31 b(no)h(details)f(at)i(all,)e(there's)h(no)g(w)m(a)m(y)h(I)f
+(can)g(p)s(ossibly)d(b)s(egin)h(to)j(\014gure)e(out)i(what)e(the)i
+(problem)150 3969 y(is.)150 4126 y(The)d(rules)e(of)i(the)g(game)h
+(are:)41 b(facts,)32 b(facts,)f(facts.)41 b(Don't)31
+b(omit)f(them)g(b)s(ecause)g Fj(")p Fl(oh,)g(they)g(w)m(on't)h(b)s(e)
+150 4235 y(relev)-5 b(an)m(t)p Fj(")p Fl(.)41 b(A)m(t)31
+b(the)g(bare)f(minim)m(um:)481 4386 y(Mac)m(hine)h(t)m(yp)s(e.)61
+b(Op)s(erating)29 b(system)h(v)m(ersion.)481 4490 y(Exact)h(v)m(ersion)
+f(of)h Fj(bzip2)e Fl(\(do)h Fj(bzip2)47 b(-V)p Fl(\).)481
+4594 y(Exact)31 b(v)m(ersion)f(of)h(the)f(compiler)f(used.)481
+4698 y(Flags)i(passed)e(to)j(the)e(compiler.)150 4854
+y(Ho)m(w)m(ev)m(er,)i(the)d(most)h(imp)s(ortan)m(t)f(single)f(thing)g
+(that)i(will)d(help)h(me)h(is)f(the)i(\014le)e(that)i(y)m(ou)g(w)m(ere)
+g(trying)150 4964 y(to)f(compress)f(or)g(decompress)g(at)h(the)f(time)g
+(the)g(problem)f(happ)s(ened.)38 b(Without)28 b(that,)h(m)m(y)g(abilit)
+m(y)d(to)150 5074 y(do)k(an)m(ything)g(more)h(than)f(sp)s(eculate)g(ab)
+s(out)g(the)g(cause,)i(is)d(limited.)150 5230 y(Please)34
+b(remem)m(b)s(er)f(that)h(I)f(connect)i(to)f(the)g(In)m(ternet)g(with)e
+(a)i(mo)s(dem,)g(so)f(y)m(ou)h(should)e(con)m(tact)k(me)150
+5340 y(b)s(efore)30 b(mailing)e(me)j(h)m(uge)f(\014les.)p
+eop
+%%Page: 34 35
+34 34 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(34)150 299 y Fk(4.4)68 b(Did)45 b(y)l(ou)g(get)h(the)f(righ)l(t)h
+(pac)l(k)-7 b(age?)150 491 y Fj(bzip2)34 b Fl(is)h(a)h(resource)g(hog.)
+56 b(It)36 b(soaks)g(up)f(large)g(amoun)m(ts)h(of)g(CPU)f(cycles)h(and)
+f(memory)-8 b(.)57 b(Also,)36 b(it)150 601 y(giv)m(es)26
+b(v)m(ery)h(large)f(latencies.)39 b(In)25 b(the)h(w)m(orst)g(case,)i(y)
+m(ou)f(can)f(feed)g(man)m(y)g(megab)m(ytes)h(of)f(uncompressed)150
+711 y(data)45 b(in)m(to)e(the)i(library)c(b)s(efore)j(getting)g(an)m(y)
+g(compressed)g(output,)j(so)d(this)f(probably)f(rules)h(out)150
+820 y(applications)29 b(requiring)e(in)m(teractiv)m(e)32
+b(b)s(eha)m(viour.)150 977 y(These)38 b(aren't)h(faults)e(of)h(m)m(y)g
+(implemen)m(tation,)h(I)f(hop)s(e,)i(but)d(more)h(an)g(in)m(trinsic)e
+(prop)s(ert)m(y)h(of)i(the)150 1087 y(Burro)m(ws-Wheeler)30
+b(transform)g(\(unfortunately\).)40 b(Ma)m(yb)s(e)31
+b(this)e(isn't)h(what)g(y)m(ou)h(w)m(an)m(t.)150 1244
+y(If)h(y)m(ou)h(w)m(an)m(t)g(a)g(compressor)g(and/or)f(library)e(whic)m
+(h)h(is)h(faster,)i(uses)e(less)g(memory)g(but)g(gets)h(prett)m(y)150
+1353 y(go)s(o)s(d)e(compression,)g(and)g(has)h(minimal)c(latency)-8
+b(,)33 b(consider)e(Jean-loup)f(Gailly's)g(and)h(Mark)h(Adler's)150
+1463 y(w)m(ork,)f Fj(zlib-1.1.2)c Fl(and)j Fj(gzip-1.2.4)p
+Fl(.)38 b(Lo)s(ok)31 b(for)f(them)g(at)150 1620 y Fj
+(http://www.cdrom.com/pub)o(/inf)o(ozip)o(/zl)o(ib)24
+b Fl(and)30 b Fj(http://www.gzip.org)25 b Fl(resp)s(ectiv)m(ely)-8
+b(.)150 1776 y(F)g(or)32 b(something)f(faster)i(and)e(ligh)m(ter)f
+(still,)h(y)m(ou)g(migh)m(t)h(try)f(Markus)h(F)g(X)f(J)h(Ob)s(erh)m
+(umer's)d Fj(LZO)i Fl(real-)150 1886 y(time)f
+(compression/decompression)f(library)-8 b(,)28 b(at)150
+1996 y Fj(http://wildsau.idv.uni-l)o(inz.)o(ac.a)o(t/m)o(fx/l)o(zo.h)o
+(tml)o Fl(.)150 2152 y(If)38 b(y)m(ou)h(w)m(an)m(t)g(to)h(use)e(the)g
+Fj(bzip2)g Fl(algorithms)f(to)i(compress)f(small)g(blo)s(c)m(ks)f(of)i
+(data,)j(64k)d(b)m(ytes)g(or)150 2262 y(smaller,)i(for)e(example)g(on)h
+(an)f(on-the-\015y)h(disk)e(compressor,)k(y)m(ou'd)e(b)s(e)f(w)m(ell)g
+(advised)f(not)i(to)g(use)150 2372 y(this)i(library)-8
+b(.)77 b(Instead,)47 b(I'v)m(e)d(made)f(a)h(sp)s(ecial)e(library)f
+(tuned)h(for)h(that)h(kind)d(of)j(use.)79 b(It's)43 b(part)150
+2481 y(of)d Fj(e2compr-0.40)p Fl(,)f(an)g(on-the-\015y)h(disk)e
+(compressor)h(for)h(the)f(Lin)m(ux)f Fj(ext2)h Fl(\014lesystem.)67
+b(Lo)s(ok)40 b(at)150 2591 y Fj(http://www.netspace.net.)o(au/~)o(reit)
+o(er/)o(e2co)o(mpr)p Fl(.)150 2880 y Fk(4.5)68 b(T)-11
+b(esting)150 3072 y Fl(A)30 b(record)h(of)f(the)h(tests)g(I'v)m(e)g
+(done.)150 3229 y(First,)f(some)h(data)g(sets:)225 3386
+y Fi(\017)60 b Fl(B:)32 b(a)f(directory)f(con)m(taining)h(6001)i
+(\014les,)d(one)h(for)g(ev)m(ery)h(length)e(in)g(the)h(range)g(0)h(to)f
+(6000)i(b)m(ytes.)330 3496 y(The)d(\014les)f(con)m(tain)i(random)e(lo)m
+(w)m(ercase)j(letters.)41 b(18.7)32 b(megab)m(ytes.)225
+3633 y Fi(\017)60 b Fl(H:)36 b(m)m(y)f(home)h(directory)f(tree.)56
+b(Do)s(cumen)m(ts,)38 b(source)d(co)s(de,)i(mail)d(\014les,)i
+(compressed)f(data.)57 b(H)330 3743 y(con)m(tains)39
+b(B,)h(and)f(also)g(a)g(directory)g(of)g(\014les)f(designed)g(as)i(b)s
+(oundary)d(cases)j(for)f(the)g(sorting;)330 3853 y(mostly)30
+b(v)m(ery)h(rep)s(etitiv)m(e,)f(nast)m(y)h(\014les.)39
+b(565)32 b(megab)m(ytes.)225 3990 y Fi(\017)60 b Fl(A:)43
+b(directory)f(tree)i(holding)d(v)-5 b(arious)41 b(applications)g(built)
+g(from)h(source:)66 b Fj(egcs)p Fl(,)45 b Fj(gcc-2.8.1)p
+Fl(,)330 4100 y(KDE,)31 b(GTK,)f(Octa)m(v)m(e,)j(etc.)41
+b(2200)33 b(megab)m(ytes.)150 4285 y(The)i(tests)g(conducted)g(are)h
+(as)f(follo)m(ws.)54 b(Eac)m(h)36 b(test)g(means)f(compressing)f(\(a)h
+(cop)m(y)h(of)7 b(\))36 b(eac)m(h)g(\014le)e(in)150 4394
+y(the)d(data)g(set,)g(decompressing)e(it)h(and)g(comparing)f(it)h
+(against)h(the)g(original.)150 4551 y(First,)26 b(a)g(bunc)m(h)f(of)h
+(tests)h(with)d(blo)s(c)m(k)h(sizes)h(and)f(in)m(ternal)g(bu\013er)f
+(sizes)i(set)g(v)m(ery)g(small,)g(to)g(detect)i(an)m(y)150
+4661 y(problems)g(with)g(the)i(blo)s(c)m(king)f(and)g(bu\013ering)e
+(mec)m(hanisms.)40 b(This)28 b(required)g(mo)s(difying)f(the)j(source)
+150 4770 y(co)s(de)h(so)f(as)h(to)g(try)f(to)h(break)g(it.)199
+4927 y(1.)61 b(Data)32 b(set)f(H,)g(with)e(bu\013er)g(size)h(of)h(1)g
+(b)m(yte,)g(and)f(blo)s(c)m(k)g(size)g(of)g(23)i(b)m(ytes.)199
+5065 y(2.)61 b(Data)32 b(set)f(B,)g(bu\013er)e(sizes)h(1)h(b)m(yte,)g
+(blo)s(c)m(k)f(size)g(1)h(b)m(yte.)199 5202 y(3.)61 b(As)30
+b(\(2\))i(but)d(small-mo)s(de)g(decompression.)199 5340
+y(4.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)g(2)h(b)m(ytes.)p
+eop
+%%Page: 35 36
+35 35 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(35)199 299 y(5.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)g(3)h
+(b)m(ytes.)199 431 y(6.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h(size)
+g(4)h(b)m(ytes.)199 564 y(7.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)m(k)h
+(size)g(5)h(b)m(ytes.)199 697 y(8.)61 b(As)30 b(\(2\))i(with)d(blo)s(c)
+m(k)h(size)g(6)h(b)m(ytes)g(and)e(small-mo)s(de)g(decompression.)199
+829 y(9.)61 b(H)30 b(with)g(bu\013er)f(size)h(of)h(1)f(b)m(yte,)i(but)d
+(normal)h(blo)s(c)m(k)g(size)g(\(up)f(to)j(900000)h(b)m(ytes\).)150
+1009 y(Then)c(some)i(tests)g(with)e(unmo)s(di\014ed)f(source)i(co)s
+(de.)199 1166 y(1.)61 b(H,)31 b(all)e(settings)h(normal.)199
+1299 y(2.)61 b(As)30 b(\(1\),)i(with)d(small-mo)s(de)g(decompress.)199
+1431 y(3.)61 b(H,)31 b(compress)f(with)f(\015ag)i Fj(-1)p
+Fl(.)199 1564 y(4.)61 b(H,)31 b(compress)f(with)f(\015ag)i
+Fj(-s)p Fl(,)f(decompress)g(with)f(\015ag)i Fj(-s)p Fl(.)199
+1697 y(5.)61 b(F)-8 b(orw)m(ards)33 b(compatibilit)m(y:)45
+b(H,)33 b Fj(bzip2-0.1pl2)d Fl(compressing,)j Fj(bzip2-0.9.5)d
+Fl(decompressing,)330 1806 y(all)f(settings)i(normal.)199
+1939 y(6.)61 b(Bac)m(kw)m(ards)23 b(compatibilit)m(y:)35
+b(H,)23 b Fj(bzip2-0.9.5)c Fl(compressing,)k Fj(bzip2-0.1pl2)c
+Fl(decompressing,)330 2048 y(all)29 b(settings)i(normal.)199
+2181 y(7.)61 b(Bigger)31 b(tests:)41 b(A,)31 b(all)e(settings)i
+(normal.)199 2314 y(8.)61 b(As)30 b(\(7\),)i(using)d(the)i(fallbac)m(k)
+e(\(Sadak)-5 b(ane-lik)m(e\))31 b(sorting)f(algorithm.)199
+2446 y(9.)61 b(As)30 b(\(8\),)i(compress)e(with)f(\015ag)i
+Fj(-1)p Fl(,)f(decompress)g(with)f(\015ag)i Fj(-s)p Fl(.)154
+2579 y(10.)61 b(H,)31 b(using)e(the)h(fallbac)m(k)g(sorting)g
+(algorithm.)154 2711 y(11.)61 b(F)-8 b(orw)m(ards)33
+b(compatibilit)m(y:)45 b(A,)33 b Fj(bzip2-0.1pl2)d Fl(compressing,)j
+Fj(bzip2-0.9.5)d Fl(decompressing,)330 2821 y(all)f(settings)i(normal.)
+154 2954 y(12.)61 b(Bac)m(kw)m(ards)23 b(compatibilit)m(y:)35
+b(A,)23 b Fj(bzip2-0.9.5)c Fl(compressing,)k Fj(bzip2-0.1pl2)c
+Fl(decompressing,)330 3063 y(all)29 b(settings)i(normal.)154
+3196 y(13.)61 b(Misc)39 b(test:)58 b(ab)s(out)39 b(400)h(megab)m(ytes)h
+(of)e Fj(.tar)f Fl(\014les)f(with)h Fj(bzip2)f Fl(compiled)h(with)f
+(Chec)m(k)m(er)j(\(a)330 3305 y(memory)30 b(access)i(error)e(detector,)
+i(lik)m(e)e(Purify\).)154 3438 y(14.)61 b(Misc)30 b(tests)h(to)g(mak)m
+(e)h(sure)d(it)h(builds)e(and)h(runs)g(ok)i(on)f(non-Lin)m(ux/x86)g
+(platforms.)150 3618 y(These)35 b(tests)h(w)m(ere)f(conducted)g(on)g(a)
+h(225)g(MHz)g(IDT)f(WinChip)d(mac)m(hine,)k(running)d(Lin)m(ux)g
+(2.0.36.)150 3728 y(They)d(represen)m(t)g(nearly)g(a)h(w)m(eek)g(of)f
+(con)m(tin)m(uous)g(computation.)41 b(All)29 b(tests)i(completed)f
+(successfully)-8 b(.)150 4003 y Fk(4.6)68 b(F)-11 b(urther)44
+b(reading)150 4196 y Fj(bzip2)28 b Fl(is)h(not)h(researc)m(h)g(w)m
+(ork,)g(in)e(the)i(sense)g(that)g(it)f(do)s(esn't)g(presen)m(t)h(an)m
+(y)g(new)f(ideas.)40 b(Rather,)30 b(it's)150 4306 y(an)g(engineering)f
+(exercise)i(based)f(on)g(existing)g(ideas.)150 4463 y(F)-8
+b(our)31 b(do)s(cumen)m(ts)f(describ)s(e)e(essen)m(tially)i(all)f(the)i
+(ideas)e(b)s(ehind)f Fj(bzip2)p Fl(:)390 4614 y Fj(Michael)46
+b(Burrows)g(and)h(D.)g(J.)g(Wheeler:)485 4717 y("A)h(block-sorting)c
+(lossless)h(data)i(compression)e(algorithm")533 4821
+y(10th)i(May)g(1994.)533 4925 y(Digital)f(SRC)h(Research)e(Report)i
+(124.)533 5029 y(ftp://ftp.digital.com/pub)o(/DEC)o(/SR)o(C/re)o(sear)o
+(ch-)o(repo)o(rts/)o(SRC)o(-124)o(.ps.)o(gz)533 5132
+y(If)g(you)g(have)g(trouble)f(finding)g(it,)g(try)h(searching)f(at)h
+(the)533 5236 y(New)g(Zealand)f(Digital)g(Library,)f
+(http://www.nzdl.org.)p eop
+%%Page: 36 37
+36 36 bop 150 -116 a Fl(Chapter)30 b(4:)41 b(Miscellanea)2586
+b(36)390 299 y Fj(Daniel)46 b(S.)h(Hirschberg)e(and)i(Debra)g(A.)g
+(LeLewer)485 403 y("Efficient)e(Decoding)h(of)h(Prefix)f(Codes")533
+506 y(Communications)e(of)j(the)g(ACM,)g(April)f(1990,)h(Vol)f(33,)h
+(Number)f(4.)533 610 y(You)h(might)f(be)i(able)e(to)h(get)g(an)h
+(electronic)d(copy)h(of)h(this)676 714 y(from)g(the)g(ACM)g(Digital)f
+(Library.)390 922 y(David)g(J.)i(Wheeler)533 1025 y(Program)e(bred3.c)g
+(and)h(accompanying)d(document)i(bred3.ps.)533 1129 y(This)h(contains)e
+(the)i(idea)g(behind)f(the)h(multi-table)e(Huffman)533
+1233 y(coding)h(scheme.)533 1337 y(ftp://ftp.cl.cam.ac.uk/us)o(ers/)o
+(djw)o(3/)390 1544 y(Jon)h(L.)g(Bentley)f(and)h(Robert)f(Sedgewick)485
+1648 y("Fast)h(Algorithms)e(for)i(Sorting)f(and)g(Searching)g(Strings")
+533 1752 y(Available)f(from)i(Sedgewick's)e(web)i(page,)533
+1856 y(www.cs.princeton.edu/~rs)150 2012 y Fl(The)29
+b(follo)m(wing)f(pap)s(er)g(giv)m(es)h(v)-5 b(aluable)28
+b(additional)g(insigh)m(ts)f(in)m(to)j(the)f(algorithm,)g(but)g(is)f
+(not)i(imme-)150 2122 y(diately)g(the)g(basis)f(of)i(an)m(y)g(co)s(de)f
+(used)g(in)f(bzip2.)390 2273 y Fj(Peter)46 b(Fenwick:)533
+2377 y(Block)h(Sorting)e(Text)i(Compression)533 2481
+y(Proceedings)e(of)i(the)g(19th)g(Australasian)d(Computer)i(Science)f
+(Conference,)629 2584 y(Melbourne,)g(Australia.)92 b(Jan)47
+b(31)g(-)h(Feb)f(2,)g(1996.)533 2688 y(ftp://ftp.cs.auckland.ac.)o
+(nz/p)o(ub/)o(pete)o(r-f/)o(ACS)o(C96p)o(aper)o(.ps)150
+2845 y Fl(Kunihik)m(o)28 b(Sadak)-5 b(ane's)31 b(sorting)e(algorithm,)h
+(men)m(tioned)g(ab)s(o)m(v)m(e,)i(is)d(a)m(v)-5 b(ailable)30
+b(from:)390 2996 y Fj(http://naomi.is.s.u-toky)o(o.ac)o(.jp/)o(~sa)o
+(da/p)o(aper)o(s/S)o(ada9)o(8b.p)o(s.g)o(z)150 3153 y
+Fl(The)41 b(Man)m(b)s(er-My)m(ers)g(su\016x)g(arra)m(y)g(construction)g
+(algorithm)f(is)g(describ)s(ed)f(in)h(a)i(pap)s(er)e(a)m(v)-5
+b(ailable)150 3262 y(from:)390 3413 y Fj(http://www.cs.arizona.ed)o
+(u/pe)o(ople)o(/ge)o(ne/P)o(APER)o(S/s)o(uffi)o(x.ps)150
+3570 y Fl(Finally)d(,)33 b(the)h(follo)m(wing)e(pap)s(er)h(do)s(cumen)m
+(ts)g(some)h(recen)m(t)h(in)m(v)m(estigations)e(I)h(made)f(in)m(to)h
+(the)g(p)s(erfor-)150 3680 y(mance)d(of)f(sorting)g(algorithms:)390
+3831 y Fj(Julian)46 b(Seward:)533 3935 y(On)h(the)g(Performance)e(of)i
+(BWT)g(Sorting)f(Algorithms)533 4038 y(Proceedings)f(of)i(the)g(IEEE)g
+(Data)f(Compression)f(Conference)g(2000)629 4142 y(Snowbird,)g(Utah.)94
+b(28-30)46 b(March)h(2000.)p eop
+%%Page: -1 38
+-1 37 bop 3725 -116 a Fl(i)150 299 y Fh(T)-13 b(able)54
+b(of)g(Con)l(ten)l(ts)150 641 y Fk(1)135 b(In)l(tro)t(duction)15
+b Fb(.)20 b(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f
+(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)60
+b Fk(2)150 911 y(2)135 b(Ho)l(w)45 b(to)h(use)f Fd(bzip2)31
+b Fb(.)19 b(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g
+(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)78 b Fk(3)1047
+1048 y Fl(NAME)20 b Fa(.)c(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50 b Fl(3)1047
+1157 y(SYNOPSIS)21 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)h(.)f(.)g(.)50 b Fl(3)1047 1267 y(DESCRIPTION)10
+b Fa(.)j(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40
+b Fl(3)1047 1377 y(OPTIONS)16 b Fa(.)d(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)45 b Fl(4)1047
+1486 y(MEMOR)-8 b(Y)31 b(MANA)m(GEMENT)14 b Fa(.)j(.)e(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44
+b Fl(6)1047 1596 y(RECO)m(VERING)30 b(D)m(A)-8 b(T)g(A)32
+b(FR)m(OM)f(D)m(AMA)m(GED)i(FILES)1256 1705 y Fa(.)15
+b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)57 b Fl(7)1047 1815 y(PERF)m(ORMANCE)30
+b(NOTES)9 b Fa(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)38 b Fl(7)1047 1924
+y(CA)-10 b(VEA)i(TS)10 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40 b Fl(8)1047 2034
+y(A)m(UTHOR)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 b Fl(8)150 2276 y Fk(3)135
+b(Programming)46 b(with)f Fd(libbzip2)29 b Fb(.)16 b(.)j(.)h(.)f(.)h(.)
+f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)74 b Fk(9)449
+2413 y Fl(3.1)92 b(T)-8 b(op-lev)m(el)30 b(structure)24
+b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)54 b Fl(9)748 2523 y(3.1.1)93 b(Lo)m(w-lev)m(el)30
+b(summary)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)53
+b Fl(9)748 2633 y(3.1.2)93 b(High-lev)m(el)29 b(summary)12
+b Fa(.)i(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)41 b
+Fl(9)748 2742 y(3.1.3)93 b(Utilit)m(y)29 b(functions)g(summary)12
+b Fa(.)h(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)41 b Fl(10)449 2852 y(3.2)92 b(Error)29
+b(handling)18 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(10)449
+2961 y(3.3)92 b(Lo)m(w-lev)m(el)31 b(in)m(terface)d Fa(.)15
+b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)57 b Fl(12)748 3071 y(3.3.1)93 b Fj(BZ2_bzCompressInit)21
+b Fa(.)9 b(.)15 b(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50 b Fl(12)748
+3181 y(3.3.2)93 b Fj(BZ2_bzCompress)9 b Fa(.)h(.)15 b(.)g(.)g(.)g(.)g
+(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)38 b Fl(14)748 3290 y(3.3.3)93
+b Fj(BZ2_bzCompressEnd)23 b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g
+(.)52 b Fl(17)748 3400 y(3.3.4)93 b Fj(BZ2_bzDecompressInit)16
+b Fa(.)9 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45 b Fl(17)748 3509
+y(3.3.5)93 b Fj(BZ2_bzDecompress)21 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)55 b Fl(17)748 3619 y(3.3.6)93 b Fj(BZ2_bzDecompressEnd)18
+b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(19)449
+3729 y(3.4)92 b(High-lev)m(el)30 b(in)m(terface)16 b
+Fa(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)45 b Fl(19)748 3838 y(3.4.1)93 b Fj(BZ2_bzReadOpen)9
+b Fa(.)h(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)38
+b Fl(19)748 3948 y(3.4.2)93 b Fj(BZ2_bzRead)18 b Fa(.)12
+b(.)j(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47
+b Fl(20)748 4057 y(3.4.3)93 b Fj(BZ2_bzReadGetUnused)18
+b Fa(.)10 b(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)48 b Fl(22)748
+4167 y(3.4.4)93 b Fj(BZ2_bzReadClose)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)57 b Fl(22)748 4276 y(3.4.5)93 b
+Fj(BZ2_bzWriteOpen)23 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)57 b Fl(22)748 4386 y(3.4.6)93 b Fj(BZ2_bzWrite)16
+b Fa(.)11 b(.)k(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+45 b Fl(23)748 4496 y(3.4.7)93 b Fj(BZ2_bzWriteClose)21
+b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Fl(23)748
+4605 y(3.4.8)93 b(Handling)28 b(em)m(b)s(edded)h(compressed)h(data)h
+(streams)17 b Fa(.)f(.)f(.)g(.)46 b Fl(24)748 4715 y(3.4.9)93
+b(Standard)29 b(\014le-reading/writing)e(co)s(de)22 b
+Fa(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52
+b Fl(25)449 4824 y(3.5)92 b(Utilit)m(y)29 b(functions)f
+Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)59 b Fl(26)748 4934 y(3.5.1)93 b
+Fj(BZ2_bzBuffToBuffCompres)o(s)22 b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)57 b Fl(26)748
+5044 y(3.5.2)93 b Fj(BZ2_bzBuffToBuffDecompr)o(ess)17
+b Fa(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+53 b Fl(27)449 5153 y(3.6)92 b Fj(zlib)29 b Fl(compatibilit)m(y)g
+(functions)23 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52
+b Fl(28)449 5263 y(3.7)92 b(Using)30 b(the)g(library)e(in)h(a)i
+Fj(stdio)p Fl(-free)e(en)m(vironmen)m(t)23 b Fa(.)15
+b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)52 b Fl(29)p
+eop
+%%Page: -2 39
+-2 38 bop 3699 -116 a Fl(ii)748 83 y(3.7.1)93 b(Getting)31
+b(rid)d(of)j Fj(stdio)20 b Fa(.)13 b(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)49
+b Fl(29)748 193 y(3.7.2)93 b(Critical)28 b(error)i(handling)22
+b Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Fl(29)449 302
+y(3.8)92 b(Making)30 b(a)h(Windo)m(ws)e(DLL)15 b Fa(.)h(.)f(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)44 b Fl(30)150 545
+y Fk(4)135 b(Miscellanea)11 b Fb(.)21 b(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)h
+(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)
+h(.)f(.)g(.)h(.)56 b Fk(31)449 682 y Fl(4.1)92 b(Limitations)29
+b(of)h(the)h(compressed)f(\014le)f(format)9 b Fa(.)15
+b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)38
+b Fl(31)449 791 y(4.2)92 b(P)m(ortabilit)m(y)30 b(issues)14
+b Fa(.)f(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)h(.)f(.)g(.)43 b Fl(32)449 901 y(4.3)92 b(Rep)s(orting)29
+b(bugs)f Fa(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58 b Fl(32)449 1010 y(4.4)92
+b(Did)29 b(y)m(ou)i(get)h(the)e(righ)m(t)g(pac)m(k)-5
+b(age?)22 b Fa(.)17 b(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51
+b Fl(34)449 1120 y(4.5)92 b(T)-8 b(esting)16 b Fa(.)f(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)45 b Fl(34)449 1230 y(4.6)92
+b(F)-8 b(urther)30 b(reading)22 b Fa(.)14 b(.)h(.)g(.)h(.)f(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)51
+b Fl(35)p eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF
diff --git a/bzip2/manual.texi b/bzip2/manual.texi
new file mode 100644
index 000000000..336776ab8
--- /dev/null
+++ b/bzip2/manual.texi
@@ -0,0 +1,2215 @@
+\input texinfo  @c                                  -*- Texinfo -*-
+@setfilename bzip2.info
+
+@ignore
+This file documents bzip2 version 1.0, and associated library
+libbzip2, written by Julian Seward (jseward@acm.org).
+
+Copyright (C) 1996-2000 Julian R Seward
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for verbatim copies.
+@end ignore
+
+@ifinfo
+@format
+START-INFO-DIR-ENTRY
+* Bzip2: (bzip2).		A program and library for data compression.
+END-INFO-DIR-ENTRY
+@end format
+
+@end ifinfo
+
+@iftex
+@c @finalout
+@settitle bzip2 and libbzip2
+@titlepage
+@title bzip2 and libbzip2
+@subtitle a program and library for data compression
+@subtitle copyright (C) 1996-2000 Julian Seward
+@subtitle version 1.0 of 21 March 2000
+@author Julian Seward
+
+@end titlepage
+
+@parindent 0mm
+@parskip 2mm
+
+@end iftex
+@node Top, Overview, (dir), (dir)
+
+This program, @code{bzip2}, 
+and associated library @code{libbzip2}, are
+Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+@itemize @bullet
+@item
+   Redistributions of source code must retain the above copyright
+   notice, this list of conditions and the following disclaimer.
+@item
+   The origin of this software must not be misrepresented; you must 
+   not claim that you wrote the original software.  If you use this 
+   software in a product, an acknowledgment in the product 
+   documentation would be appreciated but is not required.
+@item
+   Altered source versions must be plainly marked as such, and must
+   not be misrepresented as being the original software.
+@item
+   The name of the author may not be used to endorse or promote 
+   products derived from this software without specific prior written 
+   permission.
+@end itemize
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+Julian Seward, Cambridge, UK.
+
+@code{jseward@@acm.org}
+
+@code{http://sourceware.cygnus.com/bzip2}
+
+@code{http://www.cacheprof.org}
+
+@code{http://www.muraroa.demon.co.uk}
+
+@code{bzip2}/@code{libbzip2} version 1.0 of 21 March 2000.
+
+PATENTS: To the best of my knowledge, @code{bzip2} does not use any patented
+algorithms.  However, I do not have the resources available to carry out
+a full patent search.  Therefore I cannot give any guarantee of the
+above statement.
+
+
+
+
+
+
+
+@node Overview, Implementation, Top, Top
+@chapter Introduction
+
+@code{bzip2}  compresses  files  using the Burrows-Wheeler 
+block-sorting text compression algorithm,  and  Huffman  coding.
+Compression  is  generally  considerably  better than that
+achieved by more conventional LZ77/LZ78-based compressors,
+and  approaches  the performance of the PPM family of statistical compressors.
+
+@code{bzip2} is built on top of @code{libbzip2}, a flexible library
+for handling compressed data in the @code{bzip2} format.  This manual
+describes both how to use the program and 
+how to work with the library interface.  Most of the
+manual is devoted to this library, not the program, 
+which is good news if your interest is only in the program.
+
+Chapter 2 describes how to use @code{bzip2}; this is the only part 
+you need to read if you just want to know how to operate the program.
+Chapter 3 describes the programming interfaces in detail, and
+Chapter 4 records some miscellaneous notes which I thought
+ought to be recorded somewhere.
+
+
+@chapter How to use @code{bzip2}
+
+This chapter contains a copy of the @code{bzip2} man page,
+and nothing else.
+
+@quotation
+
+@unnumberedsubsubsec NAME
+@itemize
+@item @code{bzip2}, @code{bunzip2}
+- a block-sorting file compressor, v1.0
+@item @code{bzcat} 
+- decompresses files to stdout
+@item @code{bzip2recover}
+- recovers data from damaged bzip2 files
+@end itemize
+
+@unnumberedsubsubsec SYNOPSIS
+@itemize
+@item @code{bzip2} [ -cdfkqstvzVL123456789 ] [ filenames ...  ]
+@item @code{bunzip2} [ -fkvsVL ] [ filenames ...  ]
+@item @code{bzcat} [ -s ] [ filenames ...  ]
+@item @code{bzip2recover} filename
+@end itemize
+
+@unnumberedsubsubsec DESCRIPTION
+
+@code{bzip2} compresses files using the Burrows-Wheeler block sorting
+text compression algorithm, and Huffman coding.  Compression is
+generally considerably better than that achieved by more conventional
+LZ77/LZ78-based compressors, and approaches the performance of the PPM
+family of statistical compressors.
+
+The command-line options are deliberately very similar to those of GNU
+@code{gzip}, but they are not identical.
+
+@code{bzip2} expects a list of file names to accompany the command-line
+flags.  Each file is replaced by a compressed version of itself, with
+the name @code{original_name.bz2}.  Each compressed file has the same
+modification date, permissions, and, when possible, ownership as the
+corresponding original, so that these properties can be correctly
+restored at decompression time.  File name handling is naive in the
+sense that there is no mechanism for preserving original file names,
+permissions, ownerships or dates in filesystems which lack these
+concepts, or have serious file name length restrictions, such as MS-DOS.
+
+@code{bzip2} and @code{bunzip2} will by default not overwrite existing
+files.  If you want this to happen, specify the @code{-f} flag.
+
+If no file names are specified, @code{bzip2} compresses from standard
+input to standard output.  In this case, @code{bzip2} will decline to
+write compressed output to a terminal, as this would be entirely
+incomprehensible and therefore pointless.
+
+@code{bunzip2} (or @code{bzip2 -d}) decompresses all
+specified files.  Files which were not created by @code{bzip2}
+will be detected and ignored, and a warning issued.  
+@code{bzip2} attempts to guess the filename for the decompressed file 
+from that of the compressed file as follows:
+@itemize
+@item @code{filename.bz2 } becomes @code{filename}
+@item @code{filename.bz  } becomes @code{filename}
+@item @code{filename.tbz2} becomes @code{filename.tar}
+@item @code{filename.tbz } becomes @code{filename.tar}
+@item @code{anyothername } becomes @code{anyothername.out}
+@end itemize
+If the file does not end in one of the recognised endings, 
+@code{.bz2}, @code{.bz}, 
+@code{.tbz2} or @code{.tbz}, @code{bzip2} complains that it cannot
+guess the name of the original file, and uses the original name
+with @code{.out} appended.
+
+As with compression, supplying no
+filenames causes decompression from standard input to standard output.
+
+@code{bunzip2} will correctly decompress a file which is the
+concatenation of two or more compressed files.  The result is the
+concatenation of the corresponding uncompressed files.  Integrity
+testing (@code{-t}) of concatenated compressed files is also supported.
+
+You can also compress or decompress files to the standard output by
+giving the @code{-c} flag.  Multiple files may be compressed and
+decompressed like this.  The resulting outputs are fed sequentially to
+stdout.  Compression of multiple files in this manner generates a stream
+containing multiple compressed file representations.  Such a stream
+can be decompressed correctly only by @code{bzip2} version 0.9.0 or
+later.  Earlier versions of @code{bzip2} will stop after decompressing
+the first file in the stream.
+
+@code{bzcat} (or @code{bzip2 -dc}) decompresses all specified files to
+the standard output.
+
+@code{bzip2} will read arguments from the environment variables
+@code{BZIP2} and @code{BZIP}, in that order, and will process them
+before any arguments read from the command line.  This gives a 
+convenient way to supply default arguments.
+
+Compression is always performed, even if the compressed file is slightly
+larger than the original.  Files of less than about one hundred bytes
+tend to get larger, since the compression mechanism has a constant
+overhead in the region of 50 bytes.  Random data (including the output
+of most file compressors) is coded at about 8.05 bits per byte, giving
+an expansion of around 0.5%.
+
+As a self-check for your protection, @code{bzip2} uses 32-bit CRCs to
+make sure that the decompressed version of a file is identical to the
+original.  This guards against corruption of the compressed data, and
+against undetected bugs in @code{bzip2} (hopefully very unlikely).  The
+chances of data corruption going undetected is microscopic, about one
+chance in four billion for each file processed.  Be aware, though, that
+the check occurs upon decompression, so it can only tell you that
+something is wrong.  It can't help you recover the original uncompressed
+data.  You can use @code{bzip2recover} to try to recover data from
+damaged files.
+
+Return values: 0 for a normal exit, 1 for environmental problems (file
+not found, invalid flags, I/O errors, &c), 2 to indicate a corrupt
+compressed file, 3 for an internal consistency error (eg, bug) which
+caused @code{bzip2} to panic.
+
+
+@unnumberedsubsubsec OPTIONS
+@table @code
+@item -c  --stdout
+Compress or decompress to standard output.
+@item -d  --decompress
+Force decompression.  @code{bzip2}, @code{bunzip2} and @code{bzcat} are
+really the same program, and the decision about what actions to take is
+done on the basis of which name is used.  This flag overrides that
+mechanism, and forces bzip2 to decompress.
+@item -z --compress
+The complement to @code{-d}: forces compression, regardless of the
+invokation name.
+@item -t --test
+Check integrity of the specified file(s), but don't decompress them.
+This really performs a trial decompression and throws away the result.
+@item -f --force
+Force overwrite of output files.  Normally, @code{bzip2} will not overwrite
+existing output files.  Also forces @code{bzip2} to break hard links
+to files, which it otherwise wouldn't do.
+@item -k --keep
+Keep (don't delete) input files during compression
+or decompression.
+@item -s --small
+Reduce memory usage, for compression, decompression and testing.  Files
+are decompressed and tested using a modified algorithm which only
+requires 2.5 bytes per block byte.  This means any file can be
+decompressed in 2300k of memory, albeit at about half the normal speed.
+
+During compression, @code{-s} selects a block size of 200k, which limits
+memory use to around the same figure, at the expense of your compression
+ratio.  In short, if your machine is low on memory (8 megabytes or
+less), use -s for everything.  See MEMORY MANAGEMENT below.
+@item -q --quiet
+Suppress non-essential warning messages.  Messages pertaining to
+I/O errors and other critical events will not be suppressed.
+@item -v --verbose
+Verbose mode -- show the compression ratio for each file processed.
+Further @code{-v}'s increase the verbosity level, spewing out lots of
+information which is primarily of interest for diagnostic purposes.
+@item -L --license -V --version
+Display the software version, license terms and conditions.
+@item -1 to -9
+Set the block size to 100 k, 200 k ..  900 k when compressing.  Has no
+effect when decompressing.  See MEMORY MANAGEMENT below.
+@item --
+Treats all subsequent arguments as file names, even if they start
+with a dash.  This is so you can handle files with names beginning
+with a dash, for example: @code{bzip2 -- -myfilename}.
+@item --repetitive-fast 
+@item --repetitive-best
+These flags are redundant in versions 0.9.5 and above.  They provided
+some coarse control over the behaviour of the sorting algorithm in
+earlier versions, which was sometimes useful.  0.9.5 and above have an
+improved algorithm which renders these flags irrelevant.
+@end table
+
+
+@unnumberedsubsubsec MEMORY MANAGEMENT
+
+@code{bzip2} compresses large files in blocks.  The block size affects
+both the compression ratio achieved, and the amount of memory needed for
+compression and decompression.  The flags @code{-1} through @code{-9}
+specify the block size to be 100,000 bytes through 900,000 bytes (the
+default) respectively.  At decompression time, the block size used for
+compression is read from the header of the compressed file, and
+@code{bunzip2} then allocates itself just enough memory to decompress
+the file.  Since block sizes are stored in compressed files, it follows
+that the flags @code{-1} to @code{-9} are irrelevant to and so ignored
+during decompression.
+
+Compression and decompression requirements, in bytes, can be estimated
+as:
+@example
+     Compression:   400k + ( 8 x block size )
+
+     Decompression: 100k + ( 4 x block size ), or
+                    100k + ( 2.5 x block size )
+@end example
+Larger block sizes give rapidly diminishing marginal returns.  Most of
+the compression comes from the first two or three hundred k of block
+size, a fact worth bearing in mind when using @code{bzip2} on small machines.
+It is also important to appreciate that the decompression memory
+requirement is set at compression time by the choice of block size.
+
+For files compressed with the default 900k block size, @code{bunzip2}
+will require about 3700 kbytes to decompress.  To support decompression
+of any file on a 4 megabyte machine, @code{bunzip2} has an option to
+decompress using approximately half this amount of memory, about 2300
+kbytes.  Decompression speed is also halved, so you should use this
+option only where necessary.  The relevant flag is @code{-s}.
+
+In general, try and use the largest block size memory constraints allow,
+since that maximises the compression achieved.  Compression and
+decompression speed are virtually unaffected by block size.
+
+Another significant point applies to files which fit in a single block
+-- that means most files you'd encounter using a large block size.  The
+amount of real memory touched is proportional to the size of the file,
+since the file is smaller than a block.  For example, compressing a file
+20,000 bytes long with the flag @code{-9} will cause the compressor to
+allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560
+kbytes of it.  Similarly, the decompressor will allocate 3700k but only
+touch 100k + 20000 * 4 = 180 kbytes.
+
+Here is a table which summarises the maximum memory usage for different
+block sizes.  Also recorded is the total compressed size for 14 files of
+the Calgary Text Compression Corpus totalling 3,141,622 bytes.  This
+column gives some feel for how compression varies with block size.
+These figures tend to understate the advantage of larger block sizes for
+larger files, since the Corpus is dominated by smaller files.
+@example
+          Compress   Decompress   Decompress   Corpus
+   Flag     usage      usage       -s usage     Size
+
+    -1      1200k       500k         350k      914704
+    -2      2000k       900k         600k      877703
+    -3      2800k      1300k         850k      860338
+    -4      3600k      1700k        1100k      846899
+    -5      4400k      2100k        1350k      845160
+    -6      5200k      2500k        1600k      838626
+    -7      6100k      2900k        1850k      834096
+    -8      6800k      3300k        2100k      828642
+    -9      7600k      3700k        2350k      828642
+@end example
+
+@unnumberedsubsubsec RECOVERING DATA FROM DAMAGED FILES
+
+@code{bzip2} compresses files in blocks, usually 900kbytes long.  Each
+block is handled independently.  If a media or transmission error causes
+a multi-block @code{.bz2} file to become damaged, it may be possible to
+recover data from the undamaged blocks in the file.
+
+The compressed representation of each block is delimited by a 48-bit
+pattern, which makes it possible to find the block boundaries with
+reasonable certainty.  Each block also carries its own 32-bit CRC, so
+damaged blocks can be distinguished from undamaged ones.
+
+@code{bzip2recover} is a simple program whose purpose is to search for
+blocks in @code{.bz2} files, and write each block out into its own
+@code{.bz2} file.  You can then use @code{bzip2 -t} to test the
+integrity of the resulting files, and decompress those which are
+undamaged.
+
+@code{bzip2recover} 
+takes a single argument, the name of the damaged file, 
+and writes a number of files @code{rec0001file.bz2},
+       @code{rec0002file.bz2}, etc, containing the  extracted  blocks.
+       The  output  filenames  are  designed  so  that the use of
+       wildcards in subsequent processing -- for example,  
+@code{bzip2 -dc  rec*file.bz2 > recovered_data} -- lists the files in
+       the correct order.
+
+@code{bzip2recover} should be of most use dealing with large @code{.bz2}
+       files,  as  these will contain many blocks.  It is clearly
+       futile to use it on damaged single-block  files,  since  a
+       damaged  block  cannot  be recovered.  If you wish to minimise 
+any potential data loss through media  or  transmission errors, 
+you might consider compressing with a smaller
+       block size.
+
+
+@unnumberedsubsubsec PERFORMANCE NOTES
+
+The sorting phase of compression gathers together similar strings in the
+file.  Because of this, files containing very long runs of repeated
+symbols, like "aabaabaabaab ..."  (repeated several hundred times) may
+compress more slowly than normal.  Versions 0.9.5 and above fare much
+better than previous versions in this respect.  The ratio between
+worst-case and average-case compression time is in the region of 10:1.
+For previous versions, this figure was more like 100:1.  You can use the
+@code{-vvvv} option to monitor progress in great detail, if you want.
+
+Decompression speed is unaffected by these phenomena.
+
+@code{bzip2} usually allocates several megabytes of memory to operate
+in, and then charges all over it in a fairly random fashion.  This means
+that performance, both for compressing and decompressing, is largely
+determined by the speed at which your machine can service cache misses.
+Because of this, small changes to the code to reduce the miss rate have
+been observed to give disproportionately large performance improvements.
+I imagine @code{bzip2} will perform best on machines with very large
+caches.
+
+
+@unnumberedsubsubsec CAVEATS
+
+I/O error messages are not as helpful as they could be.  @code{bzip2}
+tries hard to detect I/O errors and exit cleanly, but the details of
+what the problem is sometimes seem rather misleading.
+
+This manual page pertains to version 1.0 of @code{bzip2}.  Compressed
+data created by this version is entirely forwards and backwards
+compatible with the previous public releases, versions 0.1pl2, 0.9.0 and
+0.9.5, but with the following exception: 0.9.0 and above can correctly
+decompress multiple concatenated compressed files.  0.1pl2 cannot do
+this; it will stop after decompressing just the first file in the
+stream.
+
+@code{bzip2recover} uses 32-bit integers to represent bit positions in
+compressed files, so it cannot handle compressed files more than 512
+megabytes long.  This could easily be fixed.
+
+
+@unnumberedsubsubsec AUTHOR
+Julian Seward, @code{jseward@@acm.org}.
+
+The ideas embodied in @code{bzip2} are due to (at least) the following
+people: Michael Burrows and David Wheeler (for the block sorting
+transformation), David Wheeler (again, for the Huffman coder), Peter
+Fenwick (for the structured coding model in the original @code{bzip},
+and many refinements), and Alistair Moffat, Radford Neal and Ian Witten
+(for the arithmetic coder in the original @code{bzip}).  I am much
+indebted for their help, support and advice.  See the manual in the
+source distribution for pointers to sources of documentation.  Christian
+von Roques encouraged me to look for faster sorting algorithms, so as to
+speed up compression.  Bela Lubkin encouraged me to improve the
+worst-case compression performance.  Many people sent patches, helped
+with portability problems, lent machines, gave advice and were generally
+helpful.
+
+@end quotation
+
+
+
+
+@chapter Programming with @code{libbzip2}
+
+This chapter describes the programming interface to @code{libbzip2}.
+
+For general background information, particularly about memory
+use and performance aspects, you'd be well advised to read Chapter 2
+as well.
+
+@section Top-level structure
+
+@code{libbzip2} is a flexible library for compressing and decompressing
+data in the @code{bzip2} data format.  Although packaged as a single
+entity, it helps to regard the library as three separate parts: the low
+level interface, and the high level interface, and some utility
+functions.
+
+The structure of @code{libbzip2}'s interfaces is similar to
+that of Jean-loup Gailly's and Mark Adler's excellent @code{zlib} 
+library.
+
+All externally visible symbols have names beginning @code{BZ2_}.
+This is new in version 1.0.  The intention is to minimise pollution
+of the namespaces of library clients.
+
+@subsection Low-level summary
+
+This interface provides services for compressing and decompressing
+data in memory.  There's no provision for dealing with files, streams
+or any other I/O mechanisms, just straight memory-to-memory work.
+In fact, this part of the library can be compiled without inclusion
+of @code{stdio.h}, which may be helpful for embedded applications.
+
+The low-level part of the library has no global variables and
+is therefore thread-safe.
+
+Six routines make up the low level interface: 
+@code{BZ2_bzCompressInit}, @code{BZ2_bzCompress}, and @* @code{BZ2_bzCompressEnd}
+for compression,
+and a corresponding trio @code{BZ2_bzDecompressInit}, @* @code{BZ2_bzDecompress}
+and @code{BZ2_bzDecompressEnd} for decompression.  
+The @code{*Init} functions allocate
+memory for compression/decompression and do other
+initialisations, whilst the @code{*End} functions close down operations
+and release memory.
+
+The real work is done by @code{BZ2_bzCompress} and @code{BZ2_bzDecompress}.  
+These compress and decompress data from a user-supplied input buffer
+to a user-supplied output buffer.  These buffers can be any size;
+arbitrary quantities of data are handled by making repeated calls
+to these functions.  This is a flexible mechanism allowing a 
+consumer-pull style of activity, or producer-push, or a mixture of
+both.
+
+
+
+@subsection High-level summary
+
+This interface provides some handy wrappers around the low-level
+interface to facilitate reading and writing @code{bzip2} format
+files (@code{.bz2} files).  The routines provide hooks to facilitate
+reading files in which the @code{bzip2} data stream is embedded 
+within some larger-scale file structure, or where there are
+multiple @code{bzip2} data streams concatenated end-to-end.
+
+For reading files, @code{BZ2_bzReadOpen}, @code{BZ2_bzRead},
+@code{BZ2_bzReadClose} and @* @code{BZ2_bzReadGetUnused} are supplied.  For
+writing files, @code{BZ2_bzWriteOpen}, @code{BZ2_bzWrite} and
+@code{BZ2_bzWriteFinish} are available.
+
+As with the low-level library, no global variables are used
+so the library is per se thread-safe.  However, if I/O errors
+occur whilst reading or writing the underlying compressed files,
+you may have to consult @code{errno} to determine the cause of
+the error.  In that case, you'd need a C library which correctly
+supports @code{errno} in a multithreaded environment.
+
+To make the library a little simpler and more portable,
+@code{BZ2_bzReadOpen} and @code{BZ2_bzWriteOpen} require you to pass them file
+handles (@code{FILE*}s) which have previously been opened for reading or
+writing respectively.  That avoids portability problems associated with
+file operations and file attributes, whilst not being much of an
+imposition on the programmer.
+
+
+
+@subsection Utility functions summary
+For very simple needs, @code{BZ2_bzBuffToBuffCompress} and
+@code{BZ2_bzBuffToBuffDecompress} are provided.  These compress
+data in memory from one buffer to another buffer in a single
+function call.  You should assess whether these functions
+fulfill your memory-to-memory compression/decompression
+requirements before investing effort in understanding the more
+general but more complex low-level interface.
+
+Yoshioka Tsuneo (@code{QWF00133@@niftyserve.or.jp} /
+@code{tsuneo-y@@is.aist-nara.ac.jp}) has contributed some functions to
+give better @code{zlib} compatibility.  These functions are
+@code{BZ2_bzopen}, @code{BZ2_bzread}, @code{BZ2_bzwrite}, @code{BZ2_bzflush},
+@code{BZ2_bzclose},
+@code{BZ2_bzerror} and @code{BZ2_bzlibVersion}.  You may find these functions
+more convenient for simple file reading and writing, than those in the
+high-level interface.  These functions are not (yet) officially part of
+the library, and are minimally documented here.  If they break, you
+get to keep all the pieces.  I hope to document them properly when time
+permits.
+
+Yoshioka also contributed modifications to allow the library to be
+built as a Windows DLL.
+
+
+@section Error handling
+
+The library is designed to recover cleanly in all situations, including
+the worst-case situation of decompressing random data.  I'm not 
+100% sure that it can always do this, so you might want to add
+a signal handler to catch segmentation violations during decompression
+if you are feeling especially paranoid.  I would be interested in
+hearing more about the robustness of the library to corrupted
+compressed data.
+
+Version 1.0 is much more robust in this respect than
+0.9.0 or 0.9.5.  Investigations with Checker (a tool for 
+detecting problems with memory management, similar to Purify)
+indicate that, at least for the few files I tested, all single-bit
+errors in the decompressed data are caught properly, with no
+segmentation faults, no reads of uninitialised data and no 
+out of range reads or writes.  So it's certainly much improved,
+although I wouldn't claim it to be totally bombproof.
+
+The file @code{bzlib.h} contains all definitions needed to use
+the library.  In particular, you should definitely not include
+@code{bzlib_private.h}.
+
+In @code{bzlib.h}, the various return values are defined.  The following
+list is not intended as an exhaustive description of the circumstances 
+in which a given value may be returned -- those descriptions are given
+later.  Rather, it is intended to convey the rough meaning of each
+return value.  The first five actions are normal and not intended to 
+denote an error situation.
+@table @code
+@item BZ_OK
+The requested action was completed successfully.
+@item BZ_RUN_OK
+@itemx BZ_FLUSH_OK
+@itemx BZ_FINISH_OK
+In @code{BZ2_bzCompress}, the requested flush/finish/nothing-special action
+was completed successfully.
+@item BZ_STREAM_END
+Compression of data was completed, or the logical stream end was
+detected during decompression.
+@end table
+
+The following return values indicate an error of some kind.
+@table @code
+@item BZ_CONFIG_ERROR
+Indicates that the library has been improperly compiled on your
+platform -- a major configuration error.  Specifically, it means
+that @code{sizeof(char)}, @code{sizeof(short)} and @code{sizeof(int)}
+are not 1, 2 and 4 respectively, as they should be.  Note that the 
+library should still work properly on 64-bit platforms which follow
+the LP64 programming model -- that is, where @code{sizeof(long)}
+and @code{sizeof(void*)} are 8.  Under LP64, @code{sizeof(int)} is
+still 4, so @code{libbzip2}, which doesn't use the @code{long} type,
+is OK.
+@item BZ_SEQUENCE_ERROR
+When using the library, it is important to call the functions in the
+correct sequence and with data structures (buffers etc) in the correct
+states.  @code{libbzip2} checks as much as it can to ensure this is
+happening, and returns @code{BZ_SEQUENCE_ERROR} if not.  Code which
+complies precisely with the function semantics, as detailed below,
+should never receive this value; such an event denotes buggy code
+which you should investigate.
+@item BZ_PARAM_ERROR
+Returned when a parameter to a function call is out of range 
+or otherwise manifestly incorrect.  As with @code{BZ_SEQUENCE_ERROR},
+this denotes a bug in the client code.  The distinction between
+@code{BZ_PARAM_ERROR} and @code{BZ_SEQUENCE_ERROR} is a bit hazy, but still worth
+making.
+@item BZ_MEM_ERROR
+Returned when a request to allocate memory failed.  Note that the
+quantity of memory needed to decompress a stream cannot be determined
+until the stream's header has been read.  So @code{BZ2_bzDecompress} and
+@code{BZ2_bzRead} may return @code{BZ_MEM_ERROR} even though some of
+the compressed data has been read.  The same is not true for
+compression; once @code{BZ2_bzCompressInit} or @code{BZ2_bzWriteOpen} have
+successfully completed, @code{BZ_MEM_ERROR} cannot occur.
+@item BZ_DATA_ERROR
+Returned when a data integrity error is detected during decompression.
+Most importantly, this means when stored and computed CRCs for the
+data do not match.  This value is also returned upon detection of any
+other anomaly in the compressed data.
+@item BZ_DATA_ERROR_MAGIC
+As a special case of @code{BZ_DATA_ERROR}, it is sometimes useful to
+know when the compressed stream does not start with the correct
+magic bytes (@code{'B' 'Z' 'h'}).  
+@item BZ_IO_ERROR
+Returned by @code{BZ2_bzRead} and @code{BZ2_bzWrite} when there is an error
+reading or writing in the compressed file, and by @code{BZ2_bzReadOpen}
+and @code{BZ2_bzWriteOpen} for attempts to use a file for which the
+error indicator (viz, @code{ferror(f)}) is set.
+On receipt of @code{BZ_IO_ERROR}, the caller should consult
+@code{errno} and/or @code{perror} to acquire operating-system
+specific information about the problem.
+@item BZ_UNEXPECTED_EOF
+Returned by @code{BZ2_bzRead} when the compressed file finishes
+before the logical end of stream is detected.
+@item BZ_OUTBUFF_FULL
+Returned by @code{BZ2_bzBuffToBuffCompress} and
+@code{BZ2_bzBuffToBuffDecompress} to indicate that the output data
+will not fit into the output buffer provided.
+@end table
+
+
+
+@section Low-level interface
+
+@subsection @code{BZ2_bzCompressInit}
+@example
+typedef 
+   struct @{
+      char *next_in;
+      unsigned int avail_in;
+      unsigned int total_in_lo32;
+      unsigned int total_in_hi32;
+
+      char *next_out;
+      unsigned int avail_out;
+      unsigned int total_out_lo32;
+      unsigned int total_out_hi32;
+
+      void *state;
+
+      void *(*bzalloc)(void *,int,int);
+      void (*bzfree)(void *,void *);
+      void *opaque;
+   @} 
+   bz_stream;
+
+int BZ2_bzCompressInit ( bz_stream *strm, 
+                         int blockSize100k, 
+                         int verbosity,
+                         int workFactor );
+
+@end example
+
+Prepares for compression.  The @code{bz_stream} structure
+holds all data pertaining to the compression activity.  
+A @code{bz_stream} structure should be allocated and initialised
+prior to the call.
+The fields of @code{bz_stream}
+comprise the entirety of the user-visible data.  @code{state}
+is a pointer to the private data structures required for compression.
+
+Custom memory allocators are supported, via fields @code{bzalloc}, 
+@code{bzfree},
+and @code{opaque}.  The value 
+@code{opaque} is passed to as the first argument to
+all calls to @code{bzalloc} and @code{bzfree}, but is 
+otherwise ignored by the library.
+The call @code{bzalloc ( opaque, n, m )} is expected to return a 
+pointer @code{p} to
+@code{n * m} bytes of memory, and @code{bzfree ( opaque, p )} 
+should free
+that memory.
+
+If you don't want to use a custom memory allocator, set @code{bzalloc}, 
+@code{bzfree} and
+@code{opaque} to @code{NULL}, 
+and the library will then use the standard @code{malloc}/@code{free}
+routines.
+
+Before calling @code{BZ2_bzCompressInit}, fields @code{bzalloc}, 
+@code{bzfree} and @code{opaque} should
+be filled appropriately, as just described.  Upon return, the internal
+state will have been allocated and initialised, and @code{total_in_lo32}, 
+@code{total_in_hi32}, @code{total_out_lo32} and 
+@code{total_out_hi32} will have been set to zero.  
+These four fields are used by the library
+to inform the caller of the total amount of data passed into and out of
+the library, respectively.  You should not try to change them.
+As of version 1.0, 64-bit counts are maintained, even on 32-bit
+platforms, using the @code{_hi32} fields to store the upper 32 bits
+of the count.  So, for example, the total amount of data in
+is @code{(total_in_hi32 << 32) + total_in_lo32}.
+
+Parameter @code{blockSize100k} specifies the block size to be used for
+compression.  It should be a value between 1 and 9 inclusive, and the
+actual block size used is 100000 x this figure.  9 gives the best
+compression but takes most memory.
+
+Parameter @code{verbosity} should be set to a number between 0 and 4
+inclusive.  0 is silent, and greater numbers give increasingly verbose
+monitoring/debugging output.  If the library has been compiled with
+@code{-DBZ_NO_STDIO}, no such output will appear for any verbosity
+setting.
+
+Parameter @code{workFactor} controls how the compression phase behaves
+when presented with worst case, highly repetitive, input data.  If
+compression runs into difficulties caused by repetitive data, the
+library switches from the standard sorting algorithm to a fallback
+algorithm.  The fallback is slower than the standard algorithm by
+perhaps a factor of three, but always behaves reasonably, no matter how
+bad the input.
+
+Lower values of @code{workFactor} reduce the amount of effort the
+standard algorithm will expend before resorting to the fallback.  You
+should set this parameter carefully; too low, and many inputs will be
+handled by the fallback algorithm and so compress rather slowly, too
+high, and your average-to-worst case compression times can become very
+large.  The default value of 30 gives reasonable behaviour over a wide
+range of circumstances.
+
+Allowable values range from 0 to 250 inclusive.  0 is a special case,
+equivalent to using the default value of 30.
+
+Note that the compressed output generated is the same regardless of
+whether or not the fallback algorithm is used.
+
+Be aware also that this parameter may disappear entirely in future
+versions of the library.  In principle it should be possible to devise a
+good way to automatically choose which algorithm to use.  Such a
+mechanism would render the parameter obsolete.
+
+Possible return values:
+@display
+      @code{BZ_CONFIG_ERROR}
+         if the library has been mis-compiled
+      @code{BZ_PARAM_ERROR} 
+         if @code{strm} is @code{NULL} 
+         or @code{blockSize} < 1 or @code{blockSize} > 9
+         or @code{verbosity} < 0 or @code{verbosity} > 4
+         or @code{workFactor} < 0 or @code{workFactor} > 250
+      @code{BZ_MEM_ERROR} 
+         if not enough memory is available
+      @code{BZ_OK} 
+         otherwise
+@end display
+Allowable next actions:
+@display
+      @code{BZ2_bzCompress} 
+         if @code{BZ_OK} is returned
+      no specific action needed in case of error
+@end display
+
+@subsection @code{BZ2_bzCompress}
+@example
+   int BZ2_bzCompress ( bz_stream *strm, int action );
+@end example
+Provides more input and/or output buffer space for the library.  The
+caller maintains input and output buffers, and calls @code{BZ2_bzCompress} to
+transfer data between them.
+
+Before each call to @code{BZ2_bzCompress}, @code{next_in} should point at
+the data to be compressed, and @code{avail_in} should indicate how many
+bytes the library may read.  @code{BZ2_bzCompress} updates @code{next_in},
+@code{avail_in} and @code{total_in} to reflect the number of bytes it
+has read.
+
+Similarly, @code{next_out} should point to a buffer in which the
+compressed data is to be placed, with @code{avail_out} indicating how
+much output space is available.  @code{BZ2_bzCompress} updates
+@code{next_out}, @code{avail_out} and @code{total_out} to reflect the
+number of bytes output.
+
+You may provide and remove as little or as much data as you like on each
+call of @code{BZ2_bzCompress}.  In the limit, it is acceptable to supply and
+remove data one byte at a time, although this would be terribly
+inefficient.  You should always ensure that at least one byte of output
+space is available at each call.
+
+A second purpose of @code{BZ2_bzCompress} is to request a change of mode of the
+compressed stream.  
+
+Conceptually, a compressed stream can be in one of four states: IDLE,
+RUNNING, FLUSHING and FINISHING.  Before initialisation
+(@code{BZ2_bzCompressInit}) and after termination (@code{BZ2_bzCompressEnd}), a
+stream is regarded as IDLE.
+
+Upon initialisation (@code{BZ2_bzCompressInit}), the stream is placed in the
+RUNNING state.  Subsequent calls to @code{BZ2_bzCompress} should pass
+@code{BZ_RUN} as the requested action; other actions are illegal and
+will result in @code{BZ_SEQUENCE_ERROR}.
+
+At some point, the calling program will have provided all the input data
+it wants to.  It will then want to finish up -- in effect, asking the
+library to process any data it might have buffered internally.  In this
+state, @code{BZ2_bzCompress} will no longer attempt to read data from
+@code{next_in}, but it will want to write data to @code{next_out}.
+Because the output buffer supplied by the user can be arbitrarily small,
+the finishing-up operation cannot necessarily be done with a single call
+of @code{BZ2_bzCompress}.
+
+Instead, the calling program passes @code{BZ_FINISH} as an action to
+@code{BZ2_bzCompress}.  This changes the stream's state to FINISHING.  Any
+remaining input (ie, @code{next_in[0 .. avail_in-1]}) is compressed and
+transferred to the output buffer.  To do this, @code{BZ2_bzCompress} must be
+called repeatedly until all the output has been consumed.  At that
+point, @code{BZ2_bzCompress} returns @code{BZ_STREAM_END}, and the stream's
+state is set back to IDLE.  @code{BZ2_bzCompressEnd} should then be
+called.
+
+Just to make sure the calling program does not cheat, the library makes
+a note of @code{avail_in} at the time of the first call to
+@code{BZ2_bzCompress} which has @code{BZ_FINISH} as an action (ie, at the
+time the program has announced its intention to not supply any more
+input).  By comparing this value with that of @code{avail_in} over
+subsequent calls to @code{BZ2_bzCompress}, the library can detect any
+attempts to slip in more data to compress.  Any calls for which this is
+detected will return @code{BZ_SEQUENCE_ERROR}.  This indicates a
+programming mistake which should be corrected.
+
+Instead of asking to finish, the calling program may ask
+@code{BZ2_bzCompress} to take all the remaining input, compress it and
+terminate the current (Burrows-Wheeler) compression block.  This could
+be useful for error control purposes.  The mechanism is analogous to
+that for finishing: call @code{BZ2_bzCompress} with an action of
+@code{BZ_FLUSH}, remove output data, and persist with the
+@code{BZ_FLUSH} action until the value @code{BZ_RUN} is returned.  As
+with finishing, @code{BZ2_bzCompress} detects any attempt to provide more
+input data once the flush has begun.
+
+Once the flush is complete, the stream returns to the normal RUNNING
+state.
+
+This all sounds pretty complex, but isn't really.  Here's a table
+which shows which actions are allowable in each state, what action
+will be taken, what the next state is, and what the non-error return
+values are.  Note that you can't explicitly ask what state the
+stream is in, but nor do you need to -- it can be inferred from the
+values returned by @code{BZ2_bzCompress}.
+@display
+IDLE/@code{any}           
+      Illegal.  IDLE state only exists after @code{BZ2_bzCompressEnd} or
+      before @code{BZ2_bzCompressInit}.
+      Return value = @code{BZ_SEQUENCE_ERROR}
+
+RUNNING/@code{BZ_RUN}     
+      Compress from @code{next_in} to @code{next_out} as much as possible.
+      Next state = RUNNING
+      Return value = @code{BZ_RUN_OK}
+
+RUNNING/@code{BZ_FLUSH}   
+      Remember current value of @code{next_in}.  Compress from @code{next_in}
+      to @code{next_out} as much as possible, but do not accept any more input.  
+      Next state = FLUSHING
+      Return value = @code{BZ_FLUSH_OK}
+
+RUNNING/@code{BZ_FINISH}  
+      Remember current value of @code{next_in}.  Compress from @code{next_in}
+      to @code{next_out} as much as possible, but do not accept any more input.
+      Next state = FINISHING
+      Return value = @code{BZ_FINISH_OK}
+
+FLUSHING/@code{BZ_FLUSH}  
+      Compress from @code{next_in} to @code{next_out} as much as possible, 
+      but do not accept any more input.  
+      If all the existing input has been used up and all compressed
+      output has been removed
+         Next state = RUNNING; Return value = @code{BZ_RUN_OK}
+      else
+         Next state = FLUSHING; Return value = @code{BZ_FLUSH_OK}
+
+FLUSHING/other     
+      Illegal.
+      Return value = @code{BZ_SEQUENCE_ERROR}
+
+FINISHING/@code{BZ_FINISH}  
+      Compress from @code{next_in} to @code{next_out} as much as possible,
+      but to not accept any more input.  
+      If all the existing input has been used up and all compressed
+      output has been removed
+         Next state = IDLE; Return value = @code{BZ_STREAM_END}
+      else
+         Next state = FINISHING; Return value = @code{BZ_FINISHING}
+
+FINISHING/other
+      Illegal.
+      Return value = @code{BZ_SEQUENCE_ERROR}
+@end display
+
+That still looks complicated?  Well, fair enough.  The usual sequence
+of calls for compressing a load of data is:
+@itemize @bullet
+@item Get started with @code{BZ2_bzCompressInit}.
+@item Shovel data in and shlurp out its compressed form using zero or more
+calls of @code{BZ2_bzCompress} with action = @code{BZ_RUN}.
+@item Finish up.  
+Repeatedly call @code{BZ2_bzCompress} with action = @code{BZ_FINISH}, 
+copying out the compressed output, until @code{BZ_STREAM_END} is returned.
+@item Close up and go home.  Call @code{BZ2_bzCompressEnd}.
+@end itemize
+If the data you want to compress fits into your input buffer all
+at once, you can skip the calls of @code{BZ2_bzCompress ( ..., BZ_RUN )} and 
+just do the @code{BZ2_bzCompress ( ..., BZ_FINISH )} calls.
+
+All required memory is allocated by @code{BZ2_bzCompressInit}.  The
+compression library can accept any data at all (obviously).  So you
+shouldn't get any error return values from the @code{BZ2_bzCompress} calls.
+If you do, they will be @code{BZ_SEQUENCE_ERROR}, and indicate a bug in
+your programming.
+
+Trivial other possible return values:
+@display
+      @code{BZ_PARAM_ERROR}   
+         if @code{strm} is @code{NULL}, or @code{strm->s} is @code{NULL}
+@end display
+
+@subsection @code{BZ2_bzCompressEnd}
+@example
+int BZ2_bzCompressEnd ( bz_stream *strm );
+@end example
+Releases all memory associated with a compression stream.
+
+Possible return values:
+@display
+   @code{BZ_PARAM_ERROR}    if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL}
+   @code{BZ_OK}    otherwise
+@end display
+
+
+@subsection @code{BZ2_bzDecompressInit}
+@example
+int BZ2_bzDecompressInit ( bz_stream *strm, int verbosity, int small );
+@end example
+Prepares for decompression.  As with @code{BZ2_bzCompressInit}, a
+@code{bz_stream} record should be allocated and initialised before the
+call.  Fields @code{bzalloc}, @code{bzfree} and @code{opaque} should be
+set if a custom memory allocator is required, or made @code{NULL} for
+the normal @code{malloc}/@code{free} routines.  Upon return, the internal
+state will have been initialised, and @code{total_in} and
+@code{total_out} will be zero.
+
+For the meaning of parameter @code{verbosity}, see @code{BZ2_bzCompressInit}.
+
+If @code{small} is nonzero, the library will use an alternative
+decompression algorithm which uses less memory but at the cost of
+decompressing more slowly (roughly speaking, half the speed, but the
+maximum memory requirement drops to around 2300k).  See Chapter 2 for
+more information on memory management.
+
+Note that the amount of memory needed to decompress
+a stream cannot be determined until the stream's header has been read,
+so even if @code{BZ2_bzDecompressInit} succeeds, a subsequent
+@code{BZ2_bzDecompress} could fail with @code{BZ_MEM_ERROR}.
+
+Possible return values:
+@display
+      @code{BZ_CONFIG_ERROR}
+         if the library has been mis-compiled
+      @code{BZ_PARAM_ERROR}
+         if @code{(small != 0 && small != 1)}
+         or @code{(verbosity < 0 || verbosity > 4)}
+      @code{BZ_MEM_ERROR}
+         if insufficient memory is available
+@end display
+
+Allowable next actions:
+@display
+      @code{BZ2_bzDecompress}
+         if @code{BZ_OK} was returned
+      no specific action required in case of error
+@end display
+
+ 
+
+@subsection @code{BZ2_bzDecompress}
+@example
+int BZ2_bzDecompress ( bz_stream *strm );
+@end example
+Provides more input and/out output buffer space for the library.  The
+caller maintains input and output buffers, and uses @code{BZ2_bzDecompress}
+to transfer data between them.
+
+Before each call to @code{BZ2_bzDecompress}, @code{next_in} 
+should point at the compressed data,
+and @code{avail_in} should indicate how many bytes the library
+may read.  @code{BZ2_bzDecompress} updates @code{next_in}, @code{avail_in} 
+and @code{total_in}
+to reflect the number of bytes it has read.
+
+Similarly, @code{next_out} should point to a buffer in which the uncompressed
+output is to be placed, with @code{avail_out} indicating how much output space
+is available.  @code{BZ2_bzCompress} updates @code{next_out},
+@code{avail_out} and @code{total_out} to reflect
+the number of bytes output.
+
+You may provide and remove as little or as much data as you like on
+each call of @code{BZ2_bzDecompress}.  
+In the limit, it is acceptable to
+supply and remove data one byte at a time, although this would be
+terribly inefficient.  You should always ensure that at least one
+byte of output space is available at each call.
+
+Use of @code{BZ2_bzDecompress} is simpler than @code{BZ2_bzCompress}.
+
+You should provide input and remove output as described above, and
+repeatedly call @code{BZ2_bzDecompress} until @code{BZ_STREAM_END} is
+returned.  Appearance of @code{BZ_STREAM_END} denotes that
+@code{BZ2_bzDecompress} has detected the logical end of the compressed
+stream.  @code{BZ2_bzDecompress} will not produce @code{BZ_STREAM_END} until
+all output data has been placed into the output buffer, so once
+@code{BZ_STREAM_END} appears, you are guaranteed to have available all
+the decompressed output, and @code{BZ2_bzDecompressEnd} can safely be
+called.
+
+If case of an error return value, you should call @code{BZ2_bzDecompressEnd}
+to clean up and release memory.
+
+Possible return values:
+@display
+      @code{BZ_PARAM_ERROR}
+         if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL}
+         or @code{strm->avail_out < 1}
+      @code{BZ_DATA_ERROR}
+         if a data integrity error is detected in the compressed stream
+      @code{BZ_DATA_ERROR_MAGIC}
+         if the compressed stream doesn't begin with the right magic bytes
+      @code{BZ_MEM_ERROR}
+         if there wasn't enough memory available
+      @code{BZ_STREAM_END}
+         if the logical end of the data stream was detected and all
+         output in has been consumed, eg @code{s->avail_out > 0}
+      @code{BZ_OK}
+         otherwise
+@end display
+Allowable next actions:
+@display
+      @code{BZ2_bzDecompress}
+         if @code{BZ_OK} was returned
+      @code{BZ2_bzDecompressEnd}
+         otherwise
+@end display
+
+
+@subsection @code{BZ2_bzDecompressEnd}
+@example
+int BZ2_bzDecompressEnd ( bz_stream *strm );
+@end example
+Releases all memory associated with a decompression stream.
+
+Possible return values:
+@display
+      @code{BZ_PARAM_ERROR}
+         if @code{strm} is @code{NULL} or @code{strm->s} is @code{NULL}
+      @code{BZ_OK}
+         otherwise
+@end display
+
+Allowable next actions:
+@display
+      None.
+@end display
+
+
+@section High-level interface
+
+This interface provides functions for reading and writing 
+@code{bzip2} format files.  First, some general points.
+
+@itemize @bullet
+@item All of the functions take an @code{int*} first argument,
+  @code{bzerror}.
+  After each call, @code{bzerror} should be consulted first to determine
+  the outcome of the call.  If @code{bzerror} is @code{BZ_OK}, 
+  the call completed
+  successfully, and only then should the return value of the function
+  (if any) be consulted.  If @code{bzerror} is @code{BZ_IO_ERROR}, 
+  there was an error
+  reading/writing the underlying compressed file, and you should
+  then consult @code{errno}/@code{perror} to determine the 
+  cause of the difficulty.
+  @code{bzerror} may also be set to various other values; precise details are
+  given on a per-function basis below.
+@item If @code{bzerror} indicates an error 
+  (ie, anything except @code{BZ_OK} and @code{BZ_STREAM_END}),
+  you should immediately call @code{BZ2_bzReadClose} (or @code{BZ2_bzWriteClose},
+  depending on whether you are attempting to read or to write)
+  to free up all resources associated
+  with the stream.  Once an error has been indicated, behaviour of all calls
+  except @code{BZ2_bzReadClose} (@code{BZ2_bzWriteClose}) is undefined.  
+  The implication is that (1) @code{bzerror} should
+  be checked after each call, and (2) if @code{bzerror} indicates an error, 
+  @code{BZ2_bzReadClose} (@code{BZ2_bzWriteClose}) should then be called to clean up.
+@item The @code{FILE*} arguments passed to
+   @code{BZ2_bzReadOpen}/@code{BZ2_bzWriteOpen}  
+  should be set to binary mode.
+  Most Unix systems will do this by default, but other platforms,
+  including Windows and Mac, will not.  If you omit this, you may
+  encounter problems when moving code to new platforms.
+@item Memory allocation requests are handled by
+  @code{malloc}/@code{free}.  
+  At present
+  there is no facility for user-defined memory allocators in the file I/O
+  functions (could easily be added, though).
+@end itemize
+
+
+
+@subsection @code{BZ2_bzReadOpen}
+@example
+   typedef void BZFILE;
+
+   BZFILE *BZ2_bzReadOpen ( int *bzerror, FILE *f, 
+                            int small, int verbosity,
+                            void *unused, int nUnused );
+@end example
+Prepare to read compressed data from file handle @code{f}.  @code{f}
+should refer to a file which has been opened for reading, and for which
+the error indicator (@code{ferror(f)})is not set.  If @code{small} is 1,
+the library will try to decompress using less memory, at the expense of
+speed.
+
+For reasons explained below, @code{BZ2_bzRead} will decompress the
+@code{nUnused} bytes starting at @code{unused}, before starting to read
+from the file @code{f}.  At most @code{BZ_MAX_UNUSED} bytes may be
+supplied like this.  If this facility is not required, you should pass
+@code{NULL} and @code{0} for @code{unused} and n@code{Unused}
+respectively.
+
+For the meaning of parameters @code{small} and @code{verbosity},
+see @code{BZ2_bzDecompressInit}.
+
+The amount of memory needed to decompress a file cannot be determined
+until the file's header has been read.  So it is possible that
+@code{BZ2_bzReadOpen} returns @code{BZ_OK} but a subsequent call of
+@code{BZ2_bzRead} will return @code{BZ_MEM_ERROR}.
+
+Possible assignments to @code{bzerror}:
+@display
+      @code{BZ_CONFIG_ERROR}
+         if the library has been mis-compiled
+      @code{BZ_PARAM_ERROR}
+         if @code{f} is @code{NULL} 
+         or @code{small} is neither @code{0} nor @code{1}                 
+         or @code{(unused == NULL && nUnused != 0)}
+         or @code{(unused != NULL && !(0 <= nUnused <= BZ_MAX_UNUSED))}
+      @code{BZ_IO_ERROR}    
+         if @code{ferror(f)} is nonzero
+      @code{BZ_MEM_ERROR}   
+         if insufficient memory is available
+      @code{BZ_OK}
+         otherwise.
+@end display
+
+Possible return values:
+@display
+      Pointer to an abstract @code{BZFILE}        
+         if @code{bzerror} is @code{BZ_OK}   
+      @code{NULL}
+         otherwise
+@end display
+
+Allowable next actions:
+@display
+      @code{BZ2_bzRead}
+         if @code{bzerror} is @code{BZ_OK}   
+      @code{BZ2_bzClose} 
+         otherwise
+@end display
+
+
+@subsection @code{BZ2_bzRead}
+@example
+   int BZ2_bzRead ( int *bzerror, BZFILE *b, void *buf, int len );
+@end example
+Reads up to @code{len} (uncompressed) bytes from the compressed file 
+@code{b} into
+the buffer @code{buf}.  If the read was successful, 
+@code{bzerror} is set to @code{BZ_OK}
+and the number of bytes read is returned.  If the logical end-of-stream
+was detected, @code{bzerror} will be set to @code{BZ_STREAM_END}, 
+and the number
+of bytes read is returned.  All other @code{bzerror} values denote an error.
+
+@code{BZ2_bzRead} will supply @code{len} bytes,
+unless the logical stream end is detected
+or an error occurs.  Because of this, it is possible to detect the 
+stream end by observing when the number of bytes returned is 
+less than the number
+requested.  Nevertheless, this is regarded as inadvisable; you should
+instead check @code{bzerror} after every call and watch out for
+@code{BZ_STREAM_END}.
+
+Internally, @code{BZ2_bzRead} copies data from the compressed file in chunks
+of size @code{BZ_MAX_UNUSED} bytes
+before decompressing it.  If the file contains more bytes than strictly
+needed to reach the logical end-of-stream, @code{BZ2_bzRead} will almost certainly
+read some of the trailing data before signalling @code{BZ_SEQUENCE_END}.
+To collect the read but unused data once @code{BZ_SEQUENCE_END} has 
+appeared, call @code{BZ2_bzReadGetUnused} immediately before @code{BZ2_bzReadClose}.
+
+Possible assignments to @code{bzerror}:
+@display
+      @code{BZ_PARAM_ERROR}
+         if @code{b} is @code{NULL} or @code{buf} is @code{NULL} or @code{len < 0}
+      @code{BZ_SEQUENCE_ERROR} 
+         if @code{b} was opened with @code{BZ2_bzWriteOpen}
+      @code{BZ_IO_ERROR} 
+         if there is an error reading from the compressed file
+      @code{BZ_UNEXPECTED_EOF} 
+         if the compressed file ended before the logical end-of-stream was detected
+      @code{BZ_DATA_ERROR} 
+         if a data integrity error was detected in the compressed stream
+      @code{BZ_DATA_ERROR_MAGIC}
+         if the stream does not begin with the requisite header bytes (ie, is not 
+         a @code{bzip2} data file).  This is really a special case of @code{BZ_DATA_ERROR}.
+      @code{BZ_MEM_ERROR} 
+         if insufficient memory was available
+      @code{BZ_STREAM_END} 
+         if the logical end of stream was detected.
+      @code{BZ_OK}
+         otherwise.
+@end display
+
+Possible return values:
+@display
+      number of bytes read
+         if @code{bzerror} is @code{BZ_OK} or @code{BZ_STREAM_END}
+      undefined
+         otherwise
+@end display
+
+Allowable next actions:
+@display
+      collect data from @code{buf}, then @code{BZ2_bzRead} or @code{BZ2_bzReadClose}
+         if @code{bzerror} is @code{BZ_OK} 
+      collect data from @code{buf}, then @code{BZ2_bzReadClose} or @code{BZ2_bzReadGetUnused} 
+         if @code{bzerror} is @code{BZ_SEQUENCE_END}   
+      @code{BZ2_bzReadClose} 
+         otherwise
+@end display
+
+
+
+@subsection @code{BZ2_bzReadGetUnused}
+@example
+   void BZ2_bzReadGetUnused ( int* bzerror, BZFILE *b, 
+                              void** unused, int* nUnused );
+@end example
+Returns data which was read from the compressed file but was not needed
+to get to the logical end-of-stream.  @code{*unused} is set to the address
+of the data, and @code{*nUnused} to the number of bytes.  @code{*nUnused} will
+be set to a value between @code{0} and @code{BZ_MAX_UNUSED} inclusive.
+
+This function may only be called once @code{BZ2_bzRead} has signalled 
+@code{BZ_STREAM_END} but before @code{BZ2_bzReadClose}.
+
+Possible assignments to @code{bzerror}:
+@display
+      @code{BZ_PARAM_ERROR} 
+         if @code{b} is @code{NULL} 
+         or @code{unused} is @code{NULL} or @code{nUnused} is @code{NULL}
+      @code{BZ_SEQUENCE_ERROR} 
+         if @code{BZ_STREAM_END} has not been signalled
+         or if @code{b} was opened with @code{BZ2_bzWriteOpen}
+     @code{BZ_OK}
+         otherwise
+@end display
+
+Allowable next actions:
+@display 
+      @code{BZ2_bzReadClose}
+@end display
+
+
+@subsection @code{BZ2_bzReadClose}
+@example
+   void BZ2_bzReadClose ( int *bzerror, BZFILE *b );
+@end example
+Releases all memory pertaining to the compressed file @code{b}.  
+@code{BZ2_bzReadClose} does not call @code{fclose} on the underlying file
+handle, so you should do that yourself if appropriate.
+@code{BZ2_bzReadClose} should be called to clean up after all error
+situations.
+
+Possible assignments to @code{bzerror}:
+@display
+      @code{BZ_SEQUENCE_ERROR} 
+         if @code{b} was opened with @code{BZ2_bzOpenWrite} 
+      @code{BZ_OK} 
+         otherwise
+@end display
+
+Allowable next actions:
+@display
+      none
+@end display
+
+
+
+@subsection @code{BZ2_bzWriteOpen}
+@example
+   BZFILE *BZ2_bzWriteOpen ( int *bzerror, FILE *f, 
+                             int blockSize100k, int verbosity,
+                             int workFactor );
+@end example
+Prepare to write compressed data to file handle @code{f}.  
+@code{f} should refer to
+a file which has been opened for writing, and for which the error
+indicator (@code{ferror(f)})is not set.  
+
+For the meaning of parameters @code{blockSize100k},
+@code{verbosity} and @code{workFactor}, see
+@* @code{BZ2_bzCompressInit}.
+
+All required memory is allocated at this stage, so if the call
+completes successfully, @code{BZ_MEM_ERROR} cannot be signalled by a
+subsequent call to @code{BZ2_bzWrite}.
+
+Possible assignments to @code{bzerror}:
+@display 
+      @code{BZ_CONFIG_ERROR}
+         if the library has been mis-compiled
+      @code{BZ_PARAM_ERROR} 
+         if @code{f} is @code{NULL} 
+         or @code{blockSize100k < 1} or @code{blockSize100k > 9}
+      @code{BZ_IO_ERROR} 
+         if @code{ferror(f)} is nonzero
+      @code{BZ_MEM_ERROR} 
+         if insufficient memory is available
+      @code{BZ_OK} 
+         otherwise
+@end display
+
+Possible return values:
+@display
+      Pointer to an abstract @code{BZFILE}  
+         if @code{bzerror} is @code{BZ_OK}   
+      @code{NULL} 
+         otherwise
+@end display
+
+Allowable next actions:
+@display
+      @code{BZ2_bzWrite} 
+         if @code{bzerror} is @code{BZ_OK} 
+         (you could go directly to @code{BZ2_bzWriteClose}, but this would be pretty pointless)
+      @code{BZ2_bzWriteClose} 
+         otherwise
+@end display
+
+
+
+@subsection @code{BZ2_bzWrite}
+@example
+   void BZ2_bzWrite ( int *bzerror, BZFILE *b, void *buf, int len );
+@end example
+Absorbs @code{len} bytes from the buffer @code{buf}, eventually to be
+compressed and written to the file.
+
+Possible assignments to @code{bzerror}:
+@display
+      @code{BZ_PARAM_ERROR} 
+         if @code{b} is @code{NULL} or @code{buf} is @code{NULL} or @code{len < 0}
+      @code{BZ_SEQUENCE_ERROR} 
+         if b was opened with @code{BZ2_bzReadOpen}
+      @code{BZ_IO_ERROR} 
+         if there is an error writing the compressed file.
+      @code{BZ_OK} 
+         otherwise
+@end display
+
+
+
+
+@subsection @code{BZ2_bzWriteClose}
+@example
+   void BZ2_bzWriteClose ( int *bzerror, BZFILE* f,
+                           int abandon,
+                           unsigned int* nbytes_in,
+                           unsigned int* nbytes_out );
+
+   void BZ2_bzWriteClose64 ( int *bzerror, BZFILE* f,
+                             int abandon,
+                             unsigned int* nbytes_in_lo32,
+                             unsigned int* nbytes_in_hi32,
+                             unsigned int* nbytes_out_lo32,
+                             unsigned int* nbytes_out_hi32 );
+@end example
+
+Compresses and flushes to the compressed file all data so far supplied
+by @code{BZ2_bzWrite}.  The logical end-of-stream markers are also written, so
+subsequent calls to @code{BZ2_bzWrite} are illegal.  All memory associated 
+with the compressed file @code{b} is released.  
+@code{fflush} is called on the
+compressed file, but it is not @code{fclose}'d.
+
+If @code{BZ2_bzWriteClose} is called to clean up after an error, the only
+action is to release the memory.  The library records the error codes
+issued by previous calls, so this situation will be detected
+automatically.  There is no attempt to complete the compression
+operation, nor to @code{fflush} the compressed file.  You can force this
+behaviour to happen even in the case of no error, by passing a nonzero
+value to @code{abandon}.
+
+If @code{nbytes_in} is non-null, @code{*nbytes_in} will be set to be the
+total volume of uncompressed data handled.  Similarly, @code{nbytes_out}
+will be set to the total volume of compressed data written.  For 
+compatibility with older versions of the library, @code{BZ2_bzWriteClose}
+only yields the lower 32 bits of these counts.  Use
+@code{BZ2_bzWriteClose64} if you want the full 64 bit counts.  These
+two functions are otherwise absolutely identical.
+
+
+Possible assignments to @code{bzerror}:
+@display
+      @code{BZ_SEQUENCE_ERROR} 
+         if @code{b} was opened with @code{BZ2_bzReadOpen}
+      @code{BZ_IO_ERROR} 
+         if there is an error writing the compressed file
+      @code{BZ_OK} 
+         otherwise
+@end display
+
+@subsection Handling embedded compressed data streams
+
+The high-level library facilitates use of
+@code{bzip2} data streams which form some part of a surrounding, larger
+data stream.
+@itemize @bullet
+@item For writing, the library takes an open file handle, writes
+compressed data to it, @code{fflush}es it but does not @code{fclose} it.
+The calling application can write its own data before and after the
+compressed data stream, using that same file handle.
+@item Reading is more complex, and the facilities are not as general
+as they could be since generality is hard to reconcile with efficiency.
+@code{BZ2_bzRead} reads from the compressed file in blocks of size
+@code{BZ_MAX_UNUSED} bytes, and in doing so probably will overshoot
+the logical end of compressed stream.
+To recover this data once decompression has
+ended, call @code{BZ2_bzReadGetUnused} after the last call of @code{BZ2_bzRead}
+(the one returning @code{BZ_STREAM_END}) but before calling
+@code{BZ2_bzReadClose}.
+@end itemize
+
+This mechanism makes it easy to decompress multiple @code{bzip2}
+streams placed end-to-end.  As the end of one stream, when @code{BZ2_bzRead}
+returns @code{BZ_STREAM_END}, call @code{BZ2_bzReadGetUnused} to collect the
+unused data (copy it into your own buffer somewhere).  
+That data forms the start of the next compressed stream.
+To start uncompressing that next stream, call @code{BZ2_bzReadOpen} again,
+feeding in the unused data via the @code{unused}/@code{nUnused}
+parameters.
+Keep doing this until @code{BZ_STREAM_END} return coincides with the
+physical end of file (@code{feof(f)}).  In this situation
+@code{BZ2_bzReadGetUnused}
+will of course return no data.
+
+This should give some feel for how the high-level interface can be used.
+If you require extra flexibility, you'll have to bite the bullet and get
+to grips with the low-level interface.
+
+@subsection Standard file-reading/writing code
+Here's how you'd write data to a compressed file:
+@example @code
+FILE*   f;
+BZFILE* b;
+int     nBuf;
+char    buf[ /* whatever size you like */ ];
+int     bzerror;
+int     nWritten;
+
+f = fopen ( "myfile.bz2", "w" );
+if (!f) @{
+   /* handle error */
+@}
+b = BZ2_bzWriteOpen ( &bzerror, f, 9 );
+if (bzerror != BZ_OK) @{
+   BZ2_bzWriteClose ( b );
+   /* handle error */
+@}
+
+while ( /* condition */ ) @{
+   /* get data to write into buf, and set nBuf appropriately */
+   nWritten = BZ2_bzWrite ( &bzerror, b, buf, nBuf );
+   if (bzerror == BZ_IO_ERROR) @{ 
+      BZ2_bzWriteClose ( &bzerror, b );
+      /* handle error */
+   @}
+@}
+
+BZ2_bzWriteClose ( &bzerror, b );
+if (bzerror == BZ_IO_ERROR) @{
+   /* handle error */
+@}
+@end example
+And to read from a compressed file:
+@example
+FILE*   f;
+BZFILE* b;
+int     nBuf;
+char    buf[ /* whatever size you like */ ];
+int     bzerror;
+int     nWritten;
+
+f = fopen ( "myfile.bz2", "r" );
+if (!f) @{
+   /* handle error */
+@}
+b = BZ2_bzReadOpen ( &bzerror, f, 0, NULL, 0 );
+if (bzerror != BZ_OK) @{
+   BZ2_bzReadClose ( &bzerror, b );
+   /* handle error */
+@}
+
+bzerror = BZ_OK;
+while (bzerror == BZ_OK && /* arbitrary other conditions */) @{
+   nBuf = BZ2_bzRead ( &bzerror, b, buf, /* size of buf */ );
+   if (bzerror == BZ_OK) @{
+      /* do something with buf[0 .. nBuf-1] */
+   @}
+@}
+if (bzerror != BZ_STREAM_END) @{
+   BZ2_bzReadClose ( &bzerror, b );
+   /* handle error */
+@} else @{
+   BZ2_bzReadClose ( &bzerror );
+@}
+@end example
+
+
+
+@section Utility functions
+@subsection @code{BZ2_bzBuffToBuffCompress}
+@example
+   int BZ2_bzBuffToBuffCompress( char*         dest,
+                                 unsigned int* destLen,
+                                 char*         source,
+                                 unsigned int  sourceLen,
+                                 int           blockSize100k,
+                                 int           verbosity,
+                                 int           workFactor );
+@end example
+Attempts to compress the data in @code{source[0 .. sourceLen-1]}
+into the destination buffer, @code{dest[0 .. *destLen-1]}.
+If the destination buffer is big enough, @code{*destLen} is
+set to the size of the compressed data, and @code{BZ_OK} is
+returned.  If the compressed data won't fit, @code{*destLen}
+is unchanged, and @code{BZ_OUTBUFF_FULL} is returned.
+
+Compression in this manner is a one-shot event, done with a single call
+to this function.  The resulting compressed data is a complete
+@code{bzip2} format data stream.  There is no mechanism for making
+additional calls to provide extra input data.  If you want that kind of
+mechanism, use the low-level interface.
+
+For the meaning of parameters @code{blockSize100k}, @code{verbosity}
+and @code{workFactor}, @* see @code{BZ2_bzCompressInit}.
+
+To guarantee that the compressed data will fit in its buffer, allocate
+an output buffer of size 1% larger than the uncompressed data, plus
+six hundred extra bytes.
+
+@code{BZ2_bzBuffToBuffDecompress} will not write data at or
+beyond @code{dest[*destLen]}, even in case of buffer overflow.
+
+Possible return values:
+@display
+      @code{BZ_CONFIG_ERROR}
+         if the library has been mis-compiled
+      @code{BZ_PARAM_ERROR} 
+         if @code{dest} is @code{NULL} or @code{destLen} is @code{NULL}
+         or @code{blockSize100k < 1} or @code{blockSize100k > 9}
+         or @code{verbosity < 0} or @code{verbosity > 4} 
+         or @code{workFactor < 0} or @code{workFactor > 250}
+      @code{BZ_MEM_ERROR}
+         if insufficient memory is available 
+      @code{BZ_OUTBUFF_FULL}
+         if the size of the compressed data exceeds @code{*destLen}
+      @code{BZ_OK} 
+         otherwise
+@end display
+
+
+
+@subsection @code{BZ2_bzBuffToBuffDecompress}
+@example
+   int BZ2_bzBuffToBuffDecompress ( char*         dest,
+                                    unsigned int* destLen,
+                                    char*         source,
+                                    unsigned int  sourceLen,
+                                    int           small,
+                                    int           verbosity );
+@end example
+Attempts to decompress the data in @code{source[0 .. sourceLen-1]}
+into the destination buffer, @code{dest[0 .. *destLen-1]}.
+If the destination buffer is big enough, @code{*destLen} is
+set to the size of the uncompressed data, and @code{BZ_OK} is
+returned.  If the compressed data won't fit, @code{*destLen}
+is unchanged, and @code{BZ_OUTBUFF_FULL} is returned.
+
+@code{source} is assumed to hold a complete @code{bzip2} format
+data stream.  @* @code{BZ2_bzBuffToBuffDecompress} tries to decompress
+the entirety of the stream into the output buffer.
+
+For the meaning of parameters @code{small} and @code{verbosity},
+see @code{BZ2_bzDecompressInit}.
+
+Because the compression ratio of the compressed data cannot be known in
+advance, there is no easy way to guarantee that the output buffer will
+be big enough.  You may of course make arrangements in your code to
+record the size of the uncompressed data, but such a mechanism is beyond
+the scope of this library.
+
+@code{BZ2_bzBuffToBuffDecompress} will not write data at or
+beyond @code{dest[*destLen]}, even in case of buffer overflow.
+
+Possible return values:
+@display
+      @code{BZ_CONFIG_ERROR}
+         if the library has been mis-compiled
+      @code{BZ_PARAM_ERROR} 
+         if @code{dest} is @code{NULL} or @code{destLen} is @code{NULL}
+         or @code{small != 0 && small != 1}
+         or @code{verbosity < 0} or @code{verbosity > 4} 
+      @code{BZ_MEM_ERROR}
+         if insufficient memory is available 
+      @code{BZ_OUTBUFF_FULL}
+         if the size of the compressed data exceeds @code{*destLen}
+      @code{BZ_DATA_ERROR}
+         if a data integrity error was detected in the compressed data
+      @code{BZ_DATA_ERROR_MAGIC}
+         if the compressed data doesn't begin with the right magic bytes
+      @code{BZ_UNEXPECTED_EOF}
+         if the compressed data ends unexpectedly
+      @code{BZ_OK} 
+         otherwise
+@end display
+
+
+
+@section @code{zlib} compatibility functions
+Yoshioka Tsuneo has contributed some functions to
+give better @code{zlib} compatibility.  These functions are
+@code{BZ2_bzopen}, @code{BZ2_bzread}, @code{BZ2_bzwrite}, @code{BZ2_bzflush},
+@code{BZ2_bzclose},
+@code{BZ2_bzerror} and @code{BZ2_bzlibVersion}.
+These functions are not (yet) officially part of
+the library.  If they break, you get to keep all the pieces.
+Nevertheless, I think they work ok.
+@example
+typedef void BZFILE;
+
+const char * BZ2_bzlibVersion ( void );
+@end example
+Returns a string indicating the library version.
+@example
+BZFILE * BZ2_bzopen  ( const char *path, const char *mode );
+BZFILE * BZ2_bzdopen ( int        fd,    const char *mode );
+@end example
+Opens a @code{.bz2} file for reading or writing, using either its name
+or a pre-existing file descriptor. 
+Analogous to @code{fopen} and @code{fdopen}.
+@example         
+int BZ2_bzread  ( BZFILE* b, void* buf, int len );
+int BZ2_bzwrite ( BZFILE* b, void* buf, int len );
+@end example
+Reads/writes data from/to a previously opened @code{BZFILE}.
+Analogous to @code{fread} and @code{fwrite}.
+@example
+int  BZ2_bzflush ( BZFILE* b );
+void BZ2_bzclose ( BZFILE* b );
+@end example
+Flushes/closes a @code{BZFILE}.  @code{BZ2_bzflush} doesn't actually do
+anything.  Analogous to @code{fflush} and @code{fclose}.
+
+@example 
+const char * BZ2_bzerror ( BZFILE *b, int *errnum )
+@end example
+Returns a string describing the more recent error status of
+@code{b}, and also sets @code{*errnum} to its numerical value.
+
+
+@section Using the library in a @code{stdio}-free environment
+
+@subsection Getting rid of @code{stdio}
+
+In a deeply embedded application, you might want to use just
+the memory-to-memory functions.  You can do this conveniently
+by compiling the library with preprocessor symbol @code{BZ_NO_STDIO}
+defined.  Doing this gives you a library containing only the following
+eight functions:
+
+@code{BZ2_bzCompressInit}, @code{BZ2_bzCompress}, @code{BZ2_bzCompressEnd} @*
+@code{BZ2_bzDecompressInit}, @code{BZ2_bzDecompress}, @code{BZ2_bzDecompressEnd} @*
+@code{BZ2_bzBuffToBuffCompress}, @code{BZ2_bzBuffToBuffDecompress}
+
+When compiled like this, all functions will ignore @code{verbosity}
+settings.
+
+@subsection Critical error handling
+@code{libbzip2} contains a number of internal assertion checks which
+should, needless to say, never be activated.  Nevertheless, if an
+assertion should fail, behaviour depends on whether or not the library
+was compiled with @code{BZ_NO_STDIO} set.
+
+For a normal compile, an assertion failure yields the message
+@example
+   bzip2/libbzip2: internal error number N.
+   This is a bug in bzip2/libbzip2, 1.0 of 21-Mar-2000.
+   Please report it to me at: jseward@@acm.org.  If this happened
+   when you were using some program which uses libbzip2 as a
+   component, you should also report this bug to the author(s)
+   of that program.  Please make an effort to report this bug;
+   timely and accurate bug reports eventually lead to higher
+   quality software.  Thanks.  Julian Seward, 21 March 2000.
+@end example
+where @code{N} is some error code number.  @code{exit(3)}
+is then called.
+
+For a @code{stdio}-free library, assertion failures result
+in a call to a function declared as:
+@example
+   extern void bz_internal_error ( int errcode );
+@end example
+The relevant code is passed as a parameter.  You should supply
+such a function.
+
+In either case, once an assertion failure has occurred, any 
+@code{bz_stream} records involved can be regarded as invalid.
+You should not attempt to resume normal operation with them.
+
+You may, of course, change critical error handling to suit
+your needs.  As I said above, critical errors indicate bugs
+in the library and should not occur.  All "normal" error
+situations are indicated via error return codes from functions,
+and can be recovered from.
+
+
+@section Making a Windows DLL
+Everything related to Windows has been contributed by Yoshioka Tsuneo
+@* (@code{QWF00133@@niftyserve.or.jp} /
+@code{tsuneo-y@@is.aist-nara.ac.jp}), so you should send your queries to
+him (but perhaps Cc: me, @code{jseward@@acm.org}).
+
+My vague understanding of what to do is: using Visual C++ 5.0,
+open the project file @code{libbz2.dsp}, and build.  That's all.
+
+If you can't
+open the project file for some reason, make a new one, naming these files:
+@code{blocksort.c}, @code{bzlib.c}, @code{compress.c}, 
+@code{crctable.c}, @code{decompress.c}, @code{huffman.c}, @*
+@code{randtable.c} and @code{libbz2.def}.  You will also need
+to name the header files @code{bzlib.h} and @code{bzlib_private.h}.
+
+If you don't use VC++, you may need to define the proprocessor symbol
+@code{_WIN32}. 
+
+Finally, @code{dlltest.c} is a sample program using the DLL.  It has a
+project file, @code{dlltest.dsp}.
+
+If you just want a makefile for Visual C, have a look at
+@code{makefile.msc}.
+
+Be aware that if you compile @code{bzip2} itself on Win32, you must set
+@code{BZ_UNIX} to 0 and @code{BZ_LCCWIN32} to 1, in the file
+@code{bzip2.c}, before compiling.  Otherwise the resulting binary won't
+work correctly.
+
+I haven't tried any of this stuff myself, but it all looks plausible.
+
+
+
+@chapter Miscellanea
+
+These are just some random thoughts of mine.  Your mileage may
+vary.
+
+@section Limitations of the compressed file format
+@code{bzip2-1.0}, @code{0.9.5} and @code{0.9.0}
+use exactly the same file format as the previous
+version, @code{bzip2-0.1}.  This decision was made in the interests of
+stability.  Creating yet another incompatible compressed file format
+would create further confusion and disruption for users.
+
+Nevertheless, this is not a painless decision.  Development
+work since the release of @code{bzip2-0.1} in August 1997
+has shown complexities in the file format which slow down
+decompression and, in retrospect, are unnecessary.  These are:
+@itemize @bullet
+@item The run-length encoder, which is the first of the 
+      compression transformations, is entirely irrelevant.
+      The original purpose was to protect the sorting algorithm
+      from the very worst case input: a string of repeated
+      symbols.  But algorithm steps Q6a and Q6b in the original
+      Burrows-Wheeler technical report (SRC-124) show how
+      repeats can be handled without difficulty in block
+      sorting.
+@item The randomisation mechanism doesn't really need to be
+      there.  Udi Manber and Gene Myers published a suffix
+      array construction algorithm a few years back, which
+      can be employed to sort any block, no matter how 
+      repetitive, in O(N log N) time.  Subsequent work by
+      Kunihiko Sadakane has produced a derivative O(N (log N)^2) 
+      algorithm which usually outperforms the Manber-Myers
+      algorithm.
+
+      I could have changed to Sadakane's algorithm, but I find
+      it to be slower than @code{bzip2}'s existing algorithm for
+      most inputs, and the randomisation mechanism protects
+      adequately against bad cases.  I didn't think it was
+      a good tradeoff to make.  Partly this is due to the fact
+      that I was not flooded with email complaints about
+      @code{bzip2-0.1}'s performance on repetitive data, so
+      perhaps it isn't a problem for real inputs.
+
+      Probably the best long-term solution,
+      and the one I have incorporated into 0.9.5 and above,
+      is to use the existing sorting
+      algorithm initially, and fall back to a O(N (log N)^2)
+      algorithm if the standard algorithm gets into difficulties.
+@item The compressed file format was never designed to be
+      handled by a library, and I have had to jump though
+      some hoops to produce an efficient implementation of
+      decompression.  It's a bit hairy.  Try passing
+      @code{decompress.c} through the C preprocessor 
+      and you'll see what I mean.  Much of this complexity
+      could have been avoided if the compressed size of
+      each block of data was recorded in the data stream.
+@item An Adler-32 checksum, rather than a CRC32 checksum,
+      would be faster to compute.
+@end itemize
+It would be fair to say that the @code{bzip2} format was frozen
+before I properly and fully understood the performance
+consequences of doing so.
+
+Improvements which I was able to incorporate into
+0.9.0, despite using the same file format, are:
+@itemize @bullet
+@item Single array implementation of the inverse BWT.  This
+      significantly speeds up decompression, presumably
+      because it reduces the number of cache misses.
+@item Faster inverse MTF transform for large MTF values.  The
+      new implementation is based on the notion of sliding blocks
+      of values.
+@item @code{bzip2-0.9.0} now reads and writes files with @code{fread}
+      and @code{fwrite}; version 0.1 used @code{putc} and @code{getc}.
+      Duh!  Well, you live and learn.
+
+@end itemize
+Further ahead, it would be nice 
+to be able to do random access into files.  This will 
+require some careful design of compressed file formats.
+
+
+
+@section Portability issues
+After some consideration, I have decided not to use
+GNU @code{autoconf} to configure 0.9.5 or 1.0.
+
+@code{autoconf}, admirable and wonderful though it is, 
+mainly assists with portability problems between Unix-like
+platforms.  But @code{bzip2} doesn't have much in the way
+of portability problems on Unix; most of the difficulties appear
+when porting to the Mac, or to Microsoft's operating systems.
+@code{autoconf} doesn't help in those cases, and brings in a 
+whole load of new complexity.
+
+Most people should be able to compile the library and program
+under Unix straight out-of-the-box, so to speak, especially 
+if you have a version of GNU C available.
+
+There are a couple of @code{__inline__} directives in the code.  GNU C
+(@code{gcc}) should be able to handle them.  If you're not using
+GNU C, your C compiler shouldn't see them at all.
+If your compiler does, for some reason, see them and doesn't
+like them, just @code{#define} @code{__inline__} to be @code{/* */}.  One
+easy way to do this is to compile with the flag @code{-D__inline__=}, 
+which should be understood by most Unix compilers.
+
+If you still have difficulties, try compiling with the macro
+@code{BZ_STRICT_ANSI} defined.  This should enable you to build the
+library in a strictly ANSI compliant environment.  Building the program
+itself like this is dangerous and not supported, since you remove
+@code{bzip2}'s checks against compressing directories, symbolic links,
+devices, and other not-really-a-file entities.  This could cause
+filesystem corruption!
+
+One other thing: if you create a @code{bzip2} binary for public
+distribution, please try and link it statically (@code{gcc -s}).  This
+avoids all sorts of library-version issues that others may encounter
+later on.
+
+If you build @code{bzip2} on Win32, you must set @code{BZ_UNIX} to 0 and
+@code{BZ_LCCWIN32} to 1, in the file @code{bzip2.c}, before compiling.
+Otherwise the resulting binary won't work correctly.
+
+
+
+@section Reporting bugs
+I tried pretty hard to make sure @code{bzip2} is
+bug free, both by design and by testing.  Hopefully
+you'll never need to read this section for real.
+
+Nevertheless, if @code{bzip2} dies with a segmentation
+fault, a bus error or an internal assertion failure, it
+will ask you to email me a bug report.  Experience with
+version 0.1 shows that almost all these problems can
+be traced to either compiler bugs or hardware problems.
+@itemize @bullet
+@item
+Recompile the program with no optimisation, and see if it
+works.  And/or try a different compiler.
+I heard all sorts of stories about various flavours
+of GNU C (and other compilers) generating bad code for
+@code{bzip2}, and I've run across two such examples myself.
+
+2.7.X versions of GNU C are known to generate bad code from
+time to time, at high optimisation levels.  
+If you get problems, try using the flags
+@code{-O2} @code{-fomit-frame-pointer} @code{-fno-strength-reduce}.
+You should specifically @emph{not} use @code{-funroll-loops}.
+
+You may notice that the Makefile runs six tests as part of
+the build process.  If the program passes all of these, it's
+a pretty good (but not 100%) indication that the compiler has
+done its job correctly.
+@item
+If @code{bzip2} crashes randomly, and the crashes are not
+repeatable, you may have a flaky memory subsystem.  @code{bzip2}
+really hammers your memory hierarchy, and if it's a bit marginal,
+you may get these problems.  Ditto if your disk or I/O subsystem
+is slowly failing.  Yup, this really does happen.
+
+Try using a different machine of the same type, and see if
+you can repeat the problem.
+@item This isn't really a bug, but ... If @code{bzip2} tells
+you your file is corrupted on decompression, and you
+obtained the file via FTP, there is a possibility that you
+forgot to tell FTP to do a binary mode transfer.  That absolutely
+will cause the file to be non-decompressible.  You'll have to transfer
+it again.
+@end itemize
+
+If you've incorporated @code{libbzip2} into your own program
+and are getting problems, please, please, please, check that the 
+parameters you are passing in calls to the library, are
+correct, and in accordance with what the documentation says
+is allowable.  I have tried to make the library robust against
+such problems, but I'm sure I haven't succeeded.
+
+Finally, if the above comments don't help, you'll have to send
+me a bug report.  Now, it's just amazing how many people will 
+send me a bug report saying something like
+@display
+   bzip2 crashed with segmentation fault on my machine
+@end display
+and absolutely nothing else.  Needless to say, a such a report
+is @emph{totally, utterly, completely and comprehensively 100% useless; 
+a waste of your time, my time, and net bandwidth}.
+With no details at all, there's no way I can possibly begin
+to figure out what the problem is.
+
+The rules of the game are: facts, facts, facts.  Don't omit
+them because "oh, they won't be relevant".  At the bare 
+minimum:
+@display
+   Machine type.  Operating system version.  
+   Exact version of @code{bzip2} (do @code{bzip2 -V}).  
+   Exact version of the compiler used.  
+   Flags passed to the compiler.
+@end display
+However, the most important single thing that will help me is
+the file that you were trying to compress or decompress at the
+time the problem happened.  Without that, my ability to do anything
+more than speculate about the cause, is limited.
+
+Please remember that I connect to the Internet with a modem, so
+you should contact me before mailing me huge files.
+
+
+@section Did you get the right package?
+
+@code{bzip2} is a resource hog.  It soaks up large amounts of CPU cycles
+and memory.  Also, it gives very large latencies.  In the worst case, you
+can feed many megabytes of uncompressed data into the library before
+getting any compressed output, so this probably rules out applications
+requiring interactive behaviour.
+
+These aren't faults of my implementation, I hope, but more
+an intrinsic property of the Burrows-Wheeler transform (unfortunately).  
+Maybe this isn't what you want.
+
+If you want a compressor and/or library which is faster, uses less
+memory but gets pretty good compression, and has minimal latency,
+consider Jean-loup
+Gailly's and Mark Adler's work, @code{zlib-1.1.2} and
+@code{gzip-1.2.4}.  Look for them at
+
+@code{http://www.cdrom.com/pub/infozip/zlib} and
+@code{http://www.gzip.org} respectively.
+
+For something faster and lighter still, you might try Markus F X J
+Oberhumer's @code{LZO} real-time compression/decompression library, at
+@* @code{http://wildsau.idv.uni-linz.ac.at/mfx/lzo.html}.
+
+If you want to use the @code{bzip2} algorithms to compress small blocks
+of data, 64k bytes or smaller, for example on an on-the-fly disk
+compressor, you'd be well advised not to use this library.  Instead,
+I've made a special library tuned for that kind of use.  It's part of
+@code{e2compr-0.40}, an on-the-fly disk compressor for the Linux
+@code{ext2} filesystem.  Look at
+@code{http://www.netspace.net.au/~reiter/e2compr}.
+
+
+
+@section Testing
+
+A record of the tests I've done.
+
+First, some data sets:
+@itemize @bullet
+@item B: a directory containing 6001 files, one for every length in the
+      range 0 to 6000 bytes.  The files contain random lowercase
+      letters.  18.7 megabytes.
+@item H: my home directory tree.  Documents, source code, mail files,
+      compressed data.  H contains B, and also a directory of 
+      files designed as boundary cases for the sorting; mostly very
+      repetitive, nasty files.  565 megabytes.
+@item A: directory tree holding various applications built from source:
+      @code{egcs}, @code{gcc-2.8.1}, KDE, GTK, Octave, etc.
+      2200 megabytes.
+@end itemize
+The tests conducted are as follows.  Each test means compressing 
+(a copy of) each file in the data set, decompressing it and
+comparing it against the original.
+
+First, a bunch of tests with block sizes and internal buffer
+sizes set very small, 
+to detect any problems with the
+blocking and buffering mechanisms.  
+This required modifying the source code so as to try to 
+break it.
+@enumerate
+@item Data set H, with
+      buffer size of 1 byte, and block size of 23 bytes.
+@item Data set B, buffer sizes 1 byte, block size 1 byte.
+@item As (2) but small-mode decompression.
+@item As (2) with block size 2 bytes.
+@item As (2) with block size 3 bytes.
+@item As (2) with block size 4 bytes.
+@item As (2) with block size 5 bytes.
+@item As (2) with block size 6 bytes and small-mode decompression.
+@item H with buffer size of 1 byte, but normal block
+      size (up to 900000 bytes).
+@end enumerate
+Then some tests with unmodified source code.
+@enumerate
+@item H, all settings normal.
+@item As (1), with small-mode decompress.
+@item H, compress with flag @code{-1}.
+@item H, compress with flag @code{-s}, decompress with flag @code{-s}.
+@item Forwards compatibility: H, @code{bzip2-0.1pl2} compressing,
+      @code{bzip2-0.9.5} decompressing, all settings normal.
+@item Backwards compatibility:  H, @code{bzip2-0.9.5} compressing,
+      @code{bzip2-0.1pl2} decompressing, all settings normal.
+@item Bigger tests: A, all settings normal.
+@item As (7), using the fallback (Sadakane-like) sorting algorithm.
+@item As (8), compress with flag @code{-1}, decompress with flag
+      @code{-s}.
+@item H, using the fallback sorting algorithm.
+@item Forwards compatibility: A, @code{bzip2-0.1pl2} compressing,
+      @code{bzip2-0.9.5} decompressing, all settings normal.
+@item Backwards compatibility:  A, @code{bzip2-0.9.5} compressing,
+      @code{bzip2-0.1pl2} decompressing, all settings normal.
+@item Misc test: about 400 megabytes of @code{.tar} files with
+      @code{bzip2} compiled with Checker (a memory access error
+       detector, like Purify).
+@item Misc tests to make sure it builds and runs ok on non-Linux/x86
+      platforms.
+@end enumerate
+These tests were conducted on a 225 MHz IDT WinChip machine, running
+Linux 2.0.36.  They represent nearly a week of continuous computation.
+All tests completed successfully.
+
+
+@section Further reading
+@code{bzip2} is not research work, in the sense that it doesn't present
+any new ideas.  Rather, it's an engineering exercise based on existing
+ideas.
+
+Four documents describe essentially all the ideas behind @code{bzip2}:
+@example
+Michael Burrows and D. J. Wheeler:
+  "A block-sorting lossless data compression algorithm"
+   10th May 1994. 
+   Digital SRC Research Report 124.
+   ftp://ftp.digital.com/pub/DEC/SRC/research-reports/SRC-124.ps.gz
+   If you have trouble finding it, try searching at the
+   New Zealand Digital Library, http://www.nzdl.org.
+
+Daniel S. Hirschberg and Debra A. LeLewer
+  "Efficient Decoding of Prefix Codes"
+   Communications of the ACM, April 1990, Vol 33, Number 4.
+   You might be able to get an electronic copy of this
+      from the ACM Digital Library.
+
+David J. Wheeler
+   Program bred3.c and accompanying document bred3.ps.
+   This contains the idea behind the multi-table Huffman
+   coding scheme.
+   ftp://ftp.cl.cam.ac.uk/users/djw3/
+
+Jon L. Bentley and Robert Sedgewick
+  "Fast Algorithms for Sorting and Searching Strings"
+   Available from Sedgewick's web page,
+   www.cs.princeton.edu/~rs
+@end example
+The following paper gives valuable additional insights into the
+algorithm, but is not immediately the basis of any code
+used in bzip2.
+@example
+Peter Fenwick:
+   Block Sorting Text Compression
+   Proceedings of the 19th Australasian Computer Science Conference,
+     Melbourne, Australia.  Jan 31 - Feb 2, 1996.
+   ftp://ftp.cs.auckland.ac.nz/pub/peter-f/ACSC96paper.ps
+@end example
+Kunihiko Sadakane's sorting algorithm, mentioned above,
+is available from:
+@example
+http://naomi.is.s.u-tokyo.ac.jp/~sada/papers/Sada98b.ps.gz
+@end example
+The Manber-Myers suffix array construction
+algorithm is described in a paper
+available from:
+@example
+http://www.cs.arizona.edu/people/gene/PAPERS/suffix.ps
+@end example
+Finally, the following paper documents some recent investigations
+I made into the performance of sorting algorithms:
+@example
+Julian Seward:
+   On the Performance of BWT Sorting Algorithms
+   Proceedings of the IEEE Data Compression Conference 2000
+     Snowbird, Utah.  28-30 March 2000.
+@end example
+
+
+@contents
+
+@bye
+
diff --git a/bzip2/manual_1.html b/bzip2/manual_1.html
new file mode 100644
index 000000000..92ba7c6df
--- /dev/null
+++ b/bzip2/manual_1.html
@@ -0,0 +1,47 @@
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+     from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - Introduction</TITLE>
+<link href="manual_2.html" rel=Next>
+<link href="manual_toc.html" rel=ToC>
+
+</HEAD>
+<BODY>
+<p>Go to the first, previous, <A HREF="manual_2.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+<P><HR><P>
+
+
+<H1><A NAME="SEC1" HREF="manual_toc.html#TOC1">Introduction</A></H1>
+
+<P>
+<CODE>bzip2</CODE>  compresses  files  using the Burrows-Wheeler 
+block-sorting text compression algorithm,  and  Huffman  coding.
+Compression  is  generally  considerably  better than that
+achieved by more conventional LZ77/LZ78-based compressors,
+and  approaches  the performance of the PPM family of statistical compressors.
+
+</P>
+<P>
+<CODE>bzip2</CODE> is built on top of <CODE>libbzip2</CODE>, a flexible library
+for handling compressed data in the <CODE>bzip2</CODE> format.  This manual
+describes both how to use the program and 
+how to work with the library interface.  Most of the
+manual is devoted to this library, not the program, 
+which is good news if your interest is only in the program.
+
+</P>
+<P>
+Chapter 2 describes how to use <CODE>bzip2</CODE>; this is the only part 
+you need to read if you just want to know how to operate the program.
+Chapter 3 describes the programming interfaces in detail, and
+Chapter 4 records some miscellaneous notes which I thought
+ought to be recorded somewhere.
+
+</P>
+
+<P><HR><P>
+<p>Go to the first, previous, <A HREF="manual_2.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+</BODY>
+</HTML>
diff --git a/bzip2/manual_2.html b/bzip2/manual_2.html
new file mode 100644
index 000000000..39453c42d
--- /dev/null
+++ b/bzip2/manual_2.html
@@ -0,0 +1,484 @@
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+     from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - How to use bzip2</TITLE>
+<link href="manual_3.html" rel=Next>
+<link href="manual_1.html" rel=Previous>
+<link href="manual_toc.html" rel=ToC>
+
+</HEAD>
+<BODY>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_1.html">previous</A>, <A HREF="manual_3.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+<P><HR><P>
+
+
+<H1><A NAME="SEC2" HREF="manual_toc.html#TOC2">How to use <CODE>bzip2</CODE></A></H1>
+
+<P>
+This chapter contains a copy of the <CODE>bzip2</CODE> man page,
+and nothing else.
+
+</P>
+
+<BLOCKQUOTE>
+
+
+
+<H4><A NAME="SEC3" HREF="manual_toc.html#TOC3">NAME</A></H4>
+
+<UL>
+<LI><CODE>bzip2</CODE>, <CODE>bunzip2</CODE>
+
+- a block-sorting file compressor, v1.0
+<LI><CODE>bzcat</CODE>
+
+- decompresses files to stdout
+<LI><CODE>bzip2recover</CODE>
+
+- recovers data from damaged bzip2 files
+</UL>
+
+
+
+<H4><A NAME="SEC4" HREF="manual_toc.html#TOC4">SYNOPSIS</A></H4>
+
+<UL>
+<LI><CODE>bzip2</CODE> [ -cdfkqstvzVL123456789 ] [ filenames ...  ]
+
+<LI><CODE>bunzip2</CODE> [ -fkvsVL ] [ filenames ...  ]
+
+<LI><CODE>bzcat</CODE> [ -s ] [ filenames ...  ]
+
+<LI><CODE>bzip2recover</CODE> filename
+
+</UL>
+
+
+
+<H4><A NAME="SEC5" HREF="manual_toc.html#TOC5">DESCRIPTION</A></H4>
+
+<P>
+<CODE>bzip2</CODE> compresses files using the Burrows-Wheeler block sorting
+text compression algorithm, and Huffman coding.  Compression is
+generally considerably better than that achieved by more conventional
+LZ77/LZ78-based compressors, and approaches the performance of the PPM
+family of statistical compressors.
+
+</P>
+<P>
+The command-line options are deliberately very similar to those of GNU
+<CODE>gzip</CODE>, but they are not identical.
+
+</P>
+<P>
+<CODE>bzip2</CODE> expects a list of file names to accompany the command-line
+flags.  Each file is replaced by a compressed version of itself, with
+the name <CODE>original_name.bz2</CODE>.  Each compressed file has the same
+modification date, permissions, and, when possible, ownership as the
+corresponding original, so that these properties can be correctly
+restored at decompression time.  File name handling is naive in the
+sense that there is no mechanism for preserving original file names,
+permissions, ownerships or dates in filesystems which lack these
+concepts, or have serious file name length restrictions, such as MS-DOS.
+
+</P>
+<P>
+<CODE>bzip2</CODE> and <CODE>bunzip2</CODE> will by default not overwrite existing
+files.  If you want this to happen, specify the <CODE>-f</CODE> flag.
+
+</P>
+<P>
+If no file names are specified, <CODE>bzip2</CODE> compresses from standard
+input to standard output.  In this case, <CODE>bzip2</CODE> will decline to
+write compressed output to a terminal, as this would be entirely
+incomprehensible and therefore pointless.
+
+</P>
+<P>
+<CODE>bunzip2</CODE> (or <CODE>bzip2 -d</CODE>) decompresses all
+specified files.  Files which were not created by <CODE>bzip2</CODE>
+will be detected and ignored, and a warning issued.  
+<CODE>bzip2</CODE> attempts to guess the filename for the decompressed file 
+from that of the compressed file as follows:
+
+<UL>
+<LI><CODE>filename.bz2 </CODE> becomes <CODE>filename</CODE>
+
+<LI><CODE>filename.bz  </CODE> becomes <CODE>filename</CODE>
+
+<LI><CODE>filename.tbz2</CODE> becomes <CODE>filename.tar</CODE>
+
+<LI><CODE>filename.tbz </CODE> becomes <CODE>filename.tar</CODE>
+
+<LI><CODE>anyothername </CODE> becomes <CODE>anyothername.out</CODE>
+
+</UL>
+
+<P>
+If the file does not end in one of the recognised endings, 
+<CODE>.bz2</CODE>, <CODE>.bz</CODE>, 
+<CODE>.tbz2</CODE> or <CODE>.tbz</CODE>, <CODE>bzip2</CODE> complains that it cannot
+guess the name of the original file, and uses the original name
+with <CODE>.out</CODE> appended.
+
+</P>
+<P>
+As with compression, supplying no
+filenames causes decompression from standard input to standard output.
+
+</P>
+<P>
+<CODE>bunzip2</CODE> will correctly decompress a file which is the
+concatenation of two or more compressed files.  The result is the
+concatenation of the corresponding uncompressed files.  Integrity
+testing (<CODE>-t</CODE>) of concatenated compressed files is also supported.
+
+</P>
+<P>
+You can also compress or decompress files to the standard output by
+giving the <CODE>-c</CODE> flag.  Multiple files may be compressed and
+decompressed like this.  The resulting outputs are fed sequentially to
+stdout.  Compression of multiple files in this manner generates a stream
+containing multiple compressed file representations.  Such a stream
+can be decompressed correctly only by <CODE>bzip2</CODE> version 0.9.0 or
+later.  Earlier versions of <CODE>bzip2</CODE> will stop after decompressing
+the first file in the stream.
+
+</P>
+<P>
+<CODE>bzcat</CODE> (or <CODE>bzip2 -dc</CODE>) decompresses all specified files to
+the standard output.
+
+</P>
+<P>
+<CODE>bzip2</CODE> will read arguments from the environment variables
+<CODE>BZIP2</CODE> and <CODE>BZIP</CODE>, in that order, and will process them
+before any arguments read from the command line.  This gives a 
+convenient way to supply default arguments.
+
+</P>
+<P>
+Compression is always performed, even if the compressed file is slightly
+larger than the original.  Files of less than about one hundred bytes
+tend to get larger, since the compression mechanism has a constant
+overhead in the region of 50 bytes.  Random data (including the output
+of most file compressors) is coded at about 8.05 bits per byte, giving
+an expansion of around 0.5%.
+
+</P>
+<P>
+As a self-check for your protection, <CODE>bzip2</CODE> uses 32-bit CRCs to
+make sure that the decompressed version of a file is identical to the
+original.  This guards against corruption of the compressed data, and
+against undetected bugs in <CODE>bzip2</CODE> (hopefully very unlikely).  The
+chances of data corruption going undetected is microscopic, about one
+chance in four billion for each file processed.  Be aware, though, that
+the check occurs upon decompression, so it can only tell you that
+something is wrong.  It can't help you recover the original uncompressed
+data.  You can use <CODE>bzip2recover</CODE> to try to recover data from
+damaged files.
+
+</P>
+<P>
+Return values: 0 for a normal exit, 1 for environmental problems (file
+not found, invalid flags, I/O errors, &#38;c), 2 to indicate a corrupt
+compressed file, 3 for an internal consistency error (eg, bug) which
+caused <CODE>bzip2</CODE> to panic.
+
+</P>
+
+
+
+<H4><A NAME="SEC6" HREF="manual_toc.html#TOC6">OPTIONS</A></H4>
+<DL COMPACT>
+
+<DT><CODE>-c  --stdout</CODE>
+<DD>
+Compress or decompress to standard output.
+<DT><CODE>-d  --decompress</CODE>
+<DD>
+Force decompression.  <CODE>bzip2</CODE>, <CODE>bunzip2</CODE> and <CODE>bzcat</CODE> are
+really the same program, and the decision about what actions to take is
+done on the basis of which name is used.  This flag overrides that
+mechanism, and forces bzip2 to decompress.
+<DT><CODE>-z --compress</CODE>
+<DD>
+The complement to <CODE>-d</CODE>: forces compression, regardless of the
+invokation name.
+<DT><CODE>-t --test</CODE>
+<DD>
+Check integrity of the specified file(s), but don't decompress them.
+This really performs a trial decompression and throws away the result.
+<DT><CODE>-f --force</CODE>
+<DD>
+Force overwrite of output files.  Normally, <CODE>bzip2</CODE> will not overwrite
+existing output files.  Also forces <CODE>bzip2</CODE> to break hard links
+to files, which it otherwise wouldn't do.
+<DT><CODE>-k --keep</CODE>
+<DD>
+Keep (don't delete) input files during compression
+or decompression.
+<DT><CODE>-s --small</CODE>
+<DD>
+Reduce memory usage, for compression, decompression and testing.  Files
+are decompressed and tested using a modified algorithm which only
+requires 2.5 bytes per block byte.  This means any file can be
+decompressed in 2300k of memory, albeit at about half the normal speed.
+
+During compression, <CODE>-s</CODE> selects a block size of 200k, which limits
+memory use to around the same figure, at the expense of your compression
+ratio.  In short, if your machine is low on memory (8 megabytes or
+less), use -s for everything.  See MEMORY MANAGEMENT below.
+<DT><CODE>-q --quiet</CODE>
+<DD>
+Suppress non-essential warning messages.  Messages pertaining to
+I/O errors and other critical events will not be suppressed.
+<DT><CODE>-v --verbose</CODE>
+<DD>
+Verbose mode -- show the compression ratio for each file processed.
+Further <CODE>-v</CODE>'s increase the verbosity level, spewing out lots of
+information which is primarily of interest for diagnostic purposes.
+<DT><CODE>-L --license -V --version</CODE>
+<DD>
+Display the software version, license terms and conditions.
+<DT><CODE>-1 to -9</CODE>
+<DD>
+Set the block size to 100 k, 200 k ..  900 k when compressing.  Has no
+effect when decompressing.  See MEMORY MANAGEMENT below.
+<DT><CODE>--</CODE>
+<DD>
+Treats all subsequent arguments as file names, even if they start
+with a dash.  This is so you can handle files with names beginning
+with a dash, for example: <CODE>bzip2 -- -myfilename</CODE>.
+<DT><CODE>--repetitive-fast</CODE>
+<DD>
+<DT><CODE>--repetitive-best</CODE>
+<DD>
+These flags are redundant in versions 0.9.5 and above.  They provided
+some coarse control over the behaviour of the sorting algorithm in
+earlier versions, which was sometimes useful.  0.9.5 and above have an
+improved algorithm which renders these flags irrelevant.
+</DL>
+
+
+
+<H4><A NAME="SEC7" HREF="manual_toc.html#TOC7">MEMORY MANAGEMENT</A></H4>
+
+<P>
+<CODE>bzip2</CODE> compresses large files in blocks.  The block size affects
+both the compression ratio achieved, and the amount of memory needed for
+compression and decompression.  The flags <CODE>-1</CODE> through <CODE>-9</CODE>
+specify the block size to be 100,000 bytes through 900,000 bytes (the
+default) respectively.  At decompression time, the block size used for
+compression is read from the header of the compressed file, and
+<CODE>bunzip2</CODE> then allocates itself just enough memory to decompress
+the file.  Since block sizes are stored in compressed files, it follows
+that the flags <CODE>-1</CODE> to <CODE>-9</CODE> are irrelevant to and so ignored
+during decompression.
+
+</P>
+<P>
+Compression and decompression requirements, in bytes, can be estimated
+as:
+
+<PRE>
+     Compression:   400k + ( 8 x block size )
+
+     Decompression: 100k + ( 4 x block size ), or
+                    100k + ( 2.5 x block size )
+</PRE>
+
+<P>
+Larger block sizes give rapidly diminishing marginal returns.  Most of
+the compression comes from the first two or three hundred k of block
+size, a fact worth bearing in mind when using <CODE>bzip2</CODE> on small machines.
+It is also important to appreciate that the decompression memory
+requirement is set at compression time by the choice of block size.
+
+</P>
+<P>
+For files compressed with the default 900k block size, <CODE>bunzip2</CODE>
+will require about 3700 kbytes to decompress.  To support decompression
+of any file on a 4 megabyte machine, <CODE>bunzip2</CODE> has an option to
+decompress using approximately half this amount of memory, about 2300
+kbytes.  Decompression speed is also halved, so you should use this
+option only where necessary.  The relevant flag is <CODE>-s</CODE>.
+
+</P>
+<P>
+In general, try and use the largest block size memory constraints allow,
+since that maximises the compression achieved.  Compression and
+decompression speed are virtually unaffected by block size.
+
+</P>
+<P>
+Another significant point applies to files which fit in a single block
+-- that means most files you'd encounter using a large block size.  The
+amount of real memory touched is proportional to the size of the file,
+since the file is smaller than a block.  For example, compressing a file
+20,000 bytes long with the flag <CODE>-9</CODE> will cause the compressor to
+allocate around 7600k of memory, but only touch 400k + 20000 * 8 = 560
+kbytes of it.  Similarly, the decompressor will allocate 3700k but only
+touch 100k + 20000 * 4 = 180 kbytes.
+
+</P>
+<P>
+Here is a table which summarises the maximum memory usage for different
+block sizes.  Also recorded is the total compressed size for 14 files of
+the Calgary Text Compression Corpus totalling 3,141,622 bytes.  This
+column gives some feel for how compression varies with block size.
+These figures tend to understate the advantage of larger block sizes for
+larger files, since the Corpus is dominated by smaller files.
+
+<PRE>
+          Compress   Decompress   Decompress   Corpus
+   Flag     usage      usage       -s usage     Size
+
+    -1      1200k       500k         350k      914704
+    -2      2000k       900k         600k      877703
+    -3      2800k      1300k         850k      860338
+    -4      3600k      1700k        1100k      846899
+    -5      4400k      2100k        1350k      845160
+    -6      5200k      2500k        1600k      838626
+    -7      6100k      2900k        1850k      834096
+    -8      6800k      3300k        2100k      828642
+    -9      7600k      3700k        2350k      828642
+</PRE>
+
+
+
+<H4><A NAME="SEC8" HREF="manual_toc.html#TOC8">RECOVERING DATA FROM DAMAGED FILES</A></H4>
+
+<P>
+<CODE>bzip2</CODE> compresses files in blocks, usually 900kbytes long.  Each
+block is handled independently.  If a media or transmission error causes
+a multi-block <CODE>.bz2</CODE> file to become damaged, it may be possible to
+recover data from the undamaged blocks in the file.
+
+</P>
+<P>
+The compressed representation of each block is delimited by a 48-bit
+pattern, which makes it possible to find the block boundaries with
+reasonable certainty.  Each block also carries its own 32-bit CRC, so
+damaged blocks can be distinguished from undamaged ones.
+
+</P>
+<P>
+<CODE>bzip2recover</CODE> is a simple program whose purpose is to search for
+blocks in <CODE>.bz2</CODE> files, and write each block out into its own
+<CODE>.bz2</CODE> file.  You can then use <CODE>bzip2 -t</CODE> to test the
+integrity of the resulting files, and decompress those which are
+undamaged.
+
+</P>
+<P>
+<CODE>bzip2recover</CODE> 
+takes a single argument, the name of the damaged file, 
+and writes a number of files <CODE>rec0001file.bz2</CODE>,
+       <CODE>rec0002file.bz2</CODE>, etc, containing the  extracted  blocks.
+       The  output  filenames  are  designed  so  that the use of
+       wildcards in subsequent processing -- for example,  
+<CODE>bzip2 -dc  rec*file.bz2 &#62; recovered_data</CODE> -- lists the files in
+       the correct order.
+
+</P>
+<P>
+<CODE>bzip2recover</CODE> should be of most use dealing with large <CODE>.bz2</CODE>
+       files,  as  these will contain many blocks.  It is clearly
+       futile to use it on damaged single-block  files,  since  a
+       damaged  block  cannot  be recovered.  If you wish to minimise 
+any potential data loss through media  or  transmission errors, 
+you might consider compressing with a smaller
+       block size.
+
+</P>
+
+
+
+<H4><A NAME="SEC9" HREF="manual_toc.html#TOC9">PERFORMANCE NOTES</A></H4>
+
+<P>
+The sorting phase of compression gathers together similar strings in the
+file.  Because of this, files containing very long runs of repeated
+symbols, like "aabaabaabaab ..."  (repeated several hundred times) may
+compress more slowly than normal.  Versions 0.9.5 and above fare much
+better than previous versions in this respect.  The ratio between
+worst-case and average-case compression time is in the region of 10:1.
+For previous versions, this figure was more like 100:1.  You can use the
+<CODE>-vvvv</CODE> option to monitor progress in great detail, if you want.
+
+</P>
+<P>
+Decompression speed is unaffected by these phenomena.
+
+</P>
+<P>
+<CODE>bzip2</CODE> usually allocates several megabytes of memory to operate
+in, and then charges all over it in a fairly random fashion.  This means
+that performance, both for compressing and decompressing, is largely
+determined by the speed at which your machine can service cache misses.
+Because of this, small changes to the code to reduce the miss rate have
+been observed to give disproportionately large performance improvements.
+I imagine <CODE>bzip2</CODE> will perform best on machines with very large
+caches.
+
+</P>
+
+
+
+<H4><A NAME="SEC10" HREF="manual_toc.html#TOC10">CAVEATS</A></H4>
+
+<P>
+I/O error messages are not as helpful as they could be.  <CODE>bzip2</CODE>
+tries hard to detect I/O errors and exit cleanly, but the details of
+what the problem is sometimes seem rather misleading.
+
+</P>
+<P>
+This manual page pertains to version 1.0 of <CODE>bzip2</CODE>.  Compressed
+data created by this version is entirely forwards and backwards
+compatible with the previous public releases, versions 0.1pl2, 0.9.0 and
+0.9.5, but with the following exception: 0.9.0 and above can correctly
+decompress multiple concatenated compressed files.  0.1pl2 cannot do
+this; it will stop after decompressing just the first file in the
+stream.
+
+</P>
+<P>
+<CODE>bzip2recover</CODE> uses 32-bit integers to represent bit positions in
+compressed files, so it cannot handle compressed files more than 512
+megabytes long.  This could easily be fixed.
+
+</P>
+
+
+
+<H4><A NAME="SEC11" HREF="manual_toc.html#TOC11">AUTHOR</A></H4>
+<P>
+Julian Seward, <CODE>jseward@acm.org</CODE>.
+
+</P>
+<P>
+The ideas embodied in <CODE>bzip2</CODE> are due to (at least) the following
+people: Michael Burrows and David Wheeler (for the block sorting
+transformation), David Wheeler (again, for the Huffman coder), Peter
+Fenwick (for the structured coding model in the original <CODE>bzip</CODE>,
+and many refinements), and Alistair Moffat, Radford Neal and Ian Witten
+(for the arithmetic coder in the original <CODE>bzip</CODE>).  I am much
+indebted for their help, support and advice.  See the manual in the
+source distribution for pointers to sources of documentation.  Christian
+von Roques encouraged me to look for faster sorting algorithms, so as to
+speed up compression.  Bela Lubkin encouraged me to improve the
+worst-case compression performance.  Many people sent patches, helped
+with portability problems, lent machines, gave advice and were generally
+helpful.
+
+</P>
+</BLOCKQUOTE>
+
+<P><HR><P>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_1.html">previous</A>, <A HREF="manual_3.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+</BODY>
+</HTML>
diff --git a/bzip2/manual_3.html b/bzip2/manual_3.html
new file mode 100644
index 000000000..a8fa7e682
--- /dev/null
+++ b/bzip2/manual_3.html
@@ -0,0 +1,1773 @@
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+     from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - Programming with libbzip2</TITLE>
+<link href="manual_4.html" rel=Next>
+<link href="manual_2.html" rel=Previous>
+<link href="manual_toc.html" rel=ToC>
+
+</HEAD>
+<BODY>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_2.html">previous</A>, <A HREF="manual_4.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+<P><HR><P>
+
+
+<H1><A NAME="SEC12" HREF="manual_toc.html#TOC12">Programming with <CODE>libbzip2</CODE></A></H1>
+
+<P>
+This chapter describes the programming interface to <CODE>libbzip2</CODE>.
+
+</P>
+<P>
+For general background information, particularly about memory
+use and performance aspects, you'd be well advised to read Chapter 2
+as well.
+
+</P>
+
+
+<H2><A NAME="SEC13" HREF="manual_toc.html#TOC13">Top-level structure</A></H2>
+
+<P>
+<CODE>libbzip2</CODE> is a flexible library for compressing and decompressing
+data in the <CODE>bzip2</CODE> data format.  Although packaged as a single
+entity, it helps to regard the library as three separate parts: the low
+level interface, and the high level interface, and some utility
+functions.
+
+</P>
+<P>
+The structure of <CODE>libbzip2</CODE>'s interfaces is similar to
+that of Jean-loup Gailly's and Mark Adler's excellent <CODE>zlib</CODE> 
+library.
+
+</P>
+<P>
+All externally visible symbols have names beginning <CODE>BZ2_</CODE>.
+This is new in version 1.0.  The intention is to minimise pollution
+of the namespaces of library clients.
+
+</P>
+
+
+<H3><A NAME="SEC14" HREF="manual_toc.html#TOC14">Low-level summary</A></H3>
+
+<P>
+This interface provides services for compressing and decompressing
+data in memory.  There's no provision for dealing with files, streams
+or any other I/O mechanisms, just straight memory-to-memory work.
+In fact, this part of the library can be compiled without inclusion
+of <CODE>stdio.h</CODE>, which may be helpful for embedded applications.
+
+</P>
+<P>
+The low-level part of the library has no global variables and
+is therefore thread-safe.
+
+</P>
+<P>
+Six routines make up the low level interface: 
+<CODE>BZ2_bzCompressInit</CODE>, <CODE>BZ2_bzCompress</CODE>, and <BR> <CODE>BZ2_bzCompressEnd</CODE>
+for compression,
+and a corresponding trio <CODE>BZ2_bzDecompressInit</CODE>, <BR> <CODE>BZ2_bzDecompress</CODE>
+and <CODE>BZ2_bzDecompressEnd</CODE> for decompression.  
+The <CODE>*Init</CODE> functions allocate
+memory for compression/decompression and do other
+initialisations, whilst the <CODE>*End</CODE> functions close down operations
+and release memory.
+
+</P>
+<P>
+The real work is done by <CODE>BZ2_bzCompress</CODE> and <CODE>BZ2_bzDecompress</CODE>.  
+These compress and decompress data from a user-supplied input buffer
+to a user-supplied output buffer.  These buffers can be any size;
+arbitrary quantities of data are handled by making repeated calls
+to these functions.  This is a flexible mechanism allowing a 
+consumer-pull style of activity, or producer-push, or a mixture of
+both.
+
+</P>
+
+
+
+<H3><A NAME="SEC15" HREF="manual_toc.html#TOC15">High-level summary</A></H3>
+
+<P>
+This interface provides some handy wrappers around the low-level
+interface to facilitate reading and writing <CODE>bzip2</CODE> format
+files (<CODE>.bz2</CODE> files).  The routines provide hooks to facilitate
+reading files in which the <CODE>bzip2</CODE> data stream is embedded 
+within some larger-scale file structure, or where there are
+multiple <CODE>bzip2</CODE> data streams concatenated end-to-end.
+
+</P>
+<P>
+For reading files, <CODE>BZ2_bzReadOpen</CODE>, <CODE>BZ2_bzRead</CODE>,
+<CODE>BZ2_bzReadClose</CODE> and <BR> <CODE>BZ2_bzReadGetUnused</CODE> are supplied.  For
+writing files, <CODE>BZ2_bzWriteOpen</CODE>, <CODE>BZ2_bzWrite</CODE> and
+<CODE>BZ2_bzWriteFinish</CODE> are available.
+
+</P>
+<P>
+As with the low-level library, no global variables are used
+so the library is per se thread-safe.  However, if I/O errors
+occur whilst reading or writing the underlying compressed files,
+you may have to consult <CODE>errno</CODE> to determine the cause of
+the error.  In that case, you'd need a C library which correctly
+supports <CODE>errno</CODE> in a multithreaded environment.
+
+</P>
+<P>
+To make the library a little simpler and more portable,
+<CODE>BZ2_bzReadOpen</CODE> and <CODE>BZ2_bzWriteOpen</CODE> require you to pass them file
+handles (<CODE>FILE*</CODE>s) which have previously been opened for reading or
+writing respectively.  That avoids portability problems associated with
+file operations and file attributes, whilst not being much of an
+imposition on the programmer.
+
+</P>
+
+
+
+<H3><A NAME="SEC16" HREF="manual_toc.html#TOC16">Utility functions summary</A></H3>
+<P>
+For very simple needs, <CODE>BZ2_bzBuffToBuffCompress</CODE> and
+<CODE>BZ2_bzBuffToBuffDecompress</CODE> are provided.  These compress
+data in memory from one buffer to another buffer in a single
+function call.  You should assess whether these functions
+fulfill your memory-to-memory compression/decompression
+requirements before investing effort in understanding the more
+general but more complex low-level interface.
+
+</P>
+<P>
+Yoshioka Tsuneo (<CODE>QWF00133@niftyserve.or.jp</CODE> /
+<CODE>tsuneo-y@is.aist-nara.ac.jp</CODE>) has contributed some functions to
+give better <CODE>zlib</CODE> compatibility.  These functions are
+<CODE>BZ2_bzopen</CODE>, <CODE>BZ2_bzread</CODE>, <CODE>BZ2_bzwrite</CODE>, <CODE>BZ2_bzflush</CODE>,
+<CODE>BZ2_bzclose</CODE>,
+<CODE>BZ2_bzerror</CODE> and <CODE>BZ2_bzlibVersion</CODE>.  You may find these functions
+more convenient for simple file reading and writing, than those in the
+high-level interface.  These functions are not (yet) officially part of
+the library, and are minimally documented here.  If they break, you
+get to keep all the pieces.  I hope to document them properly when time
+permits.
+
+</P>
+<P>
+Yoshioka also contributed modifications to allow the library to be
+built as a Windows DLL.
+
+</P>
+
+
+
+<H2><A NAME="SEC17" HREF="manual_toc.html#TOC17">Error handling</A></H2>
+
+<P>
+The library is designed to recover cleanly in all situations, including
+the worst-case situation of decompressing random data.  I'm not 
+100% sure that it can always do this, so you might want to add
+a signal handler to catch segmentation violations during decompression
+if you are feeling especially paranoid.  I would be interested in
+hearing more about the robustness of the library to corrupted
+compressed data.
+
+</P>
+<P>
+Version 1.0 is much more robust in this respect than
+0.9.0 or 0.9.5.  Investigations with Checker (a tool for 
+detecting problems with memory management, similar to Purify)
+indicate that, at least for the few files I tested, all single-bit
+errors in the decompressed data are caught properly, with no
+segmentation faults, no reads of uninitialised data and no 
+out of range reads or writes.  So it's certainly much improved,
+although I wouldn't claim it to be totally bombproof.
+
+</P>
+<P>
+The file <CODE>bzlib.h</CODE> contains all definitions needed to use
+the library.  In particular, you should definitely not include
+<CODE>bzlib_private.h</CODE>.
+
+</P>
+<P>
+In <CODE>bzlib.h</CODE>, the various return values are defined.  The following
+list is not intended as an exhaustive description of the circumstances 
+in which a given value may be returned -- those descriptions are given
+later.  Rather, it is intended to convey the rough meaning of each
+return value.  The first five actions are normal and not intended to 
+denote an error situation.
+<DL COMPACT>
+
+<DT><CODE>BZ_OK</CODE>
+<DD>
+The requested action was completed successfully.
+<DT><CODE>BZ_RUN_OK</CODE>
+<DD>
+<DT><CODE>BZ_FLUSH_OK</CODE>
+<DD>
+<DT><CODE>BZ_FINISH_OK</CODE>
+<DD>
+In <CODE>BZ2_bzCompress</CODE>, the requested flush/finish/nothing-special action
+was completed successfully.
+<DT><CODE>BZ_STREAM_END</CODE>
+<DD>
+Compression of data was completed, or the logical stream end was
+detected during decompression.
+</DL>
+
+<P>
+The following return values indicate an error of some kind.
+<DL COMPACT>
+
+<DT><CODE>BZ_CONFIG_ERROR</CODE>
+<DD>
+Indicates that the library has been improperly compiled on your
+platform -- a major configuration error.  Specifically, it means
+that <CODE>sizeof(char)</CODE>, <CODE>sizeof(short)</CODE> and <CODE>sizeof(int)</CODE>
+are not 1, 2 and 4 respectively, as they should be.  Note that the 
+library should still work properly on 64-bit platforms which follow
+the LP64 programming model -- that is, where <CODE>sizeof(long)</CODE>
+and <CODE>sizeof(void*)</CODE> are 8.  Under LP64, <CODE>sizeof(int)</CODE> is
+still 4, so <CODE>libbzip2</CODE>, which doesn't use the <CODE>long</CODE> type,
+is OK.
+<DT><CODE>BZ_SEQUENCE_ERROR</CODE>
+<DD>
+When using the library, it is important to call the functions in the
+correct sequence and with data structures (buffers etc) in the correct
+states.  <CODE>libbzip2</CODE> checks as much as it can to ensure this is
+happening, and returns <CODE>BZ_SEQUENCE_ERROR</CODE> if not.  Code which
+complies precisely with the function semantics, as detailed below,
+should never receive this value; such an event denotes buggy code
+which you should investigate.
+<DT><CODE>BZ_PARAM_ERROR</CODE>
+<DD>
+Returned when a parameter to a function call is out of range 
+or otherwise manifestly incorrect.  As with <CODE>BZ_SEQUENCE_ERROR</CODE>,
+this denotes a bug in the client code.  The distinction between
+<CODE>BZ_PARAM_ERROR</CODE> and <CODE>BZ_SEQUENCE_ERROR</CODE> is a bit hazy, but still worth
+making.
+<DT><CODE>BZ_MEM_ERROR</CODE>
+<DD>
+Returned when a request to allocate memory failed.  Note that the
+quantity of memory needed to decompress a stream cannot be determined
+until the stream's header has been read.  So <CODE>BZ2_bzDecompress</CODE> and
+<CODE>BZ2_bzRead</CODE> may return <CODE>BZ_MEM_ERROR</CODE> even though some of
+the compressed data has been read.  The same is not true for
+compression; once <CODE>BZ2_bzCompressInit</CODE> or <CODE>BZ2_bzWriteOpen</CODE> have
+successfully completed, <CODE>BZ_MEM_ERROR</CODE> cannot occur.
+<DT><CODE>BZ_DATA_ERROR</CODE>
+<DD>
+Returned when a data integrity error is detected during decompression.
+Most importantly, this means when stored and computed CRCs for the
+data do not match.  This value is also returned upon detection of any
+other anomaly in the compressed data.
+<DT><CODE>BZ_DATA_ERROR_MAGIC</CODE>
+<DD>
+As a special case of <CODE>BZ_DATA_ERROR</CODE>, it is sometimes useful to
+know when the compressed stream does not start with the correct
+magic bytes (<CODE>'B' 'Z' 'h'</CODE>).  
+<DT><CODE>BZ_IO_ERROR</CODE>
+<DD>
+Returned by <CODE>BZ2_bzRead</CODE> and <CODE>BZ2_bzWrite</CODE> when there is an error
+reading or writing in the compressed file, and by <CODE>BZ2_bzReadOpen</CODE>
+and <CODE>BZ2_bzWriteOpen</CODE> for attempts to use a file for which the
+error indicator (viz, <CODE>ferror(f)</CODE>) is set.
+On receipt of <CODE>BZ_IO_ERROR</CODE>, the caller should consult
+<CODE>errno</CODE> and/or <CODE>perror</CODE> to acquire operating-system
+specific information about the problem.
+<DT><CODE>BZ_UNEXPECTED_EOF</CODE>
+<DD>
+Returned by <CODE>BZ2_bzRead</CODE> when the compressed file finishes
+before the logical end of stream is detected.
+<DT><CODE>BZ_OUTBUFF_FULL</CODE>
+<DD>
+Returned by <CODE>BZ2_bzBuffToBuffCompress</CODE> and
+<CODE>BZ2_bzBuffToBuffDecompress</CODE> to indicate that the output data
+will not fit into the output buffer provided.
+</DL>
+
+
+
+<H2><A NAME="SEC18" HREF="manual_toc.html#TOC18">Low-level interface</A></H2>
+
+
+
+<H3><A NAME="SEC19" HREF="manual_toc.html#TOC19"><CODE>BZ2_bzCompressInit</CODE></A></H3>
+
+<PRE>
+typedef 
+   struct {
+      char *next_in;
+      unsigned int avail_in;
+      unsigned int total_in_lo32;
+      unsigned int total_in_hi32;
+
+      char *next_out;
+      unsigned int avail_out;
+      unsigned int total_out_lo32;
+      unsigned int total_out_hi32;
+
+      void *state;
+
+      void *(*bzalloc)(void *,int,int);
+      void (*bzfree)(void *,void *);
+      void *opaque;
+   } 
+   bz_stream;
+
+int BZ2_bzCompressInit ( bz_stream *strm, 
+                         int blockSize100k, 
+                         int verbosity,
+                         int workFactor );
+
+</PRE>
+
+<P>
+Prepares for compression.  The <CODE>bz_stream</CODE> structure
+holds all data pertaining to the compression activity.  
+A <CODE>bz_stream</CODE> structure should be allocated and initialised
+prior to the call.
+The fields of <CODE>bz_stream</CODE>
+comprise the entirety of the user-visible data.  <CODE>state</CODE>
+is a pointer to the private data structures required for compression.
+
+</P>
+<P>
+Custom memory allocators are supported, via fields <CODE>bzalloc</CODE>, 
+<CODE>bzfree</CODE>,
+and <CODE>opaque</CODE>.  The value 
+<CODE>opaque</CODE> is passed to as the first argument to
+all calls to <CODE>bzalloc</CODE> and <CODE>bzfree</CODE>, but is 
+otherwise ignored by the library.
+The call <CODE>bzalloc ( opaque, n, m )</CODE> is expected to return a 
+pointer <CODE>p</CODE> to
+<CODE>n * m</CODE> bytes of memory, and <CODE>bzfree ( opaque, p )</CODE> 
+should free
+that memory.
+
+</P>
+<P>
+If you don't want to use a custom memory allocator, set <CODE>bzalloc</CODE>, 
+<CODE>bzfree</CODE> and
+<CODE>opaque</CODE> to <CODE>NULL</CODE>, 
+and the library will then use the standard <CODE>malloc</CODE>/<CODE>free</CODE>
+routines.
+
+</P>
+<P>
+Before calling <CODE>BZ2_bzCompressInit</CODE>, fields <CODE>bzalloc</CODE>, 
+<CODE>bzfree</CODE> and <CODE>opaque</CODE> should
+be filled appropriately, as just described.  Upon return, the internal
+state will have been allocated and initialised, and <CODE>total_in_lo32</CODE>, 
+<CODE>total_in_hi32</CODE>, <CODE>total_out_lo32</CODE> and 
+<CODE>total_out_hi32</CODE> will have been set to zero.  
+These four fields are used by the library
+to inform the caller of the total amount of data passed into and out of
+the library, respectively.  You should not try to change them.
+As of version 1.0, 64-bit counts are maintained, even on 32-bit
+platforms, using the <CODE>_hi32</CODE> fields to store the upper 32 bits
+of the count.  So, for example, the total amount of data in
+is <CODE>(total_in_hi32 &#60;&#60; 32) + total_in_lo32</CODE>.
+
+</P>
+<P>
+Parameter <CODE>blockSize100k</CODE> specifies the block size to be used for
+compression.  It should be a value between 1 and 9 inclusive, and the
+actual block size used is 100000 x this figure.  9 gives the best
+compression but takes most memory.
+
+</P>
+<P>
+Parameter <CODE>verbosity</CODE> should be set to a number between 0 and 4
+inclusive.  0 is silent, and greater numbers give increasingly verbose
+monitoring/debugging output.  If the library has been compiled with
+<CODE>-DBZ_NO_STDIO</CODE>, no such output will appear for any verbosity
+setting.
+
+</P>
+<P>
+Parameter <CODE>workFactor</CODE> controls how the compression phase behaves
+when presented with worst case, highly repetitive, input data.  If
+compression runs into difficulties caused by repetitive data, the
+library switches from the standard sorting algorithm to a fallback
+algorithm.  The fallback is slower than the standard algorithm by
+perhaps a factor of three, but always behaves reasonably, no matter how
+bad the input.
+
+</P>
+<P>
+Lower values of <CODE>workFactor</CODE> reduce the amount of effort the
+standard algorithm will expend before resorting to the fallback.  You
+should set this parameter carefully; too low, and many inputs will be
+handled by the fallback algorithm and so compress rather slowly, too
+high, and your average-to-worst case compression times can become very
+large.  The default value of 30 gives reasonable behaviour over a wide
+range of circumstances.
+
+</P>
+<P>
+Allowable values range from 0 to 250 inclusive.  0 is a special case,
+equivalent to using the default value of 30.
+
+</P>
+<P>
+Note that the compressed output generated is the same regardless of
+whether or not the fallback algorithm is used.
+
+</P>
+<P>
+Be aware also that this parameter may disappear entirely in future
+versions of the library.  In principle it should be possible to devise a
+good way to automatically choose which algorithm to use.  Such a
+mechanism would render the parameter obsolete.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+      <CODE>BZ_CONFIG_ERROR</CODE>
+         if the library has been mis-compiled
+      <CODE>BZ_PARAM_ERROR</CODE> 
+         if <CODE>strm</CODE> is <CODE>NULL</CODE> 
+         or <CODE>blockSize</CODE> &#60; 1 or <CODE>blockSize</CODE> &#62; 9
+         or <CODE>verbosity</CODE> &#60; 0 or <CODE>verbosity</CODE> &#62; 4
+         or <CODE>workFactor</CODE> &#60; 0 or <CODE>workFactor</CODE> &#62; 250
+      <CODE>BZ_MEM_ERROR</CODE> 
+         if not enough memory is available
+      <CODE>BZ_OK</CODE> 
+         otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      <CODE>BZ2_bzCompress</CODE> 
+         if <CODE>BZ_OK</CODE> is returned
+      no specific action needed in case of error
+</PRE>
+
+
+
+<H3><A NAME="SEC20" HREF="manual_toc.html#TOC20"><CODE>BZ2_bzCompress</CODE></A></H3>
+
+<PRE>
+   int BZ2_bzCompress ( bz_stream *strm, int action );
+</PRE>
+
+<P>
+Provides more input and/or output buffer space for the library.  The
+caller maintains input and output buffers, and calls <CODE>BZ2_bzCompress</CODE> to
+transfer data between them.
+
+</P>
+<P>
+Before each call to <CODE>BZ2_bzCompress</CODE>, <CODE>next_in</CODE> should point at
+the data to be compressed, and <CODE>avail_in</CODE> should indicate how many
+bytes the library may read.  <CODE>BZ2_bzCompress</CODE> updates <CODE>next_in</CODE>,
+<CODE>avail_in</CODE> and <CODE>total_in</CODE> to reflect the number of bytes it
+has read.
+
+</P>
+<P>
+Similarly, <CODE>next_out</CODE> should point to a buffer in which the
+compressed data is to be placed, with <CODE>avail_out</CODE> indicating how
+much output space is available.  <CODE>BZ2_bzCompress</CODE> updates
+<CODE>next_out</CODE>, <CODE>avail_out</CODE> and <CODE>total_out</CODE> to reflect the
+number of bytes output.
+
+</P>
+<P>
+You may provide and remove as little or as much data as you like on each
+call of <CODE>BZ2_bzCompress</CODE>.  In the limit, it is acceptable to supply and
+remove data one byte at a time, although this would be terribly
+inefficient.  You should always ensure that at least one byte of output
+space is available at each call.
+
+</P>
+<P>
+A second purpose of <CODE>BZ2_bzCompress</CODE> is to request a change of mode of the
+compressed stream.  
+
+</P>
+<P>
+Conceptually, a compressed stream can be in one of four states: IDLE,
+RUNNING, FLUSHING and FINISHING.  Before initialisation
+(<CODE>BZ2_bzCompressInit</CODE>) and after termination (<CODE>BZ2_bzCompressEnd</CODE>), a
+stream is regarded as IDLE.
+
+</P>
+<P>
+Upon initialisation (<CODE>BZ2_bzCompressInit</CODE>), the stream is placed in the
+RUNNING state.  Subsequent calls to <CODE>BZ2_bzCompress</CODE> should pass
+<CODE>BZ_RUN</CODE> as the requested action; other actions are illegal and
+will result in <CODE>BZ_SEQUENCE_ERROR</CODE>.
+
+</P>
+<P>
+At some point, the calling program will have provided all the input data
+it wants to.  It will then want to finish up -- in effect, asking the
+library to process any data it might have buffered internally.  In this
+state, <CODE>BZ2_bzCompress</CODE> will no longer attempt to read data from
+<CODE>next_in</CODE>, but it will want to write data to <CODE>next_out</CODE>.
+Because the output buffer supplied by the user can be arbitrarily small,
+the finishing-up operation cannot necessarily be done with a single call
+of <CODE>BZ2_bzCompress</CODE>.
+
+</P>
+<P>
+Instead, the calling program passes <CODE>BZ_FINISH</CODE> as an action to
+<CODE>BZ2_bzCompress</CODE>.  This changes the stream's state to FINISHING.  Any
+remaining input (ie, <CODE>next_in[0 .. avail_in-1]</CODE>) is compressed and
+transferred to the output buffer.  To do this, <CODE>BZ2_bzCompress</CODE> must be
+called repeatedly until all the output has been consumed.  At that
+point, <CODE>BZ2_bzCompress</CODE> returns <CODE>BZ_STREAM_END</CODE>, and the stream's
+state is set back to IDLE.  <CODE>BZ2_bzCompressEnd</CODE> should then be
+called.
+
+</P>
+<P>
+Just to make sure the calling program does not cheat, the library makes
+a note of <CODE>avail_in</CODE> at the time of the first call to
+<CODE>BZ2_bzCompress</CODE> which has <CODE>BZ_FINISH</CODE> as an action (ie, at the
+time the program has announced its intention to not supply any more
+input).  By comparing this value with that of <CODE>avail_in</CODE> over
+subsequent calls to <CODE>BZ2_bzCompress</CODE>, the library can detect any
+attempts to slip in more data to compress.  Any calls for which this is
+detected will return <CODE>BZ_SEQUENCE_ERROR</CODE>.  This indicates a
+programming mistake which should be corrected.
+
+</P>
+<P>
+Instead of asking to finish, the calling program may ask
+<CODE>BZ2_bzCompress</CODE> to take all the remaining input, compress it and
+terminate the current (Burrows-Wheeler) compression block.  This could
+be useful for error control purposes.  The mechanism is analogous to
+that for finishing: call <CODE>BZ2_bzCompress</CODE> with an action of
+<CODE>BZ_FLUSH</CODE>, remove output data, and persist with the
+<CODE>BZ_FLUSH</CODE> action until the value <CODE>BZ_RUN</CODE> is returned.  As
+with finishing, <CODE>BZ2_bzCompress</CODE> detects any attempt to provide more
+input data once the flush has begun.
+
+</P>
+<P>
+Once the flush is complete, the stream returns to the normal RUNNING
+state.
+
+</P>
+<P>
+This all sounds pretty complex, but isn't really.  Here's a table
+which shows which actions are allowable in each state, what action
+will be taken, what the next state is, and what the non-error return
+values are.  Note that you can't explicitly ask what state the
+stream is in, but nor do you need to -- it can be inferred from the
+values returned by <CODE>BZ2_bzCompress</CODE>.
+
+<PRE>
+IDLE/<CODE>any</CODE>           
+      Illegal.  IDLE state only exists after <CODE>BZ2_bzCompressEnd</CODE> or
+      before <CODE>BZ2_bzCompressInit</CODE>.
+      Return value = <CODE>BZ_SEQUENCE_ERROR</CODE>
+
+RUNNING/<CODE>BZ_RUN</CODE>     
+      Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible.
+      Next state = RUNNING
+      Return value = <CODE>BZ_RUN_OK</CODE>
+
+RUNNING/<CODE>BZ_FLUSH</CODE>   
+      Remember current value of <CODE>next_in</CODE>.  Compress from <CODE>next_in</CODE>
+      to <CODE>next_out</CODE> as much as possible, but do not accept any more input.  
+      Next state = FLUSHING
+      Return value = <CODE>BZ_FLUSH_OK</CODE>
+
+RUNNING/<CODE>BZ_FINISH</CODE>  
+      Remember current value of <CODE>next_in</CODE>.  Compress from <CODE>next_in</CODE>
+      to <CODE>next_out</CODE> as much as possible, but do not accept any more input.
+      Next state = FINISHING
+      Return value = <CODE>BZ_FINISH_OK</CODE>
+
+FLUSHING/<CODE>BZ_FLUSH</CODE>  
+      Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible, 
+      but do not accept any more input.  
+      If all the existing input has been used up and all compressed
+      output has been removed
+         Next state = RUNNING; Return value = <CODE>BZ_RUN_OK</CODE>
+      else
+         Next state = FLUSHING; Return value = <CODE>BZ_FLUSH_OK</CODE>
+
+FLUSHING/other     
+      Illegal.
+      Return value = <CODE>BZ_SEQUENCE_ERROR</CODE>
+
+FINISHING/<CODE>BZ_FINISH</CODE>  
+      Compress from <CODE>next_in</CODE> to <CODE>next_out</CODE> as much as possible,
+      but to not accept any more input.  
+      If all the existing input has been used up and all compressed
+      output has been removed
+         Next state = IDLE; Return value = <CODE>BZ_STREAM_END</CODE>
+      else
+         Next state = FINISHING; Return value = <CODE>BZ_FINISHING</CODE>
+
+FINISHING/other
+      Illegal.
+      Return value = <CODE>BZ_SEQUENCE_ERROR</CODE>
+</PRE>
+
+<P>
+That still looks complicated?  Well, fair enough.  The usual sequence
+of calls for compressing a load of data is:
+
+<UL>
+<LI>Get started with <CODE>BZ2_bzCompressInit</CODE>.
+
+<LI>Shovel data in and shlurp out its compressed form using zero or more
+
+calls of <CODE>BZ2_bzCompress</CODE> with action = <CODE>BZ_RUN</CODE>.
+<LI>Finish up.
+
+Repeatedly call <CODE>BZ2_bzCompress</CODE> with action = <CODE>BZ_FINISH</CODE>, 
+copying out the compressed output, until <CODE>BZ_STREAM_END</CODE> is returned.
+<LI>Close up and go home.  Call <CODE>BZ2_bzCompressEnd</CODE>.
+
+</UL>
+
+<P>
+If the data you want to compress fits into your input buffer all
+at once, you can skip the calls of <CODE>BZ2_bzCompress ( ..., BZ_RUN )</CODE> and 
+just do the <CODE>BZ2_bzCompress ( ..., BZ_FINISH )</CODE> calls.
+
+</P>
+<P>
+All required memory is allocated by <CODE>BZ2_bzCompressInit</CODE>.  The
+compression library can accept any data at all (obviously).  So you
+shouldn't get any error return values from the <CODE>BZ2_bzCompress</CODE> calls.
+If you do, they will be <CODE>BZ_SEQUENCE_ERROR</CODE>, and indicate a bug in
+your programming.
+
+</P>
+<P>
+Trivial other possible return values:
+
+<PRE>
+      <CODE>BZ_PARAM_ERROR</CODE>   
+         if <CODE>strm</CODE> is <CODE>NULL</CODE>, or <CODE>strm-&#62;s</CODE> is <CODE>NULL</CODE>
+</PRE>
+
+
+
+<H3><A NAME="SEC21" HREF="manual_toc.html#TOC21"><CODE>BZ2_bzCompressEnd</CODE></A></H3>
+
+<PRE>
+int BZ2_bzCompressEnd ( bz_stream *strm );
+</PRE>
+
+<P>
+Releases all memory associated with a compression stream.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+   <CODE>BZ_PARAM_ERROR</CODE>    if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm-&#62;s</CODE> is <CODE>NULL</CODE>
+   <CODE>BZ_OK</CODE>    otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC22" HREF="manual_toc.html#TOC22"><CODE>BZ2_bzDecompressInit</CODE></A></H3>
+
+<PRE>
+int BZ2_bzDecompressInit ( bz_stream *strm, int verbosity, int small );
+</PRE>
+
+<P>
+Prepares for decompression.  As with <CODE>BZ2_bzCompressInit</CODE>, a
+<CODE>bz_stream</CODE> record should be allocated and initialised before the
+call.  Fields <CODE>bzalloc</CODE>, <CODE>bzfree</CODE> and <CODE>opaque</CODE> should be
+set if a custom memory allocator is required, or made <CODE>NULL</CODE> for
+the normal <CODE>malloc</CODE>/<CODE>free</CODE> routines.  Upon return, the internal
+state will have been initialised, and <CODE>total_in</CODE> and
+<CODE>total_out</CODE> will be zero.
+
+</P>
+<P>
+For the meaning of parameter <CODE>verbosity</CODE>, see <CODE>BZ2_bzCompressInit</CODE>.
+
+</P>
+<P>
+If <CODE>small</CODE> is nonzero, the library will use an alternative
+decompression algorithm which uses less memory but at the cost of
+decompressing more slowly (roughly speaking, half the speed, but the
+maximum memory requirement drops to around 2300k).  See Chapter 2 for
+more information on memory management.
+
+</P>
+<P>
+Note that the amount of memory needed to decompress
+a stream cannot be determined until the stream's header has been read,
+so even if <CODE>BZ2_bzDecompressInit</CODE> succeeds, a subsequent
+<CODE>BZ2_bzDecompress</CODE> could fail with <CODE>BZ_MEM_ERROR</CODE>.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+      <CODE>BZ_CONFIG_ERROR</CODE>
+         if the library has been mis-compiled
+      <CODE>BZ_PARAM_ERROR</CODE>
+         if <CODE>(small != 0 &#38;&#38; small != 1)</CODE>
+         or <CODE>(verbosity &#60; 0 || verbosity &#62; 4)</CODE>
+      <CODE>BZ_MEM_ERROR</CODE>
+         if insufficient memory is available
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      <CODE>BZ2_bzDecompress</CODE>
+         if <CODE>BZ_OK</CODE> was returned
+      no specific action required in case of error
+</PRE>
+
+<P>
+ 
+
+</P>
+
+
+<H3><A NAME="SEC23" HREF="manual_toc.html#TOC23"><CODE>BZ2_bzDecompress</CODE></A></H3>
+
+<PRE>
+int BZ2_bzDecompress ( bz_stream *strm );
+</PRE>
+
+<P>
+Provides more input and/out output buffer space for the library.  The
+caller maintains input and output buffers, and uses <CODE>BZ2_bzDecompress</CODE>
+to transfer data between them.
+
+</P>
+<P>
+Before each call to <CODE>BZ2_bzDecompress</CODE>, <CODE>next_in</CODE> 
+should point at the compressed data,
+and <CODE>avail_in</CODE> should indicate how many bytes the library
+may read.  <CODE>BZ2_bzDecompress</CODE> updates <CODE>next_in</CODE>, <CODE>avail_in</CODE> 
+and <CODE>total_in</CODE>
+to reflect the number of bytes it has read.
+
+</P>
+<P>
+Similarly, <CODE>next_out</CODE> should point to a buffer in which the uncompressed
+output is to be placed, with <CODE>avail_out</CODE> indicating how much output space
+is available.  <CODE>BZ2_bzCompress</CODE> updates <CODE>next_out</CODE>,
+<CODE>avail_out</CODE> and <CODE>total_out</CODE> to reflect
+the number of bytes output.
+
+</P>
+<P>
+You may provide and remove as little or as much data as you like on
+each call of <CODE>BZ2_bzDecompress</CODE>.  
+In the limit, it is acceptable to
+supply and remove data one byte at a time, although this would be
+terribly inefficient.  You should always ensure that at least one
+byte of output space is available at each call.
+
+</P>
+<P>
+Use of <CODE>BZ2_bzDecompress</CODE> is simpler than <CODE>BZ2_bzCompress</CODE>.
+
+</P>
+<P>
+You should provide input and remove output as described above, and
+repeatedly call <CODE>BZ2_bzDecompress</CODE> until <CODE>BZ_STREAM_END</CODE> is
+returned.  Appearance of <CODE>BZ_STREAM_END</CODE> denotes that
+<CODE>BZ2_bzDecompress</CODE> has detected the logical end of the compressed
+stream.  <CODE>BZ2_bzDecompress</CODE> will not produce <CODE>BZ_STREAM_END</CODE> until
+all output data has been placed into the output buffer, so once
+<CODE>BZ_STREAM_END</CODE> appears, you are guaranteed to have available all
+the decompressed output, and <CODE>BZ2_bzDecompressEnd</CODE> can safely be
+called.
+
+</P>
+<P>
+If case of an error return value, you should call <CODE>BZ2_bzDecompressEnd</CODE>
+to clean up and release memory.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+      <CODE>BZ_PARAM_ERROR</CODE>
+         if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm-&#62;s</CODE> is <CODE>NULL</CODE>
+         or <CODE>strm-&#62;avail_out &#60; 1</CODE>
+      <CODE>BZ_DATA_ERROR</CODE>
+         if a data integrity error is detected in the compressed stream
+      <CODE>BZ_DATA_ERROR_MAGIC</CODE>
+         if the compressed stream doesn't begin with the right magic bytes
+      <CODE>BZ_MEM_ERROR</CODE>
+         if there wasn't enough memory available
+      <CODE>BZ_STREAM_END</CODE>
+         if the logical end of the data stream was detected and all
+         output in has been consumed, eg <CODE>s-&#62;avail_out &#62; 0</CODE>
+      <CODE>BZ_OK</CODE>
+         otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      <CODE>BZ2_bzDecompress</CODE>
+         if <CODE>BZ_OK</CODE> was returned
+      <CODE>BZ2_bzDecompressEnd</CODE>
+         otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC24" HREF="manual_toc.html#TOC24"><CODE>BZ2_bzDecompressEnd</CODE></A></H3>
+
+<PRE>
+int BZ2_bzDecompressEnd ( bz_stream *strm );
+</PRE>
+
+<P>
+Releases all memory associated with a decompression stream.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+      <CODE>BZ_PARAM_ERROR</CODE>
+         if <CODE>strm</CODE> is <CODE>NULL</CODE> or <CODE>strm-&#62;s</CODE> is <CODE>NULL</CODE>
+      <CODE>BZ_OK</CODE>
+         otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      None.
+</PRE>
+
+
+
+<H2><A NAME="SEC25" HREF="manual_toc.html#TOC25">High-level interface</A></H2>
+
+<P>
+This interface provides functions for reading and writing 
+<CODE>bzip2</CODE> format files.  First, some general points.
+
+</P>
+
+<UL>
+<LI>All of the functions take an <CODE>int*</CODE> first argument,
+
+  <CODE>bzerror</CODE>.
+  After each call, <CODE>bzerror</CODE> should be consulted first to determine
+  the outcome of the call.  If <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>, 
+  the call completed
+  successfully, and only then should the return value of the function
+  (if any) be consulted.  If <CODE>bzerror</CODE> is <CODE>BZ_IO_ERROR</CODE>, 
+  there was an error
+  reading/writing the underlying compressed file, and you should
+  then consult <CODE>errno</CODE>/<CODE>perror</CODE> to determine the 
+  cause of the difficulty.
+  <CODE>bzerror</CODE> may also be set to various other values; precise details are
+  given on a per-function basis below.
+<LI>If <CODE>bzerror</CODE> indicates an error
+
+  (ie, anything except <CODE>BZ_OK</CODE> and <CODE>BZ_STREAM_END</CODE>),
+  you should immediately call <CODE>BZ2_bzReadClose</CODE> (or <CODE>BZ2_bzWriteClose</CODE>,
+  depending on whether you are attempting to read or to write)
+  to free up all resources associated
+  with the stream.  Once an error has been indicated, behaviour of all calls
+  except <CODE>BZ2_bzReadClose</CODE> (<CODE>BZ2_bzWriteClose</CODE>) is undefined.  
+  The implication is that (1) <CODE>bzerror</CODE> should
+  be checked after each call, and (2) if <CODE>bzerror</CODE> indicates an error, 
+  <CODE>BZ2_bzReadClose</CODE> (<CODE>BZ2_bzWriteClose</CODE>) should then be called to clean up.
+<LI>The <CODE>FILE*</CODE> arguments passed to
+
+   <CODE>BZ2_bzReadOpen</CODE>/<CODE>BZ2_bzWriteOpen</CODE>  
+  should be set to binary mode.
+  Most Unix systems will do this by default, but other platforms,
+  including Windows and Mac, will not.  If you omit this, you may
+  encounter problems when moving code to new platforms.
+<LI>Memory allocation requests are handled by
+
+  <CODE>malloc</CODE>/<CODE>free</CODE>.  
+  At present
+  there is no facility for user-defined memory allocators in the file I/O
+  functions (could easily be added, though).
+</UL>
+
+
+
+<H3><A NAME="SEC26" HREF="manual_toc.html#TOC26"><CODE>BZ2_bzReadOpen</CODE></A></H3>
+
+<PRE>
+   typedef void BZFILE;
+
+   BZFILE *BZ2_bzReadOpen ( int *bzerror, FILE *f, 
+                            int small, int verbosity,
+                            void *unused, int nUnused );
+</PRE>
+
+<P>
+Prepare to read compressed data from file handle <CODE>f</CODE>.  <CODE>f</CODE>
+should refer to a file which has been opened for reading, and for which
+the error indicator (<CODE>ferror(f)</CODE>)is not set.  If <CODE>small</CODE> is 1,
+the library will try to decompress using less memory, at the expense of
+speed.
+
+</P>
+<P>
+For reasons explained below, <CODE>BZ2_bzRead</CODE> will decompress the
+<CODE>nUnused</CODE> bytes starting at <CODE>unused</CODE>, before starting to read
+from the file <CODE>f</CODE>.  At most <CODE>BZ_MAX_UNUSED</CODE> bytes may be
+supplied like this.  If this facility is not required, you should pass
+<CODE>NULL</CODE> and <CODE>0</CODE> for <CODE>unused</CODE> and n<CODE>Unused</CODE>
+respectively.
+
+</P>
+<P>
+For the meaning of parameters <CODE>small</CODE> and <CODE>verbosity</CODE>,
+see <CODE>BZ2_bzDecompressInit</CODE>.
+
+</P>
+<P>
+The amount of memory needed to decompress a file cannot be determined
+until the file's header has been read.  So it is possible that
+<CODE>BZ2_bzReadOpen</CODE> returns <CODE>BZ_OK</CODE> but a subsequent call of
+<CODE>BZ2_bzRead</CODE> will return <CODE>BZ_MEM_ERROR</CODE>.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+      <CODE>BZ_CONFIG_ERROR</CODE>
+         if the library has been mis-compiled
+      <CODE>BZ_PARAM_ERROR</CODE>
+         if <CODE>f</CODE> is <CODE>NULL</CODE> 
+         or <CODE>small</CODE> is neither <CODE>0</CODE> nor <CODE>1</CODE>                 
+         or <CODE>(unused == NULL &#38;&#38; nUnused != 0)</CODE>
+         or <CODE>(unused != NULL &#38;&#38; !(0 &#60;= nUnused &#60;= BZ_MAX_UNUSED))</CODE>
+      <CODE>BZ_IO_ERROR</CODE>    
+         if <CODE>ferror(f)</CODE> is nonzero
+      <CODE>BZ_MEM_ERROR</CODE>   
+         if insufficient memory is available
+      <CODE>BZ_OK</CODE>
+         otherwise.
+</PRE>
+
+<P>
+Possible return values:
+
+<PRE>
+      Pointer to an abstract <CODE>BZFILE</CODE>        
+         if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>   
+      <CODE>NULL</CODE>
+         otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      <CODE>BZ2_bzRead</CODE>
+         if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>   
+      <CODE>BZ2_bzClose</CODE> 
+         otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC27" HREF="manual_toc.html#TOC27"><CODE>BZ2_bzRead</CODE></A></H3>
+
+<PRE>
+   int BZ2_bzRead ( int *bzerror, BZFILE *b, void *buf, int len );
+</PRE>
+
+<P>
+Reads up to <CODE>len</CODE> (uncompressed) bytes from the compressed file 
+<CODE>b</CODE> into
+the buffer <CODE>buf</CODE>.  If the read was successful, 
+<CODE>bzerror</CODE> is set to <CODE>BZ_OK</CODE>
+and the number of bytes read is returned.  If the logical end-of-stream
+was detected, <CODE>bzerror</CODE> will be set to <CODE>BZ_STREAM_END</CODE>, 
+and the number
+of bytes read is returned.  All other <CODE>bzerror</CODE> values denote an error.
+
+</P>
+<P>
+<CODE>BZ2_bzRead</CODE> will supply <CODE>len</CODE> bytes,
+unless the logical stream end is detected
+or an error occurs.  Because of this, it is possible to detect the 
+stream end by observing when the number of bytes returned is 
+less than the number
+requested.  Nevertheless, this is regarded as inadvisable; you should
+instead check <CODE>bzerror</CODE> after every call and watch out for
+<CODE>BZ_STREAM_END</CODE>.
+
+</P>
+<P>
+Internally, <CODE>BZ2_bzRead</CODE> copies data from the compressed file in chunks
+of size <CODE>BZ_MAX_UNUSED</CODE> bytes
+before decompressing it.  If the file contains more bytes than strictly
+needed to reach the logical end-of-stream, <CODE>BZ2_bzRead</CODE> will almost certainly
+read some of the trailing data before signalling <CODE>BZ_SEQUENCE_END</CODE>.
+To collect the read but unused data once <CODE>BZ_SEQUENCE_END</CODE> has 
+appeared, call <CODE>BZ2_bzReadGetUnused</CODE> immediately before <CODE>BZ2_bzReadClose</CODE>.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+      <CODE>BZ_PARAM_ERROR</CODE>
+         if <CODE>b</CODE> is <CODE>NULL</CODE> or <CODE>buf</CODE> is <CODE>NULL</CODE> or <CODE>len &#60; 0</CODE>
+      <CODE>BZ_SEQUENCE_ERROR</CODE> 
+         if <CODE>b</CODE> was opened with <CODE>BZ2_bzWriteOpen</CODE>
+      <CODE>BZ_IO_ERROR</CODE> 
+         if there is an error reading from the compressed file
+      <CODE>BZ_UNEXPECTED_EOF</CODE> 
+         if the compressed file ended before the logical end-of-stream was detected
+      <CODE>BZ_DATA_ERROR</CODE> 
+         if a data integrity error was detected in the compressed stream
+      <CODE>BZ_DATA_ERROR_MAGIC</CODE>
+         if the stream does not begin with the requisite header bytes (ie, is not 
+         a <CODE>bzip2</CODE> data file).  This is really a special case of <CODE>BZ_DATA_ERROR</CODE>.
+      <CODE>BZ_MEM_ERROR</CODE> 
+         if insufficient memory was available
+      <CODE>BZ_STREAM_END</CODE> 
+         if the logical end of stream was detected.
+      <CODE>BZ_OK</CODE>
+         otherwise.
+</PRE>
+
+<P>
+Possible return values:
+
+<PRE>
+      number of bytes read
+         if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> or <CODE>BZ_STREAM_END</CODE>
+      undefined
+         otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      collect data from <CODE>buf</CODE>, then <CODE>BZ2_bzRead</CODE> or <CODE>BZ2_bzReadClose</CODE>
+         if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> 
+      collect data from <CODE>buf</CODE>, then <CODE>BZ2_bzReadClose</CODE> or <CODE>BZ2_bzReadGetUnused</CODE> 
+         if <CODE>bzerror</CODE> is <CODE>BZ_SEQUENCE_END</CODE>   
+      <CODE>BZ2_bzReadClose</CODE> 
+         otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC28" HREF="manual_toc.html#TOC28"><CODE>BZ2_bzReadGetUnused</CODE></A></H3>
+
+<PRE>
+   void BZ2_bzReadGetUnused ( int* bzerror, BZFILE *b, 
+                              void** unused, int* nUnused );
+</PRE>
+
+<P>
+Returns data which was read from the compressed file but was not needed
+to get to the logical end-of-stream.  <CODE>*unused</CODE> is set to the address
+of the data, and <CODE>*nUnused</CODE> to the number of bytes.  <CODE>*nUnused</CODE> will
+be set to a value between <CODE>0</CODE> and <CODE>BZ_MAX_UNUSED</CODE> inclusive.
+
+</P>
+<P>
+This function may only be called once <CODE>BZ2_bzRead</CODE> has signalled 
+<CODE>BZ_STREAM_END</CODE> but before <CODE>BZ2_bzReadClose</CODE>.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+      <CODE>BZ_PARAM_ERROR</CODE> 
+         if <CODE>b</CODE> is <CODE>NULL</CODE> 
+         or <CODE>unused</CODE> is <CODE>NULL</CODE> or <CODE>nUnused</CODE> is <CODE>NULL</CODE>
+      <CODE>BZ_SEQUENCE_ERROR</CODE> 
+         if <CODE>BZ_STREAM_END</CODE> has not been signalled
+         or if <CODE>b</CODE> was opened with <CODE>BZ2_bzWriteOpen</CODE>
+     <CODE>BZ_OK</CODE>
+         otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      <CODE>BZ2_bzReadClose</CODE>
+</PRE>
+
+
+
+<H3><A NAME="SEC29" HREF="manual_toc.html#TOC29"><CODE>BZ2_bzReadClose</CODE></A></H3>
+
+<PRE>
+   void BZ2_bzReadClose ( int *bzerror, BZFILE *b );
+</PRE>
+
+<P>
+Releases all memory pertaining to the compressed file <CODE>b</CODE>.  
+<CODE>BZ2_bzReadClose</CODE> does not call <CODE>fclose</CODE> on the underlying file
+handle, so you should do that yourself if appropriate.
+<CODE>BZ2_bzReadClose</CODE> should be called to clean up after all error
+situations.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+      <CODE>BZ_SEQUENCE_ERROR</CODE> 
+         if <CODE>b</CODE> was opened with <CODE>BZ2_bzOpenWrite</CODE> 
+      <CODE>BZ_OK</CODE> 
+         otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      none
+</PRE>
+
+
+
+<H3><A NAME="SEC30" HREF="manual_toc.html#TOC30"><CODE>BZ2_bzWriteOpen</CODE></A></H3>
+
+<PRE>
+   BZFILE *BZ2_bzWriteOpen ( int *bzerror, FILE *f, 
+                             int blockSize100k, int verbosity,
+                             int workFactor );
+</PRE>
+
+<P>
+Prepare to write compressed data to file handle <CODE>f</CODE>.  
+<CODE>f</CODE> should refer to
+a file which has been opened for writing, and for which the error
+indicator (<CODE>ferror(f)</CODE>)is not set.  
+
+</P>
+<P>
+For the meaning of parameters <CODE>blockSize100k</CODE>,
+<CODE>verbosity</CODE> and <CODE>workFactor</CODE>, see
+<BR> <CODE>BZ2_bzCompressInit</CODE>.
+
+</P>
+<P>
+All required memory is allocated at this stage, so if the call
+completes successfully, <CODE>BZ_MEM_ERROR</CODE> cannot be signalled by a
+subsequent call to <CODE>BZ2_bzWrite</CODE>.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+      <CODE>BZ_CONFIG_ERROR</CODE>
+         if the library has been mis-compiled
+      <CODE>BZ_PARAM_ERROR</CODE> 
+         if <CODE>f</CODE> is <CODE>NULL</CODE> 
+         or <CODE>blockSize100k &#60; 1</CODE> or <CODE>blockSize100k &#62; 9</CODE>
+      <CODE>BZ_IO_ERROR</CODE> 
+         if <CODE>ferror(f)</CODE> is nonzero
+      <CODE>BZ_MEM_ERROR</CODE> 
+         if insufficient memory is available
+      <CODE>BZ_OK</CODE> 
+         otherwise
+</PRE>
+
+<P>
+Possible return values:
+
+<PRE>
+      Pointer to an abstract <CODE>BZFILE</CODE>  
+         if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE>   
+      <CODE>NULL</CODE> 
+         otherwise
+</PRE>
+
+<P>
+Allowable next actions:
+
+<PRE>
+      <CODE>BZ2_bzWrite</CODE> 
+         if <CODE>bzerror</CODE> is <CODE>BZ_OK</CODE> 
+         (you could go directly to <CODE>BZ2_bzWriteClose</CODE>, but this would be pretty pointless)
+      <CODE>BZ2_bzWriteClose</CODE> 
+         otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC31" HREF="manual_toc.html#TOC31"><CODE>BZ2_bzWrite</CODE></A></H3>
+
+<PRE>
+   void BZ2_bzWrite ( int *bzerror, BZFILE *b, void *buf, int len );
+</PRE>
+
+<P>
+Absorbs <CODE>len</CODE> bytes from the buffer <CODE>buf</CODE>, eventually to be
+compressed and written to the file.
+
+</P>
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+      <CODE>BZ_PARAM_ERROR</CODE> 
+         if <CODE>b</CODE> is <CODE>NULL</CODE> or <CODE>buf</CODE> is <CODE>NULL</CODE> or <CODE>len &#60; 0</CODE>
+      <CODE>BZ_SEQUENCE_ERROR</CODE> 
+         if b was opened with <CODE>BZ2_bzReadOpen</CODE>
+      <CODE>BZ_IO_ERROR</CODE> 
+         if there is an error writing the compressed file.
+      <CODE>BZ_OK</CODE> 
+         otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC32" HREF="manual_toc.html#TOC32"><CODE>BZ2_bzWriteClose</CODE></A></H3>
+
+<PRE>
+   void BZ2_bzWriteClose ( int *bzerror, BZFILE* f,
+                           int abandon,
+                           unsigned int* nbytes_in,
+                           unsigned int* nbytes_out );
+
+   void BZ2_bzWriteClose64 ( int *bzerror, BZFILE* f,
+                             int abandon,
+                             unsigned int* nbytes_in_lo32,
+                             unsigned int* nbytes_in_hi32,
+                             unsigned int* nbytes_out_lo32,
+                             unsigned int* nbytes_out_hi32 );
+</PRE>
+
+<P>
+Compresses and flushes to the compressed file all data so far supplied
+by <CODE>BZ2_bzWrite</CODE>.  The logical end-of-stream markers are also written, so
+subsequent calls to <CODE>BZ2_bzWrite</CODE> are illegal.  All memory associated 
+with the compressed file <CODE>b</CODE> is released.  
+<CODE>fflush</CODE> is called on the
+compressed file, but it is not <CODE>fclose</CODE>'d.
+
+</P>
+<P>
+If <CODE>BZ2_bzWriteClose</CODE> is called to clean up after an error, the only
+action is to release the memory.  The library records the error codes
+issued by previous calls, so this situation will be detected
+automatically.  There is no attempt to complete the compression
+operation, nor to <CODE>fflush</CODE> the compressed file.  You can force this
+behaviour to happen even in the case of no error, by passing a nonzero
+value to <CODE>abandon</CODE>.
+
+</P>
+<P>
+If <CODE>nbytes_in</CODE> is non-null, <CODE>*nbytes_in</CODE> will be set to be the
+total volume of uncompressed data handled.  Similarly, <CODE>nbytes_out</CODE>
+will be set to the total volume of compressed data written.  For 
+compatibility with older versions of the library, <CODE>BZ2_bzWriteClose</CODE>
+only yields the lower 32 bits of these counts.  Use
+<CODE>BZ2_bzWriteClose64</CODE> if you want the full 64 bit counts.  These
+two functions are otherwise absolutely identical.
+
+</P>
+
+<P>
+Possible assignments to <CODE>bzerror</CODE>:
+
+<PRE>
+      <CODE>BZ_SEQUENCE_ERROR</CODE> 
+         if <CODE>b</CODE> was opened with <CODE>BZ2_bzReadOpen</CODE>
+      <CODE>BZ_IO_ERROR</CODE> 
+         if there is an error writing the compressed file
+      <CODE>BZ_OK</CODE> 
+         otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC33" HREF="manual_toc.html#TOC33">Handling embedded compressed data streams</A></H3>
+
+<P>
+The high-level library facilitates use of
+<CODE>bzip2</CODE> data streams which form some part of a surrounding, larger
+data stream.
+
+<UL>
+<LI>For writing, the library takes an open file handle, writes
+
+compressed data to it, <CODE>fflush</CODE>es it but does not <CODE>fclose</CODE> it.
+The calling application can write its own data before and after the
+compressed data stream, using that same file handle.
+<LI>Reading is more complex, and the facilities are not as general
+
+as they could be since generality is hard to reconcile with efficiency.
+<CODE>BZ2_bzRead</CODE> reads from the compressed file in blocks of size
+<CODE>BZ_MAX_UNUSED</CODE> bytes, and in doing so probably will overshoot
+the logical end of compressed stream.
+To recover this data once decompression has
+ended, call <CODE>BZ2_bzReadGetUnused</CODE> after the last call of <CODE>BZ2_bzRead</CODE>
+(the one returning <CODE>BZ_STREAM_END</CODE>) but before calling
+<CODE>BZ2_bzReadClose</CODE>.
+</UL>
+
+<P>
+This mechanism makes it easy to decompress multiple <CODE>bzip2</CODE>
+streams placed end-to-end.  As the end of one stream, when <CODE>BZ2_bzRead</CODE>
+returns <CODE>BZ_STREAM_END</CODE>, call <CODE>BZ2_bzReadGetUnused</CODE> to collect the
+unused data (copy it into your own buffer somewhere).  
+That data forms the start of the next compressed stream.
+To start uncompressing that next stream, call <CODE>BZ2_bzReadOpen</CODE> again,
+feeding in the unused data via the <CODE>unused</CODE>/<CODE>nUnused</CODE>
+parameters.
+Keep doing this until <CODE>BZ_STREAM_END</CODE> return coincides with the
+physical end of file (<CODE>feof(f)</CODE>).  In this situation
+<CODE>BZ2_bzReadGetUnused</CODE>
+will of course return no data.
+
+</P>
+<P>
+This should give some feel for how the high-level interface can be used.
+If you require extra flexibility, you'll have to bite the bullet and get
+to grips with the low-level interface.
+
+</P>
+
+
+<H3><A NAME="SEC34" HREF="manual_toc.html#TOC34">Standard file-reading/writing code</A></H3>
+<P>
+Here's how you'd write data to a compressed file:
+
+<PRE>
+FILE*   f;
+BZFILE* b;
+int     nBuf;
+char    buf[ /* whatever size you like */ ];
+int     bzerror;
+int     nWritten;
+
+f = fopen ( "myfile.bz2", "w" );
+if (!f) {
+   /* handle error */
+}
+b = BZ2_bzWriteOpen ( &#38;bzerror, f, 9 );
+if (bzerror != BZ_OK) {
+   BZ2_bzWriteClose ( b );
+   /* handle error */
+}
+
+while ( /* condition */ ) {
+   /* get data to write into buf, and set nBuf appropriately */
+   nWritten = BZ2_bzWrite ( &#38;bzerror, b, buf, nBuf );
+   if (bzerror == BZ_IO_ERROR) { 
+      BZ2_bzWriteClose ( &#38;bzerror, b );
+      /* handle error */
+   }
+}
+
+BZ2_bzWriteClose ( &#38;bzerror, b );
+if (bzerror == BZ_IO_ERROR) {
+   /* handle error */
+}
+</PRE>
+
+<P>
+And to read from a compressed file:
+
+<PRE>
+FILE*   f;
+BZFILE* b;
+int     nBuf;
+char    buf[ /* whatever size you like */ ];
+int     bzerror;
+int     nWritten;
+
+f = fopen ( "myfile.bz2", "r" );
+if (!f) {
+   /* handle error */
+}
+b = BZ2_bzReadOpen ( &#38;bzerror, f, 0, NULL, 0 );
+if (bzerror != BZ_OK) {
+   BZ2_bzReadClose ( &#38;bzerror, b );
+   /* handle error */
+}
+
+bzerror = BZ_OK;
+while (bzerror == BZ_OK &#38;&#38; /* arbitrary other conditions */) {
+   nBuf = BZ2_bzRead ( &#38;bzerror, b, buf, /* size of buf */ );
+   if (bzerror == BZ_OK) {
+      /* do something with buf[0 .. nBuf-1] */
+   }
+}
+if (bzerror != BZ_STREAM_END) {
+   BZ2_bzReadClose ( &#38;bzerror, b );
+   /* handle error */
+} else {
+   BZ2_bzReadClose ( &#38;bzerror );
+}
+</PRE>
+
+
+
+<H2><A NAME="SEC35" HREF="manual_toc.html#TOC35">Utility functions</A></H2>
+
+
+<H3><A NAME="SEC36" HREF="manual_toc.html#TOC36"><CODE>BZ2_bzBuffToBuffCompress</CODE></A></H3>
+
+<PRE>
+   int BZ2_bzBuffToBuffCompress( char*         dest,
+                                 unsigned int* destLen,
+                                 char*         source,
+                                 unsigned int  sourceLen,
+                                 int           blockSize100k,
+                                 int           verbosity,
+                                 int           workFactor );
+</PRE>
+
+<P>
+Attempts to compress the data in <CODE>source[0 .. sourceLen-1]</CODE>
+into the destination buffer, <CODE>dest[0 .. *destLen-1]</CODE>.
+If the destination buffer is big enough, <CODE>*destLen</CODE> is
+set to the size of the compressed data, and <CODE>BZ_OK</CODE> is
+returned.  If the compressed data won't fit, <CODE>*destLen</CODE>
+is unchanged, and <CODE>BZ_OUTBUFF_FULL</CODE> is returned.
+
+</P>
+<P>
+Compression in this manner is a one-shot event, done with a single call
+to this function.  The resulting compressed data is a complete
+<CODE>bzip2</CODE> format data stream.  There is no mechanism for making
+additional calls to provide extra input data.  If you want that kind of
+mechanism, use the low-level interface.
+
+</P>
+<P>
+For the meaning of parameters <CODE>blockSize100k</CODE>, <CODE>verbosity</CODE>
+and <CODE>workFactor</CODE>, <BR> see <CODE>BZ2_bzCompressInit</CODE>.
+
+</P>
+<P>
+To guarantee that the compressed data will fit in its buffer, allocate
+an output buffer of size 1% larger than the uncompressed data, plus
+six hundred extra bytes.
+
+</P>
+<P>
+<CODE>BZ2_bzBuffToBuffDecompress</CODE> will not write data at or
+beyond <CODE>dest[*destLen]</CODE>, even in case of buffer overflow.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+      <CODE>BZ_CONFIG_ERROR</CODE>
+         if the library has been mis-compiled
+      <CODE>BZ_PARAM_ERROR</CODE> 
+         if <CODE>dest</CODE> is <CODE>NULL</CODE> or <CODE>destLen</CODE> is <CODE>NULL</CODE>
+         or <CODE>blockSize100k &#60; 1</CODE> or <CODE>blockSize100k &#62; 9</CODE>
+         or <CODE>verbosity &#60; 0</CODE> or <CODE>verbosity &#62; 4</CODE> 
+         or <CODE>workFactor &#60; 0</CODE> or <CODE>workFactor &#62; 250</CODE>
+      <CODE>BZ_MEM_ERROR</CODE>
+         if insufficient memory is available 
+      <CODE>BZ_OUTBUFF_FULL</CODE>
+         if the size of the compressed data exceeds <CODE>*destLen</CODE>
+      <CODE>BZ_OK</CODE> 
+         otherwise
+</PRE>
+
+
+
+<H3><A NAME="SEC37" HREF="manual_toc.html#TOC37"><CODE>BZ2_bzBuffToBuffDecompress</CODE></A></H3>
+
+<PRE>
+   int BZ2_bzBuffToBuffDecompress ( char*         dest,
+                                    unsigned int* destLen,
+                                    char*         source,
+                                    unsigned int  sourceLen,
+                                    int           small,
+                                    int           verbosity );
+</PRE>
+
+<P>
+Attempts to decompress the data in <CODE>source[0 .. sourceLen-1]</CODE>
+into the destination buffer, <CODE>dest[0 .. *destLen-1]</CODE>.
+If the destination buffer is big enough, <CODE>*destLen</CODE> is
+set to the size of the uncompressed data, and <CODE>BZ_OK</CODE> is
+returned.  If the compressed data won't fit, <CODE>*destLen</CODE>
+is unchanged, and <CODE>BZ_OUTBUFF_FULL</CODE> is returned.
+
+</P>
+<P>
+<CODE>source</CODE> is assumed to hold a complete <CODE>bzip2</CODE> format
+data stream.  <BR> <CODE>BZ2_bzBuffToBuffDecompress</CODE> tries to decompress
+the entirety of the stream into the output buffer.
+
+</P>
+<P>
+For the meaning of parameters <CODE>small</CODE> and <CODE>verbosity</CODE>,
+see <CODE>BZ2_bzDecompressInit</CODE>.
+
+</P>
+<P>
+Because the compression ratio of the compressed data cannot be known in
+advance, there is no easy way to guarantee that the output buffer will
+be big enough.  You may of course make arrangements in your code to
+record the size of the uncompressed data, but such a mechanism is beyond
+the scope of this library.
+
+</P>
+<P>
+<CODE>BZ2_bzBuffToBuffDecompress</CODE> will not write data at or
+beyond <CODE>dest[*destLen]</CODE>, even in case of buffer overflow.
+
+</P>
+<P>
+Possible return values:
+
+<PRE>
+      <CODE>BZ_CONFIG_ERROR</CODE>
+         if the library has been mis-compiled
+      <CODE>BZ_PARAM_ERROR</CODE> 
+         if <CODE>dest</CODE> is <CODE>NULL</CODE> or <CODE>destLen</CODE> is <CODE>NULL</CODE>
+         or <CODE>small != 0 &#38;&#38; small != 1</CODE>
+         or <CODE>verbosity &#60; 0</CODE> or <CODE>verbosity &#62; 4</CODE> 
+      <CODE>BZ_MEM_ERROR</CODE>
+         if insufficient memory is available 
+      <CODE>BZ_OUTBUFF_FULL</CODE>
+         if the size of the compressed data exceeds <CODE>*destLen</CODE>
+      <CODE>BZ_DATA_ERROR</CODE>
+         if a data integrity error was detected in the compressed data
+      <CODE>BZ_DATA_ERROR_MAGIC</CODE>
+         if the compressed data doesn't begin with the right magic bytes
+      <CODE>BZ_UNEXPECTED_EOF</CODE>
+         if the compressed data ends unexpectedly
+      <CODE>BZ_OK</CODE> 
+         otherwise
+</PRE>
+
+
+
+<H2><A NAME="SEC38" HREF="manual_toc.html#TOC38"><CODE>zlib</CODE> compatibility functions</A></H2>
+<P>
+Yoshioka Tsuneo has contributed some functions to
+give better <CODE>zlib</CODE> compatibility.  These functions are
+<CODE>BZ2_bzopen</CODE>, <CODE>BZ2_bzread</CODE>, <CODE>BZ2_bzwrite</CODE>, <CODE>BZ2_bzflush</CODE>,
+<CODE>BZ2_bzclose</CODE>,
+<CODE>BZ2_bzerror</CODE> and <CODE>BZ2_bzlibVersion</CODE>.
+These functions are not (yet) officially part of
+the library.  If they break, you get to keep all the pieces.
+Nevertheless, I think they work ok.
+
+<PRE>
+typedef void BZFILE;
+
+const char * BZ2_bzlibVersion ( void );
+</PRE>
+
+<P>
+Returns a string indicating the library version.
+
+<PRE>
+BZFILE * BZ2_bzopen  ( const char *path, const char *mode );
+BZFILE * BZ2_bzdopen ( int        fd,    const char *mode );
+</PRE>
+
+<P>
+Opens a <CODE>.bz2</CODE> file for reading or writing, using either its name
+or a pre-existing file descriptor. 
+Analogous to <CODE>fopen</CODE> and <CODE>fdopen</CODE>.
+
+<PRE>
+int BZ2_bzread  ( BZFILE* b, void* buf, int len );
+int BZ2_bzwrite ( BZFILE* b, void* buf, int len );
+</PRE>
+
+<P>
+Reads/writes data from/to a previously opened <CODE>BZFILE</CODE>.
+Analogous to <CODE>fread</CODE> and <CODE>fwrite</CODE>.
+
+<PRE>
+int  BZ2_bzflush ( BZFILE* b );
+void BZ2_bzclose ( BZFILE* b );
+</PRE>
+
+<P>
+Flushes/closes a <CODE>BZFILE</CODE>.  <CODE>BZ2_bzflush</CODE> doesn't actually do
+anything.  Analogous to <CODE>fflush</CODE> and <CODE>fclose</CODE>.
+
+</P>
+
+<PRE>
+const char * BZ2_bzerror ( BZFILE *b, int *errnum )
+</PRE>
+
+<P>
+Returns a string describing the more recent error status of
+<CODE>b</CODE>, and also sets <CODE>*errnum</CODE> to its numerical value.
+
+</P>
+
+
+
+<H2><A NAME="SEC39" HREF="manual_toc.html#TOC39">Using the library in a <CODE>stdio</CODE>-free environment</A></H2>
+
+
+
+<H3><A NAME="SEC40" HREF="manual_toc.html#TOC40">Getting rid of <CODE>stdio</CODE></A></H3>
+
+<P>
+In a deeply embedded application, you might want to use just
+the memory-to-memory functions.  You can do this conveniently
+by compiling the library with preprocessor symbol <CODE>BZ_NO_STDIO</CODE>
+defined.  Doing this gives you a library containing only the following
+eight functions:
+
+</P>
+<P>
+<CODE>BZ2_bzCompressInit</CODE>, <CODE>BZ2_bzCompress</CODE>, <CODE>BZ2_bzCompressEnd</CODE> <BR>
+<CODE>BZ2_bzDecompressInit</CODE>, <CODE>BZ2_bzDecompress</CODE>, <CODE>BZ2_bzDecompressEnd</CODE> <BR>
+<CODE>BZ2_bzBuffToBuffCompress</CODE>, <CODE>BZ2_bzBuffToBuffDecompress</CODE>
+
+</P>
+<P>
+When compiled like this, all functions will ignore <CODE>verbosity</CODE>
+settings.
+
+</P>
+
+
+<H3><A NAME="SEC41" HREF="manual_toc.html#TOC41">Critical error handling</A></H3>
+<P>
+<CODE>libbzip2</CODE> contains a number of internal assertion checks which
+should, needless to say, never be activated.  Nevertheless, if an
+assertion should fail, behaviour depends on whether or not the library
+was compiled with <CODE>BZ_NO_STDIO</CODE> set.
+
+</P>
+<P>
+For a normal compile, an assertion failure yields the message
+
+<PRE>
+   bzip2/libbzip2: internal error number N.
+   This is a bug in bzip2/libbzip2, 1.0 of 21-Mar-2000.
+   Please report it to me at: jseward@acm.org.  If this happened
+   when you were using some program which uses libbzip2 as a
+   component, you should also report this bug to the author(s)
+   of that program.  Please make an effort to report this bug;
+   timely and accurate bug reports eventually lead to higher
+   quality software.  Thanks.  Julian Seward, 21 March 2000.
+</PRE>
+
+<P>
+where <CODE>N</CODE> is some error code number.  <CODE>exit(3)</CODE>
+is then called.
+
+</P>
+<P>
+For a <CODE>stdio</CODE>-free library, assertion failures result
+in a call to a function declared as:
+
+<PRE>
+   extern void bz_internal_error ( int errcode );
+</PRE>
+
+<P>
+The relevant code is passed as a parameter.  You should supply
+such a function.
+
+</P>
+<P>
+In either case, once an assertion failure has occurred, any 
+<CODE>bz_stream</CODE> records involved can be regarded as invalid.
+You should not attempt to resume normal operation with them.
+
+</P>
+<P>
+You may, of course, change critical error handling to suit
+your needs.  As I said above, critical errors indicate bugs
+in the library and should not occur.  All "normal" error
+situations are indicated via error return codes from functions,
+and can be recovered from.
+
+</P>
+
+
+
+<H2><A NAME="SEC42" HREF="manual_toc.html#TOC42">Making a Windows DLL</A></H2>
+<P>
+Everything related to Windows has been contributed by Yoshioka Tsuneo
+<BR> (<CODE>QWF00133@niftyserve.or.jp</CODE> /
+<CODE>tsuneo-y@is.aist-nara.ac.jp</CODE>), so you should send your queries to
+him (but perhaps Cc: me, <CODE>jseward@acm.org</CODE>).
+
+</P>
+<P>
+My vague understanding of what to do is: using Visual C++ 5.0,
+open the project file <CODE>libbz2.dsp</CODE>, and build.  That's all.
+
+</P>
+<P>
+If you can't
+open the project file for some reason, make a new one, naming these files:
+<CODE>blocksort.c</CODE>, <CODE>bzlib.c</CODE>, <CODE>compress.c</CODE>, 
+<CODE>crctable.c</CODE>, <CODE>decompress.c</CODE>, <CODE>huffman.c</CODE>, <BR>
+<CODE>randtable.c</CODE> and <CODE>libbz2.def</CODE>.  You will also need
+to name the header files <CODE>bzlib.h</CODE> and <CODE>bzlib_private.h</CODE>.
+
+</P>
+<P>
+If you don't use VC++, you may need to define the proprocessor symbol
+<CODE>_WIN32</CODE>. 
+
+</P>
+<P>
+Finally, <CODE>dlltest.c</CODE> is a sample program using the DLL.  It has a
+project file, <CODE>dlltest.dsp</CODE>.
+
+</P>
+<P>
+If you just want a makefile for Visual C, have a look at
+<CODE>makefile.msc</CODE>.
+
+</P>
+<P>
+Be aware that if you compile <CODE>bzip2</CODE> itself on Win32, you must set
+<CODE>BZ_UNIX</CODE> to 0 and <CODE>BZ_LCCWIN32</CODE> to 1, in the file
+<CODE>bzip2.c</CODE>, before compiling.  Otherwise the resulting binary won't
+work correctly.
+
+</P>
+<P>
+I haven't tried any of this stuff myself, but it all looks plausible.
+
+</P>
+
+<P><HR><P>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_2.html">previous</A>, <A HREF="manual_4.html">next</A>, <A HREF="manual_4.html">last</A> section, <A HREF="manual_toc.html">table of contents</A>.
+</BODY>
+</HTML>
diff --git a/bzip2/manual_4.html b/bzip2/manual_4.html
new file mode 100644
index 000000000..9ab7fb24f
--- /dev/null
+++ b/bzip2/manual_4.html
@@ -0,0 +1,528 @@
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+     from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - Miscellanea</TITLE>
+<link href="manual_3.html" rel=Previous>
+<link href="manual_toc.html" rel=ToC>
+
+</HEAD>
+<BODY>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_3.html">previous</A>, next, last section, <A HREF="manual_toc.html">table of contents</A>.
+<P><HR><P>
+
+
+<H1><A NAME="SEC43" HREF="manual_toc.html#TOC43">Miscellanea</A></H1>
+
+<P>
+These are just some random thoughts of mine.  Your mileage may
+vary.
+
+</P>
+
+
+<H2><A NAME="SEC44" HREF="manual_toc.html#TOC44">Limitations of the compressed file format</A></H2>
+<P>
+<CODE>bzip2-1.0</CODE>, <CODE>0.9.5</CODE> and <CODE>0.9.0</CODE>
+use exactly the same file format as the previous
+version, <CODE>bzip2-0.1</CODE>.  This decision was made in the interests of
+stability.  Creating yet another incompatible compressed file format
+would create further confusion and disruption for users.
+
+</P>
+<P>
+Nevertheless, this is not a painless decision.  Development
+work since the release of <CODE>bzip2-0.1</CODE> in August 1997
+has shown complexities in the file format which slow down
+decompression and, in retrospect, are unnecessary.  These are:
+
+<UL>
+<LI>The run-length encoder, which is the first of the
+
+      compression transformations, is entirely irrelevant.
+      The original purpose was to protect the sorting algorithm
+      from the very worst case input: a string of repeated
+      symbols.  But algorithm steps Q6a and Q6b in the original
+      Burrows-Wheeler technical report (SRC-124) show how
+      repeats can be handled without difficulty in block
+      sorting.
+<LI>The randomisation mechanism doesn't really need to be
+
+      there.  Udi Manber and Gene Myers published a suffix
+      array construction algorithm a few years back, which
+      can be employed to sort any block, no matter how 
+      repetitive, in O(N log N) time.  Subsequent work by
+      Kunihiko Sadakane has produced a derivative O(N (log N)^2) 
+      algorithm which usually outperforms the Manber-Myers
+      algorithm.
+
+      I could have changed to Sadakane's algorithm, but I find
+      it to be slower than <CODE>bzip2</CODE>'s existing algorithm for
+      most inputs, and the randomisation mechanism protects
+      adequately against bad cases.  I didn't think it was
+      a good tradeoff to make.  Partly this is due to the fact
+      that I was not flooded with email complaints about
+      <CODE>bzip2-0.1</CODE>'s performance on repetitive data, so
+      perhaps it isn't a problem for real inputs.
+
+      Probably the best long-term solution,
+      and the one I have incorporated into 0.9.5 and above,
+      is to use the existing sorting
+      algorithm initially, and fall back to a O(N (log N)^2)
+      algorithm if the standard algorithm gets into difficulties.
+<LI>The compressed file format was never designed to be
+
+      handled by a library, and I have had to jump though
+      some hoops to produce an efficient implementation of
+      decompression.  It's a bit hairy.  Try passing
+      <CODE>decompress.c</CODE> through the C preprocessor 
+      and you'll see what I mean.  Much of this complexity
+      could have been avoided if the compressed size of
+      each block of data was recorded in the data stream.
+<LI>An Adler-32 checksum, rather than a CRC32 checksum,
+
+      would be faster to compute.
+</UL>
+
+<P>
+It would be fair to say that the <CODE>bzip2</CODE> format was frozen
+before I properly and fully understood the performance
+consequences of doing so.
+
+</P>
+<P>
+Improvements which I was able to incorporate into
+0.9.0, despite using the same file format, are:
+
+<UL>
+<LI>Single array implementation of the inverse BWT.  This
+
+      significantly speeds up decompression, presumably
+      because it reduces the number of cache misses.
+<LI>Faster inverse MTF transform for large MTF values.  The
+
+      new implementation is based on the notion of sliding blocks
+      of values.
+<LI><CODE>bzip2-0.9.0</CODE> now reads and writes files with <CODE>fread</CODE>
+
+      and <CODE>fwrite</CODE>; version 0.1 used <CODE>putc</CODE> and <CODE>getc</CODE>.
+      Duh!  Well, you live and learn.
+
+</UL>
+
+<P>
+Further ahead, it would be nice 
+to be able to do random access into files.  This will 
+require some careful design of compressed file formats.
+
+</P>
+
+
+
+<H2><A NAME="SEC45" HREF="manual_toc.html#TOC45">Portability issues</A></H2>
+<P>
+After some consideration, I have decided not to use
+GNU <CODE>autoconf</CODE> to configure 0.9.5 or 1.0.
+
+</P>
+<P>
+<CODE>autoconf</CODE>, admirable and wonderful though it is, 
+mainly assists with portability problems between Unix-like
+platforms.  But <CODE>bzip2</CODE> doesn't have much in the way
+of portability problems on Unix; most of the difficulties appear
+when porting to the Mac, or to Microsoft's operating systems.
+<CODE>autoconf</CODE> doesn't help in those cases, and brings in a 
+whole load of new complexity.
+
+</P>
+<P>
+Most people should be able to compile the library and program
+under Unix straight out-of-the-box, so to speak, especially 
+if you have a version of GNU C available.
+
+</P>
+<P>
+There are a couple of <CODE>__inline__</CODE> directives in the code.  GNU C
+(<CODE>gcc</CODE>) should be able to handle them.  If you're not using
+GNU C, your C compiler shouldn't see them at all.
+If your compiler does, for some reason, see them and doesn't
+like them, just <CODE>#define</CODE> <CODE>__inline__</CODE> to be <CODE>/* */</CODE>.  One
+easy way to do this is to compile with the flag <CODE>-D__inline__=</CODE>, 
+which should be understood by most Unix compilers.
+
+</P>
+<P>
+If you still have difficulties, try compiling with the macro
+<CODE>BZ_STRICT_ANSI</CODE> defined.  This should enable you to build the
+library in a strictly ANSI compliant environment.  Building the program
+itself like this is dangerous and not supported, since you remove
+<CODE>bzip2</CODE>'s checks against compressing directories, symbolic links,
+devices, and other not-really-a-file entities.  This could cause
+filesystem corruption!
+
+</P>
+<P>
+One other thing: if you create a <CODE>bzip2</CODE> binary for public
+distribution, please try and link it statically (<CODE>gcc -s</CODE>).  This
+avoids all sorts of library-version issues that others may encounter
+later on.
+
+</P>
+<P>
+If you build <CODE>bzip2</CODE> on Win32, you must set <CODE>BZ_UNIX</CODE> to 0 and
+<CODE>BZ_LCCWIN32</CODE> to 1, in the file <CODE>bzip2.c</CODE>, before compiling.
+Otherwise the resulting binary won't work correctly.
+
+</P>
+
+
+
+<H2><A NAME="SEC46" HREF="manual_toc.html#TOC46">Reporting bugs</A></H2>
+<P>
+I tried pretty hard to make sure <CODE>bzip2</CODE> is
+bug free, both by design and by testing.  Hopefully
+you'll never need to read this section for real.
+
+</P>
+<P>
+Nevertheless, if <CODE>bzip2</CODE> dies with a segmentation
+fault, a bus error or an internal assertion failure, it
+will ask you to email me a bug report.  Experience with
+version 0.1 shows that almost all these problems can
+be traced to either compiler bugs or hardware problems.
+
+<UL>
+<LI>
+
+Recompile the program with no optimisation, and see if it
+works.  And/or try a different compiler.
+I heard all sorts of stories about various flavours
+of GNU C (and other compilers) generating bad code for
+<CODE>bzip2</CODE>, and I've run across two such examples myself.
+
+2.7.X versions of GNU C are known to generate bad code from
+time to time, at high optimisation levels.  
+If you get problems, try using the flags
+<CODE>-O2</CODE> <CODE>-fomit-frame-pointer</CODE> <CODE>-fno-strength-reduce</CODE>.
+You should specifically <EM>not</EM> use <CODE>-funroll-loops</CODE>.
+
+You may notice that the Makefile runs six tests as part of
+the build process.  If the program passes all of these, it's
+a pretty good (but not 100%) indication that the compiler has
+done its job correctly.
+<LI>
+
+If <CODE>bzip2</CODE> crashes randomly, and the crashes are not
+repeatable, you may have a flaky memory subsystem.  <CODE>bzip2</CODE>
+really hammers your memory hierarchy, and if it's a bit marginal,
+you may get these problems.  Ditto if your disk or I/O subsystem
+is slowly failing.  Yup, this really does happen.
+
+Try using a different machine of the same type, and see if
+you can repeat the problem.
+<LI>This isn't really a bug, but ... If <CODE>bzip2</CODE> tells
+
+you your file is corrupted on decompression, and you
+obtained the file via FTP, there is a possibility that you
+forgot to tell FTP to do a binary mode transfer.  That absolutely
+will cause the file to be non-decompressible.  You'll have to transfer
+it again.
+</UL>
+
+<P>
+If you've incorporated <CODE>libbzip2</CODE> into your own program
+and are getting problems, please, please, please, check that the 
+parameters you are passing in calls to the library, are
+correct, and in accordance with what the documentation says
+is allowable.  I have tried to make the library robust against
+such problems, but I'm sure I haven't succeeded.
+
+</P>
+<P>
+Finally, if the above comments don't help, you'll have to send
+me a bug report.  Now, it's just amazing how many people will 
+send me a bug report saying something like
+
+<PRE>
+   bzip2 crashed with segmentation fault on my machine
+</PRE>
+
+<P>
+and absolutely nothing else.  Needless to say, a such a report
+is <EM>totally, utterly, completely and comprehensively 100% useless; 
+a waste of your time, my time, and net bandwidth</EM>.
+With no details at all, there's no way I can possibly begin
+to figure out what the problem is.
+
+</P>
+<P>
+The rules of the game are: facts, facts, facts.  Don't omit
+them because "oh, they won't be relevant".  At the bare 
+minimum:
+
+<PRE>
+   Machine type.  Operating system version.  
+   Exact version of <CODE>bzip2</CODE> (do <CODE>bzip2 -V</CODE>).  
+   Exact version of the compiler used.  
+   Flags passed to the compiler.
+</PRE>
+
+<P>
+However, the most important single thing that will help me is
+the file that you were trying to compress or decompress at the
+time the problem happened.  Without that, my ability to do anything
+more than speculate about the cause, is limited.
+
+</P>
+<P>
+Please remember that I connect to the Internet with a modem, so
+you should contact me before mailing me huge files.
+
+</P>
+
+
+
+<H2><A NAME="SEC47" HREF="manual_toc.html#TOC47">Did you get the right package?</A></H2>
+
+<P>
+<CODE>bzip2</CODE> is a resource hog.  It soaks up large amounts of CPU cycles
+and memory.  Also, it gives very large latencies.  In the worst case, you
+can feed many megabytes of uncompressed data into the library before
+getting any compressed output, so this probably rules out applications
+requiring interactive behaviour.
+
+</P>
+<P>
+These aren't faults of my implementation, I hope, but more
+an intrinsic property of the Burrows-Wheeler transform (unfortunately).  
+Maybe this isn't what you want.
+
+</P>
+<P>
+If you want a compressor and/or library which is faster, uses less
+memory but gets pretty good compression, and has minimal latency,
+consider Jean-loup
+Gailly's and Mark Adler's work, <CODE>zlib-1.1.2</CODE> and
+<CODE>gzip-1.2.4</CODE>.  Look for them at
+
+</P>
+<P>
+<CODE>http://www.cdrom.com/pub/infozip/zlib</CODE> and
+<CODE>http://www.gzip.org</CODE> respectively.
+
+</P>
+<P>
+For something faster and lighter still, you might try Markus F X J
+Oberhumer's <CODE>LZO</CODE> real-time compression/decompression library, at
+<BR> <CODE>http://wildsau.idv.uni-linz.ac.at/mfx/lzo.html</CODE>.
+
+</P>
+<P>
+If you want to use the <CODE>bzip2</CODE> algorithms to compress small blocks
+of data, 64k bytes or smaller, for example on an on-the-fly disk
+compressor, you'd be well advised not to use this library.  Instead,
+I've made a special library tuned for that kind of use.  It's part of
+<CODE>e2compr-0.40</CODE>, an on-the-fly disk compressor for the Linux
+<CODE>ext2</CODE> filesystem.  Look at
+<CODE>http://www.netspace.net.au/~reiter/e2compr</CODE>.
+
+</P>
+
+
+
+<H2><A NAME="SEC48" HREF="manual_toc.html#TOC48">Testing</A></H2>
+
+<P>
+A record of the tests I've done.
+
+</P>
+<P>
+First, some data sets:
+
+<UL>
+<LI>B: a directory containing 6001 files, one for every length in the
+
+      range 0 to 6000 bytes.  The files contain random lowercase
+      letters.  18.7 megabytes.
+<LI>H: my home directory tree.  Documents, source code, mail files,
+
+      compressed data.  H contains B, and also a directory of 
+      files designed as boundary cases for the sorting; mostly very
+      repetitive, nasty files.  565 megabytes.
+<LI>A: directory tree holding various applications built from source:
+
+      <CODE>egcs</CODE>, <CODE>gcc-2.8.1</CODE>, KDE, GTK, Octave, etc.
+      2200 megabytes.
+</UL>
+
+<P>
+The tests conducted are as follows.  Each test means compressing 
+(a copy of) each file in the data set, decompressing it and
+comparing it against the original.
+
+</P>
+<P>
+First, a bunch of tests with block sizes and internal buffer
+sizes set very small, 
+to detect any problems with the
+blocking and buffering mechanisms.  
+This required modifying the source code so as to try to 
+break it.
+
+<OL>
+<LI>Data set H, with
+
+      buffer size of 1 byte, and block size of 23 bytes.
+<LI>Data set B, buffer sizes 1 byte, block size 1 byte.
+
+<LI>As (2) but small-mode decompression.
+
+<LI>As (2) with block size 2 bytes.
+
+<LI>As (2) with block size 3 bytes.
+
+<LI>As (2) with block size 4 bytes.
+
+<LI>As (2) with block size 5 bytes.
+
+<LI>As (2) with block size 6 bytes and small-mode decompression.
+
+<LI>H with buffer size of 1 byte, but normal block
+
+      size (up to 900000 bytes).
+</OL>
+
+<P>
+Then some tests with unmodified source code.
+
+<OL>
+<LI>H, all settings normal.
+
+<LI>As (1), with small-mode decompress.
+
+<LI>H, compress with flag <CODE>-1</CODE>.
+
+<LI>H, compress with flag <CODE>-s</CODE>, decompress with flag <CODE>-s</CODE>.
+
+<LI>Forwards compatibility: H, <CODE>bzip2-0.1pl2</CODE> compressing,
+
+      <CODE>bzip2-0.9.5</CODE> decompressing, all settings normal.
+<LI>Backwards compatibility:  H, <CODE>bzip2-0.9.5</CODE> compressing,
+
+      <CODE>bzip2-0.1pl2</CODE> decompressing, all settings normal.
+<LI>Bigger tests: A, all settings normal.
+
+<LI>As (7), using the fallback (Sadakane-like) sorting algorithm.
+
+<LI>As (8), compress with flag <CODE>-1</CODE>, decompress with flag
+
+      <CODE>-s</CODE>.
+<LI>H, using the fallback sorting algorithm.
+
+<LI>Forwards compatibility: A, <CODE>bzip2-0.1pl2</CODE> compressing,
+
+      <CODE>bzip2-0.9.5</CODE> decompressing, all settings normal.
+<LI>Backwards compatibility:  A, <CODE>bzip2-0.9.5</CODE> compressing,
+
+      <CODE>bzip2-0.1pl2</CODE> decompressing, all settings normal.
+<LI>Misc test: about 400 megabytes of <CODE>.tar</CODE> files with
+
+      <CODE>bzip2</CODE> compiled with Checker (a memory access error
+       detector, like Purify).
+<LI>Misc tests to make sure it builds and runs ok on non-Linux/x86
+
+      platforms.
+</OL>
+
+<P>
+These tests were conducted on a 225 MHz IDT WinChip machine, running
+Linux 2.0.36.  They represent nearly a week of continuous computation.
+All tests completed successfully.
+
+</P>
+
+
+
+<H2><A NAME="SEC49" HREF="manual_toc.html#TOC49">Further reading</A></H2>
+<P>
+<CODE>bzip2</CODE> is not research work, in the sense that it doesn't present
+any new ideas.  Rather, it's an engineering exercise based on existing
+ideas.
+
+</P>
+<P>
+Four documents describe essentially all the ideas behind <CODE>bzip2</CODE>:
+
+<PRE>
+Michael Burrows and D. J. Wheeler:
+  "A block-sorting lossless data compression algorithm"
+   10th May 1994. 
+   Digital SRC Research Report 124.
+   ftp://ftp.digital.com/pub/DEC/SRC/research-reports/SRC-124.ps.gz
+   If you have trouble finding it, try searching at the
+   New Zealand Digital Library, http://www.nzdl.org.
+
+Daniel S. Hirschberg and Debra A. LeLewer
+  "Efficient Decoding of Prefix Codes"
+   Communications of the ACM, April 1990, Vol 33, Number 4.
+   You might be able to get an electronic copy of this
+      from the ACM Digital Library.
+
+David J. Wheeler
+   Program bred3.c and accompanying document bred3.ps.
+   This contains the idea behind the multi-table Huffman
+   coding scheme.
+   ftp://ftp.cl.cam.ac.uk/users/djw3/
+
+Jon L. Bentley and Robert Sedgewick
+  "Fast Algorithms for Sorting and Searching Strings"
+   Available from Sedgewick's web page,
+   www.cs.princeton.edu/~rs
+</PRE>
+
+<P>
+The following paper gives valuable additional insights into the
+algorithm, but is not immediately the basis of any code
+used in bzip2.
+
+<PRE>
+Peter Fenwick:
+   Block Sorting Text Compression
+   Proceedings of the 19th Australasian Computer Science Conference,
+     Melbourne, Australia.  Jan 31 - Feb 2, 1996.
+   ftp://ftp.cs.auckland.ac.nz/pub/peter-f/ACSC96paper.ps
+</PRE>
+
+<P>
+Kunihiko Sadakane's sorting algorithm, mentioned above,
+is available from:
+
+<PRE>
+http://naomi.is.s.u-tokyo.ac.jp/~sada/papers/Sada98b.ps.gz
+</PRE>
+
+<P>
+The Manber-Myers suffix array construction
+algorithm is described in a paper
+available from:
+
+<PRE>
+http://www.cs.arizona.edu/people/gene/PAPERS/suffix.ps
+</PRE>
+
+<P>
+Finally, the following paper documents some recent investigations
+I made into the performance of sorting algorithms:
+
+<PRE>
+Julian Seward:
+   On the Performance of BWT Sorting Algorithms
+   Proceedings of the IEEE Data Compression Conference 2000
+     Snowbird, Utah.  28-30 March 2000.
+</PRE>
+
+<P><HR><P>
+<p>Go to the <A HREF="manual_1.html">first</A>, <A HREF="manual_3.html">previous</A>, next, last section, <A HREF="manual_toc.html">table of contents</A>.
+</BODY>
+</HTML>
diff --git a/bzip2/manual_toc.html b/bzip2/manual_toc.html
new file mode 100644
index 000000000..d4132c435
--- /dev/null
+++ b/bzip2/manual_toc.html
@@ -0,0 +1,173 @@
+<HTML>
+<HEAD>
+<!-- This HTML file has been created by texi2html 1.54
+     from manual.texi on 23 March 2000 -->
+
+<TITLE>bzip2 and libbzip2 - Table of Contents</TITLE>
+
+</HEAD>
+<BODY>
+<H1>bzip2 and libbzip2</H1>
+<H2>a program and library for data compression</H2>
+<H2>copyright (C) 1996-2000 Julian Seward</H2>
+<H2>version 1.0 of 21 March 2000</H2>
+<ADDRESS>Julian Seward</ADDRESS>
+<P>
+<P><HR><P>
+
+<P>
+This program, <CODE>bzip2</CODE>, 
+and associated library <CODE>libbzip2</CODE>, are
+Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+</P>
+<P>
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+
+<UL>
+<LI>
+
+   Redistributions of source code must retain the above copyright
+   notice, this list of conditions and the following disclaimer.
+<LI>
+
+   The origin of this software must not be misrepresented; you must 
+   not claim that you wrote the original software.  If you use this 
+   software in a product, an acknowledgment in the product 
+   documentation would be appreciated but is not required.
+<LI>
+
+   Altered source versions must be plainly marked as such, and must
+   not be misrepresented as being the original software.
+<LI>
+
+   The name of the author may not be used to endorse or promote 
+   products derived from this software without specific prior written 
+   permission.
+</UL>
+
+<P>
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR "AS IS" AND ANY EXPRESS
+OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+</P>
+<P>
+Julian Seward, Cambridge, UK.
+
+</P>
+<P>
+<CODE>jseward@acm.org</CODE>
+
+</P>
+<P>
+<CODE>http://sourceware.cygnus.com/bzip2</CODE>
+
+</P>
+<P>
+<CODE>http://www.cacheprof.org</CODE>
+
+</P>
+<P>
+<CODE>http://www.muraroa.demon.co.uk</CODE>
+
+</P>
+<P>
+<CODE>bzip2</CODE>/<CODE>libbzip2</CODE> version 1.0 of 21 March 2000.
+
+</P>
+<P>
+PATENTS: To the best of my knowledge, <CODE>bzip2</CODE> does not use any patented
+algorithms.  However, I do not have the resources available to carry out
+a full patent search.  Therefore I cannot give any guarantee of the
+above statement.
+
+</P>
+
+<UL>
+<LI><A NAME="TOC1" HREF="manual_1.html#SEC1">Introduction</A>
+<LI><A NAME="TOC2" HREF="manual_2.html#SEC2">How to use <CODE>bzip2</CODE></A>
+<UL>
+<UL>
+<UL>
+<LI><A NAME="TOC3" HREF="manual_2.html#SEC3">NAME</A>
+<LI><A NAME="TOC4" HREF="manual_2.html#SEC4">SYNOPSIS</A>
+<LI><A NAME="TOC5" HREF="manual_2.html#SEC5">DESCRIPTION</A>
+<LI><A NAME="TOC6" HREF="manual_2.html#SEC6">OPTIONS</A>
+<LI><A NAME="TOC7" HREF="manual_2.html#SEC7">MEMORY MANAGEMENT</A>
+<LI><A NAME="TOC8" HREF="manual_2.html#SEC8">RECOVERING DATA FROM DAMAGED FILES</A>
+<LI><A NAME="TOC9" HREF="manual_2.html#SEC9">PERFORMANCE NOTES</A>
+<LI><A NAME="TOC10" HREF="manual_2.html#SEC10">CAVEATS</A>
+<LI><A NAME="TOC11" HREF="manual_2.html#SEC11">AUTHOR</A>
+</UL>
+</UL>
+</UL>
+<LI><A NAME="TOC12" HREF="manual_3.html#SEC12">Programming with <CODE>libbzip2</CODE></A>
+<UL>
+<LI><A NAME="TOC13" HREF="manual_3.html#SEC13">Top-level structure</A>
+<UL>
+<LI><A NAME="TOC14" HREF="manual_3.html#SEC14">Low-level summary</A>
+<LI><A NAME="TOC15" HREF="manual_3.html#SEC15">High-level summary</A>
+<LI><A NAME="TOC16" HREF="manual_3.html#SEC16">Utility functions summary</A>
+</UL>
+<LI><A NAME="TOC17" HREF="manual_3.html#SEC17">Error handling</A>
+<LI><A NAME="TOC18" HREF="manual_3.html#SEC18">Low-level interface</A>
+<UL>
+<LI><A NAME="TOC19" HREF="manual_3.html#SEC19"><CODE>BZ2_bzCompressInit</CODE></A>
+<LI><A NAME="TOC20" HREF="manual_3.html#SEC20"><CODE>BZ2_bzCompress</CODE></A>
+<LI><A NAME="TOC21" HREF="manual_3.html#SEC21"><CODE>BZ2_bzCompressEnd</CODE></A>
+<LI><A NAME="TOC22" HREF="manual_3.html#SEC22"><CODE>BZ2_bzDecompressInit</CODE></A>
+<LI><A NAME="TOC23" HREF="manual_3.html#SEC23"><CODE>BZ2_bzDecompress</CODE></A>
+<LI><A NAME="TOC24" HREF="manual_3.html#SEC24"><CODE>BZ2_bzDecompressEnd</CODE></A>
+</UL>
+<LI><A NAME="TOC25" HREF="manual_3.html#SEC25">High-level interface</A>
+<UL>
+<LI><A NAME="TOC26" HREF="manual_3.html#SEC26"><CODE>BZ2_bzReadOpen</CODE></A>
+<LI><A NAME="TOC27" HREF="manual_3.html#SEC27"><CODE>BZ2_bzRead</CODE></A>
+<LI><A NAME="TOC28" HREF="manual_3.html#SEC28"><CODE>BZ2_bzReadGetUnused</CODE></A>
+<LI><A NAME="TOC29" HREF="manual_3.html#SEC29"><CODE>BZ2_bzReadClose</CODE></A>
+<LI><A NAME="TOC30" HREF="manual_3.html#SEC30"><CODE>BZ2_bzWriteOpen</CODE></A>
+<LI><A NAME="TOC31" HREF="manual_3.html#SEC31"><CODE>BZ2_bzWrite</CODE></A>
+<LI><A NAME="TOC32" HREF="manual_3.html#SEC32"><CODE>BZ2_bzWriteClose</CODE></A>
+<LI><A NAME="TOC33" HREF="manual_3.html#SEC33">Handling embedded compressed data streams</A>
+<LI><A NAME="TOC34" HREF="manual_3.html#SEC34">Standard file-reading/writing code</A>
+</UL>
+<LI><A NAME="TOC35" HREF="manual_3.html#SEC35">Utility functions</A>
+<UL>
+<LI><A NAME="TOC36" HREF="manual_3.html#SEC36"><CODE>BZ2_bzBuffToBuffCompress</CODE></A>
+<LI><A NAME="TOC37" HREF="manual_3.html#SEC37"><CODE>BZ2_bzBuffToBuffDecompress</CODE></A>
+</UL>
+<LI><A NAME="TOC38" HREF="manual_3.html#SEC38"><CODE>zlib</CODE> compatibility functions</A>
+<LI><A NAME="TOC39" HREF="manual_3.html#SEC39">Using the library in a <CODE>stdio</CODE>-free environment</A>
+<UL>
+<LI><A NAME="TOC40" HREF="manual_3.html#SEC40">Getting rid of <CODE>stdio</CODE></A>
+<LI><A NAME="TOC41" HREF="manual_3.html#SEC41">Critical error handling</A>
+</UL>
+<LI><A NAME="TOC42" HREF="manual_3.html#SEC42">Making a Windows DLL</A>
+</UL>
+<LI><A NAME="TOC43" HREF="manual_4.html#SEC43">Miscellanea</A>
+<UL>
+<LI><A NAME="TOC44" HREF="manual_4.html#SEC44">Limitations of the compressed file format</A>
+<LI><A NAME="TOC45" HREF="manual_4.html#SEC45">Portability issues</A>
+<LI><A NAME="TOC46" HREF="manual_4.html#SEC46">Reporting bugs</A>
+<LI><A NAME="TOC47" HREF="manual_4.html#SEC47">Did you get the right package?</A>
+<LI><A NAME="TOC48" HREF="manual_4.html#SEC48">Testing</A>
+<LI><A NAME="TOC49" HREF="manual_4.html#SEC49">Further reading</A>
+</UL>
+</UL>
+<P><HR><P>
+This document was generated on 23 March 2000 using the
+<A HREF="http://wwwcn.cern.ch/dci/texi2html/">texi2html</A>
+translator version 1.51a.</P>
+</BODY>
+</HTML>
diff --git a/bzip2/randtable.c b/bzip2/randtable.c
new file mode 100644
index 000000000..983089d46
--- /dev/null
+++ b/bzip2/randtable.c
@@ -0,0 +1,124 @@
+
+/*-------------------------------------------------------------*/
+/*--- Table for randomising repetitive blocks               ---*/
+/*---                                           randtable.c ---*/
+/*-------------------------------------------------------------*/
+
+/*--
+  This file is a part of bzip2 and/or libbzip2, a program and
+  library for lossless, block-sorting data compression.
+
+  Copyright (C) 1996-2000 Julian R Seward.  All rights reserved.
+
+  Redistribution and use in source and binary forms, with or without
+  modification, are permitted provided that the following conditions
+  are met:
+
+  1. Redistributions of source code must retain the above copyright
+     notice, this list of conditions and the following disclaimer.
+
+  2. The origin of this software must not be misrepresented; you must 
+     not claim that you wrote the original software.  If you use this 
+     software in a product, an acknowledgment in the product 
+     documentation would be appreciated but is not required.
+
+  3. Altered source versions must be plainly marked as such, and must
+     not be misrepresented as being the original software.
+
+  4. The name of the author may not be used to endorse or promote 
+     products derived from this software without specific prior written 
+     permission.
+
+  THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS
+  OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+  WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+  ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY
+  DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+  DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+  INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+  WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+  Julian Seward, Cambridge, UK.
+  jseward@acm.org
+  bzip2/libbzip2 version 1.0 of 21 March 2000
+
+  This program is based on (at least) the work of:
+     Mike Burrows
+     David Wheeler
+     Peter Fenwick
+     Alistair Moffat
+     Radford Neal
+     Ian H. Witten
+     Robert Sedgewick
+     Jon L. Bentley
+
+  For more information on these sources, see the manual.
+--*/
+
+
+#include "bzlib_private.h"
+
+
+/*---------------------------------------------*/
+Int32 BZ2_rNums[512] = { 
+   619, 720, 127, 481, 931, 816, 813, 233, 566, 247, 
+   985, 724, 205, 454, 863, 491, 741, 242, 949, 214, 
+   733, 859, 335, 708, 621, 574, 73, 654, 730, 472, 
+   419, 436, 278, 496, 867, 210, 399, 680, 480, 51, 
+   878, 465, 811, 169, 869, 675, 611, 697, 867, 561, 
+   862, 687, 507, 283, 482, 129, 807, 591, 733, 623, 
+   150, 238, 59, 379, 684, 877, 625, 169, 643, 105, 
+   170, 607, 520, 932, 727, 476, 693, 425, 174, 647, 
+   73, 122, 335, 530, 442, 853, 695, 249, 445, 515, 
+   909, 545, 703, 919, 874, 474, 882, 500, 594, 612, 
+   641, 801, 220, 162, 819, 984, 589, 513, 495, 799, 
+   161, 604, 958, 533, 221, 400, 386, 867, 600, 782, 
+   382, 596, 414, 171, 516, 375, 682, 485, 911, 276, 
+   98, 553, 163, 354, 666, 933, 424, 341, 533, 870, 
+   227, 730, 475, 186, 263, 647, 537, 686, 600, 224, 
+   469, 68, 770, 919, 190, 373, 294, 822, 808, 206, 
+   184, 943, 795, 384, 383, 461, 404, 758, 839, 887, 
+   715, 67, 618, 276, 204, 918, 873, 777, 604, 560, 
+   951, 160, 578, 722, 79, 804, 96, 409, 713, 940, 
+   652, 934, 970, 447, 318, 353, 859, 672, 112, 785, 
+   645, 863, 803, 350, 139, 93, 354, 99, 820, 908, 
+   609, 772, 154, 274, 580, 184, 79, 626, 630, 742, 
+   653, 282, 762, 623, 680, 81, 927, 626, 789, 125, 
+   411, 521, 938, 300, 821, 78, 343, 175, 128, 250, 
+   170, 774, 972, 275, 999, 639, 495, 78, 352, 126, 
+   857, 956, 358, 619, 580, 124, 737, 594, 701, 612, 
+   669, 112, 134, 694, 363, 992, 809, 743, 168, 974, 
+   944, 375, 748, 52, 600, 747, 642, 182, 862, 81, 
+   344, 805, 988, 739, 511, 655, 814, 334, 249, 515, 
+   897, 955, 664, 981, 649, 113, 974, 459, 893, 228, 
+   433, 837, 553, 268, 926, 240, 102, 654, 459, 51, 
+   686, 754, 806, 760, 493, 403, 415, 394, 687, 700, 
+   946, 670, 656, 610, 738, 392, 760, 799, 887, 653, 
+   978, 321, 576, 617, 626, 502, 894, 679, 243, 440, 
+   680, 879, 194, 572, 640, 724, 926, 56, 204, 700, 
+   707, 151, 457, 449, 797, 195, 791, 558, 945, 679, 
+   297, 59, 87, 824, 713, 663, 412, 693, 342, 606, 
+   134, 108, 571, 364, 631, 212, 174, 643, 304, 329, 
+   343, 97, 430, 751, 497, 314, 983, 374, 822, 928, 
+   140, 206, 73, 263, 980, 736, 876, 478, 430, 305, 
+   170, 514, 364, 692, 829, 82, 855, 953, 676, 246, 
+   369, 970, 294, 750, 807, 827, 150, 790, 288, 923, 
+   804, 378, 215, 828, 592, 281, 565, 555, 710, 82, 
+   896, 831, 547, 261, 524, 462, 293, 465, 502, 56, 
+   661, 821, 976, 991, 658, 869, 905, 758, 745, 193, 
+   768, 550, 608, 933, 378, 286, 215, 979, 792, 961, 
+   61, 688, 793, 644, 986, 403, 106, 366, 905, 644, 
+   372, 567, 466, 434, 645, 210, 389, 550, 919, 135, 
+   780, 773, 635, 389, 707, 100, 626, 958, 165, 504, 
+   920, 176, 193, 713, 857, 265, 203, 50, 668, 108, 
+   645, 990, 626, 197, 510, 357, 358, 850, 858, 364, 
+   936, 638
+};
+
+
+/*-------------------------------------------------------------*/
+/*--- end                                       randtable.c ---*/
+/*-------------------------------------------------------------*/
diff --git a/bzip2/sample1.bz2 b/bzip2/sample1.bz2
new file mode 100644
index 000000000..18dea6004
--- /dev/null
+++ b/bzip2/sample1.bz2
diff --git a/bzip2/sample1.ref b/bzip2/sample1.ref
new file mode 100644
index 000000000..a56e52b77
--- /dev/null
+++ b/bzip2/sample1.ref
diff --git a/bzip2/sample2.bz2 b/bzip2/sample2.bz2
new file mode 100644
index 000000000..d5a6160ba
--- /dev/null
+++ b/bzip2/sample2.bz2
diff --git a/bzip2/sample2.ref b/bzip2/sample2.ref
new file mode 100644
index 000000000..34af95839
--- /dev/null
+++ b/bzip2/sample2.ref
diff --git a/bzip2/sample3.bz2 b/bzip2/sample3.bz2
new file mode 100644
index 000000000..d90cff920
--- /dev/null
+++ b/bzip2/sample3.bz2
diff --git a/bzip2/sample3.ref b/bzip2/sample3.ref
new file mode 100644
index 000000000..775a2f68e
--- /dev/null
+++ b/bzip2/sample3.ref
@@ -0,0 +1,30007 @@
+This file is exceedingly boring.  If you find yourself
+reading it, please (1) take it from me that you can safely
+guess what the rest of the file says, and (2) seek professional
+help.
+
+ps.  there are no further sarcastic remarks in this file.
+
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
+ugh
diff --git a/bzip2/spewG.c b/bzip2/spewG.c
new file mode 100644
index 000000000..7934e7658
--- /dev/null
+++ b/bzip2/spewG.c
@@ -0,0 +1,39 @@
+
+/* spew out a thoroughly gigantic file designed so that bzip2
+   can compress it reasonably rapidly.  This is to help test
+   support for large files (> 2GB) in a reasonable amount of time.
+   I suggest you use the undocumented --exponential option to
+   bzip2 when compressing the resulting file; this saves a bit of
+   time.  Note: *don't* bother with --exponential when compressing 
+   Real Files; it'll just waste a lot of CPU time :-)
+   (but is otherwise harmless).
+*/
+
+#define _FILE_OFFSET_BITS 64
+
+#include <stdio.h>
+#include <stdlib.h>
+
+/* The number of megabytes of junk to spew out (roughly) */
+#define MEGABYTES 5000
+
+#define N_BUF 1000000
+char buf[N_BUF];
+
+int main ( int argc, char** argv )
+{
+   int ii, kk, p;
+   srandom(1);
+   setbuffer ( stdout, buf, N_BUF );
+   for (kk = 0; kk < MEGABYTES * 515; kk+=3) {
+      p = 25+random()%50;
+      for (ii = 0; ii < p; ii++)
+         printf ( "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" );
+      for (ii = 0; ii < p-1; ii++)
+         printf ( "bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb" );
+      for (ii = 0; ii < p+1; ii++)
+         printf ( "ccccccccccccccccccccccccccccccccccccc" );
+   }
+   fflush(stdout);
+   return 0;
+}
diff --git a/bzip2/unzcrash.c b/bzip2/unzcrash.c
new file mode 100644
index 000000000..f0f17fcca
--- /dev/null
+++ b/bzip2/unzcrash.c
@@ -0,0 +1,126 @@
+
+/* A test program written to test robustness to decompression of
+   corrupted data.  Usage is 
+       unzcrash filename
+   and the program will read the specified file, compress it (in memory),
+   and then repeatedly decompress it, each time with a different bit of
+   the compressed data inverted, so as to test all possible one-bit errors.
+   This should not cause any invalid memory accesses.  If it does, 
+   I want to know about it!
+
+   p.s.  As you can see from the above description, the process is
+   incredibly slow.  A file of size eg 5KB will cause it to run for
+   many hours.
+*/
+
+#include <stdio.h>
+#include <assert.h>
+#include "bzlib.h"
+
+#define M_BLOCK 1000000
+
+typedef unsigned char uchar;
+
+#define M_BLOCK_OUT (M_BLOCK + 1000000)
+uchar inbuf[M_BLOCK];
+uchar outbuf[M_BLOCK_OUT];
+uchar zbuf[M_BLOCK + 600 + (M_BLOCK / 100)];
+
+int nIn, nOut, nZ;
+
+static char *bzerrorstrings[] = {
+       "OK"
+      ,"SEQUENCE_ERROR"
+      ,"PARAM_ERROR"
+      ,"MEM_ERROR"
+      ,"DATA_ERROR"
+      ,"DATA_ERROR_MAGIC"
+      ,"IO_ERROR"
+      ,"UNEXPECTED_EOF"
+      ,"OUTBUFF_FULL"
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+      ,"???"   /* for future */
+};
+
+void flip_bit ( int bit )
+{
+   int byteno = bit / 8;
+   int bitno  = bit % 8;
+   uchar mask = 1 << bitno;
+   //fprintf ( stderr, "(byte %d  bit %d  mask %d)",
+   //          byteno, bitno, (int)mask );
+   zbuf[byteno] ^= mask;
+}
+
+int main ( int argc, char** argv )
+{
+   FILE* f;
+   int   r;
+   int   bit;
+   int   i;
+
+   if (argc != 2) {
+      fprintf ( stderr, "usage: unzcrash filename\n" );
+      return 1;
+   }
+
+   f = fopen ( argv[1], "r" );
+   if (!f) {
+      fprintf ( stderr, "unzcrash: can't open %s\n", argv[1] );
+      return 1;
+   }
+
+   nIn = fread ( inbuf, 1, M_BLOCK, f );
+   fprintf ( stderr, "%d bytes read\n", nIn );
+
+   nZ = M_BLOCK;
+   r = BZ2_bzBuffToBuffCompress (
+         zbuf, &nZ, inbuf, nIn, 9, 0, 30 );
+
+   assert (r == BZ_OK);
+   fprintf ( stderr, "%d after compression\n", nZ );
+
+   for (bit = 0; bit < nZ*8; bit++) {
+      fprintf ( stderr, "bit %d  ", bit );
+      flip_bit ( bit );
+      nOut = M_BLOCK_OUT;
+      r = BZ2_bzBuffToBuffDecompress (
+            outbuf, &nOut, zbuf, nZ, 0, 0 );
+      fprintf ( stderr, " %d  %s ", r, bzerrorstrings[-r] );
+
+      if (r != BZ_OK) {
+         fprintf ( stderr, "\n" );
+      } else {
+         if (nOut != nIn) {
+           fprintf(stderr, "nIn/nOut mismatch %d %d\n", nIn, nOut );
+           return 1;
+         } else {
+           for (i = 0; i < nOut; i++)
+             if (inbuf[i] != outbuf[i]) { 
+                fprintf(stderr, "mismatch at %d\n", i ); 
+                return 1; 
+           }
+           if (i == nOut) fprintf(stderr, "really ok!\n" );
+         }
+      }
+
+      flip_bit ( bit );
+   }
+
+#if 0
+   assert (nOut == nIn);
+   for (i = 0; i < nOut; i++) {
+     if (inbuf[i] != outbuf[i]) {
+        fprintf ( stderr, "difference at %d !\n", i );
+        return 1;
+     }
+   }
+#endif
+
+   fprintf ( stderr, "all ok\n" );
+   return 0;
+}
diff --git a/bzip2/words0 b/bzip2/words0
new file mode 100644
index 000000000..164a8ed28
--- /dev/null
+++ b/bzip2/words0
@@ -0,0 +1,5 @@
+
+If compilation produces errors, or a large number of warnings, 
+please read README.COMPILATION.PROBLEMS -- you might be able to
+adjust the flags in this Makefile to improve matters.
+
diff --git a/bzip2/words1 b/bzip2/words1
new file mode 100644
index 000000000..2e83de9f0
--- /dev/null
+++ b/bzip2/words1
@@ -0,0 +1,4 @@
+
+Doing 6 tests (3 compress, 3 uncompress) ...
+If there's a problem, things might stop at this point.
+ 
diff --git a/bzip2/words2 b/bzip2/words2
new file mode 100644
index 000000000..203ee39c4
--- /dev/null
+++ b/bzip2/words2
@@ -0,0 +1,5 @@
+
+Checking test results.  If any of the four "cmp"s which follow
+report any differences, something is wrong.  If you can't easily
+figure out what, please let me know (jseward@acm.org).
+
diff --git a/bzip2/words3 b/bzip2/words3
new file mode 100644
index 000000000..8486a84c8
--- /dev/null
+++ b/bzip2/words3
@@ -0,0 +1,23 @@
+
+If you got this far and the "cmp"s didn't complain, it looks
+like you're in business.  
+
+To install in /usr/bin, /usr/lib, /usr/man and /usr/include, type
+   make install
+To install somewhere else, eg, /xxx/yyy/{bin,lib,man,include}, type 
+   make install PREFIX=/xxx/yyy
+If you are (justifiably) paranoid and want to see what 'make install'
+is going to do, you can first do
+   make -n install                      or
+   make -n install PREFIX=/xxx/yyy      respectively.
+The -n instructs make to show the commands it would execute, but
+not actually execute them.
+
+Instructions for use are in the preformatted manual page, in the file
+bzip2.txt.  For more detailed documentation, read the full manual.  
+It is available in Postscript form (manual.ps) and HTML form
+(manual_toc.html).
+
+You can also do "bzip2 --help" to see some helpful information. 
+"bzip2 -L" displays the software license.
+