diff options
275 files changed, 33133 insertions, 3866 deletions
diff --git a/Makefile.am b/Makefile.am index 62169d2a..9c27edab 100644 --- a/Makefile.am +++ b/Makefile.am @@ -1,16 +1,9 @@ -SUBDIRS = intl m4 po +SUBDIRS = compat geometry intl keycodes keymap m4 po rules semantics symbols types -xml_in_files = xfree86.xml.in -xml_DATA = $(xml_in_files:.xml.in=.xml) xkb.dtd - -@INTLTOOL_XML_RULE@ - -EXTRA_DIST= config.rpath mkinstalldirs config.rpath $(xml_in_files) $(xml_DATA) \ +EXTRA_DIST= config.rpath mkinstalldirs config.rpath \ autogen.sh \ xfree86_xkb_xml.spec \ xfree86_xkb_xml.spec.in \ intltool-extract.in intltool-merge.in intltool-update.in -xmldir = $(xkb_base)/rules - ACLOCAL_AMFLAGS = -I m4 @@ -1,2 +1,25 @@ -This is just a module containing xmlized directory of the -XKB configuration repository. At the moment, only xfree86. is maintainer here. +X Keyboard Extension +-------------------- + +The X Keyboard Extension essentially replaces the core protocol definition of +keyboard. The extension makes possible to clearly and explicitly specify most +aspects of keyboard behaviour on per-key basis and to more closely track the +logical and physical state of the keyboard. It also includes a number of +keyboard controls designed to make keyboards more accessible to people with +physical impairments. + +There are five types of components in the server database corresponing to five +xkb symbolic names: symbols, geometry, keycodes, compat and types which +determine the keyboard behaviour. These five components can combined together +into a resulting keyboard mapping using the 'rules' component. + +The complete specification can be found on +http://www.x-docs.org/XKB/XKBproto.pdf + +For XKB configuration information see 'README.config' file. + +For information how to further enhance XKB configuration see 'README.enhancing' +file. + + +$XFree86$ diff --git a/README.config b/README.config new file mode 100644 index 00000000..229049dc --- /dev/null +++ b/README.config @@ -0,0 +1,198 @@ + The XKB Configuration Guide + + Kamil Toman, Ivan U. Pascal + + 25 November 2002 + + Abstract + + This document describes how to configure XFree86 XKB from a user's + point a few. It converts basic configuration syntax and gives also + a few examples. + +1. Overview + +The XKB configuration is decomposed into a number of components. Selecting +proper parts and combining them back you can achieve most of configurations +you might need. Unless you have a completely atypical keyboard you really +don't need to touch any of xkb configuration files. + +2. Selecting XKB Configuration + +The easiest and the most natural way how to specify a keyboard mapping is to +use rules component. As its name suggests it describes a number of general +rules how to combine all bits and pieces into a valid and useful keyboard +mapping. All you need to do is to select a suitable rules file and then to +feed it with a few parameters that will adjust the keyboard behaviour to ful- +fill your needs. + +The parameters are: + + o XkbRules - files of rules to be used for keyboard mapping composition + + o XkbModel - name of model of your keyboard type + + o XkbLayout - layout(s) you intend to use + + o XkbVariant - variant(s) of layout you intend to use + + o XkbOptions - extra xkb configuration options + +The proper rules file depends on your vendor. In reality, the commonest file +of rules is xfree86. For each rules file there is a description file named +<vendor-rules>.lst, for instance xfree86.lst which is located in xkb configu- +ration subdirectory rules (for example /etc/X11/xkb/rules). + +2.1 Basic Configuration + +Let's say you want to configure a PC style America keyboard with 104 keys as +described in xfree86.lst. It can be done by simply writing several lines from +below to you XFree86 configuration file (often found as /etc/X11/XF86Config-4 +or /etc/X11/XF86Config): + + Section "InputDevice" + Identifier "Keyboard1" + Driver "Keyboard" + + Option "XkbModel" "pc104" + Option "XkbLayout" "us" + Option "XKbOptions" "" + EndSection + +The values of parameters XkbModel and XkbLayout are really not surprising. +The parameters XkbOptions has been explicitly set to empty set of parameters. +The parameter XkbVariant has been left out. That means the default variant +named basic is loaded. + +Of course, this can be also done at runtime using utility setxkbmap. Shell +command loading the same keyboard mapping would look like: + + setxkbmap -rules xfree86 -model pc104 -layout us -option "" + +The configuration and the shell command would be very analogical for most +other layouts (internationalized mappings). + +2.2 Advanced Configuration + +Since XFree86 4.3.x you can use multi-layouts xkb configuration. What does +it mean? Basically it allows to load up to four different keyboard layouts at +a time. Each such layout would reside in its own group. The groups (unlike +complete keyboard remapping) can be switched very fast from one to another by +a combination of keys. + +Let's say you want to configure your new Logitech cordless desktop keyboard, +you intend to use three different layouts at the same time - us, czech and +german (in this order), and that you are used to Alt-Shift combination for +switching among them. + +Then the configuration snippet could look like this: + + Section "InputDevice" + Identifier "Keyboard1" + Driver "Keyboard" + + Option "XkbModel" "logicordless" + Option "XkbLayout" "us,cz,de" + Option "XKbOptions" "grp:alt_shift_toggle" + EndSection + +Of course, this can be also done at runtime using utility setxkbmap. Shell +command loading the same keyboard mapping would look like: + + setxkbmap -rules xfree86 -model logicordless -layout "us,cz,de" \ + -option "grp:alt_shift_toggle" + +2.3 Even More Advanced Configuration + +Okay, let's say you are more demanding. You do like the example above but you +want it to change a bit. Let's imagine you want the czech keyboard mapping to +use another variant but basic. The configuration snippet then changes into: + + Section "InputDevice" + Identifier "Keyboard1" + Driver "Keyboard" + + Option "XkbModel" "logicordless" + Option "XkbLayout" "us,cz,de" + Option "XkbVariant" ",bksl," + Option "XKbOptions" "grp:alt_shift_toggle" + EndSection + +That's seems tricky but it is not. The logic for settings of variants is the +same as for layouts, that means the first and the third variant settings are +left out (set to basic), the second is set to bksl (a special variant with an +enhanced definition of the backslash key). + +Analogically, the loading runtime will change to: + + setxkmap -rules xfree86 -model logicordless -layout "us,cz,de" \ + -variant ",bksl," -option "grp:alt_shift_toggle" + +2.4 Basic Global Options + +See rules/*.lst files. + +3. Direct XKB Configuration + +Generally, you can directly prescribe what configuration of each of basic xkb +components should be used to form the resulting keyboard mapping. This +method is rather "brute force". You precisely need to know the structure and +the meaning of all of used configuration components. + +This method also exposes all xkb configuration details directly into XFree86 +configuration file which is a not very fortunate fact. In rare occasions it +may be needed, though. So how does it work? + +3.1 Basic Components + +There are five basic components used to form a keyboard mapping: + + o key codes - a translation of the scan codes produced by the keyboard + into a suitable symbolic form + + o types - a specification of what various combinations of modifiers pro- + duce + + o key symbols - a translation of symbolic key codes into actual symbols + + o geometry - a description of physical keyboard geometry + + o compatibility maps - a specification of what action should each key pro- + duce in order to preserve compatibility with XKB-unware clients + +3.2 Example Configuration + +Look at the following example: + + Section "InputDevice" + Identifier "Keyboard0" + Driver "Keyboard" + + Option "XkbKeycodes" "xfree86" + Option "XkbTypes" "default" + Option "XkbSymbols" "en_US(pc104)+de+swapcaps" + Option "XkbGeometry" "pc(pc104)" + Option "XkbCompat" "basic+pc+iso9995" + EndSection + +This configuration sets the standard XFree86 default interpretation of key- +board keycodes, sets the default modificator types. The symbol table is com- +posed of extended US keyboard layout in its variant for pc keyboards with 104 +keys plus all keys for german layout are redefined respectively. Also the +logical meaning of Caps-lock and Control keys is swapped. The standard key- +board geometry (physical look) is set to pc style keyboard with 104 keys. The +compatibility map is set to allow basic shifting, to allow Alt keys to be +interpreted and also to allow iso9995 group shifting. + +4. Keymap XKB Configuration + +It is the formerly used way to configure xkb. The user included a special +keymap file which specified the direct xkb configuration. This method has +been obsoleted by previously described rules files which are far more flexi- +ble and allow simpler and more intuitive syntax. It is preserved merely for +compatibility reasons. Avoid using it if it is possible. + + Generated from XFree86: xc/programs/Xserver/hw/xfree86/doc/sgml/XKB-Config.sgml,v 1.4 dawes Exp $ + + +$XFree86: $ diff --git a/README.enhancing b/README.enhancing new file mode 100644 index 00000000..db78026b --- /dev/null +++ b/README.enhancing @@ -0,0 +1,511 @@ + How to further enhance XKB configuration + + Kamil Toman, Ivan U. Pascal + + 25 November 2002 + + Abstract + + This guide is aimed to relieve one's labour to create a new (inter- + nationalized) keyboard layout. Unlike other documents this guide + accents the keymap developer's point of view. + +1. Overview + +The developer of a new layout should read the xkb protocol specification (The +X Keyboard Extension: Protocol Specification <URL:http://www.x- +docs.org/XKB/XKBproto.pdf>) at least to clarify for himself some xkb-specific +terms used in this document and elsewhere in xkb configuration. Also it shows +wise to understand how the X server and a client digest their keyboard inputs +(with and without xkb). + +A useful source is also Ivan Pascal's text about xkb configuration +<URL:http://www.tsu.ru/~pascal/en/xkb> often referenced throughout this docu- +ment. + +Note that this document covers only enhancements which are to be made to +XFree86 version 4.3.x and above. + +2. The Basics + +At the startup (or at later at user's command) X server starts its xkb key- +board module extension and reads data from a compiled configuration file. + +This compiled configuration file is prepared by the program xkbcomp which +behaves altogether as an ordinary compiler (see man xkbcomp). Its input are +human readable xkb configuration files which are verified and then composed +into a useful xkb configuration. Users don't need to mess with xkbcomp them- +selves, for them it is invisible. Usually, it is started upon X server +startup. + +As you probably already know, the xkb configuration consists of five main +modules: + + Keycodes + Tables that defines translation from keyboard scan codes into + reasonable symbolic names, maximum, minimum legal keycodes, sym- + bolic aliases and description of physically present LED-indica- + tors. The primary sence of this component is to allow definitions + of maps of symbols (see below) to be independent of physical key- + board scancodes. There are two main naming conventions for sym- + bolic names (always four bytes long): + + o names which express some traditional meaning like <SPCE> + (stands for space bar) or + + o names which express some relative positioning on a key- + board, for example <AE01> (an exclamation mark on US key- + boards), on the right there are keys <AE02>, <AE03> etc. + + Types + Types describe how the produced key is changed by active modi- + fiers (like Shift, Control, Alt, ...). There are several prede- + fined types which cover most of used combinations. + + Compat + Compatibility component defines internal behaviour of modifiers. + Using compat component you can assign various actions (elabo- + rately described in xkb specification) to key events. This is + also the place where LED-indicators behaviour is defined. + + Symbols + For i18n purposes, this is the most important table. It defines + what values (=symbols) are assigned to what keycodes (represented + by their symbolic name, see above). There may be defined more + than one value for each key and then it depends on a key type and + on modifiers state (respective compat component) which value will + be the resulting one. + + Geometry + Geometry files aren't used by xkb itself but they may be used by + some external programs to depict a keyboard image. + +All these components have the files located in xkb configuration tree in sub- +directories with the same names (usually in /usr/lib/X11/xkb). + +3. Enhancing XKB Configuration + +Most of xkb enhancements concerns a need to define new output symbols for the +some input key events. In other words, a need to define a new symbol map (for +a new language, standard or just to feel more comfortable when typing text). + +What do you need to do? Generally, you have to define following things: + + o the map of symbols itself + + o the rules to allow users to select the new mapping + + o the description of the new layout + +First of all, it is good to go through existing layouts and to examine them +if there is something you could easily adjust to fit your needs. Even if +there is nothing similar you may get some ideas about basic concepts and used +tricks. + +3.1 Levels And Groups + +Since XFree86 4.3.0 you can use multi-layout concept of xkb configuration. +Though it is still in boundaries of xkb protocol and general ideas, the +keymap designer must obey new rules when creating new maps. In exchange we +get a more powerful and cleaner configuration system. + +Remember that it is the application which must decide which symbol matches +which keycode according to effective modifier state. The X server itself +sends only an input event message to. Of course, usually the general inter- +pretation is processed by Xlib, Xaw, Motif, Qt, Gtk and similar libraries. +The X server only supplies its mapping table (usually upon an application +startup). + +You can think of the X server's symbol table as of a irregular table where +each keycode has its row and where each combination of modifiers determines +exactly one column. The resulting cell then gives the proper symbolic value. +Not all keycodes need to bind different values for different combination of +modifiers. <ENTER> key, for instance, usually doesn't depend on any modi- +fiers so it its row has only one column defined. + +Note that in XKB there is no prior assumption that certain modifiers are +bound to certain columns. By editing proper files (see keytypes (section 4.2, +page 1)) this mapping can be changed as well. + +Unlike the original X protocol the XKB approach is far more flexible. It is +comfortable to add one additional XKB term - group. You can think of a group +as of a vector of columns per each keycode (naturally the dimension of this +vector may differ for different keycodes). What is it good for? The group is +not very useful unless you intend to use more than one logically different +set of symbols (like more than one alphabet) defined in a single mapping ta- +ble. But then, the group has a natural meaning - each symbol set has its own +group and changing it means selecting a different one. XKB approach allows +up to four different groups. The columns inside each group are called (shift) +levels. The X server knows the current group and reports it together with +modifier set and with a keycode in key events. + +To sum it up: + + o for each keycode XKB keyboard map contains up to four one-dimensional + tables - groups (logically different symbol sets) + + o for each group of a keycode XKB keyboard map contains some columns - + shift levels (values reached by combinations of Shift, Ctrl, Alt, ... + modifiers) + + o different keycodes can have different number of groups + + o different groups of one keycode can have different number of shift lev- + els + + o the current group number is tracked by X server + +It is clear that if you sanely define levels, groups and sanely bind modi- +fiers and associated actions you can have simultaneously loaded up to four +different symbol sets where each of them would reside in its own group. + +The multi-layout concept provides a facility to manipulate xkb groups and +symbol definitions in a way that allows almost arbitrary composition of pre- +defined symbol tables. To keep it fully functional you have to: + + o define all symbols only in the first group + + o (re)define any modifiers with extra care to avoid strange (anisometric) + behaviour + +4. Defining New Layouts + +See Some Words About XKB internals <URL:http://www.tsu.ru/~pas- +cal/en/xkb/internals.html> for explanation of used xkb terms and problems +addressed by XKB extension. + +See Common notes about XKB configuration files language +<URL:http://www.tsu.ru/~pascal/en/xkb/gram-common.html> for more precise +explanation of syntax of xkb configuration files. + +4.1 Predefined XKB Symbol Sets + +If you are about to define some European symbol map extension, you might want +to use on of four predefined latin alphabet layouts. + +Okay, let's assume you want extend an existing keymap and you want to over- +ride a few keys. Let's take a simple U.K. keyboard as an example (defined in +pc/gb): + + partial default alphanumeric_keys + xkb_symbols "basic" { + include "pc/latin" + + name[Group1]="Great Britain"; + + key <AE02> { [ 2, quotedbl, twosuperior, oneeighth ] }; + key <AE03> { [ 3, sterling, threesuperior, sterling ] }; + key <AC11> { [apostrophe, at, dead_circumflex, dead_caron] }; + key <TLDE> { [ grave, notsign, bar, bar ] }; + key <BKSL> { [numbersign, asciitilde, dead_grave, dead_breve ] }; + key <RALT> { type[Group1]="TWO_LEVEL", + [ ISO_Level3_Shift, Multi_key ] }; + + modifier_map Mod5 { <RALT> }; + }; + +It defines a new layout in basic variant as an extension of common latin +alphabet layout. The layout (symbol set) name is set to "Great Britain". +Then there are redefinitions of a few keycodes and a modifiers binding. As +you can see the number of shift levels is the same for <AE02>, <AE03>, +<AC11>, <TLDE> and <BKSL> keys but it differs from number of shift levels of +<RALT>. + +Note that the <RALT> key itself is a binding key for Mod5 and that it serves +like a shift modifier for LevelThree, together with Shift as a multi-key. It +is a good habit to respect this rule in a new similar layout. + +Okay, you could now define more variants of your new layout besides basic +simply by including (augmenting/overriding/...) the basic definition and +altering what may be needed. + +4.2 Key Types + +The differences in the number of columns (shift levels) are caused by a dif- +ferent types of keys (see the types definition in section basics). Most key- +codes have implicitly set the keytype in the included "pc/latin" file to +"FOUR_LEVEL_ALPHABETIC". The only exception is <RALT> keycode which is +explicitly set "TWO_LEVEL" keytype. + +All those names refer to pre-defined shift level schemes. Usually you can +choose a suitable shift level scheme from default types scheme list in proper +xkb component's subdirectory. + +The most used schemes are: + + ONE_LEVEL + The key does not depend on any modifiers. The symbol from first + level is always chosen. + + TWO_LEVEL + The key uses a modifier Shift and may have two possible values. + The second level may be chosen by Shift modifier. If Lock modi- + fier (usually Caps-lock) applies the symbol is further processed + using system-specific capitalization rules. If both Shift+Lock + modifier apply the symbol from the second level is taken and cap- + italization rules are applied (and usually have no effect). + + ALPHABETIC + The key uses modifiers Shift and Lock. It may have two possible + values. The second level may be chosen by Shift modifier. When + Lock modifier applies, the symbol from the first level is taken + and further processed using system-specific capitalization rules. + If both Shift+Lock modifier apply the symbol from the first level + is taken and no capitalization rules applied. This is often + called shift-cancels-caps behaviour. + + THREE_LEVEL + Is the same as TWO_LEVEL but it considers an extra modifier - + LevelThree which can be used to gain the symbol value from the + third level. If both Shift+LevelThree modifiers apply the value + from the third level is also taken. As in TWO_LEVEL, the Lock + modifier doesn't influence the resulting level. Only Shift and + LevelThree are taken into that consideration. If the Lock modi- + fier is active capitalization rules are applied on the resulting + symbol. + + FOUR_LEVEL + Is the same as THREE_LEVEL but unlike LEVEL_THREE if both + Shift+LevelThree modifiers apply the symbol is taken from the + fourth level. + + FOUR_LEVEL_ALPHABETIC + Is similar to FOUR_LEVEL but also defines shift-cancels-caps + behaviour as in ALPHABETIC. If Lock+LevelThree apply the symbol + from the third level is taken and the capitalization rules are + applied. If Lock+Shift+LevelThree apply the symbol from the + third level is taken and no capitalization rules are applied. + + KEYPAD + As the name suggest this scheme is primarily used for numeric + keypads. The scheme considers two modifiers - Shift and NumLock. + If none of modifiers applies the symbol from the first level is + taken. If either Shift or NumLock modifiers apply the symbol from + the second level is taken. If both Shift+NumLock modifiers apply + the symbol from the first level is taken. Again, shift-cancels- + caps variant. + + FOUR_LEVEL_KEYPAD + Is similar to KEYPAD scheme but considers also LevelThree modi- + fier. If LevelThree modifier applies the symbol from the third + level is taken. If Shift+LevelThree or NumLock+LevelThree apply + the symbol from the fourth level is taken. If all Shift+Num- + Lock+LevelThree modifiers apply the symbol from the third level + is taken. This also, shift-cancels-caps variant. + +Besides that, there are several schemes for special purposes: + + PC_BREAK + It is similar to TWO_LEVEL scheme but it considers the Control + modifier rather than Shift. That means, the symbol from the sec- + ond level is chosen by Control rather than by Shift. + + PC_SYSRQ + It is similar to TWO_LEVEL scheme but it considers the Alt modi- + fier rather than Shift. That means, the symbol from the second + level is chosen by Alt rather than by Shift. + + CTRL+ALT + The key uses modifiers Alt and Control. It may have two possible + values. If only one modifier (Alt or Control) applies the symbol + from the first level is chosen. Only if both Alt+Control modi- + fiers apply the symbol from the second level is chosen. + + SHIFT+ALT + The key uses modifiers Shift and Alt. It may have two possible + values. If only one modifier (Alt or Shift) applies the symbol + from the first level is chosen. Only if both Alt+Shift modifiers + apply the symbol from the second level is chosen. + +If needed, special caps schemes may be used. They redefine the standard +behaviour of all *ALPHABETIC types. The layouts (maps of symbols) with keys +defined in respective types then automatically change their behaviour accord- +ingly. Possible redefinitions are: + + o internal + + o internal_nocancel + + o shift + + o shift_nocancel + +None of these schemes should be used directly. They are defined merely for +'caps:' xkb options (used to globally change the layouts behaviour). + +Don't alter any of existing key types. If you need a different behaviour cre- +ate a new one. + +4.2.1 More On Definitions Of Types + +When the XKB software deals with a separate type description it gets a com- +plete list of modifiers that should be taken into account from the 'modi- +fiers=<list of modifiers>' list and expects that a set of 'map[<combination +of modifiers>]=<list of modifiers>' instructions that contain the mapping for +each combination of modifiers mentioned in that list. Modifiers that are not +explicitly listed are NOT taken into account when the resulting shift level +is computed. If some combination is omitted the program (subroutine) should +choose the first level for this combination (a quite reasonable behavior). + +Lets consider an example with two modifiers ModOne and ModTwo: + + type "..." { + modifiers = ModOne+ModTwo; + map[None] = Level1; + map[ModOne] = Level2; + }; + +In this case the map statements for ModTwo only and ModOne+ModTwo are omit- +ted. It means that if the ModTwo is active the subroutine can't found +explicit mapping for such combination an will use the default level i.e. +Level1. + +But in the case the type described as: + + type "..." { + modifiers = ModOne; + map[None] = Level1; + map[ModOne] = Level2; + }; + +the ModTwo will not be taken into account and the resulting level depends on +the ModOne state only. That means, ModTwo alone produces the Level1 but the +combination ModOne+ModTwo produces the Level2 as well as ModOne alone. + +What does it mean if the second modifier is the Lock? It means that in the +first case (the Lock itself is included in the list of modifiers but combina- +tions with this modifier aren't mentioned in the map statements) the internal +capitalization rules will be applied to the symbol from the first level. But +in the second case the capitalization will be applied to the symbol chosen +accordingly to he first modifier - and this can be the symbol from the first +as well as from the second level. + +Usually, all modifiers introduced in 'modifiers=<list of modifiers>' list are +used for shift level calculation and then discarded. Sometimes this is not +desirable. If you want to use a modifier for shift level calculation but you +don't want to discard it, you may list in 'preserve[<combination of modi- +fiers>]=<list of modifiers>'. That means, for a given combination all listed +modifiers will be preserved. If the Lock modifier is preserved then the +resulting symbol is passed to internal capitalization routine regardless +whether it has been used for a shift level calculation or not. + +Any key type description can use both real and virtual modifiers. Since real +modifiers always have standard names it is not necessary to explicitly +declare them. Virtual modifiers can have arbitrary names and can be declared +(prior using them) directly in key type definition: + + virtual_modifiers <comma-separated list of modifiers> ; + +as seen in for example basic, pc or mousekeys key type definitions. + +4.3 Rules + +Once you are finished with your symbol map you need to add it to rules file. +The rules file describes how all the five basic keycodes, types, compat, sym- +bols and geometry components should be composed to give a sensible resulting +xkb configuration. + +The main advantage of rules over formerly used keymaps is a possibility to +simply parameterize (once) fixed patterns of configurations and thus to ele- +gantly allow substitutions of various local configurations into predefined +templates. + +A pattern in a rules file (often located in /usr/lib/X11/xkb/rules) can be +parameterized with four other arguments: Model, Layout, Variant and Options. +For most cases parameters model and layout should be sufficient for choosing +a functional keyboard mapping. + +The rules file itself is composed of pattern lines and lines with rules. The +pattern line starts with an exclamation mark ('!') and describes how will the +xkb interpret the following lines (rules). A sample rules file looks like +this: + + ! model = keycodes + macintosh_old = macintosh + ... + * = xfree86 + + ! model = symbols + hp = +inet(%m) + microsoftpro = +inet(%m) + geniuscomfy = +inet(%m) + + ! model layout[1] = symbols + macintosh us = macintosh/us%(v[1]) + * * = pc/pc(%m)+pc/%l[1]%(v[1]) + + ! model layout[2] = symbols + macintosh us = +macintosh/us[2]%(v[2]):2 + * * = +pc/%l[2]%(v[2]):2 + + ! option = types + caps:internal = +caps(internal) + caps:internal_nocancel = +caps(internal_nocancel) + +Each rule defines what certain combination of values on the left side of +equal sign ('=') results in. For example a (keyboard) model macintosh_old +instructs xkb to take definitions of keycodes from file keycodes/macintosh +while the rest of models (represented by a wild card '*') instructs it to +take them from file keycodes/xfree86. The wild card represents all possible +values on the left side which were not found in any of the previous rules. +The more specialized (more complete) rules have higher precedence than gen- +eral ones, i.e. the more general rules supply reasonable default values. + +As you can see some lines contain substitution parameters - the parameters +preceded by the percent sign ('%'). The first alphabetical character after +the percent sign expands to the value which has been found on the left side. +For example +%l%(v) expands into +cz(bksl) if the respective values on the +left side were cz layout in its bksl variant. More, if the layout resp. vari- +ant parameter is followed by a pair of brackets ('[', ']') it means that xkb +should place the layout resp. variant into specified xkb group. If the brack- +ets are omitted the first group is the default value. + +So the second block of rules enhances symbol definitions for some particular +keyboard models with extra keys (for internet, multimedia, ...) . Other mod- +els are left intact. Similarly, the last block overrides some key type defi- +nitions, so the common global behaviour ''shift cancels caps'' or ''shift +doesn't cancel caps'' can be selected. The rest of rules produces special +symbols for each variant us layout of macintosh keyboard and standard pc sym- +bols in appropriate variants as a default. + +4.4 Descriptive Files of Rules + +Now you just need to add a detailed description to <rules>.xml description +file so the other users (and external programs which often parse this file) +know what is your work about. + +4.4.1 Old Descriptive Files + +The formerly used descriptive files were named <rules>.lst Its structure is +very simple and quite self descriptive but such simplicity had also some cav- +ities, for example there was no way how to describe local variants of layouts +and there were problems with the localization of descriptions. To preserve +compatibility with some older programs, new XML descriptive files can be con- +verted to old format '.lst'. + +For each parameter of rules file should be described its meaning. For the +rules file described above the .lst file could look like: + + ! model + pc104 Generic 104-key PC + microsoft Microsoft Natural + pc98 PC-98xx Series + macintosh Original Macintosh + ... + + ! layout + us U.S. English + cz Czech + de German + ... + + ! option + caps:internal uses internal capitalization. Shift cancels Caps + caps:internal_nocancel uses internal capitalization. Shift doesn't cancel Caps + +And that should be it. Enjoy creating your own xkb mapping. + + Generated from XFree86: xc/programs/Xserver/hw/xfree86/doc/sgml/XKB-Enhancing.sgml,v 1.2 dawes Exp $ + + +$XFree86: $ diff --git a/compat/.cvsignore b/compat/.cvsignore new file mode 100644 index 00000000..282522db --- /dev/null +++ b/compat/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/compat/Makefile.am b/compat/Makefile.am new file mode 100644 index 00000000..b667bd14 --- /dev/null +++ b/compat/Makefile.am @@ -0,0 +1,13 @@ +compat_DATA = \ +accessx basic complete \ +default group_led iso9995 \ +japan keypad leds \ +misc mousekeys norepeat \ +pc pc98 xfree86 \ +xtest README + +EXTRA_DIST= $(compat_DATA) + +compatdir = $(xkb_base)/compat + + diff --git a/compat/README b/compat/README new file mode 100644 index 00000000..fb84d71e --- /dev/null +++ b/compat/README @@ -0,0 +1,37 @@ +The core protocol interpretation of keyboard modifiers does not include direct +support for multiple keyboard groups, so XKB reports the effective keyboard +group to XKB-aware clients using some of reserved bits in the state field of +some core protocol events. This modified state field would not be interpreted +correctly by XKB-unaware clients, so XKB provides a group compatibility mapping +which remaps the keyboard group into a core modifier mask that has similar +effects, when possible. + +XKB maintains three compatibility state components that are used to make +XKB-unaware clients(*) work as well as possible: +- The compatibility state which corresponds to the effective modifier and + effective group state. +- The compatibility lookup state which is the core-protocol equivalent of the + lookup state. +- The compatibility grab state which is the nearest core-protocol equivalent + of the grab state. + +Compatibility state are essentially the corresponding XKB states, but with +keyboard group possibly encoded as one or more modifiers. + +Modifiers that correspond to each keyboard group are described in this +group compatibility map. + + +---- +(*) The implementation of XKB invisibly extends the X library to use the +keyboard extension if it is present. That means, clients that use library or +toolkit routines to interpret keyboard events automatically use all of XKB +features; clients that directly interpret the state field of core protocol +events or the keymap direcly may be affected by some of the XKB differences. +Thus most clients can take all advantages without modification but it also +means that XKB state can be reported to clients that have not explicitly +requested the keyboard extension. + + + +/* $XFree86$ */ diff --git a/compat/accessx b/compat/accessx new file mode 100644 index 00000000..3e4b4616 --- /dev/null +++ b/compat/accessx @@ -0,0 +1,54 @@ +// $Xorg: accessx,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +default partial xkb_compatibility "basic" { + interpret AccessX_Enable { + action= LockControls(controls=AccessXKeys); + }; +}; + +partial xkb_compatibility "full" { + + interpret AccessX_Enable { + action= LockControls(controls=AccessXKeys); + }; + + interpret AccessX_Feedback_Enable { + action= LockControls(controls=AccessXFeedback); + }; + + interpret RepeatKeys_Enable { + action= LockControls(controls=RepeatKeys); + }; + + interpret SlowKeys_Enable { + action= LockControls(controls=SlowKeys); + }; + + interpret BounceKeys_Enable { + action= LockControls(controls=BounceKeys); + }; + + interpret StickyKeys_Enable { + action= LockControls(controls=StickyKeys); + }; + + interpret MouseKeys_Enable { + action= LockControls(controls=MouseKeys); + }; + + interpret MouseKeys_Accel_Enable { + action= LockControls(controls=MouseKeysAccel); + }; + + interpret Overlay1_Enable { + action= LockControls(controls=Overlay1); + }; + + interpret Overlay2_Enable { + action= LockControls(controls=Overlay2); + }; + + interpret AudibleBell_Enable { + action= LockControls(controls=AudibleBell); + }; +}; diff --git a/compat/basic b/compat/basic new file mode 100644 index 00000000..f369b0be --- /dev/null +++ b/compat/basic @@ -0,0 +1,59 @@ +// $Xorg: basic,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Minimal set of symbol interpretations to provide +// reasonable default behavior (Num lock, shift and +// caps lock and mode switch) and set up the +// automatic updating of common keyboard LEDs. + +// $XFree86: xc/programs/xkbcomp/compat/basic,v 1.2 2000/11/06 19:24:10 dawes Exp $ + +default xkb_compatibility "basic" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= LockMods(modifiers=Shift); + }; + + interpret Any+Lock { + action= LockMods(modifiers=Lock); + }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=+1); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + indicator.allowExplicit= False; + indicator "Caps Lock" { + whichModState= Locked; + modifiers= Lock; + }; + indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + }; + indicator "Shift Lock" { + whichModState= Locked; + modifiers= Shift; + }; + indicator.allowExplicit= True; +}; diff --git a/compat/complete b/compat/complete new file mode 100644 index 00000000..68f89c80 --- /dev/null +++ b/compat/complete @@ -0,0 +1,10 @@ +// $Xorg: complete,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "complete" { + include "basic" + augment "iso9995" + augment "mousekeys" + augment "accessx(full)" + augment "misc" + augment "xfree86" +}; + diff --git a/compat/default b/compat/default new file mode 100644 index 00000000..7cea0f8c --- /dev/null +++ b/compat/default @@ -0,0 +1,11 @@ +// $Xorg: default,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "default" { + include "basic" + augment "mousekeys" + augment "accessx(basic)" + augment "misc" + augment "iso9995" +// ??should be changed/renamed/removed +// augment "xfree86" + augment "japan" +}; diff --git a/compat/group_led b/compat/group_led new file mode 100644 index 00000000..0805fa6a --- /dev/null +++ b/compat/group_led @@ -0,0 +1,22 @@ +// $XFree86: xc/programs/xkbcomp/compat/group_led,v 1.1.2.2 1999/07/22 14:21:30 hohndel Exp $ +// This is a "default" compatibility with a small modification: +// an "Scroll Lock" LED now shows the active keyboard group +default xkb_compatibility "group_led" { + include "basic" + augment "mousekeys" + augment "accessx(basic)" + augment "misc" + augment "iso9995" + augment "japan" +// This is to make Mode_switch working even in group 2 + virtual_modifiers AltGr; + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=+1); + }; + indicator "Scroll Lock" { + allowExplicit; + groups= All-Group1; + }; +}; diff --git a/compat/iso9995 b/compat/iso9995 new file mode 100644 index 00000000..d513c1ce --- /dev/null +++ b/compat/iso9995 @@ -0,0 +1,84 @@ +// $Xorg: iso9995,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Fairly complete set of symbol interpretations +// to provide reasonable default behavior + +// $XFree86: xc/programs/xkbcomp/compat/iso9995,v 1.3 2003/02/21 03:16:34 dawes Exp $ + +default partial xkb_compatibility "default" { + virtual_modifiers LevelThree,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret ISO_Lock+Any { + action= ISOLock(affect= all,modifiers=modMapMods); + }; + + interpret ISO_Level2_Latch+Shift { + useModMapMods= level1; + action= LatchMods(modifiers=Shift); + }; + + interpret ISO_Level3_Shift+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= SetMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Shift { + action= SetMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Latch+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= LatchMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Latch { + action= LatchMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Lock+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= LockMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Lock { + action= LockMods(modifiers=LevelThree); + }; + + interpret ISO_Group_Latch { + useModMapMods= level1; + virtualModifier= AltGr; + action= LatchGroup(group=2); + }; + + interpret ISO_Next_Group { + useModMapMods= level1; + virtualModifier= AltGr; + action= LockGroup(group=+1); + }; + + interpret ISO_Prev_Group { + useModMapMods= level1; + virtualModifier= AltGr; + action= LockGroup(group=-1); + }; + interpret ISO_First_Group { + action= LockGroup(group=1); + }; + + interpret ISO_Last_Group { + action= LockGroup(group=2); + }; + + indicator "Group 2" { + !allowExplicit; + groups= All-Group1; + }; +}; diff --git a/compat/japan b/compat/japan new file mode 100644 index 00000000..34bcc096 --- /dev/null +++ b/compat/japan @@ -0,0 +1,29 @@ +// $Xorg: japan,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Japanese keyboards need Eisu and Kana shift and +// lock keys, which are typically bound to the +// second shift level for some other modifier key. +// These interpretations disable the default +// interpretation (which would have these keys set +// the same modifier as the level one symbol). + +default partial xkb_compatibility "japan" { + + interpret.repeat= False; + + interpret Eisu_Shift+Lock { + action= NoAction(); + }; + + interpret Eisu_toggle+Lock { + action= NoAction(); + }; + + interpret Kana_Shift+Lock { + action= NoAction(); + }; + + interpret Kana_Lock+Lock { + action= NoAction(); + }; +}; diff --git a/compat/keypad b/compat/keypad new file mode 100644 index 00000000..469edec2 --- /dev/null +++ b/compat/keypad @@ -0,0 +1,60 @@ +// $Xorg: keypad,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Interpretations needed to implement the numeric keypad +// as an overlay instead of a modifier. + +partial hidden xkb_compatibility "overlay" { + include "keypad(overlay1)" +}; +partial hidden xkb_compatibility "overlay1" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Num_Lock { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + + indicator.allowExplicit= True; + indicator.driveskbd= True; + replace indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + controls= Overlay1; + }; + indicator.allowExplicit= True; +}; +partial hidden xkb_compatibility "overlay2" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Num_Lock { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay2); + }; + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + + indicator.allowExplicit= True; + indicator.driveskbd= True; + replace indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + controls= Overlay2; + }; + indicator.allowExplicit= True; +}; diff --git a/compat/leds b/compat/leds new file mode 100644 index 00000000..3d616063 --- /dev/null +++ b/compat/leds @@ -0,0 +1,24 @@ +// Use keyboard LEDs to show alternative group +// +// $XFree86$ + +partial xkb_compatibility "scroll" { + indicator "Scroll Lock" { + modifiers= None; + groups=All-group1; + }; +}; + +partial xkb_compatibility "num" { + indicator "Num Lock" { + modifiers= None; + groups=All-group1; + }; +}; + +partial xkb_compatibility "caps" { + indicator "Caps Lock" { + modifiers= None; + groups=All-group1; + }; +}; diff --git a/compat/misc b/compat/misc new file mode 100644 index 00000000..e1dbfd54 --- /dev/null +++ b/compat/misc @@ -0,0 +1,121 @@ +// $XdotOrg: xc/programs/xkbcomp/compat/misc,v 1.1.4.4 2004/03/05 13:41:28 eich Exp $ +// $Xorg: misc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +// +// +// +// $XFree86: xc/programs/xkbcomp/compat/misc,v 1.4 2003/05/15 13:31:57 pascal Exp $ + +default partial xkb_compatibility "misc" { + + virtual_modifiers Alt,Meta,Super,Hyper,ScrollLock; + + // Interpretations for some other useful keys + + interpret Terminate_Server { + action = Terminate(); + }; + + setMods.clearLocks= True; + + // Sets the "Alt" virtual modifier + + interpret Alt_L+Any { + useModMapMods= level1; + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_L { + action = SetMods(modifiers=Alt); + }; + + interpret Alt_R+Any { + useModMapMods= level1; + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_R { + action = SetMods(modifiers=Alt); + }; + + // Sets the "Meta" virtual modifier + + interpret Meta_L+Any { +// useModMapMods= level1; + virtualModifier= Meta; + action = SetMods(modifiers=modMapMods); + }; + + interpret Meta_L { + action = SetMods(modifiers=Meta); + }; + + interpret Meta_R+Any { + useModMapMods= level1; + virtualModifier= Meta; + action = SetMods(modifiers=modMapMods); + }; + + interpret Meta_R { + action = SetMods(modifiers=Alt); + }; + + // Sets the "Super" virtual modifier + + interpret Super_L+Any { +// useModMapMods= level1; + virtualModifier= Super; + action = SetMods(modifiers=modMapMods); + }; + + interpret Super_L { + action = SetMods(modifiers=Super); + }; + + interpret Super_R+Any { + useModMapMods= level1; + virtualModifier= Super; + action = SetMods(modifiers=modMapMods); + }; + + interpret Super_R { + action = SetMods(modifiers=Super); + }; + + // Sets the "Hyper" virtual modifier + + interpret Hyper_L+Any { +// useModMapMods= level1; + virtualModifier= Hyper; + action = SetMods(modifiers=modMapMods); + }; + + interpret Hyper_L { + action = SetMods(modifiers=Hyper); + }; + + interpret Hyper_R+Any { + useModMapMods= level1; + virtualModifier= Hyper; + action = SetMods(modifiers=modMapMods); + }; + + interpret Hyper_R { + action = SetMods(modifiers=Hyper); + }; + + // Sets the "ScrollLock" virtual modifier and + // makes it actually lock when pressed. Sets + // up a map for the scroll lock indicator. + interpret Scroll_Lock+Any { + virtualModifier= ScrollLock; + action = LockMods(modifiers=modMapMods); + }; + + indicator "Scroll Lock" { + allowExplicit; + whichModState= Locked; + modifiers= ScrollLock; + }; +}; diff --git a/compat/mousekeys b/compat/mousekeys new file mode 100644 index 00000000..6e9a208d --- /dev/null +++ b/compat/mousekeys @@ -0,0 +1,182 @@ + +// $Xorg: mousekeys,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Interpretations for arrow keys and a bunch of other +// common keysyms which make it possible to bind "mouse" +// keys using xmodmap and activate or deactivate them +// from the keyboard. + +default partial xkb_compatibility "mousekeys" { + + // Keypad actions. + // + interpret.repeat= True; + + interpret KP_1 { + action = MovePtr(x=-1,y= +1); + }; + interpret KP_End { + action = MovePtr(x=-1,y= +1); + }; + + interpret KP_2 { + action = MovePtr(x=+0,y= +1); + }; + interpret KP_Down { + action = MovePtr(x=+0,y= +1); + }; + + interpret KP_3 { + action = MovePtr(x=+1,y=+1); + }; + interpret KP_Next { + action = MovePtr(x=+1,y=+1); + }; + + interpret KP_4 { + action = MovePtr(x=-1,y=+0); + }; + interpret KP_Left { + action = MovePtr(x=-1,y=+0); + }; + + interpret KP_6 { + action = MovePtr(x=+1,y=+0); + }; + interpret KP_Right { + action = MovePtr(x=+1,y=+0); + }; + + interpret KP_7 { + action = MovePtr(x=-1,y=-1); + }; + interpret KP_Home { + action = MovePtr(x=-1,y=-1); + }; + + interpret KP_8 { + action = MovePtr(x=+0,y=-1); + }; + interpret KP_Up { + action = MovePtr(x=+0,y=-1); + }; + + interpret KP_9 { + action = MovePtr(x=+1,y=-1); + }; + interpret KP_Prior { + action = MovePtr(x=+1,y=-1); + }; + + interpret KP_5 { + action = PointerButton(button=default); + }; + interpret KP_Begin { + action = PointerButton(button=default); + }; + + interpret KP_F2 { + action = SetPtrDflt(affect=defaultButton,button=1); + }; + interpret KP_Divide { + action = SetPtrDflt(affect=defaultButton,button=1); + }; + + interpret KP_F3 { + action = SetPtrDflt(affect=defaultButton,button=2); + }; + interpret KP_Multiply { + action = SetPtrDflt(affect=defaultButton,button=2); + }; + + interpret KP_F4 { + action = SetPtrDflt(affect=defaultButton,button=3); + }; + interpret KP_Subtract { + action = SetPtrDflt(affect=defaultButton,button=3); + }; + + interpret KP_Separator { + action = PointerButton(button=default,count=2); + }; + interpret KP_Add { + action = PointerButton(button=default,count=2); + }; + + interpret KP_0 { + action = LockPointerButton(button=default,affect=lock); + }; + interpret KP_Insert { + action = LockPointerButton(button=default,affect=lock); + }; + + interpret KP_Decimal { + action = LockPointerButton(button=default,affect=unlock); + }; + interpret KP_Delete { + action = LockPointerButton(button=default,affect=unlock); + }; + + interpret.repeat= False; + + + // New Keysym Actions. + // + interpret Pointer_Button_Dflt { + action= PointerButton(button=default); + }; + interpret Pointer_Button1 { + action= PointerButton(button=1); + }; + interpret Pointer_Button2 { + action= PointerButton(button=2); + }; + interpret Pointer_Button3 { + action= PointerButton(button=3); + }; + interpret Pointer_DblClick_Dflt { + action= PointerButton(button=default,count=2); + }; + interpret Pointer_DblClick1 { + action= PointerButton(button=1,count=2); + }; + interpret Pointer_DblClick2 { + action= PointerButton(button=2,count=2); + }; + interpret Pointer_DblClick3 { + action= PointerButton(button=3,count=2); + }; + interpret Pointer_Drag_Dflt { + action= LockPointerButton(button=default); + }; + interpret Pointer_Drag1 { + action= LockPointerButton(button=1); + }; + interpret Pointer_Drag2 { + action= LockPointerButton(button=2); + }; + interpret Pointer_Drag3 { + action= LockPointerButton(button=3); + }; + + interpret Pointer_EnableKeys { + action= LockControls(controls=MouseKeys); + }; + interpret Pointer_Accelerate { + action= LockControls(controls=MouseKeysAccel); + }; + interpret Pointer_DfltBtnNext { + action= SetPtrDflt(affect=defaultButton,button= +1); + }; + interpret Pointer_DfltBtnPrev { + action= SetPtrDflt(affect=defaultButton,button= -1); + }; + + + // Allow an indicator for MouseKeys. + indicator "Mouse Keys" { +// !allowExplicit; + indicatorDrivesKeyboard; + controls= MouseKeys; + }; +}; diff --git a/compat/norepeat b/compat/norepeat new file mode 100644 index 00000000..07b0b7a6 --- /dev/null +++ b/compat/norepeat @@ -0,0 +1,11 @@ +// $Xorg: norepeat,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Put any otherwise normal keys that you don't want to repeat in +// this file + +default partial xkb_compatibility "norepeat" { + interpret Return { + action= NoAction(); + repeat= False; + }; +}; diff --git a/compat/pc b/compat/pc new file mode 100644 index 00000000..5ce7d767 --- /dev/null +++ b/compat/pc @@ -0,0 +1,18 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default partial xkb_compatibility "pc" { + + // Sets the "Alt" virtual modifier + + virtual_modifiers Alt; + + setMods.clearLocks= True; + interpret Alt_L+Any { + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_R+Any { + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; +}; diff --git a/compat/pc98 b/compat/pc98 new file mode 100644 index 00000000..23f3f798 --- /dev/null +++ b/compat/pc98 @@ -0,0 +1,62 @@ +// $Xorg: pc98,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/compat/pc98,v 3.1 1997/10/26 13:25:33 dawes Exp $ + +// Minimal set of symbol interpretations to provide +// reasonable default behavior (Num lock, shift and +// caps lock and mode switch) and set up the +// automatic updating of common keyboard LEDs. + +default xkb_compatibility "basic" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= LockMods(modifiers=Shift); + }; + +// interpret Any+Lock { +// action= LockMods(modifiers=Lock); +// }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=2,clearLocks); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + indicator.allowExplicit= False; + indicator "Caps Lock" { + whichModState= Locked; + modifiers= Lock; + }; + indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + }; + indicator "Shift Lock" { + whichModState= Locked; + modifiers= Shift; + }; + indicator.allowExplicit= True; +}; diff --git a/compat/xfree86 b/compat/xfree86 new file mode 100644 index 00000000..2da65fd6 --- /dev/null +++ b/compat/xfree86 @@ -0,0 +1,57 @@ +// $XFree86$ +// XFree86 special keysyms + +default partial xkb_compatibility "basic" { + + interpret.repeat= True; + + interpret XF86_Switch_VT_1 { + action = SwitchScreen(Screen=1, !SameServer); + }; + interpret XF86_Switch_VT_2 { + action = SwitchScreen(Screen=2, !SameServer); + }; + interpret XF86_Switch_VT_3 { + action = SwitchScreen(Screen=3, !SameServer); + }; + interpret XF86_Switch_VT_4 { + action = SwitchScreen(Screen=4, !SameServer); + }; + interpret XF86_Switch_VT_5 { + action = SwitchScreen(Screen=5, !SameServer); + }; + interpret XF86_Switch_VT_6 { + action = SwitchScreen(Screen=6, !SameServer); + }; + interpret XF86_Switch_VT_7 { + action = SwitchScreen(Screen=7, !SameServer); + }; + interpret XF86_Switch_VT_8 { + action = SwitchScreen(Screen=8, !SameServer); + }; + interpret XF86_Switch_VT_9 { + action = SwitchScreen(Screen=9, !SameServer); + }; + interpret XF86_Switch_VT_10 { + action = SwitchScreen(Screen=10, !SameServer); + }; + interpret XF86_Switch_VT_11 { + action = SwitchScreen(Screen=11, !SameServer); + }; + interpret XF86_Switch_VT_12 { + action = SwitchScreen(Screen=12, !SameServer); + }; + + interpret XF86_Ungrab { + action = Private(type=0x86, data="Ungrab"); + }; + interpret XF86_ClearGrab { + action = Private(type=0x86, data="ClsGrb"); + }; + interpret XF86_Next_VMode { + action = Private(type=0x86, data="+VMode"); + }; + interpret XF86_Prev_VMode { + action = Private(type=0x86, data="-VMode"); + }; +}; diff --git a/compat/xtest b/compat/xtest new file mode 100644 index 00000000..a35ced91 --- /dev/null +++ b/compat/xtest @@ -0,0 +1,58 @@ +// $Xorg: xtest,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "xtest" { + + // Minimal set of symbol interpretations to provide + // reasonable behavior for testing. The X Test + // Suite assumes that it can set any modifier by + // simulating a KeyPress and clear it by simulating + // a KeyRelease. Because of the way that XKB + // implements locking/latching modifiers, this + // approach fails in some cases (typically the + // lock or num lock modifiers). These symbol + // interpretations make all modifier keys just + // set the corresponding modifier so that xtest + // will see the behavior it expects. + + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= False; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= SetMods(modifiers=Shift); + }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= SetMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=2); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + indicator.allowExplicit= False; + indicator "Caps Lock" { + modifiers= Lock; + }; + indicator "Num Lock" { + modifiers= NumLock; + }; + indicator "Shift Lock" { + whichModState= Locked; + modifiers= Shift; + }; + indicator.allowExplicit= True; +}; diff --git a/configure.in b/configure.in index 78c2df96..c0ec15bf 100644 --- a/configure.in +++ b/configure.in @@ -1,9 +1,9 @@ -AC_INIT(xfree86.xml.in) +AC_INIT(rules/base.xml.in) -PACKAGE=xfree86_xkb_xml +PACKAGE=xkbdesc GETTEXT_PACKAGE=$PACKAGE MAJOR_VERSION=0 -MINOR_VERSION=5 +MINOR_VERSION=1 VERSION=$MAJOR_VERSION.$MINOR_VERSION AC_SUBST(MAJOR_VERSION) @@ -32,6 +32,31 @@ AC_SUBST(xkb_base) AC_OUTPUT([ intl/Makefile po/Makefile.in m4/Makefile Makefile -xfree86_xkb_xml.spec +compat/Makefile +geometry/Makefile +geometry/digital.vndr/Makefile +geometry/ibm.vndr/Makefile +geometry/sgi.vndr/Makefile +keycodes/Makefile +keycodes/digital.vndr/Makefile +keycodes/sgi.vndr/Makefile +keymap/Makefile +keymap/digital.vndr/Makefile +keymap/sgi.vndr/Makefile +keymap/sun.vndr/Makefile +semantics/Makefile +rules/Makefile +symbols/Makefile +symbols/digital.vndr/Makefile +symbols/fujitsu.vndr/Makefile +symbols/hp.vndr/Makefile +symbols/macintosh.vndr/Makefile +symbols/nec.vndr/Makefile +symbols/sgi.vndr/Makefile +symbols/sony.vndr/Makefile +symbols/sun.vndr/Makefile +symbols/xfree68.vndr/Makefile +types/Makefile +xkbdesc.spec ]) diff --git a/geometry/.cvsignore b/geometry/.cvsignore new file mode 100644 index 00000000..282522db --- /dev/null +++ b/geometry/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/geometry/Makefile.am b/geometry/Makefile.am new file mode 100644 index 00000000..684553ae --- /dev/null +++ b/geometry/Makefile.am @@ -0,0 +1,15 @@ +SUBDIRS = digital.vndr ibm.vndr sgi.vndr + +geom_DATA = \ +amiga ataritt chicony \ +dell everex fujitsu \ +hp keytronic kinesis \ +macintosh microsoft nec \ +northgate pc sony \ +sun winbook README + +EXTRA_DIST= $(geom_DATA) + +geomdir = $(xkb_base)/geometry + + diff --git a/geometry/README b/geometry/README new file mode 100644 index 00000000..245270d2 --- /dev/null +++ b/geometry/README @@ -0,0 +1,10 @@ +The geometry component of a keyboard mapping specifies primarily the geometry of +the keyboard. It contains the geometry symbolic name and the keyboard geometry +description. The geometry component might also contain aliases for some keys or +symbolic names for some indicators and might affect the set of indicators that +are physically present. Key aliases defined in the geometry component of a +keyboard mapping override those defined in the keycodes component. + + + +/* $XFree86$ */ diff --git a/geometry/amiga b/geometry/amiga new file mode 100644 index 00000000..357c4c0e --- /dev/null +++ b/geometry/amiga @@ -0,0 +1,270 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/geometry/amiga,v 3.2 1997/10/26 13:25:34 dawes Exp $ + +default xkb_geometry "usa1" { + + description= "Amiga (usa1)"; + width= 490; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "FCTS" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "TLDE" { { [ 28,18] }, { [2,1], [ 21,17] } }; + shape "TABK" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "CTRL" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "CAPS" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "RTRN" { + approx = { [ 16, 0], [42,37] }, + { [16, 0], [42, 0], [42,37], + [ 0,37], [ 0,19], [16,19] }, + { [18, 1], [40, 1], [40,36], + [ 2,36], [ 2,20], [18,20] } }; + shape "LFSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "DELE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 22; + row.left= 1; + key.shape= "FCTS"; + key.gap= 1; + section "Function" { + top= 28; + row { + top= 1; + keys { { <ESC>, shape="NORM" }, + { <FK01>, 9 }, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 9 }, <FK07>, <FK08>, <FK09>, <FK10> + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 56; + row { + top= 1; + keys { { <TLDE>, shape="TLDE" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <BKSL>, { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN", -15 } + }; + }; + row { + top= 39; + keys { { <LCTL>, "CTRL" }, { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { <LALT>, 10 }, <LAMI>, + { <SPCE>, "SPCE" }, + <RAMI>, <RALT> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 56; + left= 326; + row { + top= 1; + key.shape = "DELE"; + keys { <DELE>, <HELP> }; + }; + row { + top= 39; + left = 20; + keys { <UP> }; + }; + row { + top= 58; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 56; + left= 392; + row { + top= 1; + keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDC> }; + }; + }; // End of "Keypad" section + +}; + +xkb_geometry "de" { + + description= "Amiga (de)"; + width= 490; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "FCTS" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "TLDE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "TABK" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "CTRL" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "CAPS" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "RTRN" { + { [ 0, 0], [28,0], [28,37], [5,37], [5,18], [ 0,18] }, + { [ 2, 1], [26,1], [26,36], [7,36], [7,17], [ 2,17] } }; + shape "LFSH" { { [ 32,18] }, { [2,1], [ 29,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "DELE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 22; + row.left= 1; + key.shape= "FCTS"; + key.gap= 1; + section "Function" { + top= 28; + row { + top= 1; + keys { { <ESC>, shape="NORM" }, + { <FK01>, 9 }, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 9 }, <FK07>, <FK08>, <FK09>, <FK10> + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 56; + row { + top= 1; + keys { { <TLDE>, shape="TLDE" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <BKSL>, { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" } + }; + }; + row { + top= 39; + keys { { <LCTL>, "CTRL" }, { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { <LALT>, 14 }, <LAMI>, + { <SPCE>, "SPCE" }, + <RAMI>, <RALT> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 56; + left= 326; + row { + top= 1; + key.shape = "DELE"; + keys { <DELE>, <HELP> }; + }; + row { + top= 39; + left = 20; + keys { <UP> }; + }; + row { + top= 58; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 56; + left= 392; + row { + top= 1; + keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDC> }; + }; + }; // End of "Keypad" section + +}; diff --git a/geometry/ataritt b/geometry/ataritt new file mode 100644 index 00000000..e53cd94c --- /dev/null +++ b/geometry/ataritt @@ -0,0 +1,257 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/geometry/ataritt,v 3.2 1997/10/26 13:25:34 dawes Exp $ + +default xkb_geometry "us" { + + description= "Atari TT (us)"; + width= 480; + height= 173; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTRN" { approx = { [0,19], [32,37] }, + { [ 14, 0], [32, 0], [32,37], [0,37], [0,19], [14,19] }, + { [ 16, 1], [30, 1], [30,36], [2,36], [2,20], [16,20] } }; + shape "CTRL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "FCTS" { { [ 28,10] }, { [2,1], [ 26,9] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 21; + row.left= 1; + key.shape = "NORM"; + key.gap= 1; + section "Function" { + top= 36; + key.shape= "FCTS"; + row { + top= 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 63; + row { + top= 1; + keys { <ESC>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, <TLDE>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN", -13 }, <DELE> + }; + }; + row { + top= 39; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <BKSL>, 34 } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { <ALT>, 24 }, + { <SPCE>, "SPCE" }, + <CAPS> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 63; + left= 319; + row { + top= 1; + key.shape = "BKSP"; + keys { <HELP>, <UNDO> }; + }; + row { + top= 20; + keys { <INS>, <UP>, <HOME> }; + }; + row { + top= 39; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 63; + left= 381; + row { + top= 1; + keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDC> }; + }; + }; // End of "Keypad" section + +}; + +xkb_geometry "de" { + + description= "Atari TT (de)"; + width= 480; + height= 173; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { approx = { [0,19], [32,37] }, + { [ 14, 0], [32, 0], [32,37], [0,37], [0,19], [14,19] }, + { [ 16, 1], [30, 1], [30,36], [2,36], [2,20], [16,20] } }; + shape "CTRL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "RTSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "FCTS" { { [ 28,11] }, { [2,1], [ 26,10] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 21; + row.left= 1; + key.shape = "NORM"; + key.gap= 1; + section "Function" { + top= 36; + key.shape= "FCTS"; + row { + top= 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 63; + row { + top= 1; + keys { <ESC>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, <TLDE>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN", -13 }, <DELE> + }; + }; + row { + top= 39; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <BKSL>, 34 } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, + <AB05>, <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { <ALT>, 24 }, { <SPCE>, "SPCE" }, <CAPS> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 63; + left= 319; + row { + top= 1; + key.shape = "BKSP"; + keys { <HELP>, <UNDO> }; + }; + row { + top= 20; + keys { <INS>, <UP>, <HOME> }; + }; + row { + top= 39; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 63; + left= 381; + row { + top= 1; + keys { <KPLP>, <KPRP>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDC> }; + }; + }; // End of "Keypad" section + +}; diff --git a/geometry/chicony b/geometry/chicony new file mode 100644 index 00000000..9bdd15b0 --- /dev/null +++ b/geometry/chicony @@ -0,0 +1,190 @@ +// -*- indent-tabs-mode: nil -*- +// $XFree86: xc/programs/xkbcomp/geometry/chicony,v 1.1 2003/05/29 12:41:57 pascal Exp $ + +// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net> +// Geometry specification for Chicony KB-9820 keyboard. + +// 86 keys +default xkb_geometry "us" { + description = "Chicony KB-9820 infra-red keyboard"; + width = 350; + height = 180; + //baseColor = "grey60"; + labelColor = "white"; + + shape "EDGE" { cornerRadius = 25, + { [0, 8], [142.5, 0], [202.5, 0], [347, 8], + [347, 60], [327, 100], [322, 160], + [202.5, 165], [142.5, 165], + [25, 160], [20, 100], [0, 60] } }; + shape "KEYS" { cornerRadius = 2, { [271, 109] } }; + shape "MOUS" { cornerRadius = 12, { [24, 24] } }; + shape "MOUS2" { cornerRadius = 9, { [18, 18] } }; + shape "BTNS" { cornerRadius = 5, { [10, 10] } }; + + solid "Edges" { + top = 0; + left = 0; + shape = "EDGE"; + color = "grey60"; + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 38; + top = 22; + color = "black"; + }; + + solid "Mouse" { + shape = "MOUS"; + left = 315; + top = 30; + color = "grey30"; + }; + + outline "Mouse2" { + shape = "MOUS2"; + left = 318; + top = 33; + color = "black"; + }; + + solid "Button1" { + shape = "BTNS"; + left = 10; + top = 32; + color = "grey30"; + }; + + solid "Button2" { + shape = "BTNS"; + left = 20; + top = 42; + color = "grey30"; + }; + + outline "Buttons" { + shape = "MOUS"; + left = 8; + top = 30; + color = "black"; + }; + + shape.cornerRadius = 1; + shape "ESC" { { [17, 12] }, { [1.5, 0], [15.5, 10] } }; + shape "SMALL" { { [15, 12] }, { [1.5, 0], [13.5, 10] } }; + shape "THIN" { { [14, 18] }, { [2, 0], [12, 15] } }; + shape "NARR" { { [16, 18] }, { [2, 0], [14, 15] } }; + shape "NORM" { { [17, 18] }, { [2, 0], [15, 15] } }; + shape "WIDER" { { [18, 18] }, { [2, 0], [16, 15] } }; + shape "CAPS" { { [22, 18] }, { [2, 0], [20, 15] } }; + shape "RTSH" { { [23, 18] }, { [2, 0], [21, 15] } }; + shape "WIDEST" { { [30, 18] }, { [2, 0], [28, 15] } }; + shape "SPCE" { { [68, 18] }, { [2, 0], [66, 15] } }; + + section "Function" { + key.shape = "SMALL"; + key.gap = 0.79; + key.color = "grey60"; + left = 38; + top = 22; + row { + top = 1; + keys { { <ESC>, shape="ESC", 1 }, + { <FK01>, 1.5 }, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + <NMLK>, <PRSC>, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Control" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey60"; + left = 38; + top = 111; + row { + top = 1; + keys { <EASY>, <LCTL>, <LWIN>, <LALT>, + { <SPCE>, shape="SPCE" }, + <RALT>, + { <RWIN>, shape="THIN" }, + { <MENU>, shape="THIN" }, + { <INS>, shape="THIN" }, + { <DELE>, shape="THIN" } }; + }; + }; // End of "Control" section + + section "Editing" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey60"; + left = 291; + top = 34; + row.vertical = True; + row { + top = 1; + keys { <HOME>, <PGUP>, <PGDN>, <END> }; + }; + }; // End of "Editing" section + + section "Navigation" { + key.gap = 1; + key.shape = "NARR"; + key.color = "grey60"; + left = 257; + top = 92; + row { + left = 16; + top = 1; + keys { <UP> }; + }; + row { + top = 20; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Navigation" section + + section "Alpha" { + key.gap = 1; + key.shape = "NORM"; + key.color = "grey60"; + left = 38; + top = 35; + row { + top = 1; + keys { { <TLDE>, shape="NARR" }, + <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, shape="WIDER" } + }; + }; + row { + top = 20; + keys { <TAB>, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, <AD13> + }; + }; + row { + top = 39; + keys { { <CAPS>, shape="CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, shape="WIDEST" } + }; + }; + row { + top = 58; + keys { { <LFSH>, shape="WIDEST" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, shape="RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff --git a/geometry/dell b/geometry/dell new file mode 100644 index 00000000..935bccaa --- /dev/null +++ b/geometry/dell @@ -0,0 +1,185 @@ +// $Xorg: dell,v 1.4 2001/02/09 02:05:49 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86$ +// +default xkb_geometry "dell101" { + + description= "Dell 101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 21 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 21 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "default" geometry diff --git a/geometry/digital.vndr/.cvsignore b/geometry/digital.vndr/.cvsignore new file mode 100644 index 00000000..282522db --- /dev/null +++ b/geometry/digital.vndr/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/geometry/digital.vndr/Makefile.am b/geometry/digital.vndr/Makefile.am new file mode 100644 index 00000000..3e918b9f --- /dev/null +++ b/geometry/digital.vndr/Makefile.am @@ -0,0 +1,6 @@ +geom_DATA = \ +lk pc unix + +EXTRA_DIST= $(geom_DATA) + +geomdir = $(xkb_base)/geometry/digital.vndr diff --git a/geometry/digital.vndr/lk b/geometry/digital.vndr/lk new file mode 100644 index 00000000..1ccd3316 --- /dev/null +++ b/geometry/digital.vndr/lk @@ -0,0 +1,730 @@ +// $Xorg: lk,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: lk,v +// Revision 1.2 1996/06/18 09:12:47 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/18 21:15:16 William_Walker +// Upgrade XKB to Protocol Rev. 0.64 +// [1995/08/18 20:41:46 William_Walker] +// +// Revision 1.1.2.5 1995/08/11 19:35:47 William_Walker +// Sync up with Erik's pool. +// [1995/08/11 18:35:58 William_Walker] +// +// Revision 1.1.2.4 1995/06/27 12:17:28 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:23:07 William_Walker] +// +// Revision 1.1.2.3 1995/06/09 20:54:36 William_Walker +// Add VT105 layout support and ISO group support +// [1995/06/09 20:40:38 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:16 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:43 William_Walker] +// +// EndLog +// +// @(#)RCSfile: lk,v Revision: 1.2 (DEC) Date: 1996/01/24 12:16:00 +// +xkb_geometry "lk201" { + width = 530; + height = 170; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [171,19] },{ [3,2], [168,16]} }; + shape "LEDS" { [ 30,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 27; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Function" { top = 20; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 19 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 19 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 98 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 20; left = 350; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 41; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 61; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 81; left = 20; + keys { <UP> }; + }; + row { top = 101; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 60; left = 426; + row { top = 1; + keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> }; + }; + row { top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 15; + keys { { <TAB>, "MED" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + + }; + row { top = 41; + keys { <LCTL>, + { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { { <LFSH>, "LONG" }, + <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "LONG" } + }; + }; + row { top = 81; left = 26; + keys { { <LCMP>, "LONG" }, + { <SPCE>, "SPCE" } + }; + }; + }; + + section.left = 341; + section.top = 3; + + section "Indicators" { + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 10; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 9; }; + indicator "Caps Lock" { left = 27; }; + indicator "Compose" { left = 45; }; + indicator "Wait" { left = 63; }; + text.top = 4; + text.color = "black"; + text "HoldScreenLabel" {left = 5; text="Hold\n"; }; + text "CapsLockLabel" {left = 23; text="Lock\n"; }; + text "ComposeLabel" {left = 37; text="Compose\n"; }; + text "WaitLabel" {left = 60; text="Wait\n"; }; + }; +}; + +xkb_geometry "lk401" { + + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 36,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 15 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 75 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 41; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 61; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 81; left= 20; + keys { <UP> }; + }; + row { top = 101; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> }; + }; + row { + top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 15; + keys { { <TAB>, "MED" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + + }; + row { top = 41; + keys { <LCTL>, + { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { { <LFSH>, "LONG" }, + <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { <LCMP>, "MED" }, + { <LALT>, "MED" }, + { <SPCE>, "SPCE" }, + { <RALT>, "MED" }, + { <RCMP>, "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.shape = "LED"; + indicator.top = 1; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + }; + section "IndicatorLabels" { + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk450" { + + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 36,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 15 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 75 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 41; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 61; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 81; left= 20; + keys { <UP> }; + }; + row { top = 101; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { <KPF1>, <KPF2>, <KPF3>, <KPF4> }; + }; + row { + top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 15; + keys { { <TAB>, "MED" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + + }; + row { top = 41; + keys { <LCTL>, + { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { { <LFSH>, "LONG" }, + <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { <LCMP>, "MED" }, + { <LALT>, "MED" }, + { <SPCE>, "SPCE" }, + { <RALT>, "MED" }, + { <RCMP>, "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.shape = "LED"; + indicator.top = 1; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + }; + section "IndicatorLabels" { + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk401bj" +{ + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 30,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 15 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 15 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 75 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 41; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 61; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 81; left = 20; + keys { <UP> }; + }; + row { top = 101; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { <PF1>, <PF2>, <PF3>, <PF4> }; + }; + row { top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 15; + keys { { <TAB>, "MED" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 41; + keys { <LCTL>, + { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { { <LFSH>, "LONG" }, + <AB00>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { <LCMP>, "MED" }, + { <LALT>, "MED" }, + { <SPCE>, "SPCE" }, + { <RALT>, "MED" }, + { <RCMP>, "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 1; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 19; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk401jj" { + + width = 460; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[28,23] }, + { [0,0], [28,0], [28,39], [5,39], [5,19], [0,19] }, + { [3,2], [25,2], [25,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "LONG1" { { [32,19] }, { [3,2], [29,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "MED1" { { [23,19] }, { [3,2], [20,16] } }; + shape "CTRL" { { [43,19] }, { [3,2], [38,16] } }; + shape "SPCE" { { [55,19] },{ [3,2], [53,16]} }; + shape "LEDS" { [ 56,15] }; + shape "LED" { [ 5, 2] }; + + section.left = 5; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 7; top = 10; text="digital\n"; }; + + section "Function" { top = 40; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 18 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 18 }, <FK12>, <FK13>, <FK14>, + { <FK17>, 73 }, <FK18>, <FK19>, <FK20> + }; + }; + }; + + section "Editing" { top = 40; left = 313; + row { top = 1; + keys { <HELP>, { <DO>, "LONG" } }; + }; + row { top = 31; + keys { <FIND>, <INS>, <DELE> }; + }; + row { top = 51; + keys { <SELE>, <PGUP>, <PGDN> }; + }; + row { top = 71; left= 20; + keys { <UP> }; + }; + row { top = 91; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 70; left = 377; + row { top = 1; + keys { <PF1>, <PF2>, <PF3>, <PF4> }; + }; + row { top = 21; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6>, <KPCO> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "TALL" } }; + }; + row { top = 81; + keys { { <KP0>, "LONG" }, <KPDL> }; + }; + }; + + section "Alpha" { top = 70; + row { top = 1; left = 7; + keys { { <AE00>, "MED1" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AB00>, { <BKSP>, "MED1" } + }; + }; + row { top = 21; left = 7; + keys { { <TAB>, "LONG1" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 41; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { <CAPS>, { <LFSH>, "LONG1" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "MED" } + }; + }; + row { top = 81; left = 7; + keys { { <LCMP>, "LONG" }, + { <LALT>, "LONG" }, + { <MUHE>, "LONG" }, + { <SPCE>, "SPCE" }, + { <KANJ>, "LONG" }, + { <HIRA>, "LONG" }, + <RALT>, <RCMP> + }; + }; + }; + + section.left = 315; + section.top = 20; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 11; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 6; }; + indicator "Caps Lock" { left = 26; }; + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + diff --git a/geometry/digital.vndr/pc b/geometry/digital.vndr/pc new file mode 100644 index 00000000..1529ed20 --- /dev/null +++ b/geometry/digital.vndr/pc @@ -0,0 +1,350 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: pc,v +// Revision 1.2 1996/06/18 09:12:50 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/18 21:15:18 William_Walker +// Upgrade XKB to Protocol Rev. 0.64 +// [1995/08/18 20:41:49 William_Walker] +// +// Revision 1.1.2.4 1995/08/11 19:35:48 William_Walker +// Sync up with Erik's pool. +// [1995/08/11 18:36:03 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:29 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:23:10 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:19 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:51 William_Walker] +// +// EndLog +// +// @(#)RCSfile: pc,v Revision: 1.2 (DEC) Date: 1996/02/02 14:40:25 +// +partial xkb_geometry "common" { + width = 480; + height = 200; + + shape.cornerRadius = 1; + shape "NORM" { primary = { [18,19] }, { [3,2], [15,16] } }; + shape "KP0" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "KPAD" { primary = { [18,39] }, { [3,2], [15,36] } }; + shape "LEDS" { [78,22] }; + shape "LED" { [5,2] }; + + text.color = "black"; + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Function" { top = 40; + row { top = 1; + keys { <ESC>, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 10 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 10 }, <FK10>, <FK11>, <FK12> + }; + }; + }; + + section "Editing" { top = 40; left = 308; + row { top = 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { top = 41; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { top = 61; + keys { <DELE>, <END>, <PGDN> }; + }; + row { top = 101; left = 20; + keys { <UP> }; + }; + row { top = 121; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; + + section "Keypad" { top = 80; left = 374; + row { top = 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { top = 21; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD" } }; + }; + row { top = 41; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { top = 61; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD" } }; + }; + row { top = 81; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; +}; + +partial xkb_geometry "leds_on_keys" { + section.top = 40; + section.left = 17; + section "LedPanel" { + indicator.onColor = "#00ff00"; + indicator.offColor = "#001000"; + indicator.shape = "LED"; + indicator "Scroll Lock" { left = 317; top = 5; }; + indicator "Num Lock" { left = 364; top = 45; }; + indicator "Caps Lock" { left = 10; top = 85; }; + }; + + section.left = 375; + section.top = 40; + section "LogoPanel" { + solid "logo_panel" { top = 0; left = 0; + shape = "LEDS"; + color = "grey"; + }; + text "Logo" {left = 28; top = 10; text="digital\n"; }; + }; +}; + +partial xkb_geometry "leds_alone" { + section.left = 375; + section.top = 40; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + shape = "LEDS"; + color = "grey"; + }; + indicator.top = 16; + indicator.onColor = "#00ff00"; + indicator.offColor = "#001000"; + indicator.shape = "LED"; + indicator "Num Lock" { left = 3; }; + indicator "Caps Lock" { left = 26; }; + indicator "Scroll Lock" { left = 50; }; + text "Logo" {left = 2; top = 3; text="digital\n"; }; + }; + section "IndicatorLabels" { + text.top = 11; + text "NumLockLabel" {left = 10; text="Num\nLock"; }; + text "CapsLockLabel" {left = 33; text="Caps\nLock"; }; + text "ScrollLockLabel" {left = 58; text="Scroll\nLock"; }; + }; +}; + +xkb_geometry "pc101" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "RTSH" { primary = { [51,19] }, { [3,2], [49,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { top = 21; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + + }; + row { top = 41; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 61; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>, + <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { <LCTL>, + { <LALT>, 20 }, + { <SPCE>, "SPCE" }, + <RALT>, + { <RCTL>, 21 } + }; + }; + }; +}; + +xkb_geometry "pc102" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { + approx = { [0,0],[28,19] }, + { [0,0], [27,0], [27,39], [5,39], [5,19], [0,19] }, + { [3,2], [24,2], [24,36], [8,36], [8,16], [3,16] } + }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [22,19] }, { [3,2], [19,16] } }; + shape "RTSH" { primary = { [51,19] }, { [3,2], [49,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { top = 21; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + + }; + row { top = 41; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <AC12> + }; + }; + row { top = 61; + keys { { <LFSH>, "LFSH" }, + <BKSL>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { <LCTL>, + { <LALT>, 20 }, + { <SPCE>, "SPCE" }, + <RALT>, + { <RCTL>, 21 } + }; + }; + }; +}; + +xkb_geometry "pcxaj" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { primary = { [22,19] }, { [3,2], [19,16] } }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "RTSH" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [114,19]}, { [3,2], [111,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { <AE00>, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { top = 21; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { top = 41; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <AC12>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 61; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>, + <AB07>, <AB08>, <AB09>, <AB10>, <AB11>, + { <RTSH>, "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { <LCTL>, <LALT>, + { <MUHE>, "NORM" }, + { <SPCE>, "SPCE" }, + { <KANJ>, "NORM" }, + { <HIRA>, "NORM" }, + <RALT>, <RCTL> + }; + }; + }; +}; diff --git a/geometry/digital.vndr/unix b/geometry/digital.vndr/unix new file mode 100644 index 00000000..2ca477e8 --- /dev/null +++ b/geometry/digital.vndr/unix @@ -0,0 +1,230 @@ +// $Xorg: unix,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: unix,v +// Revision 1.2 1996/06/18 09:12:53 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.2.3 1995/06/27 12:17:30 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:23:12 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:23 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:56 William_Walker] +// +// EndLog +// +// @(#)RCSfile: unix,v Revision: 1.2 (DEC) Date: 1996/01/24 12:16: +// +xkb_geometry "unix" { + + width = 340; + height = 160; + shape.cornerRadius = 1; + + shape "NORM" { primary = { [18,19] }, { [3,2], [15,16] } }; + shape "AE00" { primary = { [28,19] }, { [3,2], [25,16] } }; + shape "BKSP" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "TABK" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "CTRL" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "RTRN" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "SHFT" { primary = { [56,19] }, { [3,2], [53,16] } }; + shape "MODK" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text.color = "black"; + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 30; + row { top = 1; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 20 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <LEFT>, 20 }, <DOWN>, <UP>, <RGHT> + }; + }; + }; + + section "Alpha" { top = 50; + row { top = 1; + keys { { <AE00>, "AE00" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { top = 21; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + <BKSL>, <AB00> + }; + + }; + row { top = 41; left = -4; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 61; left = -4; + keys { { <LFSH>, "SHFT" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, <AB06>, + <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "SHFT" } + }; + }; + solid "ExtendKey" { top = 81; left= 1; + shape= "NORM"; + color= "grey20"; + }; + text.top = 89; + text.color = "black"; + text "ExtendLabel" {left = 6; text="Ext\nend"; }; + row { top = 81; left = 19; + key.shape = "MODK"; + keys { { <LCMP>, "NORM" }, <LALT>, + { <SPCE>, "SPCE" }, + <RALT>, <RCMP> + }; + }; + }; +}; + +xkb_geometry "lk421jj" { + + width = 315; + height = 170; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[28,23] }, + { [0,0], [28,0], [28,39], [5,39], [5,19], [0,19] }, + { [3,2], [25,2], [25,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "LONG1" { { [32,19] }, { [3,2], [29,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [23,19] }, { [3,2], [20,16] } }; + shape "CTRL" { { [43,19] }, { [3,2], [38,16] } }; + shape "SPCE" { { [55,19] },{ [3,2], [53,16]} }; + shape "LEDS" { [ 56,15] }; + shape "LED" { [ 5, 2] }; + + section.left = 5; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 7; top = 10; text="digital\n"; }; + + section "Function" { top = 45; + row { top = 1; left = 7; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 18 }, <FK07>, <FK08>, <FK09>, <FK10> + }; + }; + }; + + section "Editing" { top = 45; left= 230; + row { top = 1; + keys { <LEFT>, <DOWN>, <UP>, <RGHT> }; + }; + }; + + section "Alpha" { top = 65; + row { top = 1; left = 7; + keys { { <AE00>, "MED" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AB00>, { <BKSP>, "MED" } + }; + }; + row { top = 21; left = 7; + keys { { <TAB>, "LONG1" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <RTRN>, "RTRN" } + }; + }; + row { top = 41; + keys { { <LCTL>, "CTRL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, <AC06>, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, <BKSL> + }; + }; + row { top = 61; + keys { <CAPS>, { <LFSH>, "LONG1" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "LONG1" } + }; + }; + row { top = 81; left = 7; + keys { <AA00>, <LCMP>, + { <LALT>, "LONG" }, + { <MUHE>, "LONG" }, + { <SPCE>, "SPCE" }, + { <KANJ>, "LONG" }, + { <HIRA>, "LONG" }, + <RALT>, <RCMP> + }; + }; + }; + + section.left = 233; + section.top = 20; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 11; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 6; }; + indicator "Caps Lock" { left = 26; }; + text.top = 3; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + + diff --git a/geometry/everex b/geometry/everex new file mode 100644 index 00000000..5be3266b --- /dev/null +++ b/geometry/everex @@ -0,0 +1,174 @@ +// $Xorg: everex,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "STEPnote" { + + description= "Everex STEPnote"; + width= 281; + height= 150; + + shape.cornerRadius= 1; + + shape "NORM" { + { [17,17] }, + { [ 2, 1], [ 15, 15 ] } + }; + shape "NARR" { + { [ 15, 17 ] }, + { [ 2, 1 ], [ 13, 15 ] } + }; + shape "FKEY" { + { [ 15.1, 15.5 ] }, + { [ 1, 1 ], [ 14.1, 14.5 ] } + }; + shape "ESC" { + { [ 16.4, 15.5 ] }, + { [ 1, 1 ], [ 14.1, 14.5 ] } + }; + shape "WIDE" { // backspace, tab and Fn + { [ 25, 17 ] }, + { [ 2, 1 ], [ 23, 15 ] } + }; + shape "RTRN" { + { [ 27.5, 17 ] }, + { [ 2, 1 ], [ 25.5, 15 ] } + }; + shape "CAPS" { + { [ 30, 17 ] }, + { [ 2, 1 ], [ 28, 15 ] } + }; + shape "LFSH" { + { [ 38.5, 17 ] }, + { [ 2, 1 ], [ 36.5, 15 ] } + }; + shape "RTSH" { + { [ 21, 17 ] }, + { [ 2, 1 ], [ 19, 15 ] } + }; + shape "SPCE" { + { [ 88.8, 17 ] }, + { [ 2, 1 ], [ 86.8, 15 ] } + }; + shape "WELL" { + { [ 269, 105 ] } + }; + shape "LED" { + cornerRadius= 1.5, + { [ 3, 10 ] } + }; + + section.left= 6; + row.left= 1; + key.shape= "NORM"; + key.gap= 0.5; + + key.color= "grey20"; + labelColor= "white"; + baseColor= "grey20"; + + indicator.top= 20; + indicator.shape= "LED"; + indicator.onColor= "green"; + indicator.offColor= "green30"; + + indicator "Power" { left= 40; }; + indicator "Battery" { left=101; }; + indicator "Suspend" { left=112; }; + indicator "HardDrive" { left=123; }; + indicator "Floppy" { left=134; }; + indicator "KeyPad" { left=145; }; + indicator "Num Lock" { left=156; }; + indicator "Caps Lock" { left=167; }; + indicator "Scroll Lock" { left=178; }; + + solid "KeyWell" { + top= 35; + left= 6; + shape= "WELL"; + color= "grey10"; + }; + section "Whole" { + top= 35; + row { + top= 0.5; + key.color= "grey30"; + key.shape= "FKEY"; + keys { + { <ESC>, "ESC" }, + <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, <FK06>, + <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12>, + <NMLK>, <PRSC>, <SCLK>, <PAUS> + }; + }; + row { + top= 16.5; + keys { + { <TLDE>, "NARR" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, shape="WIDE", color="grey30" }, + { <HOME>, shape="NARR", color="grey30" } + }; + }; + row { + top= 34; + keys { + { <TAB>, shape="WIDE", color="grey30" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "NARR" }, + { <PGUP>, shape="NARR", color="grey30" } + }; + }; + row { + top= 51.5; + keys { + { <CAPS>, shape="CAPS", color="grey30" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, shape="RTRN", color="grey30" }, + { <PGDN>, shape="NARR", color="grey30" } + }; + }; + row { + top= 69; + keys { + { <LFSH>, shape="LFSH", color="grey30" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, shape="RTSH", color="grey30" }, + { <UP>, shape="NARR", color="grey30" }, + { <END>, shape="NARR", color="grey30" } + }; + }; + row { + top= 86.5; + key.color= "grey30"; + keys { + { <FUNC>, "WIDE" }, + <LCTL>, <LALT>, + { <SPCE>, shape="SPCE", 18, color="grey20" }, + <RALT>, <INS>, <DELE>, + { <LEFT>, "NARR" }, { <DOWN>, "NARR" }, + { <RGHT>, "NARR" } + }; + }; + solid "FakeKey" { + top= 86.5; + left= 62.1; + shape= "NORM"; + color= "grey20"; + }; + overlay "KPAD" { + <AE07>=<KP7>, <AE08>=<KP8>, <AE09>=<KP9>, <AE10>=<KPMU>, + <AD07>=<KP4>, <AD08>=<KP5>, <AD09>=<KP6>, <AD10>=<KPSU>, + <AC07>=<KP1>, <AC08>=<KP2>, <AC09>=<KP3>, <AC10>=<KPAD>, + <AB07>=<KP0>, <AB09>=<KPDL>, <AB10>=<KPSL> + }; + }; // End of "Whole" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; diff --git a/geometry/fujitsu b/geometry/fujitsu new file mode 100644 index 00000000..02fe0bc2 --- /dev/null +++ b/geometry/fujitsu @@ -0,0 +1,315 @@ +// $Xorg: fujitsu,v 1.4 2001/02/09 02:05:49 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_geometry "138" { + + // This is an approximate layout for a (US/ASCII) Fujitsu keyboard. + + description= "Fujitsu English keyboard"; + + width= 480; + height= 215; + + shape "EDGE" { cornerRadius= 2, { [ 480, 215 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "LFSH" { { [ 41,18] }, { [2,1], [ 39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "SPCE" { { [151,18] }, { [2,1], [149,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "EXEC" { { [ 57,18] }, { [2,1], [ 55,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 15; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 28; + row { + top= 1; + keys { + <BREA>, { <PRSC>, 6 }, + { <FK13>, 30 }, <FK14>, <FK15>, <FK16>, + { <FK17>, 6 }, <FK18>, <FK19>, <FK20>, + { <FK21>, 6 }, <FK22>, <FK23>, <FK24>, + { <FK29>, 68 }, <FK30>, <FK31>, <FK32> + }; + }; + row { + top= 20; + keys { + <KNJI>, { <PAUS>, 6 }, + { <FK01>, 30 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 6 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 6 }, <FK10>, <FK11>, <FK12>, + { <UNK0>, 6 }, <UNK1>, <UNK2>, + { <FK25>, 6 }, <FK26>, <FK27>, <FK28> + }; + }; + row { + top= 39; + left= 316; + keys { + <PGUP>, <HOME>, <PGDN> + }; + }; + row { + top= 54; + keys { + <UNDO>, { <ESC>, 6 }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, + <AE06>, <AE07>, <AE08>, <AE09>, <AE10>, + <AE11>, <AE12>, <TLDE>, <BKSP>, + { <KPMU>, 68 }, <KPDV>, <KPAD>, <KPSU> + + }; + }; + row { + top= 58; + left= 316; + keys { + <UNK3>, <DEL>, <INS> + }; + }; + row { + top= 73; + keys { <COPY>, + { <TAB>, 6, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" }, + { <KP7>, 68 }, <KP8>, <KP9>, <KPEQ> + }; + }; + row { + top= 92; + keys { <PAST>, + { <LCTL>, 6, "LCTL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <BKSL>, + { <UP>, 49 }, + { <KP4>, 25 }, <KP5>, <KP6>, <KPDC> + }; + }; + row { + top= 102; + left= 316; + keys { <LEFT>, { <RGHT>, 19 } + }; + }; + row { + top= 111; + keys { <CUT>, + { <LFSH>, 6 , "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH" }, + { <DOWN>, 25 }, + { <KP1>, 25 }, <KP2>, <KP3>, { <KPEN>, "KPEN" } + }; + }; + row { + top= 130; + keys { <HELP>, { <CAPS>, 6 }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE" }, + <RMTA>, <RALT>, <COMP>, <LNFD>, + { <KP0>, 68, "KP0" }, <KP00> + }; + }; + row { + top= 149; + left= 316; + keys { + { <EXEC>, "EXEC" } + }; + }; + }; // End of "Alpha" section +}; + +xkb_geometry "140" { + + // This is an approximate layout for a Fujitsu Japanese keyboard. + + description= "Fujitsu Japanese keyboard"; + + width= 480; + height= 215; + + shape "EDGE" { cornerRadius= 2, { [ 480, 215 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "LFSH" { { [ 41,18] }, { [2,1], [ 39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "HNKN" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "EXEC" { { [ 57,18] }, { [2,1], [ 55,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 15; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 28; + row { + top= 1; + keys { + <BREA>, { <PRSC>, 6 }, + { <FK13>, 30 }, <FK14>, <FK15>, <FK16>, + { <FK17>, 6 }, <FK18>, <FK19>, <FK20>, + { <FK21>, 6 }, <FK22>, <FK23>, <FK24>, + { <FK29>, 68 }, <FK30>, <FK31>, <FK32> + }; + }; + row { + top= 20; + keys { + <KNJI>, { <PAUS>, 6 }, + { <FK01>, 30 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 6 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 6 }, <FK10>, <FK11>, <FK12>, + { <UNK0>, 6 }, <UNK1>, <UNK2>, + { <FK25>, 6 }, <FK26>, <FK27>, <FK28> + }; + }; + row { + top= 39; + left= 316; + keys { + <PGUP>, <HOME>, <PGDN> + }; + }; + row { + top= 54; + keys { + <UNDO>, { <ESC>, 6 }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, + <AE06>, <AE07>, <AE08>, <AE09>, <AE10>, + <AE11>, <AE12>, <BKSL>, <BKSP>, + { <KPMU>, 68 }, <KPDV>, <KPAD>, <KPSU> + + }; + }; + row { + top= 58; + left= 316; + keys { + <UNK3>, <DEL>, <INS> + }; + }; + row { + top= 73; + keys { <COPY>, + { <TAB>, 6, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" }, + { <KP7>, 68 }, <KP8>, <KP9>, <KPEQ> + }; + }; + row { + top= 92; + keys { <PAST>, + { <LCTL>, 6, "LCTL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <TLDE>, + { <UP>, 49 }, + { <KP4>, 25 }, <KP5>, <KP6>, <KPDC> + }; + }; + row { + top= 102; + left= 316; + keys { <LEFT>, { <RGHT>, 19 } + }; + }; + row { + top= 111; + keys { <CUT>, + { <LFSH>, 6 , "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH" }, + { <DOWN>, 25 }, + { <KP1>, 25 }, <KP2>, <KP3>, { <KPEN>, "KPEN" } + }; + }; + row { + top= 130; + keys { <HELP>, { <CAPS>, 6 }, + <LALT>, <LMTA>, <UNK4>, + { <SPCE>, "SPCE" }, + <UNK5>, <RMTA>, <COMP>, <LNFD>, <UNK6>, + { <KP0>, 68, "KP0" }, <KP00> + }; + }; + row { + top= 149; + left= 134; + keys { + { <UNK7>, "HNKN" }, { <UNK8>, "HNKN" }, + { <EXEC>, 132, "EXEC" } + }; + }; + }; // End of "Alpha" section +}; diff --git a/geometry/hp b/geometry/hp new file mode 100644 index 00000000..c93cb0cd --- /dev/null +++ b/geometry/hp @@ -0,0 +1,456 @@ +// $Xorg: hp,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/hp,v 1.8 2003/08/09 14:30:46 pascal Exp $ + +default xkb_geometry "pc101" { + + description= "HP PC101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [132,18] }, { [2,1], [130,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "default" geometry + +xkb_geometry "hil" { + + description= "HP hil"; + width= 455; + height= 170; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "TABK" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "BKSL" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "RTRN" { { [ 38,18] }, { [2,1], [ 36,17] } }; + shape "LFSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [151,18] }, { [2,1], [150,17] } }; + shape "KP0" { { [ 38,18] }, { [2,1], [ 36,17] } }; + shape "KPTB" { { [ 18,38] }, { [2,1], [ 16,37] } }; + shape "TLDE" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "FKT1" { { [ 17,14] }, { [2,1], [ 15,13] } }; + shape "FKT2" { { [ 23,14] }, { [2,1], [ 21,13] } }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 14; + row { + top= 1; + keys { { <BRK>, "FKT1" }, { <STOP>, "FKT1" } , + { <FK01>, "FKT2", 10 }, { <FK02>, "FKT2" }, + { <FK03>, "FKT2" }, { <FK04>, "FKT2" }, + { <MENU>, "FKT1" }, { <SYST>, "FKT1" }, + { <FK05>, "FKT2" }, { <FK06>, "FKT2" }, + { <FK07>, "FKT2" }, { <FK08>, "FKT2" }, + { <CLRL>, "FKT1", 10 }, { <CLR>, "FKT1" }, + { <FK09>, "FKT1", 19 }, { <FK10>, "FKT1" }, + { <FK11>, "FKT1" }, { <FK12>, "FKT1" } + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 52; + row { + top= 1; + keys { { <TLDE>, "TLDE" }, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" }, <INSL>, <DELL> + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" }, + <INSC>, <DELC> + }; + }; + row { + top= 39; + keys { <CAPS>, <LCTL>, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN" }, + <HOME>, <PGUP> + }; + }; + row { + top= 58; + keys { <ESC>, { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" }, <SELE>, + <UP>, <PGDN> + }; + }; + row { + top= 77; + keys { <PRSC>, { <LALT>, 30 }, + { <SPCE>, "SPCE" }, + <RALT>, { <LEFT>, 30 }, <DOWN>, <RGHT> + }; + }; + }; // End of "Alpha" section + + section "Keypad" { + top= 52; + left= 360; + row { + top= 1; + keys { <KPMU>, <KPDV>, <KPAD>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPEN> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPSP> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPTB>, "KPTB" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry + + +// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net> +// Geometry specification for HP Omnibook keyboards. +// Compatible Models: 6100, 6000. + +xkb_geometry "omnibook" { + width = 282; + height = 128; + baseColor = "grey80"; + labelColor = "white"; + + shape "FN0" { cornerRadius = 1, { [15.5, 12] }, { [1, 0], [14.5, 11] } }; + shape "NORM" { cornerRadius = 1, { [18, 16] }, { [2, 0], [16, 14] } }; + shape "BKSP" { cornerRadius = 1, { [31, 16] }, { [2, 0], [29, 14] } }; + shape "TABK" { cornerRadius = 1, { [27, 16] }, { [2, 0], [25, 14] } }; + shape "CAPS" { cornerRadius = 1, { [32, 16] }, { [2, 0], [30, 14] } }; + shape "RTSH" { cornerRadius = 1, { [45, 16] }, { [2, 0], [43, 14] } }; + shape "MODK" { cornerRadius = 1, { [28, 16] }, { [2, 0], [26, 14] } }; + shape "SPCE" { cornerRadius = 1, { [90, 16] }, { [2, 0], [88, 14] } }; + shape "ARRS" { cornerRadius = 1, { [17, 12] }, { [2, 0], [15, 11] } }; + + shape "LED" { cornerRadius = 1, { [2, 4] } }; + + shape "KEYS" { cornerRadius = 1, + { [0, 13], + [197, 13], [197, 0], + [280, 0], [280, 125], + [224, 125], [224, 112], + [0, 112] } + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 1; + top = 1; + color = "black"; + }; + + shape "NULL1" { cornerRadius = 1, { [54, 16] } }; + + solid "NullPanel1" { + shape = "NULL1"; + left = 226; + top = 96; + color = "grey80"; + }; + + shape "NULL2" { cornerRadius = 1, { [19, 14] } }; + + solid "NullPanel2" { + shape = "NULL2"; + left = 243; + top = 97; + color = "black"; + }; + + indicator.onColor = "green"; + indicator.offColor = "grey10"; + indicator.top = 4; + indicator.shape = "LED"; + indicator "Caps Lock" { left = 45; }; + indicator "Num Lock" { left = 60; }; + indicator "Scroll Lock" { left = 75; }; + indicator "HDDActivity" { onColor = "red"; left = 90; }; + + key.color = "grey60"; + + section "Function" { + key.gap = 0.99; + left = 1; + top = 1; + key.shape = "FN0"; + row { + left = 197; + top = 1; + keys { <PRSC>, <PAUS>, <INS>, <HOME>, <PGUP> }; + }; + row { + top = 14; + keys { <ESC>, + <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + <SCLK>, <DELE>, <END>, <PGDN> + }; + }; + }; // End of "Function" section + + section "Control" { + left = 1; + top = 34; + key.gap = 1; + row { + top = 62; + key.shape = "NORM"; + keys { <LCTL>, <FN>, <LWIN>, <LALT>, + { <SPCE>, "SPCE" }, <RALT>, <MENU>, <RCTL> + }; + }; + }; // End of "Control" section + + section "Navigation" { + key.shape = "ARRS"; + left = 225; + top = 97; + key.gap = 1.4; + row { + left= 18; + top = 1; + keys { <UP> }; + }; + row { + top = 16; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Navigation" section + + shape "STIK" { cornerRadius = 4, { [7, 7] } }; + + solid "STIK" { + priority = 255; + color = "red"; + shape = "STIK"; + top = 73; + left = 126; + }; +}; + +// 86 keys +xkb_geometry "omnibook_intl" { + include "hp(omnibook)" + description = "HP Omnibook 6000/6100, Intl"; + + shape "RTRN" { cornerRadius = 1, + { [22, 0], [22, 33], [5, 33], [5, 16], [0, 16], [0, 0] }, + { [20, 0], [20, 31], [7, 31], [7, 14], [2, 14], [2, 0] } }; + shape "LFSH" { cornerRadius = 1, { [23, 16] }, { [2, 0], [21, 14] } }; + + section "Alpha" { + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + left = 1; + top = 27; + row { + top = 1; + keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" } + }; + }; + row { + top = 18; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" } + }; + }; + row { + top = 35; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top = 52; + keys { { <LFSH>, "LFSH" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff --git a/geometry/ibm.vndr/.cvsignore b/geometry/ibm.vndr/.cvsignore new file mode 100644 index 00000000..282522db --- /dev/null +++ b/geometry/ibm.vndr/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/geometry/ibm.vndr/Makefile.am b/geometry/ibm.vndr/Makefile.am new file mode 100644 index 00000000..883420e6 --- /dev/null +++ b/geometry/ibm.vndr/Makefile.am @@ -0,0 +1,6 @@ +geom_DATA = \ +thinkpad + +EXTRA_DIST= $(geom_DATA) + +geomdir = $(xkb_base)/geometry/ibm.vndr diff --git a/geometry/ibm.vndr/thinkpad b/geometry/ibm.vndr/thinkpad new file mode 100644 index 00000000..c9b769cc --- /dev/null +++ b/geometry/ibm.vndr/thinkpad @@ -0,0 +1,267 @@ +// -*- indent-tabs-mode: nil -*- +// $XFree86: xc/programs/xkbcomp/geometry/ibm/thinkpad,v 1.3 2003/08/09 14:30:48 pascal Exp $ + +// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net> +// Geometry specification for IBM ThinkPad keyboard. +// Compatible Models: THINKPAD 560Z 2640-90U, THINKPAD 560Z 2640-91U, +// THINKPAD 560Z 2640-B0U, THINKPAD 560Z 2640-B1U, THINKPAD 560Z 2640-RR3, +// THINKPAD 600 2645-31U, THINKPAD 600 2645-35U, THINKPAD 600 2645-41U, +// THINKPAD 600 2645-42U, THINKPAD 600 2645-45U, THINKPAD 600 2645-48U, +// THINKPAD 600 2645-51U, THINKPAD 600 2645-85U, THINKPAD 600 2645-A1U, +// THINKPAD 600 2645-RR1, THINKPAD 600 2645-RR2, THINKPAD 600E 2645-3AU, +// THINKPAD 600E 2645-4AU, THINKPAD 600E 2645-4BU, THINKPAD 600E 2645-55U, +// THINKPAD 600E 2645-5AU, THINKPAD 600E 2645-5BU, THINKPAD 600E 2645-5JU, +// THINKPAD 600E 2645-8AO, THINKPAD 600E 2645-8AU, THINKPAD 600E 2645-8BU, +// THINKPAD 600E 2645-AAU, THINKPAD 600E 2645-RRB, THINKPAD 600E 2645-RRD, +// THINKPAD 600E 2645-RRF, THINKPAD 600E 2645-RRS, THINKPAD A22E 2645-45U + +xkb_geometry "common" { + width = 290; + height = 150; + baseColor = "grey80"; + labelColor = "white"; + + shape "FN0" { cornerRadius = 1, { [17, 12] }, { [2, 0], [15, 10] } }; + shape "NORM" { cornerRadius = 1, { [18, 18] }, { [2.5, 0], [15.5, 14] } }; + shape "BKSP" { cornerRadius = 1, { [37, 18] }, { [2.5, 0], [34.5, 14] } }; + shape "TABK" { cornerRadius = 1, { [27, 18] }, { [2.5, 0], [24.5, 14] } }; + shape "CAPS" { cornerRadius = 1, { [31, 18] }, { [1, 0], [30, 16] }, + { [1, 0], [26, 16] }, + { [2.5, 0], [24.5, 14] } }; + shape "RTSH" { cornerRadius = 1, { [50, 18] }, { [2.5, 0], [46.5, 14] } }; + shape "MODK" { cornerRadius = 1, { [27.5, 18] }, { [2.5, 0], [25, 14] } }; + shape "SPCE" { cornerRadius = 1, { [100, 18] }, { [2.5, 0], [97.5, 14] } }; + shape "ARRS" { cornerRadius = 1, { [16, 13] }, { [1.5, 0], [14.5, 11] } }; + + shape "LED" { cornerRadius = 2, { [3, 3] } }; + + shape "KEYS" { cornerRadius = 2, + { [0, 0], [19, 0], [19, 13], [172, 13], + [172, 0], [286, 0], [286, 138], [216, 138], + [216, 124], [0, 124] } }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 2; + top = 5; + color = "black"; + }; + + shape "NULL1" { cornerRadius = 1, + { [0, 0], [50, 0], [50, 18], [34, 18], [34, 4], + [16, 4], [16, 18], [0, 18] } }; + + solid "NullPanel1" { + shape = "NULL1"; + left = 237; + top = 110; + color = "grey80"; + }; + + shape "NULL2" { cornerRadius = 1, { [17, 13] } }; + + solid "NullPanel2" { + shape = "NULL2"; + left = 219; + top = 129; + color = "grey80"; + }; + + shape "NULL3" { cornerRadius = 1, + { [0, 26], + [72, 26], [72, 13], [76, 13], [76, 26], + [149, 26], [149, 13], [153, 13], [153, 26], + [226, 26], [226, 0], [230, 0], [230, 26], + [284, 26], [285, 27], + [0, 27] } }; + + solid "NullPanel3" { + shape = "NULL3"; + left = 3; + top = 6; + color = "grey80"; + }; + + indicator.onColor = "green"; + indicator.offColor = "grey10"; + indicator.top = 4; + indicator.shape = "LED"; + indicator "HDDActivity" { onColor = "red"; left = 100; }; + indicator "Num Lock" { left = 108; }; + indicator "Caps Lock" { left = 114; }; + indicator "Scroll Lock" { left = 120; }; + indicator "Power" { left = 128; }; + + key.gap = 1; + key.color = "grey60"; + + section "Function" { + left = 2; + top = 5; + key.shape = "FN0"; + row { + top = 1; + keys { <ESC>, { <PRSC>, 155 }, <SCLK>, <PAUS> }; + }; + row { + top = 14; + keys { <FK01>, <FK02>, <FK03>, <FK04>, + { <FK05>, 6 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 6 }, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Control" { + left= 2; + top = 109; + key.shape = "MODK"; + row { + top = 1; + keys { { <FN>, "NORM" }, <LCTL>, <LALT>, + { <SPCE>, "SPCE" }, <RALT>, <RCTL> + }; + }; + }; // End of "Control" section + + section "Editing" { + top = 5; + left = 233; + key.shape = "FN0"; + row { + top = 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top = 14; + keys { <DELE>, <END>, <PGDN> }; + }; + }; // End of "Editing" section + + section "Navigation" { + top = 114; + left = 236; + key.shape = "ARRS"; + row { + top = 1; + left = 17; + keys { <UP> }; + }; + row { + top = 15; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Navigation" section + + shape "STIK" { cornerRadius = 4, { [7, 7] } }; + + solid "STIK" { + priority = 255; + color = "red"; + shape = "STIK"; + top = 85; + left = 126; + }; +}; + +// 85 keys +// US/English (FRU 02K4785). +xkb_geometry "us" { + include "thinkpad(common)" + description = "IBM ThinkPad 560Z/600/600E/A22E, US"; + + shape "RTRN" { cornerRadius = 1, { [43, 18] }, { [2.5, 0], [40.5, 14] } }; + shape "LFSH" { cornerRadius = 1, { [43, 18] }, { [2.5, 0], [40.5, 14] } }; + shape "BKSL" { cornerRadius = 1, { [28, 18] }, { [2.5, 0], [25.5, 14] } }; + + section "Alpha" { + left = 2; + top = 33; + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + row { + top = 1; + keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" } + }; + }; + row { + top = 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top = 39; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN" } + }; + }; + row { + top = 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + }; // End of "Alpha" section +}; + +// 86 keys +// Tested on: DE/German, UK/English (FRU 02K4787). +xkb_geometry "intl" { + include "thinkpad(common)" + description = "IBM ThinkPad 560Z/600/600E/A22E, Intl"; + + shape "RTRN" { cornerRadius = 1, { [28, 0], [28, 37], [4, 37], [4, 18], + [0, 18], [0, 0] }, + { [25.5, 0], [25.5, 33], [6.5, 33], + [6.5, 14], [2.5, 14], [2.5, 0] } }; + shape "LFSH" { cornerRadius = 1, { [24, 18] }, { [2.5, 0], [21.5, 14] } }; + + section "Alpha" { + left = 2; + top = 33; + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + row { + top = 1; + keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" } + }; + }; + row { + top = 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" } + }; + }; + row { + top = 39; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top = 58; + keys { { <LFSH>, "LFSH" }, <AB00>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff --git a/geometry/keytronic b/geometry/keytronic new file mode 100644 index 00000000..2e4e37a1 --- /dev/null +++ b/geometry/keytronic @@ -0,0 +1,255 @@ +// $Xorg: keytronic,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86$ +// +default xkb_geometry "FlexPro" { + + // This is an approximate layout for a Key Tronic FlexPro + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Key Tronic FlexPro keyboard"; + + width= 515; + height= 200; + + shape "EDGE" { cornerRadius= 2, { [ 515, 200 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "TABK" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "BKSL" { { [ 23,18] }, { [2,1], [21,17] } }; + shape "RTRN" { + approx = { [16, 0], [38,37] }, + { [16, 0], [38, 0], [38,37], + [ 0,37], [ 0,19], [16,19] }, + { [18, 1], [36, 1], [36,36], + [ 2,36], [ 2,20], [18,20] } }; + shape "CAPS" { { [36,18] }, { [2,1], [34,17] } }; + shape "SHFT" { { [46,18] }, { [2,1], [44,17] } }; + shape "LCTL" { { [32,18] }, { [2,1], [30,17] } }; + shape "RCTL" { { [38,18] }, { [2,1], [36,17] } }; + shape "LALT" { { [28,18] }, { [2,1], [26,17] } }; + shape "RALT" { { [33,18] }, { [2,1], [31,17] } }; + shape "LSPC" { { [66,22] }, { [0,0], [66,22] } }; + shape "RSPC" { { [76,22] }, { [0,0], [76,22] } }; + shape "KP0" { { [37,18] }, { [2,1], [35,17] } }; + shape "KPEN" { { [18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { cornerRadius= 3, { [80,35] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 9; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Function" { + top= 56; + row { + top = 1; + key.color= "grey20"; + keys { <FK01>, <FK02> }; + }; + row { + top = 20; + key.color= "grey20"; + keys { <FK03>, <FK04> }; + }; + row { + top = 39; + keys { <FK05>, <FK06> }; + }; + row { + top = 58; + key.color= "grey20"; + keys { <FK07>, <FK08> }; + }; + row { + top = 77; + key.color= "grey20"; + keys { <FK09>, <FK10> }; + }; + row { + top = 96; + keys { <FK11>, <FK12> }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 56; + left= 53; + row { + top= 1; + keys { + { <ESC>, color="grey20" }, { <BKSL>, "BKSL", color="grey20" }, + <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { + { <TLDE>, color="grey20" }, { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { + { <LCTL>, color="grey20" }, { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, <AC11> + }; + }; + row { + top= 58; + keys { + { <LFSH>, color="grey20" }, + { <LFSH>, "SHFT", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "SHFT", color="grey20" } + }; + }; + row { + top= 77; + key.color= "grey20"; + keys { + <LALT>, + { <LCTL>, shape="LCTL" }, + { <LALT>, shape="LALT" }, + { <SPCE>, shape="LSPC", 4, color="white" }, + { <SPCE>, shape="RSPC",color="white" }, + { <RALT>, shape="RALT", 4 }, + { <RCTL>, shape="RCTL" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 12; + left= 365; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 45; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 64; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 102; + left= 20; + keys { <UP> }; + }; + row { + top= 121; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 3, { [ 76, 20 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 11; + left= 430; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 13; + indicator.shape= "LED"; + indicator "Num Lock" { left= 440; }; + indicator "Caps Lock" { left= 467; }; + indicator "Scroll Lock" { left= 489; }; + text.top= 22; + text.color= "black"; + text "NumLockLabel" { left= 438; text="Num\nLock"; }; + text "CapsLockLabel" { left= 465; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 487; text="Scroll\nLock"; }; + + logo "FlexProLogoImage" { + top= 12; + left= 45; + name= "KeyTronic"; + shape= "LOGO"; + }; + text "KeyTronicLogoText" { + top= 15; + left= 50; + width= 55; + text= "FlexPro"; + font= "times"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 36; + }; + + section "Keypad" { + top= 56; + left= 430; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <LEFT> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPSU>, color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, { <KPAD>, color= "grey20" } }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section +}; diff --git a/geometry/kinesis b/geometry/kinesis new file mode 100644 index 00000000..548d0920 --- /dev/null +++ b/geometry/kinesis @@ -0,0 +1,193 @@ +// $Xorg: kinesis,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "model100" { + + // This is an approximate layout for a Kinesis Ergonomic keyboard + // Generated completely by eye. I didn't actually *measure* a real + // keyboard. + + description= "Kinesis Ergonomic Keyboard"; + width= 421; + height= 185; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "WIDE" { { [ 21,18] }, { [2,1], [19,17] } }; + shape "TALL" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "FKEY" { cornerRadius=0, { [ 10,13] } }; + shape "LED" { cornerRadius= 1.5, { [ 3, 3] } }; + shape "LOGO" { { [ 40, 10 ] } }; + shape "EDGE" { cornerRadius=5, { [ 421, 185 ] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section "LeftFunction" { + left= 15; + top= 11; + key.shape= "FKEY"; + key.gap= 3; + row { + left= 1; + top= 1; + keys { + <ESC>, <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08> + }; + }; + }; // End of "LeftFunction" section + + section "RightFunction" { + left= 290; + top= 11; + key.shape= "FKEY"; + key.gap= 3; + row { + left= 1; + top= 0.2; + keys { + <FK09>, <FK10>, <FK11>, <FK12>, <PRSC>, + <SCLK>, <PAUS>, <FK16>, <FK17> + }; + }; + }; // End of "RightFunction" section + + row.vertical= True; + row.top= 1; + key.gap= 0.5; + + logo "KinesisLogoImage" { + top= 25; + left= 240; + name= "Kinesis"; + shape= "LOGO"; + }; + + indicator.shape= "LED"; + indicator.top= 30; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator "Caps Lock" { left= 23; }; + + section "LeftAlpha" { + top= 34; + left= 15; + row { + left= 2; + key.shape= "WIDE"; + keys { <AE12>, <TAB>, <CAPS>, <LFSH> }; + }; + row { + top= 4; + left= 24; + keys { <AE01>, <AD01>, { <AC01>, color="grey20" }, <AB01>, <TLDE> }; + }; + row { + left= 43; + keys { <AE02>, <AD02>, { <AC02>, color="grey20" }, <AB02>, <INS> }; + }; + row { + left= 62; + keys { <AE03>, <AD03>, { <AC03>, color="grey20" }, <AB03>, <LEFT> }; + }; + row { + left= 81; + keys { <AE04>, <AD04>, { <AC04>, color="grey20" }, <AB04>, <RGHT> }; + }; + row { + left= 100; + keys { <AE05>, <AD05>, <AC05>, <AB05> }; + }; + }; // End of "LeftAlpha" section + + indicator "NumLock" { left= 318; }; + indicator "Overlay" { left= 387; }; + section "RightAlpha" { + top= 34; + left= 290; + row { + left= 2; + keys { <AE06>, <AD06>, <AC06>, <AB06> }; + }; + row { + left= 21; + keys { <AE07>, <AD07>, { <AC07>, color="grey20" }, <AB07>, <UP> }; + }; + row { + left= 40; + keys { <AE08>, <AD08>, { <AC08>, color="grey20" }, <AB08>, <DOWN> }; + }; + row { + left= 59; + keys { <AE09>, <AD09>, { <AC09>, color="grey20" }, <AB09>, <AD11> }; + }; + row { + top= 4; + left= 78; + keys { <AE10>, <AD10>, { <AC10>, color="grey20" }, <AB10>, <AD12> }; + }; + row { + left= 97; + key.shape= "WIDE"; + keys { <AE11>, <BKSL>, <AC11>, <RTSH> }; + }; + overlay "KPAD" { + <AE07>=<NMLK>, <AE08>=<KPEQ>, <AE09>=<KPSL>, <AE10>=<KPMU>, + <AD07>=<KP7>, <AD08>=<KP8>, <AD09>=<KP9>, <AD10>=<KPSU>, + <AC07>=<KP4>, <AC08>=<KP5>, <AC09>=<KP6>, <AC10>=<KPAD>, + <AB07>=<KP1>, <AB08>=<KP2>, <AB09>=<KP3>, <AB10>=<KPEN>, + <AE10>=<KPDL>, <AE11>=<KPEN> + }; + }; // End of "RightAlpha" section + + section "LeftEdit" { + top= 109; + left= 123; + angle= 20; + row.top= -18; + row { + top= 1; + left= 1; + keys { { <BKSP>, "TALL" } }; + }; + row { + left= 20; + keys { <LCTL>, { <DELE>, "TALL" } }; + }; + row { + left= 39; + keys { <LALT>, <HOME>, <END> }; + }; + }; // End of "RightEdit" section + + section "RightEdit" { + top= 109; + left= 302; + angle= -20; + row.top= -18; + row { + left= -57; + keys { <RALT>, <PGUP>, <PGDN> }; + }; + row { + left= -38; + keys { <RCTL>, { <RTRN>, "TALL" } }; + }; + row { + top= 1; + left= -19; + keys { { <SPCE>, "TALL" } }; + }; + overlay "KPAD" { + <SPCE>= <KP0> + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; diff --git a/geometry/macintosh b/geometry/macintosh new file mode 100644 index 00000000..f97251fc --- /dev/null +++ b/geometry/macintosh @@ -0,0 +1,174 @@ +// $XFree86: xc/programs/xkbcomp/geometry/macintosh,v 1.3 2003/08/09 14:30:47 pascal Exp $ +// +// Some modifications (<eqdar@castalie.org>) : +// - Added a <LSGT> key +// - Fixed the shape of the <RTRN> key +// - Moved <BKSL> to the 'AC' row +// - Added a special Macintosh sysctl key +// - Minor changes (Function keys shape, LED position...) + +default xkb_geometry "macintosh" { + + description= "Apple Extended Keyboard II"; + width = 475; + height = 194; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TLDE" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "BKSP" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "TAB" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "RTRN" { + { [0,0],[23,0],[23,37],[4,37],[4,18],[0,18] }, + { [2,1],[21,1],[21,36],[6,36],[6,17],[2,17] } }; + shape "CAPS" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "LCTL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "LALT" { { [ 22,18] }, { [2,1], [ 20,17] } }; + shape "LMTA" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "LFSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RCTL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RALT" { { [ 22,18] }, { [2,1], [ 20,17] } }; + shape "RMTA" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTSH" { { [ 47,18] }, { [2,1], [ 45,17] } }; + shape "SPCE" { { [123,18] }, { [2,1], [121,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + // Macintosh keyboards have a special sysctl key at the top right + shape "AAPL" { + { [ 0,0], [ 18,0], [ 18,18], [ 0,18] }, + { [ 1,1], [ 17,1], [ 17,17], [ 1,17] }, + { [ 8,5], [ 8,12], [ 2,9] } }; + + shape "LEDS" { cornerRadius = 0, { [ 55,19] } }; + shape "LED" { cornerRadius = 0, { [ 8, 2] } }; + + solid "LedPanel" { + shape= "LEDS"; + top = 48; + left = 378; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top = 50; + indicator.shape= "LED"; + indicator "NumLock" { left = 381; }; + indicator "CapsLock" { left = 398; }; + indicator "ScrollLock" { left = 415; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left = 381; text = "Num\nLock"; }; + text "CapsLockLabel" { left = 398; text = "Caps\nLock"; }; + text "ScrollLockLabel" { left = 415; text = "Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Function" { + top = 48; + row { + top= 1; + keys { <ESC>, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 10 }, <SCLK>, <PAUS>, + // This is the sysctl key on macintosh keyboards + // keycode is 222 with a 4.21 kernel, which is <I5E> + { <I5E>, "AAPL", 67 } + }; + }; + }; // End of "Function" section + + section "Alpha" { + top = 87; + row { + top= 1; + keys { { <TLDE>, "TLDE" }, <AE01>, <AE02>, <AE03>, + <AE04>, <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TAB" }, <AD01>, <AD02>, <AD03>, + <AD04>, <AD05>, <AD06>, <AD07>, <AD08>, <AD09>, + <AD10>, <AD11>, <AD12>, { <RTRN>, "RTRN" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS" }, <AC01>, <AC02>, <AC03>, + <AC04>, <AC05>, <AC06>, <AC07>, <AC08>, <AC09>, + <AC10>, <AC11>, <BKSL> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, <LSGT>, <AB01>, <AB02>, + <AB03>, <AB04>, <AB05>, <AB06>, <AB07>, <AB08>, + <AB09>, <AB10>, { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + keys { { <LCTL>, "LCTL" }, { <LALT>, "LALT" }, + { <LMTA>, "LMTA" }, + { <SPCE>, "SPCE" }, + { <RMTA>, "RMTA" }, + { <RALT>, "RALT" }, { <RCTL>, "RCTL" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top = 87; + left = 314; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + // Begin of "Keypad" section + section "Keypad" { + top = 87; + left = 380; + row { + top= 1; + keys { <NMLK>, <KPEQ>, <KPDV>, <KPMU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPSU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry diff --git a/geometry/microsoft b/geometry/microsoft new file mode 100644 index 00000000..0894937a --- /dev/null +++ b/geometry/microsoft @@ -0,0 +1,256 @@ +// $Xorg: microsoft,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "natural" { + + // Approximate layout for a Microsoft Natural Keyboard + description= "Microsoft Natural Keyboard"; + width= 550; + height= 190; + + shape.cornerRadius= 1; + shape "LDEF" { { [ 18,18] }, { [2,1], [15,15] } }; + shape "TABK" { { [ 26,18] }, { [2,1], [23,15] } }; + shape "CAPS" { { [ 30,18] }, { [2,1], [23,15] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [38,15] } }; + shape "KEY6" { { [ 22,18] }, { [2,1], [15,15] } }; + shape "KEYT" { { [ 33,18] }, { [2,1], [15,15] } }; + shape "KEYG" { { [ 29,18] }, { [2,1], [15,15] } }; + shape "LCTL" { + approx= { [ 32, 22 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 23 ], [ 0, 22 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 17 ], [ 2, 15 ] } + }; + shape "LWIN" { + approx= { [ 32, 23 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 24 ], [ 0, 23 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 18 ], [ 2, 17 ] } + }; + shape "LALT" { + approx= { [ 32, 24 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 25 ], [ 0, 24 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 20 ], [ 2, 19 ] } + }; + shape "RDEF" { { [ 18,18] }, { [3,1], [15,15] } }; + shape "KEY7" { { [ 28, 18 ] }, { [ 14, 1], [26, 15] } }; + shape "KEYH" { { [ 24, 18 ] }, { [ 10, 1], [22, 15] } }; + shape "KEYN" { { [ 32, 18 ] }, { [ 18, 1], [30, 15] } }; + shape "BKSP" { { [ 41, 18 ] }, { [ 3, 1], [39, 15] } }; + shape "BKSL" { { [ 24, 18 ] }, { [ 3, 1], [22, 15] } }; + shape "RTRN" { { [ 37, 18 ] }, { [ 3, 1], [35, 15] } }; + shape "RTSH" { { [ 43, 18 ] }, { [ 3, 1], [41, 15] } }; + shape "RALT" { + approx= { [ 27, 24 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 24 ], [ 0, 25 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 19 ], [ 3, 20 ] } + }; + shape "RWIN" { + approx= { [ 27, 23 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 23 ], [ 0, 24 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 18 ], [ 3, 19 ] } + }; + shape "MENU" { + approx= { [ 27, 21 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 21 ], [ 0, 23 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 16 ], [ 3, 17 ] } + }; + shape "RCTL" { + approx= { [ 27, 19 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 19 ], [ 0, 21 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 14 ], [ 3, 15 ] } + }; + shape "KPAD" { { [ 18, 37 ] }, { [ 3, 1 ], [ 16, 34 ] } }; + shape "KP0" { { [ 37, 18 ] }, { [ 3, 1 ], [ 35, 15 ] } }; + shape "SPCE" { + { [ 4, 3], [42,10], [44, 0], [88, 0], [90,10], [130, 3], + [134,26], [99,30], [67,33], [33,30], [ 0,26] }, + { [ 6, 4.5], [43,11], [45, 1], [87, 1], [89,11], [128, 4.5], + [131,23], [99,28], [67,32], [33,28], [ 3,23] } + }; + + shape "EDGE" { + cornerRadius= 2, + { [ 25, 0 ], [ 177, 17 ], [ 329, 0 ], [ 542, 0 ], + [ 542, 150 ], [ 354, 150 ], [ 177, 185 ], [ 0, 150 ] } + }; + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + row.left= 1; + key.shape= "LDEF"; + key.gap= 1; + section "LeftFunction" { + top= 10; + left= 40; + angle= 10; + row { + top= 1; + keys { <ESC>, { <FK01>, 12 }, <FK02>, <FK03>, <FK04>, <FK05> }; + }; + }; // End of "LeftFunction" section + + section "LeftAlpha" { + top= 47; + left= 30; + angle= 10; + row { + top= 1; + keys { <AE00>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, { <AE06>, "KEY6" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, { <AD05>, "KEYT" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, { <AC05>, "KEYG" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05> + }; + }; + row { + top= 77; + keys { { <LCTL>, "LCTL" }, { <LWIN>, "LWIN" }, { <LALT>, "LALT" } }; + }; + }; // End of "LeftAlpha" section + + key.shape= "RDEF"; + section "RightFunction" { + top= 32; + left= 195; + angle= -10; + row { + top= 1; + left= 1; + keys { <FK06>, <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12> }; + }; + }; // End of "RightFunction" section + + section "RightAlpha" { + top= 71; + left= 190; + angle= -10; + row.left= 1; + row { + top= 1; + keys { { <AE07>, "KEY7" }, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <AC06>, "KEYH" }, + <AC07>, <AC08>, <AC09>, <AC10>, <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { + top= 58; + keys { { <AB06>, "KEYN" }, + <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + left= 40; + keys { { <RALT>, "RALT" }, { <RWIN>, "RWIN" }, + { <MENU>, "MENU" }, { <RCTL>, "RCTL" } + }; + }; + }; // End of "RightAlpha" section + + section "SpaceBar" { + top= 139; + left= 111; + key.shape= "SPCE"; + row { keys { <SPCE> }; }; + }; + + section "Editing" { + top= 15; + left= 385; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 109; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LED" { + cornerRadius= 0, + { [ 3, 1 ] } + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.left= 177; + indicator.shape= "LED"; + indicator "Num Lock" { top= 90; }; + indicator "Caps Lock" { top= 107; }; + indicator "Scroll Lock" { top= 127; }; + + section "Keypad" { + top= 47; + left= 456; + row { + top= 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; diff --git a/geometry/nec b/geometry/nec new file mode 100644 index 00000000..189d9ca7 --- /dev/null +++ b/geometry/nec @@ -0,0 +1,159 @@ +// $Xorg: nec,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/nec,v 3.4 2001/01/17 23:45:49 dawes Exp $ + +default xkb_geometry "pc98" { + + description= "Generic PC98"; + width= 405; + height= 172; + + shape.cornerRadius= 1; + shape "NORM" { { [ 17,18] }, { [2,1], [ 15,17] } }; + shape "RTRN" { { [ 20,37] }, { [2,1], [ 18,35] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 31,18] }, { [2,1], [ 29,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [115,18] }, { [2,1], [113,17] } }; + shape "FUNC" { { [ 21,18] }, { [2,1], [ 19,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "TABK" { { [ 30,18] }, { [2,1], [ 28,17] } }; + shape "ARRW" { { [ 35,18] }, { [2,1], [ 33,17] } }; + + section.left= 8; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 29; + row { + top= 1; + key.shape="FUNC"; + keys { { <BRK>, "NORM" }, { <PRSC>, "NORM", 5 }, + { <FK01>, 6 }, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 6 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 6 }, <FK12>, <FK13>, <FK14>, <FK15> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 54; + row { + top= 1; + keys { { <ESC>, shape="BKSP"}, + <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, <BKSL>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN", 6 } + }; + }; + row { + top= 39; + keys { <LCTL>, <CAPS>, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, <AB11>, + { <RTSH>, "RTSH" } + }; + }; + row { + top= 77; + keys { { <ALGR>, 35 } , <LALT>, { <NFER>, "FUNC" }, + { <SPCE>, "SPCE" }, { <XFER>, "FUNC" } + + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 54; + left= 281; + row { + top= 1; + keys { <INS>, <DELE> }; + }; + row { + top= 20; + keys { <PGDN>, <PGUP> }; + }; + row { + top= 39; + keys { { <UP>, "ARRW" } }; + }; + row { + top= 58; + keys { <LEFT>, <RGHT> }; + }; + row { + top= 77; + keys { { <DOWN>, "ARRW" } }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 54; + left= 320; + row { + top= 1; + keys { <HOME>, <HELP>, <KPSU>, <KPDV> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, <KPMU> }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, <KPAD> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, <KPEQ> }; + }; + row { + top= 77; + keys { <KP0>, <KPSP>, <KPDC>, <KPEN> }; + }; + }; // End of "Keypad" section + +}; // End of "pc98" geometry diff --git a/geometry/northgate b/geometry/northgate new file mode 100644 index 00000000..fd376cee --- /dev/null +++ b/geometry/northgate @@ -0,0 +1,172 @@ +// $Xorg: northgate,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "omnikey101" { + + description= "North Gate Omnikey 101"; + width= 470; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [34,18] }, { [2,1], [32,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [15, 0], [40,37] }, + { [15, 0], [40, 0], [40,37], + [ 0,37], [ 0,19], [15,19] }, + { [17, 1], [38, 1], [38,36], + [ 2,36], [ 2,20], [17,20] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } }; + shape "RTSH" { { [ 30,18] }, { [2,1], [28,17] } }; + shape "MODK" { { [ 26,18] }, { [2,1], [24,17] } }; + shape "SPCE" { { [129,18] }, { [2,1], [127,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 32; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 46.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 34; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 32; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18}, <FK02>, <FK03>, <FK04>, + { <FK05>, 9 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 9 }, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 65; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" }, <BKSL> + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LALT>, + { <LCTL>, 23 }, + { <SPCE>, "SPCE", color="white" }, + <RCTL>, + { <RALT>, 23 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 32; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 65; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "default" geometry diff --git a/geometry/pc b/geometry/pc new file mode 100644 index 00000000..8a538719 --- /dev/null +++ b/geometry/pc @@ -0,0 +1,1159 @@ +// $Xorg: pc,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/pc,v 3.14 2003/08/09 14:30:47 pascal Exp $ + +default xkb_geometry "pc101" { + + description= "Generic 101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 21 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 21 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "default" geometry + +xkb_geometry "pc102" { + + description= "Generic 102"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { + { [16,0],[ 43,0],[43,37],[2,37],[2,19],[16,19] }, + { [18,1],[ 41,1],[41,36],[4,36],[4,20],[18,20] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 25,18] }, { [2,1], [ 23,16] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [ 47,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [134,18] }, { [2,1], [132,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, "TABK", color="grey20" }, + { <FK01>, 10 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, <BKSL>, + { <BKSP>, color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, -15, "RTRN", color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "pc102" geometry + +xkb_geometry "pc104" { + + description= "Generic 104"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SMOD" { { [ 23,18] }, { [2,1], [ 21,16] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "SMOD"; + key.color= "grey20"; + keys { { <LCTL>, "MODK" }, <LWIN>, <LALT>, + { <SPCE>, "SPCE", color="white" }, + <RALT>, <RWIN>, <MENU>, <RCTL> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "pc104" geometry + +xkb_geometry "pc105" { + + description= "Generic 105"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 25,18] }, { [2,1], [ 23,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SMOD" { { [ 23,18] }, { [2,1], [ 21,16] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 20 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <LSGT>, <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "SMOD"; + key.color= "grey20"; + keys { { <LCTL>, "MODK" }, <LWIN>, <LALT>, + { <SPCE>, "SPCE", color="white" }, + <RALT>, <RWIN>, <MENU>, <RCTL> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "pc105" geometry + + +// Added for japanese 106 keyboard +// by tsuka@kawalab.dnj.ynu.ac.jp . +xkb_geometry "jp106" { + + description= "Japanese 106"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 379; }; + indicator "Caps Lock" { left= 404; }; + indicator "Scroll Lock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"}, + { <FK07>, color="grey20"}, {<FK08>,color="grey20"}, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>, + <AE03>, <AE04>, <AE05>, <AE06>, <AE07>, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AE13>, { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 },<NFER>, + { <SPCE>, "SPCE", color="white" }, + <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "jp106" geometry + +// Added for brazilian ABNT2 by Ricardo Y. Igarashi(iga@that.com.br) +xkb_geometry "abnt2" { + + description= "Brazilian ABNT2"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "RTSH" { { [ 31,18] }, { [2,1], [ 29,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 379; }; + indicator "Caps Lock" { left= 404; }; + indicator "Scroll Lock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"}, + { <FK07>, color="grey20"}, {<FK08>,color="grey20"}, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>, + <AE03>, <AE04>, <AE05>, <AE06>, <AE07>, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, <BKSL>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, { <RCTL>, 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "abnt2" geometry + + +// Created by Alexander Pohoyda <alexander.pohoyda@gmx.net> + +xkb_geometry "pc86" { + description = "Noname keyboard with 86 keys, DE"; + width = 287; + height = 143; + baseColor = "grey20"; + + shape "EDGE" { cornerRadius = 2, { [287, 143] } }; + shape "LED" { cornerRadius = 2, { [3, 3] } }; + shape "LEDS" { cornerRadius = 0, { [75, 5] } }; + shape "KEYS" { cornerRadius = 0, { [271, 109] } }; + + outline "Edges" { + top = 0; + left = 0; + shape = "EDGE"; + color = "black"; + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 8; + top = 22; + color = "grey70"; + }; + + solid "LedPanel" { + shape = "LEDS"; + left = 212; + top = 10; + color = "black"; + }; + + indicator.onColor = "green"; + indicator.offColor = "green30"; + indicator.top = 11; + indicator.shape = "LED"; + indicator "Num Lock" { left = 212 + 7; }; + indicator "Caps Lock" { left = 212 + 23; }; + indicator "Scroll Lock" { left = 212 + 39; }; + text.fontSize = 6; + text.top = 10; + text.color = "white"; + text "NumLockLabel" { left = 212 + 7 + 5; text = "Num\nLock"; }; + text "CapsLockLabel" { left = 212 + 23 + 5; text = "Caps\nLock"; }; + text "ScrollLockLabel" { left = 212 + 39 + 5; text = "Scroll\nLock"; }; + + shape.cornerRadius = 1; + shape "SMALL" { { [15, 12] }, { [1.5, 0], [13.5, 10] } }; + shape "NARR" { { [13, 18] }, { [1.5, 0], [11.5, 14] } }; + shape "NORM" { { [18, 18] }, { [3, 0], [15, 14] } }; + shape "NORM_1" { { [22, 18] }, { [4, 0], [22, 18] }, + { [7, 0], [19, 14] } }; + shape "WIDER" { { [23, 18] }, { [3, 0], [20, 14] } }; + shape "WIDEST" { { [27, 18] }, { [3, 0], [24, 14] } }; + shape "SPCE" { { [75, 18] }, { [3, 0], [72, 14] } }; + + section "Function" { + key.shape = "SMALL"; + key.gap = 0.99; + key.color = "grey30"; + left = 8; + top = 22; + row { + top = 1; + keys { <ESC>, + <FK01>, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + <NMLK>, <PRSC>, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Control" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey30"; + left = 8; + top = 111; + row { + top = 1; + keys { <LCTL>, <FN>, <LALT>, + { <SPCE>, shape="SPCE", 39 }, <RALT>, + <INS>, <DELE> + }; + }; + }; // End of "Control" section + + section "Editing" { + key.shape = "NARR"; + key.gap = 1; + key.color = "grey30"; + left = 265; + top = 34; + row.vertical = True; + row { + top = 1; + keys { <HOME>, <PGUP>, <PGDN>, <END> }; + }; + }; // End of "Editing" section + + section "Navigation" { + key.gap = 1; + key.shape = "NARR"; + key.color = "grey30"; + left = 236; + top = 92; + row { + left = 14; + top = 1; + keys { <UP> }; + }; + row { + top = 20; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Navigation" section + + section "Alpha" { + key.gap = 1; + key.shape = "NORM"; + key.color = "grey10"; + left = 8; + top = 35; + row { + top = 1; + keys { { <AE01>, shape="NORM_1" }, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, shape="WIDER", color="grey30" } + }; + }; + row { + top = 20; + keys { { <TAB>, shape="NARR", color="grey30" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <AD13>, shape="NARR" } + }; + }; + row { + top = 39; + keys { { <CAPS>, color="grey30" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, shape="WIDEST", color="grey30" } + }; + }; + row { + top = 58; + keys { { <LFSH>, shape="WIDEST", color="grey30" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, shape="WIDER", color="grey30" } + }; + }; + row { + left = 57; + top = 77; + keys { <AE00>, <LSGT> }; + }; + }; // End of "Alpha" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; // End of "pc86" geometry diff --git a/geometry/sgi.vndr/.cvsignore b/geometry/sgi.vndr/.cvsignore new file mode 100644 index 00000000..282522db --- /dev/null +++ b/geometry/sgi.vndr/.cvsignore @@ -0,0 +1,2 @@ +Makefile +Makefile.in diff --git a/geometry/sgi.vndr/Makefile.am b/geometry/sgi.vndr/Makefile.am new file mode 100644 index 00000000..c72d1c2b --- /dev/null +++ b/geometry/sgi.vndr/Makefile.am @@ -0,0 +1,6 @@ +geom_DATA = \ +indigo indy O2 + +EXTRA_DIST= $(geom_DATA) + +geomdir = $(xkb_base)/geometry/sgi.vndr diff --git a/geometry/sgi.vndr/O2 b/geometry/sgi.vndr/O2 new file mode 100644 index 00000000..52ba1a63 --- /dev/null +++ b/geometry/sgi.vndr/O2 @@ -0,0 +1,618 @@ +// $Xorg: O2,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "101-key keyboard for Silicon Graphics O2"; + + width= 448; + height= 162; + + shape "EDGE" { + cornerRadius= 2, + { [ 15, 0 ], [ 433, 0 ], [ 433, 10 ], [ 448, 10 ], + [ 448, 162 ], [ 0, 162 ], [ 0, 10 ], [ 15, 10 ] } + }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 12,12] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 6; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 19}, <FK02>, <FK03>, <FK04>, + { <FK05>, 11}, <FK06>, <FK07>, <FK08>, + { <FK09>, 11}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 58; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE",color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 25; + left= 299; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 3, 1.5] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 364; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 372; }; + indicator "Caps Lock" { left= 397; }; + indicator "Scro llLock" { left= 422; }; + + text.font= "helvetica"; + text.weight= "bold"; + text.slant= "r"; + text.fontWidth= "normal"; + text.fontSize= 12; + text.top= 39.5; + text.color= "black"; + text "NumLockLabel" { left= 376.5; text="1"; }; + text "CapsLockLabel" { left= 401.5; text="A"; }; + text "ScrollLockLabel" { left= 426.5; text="S"; }; + + logo "SGILogoImage" { + top= 26.5; + left= 396; + name= "SGI"; + shape= "LOGO"; + }; + text.font= "helvetica"; + text.weight= "bold"; + text.slant= "o"; + text.fontWidth= "narrow"; + text.fontSize= 18; + text "SiliconLogoText" { + top= 27; + left= 375; + width= 20; + text= "Silicon"; + }; + text "GraphicsLogoText" { + top= 27; + left= 409; + width= 20; + text= "Graphics"; + }; + + section "Keypad" { + top= 58; + left= 363; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; + +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18}, <FK02>, <FK03>, <FK04>, + { <FK05>, 10}, <FK06>, <FK07>, <FK08>, + { <FK09>, 10}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color= "grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <BKSL> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, + { <LALT>, 19 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, + { <RCTL>, 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; + +xkb_geometry "jp106" { + description= "Silicon Graphics 106-key Japanese keyboard"; + width= 442; + height= 167; + + shape "EDGE" { cornerRadius= 2, { [ 442, 167 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + logo "SGILogoImage" { + top= 5; + left= 6; + name= "SGI"; + shape= "LOGO"; + }; + + text "SGILogoText" { + top= 9; + left= 25; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + shape "LEDS" { cornerRadius= 0.1, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 362; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 366; }; + indicator "Caps Lock" { left= 391; }; + indicator "Scroll Lock" { left= 416; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 366; text="Num\nLock"; }; + text "CapsLockLabel" { left= 391; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 416; text="Scroll\nLock"; }; + + section.left= 5; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"}, + { <FK07>, color="grey20"}, {<FK08>,color="grey20"}, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>, + <AE03>, <AE04>, <AE05>, <AE06>, <AE07>, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AE13>, { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 },<NFER>, + { <SPCE>, "SPCE", color="white" }, + <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 296; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 361; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "jp106" geometry + diff --git a/geometry/sgi.vndr/indigo b/geometry/sgi.vndr/indigo new file mode 100644 index 00000000..f7b7a686 --- /dev/null +++ b/geometry/sgi.vndr/indigo @@ -0,0 +1,413 @@ +// $Xorg: indigo,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 101-key keyboard"; + + width= 472; + height= 193; + + shape "EDGE" { cornerRadius= 2, { [ 472, 193 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 19}, <FK02>, <FK03>, <FK04>, + { <FK05>, 11}, <FK06>, <FK07>, <FK08>, + { <FK09>, 11}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE",color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 377; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 386; }; + indicator "Caps Lock" { left= 411; }; + indicator "Scroll Lock" { left= 436; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 382.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 407; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 432; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18}, <FK02>, <FK03>, <FK04>, + { <FK05>, 10}, <FK06>, <FK07>, <FK08>, + { <FK09>, 10}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color= "grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <BKSL> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, + { <LALT>, 19 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, + { <RCTL>, 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; diff --git a/geometry/sgi.vndr/indy b/geometry/sgi.vndr/indy new file mode 100644 index 00000000..fc5d485a --- /dev/null +++ b/geometry/sgi.vndr/indy @@ -0,0 +1,601 @@ +// $Xorg: indy,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 101-key keyboard"; + + width= 472; + height= 193; + + shape "EDGE" { cornerRadius= 2, { [ 472, 193 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 19}, <FK02>, <FK03>, <FK04>, + { <FK05>, 11}, <FK06>, <FK07>, <FK08>, + { <FK09>, 11}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, { <RTRN>, "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 }, + { <SPCE>, "SPCE",color="white" }, + <RALT>, { <RCTL>, 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 377; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 386; }; + indicator "Caps Lock" { left= 411; }; + indicator "Scroll Lock" { left= 436; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 382.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 407; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 432; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; + +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18}, <FK02>, <FK03>, <FK04>, + { <FK05>, 10}, <FK06>, <FK07>, <FK08>, + { <FK09>, 10}, <FK10>, <FK11>, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { <TLDE>, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color= "grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color= "grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <BKSL> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color= "grey20" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, + { <LALT>, 19 }, + { <SPCE>, "SPCE", color="white" }, + <RALT>, + { <RCTL>, 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { <PRSC>, <SCLK>, <PAUS> }; + }; + row { + top= 33; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 53; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 91; + left= 20; + keys { <UP> }; + }; + row { + top= 110; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; +}; + +xkb_geometry "jp106" { + description= "Silicon Graphics 106-key Japanese keyboard"; + width= 442; + height= 167; + + shape "EDGE" { cornerRadius= 2, { [ 442, 167 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + logo "SGILogoImage" { + top= 5; + left= 6; + name= "SGI"; + shape= "LOGO"; + }; + + text "SGILogoText" { + top= 9; + left= 25; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + shape "LEDS" { cornerRadius= 0.1, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 362; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 366; }; + indicator "Caps Lock" { left= 391; }; + indicator "Scroll Lock" { left= 416; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 366; text="Num\nLock"; }; + text "CapsLockLabel" { left= 391; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 416; text="Scroll\nLock"; }; + + section.left= 5; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { <ESC>, color="grey20" }, + { <FK01>, 18 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 ,color="grey20"}, {<FK06>,color="grey20"}, + { <FK07>, color="grey20"}, {<FK08>,color="grey20"}, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 8 }, <SCLK>, <PAUS> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {<HZTG>,color="grey20"}, <AE01>, <AE02>, + <AE03>, <AE04>, <AE05>, <AE06>, <AE07>, + <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + <AE13>, { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { <CAPS>, "CAPS", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12> + }; + }; + row { + top= 58; + keys { { <LFSH>, "LFSH", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <AB11>, { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LCTL>, { <LALT>, 20 },<NFER>, + { <SPCE>, "SPCE", color="white" }, + <XFER>,<HKTG>,<RALT>, { <RCTL>, 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 296; + key.color= "grey20"; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 361; + row { + top= 1; + key.color= "grey20"; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; // End of "jp106" geometry diff --git a/geometry/sony b/geometry/sony new file mode 100644 index 00000000..4e69f0e9 --- /dev/null +++ b/geometry/sony @@ -0,0 +1,180 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:51 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_geometry "nwp5461" { + + description= "Sony NEWS NWS-5000 Keyboard"; + width= 425; + height= 190; + + shape.cornerRadius= 1; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [28,18] }, { [2,1], [26,17] } }; + shape "TABK" { { [28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [28,18] }, { [2,1], [26,17] } }; + shape "RTRN" { + approx = { [15, 0], [33,37] }, + { [15, 0], [33, 0], [33,37], + [ 0,37], [ 0,19], [15,19] }, + { [17, 1], [31, 1], [31,36], + [ 2,36], [ 2,20], [17,20] } + }; + shape "SHFT" { { [42,18] }, { [2,1], [40,17] } }; + shape "MODK" { { [33,18] }, { [2,1], [31,17] } }; + shape "SPCE" { { [85,18] }, { [2,1], [83,17] } }; + shape "KPEN" { { [18,38] }, { [2,1], [16,37] } }; + shape "STOP" { { [28,18] }, { [2,1], [26,17] } }; + shape "CUT" { { [55,18] }, { [2,1], [53,17] } }; + shape "EXEC" { { [32,18] }, { [2,1], [30,17] } }; + shape "UNK" { { [18,18] }, { [2,1], [16,17] } }; + shape "CAPS" { { [18,18] }, { [2,1], [16,17] } }; + shape "FKEY" { { [23,18] }, { [2,1], [21,17] } }; + + section.left= 13; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 55; + row { + top= 1; + left= 37; + key.shape="FKEY"; + keys { <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, + { <FK06>, 5 }, <FK07>, <FK08>, <FK09>, <FK10>, + { <FK11>, 5 }, <FK12> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 80; + row { + top= 1; + keys { { <ESC>, color="grey20" } , + <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, + <AE09>, <AE10>, <AE11>, <AE12>, + <BKSL>, { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { <TAB>, "TABK", color="grey20" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <DELE>, color="grey20" }, + { <RTRN>, "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { { <LCTL>, "MODK", color="grey20" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <TLDE> + }; + }; + row { + top= 58; + keys { { <LFSH>, "SHFT", color="grey20" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, <AB11>, + { <RTSH>, "SHFT", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { <LALT>, { <CAPS>, "CAPS" }, + { <STOP>, "STOP", color="white" }, + { <SPCE>, "SPCE", color="white" }, + { <CUT>, "CUT", color="white" }, + { <UNK0>, "UNK" }, { <UNK1>, "UNK" }, + { <EXEC>, "EXEC" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 80; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { <HELP> }; + }; + row { + top= 20; + keys { <INS> }; + }; + row { + top= 39; + keys { <CLR> }; + }; + row { + top= 58; + keys { <PGUP> }; + }; + row { + top= 77; + keys { <PGDN> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 334; + row { + top= 1; + key.color= "grey20"; + keys { { <KPMU>, 19 }, <KPDV>, <KPAD> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPSU>, color="grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6>, { <KPSP>, color="grey20" } }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPEN", color="grey20" } }; + }; + row { + top= 77; + keys { <KP0>, { <KPDC>, color="grey20" }, <UP> }; + }; + row { + top= 96; + key.color= "grey20"; + keys { <KPTB>, <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry diff --git a/geometry/sun b/geometry/sun new file mode 100644 index 00000000..1b8117a8 --- /dev/null +++ b/geometry/sun @@ -0,0 +1,1338 @@ +// $Xorg: sun,v 1.4 2001/02/09 02:05:51 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/sun,v 1.6 2001/12/14 20:01:58 dawes Exp $ +// +xkb_geometry "type4" { + + // This is an approximate layout for a (US/ASCII) Sun Type4 US + // keyboard. + + description= "Sun Type4 keyboard"; + + width= 452; + height= 185; + + shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "DELE" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 17; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 58; + row { + top= 1; + keys { <STOP>, <AGAI>, + { <FK01>, 9 }, <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + <BKSL>, { <DELE>, "DELE" }, + { <PAUS>, 9 }, <PRSC>, <SCLK>, <NMLK> + }; + }; + row { + top= 20; + keys { <PROP>, <UNDO>, { <ESC>, 9 }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, + <AE06>, <AE07>, <AE08>, <AE09>, <AE10>, + <AE11>, <AE12>, + { <BKSP>, "BKSP" }, + { <KPEQ>, 9 }, <KPDV>, <KPMU>, <KPSU> + + }; + }; + row { + top= 39; + keys { <FRNT>, <COPY>, + { <TAB>, 9, shape="TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, { <RTRN>, "RTRN" }, + { <KP7>, 9 }, <KP8>, <KP9>, { <KPAD>, "KPAD" } + }; + }; + row { + top= 58; + keys { <OPEN>, <PAST>, + { <LCTL>, 9, shape="LCTL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <TLDE>, + { <KP4>, 33 }, <KP5>, <KP6> + }; + }; + row { + top= 77; + keys { <FIND>, <CUT>, + { <LFSH>, 9 , shape="LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH" }, <LNFD>, + { <KP1>, 9} , <KP2>, <KP3>, { <KPEN>, "KPAD" } + }; + }; + row { + top= 96; + keys { { <HELP>, "HELP" }, { <CAPS>, 9 }, + <LALT>, <LMTA>, { <SPCE>, "SPCE" }, + <RMTA>, <COMP>, <ALGR>, + { <KP0>, 9, shape="KP0" }, <KPDL> + }; + }; + }; // End of "Alpha" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 28; + left= 358; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 43; + indicator.shape= "LED"; + indicator "Caps Lock" { left= 364; }; + indicator "Compose" { left= 383; }; + indicator "Scroll Lock" { left= 402; }; + indicator "Num Lock" { left= 421; }; + text.top= 34; + text.color= "black"; + text "CapsLockLabel" { left= 364; text="Caps\nLock"; }; + text "ComposeLabel" { left= 380; text="Compose"; }; + text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 421; text="Num\nLock"; }; +}; + +default xkb_geometry "type5" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + description= "Sun Type5 keyboard"; + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [157,18] }, { [2,1], [155,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { <HELP>, "HELP" }, { <ESC>, 9 }, + { <FK01>, 19 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 9 }, <SCLK>, <PAUS>, + { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { <STOP>, <AGAI>, + { <TLDE>, 9}, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { <FRNT>, <COPY>, { <CAPS>, 9, shape="CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { + top= 58; + keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { <FIND>, <CUT>, { <LCTL>, 9, shape="LCTL" }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE" }, + <RMTA>, <COMP>, <ALGR> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section +}; + +xkb_geometry "type5euro" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + description= "Sun Type5 keyboard"; + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 24,18] }, { [2,1], [22,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [157,18] }, { [2,1], [155,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { <HELP>, "HELP" }, { <ESC>, 9 }, + { <FK01>, 19 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 9 }, <SCLK>, <PAUS>, + { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { <STOP>, <AGAI>, + { <TLDE>, 9}, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + { <BKSP>, "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSL>, "BKSL" } + }; + }; + row { + top= 39; + keys { <FRNT>, <COPY>, { <CAPS>, 9, shape="CAPS" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { + top= 58; + keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" }, <LSGT>, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { <FIND>, <CUT>, { <LCTL>, 9, shape="LCTL" }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE" }, + <RMTA>, <COMP>, <ALGR> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section +}; + + +xkb_geometry "type5unix" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + description= "Sun Type5 Unix keyboard"; + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [157,18] }, { [2,1], [155,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { <HELP>, "HELP" }, { <NONE>, 9 }, + { <FK01>, 19 }, <FK02>, <FK03>, <FK04>, + { <FK05>, 11 }, <FK06>, <FK07>, <FK08>, + { <FK09>, 11 }, <FK10>, <FK11>, <FK12>, + { <PRSC>, 9 }, <SCLK>, <PAUS>, + { <MUTE>, 9 }, <VOL->, <VOL+>, <POWR> + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { <STOP>, <AGAI>, + { <ESC>, 9}, <AE01>, <AE02>, <AE03>, <AE04>, + <AE05>, <AE06>, <AE07>, <AE08>, <AE09>, + <AE10>, <AE11>, <AE12>, + <BKSL>, <TLDE> + }; + }; + row { + top= 20; + keys { <PROP>, <UNDO>, { <TAB>, 9, shape="TABK" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <BKSP>, "BKSP" } + }; + }; + row { + top= 39; + keys { <FRNT>, <COPY>, { <LCTL>, 9, shape="LCTL" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, "RTRN" } + }; + }; + row { + top= 58; + keys { <OPEN>, <PAST>, { <LFSH>, 9 , shape="LFSH" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { <FIND>, <CUT>, { <CAPS>, 9, shape="CAPS" }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE" }, + <RMTA>, <COMP>, <ALGR> + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { <INS>, <HOME>, <PGUP> }; + }; + row { + top= 20; + keys { <DELE>, <END>, <PGDN> }; + }; + row { + top= 58; + left= 20; + keys { <UP> }; + }; + row { + top= 77; + keys { <LEFT>, <DOWN>, <RGHT> }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { <NMLK>, <KPDV>, <KPMU>, <KPSU> }; + }; + row { + top= 20; + keys { <KP7>, <KP8>, <KP9>, { <KPAD>, "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { <KP4>, <KP5>, <KP6> }; + }; + row { + top= 58; + keys { <KP1>, <KP2>, <KP3>, { <KPEN>, "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { <KP0>, "KP0" }, <KPDL> }; + }; + }; // End of "Keypad" section +}; + +xkb_geometry "type5_se" { + + // kbd: type = 4, layout = 43 + + description= "Sun Type5 keyboard (Sweden)"; + + width= 510; + height= 170; + + baseColor= "grey"; + labelColor= "black"; + + shape.cornerRadius= 1; + + shape "EDGE" { cornerRadius= 2, { [ 510, 170 ] } }; + shape "LOGO" { cornerRadius= 2, + { [ 0, 8], [ 8, 16], [ 16, 8], [ 8, 0] } + }; + + shape "NORM" { { [ 18, 18] }, { [ 2, 1], [ 16, 17] } }; + shape "BKSP" { { [ 38, 18] }, { [ 2, 1], [ 36, 17] } }; + shape "TABK" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } }; + shape "RTRN" { + { [ 0, 0], [ 29, 0], [ 29, 37], [ 5, 37], [ 5, 18], [ 0, 18] }, + { [ 2, 1], [ 27, 1], [ 27, 36], [ 7, 36], [ 7, 17], [ 2, 17] } + }; + shape "CAPS" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } }; + shape "LFSH" { { [ 24, 18] }, { [ 2, 1], [ 22, 17 ] } }; + shape "RTSH" { { [ 51, 18] }, { [ 2, 1], [ 49, 17 ] } }; + shape "LCTL" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } }; + shape "MODK" { { [ 28, 18] }, { [ 2, 1], [ 26, 17 ] } }; + shape "SPCE" { { [157, 18] }, { [ 2, 1], [155, 17 ] } }; + shape "KP0" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } }; + shape "KPAD" { { [ 18, 37] }, { [ 2, 1], [ 16, 36 ] } }; + shape "HELP" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } }; + + section "Function" { + key.color= "grey10"; + priority= 1; + top= 24; + left= 14; + width= 481; + height= 19; + row { + top= 1; + left= 1; + keys { + { <HELP>, "HELP", 1 }, { <ESC>, "NORM", 9 }, + { <FK01>, "NORM", 19 }, { <FK02>, "NORM", 1 }, + { <FK03>, "NORM", 1 }, { <FK04>, "NORM", 1 }, + { <FK05>, "NORM", 11 }, { <FK06>, "NORM", 1 }, + { <FK07>, "NORM", 1 }, { <FK08>, "NORM", 1 }, + { <FK09>, "NORM", 11 }, { <FK10>, "NORM", 1 }, + { <FK11>, "NORM", 1 }, { <FK12>, "NORM", 1 }, + { <PRSC>, "NORM", 9 }, { <SCLK>, "NORM", 1 }, + { <PAUS>, "NORM", 1 }, { <MUTE>, "NORM", 11 }, + { <VOL->, "NORM", 1 }, { <VOL+>, "NORM", 1 }, + { <POWR>, "NORM", 1, color= "white" } + }; + }; + }; // End of "Function" section + + section "Alpha" { + key.color= "white"; + priority= 2; + top= 61; + left= 14; + width= 333; + height= 95; + row { + top= 1; + left= 1; + keys { + { <STOP>, "NORM", 1, color= "grey10" }, + { <AGAI>, "NORM", 1, color= "grey10" }, + { <TLDE>, "NORM", 9 }, { <AE01>, "NORM", 1 }, + { <AE02>, "NORM", 1 }, { <AE03>, "NORM", 1 }, + { <AE04>, "NORM", 1 }, { <AE05>, "NORM", 1 }, + { <AE06>, "NORM", 1 }, { <AE07>, "NORM", 1 }, + { <AE08>, "NORM", 1 }, { <AE09>, "NORM", 1 }, + { <AE10>, "NORM", 1 }, { <AE11>, "NORM", 1 }, + { <AE12>, "NORM", 1 }, + { <BKSP>, "BKSP", 1, color="grey10" } + }; + }; + row { + top= 20; + left= 1; + keys { + { <PROP>, "NORM", 1, color= "grey10" }, + { <UNDO>, "NORM", 1, color= "grey10" }, + { <TAB>, "TABK", 9, color= "grey10" }, + { <AD01>, "NORM", 1 }, + { <AD02>, "NORM", 1 }, { <AD03>, "NORM", 1 }, + { <AD04>, "NORM", 1 }, { <AD05>, "NORM", 1 }, + { <AD06>, "NORM", 1 }, { <AD07>, "NORM", 1 }, + { <AD08>, "NORM", 1 }, { <AD09>, "NORM", 1 }, + { <AD10>, "NORM", 1 }, { <AD11>, "NORM", 1 }, + { <AD12>, "NORM", 1 }, + { <RTRN>, "RTRN", 1, color= "grey10" } + }; + }; + row { + top= 39; + left= 1; + keys { + { <FRNT>, "NORM", 1, color= "grey10" }, + { <COPY>, "NORM", 1, color= "grey10" }, + { <CAPS>, "CAPS", 9, color= "grey10" }, + { <AC01>, "NORM", 1 }, + { <AC02>, "NORM", 1 }, { <AC03>, "NORM", 1 }, + { <AC04>, "NORM", 1 }, { <AC05>, "NORM", 1 }, + { <AC06>, "NORM", 1 }, { <AC07>, "NORM", 1 }, + { <AC08>, "NORM", 1 }, { <AC09>, "NORM", 1 }, + { <AC10>, "NORM", 1 }, { <AC11>, "NORM", 1 }, + { <AC12>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 1; + keys { + { <OPEN>, "NORM", 1, color= "grey10" }, + { <PAST>, "NORM", 1, color= "grey10" }, + { <LFSH>, "LFSH", 9, color= "grey10" }, + { <AB00>, "NORM", 1 }, { <AB01>, "NORM", 1 }, + { <AB02>, "NORM", 1 }, { <AB03>, "NORM", 1 }, + { <AB04>, "NORM", 1 }, { <AB05>, "NORM", 1 }, + { <AB06>, "NORM", 1 }, { <AB07>, "NORM", 1 }, + { <AB08>, "NORM", 1 }, { <AB09>, "NORM", 1 }, + { <AB10>, "NORM", 1 }, + { <RTSH>, "RTSH", 1, color="grey10" } + }; + }; + row { + top= 77; + left= 1; + key.color= "grey10"; + keys { + { <FIND>, "NORM", 1 }, { <CUT>, "NORM", 1 }, + { <LCTL>, "LCTL", 9 }, { <LALT>, "NORM", 1 }, + { <LMTA>, "NORM", 1 }, + { <SPCE>, "SPCE", 1, color= "white" }, + { <RMTA>, "NORM", 1 }, { <COMP>, "NORM", 1 }, + { <ALGR>, "NORM", 1 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + key.color= "grey10"; + priority= 3; + top= 61; + left= 352; + width= 58; + height= 95; + row { + top= 1; + left= 1; + keys { + { <INS>, "NORM", 1 }, { <HOME>, "NORM", 1 }, + { <PGUP>, "NORM", 1 } + }; + }; + row { + top= 20; + left= 1; + keys { + { <DELE>, "NORM", 1 }, { <END>, "NORM", 1 }, + { <PGDN>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 20; + keys { + { <UP>, "NORM", 1 } + }; + }; + row { + top= 77; + left= 1; + keys { + { <LEFT>, "NORM", 1 }, { <DOWN>, "NORM", 1 }, + { <RGHT>, "NORM", 1 } + }; + }; + }; // End of "Editing" section + + section "Keypad" { + key.color= "white"; + priority= 4; + top= 61; + left= 420; + width= 77; + height= 95; + row { + top= 1; + left= 1; + key.color= "grey10"; + keys { + { <NMLK>, "NORM", 1 }, { <KPDV>, "NORM", 1 }, + { <KPMU>, "NORM", 1 }, { <KPSU>, "NORM", 1 } + }; + }; + row { + top= 20; + left= 1; + keys { + { <KP7>, "NORM", 1 }, { <KP8>, "NORM", 1 }, + { <KP9>, "NORM", 1 }, + { <KPAD>, "KPAD", 1, color="grey10" } + }; + }; + row { + top= 39; + left= 1; + keys { + { <KP4>, "NORM", 1 }, { <KP5>, "NORM", 1 }, + { <KP6>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 1; + keys { + { <KP1>, "NORM", 1 }, { <KP2>, "NORM", 1 }, + { <KP3>, "NORM", 1 }, + { <KPEN>, "KPAD", 1, color="grey10" } + }; + }; + row { + top= 77; + left= 1; + keys { + { <KP0>, "KP0", 1 }, { <KPDL>, "NORM", 1 } + }; + }; + }; // End of "Keypad" section + + outline "Edges" { + top= 0; + left= 0; + priority= 0; + shape= "EDGE"; + }; + + solid "Logos" { + color= "blue"; + top= 5; + left= 25; + priority= 0; + shape= "LOGO"; + }; + + logo "SUNLogoImage" { + top= 5; + left= 25; + name= "SUN"; + priority= 1; + shape= "LOGO"; + }; + + shape "LED" { cornerRadius= 1, + { [ 0, 1.5], [ 1.5, 3], [ 3, 1.5], [ 1.5, 0] } + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.shape= "LED"; + indicator "Caps Lock" { left= 75; top= 103; priority= 5; }; + indicator "Compose" { left= 314; top= 142; priority= 5; }; + indicator "Scroll Lock" { left= 378; top= 29; }; + indicator "Num Lock" { left= 426; top= 66; }; +}; + +xkb_geometry "type5c_se" { + + // kbd: type = 4, layout = 43 + + description= "Sun Type5c keyboard (Sweden)"; + + width= 510; + height= 170; + + baseColor= "grey"; + labelColor= "black"; + + shape.cornerRadius= 1; + + shape "EDGE" { cornerRadius= 2, { [ 510, 170 ] } }; + shape "LOGO" { cornerRadius= 2, + { [ 0, 8], [ 8, 16], [ 16, 8], [ 8, 0] } + }; + + shape "NORM" { { [ 18, 18] }, { [ 2, 1], [ 16, 17] } }; + shape "BKSP" { { [ 38, 18] }, { [ 2, 1], [ 36, 17] } }; + shape "TABK" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } }; + shape "META" { { [ 27, 18] }, { [ 2, 1], [ 25, 17] } }; + shape "RTRN" { + { [ 0, 0], [ 29, 0], [ 29, 37], [ 5, 37], [ 5, 18], [ 0, 18] }, + { [ 2, 1], [ 27, 1], [ 27, 36], [ 7, 36], [ 7, 17], [ 2, 17] } + }; + shape "CAPS" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } }; + shape "LFSH" { { [ 24, 18] }, { [ 2, 1], [ 22, 17 ] } }; + shape "RTSH" { { [ 51, 18] }, { [ 2, 1], [ 49, 17 ] } }; + shape "LCTL" { { [ 32, 18] }, { [ 2, 1], [ 30, 17 ] } }; + shape "MODK" { { [ 28, 18] }, { [ 2, 1], [ 26, 17 ] } }; + shape "SPCE" { { [139, 18] }, { [ 2, 1], [137, 17 ] } }; + shape "KP0" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } }; + shape "KPAD" { { [ 18, 37] }, { [ 2, 1], [ 16, 36 ] } }; + shape "HELP" { { [ 37, 18] }, { [ 2, 1], [ 35, 17 ] } }; + + section "Function" { + key.color= "grey10"; + priority= 1; + top= 24; + left= 14; + width= 481; + height= 19; + row { + top= 1; + left= 1; + keys { + { <HELP>, "HELP", 1 }, { <ESC>, "NORM", 9 }, + { <FK01>, "NORM", 19 }, { <FK02>, "NORM", 1 }, + { <FK03>, "NORM", 1 }, { <FK04>, "NORM", 1 }, + { <FK05>, "NORM", 11 }, { <FK06>, "NORM", 1 }, + { <FK07>, "NORM", 1 }, { <FK08>, "NORM", 1 }, + { <FK09>, "NORM", 11 }, { <FK10>, "NORM", 1 }, + { <FK11>, "NORM", 1 }, { <FK12>, "NORM", 1 }, + { <PRSC>, "NORM", 9 }, { <SCLK>, "NORM", 1 }, + { <PAUS>, "NORM", 1 }, { <MUTE>, "NORM", 11 }, + { <VOL->, "NORM", 1 }, { <VOL+>, "NORM", 1 }, + { <POWR>, "NORM", 1, color= "white" } + }; + }; + }; // End of "Function" section + + section "Alpha" { + key.color= "white"; + priority= 2; + top= 61; + left= 14; + width= 333; + height= 95; + row { + top= 1; + left= 1; + keys { + { <STOP>, "NORM", 1, color= "grey10" }, + { <AGAI>, "NORM", 1, color= "grey10" }, + { <TLDE>, "NORM", 9 }, { <AE01>, "NORM", 1 }, + { <AE02>, "NORM", 1 }, { <AE03>, "NORM", 1 }, + { <AE04>, "NORM", 1 }, { <AE05>, "NORM", 1 }, + { <AE06>, "NORM", 1 }, { <AE07>, "NORM", 1 }, + { <AE08>, "NORM", 1 }, { <AE09>, "NORM", 1 }, + { <AE10>, "NORM", 1 }, { <AE11>, "NORM", 1 }, + { <AE12>, "NORM", 1 }, + { <BKSP>, "BKSP", 1, color="grey10" } + }; + }; + row { + top= 20; + left= 1; + keys { + { <PROP>, "NORM", 1, color= "grey10" }, + { <UNDO>, "NORM", 1, color= "grey10" }, + { <TAB>, "TABK", 9, color= "grey10" }, + { <AD01>, "NORM", 1 }, + { <AD02>, "NORM", 1 }, { <AD03>, "NORM", 1 }, + { <AD04>, "NORM", 1 }, { <AD05>, "NORM", 1 }, + { <AD06>, "NORM", 1 }, { <AD07>, "NORM", 1 }, + { <AD08>, "NORM", 1 }, { <AD09>, "NORM", 1 }, + { <AD10>, "NORM", 1 }, { <AD11>, "NORM", 1 }, + { <AD12>, "NORM", 1 }, + { <RTRN>, "RTRN", 1, color= "grey10" } + }; + }; + row { + top= 39; + left= 1; + keys { + { <FRNT>, "NORM", 1, color= "grey10" }, + { <COPY>, "NORM", 1, color= "grey10" }, + { <CAPS>, "CAPS", 9, color= "grey10" }, + { <AC01>, "NORM", 1 }, + { <AC02>, "NORM", 1 }, { <AC03>, "NORM", 1 }, + { <AC04>, "NORM", 1 }, { <AC05>, "NORM", 1 }, + { <AC06>, "NORM", 1 }, { <AC07>, "NORM", 1 }, + { <AC08>, "NORM", 1 }, { <AC09>, "NORM", 1 }, + { <AC10>, "NORM", 1 }, { <AC11>, "NORM", 1 }, + { <AC12>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 1; + keys { + { <OPEN>, "NORM", 1, color= "grey10" }, + { <PAST>, "NORM", 1, color= "grey10" }, + { <LFSH>, "LFSH", 9, color= "grey10" }, + { <AB00>, "NORM", 1 }, { <AB01>, "NORM", 1 }, + { <AB02>, "NORM", 1 }, { <AB03>, "NORM", 1 }, + { <AB04>, "NORM", 1 }, { <AB05>, "NORM", 1 }, + { <AB06>, "NORM", 1 }, { <AB07>, "NORM", 1 }, + { <AB08>, "NORM", 1 }, { <AB09>, "NORM", 1 }, + { <AB10>, "NORM", 1 }, + { <RTSH>, "RTSH", 1, color="grey10" } + }; + }; + row { + top= 77; + left= 1; + key.color= "grey10"; + keys { + { <FIND>, "NORM", 1 }, { <CUT>, "NORM", 1 }, + { <LCTL>, "LCTL", 9 }, { <LALT>, "NORM", 1 }, + { <LMTA>, "META", 1 }, + { <SPCE>, "SPCE", 1, color= "white" }, + { <RMTA>, "META", 1 }, { <COMP>, "NORM", 1 }, + { <ALGR>, "NORM", 1 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + key.color= "grey10"; + priority= 3; + top= 61; + left= 352; + width= 58; + height= 95; + row { + top= 1; + left= 1; + keys { + { <INS>, "NORM", 1 }, { <HOME>, "NORM", 1 }, + { <PGUP>, "NORM", 1 } + }; + }; + row { + top= 20; + left= 1; + keys { + { <DELE>, "NORM", 1 }, { <END>, "NORM", 1 }, + { <PGDN>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 20; + keys { + { <UP>, "NORM", 1 } + }; + }; + row { + top= 77; + left= 1; + keys { + { <LEFT>, "NORM", 1 }, { <DOWN>, "NORM", 1 }, + { <RGHT>, "NORM", 1 } + }; + }; + }; // End of "Editing" section + + section "Keypad" { + key.color= "white"; + priority= 4; + top= 61; + left= 420; + width= 77; + height= 95; + row { + top= 1; + left= 1; + key.color= "grey10"; + keys { + { <NMLK>, "NORM", 1 }, { <KPDV>, "NORM", 1 }, + { <KPMU>, "NORM", 1 }, { <KPSU>, "NORM", 1 } + }; + }; + row { + top= 20; + left= 1; + keys { + { <KP7>, "NORM", 1 }, { <KP8>, "NORM", 1 }, + { <KP9>, "NORM", 1 }, + { <KPAD>, "KPAD", 1, color="grey10" } + }; + }; + row { + top= 39; + left= 1; + keys { + { <KP4>, "NORM", 1 }, { <KP5>, "NORM", 1 }, + { <KP6>, "NORM", 1 } + }; + }; + row { + top= 58; + left= 1; + keys { + { <KP1>, "NORM", 1 }, { <KP2>, "NORM", 1 }, + { <KP3>, "NORM", 1 }, + { <KPEN>, "KPAD", 1, color="grey10" } + }; + }; + row { + top= 77; + left= 1; + keys { + { <KP0>, "KP0", 1 }, { <KPDL>, "NORM", 1 } + }; + }; + }; // End of "Keypad" section + + outline "Edges" { + top= 0; + left= 0; + priority= 0; + shape= "EDGE"; + }; + + solid "Logos" { + color= "blue"; + top= 5; + left= 15; + priority= 0; + shape= "LOGO"; + }; + + logo "SUNLogoImage" { + top= 5; + left= 15; + name= "SUN"; + priority= 1; + shape= "LOGO"; + }; + + text.font= "charter"; + text.weight= "medium"; + text.slant= "i"; + text.fontSize= 40; + text "SunLogoText" { + top= 5; + left= 32; + color= "blue"; + text= "Sun"; + }; + + shape "LED" { cornerRadius= 1, + { [ 0, 1.5], [ 1.5, 3], [ 3, 1.5], [ 1.5, 0] } + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.shape= "LED"; + indicator "Caps Lock" { left= 75; top= 103; priority= 5; }; + indicator "Compose" { left= 314; top= 142; priority= 5; }; + indicator "Scroll Lock" { left= 378; top= 29; }; + indicator "Num Lock" { left= 426; top= 66; }; +}; + +xkb_geometry "type4_se" { + + // kbd: type = 4, layout = 11 + + description= "Sun Type4 keyboard (Sweden)"; + + + width= 453; + height= 183; + + baseColor= "grey"; + labelColor= "black"; + + shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "DELE" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 17; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 58; + row { + top= 1; + key.color= "grey10"; + keys { <STOP>, <AGAI>, { <FK01>, 9 }, + <FK02>, <FK03>, <FK04>, + <FK05>, <FK06>, <FK07>, <FK08>, + <FK09>, <FK10>, <FK11>, <FK12>, + { <AF13>, color= "white"}, + { <AF14>, color= "white"}, + <DELE>, { <PAUS>, 9 }, + <PRSC>, <SCLK>, <NMLK> + }; + }; + row { + top= 20; + key.color= "white"; + keys { + { <PROP>, color= "grey10" }, + { <UNDO>, color= "grey10" }, + { <ESC>, 9, color= "grey10" }, + <AE01>, <AE02>, <AE03>, <AE04>, <AE05>, + <AE06>, <AE07>, <AE08>, <AE09>, <AE10>, + <AE11>, <AE12>, + { <BKSP>, "BKSP", color= "grey10" }, + { <KPEQ>, 9, color= "grey10" }, + { <KPDV>, color= "grey10" }, + { <KPMU>, color= "grey10" }, + { <KPSU>, color= "grey10" } + }; + }; + row { + top= 39; + key.color= "white"; + keys { + { <FRNT>, color= "grey10" }, + { <COPY>, color= "grey10" }, + { <TAB>, 9, "TABK", color= "grey10" }, + <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, + <AD06>, <AD07>, <AD08>, <AD09>, <AD10>, + <AD11>, <AD12>, + { <RTRN>, "RTRN", color= "grey10" }, + { <KP7>, 9, color= "grey10" }, + { <KP8>, color= "grey10" }, + { <KP9>, color= "grey10" }, + { <KPAD>, "KPAD", color= "grey10" } + }; + }; + row { + top= 58; + key.color= "white"; + keys { + { <OPEN>, color= "grey10" }, + { <PAST>, color= "grey10" }, + { <CAPS>, 9, "LCTL", color= "grey10" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, <AC12>, + { <KP4>, 33, color= "grey10" }, + { <KP5>, color= "grey10" }, + { <KP6>, color= "grey10" } + }; + }; + row { + top= 77; + key.color= "white"; + keys { + { <FIND>, color= "grey10" }, + { <CUT>, color= "grey10" }, + { <LFSH>, 9 , "LFSH", color= "grey10" }, + <AB00>, <AB01>, <AB02>, <AB03>, + <AB04>, <AB05>, <AB06>, <AB07>, + <AB08>, <AB09>, <AB10>, + { <RTSH>, "RTSH", color= "grey10" }, + { <LNFD>, color= "grey10" }, + { <KP1>, 9, color= "grey10" }, + { <KP2>, color= "grey10" }, + { <KP3>, color= "grey10" }, + { <KPEN>, "KPAD", color= "grey10" } + }; + }; + row { + top= 96; + key.color= "grey10"; + keys { + { <HELP>, "HELP" }, { <LCTL>, 9 }, + <LALT>, <LMTA>, + { <SPCE>, "SPCE", color= "white" }, + <RMTA>, <COMP>, <ALGR>, + { <KP0>, 9, "KP0" }, <KPDL> + }; + }; + }; // End of "Alpha" section + + shape "RIDGE" { cornerRadius= 1, { [ 0, 1], [ 1, 0 ], + [330, 0], [331, 1], + [330, 2], [ 1, 2] } }; + solid "Ridge" { + shape= "RIDGE"; + top= 48; + left= 18; + }; + + shape "LEDS" { cornerRadius= 1, { [ 75 ,21 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + outline "LedPanel" { + shape= "LEDS"; + top= 28; + left= 358; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 43; + indicator.shape= "LED"; + indicator "Caps Lock" { left= 364; }; + indicator "Compose" { left= 383; }; + indicator "Scroll Lock" { left= 402; }; + indicator "Num Lock" { left= 421; }; + text.top= 32; + text.color= "black"; + text "CapsLockLabel" { left= 364; text="Caps\nLock"; }; + text "ComposeLabel" { left= 380; text="\nCompose"; }; + text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 421; text="Num\nLock"; }; +}; diff --git a/geometry/winbook b/geometry/winbook new file mode 100644 index 00000000..e4de4786 --- /dev/null +++ b/geometry/winbook @@ -0,0 +1,144 @@ +// $Xorg: winbook,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +default xkb_geometry "XP5" { + + description= "WinBook XP5"; + width= 281; + height= 180; + + shape.cornerRadius= 1; + + shape "NORM" { + { [17,17] }, + { [ 2, 1], [ 15, 15 ] } + }; + shape "FKEY" { + { [ 15, 10 ] }, + { [ 1, 0 ], [ 14, 9.5 ] } + }; + shape "ONE" { + { [ 28, 17 ] }, + { [ 11, 0 ], [ 28, 17 ] }, + { [ 13, 1 ], [ 26, 15 ] } + }; + shape "WIDE" { // backspace, caps lock, ctrl alt ? + { [ 24.5, 17 ] }, + { [ 2, 1 ], [ 22.5, 15 ] } + }; + shape "WIDR" { // backslash, left shift + { [ 35, 17 ] }, + { [ 2, 1 ], [ 33, 15 ] } + }; + shape "RTRN" { + { [ 45, 17 ] }, + { [ 2, 1 ], [ 43, 15 ] } + }; + shape "SPCE" { + { [ 90, 17 ] }, + { [ 2, 1 ], [ 88, 15 ] } + }; + shape "STIK" { + cornerRadius= 4, + { [ 8, 8 ] } + }; + shape "BTN" { + { [ 31, 6 ] } + }; + + section.left= 2; + row.left= 1; + key.shape= "NORM"; + key.gap= 0.5; + + key.color= "grey10"; + labelColor= "white"; + baseColor= "grey20"; + + section "Whole" { + top= 10; + row { + top= 11; + key.shape= "FKEY"; + keys { + <ESC>, + <FK01>, <FK02>, <FK03>, <FK04>, <FK05>, <FK06>, + <FK07>, <FK08>, <FK09>, <FK10>, <FK11>, <FK12>, + <PAUS>, <HOME>, <END>, <PGUP> + }; + }; + row { + top= 22; + keys { + { <AEO1>, "ONE" }, + <AE02>, <AE03>, <AE04>, <AE05>, <AE06>, + <AE07>, <AE08>, <AE09>, <AE10>, <AE11>, <AE12>, + { <BKSP>, shape="WIDE" }, + <PGDN> + }; + }; + row { + top= 40; + keys { + <TAB>, <AD01>, <AD02>, <AD03>, <AD04>, <AD05>, <AD06>, + <AD07>, <AD08>, <AD09>, <AD10>, <AD11>, <AD12>, + { <BKSL>, "WIDR" } + }; + }; + row { + top= 58; + keys { { <CAPS>, shape="WIDE" }, + <AC01>, <AC02>, <AC03>, <AC04>, <AC05>, + <AC06>, <AC07>, <AC08>, <AC09>, <AC10>, + <AC11>, + { <RTRN>, shape="RTRN" } + }; + }; + row { + top= 76; + keys { + { <LFSH>, shape="WIDR" }, + <AB01>, <AB02>, <AB03>, <AB04>, <AB05>, + <AB06>, <AB07>, <AB08>, <AB09>, <AB10>, + <RTSH>, <UP>, <NMLK> + }; + }; + row { + top= 94; + keys { + { <LCTL>, "WIDE" }, <FUNC>, { <LALT>, "WIDE" }, + <TLDE>, { <SPCE>, shape="SPCE" }, <INS>, <DELE>, + <LEFT>, <DOWN>, <RGHT> + }; + }; + overlay "KPAD" { + <AE07>=<KP7>, <AE08>=<KP8>, <AE09>=<KP9>, <AE10>=<KPMU>, + <AD07>=<KP4>, <AD08>=<KP5>, <AD09>=<KP6>, <AD10>=<KPSU>, + <AC07>=<KP1>, <AC08>=<KP2>, <AC09>=<KP3>, <AC10>=<KPAD>, + <AB07>=<KP0>, <AB09>=<KPDL>, <AB10>=<KPSL> + }; + }; // End of "Whole" section + + solid "STIK" { + color= "red"; + shape= "STIK"; + top= 81; + left= 112; + }; + + solid "BTN1" { + color= "red"; + shape= "BTN"; + top= 137; + left= 93; + }; + + solid "BTN2" { + color= "red"; + shape= "BTN"; + top= 137; + left= 127; + }; + + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + +}; diff --git a/keycodes/README b/keycodes/README new file mode 100644 index 00000000..b0ca78aa --- /dev/null +++ b/keycodes/README @@ -0,0 +1,10 @@ +The keycodes component of a keyboard mapping specifies the range and +interpretation of the raw keycodes reported by the device. It sets the keycodes +symbolic name, the minimum and maximum legal codes for the keyboard, and the +symbolic name for each key. The keycodes component might also contain aliases +for some keys, symbolic names for some indicators and a description of which +indicators are physically present. + + + +/* $XFree86$ */ diff --git a/keycodes/aliases b/keycodes/aliases new file mode 100644 index 00000000..7cfc25bd --- /dev/null +++ b/keycodes/aliases @@ -0,0 +1,101 @@ + +// keycode aliases for phonetic keyboard maps +// +// $XFree86$ + +default +xkb_keycodes "qwerty" { + + alias <LatQ> = <AD01>; + alias <LatW> = <AD02>; + alias <LatE> = <AD03>; + alias <LatR> = <AD04>; + alias <LatT> = <AD05>; + alias <LatY> = <AD06>; + alias <LatU> = <AD07>; + alias <LatI> = <AD08>; + alias <LatO> = <AD09>; + alias <LatP> = <AD10>; + + alias <LatA> = <AC01>; + alias <LatS> = <AC02>; + alias <LatD> = <AC03>; + alias <LatF> = <AC04>; + alias <LatG> = <AC05>; + alias <LatH> = <AC06>; + alias <LatJ> = <AC07>; + alias <LatK> = <AC08>; + alias <LatL> = <AC09>; + + alias <LatZ> = <AB01>; + alias <LatX> = <AB02>; + alias <LatC> = <AB03>; + alias <LatV> = <AB04>; + alias <LatB> = <AB05>; + alias <LatN> = <AB06>; + alias <LatM> = <AB07>; +}; + +xkb_keycodes "azerty" { + + alias <LatA> = <AD01>; + alias <LatZ> = <AD02>; + alias <LatE> = <AD03>; + alias <LatR> = <AD04>; + alias <LatT> = <AD05>; + alias <LatY> = <AD06>; + alias <LatU> = <AD07>; + alias <LatI> = <AD08>; + alias <LatO> = <AD09>; + alias <LatP> = <AD10>; + + alias <LatQ> = <AC01>; + alias <LatS> = <AC02>; + alias <LatD> = <AC03>; + alias <LatF> = <AC04>; + alias <LatG> = <AC05>; + alias <LatH> = <AC06>; + alias <LatJ> = <AC07>; + alias <LatK> = <AC08>; + alias <LatL> = <AC09>; + alias <LatM> = <AC10>; + + alias <LatW> = <AB01>; + alias <LatX> = <AB02>; + alias <LatC> = <AB03>; + alias <LatV> = <AB04>; + alias <LatB> = <AB05>; + alias <LatN> = <AB06>; +}; + +xkb_keycodes "qwertz" { + + alias <LatQ> = <AD01>; + alias <LatW> = <AD02>; + alias <LatE> = <AD03>; + alias <LatR> = <AD04>; + alias <LatT> = <AD05>; + alias <LatZ> = <AD06>; + alias <LatU> = <AD07>; + alias <LatI> = <AD08>; + alias <LatO> = <AD09>; + alias <LatP> = <AD10>; + + alias <LatA> = <AC01>; + alias <LatS> = <AC02>; + alias <LatD> = <AC03>; + alias <LatF> = <AC04>; + alias <LatG> = <AC05>; + alias <LatH> = <AC06>; + alias <LatJ> = <AC07>; + alias <LatK> = <AC08>; + alias <LatL> = <AC09>; + + alias <LatY> = <AB01>; + alias <LatX> = <AB02>; + alias <LatC> = <AB03>; + alias <LatV> = <AB04>; + alias <LatB> = <AB05>; + alias <LatN> = <AB06>; + alias <LatM> = <AB07>; +}; diff --git a/keycodes/amiga b/keycodes/amiga new file mode 100644 index 00000000..7b661a5c --- /dev/null +++ b/keycodes/amiga @@ -0,0 +1,231 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/keycodes/amiga,v 3.2 1997/10/26 13:25:35 dawes Exp $ + +default xkb_keycodes "usa1" { + + minimum= 8; + maximum= 111; + + <ESC> = 77; + <FK01> = 88; + <FK02> = 89; + <FK03> = 90; + <FK04> = 91; + <FK05> = 92; + <FK06> = 93; + <FK07> = 94; + <FK08> = 95; + <FK09> = 96; + <FK10> = 97; + + <TLDE> = 8; + <AE01> = 9; + <AE02> = 10; + <AE03> = 11; + <AE04> = 12; + <AE05> = 13; + <AE06> = 14; + <AE07> = 15; + <AE08> = 16; + <AE09> = 17; + <AE10> = 18; + <AE11> = 19; + <AE12> = 20; + <BKSL> = 21; + <BKSP> = 73; + + <TAB> = 74; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 76; + + <LCTL> = 107; + <CAPS> = 106; + <AC01> = 40; + <AC02> = 41; + <AC03> = 42; + <AC04> = 43; + <AC05> = 44; + <AC06> = 45; + <AC07> = 46; + <AC08> = 47; + <AC09> = 48; + <AC10> = 49; + <AC11> = 50; + + <LFSH> = 104; + <AB01> = 57; + <AB02> = 58; + <AB03> = 59; + <AB04> = 60; + <AB05> = 61; + <AB06> = 62; + <AB07> = 63; + <AB08> = 64; + <AB09> = 65; + <AB10> = 66; + <RTSH> = 105; + + <LALT> = 108; + <LAMI> = 110; + <SPCE> = 72; + <RAMI> = 111; + <RALT> = 109; + + <DELE> = 78; + <HELP> = 103; + <UP> = 84; + <LEFT> = 87; + <DOWN> = 85; + <RGHT> = 86; + + <KPLP> = 98; + <KPRP> = 99; + <KPDV> = 100; + <KPMU> = 101; + + <KP7> = 69; + <KP8> = 70; + <KP9> = 71; + <KPSU> = 82; + + <KP4> = 53; + <KP5> = 54; + <KP6> = 55; + <KPAD> = 102; + + <KP1> = 37; + <KP2> = 38; + <KP3> = 39; + + <KP0> = 23; + <KPDC> = 68; + <KPEN> = 75; +}; + +xkb_keycodes "de" { + + minimum= 8; + maximum= 111; + + <ESC> = 77; + <FK01> = 88; + <FK02> = 89; + <FK03> = 90; + <FK04> = 91; + <FK05> = 92; + <FK06> = 93; + <FK07> = 94; + <FK08> = 95; + <FK09> = 96; + <FK10> = 97; + + <TLDE> = 8; + <AE01> = 9; + <AE02> = 10; + <AE03> = 11; + <AE04> = 12; + <AE05> = 13; + <AE06> = 14; + <AE07> = 15; + <AE08> = 16; + <AE09> = 17; + <AE10> = 18; + <AE11> = 19; + <AE12> = 20; + <BKSL> = 21; + <BKSP> = 73; + + <TAB> = 74; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 76; + + <LCTL> = 107; + <CAPS> = 106; + <AC01> = 40; + <AC02> = 41; + <AC03> = 42; + <AC04> = 43; + <AC05> = 44; + <AC06> = 45; + <AC07> = 46; + <AC08> = 47; + <AC09> = 48; + <AC10> = 49; + <AC11> = 50; + <AC12> = 51; + + <LFSH> = 104; + <LSGT> = 56; + <AB01> = 57; + <AB02> = 58; + <AB03> = 59; + <AB04> = 60; + <AB05> = 61; + <AB06> = 62; + <AB07> = 63; + <AB08> = 64; + <AB09> = 65; + <AB10> = 66; + <RTSH> = 105; + + <LALT> = 108; + <LAMI> = 110; + <SPCE> = 72; + <RAMI> = 111; + <RALT> = 109; + + <DELE> = 78; + <HELP> = 103; + <UP> = 84; + <LEFT> = 87; + <DOWN> = 85; + <RGHT> = 86; + + <KPLP> = 98; + <KPRP> = 99; + <KPDV> = 100; + <KPMU> = 101; + + <KP7> = 69; + <KP8> = 70; + <KP9> = 71; + <KPSU> = 82; + + <KP4> = 53; + <KP5> = 54; + <KP6> = 55; + <KPAD> = 102; + + <KP1> = 37; + <KP2> = 38; + <KP3> = 39; + + <KP0> = 23; + <KPDC> = 68; + <KPEN> = 75; +}; diff --git a/keycodes/ataritt b/keycodes/ataritt new file mode 100644 index 00000000..3cfd503b --- /dev/null +++ b/keycodes/ataritt @@ -0,0 +1,123 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/keycodes/ataritt,v 3.1 1997/10/26 13:25:35 dawes Exp $ + +default xkb_keycodes "us" { + + minimum= 8; + maximum= 134; + + <ESC> = 9; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <TLDE> = 49; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + <DELE> = 91; + + <LCTL> = 37; + <AC01> = 38; + <AC02> = 39; + <AC03> = 40; + <AC04> = 41; + <AC05> = 42; + <AC06> = 43; + <AC07> = 44; + <AC08> = 45; + <AC09> = 46; + <AC10> = 47; + <AC11> = 48; + <BKSL> = 51; + + <LFSH> = 50; + <AB01> = 52; + <AB02> = 53; + <AB03> = 54; + <AB04> = 55; + <AB05> = 56; + <AB06> = 57; + <AB07> = 58; + <AB08> = 59; + <AB09> = 60; + <AB10> = 61; + <RTSH> = 62; + + <ALT> = 64; + <SPCE> = 65; + <CAPS> = 66; + + <FK01> = 67; + <FK02> = 68; + <FK03> = 69; + <FK04> = 70; + <FK05> = 71; + <FK06> = 72; + <FK07> = 73; + <FK08> = 74; + <FK09> = 75; + <FK10> = 76; + + <HELP> = 106; + <UNDO> = 105; + <INS> = 90; + <HOME> = 79; + <UP> = 80; + <LEFT> = 83; + <DOWN> = 88; + <RGHT> = 85; + + <KPLP> = 107; + <KPRP> = 108; + <KPDV> = 109; + <KPMU> = 110; + + <KP7> = 111; + <KP8> = 112; + <KP9> = 113; + <KPSU> = 82; + + <KP4> = 114; + <KP5> = 115; + <KP6> = 116; + <KPAD> = 86; + + <KP1> = 117; + <KP2> = 118; + <KP3> = 119; + + <KP0> = 120; + <KPDC> = 121; + <KPEN> = 122; +}; + +xkb_keycodes "de" { + include "ataritt(us)" + + <LSGT> = 104; +}; diff --git a/keycodes/digital.vndr/lk b/keycodes/digital.vndr/lk new file mode 100644 index 00000000..2d8c5842 --- /dev/null +++ b/keycodes/digital.vndr/lk @@ -0,0 +1,271 @@ +// $Xorg: lk,v 1.3 2000/08/17 19:54:38 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:13:22 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/07 17:40:34 William_Walker +// Upgrade XKB to protocol 0.62 (dual submit from decx11) +// [1995/08/06 14:06:25 William_Walker] +// +// Revision 1.1.2.4 1995/08/05 15:25:55 William_Walker +// Upgrade to XKB protocol 0.62 +// [1995/08/05 14:39:58 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:31 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:24:04 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:28 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:07:29 William_Walker] +// +// EndLog +// +// @(#)RCSfile: lk Revision: /main/3 (DEC) Date: 1996/01/24 12:13:31 +// +xkb_keycodes "lk_common" { + // "Function" keys + <FK01> = 86; + <FK02> = 87; + <FK03> = 88; + <FK04> = 89; + <FK05> = 90; + <FK06> = 100; + <FK07> = 101; + <FK08> = 102; + <FK09> = 103; + <FK10> = 104; + <FK11> = 113; + <FK12> = 114; + + <UP> = 170; + <LEFT> = 167; + <DOWN> = 169; + <RGHT> = 168; + + // "Keypad" keys + <KP7> = 157; + <KP8> = 158; + <KP9> = 159; + <KP4> = 153; + <KP5> = 154; + <KP6> = 155; + <KP1> = 150; + <KP2> = 151; + <KP3> = 152; + <KPEN> = 149; + <KP0> = 146; + <KPDL> = 148; + + // "Alphanumeric" keys + <AE00> = 191; + <AE01> = 192; + <AE02> = 197; + <AE03> = 203; + <AE04> = 208; + <AE05> = 214; + <AE06> = 219; + <AE07> = 224; + <AE08> = 229; + <AE09> = 234; + <AE10> = 239; + <AE11> = 249; + <AE12> = 245; + <BKSP> = 188; + + <TAB> = 190; + <AD01> = 193; + <AD02> = 198; + <AD03> = 204; + <AD04> = 209; + <AD05> = 215; + <AD06> = 220; + <AD07> = 225; + <AD08> = 230; + <AD09> = 235; + <AD10> = 240; + <AD11> = 250; + <AD12> = 246; + <RTRN> = 189; + + <LCTL> = 175; + <CAPS> = 176; + <AC01> = 194; + <AC02> = 199; + <AC03> = 205; + <AC04> = 210; + <AC05> = 216; + <AC06> = 221; + <AC07> = 226; + <AC08> = 231; + <AC09> = 236; + <AC10> = 242; + <AC11> = 251; + + <LFSH> = 174; + <AB01> = 195; + <AB02> = 200; + <AB03> = 206; + <AB04> = 211; + <AB05> = 217; + <AB06> = 222; + <AB07> = 227; + <AB08> = 232; + <AB09> = 237; + <AB10> = 243; + <RTSH> = 171; + + <SPCE> = 212; + + <LDM> = 255; // Support R5 Lock Down Modifiers + + alias <TLDE> = <AE00>; +}; + +xkb_keycodes "lkx01" { + include "digital/lk(lk_common)" + <AB00> = 201; + <FK13> = 115; + <FK14> = 116; + <FK17> = 128; + <FK18> = 129; + <FK19> = 130; + <FK20> = 131; + <HELP> = 124; + <DO> = 125; + <FIND> = 138; + <INS> = 139; + <DELE> = 140; + <SELE> = 141; + <PGUP> = 142; + <PGDN> = 143; + <KPF1> = 161; + <KPF2> = 162; + <KPF3> = 163; + <KPF4> = 164; + <KPSU> = 160; + <KPCO> = 156; + <BKSL> = 247; + <LCMP> = 177; +}; + +xkb_keycodes "lk201" { + include "digital/lk(lkx01)" + indicator 4 = "Scroll Lock"; + indicator 3 = "Caps Lock"; + indicator 2 = "Compose"; + indicator 1 = "Wait"; +}; + +xkb_keycodes "lk421" { + include "digital/lk(lkx01)" + <LALT> = 172; + <RALT> = 178; + <RCMP> = 173; +}; + +xkb_keycodes "lk401" { + include "digital/lk(lk421)" + indicator 4 = "Scroll Lock"; + indicator 3 = "Caps Lock"; +}; + +xkb_keycodes "lk44x" { + include "digital/lk(lk_common)" + <ESC> = 85; + <PRSC> = 115; + <SCLK> = 116; + <PAUS> = 124; + <INS> = 138; + <HOME> = 139; + <PGUP> = 140; + <DELE> = 141; + <END> = 142; + <PGDN> = 143; + <NMLK> = 161; + <KPDV> = 162; + <KPMU> = 163; + <KPSU> = 164; + <KPAD> = 156; + <LALT> = 172; + <RALT> = 178; + <RCTL> = 173; +}; + +xkb_keycodes "lk443" { + include "digital/lk(lk44x)" + <BKSL> = 247; + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; + indicator 5 = "Num Lock"; +}; + +xkb_keycodes "lk444" { + include "digital/lk(lk44x)" + <BKSL> = 201; + <AC12> = 247; + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; + indicator 5 = "Num Lock"; +}; + +// LK201-LT = lk201 +// LK421-AJ = lk421 +AB11 +// LK421-JJ = lk421aj+MUHE+KANJ+HIRA +// LK401-AJ = lk401 +// LK401-BJ = lk401 +MUHE+KANJ+HIRA +// LK401-JJ = lk401bj+AB11 +// LK401-LT = lk401 +// LK441-LT = lk443 + +xkb_keycodes "lk421aj" { + include "digital/lk(lk421)" + <AB11> = 252; +}; + +xkb_keycodes "lk421jj" { + include "digital/lk(lk421aj)" + <MUHE> = 94; + <KANJ> = 95; + <HIRA> = 97; +}; + +xkb_keycodes "lk401bj" { + include "digital/lk(lk401)" + <MUHE> = 94; + <KANJ> = 95; + <HIRA> = 97; +}; + +xkb_keycodes "lk401jj" { + include "digital/lk(lk401bj)" + <AB11> = 252; +}; diff --git a/keycodes/digital.vndr/pc b/keycodes/digital.vndr/pc new file mode 100644 index 00000000..b0aebc3e --- /dev/null +++ b/keycodes/digital.vndr/pc @@ -0,0 +1,280 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:38 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:13:25 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.3 1995/10/25 21:00:14 William_Walker +// Add pc104-key support +// [1995/10/23 15:46:21 William_Walker] +// +// Revision 1.1.6.2 1995/08/07 17:40:37 William_Walker +// Upgrade XKB to protocol 0.62 (dual submit from decx11) +// [1995/08/06 14:06:28 William_Walker] +// +// Revision 1.1.2.4 1995/08/05 15:25:56 William_Walker +// Upgrade to XKB protocol 0.62 +// [1995/08/05 14:40:02 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:32 William_Walker +// Rename <TLDE> to ISO9995 compliant <AE00>. +// [1995/06/26 20:24:07 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:31 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:07:34 William_Walker] +// +// EndLog +// +// @(#)RCSfile: pc Revision: /main/3 (DEC) Date: 1996/01/24 12:13:36 +// +xkb_keycodes "pc_common" { + // "Function" keys + <FK01> = 9; + <FK02> = 15; + <FK03> = 23; + <FK04> = 31; + <FK05> = 39; + <FK06> = 47; + <FK07> = 55; + <FK08> = 63; + <FK09> = 71; + <FK10> = 79; + <FK11> = 86; + <FK12> = 94; + + // "Editing" keys + + <UP> = 99; + <LEFT> = 97; + <DOWN> = 96; + <RGHT> = 106; + + // "Keypad" keys + <KP7> = 108; + <KP8> = 117; + <KP9> = 125; + + <KP4> = 107; + <KP5> = 115; + <KP6> = 116; + + <KP1> = 105; + <KP2> = 114; + <KP3> = 122; + <KPEN> = 121; + + <KP0> = 112; + <KPDL> = 113; + + // "Alphanumeric" keys + <AE01> = 22; + <AE02> = 30; + <AE03> = 38; + <AE04> = 37; + <AE05> = 46; + <AE06> = 54; + <AE07> = 61; + <AE08> = 62; + <AE09> = 70; + <AE10> = 69; + <AE11> = 78; + <AE12> = 85; + <BKSP> = 102; + + <TAB> = 13; + <AD01> = 21; + <AD02> = 29; + <AD03> = 36; + <AD04> = 45; + <AD05> = 44; + <AD06> = 53; + <AD07> = 60; + <AD08> = 67; + <AD09> = 68; + <AD10> = 77; + <AD11> = 84; + <AD12> = 91; + + <CAPS> = 20; + <AC01> = 28; + <AC02> = 27; + <AC03> = 35; + <AC04> = 43; + <AC05> = 52; + <AC06> = 51; + <AC07> = 59; + <AC08> = 66; + <AC09> = 75; + <AC10> = 76; + <AC11> = 82; + <RTRN> = 90; + + <LFSH> = 18; + <AB01> = 26; + <AB02> = 34; + <AB03> = 33; + <AB04> = 42; + <AB05> = 50; + <AB06> = 49; + <AB07> = 58; + <AB08> = 65; + <AB09> = 73; + <AB10> = 74; + <RTSH> = 89; + + <LCTL> = 17; + <LALT> = 25; + <SPCE> = 41; + <RALT> = 57; + + <LDM> = 255; // Support R5 Lock Down Modifiers + +}; + +xkb_keycodes "pc10x" { + include "digital/pc(pc_common)" + <ESC> = 8; + <AE00> = 14; + <PRSC> = 87; + <SCLK> = 95; + <PAUS> = 98; + <INS> = 103; + <HOME> = 110; + <PGUP> = 111; + <DELE> = 100; + <END> = 101; + <PGDN> = 109; + <NMLK> = 118; + <KPDV> = 119; + <KPMU> = 126; + <KPSU> = 132; + <KPAD> = 124; + <RCTL> = 88; + + alias <TLDE> = <AE00>; + + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; +}; + +xkb_keycodes "pc101" { + include "digital/pc(pc10x)" + <BKSL> = 92; + indicator 5 = "Num Lock"; +}; + + +xkb_keycodes "pc102" { + include "digital/pc(pc10x)" + <BKSL> = 19; + <AC12> = 83; + indicator 5 = "Num Lock"; +}; + +xkb_keycodes "pc104" { + include "digital/pc(pc101)" + <LWIN> = 139; + <RWIN> = 140; + <MENU> = 141; +}; + +xkb_keycodes "lk411_common" { + include "digital/pc(pc_common)" + <AE00> = 8; + <AB00> = 14; + <FK13> = 24; + <FK14> = 10; + <FK17> = 16; + <FK18> = 87; + <FK19> = 95; + <FK20> = 98; + <HELP> = 11; + <DO> = 12; + <FIND> = 110; + <INS> = 103; + <DELE> = 100; + <SELE> = 101; + <PGUP> = 111; + <PGDN> = 109; + <KPF1> = 118; + <KPF2> = 119; + <KPF3> = 126; + <KPF4> = 132; + <KPSU> = 19; + <KPCO> = 124; + <LCMP> = 40; + <RCMP> = 88; + + alias <TLDE> = <AE00>; + + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; +}; + +xkb_keycodes "lk411" { + include "digital/pc(lk411_common)" + <BKSL> = 92; +}; + +xkb_keycodes "lk450" { + include "digital/pc(lk411)" + indicator 2 = "Compose"; + indicator 1 = "Wait"; +}; + +// Japanese variants +// +// PCXAJ-AA = pc+BKSL+AC12+AB11+MUHE+KANJ+HIRA+indicator +// LK411-AJ = lk411+MUHE+KANJ+HIRA +// LK411-JJ = lk411+BKSL+AZ01+MUHE+KANJ+HIRA +// LK411-LT = lk411 + +xkb_keycodes "pcxajaa" { + include "digital/pc(pc10x)" + <BKSL> = 93; + <AC12> = 83; + <AB11> = 81; + <MUHE> = 133; + <KANJ> = 134; + <HIRA> = 135; + indicator 5 = "Group 2"; +}; + +xkb_keycodes "lk411jj" { + include "digital/pc(lk411_common)" + <AB11> = 81; + <BKSL> = 83; + <MUHE> = 133; + <KANJ> = 134; + <HIRA> = 135; +}; + + diff --git a/keycodes/fujitsu b/keycodes/fujitsu new file mode 100644 index 00000000..e0e63c6b --- /dev/null +++ b/keycodes/fujitsu @@ -0,0 +1,187 @@ +// $Xorg: fujitsu,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_keycodes "138" { + + minimum= 8; + maximum= 156; + + <ESC> = 37; + <AE01> = 38; + <AE02> = 39; + <AE03> = 40; + <AE04> = 41; + <AE05> = 42; + <AE06> = 43; + <AE07> = 44; + <AE08> = 45; + <AE09> = 46; + <AE10> = 47; + <AE11> = 48; + <AE12> = 49; + <TLDE> = 50; + <BKSP> = 51; + + <TAB> = 61; + <AD01> = 62; + <AD02> = 63; + <AD03> = 64; + <AD04> = 65; + <AD05> = 66; + <AD06> = 67; + <AD07> = 68; + <AD08> = 69; + <AD09> = 70; + <AD10> = 71; + <AD11> = 72; + <AD12> = 73; + + <LCTL> = 84; + <AC01> = 85; + <AC02> = 86; + <AC03> = 87; + <AC04> = 88; + <AC05> = 89; + <AC06> = 90; + <AC07> = 91; + <AC08> = 92; + <AC09> = 93; + <AC10> = 94; + <AC11> = 95; + <BKSL> = 96; + <RTRN> = 97; + + <LFSH> = 107; + <AB01> = 108; + <AB02> = 109; + <AB03> = 110; + <AB04> = 111; + <AB05> = 112; + <AB06> = 113; + <AB07> = 114; + <AB08> = 115; + <AB09> = 116; + <AB10> = 117; + <AB11> = 52; + <RTSH> = 118; + + <CAPS> = 127; + <LALT> = 27; + <LMTA> = 128; + <UNK4> = 125; + <SPCE> = 129; + <UNK5> = 10; + <RMTA> = 130; + <RALT> = 23; + <COMP> = 75; + <LNFD> = 119; + <UNK6> = 56; + + <FK01> = 13; + <FK02> = 14; + <FK03> = 16; + <FK04> = 18; + <FK05> = 20; + <FK06> = 22; + <FK07> = 24; + <FK08> = 25; + <FK09> = 26; + <FK10> = 15; + <FK11> = 17; + <FK12> = 19; + <FK13> = 137; + <FK14> = 138; + <FK15> = 139; + <FK16> = 140; + <FK17> = 141; + <FK18> = 142; + <FK19> = 143; + <FK20> = 144; + <FK21> = 145; + <FK22> = 146; + <FK23> = 147; + <FK24> = 148; + <FK25> = 153; + <FK26> = 154; + <FK27> = 155; + <FK28> = 156; + <FK29> = 149; + <FK30> = 150; + <FK31> = 151; + <FK32> = 152; + + <UNDO> = 34; + <COPY> = 59; + <PAST> = 81; + <CUT> = 105; + <HELP> = 126; + + <BREA> = 9; + <PRSC> = 30; + <KNJI> = 21; + <PAUS> = 29; + + <UNK0> = 82; + <UNK1> = 83; + <UNK2> = 12; + <PGUP> = 35; + <HOME> = 32; + <PGDN> = 36; + <UNK3> = 28; + <DEL> = 74; + <INS> = 60; + <UP> = 33; + <DOWN> = 103; + <LEFT> = 57; + <RGHT> = 80; + <EXEC> = 11; + + <KPMU> = 55; + <KPDV> = 54; + <KPAD> = 133; + <KPSU> = 79; + + <KP7> = 76; + <KP8> = 77; + <KP9> = 78; + <KPEQ> = 53; + + <KP4> = 99; + <KP5> = 100; + <KP6> = 101; + <KPDC> = 58; + + <KP1> = 120; + <KP2> = 121; + <KP3> = 122; + <KPEN> = 98; + + <KP0> = 102; + <KP00> = 31; + + <UNK7> = 123; + <UNK8> = 124; +}; diff --git a/keycodes/hp b/keycodes/hp new file mode 100644 index 00000000..0c98072d --- /dev/null +++ b/keycodes/hp @@ -0,0 +1,271 @@ +// $Xorg: hp,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_keycodes "hp-101" { + + <TLDE> = 23; + <AE01> = 31; + <AE02> = 39; + <AE03> = 47; + <AE04> = 46; + <AE05> = 55; + <AE06> = 63; + <AE07> = 70; + <AE08> = 71; + <AE09> = 79; + <AE10> = 78; + <AE11> = 87; + <AE12> = 94; + <BKSP> = 111; + + <TAB> = 22; + <AD01> = 30; + <AD02> = 38; + <AD03> = 45; + <AD04> = 54; + <AD05> = 53; + <AD06> = 62; + <AD07> = 69; + <AD08> = 76; + <AD09> = 77; + <AD10> = 86; + <AD11> = 93; + <AD12> = 100; + <BKSL> = 101; + + <CAPS> = 29; + <AC01> = 37; + <AC02> = 36; + <AC03> = 44; + <AC04> = 52; + <AC05> = 61; + <AC06> = 60; + <AC07> = 68; + <AC08> = 75; + <AC09> = 84; + <AC10> = 85; + <AC11> = 91; + <RTRN> = 99; + + <LFSH> = 27; + <AB01> = 35; + <AB02> = 43; + <AB03> = 42; + <AB04> = 51; + <AB05> = 59; + <AB06> = 58; + <AB07> = 67; + <AB08> = 74; + <AB09> = 82; + <AB10> = 83; + <RTSH> = 98; + + <LCTL> = 26; + <LALT> = 34; + <SPCE> = 50; + <RALT> = 66; + <RCTL> = 97; + + <ESC> = 17; + <FK01> = 16; + <FK02> = 24; + <FK03> = 32; + <FK04> = 40; + <FK05> = 48; + <FK06> = 56; + <FK07> = 64; + <FK08> = 72; + <FK09> = 80; + <FK10> = 88; + <FK11> = 95; + <FK12> = 103; + + <PRSC> = 96; + <SCLK> = 104; + <PAUS> = 107; + + <INS> = 112; + <HOME> = 119; + <PGUP> = 120; + <DELE> = 109; + <END> = 110; + <PGDN> = 118; + + <UP> = 108; + <LEFT> = 106; + <DOWN> = 105; + <RGHT> = 115; + + <NMLK> = 127; + <KPDV> = 128; + <KPMU> = 135; + <KPSU> = 141; + + <KP7> = 117; + <KP8> = 126; + <KP9> = 134; + <KPAD> = 133; + + <KP4> = 116; + <KP5> = 124; + <KP6> = 125; + + <KP1> = 114; + <KP2> = 123; + <KP3> = 131; + <KPEN> = 130; + + <KP0> = 121; + <KPDL> = 122; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; + +xkb_keycodes "hil" { + + <TLDE> = 71; + <AE01> = 70; + <AE02> = 69; + <AE03> = 68; + <AE04> = 67; + <AE05> = 66; + <AE06> = 65; + <AE07> = 64; + <AE08> = 96; + <AE09> = 97; + <AE10> = 98; + <AE11> = 99; + <AE12> = 100; + <BKSP> = 101; + + <TAB> = 63; + <AD01> = 62; + <AD02> = 61; + <AD03> = 60; + <AD04> = 59; + <AD05> = 58; + <AD06> = 57; + <AD07> = 56; + <AD08> = 104; + <AD09> = 105; + <AD10> = 106; + <AD11> = 107; + <AD12> = 108; + <BKSL> = 109; + + <CAPS> = 55; + <AC01> = 53; + <AC02> = 52; + <AC03> = 51; + <AC04> = 50; + <AC05> = 49; + <AC06> = 48; + <AC07> = 112; + <AC08> = 113; + <AC09> = 114; + <AC10> = 115; + <AC11> = 116; + <RTRN> = 117; + + <LFSH> = 13; + <AB01> = 36; + <AB02> = 35; + <AB03> = 34; + <AB04> = 33; + <AB05> = 32; + <AB06> = 128; + <AB07> = 120; + <AB08> = 121; + <AB09> = 122; + <AB10> = 123; + <RTSH> = 12; + + <LCTL> = 14; + <LALT> = 11; + <SPCE> = 129; + <RALT> = 10; + <PRSC> = 87; + + <ESC> = 39; + <BRK> = 15; + <STOP> = 86; + <FK01> = 84; + <FK02> = 83; + <FK03> = 82; + <FK04> = 81; + <MENU> = 80; + <SYST> = 88; + <FK05> = 89; + <FK06> = 90; + <FK07> = 91; + <FK08> = 92; + <FK09> = 45; + <FK10> = 41; + <FK11> = 43; + <FK12> = 47; + <CLRL> = 94; + <CLR> = 95; + + <INSL> = 102; + <DELL> = 103; + <INSC> = 110; + <DELC> = 111; + + <HOME> = 118; + <PGUP> = 119; + <PGDN> = 127; + <SELE> = 125; + + <UP> = 134; + <LEFT> = 132; + <DOWN> = 133; + <RGHT> = 135; + + <KPDV> = 25; + <KPMU> = 29; + <KPAD> = 27; + <KPSU> = 31; + + <KP7> = 21; + <KP8> = 17; + <KP9> = 19; + <KPEN> = 23; + + <KP4> = 16; + <KP5> = 18; + <KP6> = 20; + <KPSP> = 22; + + <KP1> = 24; + <KP2> = 26; + <KP3> = 28; + <KPTB> = 46; + + <KP0> = 30; + <KPDL> = 44; +}; diff --git a/keycodes/ibm b/keycodes/ibm new file mode 100644 index 00000000..303d4b36 --- /dev/null +++ b/keycodes/ibm @@ -0,0 +1,151 @@ +// $Xorg: ibm,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keycodes "rs6k-101" { + + <TLDE> = 9; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <BKSP> = 23; + + <TAB> = 24; + <AD01> = 25; + <AD02> = 26; + <AD03> = 27; + <AD04> = 28; + <AD05> = 29; + <AD06> = 30; + <AD07> = 31; + <AD08> = 32; + <AD09> = 33; + <AD10> = 34; + <AD11> = 35; + <AD12> = 36; + <BKSL> = 37; + + <CAPS> = 38; + <AC01> = 39; + <AC02> = 40; + <AC03> = 41; + <AC04> = 42; + <AC05> = 43; + <AC06> = 44; + <AC07> = 45; + <AC08> = 46; + <AC09> = 47; + <AC10> = 48; + <AC11> = 49; + <RTRN> = 51; + + <LFSH> = 52; + <AB01> = 54; + <AB02> = 55; + <AB03> = 56; + <AB04> = 57; + <AB05> = 58; + <AB06> = 59; + <AB07> = 60; + <AB08> = 61; + <AB09> = 62; + <AB10> = 63; + <RTSH> = 65; + + <LCTL> = 66; + <LALT> = 68; + <SPCE> = 69; + <RALT> = 70; + <RCTL> = 72; + + <ESC> = 118; + <FK01> = 120; + <FK02> = 121; + <FK03> = 122; + <FK04> = 123; + <FK05> = 124; + <FK06> = 125; + <FK07> = 126; + <FK08> = 127; + <FK09> = 128; + <FK10> = 129; + <FK11> = 130; + <FK12> = 131; + + <PRSC> = 132; + <SCLK> = 133; + <PAUS> = 134; + + <INS> = 83; + <HOME> = 88; + <PGUP> = 93; + <DELE> = 84; + <END> = 89; + <PGDN> = 94; + + <UP> = 91; + <LEFT> = 87; + <DOWN> = 92; + <RGHT> = 97; + + <NMLK> = 98; + <KPDV> = 103; + <KPMU> = 108; + <KPSU> = 113; + + <KP7> = 99; + <KP8> = 104; + <KP9> = 109; + <KPAD> = 114; + + <KP4> = 100; + <KP5> = 105; + <KP6> = 110; + + <KP1> = 101; + <KP2> = 106; + <KP3> = 111; + <KPEN> = 116; + + <KP0> = 107; + <KPDL> = 112; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; +xkb_keycodes "rs6k-102" { + include "ibm(rs6k-101)" + <LSGT> = 53; +}; diff --git a/keycodes/macintosh b/keycodes/macintosh new file mode 100644 index 00000000..5ed575c1 --- /dev/null +++ b/keycodes/macintosh @@ -0,0 +1,161 @@ +// $XConsortium: macintosh /main/10 1996/01/24 12:17:35 kaleb $ +// +//Copyright (c) 1996 X Consortium +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and/or sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the X Consortium shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from the X Consortium. +// +// $XFree86: xc/programs/xkbcomp/keycodes/macintosh,v 1.4 2001/10/02 19:57:00 alanh Exp $ +// +default xkb_keycodes "macintosh" { + + minimum= 8; + maximum= 134; + + <ESC> = 61; + <TLDE> = 58; + <AE01> = 26; + <AE02> = 27; + <AE03> = 28; + <AE04> = 29; + <AE05> = 31; + <AE06> = 30; + <AE07> = 34; + <AE08> = 36; + <AE09> = 33; + <AE10> = 37; + <AE11> = 35; + <AE12> = 32; + <BKSP> = 59; + + <TAB> = 56; + <AD01> = 20; + <AD02> = 21; + <AD03> = 22; + <AD04> = 23; + <AD05> = 25; + <AD06> = 24; + <AD07> = 40; + <AD08> = 42; + <AD09> = 39; + <AD10> = 43; + <AD11> = 41; + <AD12> = 38; + <BKSL> = 50; + + <CAPS> = 65; + <AC01> = 8; + <AC02> = 9; + <AC03> = 10; + <AC04> = 11; + <AC05> = 13; + <AC06> = 12; + <AC07> = 46; + <AC08> = 48; + <AC09> = 45; + <AC10> = 49; + <AC11> = 47; + <RTRN> = 44; + + <LSGT> = 18; + <AB01> = 14; + <AB02> = 15; + <AB03> = 16; + <AB04> = 17; + <AB05> = 19; + <AB06> = 53; + <AB07> = 54; + <AB08> = 51; + <AB09> = 55; + <AB10> = 52; + + <SPCE> = 57; + + <LCTL> = 62; // Left Control + <LALT> = 63; // Left Option + <LFSH> = 64; // Left Shift + <RALT> = 66; // Left Command +// <RTSH> = 131; // Right Shift +// <RALT> = 132; // Right Command +// <RCTL> = 133; // Right Control +// <RMTA> = 134; // Right Option + + <FK01> = 130; + <FK02> = 128; + <FK03> = 107; + <FK04> = 126; + <FK05> = 104; + <FK06> = 105; + <FK07> = 106; + <FK08> = 108; + <FK09> = 109; + <FK10> = 117; + <FK11> = 111; + <FK12> = 119; + + <PRSC> = 113; + <SCLK> = 115; + <PAUS> = 121; + + <INS> = 122; + <HOME> = 123; + <PGUP> = 124; + <DELE> = 125; + <END> = 127; + <PGDN> = 129; + + <UP> = 70; + <LEFT> = 67; + <DOWN> = 69; + <RGHT> = 68; + + <NMLK> = 79; + <KPEQ> = 89; + <KPDV> = 83; + <KPMU> = 75; + + <KP7> = 97; + <KP8> = 99; + <KP9> = 100; + <KPSU> = 86; + + <KP4> = 94; + <KP5> = 95; + <KP6> = 96; + <KPAD> = 77; + + <KP1> = 91; + <KP2> = 92; + <KP3> = 93; + <KPEN> = 84; + + <KP0> = 90; + <KPDL> = 73; + + indicator 3 = "Scroll Lock"; + indicator 2 = "Num Lock"; + indicator 1 = "Caps Lock"; + + alias <ALGR> = <RALT>; +}; diff --git a/keycodes/powerpcps2 b/keycodes/powerpcps2 new file mode 100644 index 00000000..a607036c --- /dev/null +++ b/keycodes/powerpcps2 @@ -0,0 +1,134 @@ +// $XConsortium: xfree86 /main/4 1996/08/31 12:16:59 kaleb $ +// $XFree86: xc/programs/xkbcomp/keycodes/xfree86,v 3.3.2.1 1999/06/21 09:45:28 hohndel Exp $ +default xkb_keycodes "powerpcps2" { + + minimum= 8; + maximum= 135; + + <TLDE> = 49; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + + <CAPS> = 66; + <AC01> = 38; + <AC02> = 39; + <AC03> = 40; + <AC04> = 41; + <AC05> = 42; + <AC06> = 43; + <AC07> = 44; + <AC08> = 45; + <AC09> = 46; + <AC10> = 47; + <AC11> = 48; + + <LFSH> = 50; + <AB01> = 52; + <AB02> = 53; + <AB03> = 54; + <AB04> = 55; + <AB05> = 56; + <AB06> = 57; + <AB07> = 58; + <AB08> = 59; + <AB09> = 60; + <AB10> = 61; + <RTSH> = 62; + <BKSL> = 51; + <LSGT> = 94; + + <LALT> = 64; + <LCTL> = 37; + <SPCE> = 65; + <RCTL> = 105; + <RALT> = 108; + // Microsoft keyboard extra keys + <LWIN> = 133; + <RWIN> = 134; + <MENU> = 135; + + <ESC> = 9; + <FK01> = 67; + <FK02> = 68; + <FK03> = 69; + <FK04> = 70; + <FK05> = 71; + <FK06> = 72; + <FK07> = 73; + <FK08> = 74; + <FK09> = 75; + <FK10> = 76; + <FK11> = 95; + <FK12> = 96; + + <PRSC> = 107; + <SCLK> = 78; + <PAUS> = 127; + + <INS> = 118; + <HOME> = 110; + <PGUP> = 112; + <DELE> = 119; + <END> = 115; + <PGDN> = 117; + + <UP> = 111; + <LEFT> = 113; + <DOWN> = 116; + <RGHT> = 114; + + <NMLK> = 77; + <KPDV> = 106; + <KPMU> = 63; + <KPSU> = 82; + + <KP7> = 79; + <KP8> = 80; + <KP9> = 81; + <KPAD> = 86; + + <KP4> = 83; + <KP5> = 84; + <KP6> = 85; + + <KP1> = 87; + <KP2> = 88; + <KP3> = 89; + <KPEN> = 104; + + <KP0> = 90; + <KPDL> = 91; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; + + alias <ALGR> = <RALT>; +}; + diff --git a/keycodes/sgi.vndr/indigo b/keycodes/sgi.vndr/indigo new file mode 100644 index 00000000..df868026 --- /dev/null +++ b/keycodes/sgi.vndr/indigo @@ -0,0 +1,140 @@ +// $Xorg: indigo,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "pc101" { + minimum= 10; + maximum= 118; + + <TLDE> = 62; + <AE01> = 15; + <AE02> = 21; + <AE03> = 22; + <AE04> = 29; + <AE05> = 30; + <AE06> = 37; + <AE07> = 38; + <AE08> = 45; + <AE09> = 46; + <AE10> = 53; + <AE11> = 54; + <AE12> = 61; + <BKSP> = 68; + + <TAB> = 16; + <AD01> = 17; + <AD02> = 23; + <AD03> = 24; + <AD04> = 31; + <AD05> = 32; + <AD06> = 39; + <AD07> = 40; + <AD08> = 47; + <AD09> = 48; + <AD10> = 55; + <AD11> = 56; + <AD12> = 63; + <RTRN> = 58; + + <CAPS> = 11; + <AC01> = 18; + <AC02> = 19; + <AC03> = 25; + <AC04> = 26; + <AC05> = 33; + <AC06> = 34; + <AC07> = 41; + <AC08> = 42; + <AC09> = 49; + <AC10> = 50; + <AC11> = 57; + + <LFSH> = 13; + <AB01> = 27; + <AB02> = 28; + <AB03> = 35; + <AB04> = 36; + <AB05> = 43; + <AB06> = 44; + <AB07> = 51; + <AB08> = 52; + <AB09> = 59; + <AB10> = 60; + <RTSH> = 12; + <BKSL> = 64; + + <LALT> = 91; + <LCTL> = 10; + <SPCE> = 90; + <RCTL> = 93; + <RALT> = 92; + + <ESC> = 14; + <FK01> = 94; + <FK02> = 95; + <FK03> = 96; + <FK04> = 97; + <FK05> = 98; + <FK06> = 99; + <FK07> = 100; + <FK08> = 101; + <FK09> = 102; + <FK10> = 103; + <FK11> = 104; + <FK12> = 105; + + <PRSC> = 106; + <SCLK> = 107; + <PAUS> = 108; + + <INS> = 109; + <HOME> = 110; + <PGUP> = 111; + <DELE> = 69; + <END> = 112; + <PGDN> = 113; + + <UP> = 88; + <LEFT> = 80; + <DOWN> = 81; + <RGHT> = 87; + + <NMLK> = 114; + <KPDV> = 115; + <KPMU> = 116; + <KPSU> = 83; + + <KP7> = 74; + <KP8> = 75; + <KP9> = 82; + <KPAD> = 117; + + <KP4> = 70; + <KP5> = 76; + <KP6> = 77; + + <KP1> = 65; + <KP2> = 71; + <KP3> = 72; + <KPEN> = 89; + + <KP0> = 66; + <KPDL> = 73; + + alias <AE00> = <TLDE>; + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + alias <AA01> = <LALT>; + alias <AA09> = <RALT>; + alias <ALGR> = <RALT>; + alias <AA12> = <RCTL>; + + virtual indicator 1 = "L1"; + virtual indicator 2 = "L2"; + virtual indicator 3 = "L3"; + virtual indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; +}; +xkb_keycodes "pc102" { + include "sgi/indigo(pc101)" + <LSGT> = 118; +}; diff --git a/keycodes/sgi.vndr/indy b/keycodes/sgi.vndr/indy new file mode 100644 index 00000000..f59609d8 --- /dev/null +++ b/keycodes/sgi.vndr/indy @@ -0,0 +1,203 @@ +// $Xorg: indy,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "universal" { + minimum= 15; + maximum= 149; + include "sgi/indy(pc105)" + alternate <BKSL> = 91; + alternate <BKSL> = 100; + alternate <BKSL> = 101; +}; +xkb_keycodes "pc101" { + minimum= 15; + maximum= 149; + + <TLDE> = 22; + <AE01> = 30; + <AE02> = 38; + <AE03> = 46; + <AE04> = 45; + <AE05> = 54; + <AE06> = 62; + <AE07> = 69; + <AE08> = 70; + <AE09> = 78; + <AE10> = 77; + <AE11> = 86; + <AE12> = 93; + <BKSP> = 110; + + <TAB> = 21; + <AD01> = 29; + <AD02> = 37; + <AD03> = 44; + <AD04> = 53; + <AD05> = 52; + <AD06> = 61; + <AD07> = 68; + <AD08> = 75; + <AD09> = 76; + <AD10> = 85; + <AD11> = 92; + <AD12> = 99; + <RTRN> = 98; + + <CAPS> = 28; + <AC01> = 36; + <AC02> = 35; + <AC03> = 43; + <AC04> = 51; + <AC05> = 60; + <AC06> = 59; + <AC07> = 67; + <AC08> = 74; + <AC09> = 83; + <AC10> = 84; + <AC11> = 90; + + <LFSH> = 26; + <AB01> = 34; + <AB02> = 42; + <AB03> = 41; + <AB04> = 50; + <AB05> = 58; + <AB06> = 57; + <AB07> = 66; + <AB08> = 73; + <AB09> = 81; + <AB10> = 82; + <RTSH> = 97; + <BKSL> = 100; + + <LALT> = 33; + <LCTL> = 25; + <SPCE> = 49; + <RCTL> = 96; + <RALT> = 65; + + <ESC> = 16; + <FK01> = 15; + <FK02> = 23; + <FK03> = 31; + <FK04> = 39; + <FK05> = 47; + <FK06> = 55; + <FK07> = 63; + <FK08> = 71; + <FK09> = 79; + <FK10> = 87; + <FK11> = 94; + <FK12> = 102; + + <PRSC> = 95; + <SCLK> = 103; + <PAUS> = 106; + + <INS> = 111; + <HOME> = 118; + <PGUP> = 119; + <DELE> = 108; + <END> = 109; + <PGDN> = 117; + + <UP> = 107; + <LEFT> = 105; + <DOWN> = 104; + <RGHT> = 114; + + <NMLK> = 126; + <KPDV> = 127; + <KPMU> = 134; + <KPSU> = 140; + + <KP7> = 116; + <KP8> = 125; + <KP9> = 133; + <KPAD> = 132; + + <KP4> = 115; + <KP5> = 123; + <KP6> = 124; + + <KP1> = 113; + <KP2> = 122; + <KP3> = 130; + <KPEN> = 129; + + <KP0> = 120; + <KPDL> = 121; + + alias <AE00> = <TLDE>; + alias <AC00> = <CAPS>; + alias <AA00> = <LCTL>; + alias <AA01> = <LALT>; + alias <AA09> = <RALT>; + alias <ALGR> = <RALT>; + alias <AA12> = <RCTL>; + + virtual indicator 1 = "L1"; + virtual indicator 2 = "L2"; + virtual indicator 3 = "L3"; + virtual indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; + +}; +xkb_keycodes "pc102" { + <BKSL> = 91; + <LSGT> = 27; + augment "sgi/indy(pc101)" + maximum= 149; + minimum= 15; +}; +xkb_keycodes "pc104" { + include "sgi/indy(pc101)" + minimum= 15; + maximum= 149; + + // These key names are here to support so-called "Windows95" + // keyboards like the Microsoft Natural keyboard. + <LWIN> = 147; + <RWIN> = 148; + <MENU> = 149; +}; +xkb_keycodes "pc105" { + <LSGT> = 27; + augment "sgi/indy(pc104)" + minimum= 15; + maximum= 149; +}; +xkb_keycodes "jp106" { + <HZTG> = 22; + <AB11> = 89; + <AC12> = 91; + <NFER> = 141; + <XFER> = 142; + <HKTG> = 143; + alias <TLDE> = <HZTG>; + alias <AE00> = <HZTG>; + alias <AE13> = <BKSL>; + augment "sgi/indy(pc101)" + minimum= 15; + maximum= 149; +}; +// can be combined with any other "indy" keycode +// description to add virtual keys which can be +// used to implement an overlay-based numeric +// keypad. +partial hidden xkb_keycodes "overlayKeypad" { + <KO7> = 17; + <KO8> = 18; + <KO9> = 19; + <KO6> = 146; + <KO5> = 145; + <KO4> = 144; + <KO1> = 136; + <KO2> = 137; + <KO3> = 138; + <KO0> = 135; + <KODL> = 139; +}; +partial hidden xkb_keycodes "shiftLock" { + indicator 5 = "Shift Lock"; +}; diff --git a/keycodes/sgi.vndr/iris b/keycodes/sgi.vndr/iris new file mode 100644 index 00000000..30375e9b --- /dev/null +++ b/keycodes/sgi.vndr/iris @@ -0,0 +1,11 @@ +// $Xorg: iris,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "iris" { + include "sgi/indigo(pc101)" + indicator 1 = "L1"; + indicator 2 = "L2"; + indicator 3 = "L3"; + indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; +}; diff --git a/keycodes/sony b/keycodes/sony new file mode 100644 index 00000000..0e720b42 --- /dev/null +++ b/keycodes/sony @@ -0,0 +1,142 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keycodes "nwp5461" { + + <ESC> = 18; + <AE01> = 19; + <AE02> = 20; + <AE03> = 21; + <AE04> = 22; + <AE05> = 23; + <AE06> = 24; + <AE07> = 25; + <AE08> = 26; + <AE09> = 27; + <AE10> = 28; + <AE11> = 29; + <AE12> = 30; + <BKSL> = 31; + <BKSP> = 32; + + <TAB> = 33; + <AD01> = 34; + <AD02> = 35; + <AD03> = 36; + <AD04> = 37; + <AD05> = 38; + <AD06> = 39; + <AD07> = 40; + <AD08> = 41; + <AD09> = 42; + <AD10> = 43; + <AD11> = 44; + <AD12> = 45; + <DELE> = 46; + + <LCTL> = 47; + <AC01> = 48; + <AC02> = 49; + <AC03> = 50; + <AC04> = 51; + <AC05> = 52; + <AC06> = 53; + <AC07> = 54; + <AC08> = 55; + <AC09> = 56; + <AC10> = 57; + <AC11> = 58; + <TLDE> = 59; + <RTRN> = 60; + + <LFSH> = 61; + <AB01> = 62; + <AB02> = 63; + <AB03> = 64; + <AB04> = 65; + <AB05> = 66; + <AB06> = 67; + <AB07> = 68; + <AB08> = 69; + <AB09> = 70; + <AB10> = 71; + <AB11> = 72; + <RTSH> = 73; + + <LALT> = 74; + <CAPS> = 75; + <STOP> = 76; + <SPCE> = 77; + <CUT> = 78; + <EXEC> = 81; + + <FK01> = 8; + <FK02> = 9; + <FK03> = 10; + <FK04> = 11; + <FK05> = 12; + <FK06> = 13; + <FK07> = 14; + <FK08> = 15; + <FK09> = 16; + <FK10> = 17; + <FK11> = 111; + <FK12> = 112; + + <HELP> = 113; + <INS> = 114; + <CLR> = 115; + <PGUP> = 116; + <PGDN> = 117; + + <KPTB> = 109; + <UP> = 95; + <LEFT> = 98; + <DOWN> = 99; + <RGHT> = 100; + + <KPMU> = 107; + <KPDV> = 108; + <KPAD> = 89; + + <KP7> = 82; + <KP8> = 83; + <KP9> = 84; + <KPSU> = 85; + + <KP4> = 86; + <KP5> = 87; + <KP6> = 88; + <KPSP> = 93; + + <KP1> = 90; + <KP2> = 91; + <KP3> = 92; + <KPEN> = 97; + + <KP0> = 94; + <KPDC> = 96; +}; diff --git a/keycodes/sun b/keycodes/sun new file mode 100644 index 00000000..a74411ad --- /dev/null +++ b/keycodes/sun @@ -0,0 +1,819 @@ +// $Xorg: sun,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keycodes/sun,v 3.5 2001/12/14 20:02:00 dawes Exp $ +// +default xkb_keycodes "type4" { + + minimum= 8; + maximum= 132; + + <ESC> = 36; + <AE01> = 37; + <AE02> = 38; + <AE03> = 39; + <AE04> = 40; + <AE05> = 41; + <AE06> = 42; + <AE07> = 43; + <AE08> = 44; + <AE09> = 45; + <AE10> = 46; + <AE11> = 47; + <AE12> = 48; + <TLDE> = 49; + <BKSP> = 50; + + <TAB> = 60; + <AD01> = 61; + <AD02> = 62; + <AD03> = 63; + <AD04> = 64; + <AD05> = 65; + <AD06> = 66; + <AD07> = 67; + <AD08> = 68; + <AD09> = 69; + <AD10> = 70; + <AD11> = 71; + <AD12> = 72; + <DELE> = 73; + + <LCTL> = 83; + <AC01> = 84; + <AC02> = 85; + <AC03> = 86; + <AC04> = 87; + <AC05> = 88; + <AC06> = 89; + <AC07> = 90; + <AC08> = 91; + <AC09> = 92; + <AC10> = 93; + <AC11> = 94; + <BKSL> = 95; + <RTRN> = 96; + + <LFSH> = 106; + <AB01> = 107; + <AB02> = 108; + <AB03> = 109; + <AB04> = 110; + <AB05> = 111; + <AB06> = 112; + <AB07> = 113; + <AB08> = 114; + <AB09> = 115; + <AB10> = 116; + <RTSH> = 117; + <LNFD> = 118; + + <HELP> = 125; + <CAPS> = 126; + <LALT> = 26; + <LMTA> = 127; + <SPCE> = 128; + <RMTA> = 129; + <COMP> = 74; + <ALGR> = 20; + alias <RALT> = <ALGR>; + + <FK01> = 12; + <FK02> = 13; + <FK03> = 15; + <FK04> = 17; + <FK05> = 19; + <FK06> = 21; + <FK07> = 23; + <FK08> = 24; + <FK09> = 25; + <FK10> = 14; + <FK11> = 16; + <FK12> = 18; + + <STOP> = 8; + <AGAI> = 10; + <PROP> = 32; + <UNDO> = 33; + <FRNT> = 56; + <COPY> = 58; + <OPEN> = 79; + <PAST> = 80; + <FIND> = 102; + <CUT> = 104; + + <PRSC> = 29; + <SCLK> = 30; + <PAUS> = 28; + + <NMLK> = 105; + <KPEQ> = 52; + <KPDV> = 53; + <KPMU> = 54; + <KPSU> = 78; + + <KP7> = 75; + <KP8> = 76; + <KP9> = 77; + <KPAD> = 132; + + <KP4> = 98; + <KP5> = 99; + <KP6> = 100; + + <KP1> = 119; + <KP2> = 120; + <KP3> = 121; + <KPEN> = 97; + + <KP0> = 101; + <KPDL> = 57; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type5" { + + minimum= 8; + maximum= 132; + + <ESC> = 36; + <AE01> = 37; + <AE02> = 38; + <AE03> = 39; + <AE04> = 40; + <AE05> = 41; + <AE06> = 42; + <AE07> = 43; + <AE08> = 44; + <AE09> = 45; + <AE10> = 46; + <AE11> = 47; + <AE12> = 48; + <TLDE> = 49; + <BKSP> = 50; + + <TAB> = 60; + <AD01> = 61; + <AD02> = 62; + <AD03> = 63; + <AD04> = 64; + <AD05> = 65; + <AD06> = 66; + <AD07> = 67; + <AD08> = 68; + <AD09> = 69; + <AD10> = 70; + <AD11> = 71; + <AD12> = 72; + <DELE> = 73; + <COMP> = 74; + <ALGR> = 20; + alias <RALT> = <ALGR>; + + <LCTL> = 83; + <AC01> = 84; + <AC02> = 85; + <AC03> = 86; + <AC04> = 87; + <AC05> = 88; + <AC06> = 89; + <AC07> = 90; + <AC08> = 91; + <AC09> = 92; + <AC10> = 93; + <AC11> = 94; + <BKSL> = 95; + <RTRN> = 96; + + <LFSH> = 106; + <AB01> = 107; + <AB02> = 108; + <AB03> = 109; + <AB04> = 110; + <AB05> = 111; + <AB06> = 112; + <AB07> = 113; + <AB08> = 114; + <AB09> = 115; + <AB10> = 116; + <RTSH> = 117; + + <LALT> = 26; + <CAPS> = 126; + <LMTA> = 127; + <SPCE> = 128; + <RMTA> = 129; + + <FK01> = 12; + <FK02> = 13; + <FK03> = 15; + <FK04> = 17; + <FK05> = 19; + <FK06> = 21; + <FK07> = 23; + <FK08> = 24; + <FK09> = 25; + <FK10> = 14; + <FK11> = 16; + <FK12> = 18; + <STOP> = 8; + <AGAI> = 10; + <PROP> = 32; + <UNDO> = 33; + <FRNT> = 56; + <COPY> = 58; + <OPEN> = 79; + <PAST> = 80; + <FIND> = 102; + <CUT> = 104; + + <PRSC> = 29; + <SCLK> = 30; + <PAUS> = 28; + + <NMLK> = 105; + <KPDV> = 53; + <KPMU> = 54; + <KPSU> = 78; + + <KP7> = 75; + <KP8> = 76; + <KP9> = 77; + <KPAD> = 132; + + <KP4> = 98; + <KP5> = 99; + <KP6> = 100; + + <KP1> = 119; + <KP2> = 120; + <KP3> = 121; + <KPEN> = 97; + + <KP0> = 101; + <KPDL> = 57; + + <UP> = 27; + <LEFT> = 31; + <DOWN> = 34; + <RGHT> = 35; + + <INS> = 51; + <HOME> = 59; + <END> = 81; + <PGUP> = 103; + <PGDN> = 130; + <HELP> = 125; + + <MUTE> = 52; + <VOL-> = 9; + <VOL+> = 11; + <POWR> = 55; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type6" { + minimum= 8; + maximum= 255; + + <TLDE> = 49; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + + <CAPS> = 66; + <AC01> = 38; + <AC02> = 39; + <AC03> = 40; + <AC04> = 41; + <AC05> = 42; + <AC06> = 43; + <AC07> = 44; + <AC08> = 45; + <AC09> = 46; + <AC10> = 47; + <AC11> = 48; + + <LFSH> = 50; + <AB01> = 52; + <AB02> = 53; + <AB03> = 54; + <AB04> = 55; + <AB05> = 56; + <AB06> = 57; + <AB07> = 58; + <AB08> = 59; + <AB09> = 60; + <AB10> = 61; + <RTSH> = 62; + <BKSL> = 51; + + <LALT> = 64; + <LCTL> = 37; + <SPCE> = 65; + <ALGR> = 113; + alias <RALT> = <ALGR>; + + <LMTA> = 115; + <RMTA> = 116; + <COMP> = 117; + + <ESC> = 9; + <FK01> = 67; + <FK02> = 68; + <FK03> = 69; + <FK04> = 70; + <FK05> = 71; + <FK06> = 72; + <FK07> = 73; + <FK08> = 74; + <FK09> = 75; + <FK10> = 76; + <FK11> = 95; + <FK12> = 96; + + <PRSC> = 111; + <SCLK> = 78; + <PAUS> = 110; + + <INS> = 106; + <HOME> = 97; + <PGUP> = 99; + <DELE> = 107; + <END> = 103; + <PGDN> = 105; + + <UP> = 98; + <LEFT> = 100; + <DOWN> = 104; + <RGHT> = 102; + + <NMLK> = 77; + <KPDV> = 112; + <KPMU> = 63; + <KPSU> = 82; + + <KP7> = 79; + <KP8> = 80; + <KP9> = 81; + <KPAD> = 86; + + <KP4> = 83; + <KP5> = 84; + <KP6> = 85; + + <KP1> = 87; + <KP2> = 88; + <KP3> = 89; + <KPEN> = 108; + + <KP0> = 90; + <KPDL> = 91; + + <STOP> = 222; + <AGAI> = 223; + <PROP> = 224; + <UNDO> = 225; + <FRNT> = 226; + <COPY> = 227; + <OPEN> = 228; + <PAST> = 229; + <FIND> = 230; + <CUT> = 231; + + <HELP> = 232; + + <MUTE> = 165; + <VOL-> = 159; + <VOL+> = 158; + <POWR> = 160; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; + +xkb_keycodes "type4_euro" { + include "sun(type4)" + <LSGT> = 131; +}; + +xkb_keycodes "type5_euro" { + include "sun(type5)" + <LSGT> = 131; +}; + +xkb_keycodes "type6_euro" { + include "sun(type6)" + <LSGT> = 94; +}; + +xkb_keycodes "type5_se" { + + minimum= 8; + maximum= 132; + + // Row G + <HELP> = 125; + // + <ESC> = 36; + // + <FK01> = 12; + <FK02> = 13; + <FK03> = 15; + <FK04> = 17; + // + <FK05> = 19; + <FK06> = 21; + <FK07> = 23; + <FK08> = 24; + // + <FK09> = 25; + <FK10> = 14; + <FK11> = 16; + <FK12> = 18; + // + <PRSC> = 29; + <SCLK> = 30; + <PAUS> = 28; + // + <MUTE> = 52; + <VOL-> = 9; + <VOL+> = 11; + <POWR> = 55; + // End Row G + + // Row F + // + // End Row F + + // Row E + <STOP> = 8; + <AGAI> = 10; + // + <AE00> = 49; + alias <TLDE> = <AE00>; + <AE01> = 37; + <AE02> = 38; + <AE03> = 39; + <AE04> = 40; + <AE05> = 41; + <AE06> = 42; + <AE07> = 43; + <AE08> = 44; + <AE09> = 45; + <AE10> = 46; + <AE11> = 47; + <AE12> = 48; + <BKSP> = 50; + // + <INS> = 51; + <HOME> = 59; + <PGUP> = 103; + // + <NMLK> = 105; + <KPDV> = 53; + <KPMU> = 54; + <KPSU> = 78; + //End Row E + + // Row D + <PROP> = 32; + <UNDO> = 33; + // + <AD00> = 60; + alias <TAB> = <AD00>; + <AD01> = 61; + <AD02> = 62; + <AD03> = 63; + <AD04> = 64; + <AD05> = 65; + <AD06> = 66; + <AD07> = 67; + <AD08> = 68; + <AD09> = 69; + <AD10> = 70; + <AD11> = 71; + <AD12> = 72; + // + <DELE> = 73; + <END> = 81; + <PGDN> = 130; + // + <KP7> = 75; + <KP8> = 76; + <KP9> = 77; + <KPAD> = 132; + // End Row D + + // Row C + <FRNT> = 56; + <COPY> = 58; + // + <AC00> = 126; + alias <CAPS> = <AC00>; + <AC01> = 84; + <AC02> = 85; + <AC03> = 86; + <AC04> = 87; + <AC05> = 88; + <AC06> = 89; + <AC07> = 90; + <AC08> = 91; + <AC09> = 92; + <AC10> = 93; + <AC11> = 94; + <AC12> = 95; + alias <BKSL> = <AC12>; + <RTRN> = 96; + // + <KP4> = 98; + <KP5> = 99; + <KP6> = 100; + // End Row C + + // Row B + <OPEN> = 79; + <PAST> = 80; + // + <LFSH> = 106; + <AB00> = 131; + alias <LSGT> = <AB00>; + <AB01> = 107; + <AB02> = 108; + <AB03> = 109; + <AB04> = 110; + <AB05> = 111; + <AB06> = 112; + <AB07> = 113; + <AB08> = 114; + <AB09> = 115; + <AB10> = 116; + <RTSH> = 117; + // + <UP> = 27; + // + <KP1> = 119; + <KP2> = 120; + <KP3> = 121; + <KPEN> = 97; + // End Row B + + // Row A + <FIND> = 102; + <CUT> = 104; + // + <LCTL> = 83; + <LALT> = 26; + <LMTA> = 127; + <SPCE> = 128; + <RMTA> = 129; + <COMP> = 74; + <ALGR> = 20; + alias <RALT> = <ALGR>; + // + <LEFT> = 31; + <DOWN> = 34; + <RGHT> = 35; + // + <KP0> = 101; + <KPDL> = 57; + // End Row A + + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type5c_se" { + include "sun(type5_se)" +}; + +xkb_keycodes "type4__se" { + + minimum= 8; + maximum= 132; + + // Row F + <STOP> = 8; + <AGAI> = 10; + // + <FK01> = 12; + <FK02> = 13; + <FK03> = 15; + <FK04> = 17; + <FK05> = 19; + <FK06> = 21; + <FK07> = 23; + <FK08> = 24; + <FK09> = 25; + <FK10> = 14; + <FK11> = 16; + <FK12> = 18; + <AF13> = 95; + alias <TLDE> = <AF13>; + <AF14> = 22; + <DELE> = 73; + // + <PAUS> = 28; + <PRSC> = 29; + <SCLK> = 30; + <NMLK> = 105; + // End Row F + + // Row E + <PROP> = 32; + <UNDO> = 33; + // + <AE00> = 36; + alias <ESC> = <AE00>; + <AE01> = 37; + <AE02> = 38; + <AE03> = 39; + <AE04> = 40; + <AE05> = 41; + <AE06> = 42; + <AE07> = 43; + <AE08> = 44; + <AE09> = 45; + <AE10> = 46; + <AE11> = 47; + <AE12> = 48; + <BKSP> = 50; + // + <KPEQ> = 52; + <KPDV> = 53; + <KPMU> = 54; + <KPSU> = 78; + // End Row E + + // Row D + <FRNT> = 56; + <COPY> = 58; + // + <AD00> = 60; + alias <TAB> = <AD00>; + <AD01> = 61; + <AD02> = 62; + <AD03> = 63; + <AD04> = 64; + <AD05> = 65; + <AD06> = 66; + <AD07> = 67; + <AD08> = 68; + <AD09> = 69; + <AD10> = 70; + <AD11> = 71; + <AD12> = 72; + // + <KP7> = 75; + <KP8> = 76; + <KP9> = 77; + <KPAD> = 132; + // End Row D + + // Row C + <OPEN> = 79; + <PAST> = 80; + // + <AC00> = 83; + // alias <CAPS> = <AC00>; + <AC01> = 84; + <AC02> = 85; + <AC03> = 86; + <AC04> = 87; + <AC05> = 88; + <AC06> = 89; + <AC07> = 90; + <AC08> = 91; + <AC09> = 92; + <AC10> = 93; + <AC11> = 94; + <AC12> = 49; + alias <BKSL> = <AC12>; + <RTRN> = 96; + // + <KP4> = 98; + <KP5> = 99; + <KP6> = 100; + // End Row C + + // Row B + <FIND> = 102; + <CUT> = 104; + // + <LFSH> = 106; + <AB00> = 131; + alias <LSGT> = <AB00>; + <AB01> = 107; + <AB02> = 108; + <AB03> = 109; + <AB04> = 110; + <AB05> = 111; + <AB06> = 112; + <AB07> = 113; + <AB08> = 114; + <AB09> = 115; + <AB10> = 116; + <RTSH> = 117; + <LNFD> = 118; + // + <KP1> = 119; + <KP2> = 120; + <KP3> = 121; + <KPEN> = 97; + // End Row B + + // Row A + <HELP> = 125; + // + <AA00> = 126; + // alias <LCTL> = <AA00>; + <LALT> = 26; + <LMTA> = 127; + <SPCE> = 128; + <RMTA> = 129; + <COMP> = 74; + <ALGR> = 20; + alias <RALT> = <ALGR>; + // + <KP0> = 101; + <KPDL> = 57; + // End Row A + + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type4_se" { + + include "sun(type4__se)" + + alias <LCTL> = <AA00>; + alias <CAPS> = <AC00>; +}; + +xkb_keycodes "type4_se_swapctl" { + + include "sun(type4__se)" + + alias <LCTL> = <AC00>; + alias <CAPS> = <AA00>; +}; diff --git a/keycodes/xfree86 b/keycodes/xfree86 new file mode 100644 index 00000000..6b1387a1 --- /dev/null +++ b/keycodes/xfree86 @@ -0,0 +1,415 @@ +// $XdotOrg: xc/programs/xkbcomp/keycodes/xfree86,v 1.1.4.4 2004/03/05 13:41:30 eich Exp $ +// $Xorg: xfree86,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keycodes/xfree86,v 3.28 2003/11/21 04:46:42 dawes Exp $ + +// "standard" XFree86 codes +// It seems that the "default" must be the first entry in the file. + +default xkb_keycodes "xfree86" { + include "xfree86(basic)" + <BKSL> = 51; + <LSGT> = 94; +}; + +xkb_keycodes "basic" { + + minimum= 8; + maximum= 255; + + <TLDE> = 49; + <AE01> = 10; + <AE02> = 11; + <AE03> = 12; + <AE04> = 13; + <AE05> = 14; + <AE06> = 15; + <AE07> = 16; + <AE08> = 17; + <AE09> = 18; + <AE10> = 19; + <AE11> = 20; + <AE12> = 21; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + + <CAPS> = 66; + <AC01> = 38; + <AC02> = 39; + <AC03> = 40; + <AC04> = 41; + <AC05> = 42; + <AC06> = 43; + <AC07> = 44; + <AC08> = 45; + <AC09> = 46; + <AC10> = 47; + <AC11> = 48; + + <LFSH> = 50; + <AB01> = 52; + <AB02> = 53; + <AB03> = 54; + <AB04> = 55; + <AB05> = 56; + <AB06> = 57; + <AB07> = 58; + <AB08> = 59; + <AB09> = 60; + <AB10> = 61; + <RTSH> = 62; + + <LALT> = 64; + <LCTL> = 37; + <SPCE> = 65; + <RCTL> = 109; + <RALT> = 113; + // Microsoft keyboard extra keys + <LWIN> = 115; + <RWIN> = 116; + <MENU> = 117; + + <ESC> = 9; + <FK01> = 67; + <FK02> = 68; + <FK03> = 69; + <FK04> = 70; + <FK05> = 71; + <FK06> = 72; + <FK07> = 73; + <FK08> = 74; + <FK09> = 75; + <FK10> = 76; + <FK11> = 95; + <FK12> = 96; + + <PRSC> = 111; + <SYRQ> = 92; + <SCLK> = 78; + <PAUS> = 110; + <BRK> = 114; + + <INS> = 106; + <HOME> = 97; + <PGUP> = 99; + <DELE> = 107; + <END> = 103; + <PGDN> = 105; + + <UP> = 98; + <LEFT> = 100; + <DOWN> = 104; + <RGHT> = 102; + + <NMLK> = 77; + <KPDV> = 112; + <KPMU> = 63; + <KPSU> = 82; + + <KP7> = 79; + <KP8> = 80; + <KP9> = 81; + <KPAD> = 86; + + <KP4> = 83; + <KP5> = 84; + <KP6> = 85; + + <KP1> = 87; + <KP2> = 88; + <KP3> = 89; + <KPEN> = 108; + + <KP0> = 90; + <KPDL> = 91; + <KPEQ> = 126; + + <FK13> = 118; + <FK14> = 119; + <FK15> = 120; + <FK16> = 121; + <FK17> = 122; + <KPDC> = 123; + + // Keys that are generated on Japanese keyboards + + alias <HZTG> = <TLDE>; // Hankaku_Zenkaku toggle + <HKTG> = 208; // Hiragana_Katakana toggle + <AB11> = 211; // backslash/underscore + <XFER> = 129; // Henkan + <NFER> = 131; // Muhenkan + <AE13> = 133; // Yen + + // Keys that are generated on Korean keyboards + + alias <HNGL> = <FK16>; // Hangul Latin toggle + alias <HJCV> = <FK17>; // Hangul to Hanja conversion + + // Extended keys that may be generated on "Internet" keyboards. + // These are not standardised, hence the meaningless names. + // The entries commented out are never generated because the raw codes + // in those positions are already used for well-defined keys. + + alias <I01> = <XFER>; + <I02> = 130; + alias <I03> = <NFER>; + <I04> = 132; + alias <I05> = <AE13>; + <I06> = 134; + <I07> = 135; + <I08> = 136; + <I09> = 137; + <I0A> = 138; + <I0B> = 139; + <I0C> = 140; + <I0D> = 141; + <I0E> = 142; + <I0F> = 143; + <I10> = 144; + <I11> = 145; + <I12> = 146; + <I13> = 147; + <I14> = 148; + <I15> = 149; + <I16> = 150; + <I17> = 151; + <I18> = 152; + <I19> = 153; + <I1A> = 154; + <I1B> = 155; + // <I1C> = 156; <META> + // <I1D> = 157; <K59> + <I1E> = 158; + <I1F> = 159; + <I20> = 160; + <I21> = 161; + <I22> = 162; + <I23> = 163; + <I24> = 164; + <I25> = 165; + <I26> = 166; + <I27> = 167; + <I28> = 168; + <I29> = 169; + // <I2A> = 170; <K5A> + <I2B> = 171; + <I2C> = 172; + <I2D> = 173; + <I2E> = 174; + <I2F> = 175; + <I30> = 176; + <I31> = 177; + <I32> = 178; + <I33> = 179; + <I34> = 180; + // <I35> = 181; <K5B> + // <I36> = 182; <K5D> + // <I37> = 183; <K5E> + // <I38> = 184; <K5F> + <I39> = 185; + <I3A> = 186; + <I3B> = 187; + <I3C> = 188; + // <I3D> = 189; <K62> + // <I3E> = 190; <K63> + // <I3F> = 191; <K64> + // <I40> = 192; <K65> + // <I41> = 193; <K66> + <I42> = 194; + <I43> = 195; + <I44> = 196; + <I45> = 197; + // <I46> = 198; <K67> + // <I47> = 199; <K68> + // <I48> = 200; <K69> + // <I49> = 201; <K6A> + <I4A> = 202; + // <I4B> = 203; <K6B> + // <I4C> = 204; <K6C> + // <I4D> = 205; <K6D> + // <I4E> = 206; <K6E> + // <I4F> = 207; <K6F> + // <I50> = 208; <K70> + // <I51> = 209; <K71> + // <I52> = 210; <K72> + // <I53> = 211; <K73> + <I54> = 212; + <I55> = 213; + <I56> = 214; + <I57> = 215; + <I58> = 216; + <I59> = 217; + <I5A> = 218; + // <I5B> = 219; <K74> + // <I5C> = 220; <K75> + // <I5D> = 221; <K76> + <I5E> = 222; + <I5F> = 223; + <I60> = 224; + <I61> = 225; + <I62> = 226; + <I63> = 227; + <I64> = 228; + <I65> = 229; + <I66> = 230; + <I67> = 231; + <I68> = 232; + <I69> = 233; + <I6A> = 234; + <I6B> = 235; + <I6C> = 236; + <I6D> = 237; + <I6E> = 238; + <I6F> = 239; + <I70> = 240; + <I71> = 241; + <I72> = 242; + <I73> = 243; + <I74> = 244; + <I75> = 245; + <I76> = 246; + <I77> = 247; + <I78> = 248; + <I79> = 249; + <I7A> = 250; + <I7B> = 251; + <I7C> = 252; + <I7D> = 253; + <I7E> = 254; + <I7F> = 255; + + // Codes generated for scancodes 0x59-0x5f, 0x62-0x76 + <K59> = 157; // <I1D> + <K5A> = 170; // <I2A> + <K5B> = 181; // <I35> + alias <K5C> = <KPEQ>; + <K5D> = 182; // <I36> + <K5E> = 183; // <I37> + <K5F> = 184; // <I38> + <K62> = 189; // <I3D> + <K63> = 190; // <I3E> + <K64> = 191; // <I3F> + <K65> = 192; // <I40> + <K66> = 193; // <I41> + <K67> = 198; // <I46> + <K68> = 199; // <I47> + <K69> = 200; // <I48> + <K6A> = 201; // <I49> + <K6B> = 203; // <I4B> + <K6C> = 204; // <I4C> + <K6D> = 205; // <I4D> + <K6E> = 206; // <I4E> + <K6F> = 207; // <I4F> + alias <K70> = <HKTG>; // <I50> + <K71> = 209; // <I51> + <K72> = 210; // <I52> + alias <K73> = <AB11>; // <I53> + <K74> = 219; // <I5B> + <K75> = 220; // <I5C> + <K76> = 221; // <I5D> + + // Solaris compatibility + + alias <LMTA> = <LWIN>; + alias <RMTA> = <RWIN>; + alias <COMP> = <MENU>; + alias <POWR> = <I0C>; + alias <MUTE> = <I0D>; + alias <VOL-> = <I0E>; + alias <VOL+> = <I0F>; + alias <HELP> = <I10>; + alias <STOP> = <I11>; + alias <AGAI> = <I12>; + alias <PROP> = <I13>; + alias <UNDO> = <I14>; + alias <FRNT> = <I15>; + alias <COPY> = <I16>; + alias <OPEN> = <I17>; + alias <PAST> = <I18>; + alias <FIND> = <I19>; + alias <CUT> = <I1A>; + + // Other codes never generated. The XFree86 ddx never generates + // these codes. + // Thus we can use them as fake keys + <MDSW> = 93; // <U5D> + <LVL3> = 124; // <U7C> + <ALT> = 125; // <U7D> + <META> = 156; // <I1C> + <SUPR> = 127; // <U7F> + <HYPR> = 128; // <U80> + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; + + alias <ALGR> = <RALT>; +}; + +// What keyboard is this? + +xkb_keycodes "102" { + include "xfree86(xfree86)" + + // There will be warnings from xkbcomp because of multiple definitions. + + <RALT> = 122; + <RCTL> = 123; + + <PRSC> = 121; + <PAUS> = 118; + + <INS> = 131; + <HOME> = 135; + <PGUP> = 119; + <DELE> = 129; + <END> = 130; + <PGDN> = 134; + + <UP> = 128; + <LEFT> = 132; + <DOWN> = 120; + <RGHT> = 133; + + <KPDV> = 125; + + <KPEN> = 124; +}; + + +// For japanese 106 keyboard. by tsuka(tsuka@kawalab.dnj.ynu.ac.jp) +// +// All of the keycodes here are now in the basic "xfree86" set. +// +xkb_keycodes "jp106" { + include "xfree86(basic)" + <AC12> = 51; +}; + + +// For brazilian ABNT2 keyboard. by Ricardo Y. Igarashi(iga@that.com.br) +xkb_keycodes "abnt2" { + include "xfree86(basic)" + <BKSL> = 94; + <AC12> = 51; + <KPPT> = 134; +}; + + diff --git a/keycodes/xfree98 b/keycodes/xfree98 new file mode 100644 index 00000000..6d34772f --- /dev/null +++ b/keycodes/xfree98 @@ -0,0 +1,155 @@ +// $Xorg: xfree98,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keycodes/xfree98,v 3.6 2001/01/17 23:45:51 dawes Exp $ +// +default xkb_keycodes "pc98" { + + minimum= 8; + maximum= 134; + + <ESC> = 8; + <AE01> = 9; + <AE02> = 10; + <AE03> = 11; + <AE04> = 12; + <AE05> = 13; + <AE06> = 14; + <AE07> = 15; + <AE08> = 16; + <AE09> = 17; + <AE10> = 18; + <AE11> = 19; + <AE12> = 20; + <BKSL> = 21; + <BKSP> = 22; + + <TAB> = 23; + <AD01> = 24; + <AD02> = 25; + <AD03> = 26; + <AD04> = 27; + <AD05> = 28; + <AD06> = 29; + <AD07> = 30; + <AD08> = 31; + <AD09> = 32; + <AD10> = 33; + <AD11> = 34; + <AD12> = 35; + <RTRN> = 36; + + <LCTL> = 124; + <CAPS> = 121; + <AC01> = 37; + <AC02> = 38; + <AC03> = 39; + <AC04> = 40; + <AC05> = 41; + <AC06> = 42; + <AC07> = 43; + <AC08> = 44; + <AC09> = 45; + <AC10> = 46; + <AC11> = 47; + <AC12> = 48; + + <LFSH> = 120; + <AB01> = 49; + <AB02> = 50; + <AB03> = 51; + <AB04> = 52; + <AB05> = 53; + <AB06> = 54; + <AB07> = 55; + <AB08> = 56; + <AB09> = 57; + <AB10> = 58; + <AB11> = 59; + + <ALGR> = 122; + <LALT> = 123; + <NFER> = 89; + <SPCE> = 60; + <XFER> = 61; + + <BRK> = 104; + <PRSC> = 105; + <FK01> = 106; + <FK02> = 107; + <FK03> = 108; + <FK04> = 109; + <FK05> = 110; + <FK06> = 111; + <FK07> = 112; + <FK08> = 113; + <FK09> = 114; + <FK10> = 115; + <FK11> = 90; + <FK12> = 91; + <FK13> = 92; + <FK14> = 93; + <FK15> = 94; + + + <INS> = 64; + <DELE> = 65; + <PGUP> = 63; + <PGDN> = 62; + <UP> = 66; + <LEFT> = 67; + <RGHT> = 68; + <DOWN> = 69; + + <HOME> = 70; + <HELP> = 71; + + <KPSU> = 72; + <KPDV> = 73; + + <KP7> = 74; + <KP8> = 75; + <KP9> = 76; + <KPMU> = 77; + + <KP4> = 78; + <KP5> = 79; + <KP6> = 80; + <KPAD> = 81; + + <KP1> = 82; + <KP2> = 83; + <KP3> = 84; + <KPEQ> = 85; + + <KP0> = 86; + <KPSP> = 87; + <KPDC> = 88; + + indicator 1 = "Caps Lock"; + indicator 2 = "Kana"; +}; + diff --git a/keymap/README b/keymap/README new file mode 100644 index 00000000..adef966d --- /dev/null +++ b/keymap/README @@ -0,0 +1,8 @@ +The keymap component provides a way how to set up one pre-defined keyboard +mapping from a given set. It has been obsoleted by 'rules' component which +is simplier and more flexible. The directory is preserved for compatibility +reasons. Avoid using it if it is possible. + + + +/* $XFree86$ */ diff --git a/keymap/amiga b/keymap/amiga new file mode 100644 index 00000000..d697a986 --- /dev/null +++ b/keymap/amiga @@ -0,0 +1,22 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keymap/amiga,v 3.2 1997/10/26 13:25:36 dawes Exp $ + +default xkb_keymap "usa1" { + xkb_keycodes { include "amiga(usa1)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "amiga(usa1)" }; + xkb_geometry { include "amiga(usa1)" }; +}; + +xkb_keymap "de" { + xkb_keycodes { include "amiga(de)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "amiga(de)" }; + xkb_geometry { include "amiga(de)" }; +}; diff --git a/keymap/ataritt b/keymap/ataritt new file mode 100644 index 00000000..b801ac29 --- /dev/null +++ b/keymap/ataritt @@ -0,0 +1,21 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keymap/ataritt,v 3.1 1997/10/26 13:25:37 dawes Exp $ + +default xkb_keymap "us" { + xkb_keycodes { include "ataritt(us)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "ataritt(us)" }; + xkb_geometry { include "ataritt(us)" }; +}; +xkb_keymap "de" { + xkb_keycodes { include "ataritt(de)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "ataritt(de)" }; + xkb_geometry { include "ataritt(de)" }; +}; diff --git a/keymap/digital.vndr/us b/keymap/digital.vndr/us new file mode 100644 index 00000000..00058cd8 --- /dev/null +++ b/keymap/digital.vndr/us @@ -0,0 +1,188 @@ +// $Xorg: us,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: us,v +// Revision 1.3 1996/06/18 09:14:51 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/10/25 21:00:53 William_Walker +// Add pc104-key support +// [1995/10/23 15:46:24 William_Walker] +// +// Revision 1.1.2.6 1995/06/27 12:18:05 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:26:19 William_Walker] +// +// Revision 1.1.2.5 1995/06/05 19:23:12 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:14:04 William_Walker] +// +// EndLog +// +// @(#)RCSfile: us,v Revision: 1.3 (DEC) Date: 1996/02/02 14:21:15 +// + +// ************************************************************** +// * * +// * Keymaps for en_US.ISO8859-1 - English for U.S. * +// * * +// ************************************************************** + +xkb_keymap "lk201" { + xkb_keycodes { include "digital/lk(lk201)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt105)" }; + xkb_geometry { description = "Digital US LK201"; + include "digital/lk(lk201)" }; +}; + +xkb_keymap "lk401" { + xkb_keycodes { include "digital/lk(lk401)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK401"; + include "digital/lk(lk401)" }; +}; + +xkb_keymap "lk411" { + xkb_keycodes { include "digital/pc(lk411)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK411"; + include "digital/lk(lk401)" }; +}; + +xkb_keymap "lk421" { + xkb_keycodes { include "digital/lk(lk421)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(unix)" }; + xkb_geometry { description = "Digital US LK421"; + include "digital/unix(unix)" }; +}; + +xkb_keymap "lk441" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK441"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk443" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK443"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk44x" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK443"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk450" { + xkb_keycodes { include "digital/pc(lk450)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK450"; + include "digital/lk(lk450)" }; +}; + +xkb_keymap "pcxalaa" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalaa)" }; + xkb_geometry { description = "Digital US PCXAL-AA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxalfa" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalfa)" }; + xkb_geometry { description = "Digital US PCXAL-FA"; + include "digital/pc(pc101)" + include "digital/pc(leds_on_keys)" }; +}; + +xkb_keymap "pcxalga" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalga)" }; + xkb_geometry { description = "Digital US PCXAL-GA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxalka" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalka)" }; + xkb_geometry { description = "Digital US PCXAL-KA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxal" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxal)" }; + xkb_geometry { description = "Digital US PCXAL"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "mnk" { + xkb_keycodes { include "digital/pc(pc104)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pc104)" }; + xkb_geometry { include "microsoft" }; +}; diff --git a/keymap/macintosh b/keymap/macintosh new file mode 100644 index 00000000..d230dca9 --- /dev/null +++ b/keymap/macintosh @@ -0,0 +1,17 @@ +// $XConsortium: macintosh /main/11 1996/03/07 13:42:13 kaleb $ +// $XFree86: xc/programs/xkbcomp/keymap/macintosh,v 1.1 1999/05/23 05:27:51 dawes Exp $ +default xkb_keymap "macintosh" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "macintosh/us(extended)" }; + xkb_geometry { include "macintosh" }; +}; + +xkb_keymap "macintosh_old" { + xkb_keycodes { include "macintosh" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "macintosh/us(extended)" }; + xkb_geometry { include "macintosh" }; +}; diff --git a/keymap/sgi.vndr/be b/keymap/sgi.vndr/be new file mode 100644 index 00000000..ef8c3dca --- /dev/null +++ b/keymap/sgi.vndr/be @@ -0,0 +1,34 @@ +// $Xorg: be,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+be" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+be(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+be" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+be(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/bg b/keymap/sgi.vndr/bg new file mode 100644 index 00000000..46cd5450 --- /dev/null +++ b/keymap/sgi.vndr/bg @@ -0,0 +1,19 @@ +// $Xorg: bg,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "us(pc_universal)+bg+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "us(pc102)+bg+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/ca b/keymap/sgi.vndr/ca new file mode 100644 index 00000000..9030e157 --- /dev/null +++ b/keymap/sgi.vndr/ca @@ -0,0 +1,33 @@ +// $Xorg: ca,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+ca" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+ca(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+ca" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+ca(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/cz b/keymap/sgi.vndr/cz new file mode 100644 index 00000000..b1c8598b --- /dev/null +++ b/keymap/sgi.vndr/cz @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+cz" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+cz" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/cz_qwerty b/keymap/sgi.vndr/cz_qwerty new file mode 100644 index 00000000..a87e7d5a --- /dev/null +++ b/keymap/sgi.vndr/cz_qwerty @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+cz_qwerty" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+cz_qwerty" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/de b/keymap/sgi.vndr/de new file mode 100644 index 00000000..1e4cfe73 --- /dev/null +++ b/keymap/sgi.vndr/de @@ -0,0 +1,34 @@ +// $Xorg: de,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+de" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+de" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/de_CH b/keymap/sgi.vndr/de_CH new file mode 100644 index 00000000..093a5b10 --- /dev/null +++ b/keymap/sgi.vndr/de_CH @@ -0,0 +1,34 @@ +// $Xorg: de_CH,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+de_CH" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+de_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+de_CH" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+de_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/dk b/keymap/sgi.vndr/dk new file mode 100644 index 00000000..9eceffd1 --- /dev/null +++ b/keymap/sgi.vndr/dk @@ -0,0 +1,34 @@ +// $Xorg: dk,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+dk" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+dk(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+dk" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+dk(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/dvorak b/keymap/sgi.vndr/dvorak new file mode 100644 index 00000000..a282cd18 --- /dev/null +++ b/keymap/sgi.vndr/dvorak @@ -0,0 +1,15 @@ +// $Xorg: dvorak,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+dvorak" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+dvorak" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; diff --git a/keymap/sgi.vndr/en_US b/keymap/sgi.vndr/en_US new file mode 100644 index 00000000..446f5632 --- /dev/null +++ b/keymap/sgi.vndr/en_US @@ -0,0 +1,58 @@ +// $Xorg: en_US,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy101" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy101_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy104" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "microsoft(natural)" }; +}; +xkb_keymap "indy104_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "microsoft(natural)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102_nodeadkeys)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/es b/keymap/sgi.vndr/es new file mode 100644 index 00000000..a57750c9 --- /dev/null +++ b/keymap/sgi.vndr/es @@ -0,0 +1,34 @@ +// $Xorg: es,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+es" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+es(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+es" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+es(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/fi b/keymap/sgi.vndr/fi new file mode 100644 index 00000000..bb0fd208 --- /dev/null +++ b/keymap/sgi.vndr/fi @@ -0,0 +1,34 @@ +// $Xorg: fi,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fi" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fi(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fi" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fi(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/fr b/keymap/sgi.vndr/fr new file mode 100644 index 00000000..ecf615f6 --- /dev/null +++ b/keymap/sgi.vndr/fr @@ -0,0 +1,34 @@ +// $Xorg: fr,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fr" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fr(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fr" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fr(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/fr_CH b/keymap/sgi.vndr/fr_CH new file mode 100644 index 00000000..3f825e04 --- /dev/null +++ b/keymap/sgi.vndr/fr_CH @@ -0,0 +1,34 @@ +// $Xorg: fr_CH,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fr_CH" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fr_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fr_CH" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fr_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/gb b/keymap/sgi.vndr/gb new file mode 100644 index 00000000..5c7566cc --- /dev/null +++ b/keymap/sgi.vndr/gb @@ -0,0 +1,34 @@ +// $Xorg: gb,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+gb" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+gb(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+gb" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+gb(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/hu b/keymap/sgi.vndr/hu new file mode 100644 index 00000000..92d31a89 --- /dev/null +++ b/keymap/sgi.vndr/hu @@ -0,0 +1,105 @@ +// $Xorg: hu,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+hu(basic)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_caps_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+hu(basic)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_caps_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/it b/keymap/sgi.vndr/it new file mode 100644 index 00000000..17d6a106 --- /dev/null +++ b/keymap/sgi.vndr/it @@ -0,0 +1,34 @@ +// $Xorg: it,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+it" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+it(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+it" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+it(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/jp b/keymap/sgi.vndr/jp new file mode 100644 index 00000000..c83900ae --- /dev/null +++ b/keymap/sgi.vndr/jp @@ -0,0 +1,8 @@ +// $Xorg: jp,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(jp106)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+sgi/jp" }; + xkb_geometry { include "sgi/indy(jp106)" }; +}; diff --git a/keymap/sgi.vndr/no b/keymap/sgi.vndr/no new file mode 100644 index 00000000..ed293d21 --- /dev/null +++ b/keymap/sgi.vndr/no @@ -0,0 +1,34 @@ +// $Xorg: no,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+no" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+no(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+no" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+no(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/pl b/keymap/sgi.vndr/pl new file mode 100644 index 00000000..b75f1f3c --- /dev/null +++ b/keymap/sgi.vndr/pl @@ -0,0 +1,29 @@ +// $Xorg: pl,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+pl" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+pl(nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+pl" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+pl(nodeadkeys)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/pt b/keymap/sgi.vndr/pt new file mode 100644 index 00000000..eda00357 --- /dev/null +++ b/keymap/sgi.vndr/pt @@ -0,0 +1,34 @@ +// $Xorg: pt,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+pt" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+pt(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+pt" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+pt(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/ru b/keymap/sgi.vndr/ru new file mode 100644 index 00000000..6a2a1897 --- /dev/null +++ b/keymap/sgi.vndr/ru @@ -0,0 +1,105 @@ +// $Xorg: ru,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+ru(basic)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_caps_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+ru(basic)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_caps_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/se b/keymap/sgi.vndr/se new file mode 100644 index 00000000..3fe54e27 --- /dev/null +++ b/keymap/sgi.vndr/se @@ -0,0 +1,34 @@ +// $Xorg: se,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+se" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+se(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+se" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+se(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/sk b/keymap/sgi.vndr/sk new file mode 100644 index 00000000..89bd9b52 --- /dev/null +++ b/keymap/sgi.vndr/sk @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+sk" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+sk" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/sk_qwerty b/keymap/sgi.vndr/sk_qwerty new file mode 100644 index 00000000..9094cbc3 --- /dev/null +++ b/keymap/sgi.vndr/sk_qwerty @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+sk_qwerty" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+sk_qwerty" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff --git a/keymap/sgi.vndr/th b/keymap/sgi.vndr/th new file mode 100644 index 00000000..b614913e --- /dev/null +++ b/keymap/sgi.vndr/th @@ -0,0 +1,17 @@ +// $Xorg: th,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+th+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+th+group(shift_toggle)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff --git a/keymap/sgi.vndr/us b/keymap/sgi.vndr/us new file mode 100644 index 00000000..2d704ca5 --- /dev/null +++ b/keymap/sgi.vndr/us @@ -0,0 +1,43 @@ +// $Xorg: us,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy101_euro" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy_compose" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; +xkb_keymap "indigo_compose" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101compose)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; +xkb_keymap "indigo101_compose" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101euro)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; diff --git a/keymap/sony b/keymap/sony new file mode 100644 index 00000000..5380c4e5 --- /dev/null +++ b/keymap/sony @@ -0,0 +1,33 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keymap "news5000-nwp5461" { + xkb_keycodes { include "sony(nwp5461)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sony/us(nwp5461)" }; + xkb_geometry { include "sony(nwp5461)" }; +}; diff --git a/keymap/sun.vndr/de b/keymap/sun.vndr/de new file mode 100644 index 00000000..0b4bd53f --- /dev/null +++ b/keymap/sun.vndr/de @@ -0,0 +1,78 @@ +// $Xorg: de,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keymap "type4_de" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+de" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_de_nodeadkeys" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_de_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+de" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_de" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+de" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_de_nodeadkeys" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_de_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+de" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/es b/keymap/sun.vndr/es new file mode 100644 index 00000000..ab29c434 --- /dev/null +++ b/keymap/sun.vndr/es @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/es,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_es" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+es" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_es_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+es" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_es" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+es" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_es_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+es" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/fi b/keymap/sun.vndr/fi new file mode 100644 index 00000000..3ca6003d --- /dev/null +++ b/keymap/sun.vndr/fi @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/fi,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_fi" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+fi" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_fi_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+fi" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_fi" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+fi" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_fi_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+fi" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/fr b/keymap/sun.vndr/fr new file mode 100644 index 00000000..60be0d1d --- /dev/null +++ b/keymap/sun.vndr/fr @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/fr,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_fr" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+fr" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_fr_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+fr" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_fr" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+fr" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_fr_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+fr" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/no b/keymap/sun.vndr/no new file mode 100644 index 00000000..d57fc49b --- /dev/null +++ b/keymap/sun.vndr/no @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/no,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_no" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+no" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_no_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+no" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_no" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+no" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_no_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+no" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/pl b/keymap/sun.vndr/pl new file mode 100644 index 00000000..d672db78 --- /dev/null +++ b/keymap/sun.vndr/pl @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/pl,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_pl" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+pl" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_pl_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+pl" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_pl" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+pl" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_pl_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+pl" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/ru b/keymap/sun.vndr/ru new file mode 100644 index 00000000..9dead904 --- /dev/null +++ b/keymap/sun.vndr/ru @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/ru,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_ru" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+ru" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_ru_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+ru" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_ru" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+ru" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_ru_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+ru" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/se b/keymap/sun.vndr/se new file mode 100644 index 00000000..dd0a1670 --- /dev/null +++ b/keymap/sun.vndr/se @@ -0,0 +1,56 @@ +// $XFree86: xc/programs/xkbcomp/keymap/sun/se,v 1.2 1998/12/20 09:34:42 dawes Exp $ + +default xkb_keymap "type5c_se_fixdollar" { + xkb_keycodes { include "sun(type5_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun5)+se(fixdollar)" + }; + xkb_geometry { include "sun(type5c_se)" }; +}; +xkb_keymap "type5c_se" { + xkb_keycodes { include "sun(type5_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun5)" + }; + xkb_geometry { include "sun(type5c_se)" }; +}; +xkb_keymap "type5_se" { + xkb_keycodes { include "sun(type5_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun5)" + }; + xkb_geometry { include "sun(type5_se)" }; +}; +xkb_keymap "type4_se_fixdollar_swapctl" { + xkb_keycodes { include "sun(type4_se_swapctl)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun4)+se(fixdollar)" + }; + xkb_geometry { include "sun(type4_se)" }; +}; +xkb_keymap "type4_se_fixdollar" { + xkb_keycodes { include "sun(type4_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun4)+se(fixdollar)" + }; + xkb_geometry { include "sun(type4_se)" }; +}; +xkb_keymap "type4_se" { + xkb_keycodes { include "sun(type4_se)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/se(sun4)" + }; + xkb_geometry { include "sun(type4_se)" }; +}; diff --git a/keymap/sun.vndr/uk b/keymap/sun.vndr/uk new file mode 100644 index 00000000..d99e2ff4 --- /dev/null +++ b/keymap/sun.vndr/uk @@ -0,0 +1,62 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/sun/uk,v 1.2 2000/10/28 00:34:05 dawes Exp $ +// +xkb_keymap "type4_uk" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4)+iso9995-3(basic)+uk" + }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_uk_openlook" { + xkb_keycodes { include "sun(type4_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun4ol)+iso9995-3(basic)+uk" + }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_uk" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "sun/us(sun5)+iso9995-3(basic)+uk" + }; + xkb_geometry { include "sun(type5euro)" }; +}; +xkb_keymap "type5_uk_openlook" { + xkb_keycodes { include "sun(type5_euro)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)+iso9995-3+uk" }; + xkb_geometry { include "sun(type5euro)" }; +}; diff --git a/keymap/sun.vndr/us b/keymap/sun.vndr/us new file mode 100644 index 00000000..2133c21d --- /dev/null +++ b/keymap/sun.vndr/us @@ -0,0 +1,68 @@ +// $Xorg: us,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keymap "type4_us" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun4)" }; + xkb_geometry { include "sun(type4)" }; +}; +xkb_keymap "type4_us_openlook" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun4ol)" }; + xkb_geometry { include "sun(type4)" }; +}; +default xkb_keymap "type5_us" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5)" }; + xkb_geometry { include "sun(type5)" }; +}; +xkb_keymap "type5_us_openlook" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)" }; + xkb_geometry { include "sun(type5)" }; +}; +xkb_keymap "type5_unix" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5)" }; + xkb_geometry { include "sun(type5unix)" }; +}; +xkb_keymap "type5_unix_openlook" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(sun5ol)" }; + xkb_geometry { include "sun(type5unix)" }; +}; diff --git a/keymap/xfree86 b/keymap/xfree86 new file mode 100644 index 00000000..e1967a1b --- /dev/null +++ b/keymap/xfree86 @@ -0,0 +1,362 @@ +// $XFree86: xc/programs/xkbcomp/keymap/xfree86,v 3.30 2003/04/03 16:34:49 dawes Exp $ + + +default xkb_keymap "us" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc105)" }; + xkb_geometry { include "pc" }; +}; + +// "ar" addition by Arabeyes Team, <support@arabeyes.org> +xkb_keymap "ar" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ar" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "be" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+be" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "bg" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+bg" }; + xkb_geometry { include "pc(pc102)" }; +}; +// us_intl and br by Ricardo Y. Igarashi (iga@that.com.br) +xkb_keymap "br" { + xkb_keycodes { include "xfree86(abnt2)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+br" }; + xkb_geometry { include "pc(abnt2)" }; +}; +// cz and sk keymaps by Kamil Toman (ktoman@email.cz) +// are designed to replace old czechoslovakian and czsk keyboards +// and their prog variants. Those are now obsolete and should not be used anymore. +xkb_keymap "cz" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+cz" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "cz_qwerty" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+cz_qwerty" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "de" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+de" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "de_CH" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+de_CH" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "dk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+dk" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "dvorak" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+dvorak" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "en_US" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "es" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+es" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr-latin9" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr-latin9" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "fr_CA" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ca" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr_CH" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr_CH" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "gb" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+gb" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "hr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+hr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "it" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+it" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "jp106" { + xkb_keycodes { include "xfree86(jp106)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "jp(jp106)" }; + xkb_geometry { include "pc(jp106)" }; +}; +xkb_keymap "lt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lt" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "lt_std" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lt_std" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "lv" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lv" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mk" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mt" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mt_us" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mt_us" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "no" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+no" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "pl" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+pl" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "pt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+pt" }; + xkb_geometry { include "pc(pc102)" }; +}; +// ro: additions by Cristian Gafton, <gafton@redhat.com> +xkb_keymap "ro" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc101)+ro(pc101)" }; + xkb_geometry { include "pc(pc101)" }; +}; +xkb_keymap "ro_microsoft" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ro(pc105)" }; + xkb_geometry { include "pc(pc105)" }; +}; +xkb_keymap "ru" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ru" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "se_FI" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fi" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "se_SE" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+se" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "sl" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+si" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "sl_SI" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+si" }; + xkb_geometry { include "pc(pc102)" }; +}; +// cz and sk keymaps by Kamil Toman (ktoman@email.cz) +// are designed to replace old czechoslovakian and czsk keyboards +// and their prog variants. Those are now obsolete and should not be used anymore. +xkb_keymap "sk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+sk" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "sk_qwerty" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+sk_qwerty" }; + xkb_geometry { include "pc" }; +}; +// Additions by Emil Soleyman-Zomalan, <emil@nishra.com> +xkb_keymap "syr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+syr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th_tis" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th_tis" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th_pat" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th_pat" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "tr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+tr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "uk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+uk)" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "us_flexpro" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc105)" }; + xkb_geometry { include "keytronic(FlexPro)" }; +}; +// us_intl and br by Ricardo Y. Igarashi (iga@that.com.br) +// us_intl means standard us keyboard plus dead_keys symbols +// these keyboards are very popular in Brazil +xkb_keymap "us_intl" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+us_intl" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "us_microsoft" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc105)" }; + xkb_geometry { include "microsoft" }; +}; + +xkb_keymap "uz" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+uz" }; + xkb_geometry { include "pc(pc102)" }; +}; + diff --git a/keymap/xfree98 b/keymap/xfree98 new file mode 100644 index 00000000..e78b15ce --- /dev/null +++ b/keymap/xfree98 @@ -0,0 +1,35 @@ +// $Xorg: xfree98,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/xfree98,v 3.6 2001/01/17 23:45:53 dawes Exp $ + +default xkb_keymap "jp" { + xkb_keycodes { include "xfree98" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "nec/jp(pc98)" }; + xkb_geometry { include "nec(pc98)" }; +}; diff --git a/po/POTFILES.in b/po/POTFILES.in index 385070c4..8b93ba49 100644 --- a/po/POTFILES.in +++ b/po/POTFILES.in @@ -1 +1 @@ -xfree86.xml.in +rules/base.xml.in @@ -7,7 +7,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2003-11-25 23:38+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2004-03-18 00:17+0200\n" "Last-Translator: Petri Jooste <rkwjpj@puk.ac.za>\n" "Language-Team: Afrikaans <i18n@af.org.za>\n" @@ -108,1357 +108,1463 @@ msgid "Azerbaijani" msgstr "Azerbaijaans" #: xfree86.xml.in.h:24 +#, fuzzy +msgid "Azona RF2300 wireless Internet Keyboard" +msgstr "Logitech Internet Keyboard" + +#: xfree86.xml.in.h:25 msgid "BTC 5090" msgstr "BTC 5090" -#: xfree86.xml.in.h:25 +#: xfree86.xml.in.h:26 msgid "BTC 5113RF Multimedia" msgstr "BTC 5113RF Multimedia" -#: xfree86.xml.in.h:26 +#: xfree86.xml.in.h:27 msgid "BTC 5126T" msgstr "BTC 5126T" -#: xfree86.xml.in.h:27 +#: xfree86.xml.in.h:28 msgid "BTC 9000" msgstr "BTC 9000" -#: xfree86.xml.in.h:28 +#: xfree86.xml.in.h:29 msgid "BTC 9000A" msgstr "BTC 9000A" -#: xfree86.xml.in.h:29 +#: xfree86.xml.in.h:30 msgid "BTC 9001AH" msgstr "BTC 9001AH" -#: xfree86.xml.in.h:30 +#: xfree86.xml.in.h:31 msgid "Basic" msgstr "Basies" -#: xfree86.xml.in.h:31 +#: xfree86.xml.in.h:32 msgid "Bel" msgstr "Bel" -#: xfree86.xml.in.h:32 +#: xfree86.xml.in.h:33 msgid "Belarusian" msgstr "Belarussies" -#: xfree86.xml.in.h:33 +#: xfree86.xml.in.h:34 msgid "Belgian" msgstr "Belgies" -#: xfree86.xml.in.h:34 +#: xfree86.xml.in.h:35 msgid "Ben" msgstr "Ben" -#: xfree86.xml.in.h:35 +#: xfree86.xml.in.h:36 msgid "Bengali" msgstr "Bengaals" -#: xfree86.xml.in.h:36 +#: xfree86.xml.in.h:37 msgid "Bgr" msgstr "Bgr" -#: xfree86.xml.in.h:37 +#: xfree86.xml.in.h:38 msgid "Bih" msgstr "Bih" -#: xfree86.xml.in.h:38 +#: xfree86.xml.in.h:39 msgid "Blr" msgstr "Blr" -#: xfree86.xml.in.h:39 +#: xfree86.xml.in.h:40 msgid "Bosnian" msgstr "Bosnies" -#: xfree86.xml.in.h:40 +#: xfree86.xml.in.h:41 msgid "Both Alt keys together change group" msgstr "Beide Alt-sleutels tesame verander groep" -#: xfree86.xml.in.h:41 +#: xfree86.xml.in.h:42 msgid "Both Ctrl keys together change group" msgstr "Beide Ctrl-sleutels tesame verander groep" -#: xfree86.xml.in.h:42 +#: xfree86.xml.in.h:43 msgid "Both Shift keys together change group" msgstr "Beide Shift-sleutels tesame verander groep" -#: xfree86.xml.in.h:43 +#: xfree86.xml.in.h:44 msgid "Both Win-keys switch group while pressed" msgstr "Beide Win-sleutels wissel groep terwyl gedruk" -#: xfree86.xml.in.h:44 +#: xfree86.xml.in.h:45 msgid "Bra" msgstr "Bra" -#: xfree86.xml.in.h:45 +#: xfree86.xml.in.h:46 msgid "Brazilian" msgstr "Braziliaans" -#: xfree86.xml.in.h:46 +#: xfree86.xml.in.h:47 msgid "Brazilian ABNT2" msgstr "Braziliaans ABNT2" -#: xfree86.xml.in.h:47 +#: xfree86.xml.in.h:48 msgid "Brother Internet Keyboard" msgstr "Brother Internetsleutelbord" -#: xfree86.xml.in.h:48 +#: xfree86.xml.in.h:49 msgid "Bulgarian" msgstr "Bulgaars" -#: xfree86.xml.in.h:49 +#: xfree86.xml.in.h:50 msgid "Burmese" msgstr "Burmees" -#: xfree86.xml.in.h:50 +#: xfree86.xml.in.h:51 msgid "Can" msgstr "Kan" -#: xfree86.xml.in.h:51 +#: xfree86.xml.in.h:52 msgid "Canadian" msgstr "Kanadees" -#: xfree86.xml.in.h:52 +#: xfree86.xml.in.h:53 msgid "Caps Lock key changes group" msgstr "CapsLock-sleutel verander groep" -#: xfree86.xml.in.h:53 +#: xfree86.xml.in.h:54 msgid "CapsLock key behavior" msgstr "CapsLock-sleutelgedrag" -#: xfree86.xml.in.h:54 +#: xfree86.xml.in.h:55 msgid "Caps_Lock LED shows alternative group" msgstr "Caps_Lock LED vertoon alternatiewe groep" -#: xfree86.xml.in.h:55 +#: xfree86.xml.in.h:56 msgid "Cherry Blue Line CyBo@rd" msgstr "Cherry Blue Line CyBo@rd" -#: xfree86.xml.in.h:56 +#: xfree86.xml.in.h:57 msgid "Cherry Blue Line CyBo@rd (alternate option)" msgstr "Cherry Blue Line CyBo@rd (alternatief)" -#: xfree86.xml.in.h:57 +#: xfree86.xml.in.h:58 msgid "Chicony Internet Keyboard" msgstr "Chicony Internetsleutelbord" -#: xfree86.xml.in.h:58 +#: xfree86.xml.in.h:59 msgid "Chicony KB-9885" msgstr "Chicony KB-9885" -#: xfree86.xml.in.h:59 +#: xfree86.xml.in.h:60 msgid "CloGaelach" msgstr "CloGaelach" -#: xfree86.xml.in.h:60 +#: xfree86.xml.in.h:61 msgid "CloGaelach Laptop" msgstr "CloGaelach Skootrekenaar" -#: xfree86.xml.in.h:61 +#: xfree86.xml.in.h:62 msgid "Compaq Easy Access Keyboard" msgstr "Compaq Easy Access Keyboard" -#: xfree86.xml.in.h:62 +#: xfree86.xml.in.h:63 msgid "Compaq Internet Keyboard (13 keys)" msgstr "Compaq Internet Keyboard (13 sleutels)" -#: xfree86.xml.in.h:63 +#: xfree86.xml.in.h:64 msgid "Compaq Internet Keyboard (18 keys)" msgstr "Compaq Internet Keyboard (18 sleutels)" -#: xfree86.xml.in.h:64 +#: xfree86.xml.in.h:65 msgid "Compaq Internet Keyboard (7 keys)" msgstr "Compaq Internet Keyboard (7 sleutels)" -#: xfree86.xml.in.h:65 +#: xfree86.xml.in.h:66 msgid "Compaq iPaq Keyboard" msgstr "Compaq iPaq Keyboard" -#: xfree86.xml.in.h:66 +#: xfree86.xml.in.h:67 msgid "Control Key Position" msgstr "Kontrolesleutel posisie" -#: xfree86.xml.in.h:67 +#: xfree86.xml.in.h:68 msgid "Control key at bottom left" msgstr "Kontrolesleutel links onder" -#: xfree86.xml.in.h:68 +#: xfree86.xml.in.h:69 msgid "Control key at left of 'A'" msgstr "Kontrolesleutel links van 'A'" -#: xfree86.xml.in.h:69 +#: xfree86.xml.in.h:70 msgid "Control+Shift changes group" msgstr "Ctrl+Shift verander groep" -#: xfree86.xml.in.h:70 +#: xfree86.xml.in.h:71 msgid "Croatian" msgstr "Kroaties" -#: xfree86.xml.in.h:71 +#: xfree86.xml.in.h:72 msgid "Cyrillic" msgstr "Kirrillies" -#: xfree86.xml.in.h:72 +#: xfree86.xml.in.h:73 msgid "Cze" msgstr "Cze" -#: xfree86.xml.in.h:73 +#: xfree86.xml.in.h:74 msgid "Czech" msgstr "Tsjeggies" -#: xfree86.xml.in.h:74 +#: xfree86.xml.in.h:75 msgid "Czech (qwerty)" msgstr "Tsjeggies (qwerty)" -#: xfree86.xml.in.h:75 +#: xfree86.xml.in.h:76 +msgid "DTK2000" +msgstr "" + +#: xfree86.xml.in.h:77 msgid "Danish" msgstr "Deens" -#: xfree86.xml.in.h:76 +#: xfree86.xml.in.h:78 msgid "Dead acute" msgstr "Dooie akuutaksent" -#: xfree86.xml.in.h:77 +#: xfree86.xml.in.h:79 msgid "Dead grave acute" msgstr "Dooie gravisaksent" -#: xfree86.xml.in.h:78 +#: xfree86.xml.in.h:80 msgid "Dell" msgstr "Dell" -#: xfree86.xml.in.h:79 +#: xfree86.xml.in.h:81 msgid "Dell 101-key PC" msgstr "Dell 101-key PC" -#: xfree86.xml.in.h:80 +#: xfree86.xml.in.h:82 msgid "Deu" msgstr "Deu" -#: xfree86.xml.in.h:81 +#: xfree86.xml.in.h:83 msgid "Dexxa Wireless Desktop Keyboard" msgstr "Dexxa Wireless Desktop Keyboard" -#: xfree86.xml.in.h:82 +#: xfree86.xml.in.h:84 msgid "Diamond 9801 / 9802 series" msgstr "Diamond 9801 / 9802 series" -#: xfree86.xml.in.h:83 +#: xfree86.xml.in.h:85 msgid "Dnk" msgstr "Dnk" -#: xfree86.xml.in.h:84 +#: xfree86.xml.in.h:86 msgid "Dutch" msgstr "Nederlands" -#: xfree86.xml.in.h:85 +#: xfree86.xml.in.h:87 msgid "Dvo" msgstr "Dvo" -#: xfree86.xml.in.h:86 +#: xfree86.xml.in.h:88 msgid "Dvorak" msgstr "Dvorak" -#: xfree86.xml.in.h:87 +#: xfree86.xml.in.h:89 +msgid "Dzongkha / Tibetan" +msgstr "" + +#: xfree86.xml.in.h:90 msgid "Eliminate dead keys" msgstr "Elimineer dooie sleutels" -#: xfree86.xml.in.h:88 +#: xfree86.xml.in.h:91 msgid "Ennyah DKB-1008" msgstr "Ennyah DKB-1008" -#: xfree86.xml.in.h:89 +#: xfree86.xml.in.h:92 msgid "Esp" msgstr "Esp" -#: xfree86.xml.in.h:90 +#: xfree86.xml.in.h:93 msgid "Est" msgstr "Est" -#: xfree86.xml.in.h:91 +#: xfree86.xml.in.h:94 msgid "Estonian" msgstr "Estoniaans" -#: xfree86.xml.in.h:92 +#: xfree86.xml.in.h:95 msgid "Everex STEPnote" msgstr "Everex STEPnote" -#: xfree86.xml.in.h:93 +#: xfree86.xml.in.h:96 msgid "Extended" msgstr "Uitgebreide" -#: xfree86.xml.in.h:94 +#: xfree86.xml.in.h:97 msgid "Fao" msgstr "Fao" -#: xfree86.xml.in.h:95 +#: xfree86.xml.in.h:98 msgid "Faroese" msgstr "Faroees" -#: xfree86.xml.in.h:96 +#: xfree86.xml.in.h:99 msgid "Farsi" msgstr "Farsi" -#: xfree86.xml.in.h:97 +#: xfree86.xml.in.h:100 msgid "Fin" msgstr "Fin" -#: xfree86.xml.in.h:98 +#: xfree86.xml.in.h:101 msgid "Finnish" msgstr "Fins" -#: xfree86.xml.in.h:99 +#: xfree86.xml.in.h:102 msgid "Fra" msgstr "Fra" -#: xfree86.xml.in.h:100 +#: xfree86.xml.in.h:103 msgid "French" msgstr "Frans" -#: xfree86.xml.in.h:101 +#: xfree86.xml.in.h:104 msgid "French (alternative)" msgstr "Frans (alternatief)" -#: xfree86.xml.in.h:102 +#: xfree86.xml.in.h:105 msgid "French Canadian" msgstr "Franse Kanadees" -#: xfree86.xml.in.h:103 +#: xfree86.xml.in.h:106 msgid "GBr" msgstr "GBr" -#: xfree86.xml.in.h:104 +#: xfree86.xml.in.h:107 msgid "Generic 101-key PC" msgstr "Generies 101-sleutel PC" -#: xfree86.xml.in.h:105 +#: xfree86.xml.in.h:108 msgid "Generic 102-key (Intl) PC" msgstr "Generies 102-sleutel (Intl) PC" -#: xfree86.xml.in.h:106 +#: xfree86.xml.in.h:109 msgid "Generic 104-key PC" msgstr "Generies 104-sleutel PC" -#: xfree86.xml.in.h:107 +#: xfree86.xml.in.h:110 msgid "Generic 105-key (Intl) PC" msgstr "Generies 105-sleutel (Intl) PC" -#: xfree86.xml.in.h:108 +#: xfree86.xml.in.h:111 msgid "Genius Comfy KB-16M / Genius MM Keyboard KWD-910" msgstr "Genius Comfy KB-16M / Genius MM Keyboard KWD-910" -#: xfree86.xml.in.h:109 +#: xfree86.xml.in.h:112 +msgid "Genius Comfy KB-21e-Scroll" +msgstr "" + +#: xfree86.xml.in.h:113 msgid "Geo" msgstr "Geo" -#: xfree86.xml.in.h:110 +#: xfree86.xml.in.h:114 msgid "Georgian (latin)" msgstr "Georgies (latyns)" -#: xfree86.xml.in.h:111 +#: xfree86.xml.in.h:115 msgid "Georgian (russian)" msgstr "Georgies (russies)" -#: xfree86.xml.in.h:112 +#: xfree86.xml.in.h:116 msgid "German" msgstr "Duits" -#: xfree86.xml.in.h:113 +#: xfree86.xml.in.h:117 msgid "Grc" msgstr "Grc" -#: xfree86.xml.in.h:114 +#: xfree86.xml.in.h:118 msgid "Greek" msgstr "Grieks" -#: xfree86.xml.in.h:115 +#: xfree86.xml.in.h:119 msgid "Group Shift/Lock behavior" msgstr "Groep Shift/Lock gedrag" -#: xfree86.xml.in.h:116 +#: xfree86.xml.in.h:120 msgid "Guj" msgstr "Guj" -#: xfree86.xml.in.h:117 +#: xfree86.xml.in.h:121 msgid "Gujarati" msgstr "Gujarati" -#: xfree86.xml.in.h:118 +#: xfree86.xml.in.h:122 msgid "Gurmukhi" msgstr "Gurmukhi" -#: xfree86.xml.in.h:119 +#: xfree86.xml.in.h:123 msgid "Hewlett-Packard Internet Keyboard" msgstr "Hewlett-Packard Internet Keyboard" -#: xfree86.xml.in.h:120 +#: xfree86.xml.in.h:124 msgid "Hewlett-Packard Omnibook 500 FA" msgstr "Hewlett-Packard Omnibook 500 FA" -#: xfree86.xml.in.h:121 +#: xfree86.xml.in.h:125 msgid "Hewlett-Packard Omnibook 5xx" msgstr "Hewlett-Packard Omnibook 5xx" -#: xfree86.xml.in.h:122 +#: xfree86.xml.in.h:126 msgid "Hewlett-Packard Omnibook 6000/6100" msgstr "Hewlett-Packard Omnibook 6000/6100" -#: xfree86.xml.in.h:123 +#: xfree86.xml.in.h:127 msgid "Hewlett-Packard Omnibook XE3 GC" msgstr "Hewlett-Packard Omnibook XE3 GC" -#: xfree86.xml.in.h:124 +#: xfree86.xml.in.h:128 msgid "Hewlett-Packard Omnibook XE3 GF" msgstr "Hewlett-Packard Omnibook XE3 GF" -#: xfree86.xml.in.h:125 +#: xfree86.xml.in.h:129 msgid "Hewlett-Packard Omnibook XT1000" msgstr "Hewlett-Packard Omnibook XT1000" -#: xfree86.xml.in.h:126 +#: xfree86.xml.in.h:130 msgid "Hewlett-Packard Pavilion ZT11xx" msgstr "Hewlett-Packard Pavilion ZT11xx" -#: xfree86.xml.in.h:127 +#: xfree86.xml.in.h:131 msgid "Hewlett-Packard SK-2501 Multimedia Keyboard" msgstr "Hewlett-Packard SK-2501 Multimedia Keyboard" -#: xfree86.xml.in.h:128 +#: xfree86.xml.in.h:132 msgid "Hewlett-Packard SK-2505 Internet Keyboard" msgstr "Hewlett-Packard SK-2505 Internet Keyboard" -#: xfree86.xml.in.h:129 +#: xfree86.xml.in.h:133 msgid "Hin" msgstr "Hin" -#: xfree86.xml.in.h:130 +#: xfree86.xml.in.h:134 msgid "Hindi" msgstr "Hindi" -#: xfree86.xml.in.h:131 +#: xfree86.xml.in.h:135 msgid "Honeywell Euroboard" msgstr "Honeywell Euroboard" -#: xfree86.xml.in.h:132 +#: xfree86.xml.in.h:136 msgid "Hrv" msgstr "Hrv" -#: xfree86.xml.in.h:133 +#: xfree86.xml.in.h:137 msgid "Hun" msgstr "Hun" -#: xfree86.xml.in.h:134 +#: xfree86.xml.in.h:138 msgid "Hungarian" msgstr "Hongaars" -#: xfree86.xml.in.h:135 +#: xfree86.xml.in.h:139 msgid "Hungarian (qwerty)" msgstr "Hongaars (qwerty)" -#: xfree86.xml.in.h:136 +#: xfree86.xml.in.h:140 msgid "Hyper is mapped to the Win-keys." msgstr "Hiper is verbind aan die Win-sleutels." -#: xfree86.xml.in.h:137 +#: xfree86.xml.in.h:141 msgid "IBM Rapid Access" msgstr "IBM Rapid Access" -#: xfree86.xml.in.h:138 +#: xfree86.xml.in.h:142 msgid "IBM Rapid Access II" msgstr "IBM Rapid Access II" -#: xfree86.xml.in.h:139 +#: xfree86.xml.in.h:143 msgid "IBM Rapid Access II (alternate option)" msgstr "IBM Rapid Access II (alternate option)" -#: xfree86.xml.in.h:140 +#: xfree86.xml.in.h:144 msgid "IBM ThinkPad 560Z/600/600E/A22E" msgstr "IBM ThinkPad 560Z/600/600E/A22E" -#: xfree86.xml.in.h:141 +#: xfree86.xml.in.h:145 msgid "INSCRIPT layout" msgstr "INSCRIPT-uitleg" -#: xfree86.xml.in.h:142 +#: xfree86.xml.in.h:146 msgid "IS434" msgstr "IS434" -#: xfree86.xml.in.h:143 +#: xfree86.xml.in.h:147 msgid "IS434 laptop" msgstr "IS434 laptop" -#: xfree86.xml.in.h:144 +#: xfree86.xml.in.h:148 msgid "ISO Alternate" msgstr "ISO Alternatief" -#: xfree86.xml.in.h:145 +#: xfree86.xml.in.h:149 msgid "Icelandic" msgstr "Yslandies" -#: xfree86.xml.in.h:146 +#: xfree86.xml.in.h:150 msgid "Iku" msgstr "Iku" -#: xfree86.xml.in.h:147 +#: xfree86.xml.in.h:151 +msgid "International (with dead keys)" +msgstr "" + +#: xfree86.xml.in.h:152 msgid "Inuktitut" msgstr "Inuktitut" -#: xfree86.xml.in.h:148 +#: xfree86.xml.in.h:153 msgid "Irish" msgstr "Iers" -#: xfree86.xml.in.h:149 +#: xfree86.xml.in.h:154 msgid "Irl" msgstr "Irl" -#: xfree86.xml.in.h:150 +#: xfree86.xml.in.h:155 msgid "Irn" msgstr "Irn" -#: xfree86.xml.in.h:151 +#: xfree86.xml.in.h:156 msgid "Isl" msgstr "Isl" -#: xfree86.xml.in.h:152 +#: xfree86.xml.in.h:157 msgid "Isr" msgstr "Isr" -#: xfree86.xml.in.h:153 +#: xfree86.xml.in.h:158 msgid "Israeli" msgstr "Israelies" -#: xfree86.xml.in.h:154 +#: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Israelies" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:155 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Italiaans" -#: xfree86.xml.in.h:156 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japanees" -#: xfree86.xml.in.h:157 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japanees 106-sleutel" -#: xfree86.xml.in.h:158 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:159 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kannada" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:168 +#, fuzzy +msgid "Kor" +msgstr "Nor" + +#: xfree86.xml.in.h:169 +#, fuzzy +msgid "Korean" +msgstr "Noorweegs" + +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Skootrekenaar" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latyns" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latyns Amerika" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Latvies" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Linkerkant Alt-sleutel verander groep" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:179 +#, fuzzy +msgid "Left Alt key switches group while pressed" +msgstr "Linkerkant Win-sleutel wissel groep terwyl gedruk" + +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Linkerkant Ctrl-sleutel verander groep" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Linkerkant Shift-sleutel verander groep" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Linkerkant Win-sleutel verander groep" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Linkerkant Win-sleutel wissel groep terwyl gedruk" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Lithuaniese azerty standaard" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Lithuanian qwerty \"numeries\"" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:186 +#, fuzzy +msgid "Logitech Access Keyboard" +msgstr "Logitech Deluxe Access Keyboard" + +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (alternatiewe opsie)" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (alternatiewe opsie2)" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Internet Keyboard" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator Keyboard" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (model Y-RB6)" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch keyboard Internet Navigator" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Masedonies" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh (oud)" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Maak CapsLock 'n adisionele Kontrole" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malayalam" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Maltees" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltese (VSA-uitleg)" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access Keyboard" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Kieslys-sleutel is Komponeer" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Kieslyssleutel verander groep" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta is verbind aan die Win-sleutels." -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta is verbind aan die linkerkantste Win-sleutel." -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Internetsleutelbord" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, Sweeds" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natuurlik" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office sleutelbord" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:224 +#, fuzzy +msgid "Microsoft Wireless Multimedia Keyboard 1.0A" +msgstr "Microsoft Internetsleutelbord" + +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Verskeie versoenbaarheid-opsies" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Mongolees" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Noordelike Saami (Finland)" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Noordelike Saami (Noorwe)" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Noordelike Saami (Swede)" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Noorweegs" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Num_Lock LED vertoon alternatiewe groep" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Ogham" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:241 +#, fuzzy +msgid "Old standard" +msgstr "Standaard" + +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet keyboard" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx Reeks" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Foneties" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Pools" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Pools (qwertz)" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:252 +msgid "Polish with Polish quotes on key \"1/!\"" +msgstr "" + +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytonic" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portugees" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:256 +#, fuzzy +msgid "Press Left Alt key to choose 3rd level" +msgstr "Druk Linkerkantste Win-sleutel om die 3de vlak te kies" + +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Druk Linkerkantste Win-sleutel om die 3de vlak te kies" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Druk Kieslys-sleutel om die 3de vlak te kies" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:259 +#, fuzzy +msgid "Press Right Alt key to choose 3rd level" +msgstr "Druk Regterkantste Win-sleutel om die 3de vlak te kies" + +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Druk Regterkantste Ctrl-sleutel om die 3de vlak te kies" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Druk Regterkantste Win-sleutel om die 3de vlak te kies" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:262 +#, fuzzy +msgid "Press any of Alt keys to choose 3rd level" +msgstr "Druk enige van die Win-sleutels om die 3de vlak te kies" + +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Druk enige van die Win-sleutels om die 3de vlak te kies" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "R-Alt wissel die groep terwyl gedruk" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Regterkant Alt is Komponeer" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Regterkant Alt-sleutel verander groep" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Regterkant Ctrl-sleutel werk soos Regterkant Alt" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Regterkant Ctrl-sleutel verander groep" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Regterkant Shift-sleutel verander groep" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Regterkant Win-sleutel verander groep" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Regterkant Win-sleutel is Komponeer" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Regterkant Win-sleutel skakel groep terwyl gedruk" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Romeens" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Russies" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Scroll_Lock LED wys alternatiewe groep" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Serbies" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:291 +msgid "Serbian Cyrillic (swap Zhe, Ze)" +msgstr "" + +#: xfree86.xml.in.h:292 +msgid "Serbian Latin (swap Y, Z)" +msgstr "" + +#: xfree86.xml.in.h:293 +msgid "Serbian Latin Unicode" +msgstr "" + +#: xfree86.xml.in.h:294 +msgid "Serbian Latin Unicode (swap ZHE, Z)" +msgstr "" + +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Shift met numeriese sleutels werk soos in MS Windows" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:296 +#, fuzzy +msgid "Shift+CapsLock changes group" +msgstr "CapsLock-sleutel verander groep" + +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slovaaks" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slovaaks (qwerty)" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Sloveens" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Spaans" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." -msgstr "Spesiale sleutels (Ctrl+Alt+<sleutel>) word hanteer in 'n bediener." +msgstr "" +"Spesiale sleutels (Ctrl+Alt+<sleutel>) word hanteer in 'n bediener." -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standaard" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun (dooie sleutels)" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super is verbind aan die Win-sleutels (verstek)." -#: xfree86.xml.in.h:285 -msgid "Sv" -msgstr "Sv" - -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Ruil Ctrl en CapsLock om" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Swe" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Sweeds" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Switserse Frans" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Switserse Duits" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Siries" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Foneties" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tajikees" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamilees" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugu" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Thai (Kedmanee)" -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Thai (Pattachote)" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Thai (TIS-820.2538)" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Derdevlak kiesers" -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access Keyboard" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Turks" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Turks (F)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Turks Alt-Q-uitleg" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "VSA Engels" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "VSA Engels met ISO9995-3" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "VSA Engels met dooie sleutels" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:338 msgid "US" msgstr "VSA" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "VSA sleutelbord met Romeense letters" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "VSA" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukranies" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Vereenigde Koninkryk" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Gebruik sleutelbord LED om alternatiewe groep te wys" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Gebruik interne bokas. Shift kanseleer Caps." -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Gebruik interne bokas. Shift kanseleer nie Caps nie." -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Uzbek" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vitnamees" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Winkeys" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:354 +#, fuzzy +msgid "With Malayalam digits" +msgstr "Malayalam" + +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Internetsleutelbord" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Joegoslaafs" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/syfers" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "syfers" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/komma" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/dot" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/komma" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/dot" -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/komma" -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/dot" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/komma" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/dot" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "skootrekenaar" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/syfers" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/komma" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/dot" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/komma" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/dot" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/komma" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/dot" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/comma" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/dot" + +#~ msgid "Sv" +#~ msgstr "Sv" @@ -7,7 +7,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml-4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2003-11-25 23:38+0000\n" +"POT-Creation-Date: 2004-04-04 02:44+0100\n" "PO-Revision-Date: 2004-03-21 20:00+0200\n" "Last-Translator: Metin Amiroff <metin@karegen.com>\n" "Language-Team: Azerbaijani <translation-team-az@lists.sourceforge.net>\n" @@ -109,1357 +109,1463 @@ msgid "Azerbaijani" msgstr "Azərbaycanca" #: xfree86.xml.in.h:24 +#, fuzzy +msgid "Azona RF2300 wireless Internet Keyboard" +msgstr "Logitech Internet Keyboard" + +#: xfree86.xml.in.h:25 msgid "BTC 5090" msgstr "BTC 5090" -#: xfree86.xml.in.h:25 +#: xfree86.xml.in.h:26 msgid "BTC 5113RF Multimedia" msgstr "BTC 5113RF Multimedia" -#: xfree86.xml.in.h:26 +#: xfree86.xml.in.h:27 msgid "BTC 5126T" msgstr "BTC 5126T" -#: xfree86.xml.in.h:27 +#: xfree86.xml.in.h:28 msgid "BTC 9000" msgstr "BTC 9000" -#: xfree86.xml.in.h:28 +#: xfree86.xml.in.h:29 msgid "BTC 9000A" msgstr "BTC 9000A" -#: xfree86.xml.in.h:29 +#: xfree86.xml.in.h:30 msgid "BTC 9001AH" msgstr "BTC 9001AH" -#: xfree86.xml.in.h:30 +#: xfree86.xml.in.h:31 msgid "Basic" msgstr "Əsas" -#: xfree86.xml.in.h:31 +#: xfree86.xml.in.h:32 msgid "Bel" msgstr "Bel" -#: xfree86.xml.in.h:32 +#: xfree86.xml.in.h:33 msgid "Belarusian" msgstr "Belarusca" -#: xfree86.xml.in.h:33 +#: xfree86.xml.in.h:34 msgid "Belgian" msgstr "Belçikaca" -#: xfree86.xml.in.h:34 +#: xfree86.xml.in.h:35 msgid "Ben" msgstr "Ben" -#: xfree86.xml.in.h:35 +#: xfree86.xml.in.h:36 msgid "Bengali" msgstr "Benqalca" -#: xfree86.xml.in.h:36 +#: xfree86.xml.in.h:37 msgid "Bgr" msgstr "Bgr" -#: xfree86.xml.in.h:37 +#: xfree86.xml.in.h:38 msgid "Bih" msgstr "Bih" -#: xfree86.xml.in.h:38 +#: xfree86.xml.in.h:39 msgid "Blr" msgstr "Blr" -#: xfree86.xml.in.h:39 +#: xfree86.xml.in.h:40 msgid "Bosnian" msgstr "Bosniyaca" -#: xfree86.xml.in.h:40 +#: xfree86.xml.in.h:41 msgid "Both Alt keys together change group" msgstr "İki Alt düyməsi də bərabər qrupu dəyişdirir" -#: xfree86.xml.in.h:41 +#: xfree86.xml.in.h:42 msgid "Both Ctrl keys together change group" msgstr "İki Ctrl düyməsi də bərabər qrupu dəyişdirir" -#: xfree86.xml.in.h:42 +#: xfree86.xml.in.h:43 msgid "Both Shift keys together change group" msgstr "Hər iki Shift düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:43 +#: xfree86.xml.in.h:44 msgid "Both Win-keys switch group while pressed" msgstr "İki Win düyməsi də basılı olduğu müddətcə qrupu dəyişdirir" -#: xfree86.xml.in.h:44 +#: xfree86.xml.in.h:45 msgid "Bra" msgstr "Bra" -#: xfree86.xml.in.h:45 +#: xfree86.xml.in.h:46 msgid "Brazilian" msgstr "Brazilya düzülüşü" -#: xfree86.xml.in.h:46 +#: xfree86.xml.in.h:47 msgid "Brazilian ABNT2" msgstr "Brazilya düzülüşü ABNT2" -#: xfree86.xml.in.h:47 +#: xfree86.xml.in.h:48 msgid "Brother Internet Keyboard" msgstr "Brother Internet Keyboard" -#: xfree86.xml.in.h:48 +#: xfree86.xml.in.h:49 msgid "Bulgarian" msgstr "Bolqarca" -#: xfree86.xml.in.h:49 +#: xfree86.xml.in.h:50 msgid "Burmese" msgstr "Burmaca" -#: xfree86.xml.in.h:50 +#: xfree86.xml.in.h:51 msgid "Can" msgstr "Kan" -#: xfree86.xml.in.h:51 +#: xfree86.xml.in.h:52 msgid "Canadian" msgstr "Kanada düzülüşü" -#: xfree86.xml.in.h:52 +#: xfree86.xml.in.h:53 msgid "Caps Lock key changes group" msgstr "Caps Lock düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:53 +#: xfree86.xml.in.h:54 msgid "CapsLock key behavior" msgstr "CapsLock düyməsinin davranışı" -#: xfree86.xml.in.h:54 +#: xfree86.xml.in.h:55 msgid "Caps_Lock LED shows alternative group" msgstr "Caps_Lock LED-ləri alternativ qrupları göstərir" -#: xfree86.xml.in.h:55 +#: xfree86.xml.in.h:56 msgid "Cherry Blue Line CyBo@rd" msgstr "Cherry Blue Line CyBo@rd" -#: xfree86.xml.in.h:56 +#: xfree86.xml.in.h:57 msgid "Cherry Blue Line CyBo@rd (alternate option)" msgstr "Cherry Blue Line CyBo@rd (alternate option)" -#: xfree86.xml.in.h:57 +#: xfree86.xml.in.h:58 msgid "Chicony Internet Keyboard" msgstr "Chicony Internet Keyboard" -#: xfree86.xml.in.h:58 +#: xfree86.xml.in.h:59 msgid "Chicony KB-9885" msgstr "Chicony KB-9885" -#: xfree86.xml.in.h:59 +#: xfree86.xml.in.h:60 msgid "CloGaelach" msgstr "CloGaelach" -#: xfree86.xml.in.h:60 +#: xfree86.xml.in.h:61 msgid "CloGaelach Laptop" msgstr "CloGaelach Laptop" -#: xfree86.xml.in.h:61 +#: xfree86.xml.in.h:62 msgid "Compaq Easy Access Keyboard" msgstr "Compaq Easy Access Keyboard" -#: xfree86.xml.in.h:62 +#: xfree86.xml.in.h:63 msgid "Compaq Internet Keyboard (13 keys)" msgstr "Compaq Internet Keyboard (13 düymə)" -#: xfree86.xml.in.h:63 +#: xfree86.xml.in.h:64 msgid "Compaq Internet Keyboard (18 keys)" msgstr "Compaq Internet Keyboard (18 düymə)" -#: xfree86.xml.in.h:64 +#: xfree86.xml.in.h:65 msgid "Compaq Internet Keyboard (7 keys)" msgstr "Compaq Internet Keyboard (7 düymə)" -#: xfree86.xml.in.h:65 +#: xfree86.xml.in.h:66 msgid "Compaq iPaq Keyboard" msgstr "Compaq iPaq Keyboard" -#: xfree86.xml.in.h:66 +#: xfree86.xml.in.h:67 msgid "Control Key Position" msgstr "Control Düyməsinin Yeri" -#: xfree86.xml.in.h:67 +#: xfree86.xml.in.h:68 msgid "Control key at bottom left" msgstr "Control düyməsi sol altda" -#: xfree86.xml.in.h:68 +#: xfree86.xml.in.h:69 msgid "Control key at left of 'A'" msgstr "Control düyməsi 'A' hərfinin solunda" -#: xfree86.xml.in.h:69 +#: xfree86.xml.in.h:70 msgid "Control+Shift changes group" msgstr "Control+Shift düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:70 +#: xfree86.xml.in.h:71 msgid "Croatian" msgstr "Xorvatca" -#: xfree86.xml.in.h:71 +#: xfree86.xml.in.h:72 msgid "Cyrillic" msgstr "Kiril" -#: xfree86.xml.in.h:72 +#: xfree86.xml.in.h:73 msgid "Cze" msgstr "Çex" -#: xfree86.xml.in.h:73 +#: xfree86.xml.in.h:74 msgid "Czech" msgstr "Çexcə" -#: xfree86.xml.in.h:74 +#: xfree86.xml.in.h:75 msgid "Czech (qwerty)" msgstr "Çexcə (qwerty)" -#: xfree86.xml.in.h:75 +#: xfree86.xml.in.h:76 +msgid "DTK2000" +msgstr "" + +#: xfree86.xml.in.h:77 msgid "Danish" msgstr "Danimarkaca" -#: xfree86.xml.in.h:76 +#: xfree86.xml.in.h:78 msgid "Dead acute" msgstr "Dead acute" -#: xfree86.xml.in.h:77 +#: xfree86.xml.in.h:79 msgid "Dead grave acute" msgstr "Dead grave acute" -#: xfree86.xml.in.h:78 +#: xfree86.xml.in.h:80 msgid "Dell" msgstr "Dell" -#: xfree86.xml.in.h:79 +#: xfree86.xml.in.h:81 msgid "Dell 101-key PC" msgstr "Dell 101-key PC" -#: xfree86.xml.in.h:80 +#: xfree86.xml.in.h:82 msgid "Deu" msgstr "Deu" -#: xfree86.xml.in.h:81 +#: xfree86.xml.in.h:83 msgid "Dexxa Wireless Desktop Keyboard" msgstr "Dexxa Wireless Desktop Keyboard" -#: xfree86.xml.in.h:82 +#: xfree86.xml.in.h:84 msgid "Diamond 9801 / 9802 series" msgstr "Diamond 9801 / 9802 seryaları" -#: xfree86.xml.in.h:83 +#: xfree86.xml.in.h:85 msgid "Dnk" msgstr "Dnk" -#: xfree86.xml.in.h:84 +#: xfree86.xml.in.h:86 msgid "Dutch" msgstr "Niderlandca" -#: xfree86.xml.in.h:85 +#: xfree86.xml.in.h:87 msgid "Dvo" msgstr "Dvo" -#: xfree86.xml.in.h:86 +#: xfree86.xml.in.h:88 msgid "Dvorak" msgstr "Dvorak" -#: xfree86.xml.in.h:87 +#: xfree86.xml.in.h:89 +msgid "Dzongkha / Tibetan" +msgstr "" + +#: xfree86.xml.in.h:90 msgid "Eliminate dead keys" msgstr "Ölü düymələri sayma" -#: xfree86.xml.in.h:88 +#: xfree86.xml.in.h:91 msgid "Ennyah DKB-1008" msgstr "Ennyah DKB-1008" -#: xfree86.xml.in.h:89 +#: xfree86.xml.in.h:92 msgid "Esp" msgstr "İsp" -#: xfree86.xml.in.h:90 +#: xfree86.xml.in.h:93 msgid "Est" msgstr "Est" -#: xfree86.xml.in.h:91 +#: xfree86.xml.in.h:94 msgid "Estonian" msgstr "Estonca" -#: xfree86.xml.in.h:92 +#: xfree86.xml.in.h:95 msgid "Everex STEPnote" msgstr "Everex STEPnote" -#: xfree86.xml.in.h:93 +#: xfree86.xml.in.h:96 msgid "Extended" msgstr "Uzadılmış" -#: xfree86.xml.in.h:94 +#: xfree86.xml.in.h:97 msgid "Fao" msgstr "Fao" -#: xfree86.xml.in.h:95 +#: xfree86.xml.in.h:98 msgid "Faroese" msgstr "Faroescə" -#: xfree86.xml.in.h:96 +#: xfree86.xml.in.h:99 msgid "Farsi" msgstr "Farsca" -#: xfree86.xml.in.h:97 +#: xfree86.xml.in.h:100 msgid "Fin" msgstr "Fin" -#: xfree86.xml.in.h:98 +#: xfree86.xml.in.h:101 msgid "Finnish" msgstr "Fincə" -#: xfree86.xml.in.h:99 +#: xfree86.xml.in.h:102 msgid "Fra" msgstr "Fra" -#: xfree86.xml.in.h:100 +#: xfree86.xml.in.h:103 msgid "French" msgstr "Fransızca" -#: xfree86.xml.in.h:101 +#: xfree86.xml.in.h:104 msgid "French (alternative)" msgstr "Fransızca (alternativ)" -#: xfree86.xml.in.h:102 +#: xfree86.xml.in.h:105 msgid "French Canadian" msgstr "Kanada Fransızcası" -#: xfree86.xml.in.h:103 +#: xfree86.xml.in.h:106 msgid "GBr" msgstr "GBr" -#: xfree86.xml.in.h:104 +#: xfree86.xml.in.h:107 msgid "Generic 101-key PC" msgstr "Generic 101-key PC" -#: xfree86.xml.in.h:105 +#: xfree86.xml.in.h:108 msgid "Generic 102-key (Intl) PC" msgstr "Generic 102-key (Intl) PC" -#: xfree86.xml.in.h:106 +#: xfree86.xml.in.h:109 msgid "Generic 104-key PC" msgstr "Generic 104-key PC" -#: xfree86.xml.in.h:107 +#: xfree86.xml.in.h:110 msgid "Generic 105-key (Intl) PC" msgstr "Generic 105-key (Intl) PC" -#: xfree86.xml.in.h:108 +#: xfree86.xml.in.h:111 msgid "Genius Comfy KB-16M / Genius MM Keyboard KWD-910" msgstr "Genius Comfy KB-16M / Genius MM Keyboard KWD-910" -#: xfree86.xml.in.h:109 +#: xfree86.xml.in.h:112 +msgid "Genius Comfy KB-21e-Scroll" +msgstr "" + +#: xfree86.xml.in.h:113 msgid "Geo" msgstr "Gür" -#: xfree86.xml.in.h:110 +#: xfree86.xml.in.h:114 msgid "Georgian (latin)" msgstr "Gürcücə (latın)" -#: xfree86.xml.in.h:111 +#: xfree86.xml.in.h:115 msgid "Georgian (russian)" msgstr "Gürcücə (kiril)" -#: xfree86.xml.in.h:112 +#: xfree86.xml.in.h:116 msgid "German" msgstr "Almaca" -#: xfree86.xml.in.h:113 +#: xfree86.xml.in.h:117 msgid "Grc" msgstr "Yun" -#: xfree86.xml.in.h:114 +#: xfree86.xml.in.h:118 msgid "Greek" msgstr "Yunanca" -#: xfree86.xml.in.h:115 +#: xfree86.xml.in.h:119 msgid "Group Shift/Lock behavior" msgstr "Shift/Lock Qrupu Davranışı" -#: xfree86.xml.in.h:116 +#: xfree86.xml.in.h:120 msgid "Guj" msgstr "Guj" -#: xfree86.xml.in.h:117 +#: xfree86.xml.in.h:121 msgid "Gujarati" msgstr "Gujaraticə" -#: xfree86.xml.in.h:118 +#: xfree86.xml.in.h:122 msgid "Gurmukhi" msgstr "Gurmukhi" -#: xfree86.xml.in.h:119 +#: xfree86.xml.in.h:123 msgid "Hewlett-Packard Internet Keyboard" msgstr "Hewlett-Packard Internet Keyboard" -#: xfree86.xml.in.h:120 +#: xfree86.xml.in.h:124 msgid "Hewlett-Packard Omnibook 500 FA" msgstr "Hewlett-Packard Omnibook 500 FA" -#: xfree86.xml.in.h:121 +#: xfree86.xml.in.h:125 msgid "Hewlett-Packard Omnibook 5xx" msgstr "Hewlett-Packard Omnibook 5xx" -#: xfree86.xml.in.h:122 +#: xfree86.xml.in.h:126 msgid "Hewlett-Packard Omnibook 6000/6100" msgstr "Hewlett-Packard Omnibook 6000/6100" -#: xfree86.xml.in.h:123 +#: xfree86.xml.in.h:127 msgid "Hewlett-Packard Omnibook XE3 GC" msgstr "Hewlett-Packard Omnibook XE3 GC" -#: xfree86.xml.in.h:124 +#: xfree86.xml.in.h:128 msgid "Hewlett-Packard Omnibook XE3 GF" msgstr "Hewlett-Packard Omnibook XE3 GF" -#: xfree86.xml.in.h:125 +#: xfree86.xml.in.h:129 msgid "Hewlett-Packard Omnibook XT1000" msgstr "Hewlett-Packard Omnibook XT1000" -#: xfree86.xml.in.h:126 +#: xfree86.xml.in.h:130 msgid "Hewlett-Packard Pavilion ZT11xx" msgstr "Hewlett-Packard Pavilion ZT11xx" -#: xfree86.xml.in.h:127 +#: xfree86.xml.in.h:131 msgid "Hewlett-Packard SK-2501 Multimedia Keyboard" msgstr "Hewlett-Packard SK-2501 Multimedia Keyboard" -#: xfree86.xml.in.h:128 +#: xfree86.xml.in.h:132 msgid "Hewlett-Packard SK-2505 Internet Keyboard" msgstr "Hewlett-Packard SK-2505 Internet Keyboard" -#: xfree86.xml.in.h:129 +#: xfree86.xml.in.h:133 msgid "Hin" msgstr "Hin" -#: xfree86.xml.in.h:130 +#: xfree86.xml.in.h:134 msgid "Hindi" msgstr "Hindi" -#: xfree86.xml.in.h:131 +#: xfree86.xml.in.h:135 msgid "Honeywell Euroboard" msgstr "Honeywell Euroboard" -#: xfree86.xml.in.h:132 +#: xfree86.xml.in.h:136 msgid "Hrv" msgstr "Xrv" -#: xfree86.xml.in.h:133 +#: xfree86.xml.in.h:137 msgid "Hun" msgstr "Mac" -#: xfree86.xml.in.h:134 +#: xfree86.xml.in.h:138 msgid "Hungarian" msgstr "Macarca" -#: xfree86.xml.in.h:135 +#: xfree86.xml.in.h:139 msgid "Hungarian (qwerty)" msgstr "Macarca (qwerty)" -#: xfree86.xml.in.h:136 +#: xfree86.xml.in.h:140 msgid "Hyper is mapped to the Win-keys." msgstr "Hyper Win düymələrinə xəritələnib." -#: xfree86.xml.in.h:137 +#: xfree86.xml.in.h:141 msgid "IBM Rapid Access" msgstr "IBM Rapid Access" -#: xfree86.xml.in.h:138 +#: xfree86.xml.in.h:142 msgid "IBM Rapid Access II" msgstr "IBM Rapid Access II" -#: xfree86.xml.in.h:139 +#: xfree86.xml.in.h:143 msgid "IBM Rapid Access II (alternate option)" msgstr "IBM Rapid Access II (alternate option)" -#: xfree86.xml.in.h:140 +#: xfree86.xml.in.h:144 msgid "IBM ThinkPad 560Z/600/600E/A22E" msgstr "IBM ThinkPad 560Z/600/600E/A22E" -#: xfree86.xml.in.h:141 +#: xfree86.xml.in.h:145 msgid "INSCRIPT layout" msgstr "INSCRIPT düzülüşü" -#: xfree86.xml.in.h:142 +#: xfree86.xml.in.h:146 msgid "IS434" msgstr "IS434" -#: xfree86.xml.in.h:143 +#: xfree86.xml.in.h:147 msgid "IS434 laptop" msgstr "IS434 laptop" -#: xfree86.xml.in.h:144 +#: xfree86.xml.in.h:148 msgid "ISO Alternate" msgstr "ISO Alternate" -#: xfree86.xml.in.h:145 +#: xfree86.xml.in.h:149 msgid "Icelandic" msgstr "Icelandic" -#: xfree86.xml.in.h:146 +#: xfree86.xml.in.h:150 msgid "Iku" msgstr "İku" -#: xfree86.xml.in.h:147 +#: xfree86.xml.in.h:151 +msgid "International (with dead keys)" +msgstr "" + +#: xfree86.xml.in.h:152 msgid "Inuktitut" msgstr "İnuktitut" -#: xfree86.xml.in.h:148 +#: xfree86.xml.in.h:153 msgid "Irish" msgstr "İrlandca" -#: xfree86.xml.in.h:149 +#: xfree86.xml.in.h:154 msgid "Irl" msgstr "İrl" -#: xfree86.xml.in.h:150 +#: xfree86.xml.in.h:155 msgid "Irn" msgstr "İrn" -#: xfree86.xml.in.h:151 +#: xfree86.xml.in.h:156 msgid "Isl" msgstr "İsl" -#: xfree86.xml.in.h:152 +#: xfree86.xml.in.h:157 msgid "Isr" msgstr "İsr" -#: xfree86.xml.in.h:153 +#: xfree86.xml.in.h:158 msgid "Israeli" msgstr "Yəhudicə" -#: xfree86.xml.in.h:154 +#: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Yəhudicə" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "İta" -#: xfree86.xml.in.h:155 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "İtalyanca" -#: xfree86.xml.in.h:156 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Yaponca" -#: xfree86.xml.in.h:157 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Yaponca 106-düymə" -#: xfree86.xml.in.h:158 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Ypn" -#: xfree86.xml.in.h:159 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kannada" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:168 +#, fuzzy +msgid "Kor" +msgstr "Nor" + +#: xfree86.xml.in.h:169 +#, fuzzy +msgid "Korean" +msgstr "Norveçcə" + +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Laptop" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Laptop/notebook Compaq (məs. Armada) Laptop Klaviaturası" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Laptop/notebook Compaq (məs. Presario) İnternet Klaviaturası" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latın" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latın Amerika" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Latışca" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Sol Alt düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:179 +#, fuzzy +msgid "Left Alt key switches group while pressed" +msgstr "Sol Win düyməsi basılı olduğu müddətcə qrupu dəyişdirir" + +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Sol Ctrl düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Sol Shift düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Sol Win düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Sol Win düyməsi basılı olduğu müddətcə qrupu dəyişdirir" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Litovca azerty standart" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Litovca qwerty \"numeric\"" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:186 +#, fuzzy +msgid "Logitech Access Keyboard" +msgstr "Logitech Deluxe Access Keyboard" + +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (alternate option)" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (alternate option2)" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Internet Keyboard" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator Keyboard" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (model Y-RB6)" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch keyboard Internet Navigator" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Makedonca" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh Old" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "CapsLock düyməsini əlavə idarə olaraq tə'yin et" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malayalamca" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Maltaca" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltaca (ABŞ düzülüşü)" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access Keyboard" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Menyu yazma düyməsidir" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Menü düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta Win düymələrinə xəritələnib." -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta sol Win düyməsinə xəritələnib." -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, Swedish" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office Keyboard" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:224 +#, fuzzy +msgid "Microsoft Wireless Multimedia Keyboard 1.0A" +msgstr "Microsoft Internet Keyboard" + +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Müxtəlif yetişmə qabiliyyəti seçimləri" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Monqolca" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Şimali Saami (Finlandiya)" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Şimali Saami (Norveç)" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Şimali Saami (İsveç)" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Norveçcə" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Num_Lock LED-ləri alternativ qrupları göstərir" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Ogham" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:241 +#, fuzzy +msgid "Old standard" +msgstr "Standart" + +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet keyboard" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx Seriyaları" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Fonetik" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Polyakca" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Polyakca (qwertz)" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:252 +msgid "Polish with Polish quotes on key \"1/!\"" +msgstr "" + +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Politonik" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portuqalca" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:256 +#, fuzzy +msgid "Press Left Alt key to choose 3rd level" +msgstr "3-cü səviyyəni seçmək üçün sol Win düyməsinə basılsın" + +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "3-cü səviyyəni seçmək üçün sol Win düyməsinə basılsın" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "3-cü səviyyəni seçmək üçün sağ menyuya basılsın" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:259 +#, fuzzy +msgid "Press Right Alt key to choose 3rd level" +msgstr "3-cü səviyyəni seçmək üçün sağ Win düyməsinə basılsın" + +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "3-cü səviyyəni seçmək üçün sağ Control düyməsinə basılsın" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "3-cü səviyyəni seçmək üçün sağ Win düyməsinə basılsın" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:262 +#, fuzzy +msgid "Press any of Alt keys to choose 3rd level" +msgstr "3-cü səviyyəni seçmək üçün hər hansı bir Win düyməsinə basılsın" + +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "3-cü səviyyəni seçmək üçün hər hansı bir Win düyməsinə basılsın" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "R-Alt basılı olduğu müddətcə qrupu dəyişdirir" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Sağ Alt düyməsi yazma düyməsidir" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Sağ Alt düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Sağ Control düyməsi sağ Alt kimi işləyir" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Sağ Ctrl düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Sağ Shift düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Sağ Win düyməsi qrupu dəyişdirir" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Sağ Win düyməsi yazma düyməsidir" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Sağ Win düyməsi basılı olduğu müddətcə qrupu dəyişdirir" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Rumınca" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Rusca" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Scroll_Lock LED-ləri alternativ qrupları göstərir" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Servcə" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:291 +msgid "Serbian Cyrillic (swap Zhe, Ze)" +msgstr "" + +#: xfree86.xml.in.h:292 +msgid "Serbian Latin (swap Y, Z)" +msgstr "" + +#: xfree86.xml.in.h:293 +msgid "Serbian Latin Unicode" +msgstr "" + +#: xfree86.xml.in.h:294 +msgid "Serbian Latin Unicode (swap ZHE, Z)" +msgstr "" + +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Ədəd düymələrində Shift MS Windows-dakı kimi işləyir" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:296 +#, fuzzy +msgid "Shift+CapsLock changes group" +msgstr "Caps Lock düyməsi qrupu dəyişdirir" + +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slovakca" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slovakca (qwerty)" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Slovencə" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "İspanca" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." -msgstr "Xüsusi düymələr (Ctrl+Alt+<düyməsi>) verici tərəfindən idarə edilsin." +msgstr "" +"Xüsusi düymələr (Ctrl+Alt+<düyməsi>) verici tərəfindən idarə edilsin." -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standart" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun ölü düymələr" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super Win düymələrinə xəritələnib (ön qurğulu)." -#: xfree86.xml.in.h:285 -msgid "Sv" -msgstr "Sv" - -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Control və Caps Lock arasında dəyiş" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Swe" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "İsveçcə" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "İsveçrə Fransızcası" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "İsveçrə Almancası" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Syriac" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Fonetik" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tacikcə" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamilcə" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugu" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tay" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Tayca (Kedmanee)" -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Tayca (Pattachote)" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Tayca (TIS-820.2538)" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Üçüncü səviyyə seçicilər" -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tac" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access Keyboard" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tür" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Türkcə" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Türkcə (F)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Türkcə Alt-Q Düzülüşü" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "A.B.Ş. İngiliscəsi" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "A.B.Ş. İngiliscəsi və/ ISO9995-3" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "A.B.Ş. İngiliscəsi və/ ölü düymələr" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:338 msgid "US" msgstr "ABŞ" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "Roman hərfli ABŞ klaviaturası" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "ABŞ" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukraynaca" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Birləşik Krallıq" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Alternativ qrupu göstərmək üçün klaviatura LED-ini işlət" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Daxili kapitalizasiya işlədir. Shift Caps-i ləğv edir." -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Daxili kapitalizasiya işlədir. Shift Caps-i ləğv etmir." -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Özb" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Özbəkcə" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vyetnamca" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vye" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Winkeys" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:354 +#, fuzzy +msgid "With Malayalam digits" +msgstr "Malayalamca" + +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Internet Keyboard" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Yugoslavca" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/ədədlər" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "ədədlər" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/vergül" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/nöqtə" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/vergül" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "2/101/qwertz/nöqtə" -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/vergül" -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/nöqtə" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/vergül" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/nöqtə" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "laptop" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/ədədlər" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/vergül" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/nöqtə" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/vergül" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/nöqtə" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/vergül" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/nöqtə" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/vergül" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/nöqtə" + +#~ msgid "Sv" +#~ msgstr "Sv" @@ -7,7 +7,7 @@ msgid "" msgstr "" "Project-Id-Version: 0.3.1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2002-12-10 19:52+0200\n" "Last-Translator: Alexander Shopov <al_shopov@web.bg>\n" "Language-Team: Bulgarian <dict@linux.zonebg.com>\n" @@ -672,941 +672,951 @@ msgid "Israeli" msgstr "израелска" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "израелска" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "италианска" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "японска" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "японска 106 клавишна" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 #, fuzzy msgid "Kannada" msgstr "канадска" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 msgid "Kor" msgstr "" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "норвежка" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 #, fuzzy msgid "Latin" msgstr "латвийска" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "латиноамериканска" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "латвийска" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 #, fuzzy msgid "Left Alt key changes group" msgstr "Десният Alt сменя групата" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "Левият Win клавиш сменя групата докато е натиснат" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 #, fuzzy msgid "Left Ctrl key changes group" msgstr "Левият Win клавиш сменя групата" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 #, fuzzy msgid "Left Shift key changes group" msgstr "Левият Win клавиш сменя групата" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Левият Win клавиш сменя групата" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Левият Win клавиш сменя групата докато е натиснат" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "литовска стандартна azerty" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "литовска \"цифрова\" qwerty" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Интернет клавиатура" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 #, fuzzy msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 #, fuzzy msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 #, fuzzy msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 #, fuzzy msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 #, fuzzy msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 #, fuzzy msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 #, fuzzy msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 #, fuzzy msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Интернет клавиатура" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Интернет клавиатура" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech клавиатура за Интернет навигация" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 #, fuzzy msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech клавиатура за Интернет навигация" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "македонска" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Caps Lock да функционира като Control" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "малтийска" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "малтийска (американска подредба)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Клавиша Menu фунцкионира като Compose" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Menu клавишът сменя групата" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Win клавишите фунцкионират като Meta" -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Левият Win клавиш функционира като Meta" -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 #, fuzzy msgid "Microsoft Internet Keyboard" msgstr "Интернет клавиатура на Chicony" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 #, fuzzy msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Интернет клавиатура на Chicony" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 #, fuzzy msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Pro" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Интернет клавиатура на Chicony" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 #, fuzzy msgid "Mongolian" msgstr "македонска" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "северносамска (Финландия)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "северносамска (Норвегия)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "северносамска (Швеция)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "норвежка" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Индикаторът на Num_Lock указва алтернативната група" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 msgid "Old standard" msgstr "" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 #, fuzzy msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Logitech Интернет клавиатура" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx серии" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 #, fuzzy msgid "Pol" msgstr "полска" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "полска" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "полска (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "португалска" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "Левият Win клавиш избира третата група" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Левият Win клавиш избира третата група" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Menu избира третата група" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "Десният Win избира третата група" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Десният Control избира третата група" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Десният Win избира третата група" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "Двата Win клавиша избират третата група" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Двата Win клавиша избират третата група" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "Десният Alt сменя групата докато е натиснат" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Десният Alt фунцкионира като Compose" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Десният Alt сменя групата" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 #, fuzzy msgid "Right Ctrl key changes group" msgstr "Десният Alt сменя групата" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 #, fuzzy msgid "Right Shift key changes group" msgstr "Десният Alt сменя групата" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Десният Win сменя групата" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Десният Win фунцкионира като Compose" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Десният Win сменя групата докато е натиснат" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "румънска" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "руска" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 #, fuzzy msgid "Sapmi" msgstr "тамилска" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Индикаторът на Scroll_Lock указва смяната на групата" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "сръбска" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "Caps Lock сменя групата" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "словашка" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "словашка (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "словенска" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "испанска" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "" -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 #, fuzzy msgid "Sun dead keys" msgstr "Изключи специалните клавиши (dead keys)" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Win клавишите функционират като Super" -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 #, fuzzy msgid "Svk" msgstr "словашка" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Размени Control и Caps Lock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "шведска" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "швейцарска френска" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "швейцарска немска" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 #, fuzzy msgid "Syr" msgstr "сръбска" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 #, fuzzy msgid "Syriac" msgstr "сръбска" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "руска (фонетична кирилица)" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "таджикска" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "тамилска" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 #, fuzzy msgid "Tha" msgstr "тайландска" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Избор на третата група" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 #, fuzzy msgid "Tjk" msgstr "таджикска" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 #, fuzzy msgid "Tml" msgstr "тамилска" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "турска" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "турска (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "американска английска" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "американска английска с ISO9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 #, fuzzy msgid "U.S. English w/ dead keys" msgstr "американска английска със специални клавиши " -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "украинска" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "британска" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Използвай клавиатурен индикатор за указване на алтернативна група" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Използва вътрешна промяна на регистъра. Shift отменя Caps." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 #, fuzzy msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Използва вътрешна промяна на регистъра. Shift не отменя Caps." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "виетнамска" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 msgid "With Malayalam digits" msgstr "" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 #, fuzzy msgid "Yahoo! Internet Keyboard" msgstr "Интернет клавиатура на Chicony" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "югославска" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 #, fuzzy msgid "l2/102/qwerty/comma" msgstr "hu(l2_102_qwerty_comma) - без описание" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 #, fuzzy msgid "qwerty" msgstr "чешка (qwerty)" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "" @@ -1932,9 +1942,6 @@ msgstr "" #~ msgid "ua(winkeys) - No decription" #~ msgstr "ua(winkeys) - без описание" -#~ msgid "Russian (cyrillic phonetic)" -#~ msgstr "руска (фонетична кирилица)" - #~ msgid "Thai" #~ msgstr "тайландска" @@ -7,7 +7,7 @@ msgid "" msgstr "" "Project-Id-Version: cs\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2003-11-27 21:34GMT\n" "Last-Translator: Michal Bukovjan <bukm@centrum.cz>\n" "Language-Team: Czech <cs@li.org>\n" @@ -650,909 +650,919 @@ msgid "Israeli" msgstr "Izraelské" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Izraelské" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Italské" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japonské" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japonské 106 kláves" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jap" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Knn" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kannadské" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Nor" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "Norské" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Laptop" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Laptop/notebook Compaq (např. Armada) Laptop Keyboard" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Laptop/notebook Compaq (např. Presario) Internet Keyboard" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latinské" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latinská Amerika" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Lotyšské" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Levá klávesa Alt mění skupinu" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "Levá klávesa Win přepne při stisku skupinu" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Levá klávesa Ctrl mění skupinu" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Levá klávesa Shift mění skupinu" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Levá klávesa Win mění skupinu" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Levá klávesa Win přepne při stisku skupinu" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Litevské azerty standardní" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Litevské qwerty \"numerické\"" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (alternativní volba)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (alternativní volba 2)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Internet Keyboard" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator Keyboard" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (model Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch keyboard Internet Navigator" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Lit" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lot" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Makedonské" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh staré" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Vyrobit z CapsLock další Control" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malajské" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Maltézské" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltézské (rozložení US)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access Keyboard" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Menu je Compose" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Klávesa Menu mění skupinu" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta je mapována na klávesy Win." -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta je mapována na levou klávesu Win." -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, Švédská" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office Keyboard" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Dodatečné volby pro kompatibilitu" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mak" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Mongolské" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Severní Saami (Finsko)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Severní Saami (Norsko)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Severní Saami (Švédsko)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Norské" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "LED Num_Lock zobrazuje alternativní skupinu" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Oghamské" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "Standardní" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet keyboard" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx řada" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Fonetické" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Polské" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Polské (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytónické" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portugalské" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "Stiskněte levou klávesu Win pro výběr 3. úrovně" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Stiskněte levou klávesu Win pro výběr 3. úrovně" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Stiskněte levou klávesu Menu pro výběr 3. úrovně" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "Stiskněte pravou klávesu Win pro výběr 3. úrovně" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Stiskněte pravou klávesu Control pro výběr 3. úrovně" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Stiskněte pravou klávesu Win pro výběr 3. úrovně" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "Stiskněte kteroukoli klávesu Win pro výběr 3. úrovně" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Stiskněte kteroukoli klávesu Win pro výběr 3. úrovně" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "Pravý Alt přepne při stisku skupinu" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Pravý Alt je Compose" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Klávesa Pravý Alt mění skupinu" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Klávesa Pravý Control pracuje jako Pravý Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Klávesa Pravý Control mění skupinu" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Klávesa Pravý Shift mění skupinu" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Klávesa Pravý Win mění skupinu" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Klávesa Pravý Win je Compose" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Klávesa Pravý Win přepne při stisku skupinu" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Rumunské" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rum" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Ruské" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "LED Scroll_Lock zobrazuje alternativní skupinu" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Srbské" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Shift s numerickými klávesami pracuje jako v MS Windows" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "Klávesa CapsLock mění skupinu" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slovenské" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slovenské (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Slovinské" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Španělské" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Speciální klávesy (Ctrl+Alt+<key>) zpracovány v serveru." -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standardní" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Mrtvé klávesy Sun" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super je mapováno na klávesy Win (výchozí)." -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Zaměnit Control a CapsLock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Švé" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Švédské" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Švýcarské francouzské" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Švýcarské německé" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Syrské" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Fonetické" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tádžikistánské" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamilské" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugu" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Thajské (Kedmanee)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Thajské (Pattachote)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Thajské (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Výběr třetí úrovně" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access Keyboard" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Turecké" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Turecké (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Turecké rozložení Alt-Q" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "Anglické (US)" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "Anglické (US) s ISO9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "Anglické (US) s mrtvými klávesami" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "US" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "Americká klávesnice s rumunskými písmeny" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukrajinské" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Spojené království" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Použít LED klávesnice pro zobrazení alternativní skupiny" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Používá interní převod na kapitálky. Shift ruší Caps." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Používá interní převod na kapitálky. Shift neruší Caps." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Uzbecké" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vietnamské" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Winkeys" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "Malajské" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Internet Keyboard" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Jug" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Jugoslávské" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/číslice" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "číslice" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/čárka" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/tečka" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/čárka" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/tečka" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/čárka" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/tečka" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/čárka" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/tečka" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "laptop" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/číslice" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/čárka" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/tečka" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/čárka" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/tečka" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/čárka" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/tečka" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/čárka" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/tečka" @@ -7,7 +7,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml-4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2003-12-17 23:03+0100\n" "Last-Translator: Ole Laursen <olau@hardworking.dk>\n" "Language-Team: Danish <dansk@klid.dk>\n" @@ -649,910 +649,920 @@ msgid "Israeli" msgstr "Israelsk" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Israelsk" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Italiensk" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japansk" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japansk 106-taster" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kannada" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Nor" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "Norsk" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Brbar" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Brbar Compaq (fx Armada) Laptop Keyboard" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Brbar Compaq (fx Presario) Internet Keyboard" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Brbar Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latin" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latinamerika" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Lettisk" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Venstre Alt-tast skifter gruppe" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "Venstre Win-tast skifter gruppe mens nedtrykket" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Venstre Ctrl-tast skifter gruppe" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Venstre skiftetast skifter gruppe" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Venstre Win-tast skifter gruppe" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Venstre Win-tast skifter gruppe mens nedtrykket" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Litauisk azerty-standard" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Litauisk qwerty-numerisk" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (alternativ)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (alternativ 2)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Internet Keyboard" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator Keyboard" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (model Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch keyboard Internet Navigator" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Lit" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Let" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Makedonsk" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh gammel" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Gr Caps Lock til en ekstra Ctrl" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malayalam" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Maltesisk" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltesisk (US-layout)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access Keyboard" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Menu is Compose" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Menutast skifter gruppe" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta ligger p Win-tasterne." -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta ligger p venstre Win-tast." -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, svensk" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office Keyboard" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Diverse kompatibilitetsvalg" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Mongolsk" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Hollandsk" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Nordligt Saami (Finland)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Nordligt Saami (Norge)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Nordligt Saami (Sverige)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Norsk" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Num Lock LED viser alternativ gruppe" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Ogham" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "Standard" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet keyboard" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx-serien" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Fonetisk" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Polsk" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Polsk (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytonisk" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portugisisk" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "Tryk venstre Win-tast for at vlge tredje niveau" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Tryk venstre Win-tast for at vlge tredje niveau" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Tryk menutast for at vlge tredje niveau" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "Tryk hjre Win-tast for at vlge tredje niveau" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Tryk hjre Ctrl-tast for at vlge tredje niveau" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Tryk hjre Win-tast for at vlge tredje niveau" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "Tryk en af Win-tasterne for at vlge tredje niveau" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Tryk en af Win-tasterne for at vlge tredje niveau" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "Hjre Alt skifter gruppe mens nedtrykket" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Hjre Alt er Compose" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Hjre Alt-tast skifter gruppe" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Hjre Ctrl-tast virker som hjre Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Hjre Ctrl-tast skifter gruppe" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Hjre skiftetast skifter gruppe" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Hjre Win-tast skifter gruppe" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Hjre Win-tast er Compose" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Hjre Win-tast skifter gruppe mens nedtrykket" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Rumnsk" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rum" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Russisk" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Scroll Lock LED viser alternativ gruppe" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Serbisk" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Skift med numeriske taster virker som i MS Windows" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "Caps Lock-tast skifter gruppe" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slovakisk" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slovakisk (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Slovensk" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Spansk" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Specialtaster (Ctrl+Alt+<key>) hndteret i en server." -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standard" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun dde taster" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super ligger p Win-tasterne (standard)." -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Ombyt Ctrl og Caps Lock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Sve" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Svensk" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Schweizisk-fransk" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Schweizisk-tysk" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet-pc)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Syrisk" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Fonetisk" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tajik" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamil" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugu" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Thai (Kedmanee)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Thai (Pattachote)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Thai (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Tredje niveaus vlgere" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access Keyboard" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tyr" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Tyrkisk" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Tyrkisk (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Tyrkisk Alt-Q-layout" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "U.S. Engelsk" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "U.S. Engelsk w/ ISO9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "U.S. Engelsk m. dde taster" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "US" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "US-tastatur med rumnske bogstaver" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukraine" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "United Kingdom" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Bruger tastatur-LED til at vise alternativ gruppe" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Bruger intern forstrrelse af bogstaver. Skift annullerer Caps Lock." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "" "Bruger intern forstrrelse af bogstaver. Skift annullerer ikke Caps Lock." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Uzbekisk" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vietnamesisk" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Win-taster" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "Malayalam" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Internet Keyboard" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Yugoslavisk" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/cifre" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "omsk" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "cifre" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/komma" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/punktum" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/komma" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/punktum" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/komma" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/punktum" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/komma" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/punktum" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "bbar" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/cifre" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/komma" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/punktum" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/komma" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/punktum" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/komma" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/punktum" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/komma" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/punktum" @@ -7,7 +7,7 @@ msgid "" msgstr "" "Project-Id-Version: GNU xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2004-01-04 20:00-0500\n" "Last-Translator: Michel Robitaille <robitail@IRO.UMontreal.CA>\n" "Language-Team: French <traduc@traduc.org>\n" @@ -649,909 +649,919 @@ msgid "Israeli" msgstr "Isralien" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Isralien" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Italien" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japanais" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japanese 106-cls" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kannada" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Nor" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "Norvgien" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Laptop" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "clavier Laptop/notebook Compaq (ie. Armada) Laptop" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "clavier Laptop/notebook Compaq (ie. Presario) Internet" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "clavier Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latin" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Amrique latine" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Latvian" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "cl gauche Alt change de groupe" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "cl gauche Win-key bascule de groupe lorsqu'enfonc" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "cl Ctrl gauche change de groupe" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "cl gauche Shift change de groupe" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "cl gauche Win-key change de groupe" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "cl gauche Win-key bascule de groupe lorsqu'enfonc" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Lithuanien azerty standard" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Lithuanian qwerty \"numrique\"" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "clavier Logitech Deluxe Access" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (option alternative)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (option2 alternative)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "clavier Logitech Deluxe Access" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "clavier Logitech Internet" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "clavier Logitech Internet Navigator" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "clavier Logitech iTouch Cordless (model Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "clavier Logitech iTouch Internet Navigator" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Macdonien" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh ancien" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "rendre la touche CapsLock un contrle additionnel" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malayalam" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Maltais" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltais (disposition US)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "clavier Memorex MX2500 EZ-Access" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Menu est Compose" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "cl Menu change de groupe" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Mta est mapp sur les Win-Keys" -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Mta est mapp la cl gauche Win-key" -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "clavier Microsoft Internet" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "clavier Microsoft Internet Pro, Sudois" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "clavier Microsoft Natural Pro / Microsoft Internet Pro" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "clavier Microsoft Natural Pro OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "clavier Microsoft Office" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "clavier Microsoft Internet" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "diverses options de compatibilit" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Mongole" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Saami du Nord (Finlande)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Saami du Nord (Norvge)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Saami du Nord (Sude)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Norvgien" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "le LED Num_Lock indique un groupe alternatif" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Ogham" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "Standard" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet keyboard" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx Series" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Phontique" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Polonais" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Polonais (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytonique" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portugais" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "enfoncer la cl gauche Win-Key pour choisir le 3e niveau" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "enfoncer la cl gauche Win-Key pour choisir le 3e niveau" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "enfoncer la cl Menu pour choisir le 3e niveau" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "enfoncer la cl droite Win-key pour choisir le 3e niveau" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "enfoncer la cl Contrle pour choisir le 3e niveau" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "enfoncer la cl droite Win-key pour choisir le 3e niveau" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "enfoncer n'importe cl Win-key pour choisir le 3e niveau" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "enfoncer n'importe cl Win-key pour choisir le 3e niveau" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "la cl droite Alt bascule de groupe lorsque'enfonce" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "la cl droite Alt est Compose" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "la cl droite Alt change de groupe" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "la cl droite Contrle se comporte comme la cl droite Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "la cl droite Ctrl change de groupe" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "la cl droite Shift change de groupe" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "la cl droite Win-key change de groupe" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "la cl droite Win-key est Compose" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "la cl droite Win-key bascule de groupe lorsqu'enfonce" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Roumain" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Russe" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "le LED Scroll_Lock indique un groupe alternatif" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Serbe" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "la cl Shift avec le pav nurique se comporte comme dans MS Windows" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "la cl Caps Lock change de groupe" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slovaque" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slovaque (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Slovne" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Espagnol" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "les spciales (Ctrl+Alt+<cl>) sont traites par le serveur." -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standard" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "cls mortes Sun" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super est mapp au cls Win-keys (par dfaut)." -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "interchanger Contrle et Caps_lock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Su" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Sudois" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Franais Suisse" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Allemand Suisse" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Syriac" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Phontique" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tajik" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamoul" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugu" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Thai (Kedmanee)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Thai (Pattachote)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Thai (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "slecteur du 3e niveau" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "clavier Trust Direct Access" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "clavier classique Trust Wireless" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Turque" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Turque (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "disposition Turque Alt-Q" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "Anglais U.S." -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "Anglais U.S. w/ ISO9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "Anglais U.S. w/ cls mortes" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "US" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "clavier US avec lettres roumaines" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukrnien" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Royaume Uni" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Utiliser le LED du clavier pour afficher un groupe alternatif" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "utiliser la mise en majuscule interne. Shift l'annule." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "utiliser la mise en majuscule interne. Shift ne permet de l'annuler." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Uzbque" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vietnamien" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Winkeys" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "Malayalam" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "clavier Yahoo! Internet" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Yugoslave" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/chiffres" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "chiffres" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/virgule" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/dot" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/virgule" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/dot" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/comma" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/dot" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/comma" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/dot" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "laptop" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/chiffres" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/virgule" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/dot" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/virgule" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/dot" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/virgule" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/dot" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/virgule" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/dot" @@ -7,7 +7,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2004-01-24 10:46+0100\n" "Last-Translator: Andras Timar <timar@fsf.hu>\n" "Language-Team: Hungarian <translation-team-hu@lists.sourceforge.net>\n" @@ -652,915 +652,925 @@ msgid "Israeli" msgstr "izraeli" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "izraeli" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "olasz" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "japán" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "japán 106 gombos" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "kannada" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Nor" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "norvég" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Laptop" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Laptop/notebook Compaq (pl. Armada) Laptop Keyboard" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Laptop/notebook Compaq (pl. Presario) Internet Keyboard" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "latin" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "latin-amerikai" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "lett" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "A bal Alt lenyomásával lehet csoportot váltani" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "" "A bal Win billentyű lenyomva tartása mellett lehet a csoportok közt váltani" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "A bal Ctrl lenyomásával lehet csoportot váltani" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "A bal Shift lenyomásával lehet a csoportot váltani" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "A bal Win billentyű lenyomásával lehet a csoportok közt váltani" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "" "A bal Win billentyű lenyomva tartása mellett lehet a csoportok közt váltani" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "litván (azerty)" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "litván (qwerty, \"numerikus\")" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (másik lehetőség)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (harmadik lehetőség)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Internet Keyboard" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator Keyboard" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (model Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch Keyboard Internet Navigator" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "macedón" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh Old" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "A Caps Lock is Ctrl billentyűnek számítson" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "malajalam" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "máltai" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "máltai (amerikai kiosztás)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access billentyűzet" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "A Menü a kombináló (Compose)" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "A Menü billentyűvel lehet csoportot váltani" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "A Meta a Win billentyűkhöz van rendelve." -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "A Meta a bal Win billentyűhöz van rendelve." -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, svéd" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office billentyűzet" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Egyéb kompatibilitási beállítások" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "mongol" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "északi lapp (Finnország)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "északi lapp (Norvégia)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "északi lapp (Svédország)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "norvég" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "A Num Lock LED-je mutassa a másik csoportot" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "ogham" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "Szabványos" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet billentyűzet" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "orija" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx Series" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "fonetikus" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "lengyel" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "lengyel (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytonic" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "portugál" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "A bal Win billentyűvel lehet a harmadik szintet választani" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "A bal Win billentyűvel lehet a harmadik szintet választani" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "A Menü billentyűvel lehet a harmadik szintet választani" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "A jobb Win billentyűvel lehet a harmadik szintet választani" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "A jobb Ctrl-lal lehet a haramdik szintet választani" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "A jobb Win billentyűvel lehet a harmadik szintet választani" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "Bármelyik Win billentyűvel lehet a harmadik szintet választani" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Bármelyik Win billentyűvel lehet a harmadik szintet választani" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "A jobb Alt lenyomva tartása mellett lehet a csoportok közt váltani" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "A jobb Alt a kombináló (Compose)" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "A jobb Alt-tal lehet csoportot váltani" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "A jobb Ctrl úgy működjön, mint a jobb Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "A jobb Ctrl lenyomásával lehet csoportot váltani" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "A jobb Shift lenyomásával lehet csoportot váltani" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "A jobb Win billentyű lenyomásával lehet a csoportok közt váltani" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "A jobb Win billentyű a kombináló (Compose)" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "" "A jobb Win billentyű lenyomva tartása mellett lehet a csoportok közt váltani" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "román" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "orosz" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "A Scroll Lock LED-je mutassa a másik csoportot" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "szerb" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "" "A Shift+numerikus billentyűk úgy működjenek, mint Microsoft Windowsban." -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "A Caps Lock-kal lehet csoportot váltani" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "szlovák" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "szlovák (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "szlovén" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "spanyol" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "" "Speciális billentyűk (Ctrl+Alt+<key>), amelyeket a kiszolgáló kezel." -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Szabványos" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun halott billentyűk" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "" "A Super billentyű a Win billentyűkhöz van rendelve (ez az alapértelmezés)." -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "A Ctrl és a Caps Lock felcserélése" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Swe" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "svéd" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "svájci francia" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "svájci német" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "szír" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "fonetikus" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "tadzsik" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "tamil" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "telugu" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "thai (kedmanee)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "thai (pattachote)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "thai (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Harmadik szintű választók" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access billentyűzet" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "török" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "török (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Turkish Alt-Q kiosztás" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "amerikai angol" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "amerikai angol (ISO9995-3 szerint)" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "amerikai angol halott billentyűkkel" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "US" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "US billentyűzet román betűkkel" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "ukrán" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "brit angol" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "A másik csoport mutatása a billentyűzet LED-jeivel" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Nagybetűkre váltás - a Shift megszakítja." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Nagybetűkre váltás - a Shift nem szakítja meg." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "üzbég" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "vietnami" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Winkeys" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "malajalam" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Internet billentyűzet" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "jugoszláv" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/számjegyek" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "számjegyek" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/vessző" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/pont" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/vessző" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/pont" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/vessző" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/pont" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/vessző" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/pont" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "laptop" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/számjegyek" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/vessző" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/pont" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/vessző" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/pont" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/vessző" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/pont" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/vessző" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/pont" @@ -8,7 +8,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2004-01-03 15:04+0100\n" "Last-Translator: Elros Cyriatan <cyriatan@fastmail.fm>\n" "Language-Team: Dutch <vertaling@nl.linux.org>\n" @@ -650,909 +650,919 @@ msgid "Israeli" msgstr "Israëlisch" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Israëlisch" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Italiaans" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japans" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japans 106-toetsen" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kannada" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Nor" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "Noors" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Laptop" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Laptop/notebook Compaq (bijv. Armada) laptop toetsenbord" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Laptop/notebook Compaq (bijv. Presario) internet toetsenbord" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latijn" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latijns-Amerikaans" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Lets" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Linker Alt-toets verandert groep" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "Linker Win-toets schakelt groep bij indrukken" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Linker Ctrl-toets verandert groep" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Linker Shift-toets verandert groep" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Linker Win-toets verandert groep" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Linker Win-toets schakelt groep bij indrukken" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Litouwse azerty standaard" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Litouws qwerty \"numeriek\"" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Deluxe Access toetsenbord" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optisch" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (alternatieve optie)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (alternatieve optie2)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access toetsenbord" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech internet toetsenbord" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator toetsenbord" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch draadloos toetsenbord (model Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch toetsenbord Internet Navigator" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Macedonisch" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh oud" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Van CapsLock een extra Control maken" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malayalamees" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Maltees" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltees (Amerikaanse indeling)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access toetsenbord" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Menu is samenstellingstoets" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Menu-toets verandert groep" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta wordt afgebeeld op de Win-toetsen." -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta wordt afgebeeld op de linker Win-toets." -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft internet toetsenbord" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, Zweeds" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office toetsenbord" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Microsoft internet toetsenbord" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Overige compatibiliteitsopties" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Mongools" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Noord-Lapland (Finland)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Noord-Lapland (Noorwegen)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Noord-Lapland (Zweden)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Noors" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "NumLock LED toont alternatieve groep" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Oghamees" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "Standaard" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet toetsenbord" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx serie" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Fonetisch" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Pools" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Pools (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytonisch" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portugees" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "Druk op de linker Win-toets om het 3e niveau te kiezen" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Druk op de linker Win-toets om het 3e niveau te kiezen" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Druk op de Menu-toets om het 3e niveau te kiezen" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "Druk op de rechter Win-toets om het 3e niveau te kiezen" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Druk op de rechter Control op het 3e niveau te kiezen" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Druk op de rechter Win-toets om het 3e niveau te kiezen" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "Druk op een Win-toets om het 3e niveau te kiezen" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Druk op een Win-toets om het 3e niveau te kiezen" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "R-Alt schakelt groep bij indrukken" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Rechter Alt is samenstellingstoets" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Rechter Alt-toets verandert groep" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Rechter Control-toets werkt als rechter Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Rechter Ctrl-toets verandert groep" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Rechter Shift-toets verandert groep" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Rechter Win-toets verandert groep" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Rechter Win-toets is samenstellingstoets" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Rechter Win-toets schakelt groep bij indrukken" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Roemeens" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Russisch" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "ScrollLock LED toont alternatieve groep" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Servisch" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Shift met cijferblok-toetsen werkt zoals in MS Windows" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "CapsLock-toets verandert groep" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slowaaks" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slowaaks (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Sloveens" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Spaans" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Speciale toetsen (Ctrl+Alt+<toets>) afgehandeld in een server." -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standaard" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun dode toetsen" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super wordt afgebeeld op de Win-toetsen (standaard)." -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Control en CapsLock verwisselen" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Swe" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Zweeds" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Zwitsers-Frans" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Zwitsers-Duits" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Syrisch" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Fonetisch" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tadzjikisch" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamil" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugu" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Thaïsch (Kedmanee)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Thaïsch (Pattachote)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Thaïsch (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Derde niveau kiezers" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access toetsenbord" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Turks" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Turks (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Turkse Alt-Q indeling" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "Amerikaans-Engels" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "Amerikaans-Engels met ISO9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "Amerikaans-Engels met dode toetsen" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "Amerikaans" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "Amerikaans toetsenbord met Roemeense letters" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Oekraïens" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Verenigd Koninkrijk" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Gebruik toetsenbord LED om alternatieve groep te tonen" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Gebruikt interne conversie naar hoofdletters. Shift heft Caps op." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Gebruikt interne conversie naar hoofdletters. Shift heft Caps niet op." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Oezbeeks" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Viëtnamees" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Win-toetsen" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "Malayalamees" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! internet toetsenbord" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Joegoslavisch" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/cijfers" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "cijfers" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/komma" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/punt" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/komma" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/punt" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/komma" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/punt" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/komma" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/punt" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "laptop" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/cijfers" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/komma" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/punt" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/komma" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/punt" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/komma" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/punt" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/komma" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/punt" @@ -6,7 +6,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 0.1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-04-04 01:03+0100\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2004-01-09 16:17+0000\n" "Last-Translator: Sergey V. Oudaltsov <svu@gnome.org>\n" "Language-Team: Russian <ru@li.org>\n" @@ -6,7 +6,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2003-12-10 21:36+0100\n" "Last-Translator: Zdenko Podobný <zdpo@mailbox.sk>\n" "Language-Team: Slovak <sk-i18n@lists.linux.sk>\n" @@ -649,909 +649,919 @@ msgid "Israeli" msgstr "Izraelské" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Izraelské" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Tal" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Talianske" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japonské" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japonskáé106 kláves" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Knn" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kannadské" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Nor" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "Nórske" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Laptop" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Laptop/notebook Compaq (napr. Armada) Laptop Keyboard" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Laptop/notebook Compaq (napr. Presario) Internet Keyboard" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latinské" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latinská Amerika" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Lotyšské" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Ľavý kláves Alt mení skupinu" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "Ľavý Win-kláves prepína skupinu pri stlačení" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Ľavý kláves Ctrl mení skupinu" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Ľavý kláves Shift mení skupinu" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Ľavý Win-kláves mení skupinu" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Ľavý Win-kláves prepína skupinu pri stlačení" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Litovské azerty štandardné" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Litovské qwerty \"číselné\"" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (alternatívna voľba)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (alternatívna voľba2)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Internet Keyboard" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator Keyboard" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (model Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch keyboard Internet Navigator" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Lit" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lot" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Macedónske" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh staré" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Urobiť z CapsLock dodatočný Control" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malajalamské" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Maltézske" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltézske (US)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access Keyboard" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Ponuka je Compose" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Kláves Ponuka mení skupinu" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta je mapovaný na Win-klávesy." -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta je mapovaný na ľavý Win-kláves." -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, Švédska" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office Keyboard" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Dodatočné voľby pre kompatibilitu" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mak" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Mongloské" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Severný Saami (Fínsko)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Severný Saami (Nórsko)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Severný Saami (Švédsko)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Nórske" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Num_Lock LED zobrazuje alternatívnu skupinu" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Oghamské" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "Štandardné" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet keyboard" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "Séria PC-98xx" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Fonetické" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Poľské" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Poľské (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytónické" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portugalské" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "Stlačenie ľavého Win-klávesu vyberá 3. úroveň" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Stlačenie ľavého Win-klávesu vyberá 3. úroveň" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Stlačenie klávesu Ponuka vyberá 3. úroveň" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "Stlačenie pravého klávesu Win vyberá 3. úroveň" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Stlačenie pravého Control vyberá 3. úroveň" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Stlačenie pravého klávesu Win vyberá 3. úroveň" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "Stlačenie niektorého klávesu Win vyberá 3. úroveň" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Stlačenie niektorého klávesu Win vyberá 3. úroveň" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "R-Alt prepína skupinu pri stlačení" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Pravý Alt je Compose" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Pravý Alt mení skupinu" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Kláves pravý Control funguje ako pravý Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Kláves pravý Ctrl mení skupinu" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Kláves pravý Shift mení skupinu" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Pravý kláves Win mení skupinu" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Pravý kláves Win je Compose" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Pravý kláves Win prepína skupinu pri stlačení" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Rumunské" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rum" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Ruské" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Scroll_Lock LED zobrazuje alternatívnu skupinu" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Srbské" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Shift s numerickými klávesmi pracuje ako v MS Windows" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "Kláves Caps Lock mení skupinu" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slovenské" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slovenské (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Slovinské" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Španielske" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Špeciálne klávesy (Ctrl+Alt+<key>) spracované na serveru." -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Štandardné" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Mŕtve klávesy Sun" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super je mapovaný na Win-klávesy (štandardné)." -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Prehodiť Control a Caps Lock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Swe" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Švédske" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Švajčiarske francúzske" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Nemecké (Švajčiarsko)" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Syrské" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Fonetické" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tadžitské" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamilské" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugské" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Thajské (Kedmanee)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Thajské (Pattachote)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Thajské (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Výber tretej úrovne" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access Keyboard" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Turecké" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Turecké (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Turecké rozloženie Alt-Q" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "U.S.A. anglické" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "U.S.A. anglické s ISO9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "Anglické (US) s mŕtvymi klávesmi" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "US" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "Americká klávesnica s rumunskými písmami" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukrajinské" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Spojené kráľovstvo" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Použiť LED klávesnice pre zobrazenie alternatívnej skupiny" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Používa interný prevod na kapitálky. Shift ruší Caps." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Používa interný prevod na kapitálky. Shift neruší Caps." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Uzbecké" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vietnamské" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Win klávesy" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "Malajalamské" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Internet Keyboard" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Juh" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Juhoslovanské" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/číslice" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "číslice" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/čiarka" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/bodka" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/čiarka" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/bodka" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/čiarka" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/bodka" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/čiarka" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/bodka" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "laptop" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/číslice" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/čiarka" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/bodka" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/čiarka" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/bodka" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/čiarka" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/bodka" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/čiarka" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/bodka" @@ -6,7 +6,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2003-11-25 23:38+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2004-03-03 08:55-0500\n" "Last-Translator: Laurent Dhima <laurenti@alblinux.net>\n" "Language-Team: Albanian <gnome-albanian-perkthyesit@lists.sourceforge.net>\n" @@ -108,1358 +108,1462 @@ msgid "Azerbaijani" msgstr "Azerbaijani" #: xfree86.xml.in.h:24 +#, fuzzy +msgid "Azona RF2300 wireless Internet Keyboard" +msgstr "Tastierë për Internet Logitech" + +#: xfree86.xml.in.h:25 msgid "BTC 5090" msgstr "BTC 5090" -#: xfree86.xml.in.h:25 +#: xfree86.xml.in.h:26 msgid "BTC 5113RF Multimedia" msgstr "BTC 5113RF Multimedia" -#: xfree86.xml.in.h:26 +#: xfree86.xml.in.h:27 msgid "BTC 5126T" msgstr "BTC 5126T" -#: xfree86.xml.in.h:27 +#: xfree86.xml.in.h:28 msgid "BTC 9000" msgstr "BTC 9000" -#: xfree86.xml.in.h:28 +#: xfree86.xml.in.h:29 msgid "BTC 9000A" msgstr "BTC 9000A" -#: xfree86.xml.in.h:29 +#: xfree86.xml.in.h:30 msgid "BTC 9001AH" msgstr "BTC 9001AH" -#: xfree86.xml.in.h:30 +#: xfree86.xml.in.h:31 msgid "Basic" msgstr "Bazë" -#: xfree86.xml.in.h:31 +#: xfree86.xml.in.h:32 msgid "Bel" msgstr "Bel" -#: xfree86.xml.in.h:32 +#: xfree86.xml.in.h:33 msgid "Belarusian" msgstr "Bjelloruse" -#: xfree86.xml.in.h:33 +#: xfree86.xml.in.h:34 msgid "Belgian" msgstr "Belg" -#: xfree86.xml.in.h:34 +#: xfree86.xml.in.h:35 msgid "Ben" msgstr "Ben" -#: xfree86.xml.in.h:35 +#: xfree86.xml.in.h:36 msgid "Bengali" msgstr "Bengali" -#: xfree86.xml.in.h:36 +#: xfree86.xml.in.h:37 msgid "Bgr" msgstr "Bgr" -#: xfree86.xml.in.h:37 +#: xfree86.xml.in.h:38 msgid "Bih" msgstr "Bih" -#: xfree86.xml.in.h:38 +#: xfree86.xml.in.h:39 msgid "Blr" msgstr "Blr" -#: xfree86.xml.in.h:39 +#: xfree86.xml.in.h:40 msgid "Bosnian" msgstr "Bosnjake" -#: xfree86.xml.in.h:40 +#: xfree86.xml.in.h:41 msgid "Both Alt keys together change group" msgstr "Dy pulsantët Alt së bashku ndryshjnë grupin" -#: xfree86.xml.in.h:41 +#: xfree86.xml.in.h:42 msgid "Both Ctrl keys together change group" msgstr "Dy pulsantët Ctrl së bashku ndryshojnë grupin" -#: xfree86.xml.in.h:42 +#: xfree86.xml.in.h:43 msgid "Both Shift keys together change group" msgstr "Dy pulsantët Shift së bashku ndryshojnë grupin" -#: xfree86.xml.in.h:43 +#: xfree86.xml.in.h:44 msgid "Both Win-keys switch group while pressed" msgstr "Të dy pulsantët Win ndryshojnë gropin kur shtypen" -#: xfree86.xml.in.h:44 +#: xfree86.xml.in.h:45 msgid "Bra" msgstr "Bra" -#: xfree86.xml.in.h:45 +#: xfree86.xml.in.h:46 msgid "Brazilian" msgstr "Braziliane" -#: xfree86.xml.in.h:46 +#: xfree86.xml.in.h:47 msgid "Brazilian ABNT2" msgstr "Braziliane ABNT2" -#: xfree86.xml.in.h:47 +#: xfree86.xml.in.h:48 msgid "Brother Internet Keyboard" msgstr "Tastiera Internet Brother" -#: xfree86.xml.in.h:48 +#: xfree86.xml.in.h:49 msgid "Bulgarian" msgstr "Bullgarisht" -#: xfree86.xml.in.h:49 +#: xfree86.xml.in.h:50 msgid "Burmese" msgstr "Burmese" -#: xfree86.xml.in.h:50 +#: xfree86.xml.in.h:51 msgid "Can" msgstr "Can" -#: xfree86.xml.in.h:51 +#: xfree86.xml.in.h:52 msgid "Canadian" msgstr "Kanadeze" -#: xfree86.xml.in.h:52 +#: xfree86.xml.in.h:53 msgid "Caps Lock key changes group" msgstr "Pulsanti Caps Lock ndryshon grupin" -#: xfree86.xml.in.h:53 +#: xfree86.xml.in.h:54 msgid "CapsLock key behavior" msgstr "Sjellja e pulsantit CapsLock" -#: xfree86.xml.in.h:54 +#: xfree86.xml.in.h:55 msgid "Caps_Lock LED shows alternative group" msgstr "Llampa e Caps_Lock tregon grupin alternativ" -#: xfree86.xml.in.h:55 +#: xfree86.xml.in.h:56 msgid "Cherry Blue Line CyBo@rd" msgstr "Cherry Blue Line CyBo@rd" -#: xfree86.xml.in.h:56 +#: xfree86.xml.in.h:57 msgid "Cherry Blue Line CyBo@rd (alternate option)" msgstr "Cherry Blue Line CyBo@rd (opcioni alterno)" -#: xfree86.xml.in.h:57 +#: xfree86.xml.in.h:58 msgid "Chicony Internet Keyboard" msgstr "Tastiera Internet Chicony" -#: xfree86.xml.in.h:58 +#: xfree86.xml.in.h:59 msgid "Chicony KB-9885" msgstr "Chicony KB-9885" -#: xfree86.xml.in.h:59 +#: xfree86.xml.in.h:60 msgid "CloGaelach" msgstr "CloGaelach" -#: xfree86.xml.in.h:60 +#: xfree86.xml.in.h:61 msgid "CloGaelach Laptop" msgstr "Laptop CloGaelach" -#: xfree86.xml.in.h:61 +#: xfree86.xml.in.h:62 msgid "Compaq Easy Access Keyboard" msgstr "Tastiera Compaq Easy Access" -#: xfree86.xml.in.h:62 +#: xfree86.xml.in.h:63 msgid "Compaq Internet Keyboard (13 keys)" msgstr "Tatiera Internet Compaq (13 pulsante)" -#: xfree86.xml.in.h:63 +#: xfree86.xml.in.h:64 msgid "Compaq Internet Keyboard (18 keys)" msgstr "Tastiera Internet Compaq (18 pulsante)" -#: xfree86.xml.in.h:64 +#: xfree86.xml.in.h:65 msgid "Compaq Internet Keyboard (7 keys)" msgstr "Tastiera Internet Compaq (7 pulsante)" -#: xfree86.xml.in.h:65 +#: xfree86.xml.in.h:66 msgid "Compaq iPaq Keyboard" msgstr "Tastiera Compaq iPaq" -#: xfree86.xml.in.h:66 +#: xfree86.xml.in.h:67 msgid "Control Key Position" msgstr "Pozicioni i pulsantit Control" -#: xfree86.xml.in.h:67 +#: xfree86.xml.in.h:68 msgid "Control key at bottom left" msgstr "Pulsanti Control sipër majtas" -#: xfree86.xml.in.h:68 +#: xfree86.xml.in.h:69 msgid "Control key at left of 'A'" msgstr "Pulsanti Control në të majtë të 'A'" -#: xfree86.xml.in.h:69 +#: xfree86.xml.in.h:70 msgid "Control+Shift changes group" msgstr "Control+Shift ndryshon grupin" -#: xfree86.xml.in.h:70 +#: xfree86.xml.in.h:71 msgid "Croatian" msgstr "Kroate" -#: xfree86.xml.in.h:71 +#: xfree86.xml.in.h:72 msgid "Cyrillic" msgstr "Cyrillic" -#: xfree86.xml.in.h:72 +#: xfree86.xml.in.h:73 msgid "Cze" msgstr "Cze" -#: xfree86.xml.in.h:73 +#: xfree86.xml.in.h:74 msgid "Czech" msgstr "Çekisht" -#: xfree86.xml.in.h:74 +#: xfree86.xml.in.h:75 msgid "Czech (qwerty)" msgstr "Czech (qwerty)" -#: xfree86.xml.in.h:75 +#: xfree86.xml.in.h:76 +msgid "DTK2000" +msgstr "" + +#: xfree86.xml.in.h:77 msgid "Danish" msgstr "Danisht" -#: xfree86.xml.in.h:76 +#: xfree86.xml.in.h:78 msgid "Dead acute" msgstr "Fund kritik" -#: xfree86.xml.in.h:77 +#: xfree86.xml.in.h:79 msgid "Dead grave acute" msgstr "Fund kritik serioz" -#: xfree86.xml.in.h:78 +#: xfree86.xml.in.h:80 msgid "Dell" msgstr "Dell" -#: xfree86.xml.in.h:79 +#: xfree86.xml.in.h:81 msgid "Dell 101-key PC" msgstr "Dell 101-key PC" -#: xfree86.xml.in.h:80 +#: xfree86.xml.in.h:82 msgid "Deu" msgstr "Deu" -#: xfree86.xml.in.h:81 +#: xfree86.xml.in.h:83 msgid "Dexxa Wireless Desktop Keyboard" msgstr "Tastierë Dexxa Wireless Desktop" -#: xfree86.xml.in.h:82 +#: xfree86.xml.in.h:84 msgid "Diamond 9801 / 9802 series" msgstr "Seritë Diamond 9801 / 9802" -#: xfree86.xml.in.h:83 +#: xfree86.xml.in.h:85 msgid "Dnk" msgstr "Dnk" -#: xfree86.xml.in.h:84 +#: xfree86.xml.in.h:86 msgid "Dutch" msgstr "Hollandeze" -#: xfree86.xml.in.h:85 +#: xfree86.xml.in.h:87 msgid "Dvo" msgstr "Dvo" -#: xfree86.xml.in.h:86 +#: xfree86.xml.in.h:88 msgid "Dvorak" msgstr "Dvorak" -#: xfree86.xml.in.h:87 +#: xfree86.xml.in.h:89 +msgid "Dzongkha / Tibetan" +msgstr "" + +#: xfree86.xml.in.h:90 msgid "Eliminate dead keys" msgstr "Elemino pulsantët e vdekur" -#: xfree86.xml.in.h:88 +#: xfree86.xml.in.h:91 msgid "Ennyah DKB-1008" msgstr "Ennyah DKB-1008" -#: xfree86.xml.in.h:89 +#: xfree86.xml.in.h:92 msgid "Esp" msgstr "Esp" -#: xfree86.xml.in.h:90 +#: xfree86.xml.in.h:93 msgid "Est" msgstr "Est" -#: xfree86.xml.in.h:91 +#: xfree86.xml.in.h:94 msgid "Estonian" msgstr "Estonisht" -#: xfree86.xml.in.h:92 +#: xfree86.xml.in.h:95 msgid "Everex STEPnote" msgstr "Everex STEPnote" -#: xfree86.xml.in.h:93 +#: xfree86.xml.in.h:96 msgid "Extended" msgstr "E zgjeruar" -#: xfree86.xml.in.h:94 +#: xfree86.xml.in.h:97 msgid "Fao" msgstr "Fao" -#: xfree86.xml.in.h:95 +#: xfree86.xml.in.h:98 msgid "Faroese" msgstr "Faroese" -#: xfree86.xml.in.h:96 +#: xfree86.xml.in.h:99 msgid "Farsi" msgstr "Farsi" -#: xfree86.xml.in.h:97 +#: xfree86.xml.in.h:100 msgid "Fin" msgstr "Fin" -#: xfree86.xml.in.h:98 +#: xfree86.xml.in.h:101 msgid "Finnish" msgstr "Finlandeze" -#: xfree86.xml.in.h:99 +#: xfree86.xml.in.h:102 msgid "Fra" msgstr "Fra" -#: xfree86.xml.in.h:100 +#: xfree86.xml.in.h:103 msgid "French" msgstr "Frengjisht" -#: xfree86.xml.in.h:101 +#: xfree86.xml.in.h:104 msgid "French (alternative)" msgstr "Franceze (alternativa)" -#: xfree86.xml.in.h:102 +#: xfree86.xml.in.h:105 msgid "French Canadian" msgstr "Frengjisht e Kanadasë" -#: xfree86.xml.in.h:103 +#: xfree86.xml.in.h:106 msgid "GBr" msgstr "GBr" -#: xfree86.xml.in.h:104 +#: xfree86.xml.in.h:107 msgid "Generic 101-key PC" msgstr "Generic 101-key PC" -#: xfree86.xml.in.h:105 +#: xfree86.xml.in.h:108 msgid "Generic 102-key (Intl) PC" msgstr "Generic 102-key (Intl) PC" -#: xfree86.xml.in.h:106 +#: xfree86.xml.in.h:109 msgid "Generic 104-key PC" msgstr "Generic 104-key PC" -#: xfree86.xml.in.h:107 +#: xfree86.xml.in.h:110 msgid "Generic 105-key (Intl) PC" msgstr "Generic 105-key (Intl) PC" -#: xfree86.xml.in.h:108 +#: xfree86.xml.in.h:111 msgid "Genius Comfy KB-16M / Genius MM Keyboard KWD-910" msgstr "Genius Comfy KB-16M / Genius MM Keyboard KWD-910" -#: xfree86.xml.in.h:109 +#: xfree86.xml.in.h:112 +msgid "Genius Comfy KB-21e-Scroll" +msgstr "" + +#: xfree86.xml.in.h:113 msgid "Geo" msgstr "Geo" -#: xfree86.xml.in.h:110 +#: xfree86.xml.in.h:114 msgid "Georgian (latin)" msgstr "Georgian (latine)" -#: xfree86.xml.in.h:111 +#: xfree86.xml.in.h:115 msgid "Georgian (russian)" msgstr "Georgian (rusisht)" -#: xfree86.xml.in.h:112 +#: xfree86.xml.in.h:116 msgid "German" msgstr "Gjermanisht" -#: xfree86.xml.in.h:113 +#: xfree86.xml.in.h:117 msgid "Grc" msgstr "Grc" -#: xfree86.xml.in.h:114 +#: xfree86.xml.in.h:118 msgid "Greek" msgstr "Greqisht" -#: xfree86.xml.in.h:115 +#: xfree86.xml.in.h:119 msgid "Group Shift/Lock behavior" msgstr "Sjellja e grupit Shift/Lock" -#: xfree86.xml.in.h:116 +#: xfree86.xml.in.h:120 msgid "Guj" msgstr "Guj" -#: xfree86.xml.in.h:117 +#: xfree86.xml.in.h:121 msgid "Gujarati" msgstr "Gujarati" -#: xfree86.xml.in.h:118 +#: xfree86.xml.in.h:122 msgid "Gurmukhi" msgstr "Gurmukhi" -#: xfree86.xml.in.h:119 +#: xfree86.xml.in.h:123 msgid "Hewlett-Packard Internet Keyboard" msgstr "Tastierë për Internet Hewlett-Packard" -#: xfree86.xml.in.h:120 +#: xfree86.xml.in.h:124 msgid "Hewlett-Packard Omnibook 500 FA" msgstr "Hewlett-Packard Omnibook 500 FA" -#: xfree86.xml.in.h:121 +#: xfree86.xml.in.h:125 msgid "Hewlett-Packard Omnibook 5xx" msgstr "Hewlett-Packard Omnibook 5xx" -#: xfree86.xml.in.h:122 +#: xfree86.xml.in.h:126 msgid "Hewlett-Packard Omnibook 6000/6100" msgstr "Hewlett-Packard Omnibook 6000/6100" -#: xfree86.xml.in.h:123 +#: xfree86.xml.in.h:127 msgid "Hewlett-Packard Omnibook XE3 GC" msgstr "Hewlett-Packard Omnibook XE3 GC" -#: xfree86.xml.in.h:124 +#: xfree86.xml.in.h:128 msgid "Hewlett-Packard Omnibook XE3 GF" msgstr "Hewlett-Packard Omnibook XE3 GF" -#: xfree86.xml.in.h:125 +#: xfree86.xml.in.h:129 msgid "Hewlett-Packard Omnibook XT1000" msgstr "Hewlett-Packard Omnibook XT1000" -#: xfree86.xml.in.h:126 +#: xfree86.xml.in.h:130 msgid "Hewlett-Packard Pavilion ZT11xx" msgstr "Hewlett-Packard Pavilion ZT11xx" -#: xfree86.xml.in.h:127 +#: xfree86.xml.in.h:131 msgid "Hewlett-Packard SK-2501 Multimedia Keyboard" msgstr "Tastierë multimediale Hewlett-Packard SK-2501" -#: xfree86.xml.in.h:128 +#: xfree86.xml.in.h:132 msgid "Hewlett-Packard SK-2505 Internet Keyboard" msgstr "Tastierë për Internet Hewlett-Packard SK-2505" -#: xfree86.xml.in.h:129 +#: xfree86.xml.in.h:133 msgid "Hin" msgstr "Hin" -#: xfree86.xml.in.h:130 +#: xfree86.xml.in.h:134 msgid "Hindi" msgstr "Hindi" -#: xfree86.xml.in.h:131 +#: xfree86.xml.in.h:135 msgid "Honeywell Euroboard" msgstr "Honeywell Euroboard" -#: xfree86.xml.in.h:132 +#: xfree86.xml.in.h:136 msgid "Hrv" msgstr "Hrv" -#: xfree86.xml.in.h:133 +#: xfree86.xml.in.h:137 msgid "Hun" msgstr "Hun" -#: xfree86.xml.in.h:134 +#: xfree86.xml.in.h:138 msgid "Hungarian" msgstr "Hungarisht" -#: xfree86.xml.in.h:135 +#: xfree86.xml.in.h:139 msgid "Hungarian (qwerty)" msgstr "Hungareze (qwerty)" -#: xfree86.xml.in.h:136 +#: xfree86.xml.in.h:140 msgid "Hyper is mapped to the Win-keys." msgstr "Hyper është vendosur tek pulsantët Win." -#: xfree86.xml.in.h:137 +#: xfree86.xml.in.h:141 msgid "IBM Rapid Access" msgstr "IBM Rapid Access" -#: xfree86.xml.in.h:138 +#: xfree86.xml.in.h:142 msgid "IBM Rapid Access II" msgstr "IBM Rapid Access II" -#: xfree86.xml.in.h:139 +#: xfree86.xml.in.h:143 msgid "IBM Rapid Access II (alternate option)" msgstr "IBM Rapid Access II (opcioni alternativ)" -#: xfree86.xml.in.h:140 +#: xfree86.xml.in.h:144 msgid "IBM ThinkPad 560Z/600/600E/A22E" msgstr "IBM ThinkPad 560Z/600/600E/A22E" -#: xfree86.xml.in.h:141 +#: xfree86.xml.in.h:145 msgid "INSCRIPT layout" msgstr "Planimetri INSCRIPT" -#: xfree86.xml.in.h:142 +#: xfree86.xml.in.h:146 msgid "IS434" msgstr "IS434" -#: xfree86.xml.in.h:143 +#: xfree86.xml.in.h:147 msgid "IS434 laptop" msgstr "Laptop IS434" -#: xfree86.xml.in.h:144 +#: xfree86.xml.in.h:148 msgid "ISO Alternate" msgstr "ISO Alternative" -#: xfree86.xml.in.h:145 +#: xfree86.xml.in.h:149 msgid "Icelandic" msgstr "Islandeze" -#: xfree86.xml.in.h:146 +#: xfree86.xml.in.h:150 msgid "Iku" msgstr "Iku" -#: xfree86.xml.in.h:147 +#: xfree86.xml.in.h:151 +msgid "International (with dead keys)" +msgstr "" + +#: xfree86.xml.in.h:152 msgid "Inuktitut" msgstr "Inuktitut" -#: xfree86.xml.in.h:148 +#: xfree86.xml.in.h:153 msgid "Irish" msgstr "Irlandeze" -#: xfree86.xml.in.h:149 +#: xfree86.xml.in.h:154 msgid "Irl" msgstr "Irl" -#: xfree86.xml.in.h:150 +#: xfree86.xml.in.h:155 msgid "Irn" msgstr "Irn" -#: xfree86.xml.in.h:151 +#: xfree86.xml.in.h:156 msgid "Isl" msgstr "Isl" -#: xfree86.xml.in.h:152 +#: xfree86.xml.in.h:157 msgid "Isr" msgstr "Isr" -#: xfree86.xml.in.h:153 +#: xfree86.xml.in.h:158 msgid "Israeli" msgstr "Izraeliane" -#: xfree86.xml.in.h:154 +#: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Izraeliane" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:155 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Italisht" -#: xfree86.xml.in.h:156 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japonisht" -#: xfree86.xml.in.h:157 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japoneze 106-pulsantë" -#: xfree86.xml.in.h:158 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:159 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kanadeze" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:168 +#, fuzzy +msgid "Kor" +msgstr "Nor" + +#: xfree86.xml.in.h:169 +#, fuzzy +msgid "Korean" +msgstr "Norvegjeze" + +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Laptop" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Tastierë laptop për Laptop/notebook Compaq (p.sh. Armada)" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Tastierë për Internet për Laptop/notebook Compaq (p.sh. Presario)" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latinishte" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latino amerikane" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Letonisht" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Pulsanti i majtë Alt ndryshon grupin" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:179 +#, fuzzy +msgid "Left Alt key switches group while pressed" +msgstr "Pulsanti i majtë Win ndryshon grupin kur është i shtypur" + +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Pulsanti i majtë Ctrl ndryshon grupin" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Pulsanti i majtë Shift ndryshon grupin" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Pulsanti i majtë Win ndryshon grupin" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Pulsanti i majtë Win ndryshon grupin kur është i shtypur" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Lithuanian azerty standart" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Lithuanian qwerty \"numerike\"" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:186 +#, fuzzy +msgid "Logitech Access Keyboard" +msgstr "Tastierë Logitech Deluxe Access" + +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (opcioni alternativ)" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (opcioni i dytë alternativ)" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Tastierë Logitech Deluxe Access" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Tastierë për Internet Logitech" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Tastierë Logitech Internet Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (model Y-RB6)" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch keyboard Internet Navigator" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Maqedonisht" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh i vjetër" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Kthe CapsLock në një Control shtesë" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malayalam" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Malteze" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltese (harta US)" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Tastierë Memorex MX2500 EZ-Access" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Menu është krijuar" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Pulsanti i menu ndryshon grupin" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta është vendosur tek pulsantët Win. " -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta është vendosur tek pulsanti i majtë Win." -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Tastierë Microsoft Internet" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, Suedeze" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Tastierë Microsoft Office" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:224 +#, fuzzy +msgid "Microsoft Wireless Multimedia Keyboard 1.0A" +msgstr "Tastierë Microsoft Internet" + +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Opcione të ndryshme kompatibiliteti" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Mongoliane" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Northern Saami (Finlandeze)" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Northern Saami (Norvegjeze)" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Northern Saami (Suedeze)" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Norvegjeze" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Llampa e Num_Lock tregon grupin alternativ" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Ogham" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:241 +#, fuzzy +msgid "Old standard" +msgstr "Standart" + +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Tastierë Oretec MCK-800 MM/Internet" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "Seritë PC-98xx" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Phonetic" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Polonisht" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Polake (qwertz)" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:252 +msgid "Polish with Polish quotes on key \"1/!\"" +msgstr "" + +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytonic" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portugeze" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:256 +#, fuzzy +msgid "Press Left Alt key to choose 3rd level" +msgstr "Shtyp pulsantin e majtë Win për të zgjedhur nivelin e tretë" + +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Shtyp pulsantin e majtë Win për të zgjedhur nivelin e tretë" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Shtyp pulsantin Menu për të zgjedhur nivelin e tretë" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:259 +#, fuzzy +msgid "Press Right Alt key to choose 3rd level" +msgstr "Shtyp pulsantin e djathtë Win për të zgjedhur nivelin e tretë" + +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Shtyp pulsantin e djathtë Control për të zgjedhur nivelin e tretë" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Shtyp pulsantin e djathtë Win për të zgjedhur nivelin e tretë" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:262 +#, fuzzy +msgid "Press any of Alt keys to choose 3rd level" +msgstr "Shtyp çfarëdo pulsanti Win për të zgjedhur nivelin e tretë" + +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Shtyp çfarëdo pulsanti Win për të zgjedhur nivelin e tretë" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "D-Alt ndryshon grupin kur është i shtypur" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Alt i djathtë u krijua" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Pulsanti i djathtë Alt ndryshon grupin" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Pulsanti i djathtë Control punon si Alt i djathtë" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Pulsanti i djathtë Ctrl ndryshon grupin" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Pulsanti i djathtë Shift ndryshon grupin" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Pulsanti i djathtë Win ndryshon grupin" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Pulsanti Win i djathtë u krijua" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Pulsanti i djathtë Win ndryshon grupin kur është i shtypur" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Rumanisht" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Rusisht" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Llampa e Scroll_Lock tregon grupin alternativ" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Sërbisht" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:291 +msgid "Serbian Cyrillic (swap Zhe, Ze)" +msgstr "" + +#: xfree86.xml.in.h:292 +msgid "Serbian Latin (swap Y, Z)" +msgstr "" + +#: xfree86.xml.in.h:293 +msgid "Serbian Latin Unicode" +msgstr "" + +#: xfree86.xml.in.h:294 +msgid "Serbian Latin Unicode (swap ZHE, Z)" +msgstr "" + +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Shift së bashku me pulsantin numpad funksionon si tek MS Windows" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:296 +#, fuzzy +msgid "Shift+CapsLock changes group" +msgstr "Pulsanti Caps Lock ndryshon grupin" + +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Sllovake" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Sllovake (qwerty)" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Sllovene" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Spanjisht" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Çelsa specialë (Ctrl+Alt+<çelsi>) të manazhuar në një server." -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standart" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Pulsantë të vdekur Sun" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super është vendosur tek pulsantët Win (e prezgjedhur)." -#: xfree86.xml.in.h:285 -msgid "Sv" -msgstr "Sv" - -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Shkëmbyesi Control dhe Caps Lock" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Swe" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Suedisht" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Frengjisht e Zvicrës" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Gjermenishte e Zvicrës" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Siriane" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Phonetic" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tajik" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamil" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugu" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Thai (Kedmanee)" -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Thai (Pattachote)" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Thai (TIS-820.2538)" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Zgjedhësit e nivelit të tretë" -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Tastierë Trust Direct Access" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Tastierë klasike Trust Wireless" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Turqisht" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Turke (F)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Planimetria Alt-Q Turke" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "U.S. Anglisht" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "U.S. Anglisht w/ ISO9995-3" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "U.S. Anglisht w/ dead keys" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:338 msgid "US" msgstr "US" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "Tastierë US me gërma Romane" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukrahinase" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "EkspertUnicode" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Mbretëria e Bashkuar" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Përdor LED e tastierës për të treguar grupin alternativ" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Përdor gërma të mëdha në brendësi. Shift fshin Caps." -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Përdor gërma të mëdha në brendësi. Shift nuk fshin Caps." -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Uzbek" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vietnamisht" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Winkeys" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:354 +#, fuzzy +msgid "With Malayalam digits" +msgstr "Malayalam" + +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Tastierë Yahoo! Internet" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Yugoslavian" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/digits" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "numra" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/presje" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/pikë" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/presje" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/pikë" -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/presje" -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/pikë" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/presje" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/pikë" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "laptop" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/numra" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/presje" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/pikë" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/presje" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/pikë" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/presje" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/pikë" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/presje" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/pikë" +#~ msgid "Sv" +#~ msgstr "Sv" @@ -6,7 +6,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2003-11-28 20:27+0100\n" "Last-Translator: Danilo Segan <dsegan@gmx.net>\n" "Language-Team: Serbian <sr@li.org>\n" @@ -650,910 +650,920 @@ msgid "Israeli" msgstr "израелски" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "израелски" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "ита" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "италијански" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "јапански" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "јапански са 106 тастера" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "јпн" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "кнд" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "канада (јужна индија)" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "нор" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "норвешки" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "ЈАм" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Преносни рачунар" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Тастатуре преносних рачунара из Compaq-а (нпр. Armada)" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Тастатуре преносних рачунара из Compaq-а (нпр. Presario)" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Тастатуре преносних рачунара Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "латинични" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "јужноамерички" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "летонски" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Леви Alt тастер мења групу" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "Леви Windows тастер мења групу" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Леви Ctrl тастер мења групу" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Леви Shift тастер мења групу" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Леви Windows тастер мења групу" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Леви Windows тастер мења групу" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "литвански azerty распоред" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "литвански qwerty „бројевни“" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Deluxe Access тастатура" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (додатна могућност)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (додатна могућност 2)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access тастатура" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Интернет тастатура" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Интернет навигатор тастатура" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless тастатура (модел Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch тастатура Интернет навигатор" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "лтв" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "лет" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "македонски" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Мекинтош" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Стари Мекинтош" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Учини Caps Lock додатним Control тастером" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "мал" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "малајамски" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "малтски" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "малтски (амерички распоред)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access тастатура" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Menu је комбинујући тастер" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Menu тастер мења групу" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta је мапиран на Windows тастере." -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta је мапиран на леви Windows тастер." -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Микрософтова Интернет тастатура" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Микрософтова Интернет Про тастатура, шведски" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Микрософт Натурал" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Микрософт Натурал тастатура Про / Микрософт Интернет тастатура Про " -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Микрософт Натурал тастатура Про ОЕМ" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Микрософтова канцеларијска тастатура" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Микрософтова Интернет тастатура" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Разне могућности за сагласност" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "мак" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "мал" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "ммр" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "мон" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Монголски" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "хол" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "нор" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "северносаамски (Финска)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "северносаамски (Норвешка)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "северносаамски (Шведска)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "норвешки" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Num Lock лампица приказује измене група" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "огм" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "огам" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "стандардна" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 ММ/Интернет тастатура" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "ори" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "орија" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx серија" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "пан" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "фонетски" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "пољ" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "пољски" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "пољски (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" # не ваља, можда вишезвучни? -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "вишезвучни" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "португалски" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "Притисак левог Windows тастера за избор 3. нивоа" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Притисак левог Windows тастера за избор 3. нивоа" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Притисак Menu тастера за избор 3. нивоа" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "Притисак десног Windows тастера за избор 3. нивоа" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Притисак десног Control тастера за избор 3. нивоа" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Притисак десног Windows тастера за избор 3. нивоа" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "Притисак било ког Windows тастера за избор 3. нивоа" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Притисак било ког Windows тастера за избор 3. нивоа" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "прт" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "Десни Alt мења групу када је притиснут" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Десни Alt је комбинујући" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Десни Alt је мења групу" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Десни Control тастер се понаша као десни Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Десни Control мења групу" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Десни Shift мења групу" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Десни Windows тастер мења групу" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Десни Windows тастер је комбинујући" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Десни Windows тастер мења групу када је притиснут" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "румунски" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "рум" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "рус" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "руски" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN ергономска 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "срп" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Scroll Lock лампица приказује измене група" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "српски" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Shift уз нумеричку тасатуру ради као у MS Windows-у" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "Caps Lock тастер мења групу" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "словачки" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "словачки (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "словеначки" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "сме" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "шпански" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Нарочити тастери (Ctrl+Alt+<тастер>) које обрађује сервер." -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "стандардна" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun-ови акценти" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super је мапиран на Windows тастере (подразумевано)." -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "слк" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "сло" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Размени Control и Caps Lock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "шве" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "шведски" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "швајцарски француски" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "швајцарски немачки" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "сир" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "сиријски" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "фонетски" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "таџик" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "тамил" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "тел" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "телугу" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "тај" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "тајландски (Кедмани)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "тајландски (Паташоте)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "тајландски (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Избор трећег нивоа" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "тџк" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "тмл" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access тастатура" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust класична бежична тастатура" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "тур" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "турски" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "турски (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "турски Alt-Q распоред" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "амерички енглески" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "амерички енглески са ИСО9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "амерички енглески са акцентима" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "САД" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "Америчка тастатура са румунским словима" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "САД" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "укр" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "украјински" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "Стручна за Уникод" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Велика Британија" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Употреба лампица тастатуре за приказ измене група" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Користи унутрашњу капитализацију. Shift укида Caps Lock." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Користи унутрашњу капитализацију. Shift не укида Caps Lock." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "узб" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "узбекистански" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "вијетнамски" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "вјт" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Windows тастери" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "малајамски" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Интернет тастатура" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "сцг" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "латинични српски" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "абнт2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/цифре" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "бксл" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "цифре" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "н2/101/qwerty/запета" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "н2/101/qwerty/тачка" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "н2/101/qwertz/запета" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "н2/101/qwertz/тачка" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "н2/102/qwerty/запета" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "н2/102/qwerty/тачка" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "н2/102/qwertz/запета" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "н2/102/qwertz/тачка" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "преносни" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/цифре" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "уни/101/qwerty/запета" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "уни/101/qwerty/тачка" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "уни/101/qwertz/запета" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "уни/101/qwertz/тачка" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "уни/102/qwerty/запета" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "уни/102/qwerty/тачка" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "уни/102/qwertz/запета" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "уни/102/qwertz/тачка" @@ -11,7 +11,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2003-11-25 23:38+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2004-03-18 23:25+0100\n" "Last-Translator: Christian Rose <menthos@menthos.com>\n" "Language-Team: Swedish <sv@li.org>\n" @@ -112,1362 +112,1468 @@ msgid "Azerbaijani" msgstr "Azerbajdzjansk" #: xfree86.xml.in.h:24 +#, fuzzy +msgid "Azona RF2300 wireless Internet Keyboard" +msgstr "Logitech Internettangentbord" + +#: xfree86.xml.in.h:25 msgid "BTC 5090" msgstr "BTC 5090" -#: xfree86.xml.in.h:25 +#: xfree86.xml.in.h:26 msgid "BTC 5113RF Multimedia" msgstr "BTC 5113RF Multimedia" -#: xfree86.xml.in.h:26 +#: xfree86.xml.in.h:27 msgid "BTC 5126T" msgstr "BTC 5126T" -#: xfree86.xml.in.h:27 +#: xfree86.xml.in.h:28 msgid "BTC 9000" msgstr "BTC 9000" -#: xfree86.xml.in.h:28 +#: xfree86.xml.in.h:29 msgid "BTC 9000A" msgstr "BTC 9000A" -#: xfree86.xml.in.h:29 +#: xfree86.xml.in.h:30 msgid "BTC 9001AH" msgstr "BTC 9001AH" -#: xfree86.xml.in.h:30 +#: xfree86.xml.in.h:31 msgid "Basic" msgstr "Grundläggande" -#: xfree86.xml.in.h:31 +#: xfree86.xml.in.h:32 msgid "Bel" msgstr "Bel" -#: xfree86.xml.in.h:32 +#: xfree86.xml.in.h:33 msgid "Belarusian" msgstr "Vitrysk" -#: xfree86.xml.in.h:33 +#: xfree86.xml.in.h:34 msgid "Belgian" msgstr "Belgisk" -#: xfree86.xml.in.h:34 +#: xfree86.xml.in.h:35 msgid "Ben" msgstr "Ben" -#: xfree86.xml.in.h:35 +#: xfree86.xml.in.h:36 msgid "Bengali" msgstr "Bengali" -#: xfree86.xml.in.h:36 +#: xfree86.xml.in.h:37 msgid "Bgr" msgstr "Bgr" -#: xfree86.xml.in.h:37 +#: xfree86.xml.in.h:38 msgid "Bih" msgstr "Bih" -#: xfree86.xml.in.h:38 +#: xfree86.xml.in.h:39 msgid "Blr" msgstr "Blr" -#: xfree86.xml.in.h:39 +#: xfree86.xml.in.h:40 msgid "Bosnian" msgstr "Bosnisk" -#: xfree86.xml.in.h:40 +#: xfree86.xml.in.h:41 msgid "Both Alt keys together change group" msgstr "Båda Alt-tangenterna tillsammans byter grupp" -#: xfree86.xml.in.h:41 +#: xfree86.xml.in.h:42 msgid "Both Ctrl keys together change group" msgstr "Båda Ctrl-tangenterna tillsammans byter grupp" -#: xfree86.xml.in.h:42 +#: xfree86.xml.in.h:43 msgid "Both Shift keys together change group" msgstr "Båda Skift-tangenterna tillsammans byter grupp" -#: xfree86.xml.in.h:43 +#: xfree86.xml.in.h:44 msgid "Both Win-keys switch group while pressed" msgstr "Båda Win-tangenterna byter grupp då de trycks ned" -#: xfree86.xml.in.h:44 +#: xfree86.xml.in.h:45 msgid "Bra" msgstr "Bra" -#: xfree86.xml.in.h:45 +#: xfree86.xml.in.h:46 msgid "Brazilian" msgstr "Brasiliansk" -#: xfree86.xml.in.h:46 +#: xfree86.xml.in.h:47 msgid "Brazilian ABNT2" msgstr "Brasiliansk ABNT2" -#: xfree86.xml.in.h:47 +#: xfree86.xml.in.h:48 msgid "Brother Internet Keyboard" msgstr "Brother Internettangentbord" -#: xfree86.xml.in.h:48 +#: xfree86.xml.in.h:49 msgid "Bulgarian" msgstr "Bulgarisk" -#: xfree86.xml.in.h:49 +#: xfree86.xml.in.h:50 msgid "Burmese" msgstr "Burmesisk" -#: xfree86.xml.in.h:50 +#: xfree86.xml.in.h:51 msgid "Can" msgstr "Can" -#: xfree86.xml.in.h:51 +#: xfree86.xml.in.h:52 msgid "Canadian" msgstr "Kanadensisk" -#: xfree86.xml.in.h:52 +#: xfree86.xml.in.h:53 msgid "Caps Lock key changes group" msgstr "Caps Lock-tangenten byter grupp" -#: xfree86.xml.in.h:53 +#: xfree86.xml.in.h:54 msgid "CapsLock key behavior" msgstr "Beteende för Caps Lock-tangenten" -#: xfree86.xml.in.h:54 +#: xfree86.xml.in.h:55 msgid "Caps_Lock LED shows alternative group" msgstr "Caps_Lock-lampan visar alternativ grupp" -#: xfree86.xml.in.h:55 +#: xfree86.xml.in.h:56 msgid "Cherry Blue Line CyBo@rd" msgstr "Cherry Blue Line CyBo@rd" -#: xfree86.xml.in.h:56 +#: xfree86.xml.in.h:57 msgid "Cherry Blue Line CyBo@rd (alternate option)" msgstr "Cherry Blue Line CyBo@rd (alternativ)" -#: xfree86.xml.in.h:57 +#: xfree86.xml.in.h:58 msgid "Chicony Internet Keyboard" msgstr "Chicony Internettangentbord" -#: xfree86.xml.in.h:58 +#: xfree86.xml.in.h:59 msgid "Chicony KB-9885" msgstr "Chicony KB-9885" -#: xfree86.xml.in.h:59 +#: xfree86.xml.in.h:60 msgid "CloGaelach" msgstr "CloGaelach" -#: xfree86.xml.in.h:60 +#: xfree86.xml.in.h:61 msgid "CloGaelach Laptop" msgstr "CloGaelach-laptop" -#: xfree86.xml.in.h:61 +#: xfree86.xml.in.h:62 msgid "Compaq Easy Access Keyboard" msgstr "Compaq Easy Access-tangentbord" -#: xfree86.xml.in.h:62 +#: xfree86.xml.in.h:63 msgid "Compaq Internet Keyboard (13 keys)" msgstr "Compaq Internettangentbord (13 tangenter)" -#: xfree86.xml.in.h:63 +#: xfree86.xml.in.h:64 msgid "Compaq Internet Keyboard (18 keys)" msgstr "Compaq Internettangentbord (18 tangenter)" -#: xfree86.xml.in.h:64 +#: xfree86.xml.in.h:65 msgid "Compaq Internet Keyboard (7 keys)" msgstr "Compaq Internettangentbord (7 tangenter)" -#: xfree86.xml.in.h:65 +#: xfree86.xml.in.h:66 msgid "Compaq iPaq Keyboard" msgstr "Compaq iPaq-tangentbord" -#: xfree86.xml.in.h:66 +#: xfree86.xml.in.h:67 msgid "Control Key Position" msgstr "Position för Control-tangenten" -#: xfree86.xml.in.h:67 +#: xfree86.xml.in.h:68 msgid "Control key at bottom left" msgstr "Control-tangenten nere till vänster" -#: xfree86.xml.in.h:68 +#: xfree86.xml.in.h:69 msgid "Control key at left of 'A'" msgstr "Control-tangenten till vänster om \"A\"" -#: xfree86.xml.in.h:69 +#: xfree86.xml.in.h:70 msgid "Control+Shift changes group" msgstr "Control+Skift byter grupp" -#: xfree86.xml.in.h:70 +#: xfree86.xml.in.h:71 msgid "Croatian" msgstr "Kroatisk" -#: xfree86.xml.in.h:71 +#: xfree86.xml.in.h:72 msgid "Cyrillic" msgstr "Kyrillisk" -#: xfree86.xml.in.h:72 +#: xfree86.xml.in.h:73 msgid "Cze" msgstr "Cze" -#: xfree86.xml.in.h:73 +#: xfree86.xml.in.h:74 msgid "Czech" msgstr "Tjeckisk" -#: xfree86.xml.in.h:74 +#: xfree86.xml.in.h:75 msgid "Czech (qwerty)" msgstr "Tjeckisk (qwerty)" -#: xfree86.xml.in.h:75 +#: xfree86.xml.in.h:76 +msgid "DTK2000" +msgstr "" + +#: xfree86.xml.in.h:77 msgid "Danish" msgstr "Dansk" -#: xfree86.xml.in.h:76 +#: xfree86.xml.in.h:78 msgid "Dead acute" msgstr "Stum akut accent" -#: xfree86.xml.in.h:77 +#: xfree86.xml.in.h:79 msgid "Dead grave acute" msgstr "Stum grav accent" -#: xfree86.xml.in.h:78 +#: xfree86.xml.in.h:80 msgid "Dell" msgstr "Dell" -#: xfree86.xml.in.h:79 +#: xfree86.xml.in.h:81 msgid "Dell 101-key PC" msgstr "Dell 101-tangenters PC" -#: xfree86.xml.in.h:80 +#: xfree86.xml.in.h:82 msgid "Deu" msgstr "Deu" -#: xfree86.xml.in.h:81 +#: xfree86.xml.in.h:83 msgid "Dexxa Wireless Desktop Keyboard" msgstr "Dexxa trådlöst skrivbordstangentbord" -#: xfree86.xml.in.h:82 +#: xfree86.xml.in.h:84 msgid "Diamond 9801 / 9802 series" msgstr "Diamond 9801/9802-serien" -#: xfree86.xml.in.h:83 +#: xfree86.xml.in.h:85 msgid "Dnk" msgstr "Dnk" -#: xfree86.xml.in.h:84 +#: xfree86.xml.in.h:86 msgid "Dutch" msgstr "Nederländsk" -#: xfree86.xml.in.h:85 +#: xfree86.xml.in.h:87 msgid "Dvo" msgstr "Dvo" -#: xfree86.xml.in.h:86 +#: xfree86.xml.in.h:88 msgid "Dvorak" msgstr "Dvorak" -#: xfree86.xml.in.h:87 +#: xfree86.xml.in.h:89 +msgid "Dzongkha / Tibetan" +msgstr "" + +#: xfree86.xml.in.h:90 msgid "Eliminate dead keys" msgstr "Eliminera stumma tangenter" -#: xfree86.xml.in.h:88 +#: xfree86.xml.in.h:91 msgid "Ennyah DKB-1008" msgstr "Ennyah DKB-1008" -#: xfree86.xml.in.h:89 +#: xfree86.xml.in.h:92 msgid "Esp" msgstr "Esp" -#: xfree86.xml.in.h:90 +#: xfree86.xml.in.h:93 msgid "Est" msgstr "Est" -#: xfree86.xml.in.h:91 +#: xfree86.xml.in.h:94 msgid "Estonian" msgstr "Estnisk" -#: xfree86.xml.in.h:92 +#: xfree86.xml.in.h:95 msgid "Everex STEPnote" msgstr "Everex STEPnote" -#: xfree86.xml.in.h:93 +#: xfree86.xml.in.h:96 msgid "Extended" msgstr "Utökad" -#: xfree86.xml.in.h:94 +#: xfree86.xml.in.h:97 msgid "Fao" msgstr "Fao" -#: xfree86.xml.in.h:95 +#: xfree86.xml.in.h:98 msgid "Faroese" msgstr "Färöisk" -#: xfree86.xml.in.h:96 +#: xfree86.xml.in.h:99 msgid "Farsi" msgstr "Farsi" -#: xfree86.xml.in.h:97 +#: xfree86.xml.in.h:100 msgid "Fin" msgstr "Fin" -#: xfree86.xml.in.h:98 +#: xfree86.xml.in.h:101 msgid "Finnish" msgstr "Finsk" -#: xfree86.xml.in.h:99 +#: xfree86.xml.in.h:102 msgid "Fra" msgstr "Fra" -#: xfree86.xml.in.h:100 +#: xfree86.xml.in.h:103 msgid "French" msgstr "Fransk" -#: xfree86.xml.in.h:101 +#: xfree86.xml.in.h:104 msgid "French (alternative)" msgstr "Fransk (alternativ)" -#: xfree86.xml.in.h:102 +#: xfree86.xml.in.h:105 msgid "French Canadian" msgstr "Franskkanadensisk" -#: xfree86.xml.in.h:103 +#: xfree86.xml.in.h:106 msgid "GBr" msgstr "GBr" -#: xfree86.xml.in.h:104 +#: xfree86.xml.in.h:107 msgid "Generic 101-key PC" msgstr "Allmän 101-tangenters PC" -#: xfree86.xml.in.h:105 +#: xfree86.xml.in.h:108 msgid "Generic 102-key (Intl) PC" msgstr "Allmän 102-tangenters (internationell) PC" -#: xfree86.xml.in.h:106 +#: xfree86.xml.in.h:109 msgid "Generic 104-key PC" msgstr "Allmän 104-tangenters PC" -#: xfree86.xml.in.h:107 +#: xfree86.xml.in.h:110 msgid "Generic 105-key (Intl) PC" msgstr "Allmän 105-tangenters (internationell) PC" -#: xfree86.xml.in.h:108 +#: xfree86.xml.in.h:111 msgid "Genius Comfy KB-16M / Genius MM Keyboard KWD-910" msgstr "Genius Comfy KB-16M / Genius MM-tangentbord KWD-910" -#: xfree86.xml.in.h:109 +#: xfree86.xml.in.h:112 +msgid "Genius Comfy KB-21e-Scroll" +msgstr "" + +#: xfree86.xml.in.h:113 msgid "Geo" msgstr "Geo" -#: xfree86.xml.in.h:110 +#: xfree86.xml.in.h:114 msgid "Georgian (latin)" msgstr "Georgisk (latin1)" -#: xfree86.xml.in.h:111 +#: xfree86.xml.in.h:115 msgid "Georgian (russian)" msgstr "Georgisk (rysk)" -#: xfree86.xml.in.h:112 +#: xfree86.xml.in.h:116 msgid "German" msgstr "Tysk" -#: xfree86.xml.in.h:113 +#: xfree86.xml.in.h:117 msgid "Grc" msgstr "Grc" -#: xfree86.xml.in.h:114 +#: xfree86.xml.in.h:118 msgid "Greek" msgstr "Grekisk" -#: xfree86.xml.in.h:115 +#: xfree86.xml.in.h:119 msgid "Group Shift/Lock behavior" msgstr "Gruppbeteende för Skift/Lock" -#: xfree86.xml.in.h:116 +#: xfree86.xml.in.h:120 msgid "Guj" msgstr "Guj" -#: xfree86.xml.in.h:117 +#: xfree86.xml.in.h:121 msgid "Gujarati" msgstr "Gujarati" -#: xfree86.xml.in.h:118 +#: xfree86.xml.in.h:122 msgid "Gurmukhi" msgstr "Gurmukhi" -#: xfree86.xml.in.h:119 +#: xfree86.xml.in.h:123 msgid "Hewlett-Packard Internet Keyboard" msgstr "Hewlett-Packard Internettangentbord" -#: xfree86.xml.in.h:120 +#: xfree86.xml.in.h:124 msgid "Hewlett-Packard Omnibook 500 FA" msgstr "Hewlett-Packard Omnibook 500 FA" -#: xfree86.xml.in.h:121 +#: xfree86.xml.in.h:125 msgid "Hewlett-Packard Omnibook 5xx" msgstr "Hewlett-Packard Omnibook 5xx" -#: xfree86.xml.in.h:122 +#: xfree86.xml.in.h:126 msgid "Hewlett-Packard Omnibook 6000/6100" msgstr "Hewlett-Packard Omnibook 6000/6100" -#: xfree86.xml.in.h:123 +#: xfree86.xml.in.h:127 msgid "Hewlett-Packard Omnibook XE3 GC" msgstr "Hewlett-Packard Omnibook XE3 GC" -#: xfree86.xml.in.h:124 +#: xfree86.xml.in.h:128 msgid "Hewlett-Packard Omnibook XE3 GF" msgstr "Hewlett-Packard Omnibook XE3 GF" -#: xfree86.xml.in.h:125 +#: xfree86.xml.in.h:129 msgid "Hewlett-Packard Omnibook XT1000" msgstr "Hewlett-Packard Omnibook XT1000" -#: xfree86.xml.in.h:126 +#: xfree86.xml.in.h:130 msgid "Hewlett-Packard Pavilion ZT11xx" msgstr "Hewlett-Packard Pavilion ZT11xx" -#: xfree86.xml.in.h:127 +#: xfree86.xml.in.h:131 msgid "Hewlett-Packard SK-2501 Multimedia Keyboard" msgstr "Hewlett-Packard SK-2501 multimediatangentbord" -#: xfree86.xml.in.h:128 +#: xfree86.xml.in.h:132 msgid "Hewlett-Packard SK-2505 Internet Keyboard" msgstr "Hewlett-Packard SK-2505 Internettangentbord" -#: xfree86.xml.in.h:129 +#: xfree86.xml.in.h:133 msgid "Hin" msgstr "Hin" -#: xfree86.xml.in.h:130 +#: xfree86.xml.in.h:134 msgid "Hindi" msgstr "Hindi" -#: xfree86.xml.in.h:131 +#: xfree86.xml.in.h:135 msgid "Honeywell Euroboard" msgstr "Honeywell Euroboard" -#: xfree86.xml.in.h:132 +#: xfree86.xml.in.h:136 msgid "Hrv" msgstr "Hrv" -#: xfree86.xml.in.h:133 +#: xfree86.xml.in.h:137 msgid "Hun" msgstr "Hun" -#: xfree86.xml.in.h:134 +#: xfree86.xml.in.h:138 msgid "Hungarian" msgstr "Ungersk" -#: xfree86.xml.in.h:135 +#: xfree86.xml.in.h:139 msgid "Hungarian (qwerty)" msgstr "Ungersk (qwerty)" -#: xfree86.xml.in.h:136 +#: xfree86.xml.in.h:140 msgid "Hyper is mapped to the Win-keys." msgstr "Hyper är mappat till Win-tangenterna." -#: xfree86.xml.in.h:137 +#: xfree86.xml.in.h:141 msgid "IBM Rapid Access" msgstr "IBM Rapid Access" -#: xfree86.xml.in.h:138 +#: xfree86.xml.in.h:142 msgid "IBM Rapid Access II" msgstr "IBM Rapid Access II" -#: xfree86.xml.in.h:139 +#: xfree86.xml.in.h:143 msgid "IBM Rapid Access II (alternate option)" msgstr "IBM Rapid Access II (alternativ)" -#: xfree86.xml.in.h:140 +#: xfree86.xml.in.h:144 msgid "IBM ThinkPad 560Z/600/600E/A22E" msgstr "IBM ThinkPad 560Z/600/600E/A22E" -#: xfree86.xml.in.h:141 +#: xfree86.xml.in.h:145 msgid "INSCRIPT layout" msgstr "INSCRIPT-layout" -#: xfree86.xml.in.h:142 +#: xfree86.xml.in.h:146 msgid "IS434" msgstr "IS434" -#: xfree86.xml.in.h:143 +#: xfree86.xml.in.h:147 msgid "IS434 laptop" msgstr "IS434-laptop" -#: xfree86.xml.in.h:144 +#: xfree86.xml.in.h:148 msgid "ISO Alternate" msgstr "ISO-alternativ" -#: xfree86.xml.in.h:145 +#: xfree86.xml.in.h:149 msgid "Icelandic" msgstr "Isländsk" -#: xfree86.xml.in.h:146 +#: xfree86.xml.in.h:150 msgid "Iku" msgstr "Iku" -#: xfree86.xml.in.h:147 +#: xfree86.xml.in.h:151 +msgid "International (with dead keys)" +msgstr "" + +#: xfree86.xml.in.h:152 msgid "Inuktitut" msgstr "Inuktitut" -#: xfree86.xml.in.h:148 +#: xfree86.xml.in.h:153 msgid "Irish" msgstr "Irländsk" -#: xfree86.xml.in.h:149 +#: xfree86.xml.in.h:154 msgid "Irl" msgstr "Irl" -#: xfree86.xml.in.h:150 +#: xfree86.xml.in.h:155 msgid "Irn" msgstr "Irn" -#: xfree86.xml.in.h:151 +#: xfree86.xml.in.h:156 msgid "Isl" msgstr "Isl" -#: xfree86.xml.in.h:152 +#: xfree86.xml.in.h:157 msgid "Isr" msgstr "Isr" -#: xfree86.xml.in.h:153 +#: xfree86.xml.in.h:158 msgid "Israeli" msgstr "Israelisk" -#: xfree86.xml.in.h:154 +#: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Israelisk" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:155 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Italiensk" -#: xfree86.xml.in.h:156 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japansk" -#: xfree86.xml.in.h:157 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japansk 106-tangenters" -#: xfree86.xml.in.h:158 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:159 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" # Även kanaresisk (äldre form) -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Kannada" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:168 +#, fuzzy +msgid "Kor" +msgstr "Nor" + +#: xfree86.xml.in.h:169 +#, fuzzy +msgid "Korean" +msgstr "Norsk" + +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Bärbar dator" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Laptop-tangentbord för bärbar Compaq-dator (t.ex. Armada)" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Internettangentbord för bärbar Compaq-dator (t.ex. Presario)" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Bärbar Dell Inspiron 8xxx" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latin" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latinamerikansk" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Lettisk" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Vänster Alt-tangent byter grupp" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:179 +#, fuzzy +msgid "Left Alt key switches group while pressed" +msgstr "Vänster Win-tangent byter grupp då den trycks ned" + +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Vänster Ctrl-tangent byter grupp" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Vänster Skift-tangent byter grupp" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Vänster Win-tangent byter grupp" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Vänster Win-tangent byter grupp då den trycks ned" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Litauisk azerty-standard" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Litauisk qwerty \"numerisk\"" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:186 +#, fuzzy +msgid "Logitech Access Keyboard" +msgstr "Logitech Deluxe Access-tangentbord" + +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (alternativ)" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (alternativ2)" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access-tangentbord" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Internettangentbord" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator-tangentbord" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (modell Y-RB6)" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch-tangentbord Internet Navigator" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Makedonsk" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh gammal" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Gör Caps Lock till ytterligare en Control-tangent" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malayalam" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Maltesisk" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Maltesisk (USA-layout)" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access-tangentbord" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Meny är Compose" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Meny-tangenten byter grupp" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta är mappat till Win-tangenterna." -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta är mappat till vänster Win-tangent." -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, svensk" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office-tangentbord" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:224 +#, fuzzy +msgid "Microsoft Wireless Multimedia Keyboard 1.0A" +msgstr "Microsoft Internet Keyboard" + +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Diverse kompatibilitetsalternativ" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Mongolsk" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Nordsamisk (Finland)" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Nordsamisk (Norge)" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Nordsamisk (Sverige)" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Norsk" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Num_Lock-lampan visar alternativ grupp" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Ogham" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:241 +#, fuzzy +msgid "Old standard" +msgstr "Standard" + +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet-tangentbord" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx-serien" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Fonetisk" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Polsk" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Polsk (qwertz)" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:252 +msgid "Polish with Polish quotes on key \"1/!\"" +msgstr "" + +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytonic" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portugisisk" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:256 +#, fuzzy +msgid "Press Left Alt key to choose 3rd level" +msgstr "Tryck vänster Win-tangent för att välja tredjenivå" + +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Tryck vänster Win-tangent för att välja tredjenivå" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Tryck Meny-tangenten för att välja tredjenivå" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:259 +#, fuzzy +msgid "Press Right Alt key to choose 3rd level" +msgstr "Tryck höger Win-tangent för att välja tredjenivå" + +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Tryck höger Control-tangent för att välja tredjenivå" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Tryck höger Win-tangent för att välja tredjenivå" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:262 +#, fuzzy +msgid "Press any of Alt keys to choose 3rd level" +msgstr "Tryck någon Win-tangent för att välja tredjenivå" + +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Tryck någon Win-tangent för att välja tredjenivå" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "Höger Alt byter grupp då den trycks ned" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Höger Alt är Compose" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Höger Alt-tangent byter grupp" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Höger Control-tangent fungerar som höger Alt" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Höger Control-tangent byter grupp" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Höger Skift-tangent byter grupp" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Häger Win-tangent byter grupp" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Höger Win-tangent är Compose" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Höger Win-tangent byter grupp då den trycks ned" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Rumänsk" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Rysk" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Scroll_Lock-lampan visar alternativ grupp" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Serbisk" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:291 +msgid "Serbian Cyrillic (swap Zhe, Ze)" +msgstr "" + +#: xfree86.xml.in.h:292 +msgid "Serbian Latin (swap Y, Z)" +msgstr "" + +#: xfree86.xml.in.h:293 +msgid "Serbian Latin Unicode" +msgstr "" + +#: xfree86.xml.in.h:294 +msgid "Serbian Latin Unicode (swap ZHE, Z)" +msgstr "" + +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" -msgstr "Skift med tangenterna på numeriska tangentbordet fungerar som i MS Windows" +msgstr "" +"Skift med tangenterna på numeriska tangentbordet fungerar som i MS Windows" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:296 +#, fuzzy +msgid "Shift+CapsLock changes group" +msgstr "Caps Lock-tangenten byter grupp" + +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slovakisk" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slovakisk (qwerty)" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Slovensk" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Spansk" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Specialtangenter (Ctrl+Alt+<tangent>) hanteras i en server." -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standard" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun stumma tangenter" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super är mappat till Win-tangenterna (standard)." -#: xfree86.xml.in.h:285 -msgid "Sv" -msgstr "Sv" - -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Byt Control och Caps Lock" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Swe" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Svensk" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Franskschweizisk" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Tyskschweizisk" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Syrisk" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Fonetisk" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tadzjikisk" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamilsk" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugo" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Thailändsk (Kedmanee)" -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Thailändsk (Pattachote)" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Thailändsk (TIS-820.2538)" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Tredjenivåsväljare" -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access-tangentbord" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Turkisk" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Turkisk (F)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Turkisk Alt-Q-layout" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "Engelskamerikansk" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "Engelskamerikansk med ISO9995-3" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "Engelskamerikansk med stumma tangenter" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:338 msgid "US" msgstr "USA" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "USA-tangentbord med rumänska bokstäver" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukrainsk" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Storbritannien" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Använd tangentbordslampa för att visa alternativ grupp" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Använder intern skiftlägesstyrning. Skift låser upp Caps." -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Använder intern skiftlägesstyrning. Skift låser inte upp Caps." -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Uzbekisk" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vietnamesisk" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Wintangenter" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:354 +#, fuzzy +msgid "With Malayalam digits" +msgstr "Malayalam" + +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Internettangentbord" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Jugoslavisk" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/siffror" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "siffror" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/komma" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/punkt" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/komma" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/punkt" -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/komma" -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/punkt" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/komma" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/punkt" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "bärbar dator" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/siffror" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/komma" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/punkt" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/komma" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/punkt" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/komma" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/punkt" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/komma" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/punkt" +#~ msgid "Sv" +#~ msgstr "Sv" + #~ msgid "Brazilian (ABNT2)" #~ msgstr "Brasiliansk (ABNT2)" @@ -1589,7 +1695,8 @@ msgstr "uni/102/qwertz/punkt" #~ msgstr "Behåll separat grupp för varje programfönster." #~ msgid "Keep the state of indicators separately for each application window." -#~ msgstr "Behåll tillståndet för indikatorerna separat för varje programfönster." +#~ msgstr "" +#~ "Behåll tillståndet för indikatorerna separat för varje programfönster." #~ msgid "Save/restore _indicators with group" #~ msgstr "Spara/återställ _indikatorer med grupp" @@ -1631,7 +1738,8 @@ msgstr "uni/102/qwertz/punkt" #~ msgstr "Välj layout." #~ msgid "Choose the layout. Note: one layout can provide several groups." -#~ msgstr "Välj layouten. Observera att en layout kan tillhandahålla flera grupper." +#~ msgstr "" +#~ "Välj layouten. Observera att en layout kan tillhandahålla flera grupper." #~ msgid "Choose the model of the keyboard (brand, number of keys, etc.)." #~ msgstr "Välj modellen på tangentbordet (märke, antal tangenter, osv.)." @@ -1664,13 +1772,21 @@ msgstr "uni/102/qwertz/punkt" #~ msgstr "Visa _avancerade parametrar" #~ msgid "Show tabs with advanced keyboard parameters (for power users)." -#~ msgstr "Visa flikar med avancerade tangentbordsparametrar (för avancerade användare)." +#~ msgstr "" +#~ "Visa flikar med avancerade tangentbordsparametrar (för avancerade " +#~ "användare)." -#~ msgid "This version of XFree86 does not support multiple layouts, so only one layout can be choosen." -#~ msgstr "Denna version av XFree86 stöder inte flera layouter, så endast en layout kan väljas." +#~ msgid "" +#~ "This version of XFree86 does not support multiple layouts, so only one " +#~ "layout can be choosen." +#~ msgstr "" +#~ "Denna version av XFree86 stöder inte flera layouter, så endast en layout " +#~ "kan väljas." #~ msgid "Use custom settings, ignore global configuration set in XF86Config." -#~ msgstr "Använd anpassade inställningar, ignorera global konfiguration som är angiven i XF86Config." +#~ msgstr "" +#~ "Använd anpassade inställningar, ignorera global konfiguration som är " +#~ "angiven i XF86Config." #~ msgid "Use global configuration set in XF86Config." #~ msgstr "Använd global konfiguration som är angiven i XF86Config." @@ -1735,8 +1851,12 @@ msgstr "uni/102/qwertz/punkt" #~ msgid "Show layout names instead of group names" #~ msgstr "Visa layoutnamn istället för gruppnamn" -#~ msgid "Show layout names instead of group names (only for versions of XFree supporting multiple layouts)" -#~ msgstr "Visa layoutnamn istället för gruppnamn (endast för versioner av XFree som stöder flera layouter)" +#~ msgid "" +#~ "Show layout names instead of group names (only for versions of XFree " +#~ "supporting multiple layouts)" +#~ msgstr "" +#~ "Visa layoutnamn istället för gruppnamn (endast för versioner av XFree som " +#~ "stöder flera layouter)" #~ msgid "The id of active switchcut" #~ msgstr "Id för den aktiva genvägen" @@ -6,7 +6,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2003-12-03 11:09+0300\n" "Last-Translator: Nilgün Belma Bugüner <nilgun@superonline.com>\n" "Language-Team: Turkish <gnu-tr-u12a@lists.sourceforge.net>\n" @@ -652,913 +652,923 @@ msgid "Israeli" msgstr "İbranice" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "İbranice" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "İta" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "İtalyanca" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Japonca" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Japonca 106 tuşlu" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Güney Hint dili" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Nor" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "Norveçce" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "Dizüstü" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Laptop/notebook Compaq (örn. Armada) Dizüstü Klavyesi" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Laptop/notebook Compaq (örn. Presario) Örütbağ Klavyesi" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Laptop/notebook Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "Latin" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Latin Amerika" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Letonca" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Grubu soldaki Alt tuşu değiştirir" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "Soldaki Win tuşu basılıyken diğer grup etkin olur" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Grubu soldaki Ctrl tuşu değiştirir" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Grubu soldaki Shift tuşu değiştirir" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Grubu soldaki Win tuşu değiştirir" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Soldaki Win tuşu basılıyken diğer grup etkin olur" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Litvanya azerty standardı" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Litvanya qwerty \"sayısal\"" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Deluxe Erişim Klavyesi" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Kablosuz Masaüstü" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Kablosuz Masaüstü Tarayıcı" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Kablosuz Masaüstü Optik" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Kablosuz Masaüstü Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Kablosuz Masaüstü Pro (diğer seçenek)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Kablosuz Masaüstü Pro (diğer 2. seçenek)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Kablosuz Masaüstü iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Kablosuz Özgür/Masaüstü Tarayıcı" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Erişim Klavyesi" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Örütbağ Klavyesi" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Örütbağ Tarayıcı Klavyesi" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Kablosuz Klavyesi (model Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch klavyesi Örütbağ Tarayıcı" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Makedonya dili" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Eski Macintosh" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "CapsLock tuşuna ek bir kontrol sağlar" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Malayalam dili" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Malta dili" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Malta dili (Q klavye)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ Erişim Klavyesi" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Menü tuşu karakter birleşimi yapar" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Grubu Menü tuşu değiştirir" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta, Win tuşları ile eşleştirilir." -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta, soldaki Win tuşu ile eşleştirilir." -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Örütbağ Klavyesi" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Örütbağ Klavyesi Pro, İsveçce" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Basit" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Basit Klavye Pro / Microsoft Örütbağ Klavyesi Pro" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Basit Klavye Pro OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Ofis Klavyesi" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Microsoft Örütbağ Klavyesi" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "Çeşitli uyumluluk seçenekleri" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Moğ" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Moğolca" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Hol" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Kuzey Saami (Finlandiya)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Kuzey Saami (Norveç)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Kuzey Saami (İsveç)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Norveçce" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Num_Lock LED'i diğer grubu gösterir" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Ogham" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "Standart" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Örütbağ Klavyesi" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Orissa dili" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx Serisi" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Fonetik" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Polonez" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Polonez (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Politonik" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Portekizce" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "3. seviyeyi seçmek için soldaki Win tuşuna basın" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "3. seviyeyi seçmek için soldaki Win tuşuna basın" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "3. seviyeyi seçmek için Menü tuşuna basın" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "3. seviyeyi seçmek için sağdaki Win tuşuna basın" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "3. seviyeyi seçmek için sağdaki Ctrl tuşuna basın" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "3. seviyeyi seçmek için sağdaki Win tuşuna basın" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "3. seviyeyi seçmek için Win tuşlarından birine basın" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "3. seviyeyi seçmek için Win tuşlarından birine basın" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "Sağdaki Alt tuşu basılıyken diğer grup etkin olur" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Sağdaki Alt tuşu karakter birleşimi yapar" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Grubu sağdaki Alt tuşu değiştirir" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Sağdaki Ctrl tuşu sağdaki Alt tuşu olarak çalışır" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Grubu sağdaki Ctrl tuşu değiştirir" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Grubu sağdaki Shift tuşu değiştirir" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Grubu sağdaki Win tuşu değiştirir" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Sağdaki Win tuşu karakter birleşimi yapar" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Sağdaki Win tuşu basılıyken diğer grup etkin olur" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Romence" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Rusça" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomik 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Scroll_Lock LED'i diğer grubu gösterir" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Sırpça" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Sağdaki Nümerik tuşlar MS Windows'daki gibi çalışır" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "Grubu Caps Lock tuşu değiştirir" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Slovakça" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Slovakça (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Slovence" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "İspanyolca" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Bir sunucuda elde edilen özel tuşlar (Ctrl+Alt+<tuş>)" -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "Standart" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun ölü tuşlar" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super, Win tuşlarına eşlenir (öntanımlı)." -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Takas Denetimi ve Caps Lock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "İsve" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "İsveçce" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "İsviçre Fransızcası" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "İsviçre Almancası" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (tablet PC)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Sur" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Suriye dili" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Fonetik" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Tacikçe" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Tamil dili" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Telugu dili" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Tayca (Kedmanee)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Tayca (Pattachote)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Tayca (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "3. seviye seçiciler" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tck" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Doğrudan Erişimli Klavye" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Kablosuz Klasik Klavye" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Trk" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Türkçe Q Klavye" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Türkçe F klavye" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Türkçe Alt-Q (yazılımcılar ve dizüstü) klavye" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "Amerikan ingilizcesi" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "Amerikan ingilizcesi (ISO9995-3 ile)" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "Amerikan ingilizcesi (ölü tuşlarla)" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "Amerikan" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "Romen harfleriyle amerikan klavyesi" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "ABD" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Ukraynaca" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "Unicode Uzman" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "İngiltere" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "Diğer grubu göstermek içim klavye LED'i kullanılır" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "" "Büyük/küçük harf geçişlerinde standart dönüşüm kullanılır, Shift tuşu Caps " "tuşunun işlevini ters çevirir." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "" "Büyük/küçük harf geçişlerinde standart dönüşüm kullanılır, Shift tuşu Caps " "tuşunun işlevi etkilemez.." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Özb" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Özbekçe" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "Vietnam dili" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Win tuşları" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "Malayalam dili" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Örütbağ Klavyesi" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Yugoslavya dili" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/rakamlar" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "rakamlar" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/virgül" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/nokta" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/virgül" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/nokta" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/virgül" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/nokta" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/virgül" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/nokta" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "dizüstü" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/rakamlar" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/virgül" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/nokta" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/virgül" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/nokta" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/virgül" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/nokta" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/virgül" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/nokta" @@ -6,7 +6,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 0.1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2002-05-29 21:11+100\n" "Last-Translator: Sergey V. Oudaltsov <svu@users.sourceforge.net>\n" "Language-Team: Russian\n" @@ -653,920 +653,930 @@ msgid "Israeli" msgstr "Івріт" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "Івріт" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Іта" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "Италійська" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "Японська" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "Японська 106-клавішна" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Япо" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Кан" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "Канадська" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Нор" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "Норвежська" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "ЛАм" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "Клавіатура для комп'ютерів Compaq (напр., Armada)" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "Інтернет-клавіатура для ноутбуків Compaq (напр., Presario)" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "Для ноутбуків Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 #, fuzzy msgid "Latin" msgstr "Латишська" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "Латиноамериканська" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "Латишська" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "Ліва клавіша Alt міняє групу" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "Ліва клавіша Win переключає групу на час натиснення" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "Ліва клавіша Ctrl міняє групу" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "Ліва клавіша Shift міняє групу" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "Ліва клавіша Win міняє групу" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "Ліва клавіша Win переключає групу на час натиснення" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "Литовська стандартна (azerty)" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "Литовська цифрова (qwerty)" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "Logitech Cordless Desktop" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "Logitech Cordless Desktop Navigator" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "Logitech Cordless Desktop Optical" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "Logitech Cordless Desktop Pro" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "Logitech Cordless Desktop Pro (альтернативний варіант)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "Logitech Cordless Desktop Pro (альтернативний варіант 2)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "Logitech Cordless Desktop iTouch" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "Logitech Cordless Freedom/Desktop Navigator" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "Logitech Deluxe Access Keyboard" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "Logitech Internet Keyboard" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "Logitech Internet Navigator Keyboard" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "Logitech iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "Logitech iTouch Cordless Keyboard (модель Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "Logitech iTouch keyboard Internet Navigator" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "Македонська" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "Caps Lock как додаткова клавіша Control" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Мал" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "Малайська" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "Мальтійська" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "Мальтійська (Американська розкладка)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access Keyboard" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "Клавіша Menu відповідає клавіші Compose" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "Клавіша Menu міняє групу" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Клавіша Meta відповідає клавішам Win" -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Клавіша Meta відповідає лівій клавіші Win" -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "Microsoft Internet Keyboard Pro, шведська" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "Microsoft Natural" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "Microsoft Natural Keyboard Pro OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "Microsoft Office Keyboard" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "Microsoft Internet Keyboard" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Мкд" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Млт" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Ммр" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Мнг" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "Монгольська" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Нор" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "Саамська (Фінляндия)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "Саамська (Норвегія)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "Саамська (Швеція)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "Норвежська" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "Індикатор Num Lock відображає додаткову групу" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Огх" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "Огхам (староірландська)" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "Типова ACPI" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/Internet keyboard" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Орі" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Орія" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "Моделі PC-98xx" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Пан" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Пол" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "Польська" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "Польська (qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "Португальська" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "Вибір 3-го рівня натисненням лівої клавіші Win" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "Вибір 3-го рівня натисненням лівої клавіші Win" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "Вібор 3-го рівня натисненням клавіші Menu" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "Вибір 3-го рівня натисненням правої клавіші Win" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "Вибір 3-го рівня натисненням правої клавіші Control" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "Вибір 3-го рівня натисненням правої клавіші Win" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "Вибір 3-го рівня натисненням довільної клавіші Win" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "Вибір 3-го рівня натисненням довільної клавіші Win" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Пор" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "Права клавіша Alt переключає групу на час натиснення" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "Права клавіша Alt відповідає клавіші Alt" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "Права клавіша Alt міняє групу" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "Права клавіша Control функціонує як права клавіша Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "Права клавіша Ctrl міняє групу" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "Права клавіша Shift міняє групу" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "Права клавіша Win міняє групу" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "Права клавіша Win відповідає клавіші Compose" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "Права клавіша Win переключає групу на час натиснення" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "Руминська" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Рос" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "Російська" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "Samsung SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "Samsung SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 #, fuzzy msgid "Sapmi" msgstr "Тамільська" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "Індикатор Scroll Lock відображає додаткову групу" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "Сербська" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "" "Клавіша Shift з клавішами на додатковій цировій клавіатурі функціонує як в " "Ms Windows" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "Клавіша Caps Lock міняє групу" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "Словацька" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "Словацька (qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "Словенська" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Сме" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "Іспанська" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "Спеціальні клавіші (Ctrl+Alt+<key>) обробляються на сервері." -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 #, fuzzy msgid "Standard" msgstr "Типова ACPI" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 #, fuzzy msgid "Sun dead keys" msgstr "Вилучити спеціальні клавіші (dead keys)" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super відповідає клавішам Win (за замовчанням)" -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "Замінити містами клавіші Control і Caps Lock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Шве" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "Шведська" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "Французька (Швейцарія)" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "Німецька (Швейцарія)" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook (переносний ПК)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Сир" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "Сирійська" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Російська (кирилица, фонетична)" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "Таджикська" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "Тамільська" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Тел" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "Телугу" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Тай" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "Тайландська (Кедмані)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "Тайландська (Паттачот)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "Тайландська (TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "Вибір 3-го рівня" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Тдж" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Тмл" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "Toshiba Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access Keyboard" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust Wireless Keyboard Classic" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Тук" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "Турецька" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "Турецька (F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "Турецька Alt-Q розкладка" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "Англійська (США)" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "Англійська (США) з ISO9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 #, fuzzy msgid "U.S. English w/ dead keys" msgstr "Англійська (США) із спеціальними клавішами (dead keys)" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 #, fuzzy msgid "US" msgstr "США" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "США" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Укр" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "Українська" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "Англійська (Великобританія)" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "" "Використовувати клавіатурні індикатори для відображання додаткових груп" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "Використовувати внутрішнє збільшення літер. Shift відміняє Caps." -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "Використовувати внутрішнє збільшення літер. Shift не відміняє Caps." -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Узб" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "Узбецька" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "В'єтнамська" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Внм" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "Малайська" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "Yahoo! Internet Keyboard" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Юго" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "Югославська" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 #, fuzzy msgid "l2/102/qwerty/comma" msgstr "Угорська (Latin2 pc102, qwerty, кома)" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 #, fuzzy msgid "qwerty" msgstr "Чешська (qwerty)" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "" @@ -1867,9 +1877,6 @@ msgstr "" #~ msgid "ua(winkeys) - No decription" #~ msgstr "Українська (Microsoft)" -#~ msgid "Russian (cyrillic phonetic)" -#~ msgstr "Російська (кирилица, фонетична)" - #~ msgid "Thai" #~ msgstr "Тайландська" diff --git a/po/zh_CN.po b/po/zh_CN.po index 1b9a2a76..5a560472 100644 --- a/po/zh_CN.po +++ b/po/zh_CN.po @@ -7,7 +7,7 @@ msgid "" msgstr "" "Project-Id-Version: xfree86_xkb_xml 4.4pre1\n" "Report-Msgid-Bugs-To: \n" -"POT-Creation-Date: 2004-01-26 00:21+0000\n" +"POT-Creation-Date: 2004-04-04 02:42+0100\n" "PO-Revision-Date: 2003-11-28 22:36+0800\n" "Last-Translator: Funda Wang <fundawang@linux.net.cn>\n" "Language-Team: Chinese (simplified) <i18n-translation@lists.linux.net.cn>\n" @@ -649,909 +649,919 @@ msgid "Israeli" msgstr "以色列" #: xfree86.xml.in.h:159 +#, fuzzy +msgid "Israeli phonetic" +msgstr "以色列" + +#: xfree86.xml.in.h:160 msgid "Ita" msgstr "Ita" -#: xfree86.xml.in.h:160 +#: xfree86.xml.in.h:161 msgid "Italian" msgstr "意大利" -#: xfree86.xml.in.h:161 +#: xfree86.xml.in.h:162 msgid "Japanese" msgstr "日语" -#: xfree86.xml.in.h:162 +#: xfree86.xml.in.h:163 msgid "Japanese 106-key" msgstr "日语 106 键" -#: xfree86.xml.in.h:163 +#: xfree86.xml.in.h:164 msgid "Jpn" msgstr "Jpn" -#: xfree86.xml.in.h:164 +#: xfree86.xml.in.h:165 msgid "Kan" msgstr "Kan" -#: xfree86.xml.in.h:165 +#: xfree86.xml.in.h:166 msgid "Kannada" msgstr "埃纳德" -#: xfree86.xml.in.h:166 +#: xfree86.xml.in.h:167 msgid "Keytronic FlexPro" msgstr "Keytronic FlexPro" -#: xfree86.xml.in.h:167 +#: xfree86.xml.in.h:168 #, fuzzy msgid "Kor" msgstr "Nor" -#: xfree86.xml.in.h:168 +#: xfree86.xml.in.h:169 #, fuzzy msgid "Korean" msgstr "挪威" -#: xfree86.xml.in.h:169 +#: xfree86.xml.in.h:170 msgid "LAm" msgstr "LAm" -#: xfree86.xml.in.h:170 +#: xfree86.xml.in.h:171 msgid "Laptop" msgstr "便携" -#: xfree86.xml.in.h:171 +#: xfree86.xml.in.h:172 msgid "Laptop/notebook Compaq (eg. Armada) Laptop Keyboard" msgstr "便携/笔记本 Compaq(如 Armada)便携键盘" -#: xfree86.xml.in.h:172 +#: xfree86.xml.in.h:173 msgid "Laptop/notebook Compaq (eg. Presario) Internet Keyboard" msgstr "便携/笔记本 Compaq(如自由人)网际键盘" -#: xfree86.xml.in.h:173 +#: xfree86.xml.in.h:174 msgid "Laptop/notebook Dell Inspiron 8xxx" msgstr "便携/笔记本 Dell Inspiron 8xxx" -#: xfree86.xml.in.h:174 +#: xfree86.xml.in.h:175 msgid "Latin" msgstr "拉丁" -#: xfree86.xml.in.h:175 +#: xfree86.xml.in.h:176 msgid "Latin America" msgstr "拉美" -#: xfree86.xml.in.h:176 +#: xfree86.xml.in.h:177 msgid "Latvian" msgstr "拉脱维亚" -#: xfree86.xml.in.h:177 +#: xfree86.xml.in.h:178 msgid "Left Alt key changes group" msgstr "左 Alt 键更改组" -#: xfree86.xml.in.h:178 +#: xfree86.xml.in.h:179 #, fuzzy msgid "Left Alt key switches group while pressed" msgstr "按下左 Windows 键切换组" -#: xfree86.xml.in.h:179 +#: xfree86.xml.in.h:180 msgid "Left Ctrl key changes group" msgstr "左 Ctrl 键更改组" -#: xfree86.xml.in.h:180 +#: xfree86.xml.in.h:181 msgid "Left Shift key changes group" msgstr "左 Shift 键更改组" -#: xfree86.xml.in.h:181 +#: xfree86.xml.in.h:182 msgid "Left Win-key changes group" msgstr "左 Windows 键更改组" -#: xfree86.xml.in.h:182 +#: xfree86.xml.in.h:183 msgid "Left Win-key switches group while pressed" msgstr "按下左 Windows 键切换组" -#: xfree86.xml.in.h:183 +#: xfree86.xml.in.h:184 msgid "Lithuanian azerty standard" msgstr "立陶宛 azerty 标准" -#: xfree86.xml.in.h:184 +#: xfree86.xml.in.h:185 msgid "Lithuanian qwerty \"numeric\"" msgstr "立陶宛 qwerty“数字式”" -#: xfree86.xml.in.h:185 +#: xfree86.xml.in.h:186 #, fuzzy msgid "Logitech Access Keyboard" msgstr "罗技强手键盘" -#: xfree86.xml.in.h:186 +#: xfree86.xml.in.h:187 msgid "Logitech Cordless Desktop" msgstr "罗技无影手" -#: xfree86.xml.in.h:187 +#: xfree86.xml.in.h:188 msgid "Logitech Cordless Desktop Navigator" msgstr "罗技无影手桌面导航器" -#: xfree86.xml.in.h:188 +#: xfree86.xml.in.h:189 msgid "Logitech Cordless Desktop Optical" msgstr "罗技无影手光学组合" -#: xfree86.xml.in.h:189 +#: xfree86.xml.in.h:190 msgid "Logitech Cordless Desktop Pro" msgstr "罗技无影手高级版" -#: xfree86.xml.in.h:190 +#: xfree86.xml.in.h:191 msgid "Logitech Cordless Desktop Pro (alternate option)" msgstr "罗技无影手高级版(替代选项)" -#: xfree86.xml.in.h:191 +#: xfree86.xml.in.h:192 msgid "Logitech Cordless Desktop Pro (alternate option2)" msgstr "罗技无影手高级版(替代选项)" -#: xfree86.xml.in.h:192 +#: xfree86.xml.in.h:193 msgid "Logitech Cordless Desktop iTouch" msgstr "罗技网际无影手" -#: xfree86.xml.in.h:193 +#: xfree86.xml.in.h:194 msgid "Logitech Cordless Freedom/Desktop Navigator" msgstr "罗技极光无影手组合/桌面导航器" -#: xfree86.xml.in.h:194 +#: xfree86.xml.in.h:195 msgid "Logitech Deluxe Access Keyboard" msgstr "罗技强手键盘" -#: xfree86.xml.in.h:195 +#: xfree86.xml.in.h:196 msgid "Logitech Internet Keyboard" msgstr "罗技网际键盘" -#: xfree86.xml.in.h:196 +#: xfree86.xml.in.h:197 msgid "Logitech Internet Navigator Keyboard" msgstr "罗技网际导航键盘" -#: xfree86.xml.in.h:197 +#: xfree86.xml.in.h:198 msgid "Logitech iTouch" msgstr "罗技 iTouch" -#: xfree86.xml.in.h:198 +#: xfree86.xml.in.h:199 msgid "Logitech iTouch Cordless Keyboard (model Y-RB6)" msgstr "罗技 iTouch 无影手键盘(型号 Y-RB6)" -#: xfree86.xml.in.h:199 +#: xfree86.xml.in.h:200 msgid "Logitech iTouch keyboard Internet Navigator" msgstr "罗技 iTouch 键盘网际导航器" -#: xfree86.xml.in.h:200 +#: xfree86.xml.in.h:201 msgid "Ltu" msgstr "Ltu" -#: xfree86.xml.in.h:201 +#: xfree86.xml.in.h:202 msgid "Lva" msgstr "Lva" -#: xfree86.xml.in.h:202 +#: xfree86.xml.in.h:203 msgid "Macedonian" msgstr "马其顿" -#: xfree86.xml.in.h:203 +#: xfree86.xml.in.h:204 msgid "Macintosh" msgstr "Macintosh" -#: xfree86.xml.in.h:204 +#: xfree86.xml.in.h:205 msgid "Macintosh Old" msgstr "Macintosh 旧产品" -#: xfree86.xml.in.h:205 +#: xfree86.xml.in.h:206 msgid "Make CapsLock an additional Control" msgstr "将 CapsLock 作为额外的 Ctrl" -#: xfree86.xml.in.h:206 +#: xfree86.xml.in.h:207 msgid "Mal" msgstr "Mal" -#: xfree86.xml.in.h:207 +#: xfree86.xml.in.h:208 msgid "Malayalam" msgstr "马来西亚" -#: xfree86.xml.in.h:208 +#: xfree86.xml.in.h:209 msgid "Maltese" msgstr "马耳他" -#: xfree86.xml.in.h:209 +#: xfree86.xml.in.h:210 msgid "Maltese (US layout)" msgstr "马耳他(美国布局)" -#: xfree86.xml.in.h:210 +#: xfree86.xml.in.h:211 msgid "Memorex MX1998" msgstr "Memorex MX1998" -#: xfree86.xml.in.h:211 +#: xfree86.xml.in.h:212 msgid "Memorex MX2500 EZ-Access Keyboard" msgstr "Memorex MX2500 EZ-Access 键盘" -#: xfree86.xml.in.h:212 +#: xfree86.xml.in.h:213 msgid "Memorex MX2750" msgstr "Memorex MX2750" -#: xfree86.xml.in.h:213 +#: xfree86.xml.in.h:214 msgid "Menu is Compose" msgstr "菜单已编排" -#: xfree86.xml.in.h:214 +#: xfree86.xml.in.h:215 msgid "Menu key changes group" msgstr "菜单键更改组" -#: xfree86.xml.in.h:215 +#: xfree86.xml.in.h:216 msgid "Meta is mapped to the Win-keys." msgstr "Meta 被映射到 Windows 键。" -#: xfree86.xml.in.h:216 +#: xfree86.xml.in.h:217 msgid "Meta is mapped to the left Win-key." msgstr "Meta 被映射到左 Windows 键。" -#: xfree86.xml.in.h:217 +#: xfree86.xml.in.h:218 msgid "Microsoft Internet Keyboard" msgstr "微软网际键盘" -#: xfree86.xml.in.h:218 +#: xfree86.xml.in.h:219 msgid "Microsoft Internet Keyboard Pro, Swedish" msgstr "微软网际键盘增强版，瑞典" -#: xfree86.xml.in.h:219 +#: xfree86.xml.in.h:220 msgid "Microsoft Natural" msgstr "微软自然键盘" -#: xfree86.xml.in.h:220 +#: xfree86.xml.in.h:221 msgid "Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro" msgstr "微软自然键盘增强版/微软网际键盘增强版" -#: xfree86.xml.in.h:221 +#: xfree86.xml.in.h:222 msgid "Microsoft Natural Keyboard Pro OEM" msgstr "微软自然键盘增强版 OEM" -#: xfree86.xml.in.h:222 +#: xfree86.xml.in.h:223 msgid "Microsoft Office Keyboard" msgstr "微软 Office 键盘" -#: xfree86.xml.in.h:223 +#: xfree86.xml.in.h:224 #, fuzzy msgid "Microsoft Wireless Multimedia Keyboard 1.0A" msgstr "微软网际键盘" -#: xfree86.xml.in.h:224 +#: xfree86.xml.in.h:225 msgid "Miscellaneous compatibility options" msgstr "其它兼容选项" -#: xfree86.xml.in.h:225 +#: xfree86.xml.in.h:226 msgid "Mkd" msgstr "Mkd" -#: xfree86.xml.in.h:226 +#: xfree86.xml.in.h:227 msgid "Mlt" msgstr "Mlt" -#: xfree86.xml.in.h:227 +#: xfree86.xml.in.h:228 msgid "Mmr" msgstr "Mmr" -#: xfree86.xml.in.h:228 +#: xfree86.xml.in.h:229 msgid "Mng" msgstr "Mng" -#: xfree86.xml.in.h:229 +#: xfree86.xml.in.h:230 msgid "Mongolian" msgstr "蒙古" -#: xfree86.xml.in.h:230 +#: xfree86.xml.in.h:231 msgid "Nld" msgstr "Nld" -#: xfree86.xml.in.h:231 +#: xfree86.xml.in.h:232 msgid "Nor" msgstr "Nor" -#: xfree86.xml.in.h:232 +#: xfree86.xml.in.h:233 msgid "Northern Saami (Finland)" msgstr "北部沙米(芬兰)" -#: xfree86.xml.in.h:233 +#: xfree86.xml.in.h:234 msgid "Northern Saami (Norway)" msgstr "北部沙米(挪威)" -#: xfree86.xml.in.h:234 +#: xfree86.xml.in.h:235 msgid "Northern Saami (Sweden)" msgstr "北部沙米(瑞典)" -#: xfree86.xml.in.h:235 +#: xfree86.xml.in.h:236 msgid "Northgate OmniKey 101" msgstr "Northgate OmniKey 101" -#: xfree86.xml.in.h:236 +#: xfree86.xml.in.h:237 msgid "Norwegian" msgstr "挪威" -#: xfree86.xml.in.h:237 +#: xfree86.xml.in.h:238 msgid "Num_Lock LED shows alternative group" msgstr "NumLock 灯显示替代组(_L)" -#: xfree86.xml.in.h:238 +#: xfree86.xml.in.h:239 msgid "Ogh" msgstr "Ogh" -#: xfree86.xml.in.h:239 +#: xfree86.xml.in.h:240 msgid "Ogham" msgstr "欧甘" -#: xfree86.xml.in.h:240 +#: xfree86.xml.in.h:241 #, fuzzy msgid "Old standard" msgstr "标准" -#: xfree86.xml.in.h:241 +#: xfree86.xml.in.h:242 msgid "Oretec MCK-800 MM/Internet keyboard" msgstr "Oretec MCK-800 MM/网际键盘" -#: xfree86.xml.in.h:242 +#: xfree86.xml.in.h:243 msgid "Ori" msgstr "Ori" -#: xfree86.xml.in.h:243 +#: xfree86.xml.in.h:244 msgid "Oriya" msgstr "Oriya" -#: xfree86.xml.in.h:244 +#: xfree86.xml.in.h:245 msgid "PC-98xx Series" msgstr "PC-98xx 系列" -#: xfree86.xml.in.h:245 +#: xfree86.xml.in.h:246 msgid "PC104" msgstr "PC104" -#: xfree86.xml.in.h:246 +#: xfree86.xml.in.h:247 msgid "Pan" msgstr "Pan" -#: xfree86.xml.in.h:247 +#: xfree86.xml.in.h:248 msgid "Phonetic" msgstr "Phonetic" -#: xfree86.xml.in.h:248 +#: xfree86.xml.in.h:249 msgid "Pol" msgstr "Pol" -#: xfree86.xml.in.h:249 +#: xfree86.xml.in.h:250 msgid "Polish" msgstr "波兰" -#: xfree86.xml.in.h:250 +#: xfree86.xml.in.h:251 msgid "Polish (qwertz)" msgstr "波兰(qwertz)" -#: xfree86.xml.in.h:251 +#: xfree86.xml.in.h:252 msgid "Polish with Polish quotes on key \"1/!\"" msgstr "" -#: xfree86.xml.in.h:252 +#: xfree86.xml.in.h:253 msgid "Polytonic" msgstr "Polytonic" -#: xfree86.xml.in.h:253 +#: xfree86.xml.in.h:254 msgid "Portuguese" msgstr "葡萄牙" -#: xfree86.xml.in.h:254 +#: xfree86.xml.in.h:255 msgid "PowerPC PS/2" msgstr "PowerPC PS/2" -#: xfree86.xml.in.h:255 +#: xfree86.xml.in.h:256 #, fuzzy msgid "Press Left Alt key to choose 3rd level" msgstr "按左 Windows 键选择第三级" -#: xfree86.xml.in.h:256 +#: xfree86.xml.in.h:257 msgid "Press Left Win-key to choose 3rd level" msgstr "按左 Windows 键选择第三级" -#: xfree86.xml.in.h:257 +#: xfree86.xml.in.h:258 msgid "Press Menu key to choose 3rd level" msgstr "按菜单键选择第三级" -#: xfree86.xml.in.h:258 +#: xfree86.xml.in.h:259 #, fuzzy msgid "Press Right Alt key to choose 3rd level" msgstr "按右 Windows 键选择第三级" -#: xfree86.xml.in.h:259 +#: xfree86.xml.in.h:260 msgid "Press Right Control to choose 3rd level" msgstr "按右 Ctrl 选择第三级" -#: xfree86.xml.in.h:260 +#: xfree86.xml.in.h:261 msgid "Press Right Win-key to choose 3rd level" msgstr "按右 Windows 键选择第三级" -#: xfree86.xml.in.h:261 +#: xfree86.xml.in.h:262 #, fuzzy msgid "Press any of Alt keys to choose 3rd level" msgstr "按任何 Windows 键选择第三级" -#: xfree86.xml.in.h:262 +#: xfree86.xml.in.h:263 msgid "Press any of Win-keys to choose 3rd level" msgstr "按任何 Windows 键选择第三级" -#: xfree86.xml.in.h:263 +#: xfree86.xml.in.h:264 msgid "Propeller Voyager (KTEZ-1000)" msgstr "Propeller Voyager (KTEZ-1000)" -#: xfree86.xml.in.h:264 +#: xfree86.xml.in.h:265 msgid "Prt" msgstr "Prt" -#: xfree86.xml.in.h:265 +#: xfree86.xml.in.h:266 msgid "QTronix Scorpius 98N+" msgstr "QTronix Scorpius 98N+" -#: xfree86.xml.in.h:266 +#: xfree86.xml.in.h:267 msgid "R-Alt switches group while pressed" msgstr "按下右 Alt 切换组" -#: xfree86.xml.in.h:267 +#: xfree86.xml.in.h:268 msgid "Right Alt is Compose" msgstr "右 Alt 已编排" -#: xfree86.xml.in.h:268 +#: xfree86.xml.in.h:269 msgid "Right Alt key changes group" msgstr "右 Alt 键更改组" -#: xfree86.xml.in.h:269 +#: xfree86.xml.in.h:270 msgid "Right Control key works as Right Alt" msgstr "右 Ctrl 键等同于右 Alt" -#: xfree86.xml.in.h:270 +#: xfree86.xml.in.h:271 msgid "Right Ctrl key changes group" msgstr "右 Ctrl 键更改组" -#: xfree86.xml.in.h:271 +#: xfree86.xml.in.h:272 msgid "Right Shift key changes group" msgstr "右 Shift 健更改组" -#: xfree86.xml.in.h:272 +#: xfree86.xml.in.h:273 msgid "Right Win-key changes group" msgstr "右 Windows 键更改组" -#: xfree86.xml.in.h:273 +#: xfree86.xml.in.h:274 msgid "Right Win-key is Compose" msgstr "右 Windows 键已编排" -#: xfree86.xml.in.h:274 +#: xfree86.xml.in.h:275 msgid "Right Win-key switches group while pressed" msgstr "按下右 Windows 键切换组" -#: xfree86.xml.in.h:275 +#: xfree86.xml.in.h:276 msgid "Romanian" msgstr "罗马尼亚" -#: xfree86.xml.in.h:276 +#: xfree86.xml.in.h:277 msgid "Rou" msgstr "Rou" -#: xfree86.xml.in.h:277 +#: xfree86.xml.in.h:278 msgid "Rus" msgstr "Rus" -#: xfree86.xml.in.h:278 +#: xfree86.xml.in.h:279 msgid "Russian" msgstr "俄语" -#: xfree86.xml.in.h:279 +#: xfree86.xml.in.h:280 msgid "SK-1300" msgstr "SK-1300" -#: xfree86.xml.in.h:280 +#: xfree86.xml.in.h:281 msgid "SK-2500" msgstr "SK-2500" -#: xfree86.xml.in.h:281 +#: xfree86.xml.in.h:282 msgid "SK-6200" msgstr "SK-6200" -#: xfree86.xml.in.h:282 +#: xfree86.xml.in.h:283 msgid "SK-7100" msgstr "SK-7100" -#: xfree86.xml.in.h:283 +#: xfree86.xml.in.h:284 msgid "SVEN Ergonomic 2500" msgstr "SVEN Ergonomic 2500" -#: xfree86.xml.in.h:284 +#: xfree86.xml.in.h:285 msgid "Samsung SDM 4500P" msgstr "三星 SDM 4500P" -#: xfree86.xml.in.h:285 +#: xfree86.xml.in.h:286 msgid "Samsung SDM 4510P" msgstr "三星 SDM 4510P" -#: xfree86.xml.in.h:286 +#: xfree86.xml.in.h:287 msgid "Sapmi" msgstr "Sapmi" -#: xfree86.xml.in.h:287 +#: xfree86.xml.in.h:288 msgid "Scg" msgstr "Scg" -#: xfree86.xml.in.h:288 +#: xfree86.xml.in.h:289 msgid "Scroll_Lock LED shows alternative group" msgstr "ScrollLock 灯显示替代组(_L)" -#: xfree86.xml.in.h:289 +#: xfree86.xml.in.h:290 msgid "Serbian" msgstr "塞尔维亚" -#: xfree86.xml.in.h:290 +#: xfree86.xml.in.h:291 msgid "Serbian Cyrillic (swap Zhe, Ze)" msgstr "" -#: xfree86.xml.in.h:291 +#: xfree86.xml.in.h:292 msgid "Serbian Latin (swap Y, Z)" msgstr "" -#: xfree86.xml.in.h:292 +#: xfree86.xml.in.h:293 msgid "Serbian Latin Unicode" msgstr "" -#: xfree86.xml.in.h:293 +#: xfree86.xml.in.h:294 msgid "Serbian Latin Unicode (swap ZHE, Z)" msgstr "" -#: xfree86.xml.in.h:294 +#: xfree86.xml.in.h:295 msgid "Shift with numpad keys works as in MS Windows" msgstr "Shift+数字键盘的功能等同于 MS Windows" -#: xfree86.xml.in.h:295 +#: xfree86.xml.in.h:296 #, fuzzy msgid "Shift+CapsLock changes group" msgstr "CapsLock 键更改组" -#: xfree86.xml.in.h:296 +#: xfree86.xml.in.h:297 msgid "Slovak" msgstr "斯洛伐克" -#: xfree86.xml.in.h:297 +#: xfree86.xml.in.h:298 msgid "Slovak (qwerty)" msgstr "斯洛伐克(qwerty)" -#: xfree86.xml.in.h:298 +#: xfree86.xml.in.h:299 msgid "Slovenian" msgstr "斯洛文尼亚" -#: xfree86.xml.in.h:299 +#: xfree86.xml.in.h:300 msgid "Sme" msgstr "Sme" -#: xfree86.xml.in.h:300 +#: xfree86.xml.in.h:301 msgid "Spanish" msgstr "西班牙" -#: xfree86.xml.in.h:301 +#: xfree86.xml.in.h:302 msgid "Special keys (Ctrl+Alt+<key>) handled in a server." msgstr "服务器处理的特殊键 (Ctrl+Alt+<key>)。" -#: xfree86.xml.in.h:302 +#: xfree86.xml.in.h:303 msgid "Standard" msgstr "标准" -#: xfree86.xml.in.h:303 +#: xfree86.xml.in.h:304 msgid "Sun dead keys" msgstr "Sun 死键" -#: xfree86.xml.in.h:304 +#: xfree86.xml.in.h:305 msgid "Super is mapped to the Win-keys (default)." msgstr "Super 被映射到 Windows 键(默认)。" -#: xfree86.xml.in.h:305 +#: xfree86.xml.in.h:306 msgid "Svk" msgstr "Svk" -#: xfree86.xml.in.h:306 +#: xfree86.xml.in.h:307 msgid "Svn" msgstr "Svn" -#: xfree86.xml.in.h:307 +#: xfree86.xml.in.h:308 msgid "Swap Control and Caps Lock" msgstr "交换 Ctrl 和 CapsLock" -#: xfree86.xml.in.h:308 +#: xfree86.xml.in.h:309 msgid "Swe" msgstr "Swe" -#: xfree86.xml.in.h:309 +#: xfree86.xml.in.h:310 msgid "Swedish" msgstr "瑞典" -#: xfree86.xml.in.h:310 +#: xfree86.xml.in.h:311 msgid "Swiss French" msgstr "瑞典法语" -#: xfree86.xml.in.h:311 +#: xfree86.xml.in.h:312 msgid "Swiss German" msgstr "瑞典德语" -#: xfree86.xml.in.h:312 +#: xfree86.xml.in.h:313 msgid "Symplon PaceBook (tablet PC)" msgstr "Symplon PaceBook(平板电脑)" -#: xfree86.xml.in.h:313 +#: xfree86.xml.in.h:314 msgid "Syr" msgstr "Syr" -#: xfree86.xml.in.h:314 +#: xfree86.xml.in.h:315 msgid "Syriac" msgstr "叙利亚" -#: xfree86.xml.in.h:315 +#: xfree86.xml.in.h:316 +#, fuzzy +msgid "Syriac phonetic" +msgstr "Phonetic" + +#: xfree86.xml.in.h:317 msgid "Tajik" msgstr "塔吉克" -#: xfree86.xml.in.h:316 +#: xfree86.xml.in.h:318 msgid "Tamil" msgstr "泰米尔" -#: xfree86.xml.in.h:317 +#: xfree86.xml.in.h:319 msgid "Tel" msgstr "Tel" -#: xfree86.xml.in.h:318 +#: xfree86.xml.in.h:320 msgid "Telugu" msgstr "泰卢固" -#: xfree86.xml.in.h:319 +#: xfree86.xml.in.h:321 msgid "Tha" msgstr "Tha" -#: xfree86.xml.in.h:320 +#: xfree86.xml.in.h:322 msgid "Thai (Kedmanee)" msgstr "泰语(Kedmanee)" -#: xfree86.xml.in.h:321 +#: xfree86.xml.in.h:323 msgid "Thai (Pattachote)" msgstr "泰语(Pattachote)" -#: xfree86.xml.in.h:322 +#: xfree86.xml.in.h:324 msgid "Thai (TIS-820.2538)" msgstr "泰语(TIS-820.2538)" -#: xfree86.xml.in.h:323 +#: xfree86.xml.in.h:325 msgid "Third level choosers" msgstr "第三级选择" -#: xfree86.xml.in.h:324 +#: xfree86.xml.in.h:326 msgid "Tjk" msgstr "Tjk" -#: xfree86.xml.in.h:325 +#: xfree86.xml.in.h:327 msgid "Tml" msgstr "Tml" -#: xfree86.xml.in.h:326 +#: xfree86.xml.in.h:328 msgid "Toshiba Satellite S3000" msgstr "东芝 Satellite S3000" -#: xfree86.xml.in.h:327 +#: xfree86.xml.in.h:329 msgid "Trust Direct Access Keyboard" msgstr "Trust Direct Access 键盘" -#: xfree86.xml.in.h:328 +#: xfree86.xml.in.h:330 msgid "Trust Wireless Keyboard Classic" msgstr "Trust 无线经典键盘" -#: xfree86.xml.in.h:329 +#: xfree86.xml.in.h:331 msgid "Tur" msgstr "Tur" -#: xfree86.xml.in.h:330 +#: xfree86.xml.in.h:332 msgid "Turkish" msgstr "土耳其" -#: xfree86.xml.in.h:331 +#: xfree86.xml.in.h:333 msgid "Turkish (F)" msgstr "土耳其(F)" -#: xfree86.xml.in.h:332 +#: xfree86.xml.in.h:334 msgid "Turkish Alt-Q Layout" msgstr "土耳其 ALt-Q 布局" -#: xfree86.xml.in.h:333 +#: xfree86.xml.in.h:335 msgid "U.S. English" msgstr "美国英语" -#: xfree86.xml.in.h:334 +#: xfree86.xml.in.h:336 msgid "U.S. English w/ ISO9995-3" msgstr "美国英语 ISO9995-3" -#: xfree86.xml.in.h:335 +#: xfree86.xml.in.h:337 msgid "U.S. English w/ dead keys" msgstr "美国英语带死键" -#: xfree86.xml.in.h:336 +#: xfree86.xml.in.h:338 msgid "US" msgstr "US" -#: xfree86.xml.in.h:337 +#: xfree86.xml.in.h:339 msgid "US keyboard with Romanian letters" msgstr "美国键盘，带罗马尼亚字符" -#: xfree86.xml.in.h:338 +#: xfree86.xml.in.h:340 msgid "USA" msgstr "USA" -#: xfree86.xml.in.h:339 +#: xfree86.xml.in.h:341 msgid "Ukr" msgstr "Ukr" -#: xfree86.xml.in.h:340 +#: xfree86.xml.in.h:342 msgid "Ukrainian" msgstr "乌克兰" -#: xfree86.xml.in.h:341 +#: xfree86.xml.in.h:343 msgid "UnicodeExpert" msgstr "UnicodeExpert" -#: xfree86.xml.in.h:342 +#: xfree86.xml.in.h:344 msgid "United Kingdom" msgstr "英国" -#: xfree86.xml.in.h:343 +#: xfree86.xml.in.h:345 msgid "Use keyboard LED to show alternative group" msgstr "使用键盘灯显示替代组" -#: xfree86.xml.in.h:344 +#: xfree86.xml.in.h:346 msgid "Uses internal capitalization. Shift cancels Caps." msgstr "使用内部大写。Shift 取消大写。" -#: xfree86.xml.in.h:345 +#: xfree86.xml.in.h:347 msgid "Uses internal capitalization. Shift doesn't cancel Caps." msgstr "使用内部大写。Shift 不取消大写。" -#: xfree86.xml.in.h:346 +#: xfree86.xml.in.h:348 msgid "Uzb" msgstr "Uzb" -#: xfree86.xml.in.h:347 +#: xfree86.xml.in.h:349 msgid "Uzbek" msgstr "乌兹别克" -#: xfree86.xml.in.h:348 +#: xfree86.xml.in.h:350 msgid "Vietnamese" msgstr "越南语" -#: xfree86.xml.in.h:349 +#: xfree86.xml.in.h:351 msgid "Vnm" msgstr "Vnm" -#: xfree86.xml.in.h:350 +#: xfree86.xml.in.h:352 msgid "Winbook Model XP5" msgstr "Winbook Model XP5" -#: xfree86.xml.in.h:351 +#: xfree86.xml.in.h:353 msgid "Winkeys" msgstr "Winkeys" -#: xfree86.xml.in.h:352 +#: xfree86.xml.in.h:354 #, fuzzy msgid "With Malayalam digits" msgstr "马来西亚" -#: xfree86.xml.in.h:353 +#: xfree86.xml.in.h:355 msgid "Yahoo! Internet Keyboard" msgstr "雅虎网际键盘" -#: xfree86.xml.in.h:354 +#: xfree86.xml.in.h:356 msgid "Yug" msgstr "Yug" -#: xfree86.xml.in.h:355 +#: xfree86.xml.in.h:357 msgid "Yugoslavian" msgstr "南斯拉夫" -#: xfree86.xml.in.h:356 +#: xfree86.xml.in.h:358 msgid "abnt2" msgstr "abnt2" -#: xfree86.xml.in.h:357 +#: xfree86.xml.in.h:359 msgid "azerty" msgstr "azerty" -#: xfree86.xml.in.h:358 +#: xfree86.xml.in.h:360 msgid "azerty/digits" msgstr "azerty/数字" -#: xfree86.xml.in.h:359 +#: xfree86.xml.in.h:361 msgid "bksl" msgstr "bksl" -#: xfree86.xml.in.h:360 +#: xfree86.xml.in.h:362 msgid "digits" msgstr "数字" -#: xfree86.xml.in.h:361 +#: xfree86.xml.in.h:363 msgid "l2/101/qwerty/comma" msgstr "l2/101/qwerty/comma" -#: xfree86.xml.in.h:362 +#: xfree86.xml.in.h:364 msgid "l2/101/qwerty/dot" msgstr "l2/101/qwerty/dot" -#: xfree86.xml.in.h:363 +#: xfree86.xml.in.h:365 msgid "l2/101/qwertz/comma" msgstr "l2/101/qwertz/comma" -#: xfree86.xml.in.h:364 +#: xfree86.xml.in.h:366 msgid "l2/101/qwertz/dot" msgstr "l2/101/qwertz/dot" -#: xfree86.xml.in.h:365 +#: xfree86.xml.in.h:367 msgid "l2/102/qwerty/comma" msgstr "l2/102/qwerty/comma" -#: xfree86.xml.in.h:366 +#: xfree86.xml.in.h:368 msgid "l2/102/qwerty/dot" msgstr "l2/102/qwerty/dot" -#: xfree86.xml.in.h:367 +#: xfree86.xml.in.h:369 msgid "l2/102/qwertz/comma" msgstr "l2/102/qwertz/comma" -#: xfree86.xml.in.h:368 +#: xfree86.xml.in.h:370 msgid "l2/102/qwertz/dot" msgstr "l2/102/qwertz/dot" -#: xfree86.xml.in.h:369 +#: xfree86.xml.in.h:371 msgid "laptop" msgstr "laptop" -#: xfree86.xml.in.h:370 +#: xfree86.xml.in.h:372 msgid "lyx" msgstr "lyx" -#: xfree86.xml.in.h:371 +#: xfree86.xml.in.h:373 msgid "qwerty" msgstr "qwerty" -#: xfree86.xml.in.h:372 +#: xfree86.xml.in.h:374 msgid "qwerty/digits" msgstr "qwerty/digits" -#: xfree86.xml.in.h:373 +#: xfree86.xml.in.h:375 msgid "sefi" msgstr "sefi" -#: xfree86.xml.in.h:374 +#: xfree86.xml.in.h:376 msgid "si1452" msgstr "si1452" -#: xfree86.xml.in.h:375 +#: xfree86.xml.in.h:377 msgid "uni/101/qwerty/comma" msgstr "uni/101/qwerty/comma" -#: xfree86.xml.in.h:376 +#: xfree86.xml.in.h:378 msgid "uni/101/qwerty/dot" msgstr "uni/101/qwerty/dot" -#: xfree86.xml.in.h:377 +#: xfree86.xml.in.h:379 msgid "uni/101/qwertz/comma" msgstr "uni/101/qwertz/comma" -#: xfree86.xml.in.h:378 +#: xfree86.xml.in.h:380 msgid "uni/101/qwertz/dot" msgstr "uni/101/qwertz/dot" -#: xfree86.xml.in.h:379 +#: xfree86.xml.in.h:381 msgid "uni/102/qwerty/comma" msgstr "uni/102/qwerty/comma" -#: xfree86.xml.in.h:380 +#: xfree86.xml.in.h:382 msgid "uni/102/qwerty/dot" msgstr "uni/102/qwerty/dot" -#: xfree86.xml.in.h:381 +#: xfree86.xml.in.h:383 msgid "uni/102/qwertz/comma" msgstr "uni/102/qwertz/comma" -#: xfree86.xml.in.h:382 +#: xfree86.xml.in.h:384 msgid "uni/102/qwertz/dot" msgstr "uni/102/qwertz/dot" diff --git a/rules/README b/rules/README new file mode 100644 index 00000000..2d992c0a --- /dev/null +++ b/rules/README @@ -0,0 +1,6 @@ +This directory lists sets of rules which can be used to obtain an exact XKB +configuration. + + + +/* $XFree86$ */ diff --git a/rules/base b/rules/base new file mode 100644 index 00000000..927743a8 --- /dev/null +++ b/rules/base @@ -0,0 +1,196 @@ +// $Xorg: xfree86,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + +// +// Rules for resolving XKB components for use with XFree86 +// Copyright 1996 by Joseph Moss +// +// 2002 Modifier: Ivan Pascal The XFree86 Project +// $XFree86: xc/programs/xkbcomp/rules/xfree86,v 3.79 2004/01/09 00:16:01 dawes Exp $ +// + +// Layouts that still need be composed by old rules +! $oldlayouts = az bs ca ca_enhanced de_CH fr_CH hu hu_qwerty lt_std mn vn hr_US + +// If you want non-latin layouts implicitly include the en_US layout +// uncomment lines below +//! $nonlatin = am ar ben bg by dev el ge_la ge_ru guj gur il il_phonetic\ +// ir iu kan lo mk mm ml ori ru sr syr syr_phonetic tel th\ +// tj tml ua + +! $pcmodels = pc101 pc102 pc104 pc105 +! $maclaptop = ibook powerbook +! $mac = macintosh macintosh_old ibook powerbook + +! model = keycodes + macintosh_old = macintosh + powerpcps2 = powerpcps2 + pc98 = xfree98(pc98) + abnt2 = xfree86(abnt2) + jp106 = xfree86(jp106) + * = xfree86 + +! $azerty = be fr fr-latin9 +! $qwertz = al cz de hr pl2 ro si sk + +! layout[1] = keycodes + $azerty = +aliases(azerty) + $qwertz = +aliases(qwertz) + * = +aliases(qwerty) + +! layout = keycodes + $azerty = +aliases(azerty) + $qwertz = +aliases(qwertz) + * = +aliases(qwerty) + +! model = geometry + microsoft = microsoft(natural) + microsoftpro = microsoft(natural) + microsoftprose = microsoft(natural) + dell101 = dell(dell101) + flexpro = keytronic(FlexPro) + hp6000 = hp(omnibook) + omnikey101 = northgate(omnikey101) + thinkpad = ibm/thinkpad(common) + $pcmodels = pc(%m) + jp106 = pc(jp106) + everex = everex(STEPnote) + winbook = winbook(XP5) + pc98 = nec(pc98) + abnt2 = pc(abnt2) + $mac = macintosh(macintosh) + * = pc(pc104) + +! model variant layout = symbols + $maclaptop nodeadkeys * = macintosh/us(extended)+macintosh/%l%(v)+apple(laptop_bad_switch) + $mac nodeadkeys * = macintosh/us(extended)+macintosh/%l%(v) + $pcmodels nodeadkeys $oldlayouts = en_US(%m%_v)+%l%(v) + * nodeadkeys $oldlayouts = en_US(pc105%_v)+%l%(v) + +! model layout = symbols + pc98 nec/jp = nec/jp(pc98) + abnt2 br = pc/pc(pc104)+pc/br + $maclaptop us = macintosh/us(extended)+apple(laptop_bad_switch) + $maclaptop en_US = macintosh/us(extended)+apple(laptop_bad_switch) + $maclaptop * = macintosh/us(extended)+apple(laptop_bad_switch)+macintosh/%l%(v) + $mac us = macintosh/us(extended) + $mac en_US = macintosh/us(extended) + $mac * = macintosh/us(extended)+macintosh/%l%(v) + $pcmodels intl = us(%mcompose) + * intl = us(pc104compose) + * jp = jp + $pcmodels $oldlayouts = en_US(%m)+%l%(v) + $pcmodels $nonlatin = pc/pc(%m)+pc/us+pc/%l%(v):2 + $pcmodels * = pc/pc(%m)+pc/%l%(v) + * $oldlayouts = en_US(pc105)+%l%(v) + * $nonlatin = pc/pc(pc105)+pc/us+pc/%l%(v):2 + * * = pc/pc(pc105)+pc/%l%(v) + +! model layout[1] = symbols + $pcmodels * = pc/pc(%m)+pc/%l[1]%(v[1]) + * * = pc/pc(pc105)+pc/%l[1]%(v[1]) + +! layout[2] = symbols + * = +pc/%l[2]%(v[2]):2 + +! layout[3] = symbols + * = +pc/%l[3]%(v[3]):3 + +! layout[4] = symbols + * = +pc/%l[4]%(v[4]):4 + +! $inetkbds = airkey acpi scorpius azonaRF2300 \ + brother \ + btc5113rf btc5126t btc9000 btc9000a btc9001ah btc5090\ + cherryblue cherrybluea \ + chicony chicony9885 \ + compaqeak8 compaqik7 compaqik13 compaqik18 armada presario ipaq \ + dell inspiron dtk2000 \ + dexxa diamond genius geniuscomfy2 \ + ennyah_dkb1008 \ + hpi6 hp2501 hp2505 hp5181 hpxe3gc hpxe3gf hpxe4xxx hpzt11xx \ + hp500fa hp5xx hp5185 \ + honeywell_euroboard \ + rapidaccess rapidaccess2 rapidaccess2a \ + ltcd logiaccess logicdp logicdpa logicink logiciink \ + logiinkse logiinkseusb logiik itouch \ + mx1998 mx2500 mx2750 \ + microsoftinet microsoftpro microsoftprooem microsoftprose \ + microsoftoffice microsoftmult \ + oretec \ + propeller \ + qtronix \ + samsung4500 samsung4510 \ + sk1300 sk2500 sk6200 sk7100 \ + sven symplon toshiba_s3000 trust trustda yahoo + +! model = symbols + $inetkbds = +inet(%m) + +! model layout = compat + pc98 nec/jp = pc98(basic) + * * = complete + +! model layout[1] = compat + * * = complete + +! model = types + * = complete + +! option = symbols + grp:switch = +group(switch) + grp:lswitch = +group(lswitch) + grp:win_switch = +group(win_switch) + grp:lwin_switch = +group(lwin_switch) + grp:rwin_switch = +group(rwin_switch) + grp:toggle = +group(toggle) + grp:shift_toggle = +group(shift_toggle) + grp:ctrls_toggle = +group(ctrls_toggle) + grp:alts_toggle = +group(alts_toggle) + grp:ctrl_shift_toggle = +group(ctrl_shift_toggle) + grp:caps_toggle = +group(caps_toggle) + grp:shift_caps_toggle = +group(shift_caps_toggle) + grp:ctrl_alt_toggle = +group(ctrl_alt_toggle) + grp:alt_shift_toggle = +group(alt_shift_toggle) + grp:menu_toggle = +group(menu_toggle) + grp:lwin_toggle = +group(lwin_toggle) + grp:rwin_toggle = +group(rwin_toggle) + grp:lshift_toggle = +group(lshift_toggle) + grp:rshift_toggle = +group(rshift_toggle) + grp:lctrl_toggle = +group(lctrl_toggle) + grp:rctrl_toggle = +group(rctrl_toggle) + grp:lalt_toggle = +group(lalt_toggle) + lv3:switch = +level3(switch) + lv3:ralt_switch = +level3(ralt_switch) + lv3:lalt_switch = +level3(lalt_switch) + lv3:alt_switch = +level3(alt_switch) + lv3:menu_switch = +level3(menu_switch) + lv3:win_switch = +level3(win_switch) + lv3:lwin_switch = +level3(lwin_switch) + lv3:rwin_switch = +level3(rwin_switch) + ctrl:nocaps = +ctrl(nocaps) + ctrl:swapcaps = +ctrl(swapcaps) + ctrl:ctrl_ac = +ctrl(ctrl_ac) + ctrl:ctrl_aa = +ctrl(ctrl_aa) + ctrl:ctrl_ra = +ctrl(ctrl_ra) + altwin:menu = +altwin(menu) + altwin:meta_alt = +altwin(meta_alt) + altwin:meta_win = +altwin(meta_win) + altwin:left_meta_win = +altwin(left_meta_win) + altwin:super_win = +altwin(super_win) + altwin:hyper_win = +altwin(hyper_win) + compose:ralt = +compose(ralt) + compose:rwin = +compose(rwin) + compose:menu = +compose(menu) + srvrkeys:none = +srvr_ctrl(no_srvr_keys) + +! option = compat + grp_led:num = +leds(num) + grp_led:caps = +leds(caps) + grp_led:scroll = +leds(scroll) + +! option = types + caps:internal = +caps(internal) + caps:internal_nocancel = +caps(internal_nocancel) + caps:shift = +caps(shift) + caps:shift_nocancel = +caps(shift_nocancel) + numpad:microsoft = +numpad(microsoft) diff --git a/rules/base-it.lst b/rules/base-it.lst new file mode 100644 index 00000000..7506755c --- /dev/null +++ b/rules/base-it.lst @@ -0,0 +1,51 @@ +// $Xorg: xfree86-it.lst,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + +// +// Elenco dei modelli e dei lingauggi +// Copyright 1996 by Joseph Moss +// +// $XFree86: xc/programs/xkbcomp/rules/xfree86-it.lst,v 1.5 2001/01/17 23:45:57 dawes Exp $ + +! model + microsoft Microsoft Natural + dell101 Dell 101-key PC + flexpro Keytronic FlexPro + omnikey101 Northgate OmniKey 101 + pc101 101-key PC Generico + pc102 102-key (Intl) PC Generico + pc104 104-key PC Generico + pc105 105-key (Intl) PC Generico + jp106 106-key Giapponese + everex Everex STEPnote + winbook Winbook Modello XP5 + pc98 PC-98xx Series + +! layout + us Inglese Statunitense + en_US U.S. Inglese + ISO9995-3 + be Belga + bg Bulgaro + ca Canadese + cz Ceco + cz_qwerty Ceco (qwerty) + de Tedesco + de_CH Tedesco Svizzero + dk Danese + es Spagnolo + fi Finlandese + fr Francese + fr_CH Francese Svizzero + gb Regno Unito + hu Ungherese + hu_qwerty Ungherese (qwerty) + it Italiano + jp Giapponese + no Norvegese + pl Polacco + pt Portoghese + ru Russo + se Svedese + sk Slovacco + sk_qwerty Slovacco (qwerty) + th Tailandese + nec/jp nec/jp(pc98) diff --git a/rules/base.lst b/rules/base.lst new file mode 100644 index 00000000..9f018cbf --- /dev/null +++ b/rules/base.lst @@ -0,0 +1,269 @@ +// $XdotOrg: xc/programs/xkbcomp/rules/xfree86.lst,v 1.1.4.5 2004/03/05 13:41:31 eich Exp $ +// $Xorg: xfree86.lst,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + +// +// Rules descriptions for XFree86 +// Copyright 1996 by Joseph Moss +// +// $XFree86: xc/programs/xkbcomp/rules/xfree86.lst,v 3.80 2004/01/09 14:59:17 pascal Exp $ + +! model + pc101 Generic 101-key PC + pc102 Generic 102-key (Intl) PC + pc104 Generic 104-key PC + pc105 Generic 105-key (Intl) PC + dell101 Dell 101-key PC + everex Everex STEPnote + flexpro Keytronic FlexPro + microsoft Microsoft Natural + omnikey101 Northgate OmniKey 101 + winbook Winbook Model XP5 + jp106 Japanese 106-key + pc98 PC-98xx Series + abnt2 Brazilian ABNT2 + airkey Acer AirKey V + acpi ACPI Standard + azonaRF2300 Azona RF2300 wireless Internet Keyboard + scorpius Advance Scorpius KI + brother Brother Internet Keyboard + btc5113rf BTC 5113RF Multimedia + btc5126t BTC 5126T + btc9000 BTC 9000 + btc9000a BTC 9000A + cherryblue Cherry Blue Line CyBo@rd + cherrybluea Cherry Blue Line CyBo@rd (alternate option) + chicony Chicony Internet Keyboard + chicony9885 Chicony KB-9885 + compaqeak8 Compaq Easy Access Keyboard + compaqik7 Compaq Internet Keyboard (7 keys) + compaqik13 Compaq Internet Keyboard (13 keys) + compaqik18 Compaq Internet Keyboard (18 keys) + armada Laptop/notebook Compaq (eg. Armada, Evo) Laptop Keyboard + presario Laptop/notebook Compaq (eg. Presario) Internet Keyboard + ipaq Compaq iPaq Keyboard + dell Dell + inspiron Laptop/notebook Dell Inspiron 8xxx + dexxa Dexxa Wireless Desktop Keyboard + diamond Diamond 9801 / 9802 series + dtk2000 DTK2000 + ennyah_dkb1008 Ennyah DKB-1008 + genius Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + geniuscomfy2 Genius Comfy KB-21e-Scroll + hpi6 Hewlett-Packard Internet Keyboard + hp2501 Hewlett-Packard SK-2501 Multimedia Keyboard + hp2505 Hewlett-Packard SK-2505 Internet Keyboard + hp5181 Hewlett-Packard 5181 Internet Keyboard + hpxe3gc Hewlett-Packard Omnibook XE3 GC, GD, GE and Pavilion N5xxx + hpxe3gf Hewlett-Packard Omnibook XE3 GF + hpxe4xxx Hewlett-Packard Omnibook XE4xxx and ZE4xxx + hpxt1000 Hewlett-Packard Omnibook XT1000 + hpzt11xx Hewlett-Packard Pavilion ZT11xx + hp500fa Hewlett-Packard Omnibook 500 FA + hp5xx Hewlett-Packard Omnibook 5xx + hp6000 Hewlett-Packard Omnibook 6000/6100 + hp5185 Hewlett-Packard 5185 Internet Keyboard + honeywell_euroboard Honeywell Euroboard + rapidaccess IBM Rapid Access + rapidaccess2 IBM Rapid Access II + rapidaccess2a IBM Rapid Access II (alternate option) + thinkpad IBM ThinkPad 560Z/600/600E/A22E + ltcd Logitech Cordless Desktop + logicdp Logitech Cordless Desktop Pro + logicdpa Logitech Cordless Desktop Pro (alternate option) + logiaccess Logitech Access Keyboard + logicink Logitech Internet Navigator Keyboard + logiciink Logitech iTouch Internet Navigator Keyboard + logiinkse Logitech iTouch Internet Navigator Keyboard SE + logiinkseusb Logitech iTouch Internet Navigator Keyboard SE (USB) + logiik Logitech Internet Keyboard + itouch Logitech iTouch + mx1998 Memorex MX1998 + mx2500 Memorex MX2500 EZ-Access Keyboard + mx2750 Memorex MX2750 + microsoftinet Microsoft Internet Keyboard + microsoftpro Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + microsoftprooem Microsoft Natural Keyboard Pro OEM + microsoftprose Microsoft Internet Keyboard Pro, Swedish + microsoftoffice Microsoft Office Keyboard + microsoftmult Microsoft Wireless Multimedia Keyboard + oretec Oretec MCK-800 MM/Internet keyboard + propeller Propeller Voyager (KTEZ-1000) + qtronix QTronix Scorpius 98N+ + samsung4500 Samsung SDM 4500P + samsung4510 Samsung SDM 4510P + sk1300 SK-1300 + sk2500 SK-2500 + sk6200 SK-6200 + sk7100 SK-7100 + sven SVEN Ergonomic 2500 + symplon Symplon PaceBook (tablet PC) + toshiba_s3000 Toshiba Satellite S3000 + trust Trust Wireless Keyboard Classic + trustda Trust Direct Access Keyboard + yahoo Yahoo! Internet Keyboard + + +// The entries here should be ordered as follows: +// +// US entries first +// others in alphabetical order by the language/country name in English + +! layout + us U.S. English + en_US U.S. English w/ ISO9995-3 + us_intl U.S. English w/ deadkeys + al Albanian + ar Arabic + am Armenian + az Azerbaijani + by Belarusian + be Belgian + ben Bengali + bs Bosnian + br Brazilian + bg Bulgarian + mm Burmese + ca Canadian + ca_enhanced French Canadian + hr Croatian + hr_US Croatian (US) + cz Czech + cz_qwerty Czech (qwerty) + dk Danish + nl Dutch + dvorak Dvorak + dz Dzongkha / Tibetan + ee Estonian + fo Faroese + fi Finnish + fr French + fr-latin9 French (alternative) + ge_la Georgian (latin) + ge_ru Georgian (russian) + de German + el Greek + guj Gujarati + gur Gurmukhi + dev Hindi + hu Hungarian + hu_qwerty Hungarian (qwerty) + is Icelandic + iu Inuktitut + ir Iranian + il Israeli + it Italian + jp Japanese + kan Kannada + ko Korean + lo Lao + la Latin America + lt Lithuanian qwerty "numeric" + lt_std Lithuanian azerty standard + lv Latvian + mk Macedonian + ml Malayalam + mt Maltese + mt_us Maltese (US layout) + mn Mongolian + no Norwegian + ogham Ogham + ori Oriya + pl Polish + pl2 Polish (qwertz) + pt Portuguese + ro Romanian + ru Russian + se_FI Northern Saami (Finland) + se_NO Northern Saami (Norway) + se_SE Northern Saami (Sweden) + sr Serbian (Cyrillic) + yu Serbian (Latin) + si Slovenian + sk Slovak + sk_qwerty Slovak (qwerty) + es Spanish + se Swedish + fr_CH Swiss French + de_CH Swiss German + syr Syriac + tj Tajik + tml Tamil + tel Telugu + th Thai (Kedmanee) + th_tis Thai (TIS-820.2538) + th_pat Thai (Pattachote) + tr Turkish + tr_f Turkish (F) + ua Ukrainian + gb United Kingdom + uz Uzbek + vn Vietnamese + nec/jp PC-98xx Series + +! variant + nodeadkeys Eliminate dead keys + +! option + grp Group Shift/Lock behavior + grp:switch Right Alt key switches group while pressed + grp:lswitch Left Alt key switches group while pressed + grp:lwin_switch Left Win-key switches group while pressed + grp:rwin_switch Right Win-key switches group while pressed + grp:win_switch Both Win-keys switch group while pressed + grp:toggle Right Alt key changes group + grp:lalt_toggle Left Alt key changes group + grp:caps_toggle Caps Lock key changes group + grp:shift_caps_toggle Shift+CapsLock changes group + grp:shift_toggle Both Shift keys together change group + grp:alts_toggle Both Alt keys together change group + grp:ctrls_toggle Both Ctrl keys together change group + grp:ctrl_shift_toggle Control+Shift changes group + grp:ctrl_alt_toggle Alt+Control changes group + grp:alt_shift_toggle Alt+Shift changes group + grp:menu_toggle Menu key changes group + grp:lwin_toggle Left Win-key changes group + grp:rwin_toggle Right Win-key changes group + grp:lshift_toggle Left Shift key changes group + grp:rshift_toggle Right Shift key changes group + grp:lctrl_toggle Left Ctrl key changes group + grp:rctrl_toggle Right Ctrl key changes group + lv3 Third level choosers + lv3:switch Press Right Control to choose 3rd level + lv3:lalt_switch Press Left Alt key to choose 3rd level + lv3:ralt_switch Press Right Alt key to choose 3rd level + lv3:alt_switch Press any of Alt keys to choose 3rd level + lv3:menu_switch Press Menu key to choose 3rd level + lv3:win_switch Press any of Win-keys to choose 3rd level + lv3:lwin_switch Press Left Win-key to choose 3rd level + lv3:rwin_switch Press Right Win-key to choose 3rd level + ctrl Control Key Position + ctrl:nocaps Make CapsLock an additional Control + ctrl:swapcaps Swap Control and Caps Lock + ctrl:ctrl_ac Control key at left of 'A' + ctrl:ctrl_aa Control key at bottom left + ctrl:ctrl_ra Right Control key works as Right Alt + grp_led Use keyboard LED to show alternative group + grp_led:num Num_Lock LED shows alternative group + grp_led:caps Caps_Lock LED shows alternative group + grp_led:scroll Scroll_Lock LED shows alternative group + caps CapsLock key behavior + caps:internal uses internal capitalization. Shift cancels Caps. + caps:internal_nocancel uses internal capitalization. Shift doesn't cancel Caps. + caps:shift acts as Shift with locking. Shift cancels Caps. + caps:shift_nocancel acts as Shift with locking. Shift doesn't cancel Caps. + + altwin Alt/Win key behavior + altwin:menu Add the standard behavior to Menu key. + altwin:meta_alt Alt and Meta on the Alt keys (default). + altwin:meta_win Meta is mapped to the Win-keys. + altwin:left_meta_win Meta is mapped to the left Win-key. + altwin:meta_super Super is mapped to the Win-keys (default). + altwin:meta_hyper Hyper is mapped to the Win-keys. + + compose:ralt Right Alt is Compose + compose:rwin Right Win-key is Compose + compose:menu Menu is Compose + + numpad:microsoft Shift with numpad keys works as in MS Windows. + + srvrkeys:none Special keys (Ctrl+Alt+<key>) handled in a server. diff --git a/xfree86.xml.in b/rules/base.xml.in index d69643e3..d69643e3 100644 --- a/xfree86.xml.in +++ b/rules/base.xml.in diff --git a/rules/sgi b/rules/sgi new file mode 100644 index 00000000..218c25be --- /dev/null +++ b/rules/sgi @@ -0,0 +1,73 @@ +// $Xorg: sgi,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ + +! option = symbols + grp:switch = +group(switch) + grp:toggle = +group(toggle) + grp:shift_toggle = +group(shift_toggle) + grp:ctrl_shift_toggle = +group(ctrl_shift_toggle) + grp:ctrl_alt_toggle = +group(ctrl_alt_toggle) + grp:caps_toggle = +group(caps_toggle) + ctrl:nocaps = +ctrl(nocaps) + ctrl:swapcaps = +ctrl(swapcaps) + ctrl:ctrl_ac = +ctrl(ctrl_ac) + ctrl:ctrl_aa = +ctrl(ctrl_aa) + keypad:overlay = +keypad(overlay) + keypad:overlay1 = +keypad(overlay) + keypad:overlay2 = +keypad(overlay) + lock:shift = +lock(shift) + pc104:altmeta = +pc104(altmeta) + pc104:compose = +pc104(compose) + +! option = keycodes + lock:shift = +sgi/indy(shiftLock) + +! option = keycodes compat + keypad:overlay = +sgi/indy(overlayKeypad) +keypad(overlay) + keypad:overlay1 = +sgi/indy(overlayKeypad) +keypad(overlay1) + keypad:overlay2 = +sgi/indy(overlayKeypad) +keypad(overlay2) + +! model layout = keycodes geometry + indy us = sgi/indy(universal) sgi/indy(pc101) + indy intl = sgi/indy(universal) sgi/indy(pc101) + indy dvorak = sgi/indy(universal) sgi/indy(pc101) + indigo us = sgi/indigo(pc101) sgi/indigo(pc101) + indigo intl = sgi/indigo(pc101) sgi/indigo(pc101) + indigo dvorak = sgi/indigo(pc101) sgi/indigo(pc101) + indy jp = sgi/indy(jp106) sgi/indy(jp106) + +! model = keycodes geometry + indy = sgi/indy(universal) sgi/indy(pc102) + indy101 = sgi/indy(universal) sgi/indy(pc101) + indy102 = sgi/indy(universal) sgi/indy(pc102) + indy104 = sgi/indy(universal) microsoft(natural) + indy105 = sgi/indy(universal) microsoft(natural) + indy106 = sgi/indy(jp106) sgi/indy(jp106) + indigo = sgi/indigo(pc102) sgi/indigo(pc102) + indigo102 = sgi/indigo(pc102) sgi/indigo(pc102) + microsoft = sgi/indy(universal) microsoft(natural) + kinesis = sgi/indy(universal) kinesis + dell101 = sgi/indy(universal) dell(dell101) + flexpro = sgi/indy(universal) keytronic(FlexPro) + omnikey101 = sgi/indy(universal) northgate(omnikey101) + pc101 = sgi/indy(universal) pc(pc101) + pc102 = sgi/indy(universal) pc(pc102) + jp106 = sgi/indy(jp106) pc(jp106) + digital101 = sgi/indy(universal) digital/pc(pc101) + digital102 = sgi/indy(universal) digital/pc(pc102) + digitalpcxaj = sgi/indy(jp106) digital/pc(pcxaj) + +! model variant = symbols + * nodeadkeys = en_US(pc_universal%_v)+%l%(v) + +! model layout = symbols + * us = us(pc_universal) + * jp = us(pc101)+sgi/%l%(v) + * intl = us(pc_universal_compose) + * en_US = en_US(pc_universal) + * * = en_US(pc_universal)+%l%(v) + +! layout = compat + jp = complete+japan + +! model layout = compat types + * * = complete complete diff --git a/rules/sgi.lst b/rules/sgi.lst new file mode 100644 index 00000000..2486f80f --- /dev/null +++ b/rules/sgi.lst @@ -0,0 +1,82 @@ +// $Xorg: sgi.lst,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/rules/sgi.lst,v 3.6 2001/05/18 23:35:34 dawes Exp $ + +! model + indy SGI O2, Indigo^2 or Indy + indy101 SGI O2, Indigo^2 or Indy (101-key US) + indy102 SGI O2, Indigo^2 or Indy (102-key European) + indy104 Generic 104-key PC + indy105 Generic 105-key PC + indy106 SGI O2, Indigo^2 or Indy (106-key Japanese) + indigo SGI Indigo + indigo102 SGI Indigo (102-key European) + dell101 Dell 101-key PC + flexpro Keytronic FlexPro + jp106 Generic 106-key Japanese PC + microsoft Microsoft Natural + omnikey101 Northgate OmniKey 101 + pc101 Generic 101-key PC + pc102 Generic 102-key (European) PC + +! layout + be Belgian + bg Bulgarian + ca Canadian + cz Czech + cz_qwerty Czech (qwerty) + de German + de_CH Swiss German + dvorak Dvorak (US) + dk Danish + en_US US/English w/ISO9995-3 + es Spanish + fi Finnish + fr French + fr_CH Swiss French + gb United Kingdom + hu Hungarian + it Italian + intl US w/Compose Key + jp Japanese + no Norwegian + pl Polish + pt Portuguese + ru Russian + se Swedish + sk Slovak + sk_qwerty Slovak (qwerty) + th Thai + us US/ASCII + tr Turkish + +! variant + nodeadkeys Eliminate dead keys from European keyboards + typewriter Cyrillic layout similar to manual typewriters + phonetic Cyrillic layout similar to US/ASCII layout + +! option + grp Group Shift/Lock behavior + grp:switch Right Alt key switches group while held down + grp:toggle Pressing Right Alt key toggles group + grp:shift_toggle Pressing both shift keys together toggles group + grp:ctrl_shift_toggle Pressing shift and control together toggles group + grp:ctrl_alt_toggle Pressing alt and control together toggles group + grp:caps_toggle Caps Lock key toggles group + ctrl Control Key Position + ctrl:nocaps Replace Caps Lock with another control key + ctrl:swapcaps Swap positions of control and Caps Lock + ctrl:ctrl_ac Control key is left of the 'A' key + ctrl:ctrl_aa Control key is at the left of the bottom row + keypad Specify behavior of the numeric keypad + keypad:overlay Use default Overlay instead of modifier for keypad + keypad:overlay1 Use Overlay1 instead of modifier for keypad + keypad:overlay2 Use Overlay2 instead of modifier for keypad + lock Specify behavior of the lock key + lock:shift Key is shift lock + lock:caps Key is captals lock + lock:group Key is group lock + diff --git a/rules/sun b/rules/sun new file mode 100644 index 00000000..1af228e4 --- /dev/null +++ b/rules/sun @@ -0,0 +1,43 @@ +// $XFree86: xc/programs/xkbcomp/rules/sun,v 3.1 2000/05/18 23:21:43 dawes Exp $ + +! model = keycodes geometry + type4 = sun(type4) sun(type4) + type5 = sun(type5) sun + type5_euro = sun(type5_euro) sun(type5euro) + type5_unix = sun(type5) sun(type5unix) + type6 = sun(type6) sun(type5) // no type6 yet + type6_euro = sun(type6_euro) sun(type5) + +! model layout = symbols + type4 us = sun/us(sun4) + type5 us = sun/us(sun5) + type5_unix us = sun/us(sun5) + type6 us = sun/us(sun6) + type4 en_US = sun/us(sun4)+iso9995-3(basic) + type5 en_US = sun/us(sun5)+iso9995-3(basic) + type5_unix en_US = sun/us(sun5)+iso9995-3(basic) + type6 en_US = sun/us(sun6)+iso9995-3(basic) + type4 * = sun/us(sun4)+%l%(v) + type5 * = sun/us(sun5)+%l%(v) + type5_euro * = sun/us(sun5)+%l%(v) + type6 * = sun/us(sun6)+%l%(v) + type6_euro * = sun/us(sun6)+%l%(v) + +! model layout = compat types + * * = complete complete + +! option = symbols + grp:switch = +group(switch) + grp:toggle = +group(toggle) + grp:shift_toggle = +group(shift_toggle) + grp:ctrl_shift_toggle = +group(ctrl_shift_toggle) + grp:ctrl_alt_toggle = +group(ctrl_alt_toggle) + grp:caps_toggle = +group(caps_toggle) + ctrl:nocaps = +ctrl(nocaps) + ctrl:swapcaps = +ctrl(swapcaps) + ctrl:ctrl_ac = +ctrl(ctrl_ac) + ctrl:ctrl_aa = +ctrl(ctrl_aa) + keypad:overlay = +keypad(overlay) + keypad:overlay1 = +keypad(overlay) + keypad:overlay2 = +keypad(overlay) + lock:shift = +lock(shift) diff --git a/rules/sun.lst b/rules/sun.lst new file mode 100644 index 00000000..0129f4fe --- /dev/null +++ b/rules/sun.lst @@ -0,0 +1,62 @@ +// $XFree86: xc/programs/xkbcomp/rules/sun.lst,v 3.5 2001/05/23 16:03:51 dawes Exp $ + +! model + type4 Sun Type4 + type5 Sun Type5 + type5_euro Sun Type5 European + type5_unix Sun Type5 Unix + type6 Sun Type6 + type6_euro Sun Type6 European + +! layout + be Belgian + bg Bulgarian + ca Canadian + cz Czech + de German + de_CH Swiss German + dvorak Dvorak (US) + dk Danish + en_US US/English w/ISO9995-3 + es Spanish + fi Finnish + fr French + fr_CH Swiss French + gb United Kingdom + hu Hungarian + it Italian + intl US w/Compose Key + jp Japanese + no Norwegian + pl Polish + pt Portuguese + ru Russian + se Swedish + sk Slovak + th Thai + us US/ASCII + tr Turkish + +! variant + nodeadkeys Eliminate dead keys from European keyboards + typewriter Cyrillic layout similar to manual typewriters + phonetic Cyrillic layout similar to US/ASCII layout + +! option + grp Group Shift/Lock behavior + grp:switch Right Alt key switches group while held down + grp:toggle Pressing Right Alt key toggles group + grp:shift_toggle Pressing both shift keys together toggles group + grp:ctrl_shift_toggle Pressing shift and control together toggles group + grp:ctrl_alt_toggle Pressing alt and control together toggles group + grp:caps_toggle Caps Lock key toggles group + ctrl Control Key Position + ctrl:nocaps Replace Caps Lock with another control key + ctrl:swapcaps Swap positions of control and Caps Lock + ctrl:ctrl_ac Control key is left of the 'A' key + ctrl:ctrl_aa Control key is at the left of the bottom row + lock Specify behavior of the lock key + lock:shift Key is shift lock + lock:caps Key is captals lock + lock:group Key is group lock + diff --git a/rules/xfree98 b/rules/xfree98 new file mode 100644 index 00000000..8fda6439 --- /dev/null +++ b/rules/xfree98 @@ -0,0 +1,29 @@ +// +// Rules for resolving XKB components for use with XFree86 +// Copyright 1996 by Joseph Moss +// +// $XFree86: xc/programs/xkbcomp/rules/xfree86,v 3.5 1996/12/17 21:03:59 dawes Exp $ +// + +! model = keycodes geometry + pc98 = xfree98(pc98) nec(pc98) + jp106 = xfree98(jp106) pc(jp106) + +! model layout = symbols + pc98 nec/jp = nec/jp(pc98) + jp106 jp = jp + +! model layout = compat types + * * = complete complete + +! option = symbols + grp:switch = +group(switch) + grp:toggle = +group(toggle) + grp:shift_toggle = +group(shift_toggle) + grp:ctrl_shift_toggle = +group(ctrl_shift_toggle) + grp:ctrl_alt_toggle = +group(ctrl_alt_toggle) + ctrl:nocaps = +ctrl(nocaps) + ctrl:swapcaps = +ctrl(swapcaps) + ctrl:ctrl_ac = +ctrl(ctrl_ac) + ctrl:ctrl_aa = +ctrl(ctrl_aa) + diff --git a/rules/xfree98.lst b/rules/xfree98.lst new file mode 100644 index 00000000..012c9919 --- /dev/null +++ b/rules/xfree98.lst @@ -0,0 +1,30 @@ +// +// Rules descriptions for XFree86 +// Copyright 1996 by Joseph Moss +// +// $XFree86: xc/programs/xkbcomp/rules/xfree86.lst,v 3.3 1996/12/18 03:30:14 dawes Exp $ + +! model + pc98 PC-98 series standard + jp106 Japanese 106-key + +! layout + pc98 PC98 + jp Japanese + +! variant + nodeadkeys Eliminate dead keys + +! option + grp Group Shift/Lock behavior + grp:switch R-Alt switches group while pressed + grp:toggle Right Alt key changes group + grp:shift_toggle Both Shift keys together change group + grp:ctrl_shift_toggle Control+Shift changes group + grp:ctrl_alt_toggle Alt+Control changes group + ctrl Control Key Position + ctrl:nocaps Make CapsLock an additional Control + ctrl:swapcaps Swap Control and Caps Lock + ctrl:ctrl_ac Control key at left of 'A' + ctrl:ctrl_aa Control key at bottom left + diff --git a/rules/xml2lst.pl b/rules/xml2lst.pl new file mode 100644 index 00000000..56cf0cdc --- /dev/null +++ b/rules/xml2lst.pl @@ -0,0 +1,288 @@ +#!/usr/bin/perl + +# converts the <rules>.xml file to the old format <rules>.lst file +# +# Usage: +# +# perl xml2lst.pl [lang] < filename.xml > filename.lst +# +# author Ivan Pascal + +if (@ARGV) { + $lang = shift @ARGV; +} else { + $lang = ''; +} + +$doc = new_document( 0, ''); +parse('', $doc); + +($reg) = node_by_name($doc, '/xkbConfigRegistry'); +@models = node_by_name($reg, 'modelList/model/configItem'); +@layouts = node_by_name($reg, 'layoutList/layout/configItem'); +@options = node_by_name($reg, 'optionList/group/configItem'); + +print "! model\n"; +for $i (@models) { + ($name) = node_by_name($i, 'name'); + @desc = node_by_name($i, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-15s %s\n", text_child($name), text_child($descr)); +} + +print "\n! layout\n"; +for $i (@layouts) { + ($name) = node_by_name($i, 'name'); + @desc = node_by_name($i, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr ) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-15s %s\n", text_child($name), text_child($descr)); +} + +print "\n! variant\n"; +for $l (@layouts) { + ($lname) = node_by_name($l, 'name'); + @variants = node_by_name($l, '../variantList/variant/configItem'); + for $v (@variants) { + ($name) = node_by_name($v, 'name'); + @desc = node_by_name($v, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-15s %s: %s\n", + text_child($name), text_child($lname), text_child($descr)); + } +} + +print "\n! options\n"; +for $g (@options) { + ($name) = node_by_name($g, 'name'); + @desc = node_by_name($g, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-20s %s\n", text_child($name), text_child($descr)); + + @opts = node_by_name($g, '../option/configItem'); + for $o (@opts) { + ($name) = node_by_name($o, 'name'); + @desc = node_by_name($o, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-20s %s\n", + text_child($name), text_child($descr)); + } +} + +sub with_attribute { + local ($nodelist, $attrexpr) = @_; + local ($attr, $value) = split (/=/, $attrexpr); + local ($node, $attrvalue); + if (defined $value && $value ne '') { + $value =~ s/"//g; + foreach $node (@{$nodelist}) { + $attrvalue = node_attribute($node, $attr); + if (defined $attrvalue && $attrvalue eq $value) { + return $node; + } + } + } else { + foreach $node (@{$nodelist}) { + if (! defined node_attribute($node, $attr)) { + return $node; + } + } + } + undef; +} + +# Subroutines + +sub parse { + local $intag = 0; + my (@node_stack, $parent); + $parent = @_[1]; + local ($tag, $text); + + while (<>) { + chomp; + @str = split /([<>])/; + shift @str if ($str[0] eq '' || $str[0] =~ /^[ \t]*$/); + + while (scalar @str) { + $token = shift @str; + if ($token eq '<') { + $intag = 1; + if (defined $text) { + add_text_node($parent, $text); + undef $text; + } + } elsif ($token eq '>') { + $intag = 0; + if ($tag =~ /^\/(.*)/) { # close tag + $parent = pop @node_stack; + } elsif ($tag =~ /^([^\/]*)\/$/) { + empty_tag($parent, $1); + } else { + if (defined ($node = open_tag($parent, $tag))) { + push @node_stack, $parent; + $parent = $node; + } + } + undef $tag; + } else { + if ($intag == 1) { + if (defined $tag) { + $tag .= ' '. $token; + } else { + $tag = $token; + } + } else { + if (defined $text) { + $text .= "\n" . $token; + } else { + $text = $token; + } + } + } + } + } +} + +sub new_document { + $doc = new_node( 0, '', 'DOCUMENT'); + $doc->{CHILDREN} = []; + return $doc; +} + +sub new_node { + local ($parent_node, $tag, $type) = @_; + + my %node; + $node{PARENT} = $parent_node; + $node{TYPE} = $type; + + if ($type eq 'COMMENT' || $type eq 'TEXT') { + $node{TEXT} = $tag; + $node{NAME} = $type; + return \%node; + } + + local ($tname, $attr) = split(' ', $tag, 2); + $node{NAME} = $tname; + + if (defined $attr && $attr ne '') { + my %attr_table; + local @attr_list = split ( /"/, $attr); + local ($name, $value); + while (scalar @attr_list) { + $name = shift @attr_list; + $name =~ s/[ =]//g; + next if ($name eq ''); + $value = shift @attr_list; + $attr_table{$name} =$value; + } + $node{ATTRIBUTES} = \%attr_table; + } + return \%node; +} + +sub add_node { + local ($parent_node, $node) = @_; + push @{$parent_node->{CHILDREN}}, $node; + + local $tname = $node->{NAME}; + if (defined $parent_node->{$tname}) { + push @{$parent_node->{$tname}}, $node + } else { + $parent_node->{$tname} = [ $node ]; + } +} + +sub empty_tag { + local ($parent_node, $tag) = @_; + local $node = new_node($parent_node, $tag, 'EMPTY'); + add_node($parent_node, $node); +} + +sub open_tag { + local ($parent_node, $tag) = @_; + local $node; + + if ($tag =~ /^\?.*/ || $tag =~ /^\!.*/) { + $node = new_node($parent_node, $tag, 'COMMENT'); + add_node($parent_node, $node); + undef; return; + } else { + $node = new_node($parent_node, $tag, 'NODE'); + $node->{CHILDREN} = []; + add_node($parent_node, $node); + return $node; + } +} + +sub add_text_node { + local ($parent_node, $text) = @_; + local $node = new_node($parent_node, $text, 'TEXT'); + add_node($parent_node, $node); +} + +sub node_by_name { + local ($node, $name) = @_; + local ($tagname, $path) = split(/\//, $name, 2); + + my @nodelist; + + if ($tagname eq '') { + while ($node->{PARENT} != 0) { + $node = $node->{PARENT}; + } + sublist_by_name($node, $path, \@nodelist); + } else { + sublist_by_name($node, $name, \@nodelist); + } + return @nodelist; +} + +sub sublist_by_name { + local ($node, $name, $res) = @_; + local ($tagname, $path) = split(/\//, $name, 2); + + if (! defined $path) { + push @{$res}, (@{$node->{$tagname}}); + return; + } + + if ($tagname eq '..' && $node->{PARENT} != 0) { + $node = $node->{PARENT}; + sublist_by_name($node, $path, $res); + } else { + local $n; + for $n (@{$node->{$tagname}}) { + sublist_by_name($n, $path, $res); + } + } +} + +sub node_attribute { + local $node = @_[0]; + if (defined $node->{ATTRIBUTES}) { + return $node->{ATTRIBUTES}{@_[1]}; + } + undef; +} + +sub text_child { + local ($node) = @_; + local ($child) = node_by_name($node, 'TEXT'); + return $child->{TEXT}; +} diff --git a/semantics/basic b/semantics/basic new file mode 100644 index 00000000..014e9ca6 --- /dev/null +++ b/semantics/basic @@ -0,0 +1,7 @@ +// $Xorg: basic,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +default xkb_semantics "basic" { + +xkb_types { include "basic" }; +xkb_compatibility { include "basic" }; + +}; diff --git a/semantics/complete b/semantics/complete new file mode 100644 index 00000000..df1632e2 --- /dev/null +++ b/semantics/complete @@ -0,0 +1,7 @@ +// $Xorg: complete,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +default xkb_semantics "complete" { + +xkb_types { include "complete" }; +xkb_compatibility { include "complete" }; + +}; diff --git a/semantics/default b/semantics/default new file mode 100644 index 00000000..42e755e3 --- /dev/null +++ b/semantics/default @@ -0,0 +1,7 @@ +// $Xorg: default,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +default xkb_semantics "default" { + +xkb_types { include "default" }; +xkb_compatibility { include "default" }; + +}; diff --git a/semantics/xtest b/semantics/xtest new file mode 100644 index 00000000..d221fe5b --- /dev/null +++ b/semantics/xtest @@ -0,0 +1,7 @@ +// $Xorg: xtest,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +default xkb_semantics "xtest" { + +xkb_types { include "basic" }; +xkb_compatibility { include "xtest" }; + +}; diff --git a/symbols/al b/symbols/al new file mode 100644 index 00000000..4e025c98 --- /dev/null +++ b/symbols/al @@ -0,0 +1,43 @@ + +// based on +// albanian keyboard layout +// done by Pablo Saratxaga <pablo@mandrakesoft.com> +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/al,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type3)" + + name[Group1]="Albanian"; + + key <AE01> { [ 1, exclam, asciitilde, dead_tilde ] }; + key <AE02> { [ 2, quotedbl, dead_caron, oneeighth ] }; + key <AE03> { [ 3, numbersign, dead_circumflex, sterling ] }; + key <AE04> { [ 4, dollar, dead_breve, dollar ] }; + key <AE05> { [ 5, percent, dead_abovering, threeeighths] }; + key <AE06> { [ 6, asciicircum, dead_ogonek, fiveeighths ] }; + key <AE07> { [ 7, ampersand, grave, dead_grave ] }; + key <AE08> { [ 8, asterisk, dead_abovedot, trademark ] }; + key <AE09> { [ 9, parenleft, dead_acute, plusminus ] }; + key <AE10> { [ 0, parenright, dead_doubleacute, degree ] }; + key <AE11> { [ minus, underscore, dead_diaeresis, questiondown] }; + + key <AD03> { [ e, E, EuroSign, EuroSign ] }; + key <AD11> { [ ccedilla, Ccedilla, division, dead_abovering ] }; + key <AD12> { [ at, apostrophe, multiply, dead_macron ] }; + + key <AC02> { [ s, S, dstroke, section ] }; + key <AC03> { [ d, D, Dstroke, ETH ] }; + key <AC10> { [ediaeresis, Ediaeresis, dollar, dead_doubleacute ] }; + key <AC11> { [bracketleft, braceleft, ssharp, dead_caron ] }; + key <TLDE> { [ backslash, bar, notsign, notsign ] }; + + key <BKSL> { [bracketright, braceright, currency, dead_breve ] }; + key <AB08> { [ comma, semicolon, less, multiply ] }; + key <AB09> { [ period, colon, greater, division ] }; + key <AB10> { [ slash, question, dead_belowdot, dead_abovedot ] }; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/am b/symbols/am new file mode 100644 index 00000000..f7ea4e92 --- /dev/null +++ b/symbols/am @@ -0,0 +1,174 @@ + +// based on a keyboard map from an 'xkb/symbols/am' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/am,v 1.4 2003/05/29 12:41:58 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Armenian"; + + // Alphanumeric section + key <TLDE> { [ 0x100055d, 0x100055c ] }; + key <LSGT> { [ question, 0x100058a ] }; + key <BKSL> { [ guillemotright, guillemotleft ] }; + + key <AE01> { [ 0x1000586, 0x1000556 ] }; + key <AE02> { [ 0x1000571, 0x1000541 ] }; + key <AE03> { [ 0x1002013, 0x1002014 ] }; + key <AE04> { [ comma, dollar ] }; + key <AE05> { [ 0x1000589, 0x1002026 ] }; + key <AE06> { [ 0x100055e, percent ] }; + key <AE07> { [ period, 0x1000587 ] }; + key <AE08> { [ 0x100055b, 0x10002bc ] }; + key <AE09> { [ parenright, parenleft ] }; + key <AE10> { [ 0x1000585, 0x1000555 ] }; + key <AE11> { [ 0x1000567, 0x1000537 ] }; + key <AE12> { [ 0x1000572, 0x1000542 ] }; + + + key <AD01> { [ 0x1000573, 0x1000543 ] }; + key <AD02> { [ 0x1000583, 0x1000553 ] }; + key <AD03> { [ 0x1000562, 0x1000532 ] }; + key <AD04> { [ 0x100057d, 0x100054d ] }; + key <AD05> { [ 0x1000574, 0x1000544 ] }; + key <AD06> { [ 0x1000578, 0x1000548 ] }; + key <AD07> { [ 0x1000582, 0x1000552 ] }; + key <AD08> { [ 0x100056f, 0x100053f ] }; + key <AD09> { [ 0x1000568, 0x1000538 ] }; + key <AD10> { [ 0x1000569, 0x1000539 ] }; + key <AD11> { [ 0x100056e, 0x100053e ] }; + key <AD12> { [ 0x1000581, 0x1000551 ] }; + + key <AC01> { [ 0x100057b, 0x100054b ] }; + key <AC02> { [ 0x100057e, 0x100054e ] }; + key <AC03> { [ 0x1000563, 0x1000533 ] }; + key <AC04> { [ 0x1000565, 0x1000535 ] }; + key <AC05> { [ 0x1000561, 0x1000531 ] }; + key <AC06> { [ 0x1000576, 0x1000546 ] }; + key <AC07> { [ 0x100056b, 0x100053b ] }; + key <AC08> { [ 0x100057f, 0x100054f ] }; + key <AC09> { [ 0x1000570, 0x1000540 ] }; + key <AC10> { [ 0x100057a, 0x100054a ] }; + key <AC11> { [ 0x1000580, 0x1000550 ] }; + + key <AB01> { [ 0x100056a, 0x100053a ] }; + key <AB02> { [ 0x1000564, 0x1000534 ] }; + key <AB03> { [ 0x1000579, 0x1000549 ] }; + key <AB04> { [ 0x1000575, 0x1000545 ] }; + key <AB05> { [ 0x1000566, 0x1000536 ] }; + key <AB06> { [ 0x100056c, 0x100053c ] }; + key <AB07> { [ 0x1000584, 0x1000554 ] }; + key <AB08> { [ 0x100056d, 0x100053d ] }; + key <AB09> { [ 0x1000577, 0x1000547 ] }; + key <AB10> { [ 0x100057c, 0x100054c ] }; + +}; + +xkb_symbols "old" { + include "pc/am(basic)" + + key <BKSL> { [ 0x1002026, 0x1000587 ] }; + + key <AE01> { [ 0x1000573, 0x1000543 ] }; + key <AE02> { [ 0x100057b, 0x100054b ] }; + key <AE03> { [ 0x100056a, 0x100053a ] }; + key <AE04> { [ 0x1000571, 0x1000541 ] }; + key <AE05> { [ 0x1000575, 0x1000545 ] }; + key <AE06> { [ 0x100057c, 0x100054c ] }; + key <AE07> { [ 0x1000580, 0x1000550 ] }; + key <AE08> { [ 0x1000581, 0x1000551 ] }; + key <AE09> { [ 0x1000567, 0x1000537 ] }; + key <AE10> { [ 0x1000572, 0x1000542 ] }; + key <AE11> { [ 0x1002013, 0x1002014 ] }; + key <AE12> { [ parenleft, parenright] }; + + key <AD01> { [ 0x1000583, 0x1000553 ] }; + key <AD02> { [ 0x1000562, 0x1000532 ] }; + key <AD03> { [ 0x100057d, 0x100054d ] }; + key <AD04> { [ 0x1000574, 0x1000544 ] }; + key <AD05> { [ 0x1000578, 0x1000548 ] }; + key <AD06> { [ 0x1000582, 0x1000552 ] }; + key <AD07> { [ 0x100056f, 0x100053f ] }; + key <AD08> { [ 0x1000568, 0x1000538 ] }; + key <AD09> { [ 0x1000569, 0x1000539 ] }; + key <AD10> { [ 0x100056e, 0x100053e ] }; + key <AD11> { [ 0x1000585, 0x1000555 ] }; + key <AD12> { [ 0x1000586, 0x1000556 ] }; + + key <AC01> { [ 0x100057e, 0x100054e ] }; + key <AC02> { [ 0x1000563, 0x1000533 ] }; + key <AC03> { [ 0x1000565, 0x1000535 ] }; + key <AC04> { [ 0x1000561, 0x1000531 ] }; + key <AC05> { [ 0x1000576, 0x1000546 ] }; + key <AC06> { [ 0x100056b, 0x100053b ] }; + key <AC07> { [ 0x100057f, 0x100054f ] }; + key <AC08> { [ 0x1000570, 0x1000540 ] }; + key <AC09> { [ 0x100057a, 0x100054a ] }; + key <AC10> { [ 0x1000589, 0x100058a ] }; + key <AC11> { [ 0x100055b, 0x10002bc ] }; + + key <AB01> { [ 0x1000564, 0x1000534 ] }; + key <AB02> { [ 0x1000579, 0x1000549 ] }; + key <AB03> { [ 0x1000566, 0x1000536 ] }; + key <AB04> { [ 0x100056c, 0x100053c ] }; + key <AB05> { [ 0x1000584, 0x1000554 ] }; + key <AB06> { [ 0x100056d, 0x100053d ] }; + key <AB07> { [ 0x1000577, 0x1000547 ] }; + key <AB08> { [ comma, guillemotleft ] }; + key <AB09> { [ period, guillemotright ] }; + key <AB10> { [ 0x100055e, 0x100055e ] }; + +}; + +xkb_symbols "phonetic" { + include "pc/am(old)" + + key <BKSL> { [ 0x1000577, 0x1000547 ] }; + + key <AE01> { [ 0x1000567, 0x1000537 ] }; + key <AE02> { [ 0x1000569, 0x1000539 ] }; + key <AE03> { [ 0x1000583, 0x1000553 ] }; + key <AE05> { [ 0x100057b, 0x100054b ] }; + key <AE06> { [ 0x1000582, 0x1000552 ] }; + key <AE07> { [ 0x1000587, 0x1000587 ] }; + key <AE08> { [ 0x1000580, 0x1000550 ] }; + key <AE09> { [ 0x1000579, 0x1000549 ] }; + key <AE10> { [ 0x1000573, 0x1000543 ] }; + key <AE12> { [ 0x100056a, 0x100053a ] }; + + key <LatQ> { [ 0x1000584, 0x1000554 ] }; + key <LatW> { [ 0x1000578, 0x1000548 ] }; + key <LatE> { [ 0x1000565, 0x1000535 ] }; + key <LatR> { [ 0x100057c, 0x100054c ] }; + key <LatT> { [ 0x100057f, 0x100054f ] }; + key <LatY> { [ 0x1000568, 0x1000538 ] }; + key <LatU> { [ 0x1000582, 0x1000552 ] }; + key <LatI> { [ 0x100056b, 0x100053b ] }; + key <LatO> { [ 0x1000585, 0x1000555 ] }; + key <LatP> { [ 0x100057a, 0x100054a ] }; + key <AD11> { [ 0x100056d, 0x100053d ] }; + key <AD12> { [ 0x100056e, 0x100053e ] }; + + key <LatA> { [ 0x1000561, 0x1000531 ] }; + key <LatS> { [ 0x100057d, 0x100054d ] }; + key <LatD> { [ 0x1000564, 0x1000534 ] }; + key <LatF> { [ 0x1000586, 0x1000556 ] }; + key <LatG> { [ 0x1000563, 0x1000533 ] }; + key <LatH> { [ 0x1000570, 0x1000540 ] }; + key <LatJ> { [ 0x1000575, 0x1000545 ] }; + key <LatK> { [ 0x100056f, 0x100053f ] }; + key <LatL> { [ 0x100056c, 0x100053c ] }; + key <AC10> { [ semicolon, 0x1000589 ] }; + key <AC11> { [ 0x100055b, 0x1000022 ] }; + + key <LatZ> { [ 0x1000566, 0x1000536 ] }; + key <LatX> { [ 0x1000572, 0x1000542 ] }; + key <LatC> { [ 0x1000581, 0x1000551 ] }; + key <LatV> { [ 0x100057e, 0x100054e ] }; + key <LatB> { [ 0x1000562, 0x1000532 ] }; + key <LatN> { [ 0x1000576, 0x1000546 ] }; + key <LatM> { [ 0x1000574, 0x1000544 ] }; + key <AB10> { [ 0x1002026, 0x100055e ] }; + +}; diff --git a/symbols/ar b/symbols/ar new file mode 100644 index 00000000..373fb6b4 --- /dev/null +++ b/symbols/ar @@ -0,0 +1,142 @@ + +// based on a keyboard map from an 'xkb/symbols/ar' file +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Arabic"; + +// NOTES: +// +// there is also combined shadda diacritis in AltGr position of simple +// diacritics fatha, fathatan, damma, dammatan, kasra and kasratan +// should a third state be added to Group2 ? +// + + key <TLDE> { [ Arabic_thal, Arabic_shadda ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + + key <AD01> { [ Arabic_dad, Arabic_fatha ] }; + key <AD02> { [ Arabic_sad, Arabic_fathatan ] }; + key <AD03> { [ Arabic_theh, Arabic_damma ] }; + key <AD04> { [ Arabic_qaf, Arabic_dammatan ] }; + key <AD05> { [ Arabic_feh, 0x100fef9 ] }; + key <AD06> { [ Arabic_ghain, Arabic_hamzaunderalef ] }; + key <AD07> { [ Arabic_ain, grave ] }; + key <AD08> { [ Arabic_ha, division ] }; + key <AD09> { [ Arabic_khah, multiply ] }; + key <AD10> { [ Arabic_hah, Arabic_semicolon ] }; + key <AD11> { [ Arabic_jeem, braceleft ] }; + key <AD12> { [ Arabic_dal, braceright ] }; + + key <AC01> { [ Arabic_sheen, backslash ] }; + key <AC02> { [ Arabic_seen, S ] }; + key <AC03> { [ Arabic_yeh, bracketleft ] }; + key <AC04> { [ Arabic_beh, bracketright ] }; + key <AC05> { [ Arabic_lam, 0x100fef7 ] }; + key <AC06> { [ Arabic_alef, Arabic_hamzaonalef ] }; + key <AC07> { [ Arabic_teh, Arabic_tatweel ] }; + key <AC08> { [ Arabic_noon, Arabic_comma ] }; + key <AC09> { [ Arabic_meem, slash ] }; + key <AC10> { [ Arabic_kaf, colon ] }; + key <AC11> { [ Arabic_tah, quotedbl ] }; + key <BKSL> { [ less, greater ] }; + + key <LSGT> { [ bar, brokenbar ] }; + key <AB01> { [Arabic_hamzaonyeh, asciitilde ] }; + key <AB02> { [ Arabic_hamza, Arabic_sukun ] }; + key <AB03> { [Arabic_hamzaonwaw, Arabic_kasra ] }; + key <AB04> { [ Arabic_ra, Arabic_kasratan ] }; + key <AB05> { [ 0x100fefb, 0x100fef5 ] }; + key <AB06> { [Arabic_alefmaksura, Arabic_maddaonalef ] }; + key <AB07> { [Arabic_tehmarbuta, apostrophe ] }; + key <AB08> { [ Arabic_waw, comma ] }; + key <AB09> { [ Arabic_zain, period ] }; + key <AB10> { [ Arabic_zah, Arabic_question_mark ] }; + + // End alphanumeric section +}; + +partial alphanumeric_keys +xkb_symbols "qwerty" { + include "pc/ar(basic)" +}; + +partial alphanumeric_keys +xkb_symbols "azerty" { + include "pc/ar(basic)" + + // the north african arabic keyboard differs from the middle east one + // by the numeric row; it follows French keyboard style + // + // PROBLEM: some chars are inaccessible: ! @ # $ % ^ * + // should they go elsewhere? replace " ' that are now in double ? + // also, dead_circumflex and dead_diaeresis from French keyboard + // as well as ugrave are missing, which questions the utility of the + // other accentuated latin letters. Maybe this is useful only with + // a French keyboard in Group1 ? Then, shouldn't Group1 be filled ? + + key <AE01> { [ ampersand, 1 ] }; + key <AE02> { [ eacute, 2 ] }; + key <AE03> { [ quotedbl, 3 ] }; + key <AE04> { [ apostrophe, 4 ] }; + key <AE05> { [ parenleft, 5 ] }; + key <AE06> { [ minus, 6 ] }; + key <AE07> { [ egrave, 7 ] }; + key <AE08> { [ underscore, 8 ] }; + key <AE09> { [ ccedilla, 9 ] }; + key <AE10> { [ agrave, 0 ] }; + key <AE11> { [ parenright, degree ] }; +}; + +partial alphanumeric_keys +xkb_symbols "digits" { + include "pc/ar(basic)" + + // use arabic script digits + + key <AE01> { [ 0x1000661, exclam ] }; + key <AE02> { [ 0x1000662, at ] }; + key <AE03> { [ 0x1000663, numbersign ] }; + key <AE04> { [ 0x1000664, dollar ] }; + key <AE05> { [ 0x1000665, percent ] }; + key <AE06> { [ 0x1000666, asciicircum ] }; + key <AE07> { [ 0x1000667, ampersand ] }; + key <AE08> { [ 0x1000668, asterisk ] }; + key <AE09> { [ 0x1000669, parenleft ] }; + key <AE10> { [ 0x1000660, parenright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "qwerty_digits" { + include "pc/ar(digits)" +}; + +partial alphanumeric_keys +xkb_symbols "azerty_digits" { + include "pc/ar(azerty)" + + key <AE01> { [ ampersand, 0x1000661 ] }; + key <AE02> { [ eacute, 0x1000662 ] }; + key <AE03> { [ quotedbl, 0x1000663 ] }; + key <AE04> { [ apostrophe, 0x1000664 ] }; + key <AE05> { [ parenleft, 0x1000665 ] }; + key <AE06> { [ minus, 0x1000666 ] }; + key <AE07> { [ egrave, 0x1000667 ] }; + key <AE08> { [ underscore, 0x1000668 ] }; + key <AE09> { [ ccedilla, 0x1000669 ] }; + key <AE10> { [ agrave, 0x1000660 ] }; +}; + diff --git a/symbols/be b/symbols/be new file mode 100644 index 00000000..323a0636 --- /dev/null +++ b/symbols/be @@ -0,0 +1,98 @@ + +// based on a keyboard map from an 'xkb/symbols/be' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/be,v 1.3 2003/04/12 10:53:48 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Belgian"; + + key <AE01> { [ ampersand, 1, bar, exclamdown ] }; + key <AE02> { [ eacute, 2, at, oneeighth ] }; + key <AE03> { [ quotedbl, 3, numbersign, sterling ] }; + key <AE04> { [apostrophe, 4, onequarter, dollar ] }; + key <AE05> { [ parenleft, 5, onehalf, threeeighths ] }; + key <AE06> { [ section, 6, asciicircum, fiveeighths ] }; + key <AE07> { [ egrave, 7, braceleft, seveneighths ] }; + key <AE08> { [ exclam, 8, bracketleft, trademark ] }; + key <AE09> { [ ccedilla, 9, braceleft, plusminus ] }; + key <AE10> { [ agrave, 0, braceright, degree ] }; + key <AE11> { [parenright, degree, backslash, questiondown ] }; + key <AE12> { [ minus, underscore, dead_cedilla, dead_ogonek ] }; + + key <AD01> { [ a, A, at, Greek_OMEGA ] }; + key <AD02> { [ z, Z, lstroke, Lstroke ] }; + key <AD03> { [ e, E, EuroSign, cent ] }; + key <AD11> { [dead_circumflex, dead_diaeresis, bracketleft, dead_abovering ] }; + key <AD12> { [ dollar, asterisk, bracketright, dead_macron ] }; + + key <AC01> { [ q, Q, ae, AE ] }; + key <AC10> { [ m, M, dead_acute, dead_doubleacute ] }; + key <AC11> { [ ugrave, percent, dead_acute, dead_caron ] }; + key <TLDE> { [twosuperior, threesuperior, notsign, notsign ] }; + + key <BKSL> { [ mu, sterling, dead_grave, dead_breve ] }; + key <AB01> { [ w, W, guillemotleft, less ] }; + key <AB07> { [ comma, question, dead_cedilla, masculine ] }; + key <AB08> { [ semicolon, period, horizconnector, multiply ] }; + key <AB09> { [ colon, slash, periodcentered, division ] }; + key <AB10> { [ equal, plus, dead_tilde, dead_abovedot] }; + key <LSGT> { [ less, greater, backslash, backslash ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "iso-alternate" { + include "pc/be(basic)" + + key <AD01> { [ a, A, ae, AE ] }; + key <AD02> { [ z, Z, guillemotleft, less ] }; + key <AC01> { [ q, Q, at, Greek_OMEGA ] }; + key <AC10> { [ m, M, mu, masculine ] }; + key <AB01> { [ w, W, lstroke, Lstroke ] }; + key <AB07> { [ comma, question, dead_cedilla, dead_doubleacute ] }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // Use the Sun dead keys + + include "pc/be(basic)" + + key <AD11> { [SunFA_Circum, SunFA_Diaeresis, bracketleft, bracketleft] }; + key <AC11> { [ ugrave, percent, SunFA_Acute, SunFA_Acute ] }; + key <BKSL> { [ mu, sterling, SunFA_Grave, SunFA_Grave ] }; + key <AB07> { [ comma, question, SunFA_Cedilla, SunFA_Cedilla] }; + key <AB10> { [ equal, plus, SunFA_Tilde, SunFA_Tilde ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + + // Use the Sun dead keys + + include "pc/be(Sundeadkeys)" + +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Eliminates dead keys from the basic Belgian layout + + include "pc/be(basic)" + + key <AE12> { [ minus, underscore, cedilla, ogonek ] }; + key <AD11> { [asciicircum, diaeresis, bracketleft, bracketleft] }; + key <AD12> { [ dollar, asterisk, bracketright, macron ] }; + key <AC10> { [ m, M, acute, doubleacute ] }; + key <AC11> { [ ugrave, percent, quoteright, quoteright ] }; + key <BKSL> { [ mu, sterling, quoteleft, quoteleft ] }; + key <AB07> { [ comma, question, cedilla, masculine ] }; + key <AB10> { [ equal, plus, asciitilde, asciitilde ] }; +}; diff --git a/symbols/ben b/symbols/ben new file mode 100644 index 00000000..9dd48e50 --- /dev/null +++ b/symbols/ben @@ -0,0 +1,143 @@ + +// based on a keyboard map from an 'xkb/symbols/ben' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/ben,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Bengali"; + + // Mainly numbers. + key <AE01> { [ 0x10009E7 ] }; + key <AE02> { [ 0x10009E8 ] }; + key <AE03> { [ 0x10009E9 ] }; + key <AE04> { [ 0x10009EA ] }; + key <AE05> { [ 0x10009EB ] }; + key <AE06> { [ 0x10009EC ] }; + key <AE07> { [ 0x10009ED ] }; + key <AE08> { [ 0x10009EE ] }; + key <AE09> { [ 0x10009EF, parenleft ] }; + key <AE10> { [ 0x10009E6, parenright ] }; + key <AE11> { [ minus, 0x1000983 ] }; + key <AE12> { [ 0x100098B, 0x10009C3 ] }; + +// Mainly long vowels + + key <AD01> { [ 0x10009CC, 0x1000994 ] }; + key <AD02> { [ 0x10009C8, 0x1000990 ] }; + key <AD03> { [ 0x10009BE, 0x1000986 ] }; + key <AD04> { [ 0x10009C0, 0x1000988 ] }; + key <AD05> { [ 0x10009C2, 0x100098A ] }; + +// Mainly voiced consonants + + key <AD06> { [ 0x10009AC, 0x10009AD ] }; + key <AD07> { [ 0x10009B9, 0x1000999 ] }; + key <AD08> { [ 0x1000997, 0x1000998 ] }; + key <AD09> { [ 0x10009A6, 0x10009A7 ] }; + key <AD10> { [ 0x100099C, 0x100099D ] }; + key <AD11> { [ 0x10009A1, 0x10009A2 ] }; + key <AD12> { [ 0x10009BC, 0x100099E ] }; + +// Mainly short vowels + key <AC01> { [ 0x10009CB, 0x1000993 ] }; + key <AC02> { [ 0x10009C7, 0x100098F ] }; + key <AC03> { [ 0x10009CD, 0x1000985 ] }; + key <AC04> { [ 0x10009BF, 0x1000987 ] }; + key <AC05> { [ 0x10009C1, 0x1000989 ] }; + +// Mainly unvoiced consonants + + key <AC06> { [ 0x10009AA, 0x10009AB ] }; + key <AC07> { [ 0x10009B0, 0x10009DD ] }; + key <AC08> { [ 0x1000995, 0x1000996 ] }; + key <AC09> { [ 0x10009A4, 0x10009A5 ] }; + key <AC10> { [ 0x100099A, 0x100099B ] }; + key <AC11> { [ 0x100099F, 0x10009A0 ] }; + key <BKSL> { [ backslash, bar ] }; + + key <AB01> { [ z, Z ] }; + key <AB02> { [ 0x1000982, 0x1000981 ] }; + key <AB03> { [ 0x10009AE, 0x10009A3 ] }; + key <AB04> { [ 0x10009A8, 0x10009A8 ] }; + key <AB05> { [ 0x10009AC, 0x10009AC ] }; + key <AB06> { [ 0x10009B2, 0x10009B2 ] }; + key <AB07> { [ 0x10009B8, 0x10009B6 ] }; + key <AB08> { [ comma, 0x10009B7 ] }; + key <AB09> { [ period, 0x1000964 ] }; + key <AB10> { [ 0x10009DF, 0x10009AF ] }; +}; + +xkb_symbols "probhat" { + name[Group1]= "Bengali"; + key <ESC> { [ Escape ] }; + +// numbers + key <TLDE> { [ quoteleft, asciitilde ] }; + key <AE01> { [ 0x10009E7, exclam ] }; + key <AE02> { [ 0x10009E8, at ] }; + key <AE03> { [ 0x10009E9, numbersign ] }; + key <AE04> { [ 0x10009EA, 0x10009F3 ] }; + key <AE05> { [ 0x10009EB, percent ] }; + key <AE06> { [ 0x10009EC, asciicircum ] }; + key <AE07> { [ 0x10009ED, 0x100099E ] }; + key <AE08> { [ 0x10009EE, asterisk ] }; + key <AE09> { [ 0x10009EF, parenleft ] }; + key <AE10> { [ 0x10009E6, parenright ] }; + key <AE11> { [ minus, 0x1000983 ] }; + key <AE12> { [ 0x100098B, 0x10009C3 ] }; + key <BKSP> { [ BackSpace ] }; + +// tab, q to ] + key <TAB> { [ Tab, ISO_Left_Tab ] }; + key <AD01> { [ 0x10009A6, 0x10009A7 ] }; + key <AD02> { [ 0x10009C2, 0x100098A ] }; + key <AD03> { [ 0x10009C0, 0x1000988 ] }; + key <AD04> { [ 0x10009B0, 0x10009DC ] }; + key <AD05> { [ 0x100099F, 0x10009A0 ] }; + key <AD06> { [ 0x100098F, 0x1000990 ] }; + key <AD07> { [ 0x10009C1, 0x1000989 ] }; + key <AD08> { [ 0x10009BF, 0x1000987 ] }; + key <AD09> { [ 0x1000993, 0x1000994 ] }; + key <AD10> { [ 0x10009AA, 0x10009AB ] }; + key <AD11> { [ 0x10009C7, 0x10009C8 ] }; + key <AD12> { [ 0x10009CB, 0x10009CC ] }; + key <RTRN> { [ Return ] }; + +// caps, a to ' +// key <CAPS> { [ Caps_Lock ] }; + key <AC01> { [ 0x10009BE, 0x1000985 ] }; + key <AC02> { [ 0x10009B8, 0x10009B7 ] }; + key <AC03> { [ 0x10009A1, 0x10009A2 ] }; + key <AC04> { [ 0x10009A4, 0x10009A5 ] }; + key <AC05> { [ 0x1000997, 0x1000998 ] }; + key <AC06> { [ 0x10009B9, 0x1000983 ] }; + key <AC07> { [ 0x100099C, 0x100099D ] }; + key <AC08> { [ 0x1000995, 0x1000996 ] }; + key <AC09> { [ 0x10009B2, 0x1000982 ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ quoteright, quotedbl ] }; + +// shift, z to / +// key <LFSH> { [ Shift_L ] }; + key <AB01> { [ 0x10009DF, 0x10009AF ] }; + key <AB02> { [ 0x10009B6, 0x10009DD ] }; + key <AB03> { [ 0x100099A, 0x100099B ] }; + key <AB04> { [ 0x1000986, 0x100098B ] }; + key <AB05> { [ 0x10009AC, 0x10009AD ] }; + key <AB06> { [ 0x10009A8, 0x10009A3 ] }; + key <AB07> { [ 0x10009AE, 0x1000999 ] }; + key <AB08> { [ comma, 0x10009C3 ] }; + key <AB09> { [ period, 0x1000981 ] }; + key <AB10> { [ 0x10009CD, question ] }; + key <BKSL> { [ backslash, bar ] }; + +// key <LCTL> { [ Control_L ] }; +// key <SPCE> { [ space ] }; + +// modifier_map Shift { Shift_L }; +// modifier_map Lock { Caps_Lock }; +// modifier_map Control{ Control_L }; + +}; + diff --git a/symbols/bg b/symbols/bg new file mode 100644 index 00000000..9dbf1a1a --- /dev/null +++ b/symbols/bg @@ -0,0 +1,141 @@ + +// based on a keyboard map: +// +////////////////////////////////////////////////////////////////////////// +// Copyright (C) 1999, 2000 by Anton Zinoviev <anton@lml.bas.bg> +// +// This software may be used, modified, copied, distributed, and sold, +// in both source and binary form provided that the above copyright +// and these terms are retained. Under no circumstances is the author +// responsible for the proper functioning of this software, nor does +// the author assume any responsibility for damages incurred with its +// use. +// +////////////////////////////////////////////////////////////////////////// +// Version 1.6r1 +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "bds" { + + name[Group1]= "Cyrillic"; + + key <TLDE> { [ parenleft, parenright ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, question ] }; + key <AE03> { [ 3, plus ] }; + key <AE04> { [ 4, quotedbl ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, equal ] }; + key <AE07> { [ 7, colon ] }; + key <AE08> { [ 8, slash ] }; + key <AE09> { [ 9, emdash ] }; + key <AE10> { [ 0, numerosign ] }; + key <AE11> { [ minus, I ] }; + key <AE12> { [ period, V ] }; + + key <AD01> { [ comma, Cyrillic_yeru ] }; + key <AD02> { [ Cyrillic_u, Cyrillic_U ] }; + key <AD03> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <AD04> { [ Cyrillic_i, Cyrillic_I ] }; + key <AD05> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AD06> { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key <AD07> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <AD08> { [ Cyrillic_es, Cyrillic_ES ] }; + key <AD09> { [ Cyrillic_de, Cyrillic_DE ] }; + key <AD10> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <AD11> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <AD12> { [ semicolon, section ] }; + + key <AC01> { [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key <AC02> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <AC03> { [ Cyrillic_a, Cyrillic_A ] }; + key <AC04> { [ Cyrillic_o, Cyrillic_O ] }; + key <AC05> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <AC06> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <AC07> { [ Cyrillic_te, Cyrillic_TE ] }; + key <AC08> { [ Cyrillic_en, Cyrillic_EN ] }; + key <AC09> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <AC10> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AC11> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <BKSL> { [ apostrophe, Cyrillic_YERU ] }; + + key <AB01> { [ Cyrillic_yu, Cyrillic_YU ] }; + key <AB02> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <AB03> { [ Cyrillic_hardsign, Cyrillic_HARDSIGN ] }; + key <AB04> { [ Cyrillic_e, Cyrillic_E ] }; + key <AB05> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <AB06> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <AB07> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AB08> { [ Cyrillic_er, Cyrillic_ER ] }; + key <AB09> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AB10> { [ Cyrillic_be, Cyrillic_BE ] }; + + // End alphanumeric section + + key <RALT> { [ Alt_R, Meta_R ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "phonetic" { + + name[Group1]= "Cyrillic"; + + key <TLDE> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + + key <LatQ> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <LatW> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <LatE> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <LatR> { [ Cyrillic_er, Cyrillic_ER ] }; + key <LatT> { [ Cyrillic_te, Cyrillic_TE ] }; + key <LatY> { [ Cyrillic_hardsign, Cyrillic_HARDSIGN ] }; + key <LatU> { [ Cyrillic_u, Cyrillic_U ] }; + key <LatI> { [ Cyrillic_i, Cyrillic_I ] }; + key <LatO> { [ Cyrillic_o, Cyrillic_O ] }; + key <LatP> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AD11> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AD12> { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + + key <LatA> { [ Cyrillic_a, Cyrillic_A ] }; + key <LatS> { [ Cyrillic_es, Cyrillic_ES ] }; + key <LatD> { [ Cyrillic_de, Cyrillic_DE ] }; + key <LatF> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <LatG> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <LatH> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <LatJ> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <LatK> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <LatL> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ quoteright, quotedbl ] }; + key <BKSL> { [ Cyrillic_yu, Cyrillic_YU ] }; + + key <LatZ> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <LatX> { [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key <LatC> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <LatV> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <LatB> { [ Cyrillic_be, Cyrillic_BE ] }; + key <LatN> { [ Cyrillic_en, Cyrillic_EN ] }; + key <LatM> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; + + // End alphanumeric section + + key <RALT> { [ Alt_R, Meta_R ] }; + +}; diff --git a/symbols/br b/symbols/br new file mode 100644 index 00000000..6c4536c3 --- /dev/null +++ b/symbols/br @@ -0,0 +1,60 @@ + +// based on +// "a very simple Brasilian ABNT2 keybaord +// by Ricardo Y. Igarashi (iga@that.com.br) +// Adds suport for dead-keys in I18N applications +// by Conectiva (http://www.conectiva.com.br)" +// +// $XdotOrg: xc/programs/xkbcomp/symbols/pc/br,v 1.1.4.3 2004/03/05 13:41:32 eich Exp $ +// $XFree86: xc/programs/xkbcomp/symbols/pc/br,v 1.3 2003/04/19 12:22:11 pascal Exp $ + +xkb_symbols "abnt2" { + + include "pc/latin" + + name[Group1]="Brazilian"; + + key <AE02> { [ 2, at, twosuperior, onehalf ] }; + key <AE03> { [ 3, numbersign, threesuperior, threequarters ] }; + key <AE04> { [ 4, dollar, sterling, onequarter ] }; + key <AE05> { [ 5, percent, cent, threeeighths ] }; + key <AE06> { [ 6, dead_diaeresis, notsign, diaeresis ] }; + key <AE12> { [ equal, plus, section, dead_ogonek ] }; + + key <AD03> { [ e, E, EuroSign, EuroSign ] }; + key <AD04> { [ r, R, registered, registered ] }; + key <AD11> { [dead_acute, dead_grave, acute, grave ] }; + key <AD12> { [bracketleft, braceleft, ordfeminine, dead_macron ] }; + + key <AC10> { [ ccedilla, Ccedilla, dead_acute, dead_doubleacute] }; + key <AC11> { [dead_tilde, dead_circumflex, asciitilde, asciicircum ] }; + key <AC12> { [bracketright, braceright, masculine, masculine ] }; + + key <TLDE> { [apostrophe, quotedbl, notsign, notsign ] }; + + key <BKSL> { [ backslash, bar, masculine, dead_breve ] }; + key <AB03> { [ c, C, copyright, copyright ] }; + key <AB07> { [ m, M, mu, mu ] }; + key <AB10> { [ semicolon, colon, dead_belowdot, dead_abovedot ] }; + +// ABNT-2 keyboard has this special key + + key <AB11> { [ slash, question, degree, questiondown ] }; + + key <KPPT> { [KP_Decimal ] }; + key <KPDL> { [ KP_Delete, comma ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/br(abnt2)" // for consistent naming + + key <AE06> { [ 6, diaeresis, notsign, notsign ] }; + key <AD11> { [apostrophe, grave ] }; + key <AC10> { [ ccedilla, Ccedilla, acute, doubleacute ] }; + key <AC11> { [asciitilde, asciicircum ] }; + key <AB10> { [ semicolon, colon, dead_belowdot, abovedot ] }; +}; diff --git a/symbols/by b/symbols/by new file mode 100644 index 00000000..d8c6a4b4 --- /dev/null +++ b/symbols/by @@ -0,0 +1,75 @@ + +// based on +// belarusian standard keyboard +// Alexander Mikhailian <mikhailian@altern.org> +// +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Belarusian"; + + key <TLDE> { [ Cyrillic_io, Cyrillic_IO ] }; + key <LSGT> { [ bar, brokenbar ] }; + + key <AE02> { [ 2, quotedbl ] }; + key <AE04> { [ 4, semicolon ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, colon ] }; + key <AE07> { [ 7, question ] }; + + key <AD01> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <AD02> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <AD03> { [ Cyrillic_u, Cyrillic_U ] }; + key <AD04> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <AD05> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <AD06> { [ Cyrillic_en, Cyrillic_EN ] }; + key <AB07> { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key <AD07> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <AD08> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AD09> { [ Byelorussian_shortu, Byelorussian_SHORTU ]}; + key <AD10> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <AD11> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <AD12> { [ apostrophe, apostrophe ] }; + + key <AC01> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <AC02> { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key <AC03> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <AC04> { [ Cyrillic_a, Cyrillic_A ] }; + key <AC05> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AC06> { [ Cyrillic_er, Cyrillic_ER ] }; + key <AC07> { [ Cyrillic_o, Cyrillic_O ] }; + key <AC08> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AC09> { [ Cyrillic_de, Cyrillic_DE ] }; + key <AC10> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <AC11> { [ Cyrillic_e, Cyrillic_E ] }; + + key <AB01> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <AB02> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <AB03> { [ Cyrillic_es, Cyrillic_ES ] }; + key <AB04> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AB05> { [ Ukrainian_i, Ukrainian_I ] }; + key <AB06> { [ Cyrillic_te, Cyrillic_TE ] }; + key <AB08> { [ Cyrillic_be, Cyrillic_BE ] }; + key <AB09> { [ Cyrillic_yu, Cyrillic_YU ] }; + key <AB10> { [ period, comma ] }; + + key <BKSL> { [ slash, bar ] }; + + // End alphanumeric section +}; + +partial alphanumeric_keys +xkb_symbols "winkeys" { + include "pc/by(basic)" + key <AE04> { [ 4, semicolon ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, colon ] }; + key <AE07> { [ 7, question ] }; + key <AE08> { [ 8, asterisk ] }; + key <AB10> { [ period, comma ] }; + key <BKSL> { [ slash, bar ] }; +}; diff --git a/symbols/cz b/symbols/cz new file mode 100644 index 00000000..dbacdb11 --- /dev/null +++ b/symbols/cz @@ -0,0 +1,83 @@ +// $XFree86: xc/programs/xkbcomp/symbols/pc/cz,v 1.2 2002/11/22 04:02:22 dawes +// Exp $ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // This layout conforms to a new cz compromise standard designed + // to satisfy most unix, windows and mac users. + // 2001 by Kamil Toman <ktoman@email.cz> + + include "pc/latin" + + name[Group1]= "Czech"; + + key <TLDE> { [ semicolon, dead_abovering, grave, asciitilde ] }; + key <AE01> { [ plus, 1, exclam, dead_tilde ] }; + key <AE02> { [ ecaron, 2, at, dead_caron ] }; + key <AE03> { [ scaron, 3, numbersign, dead_circumflex ] }; + key <AE04> { [ ccaron, 4, dollar, dead_breve ] }; + key <AE05> { [ rcaron, 5, percent, dead_abovering ] }; + key <AE06> { [ zcaron, 6, asciicircum, dead_ogonek ] }; + key <AE07> { [ yacute, 7, ampersand, dead_grave ] }; + key <AE08> { [ aacute, 8, asterisk, dead_abovedot] }; + key <AE09> { [ iacute, 9, braceleft, dead_acute ] }; + key <AE10> { [ eacute, 0, braceright, dead_doubleacute ] }; + key <AE11> { [ equal, percent, NoSymbol, dead_diaeresis ] }; + key <AE12> { [dead_acute, dead_caron, dead_macron, dead_cedilla ] }; + + key <AD01> { [ q, Q, backslash, NoSymbol ] }; + key <AD02> { [ w, W, bar, Nosymbol ] }; + key <AD03> { [ e, E, EuroSign, NoSymbol ] }; + key <AD04> { [ r, R, NoSymbol, NoSymbol ] }; + key <AD05> { [ t, T, NoSymbol, NoSymbol ] }; + key <AD06> { [ z, Z, NoSymbol, NoSymbol ] }; + key <AD07> { [ u, U, NoSymbol, NoSymbol ] }; + key <AD08> { [ i, I, NoSymbol, NoSymbol ] }; + key <AD09> { [ o, O, NoSymbol, NoSymbol ] }; + key <AD10> { [ p, P, NoSymbol, NoSymbol ] }; + + key <AD11> { [ uacute, slash, bracketleft, division ] }; + key <AD12> { [parenright, parenleft, bracketright, multiply ] }; + + key <AC01> { [ a, A, asciitilde, NoSymbol ] }; + key <AC02> { [ s, S, dstroke, NoSymbol ] }; + key <AC03> { [ d, D, Dstroke, NoSymbol ] }; + key <AC04> { [ f, F, bracketleft, NoSymbol ] }; + key <AC05> { [ g, G, bracketright, NoSymbol ] }; + key <AC06> { [ h, H, grave, NoSymbol ] }; + key <AC07> { [ j, J, apostrophe, NoSymbol ] }; + key <AC08> { [ k, K, lstroke, NoSymbol ] }; + key <AC09> { [ l, L, Lstroke, NoSymbol ] }; + + key <AC10> { [ uring, quotedbl, dollar, NoSymbol ] }; + key <AC11> { [ section, exclam, apostrophe, ssharp ] }; + key <AC12> { [ EuroSign, dead_diaeresis, NoSymbol, NoSymbol ] }; + key <BKSL> { [dead_diaeresis, apostrophe, backslash, bar ] }; + + key <LSGT> { [ backslash, bar, slash, NoSymbol ] }; + key <AB01> { [ y, Y, degree, NoSymbol ] }; + key <AB02> { [ x, X, numbersign, Nosymbol ] }; + key <AB03> { [ c, C, ampersand, NoSymbol ] }; + key <AB04> { [ v, V, at, NoSymbol ] }; + key <AB05> { [ b, B, braceleft, NoSymbol ] }; + key <AB06> { [ n, N, braceright, NoSymbol ] }; + key <AB07> { [ m, M, asciicircum, NoSymbol ] }; + key <AB08> { [ comma, question, less, NoSymbol ] }; + key <AB09> { [ period, colon, greater, NoSymbol ] }; + key <AB10> { [ minus, underscore, asterisk, NoSymbol ] }; + + key <SPCE> { [ space, space, nobreakspace, nobreakspace ] }; + + key <KPDL> { type[Group1]="FOUR_LEVEL_KEYPAD", + [ KP_Delete, comma, KP_Delete, KP_Decimal ] }; + + include "level3(ralt_switch_multikey)" +}; + +// Use <BKSL> instead of <LSGT> (useful for keyboard without <LSGT> key) +xkb_symbols "bksl" { + include "pc/cz(basic)" + + key <BKSL> { [ backslash, bar, slash, NoSymbol ] }; +}; diff --git a/symbols/cz_qwerty b/symbols/cz_qwerty new file mode 100644 index 00000000..1d1c47a0 --- /dev/null +++ b/symbols/cz_qwerty @@ -0,0 +1,21 @@ +// $XFree86$ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // This layout should work exactly as a cz with the exception + // of 'Z' and 'Y' keys, which are in the qwerty style (ie. swapped). + // 2001 by Kamil Toman <ktoman@email.cz> + + include "pc/cz(basic)" + + key <AB01> { [ z, Z, degree, NoSymbol ] }; + key <AD06> { [ y, Y, NoSymbol, NoSymbol ] }; +}; + +// Use <BKSL> instead of <LSGT> (useful for keyboard without <LSGT> key) +xkb_symbols "bksl" { + include "pc/cz_qwerty(basic)" + + key <BKSL> { [ backslash, bar, slash, NoSymbol ] }; +}; diff --git a/symbols/de b/symbols/de new file mode 100644 index 00000000..86be7a34 --- /dev/null +++ b/symbols/de @@ -0,0 +1,108 @@ + +// based on a keyboard map from an 'xkb/symbols/de' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/de,v 1.6 2003/09/08 13:12:51 pascal Exp $ + +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="German"; + + key <AE02> { [ 2, quotedbl, twosuperior, oneeighth ] }; + key <AE03> { [ 3, section, threesuperior, sterling ] }; + key <AE04> { [ 4, dollar, onequarter, currency ] }; + key <AE11> { [ ssharp, question, backslash, questiondown ] }; + key <AE12> { [dead_acute, dead_grave, dead_cedilla, dead_ogonek ] }; + + key <AD03> { [ e, E, EuroSign, EuroSign ] }; + key <AD06> { [ z, Z, leftarrow, yen ] }; + key <AD11> { [udiaeresis, Udiaeresis, dead_diaeresis, dead_abovering ] }; + key <AD12> { [ plus, asterisk, dead_tilde, dead_macron ] }; + + key <AC10> { [odiaeresis, Odiaeresis, dead_doubleacute, dead_doubleacute ] }; + key <AC11> { [adiaeresis, Adiaeresis, dead_circumflex, dead_caron] }; + key <TLDE> { [dead_circumflex, degree, notsign, notsign ] }; + + key <BKSL> { [numbersign, apostrophe, dead_grave, dead_breve ] }; + key <AB01> { [ y, Y, guillemotleft, less ] }; + + key <KPDL> { [ KP_Delete, KP_Separator ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // modify the default German layout to not have any dead keys + + include "pc/de(basic)" + + key <TLDE> { [asciicircum, degree, notsign, notsign ] }; + key <AE12> { [ acute, grave, cedilla, cedilla ] }; + key <AD11> { [udiaeresis, Udiaeresis, diaeresis, diaeresis ] }; + key <AD12> { [ plus, asterisk, asciitilde, macron ] }; + key <AC10> { [odiaeresis, Odiaeresis, doubleacute, doubleacute ] }; + key <AC11> { [adiaeresis, Adiaeresis, asciicircum, asciicircum ] }; + key <BKSL> { [numbersign, apostrophe, grave, grave ] }; + key <AB10> { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + +partial alphanumeric_keys +xkb_symbols "deadgraveacute" { + // modify the default German layout to have only acute and grave + // as dead keys (tilde and circumflex are needed as spacing characters + // in many programming languages) + + include "pc/de(basic)" + + key <TLDE> { [asciicircum, degree, notsign, notsign ] }; + key <AD12> { [ plus, asterisk, asciitilde, dead_macron ] }; + key <BKSL> { [numbersign, apostrophe, grave, grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "deadacute" { + // modify the default German layout to have only acute as + // dead keys (ASCII grave, tilde and circumflex are needed as + // spacing characters in many programming languages and text formatters) + + include "pc/de(deadgraveacute)" + + key <AE12> { [dead_acute, grave, dead_cedilla, dead_ogonek ] }; + key <BKSL> { [numbersign, apostrophe, dead_grave, dead_grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "de_ro" { + // add romanian-specific letters to the basic German layout. + // Romanian symbols are accessible with combination of <AltGr> and + // 'a', 's', 't', 'i', ' (ä)' (+<Shift> for capital letters). + // To view romanian-specific symbols, add "export LC_CTYPE=ro_RO" + // or "export LC_CTYPE=de_DE.utf8" to your .profile. + + include "pc/de(basic)" + + name[Group1]="Romanian for German keyboard"; + + key <AD05> { [ t, T, tcedilla, Tcedilla ] }; + key <AD08> { [ i, I, icircumflex, Icircumflex ] }; + key <AC01> { [ a, A, acircumflex, Acircumflex ] }; + key <AC02> { [ s, S, scedilla, Scedilla ] }; + key <AC11> { [ adiaeresis, Adiaeresis, abreve, Abreve ] }; +}; + +partial alphanumeric_keys +xkb_symbols "de_ro_nodeadkeys" { + // add romanian-specific letters to the German nodeadkeys layout. + // Read the comment for de_ro ! + + include "pc/de(nodeadkeys)" + + key <AD05> { [ t, T, tcedilla, Tcedilla ] }; + key <AD08> { [ i, I, icircumflex, Icircumflex ] }; + key <AC01> { [ a, A, acircumflex, Acircumflex ] }; + key <AC02> { [ s, S, scedilla, Scedilla ] }; + key <AC11> { [ adiaeresis, Adiaeresis, abreve, Abreve ] }; +}; diff --git a/symbols/dev b/symbols/dev new file mode 100644 index 00000000..94ac8440 --- /dev/null +++ b/symbols/dev @@ -0,0 +1,71 @@ + +// based on a keyboard map from an 'xkb/symbols/dev' file +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Hindi"; + + key <TLDE> { [ 0x100094A, 0x1000912 ] }; + + // Mainly numbers. + key <AE01> { [ 0x1000967, 0x100090D ] }; + key <AE02> { [ 0x1000968, 0x1000945 ] }; + key <AE03> { [ 0x1000969 ] }; + key <AE04> { [ 0x100096A ] }; + key <AE05> { [ 0x100096B ] }; + key <AE06> { [ 0x100096C ] }; + key <AE07> { [ 0x100096D ] }; + key <AE08> { [ 0x100096e ] }; + key <AE09> { [ 0x100096F, parenleft ] }; + key <AE10> { [ 0x1000966, parenright ] }; + key <AE11> { [ 0x1000903 ] }; + key <AE12> { [ 0x1000943, 0x100090B ] }; + +// Mainly long vowels + + key <AD01> { [ 0x100094C, 0x1000914 ] }; + key <AD02> { [ 0x1000948, 0x1000910 ] }; + key <AD03> { [ 0x100093E, 0x1000906 ] }; + key <AD04> { [ 0x1000940, 0x1000908 ] }; + key <AD05> { [ 0x1000942, 0x100090A ] }; + +// Mainly voiced consonants + + key <AD06> { [ 0x100092C, 0x100092D ] }; + key <AD07> { [ 0x1000939, 0x1000919 ] }; + key <AD08> { [ 0x1000917, 0x1000918 ] }; + key <AD09> { [ 0x1000926, 0x1000927 ] }; + key <AD10> { [ 0x100091C, 0x100091D ] }; + key <AD11> { [ 0x1000921, 0x1000922 ] }; + key <AD12> { [ 0x100093C, 0x100091E ] }; + +// Mainly short vowels + key <AC01> { [ 0x100094B, 0x1000913 ] }; + key <AC02> { [ 0x1000947, 0x100090F ] }; + key <AC03> { [ 0x100094D, 0x1000905 ] }; + key <AC04> { [ 0x100093F, 0x1000907 ] }; + key <AC05> { [ 0x1000941, 0x1000909 ] }; + +// Mainly unvoiced consonants + + key <AC06> { [ 0x100092A, 0x100092B ] }; + key <AC07> { [ 0x1000930, 0x1000931 ] }; + key <AC08> { [ 0x1000915, 0x1000916 ] }; + key <AC09> { [ 0x1000924, 0x1000925 ] }; + key <AC10> { [ 0x100091A, 0x100091B ] }; + key <AC11> { [ 0x100091F, 0x1000920 ] }; + key <BKSL> { [ 0x1000949, 0x1000911 ] }; + + key <AB01> { [ 0x1000946, 0x100090E ] }; + key <AB02> { [ 0x1000902, 0x1000901 ] }; + key <AB03> { [ 0x100092E, 0x1000923 ] }; + key <AB04> { [ 0x1000928, 0x1000929 ] }; + key <AB05> { [ 0x1000935, 0x1000934 ] }; + key <AB06> { [ 0x1000932, 0x1000933 ] }; + key <AB07> { [ 0x1000938, 0x1000936 ] }; + key <AB08> { [ comma, 0x1000937 ] }; + key <AB09> { [ period, 0x1000964 ] }; + key <AB10> { [ 0x100092F, question ] }; +}; diff --git a/symbols/digital.vndr/lk b/symbols/digital.vndr/lk new file mode 100644 index 00000000..e5732a30 --- /dev/null +++ b/symbols/digital.vndr/lk @@ -0,0 +1,131 @@ +// $Xorg: lk,v 1.3 2000/08/17 19:54:44 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: lk,v +// Revision 1.2 1996/06/18 09:10:09 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.2.2 1995/03/10 17:16:52 William_Walker +// Rename to avoid name conflicts with XKB stuff +// [1995/03/10 17:10:33 William_Walker] +// +// Revision 1.1.2.2 1994/10/31 15:22:00 William_Walker +// New experimental version. +// [1994/10/31 14:48:37 William_Walker] +// +// EndLog +// +// @(#)RCSfile: lk,v Revision: 1.2 (DEC) Date: 1996/01/24 12:14:58 +// +// Symbols common to all the LK-style keyboards. +// +default xkb_symbols "common" { + + // Modifier mappings + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control { Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod2 { Num_Lock }; + modifier_map Mod3 { Scroll_Lock }; + + // Additional alphanumeric keys + key <LSGT> { [ less, greater ] }; + key <LALT> { [ Alt_L, Meta_L ] }; + + // "Function" keys + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ Escape, F11 ] }; + key <FK12> { [ F12 ] }; + key <FK13> { [ F13 ] }; + key <FK14> { [ F14 ] }; + key <FK17> { [ F17 ] }; + key <FK18> { [ F18 ] }; + key <FK19> { [ F19 ] }; + key <FK20> { [ F20 ] }; + + // "Editing" keys + key <HELP> { [ Help ] }; + key <DO> { [ Menu ] }; + key <FIND> { [ Find ] }; + key <INS> { [ Insert ] }; + key <DELE> { [ Delete ] }; + key <SELE> { [ Select ] }; + key <PGUP> { [ Prior ] }; + key <PGDN> { [ Next ] }; + + key <UP> { [ Up ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <RGHT> { [ Right ] }; + + // "Keypad" keys + key <KPF1> { + type= "SHIFT+ALT", + symbols[Group1]=[ KP_F1,Pointer_EnableKeys ] + }; + key <KPF2> { [ KP_F2 ] }; + key <KPF3> { [ KP_F3 ] }; + key <KPF4> { [ KP_F4 ] }; + + key <KPCO> { [ KP_Separator ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP7> { [ KP_7 ] }; + key <KP8> { [ KP_8 ] }; + key <KP9> { [ KP_9 ] }; + + key <KP4> { [ KP_4 ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_6 ] }; + + key <KP1> { [ KP_1 ] }; + key <KP2> { [ KP_2 ] }; + key <KP3> { [ KP_3 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_0 ] }; + key <KPDL> { [ KP_Decimal ] }; +}; + +xkb_symbols "lk401" { + include "symbols/digital/lk(common)" + key <RALT> { [ Alt_R, Meta_R ] }; + key <LCMP> { [ Multi_key ] }; + key <RCMP> { [ Multi_key ] }; +}; diff --git a/symbols/digital.vndr/pc b/symbols/digital.vndr/pc new file mode 100644 index 00000000..c6cc777d --- /dev/null +++ b/symbols/digital.vndr/pc @@ -0,0 +1,176 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:44 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:10:12 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.4 1995/12/19 19:55:58 William_Walker +// Update to XKB 0.65 +// [1995/12/17 02:37:07 William_Walker] +// +// Revision 1.1.6.3 1995/10/25 21:01:09 William_Walker +// Make sure we use DIN 2137 and VT510 Spec for Group Semantics +// [1995/10/23 15:49:03 William_Walker] +// +// Revision 1.1.6.2 1995/08/07 17:40:40 William_Walker +// Upgrade XKB to protocol 0.62 (dual submit from decx11) +// [1995/08/06 14:06:32 William_Walker] +// +// Revision 1.1.2.7 1995/08/05 15:25:57 William_Walker +// Sync up with Erik's pool. +// [1995/08/03 20:17:15 William_Walker] +// +// Revision 1.1.2.6 1995/06/27 12:18:25 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:29:52 William_Walker] +// +// Revision 1.1.2.5 1995/06/08 17:10:28 William_Walker +// Make RALT default to Mode_switch +// [1995/06/08 17:08:50 William_Walker] +// +// Revision 1.1.2.4 1995/06/05 19:24:14 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:17:03 William_Walker] +// +// EndLog +// +// @(#)RCSfile: pc Revision: /main/4 (DEC) Date: 1996/01/24 12:15:02 +// + +// ************************************************************** +// * * +// * The symbols common to all Extended PC layouts. * +// * * +// ************************************************************** +xkb_symbols "pc" { + + // Modifier mappings + // + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control { Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod3 { Mode_switch }; + modifier_map Mod4 { Num_Lock }; + modifier_map Mod5 { Scroll_Lock }; + + // Common keys + // + key <BKSP> { [ BackSpace, Delete ] }; + key <TAB> { [ Tab, ISO_Left_Tab ] }; + key <CAPS> { [ Caps_Lock ] }; + key <RTRN> { [ Return ] }; + key <LFSH> { [ Shift_L ] }; + key <RTSH> { [ Shift_R ] }; + key <LCTL> { [ Control_L ] }; + key <LALT> { [ Alt_L, Meta_L ] }; + key <SPCE> { [ space ] }; + key <RALT> { [ Mode_switch ] }; + key <RCTL> { [ Control_R ] }; + + // "Function" keys + // + key <ESC> { [ Escape ] }; + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ] }; + key <FK12> { [ F12 ] }; + key <PRSC> { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Sys_Req ] + }; + key <SCLK> { [ Scroll_Lock ] }; + key <PAUS> { + type= "PC_BREAK", + symbols[Group1]= [ Pause, Break ] + }; + + // "Editing" keys + // + key <INS> { [ Insert ] }; + key <HOME> { [ Home ] }; + key <PGUP> { [ Prior ] }; + key <DELE> { [ Delete ] }; + key <END> { [ End ] }; + key <PGDN> { [ Next ] }; + + key <UP> { [ Up ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <RGHT> { [ Right ] }; + + // "Keypad" keys + // + key <NMLK> { + type= "SHIFT+ALT", + symbols[Group1]= [ Num_Lock,Pointer_EnableKeys] + }; + key <KPDV> { [ KP_Divide ] }; + key <KPMU> { [ KP_Multiply ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP7> { [ KP_Home, KP_7 ] }; + key <KP8> { [ KP_Up, KP_8 ] }; + key <KP9> { [ KP_Prior, KP_9 ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP4> { [ KP_Left, KP_4 ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_Right, KP_6 ] }; + + key <KP1> { [ KP_End, KP_1 ] }; + key <KP2> { [ KP_Down, KP_2 ] }; + key <KP3> { [ KP_Next, KP_3 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_Insert, KP_0 ] }; + key <KPDL> { [ KP_Delete, KP_Decimal ] }; + + // Key to support Lock-Down Modifier descriptions for R5 + // + key <LDM> { [ NoSymbol ] }; +}; + +xkb_symbols "pc104" { + include "digital/pc(pc)" + + replace key <LALT> { [ Alt_L ] }; + key <LWIN> { [ Meta_L ] }; + key <RWIN> { [ Meta_R ] }; + key <MENU> { [ Menu ] }; +}; diff --git a/symbols/digital.vndr/us b/symbols/digital.vndr/us new file mode 100644 index 00000000..21636aa6 --- /dev/null +++ b/symbols/digital.vndr/us @@ -0,0 +1,212 @@ +// $Xorg: us,v 1.3 2000/08/17 19:54:44 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:10:16 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.3 1995/12/19 19:56:37 William_Walker +// Update to XKB 0.65 +// [1995/12/17 02:37:44 William_Walker] +// +// Revision 1.1.6.2 1995/10/25 21:01:25 William_Walker +// Add pc104-key support +// [1995/10/23 15:46:27 William_Walker] +// +// Revision 1.1.2.7 1995/06/27 12:18:40 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:30:33 William_Walker] +// +// Revision 1.1.2.6 1995/06/09 20:55:20 William_Walker +// Add VT105 layout support and ISO group support +// [1995/06/09 20:43:05 William_Walker] +// +// Revision 1.1.2.5 1995/06/08 21:05:49 William_Walker +// Use ISO_Next_Group instead of grouplock +// [1995/06/08 21:03:56 William_Walker] +// +// Revision 1.1.2.4 1995/06/05 19:25:00 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:17:54 William_Walker] +// +// EndLog +// +// @(#)RCSfile: us Revision: /main/4 (DEC) Date: 1996/01/24 12:15:05 +// + +// ************************************************************** +// * * +// * Symbols for en_US.ISO8859-1 - English for U.S. * +// * * +// ************************************************************** + +xkb_symbols "us" { + + key <AE00> { [ grave, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + + key <AD01> { [ q, Q ] }; + key <AD02> { [ w, W ] }; + key <AD03> { [ e, E ] }; + key <AD04> { [ r, R ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ y, Y ] }; + key <AD07> { [ u, U ] }; + key <AD08> { [ i, I ] }; + key <AD09> { [ o, O ] }; + key <AD10> { [ p, P ] }; + key <AD11> { [ bracketleft, braceleft ] }; + key <AD12> { [ bracketright, braceright ] }; + + key <AC01> { [ a, A ] }; + key <AC02> { [ s, S ] }; + key <AC03> { [ d, D ] }; + key <AC04> { [ f, F ] }; + key <AC05> { [ g, G ] }; + key <AC06> { [ h, H ] }; + key <AC07> { [ j, J ] }; + key <AC08> { [ k, K ] }; + key <AC09> { [ l, L ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ apostrophe, quotedbl ] }; + key <BKSL> { [ backslash, bar ] }; + + key <AB01> { [ z, Z ] }; + key <AB02> { [ x, X ] }; + key <AB03> { [ c, C ] }; + key <AB04> { [ v, V ] }; + key <AB05> { [ b, B ] }; + key <AB06> { [ n, N ] }; + key <AB07> { [ m, M ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; +}; + +// ************************************************************** +// * * +// * The VT105 layouts * +// * * +// * NOTES: The typewriter (TW) and dataprocessing (DP) keys * +// * for the VT108 layout are identical for the US. * +// * * +// ************************************************************** +xkb_symbols "vt105-tw" { + include "digital/us(us)" + include "digital/vt(vt105)" + override key <AE03> { + symbols[Group1]= [ 3, numbersign ], + symbols[Group2]= [ sterling ] + }; + key <AB00> { [ less, greater ] }; +}; + +xkb_symbols "vt105-dp" { include "digital/us(vt105-tw)" }; +xkb_symbols "vt105" { include "digital/us(vt105-tw)" }; + +// ************************************************************** +// * * +// * The VT108 layouts - based upon the LK401-AA * +// * * +// * NOTES: The typewriter (TW) and dataprocessing (DP) keys * +// * for the VT108 layout are identical for the US. * +// * * +// ************************************************************** +xkb_symbols "vt108-tw" { + include "digital/us(us)" + include "digital/vt(vt108)" + replace key <LCMP> { [ Multi_key ] }; + override key <AE03> { + symbols[Group1]= [ 3, numbersign ], + symbols[Group2]= [ sterling ] + }; + key <AB00> { [ less, greater ] }; +}; + +xkb_symbols "vt108-dp" { include "digital/us(vt108-tw)" }; +xkb_symbols "vt108" { include "digital/us(vt108-tw)" }; + +// ************************************************************** +// * * +// * The "unix" layouts - based upon the LK421-AA * +// * * +// * NOTES: The "unix" keyboard emits the same keycodes as the * +// * LK401, but is a shorter keyboard that uses an * +// * "extend" key. To make life easier, we map <AE00> * +// * to Escape so users do not have to press Extend+F11 * +// * to get Escape. * +// * * +// ************************************************************** +xkb_symbols "unix" { + include "digital/us(vt108)" + override key <AE00> { [ Escape ] }; + override key <AB00> { [ grave, asciitilde ] }; +}; + +// ************************************************************** +// * * +// * The "pcxal" layouts * +// * * +// * NOTES: The pcxal layouts are pretty much standardized for * +// * the US and use a 101-key keyboard. * +// * * +// ************************************************************** +xkb_symbols "pcxalga" { + include "digital/pc(pc)" + include "digital/us(us)" + replace key <RALT> { [ Alt_R, Meta_R ] }; +}; + +xkb_symbols "pcxal" { include "digital/us(pcxalga)" }; +xkb_symbols "pcxalaa" { include "digital/us(pcxalga)" }; +xkb_symbols "pcxalfa" { include "digital/us(pcxalga)" }; +xkb_symbols "pcxalka" { include "digital/us(pcxalga)" }; +xkb_symbols "lk44x" { include "digital/us(pcxalga)" }; + +// ************************************************************** +// * * +// * The "pc104" layouts. * +// * * +// ************************************************************** +xkb_symbols "pc104" { + include "digital/pc(pc104)" + include "digital/us(us)" + replace key <RALT> { [ Alt_R ] }; +}; diff --git a/symbols/digital.vndr/vt b/symbols/digital.vndr/vt new file mode 100644 index 00000000..62257abf --- /dev/null +++ b/symbols/digital.vndr/vt @@ -0,0 +1,159 @@ +// $Xorg: vt,v 1.3 2000/08/17 19:54:44 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:10:19 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/12/19 19:56:39 William_Walker +// Update to XKB 0.65 +// [1995/12/17 02:37:47 William_Walker] +// +// Revision 1.1.2.5 1995/07/11 21:20:50 William_Walker +// Make RALT act as RALT +// [1995/07/11 21:18:28 William_Walker] +// +// Revision 1.1.2.4 1995/06/27 12:18:41 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:30:37 William_Walker] +// +// Revision 1.1.2.3 1995/06/09 20:55:21 William_Walker +// Add VT105 layout support and ISO group support +// [1995/06/09 20:43:09 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:25:04 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:17:58 William_Walker] +// +// EndLog +// +// @(#)RCSfile: vt Revision: /main/3 (DEC) Date: 1996/01/24 12:15:08 +// +xkb_symbols "vt105" { + + // Modifier mappings + // + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control { Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod3 { Mode_switch }; + + // Common keys + // + key <BKSP> { [ Delete ] }; + key <TAB> { [ Tab ] }; + key <RTRN> { [ Return ] }; + key <LCTL> { [ Control_L ] }; + key <CAPS> { [ Caps_Lock ] }; + key <LFSH> { [ Shift_L ] }; + key <RTSH> { [ Shift_R ] }; + key <LCMP> { [ Alt_L, Meta_L ] }; + key <SPCE> { [ space ] }; + + // "Function" keys + // + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ Escape, F11 ] }; + key <FK12> { [ F12 ] }; + key <FK13> { [ F13 ] }; + key <FK14> { [ F14 ] }; + key <FK17> { [ F17 ] }; + key <FK18> { [ F18 ] }; + key <FK19> { [ F19 ] }; + key <FK20> { [ F20 ] }; + + // "Editing" keys + // + key <HELP> { [ Help ] }; + key <DO> { [ Menu ] }; + key <FIND> { [ Find ] }; + key <INS> { [ Insert ] }; + key <DELE> { [ apLineDel ] }; + key <SELE> { [ Select ] }; + key <PGUP> { [ Prior ] }; + key <PGDN> { [ Next ] }; + + key <UP> { [ Up ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <RGHT> { [ Right ] }; + + // "Keypad" keys + // + key <KPF1> { + type= "SHIFT+ALT", + symbols[Group1]= [ KP_F1,Pointer_EnableKeys ] + }; + key <KPF2> { [ KP_F2 ] }; + key <KPF3> { [ KP_F3 ] }; + key <KPF4> { [ KP_F4 ] }; + + key <KP7> { [ KP_7 ] }; + key <KP8> { [ KP_8 ] }; + key <KP9> { [ KP_9 ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP4> { [ KP_4 ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_6 ] }; + key <KPCO> { [ KP_Separator ] }; + + key <KP1> { [ KP_1 ] }; + key <KP2> { [ KP_2 ] }; + key <KP3> { [ KP_3 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_0 ] }; + key <KPDL> { [ KP_Decimal ] }; + + // Key to support Lock-Down Modifier descriptions for R5 + // + key <LDM> { [ NoSymbol ] }; +}; + +xkb_symbols "vt108" { + + include "digital/vt(vt105)" + + replace key <LCMP> { [ Mode_switch ] }; + + key <LALT> { [ Alt_L, Meta_L ] }; + key <RALT> { [ Alt_R, Meta_R ] }; + key <RCMP> { [ Multi_key ] }; +}; diff --git a/symbols/dk b/symbols/dk new file mode 100644 index 00000000..a5013492 --- /dev/null +++ b/symbols/dk @@ -0,0 +1,44 @@ + +// based on a keyboard map from an 'xkb/symbols/dk' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/dk,v 1.3 2002/12/19 01:07:56 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type2)" + + name[Group1]="Danish"; + + key <AE11> { [ plus, question, plusminus, questiondown ] }; + key <AE12> { [dead_acute, dead_grave, bar, brokenbar ] }; + + + key <AC10> { [ ae, AE, dead_acute, dead_doubleacute ] }; + key <AC11> { [ oslash, Ooblique, dead_circumflex, dead_caron ] }; + key <TLDE> { [ onehalf, section, threequarters, paragraph ] }; + + key <BKSL> { [apostrophe, asterisk, dead_doubleacute, multiply ] }; + + key <LSGT> { [ less, greater, backslash, notsign ] }; + + key <KPDL> { [ KP_Delete, KP_Separator ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/dk(basic)" + + key <AE12> { [ acute, grave, bar, ogonek ] }; + key <AD11> { [ aring, Aring, diaeresis, degree ] }; + key <AD12> { [ diaeresis, asciicircum, asciitilde, macron ] }; + key <AC10> { [ ae, AE, acute, doubleacute ] }; + key <AC11> { [ oslash, Ooblique, asciicircum, caron ] }; + key <BKSL> { [apostrophe, asterisk, doubleacute, multiply ] }; + key <AB08> { [ comma, semicolon, cedilla, ogonek ] }; + key <AB09> { [ period, colon, periodcentered, abovedot ] }; + +}; diff --git a/symbols/dvorak b/symbols/dvorak new file mode 100644 index 00000000..2cc95e6c --- /dev/null +++ b/symbols/dvorak @@ -0,0 +1,278 @@ + +// based on a keyboard map from an 'xkb/symbols/dk' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/dvorak,v 1.5 2004/01/03 16:35:07 herrb Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Dvorak"; + + // Alphanumeric section + + key <TLDE> { [ grave, asciitilde, dead_grave, dead_tilde ] }; + + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum, dead_circumflex, dead_circumflex ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft, dead_grave] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ bracketleft, braceleft ] }; + key <AE12> { [ bracketright, braceright, dead_tilde] }; + + key <AD01> { [ apostrophe, quotedbl, dead_acute, dead_diaeresis ] }; + key <AD02> { [ comma, less, dead_cedilla, dead_caron ] }; + key <AD03> { [ period, greater, dead_abovedot, periodcentered ] }; + key <AD04> { [ p, P ] }; + key <AD05> { [ y, Y ] }; + key <AD06> { [ f, F ] }; + key <AD07> { [ g, G ] }; + key <AD08> { [ c, C ] }; + key <AD09> { [ r, R ] }; + key <AD10> { [ l, L ] }; + key <AD11> { [ slash, question ] }; + key <AD12> { [ equal, plus ] }; + + key <AC01> { [ a, A ] }; + key <AC02> { [ o, O ] }; + key <AC03> { [ e, E ] }; + key <AC04> { [ u, U ] }; + key <AC05> { [ i, I ] }; + key <AC06> { [ d, D ] }; + key <AC07> { [ h, H ] }; + key <AC08> { [ t, T ] }; + key <AC09> { [ n, N ] }; + key <AC10> { [ s, S ] }; + key <AC11> { [ minus, underscore ] }; + + key <AB01> { [ semicolon, colon, dead_ogonek, dead_doubleacute ] }; + key <AB02> { [ q, Q ] }; + key <AB03> { [ j, J ] }; + key <AB04> { [ k, K ] }; + key <AB05> { [ x, X ] }; + key <AB06> { [ b, B ] }; + key <AB07> { [ m, M ] }; + key <AB08> { [ w, W ] }; + key <AB09> { [ v, V ] }; + key <AB10> { [ z, Z ] }; + + include "level3(ralt_switch_multikey)" +}; + +// Norwegian Dvorak +partial alphanumeric_keys +xkb_symbols "no" { + include "pc/dvorak(basic)" + + key <TLDE> { [ bar, section, brokenbar, paragraph ] }; + + key <AE01> { [ 1, exclam, exclamdown, onesuperior ] }; + key <AE02> { [ 2, quotedbl, at, twosuperior ] }; + key <AE03> { [ 3, numbersign, sterling, threesuperior ] }; + key <AE04> { [ 4, dollar, currency,onequarter ] }; + key <AE05> { [ 5, percent, onehalf, onehalf ] }; + key <AE06> { [ 6, ampersand, threequarters, threequarters ] }; + key <AE07> { [ 7, slash, braceleft, division ] }; + key <AE08> { [ 8, parenleft, bracketleft ] }; + key <AE09> { [ 9, parenright, bracketright ] }; + key <AE10> { [ 0, equal, braceright ] }; + key <AE11> { [ plus, question, plusminus, questiondown ] }; + key <AE12> { [ backslash, grave, dead_acute, dead_grave ] }; + + key <AD01> { [ aring, Aring, braceright, bracketright ] }; + key <AD02> { [ comma, semicolon, dead_cedilla, cedilla ] }; + key <AD03> { [ period, colon, periodcentered ] }; + key <AD04> { [ p, P, thorn, THORN ] }; + key <AD05> { [ y, Y, yen ] }; + key <AD06> { [ f, F, ordfeminine ] }; + key <AD08> { [ c, C, ccedilla, copyright ] }; + key <AD09> { [ r, R, registered ] }; + key <AD11> { [ apostrophe, asterisk, dead_circumflex, acute ] }; + key <AD12> { [ asciitilde, asciicircum, dead_diaeresis, dead_tilde ] }; + + key <AC03> { [ e, E, EuroSign, cent ] }; + key <AC05> { [ i, I, idotless, Iabovedot] }; + key <AC06> { [ d, D, eth, ETH ] }; + key <AC10> { [ s, S, ssharp ] }; + key <AC11> { [ minus, underscore, hyphen, diaeresis] }; + + key <AB01> { [ ae, AE, braceleft, bracketleft] }; + key <AB05> { [ x, X, multiply ] }; + key <AB07> { [ m, M, mu ] }; + key <BKSL> { [ less, greater, guillemotleft, guillemotright ] }; + + key <SPCE> { [ space, space, nobreakspace, nobreakspace] }; + + key <LSGT> { [ oslash, Ooblique, bar, backslash ] }; + +}; + +// Swedish Dvorak +partial alphanumeric_keys +xkb_symbols "se" { + include "pc/dvorak(no)" + + key <TLDE> { [ section, onehalf ] }; + + key <AE04> { [ 4, currency, dollar, onequarter ] }; + key <AE11> { [ plus, question, backslash, questiondown ] }; + key <AE12> { [ dead_acute, dead_grave, backslash, grave ] }; + + key <AD01> { [ odiaeresis, Odiaeresis, braceright, bracketright ] }; + key <AD02> { [ aring, Aring ] }; + key <AD03> { [ adiaeresis, Adiaeresis ] }; + key <AD11> { [ q, Q ] }; + key <AD12> { [ dead_diaeresis, dead_circumflex, dead_tilde, asciicircum ] }; + + key <AB01> { [ comma, semicolon, dead_cedilla, cedilla ] }; + key <AB02> { [ period, colon, periodcentered ] }; + + key <BKSL> { [ less, greater, bar, brokenbar ] }; + + key <LSGT> { [ apostrophe, asterisk, bar, backslash ] }; + +}; +// Swedish Dvorak alias +partial alphanumeric_keys +xkb_symbols "sv" { + include "pc/dvorak(se)" +}; + +// Dvorak (UK) keymap (by odaen) allowing the usage of +// the and ? key and swapping the @ and " keys. + +partial alphanumeric_keys +xkb_symbols "gb" { + include "pc/dvorak(basic)" + + key <BKSL> { [ numbersign, asciitilde ] }; + key <AE02> { [ 2, quotedbl, twosuperior, NoSymbol ] }; + key <AE03> { [ 3, sterling, threesuperior, NoSymbol ] }; + key <AE04> { [ 4, dollar, EuroSign, NoSymbol ] }; + key <LSGT> { [ backslash, bar ] }; + key <AD01> { [ apostrophe, at ] }; +}; + +// Keymap Dvorak pour le Franais +// par Josselin Mouette <josselin.mouette@ens-lyon.org>. + +partial alphanumeric_keys +xkb_symbols "fr" { + + name[Group1]= "French dvorak"; + + key <TLDE> { [ oe, OE, ae, AE ] }; + + key <AE01> { [ slash, 1, ampersand, onesuperior ] }; + key <AE02> { [ plus, 2, asciitilde, twosuperior ] }; + key <AE03> { [ minus, 3, numbersign, threesuperior ] }; + key <AE04> { [ asterisk, 4, less, guillemotleft ] }; + key <AE05> { [ equal, 5, greater, guillemotright ] }; + key <AE06> { [ backslash, 6, at, notsign ] }; + key <AE07> { [ parenleft, 7, dead_circumflex, multiply ] }; + key <AE08> { [ grave, 8, dead_grave, division ] }; + key <AE09> { [ parenright, 9, asciicircum, plusminus ] }; + key <AE10> { [ quotedbl, 0, dead_diaeresis, dead_diaeresis ] }; + key <AE11> { [bracketleft, braceleft, bar, degree ] }; + key <AE12> { [bracketright, braceright, percent, percent ] }; + + key <AD01> { [ colon, question, question, questiondown ] }; + key <AD02> { [ agrave, Agrave, aring, Aring ] }; + key <AD03> { [ eacute, Eacute, EuroSign, cent ] }; + key <AD04> { [ g, G, oslash, Ooblique ] }; + key <AD05> { [ period, exclam, periodcentered, exclamdown ] }; + key <AD06> { [ h, H, eth, ETH ] }; + key <AD07> { [ v, V ] }; + key <AD08> { [ c, C, copyright, registered ] }; + key <AD09> { [ m, M, mu, mu ] }; + key <AD10> { [ k, K, dollar, dollar ] }; + key <AD11> { [ egrave, Egrave, sterling, sterling ] }; + key <AD12> { [ z, Z, yen, yen ] }; + + key <AC01> { [ o, O, ocircumflex, Ocircumflex ] }; + key <AC02> { [ a, A, acircumflex, Acircumflex ] }; + key <AC03> { [ u, U, ucircumflex, Ucircumflex ] }; + key <AC04> { [ e, E, ecircumflex, Ecircumflex ] }; + key <AC05> { [ b, B, ssharp, ssharp ] }; + key <AC06> { [ f, F ] }; + key <AC07> { [ s, S ] }; + key <AC08> { [ t, T, thorn, THORN ] }; + key <AC09> { [ n, N, ntilde, Ntilde ] }; + key <AC10> { [ d, D, section, section ] }; + key <AC11> { [ w, W, paragraph, paragraph ] }; + key <BKSL> { [ ugrave, Ugrave, masculine, ordfeminine ] }; + + key <AB01> { [ apostrophe, underscore, dead_acute, macron ] }; + key <AB02> { [ q, Q, guillemotleft, guillemotleft ] }; + key <AB03> { [ comma, semicolon, guillemotright, guillemotright ] }; + key <AB04> { [ i, I, icircumflex, Icircumflex ] }; + key <AB05> { [ y, Y, ydiaeresis, Ydiaeresis ] }; + key <AB06> { [ x, X, ediaeresis, Ediaeresis ] }; + key <AB07> { [ r, R, udiaeresis, Udiaeresis ] }; + key <AB08> { [ l, L, adiaeresis, Adiaeresis ] }; + key <AB09> { [ p, P, odiaeresis, Odiaeresis ] }; + key <AB10> { [ j, J, idiaeresis, Idiaeresis ] }; + + key <SPCE> { [ space, space, nobreakspace, nobreakspace ] }; + key <LSGT> { [ ccedilla, Ccedilla ] }; + + include "level3(ralt_switch_multikey)" +}; + + +// Polish Dvorak keymaps +// by Rafal Rzepecki <divide@users.sf.net> + +// The default keymap "pl" places Polish quotes on quotemark key and +// moves the dead symbols from there to "1/!" key. If you are used to default +// dead keys placement, you could use "pl_altquotes"; in this layout +// dead keys remain in the old place, whereas Polish quotes are placed on the +// "1/!" key. If you do not use Polish quotes at all, you can use "pl_basic" map. + +// Basic Polish keymap (without Polish quotes) +partial alphanumeric_keys +xkb_symbols "pl_basic" { + include "pc/dvorak(basic)" + + name[Group1] = "Polish Dvorak"; + + key <AD08> { [ c, C, cacute, Cacute ] }; + key <AD10> { [ l, L, lstroke, Lstroke ] }; + key <AC01> { [ a, A, aogonek, Aogonek ] }; + key <AC02> { [ o, O, oacute, Oacute ] }; + key <AC03> { [ e, E, eogonek, Eogonek ] }; + key <AC09> { [ n, N, nacute, Nacute ] }; + key <AC10> { [ s, S, sacute, Sacute ] }; + key <AB09> { [ v, V, zacute, Zacute ] }; + key <AB10> { [ z, Z, zabovedot, Zabovedot ] }; + + // this to allow writing ALL CAPS with a Shift key + include "level3(ralt_switch)" + + // use one of compose:* options to choose Multi_key, if you will, + // or layout +level3(ralt_switch_multikey) to revert standard behaviour +}; + +// Default Polish keymap with Polish quotes on quotemark key +partial alphanumeric_keys +xkb_symbols "pl" { + include "pc/dvorak(pl_basic)" + + key <AD01> { [ apostrophe, quotedbl, doublelowquotemark, rightdoublequotemark ] }; + + // Dead symbols moved to this key + key <AE01> { [ 1, exclam, dead_acute, dead_diaeresis ] }; +}; + +// Polish keymap with Polish quotes on key "1/!" +partial alphanumeric_keys +xkb_symbols "pl_altquotes" { + include "pc/dvorak(pl_basic)" + + key <AE01> { [ 1, exclam, doublelowquotemark, rightdoublequotemark ] }; +}; diff --git a/symbols/dz b/symbols/dz new file mode 100644 index 00000000..42972aa1 --- /dev/null +++ b/symbols/dz @@ -0,0 +1,87 @@ +// +// Dzongkha / Tibetan layout for Bhutanese keyboard +// +///////////////////////////////////////////////////////////////// +// +// Based on the official layout for Dzongkha +// approved by the Department of Information Technology & +// Dzongkha Development Authority of the Government of Bhutan +// +// Copyright (C) 2004, Gregory Mokhin <mokhin@bog.msu.ru> +// Layout map provided by Chris Fynn +///////////////////////////////////////////////////////////////// +// Version 0.97. Last modified: 09 Jan 2004 +///////////////////////////////////////////////////////////////// + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Dzongkha"; + + key <TLDE> { [ U0F09, U0F0A, U0F6C, U0F6B ] }; + +// numbers e.a. + key <AE01> { [ U0F21, U0F04, 1, exclam ] }; + key <AE02> { [ U0F22, U0F05, 2, at ] }; + key <AE03> { [ U0F23, U0F06, 3, numbersign ] }; + key <AE04> { [ U0F24, U0F24, 4, dollar ] }; + key <AE05> { [ U0F25, U0F25, 5, percent ] }; + key <AE06> { [ U0F26, U0F08, 6, U0F01 ] }; + key <AE07> { [ U0F27, U0F38, 7, ampersand ] }; + key <AE08> { [ U0F28, U0F34, 8, asterisk ] }; + key <AE09> { [ U0F29, U0F3C, 9, parenleft ] }; + key <AE10> { [ U0F20, U0F3D, 0, parenright ] }; + key <AE11> { [ U0F14, U0F7F, minus, underscore ] }; + key <AE12> { [ U0F0D, U0F11, equal, plus ] }; + +// consonants ( ka kha ga nga ) + key <AD01> { [ U0F40, U0F90, U0F88 ] }; + key <AD02> { [ U0F41, U0F91, U0F89 ] }; + key <AD03> { [ U0F42, U0F92 ] }; + key <AD04> { [ U0F44, U0F94, U0F83, U0F82 ] }; + +// vowels ( i u e o ) + key <AD05> { [ U0F72, U0F80, U0F1A ] }; + key <AD06> { [ U0F74, U0F84, U0F1B ] }; + key <AD07> { [ U0F7A, U0F7B, U0F1C ] }; + key <AD08> { [ U0F7C, U0F7D, U0F1D, U0F17 ] }; + +// consonants ( ca cha ja nya ) + key <AD09> { [ U0F45, U0F95, U0F1E, U0F18 ] }; + key <AD10> { [ U0F46, U0F96, U0F1F, U0F19 ] }; + key <AD11> { [ U0F47, U0F97, bracketleft, U0F3E ] }; + key <AD12> { [ U0F49, U0F99, bracketright, U0F3F ] }; + +// consonants ( ta tha da na pa pha ba ma tsa tsha dza wa ) + key <AC01> { [ U0F4F, U0F9F, U0F4A, U0F9A ] }; + key <AC02> { [ U0F50, U0FA0, U0F4B, U0F9B ] }; + key <AC03> { [ U0F51, U0FA1, U0F4C, U0F9C ] }; + key <AC04> { [ U0F53, U0FA3, U0F4E, U0F9E ] }; + key <AC05> { [ U0F54, U0FA4, U2039, U00AB ] }; + key <AC06> { [ U0F55, U0FA5, U203A, U00BB ] }; + key <AC07> { [ U0F56, U0FA6, U0F37, U0F35 ] }; + key <AC08> { [ U0F58, U0FA8, U0F7E ] }; + key <AC09> { [ U0F59, U0FA9, U0F39 ] }; + key <AC10> { [ U0F5A, U0FAA, colon, semicolon ] }; + key <AC11> { [ U0F5B, U0FAB, apostrophe, quotedbl ] }; + +// TODO: BKSL and LSGT are from gb layout, are there any variants? + key <BKSL> { [ U0F5D, U0FAD, backslash, U0FBA ] }; + key <LSGT> { [ U0F0D, U0F11, U0F10, U0F0F ] }; + +// consonants ( zha za 'a ya ra la sha sa ha a ) + key <AB01> { [ U0F5E, U0FAE, U0F13, U0F36 ] }; + key <AB02> { [ U0F5F, U0FAF, U0FBE, U0FBF ] }; + key <AB03> { [ U0F60, U0F71, U0F03, U0FB0 ] }; + key <AB04> { [ U0F61, U0FB1, U0F12, U0FBB ] }; + key <AB05> { [ U0F62, U0FB2, U0F6A, U0FBC ] }; + key <AB06> { [ U0F63, U0FB3, U0F8A, U0F88 ] }; + key <AB07> { [ U0F64, U0FB4, U0F65, U0FB5 ] }; + key <AB08> { [ U0F66, U0FB6, comma, less ] }; + key <AB09> { [ U0F67, U0FB7, period, greater ] }; + key <AB10> { [ U0F68, U0FB8, slash, question ] }; + +// space + key <SPCE> { [ U0F0B, space, U0F0C, U00A0 ] }; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/ee b/symbols/ee new file mode 100644 index 00000000..43daf5c9 --- /dev/null +++ b/symbols/ee @@ -0,0 +1,55 @@ + +// based on +// Estonian XKB-keymap by Ville Hallik <ville@linux.ee> +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/ee,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Estonian keyboard + // This layout conforms to both EVS8:1993 and EVS8:2000 standards + + include "pc/latin(type4)" + + name[Group1]="Estonian"; + + key <AE03> { [ 3, numbersign, sterling, sterling ] }; + key <AE04> { [ 4, currency, dollar, dollar ] }; + key <AE11> { [ plus, question, backslash, questiondown ] }; + key <AE12> { [dead_acute, dead_grave, grave, apostrophe ] }; + + key <AD03> { [ e, E, EuroSign, EuroSign ] }; + key <AD11> { [udiaeresis, Udiaeresis, dead_diaeresis, dead_abovering ] }; + key <AD12> { [ otilde, Otilde, section, dead_macron ] }; + + key <AC02> { [ s, S, scaron, Scaron ] }; + key <AC10> { [odiaeresis, Odiaeresis, dead_acute, dead_doubleacute ] }; + key <AC11> { [adiaeresis, Adiaeresis, asciicircum, dead_caron ] }; + key <TLDE> { [dead_caron, dead_tilde, notsign, notsign ] }; + + key <BKSL> { [apostrophe, asterisk, onehalf, dead_breve ] }; + key <AB01> { [ z, Z, zcaron, Zcaron ] }; + key <AB08> { [ comma, semicolon, less, multiply ] }; + key <AB09> { [ period, colon, greater, division ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Estonian layout to eliminate all dead keys + + include "pc/ee(basic)" + + key <TLDE> { [asciicircum,asciitilde ] }; + key <AE12> { [apostrophe, grave ] }; + key <AD11> { [udiaeresis, Udiaeresis, diaeresis, degree ] }; + key <AD12> { [ otilde, Otilde, section, macron ] }; + key <AC10> { [odiaeresis, Odiaeresis, acute, doubleacute ] }; + key <AC11> { [adiaeresis, Adiaeresis, asciicircum, caron ] }; + key <BKSL> { [apostrophe, asterisk, onehalf, breve ] }; + key <AB10> { [ minus, underscore, dead_belowdot, abovedot ] }; +}; diff --git a/symbols/el b/symbols/el new file mode 100644 index 00000000..920019d0 --- /dev/null +++ b/symbols/el @@ -0,0 +1,122 @@ +// $XFree86: xc/programs/xkbcomp/symbols/pc/el,v 1.2 2002/11/15 02:26:41 dawes Exp $ +// +// Hellenic keyboard map for XFree86 +// Original version: +// Kostas Gewrgiou <gewrgiou@imbc.gr> +// Heavily modified and maintained by: +// Vasilis Vasaitis <vvas@hal.csd.auth.gr> +// Originally converted to single group form by: +// Ivan Pascal <pascal@info.tsu.ru> + +default partial alphanumeric_keys alternate_group +xkb_symbols "basic" { + + include "pc/el(bare)" + + key <TLDE> { [ grave, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + + key <AD11> { [ bracketleft, braceleft ] }; + key <AD12> { [ bracketright, braceright ] }; + + key <AC11> { [ apostrophe, quotedbl ] }; + + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; + key <BKSL> { [ backslash, bar ] }; + +}; + +hidden partial alphanumeric_keys alternate_group +xkb_symbols "bare" { + + name[Group1] = "ISO8859-7"; + + key <AD01> { [ semicolon, colon ] }; + key <AD02> { [ Greek_finalsmallsigma, Greek_SIGMA ] }; + key <AD03> { [ Greek_epsilon, Greek_EPSILON ] }; + key <AD04> { [ Greek_rho, Greek_RHO ] }; + key <AD05> { [ Greek_tau, Greek_TAU ] }; + key <AD06> { [ Greek_upsilon, Greek_UPSILON ] }; + key <AD07> { [ Greek_theta, Greek_THETA ] }; + key <AD08> { [ Greek_iota, Greek_IOTA ] }; + key <AD09> { [ Greek_omicron, Greek_OMICRON ] }; + key <AD10> { [ Greek_pi, Greek_PI ] }; + + key <AC01> { [ Greek_alpha, Greek_ALPHA ] }; + key <AC02> { [ Greek_sigma, Greek_SIGMA ] }; + key <AC03> { [ Greek_delta, Greek_DELTA ] }; + key <AC04> { [ Greek_phi, Greek_PHI ] }; + key <AC05> { [ Greek_gamma, Greek_GAMMA ] }; + key <AC06> { [ Greek_eta, Greek_ETA ] }; + key <AC07> { [ Greek_xi, Greek_XI ] }; + key <AC08> { [ Greek_kappa, Greek_KAPPA ] }; + key <AC09> { [ Greek_lamda, Greek_LAMDA ] }; + key <AC10> { [ dead_acute, dead_diaeresis ] }; + + key <AB01> { [ Greek_zeta, Greek_ZETA ] }; + key <AB02> { [ Greek_chi, Greek_CHI ] }; + key <AB03> { [ Greek_psi, Greek_PSI ] }; + key <AB04> { [ Greek_omega, Greek_OMEGA ] }; + key <AB05> { [ Greek_beta, Greek_BETA ] }; + key <AB06> { [ Greek_nu, Greek_NU ] }; + key <AB07> { [ Greek_mu, Greek_MU ] }; + + key <LSGT> { [ guillemotleft, guillemotright ] }; + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "extended" { + + include "pc/el(basic)" + + key.type = "THREE_LEVEL"; + + key <AE05> { [ 5, percent, EuroSign ] }; + + key <AD01> { [ semicolon, colon, periodcentered ] }; + key <AD03> { [ Greek_epsilon, Greek_EPSILON, EuroSign ] }; + + key <AB08> { [ comma, less, guillemotleft ] }; + key <AB09> { [ period, greater, guillemotright ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "polytonic" { + + include "pc/el(extended)" + + key.type = "THREE_LEVEL"; + + key <AD11> { [ dead_tilde, dead_diaeresis, dead_macron ] }; + key <AD12> { [ dead_iota, VoidSymbol, dead_breve ] }; + + key <AC10> { [ dead_acute, dead_horn ] }; + key <AC11> { [ dead_grave, dead_ogonek ] }; + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "nodeadkeys" { + + include "pc/el(basic)" + + key <AC10> { [ semicolon, colon ] }; + +}; + diff --git a/symbols/en_US b/symbols/en_US new file mode 100644 index 00000000..d8a34e08 --- /dev/null +++ b/symbols/en_US @@ -0,0 +1,22 @@ + +// based on a keyboard map from an 'xkb/symbols/iso3335-3' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/en_US,v 1.3 2003/01/26 02:01:48 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + name[Group1]="en_US"; + + include "level3(ralt_switch_multikey)" +}; + +xkb_symbols "nodeadkeys" { + + // Modifies the basic iso9995-3 layout to eliminate all dead keys + + include "pc/en_US(basic)" + include "pc/latin(nodeadkeys)" + +}; diff --git a/symbols/es b/symbols/es new file mode 100644 index 00000000..38c10175 --- /dev/null +++ b/symbols/es @@ -0,0 +1,59 @@ + +// based on a keyboard +// Modified for a real Spanish Keyboard by Jon Tombs +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/es,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Spanish"; + + key <AE01> { [ 1, exclam, bar, exclamdown ] }; + key <AE03> { [ 3, periodcentered, numbersign, sterling ] }; + key <AE04> { [ 4, dollar, asciitilde, dollar ] }; + key <AE06> { [ 6, ampersand, notsign, fiveeighths ] }; + key <AE11> { [apostrophe, question, backslash, questiondown ] }; + key <AE12> { [exclamdown, questiondown, asciitilde, asciitilde ] }; + + key <AD11> { [dead_grave, dead_circumflex, bracketleft, dead_abovering ] }; + key <AD12> { [ plus, asterisk, bracketright, dead_macron ] }; + + key <AC10> { [ ntilde, Ntilde, asciitilde, dead_doubleacute ] }; + key <AC11> { [dead_acute, dead_diaeresis, braceleft, braceleft ] }; + key <TLDE> { [ masculine, ordfeminine, backslash, backslash ] }; + + key <BKSL> { [ ccedilla, Ccedilla, braceright, dead_breve ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + include "pc/es(basic)" + + key <AC11> { [SunFA_Acute, SunFA_Diaeresis, braceleft, braceleft ] }; + key <AD11> { [SunFA_Grave, SunFA_Circum, bracketleft, dead_abovering ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + + include "pc/es(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/es(basic)" + + key <AD11> { [ grave, asciicircum, bracketleft, degree ] }; + key <AD12> { [ plus, asterisk, bracketright, macron ] }; + key <AC10> { [ ntilde, Ntilde, asciitilde, doubleacute ] }; + key <AC11> { [ acute, diaeresis, braceleft, braceleft ] }; + key <BKSL> { [ ccedilla, Ccedilla, braceright, breve ] }; + key <AB10> { [ minus, underscore, dead_belowdot, abovedot ] }; +}; diff --git a/symbols/fi b/symbols/fi new file mode 100644 index 00000000..11e096d4 --- /dev/null +++ b/symbols/fi @@ -0,0 +1,73 @@ +// based on a keyboard map from an 'xkb/symbols/fi' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/fi,v 1.9 2003/01/29 17:17:31 dawes Exp $ + + +partial default alphanumeric_keys +xkb_symbols "basic" { + include "pc/latin(type2)" + include "pc/fi(fi)" +}; + +partial alphanumeric_keys +xkb_symbols "fi" { + + // a Finnish keyboard with dead key support and all of + // ISO-8859-1 and ISO-8859-15 characters available. + + name[Group1]="Finnish"; + + key <TLDE> { [ section, onehalf, onequarter, threequarters ] }; + key <LSGT> { [ less, greater, bar, brokenbar ] }; + // AltGr+<SPCE> is pressed accidentally too often after AltGr+<LSGT>, + // hence AltGr+<SPCE> produces now space, not nobreakspace. + key <SPCE> { [ space, space, space, nobreakspace ] }; + key <AE01> { [ 1, exclam, exclamdown, onesuperior ] }; + key <AE02> { [ 2, quotedbl, at, twosuperior ] }; + key <AE03> { [ 3, numbersign, sterling, threesuperior ] }; + key <AE04> { [ 4, currency, dollar, cent ] }; + key <AE05> { [ 5, percent, EuroSign, masculine ] }; + key <AE06> { [ 6, ampersand, yen, ordfeminine ] }; + key <AE07> { [ 7, slash, braceleft, plusminus ] }; + key <AE08> { [ 8, parenleft, bracketleft, guillemotleft ] }; + key <AE09> { [ 9, parenright, bracketright, guillemotright ] }; + key <AE10> { [ 0, equal, braceright, degree ] }; + key <AB09> { [ period, colon, periodcentered, notsign ] }; + key <AB01> { [ z, Z, zcaron, Zcaron ] }; + key <AB02> { [ x, X, multiply, division ] }; + key <AB03> { [ c, C, copyright, cent ] }; + key <AB05> { [ b, B, ssharp, NoSymbol ] }; + key <AB06> { [ n, N, ntilde, Ntilde ] }; + key <AB07> { [ m, M, mu, NoSymbol ] }; + key <AB10> { [ minus, underscore, hyphen, macron ] }; + key <AC02> { [ s, S, scaron, Scaron ] }; + key <AC03> { [ d, D, eth, ETH ] }; + key <AD03> { [ e, E, EuroSign, cent ] }; + key <AD04> { [ r, R, registered, NoSymbol ] }; + key <AD05> { [ t, T, thorn, THORN ] }; + key <AD10> { [ p, P, paragraph, NoSymbol ] }; + key <AC10> { [ odiaeresis, Odiaeresis, oslash, Ooblique ] }; + key <AE11> { [ plus, question, backslash, questiondown ] }; + key <AC11> { [ adiaeresis, Adiaeresis, ae, AE ] }; + key <BKSL> { [ apostrophe, asterisk ] }; + key <AD11> { [ aring, Aring, oe, OE ] }; + key <AE12> { [ dead_acute, dead_grave ] }; + key <AD12> { [ dead_diaeresis, dead_circumflex, dead_tilde, dead_caron ] }; + + // End alphanumeric section, begin "Keypad" + key <KPDL> { [ KP_Delete, KP_Separator ] }; + // End "Keypad" section + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "pc/latin(type2)" + include "pc/latin(type2_nodeadkeys)" + include "pc/fi(fi)" + + key <AE12> { [ acute, grave ] }; + key <AD12> { [ diaeresis, asciicircum, asciitilde, caron ] }; +}; + diff --git a/symbols/fo b/symbols/fo new file mode 100644 index 00000000..d21887ce --- /dev/null +++ b/symbols/fo @@ -0,0 +1,48 @@ +// $XFree86$ + +partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type2)" + + name[Group1]= "Faroese"; + + key <TLDE> { [ onehalf, section, threequarters, paragraph ] }; + key <LSGT> { [ less, greater, backslash, notsign ] }; + key <SPCE> { [ space, space, nobreakspace, nobreakspace ] }; + + key <AE05> { [ 5, percent, NoSymbol, cent ] }; + key <AE06> { [ 6, ampersand, yen, NoSymbol ] }; + key <AE11> { [ plus, question, plusminus, questiondown ] }; + key <AE12> { [dead_acute, dead_grave, bar, brokenbar ] }; + + key <AB03> { [ c, C, copyright, NoSymbol ] }; + key <AB10> { [ minus, underscore, hyphen, macron ] }; + + key <AC03> { [ d, D, eth, ETH ] }; + key <AC10> { [ ae, AE ] }; + key <AC11> { [ oslash, Ooblique ] }; + + key <AD08> { [ i, I ] }; + key <AD11> { [ aring, Aring, dead_diaeresis, dead_circumflex ] }; + key <AD12> { [ eth, ETH, dead_tilde, dead_caron ] }; + + key <BKSL> { [apostrophe, asterisk, dead_doubleacute, multiply ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/fo(basic)" + + key <AE12> { [ acute, grave, bar, ogonek ] }; + key <AD11> { [ aring, Aring, diaeresis, degree ] }; + key <AD12> { [ diaeresis, asciicircum, asciitilde, macron ] }; + key <AC10> { [ ae, AE, acute, doubleacute ] }; + key <AC11> { [ oslash, Ooblique, asciicircum, caron ] }; + key <BKSL> { [apostrophe, asterisk, doubleacute, multiply ] }; + key <AB08> { [ comma, semicolon, cedilla, ogonek ] }; + key <AB09> { [ period, colon, periodcentered, abovedot ] }; +}; diff --git a/symbols/fr b/symbols/fr new file mode 100644 index 00000000..d731f900 --- /dev/null +++ b/symbols/fr @@ -0,0 +1,78 @@ + +// based on a keyboard map from an 'xkb/symbols/fr' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/fr,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="French"; + + key <AE01> { [ ampersand, 1, onesuperior, exclamdown ] }; + key <AE02> { [ eacute, 2, asciitilde, oneeighth ] }; + key <AE03> { [ quotedbl, 3, numbersign, sterling ] }; + key <AE04> { [apostrophe, 4, braceleft, dollar ] }; + key <AE05> { [ parenleft, 5, bracketleft, threeeighths ] }; + key <AE06> { [ minus, 6, bar, fiveeighths ] }; + key <AE07> { [ egrave, 7, grave, seveneighths ] }; + key <AE08> { [underscore, 8, backslash, trademark ] }; + key <AE09> { [ ccedilla, 9, asciicircum, plusminus ] }; + key <AE10> { [ agrave, 0, at, degree ] }; + key <AE11> { [parenright, degree, bracketright, questiondown ] }; + key <AE12> { [ equal, plus, braceright, dead_ogonek ] }; + + key <AD01> { [ a, A, ae, AE ] }; + key <AD02> { [ z, Z, guillemotleft, less ] }; + key <AD03> { [ e, E, EuroSign, cent ] }; + key <AD11> { [dead_circumflex, dead_diaeresis, dead_diaeresis, dead_abovering ] }; + key <AD12> { [ dollar, sterling, currency, dead_macron ] }; + + key <AC01> { [ q, Q, at, Greek_OMEGA ] }; + key <AC10> { [ m, M, mu, masculine ] }; + key <AC11> { [ ugrave, percent, dead_circumflex, dead_caron] }; + key <TLDE> { [twosuperior, asciitilde, notsign, notsign ] }; + + key <BKSL> { [ asterisk, mu, dead_grave, dead_breve ] }; + key <AB01> { [ w, W, lstroke, Lstroke ] }; + key <AB07> { [ comma, question, dead_acute, dead_doubleacute ] }; + key <AB08> { [ semicolon, period, horizconnector, multiply ] }; + key <AB09> { [ colon, slash, periodcentered, division ] }; + key <AB10> { [ exclam, section, dead_belowdot, dead_abovedot ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // Modifies the basic French layout to use the Sun dead keys + + include "pc/fr(basic)" + + key <AD11> { [SunFA_Circum, SunFA_Diaeresis ] }; + key <AB07> { [comma, question, SunFA_Acute, dead_doubleacute ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "pc/fr(Sundeadkeys)" + +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic French layout to eliminate all dead keys + + include "pc/fr(basic)" + + key <AE12> { [ equal, plus, braceright, ogonek ] }; + key <AD11> { [asciicircum, diaeresis ] }; + key <AD12> { [ dollar, sterling, currency, macron ] }; + key <AC11> { [ ugrave, percent, asciicircum, caron ] }; + key <BKSL> { [ asterisk, mu, grave, breve ] }; + key <AB07> { [ comma, question, acute, doubleacute ] }; + key <AB10> { [ exclam, section, dead_belowdot, abovedot ] }; +}; diff --git a/symbols/fr-latin9 b/symbols/fr-latin9 new file mode 100644 index 00000000..f4676322 --- /dev/null +++ b/symbols/fr-latin9 @@ -0,0 +1,167 @@ +// Historic Linux French keyboard layout (fr-latin9) +// Copyright (c) 199x, 2002 Rene Cougnenc (original work) +// Guylhem Aznar <clavier @ externe.net> (maintainer) +// Nicolas Mailhot <Nicolas.Mailhot @ laposte.net> +// (XFree86 submission) +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/fr-latin9,v 1.1 2002/12/20 02:07:11 dawes Exp $ +// +// This layout has long been distributed and refined outside official channels. +// To this day it remains more feature-rich and popular than the 'fr' layout. +// +// This file is derived from an original version by Guylhem Aznar. The +// original version is always available from: +// http://en.tldp.org/HOWTO/Francophones-HOWTO.html +// and is distributed under a GPL license. +// +// The author has given permission for this derived version to be distributed +// under the standard XFree86 license. He would like all changes to this +// version be send to him at <clavier @ externe.net> so he can sync the +// identically named linux console map (kbd, linux-console) and this +// fileout-of-tree GPL version. +// +// Now follows the keyboard design description in French. +// (If you can't read it you probably have no business changing this file anyway:) +// +// Les accents circonflexes des principales voyelles sont obtenus avec +// la touche Alt_Gr, les trmas sont obtenus par Alt_Gr + Shift. +// +// ____ _________ _____________ _______ +// | S A| S = Shift, A = AltGr + Shift | Imprime | Arrt dfil | Pause | +// | s a| s = normal, a = AltGr | Exec | | Halte | +// +// ____ ____ ____ ____ ____ ____ ____ ____ ____ ____ ____ ____ ____ _______ +// | "| 1 | 2 | 3 ,| 4 '| 5 "| 6 || 7 | 8 | 9 | 0 | | + | <-- | +// | "| & '| ~| " #| ' {| ( [| - || `| _ \| ^| @| ) ]| = }| | +// ======================================================================== +// | |<- | A | Z | E | R | T | Y | U | I | O | P '| " `| $ | , | +// | ->| | a | z | e | r | t | y | u | i | o | p | ^ ~| | <-' | +// =================================================================== | +// | | Q | S | D | F | G | H | J | K | L | M | % | | | +// | MAJ | q | s | d | f | g | h | j | k | l | m | | * | | +// ======================================================================== +// | ^ | > | W | X | C | V | B | N | ? | . | / | | ^ | +// | | | < || w | x | c | v | b | n | , | ; | : | ! | | | +// ======================================================================== +// | | | | | | | | | +// | Ctrl | Meta | Alt | Space Nobreakspace | AltGr | Multi|Menu | Ctrl | +// +// +// +// Si les touches mortes fonctionnent, utiliser les accents dits +// morts , i.e. fonctionnant comme l'accent circonflexe & le +// trma des machines crire ; sont disponibles : +// +// (^) : accent circonflexe, +// Shift+(^) : trma, +// Shift+AltGr (^) : tilde, +// AltGr (1) : accent aigu, +// AltGr (7) : accent grave +// +// Pour s'en servir, procder comme avec l'accent circonflexe & le trma +// sur les vielles machines crire : +// +// AltGr (1) puis e : +// Shift+AltGr (1) puis e : ... + +partial default alphanumeric_keys + +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="fr-latin9"; + + key <TLDE> { [ oe, OE, leftdoublequotemark, rightdoublequotemark ] }; + key <AE01> { [ ampersand, 1, dead_acute, periodcentered ] }; + key <AE02> { [ eacute, 2, asciitilde, Eacute ] }; + key <AE03> { [ quotedbl, 3, numbersign, cedilla ] }; + key <AE04> { [ apostrophe, 4, braceleft, acute ] }; + key <AE05> { [ parenleft, 5, bracketleft, diaeresis ] }; + key <AE06> { [ minus, 6, bar, brokenbar ] }; + key <AE07> { [ egrave, 7, dead_grave, Egrave ] }; + key <AE08> { [ underscore, 8, backslash, macron ] }; + key <AE09> { [ ccedilla, 9, asciicircum, Ccedilla ] }; + key <AE10> { [ agrave, 0, at, Agrave ] }; + key <AE11> { [ parenright, degree, bracketright, ydiaeresis ] }; + key <AE12> { [ equal, plus, braceright, dead_abovering ] }; + + key <AD01> { [ a, A, acircumflex, adiaeresis ] }; + key <AD02> { [ z, Z, aring, Aring ] }; + key <AD03> { [ e, E, EuroSign, cent ] }; + key <AD04> { [ r, R, ccedilla, Ccedilla ] }; + key <AD05> { [ t, T, thorn, THORN ] }; + key <AD06> { [ y, Y, yacute, Yacute ] }; + key <AD07> { [ u, U, ucircumflex, udiaeresis ] }; + key <AD08> { [ i, I, icircumflex, idiaeresis ] }; + key <AD09> { [ o, O, ocircumflex, odiaeresis ] }; + key <AD10> { [ p, P, paragraph, quoteleft ] }; + key <AD11> { [ dead_circumflex, dead_diaeresis, dead_tilde, quoteright ] }; + key <AD12> { [ dollar, sterling, ecircumflex, ediaeresis ] }; + + key <AC01> { [ q, Q, Acircumflex, Adiaeresis ] }; + key <AC02> { [ s, S, oslash, Ooblique ] }; + key <AC03> { [ d, D, Ecircumflex, Ediaeresis ] }; + key <AC04> { [ f, F, plusminus, ordfeminine ] }; + key <AC05> { [ g, G, ae, AE ] }; + key <AC06> { [ h, H, eth, ETH ] }; + key <AC07> { [ j, J, Ucircumflex, Udiaeresis ] }; + key <AC08> { [ k, K, Icircumflex, Idiaeresis ] }; + key <AC09> { [ l, L, Ocircumflex, Odiaeresis ] }; + key <AC10> { [ m, M, onesuperior, masculine ] }; + key <AC11> { [ ugrave, percent, twosuperior, Ugrave ] }; + key <BKSL> { [ asterisk, mu, threesuperior, yen ] }; + + key <LSGT> { [ less, greater, bar ] }; + key <AB01> { [ w, W, guillemotleft ] }; + key <AB02> { [ x, X, guillemotright ] }; + key <AB03> { [ c, C, copyright ] }; + key <AB04> { [ v, V, registered ] }; + key <AB05> { [ b, B, ssharp ] }; + key <AB06> { [ n, N, notsign ] }; + key <AB07> { [ comma, question, questiondown ] }; + key <AB08> { [ semicolon, period, multiply ] }; + key <AB09> { [ colon, slash, division ] }; + key <AB10> { [ exclam, section, exclamdown ] }; + + key <SPCE> { [ space, space, nobreakspace ] }; + + // French uses a comma as decimal separator, but keyboards are labeled with a period + // Will take effect when KP_Decimal is mapped to the locale decimal separator + key <KPDL> { [ KP_Delete, period, KP_Delete, KP_Decimal ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // Modifies the basic fr-latin9 layout to use the Sun dead keys + + include "pc/fr-latin9(basic)" + + key <AE01> { [ ampersand, 1, SunFA_Acute, periodcentered ] }; + key <AE07> { [ egrave, 7, SunFA_Grave, Egrave ] }; + key <AD11> { [ SunFA_Circum, SunFA_Diaeresis, SunFA_Tilde, quoteright ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + + include "pc/fr-latin9(Sundeadkeys)" + +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic fr-latin9 layout to eliminate all dead keys + + include "pc/fr-latin9(basic)" + + key <AE01> { [ ampersand, 1, apostrophe, periodcentered ] }; + key <AE07> { [ egrave, 7, grave, Egrave ] }; + key <AE12> { [ equal, plus, braceright ] }; + key <AD11> { [ asciicircum, diaeresis, asciitilde, quoteright ] }; +}; diff --git a/symbols/fujitsu.vndr/jp b/symbols/fujitsu.vndr/jp new file mode 100644 index 00000000..bc578ae7 --- /dev/null +++ b/symbols/fujitsu.vndr/jp @@ -0,0 +1,88 @@ +// $Xorg: jp,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// Japanese layout for a Fujitsu 140 key keyboard + +xkb_symbols { + override "fujitsu/us" + augment key <AE01> { [], [ kana_NU ] }; + key <AE02> { [ 2, quotedbl ], [ kana_FU ] }; + key <AE03> { [ 3, numbersign ], [ kana_A, kana_a ] }; + key <AE04> { [ 4, dollar ], [ kana_U, kana_u ] }; + augment key <AE05> { [], [ kana_E, kana_e ] }; + key <AE06> { [ 6, ampersand ], [ kana_O, kana_o ] }; + key <AE07> { [ 7, apostrophe ], [ kana_YA, kana_ya ] }; + key <AE08> { [ 8, parenleft ], [ kana_YU, kana_yu ] }; + key <AE09> { [ 9, parenright ], [ kana_YO, kana_yo ] }; + replace key <AE10> { [ 0 ], [ kana_WA, kana_WO ] }; + key <AE11> { [ minus, equal ], [ kana_HO ] }; + key <AE12> { [ asciicircum, asciitilde ], [ kana_HE ] }; + key <BKSL> { [ backslash, bar ], [ prolongedsound] }; + augment key <AD01> { [], [ kana_TA ] }; + augment key <AD02> { [], [ kana_TE ] }; + augment key <AD03> { [], [ kana_I, kana_i ] }; + augment key <AD04> { [], [ kana_SU ] }; + augment key <AD05> { [], [ kana_KA ] }; + augment key <AD06> { [], [ kana_N ] }; + augment key <AD07> { [], [ kana_NA ] }; + augment key <AD08> { [], [ kana_NI ] }; + augment key <AD09> { [], [ kana_RA ] }; + augment key <AD10> { [], [ kana_SE ] }; + key <AD11> { [ at, grave ], [ voicedsound ] }; + key <AD12> { [ bracketleft, braceleft ], [ semivoicedsound, kana_openingbracket ] }; + augment key <AC01> { [], [ kana_CHI ] }; + augment key <AC02> { [], [ kana_TO ] }; + augment key <AC03> { [], [ kana_SHI ] }; + augment key <AC04> { [], [ kana_HA ] }; + augment key <AC05> { [], [ kana_KI ] }; + augment key <AC06> { [], [ kana_KU ] }; + augment key <AC07> { [], [ kana_MA ] }; + augment key <AC08> { [], [ kana_NO ] }; + augment key <AC09> { [], [ kana_RI ] }; + key <AC10> { [ semicolon, plus ], [ kana_RE ] }; + key <AC11> { [ colon, asterisk ], [ kana_KE ] }; + key <TLDE> { [ bracketright, braceright ], [ kana_MU, kana_closingbracket ] }; + augment key <AB01> { [], [ kana_TSU, kana_tsu ] }; + augment key <AB02> { [], [ kana_SA ] }; + augment key <AB03> { [], [ kana_SO ] }; + augment key <AB04> { [], [ kana_HI ] }; + augment key <AB05> { [], [ kana_KO ] }; + augment key <AB06> { [], [ kana_MI ] }; + augment key <AB07> { [], [ kana_MO ] }; + augment key <AB08> { [], [ kana_NE, kana_comma ] }; + augment key <AB09> { [], [ kana_RU, kana_fullstop ] }; + augment key <AB10> { [], [ kana_ME, kana_conjunctive ] }; + key <AB11> { [ underscore ], [ kana_RO ] }; + key <UNK0> { [ Select ] }; + key <UNK1> { [ Massyo ] }; + key <UNK2> { [ Touroku ] }; + key <UNK3> { [ Zenkaku_Hankaku ] }; + key <UNK4> { [ Eisu_Shift ] }; + key <UNK5> { [ Mode_switch ] }; + key <UNK6> { [ Cancel ] }; + key <UNK7> { [ Muhenkan ] }; + key <UNK8> { [ Henkan ] }; +}; diff --git a/symbols/fujitsu.vndr/us b/symbols/fujitsu.vndr/us new file mode 100644 index 00000000..e81be028 --- /dev/null +++ b/symbols/fujitsu.vndr/us @@ -0,0 +1,145 @@ +// $Xorg: us,v 1.4 2001/02/09 02:05:53 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// US/ASCII layout for a Fujitsu 138 key keyboard +xkb_symbols { + include "us(basic)" + + // A few alphanumeric keys are different + key <TLDE> { [ grave, asciitilde ] }; + key <BKSP> { [ BackSpace ] }; + key <BKSL> { [ backslash, bar ] }; + key <AB11> { [ ] }; + + key <RTSH> { [ Shift_R ] }; + + key <LALT> { [ Alt_L ] }; + key <RALT> { [ Alt_R ] }; + key <LMTA> { [ Meta_L ] }; + key <RMTA> { [ Meta_R ] }; + key <LNFD> { [ Linefeed ] }; + key <COMP> { [ Multi_key ] }; + // End alphanumeric section + + // Begin "Function" section + key <BREA> { [ Break ] }; + key <PRSC> { [ Print ] }; + key <KNJI> { [ Kanji ] }; + key <PAUS> { [ Pause ] }; + + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ] }; + key <FK12> { [ F12 ] }; + key <FK13> { [ F13 ] }; + key <FK14> { [ F14 ] }; + key <FK15> { [ F15 ] }; + key <FK16> { [ F16 ] }; + key <FK17> { [ F17 ] }; + key <FK18> { [ F18 ] }; + key <FK19> { [ F19 ] }; + key <FK20> { [ F20 ] }; + key <FK21> { [ F21 ] }; + key <FK22> { [ F22 ] }; + key <FK23> { [ F23 ] }; + key <FK24> { [ F24 ] }; + key <FK25> { [ F25 ] }; + key <FK26> { [ F26 ] }; + key <FK27> { [ F27 ] }; + key <FK28> { [ F28 ] }; + key <FK29> { [ F29 ] }; + key <FK30> { [ F30 ] }; + key <FK31> { [ F31 ] }; + key <FK32> { [ F32 ] }; + // End "Function" section + + // Begin "Editing" section + key <UNDO> { [ Undo ] }; + key <COPY> { [ F33 ] }; + key <PAST> { [ F34 ] }; + key <CUT> { [ F35 ] }; + key <HELP> { [ Help ] }; + // End "Editing" section + + // Begin "Cursor" section + key <UNK0> { [ ] }; + key <UNK1> { [ ] }; + key <UNK2> { [ ] }; + key <PGUP> { [ Prior ] }; + key <HOME> { [ Home ] }; + key <PGDN> { [ Next ] }; + key <UNK3> { [ ] }; + key <DEL> { [ Delete ] }; + key <INS> { [ Insert ] }; + key <LEFT> { [ Left ] }; + key <RGHT> { [ Right ] }; + key <UP> { [ Up ] }; + key <DOWN> { [ Down ] }; + key <EXEC> { [ Execute ] }; + // End "Cursor" section + + // Begin "Keypad" section + key <KPMU> { [ KP_Multiply ] }; + key <KPDV> { [ KP_Divide ] }; + key <KPAD> { [ KP_Add ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP7> { [ KP_7 ] }; + key <KP8> { [ KP_8 ] }; + key <KP9> { [ KP_9 ] }; + key <KPEQ> { [ KP_Equal ] }; + + key <KP4> { [ KP_4 ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_6 ] }; + key <KPDC> { [ KP_Decimal ] }; + + key <KP1> { [ KP_1 ] }; + key <KP2> { [ KP_2 ] }; + key <KP3> { [ KP_3 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_0 ] }; + key <KP00> { [ KP_0 ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Meta_L, Meta_R }; + modifier_map Mod2 { Mode_switch }; + modifier_map Mod3 { Alt_L }; + modifier_map Mod4 { Num_Lock }; + modifier_map Mod5 { F13, F18, F20 }; +}; + diff --git a/symbols/gb b/symbols/gb new file mode 100644 index 00000000..d2ec15bc --- /dev/null +++ b/symbols/gb @@ -0,0 +1,61 @@ + +// based on a keyboard map from an 'xkb/symbols/gb' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/gb,v 1.6 2003/10/04 10:25:14 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple U.K. keyboard layout defined by + // the SVR4 European Language Supplement and sometimes also + // known as the IBM 166 layout. + + include "pc/latin" + + name[Group1]="Great Britain"; + + key <AE02> { [ 2, quotedbl, twosuperior, oneeighth ] }; + key <AE03> { [ 3, sterling, threesuperior, sterling ] }; + key <AE04> { [ 4, dollar, EuroSign, onequarter ] }; + + key <AC11> { [apostrophe, at, dead_circumflex, dead_caron] }; + key <TLDE> { [ grave, notsign, bar, bar ] }; + + key <BKSL> { [numbersign, asciitilde, dead_grave, dead_breve ] }; + key <LSGT> { [ backslash, bar, bar, brokenbar ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial default alphanumeric_keys +xkb_symbols "intl" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple U.K. keyboard layout with + // dead keys. By Phil Jones (philjones1@blueyonder.co.uk) + + // Includes the following keys: + // dead_grave + // dead_acute + // dead_circumflex + // dead_tilde + // dead_diaeresis + + include "pc/latin" + + name[Group1]="Great Britain"; + + key <AE02> { [ 2, dead_diaeresis, twosuperior, onehalf ] }; + key <AE03> { [ 3, sterling, threesuperior, onethird ] }; + key <AE04> { [ 4, dollar, EuroSign, onequarter ] }; + key <AE06> { [ 6, dead_circumflex, NoSymbol, onesixth ] }; + + key <AC11> { [ dead_acute, at, apostrophe, bar ] }; + key <TLDE> { [ dead_grave, notsign, bar, bar ] }; + + key <BKSL> { [ numbersign, dead_tilde, bar, bar ] }; + key <LSGT> { [ backslash, bar, bar, bar ] }; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/ge_la b/symbols/ge_la new file mode 100644 index 00000000..62a782d3 --- /dev/null +++ b/symbols/ge_la @@ -0,0 +1,52 @@ + +// based on +// Georgian keyboard map, in the so called "latin" layout. +// 1999, Pablo Saratxaga <srtxg@chanae.alphanet.ch> +// +// $XdotOrg: xc/programs/xkbcomp/symbols/pc/ge_la,v 1.1.4.2 2004/03/05 13:41:33 eich Exp $ +// $XFree86: xc/programs/xkbcomp/symbols/pc/ge_la,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Georgian"; + + key <AD01> { [ 0x010010e5, q ] }; + key <AD02> { [ 0x010010ec, 0x010010ed ] }; + key <AD03> { [ 0x010010d4, e ] }; + key <AD04> { [ 0x010010e0, 0x010010e6 ] }; + key <AD05> { [ 0x010010e2, 0x010010d7 ] }; + key <AD06> { [ 0x010010e7, y ] }; + key <AD07> { [ 0x010010e3, u ] }; + key <AD08> { [ 0x010010d8, i ] }; + key <AD09> { [ 0x010010dd, o ] }; + key <AD10> { [ 0x010010de, p ] }; + key <AD11> { [ bracketleft, braceleft ] }; + key <AD12> { [ bracketright,braceright ] }; + + key <AC01> { [ 0x010010d0, a ] }; + key <AC02> { [ 0x010010e1, 0x010010e8 ] }; + key <AC03> { [ 0x010010d3, d ] }; + key <AC04> { [ 0x010010e4, f ] }; + key <AC05> { [ 0x010010d2, g ] }; + key <AC06> { [ 0x010010f0, h ] }; + key <AC07> { [ 0x010010ef, 0x010010df ] }; + key <AC08> { [ 0x010010d9, k ] }; + key <AC09> { [ 0x010010da, l ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ apostrophe, quotedbl ] }; + key <BKSL> { [ backslash, bar ] }; + + key <LSGT> { [ guillemotleft,guillemotright ] }; + key <AB01> { [ 0x010010d6, 0x010010eb ] }; + key <AB02> { [ 0x010010ee, x ] }; + key <AB03> { [ 0x010010ea, 0x010010e9 ] }; + key <AB04> { [ 0x010010d5, v ] }; + key <AB05> { [ 0x010010d1, b ] }; + key <AB06> { [ 0x010010dc, n ] }; + key <AB07> { [ 0x010010db, m ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; + +}; diff --git a/symbols/ge_ru b/symbols/ge_ru new file mode 100644 index 00000000..4fd347b4 --- /dev/null +++ b/symbols/ge_ru @@ -0,0 +1,65 @@ + +// based on +// Georgian keyboard map, in the so called "russian" layout. +// 1999, Pablo Saratxaga <srtxg@chanae.alphanet.ch> +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Georgian"; + + key <TLDE> { [ asciicircum, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; // 2 0xeb + key <AE03> { [ 3, numbersign ] }; // 3 0xec + key <AE04> { [ 4, semicolon ] }; + key <AE05> { [ 5, colon ] }; + key <AE06> { [ 6, comma ] }; + key <AE07> { [ 7, period ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ numbersign, bar ] }; + + key <AD01> { [ 0x010010e6, q ] }; + key <AD02> { [ 0x010010ea, w ] }; + key <AD03> { [ 0x010010e3, e ] }; + key <AD04> { [ 0x010010d9, r ] }; + key <AD05> { [ 0x010010d4, t ] }; + key <AD06> { [ 0x010010dc, y ] }; + key <AD07> { [ 0x010010d2, u ] }; + key <AD08> { [ 0x010010e8, i ] }; + key <AD09> { [ 0x010010ec, o ] }; + key <AD10> { [ 0x010010d6, p ] }; + key <AD11> { [ 0x010010ee, bracketleft ] }; + key <AD12> { [ 0x010010ef, bracketright ] }; + + key <AC01> { [ 0x010010e4, a ] }; + key <AC02> { [ 0x010010d7, s ] }; + key <AC03> { [ 0x010010d5, d ] }; + key <AC04> { [ 0x010010d0, f ] }; + key <AC05> { [ 0x010010de, g ] }; + key <AC06> { [ 0x010010e0, h ] }; + key <AC07> { [ 0x010010dd, j ] }; + key <AC08> { [ 0x010010da, k ] }; + key <AC09> { [ 0x010010d3, l ] }; + key <AC10> { [ 0x010010df, semicolon ] }; + key <AC11> { [ 0x010010eb, percent ] }; + key <BKSL> { [ backslash, bar ] }; // 0xe9 0xea + + key <LSGT> { [ guillemotleft,guillemotright ] }; // 0xab 0xbb 0xe7 0xe8 + key <AB01> { [ 0x010010ed, z ] }; + key <AB02> { [ 0x010010e9, x ] }; + key <AB03> { [ 0x010010e1, c ] }; + key <AB04> { [ 0x010010db, v ] }; + key <AB05> { [ 0x010010d8, b ] }; + key <AB06> { [ 0x010010e2, n ] }; + key <AB07> { [ 0x010010e5, m ] }; + key <AB08> { [ 0x010010d1, less ] }; + key <AB09> { [ 0x010010e7, greater ] }; + key <AB10> { [ 0x010010f0, question ] }; + +}; diff --git a/symbols/guj b/symbols/guj new file mode 100644 index 00000000..ca2b1f7a --- /dev/null +++ b/symbols/guj @@ -0,0 +1,69 @@ + +// based on a keyboard map from an 'xkb/symbols/guj' file +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Gujarati"; + + // Mainly numbers. + key <AE01> { [ 0x1000AE7, 0x1000A8D ] }; + key <AE02> { [ 0x1000AE8, 0x1000AC5 ] }; + key <AE03> { [ 0x1000AE9 ] }; + key <AE04> { [ 0x1000AEA ] }; + key <AE05> { [ 0x1000AEB ] }; + key <AE06> { [ 0x1000AEC ] }; + key <AE07> { [ 0x1000AED ] }; + key <AE08> { [ 0x1000AEE ] }; + key <AE09> { [ 0x1000AEF, parenleft ] }; + key <AE10> { [ 0x1000AE6, parenright ] }; + key <AE11> { [ minus, 0x1000A83 ] }; + key <AE12> { [ 0x1000A8B, 0x1000AC3 ] }; + +// Mainly long vowels + + key <AD01> { [ 0x1000ACC, 0x1000A94 ] }; + key <AD02> { [ 0x1000AC8, 0x1000A90 ] }; + key <AD03> { [ 0x1000ABE, 0x1000A86 ] }; + key <AD04> { [ 0x1000AC0, 0x1000A88 ] }; + key <AD05> { [ 0x1000AC2, 0x1000A8A ] }; + +// Mainly voiced consonants + + key <AD06> { [ 0x1000AAC, 0x1000AAD ] }; + key <AD07> { [ 0x1000AB9, 0x1000A99 ] }; + key <AD08> { [ 0x1000A97, 0x1000A98 ] }; + key <AD09> { [ 0x1000AA6, 0x1000AA7 ] }; + key <AD10> { [ 0x1000A9C, 0x1000A9D ] }; + key <AD11> { [ 0x1000AA1, 0x1000AA2 ] }; + key <AD12> { [ 0x1000ABC, 0x1000A9E ] }; + +// Mainly short vowels + key <AC01> { [ 0x1000ACB, 0x1000A93 ] }; + key <AC02> { [ 0x1000AC7, 0x1000A8F ] }; + key <AC03> { [ 0x1000ACD, 0x1000A85 ] }; + key <AC04> { [ 0x1000ABF, 0x1000A87 ] }; + key <AC05> { [ 0x1000AC1, 0x1000A89 ] }; + +// Mainly unvoiced consonants + + key <AC06> { [ 0x1000AAA, 0x1000AAB ] }; + key <AC07> { [ 0x1000AB0, guj_rra ] }; + key <AC08> { [ 0x1000A95, 0x1000A96 ] }; + key <AC09> { [ 0x1000AA4, 0x1000AA5 ] }; + key <AC10> { [ 0x1000A9A, 0x1000A9B ] }; + key <AC11> { [ 0x1000A9F, 0x1000AA0 ] }; + key <BKSL> { [ 0x1000AC9, 0x1000A91 ] }; + + key <AB01> { [ z , Z ] }; + key <AB02> { [ 0x1000A82, 0x1000A81 ] }; + key <AB03> { [ 0x1000AAE, 0x1000AA3 ] }; + key <AB04> { [ 0x1000AA8, guj_nnna ] }; + key <AB05> { [ 0x1000AB5, guj_llla ] }; + key <AB06> { [ 0x1000AB2, 0x1000AB3 ] }; + key <AB07> { [ 0x1000AB8, 0x1000AB6 ] }; + key <AB08> { [ comma, 0x1000AB7 ] }; + key <AB09> { [ period, 0x1000964 ] }; + key <AB10> { [ 0x1000AAF, question ] }; +}; diff --git a/symbols/gur b/symbols/gur new file mode 100644 index 00000000..12a00054 --- /dev/null +++ b/symbols/gur @@ -0,0 +1,69 @@ + +// based on a keyboard map from an 'xkb/symbols/gur' file +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Gurmukhi"; + + // Mainly numbers. + key <AE01> { [ 0x1000A67 ] }; + key <AE02> { [ 0x1000A68 ] }; + key <AE03> { [ 0x1000A69 ] }; + key <AE04> { [ 0x1000A6A ] }; + key <AE05> { [ 0x1000A6B ] }; + key <AE06> { [ 0x1000A6C ] }; + key <AE07> { [ 0x1000A6D ] }; + key <AE08> { [ 0x1000A6e ] }; + key <AE09> { [ 0x1000A6F, parenleft ] }; + key <AE10> { [ 0x1000A66, parenright ] }; + key <AE11> { [ gur_visarga ] }; + key <AE12> { [ gur_v_r, gur_v_r_s ] }; + +// Mainly long vowels + + key <AD01> { [ 0x1000A4C, 0x1000A14 ] }; + key <AD02> { [ 0x1000A48, 0x1000A10 ] }; + key <AD03> { [ 0x1000A3E, 0x1000A06 ] }; + key <AD04> { [ 0x1000A40, 0x1000A08 ] }; + key <AD05> { [ 0x1000A42, 0x1000A0A ] }; + +// Mainly voiced consonants + + key <AD06> { [ 0x1000A2C, 0x1000A2D ] }; + key <AD07> { [ 0x1000A39, 0x1000A19 ] }; + key <AD08> { [ 0x1000A17, 0x1000A18 ] }; + key <AD09> { [ 0x1000A26, 0x1000A27 ] }; + key <AD10> { [ 0x1000A1C, 0x1000A1D ] }; + key <AD11> { [ 0x1000A21, 0x1000A22 ] }; + key <AD12> { [ 0x1000A3C, 0x1000A1E ] }; + +// Mainly short vowels + key <AC01> { [ 0x1000A4B, 0x1000A13 ] }; + key <AC02> { [ 0x1000A47, 0x1000A0F ] }; + key <AC03> { [ 0x1000A4D, 0x1000A05 ] }; + key <AC04> { [ 0x1000A3F, 0x1000A07 ] }; + key <AC05> { [ 0x1000A41, 0x1000A09 ] }; + +// Mainly unvoiced consonants + + key <AC06> { [ 0x1000A2A, 0x1000A2B ] }; + key <AC07> { [ 0x1000A30, 0x1000A30 ] }; + key <AC08> { [ 0x1000A15, 0x1000A16 ] }; + key <AC09> { [ 0x1000A24, 0x1000A25 ] }; + key <AC10> { [ 0x1000A1A, 0x1000A1B ] }; + key <AC11> { [ 0x1000A1F, 0x1000A20 ] }; + key <BKSL> { [ backslash, bar ] }; + + key <AB01> { [ z, Z ] }; + key <AB02> { [ 0x1000A02, 0x1000A70 ] }; + key <AB03> { [ 0x1000A2E, 0x1000A23 ] }; + key <AB04> { [ 0x1000A28, 0x1000A28 ] }; + key <AB05> { [ 0x1000A35, 0x1000A35 ] }; + key <AB06> { [ 0x1000A32, 0x1000A33 ] }; + key <AB07> { [ 0x1000A38, 0x1000A36 ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, 0x1000964 ] }; + key <AB10> { [ 0x1000A2F, question ] }; +}; diff --git a/symbols/hp.vndr/us b/symbols/hp.vndr/us new file mode 100644 index 00000000..18ce8aea --- /dev/null +++ b/symbols/hp.vndr/us @@ -0,0 +1,106 @@ +// $Xorg: us,v 1.4 2001/02/09 02:05:53 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// US/ASCII layout for a HP non-PC keyboard +xkb_symbols "hil" { + include "us(basic)" + + // A few alphanumeric keys are different + key <TLDE> { [ grave, asciitilde ]}; + key <RTSH> { [ Shift_R ]}; + key <LALT> { [ Meta_L ]}; + key <RALT> { [ Meta_R ]}; + // End alphanumeric section + + // Begin "Function" section + key <BRK> { [ Break ]}; + key <STOP> { [ Cancel ]}; + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <MENU> { [ Menu ] }; + key <SYST> { [ hpSystem ]}; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <CLRL> { [ hpClearLine ]}; + key <CLR> { [ Clear ]}; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ] }; + key <FK12> { [ F12 ] }; + // End "Function" section + + // Begin "Editing" section + key <PRSC> { [ Execute, Print ]}; + key <INSL> { [ hpInsertLine ]}; + key <DELL> { [ hpDeleteLine ]}; + key <INSC> { [ hpInsertChar ]}; + key <DELC> { [ hpDeleteChar ]}; + key <HOME> { [ Home ] }; + key <PGUP> { [ Prior ] }; + key <PGDN> { [ Next ] }; + key <SELE> { [ Select ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <UP> { [ Up ] }; + key <RGHT> { [ Right ]}; + + // End "Editing" section, begin "Keypad" + key <KPMU> { [ KP_Multiply ]}; + key <KPDV> { [ KP_Divide ]}; + key <KPAD> { [ KP_Add ]}; + key <KPSU> { [ KP_Subtract ]}; + + key <KP7> { [ KP_7 ] }; + key <KP8> { [ KP_8 ] }; + key <KP9> { [ KP_9 ] }; + key <KPEN> { [ KP_Enter ]}; + + key <KP4> { [ KP_4 ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_6 ] }; + key <KPSP> { [ KP_Separator ]}; + + key <KP1> { [ KP_1 ] }; + key <KP2> { [ KP_2 ] }; + key <KP3> { [ KP_3 ] }; + key <KPTB> { [ KP_Tab ]}; + + key <KP0> { [ KP_0 ] }; + key <KPDL> { [ KP_Decimal ] }; + // End "Keypad" section + + + // begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Meta_L, Meta_R }; + modifier_map Mod2 { Alt_L }; + modifier_map Mod3 { Mode_switch }; +}; + diff --git a/symbols/hr b/symbols/hr new file mode 100644 index 00000000..388cb94e --- /dev/null +++ b/symbols/hr @@ -0,0 +1,50 @@ + +// based on +// Croatian keyboards +// by Vlatko Kosturjak (kost at linux.hr) +// Taken from Slovenian keyboards +// by Marko Samastur (markos@elite.org) and +// Primoz Peterlin (primoz.peterlin@biofiz.mf.uni-lj.si) +// +// Changelog +// ========= +// 2003-04-03 Added <KPDL> (Delete/Separator) +// 2000-02-06 Initial version +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/hr,v 1.3 2003/04/13 18:22:21 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type3)" + + name[Group1]="Croatian"; + + key <AE01> { [ 1, exclam, asciitilde, dead_tilde ] }; + key <AE02> { [ 2, quotedbl, dead_caron, caron ] }; + key <AE03> { [ 3, numbersign, asciicircum, dead_circumflex ] }; + key <AE04> { [ 4, dollar, dead_breve, breve ] }; + key <AE05> { [ 5, percent, degree, dead_abovering ] }; + key <AE06> { [ 6, ampersand, dead_ogonek, ogonek ] }; + key <AE07> { [ 7, slash, grave, dead_grave ] }; + key <AE08> { [ 8, parenleft, dead_abovedot, abovedot ] }; + key <AE09> { [ 9, parenright, dead_acute, apostrophe ] }; + key <AE10> { [ 0, equal, dead_doubleacute, doubleacute ] }; + key <AE11> { [apostrophe, question, dead_diaeresis, diaeresis ] }; + key <AE12> { [ plus, asterisk, dead_cedilla, cedilla ] }; + + key <AD03> { [ e, E, EuroSign, EuroSign ] }; + key <AD11> { [ scaron, Scaron, division, dead_abovering ] }; + key <AD12> { [ dstroke, Dstroke, multiply, dead_macron ] }; + + key <AC10> { [ ccaron, Ccaron, dead_acute, dead_doubleacute ] }; + key <AC11> { [ cacute, Cacute, ssharp, dead_caron ] }; + key <TLDE> { [dead_cedilla, dead_diaeresis, notsign, notsign ] }; + + key <BKSL> { [ zcaron, Zcaron, currency, dead_breve ] }; + + key <KPDL> { [ KP_Delete, KP_Seprator ] }; + + include "level3(ralt_switch_multikey)" +}; + diff --git a/symbols/ie b/symbols/ie new file mode 100644 index 00000000..09c2c135 --- /dev/null +++ b/symbols/ie @@ -0,0 +1,253 @@ +// $XFree86: xc/programs/xkbcomp/symbols/pc/ie,v 1.3 2002/12/31 02:07:04 dawes Exp $ + +// Irish keyboard map + +// Support for Irish (old and new orthography) and English +// Seamus O Ciardhuain <seoc@cnds.ucd.ie> (19 December 2002) + +// The general idea is to provide the characters in ISO 8859-1, +// ISO 8859-15, ISO 8859-14, CP1252 and "Extended Latin-8". +// However, not all are accessible directly because there aren't +// enough keys; some need deadkeys to access them, others the +// "Multi_key" compose sequences. + +// Designed to be similar to the layouts used on Windows +// and the Macintosh. + +// Everything is in Group 1 to be compatible with the +// multi-layout keyboard support in XFree86 4.3. + +// The basic layout is a modern keyboard, but dotted consonants are +// accessible using a deadkey (AltGr+H or AltGr+W). +// If a proper Clo Gaelach keyboard is needed, then use the layout +// defined below as ie(CloGaelach), which gives dotted consonants +// without use of a deadkey. + + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Modern keyboard for Irish and English + // - acute-accented vowels as AltGr+vowel and AltGr+Shift+vowel + // - euro currency sign as AltGr+4 + // - Comhartha Agus (Tironian Sign Et) as AltGr+Shift+7 + // - non-breaking space as AltGr+Space and AltGr+Shift+Space + // - matches hardware (keys and engraved symbols) for Irish keyboards + + name[Group1] = "Irish"; + + // + // Numeric row `1234567890-= + // + key <TLDE> { [ grave, notsign, brokenbar, NoSymbol ] }; + key <AE01> { [ 1, exclam, exclamdown, onesuperior ] }; + key <AE02> { [ 2, quotedbl, trademark, twosuperior ] }; + key <AE03> { [ 3, sterling, copyright, threesuperior ] }; + key <AE04> { [ 4, dollar, EuroSign, cent ] }; + key <AE05> { [ 5, percent, section, dagger ] }; + key <AE06> { [ 6, asciicircum, dead_circumflex, 0x1002030 ] }; + // per thousand + key <AE07> { [ 7, ampersand, paragraph, 0x100204A ] }; + // Tironian Et + key <AE08> { [ 8, asterisk, dead_diaeresis, enfilledcircbullet ] }; + key <AE09> { [ 9, parenleft, ordfeminine, periodcentered ] }; + key <AE10> { [ 0, parenright, masculine, degree ] }; + key <AE11> { [ minus, underscore, endash, emdash ] }; + key <AE12> { [ equal, plus, notequal, plusminus ] }; + + // + // QWERTYUIOP[] + // + key <AD01> { [ q, Q, oe, OE ] }; + key <AD02> { [ w, W, dead_abovedot, dead_abovedot ] }; + key <AD03> { [ e, E, eacute, Eacute ] }; + key <AD04> { [ r, R, registered, 0x1002030 ] }; + // per thousand + key <AD05> { [ t, T, thorn, THORN ] }; + key <AD06> { [ y, Y, yen, mu ] }; + key <AD07> { [ u, U, uacute, Uacute ] }; + key <AD08> { [ i, I, iacute, Iacute ] }; + key <AD09> { [ o, O, oacute, Oacute ] }; + key <AD10> { [ p, P, singlelowquotemark, NoSymbol ] }; + key <AD11> { [ bracketleft, braceleft, leftdoublequotemark, rightdoublequotemark ] }; + key <AD12> { [ bracketright, braceright, leftsinglequotemark, rightsinglequotemark ] }; + + // + // ASDFGHJKL;'# + // + key <AC01> { [ a, A, aacute, Aacute ] }; + key <AC02> { [ s, S, ssharp, NoSymbol ] }; + key <AC03> { [ d, D, eth, ETH ] }; + key <AC04> { [ f, F, 0x1000192, NoSymbol ] }; + // f with hook + key <AC05> { [ g, G, copyright, NoSymbol ] }; + key <AC06> { [ h, H, dead_abovedot, dead_abovedot ] }; + key <AC07> { [ j, J, idotless, onequarter ] }; + key <AC08> { [ k, K, dead_abovering, onehalf ] }; + key <AC09> { [ l, L, acute, threequarters ] }; + key <AC10> { [ semicolon, colon, ellipsis, doubledagger ] }; + key <AC11> { [ apostrophe, at, ae, AE ] }; + key <BKSL> { [ numbersign, asciitilde, guillemotleft, guillemotright ] }; + + + // + // \ZXCVBNM,./ + // + key <LSGT> { [ backslash, bar, dead_grave, dead_acute ] }; + key <AB01> { [ z, Z, leftanglebracket, rightanglebracket ] }; + key <AB02> { [ x, X, multiply, approximate ] }; + key <AB03> { [ c, C, dead_cedilla, cedilla ] }; + key <AB04> { [ v, V, dead_caron, NoSymbol ] }; + key <AB05> { [ b, B, diaeresis, NoSymbol ] }; + key <AB06> { [ n, N, dead_tilde, NoSymbol ] }; + key <AB07> { [ m, M, macron, NoSymbol ] }; + key <AB08> { [ comma, less, lessthanequal, doublelowquotemark ] }; + key <AB09> { [ period, greater, greaterthanequal, singlelowquotemark ] }; + key <AB10> { [ slash, question, division, questiondown ] }; + + + key <SPCE> { [ space, space, nobreakspace, nobreakspace ] }; + + include "level3(ralt_switch)" + + // NB: putting Shift+<RALT> as Multi_key gives odd behaviour since the + // order of pressing keys affects the result. + + key <RWIN> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "laptop" { + // For laptops which don't have the RWIN key but are otherwise + // the same as 105-key layouts. + include "ie(basic)" + key <MENU> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "CloGaelach" { + + // Adds support for Clo Gaelach (old orthography for Irish). + // Changes from "basic": + // - dotted consonants as AltGr+consonant or AltGr+Shift+consonant (TPSDFGCBM) + // - long lowercase r as AltGr+R + // - long lowercase s as AltGr+Z + // - long lowercase s dotted as AltGr+Shift+Z + // - some symbols moved around to retain them + // - several characters unlikely to be used are lost + // The long letters are needed only where the font provides + // both the long and short forms as different glyphs. + + include "ie(basic)" + + name[Group1] = "Irish (Clo Gaelach)"; + + key <TLDE> { [ grave, notsign, brokenbar, ssharp ] }; + key <AD04> { [ r, R, 0x100027C, registered ] }; + // long r + key <AD05> { [ t, T, tabovedot, Tabovedot ] }; + key <AD10> { [ p, P, pabovedot, Pabovedot ] }; + + key <AC02> { [ s, S, sabovedot, Sabovedot ] }; + key <AC03> { [ d, D, dabovedot, Dabovedot ] }; + key <AC04> { [ f, F, fabovedot, Fabovedot ] }; + key <AC05> { [ g, G, gabovedot, Gabovedot ] }; + + key <AB01> { [ z, Z, 0x100017F, 0x1001E9B ] }; + // long s, long s dot + key <AB03> { [ c, C, cabovedot, Cabovedot ] }; + key <AB05> { [ b, B, babovedot, Babovedot ] }; + key <AB07> { [ m, M, mabovedot, Mabovedot ] }; + + key <LSGT> { [ backslash, bar, dead_grave, dead_cedilla ] }; +}; + +partial alphanumeric_keys +xkb_symbols "CloGaelachLaptop" { + // For laptops which don't have the RWIN key but are otherwise + // the same as 105-key layouts. + include "ie(CloGaelach)" + key <MENU> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "UnicodeExpert" { + +// This should eventually be a "Unicode Expert" layout like the Mac one. + + name[Group1] = "Irish (Unicode Expert)"; + + // + // Numeric row `1234567890-= + // + key <TLDE> { [ grave, notsign, 0x10000A6, 0x10000A6 ] }; + // broken bar + key <AE01> { [ 1, exclam, NoSymbol, NoSymbol ] }; + key <AE02> { [ 2, quotedbl, dead_doubleacute, dead_doubleacute ] }; + key <AE03> { [ 3, sterling, NoSymbol, NoSymbol ] }; + key <AE04> { [ 4, dollar, EuroSign, EuroSign ] }; + key <AE05> { [ 5, percent, NoSymbol, NoSymbol ] }; + key <AE06> { [ 6, asciicircum, dead_circumflex, dead_circumflex ] }; + key <AE07> { [ 7, ampersand, 0x100204A, 0x100204A ] }; + // Tironian Et + key <AE08> { [ 8, asterisk, dead_abovering, dead_abovering ] }; + key <AE09> { [ 9, parenleft, dead_breve, dead_breve ] }; + key <AE10> { [ 0, parenright, dead_ogonek, dead_ogonek ] }; + key <AE11> { [ minus, underscore, dead_macron, dead_macron ] }; + key <AE12> { [ equal, plus, NoSymbol, NoSymbol ] }; + + // + // QWERTYUIOP[] + // + key <AD01> { [ q, Q, NoSymbol, NoSymbol ] }; + key <AD02> { [ w, W, NoSymbol, NoSymbol ] }; + key <AD03> { [ e, E, eacute, Eacute ] }; + key <AD04> { [ r, R, 0x100027C, 0x100027C ] }; + // long r + key <AD05> { [ t, T, NoSymbol, NoSymbol ] }; + key <AD06> { [ y, Y, NoSymbol, NoSymbol ] }; + key <AD07> { [ u, U, uacute, Uacute ] }; + key <AD08> { [ i, I, iacute, Iacute ] }; + key <AD09> { [ o, O, oacute, Oacute ] }; + key <AD10> { [ p, P, NoSymbol, NoSymbol ] }; + key <AD11> { [ bracketleft, braceleft, dead_hook, dead_hook ] }; + key <AD12> { [ bracketright, braceright, dead_horn, dead_horn ] }; + + // + // ASDFGHJKL;'# + // + key <AC01> { [ a, A, aacute, Aacute ] }; + key <AC02> { [ s, S, NoSymbol, NoSymbol ] }; + key <AC03> { [ d, D, NoSymbol, NoSymbol ] }; + key <AC04> { [ f, F, NoSymbol, NoSymbol ] }; + key <AC05> { [ g, G, NoSymbol, NoSymbol ] }; + key <AC06> { [ h, H, dead_abovedot, dead_abovedot ] }; + key <AC07> { [ j, J, NoSymbol, NoSymbol ] }; + key <AC08> { [ k, K, NoSymbol, NoSymbol ] }; + key <AC09> { [ l, L, NoSymbol, NoSymbol ] }; + key <AC10> { [ semicolon, colon, dead_diaeresis, dead_diaeresis ] }; + key <AC11> { [ apostrophe, at, dead_acute, dead_acute ] }; + key <BKSL> { [ numbersign, asciitilde, dead_tilde, dead_tilde ] }; + + // + // \ZXCVBNM,./ + // + key <LSGT> { [ backslash, bar, dead_grave, dead_grave ] }; + key <AB01> { [ z, Z, 0x100017F, 0x1001E9B ] }; + // long s, long s dot + key <AB02> { [ x, X, NoSymbol, NoSymbol ] }; + key <AB03> { [ c, C, NoSymbol, NoSymbol ] }; + key <AB04> { [ v, V, dead_caron, dead_caron ] }; + key <AB05> { [ b, B, NoSymbol, NoSymbol ] }; + key <AB06> { [ n, N, NoSymbol, NoSymbol ] }; + key <AB07> { [ m, M, NoSymbol, NoSymbol ] }; + key <AB08> { [ comma, less, dead_cedilla, dead_cedilla ] }; + key <AB09> { [ period, greater, dead_abovedot, dead_abovedot ] }; + key <AB10> { [ slash, question, dead_belowdot, dead_belowdot ] }; + + key <SPCE> { [ space, space, space, nobreakspace ] }; + + include "level3(ralt_switch)" + + key <RWIN> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; diff --git a/symbols/il b/symbols/il new file mode 100644 index 00000000..0a3386b5 --- /dev/null +++ b/symbols/il @@ -0,0 +1,154 @@ + +// based on a keyboard map from an 'xkb/symbols/il' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/il,v 1.3 2003/01/07 02:03:44 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // uses the kbd layout in use in Israel. + + name[Group1]= "Israelian"; + + key <TLDE> { [ semicolon, asciitilde ] }; + + key <AD01> { [ slash, Q ] }; + key <AD02> { [ apostrophe, W ] }; + key <AD03> { [ hebrew_qoph, E ] }; + key <AD04> { [ hebrew_resh, R ] }; + key <AD05> { [ hebrew_aleph,T ] }; + key <AD06> { [ hebrew_tet, Y ] }; + key <AD07> { [ hebrew_waw, U ] }; + key <AD08> { [ hebrew_finalnun, I ] }; + key <AD09> { [ hebrew_finalmem, O ] }; + key <AD10> { [ hebrew_pe, P ] }; + + key <AC01> { [ hebrew_shin, A ] }; + key <AC02> { [ hebrew_dalet,S ] }; + key <AC03> { [ hebrew_gimel,D ] }; + key <AC04> { [ hebrew_kaph, F ] }; + key <AC05> { [ hebrew_ayin, G ] }; + key <AC06> { [ hebrew_yod, H ] }; + key <AC07> { [ hebrew_chet, J ] }; + key <AC08> { [ hebrew_lamed, K ] }; + key <AC09> { [ hebrew_finalkaph, L ] }; + key <AC10> { [ hebrew_finalpe, colon ] }; + key <AC11> { [ comma, quotedbl ] }; + + key <AB01> { [ hebrew_zain, Z ] }; + key <AB02> { [ hebrew_samech, X ] }; + key <AB03> { [ hebrew_bet, C ] }; + key <AB04> { [ hebrew_he, V ] }; + key <AB05> { [ hebrew_nun, B ] }; + key <AB06> { [ hebrew_mem, N ] }; + key <AB07> { [ hebrew_zade, M ] }; + // Mirrored: + key <AB08> { [ hebrew_taw, greater ] }; + key <AB09> { [ hebrew_finalzade, less ] }; + key <AB10> { [ period, question ] }; + + // Note the parens mirroring below: + key <AD11> { [ bracketright, braceright ] }; + key <AD12> { [ bracketleft, braceleft ] }; + key <AE09> { [ 9 , parenright ] }; + key <AE10> { [ 0 , parenleft ] }; + key <BKSL> { [ backslash, bar ] }; +}; + + +// nikud patter based on Dekel Tsur's Hebrew mapping for LyX +partial alphanumeric_keys +xkb_symbols "lyx" { + name[Group1]= "Israelian"; + + key <TLDE> { [ semicolon, asciitilde ] }; + // On some key (e.g. AD01, right below) there is not yet mapping for the + // second shift level. Since I could not figure a simple way to map this + // to "emit nothing", it is currently mapped to the same letter of the + // first shift level (avoiding mapping may risk it be used by a character + // from a different group). + key <AD01> { [ slash, slash ] }; + key <AD02> { [ apostrophe, apostrophe ] }; + key <AD03> { [ hebrew_qoph, 0x10005b8 ] }; // Qamats + key <AD04> { [ hebrew_resh, 0x10005bc ] }; // Dagesh/Shuruq + key <AD05> { [ hebrew_aleph, 0x100200e ] }; // LRM + key <AD06> { [ hebrew_tet, 0x100200f ] }; // RLM + key <AD07> { [ hebrew_waw, 0x10005b9 ] }; // Holam + key <AD08> { [ hebrew_finalnun,hebrew_finalnun] }; + key <AD09> { [ hebrew_finalmem,hebrew_finalmem] }; + key <AD10> { [ hebrew_pe, 0x10005b7 ] }; // Patah + + key <AC01> { [ hebrew_shin, 0x10005b0 ] }; // Sheva + key <AC02> { [ hebrew_dalet, 0x10005bc ] }; // Dagesh/Shuruq + key <AC03> { [ hebrew_gimel, hebrew_gimel ] }; + key <AC04> { [ hebrew_kaph, hebrew_kaph ] }; + key <AC05> { [ hebrew_ayin, 0x10005c2 ] }; // Sin dot + key <AC06> { [ hebrew_yod, 0x10005c1 ] }; // Shin dot + key <AC07> { [ hebrew_chet, 0x10005b4 ] }; // Hiriq + key <AC08> { [ hebrew_lamed, 0x10020aa ] }; // NIS + key <AC09> { [ hebrew_finalkaph,hebrew_finalkaph] }; + key <AC10> { [ hebrew_finalpe, colon ] }; + key <AC11> { [ comma, quotedbl ] }; + + key <AB01> { [ hebrew_zain, hebrew_zain ] }; + key <AB02> { [ hebrew_samech,0x10005b6 ] }; // Segol + key <AB03> { [ hebrew_bet, 0x10005bb ] }; // Qubuts + key <AB04> { [ hebrew_he, 0x10005b1 ] }; // H. Segol + key <AB05> { [ hebrew_nun, 0x10005b2 ] }; // H. Patah + key <AB06> { [ hebrew_mem, 0x10005b3 ] }; // H. Qamats + key <AB07> { [ hebrew_zade, 0x10005b5 ] }; // Tsere + key <AB08> { [ hebrew_taw, greater ] }; + key <AB09> { [ hebrew_finalzade, less ] }; + key <AB10> { [ period, question ] }; + + // Note the parens mirroring below: + key <AD11> { [ bracketright, braceright ] }; + key <AD12> { [ bracketleft, braceleft ] }; + key <AE09> { [ 9 , parenright ] }; + key <AE10> { [ 0 , parenleft ] }; + + key <AE11> { [ minus, 0x10005be ] }; // H. Hiphen +}; + + + +// This is a partial implemetation of the Israeli standard SI-1452 +// It does not implement changes to the English layout ("Alt-English"), +// as I believe that it is not the job of this layout to modify the English +// layout. +partial alphanumeric_keys +xkb_symbols "si1452" { + name[Group1]= "Israelian"; + + include "pc/il(basic)" + + key.type = "THREE_LEVEL"; + + key <TLDE> { [ semicolon, asciitilde,0x10005b0 ]}; // Sheva + key <AB10> { [ period, question, 0x10005c3 ]}; // Sof Pasuq + + // The following may get overriden by the iso9995-3(basic101) symbols. + // therefore they are included here. + // Including them isn't a great idea (for instance: what if group 1 uses + // UK keyboard mapping, and maps shift-3 to sterling? This mapping won't + // preserve that, and I'm not sure that this is a good feature. + key <AE01> { [ 1, exclam , 0x10005b1 ]}; // H. Segol + key <AE02> { [ 2, at , 0x10005b2 ]}; // H. Patah + key <AE03> { [ 3, numbersign , 0x10005b3 ]}; // H. Qamats + key <AE04> { [ 4, dollar , 0x10005b4 ]}; // Hiriq + key <AE05> { [ 5, percent , 0x10005b5 ]}; // Tsere + key <AE06> { [ 6, asciicircum , 0x10005b6 ]}; // Segol + key <AE07> { [ 7, ampersand , 0x10005b7 ]}; // Patah + key <AE08> { [ 8, asterisk , 0x10005b8 ]}; // Qamats + // Mirrored!: + key <AE09> { [ 9, parenright , 0x10005c2 ]}; // Sin dot + key <AE10> { [ 0, parenleft , 0x10005c1 ]}; // Shin dot + key <AE11> { [ minus, underscore , 0x10005b9 ]}; // Holam + key <AE12> { [ equal, plus , 0x10005bc ]}; // Dagesh/Shuruq + + // Mirrored!: + key <AD11> { [ bracketright, braceright, 0x10005bf ]}; // Rafe + key <AD12> { [ bracketleft, braceleft, 0x10005bd ]}; // Meteg + + key <BKSL> { [ backslash, backslash, 0x10005bb ]}; // Qubuts +}; diff --git a/symbols/il_phonetic b/symbols/il_phonetic new file mode 100644 index 00000000..b16c9354 --- /dev/null +++ b/symbols/il_phonetic @@ -0,0 +1,46 @@ + +// based on a keyboard map from an 'xkb/symbols/il_phonetic' file +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // uses the phonetic layout from old Slackware 'il.map' file + + name[Group1]= "Israelian(phonetic)"; + + key <AE12> { [ equal, plus ], + [ hebrew_doublelowline, hebrew_doublelowline ]}; + + key <LatQ> { [ hebrew_qoph, hebrew_qoph ] }; + key <LatW> { [ hebrew_waw, hebrew_waw ] }; + key <LatE> { [ hebrew_aleph, hebrew_aleph ] }; + key <LatR> { [ hebrew_resh, hebrew_resh ] }; + key <LatT> { [ hebrew_taw, hebrew_tet ] }; + key <LatY> { [ hebrew_ayin, hebrew_ayin ] }; + key <LatU> { [ hebrew_waw, hebrew_waw ] }; + key <LatI> { [ hebrew_yod, hebrew_yod ] }; + key <LatO> { [ hebrew_samech, hebrew_samech ] }; + key <LatP> { [ hebrew_pe, hebrew_finalpe ] }; + + key <LatA> { [ hebrew_aleph, hebrew_aleph ] }; + key <LatS> { [ hebrew_shin, hebrew_shin ] }; + key <LatD> { [ hebrew_dalet, hebrew_dalet ] }; + key <LatF> { [ hebrew_pe, hebrew_finalpe ] }; + key <LatG> { [ hebrew_gimel, hebrew_gimel ] }; + key <LatH> { [ hebrew_he, hebrew_he ] }; + key <LatJ> { [ hebrew_yod, hebrew_yod ] }; + key <LatK> { [ hebrew_kaph, hebrew_finalkaph ] }; + key <LatL> { [ hebrew_lamed, hebrew_lamed ] }; + + key <LatZ> { [ hebrew_zain, hebrew_zain ] }; + key <LatX> { [ hebrew_chet, hebrew_chet ] }; + key <LatC> { [ hebrew_zade, hebrew_finalzade ] }; + key <LatV> { [ hebrew_waw, hebrew_waw ] }; + key <LatB> { [ hebrew_bet, hebrew_bet ] }; + key <LatN> { [ hebrew_nun, hebrew_finalnun ] }; + key <LatM> { [ hebrew_mem, hebrew_finalmem ] }; +}; + + diff --git a/symbols/ir b/symbols/ir new file mode 100644 index 00000000..b92a9c95 --- /dev/null +++ b/symbols/ir @@ -0,0 +1,69 @@ + +// based on +// Iranian keymap, by Robert Brady <robert@suse.co.uk> +// Data supplied by Roozbeh Pournader <roozbeh@sharif.edu> +// Minor changes made by Arash Zeini <a.zeini@farsikde.com>, +// and Roozbeh Pournader. +// Last update: 2002-06-19 +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Iranian"; + + key <TLDE> { [ 0x100200d ] }; + + // Mainly numbers. + key <AE01> { [ 0x10006f1, exclam ] }; + key <AE02> { [ 0x10006f2, 0x100066c ] }; + key <AE03> { [ 0x10006f3, 0x100066b ] }; + key <AE04> { [ 0x10006f4, 0x100fdfc ] }; + key <AE05> { [ 0x10006f5, 0x100066a ] }; + key <AE06> { [ 0x10006f6, multiply ] }; + key <AE07> { [ 0x10006f7, Arabic_comma ] }; + key <AE08> { [ 0x10006f8, asterisk ] }; + key <AE09> { [ 0x10006f9, parenright ] }; + key <AE10> { [ 0x10006f0, parenleft ] }; + key <AE11> { [ minus, Arabic_tatweel ] }; + key <AE12> { [ equal, plus ] }; + + key <AD01> { [ Arabic_dad, Arabic_sukun ] }; + key <AD02> { [ Arabic_sad, Arabic_dammatan ] }; + key <AD03> { [ Arabic_theh, Arabic_kasratan ] }; + key <AD04> { [ Arabic_qaf, Arabic_fathatan ] }; + key <AD05> { [ Arabic_feh, Arabic_damma ] }; + key <AD06> { [ Arabic_ghain, Arabic_kasra ] }; + key <AD07> { [ Arabic_ain, Arabic_fatha ] }; + key <AD08> { [ Arabic_heh, Arabic_shadda ] }; + key <AD09> { [ Arabic_khah, bracketright ] }; + key <AD10> { [ Arabic_hah, bracketleft ] }; + key <AD11> { [ Arabic_jeem, braceright ] }; + key <AD12> { [ 0x1000686, braceleft ] }; + + key <AC01> { [ Arabic_sheen, Arabic_hamzaonwaw ] }; + key <AC02> { [ Arabic_seen, Arabic_hamzaonyeh ] }; + key <AC03> { [ 0x10006cc, Arabic_yeh ] }; + key <AC04> { [ Arabic_beh, Arabic_hamzaunderalef] }; + key <AC05> { [ Arabic_lam, Arabic_hamzaonalef ] }; + key <AC06> { [ Arabic_alef, Arabic_maddaonalef ] }; + key <AC07> { [ Arabic_teh, Arabic_tehmarbuta ] }; + key <AC08> { [ Arabic_noon, guillemotright ] }; + key <AC09> { [ Arabic_meem, guillemotleft ] }; + key <AC10> { [ 0x10006a9, colon ] }; + key <AC11> { [ 0x10006af, Arabic_semicolon ] }; + + key <BKSL> { [ backslash, bar ] }; + key <SPCE> { [ space, 0x100200c ] }; + + key <AB01> { [ Arabic_zah, Arabic_kaf ] }; + key <AB02> { [ Arabic_tah ] }; + key <AB03> { [ Arabic_zain, 0x1000698 ] }; + key <AB04> { [ Arabic_ra ] }; + key <AB05> { [ Arabic_thal, 0x100200c ] }; + key <AB06> { [ Arabic_dal ] }; + key <AB07> { [ 0x100067e, Arabic_hamza ] }; + key <AB08> { [ Arabic_waw, greater ] }; + key <AB09> { [ period, less ] }; + key <AB10> { [ slash, Arabic_question_mark ] }; +}; diff --git a/symbols/is b/symbols/is new file mode 100644 index 00000000..a04ad183 --- /dev/null +++ b/symbols/is @@ -0,0 +1,64 @@ + +// based on +// XKB keyboard by Hrafnkell Eiriksson - hkelle@rhi.hi.is +// fixes by Olafur Osvaldsson - oli@isnic.is +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/is,v 1.3 2002/11/26 01:57:25 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Icelandic"; + + key <AE02> { [ 2, quotedbl, twosuperior, oneeighth ] }; + key <AE04> { [ 4, dollar, onequarter, currency ] }; + key <AE11> { [odiaeresis, Odiaeresis, backslash, questiondown ] }; + key <AE12> { [ minus, underscore, ccedilla, dead_ogonek ] }; + + key <AD11> { [ eth, ETH, dead_diaeresis, dead_abovering ] }; + key <AD12> { [apostrophe, question, asciitilde, dead_macron ] }; + + key <AC10> { [ ae, AE, asciicircum, dead_doubleacute ] }; + key <AC11> { [dead_acute, Adiaeresis, dead_circumflex, dead_caron] }; + key <TLDE> { [ degree, diaeresis, notsign, notsign ] }; + + key <BKSL> { [ plus, asterisk, grave, dead_breve ] }; + key <AB10> { [ thorn, THORN, dead_belowdot, dead_abovedot ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // modify the default Icelandic layout to use Sun dead keys + + include "pc/is(basic)" + + key <TLDE> { [SunFA_Circum, degree, notsign, notsign ] }; + key <AE12> { [SunFA_Acute, SunFA_Grave, SunFA_Cedilla, SunFA_Cedilla ] }; + key <AD11> { [udiaeresis, Udiaeresis, SunFA_Diaeresis, SunFA_Diaeresis ] }; + key <AD12> { [ plus, asterisk, SunFA_Tilde, dead_macron ] }; + key <AC10> { [odiaeresis, Odiaeresis, SunFA_Acute, SunFA_Acute ] }; + key <AC11> { [adiaeresis, Adiaeresis, SunFA_Circum, SunFA_Circum ] }; + key <BKSL> { [numbersign, acute, SunFA_Grave, SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // modify the default Icelandic layout to not have any dead keys + + include "pc/is(basic)" + + key <TLDE> { [asciicircum, degree, notsign, notsign ] }; + key <AE12> { [apostrophe, grave, cedilla, cedilla ] }; + key <AD11> { [udiaeresis, Udiaeresis, diaeresis, diaeresis ] }; + key <AD12> { [ plus, asterisk, asciitilde, macron ] }; + key <AC10> { [odiaeresis, Odiaeresis, acute, acute ] }; + key <AC11> { [adiaeresis, Adiaeresis, asciicircum, asciicircum ] }; + key <BKSL> { [numbersign, acute, grave, grave ] }; + key <AB10> { [ thorn, THORN, dead_belowdot, abovedot ] }; +}; diff --git a/symbols/it b/symbols/it new file mode 100644 index 00000000..e09ecca2 --- /dev/null +++ b/symbols/it @@ -0,0 +1,63 @@ + +// based on a keyboard map from an 'xkb/symbols/it' file +// 17 May 2003 Modified by Sebastiano Vigna (vigna@dsi.unimi.it) +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/it,v 1.4 2003/04/19 12:22:12 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Italian"; + + key <TLDE> { [ backslash, bar, notsign, brokenbar ] }; + + key <AE02> { [ 2, quotedbl, twosuperior, dead_doubleacute ] }; + key <AE03> { [ 3, sterling,threesuperior, dead_tilde ] }; + key <AE04> { [ 4, dollar, onequarter, oneeighth ] }; + + key <AE10> { [ 0, equal, braceright, dead_ogonek ] }; + key <AE11> { [apostrophe, question, grave, questiondown ] }; + key <AE12> { [ igrave, asciicircum, asciitilde, dead_circumflex ] }; + + key <AD11> { [ egrave, eacute, bracketleft, braceleft ] }; + key <AD12> { [ plus, asterisk, bracketright, braceright ] }; + + key <AC10> { [ ograve, ccedilla, at, dead_cedilla ] }; + key <AC11> { [ agrave, degree, numbersign, dead_abovering ] }; + + key <AB06> { [ n, N, ntilde, Ntilde ] }; + key <AB08> { [ comma, semicolon, dead_acute, multiply ] }; + key <AB09> { [ period, colon,periodcentered, dead_diaeresis ] }; + key <AB10> { [ minus, underscore, dead_macron, division ] }; + + key <BKSL> { [ ugrave, section, dead_grave, dead_breve ] }; + + key <LSGT> { [ less, greater,guillemotleft,guillemotright] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic italian layout to eliminate all dead keys + + include "pc/it(basic)" + + key <AE02> { [ 2, quotedbl, twosuperior, doubleacute ] }; + key <AE03> { [ 3, sterling,threesuperior, asciitilde ] }; + + key <AE10> { [ 0, equal, braceright, ogonek ] }; + key <AE12> { [ igrave, asciicircum, asciitilde, asciicircum ] }; + + key <AC10> { [ ograve, ccedilla, at, cedilla ] }; + key <AC11> { [ agrave, degree, numbersign, degree ] }; + + key <AB08> { [ comma, semicolon, acute, multiply ] }; + key <AB09> { [ period, colon,periodcentered, diaeresis ] }; + key <AB10> { [ minus, underscore, macron, division ] }; + + key <BKSL> { [ ugrave, section, grave, breve ] }; +}; diff --git a/symbols/iu b/symbols/iu new file mode 100644 index 00000000..c7e3ba39 --- /dev/null +++ b/symbols/iu @@ -0,0 +1,67 @@ + +// based on +// Inuktitut keyboard for X11 +// written by Pablo Saratxaga <pablo@mandrakesoft.com> +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Inuktitut"; + + key <AE01> { [ 0x01001595, 1 ] }; + key <AE02> { [ 0x01001449, 2 ] }; + key <AE03> { [ 0x01001550, 3 ] }; + key <AE04> { [ 0x01001483, 4 ] }; + key <AE05> { [ 0x01001466, 5 ] }; + key <AE06> { [ 0x01001585, 6 ] }; + key <AE07> { [ 0x010014bb, 7 ] }; + key <AE08> { [ 0x010014d0, 8 ] }; + key <AE09> { [ 0x010014ea, 9 ] }; + key <AE10> { [ 0x0100153e, 0 ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ 0x0100155d, equal ] }; + + key <AD01> { [ 0x0100158f, 0x0100148b ] }; + key <AD02> { [ 0x01001403, 0x01001431 ] }; + key <AD03> { [ 0x0100157f, 0x01001546 ] }; + key <AD04> { [ 0x0100146d, 0x01001596 ] }; + key <AD05> { [ 0x0100144e, 0x01001671 ] }; + key <AD06> { [ 0x010014ef, 0x01001673 ] }; + key <AD07> { [ 0x010014a5, 0x01001675 ] }; + key <AD08> { [ 0x010014c2, 0x010015a4 ] }; + key <AD09> { [ 0x010014d5, 0x010015a0 ] }; + key <AD10> { [ 0x01001528, 0x010015a6 ] }; + key <AD11> { [ 0x010014a1, 0x01001505 ] }; + key <AD12> { [ dead_abovedot, 0x0100141e] }; + + key <AC01> { [ 0x01001591, 0x0100148d ] }; + key <AC02> { [ 0x01001405, 0x01001433 ] }; + key <AC03> { [ 0x01001581, 0x01001548 ] }; + key <AC04> { [ 0x0100146f, 0x01001555 ] }; + key <AC05> { [ 0x01001450, parenleft ] }; + key <AC06> { [ 0x010014f1, parenright ] }; + key <AC07> { [ 0x010014a7, 0x0100152a ] }; + key <AC08> { [ 0x010014c4, 0x01001557 ] }; + key <AC09> { [ 0x010014d7, 0x010015a2 ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ apostrophe, quotedbl ] }; + + key <AB01> { [ 0x01001593, 0x01001490 ] }; + key <AB02> { [ 0x0100140a, 0x01001438 ] }; + key <AB03> { [ 0x01001583, 0x0100154b ] }; + key <AB04> { [ 0x01001472, question ] }; + key <AB05> { [ 0x01001455, 0x0100157c ] }; + key <AB06> { [ 0x010014f4, 0x010014c7 ] }; + key <AB07> { [ 0x010014aa, 0x010014da ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ 0x0100152d, 0x01001559 ] }; + + key <TLDE> { [ 0x0100157b, 0x01001575 ] }; + key <LSGT> { [ 0x01001579, 0x01001577 ] }; + key <BKSL> { [ backslash, bar ] }; + +// End alphanumeric section +}; diff --git a/symbols/kan b/symbols/kan new file mode 100644 index 00000000..43944c96 --- /dev/null +++ b/symbols/kan @@ -0,0 +1,69 @@ +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Inscript layout for Kannada + // Author : G Karunakar <karunakar@freedomink.org> + // Date : Wed Nov 13 17:22:58 IST 2002 + // Kannada digits mapped in basic only + + name[Group1]= "Kannada"; + + key <TLDE> { [ 0x01000cca, 0x01000c92 ] }; + key <AE01> { [ 0x01000ce7, 0x01000c8d ] }; + key <AE02> { [ 0x01000ce8, 0x01000cc5 ] }; + key <AE03> { [ 0x01000ce9 ] }; + key <AE04> { [ 0x01000cea ] }; + key <AE05> { [ 0x01000ceb ] }; + key <AE06> { [ 0x01000cec ] }; + key <AE07> { [ 0x01000ced ] }; + key <AE08> { [ 0x01000cee ] }; + key <AE09> { [ 0x01000cef ] }; + key <AE10> { [ 0x01000ce6 ] }; + key <AE11> { [ 0x01000c83 ] }; + key <AE12> { [ 0x01000cc3, 0x01000c8b ] }; + + key <AD01> { [ 0x01000ccc, 0x01000c94 ] }; + key <AD02> { [ 0x01000cc8, 0x01000c90 ] }; + key <AD03> { [ 0x01000cbe, 0x01000c86 ] }; + key <AD04> { [ 0x01000cc0, 0x01000c88 ] }; + key <AD05> { [ 0x01000cc2, 0x01000c8a ] }; + key <AD06> { [ 0x01000cac, 0x01000cad ] }; + key <AD07> { [ 0x01000cb9, 0x01000c99 ] }; + key <AD08> { [ 0x01000c97, 0x01000c98 ] }; + key <AD09> { [ 0x01000ca6, 0x01000ca7 ] }; + key <AD10> { [ 0x01000c9c, 0x01000c9d ] }; + key <AD11> { [ 0x01000ca1, 0x01000ca2 ] }; + key <AD12> { [ 0x01000cbc, 0x01000c9e ] }; + + key <AC01> { [ 0x01000ccb, 0x01000c93 ] }; + key <AC02> { [ 0x01000cc7, 0x01000c8f ] }; + key <AC03> { [ 0x01000ccd, 0x01000c85 ] }; + key <AC04> { [ 0x01000cbf, 0x01000c87 ] }; + key <AC05> { [ 0x01000cc1, 0x01000c89 ] }; + key <AC06> { [ 0x01000caa, 0x01000cab ] }; + key <AC07> { [ 0x01000cb0, 0x01000cb1 ] }; + key <AC08> { [ 0x01000c95, 0x01000c96 ] }; + key <AC09> { [ 0x01000ca4, 0x01000ca5 ] }; + key <AC10> { [ 0x01000c9a, 0x01000c9b ] }; + key <AC11> { [ 0x01000c9f, 0x01000ca0 ] }; + + key <AB01> { [ 0x01000cc6, 0x01000c8e ] }; + key <AB02> { [ 0x01000c82, 0x01000c81 ] }; + key <AB03> { [ 0x01000cae, 0x01000ca3 ] }; + key <AB04> { [ 0x01000ca8, 0x01000ca9 ] }; + key <AB05> { [ 0x01000cb5, 0x01000cb4 ] }; + key <AB06> { [ 0x01000cb2, 0x01000cb3 ] }; + key <AB07> { [ 0x01000cb8, 0x01000cb6 ] }; + key <AB08> { [ comma , 0x01000cb7 ] }; + key <AB09> { [ period , 0x01000ce4 ] }; + key <AB10> { [ 0x01000caf, 0x01000040 ] }; + key <BKSL> { [ 0x01000cc9, 0x01000c91 ] }; + + key <RALT> { + symbols[Group1] = [ Mode_switch , Multi_key ], + virtualMods = AltGr + }; + +}; diff --git a/symbols/la b/symbols/la new file mode 100644 index 00000000..81dc2e6b --- /dev/null +++ b/symbols/la @@ -0,0 +1,60 @@ + +// based on a keyboard +// Modified for a real Latin American Keyboard by Fabian Mandelbaum +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/la,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Latin American"; + + key <AE01> { [ 1, exclam, bar, exclamdown ] }; + key <AE03> { [ 3, numbersign, periodcentered, sterling ] }; + key <AE04> { [ 4, dollar, asciitilde, dollar ] }; + key <AE06> { [ 6, ampersand, notsign, fiveeighths ] }; + key <AE11> { [apostrophe, question, backslash, questiondown ] }; + key <AE12> { [questiondown, exclamdown, dead_cedilla, dead_ogonek] }; + + key <AD11> { [dead_acute, dead_diaeresis, dead_diaeresis, dead_abovering ] }; + key <AD12> { [ plus, asterisk, asciitilde, dead_macron ] }; + + key <AC10> { [ ntilde, Ntilde, asciitilde, dead_doubleacute ] }; + key <AC11> { [ braceleft, bracketleft, dead_circumflex, braceleft] }; + key <TLDE> { [ bar, degree, notsign, notsign ] }; + + key <BKSL> { [braceright, bracketright, dead_grave, braceright ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "pc/la(basic)" + + key <AC11> { [SunFA_Acute, SunFA_Diaeresis, braceleft, braceleft ] }; + key <AD11> { [SunFA_Grave, SunFA_Circum, bracketleft, dead_abovering ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "pc/la(Sundeadkeys)" + +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/la(basic)" + + key <AE12> { [questiondown, exclamdown, cedilla, ogonek ] }; + key <AD11> { [ grave, asciicircum, bracketleft, degree ] }; + key <AD12> { [ plus, asterisk, bracketright, macron ] }; + key <AC10> { [ ntilde, Ntilde, asciitilde, doubleacute ] }; + key <AC11> { [ acute, diaeresis, braceleft, braceleft ] }; + key <BKSL> { [ ccedilla, Ccedilla, braceright, breve ] }; + key <AB10> { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + diff --git a/symbols/latin b/symbols/latin new file mode 100644 index 00000000..0f979002 --- /dev/null +++ b/symbols/latin @@ -0,0 +1,179 @@ + +// Common Latin alphabet layout +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/latin,v 1.3 2002/12/20 20:18:34 paulo Exp $ + +default partial +xkb_symbols "basic" { + + key <AE01> { [ 1, exclam, onesuperior, exclamdown ] }; + key <AE02> { [ 2, at, twosuperior, oneeighth ] }; + key <AE03> { [ 3, numbersign, threesuperior, sterling ] }; + key <AE04> { [ 4, dollar, onequarter, dollar ] }; + key <AE05> { [ 5, percent, onehalf, threeeighths ] }; + key <AE06> { [ 6, asciicircum, threequarters, fiveeighths ] }; + key <AE07> { [ 7, ampersand, braceleft, seveneighths ] }; + key <AE08> { [ 8, asterisk, bracketleft, trademark ] }; + key <AE09> { [ 9, parenleft, bracketright, plusminus ] }; + key <AE10> { [ 0, parenright, braceright, degree ] }; + key <AE11> { [ minus, underscore, backslash, questiondown ] }; + key <AE12> { [ equal, plus, dead_cedilla, dead_ogonek ] }; + + key <AD01> { [ q, Q, at, Greek_OMEGA ] }; + key <AD02> { [ w, W, lstroke, Lstroke ] }; + key <AD03> { [ e, E ] }; + key <AD04> { [ r, R, paragraph, registered ] }; + key <AD05> { [ t, T, tslash, Tslash ] }; + key <AD06> { [ y, Y, leftarrow, yen ] }; + key <AD07> { [ u, U, downarrow, uparrow ] }; + key <AD08> { [ i, I, rightarrow, idotless ] }; + key <AD09> { [ o, O, oslash, Ooblique ] }; + key <AD10> { [ p, P, thorn, THORN ] }; + key <AD11> { [bracketleft, braceleft, dead_diaeresis, dead_abovering ] }; + key <AD12> { [bracketright, braceright, dead_tilde, dead_macron ] }; + + key <AC01> { [ a, A, ae, AE ] }; + key <AC02> { [ s, S, ssharp, section ] }; + key <AC03> { [ d, D, eth, ETH ] }; + key <AC04> { [ f, F, dstroke, ordfeminine ] }; + key <AC05> { [ g, G, eng, ENG ] }; + key <AC06> { [ h, H, hstroke, Hstroke ] }; + key <AC07> { [ j, J ] }; + key <AC08> { [ k, K, kra, ampersand ] }; + key <AC09> { [ l, L, lstroke, Lstroke ] }; + key <AC10> { [ semicolon, colon, dead_acute, dead_doubleacute ] }; + key <AC11> { [apostrophe, quotedbl, dead_circumflex, dead_caron ] }; + key <TLDE> { [ grave, asciitilde, notsign, notsign ] }; + + key <BKSL> { [ backslash, bar, dead_grave, dead_breve ] }; + key <AB01> { [ z, Z, guillemotleft, less ] }; + key <AB02> { [ x, X, guillemotright, greater ] }; + key <AB03> { [ c, C, cent, copyright ] }; + key <AB04> { [ v, V, leftdoublequotemark, grave ] }; + key <AB05> { [ b, B, rightdoublequotemark, apostrophe ] }; + key <AB06> { [ n, N ] }; + key <AB07> { [ m, M, mu, masculine ] }; + key <AB08> { [ comma, less, horizconnector, multiply ] }; + key <AB09> { [ period, greater, periodcentered, division ] }; + key <AB10> { [ slash, question, dead_belowdot, dead_abovedot ] }; + +}; + +// Northern Europe ( Danish, Finnish, Norwegian, Swedish) common layout + +partial +xkb_symbols "type2" { + + include "pc/latin" + + key <AE01> { [ 1, exclam, exclamdown, onesuperior ] }; + key <AE02> { [ 2, quotedbl, at, twosuperior ] }; + key <AE03> { [ 3, numbersign, sterling, threesuperior] }; + key <AE04> { [ 4, currency, dollar, onequarter ] }; + key <AE05> { [ 5, percent, onehalf, cent ] }; + key <AE06> { [ 6, ampersand, yen, fiveeighths ] }; + key <AE07> { [ 7, slash, braceleft, division ] }; + key <AE08> { [ 8, parenleft, bracketleft, guillemotleft] }; + key <AE09> { [ 9, parenright, bracketright, guillemotright] }; + key <AE10> { [ 0, equal, braceright, degree ] }; + + key <AD03> { [ e, E, EuroSign, cent ] }; + key <AD04> { [ r, R, registered, registered ] }; + key <AD05> { [ t, T, thorn, THORN ] }; + key <AD09> { [ o, O, oe, OE ] }; + key <AD11> { [ aring, Aring, dead_diaeresis, dead_abovering ] }; + key <AD12> { [dead_diaeresis, dead_circumflex, dead_tilde, dead_caron ] }; + + key <AC01> { [ a, A, ordfeminine, masculine ] }; + + key <AB03> { [ c, C, copyright, copyright ] }; + key <AB08> { [ comma, semicolon, dead_cedilla, dead_ogonek ] }; + key <AB09> { [ period, colon, periodcentered, dead_abovedot ] }; + key <AB10> { [ minus, underscore, dead_belowdot, dead_abovedot ] }; +}; + +// Slavic Latin ( Albanian, Croatian, Polish, Slovene, Yugoslav) +// common layout + +partial +xkb_symbols "type3" { + + include "pc/latin" + + key <AD01> { [ q, Q, backslash, Greek_OMEGA ] }; + key <AD02> { [ w, W, bar, Lstroke ] }; + key <AD06> { [ z, Z, leftarrow, yen ] }; + + key <AC04> { [ f, F, bracketleft, ordfeminine ] }; + key <AC05> { [ g, G, bracketright, ENG ] }; + key <AC08> { [ k, K, lstroke, ampersand ] }; + + key <AB01> { [ y, Y, guillemotleft, less ] }; + key <AB04> { [ v, V, at, grave ] }; + key <AB05> { [ b, B, braceleft, apostrophe ] }; + key <AB06> { [ n, N, braceright, braceright ] }; + key <AB07> { [ m, M, section, masculine ] }; + key <AB08> { [ comma, semicolon, less, multiply ] }; + key <AB09> { [ period, colon, greater, division ] }; +}; + +// Another one Latin common layout +// (German, Estonian, Spanish, Icelandic, Italian, Latin American, Portuguese) + +partial +xkb_symbols "type4" { + + include "pc/latin" + + key <AE02> { [ 2, quotedbl, at, oneeighth ] }; + key <AE06> { [ 6, ampersand, notsign, fiveeighths ] }; + key <AE07> { [ 7, slash, braceleft, seveneighths ] }; + key <AE08> { [ 8, parenleft, bracketleft, trademark ] }; + key <AE09> { [ 9, parenright, bracketright, plusminus ] }; + key <AE10> { [ 0, equal, braceright, degree ] }; + + key <AD03> { [ e, E, EuroSign, cent ] }; + + key <AB08> { [ comma, semicolon, horizconnector, multiply ] }; + key <AB09> { [ period, colon, periodcentered, division ] }; + key <AB10> { [ minus, underscore, dead_belowdot, dead_abovedot ] }; +}; + +partial +xkb_symbols "nodeadkeys" { + + key <AE12> { [ equal, plus, cedilla, ogonek ] }; + key <AD11> { [bracketleft, braceleft, diaeresis, degree ] }; + key <AD12> { [bracketright, braceright, asciitilde, macron ] }; + key <AC10> { [ semicolon, colon, acute, doubleacute ] }; + key <AC11> { [apostrophe, quotedbl, asciicircum, caron ] }; + key <BKSL> { [ backslash, bar, grave, breve ] }; + key <AB10> { [ slash, question, dead_belowdot, abovedot ] }; +}; + +partial +xkb_symbols "type2_nodeadkeys" { + + include "pc/latin(nodeadkeys)" + + key <AD11> { [ aring, Aring, diaeresis, degree ] }; + key <AD12> { [ diaeresis, asciicircum, asciitilde, caron ] }; + key <AB08> { [ comma, semicolon, cedilla, ogonek ] }; + key <AB09> { [ period, colon, periodcentered, abovedot ] }; + key <AB10> { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + +partial +xkb_symbols "type3_nodeadkeys" { + + include "pc/latin(nodeadkeys)" +}; + +partial +xkb_symbols "type4_nodeadkeys" { + + include "pc/latin(nodeadkeys)" + + key <AB10> { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + diff --git a/symbols/lo b/symbols/lo new file mode 100644 index 00000000..ad1fb1e0 --- /dev/null +++ b/symbols/lo @@ -0,0 +1,80 @@ +// $XConsortium: lo 2002/11/28 $ +// +// $XFree86$ +// +// Lao keymap, by Anousak Souphavanh <anousak@muanglao.com> +// +// +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a Lao keyboard + // This keymap uses the Lao keyboard standard [kind of] widely used inLaos + + name[Group1]= "Lao"; + + // Alphanumeric section + key <TLDE> { [ 0x100200D ]}; + key <AE01> { [ 0x1000ea2, 0x1000ed1 ]}; + key <AE01> { [ 0x1000ea2, 0x1000ed1 ]}; + key <AE02> { [ 0x1000e9f, 0x1000ed2 ]}; + key <AE03> { [ 0x1000ec2, 0x1000ed3 ]}; + key <AE04> { [ 0x1000e96, 0x1000ed4 ]}; + key <AE05> { [ 0x1000eb8, 0x1000ecc ]}; + key <AE06> { [ 0x1000eb9, 0x1000ebc ]}; + key <AE07> { [ 0x1000e84, 0x1000ed5 ]}; + key <AE08> { [ 0x1000e95, 0x1000ed6 ]}; + key <AE09> { [ 0x1000e88, 0x1000ed7 ]}; + key <AE10> { [ 0x1000e82, 0x1000ed8 ]}; + key <AE11> { [ 0x1000e8a, 0x1000ed9 ]}; + key <AE12> { [ 0x1000ecd ]}; + + key <AD01> { [ 0x1000ebb ]}; + key <AD02> { [ 0x1000ec4, 0x1000ed0 ]}; + key <AD03> { [ 0x1000eb3 ]}; + key <AD04> { [ 0x1000e9e, underscore ]}; + key <AD05> { [ 0x1000eb0, plus ]}; + key <AD06> { [ 0x1000eb4 ]}; + key <AD07> { [ 0x1000eb5 ]}; + key <AD08> { [ 0x1000ea3, 0x1000eae ]}; + key <AD09> { [ 0x1000e99 ]}; + key <AD10> { [ 0x1000e8d, 0x1000ebd ]}; + key <AD11> { [ 0x1000e9a, minus ]}; + key <AD12> { [ 0x1000ea5, braceright ]}; + key <BKSL> { [ 0x1000edc, 0x1000edd ]}; + + key <AC01> { [ 0x1000eb1 ]}; + key <AC02> { [ 0x1000eab, semicolon ]}; + key <AC03> { [ 0x1000e81, period ]}; + key <AC04> { [ 0x1000e94, comma ]}; + key <AC05> { [ 0x1000ec0, colon ]}; + key <AC06> { [ 0x1000ec9, 0x1000eca ]}; + key <AC07> { [ 0x1000ec8, 0x1000ecb ]}; + key <AC08> { [ 0x1000eb2, exclam ]}; + key <AC09> { [ 0x1000eaa, question ]}; + key <AC10> { [ 0x1000ea7, percent ]}; + key <AC11> { [ 0x1000e87, equal ]}; + + key <AB01> { [ 0x1000e9c, 0x10020ad ]}; + key <AB02> { [ 0x1000e9b, parenleft ]}; + key <AB03> { [ 0x1000ec1, 0x1000eaf ]}; + key <AB04> { [ 0x1000ead ]}; + key <AB05> { [ 0x1000eb6 ]}; + key <AB06> { [ 0x1000eb7 ]}; + key <AB07> { [ 0x1000e97, 0x1000ec6 ]}; + key <AB08> { [ 0x1000ea1, quoteleft ]}; + key <AB09> { [ 0x1000ec3, dollar ]}; + key <AB10> { [ 0x1000e9d, parenright ]}; + +override key <LFSH> { + type="PC_SYSRQ", + [ Shift_L, ISO_First_Group ] + }; +override key <RTSH> { + type="PC_SYSRQ", + [ Shift_R, ISO_Last_Group ] + }; +}; diff --git a/symbols/lt b/symbols/lt new file mode 100644 index 00000000..6c2f1b23 --- /dev/null +++ b/symbols/lt @@ -0,0 +1,111 @@ + +// based on +// Lithuanian keyboard map by Riardas epas <rch@richard.eu.org> +// merged into one file by Nerijus Balinas +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/lt,v 1.3 2002/12/14 22:26:11 dawes Exp $ + +// If you want to have 2 layouts, use +// Option "XkbLayout" "lt,lt(lt_us)" + +// Lithuanian Baltic layout - Lithuanian letters on the numeric row +partial default alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Lithuanian"; + + key <AE01> { [ aogonek, Aogonek ] }; + key <AE02> { [ ccaron, Ccaron ] }; + key <AE03> { [ eogonek, Eogonek ] }; + key <AE04> { [ eabovedot, Eabovedot ] }; + key <AE05> { [ iogonek, Iogonek ] }; + key <AE06> { [ scaron, Scaron ] }; + key <AE07> { [ uogonek, Uogonek ] }; + key <AE08> { [ umacron, Umacron ] }; + key <AE09> { [doublelowquotemark, parenleft ] }; + key <AE10> { [leftdoublequotemark,parenright ] }; + key <AE12> { [ zcaron, Zcaron ] }; + + key <LSGT> { [ endash, EuroSign ] }; + + include "level3(ralt_switch_multikey)" +}; + +// Similar to the above, but you should use Right Alt + numeric row +// for Lithuanian letters +partial default alphanumeric_keys modifier_keys +xkb_symbols "lt_us" { + + include "pc/latin" + + name[Group1]="Lithuanian"; + + key <AE01> { [ 1, exclam, aogonek, Aogonek ] }; + key <AE02> { [ 2, at, ccaron, Ccaron ] }; + key <AE03> { [ 3, numbersign, eogonek, Eogonek ] }; + key <AE04> { [ 4, dollar, eabovedot, Eabovedot ] }; + key <AE05> { [ 5, percent, iogonek, Iogonek ] }; + key <AE06> { [ 6, asciicircum, scaron, Scaron ] }; + key <AE07> { [ 7, ampersand, uogonek, Uogonek ] }; + key <AE08> { [ 8, asterisk, umacron, Umacron ] }; + key <AE09> { [ 9, parenleft, doublelowquotemark, parenleft ] }; + key <AE10> { [ 0, parenright, leftdoublequotemark,parenright ] }; + key <AE12> { [ equal, plus, zcaron, Zcaron ] }; + + key <AD03> { [ e, E, endash, EuroSign ] }; + key <LSGT> { [ endash, EuroSign ] }; + + include "level3(ralt_switch_multikey)" +}; + +// Lithuanian keyboard map by Gediminas Paulauskas <menesis@delfi.lt> +// Minor modification by Riardas epas according to http://sun3.mif.vu.lt/cs/TK4/lithkeyb.html + +// Describes Lithuanian keymap LST 1582:2000 +// Extensions: B01 L3 is "<" , B02 L3 is ">" and B03 L3 is endash to make this +// layout usable with pc101 and pc104 keyboards. + +partial default alphanumeric_keys modifier_keys +xkb_symbols "lt_std" { + + include "pc/latin" + + name[Group1]= "Lithuanian"; + + key <TLDE> {[ grave, asciitilde, acute ]}; + key <AE01> {[ exclam, 1, at ]}; + key <AE02> {[ minus, 2, underscore ]}; + key <AE03> {[ slash, 3, numbersign ]}; + key <AE04> {[ semicolon, 4, dollar ]}; + key <AE05> {[ colon, 5, section ]}; + key <AE06> {[ comma, 6, asciicircum ]}; + key <AE07> {[ period, 7, ampersand ]}; + key <AE08> {[ equal, 8, asterisk ]}; + key <AE09> {[ parenleft, 9, bracketleft ]}; + key <AE10> {[ parenright, 0, bracketright ]}; + key <AE11> {[ question, plus, apostrophe ]}; + key <AE12> {[ x, X, percent ]}; + key <AD01> {[ aogonek, Aogonek ]}; + key <AD02> {[ zcaron, Zcaron ]}; + key <AD03> {[ e, E, EuroSign ]}; + key <AD11> {[ iogonek, Iogonek, braceleft ]}; + key <AD12> {[ w, W, braceright ]}; + key <AC04> {[ scaron, Scaron ]}; + key <AC10> {[ uogonek, Uogonek ]}; + key <AC11> {[ eabovedot, Eabovedot, quotedbl ]}; + key <AB01> {[ z, Z, less ]}; + key <AB02> {[ umacron, Umacron, greater ]}; + key <AB03> {[ c, C, endash ]}; + key <AB08> {[ ccaron, Ccaron, doublelowquotemark ]}; + key <AB09> {[ f, F, leftdoublequotemark ]}; +// this is actually right quote for Lithuanian + key <AB10> {[ eogonek, Eogonek, backslash ]}; + key <BKSL> {[ q, Q, bar ]}; + key <SPCE> {[ space, space, nobreakspace, nobreakspace ]}; + + key <LSGT> {[ less, greater, endash ]}; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/lv b/symbols/lv new file mode 100644 index 00000000..850d8397 --- /dev/null +++ b/symbols/lv @@ -0,0 +1,34 @@ + +// based on +// Latvian keyboard map by Ilya Ketris <Ilya.Ketris@ipro.lv> +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/lv,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Latvian"; + + key <AE04> { [ 4, dollar, EuroSign, cent ] }; + + key <AD03> { [ e, E, emacron, Emacron ] }; + key <AD04> { [ r, R, rcedilla, Rcedilla ] }; + key <AD07> { [ u, U, umacron, Umacron ] }; + key <AD08> { [ i, I, imacron, Imacron ] }; + key <AD09> { [ o, O, omacron, Omacron ] }; + + key <AC01> { [ a, A, amacron, Amacron ] }; + key <AC02> { [ s, S, scaron, Scaron ] }; + key <AC05> { [ g, G, gcedilla, Gcedilla ] }; + key <AC08> { [ k, K, kcedilla, Kcedilla ] }; + key <AC09> { [ l, L, lcedilla, Lcedilla ] }; + key <AC11> { [apostrophe, quotedbl, leftdoublequotemark, doublelowquotemark ] }; + + key <AB01> { [ z, Z, zcaron, Zcaron ] }; + key <AB03> { [ c, C, ccaron, Ccaron ] }; + key <AB06> { [ n, N, ncedilla, Ncedilla ] }; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/macintosh.vndr/de b/symbols/macintosh.vndr/de new file mode 100644 index 00000000..b4bf6aa5 --- /dev/null +++ b/symbols/macintosh.vndr/de @@ -0,0 +1,144 @@ +// $XConsortium: de /main/4 1996/08/31 12:19:20 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/de,v 3.7.2.2 1999/07/13 07:09:56 hohndel Exp $ + +// olh@suse.de very close to MacOS map + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple German keybaord + + // Alphanumeric section + name[Group1]= "German"; + key <TLDE> { [ dead_circumflex, degree ], + [ notsign ] }; + key <AE01> { [ 1, exclam ], + [ exclamdown, at ] }; + key <AE02> { [ 2, quotedbl ], + [ twosuperior ] }; + key <AE03> { [ 3, section ], + [ threesuperior,sterling ] }; + key <AE04> { [ 4, dollar ], + [ onequarter, currency ] }; + key <AE05> { [ 5, percent ], + [ bracketleft ] }; + key <AE06> { [ 6, ampersand ], + [ bracketright ] }; + key <AE07> { [ 7, slash ], + [ bar, backslash ] }; + key <AE08> { [ 8, parenleft ], + [ braceleft, asciitilde ] }; + key <AE09> { [ 9, parenright ], + [braceright ] }; + key <AE10> { [ 0, equal ], + [ braceright, degree ] }; + key <AE11> { [ ssharp, question ], + [ backslash, questiondown ] }; + key <AE12> { [ dead_acute, dead_grave ], + [ dead_cedilla ] }; + + key <AD01> { [ q, Q ], + [guillemotleft,guillemotright ] }; + key <AD03> { [ e, E ], + [ EuroSign ] }; + key <AD04> { [ r, R ], + [ registered ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ z, Z ] }; + key <AD07> { [ u, U ], + [diaeresis, Aacute ] }; + key <AD08> { [ i, I ], + [ slash, Ucircumflex ] }; + key <AD09> { [ o, O ], + [ oslash, Ooblique ] }; + key <AD11> { [ udiaeresis, Udiaeresis ], + [ periodcentered, degree ] }; + key <AD12> { [ plus, asterisk ], + [ asciitilde ] }; + key <AC01> { [ a, A ], + [ aring, Aring ] }; + key <AC04> { [ f, F ] }; + key <AC05> { [ g, G ], + [ copyright ] }; + key <AC06> { [ h, H ], + [ ordfeminine ] }; + key <AC09> { [ l, L ], + [ at ] }; + key <AC10> { [ odiaeresis, Odiaeresis ], + [ dead_acute ] }; + key <AC11> { [ adiaeresis, Adiaeresis ], + [ dead_circumflex ] }; + + key <LSGT> { [ less, greater ], + [ bar ] }; + key <AB01> { [ y, Y ], + [ guillemotleft,less ] }; + key <AB06> { [ n, N ], + [asciitilde ] }; + key <AB07> { [ m, M ], + [ mu ] }; + key <AB08> { [ comma, semicolon ] }; + key <AB09> { [ period, colon ], + [ periodcentered, division ] }; + key <AB10> { [ minus, underscore ] }; + key <BKSL> { [ numbersign, apostrophe ], + [ dead_grave ] }; + + // End alphanumeric section, begin "Keypad" + key <KPDL> { [ KP_Delete, KP_Separator ] }; + // End "Keypad" section + + // begin modifier mappings +// modifier_map Shift { Shift_L }; +// modifier_map Lock { Caps_Lock }; +// modifier_map Control{ Control_L }; +// modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + // modify the default German layout to use Sun dead keys + include "macintosh/de(basic)" + key <TLDE> { [ SunFA_Circum, degree ], + [ notsign ] }; + key <AE12> { [ SunFA_Acute, SunFA_Grave ], + [ SunFA_Cedilla ] }; + key <AD11> { [ udiaeresis, Udiaeresis ], + [ SunFA_Diaeresis ] }; + key <AD12> { [ plus, asterisk ], + [ SunFA_Tilde, dead_macron ] }; + key <AC10> { [ odiaeresis, Odiaeresis ], + [ SunFA_Acute ] }; + key <AC11> { [ adiaeresis, Adiaeresis ], + [ SunFA_Circum ] }; + + key <BKSL> { [ numbersign, acute ], + [ SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "macintosh/de(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + // modify the default German layout to not have any dead keys + include "macintosh/de(basic)" + key <TLDE> { [ asciicircum, degree ], + [ notsign ] }; + key <AE12> { [ acute, grave ], + [ cedilla ] }; + key <AD11> { [ udiaeresis, Udiaeresis ], + [ diaeresis ] }; + key <AD12> { [ plus, asterisk ], + [ asciitilde, macron ] }; + key <AC10> { [ odiaeresis, Odiaeresis ], + [ acute ] }; + key <AC11> { [ adiaeresis, Adiaeresis ], + [ asciicircum ] }; + + key <BKSL> { [ numbersign, apostrophe ], + [ grave ] }; +}; diff --git a/symbols/macintosh.vndr/de_CH b/symbols/macintosh.vndr/de_CH new file mode 100644 index 00000000..75eb9479 --- /dev/null +++ b/symbols/macintosh.vndr/de_CH @@ -0,0 +1,150 @@ +// $XFree86$ +// +// 06.07.2000 +// Andreas Tobler a.tobler@schweiz.ch +// modified for Swiss German Apple Extended Keyboard II + +xkb_symbols "extended" { + + + name[Group1]= "Swiss German Apple Extended Keyboard II"; + // Alphanumeric section + key <TLDE> { [ less, greater ], + [ lessthanequal, greaterthanequal ] }; + key <COIN> { [ section, degree ] }; + key <AE01> { [ 1, plus ], + [ plusminus, onesuperior ] }; + key <AE02> { [ 2, quotedbl ], + [ twosuperior, oneeighth ] }; + key <AE03> { [ 3, asterisk ], + [ numbersign, threesuperior ] }; + key <AE04> { [ 4, ccedilla ], + [ Ccedilla ] }; + key <AE05> { [ 5, percent ], + [ bracketleft ] }; + key <AE06> { [ 6, ampersand ], + [ bracketright ] }; + key <AE07> { [ 7, slash ], + [ bar, backslash ] }; + key <AE08> { [ 8, parenleft ], + [ braceleft, Ograve ] }; + key <AE09> { [ 9, parenright ], + [ braceright, Ocircumflex ] }; + key <AE10> { [ 0, equal ], + [ notequal, Uacute ] }; + key <AE11> { [ apostrophe, question ], + [ questiondown ] }; + key <AE12> { [ asciicircum, grave ], + [ dead_acute,asciitilde ] }; + + + key <AD01> { [ q, Q ] }; + + key <AD02> { [ w, W ], + [ Greek_SIGMA, Aacute ] }; + + key <AD03> { [ e, E ], + [ trademark, Ediaeresis ] }; + + key <AD04> { [ r, R ], + [ registered, Egrave ] }; + + key <AD05> { [ t, T ], + [ dagger, Icircumflex ] }; + + key <AD06> { [ z, Z ], + [ Greek_OMEGA, Iacute ] }; + + key <AD07> { [ u, U ], + [ degree, Ugrave ] }; + + key <AD08> { [ i, I ], + [ exclamdown ] }; + + key <AD09> { [ o, O ], + [ oslash ] }; + + key <AD10> { [ p, P ], + [ Greek_pi, Greek_PI ] }; + + key <AD11> { [ udiaeresis, egrave ], + [ section, ydiaeresis ] }; + + + key <AD12> { [ dead_diaeresis, exclam ], + [ quoteleft, quoteright ] }; + + key <BKSL> { [ dollar, sterling ], + [ paragraph, enfilledcircbullet ] }; + + + key <AC01> { [ a, A ], + [ aring, Aring ] }; + + key <AC02> { [ s, S ], + [ ssharp ] }; + + key <AC03> { [ d, D ], + [ Greek_delta ] }; + + key <AC04> { [ f, F ], + [ section, doubledagger ] }; + + key <AC05> { [ g, G ], + [ at, comma ] }; + + key <AC06> { [ h, H ], + [ ordfeminine, periodcentered ] }; + + key <AC07> { [ j, J ], + [ masculine] }; + + key <AC08> { [ k, K ] }; + + key <AC09> { [ l, L ], + [ notsign ] }; + + key <AC10> { [ odiaeresis, eacute ], + [ cent ] }; + + key <AC11> { [ adiaeresis, agrave ], + [ ae, AE ] }; + + + + key <AB01> { [ y, Y ], + [ yen, Ydiaeresis ] }; + + key <AB02> { [ x, X ], + [similarequal, ydiaeresis ] }; + + key <AB03> { [ c, C ], + [ copyright, diamond ] }; + + key <AB04> { [ v, V ] }; + + key <AB05> { [ b, B ], + [ ssharp ] }; + + key <AB06> { [ n, N ], + [ dead_tilde ] }; + + key <AB07> { [ m, M ], + [ mu ] }; + + key <AB08> { [ comma, semicolon ], + [ guillemotleft, guillemotright ] }; + + key <AB09> { [ period, colon ], + [ Nosymbol, division ] }; + + key <AB10> { [ minus, underscore ], + [ emdash, endash ] }; + + key <SPCE> { [ space ], + [nobreakspace, nobreakspace ] }; + // End alphanumeric section + + key <KPDL> { [ KP_Separator , KP_Delete ] }; + +}; diff --git a/symbols/macintosh.vndr/dk b/symbols/macintosh.vndr/dk new file mode 100644 index 00000000..c5879763 --- /dev/null +++ b/symbols/macintosh.vndr/dk @@ -0,0 +1,92 @@ +// $XConsortium: dk /main/3 1996/08/31 12:19:29 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/dk,v 3.3.2.1 1999/12/20 12:56:01 hohndel Exp $ +partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Danish keyboard with dead key support + // and all of ISO-8859-1 characters available. + + name[Group1]= "Danish"; + + key <TLDE> { [ onehalf, section ], + [ threequarters, paragraph ]}; + key <LSGT> { [ less, greater ], + [ backslash, notsign ]}; + key <SPCE> { [ space, space ], + [ nobreakspace, nobreakspace ]}; + key <AE01> { [ 1, exclam ], + [ exclamdown, onesuperior ]}; + key <AE02> { [ 2, quotedbl ], + [ at, twosuperior ]}; + key <AE03> { [ 3, numbersign ], + [ sterling, threesuperior ]}; + key <AE04> { [ 4, currency ], + [ dollar, onequarter ]}; + key <AE05> { [ 5, percent ], + [ NoSymbol, cent ]}; + key <AE06> { [ 6, ampersand ], + [ yen, NoSymbol ]}; + key <AE07> { [ 7, slash ], + [ braceleft, division ]}; + key <AE08> { [ 8, parenleft ], + [ bracketleft, guillemotleft ]}; + key <AE09> { [ 9, parenright ], + [ bracketright, guillemotright ]}; + key <AE10> { [ 0, equal ], + [ braceright, degree ]}; + key <AB08> { [ comma, semicolon ], + [ dead_cedilla, dead_ogonek ]}; + key <AB09> { [ period, colon ], + [ periodcentered, dead_abovedot ]}; + key <AB03> { [ c, C ], + [ copyright, NoSymbol ]}; + key <AB10> { [ minus, underscore ], + [ hyphen, macron ]}; + key <AC01> { [ a, A ], + [ ordfeminine, masculine ]}; + key <AC03> { [ d, D ], + [ eth, ETH ]}; + key <AD03> { [ e, E ], + [ NoSymbol, cent ]}; + key <AD04> { [ r, R ], + [ registered, NoSymbol ]}; + key <AD05> { [ t, T ], + [ thorn, THORN ]}; + key <AD08> { [ i, I ], + [ NoSymbol, NoSymbol ]}; + key <AD09> { [ o, O ], + [ oe, OE ]}; + key <AC10> { [ ae, AE ]}; + key <AE11> { [ plus, question ], + [ plusminus, questiondown ]}; + key <AC11> { [ oslash, Ooblique ]}; + key <BKSL> { [ apostrophe, asterisk ], + [dead_doubleacute, multiply ]}; + key <AD11> { [ aring, Aring ]}; + key <AE12> { [ dead_acute, dead_grave ], + [ bar, brokenbar ]}; + key <AD12> { [ dead_diaeresis, dead_circumflex ], + [ dead_tilde, dead_caron ]}; + + + // End alphanumeric section + +}; + + +partial default alphanumeric_keys +xkb_symbols "full" { + include "iso9995-3(full)" + include "dk(basic)" +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/dk(basic)" + key <AE12> { [ acute, grave ], + [ bar, ogonek ] }; + key <AD12> { [ diaeresis, asciicircum ], + [ asciitilde, dead_macron ] }; +}; diff --git a/symbols/macintosh.vndr/es b/symbols/macintosh.vndr/es new file mode 100644 index 00000000..ad217b36 --- /dev/null +++ b/symbols/macintosh.vndr/es @@ -0,0 +1,50 @@ +// $XFree86$ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple mac_US + // keyboard and a very simple Spanish keybaord + + name[Group1]= "Spanish"; + + key <TLDE> { [ bracketleft, bracketright ], + [ braceleft, braceright ] }; + key <LSGT> { [ less, greater ], + [ bracketleft, braceleft ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, exclamdown ], + [ at, oneeighth ] }; + key <AE03> { [ 3, numbersign ], + [ guillemotleft, guillemotright ] }; + key <AE04> { [ 4, dollar ], + [ yen, Icircumflex ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, slash ], + [ backslash, Idiaeresis ] }; + key <AE07> { [ 7, ampersand ], + [ bar, Iacute ] }; + key <AE08> { [ 8, asterisk ], + [ degree ] }; + key <AE09> { [ 9, parenleft ], + [ sterling, Ocircumflex ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ], + [ plusminus ] }; + key <AD11> { [ dead_grave, degree ] }; + key <AD12> { [ dead_acute, dead_diaeresis ], + [ bar ] }; + + key <AB08> { [ comma, questiondown ] }; + key <AB09> { [ period, question ] }; + key <AB10> { [ ccedilla, Ccedilla ] }; + key <AC10> { [ ntilde, Ntilde ], + [ asciitilde,dead_doubleacute ] }; + key <AC11> { [ semicolon, colon ] }; + key <BKSL> { [ apostrophe, quotedbl ] }; + + // End alphanumeric section + +}; diff --git a/symbols/macintosh.vndr/fi b/symbols/macintosh.vndr/fi new file mode 100644 index 00000000..6f08ddbf --- /dev/null +++ b/symbols/macintosh.vndr/fi @@ -0,0 +1,19 @@ +// $XFree86$ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple mac_US + // keyboard and a very simple Swedish(Finland) keybaord + + name[Group1]= "Finnish"; + include "macintosh/se(basic)" // for consistent naming + +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/se(basic)" // for consistent naming +}; diff --git a/symbols/macintosh.vndr/fr b/symbols/macintosh.vndr/fr new file mode 100644 index 00000000..149df3b7 --- /dev/null +++ b/symbols/macintosh.vndr/fr @@ -0,0 +1,101 @@ +// $XConsortium: macintosh /main/10 1996/01/29 19:54:54 kaleb $ +// $XFree86$ +// + +xkb_symbols "extended" { + + name[Group1]= "FR-1"; + + // Alphanumeric section + key <LSGT> { [ less, greater ] }; + key <TLDE> { [ at, numbersign ], + [ periodcentered ] }; + key <AE01> { [ ampersand, 1 ], + [ dead_acute, dead_acute] }; + key <AE02> { [ eacute, 2 ] }; + key <AE03> { [ quotedbl, 3 ] }; + key <AE04> { [ quoteright, 4 ], + [ quoteleft ] }; + key <AE05> { [ parenleft, 5 ], + [ braceleft, bracketleft ] }; + key <AE06> { [ section, 6 ], + [ paragraph ] }; + key <AE07> { [ egrave, 7 ], + [ guillemotleft, guillemotright ] }; + key <AE08> { [ exclam, 8 ], + [ exclamdown, Ucircumflex ] }; + key <AE09> { [ ccedilla, 9 ], + [ Ccedilla, Aacute ] }; + key <AE10> { [ agrave, 0 ], + [ oslash, Ooblique ] }; + key <AE11> { [ parenright, degree ], + [ braceright, bracketright ] }; + key <AE12> { [ minus, underscore ] }; + + key <AD01> { [ a, A ], + [ ae, AE ] }; + key <AD02> { [ z, Z ], + [ Acircumflex, Aring ] }; + key <AD03> { [ e, E ], + [ ecircumflex, Ecircumflex ] }; + key <AD04> { [ r, R ], + [ registered, currency ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ y, Y ], + [ Uacute, ydiaeresis ] }; + key <AD07> { [ u, U ] }; + key <AD08> { [ i, I ], + [ icircumflex, idiaeresis ] }; + key <AD09> { [ o, O ] }; + key <AD10> { [ p, P ] }; + key <AD11> { [ dead_circumflex, dead_diaeresis ], + [ ocircumflex, Ocircumflex ] }; + key <AD12> { [ dollar, asterisk ], + [ comma, yen ] }; + key <BKSL> { [ dead_grave, sterling ], + [ at, numbersign ] }; + + key <AC01> { [ q, Q ] , + [ acircumflex, Acircumflex ] }; + key <AC02> { [ s, S ], + [ Ograve, S ] }; + key <AC03> { [ d, D ] }; + key <AC04> { [ f, F ], + [ f, periodcentered ] }; + key <AC05> { [ g, G ] }; + key <AC06> { [ h, H ], + [ Igrave, Icircumflex ] }; + key <AC07> { [ j, J ], + [ Idiaeresis, Iacute ] }; + key <AC08> { [ k, K ], + [ Egrave, Ediaeresis ] }; + key <AC09> { [ l, L ], + [ ssharp, bar ] }; + key <AC10> { [ m, M ], + [ mu, Oacute ] }; + key <AC11> { [ ugrave, percent ], + [ Ugrave, ucircumflex ] }; + key <RTRN> { [ Return, Return ], + [ hyphen, hyphen ] }; + + key <AB01> { [ w, W ] }; + key <AB02> { [ x, X ] }; + key <AB03> { [ c, C ], + [ copyright, copyright ] }; + key <AB04> { [ v, V ] }; + key <AB05> { [ b, B ] }; + key <AB06> { [ n, N ], + [ dead_tilde ] }; + key <AB07> { [ comma, question ], + [ at, questiondown ] }; + key <AB08> { [ semicolon, period ] }; + key <AB09> { [ colon, slash ], + [ division, backslash ] }; + key <AB10> { [ equal, plus ], + [ macron, plusminus ] }; + + // End alphanumeric section + key <KPDL> { [ KP_Separator , KP_Delete ] }; + +}; + diff --git a/symbols/macintosh.vndr/fr_CH b/symbols/macintosh.vndr/fr_CH new file mode 100644 index 00000000..e8480c55 --- /dev/null +++ b/symbols/macintosh.vndr/fr_CH @@ -0,0 +1,28 @@ +// $XConsortium: fr_CH /main/3 1996/08/31 12:19:48 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/macintosh/fr_CH,v 1.1 2000/09/19 12:46:25 eich Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Swiss/French keybaord + + include "macintosh/de_CH" + name[Group1]= "Swiss French"; + + override key <AD11> { + [ egrave, udiaeresis ], + [ bracketleft ] + }; + override key <AC10> { + [ eacute, odiaeresis ] + }; + override key <AC11> { + [ agrave, adiaeresis ], + [ braceleft ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/fr_CH" // for consistent naming +}; diff --git a/symbols/macintosh.vndr/gb b/symbols/macintosh.vndr/gb new file mode 100644 index 00000000..29a27f8b --- /dev/null +++ b/symbols/macintosh.vndr/gb @@ -0,0 +1,19 @@ +// $XConsortium: gb /main/3 1996/08/31 12:19:51 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/gb,v 3.3 1996/12/23 07:13:25 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple U.K. keyboard layout + + + name[Group1]= "Great Britain"; + + key <AE03> { [ 3, sterling ], + [ numbersign ] }; + + // End alphanumeric section + +}; + + diff --git a/symbols/macintosh.vndr/it b/symbols/macintosh.vndr/it new file mode 100644 index 00000000..9068b4c6 --- /dev/null +++ b/symbols/macintosh.vndr/it @@ -0,0 +1,93 @@ +// $XFree86$ + +xkb_symbols "extended" { + + name[Group1]= "italian"; + + // Alphanumeric section + key <LSGT> { [ less, greater ] }; + key <TLDE> { [ at, numbersign ], + [ periodcentered ] }; + key <AE01> { [ ampersand, 1 ], + [guillemotleft,guillemotright ] }; + key <AE02> { [ quotedbl, 2 ] }; + key <AE03> { [ apostrophe, 3 ] }; + key <AE04> { [ parenleft, 4 ], + [ braceleft, bracketleft ] }; + key <AE05> { [ ccedilla, 5 ], + [ Ccedilla, Iacute ] }; + key <AE06> { [ egrave, 6 ], + [ paragraph, periodcentered] }; + key <AE07> { [ parenright, 7 ], + [ braceright, bracketright ] }; + key <AE08> { [ sterling, 8 ], + [ infinity ] }; + key <AE09> { [ agrave, 9 ], + [ acute, Ocircumflex ] }; + key <AE10> { [ eacute, 0 ], + [ grave, Oacute ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ], + [ notequal, plusminus ] }; + + key <AD01> { [ q, Q ] }; + key <AD02> { [ z, Z ] }; + key <AD03> { [ e, E ] }; + key <AD04> { [ r, R ], + [ registered ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ y, Y ], + [ Uacute, ydiaeresis ] }; + key <AD07> { [ u, U ] }; + key <AD08> { [ i, I ], + [ icircumflex, idiaeresis ] }; + key <AD09> { [ o, O ] }; + key <AD10> { [ p, P ] }; + key <AD11> { [ igrave, asciicircum ] }; + key <AD12> { [ dollar, asterisk ] }; + key <BKSL> { [ section, degree ], + [ at, numbersign ] }; + + key <AC01> { [ a, A ] , + [ aring, Aring ] }; + key <AC02> { [ s, S ], + [ ssharp ] }; + key <AC03> { [ d, D ] }; + key <AC04> { [ f, F ] }; + key <AC05> { [ g, G ] }; + key <AC06> { [ h, H ], + [ Igrave, Icircumflex ] }; + key <AC07> { [ j, J ], + [ Idiaeresis, Iacute ] }; + key <AC08> { [ k, K ], + [ Egrave, Ediaeresis ] }; + key <AC09> { [ l, L ], + [ ssharp, bar ] }; + key <AC10> { [ m, M ], + [ mu, Oacute ] }; + key <AC11> { [ ugrave, percent ], + [ ae, AE ] }; + + key <AB01> { [ w, W ] }; + key <AB02> { [ x, X ] }; + key <AB03> { [ c, C ], + [ copyright, copyright ] }; + key <AB04> { [ v, V ] }; + key <AB05> { [ b, B ] }; + key <AB06> { [ n, N ], + [ dead_tilde ] }; + key <AB07> { [ comma, question ], + [ questiondown ] }; + key <AB08> { [ semicolon, period ] }; + key <AB09> { [ colon, slash ], + [ bar, backslash ] }; + key <AB10> { [ ograve, exclam ], + [ exclamdown ] }; + + // End alphanumeric section + + key <KPDL> { [ KP_Decimal , KP_Delete ] }; + // End "Keypad" section + +}; + diff --git a/symbols/macintosh.vndr/nl b/symbols/macintosh.vndr/nl new file mode 100644 index 00000000..92f8dac5 --- /dev/null +++ b/symbols/macintosh.vndr/nl @@ -0,0 +1,15 @@ +// $XFree86$ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple mac_US + // keyboard and a very simple netherland keybaord + + name[Group1]= "Netherland"; + +// do just nothing + +}; + diff --git a/symbols/macintosh.vndr/no b/symbols/macintosh.vndr/no new file mode 100644 index 00000000..689da9da --- /dev/null +++ b/symbols/macintosh.vndr/no @@ -0,0 +1,58 @@ +// $XConsortium: no /main/3 1996/08/31 12:20:02 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/no,v 3.3.2.1 1997/07/26 06:31:01 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Norwegian keybaord + + name[Group1]= "Norwegian"; + + key <TLDE> { [ bar, section ] }; + key <AE02> { [ 2, quotedbl ], + [ at, oneeighth ] }; + key <AE04> { [ 4, currency ], + [ dollar, dollar ] }; + key <AE03> { [ 3, numbersign ], + [ sterling, sterling ] }; + key <AE06> { [ 6, ampersand ] }; + key <AE07> { [ 7, slash ], + [ bar, backslash ] }; + key <AE08> { [ 8, parenleft ], + [ bracketleft, braceleft ] }; + key <AE09> { [ 9, parenright ], + [ bracketright, braceright ] }; + key <AE10> { [ 0, equal ] }; + + key <AB08> { [ comma, semicolon ] }; + key <AB09> { [ period, colon ] }; + key <AB10> { [ minus, underscore ] }; + key <AC10> { [ oslash, Ooblique ], + [ odiaeresis, Odiaeresis ] }; + key <AE11> { [ plus, question ] }; + key <AC11> { [ ae, AE ] }; + key <AD11> { [ aring, Aring ] }; + key <AE12> { [ dead_grave, dead_acute ], + [ acute, dead_ogonek ] }; + key <AD12> { [ diaeresis, asciicircum ], + [ asciitilde, dead_macron ] }; + key <BKSL> { [ at, asterisk ] }; + key <LSGT> { [ less, greater ] }; + + // End alphanumeric section + +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Norwegian layout to eliminate dead keys + + include "macintosh/no(basic)" + key <AE12> { [ grave, acute ], + [ acute, ogonek ] }; + key <AD12> { [ diaeresis, asciicircum ], + [ asciitilde, macron ] }; + +}; diff --git a/symbols/macintosh.vndr/pt b/symbols/macintosh.vndr/pt new file mode 100644 index 00000000..f48b3e37 --- /dev/null +++ b/symbols/macintosh.vndr/pt @@ -0,0 +1,66 @@ +// $XConsortium: pt /main/3 1996/08/31 12:20:08 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/pt,v 3.3.2.1 1999/11/18 15:37:37 hohndel Exp $ +// mac version from Ricardo Cabral <bfe00991@mail.telepac.pt> + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Portuguese keybaord + + name[Group1]= "Portuguese"; + + key <LSGT> { [ less, greater ], + [ bar, brokenbar ] }; + key <AE02> { [ 2, quotedbl ], + [ at, oneeighth ] }; + key <AE04> { [ 4, dollar ], + [ section, dollar ] }; + key <AE03> { [ 3, numbersign ], + [ sterling, sterling ] }; + key <AE06> { [ 6, ampersand ] }; + key <AE07> { [ 7, slash ] }; + key <AE08> { [ 8, parenleft ], + [ bracketleft, braceleft ] }; + key <AE09> { [ 9, parenright ], + [ bracketright, braceright ] }; + key <AE10> { [ 0, equal ] }; + key <AE11> { [ apostrophe, question ] }; + key <AE12> { [ plus, asterisk ], + [ dead_diaeresis ] }; + key <AB08> { [ comma, semicolon ] }; + key <AB09> { [ period, colon ] }; + key <AB10> { [ minus, underscore ] }; + key <AC10> { [ ccedilla, Ccedilla ] }; + key <AC11> { [ dead_tilde, dead_circumflex ] }; + key <AC12> { [ backslash, bar ] }; + key <AD11> { [ masculine, ordfeminine ] }; + key <AD12> { [ dead_acute, dead_grave ] }; + // End alphanumeric section + +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "macintosh/pt(basic)" // for consistent naming + + key <AE12> { [ plus, asterisk ], + [ SunFA_Diaeresis, SunFA_Diaeresis ] }; + key <AC11> { [ SunFA_Tilde, SunFA_Circum ] }; + key <AD12> { [ SunFA_Acute, SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "macintosh/pt(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/pt(basic)" // for consistent naming + + key <AE12> { [ plus, asterisk ], + [ quotedbl, quotedbl ] }; + key <AC11> { [ asciitilde, asciicircum ] }; + key <AD12> { [ acute, grave ] }; +}; diff --git a/symbols/macintosh.vndr/se b/symbols/macintosh.vndr/se new file mode 100644 index 00000000..510c5ca8 --- /dev/null +++ b/symbols/macintosh.vndr/se @@ -0,0 +1,56 @@ +// $XConsortium: se /main/3 1996/08/31 12:20:15 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/macintosh/se,v 1.1 2000/09/19 12:46:26 eich Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Swedish(Sweden) keybaord + + name[Group1]= "Swedish"; + + key <TLDE> { [ section, degree ] }; + + key <AE01> { [ 1, exclam ], + [ copyright, exclamdown ] }; + key <AE02> { [ 2, quotedbl ], + [ at, oneeighth ] }; + key <AE03> { [ 3, numbersign ], + [ sterling, yen ] }; + key <AE04> { [ 4, currency ], + [ dollar, cent ] }; + key <AE06> { [ 6, ampersand ] }; + key <AE07> { [ 7, slash ], + [ bar, backslash ] }; + key <AE08> { [ 8, parenleft ], + [ bracketleft, braceleft ] }; + key <AE09> { [ 9, parenright ], + [ bracketright, braceright ] }; + key <AB08> { [ comma, semicolon ] }; + key <AE10> { [ 0, equal ] }; + key <AB09> { [ period, colon ] }; + key <AB10> { [ minus, underscore ] }; + key <AC10> { [ odiaeresis, Odiaeresis ], + [ oslash, Ooblique ] }; + key <AE11> { [ plus, question ] }; + key <AC11> { [ adiaeresis, Adiaeresis ], + [ ae, AE ] }; + key <AD11> { [ aring, Aring ] }; + key <AE12> { [ acute, grave ] }; + key <AD12> { [ diaeresis, asciicircum ], + [ asciitilde ] }; + key <BKSL> { [ apostrophe, asterisk ], + [ at ] }; + key <LSGT> { [ less, greater ], + [ bar, brokenbar ] }; + key <KPDL> { [ KP_Delete, KP_Separator ] }; + + + // End alphanumeric section + +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/se(basic)" // for consistent naming +}; diff --git a/symbols/macintosh.vndr/us b/symbols/macintosh.vndr/us new file mode 100644 index 00000000..c53a1521 --- /dev/null +++ b/symbols/macintosh.vndr/us @@ -0,0 +1,204 @@ +// $XConsortium: macintosh /main/10 1996/01/29 19:54:54 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/macintosh/us,v 1.8 2003/08/04 10:32:31 eich Exp $ + +// symbols definition for a Macintosh "Extended" keyboard + +xkb_symbols "extended" { + + name[Group1]= "US/ASCII"; + key <ESC> { [ Escape ] }; + + // Alphanumeric section + key <TLDE> { [ quoteleft, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + key <BKSP> { [ BackSpace ] }; + + key <TAB> { [ Tab, ISO_Left_Tab ] }; + key <AD01> { [ q, Q ] }; + key <AD02> { [ w, W ] }; + key <AD03> { [ e, E ] }; + key <AD04> { [ r, R ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ y, Y ] }; + key <AD07> { [ u, U ] }; + key <AD08> { [ i, I ] }; + key <AD09> { [ o, O ] }; + key <AD10> { [ p, P ] }; + key <AD11> { [ bracketleft, braceleft ] }; + key <AD12> { [ bracketright, braceright ] }; + key <BKSL> { [ backslash, bar ] }; + + key <CAPS> { [ Caps_Lock ] }; + key <AC01> { [ a, A ] }; + key <AC02> { [ s, S ] }; + key <AC03> { [ d, D ] }; + key <AC04> { [ f, F ] }; + key <AC05> { [ g, G ] }; + key <AC06> { [ h, H ] }; + key <AC07> { [ j, J ] }; + key <AC08> { [ k, K ] }; + key <AC09> { [ l, L ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ quoteright, quotedbl ] }; + key <RTRN> { [ Return ] }; + + key <AB01> { [ z, Z ] }; + key <AB02> { [ x, X ] }; + key <AB03> { [ c, C ] }; + key <AB04> { [ v, V ] }; + key <AB05> { [ b, B ] }; + key <AB06> { [ n, N ] }; + key <AB07> { [ m, M ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; + + key <SPCE> { [ space ] }; + // End alphanumeric section + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ] }; + key <FK12> { [ F12 ] }; + key <FK13> { [ Print ] }; + key <FK14> { [ Scroll_Lock ] }; + key <FK15> { [ Pause ] }; + // End "Function" section + + // Begin "Editing" section + key <INS> { [ Insert ] }; + key <HOME> { [ Home ] }; + key <PGUP> { [ Prior ] }; + key <DELE> { [ Delete ] }; + key <END> { [ End ] }; + key <PGDN> { [ Next ] }; + + key <UP> { [ Up ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <RGHT> { [ Right ] }; + // End "Editing" section + + // Begin "Keypad" section + key <NMLK> { [ Num_Lock, Pointer_EnableKeys ] }; + key <KPEQ> { [ equal ] }; + key <KPDV> { [ KP_Divide ] }; + key <KPMU> { [ KP_Multiply ] }; + + key <KP7> { [ KP_7, KP_Home ] }; + key <KP8> { [ KP_8, KP_Up ] }; + key <KP9> { [ KP_9, KP_Prior ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP4> { [ KP_4, KP_Left ] }; + key <KP5> { [ KP_5, KP_Begin ] }; + key <KP6> { [ KP_6, KP_Right ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP1> { [ KP_1, KP_End ] }; + key <KP2> { [ KP_2, KP_Down ] }; + key <KP3> { [ KP_3, KP_Next ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_0, KP_Insert ] }; + key <KPDL> { [ KP_Decimal, KP_Delete ] }; + // End "Keypad" section + + // Begin "Modifier" section + key <LFSH> { [ Shift_L ] }; + key <RTSH> { [ Shift_R ] }; + key <LCTL> { [ Control_L ] }; + key <RCTL> { [ Control_R ] }; + key <LALT> { [ Alt_L, Meta_L ] }; + key <RALT> { [ Alt_R, Meta_R ] }; + key <LWIN> { [ Super_L ] }; + key <RWIN> { [ Super_R ] }; + // End "Modifier" section + + // begin modifier mappings + modifier_map Shift { Shift_L , Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod2 { Num_Lock }; + modifier_map Mod4 { Super_L, Super_R }; + modifier_map Mod5 { Scroll_Lock }; + // end modifier mappings + + include "compose(rwin)" + include "apple(extended)" + +// *** FIXME +// key <LSGT> { [ quoteleft, asciitilde ] }; +// key <AE01> { [ 1, exclam ], +// [exclamdown, slash ] }; +// key <AE02> { [ 2, at ], +// [ trademark, eth ] }; +// key <AE03> { [ 3, numbersign ], +// [ sterling ] }; +// key <AE04> { [ 4, dollar ], +// [ cent ] }; +// key <AE05> { [ 5, percent ], +// [ infinity ] }; +// key <AE06> { [ 6, asciicircum ], +// [ section ] }; +// key <AE07> { [ 7, ampersand ], +// [ paragraph ] }; +// key <AE08> { [ 8, asterisk ], +// [periodcentered ] }; +// key <AE09> { [ 9, parenleft ], +// [ordfeminine ] }; +// key <AE12> { [ equal, plus ], +// [ notequal, plusminus ] }; +// key <AD01> { [ q, Q ], +// [ oe, OE ] }; +// key <AD04> { [ r, R ], +// [registered ] }; +// key <AD05> { [ t, T ], +// [ dagger ] }; +// key <BKSL> { [ backslash, bar ], +// [guillemotleft,guillemotright ] }; +// key <AC01> { [ a, A ], +// [ aring, Aring ] }; +// key <AC02> { [ s, S ], +// [ ssharp, Iacute ] }; +// key <AC03> { [ d, D ], +// eth, Icircumflex ] }; +// key <AC04> { [ f, F ], +// [ Idiaeresis ] }; +// key <AC05> { [ g, G ], +// [ copyright ] }; +// key <AC09> { [ l, L ], +// [ notsign, Ograve ] }; +// key <AC11> { [ quoteright, quotedbl ], +// [ ae, AE ] }; +// key <AB03> { [ c, C ], +// [ ccedilla, Ccedilla ] }; +// key <AB06> { [ n, N ], +// [asciitilde ] }; +// key <AB07> { [ m, M ], +// [ mu, Acircumflex ] }; +// key <RALT> { [ Mode_switch, Multi_key ] }; +// modifier_map Mod3 { Mode_switch }; + +}; diff --git a/symbols/mk b/symbols/mk new file mode 100644 index 00000000..c3c5c02d --- /dev/null +++ b/symbols/mk @@ -0,0 +1,67 @@ + +// base on keyboard map: +// Author: Damjan Georgievski <gdamjan@freemail.org.mk> +// Revision: 1.4 +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Macedonian"; + + key <AB01> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <AC02> { [ Cyrillic_es, Cyrillic_ES ] }; + key <AC01> { [ Cyrillic_a, Cyrillic_A ] }; + key <AD01> { [ Cyrillic_lje, Cyrillic_LJE ] }; + key <AD02> { [ Cyrillic_nje, Cyrillic_NJE ] }; + key <AB03> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <AB02> { [ Cyrillic_dzhe, Cyrillic_DZHE ] }; + key <AC03> { [ Cyrillic_de, Cyrillic_DE ] }; + key <AD03> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <AB04> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <AC04> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <AD05> { [ Cyrillic_te, Cyrillic_TE ] }; + key <AD04> { [ Cyrillic_er, Cyrillic_ER ] }; + key <AB06> { [ Cyrillic_en, Cyrillic_EN ] }; + key <AB05> { [ Cyrillic_be, Cyrillic_BE ] }; + key <AC06> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <AC05> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <AD06> { [ Macedonia_dse, Macedonia_DSE ] }; + key <AB07> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AC07> { [ Cyrillic_je, Cyrillic_JE ] }; + key <AD07> { [ Cyrillic_u, Cyrillic_U ] }; + key <AC08> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <AD08> { [ Cyrillic_i, Cyrillic_I ] }; + key <AD09> { [ Cyrillic_o, Cyrillic_O ] }; + key <AC09> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AC10> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <AD10> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AC11> { [ Macedonia_kje, Macedonia_KJE ] }; + key <AD11> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AD12> { [ Macedonia_gje, Macedonia_GJE ] }; + key <BKSL> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <AE12> { [ equal, plus ] }; + key <AE11> { [ minus, underscore ] }; + key <TLDE> { [ grave, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, doublelowquotemark ] }; + key <AE03> { [ 3, leftdoublequotemark ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AB08> { [ comma, semicolon ] }; + key <AB09> { [ period, colon ] }; + key <AB10> { [ slash, question ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "pc104" { + include "pc/mk(basic)" + include "pc/mk(win)" +}; + diff --git a/symbols/ml b/symbols/ml new file mode 100644 index 00000000..ef476724 --- /dev/null +++ b/symbols/ml @@ -0,0 +1,91 @@ + +// Description : A keymap for Malayalam +// Encoding : Unicode (http://www.unicode.org) +// Author : Baiju M <baiju@freeshell.org> +// Date : Sat Aug 17 21:10:48 IST 2002 +// Mapping: + +default partial alphanumeric_keys +xkb_symbols "basic" { + + name[Group1] = "Malayalam"; + + //From grave to backslash (\) + + key <TLDE> { [ 0x01000d4a , 0x01000d12 ] }; + key <AE01> { [1 , exclam ] }; + key <AE02> { [2 , at ] }; + key <AE03> { [3 , numbersign ] }; + key <AE04> { [4 , dollar ] }; + key <AE05> { [5 , percent ] }; + key <AE06> { [6 ,asciicircum ] }; + key <AE07> { [7 , ampersand ] }; + key <AE08> { [8 , 0x01000d7e ] }; + key <AE09> { [9 , parenleft ] }; + key <AE10> { [0 , parenright ] }; + key <AE11> { [ minus , 0x01000d03 ] }; + key <AE12> { [ 0x01000d43 , 0x01000d0b ] }; + key <BKSL> { [ 0x01000d7c ] }; + + // From 'q' to right bracket (]) + + key <AD01> { [ 0x01000d4c , 0x01000d14 ] }; + key <AD02> { [ 0x01000d48 , 0x01000d10 ] }; + key <AD03> { [ 0x01000d3e , 0x01000d06 ] }; + key <AD04> { [ 0x01000d40 , 0x01000d08 ] }; + key <AD05> { [ 0x01000d42 , 0x01000d0a ] }; + key <AD06> { [ 0x01000d2c , 0x01000d2d ] }; + key <AD07> { [ 0x01000d39 , 0x01000d19 ] }; + key <AD08> { [ 0x01000d17 , 0x01000d18 ] }; + key <AD09> { [ 0x01000d26 , 0x01000d27 ] }; + key <AD10> { [ 0x01000d1c , 0x01000d1d ] }; + key <AD11> { [ 0x01000d21 , 0x01000d22 ] }; + key <AD12> { [ 0x0100200d , 0x01000d1e ] }; + + // From 'a' to apostrophe (') + + key <AC01> { [ 0x01000d4b , 0x01000d13 ] }; + key <AC02> { [ 0x01000d47 , 0x01000d0f ] }; + key <AC03> { [ 0x01000d4d , 0x01000d05 ] }; + key <AC04> { [ 0x01000d3f , 0x01000d07 ] }; + key <AC05> { [ 0x01000d41 , 0x01000d09 ] }; + key <AC06> { [ 0x01000d2a , 0x01000d2b ] }; + key <AC07> { [ 0x01000d30 , 0x01000d31 ] }; + key <AC08> { [ 0x01000d15 , 0x01000d16 ] }; + key <AC09> { [ 0x01000d24 , 0x01000d25 ] }; + key <AC10> { [ 0x01000d1a , 0x01000d1b ] }; + key <AC11> { [ 0x01000d1f , 0x01000d20 ] }; + + // From 'z' to slash (/) + + key <AB01> { [ 0x01000d46 , 0x01000d0e ] }; + key <AB02> { [ 0x01000d02 , 0x01000d7a ] }; + key <AB03> { [ 0x01000d2e , 0x01000d23 ] }; + key <AB04> { [ 0x01000d28 , 0x01000d7b ] }; + key <AB05> { [ 0x01000d35 , 0x01000d34 ] }; + key <AB06> { [ 0x01000d32 , 0x01000d33 ] }; + key <AB07> { [ 0x01000d38 , 0x01000d36 ] }; + key <AB08> { [ comma , 0x01000d37 ] }; + key <AB09> { [ period , 0x01000d7d ] }; + key <AB10> { [ 0x01000d2f , question ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "mlplusnum" { + + // Modifies the basic layout to include malayalam numbers + + include "pc/ml(basic)" + + key <AE01> { [ 0x01000d67 , exclam ] }; + key <AE02> { [ 0x01000d68 , at ] }; + key <AE03> { [ 0x01000d69 , numbersign ] }; + key <AE04> { [ 0x01000d6a , dollar ] }; + key <AE05> { [ 0x01000d6b , percent ] }; + key <AE06> { [ 0x01000d6c , asciicircum ] }; + key <AE07> { [ 0x01000d6d , ampersand ] }; + key <AE08> { [ 0x01000d6e , 0x01000d7e ] }; + key <AE09> { [ 0x01000d6f , parenleft ] }; + key <AE10> { [ 0x01000d66 , parenright ] }; +}; diff --git a/symbols/mm b/symbols/mm new file mode 100644 index 00000000..a85704ce --- /dev/null +++ b/symbols/mm @@ -0,0 +1,66 @@ + +// based on a keyboard map from an 'xkb/symbols/mm' file +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Burmese"; + +// Mainly numbers. + key <AE01> { [ 0x1001041, exclam ] }; + key <AE02> { [ 0x1001042 ] }; + key <AE03> { [ 0x1001043 ] }; + key <AE04> { [ 0x1001044 ] }; + key <AE05> { [ 0x1001045 ] }; + key <AE06> { [ 0x1001046 ] }; + key <AE07> { [ 0x1001047 ] }; + key <AE08> { [ 0x1001048 ] }; + key <AE09> { [ 0x1001049, parenleft ] }; + key <AE10> { [ 0x1001040, parenright ] }; + key <AE11> { [ minus, 0x1001038 ] }; + key <AE12> { [ 0x1001052, 0x1001056 ] }; + +// Mainly long vowels + key <AD01> { [ 0x100102A, 0x100102A ] }; + key <AD02> { [ 0x1001032, 0x1001032 ] }; + key <AD03> { [ 0x100102C, 0x1001021 ] }; + key <AD04> { [ 0x100102E, 0x1001024 ] }; + key <AD05> { [ 0x1001030, 0x1001026 ] }; + +// Mainly voiced consonants + key <AD06> { [ 0x1001017, 0x1001018 ] }; + key <AD07> { [ 0x100101F, 0x1001004 ] }; + key <AD08> { [ 0x1001002, 0x1001003 ] }; + key <AD09> { [ 0x1001012, 0x1001013 ] }; + key <AD10> { [ 0x1001007, 0x1001008 ] }; + key <AD11> { [ 0x100100d, 0x100100e ] }; + key <AD12> { [ 0x100100a, 0x1001009 ] }; + +// Mainly short vowels + key <AC01> { [ 0x1001029, 0x1001029 ] }; + key <AC02> { [ 0x1001027, 0x1001027 ] }; + key <AC03> { [ 0x1001039, 0x1001021 ] }; + key <AC04> { [ 0x100102D, 0x1001023 ] }; + key <AC05> { [ 0x100102F, 0x1001025 ] }; + +// Mainly unvoiced consonants + key <AC06> { [ 0x1001015, 0x1001016 ] }; + key <AC07> { [ 0x100101B, 0x100101B ] }; + key <AC08> { [ 0x1001000, 0x1001001 ] }; + key <AC09> { [ 0x1001010, 0x1001011 ] }; + key <AC10> { [ 0x1001005, 0x1001006 ] }; + key <AC11> { [ 0x100100b, 0x100100c ] }; + key <BKSL> { [ 0x100104E, 0x100104F ] }; + + key <AB01> { [ 0x100104C, 0x100104D ] }; + key <AB02> { [ 0x1001037, 0x1001036 ] }; + key <AB03> { [ 0x1001019, 0x100100f ] }; + key <AB04> { [ 0x1001014, 0x1001014 ] }; + key <AB05> { [ 0x1001017, 0x1001017 ] }; + key <AB06> { [ 0x100101C, 0x100101C ] }; + key <AB07> { [ 0x100101E, 0x1001050 ] }; + key <AB08> { [ comma, 0x1001051 ] }; + key <AB09> { [ period, 0x100104A ] }; + key <AB10> { [ slash, 0x100101A ] }; +}; diff --git a/symbols/mt b/symbols/mt new file mode 100644 index 00000000..a295be3e --- /dev/null +++ b/symbols/mt @@ -0,0 +1,34 @@ +// Maltese keyboard map (based on MSA Standard DMS100) +// by Ramon Casha (ramon.casha@linux.org.mt) +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/mt,v 1.3 2002/12/13 04:18:04 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Maltese"; + + // The following four sets are the four additional letters, with the UK + // equivalents + key <TLDE> { [ cabovedot, Cabovedot, grave, notsign ] }; + key <AD11> { [ gabovedot, Gabovedot, bracketleft, braceleft ] }; + key <AD12> { [ hstroke, Hstroke, bracketright, braceright ] }; + key <LSGT> { [ zabovedot, Zabovedot, backslash, bar ] }; + + // Euro symbol + key <AE03> { [ 3, EuroSign, sterling ] }; + + // Long accent + key <AE06> { [ 6, asciicircum, dead_circumflex, dead_circumflex ] }; + + // Normal accented vowels + key <AD03> { [ e, E, egrave, Egrave ] }; + key <AD07> { [ u, U, ugrave, Ugrave ] }; + key <AD08> { [ i, I, igrave, Igrave ] }; + key <AD09> { [ o, O, ograve, Ograve ] }; + key <AC01> { [ a, A, agrave, Agrave ] }; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/mt_us b/symbols/mt_us new file mode 100644 index 00000000..dfc4a4bc --- /dev/null +++ b/symbols/mt_us @@ -0,0 +1,22 @@ +// Maltese keyboard map (based on MSA Standard DMS100, annex A) +// by Ramon Casha (ramon.casha@linux.org.mt) +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/mt" + + // Describes the differences between the mt + // keyboard and a US-based physical keyboard + + name[Group1]="Maltese (US layout)"; + + key <BKSL> { [ zabovedot, Zabovedot, backslash, bar ] }; + + key <TLDE> { [ cabovedot, Cabovedot, grave, asciitilde ] }; + + key <AE03> { [ 3, EuroSign, numbersign ] }; + +}; diff --git a/symbols/nec.vndr/jp b/symbols/nec.vndr/jp new file mode 100644 index 00000000..0439677e --- /dev/null +++ b/symbols/nec.vndr/jp @@ -0,0 +1,167 @@ +// $Xorg: jp,v 1.4 2001/02/09 02:05:53 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/symbols/nec/jp,v 3.9 2001/01/17 23:46:03 dawes Exp $ +// +// symbols for a NEC PC98 keyboard +default xkb_symbols "pc98" { + + key <ESC> { [ Escape ] }; + + // Alphanumeric section + key <AE01> { [ 1, exclam ], [ kana_NU ] }; + key <AE02> { [ 2, quotedbl ], [ kana_FU ] }; + key <AE03> { [ 3, numbersign ], [ kana_A, kana_a ] }; + key <AE04> { [ 4, dollar ], [ kana_U, kana_u ] }; + key <AE05> { [ 5, percent ], [ kana_E, kana_e ] }; + key <AE06> { [ 6, ampersand ], [ kana_O, kana_o ] }; + key <AE07> { [ 7, apostrophe ], [ kana_YA, kana_ya ] }; + key <AE08> { [ 8, parenleft ], [ kana_YU, kana_yu ] }; + key <AE09> { [ 9, parenright ], [ kana_YO, kana_yo ] }; + key <AE10> { [ 0 ], [ kana_WA, kana_WO ] }; + key <AE11> { [ minus, equal ], [ kana_HO ] }; + key <AE12> { [ asciicircum, quoteleft ], [ kana_HE ] }; + key <BKSL> { [ backslash, bar ], [ prolongedsound ] }; + key <BKSP> { [ BackSpace ] }; + + key <TAB> { [ Tab, ISO_Left_Tab ] }; + key <AD01> { [ q, Q ], [ kana_TA ] }; + key <AD02> { [ w, W ], [ kana_TE ] }; + key <AD03> { [ e, E ], [ kana_I, kana_i ] }; + key <AD04> { [ r, R ], [ kana_SU ] }; + key <AD05> { [ t, T ], [ kana_KA ] }; + key <AD06> { [ y, Y ], [ kana_N ] }; + key <AD07> { [ u, U ], [ kana_NA ] }; + key <AD08> { [ i, I ], [ kana_NI ] }; + key <AD09> { [ o, O ], [ kana_RA ] }; + key <AD10> { [ p, P ], [ kana_SE ] }; + key <AD11> { [ at, asciitilde ], [ voicedsound ] }; + key <AD12> { [ bracketleft, braceleft ], [ semivoicedsound, kana_openingbracket ] }; + key <RTRN> { [ Return ] }; + + key <LCTL> { [ Control_L ] }; + key <CAPS> { [ Caps_Lock ] }; + key <AC01> { [ a, A ], [ kana_CHI ] }; + key <AC02> { [ s, S ], [ kana_TO ] }; + key <AC03> { [ d, D ], [ kana_SHI ] }; + key <AC04> { [ f, F ], [ kana_HA ] }; + key <AC05> { [ g, G ], [ kana_KI ] }; + key <AC06> { [ h, H ], [ kana_KU ] }; + key <AC07> { [ j, J ], [ kana_MA ] }; + key <AC08> { [ k, K ], [ kana_NO ] }; + key <AC09> { [ l, L ], [ kana_RI ] }; + key <AC10> { [ semicolon, plus ], [ kana_RE ] }; + key <AC11> { [ colon, asterisk ], [ kana_KE ] }; + key <AC12> { [ bracketright, braceright ], [ kana_MU, kana_closingbracket ] }; + + key <LFSH> { [ Shift_L ] }; + key <AB01> { [ z, Z ], [ kana_TSU, kana_tsu ] }; + key <AB02> { [ x, X ], [ kana_SA ] }; + key <AB03> { [ c, C ], [ kana_SO ] }; + key <AB04> { [ v, V ], [ kana_HI ] }; + key <AB05> { [ b, B ], [ kana_KO ] }; + key <AB06> { [ n, N ], [ kana_MI ] }; + key <AB07> { [ m, M ], [ kana_MO ] }; + key <AB08> { [ comma, less ], [ kana_NE, kana_comma ] }; + key <AB09> { [ period, greater ], [ kana_RU, kana_fullstop ] }; + key <AB10> { [ slash, question ], [ kana_ME, kana_middledot ] }; + key <AB11> { [ NoSymbol, underscore ], [ kana_RO ] }; +// key <RTSH> { [ Shift_R ] }; + + key <ALGR> { [ Mode_switch ] }; + key <LALT> { [ Alt_L ] }; + key <NFER> { [ Muhenkan ] }; + key <SPCE> { [ space ] }; + key <XFER> { [ Henkan, Kanji ] }; + + // End alphanumeric section + + // Begin "Function" section + key <BRK> { [ Break ] }; + key <PRSC> { [ Print ] }; + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ] }; + key <FK12> { [ F12 ] }; + key <FK13> { [ F13 ] }; + key <FK14> { [ F14 ] }; + key <FK15> { [ F15 ] }; + // End "Function" section + + // Begin "Editing" section + key <INS> { [ Insert ] }; + key <DELE> { [ Delete ] }; + key <PGUP> { [ Prior ] }; + key <PGDN> { [ Next ] }; + key <UP> { [ Up ] }; + key <LEFT> { [ Left ] }; + key <RGHT> { [ Right ] }; + key <DOWN> { [ Down ] }; + // End "Editing" section + + // Begin "Keypad" section + key <HOME> { [ Clear, Home ] }; + key <HELP> { [ Help ] }; + key <KPSU> { [ KP_Subtract ] }; + key <KPDV> { [ KP_Divide ] }; + + key <KP7> { [ KP_7 ] }; + key <KP8> { [ KP_8 ] }; + key <KP9> { [ KP_9 ] }; + key <KPMU> { [ KP_Multiply ] }; + + key <KP4> { [ KP_4 ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_6 ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP1> { [ KP_1 ] }; + key <KP2> { [ KP_2 ] }; + key <KP3> { [ KP_3 ] }; + key <KPEQ> { [ KP_Equal ] }; + + key <KP0> { [ KP_0 ] }; + key <KPSP> { [ KP_Separator ] }; + key <KPDC> { [ KP_Decimal ] }; +// key <KPEN> { [ KP_Enter ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod1 { Alt_L }; + modifier_map Mod2 { Mode_switch }; +}; + diff --git a/symbols/nl b/symbols/nl new file mode 100644 index 00000000..66f2ce2f --- /dev/null +++ b/symbols/nl @@ -0,0 +1,54 @@ + +// based on +// Converted keytable file to xkb/symbols/ file +// with mk_xkb by root@linux.chanae.stben.be Tue Sep 30 00:53:29 MET DST 1997 + +// converted from the nl-latin.map of the Linux kbd package by +// Pablo Saratxaga <srtxg@f2219.n293.z2.fidonet.org> +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/nl,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Nederland"; + + key <AE02> { [ 2, quotedbl, twosuperior, oneeighth ] }; + key <AE06> { [ 6, ampersand, threequarters, fiveeighths ] }; + key <AE07> { [ 7, underscore, sterling, seveneighths ] }; + key <AE08> { [ 8, parenleft, braceleft, trademark ] }; + key <AE09> { [ 9, parenright, braceright, plusminus ] }; + key <AE10> { [ 0, apostrophe, braceright, degree ] }; + key <AE11> { [ slash, question, backslash, questiondown ] }; + key <AE12> { [ degree, dead_tilde, dead_cedilla, dead_ogonek ] }; + + key <AD03> { [ e, E, eacute, Eacute ] }; + key <AD05> { [ t, T, thorn, THORN ] }; + key <AD06> { [ y, Y, ydiaeresis, yen ] }; + key <AD07> { [ u, U, udiaeresis, Udiaeresis ] }; + key <AD08> { [ i, I, idiaeresis, Idiaeresis ] }; + key <AD09> { [ o, O, ograve, Ograve ] }; + key <AD10> { [ p, P, paragraph, THORN ] }; + key <AD11> { [dead_diaeresis, dead_tilde, asciitilde, asciicircum] }; + key <AD12> { [ asterisk, bar, dead_tilde, dead_macron ] }; + + key <AC01> { [ a, A, aacute, Aacute ] }; + key <AC04> { [ f, F, ordfeminine, ordfeminine ] }; + key <AC10> { [ plus, plusminus, dead_acute, dead_doubleacute ] }; + key <AC11> { [apostrophe, grave, dead_acute, dead_grave ] }; + key <TLDE> { [ at, section, notsign, notsign ] }; + + key <BKSL> { [ less, greater, dead_grave, dead_breve ] }; + key <AB06> { [ n, N, ntilde, Ntilde ] }; + key <AB07> { [ m, M, Greek_mu, masculine ] }; + key <AB08> { [ comma, semicolon, cedilla, guillemotleft] }; + key <AB09> { [ period, colon, periodcentered, guillemotright ] }; + key <AB10> { [ minus, equal, hyphen, dead_abovedot] }; + + key <LSGT> { [bracketleft, bracketright, bar, brokenbar ] }; + + include "level3(ralt_switch_multikey)" +}; + diff --git a/symbols/no b/symbols/no new file mode 100644 index 00000000..76bda26f --- /dev/null +++ b/symbols/no @@ -0,0 +1,46 @@ + +// based on a keyboard map from an 'xkb/symbols/no' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/no,v 1.3 2002/12/19 01:07:56 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Norwegian keyboard with dead key support + // and all of ISO-8859-1 characters available. + + include "pc/latin(type2)" + + name[Group1]="Norwegian"; + + key <AE11> { [ plus, question, plusminus, questiondown ] }; + key <AE12> { [ backslash, dead_grave, dead_acute, notsign ] }; + + + key <AC10> { [ oslash, Ooblique, dead_acute, dead_doubleacute ] }; + key <AC11> { [ ae, AE, dead_circumflex, dead_caron] }; + key <TLDE> { [ bar, section, brokenbar, paragraph ] }; + + key <BKSL> { [apostrophe, asterisk, dead_doubleacute, multiply ] }; + key <LSGT> { [ less, greater, onehalf, threequarters] }; + + key <KPDL> { [ KP_Delete, KP_Separator ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Norwegian layout to eliminate dead keys + + include "pc/no(basic)" + + key <AE12> { [ backslash, grave, acute, ogonek ] }; + key <AD12> { [ diaeresis, asciicircum, asciitilde, macron ] }; + key <AC10> { [ oslash, Ooblique, acute, doubleacute ] }; + key <AC11> { [ ae, AE, asciicircum, caron ] }; + key <AB08> { [ comma, semicolon, cedilla, ogonek ] }; + key <AB09> { [ period, colon, periodcentered, abovedot ] }; +}; diff --git a/symbols/ogham b/symbols/ogham new file mode 100644 index 00000000..fb050980 --- /dev/null +++ b/symbols/ogham @@ -0,0 +1,206 @@ +// $XFree86: xc/programs/xkbcomp/symbols/pc/ogham,v 1.2 2002/12/19 00:49:41 dawes Exp $ +// +// Ogham keyboard map for XFree86 +// +// Seamus O Ciardhuain <seoc@cnds.ucd.ie> (17 December 2002) +// +// Ogham keyboard layout as recommended in I.S. 434:1999. +// Suitable for multi-layout xkbcomp. +// Character names are given as in the Unicode standard, +// range U+1680 to U+169F. + + +default partial alphanumeric_keys +xkb_symbols "basic" { + + name[Group1] = "Ogham"; + + key.type[Group1] = "ONE_LEVEL"; + + key <LSGT> { type[Group1]="TWO_LEVEL", + [ 0x100169B, 0x100169C ] }; + // OGHAM FEATHER MARK, OGHAM REVERSED FEATHER MARK + + key <BKSL> { [ 0x1001680 ] }; // OGHAM SPACE MARK + + key <TLDE> { [ 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + + key <SPCE> { [ space ] }; + + // + // Top Row QWERTYUIOP + // + key <AD01> { [ 0x100168A ] }; // OGHAM LETTER CEIRT + key <AD02> { [ 0x1001695 ] }; // OGHAM LETTER EABHADH + key <AD03> { [ 0x1001693 ] }; // OGHAM LETTER EADHADH + key <AD04> { [ 0x100168F ] }; // OGHAM LETTER RUIS + key <AD05> { [ 0x1001688 ] }; // OGHAM LETTER TINNE + key <AD06> { [ 0x1001698 ] }; // OGHAM LETTER IFIN + key <AD07> { [ 0x1001692 ] }; // OGHAM LETTER UR + key <AD08> { [ 0x1001694 ] }; // OGHAM LETTER IODHADH + key <AD09> { [ 0x1001691 ] }; // OGHAM LETTER ONN + key <AD10> { [ 0x100169A ] }; // OGHAM LETTER PEITH + + // + // Middle Row ASDFGHJKL + // + key <AC01> { [ 0x1001690 ] }; // OGHAM LETTER AILM + key <AC02> { [ 0x1001684 ] }; // OGHAM LETTER SAIL + key <AC03> { [ 0x1001687 ] }; // OGHAM LETTER DAIR + key <AC04> { [ 0x1001683 ] }; // OGHAM LETTER FEARN + key <AC05> { [ 0x100168C ] }; // OGHAM LETTER GORT + key <AC06> { [ 0x1001686 ] }; // OGHAM LETTER UATH + key <AC07> { [ 0x1001697 ] }; // OGHAM LETTER UILLEANN + key <AC08> { [ 0x1001696 ] }; // OGHAM LETTER OR + key <AC09> { [ 0x1001682 ] }; // OGHAM LETTER LUIS + + // + // Bottom Row ZXCVBNM + // + key <AB01> { [ 0x100168E ] }; // OGHAM LETTER STRAIF + key <AB02> { [ 0x1001699 ] }; // OGHAM LETTER EAMHANCHOLL + key <AB03> { [ 0x1001689 ] }; // OGHAM LETTER COLL + key <AB04> { [ 0x100168D ] }; // OGHAM LETTER NGEADAL + key <AB05> { [ 0x1001681 ] }; // OGHAM LETTER BEITH + key <AB06> { [ 0x1001685 ] }; // OGHAM LETTER NION + key <AB07> { [ 0x100168B ] }; // OGHAM LETTER MUIN + + // As an extension because <BKSL> and <LSGT> may not be + // available or sensible. These are also a bit more + // intuitive on a standard Irish keyboard. + key <AB08> { [ 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key <AB09> { [ 0x100169B ] }; // OGHAM FEATHER MARK + key <AB10> { [ 0x1001680 ] }; // OGHAM SPACE MARK + + key <RWIN> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "laptop" { + // For laptops which don't have the RWIN key but are otherwise + // the same as 105-key layouts. + include "ogham(basic)" + key <MENU> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + + +partial alphanumeric_keys +xkb_symbols "is434" { + + // This has the full layout of IS434 with an Irish QWERTY keyboard, + // and the Ogham characters accessed when CAPS LOCK is on. + + name[Group1] = "Ogham (IS434)"; + + key.type[Group1] = "THREE_LEVEL"; + + key <LSGT> { type[Group1] = "FOUR_LEVEL_ALPHABETIC", + [ backslash, bar, 0x100169B, 0x100169C ] }; + // OGHAM FEATHER MARK, OGHAM REVERSED FEATHER MARK + + key <BKSL> { [ numbersign, asciitilde, 0x1001680 ] }; // OGHAM SPACE MARK + key <TLDE> { [ grave, notsign, 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key <SPCE> { [ space, space, space ] }; + + // + // Numeric row + // + key <AE01> { type[Group1]="TWO_LEVEL", [ 1, exclam ] }; + key <AE02> { type[Group1]="TWO_LEVEL", [ 2, quotedbl ] }; + key <AE03> { type[Group1]="TWO_LEVEL", [ 3, sterling ] }; + key <AE04> { [ 4, dollar, EuroSign ] }; + key <AE05> { type[Group1]="TWO_LEVEL", [ 5, percent ] }; + key <AE06> { type[Group1]="TWO_LEVEL", [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand, 0x100204A ] }; // Tironian Et + key <AE08> { type[Group1]="TWO_LEVEL", [ 8, asterisk ] }; + key <AE09> { type[Group1]="TWO_LEVEL", [ 9, parenleft ] }; + key <AE10> { type[Group1]="TWO_LEVEL", [ 0, parenright ] }; + key <AE11> { type[Group1]="TWO_LEVEL", [ minus, underscore ] }; + key <AE12> { type[Group1]="TWO_LEVEL", [ equal, plus ] }; + + // + // Top Row QWERTYUIOP + // + key <AD01> { [ q, Q, 0x100168A ] }; // OGHAM LETTER CEIRT + key <AD02> { [ w, W, 0x1001695 ] }; // OGHAM LETTER EABHADH + key <AD03> { [ e, E, 0x1001693 ] }; // OGHAM LETTER EADHADH + key <AD04> { [ r, R, 0x100168F ] }; // OGHAM LETTER RUIS + key <AD05> { [ t, T, 0x1001688 ] }; // OGHAM LETTER TINNE + key <AD06> { [ y, Y, 0x1001698 ] }; // OGHAM LETTER IFIN + key <AD07> { [ u, U, 0x1001692 ] }; // OGHAM LETTER UR + key <AD08> { [ i, I, 0x1001694 ] }; // OGHAM LETTER IODHADH + key <AD09> { [ o, O, 0x1001691 ] }; // OGHAM LETTER ONN + key <AD10> { [ p, P, 0x100169A ] }; // OGHAM LETTER PEITH + + // + // Middle Row ASDFGHJKL + // + key <AC01> { [ a, A, 0x1001690 ] }; // OGHAM LETTER AILM + key <AC02> { [ s, S, 0x1001684 ] }; // OGHAM LETTER SAIL + key <AC03> { [ d, D, 0x1001687 ] }; // OGHAM LETTER DAIR + key <AC04> { [ f, F, 0x1001683 ] }; // OGHAM LETTER FEARN + key <AC05> { [ g, G, 0x100168C ] }; // OGHAM LETTER GORT + key <AC06> { [ h, H, 0x1001686 ] }; // OGHAM LETTER UATH + key <AC07> { [ j, J, 0x1001697 ] }; // OGHAM LETTER UILLEANN + key <AC08> { [ k, K, 0x1001696 ] }; // OGHAM LETTER OR + key <AC09> { [ l, L, 0x1001682 ] }; // OGHAM LETTER LUIS + + // + // Bottom Row ZXCVBNM + // + key <AB01> { [ z, Z, 0x100168E ] }; // OGHAM LETTER STRAIF + key <AB02> { [ x, X, 0x1001699 ] }; // OGHAM LETTER EAMHANCHOLL + key <AB03> { [ c, C, 0x1001689 ] }; // OGHAM LETTER COLL + key <AB04> { [ v, V, 0x100168D ] }; // OGHAM LETTER NGEADAL + key <AB05> { [ b, B, 0x1001681 ] }; // OGHAM LETTER BEITH + key <AB06> { [ n, N, 0x1001685 ] }; // OGHAM LETTER NION + key <AB07> { [ m, M, 0x100168B ] }; // OGHAM LETTER MUIN + + // As an extension because <BKSL> and <LSGT> may not be + // available or sensible. These are also a bit more + // intuitive on a standard Irish keyboard. + key <AB08> { [ comma, less, 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key <AB09> { [ period, greater, 0x100169B ] }; // OGHAM FEATHER MARK + key <AB10> { [ slash, question, 0x1001680 ] }; // OGHAM SPACE MARK + + // The standard says the Ogham characters should be accessed when + // Caps Lock is down; not clear if this means it should lock but + // seems logical. + + key <CAPS> { type[Group1] = "ONE_LEVEL", [ ISO_Level3_Lock ] }; + + // Also allow access to Ogham characters using RALT for convenience + key <RALT> { type[Group1] = "ONE_LEVEL", [ ISO_Level3_Shift ] }; + + modifier_map Mod5 { ISO_Level3_Shift, ISO_Level3_Lock }; + + // Redefine Scroll Lock as locking shift in case that's needed. + // Also overcomes annoying use of Scroll Lock LED inherited from + // US symbols but not relevant here since we're not changing group. + key <SCLK> {type[Group1] = "ONE_LEVEL", [ Shift_Lock ] }; + modifier_map Shift { Shift_Lock }; + + key <RWIN> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "IS434" { + // just has uppercase in the name + include "ogham(is434)" +}; + +partial alphanumeric_keys +xkb_symbols "is434laptop" { + // For laptops which don't have the RWIN key but are otherwise + // the same as 105-key layouts. + include "ogham(is434)" + key <MENU> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "IS434laptop" { + // just has uppercase in the name + include "ogham(is434)" + key <MENU> { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; diff --git a/symbols/ori b/symbols/ori new file mode 100644 index 00000000..39018258 --- /dev/null +++ b/symbols/ori @@ -0,0 +1,66 @@ +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + // Inscript layout for Oriya + // Author: G Karunakar <karunakar@freedomink.org> + // Date: Wed Nov 13 18:16:19 IST 2002 + + name[Group1]= "Oriya"; + + key <TLDE> { [ 0x01000b4a, 0x01000b12 ] }; + key <AE01> { [ 0x01000b67, 0x01000b0d ] }; + key <AE02> { [ 0x01000b68, 0x01000b45 ] }; + key <AE03> { [ 0x01000b69 ] }; + key <AE04> { [ 0x01000b6a ] }; + key <AE05> { [ 0x01000b6b ] }; + key <AE06> { [ 0x01000b6c ] }; + key <AE07> { [ 0x01000b6d ] }; + key <AE08> { [ 0x01000b6e ] }; + key <AE09> { [ 0x01000b6f ] }; + key <AE10> { [ 0x01000b66 ] }; + key <AE11> { [ 0x01000b03 ] }; + key <AE12> { [ 0x01000b43, 0x01000b0b ] }; + + key <AD01> { [ 0x01000b4c, 0x01000b14 ] }; + key <AD02> { [ 0x01000b48, 0x01000b10 ] }; + key <AD03> { [ 0x01000b3e, 0x01000b06 ] }; + key <AD04> { [ 0x01000b40, 0x01000b08 ] }; + key <AD05> { [ 0x01000b42, 0x01000b0a ] }; + key <AD06> { [ 0x01000b2c, 0x01000b2d ] }; + key <AD07> { [ 0x01000b39, 0x01000b19 ] }; + key <AD08> { [ 0x01000b17, 0x01000b18 ] }; + key <AD09> { [ 0x01000b26, 0x01000b27 ] }; + key <AD10> { [ 0x01000b1c, 0x01000b1d ] }; + key <AD11> { [ 0x01000b21, 0x01000b22 ] }; + key <AD12> { [ 0x01000b3c, 0x01000b1e ] }; + + key <AC01> { [ 0x01000b4b, 0x01000b13 ] }; + key <AC02> { [ 0x01000b47, 0x01000b0f ] }; + key <AC03> { [ 0x01000b4d, 0x01000b05 ] }; + key <AC04> { [ 0x01000b3f, 0x01000b07 ] }; + key <AC05> { [ 0x01000b41, 0x01000b09 ] }; + key <AC06> { [ 0x01000b2a, 0x01000b2b ] }; + key <AC07> { [ 0x01000b30, 0x01000b31 ] }; + key <AC08> { [ 0x01000b15, 0x01000b16 ] }; + key <AC09> { [ 0x01000b24, 0x01000b25 ] }; + key <AC10> { [ 0x01000b1a, 0x01000b1b ] }; + key <AC11> { [ 0x01000b1f, 0x01000b20 ] }; + + key <AB01> { [ 0x01000b46, 0x01000b0e ] }; + key <AB02> { [ 0x01000b02, 0x01000b01 ] }; + key <AB03> { [ 0x01000b2e, 0x01000b23 ] }; + key <AB04> { [ 0x01000b28, 0x01000b29 ] }; + key <AB05> { [ 0x01000b35, 0x01000b34 ] }; + key <AB06> { [ 0x01000b32, 0x01000b33 ] }; + key <AB07> { [ 0x01000b38, 0x01000b36 ] }; + key <AB08> { [ comma , 0x01000b37 ] }; + key <AB09> { [ period , 0x01000b64 ] }; + key <AB10> { [ 0x01000b2f, 0x01000040 ] }; + key <BKSL> { [ 0x01000b49, 0x01000b11 ] }; + + key <RALT> { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods = AltGr + }; +}; diff --git a/symbols/pc b/symbols/pc new file mode 100644 index 00000000..cf2039e9 --- /dev/null +++ b/symbols/pc @@ -0,0 +1,262 @@ + +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/pc,v 1.9 2003/06/09 19:59:46 dawes Exp $ + +partial hidden alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + key <ESC> { [ Escape ] }; + + // Alphanumeric section + key <TLDE> { [ grave, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + + key <BKSP> { + type="CTRL+ALT", + symbols[Group1]= [ BackSpace, Terminate_Server ] + }; + + key <TAB> { [ Tab, ISO_Left_Tab ] }; + key <RTRN> { [ Return ] }; + + key <CAPS> { [ Caps_Lock ] }; + + key <LFSH> { [ Shift_L ] }; + key <BKSL> { [ backslash, bar ] }; + + key <LCTL> { [ Control_L ] }; + key <SPCE> { [ space ] }; + + key <RTSH> { [ Shift_R ] }; + key <LALT> { [ Alt_L ] }; + key <RCTL> { [ Control_R ] }; + key <RALT> { [ Alt_R ] }; + + // End alphanumeric section + + // Begin "Function" section + key <FK01> { + type="CTRL+ALT", + symbols[Group1]= [ F1, XF86_Switch_VT_1 ] + }; + key <FK02> { + type="CTRL+ALT", + symbols[Group1]= [ F2, XF86_Switch_VT_2 ] + }; + key <FK03> { + type="CTRL+ALT", + symbols[Group1]= [ F3, XF86_Switch_VT_3 ] + }; + key <FK04> { + type="CTRL+ALT", + symbols[Group1]= [ F4, XF86_Switch_VT_4 ] + }; + key <FK05> { + type="CTRL+ALT", + symbols[Group1]= [ F5, XF86_Switch_VT_5 ] + }; + key <FK06> { + type="CTRL+ALT", + symbols[Group1]= [ F6, XF86_Switch_VT_6 ] + }; + key <FK07> { + type="CTRL+ALT", + symbols[Group1]= [ F7, XF86_Switch_VT_7 ] + }; + key <FK08> { + type="CTRL+ALT", + symbols[Group1]= [ F8, XF86_Switch_VT_8 ] + }; + key <FK09> { + type="CTRL+ALT", + symbols[Group1]= [ F9, XF86_Switch_VT_9 ] + }; + key <FK10> { + type="CTRL+ALT", + symbols[Group1]= [ F10, XF86_Switch_VT_10 ] + }; + key <FK11> { + type="CTRL+ALT", + symbols[Group1]= [ F11, XF86_Switch_VT_11 ] + }; + key <FK12> { + type="CTRL+ALT", + symbols[Group1]= [ F12, XF86_Switch_VT_12 ] + }; + // End "Function" section + + // Begin "Editing" section + key <PRSC> { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Sys_Req ] + }; + key <SYRQ> { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Sys_Req ] + }; + key <SCLK> { [ Scroll_Lock ] }; + key <PAUS> { + type= "PC_BREAK", + symbols[Group1]= [ Pause, Break ] + }; + key <BRK> { + type= "PC_BREAK", + symbols[Group1]= [ Pause, Break ] + }; + key <INS> { [ Insert ] }; + key <HOME> { [ Home ] }; + key <PGUP> { [ Prior ] }; + key <DELE> { [ Delete ] }; + key <END> { [ End ] }; + key <PGDN> { [ Next ] }; + + key <UP> { [ Up ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <RGHT> { [ Right ] }; + + // End "Editing" section, begin "Keypad" + key <NMLK> { [ Num_Lock, Pointer_EnableKeys ] }; + +// Ungrab cancels server/keyboard/pointer grabs + key <KPDV> { + type="CTRL+ALT", + symbols[Group1]= [ KP_Divide, XF86_Ungrab ] + }; + +// ClsGrb kills whichever client has a grab in effect + key <KPMU> { + type="CTRL+ALT", + symbols[Group1]= [ KP_Multiply, XF86_ClearGrab ] + }; + +// -VMode switches to the previous video mode + key <KPSU> { + type="CTRL+ALT", + symbols[Group1]= [ KP_Subtract, XF86_Prev_VMode ] + }; + + key <KP7> { [ KP_Home, KP_7 ] }; + key <KP8> { [ KP_Up, KP_8 ] }; + key <KP9> { [ KP_Prior, KP_9 ] }; + +// +VMode switches to the next video mode + key <KPAD> { + type="CTRL+ALT", + symbols[Group1]= [ KP_Add, XF86_Next_VMode ] + }; + + key <KP4> { [ KP_Left, KP_4 ] }; + key <KP5> { [ KP_Begin, KP_5 ] }; + key <KP6> { [ KP_Right, KP_6 ] }; + + key <KP1> { [ KP_End, KP_1 ] }; + key <KP2> { [ KP_Down, KP_2 ] }; + key <KP3> { [ KP_Next, KP_3 ] }; + key <KPEN> { [ KP_Enter ] }; + key <KPEQ> { [ KP_Equal ] }; + + key <KP0> { [ KP_Insert, KP_0 ] }; + key <KPDL> { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod2 { Num_Lock }; + + // Fake keys for virtual<->real modifiers mapping + key <LVL3> { [ ISO_Level3_Shift ] }; + key <MDSW> { [ Mode_switch ] }; + modifier_map Mod5 { <LVL3>, <MDSW> }; + + key <ALT> { [ NoSymbol, Alt_L ] }; + modifier_map Mod1 { <ALT>, <LALT> }; + + key <META> { [ NoSymbol, Meta_L ] }; + modifier_map Mod1 { <META> }; + + key <SUPR> { [ NoSymbol, Super_L ] }; + modifier_map Mod4 { <SUPR> }; + + key <HYPR> { [ NoSymbol, Hyper_L ] }; + modifier_map Mod4 { <HYPR> }; +}; + +// definition for the PC-AT type 101 key keyboard +xkb_symbols "pc101" { + include "pc/pc(basic)" + key <LALT> { [ Alt_L, Meta_L ] }; + key <RALT> { [ Alt_R, Meta_R ] }; + +}; + +// definition for the extra key on 102-key keyboards +xkb_symbols "pc102" { + include "pc/pc(pc101)" + key <LSGT> { [ less, greater, bar, brokenbar ] }; +}; + +// definition for the extra keys on 104-key "Windows95" keyboards +default +xkb_symbols "pc104" { + include "pc/pc(basic)" + key <LALT> { [ Alt_L, Meta_L ] }; + key <RALT> { [ Alt_R, Meta_R ] }; + key <LWIN> { [ Super_L ] }; + key <RWIN> { [ Super_R ] }; + key <MENU> { [ Menu ] }; + +}; + +// defintion which includes both the Windows95 keyboards _and_ +// the extra key on most European keyboards. +xkb_symbols "pc105" { + include "pc/pc(pc104)" + key <LSGT> { [ less, greater, bar, brokenbar ] }; +}; + +// common keys which can be overwritten in some layouts +xkb_symbols "common" { + + // Alphanumeric section + key <TLDE> { [ grave, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + + key <BKSL> { [ backslash, bar ] }; + key <SPCE> { [ space ] }; + + // "Keypad" section + key <KPDL> { [ KP_Delete, KP_Decimal ] }; + + // extra keys on 104-key "Windows95" keyboards + key <LWIN> { [ Super_L ] }; + key <RWIN> { [ Super_R ] }; + key <MENU> { [ Menu ] }; + + // the extra key on most European keyboards + key <LSGT> { [ less, greater, bar, brokenbar ] }; +}; diff --git a/symbols/pl b/symbols/pl new file mode 100644 index 00000000..76774752 --- /dev/null +++ b/symbols/pl @@ -0,0 +1,25 @@ + +// based on a keyboard map from an 'xkb/symbols/pl' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/pl,v 1.3 2003/04/19 12:22:12 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Polish"; + + key <AD03> { [ e, E, eogonek, Eogonek ] }; + key <AD09> { [ o, O, oacute, Oacute ] }; + + key <AC01> { [ a, A, aogonek, Aogonek ] }; + key <AC02> { [ s, S, sacute, Sacute ] }; + + key <AB01> { [ z, Z, zabovedot, Zabovedot ] }; + key <AB02> { [ x, X, zacute, Zacute ] }; + key <AB03> { [ c, C, cacute, Cacute ] }; + key <AB06> { [ n, N, nacute, Nacute ] }; + + include "level3(ralt_switch)" +}; diff --git a/symbols/pl2 b/symbols/pl2 new file mode 100644 index 00000000..bb00cfaa --- /dev/null +++ b/symbols/pl2 @@ -0,0 +1,46 @@ + +// based on a keyboard map from an 'xkb/symbols/pl2' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/pl2,v 1.4 2003/04/19 12:22:12 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple QWERTZ Polish keybaord + + include "pc/latin(type3)" + + name[Group1]="Polish"; + + key <AE01> { [ 1, exclam, asciitilde, exclamdown ] }; + key <AE02> { [ 2, quotedbl, dead_caron, oneeighth ] }; + key <AE03> { [ 3, numbersign, dead_circumflex, sterling ] }; + key <AE04> { [ 4, dollar, dead_breve, dollar ] }; + key <AE05> { [ 5, percent, degree, threeeighths ] }; + key <AE06> { [ 6, ampersand, dead_ogonek, fiveeighths ] }; + key <AE07> { [ 7, slash, dead_grave, seveneighths ] }; + key <AE08> { [ 8, parenleft, dead_abovedot, trademark ] }; + key <AE09> { [ 9, parenright, dead_acute, plusminus ] }; + key <AE10> { [ 0, equal, dead_doubleacute, degree ] }; + key <AE11> { [ plus, question, dead_diaeresis, questiondown ] }; + key <AE12> { [apostrophe, asterisk, dead_cedilla, dead_ogonek ] }; + + key <AD03> { [ e, E, EuroSign, cent ] }; + key <AD11> { [ zabovedot, nacute, division, dead_abovering ] }; + key <AD12> { [ sacute, cacute, multiply, dead_macron ] }; + + key <AC02> { [ s, S, dstroke, section ] }; + key <AC03> { [ d, D, Dstroke, ETH ] }; + key <AC08> { [ k, K, kra, ampersand ] }; + key <AC09> { [ l, L, lstroke, Lstroke ] }; + key <AC10> { [ lstroke, Lstroke, dollar, dead_doubleacute ] }; + key <AC11> { [ aogonek, eogonek, ssharp, dead_caron ] }; + key <TLDE> { [ abovedot, dead_ogonek, notsign, notsign ] }; + + key <BKSL> { [ oacute, zacute, dead_grave, dead_breve ] }; + key <AB03> { [ c, C, cent, copyright ] }; + + include "level3(ralt_switch)" +}; + diff --git a/symbols/pt b/symbols/pt new file mode 100644 index 00000000..266a9e82 --- /dev/null +++ b/symbols/pt @@ -0,0 +1,58 @@ + +// based on a keyboard map from an 'xkb/symbols/pt' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/pt,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Portuguese"; + + key <AE03> { [ 3, numbersign, sterling, sterling ] }; + key <AE04> { [ 4, dollar, section, dollar ] }; + key <AE11> { [apostrophe, question, backslash, questiondown ] }; + key <AE12> { [guillemotleft, guillemotright, dead_cedilla, dead_ogonek ] }; + + key <AD11> { [ plus, asterisk, dead_diaeresis, dead_abovering ] }; + key <AD12> { [dead_acute, dead_grave, dead_tilde, dead_macron ] }; + + key <AC10> { [ ccedilla, Ccedilla, dead_acute, dead_doubleacute ] }; + key <AC11> { [ masculine, ordfeminine, dead_circumflex, dead_caron ] }; + key <TLDE> { [ backslash, bar, notsign, notsign ] }; + + key <BKSL> { [dead_tilde, dead_circumflex, dead_grave, dead_breve] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + include "pc/pt(basic)" // for consistent naming + + key <AD11> { [plus, asterisk, SunFA_Diaeresis, SunFA_Diaeresis ] }; + key <BKSL> { [SunFA_Tilde, SunFA_Circum ] }; + key <AD12> { [SunFA_Acute, SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "pc/pt(Sundeadkeys)" // for consistent naming + +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/pt(basic)" // for consistent naming + + key <AE12> { [guillemotleft, guillemotright, cedilla, ogonek ] }; + key <AD11> { [ plus, asterisk, quotedbl, quotedbl ] }; + key <AD12> { [ acute, grave ] }; + key <AC10> { [ ccedilla, Ccedilla, acute, doubleacute ] }; + key <AC11> { [ masculine, ordfeminine, asciicircum, caron ] }; + key <BKSL> { [asciitilde, asciicircum ] }; + key <AB10> { [ minus, underscore, dead_belowdot, abovedot ] }; +}; diff --git a/symbols/ro b/symbols/ro new file mode 100644 index 00000000..c66e38bc --- /dev/null +++ b/symbols/ro @@ -0,0 +1,99 @@ +// $XFree86: xc/programs/xkbcomp/symbols/pc/ro,v 1.6 2003/09/08 13:12:51 pascal Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Romanian keybaord + // Created by Manfred Pohler, <Manfred.Pohler@t-online.de> (C) 2003 + + include "pc/latin" + + name[Group1]="Romanian"; + + // Alphanumeric section + key <TLDE> { [ bracketright, bracketleft ] }; + + key <AE01> { [ 1, exclam, asciitilde, asciitilde ] }; + key <AE02> { [ 2, quotedbl, at, at ] }; + key <AE03> { [ 3, numbersign, asciicircum,asciicircum ] }; + key <AE04> { [ 4, currency ] }; + key <AE05> { [ 5, percent, degree, degree ] }; + key <AE06> { [ 6, ampersand ] }; + key <AE07> { [ 7, slash, grave, grave ] }; + key <AE08> { [ 8, parenleft ] }; + key <AE09> { [ 9, parenright ] }; + key <AE10> { [ 0, equal ] }; + key <AE11> { [ plus, question ] }; + key <AE12> { [ apostrophe, asterisk ] }; + + key <AD01> { [ q, Q, backslash, backslash ] }; + key <AD02> { [ w, W, bar, bar ] }; + key <AD03> { [ e, E, EuroSign, EuroSign ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ z, Z ] }; + key <AD07> { [ u, U ] }; + key <AD08> { [ i, I ] }; + key <AD11> { [ abreve, Abreve, division, division ] }; + key <AD12> { [ icircumflex, Icircumflex, multiply, multiply ] }; + + key <AC04> { [ f, F ] }; + key <AC05> { [ g, G ] }; + key <AC10> { [ scedilla, Scedilla, dollar, dollar ] }; + key <AC11> { [ tcedilla, Tcedilla, ssharp, ssharp ] }; + + key <AB01> { [ y, Y ] }; + key <AB05> { [ b, B, braceleft, braceleft ] }; + key <AB06> { [ n, N, braceright, braceright ] }; + key <AB07> { [ m, M, section, section ] }; + key <AB08> { [ comma, semicolon, less, less ] }; + key <AB09> { [ period, colon, greater, greater ] }; + key <AB10> { [ minus, underscore ] }; + + key <BKSL> { [ acircumflex, Acircumflex ] }; + + // End alphanumeric section, begin "Keypad" + key <KPDL> { [ KP_Delete, KP_Separator ] }; + // End "Keypad" section + + include "level3(ralt_switch_multikey)" +}; + +// based on a keyboard +// Created by Cristian Gafton, <gafton@redhat.com> (C) 2000 +// Modified by Miu Moldovan, <dumol@go.ro> (C) 2001 +// Modified by Marius Andreiana, <mandreiana@yahoo.com> (C) 2001 +// +partial alphanumeric_keys +xkb_symbols "us_ro" { + + include "pc/latin" + + name[Group1]="Romanian for us-keyboard"; + + key <AD01> { [ q, Q, acircumflex, Acircumflex ] }; + key <AD05> { [ t, T, tcedilla, Tcedilla ] }; + key <AD08> { [ i, I, icircumflex, Icircumflex ] }; + + key <AC01> { [ a, A, abreve, Abreve ] }; + key <AC02> { [ s, S, scedilla, Scedilla ] }; + + include "level3(ralt_switch_multikey)" +}; + +// Romanian keyboard with access to German umlauts"; +// Created by Manfred Pohler, <Manfred.Pohler@t-online.de> (C) 2003 +// German umlauts are accessible with <AltGr> and a, o , u, s (+shift for capital letters) +// +partial alphanumeric_keys +xkb_symbols "ro_de" { + + include "pc/ro(basic)" + + name[Group1]="German for Romanian keyboard"; + + key <AD07> { [ u, U, udiaeresis, Udiaeresis ] }; + key <AD09> { [ o, O, odiaeresis, Odiaeresis ] }; + key <AC01> { [ a, A, adiaeresis, Adiaeresis ] }; + key <AC02> { [ s, S, ssharp , ssharp ] }; +}; diff --git a/symbols/ru b/symbols/ru new file mode 100644 index 00000000..c81857f9 --- /dev/null +++ b/symbols/ru @@ -0,0 +1,165 @@ + +// based on +// russian standard keyboard +// AEN <aen@logic.ru> +// Last Changes 2001/12/23 by Leon Kanter <leon@blackcatlinux.com> +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/ru,v 1.3 2003/02/15 22:27:05 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Russian"; + + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, quotedbl ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, asterisk ] }; + key <AE05> { [ 5, colon ] }; + key <AE06> { [ 6, comma ] }; + key <AE07> { [ 7, period ] }; + key <AE08> { [ 8, semicolon ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + key <BKSL> { [ backslash, bar ] }; + key <AB10> { [ slash, question ] }; + key <LSGT> { [ slash, bar ] }; + +key.type[group1]="ALPHABETIC"; + + key <TLDE> { [ Cyrillic_io, Cyrillic_IO ] }; + key <AD01> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <AD02> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <AD03> { [ Cyrillic_u, Cyrillic_U ] }; + key <AD04> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <AD05> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <AD06> { [ Cyrillic_en, Cyrillic_EN ] }; + key <AD07> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <AD08> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AD09> { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key <AD10> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <AD11> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <AD12> { [Cyrillic_hardsign,Cyrillic_HARDSIGN ] }; + key <AC01> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <AC02> { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key <AC03> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <AC04> { [ Cyrillic_a, Cyrillic_A ] }; + key <AC05> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AC06> { [ Cyrillic_er, Cyrillic_ER ] }; + key <AC07> { [ Cyrillic_o, Cyrillic_O ] }; + key <AC08> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AC09> { [ Cyrillic_de, Cyrillic_DE ] }; + key <AC10> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <AC11> { [ Cyrillic_e, Cyrillic_E ] }; + key <AB01> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <AB02> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <AB03> { [ Cyrillic_es, Cyrillic_ES ] }; + key <AB04> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AB06> { [ Cyrillic_te, Cyrillic_TE ] }; + key <AB05> { [ Cyrillic_i, Cyrillic_I ] }; + key <AB07> { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key <AB08> { [ Cyrillic_be, Cyrillic_BE ] }; + key <AB09> { [ Cyrillic_yu, Cyrillic_YU ] }; + +key.type[group1]="TWO_LEVEL"; + + // End alphanumeric section +}; + +partial alphanumeric_keys +xkb_symbols "winkeys" { + include "pc/ru(basic)" + key <AE03> { [ 3, numerosign ] }; + key <AE04> { [ 4, semicolon ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, colon ] }; + key <AE07> { [ 7, question ] }; + key <AE08> { [ 8, asterisk ] }; + key <AB10> { [ period, comma ] }; + key <BKSL> { [ backslash, slash ] }; +}; + +partial alphanumeric_keys +xkb_symbols "typewriter" { + include "pc/ru(basic)" + key <TLDE> { [ apostrophe, quotedbl ] }; + key <AE01> { [ exclam, 1 ] }; + key <AE02> { [ numerosign, 2 ] }; + key <AE03> { [ slash, 3 ] }; + key <AE04> { [ semicolon, 4 ] }; + key <AE05> { [ colon, 5 ] }; + key <AE06> { [ comma, 6 ] }; + key <AE07> { [ period, 7 ] }; + key <AE08> { [ underscore, 8 ] }; + key <AE09> { [ question, 9 ] }; + key <AE10> { [ percent, 0 ] }; + key <BKSL> { [ parenleft, parenright ] }; + +key.type[group1]="ALPHABETIC"; + + key <AD12> { [Cyrillic_hardsign,Cyrillic_HARDSIGN ] }; + key <AB05> { [ Cyrillic_i, Cyrillic_I ] }; + key <AB10> { [ Cyrillic_io, Cyrillic_IO ] }; +}; + +partial alphanumeric_keys +xkb_symbols "phonetic" { + + name[Group1]= "Russian(phonetic)"; + + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, Cyrillic_io ] }; + key <AE04> { [ 4, Cyrillic_IO ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; + key <AB08> { [ comma, less ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ apostrophe, quotedbl ] }; + key <LSGT> { [ bar, brokenbar ] }; + +key.type[group1]="ALPHABETIC"; + + key <TLDE> { [ Cyrillic_yu, Cyrillic_YU ] }; + key <LatQ> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <LatZ> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <LatS> { [ Cyrillic_es, Cyrillic_ES ] }; + key <LatA> { [ Cyrillic_a, Cyrillic_A ] }; + key <LatW> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <LatC> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <LatX> { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key <LatD> { [ Cyrillic_de, Cyrillic_DE ] }; + key <LatE> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <LatV> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <LatF> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <LatT> { [ Cyrillic_te, Cyrillic_TE ] }; + key <LatR> { [ Cyrillic_er, Cyrillic_ER ] }; + key <LatN> { [ Cyrillic_en, Cyrillic_EN ] }; + key <LatB> { [ Cyrillic_be, Cyrillic_BE ] }; + key <LatH> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <LatG> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <LatY> { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key <LatM> { [ Cyrillic_em, Cyrillic_EM ] }; + key <LatJ> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <LatU> { [ Cyrillic_u, Cyrillic_U ] }; + key <LatK> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <LatI> { [ Cyrillic_i, Cyrillic_I ] }; + key <LatO> { [ Cyrillic_o, Cyrillic_O ] }; + key <LatL> { [ Cyrillic_el, Cyrillic_EL ] }; + key <LatP> { [ Cyrillic_pe, Cyrillic_PE ] }; + + key <AE11> { [ minus, Cyrillic_hardsign ] }; + key <AD11> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AE12> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <AD12> { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key <BKSL> { [ Cyrillic_e, Cyrillic_E ] }; +}; diff --git a/symbols/sapmi b/symbols/sapmi new file mode 100644 index 00000000..e9f3cd43 --- /dev/null +++ b/symbols/sapmi @@ -0,0 +1,94 @@ + +// based on +// Northern Sami keyboards for Finland, Norway and Sweden +// +// Describes the differences between a very simple en_US +// keyboard and a Norwegian Northern Sami keyboard (with +// dead key support) according to the spec on +// http://www.hum.uit.no/a/trond/se-lat9-no-keys.html +// Written by Brre Gaup <boerre.gaup@pc.nu> +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/sapmi,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "basic" { + include "pc/latin" + + name[Group1]= "Smegiella"; + + key <AE01> { [ 1, exclam, copyright, exclamdown ] }; + key <AE02> { [ 2, quotedbl, at, registered ] }; + key <AE03> { [ 3, numbersign, sterling, less ] }; + key <AE04> { [ 4, dollar, dollar, greater ] }; + key <AE05> { [ 5, percent, U2022, U2030 ] }; + key <AE06> { [ 6, ampersand, section, paragraph ] }; + key <AE07> { [ 7, slash, braceleft, bar ] }; + key <AE08> { [ 8, parenleft, bracketleft, braceleft ] }; + key <AE09> { [ 9, parenright, bracketright, braceright ] }; + key <AE10> { [ 0, equal, braceright, notequal ] }; + key <AE11> { [ plus, question, division, questiondown ] }; + key <AE12> { [ backslash, grave, acute, asciitilde ] }; + + key <AD01> { [ aacute, Aacute, q, Q ] }; + key <AD02> { [ scaron, Scaron, w, W ] }; + key <AD03> { [ e, E, eacute, Eacute ] }; + key <AD04> { [ r, R, registered, trademark ] }; + key <AD06> { [ y, Y, yacute, Yacute ] }; + key <AD07> { [ u, U, udiaeresis, Udiaeresis ] }; + key <AD08> { [ i, I, idiaeresis, Idiaeresis ] }; + key <AD09> { [ o, O, oe, OE ] }; + key <AD11> { [ aring, Aring, acircumflex, Acircumflex ] }; + key <AD12> { [ eng, ENG, quotedbl, asciicircum ] }; + + key <AC01> { [ a, A, agrave, Agrave ] }; + key <AC02> { [ s, S, ssharp, apostrophe ] }; + key <AC04> { [ f, F, ordfeminine, ordfeminine ] }; + key <AC05> { [ g, G, gcaron, Gcaron ] }; + key <AC06> { [ h, H, U01E5, U01E4 ] }; + key <AC07> { [ j, J, notsign, multiply ] }; + key <AC08> { [ k, K, U01E9, U01E8 ] }; + key <AC09> { [ l, L, degree, hyphen ] }; + key <AC10> { [ oslash, Ooblique, odiaeresis, Odiaeresis ] }; + key <AC11> { [ ae, AE, adiaeresis, Adiaeresis ] }; + key <TLDE> { [ bar, section, brokenbar, paragraph ] }; + + key <BKSL> { [ dstroke, Dstroke, apostrophe, asterisk ] }; + key <AB01> { [ z, Z, U0292, U01B7 ] }; + key <AB02> { [ ccaron, Ccaron, x, X ] }; + key <AB03> { [ c, C, ccedilla, Ccedilla ] }; + key <AB04> { [ v, V, lessthanequal, guillemotleft ] }; + key <AB05> { [ b, B, greaterthanequal, guillemotright ] }; + key <AB06> { [ n, N, leftsinglequotemark, leftdoublequotemark ] }; + key <AB07> { [ m, M, rightsinglequotemark, rightdoublequotemark ] }; + key <AB08> { [ comma, semicolon, singlelowquotemark, doublelowquotemark ] }; + key <AB09> { [ period, colon, ellipsis, periodcentered ] }; + key <AB10> { [ minus, underscore, endash, emdash ] }; + + key <LSGT> { type[Group1] = "FOUR_LEVEL", + [ zcaron, Zcaron, U01EF, U01EE ] }; + + include "level3(ralt_switch_multikey)" +}; + + xkb_symbols "sefi" { + + // Describes the differences between a Norwegian Northern Sami + // (keyboard with dead key support) and a Swedish/Finnish Sami + // keyboard according to the specs at: + // http://www.hum.uit.no/a/trond/se-lat9-sefi-keys.html + + include "pc/sapmi(basic)" + + key <AC10> { [odiaeresis, Odiaeresis, oslash, Ooblique ] }; + key <AC11> { [adiaeresis, Adiaeresis, ae, AE ] }; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Norwegian layout to eliminate dead keys + + include "pc/sapmi(basic)" + + key <AE12> { [ backslash, grave, acute, ogonek ] }; +}; diff --git a/symbols/se b/symbols/se new file mode 100644 index 00000000..ddcfa9d1 --- /dev/null +++ b/symbols/se @@ -0,0 +1,46 @@ + +// based on a keyboard map from an 'xkb/symbols/se' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/se,v 1.5 2003/01/26 02:01:48 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "basic" { + include "pc/latin(type2)" + include "pc/se(se)" +}; + +partial alphanumeric_keys +xkb_symbols "se" { + + name[Group1]="Swedish"; + + key <AE05> { [ 5, percent, EuroSign, cent ] }; + key <AE11> { [ plus, question, backslash, questiondown ] }; + key <AE12> { [dead_acute, dead_grave, plusminus, notsign ] }; + + + key <AC10> { [odiaeresis, Odiaeresis, oslash, Ooblique ] }; + key <AC11> { [adiaeresis, Adiaeresis, ae, AE ] }; + key <TLDE> { [ section, onehalf, paragraph, threequarters] }; + + key <BKSL> { [apostrophe, asterisk, acute, multiply ] }; + + key <SPCE> { [ space, space, space, nobreakspace ] }; + + key <KPDL> { [ KP_Delete, KP_Separator ] }; + + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Swedish layout to eliminate all dead keys + + include "pc/latin(type2)" + include "pc/latin(type2_nodeadkeys)" + include "pc/se(se)" + + key <AE12> { [ acute, grave, plusminus, notsign ] }; + +}; diff --git a/symbols/se_FI b/symbols/se_FI new file mode 100644 index 00000000..72479189 --- /dev/null +++ b/symbols/se_FI @@ -0,0 +1,10 @@ +// Northern Sami keyboard for Finland +// Written by Brre Gaup <boerre.gaup@pc.nu> +// Quick usage: setxkbmap se_FI +// +// $XFree86: xc/programs/xkbcomp/symbols/se_FI,v 1.1 2001/11/21 21:20:55 dawes Exp $ + +partial alphanumeric_keys + xkb_symbols "basic" { + include "pc/sapmi(sefi)" +}; diff --git a/symbols/se_NO b/symbols/se_NO new file mode 100644 index 00000000..48942f54 --- /dev/null +++ b/symbols/se_NO @@ -0,0 +1,10 @@ +// Northern Sami keyboard for Norway +// Written by Brre Gaup <boerre.gaup@pc.nu> +// Quick usage: setxkbmap se_FI +// +// $XFree86: xc/programs/xkbcomp/symbols/se_NO,v 1.1 2001/11/21 21:20:55 dawes Exp $ + +partial alphanumeric_keys + xkb_symbols "basic" { + include "pc/sapmi(basic)" +}; diff --git a/symbols/se_SE b/symbols/se_SE new file mode 100644 index 00000000..06af1372 --- /dev/null +++ b/symbols/se_SE @@ -0,0 +1,10 @@ +// Northern Sami keyboard for Sweden +// Written by Brre Gaup <boerre.gaup@pc.nu> +// Quick usage: setxkbmap se_FI +// +// $XFree86: xc/programs/xkbcomp/symbols/se_SE,v 1.1 2001/11/21 21:20:55 dawes Exp $ + +partial alphanumeric_keys + xkb_symbols "basic" { + include "pc/sapmi(sefi)" +}; diff --git a/symbols/sgi.vndr/jp b/symbols/sgi.vndr/jp new file mode 100644 index 00000000..31bb3b59 --- /dev/null +++ b/symbols/sgi.vndr/jp @@ -0,0 +1,46 @@ +// $Xorg: jp,v 1.3 2000/08/17 19:54:45 cpqbld Exp $ +xkb_symbols "jp106" { + + name[group1]="Japan/ASCII"; + + key <HZTG> { [ Zenkaku_Hankaku ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, quotedbl ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, ampersand ] }; + key <AE07> { [ 7, apostrophe ] }; + key <AE08> { [ 8, parenleft ] }; + key <AE09> { [ 9, parenright ] }; + key <AE10> { [ 0, asciitilde ] }; + key <AE11> { [ minus, equal ] }; + key <AE12> { [ asciicircum, overbar ] }; + key <AE13> { [ yen, bar ] }; + + // keys <TAB> and <AD01> - <AD10> are identical to US/ASCII keyboard + key <AD11> { [ at, grave ] }; + key <AD12> { [ bracketleft, braceleft ] }; + + key <CAPS> { [ Eisu_Shift, Caps_Lock ] }; + // keys <AC01> - <AC09> are identical to US/ASCII keyboard + key <AC10> { [ semicolon, plus ] }; + key <AC11> { [ colon, asterisk ] }; + key <AC12> { [ bracketright, braceright ] }; + + // keys <LFSH> and <AB01> - <AB10> are identical to US/ASCII keyboard + key <AB11> { [ backslash, underscore ] }; + + key <NFER> { [ Muhenkan ] }; + key <XFER> { [ Kanji ] }; + key <HKTG> { [ Hiragana_Katakana ] }; +}; + +xkb_symbols "alternate106" { + key <AE10> { [ 0, overbar ] }; + key <AE12> { [ asciicircum, asciitilde] }; + key <AE13> { [ backslash, bar ] }; + key <AB11> { [ underbar, underscore ] }; + augment "sgi/jp(jp106)" +}; + diff --git a/symbols/si b/symbols/si new file mode 100644 index 00000000..9d81ca55 --- /dev/null +++ b/symbols/si @@ -0,0 +1,46 @@ + +// based on +// Slovenian keyboards +// by Marko Samastur (markos@elite.org) and +// Primoz Peterlin (primoz.peterlin@biofiz.mf.uni-lj.si) +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/si,v 1.3 2003/02/05 01:38:36 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type3)" + + name[Group1]="Slovene"; + + key <AE01> { [ 1, exclam, asciitilde, dead_tilde ] }; + key <AE02> { [ 2, quotedbl, dead_caron, caron ] }; + key <AE03> { [ 3, numbersign, asciicircum, dead_circumflex ] }; + key <AE04> { [ 4, dollar, dead_breve, breve ] }; + key <AE05> { [ 5, percent, degree, dead_abovering ] }; + key <AE06> { [ 6, ampersand, dead_ogonek, ogonek ] }; + key <AE07> { [ 7, slash, grave, dead_grave ] }; + key <AE08> { [ 8, parenleft, dead_abovedot, abovedot ] }; + key <AE09> { [ 9, parenright, dead_acute, apostrophe ] }; + key <AE10> { [ 0, equal, dead_doubleacute, doubleacute ] }; + key <AE11> { [apostrophe, question, dead_diaeresis, diaeresis ] }; + key <AE12> { [ plus, asterisk, dead_cedilla, cedilla ] }; + + key <AD03> { [ e, E, EuroSign, EuroSign ] }; + key <AD11> { [ scaron, Scaron, division, dead_abovering ] }; + key <AD12> { [ dstroke, Dstroke, multiply, dead_macron ] }; + + key <AC10> { [ ccaron, Ccaron, dead_acute, dead_doubleacute ] }; + key <AC11> { [ cacute, Cacute, ssharp, dead_caron ] }; + + key <AB10> { [ minus, underscore, dead_belowdot, dead_abovedot ] }; + + key <TLDE> { [dead_cedilla, dead_diaeresis, notsign, notsign ] }; + + key <BKSL> { [ zcaron, Zcaron, currency, dead_breve ] }; + + key <KPDL> { [ KP_Delete, KP_Separator ] }; + + include "level3(ralt_switch_multikey)" +}; + diff --git a/symbols/sk b/symbols/sk new file mode 100644 index 00000000..28808636 --- /dev/null +++ b/symbols/sk @@ -0,0 +1,83 @@ +// $XFree86: xc/programs/xkbcomp/symbols/pc/sk,v 1.2 2002/11/22 04:02:22 dawes +// Exp $ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // This layout conforms to a new sk compromise standard designed + // to satisfy most unix, windows and mac users. + // 2001 by Kamil Toman <ktoman@email.cz> + + include "pc/latin" + + name[Group1] = "Slovak"; + + key <TLDE> { [ semicolon, dead_abovering, grave, asciitilde ] }; + key <AE01> { [ plus, 1, exclam, dead_tilde ] }; + key <AE02> { [ lcaron, 2, at, dead_caron ] }; + key <AE03> { [ scaron, 3, numbersign, dead_circumflex ] }; + key <AE04> { [ ccaron, 4, dollar, dead_breve ] }; + key <AE05> { [ tcaron, 5, percent, dead_abovering ] }; + key <AE06> { [ zcaron, 6, asciicircum, dead_ogonek ] }; + key <AE07> { [ yacute, 7, ampersand, dead_grave ] }; + key <AE08> { [ aacute, 8, asterisk, dead_abovedot ] }; + key <AE09> { [ iacute, 9, braceleft, dead_acute ] }; + key <AE10> { [ eacute, 0, braceright, dead_doubleacute ] }; + key <AE11> { [ equal, percent, NoSymbol, dead_diaeresis ] }; + key <AE12> { [dead_acute, dead_caron, dead_macron, dead_cedilla ] }; + + key <AD01> { [ q, Q, backslash, NoSymbol ] }; + key <AD02> { [ w, W, bar, Nosymbol ] }; + key <AD03> { [ e, E, EuroSign, NoSymbol ] }; + key <AD04> { [ r, R, NoSymbol, NoSymbol ] }; + key <AD05> { [ t, T, NoSymbol, NoSymbol ] }; + key <AD06> { [ z, Z, NoSymbol, NoSymbol ] }; + key <AD07> { [ u, U, NoSymbol, NoSymbol ] }; + key <AD08> { [ i, I, NoSymbol, NoSymbol ] }; + key <AD09> { [ o, O, NoSymbol, NoSymbol ] }; + key <AD10> { [ p, P, NoSymbol, NoSymbol ] }; + + key <AD11> { [ uacute, slash, bracketleft, division ] }; + key <AD12> { [adiaeresis, parenleft, bracketright, multiply ] }; + + key <AC01> { [ a, A, asciitilde, NoSymbol ] }; + key <AC02> { [ s, S, dstroke, NoSymbol ] }; + key <AC03> { [ d, D, Dstroke, NoSymbol ] }; + key <AC04> { [ f, F, bracketleft, NoSymbol ] }; + key <AC05> { [ g, G, bracketright, NoSymbol ] }; + key <AC06> { [ h, H, grave, NoSymbol ] }; + key <AC07> { [ j, J, apostrophe, NoSymbol ] }; + key <AC08> { [ k, K, lstroke, NoSymbol ] }; + key <AC09> { [ l, L, Lstroke, NoSymbol ] }; + + key <AC10> { [ocircumflex, quotedbl, dollar, NoSymbol ] }; + key <AC11> { [ section, exclam, apostrophe, ssharp ] }; + key <AC12> { [ EuroSign, dead_diaeresis, NoSymbol, NoSymbol ] }; + key <BKSL> { [ ncaron, parenright, backslash, bar ] }; + + key <LSGT> { [ backslash, bar, slash, NoSymbol ] }; + key <AB01> { [ y, Y, degree, NoSymbol ] }; + key <AB02> { [ x, X, numbersign, Nosymbol ] }; + key <AB03> { [ c, C, ampersand, NoSymbol ] }; + key <AB04> { [ v, V, at, NoSymbol ] }; + key <AB05> { [ b, B, braceleft, NoSymbol ] }; + key <AB06> { [ n, N, braceright, NoSymbol ] }; + key <AB07> { [ m, M, asciicircum, NoSymbol ] }; + key <AB08> { [ comma, question, less, NoSymbol ] }; + key <AB09> { [ period, colon, greater, NoSymbol ] }; + key <AB10> { [ minus, underscore, asterisk, NoSymbol ] }; + + key <SPCE> { [ space, space, nobreakspace, nobreakspace ] }; + + key <KPDL> { type[Group1]="FOUR_LEVEL_KEYPAD", + [ KP_Delete, comma, KP_Delete, KP_Decimal ] }; + + include "level3(ralt_switch_multikey)" +}; + +// Use <BKSL> instead of <LSGT> (useful for keyboard without <LSGT> key) +xkb_symbols "bksl" { + include "pc/sk(basic)" + + key <BKSL> { [ backslash, bar, slash, NoSymbol ] }; +}; diff --git a/symbols/sk_qwerty b/symbols/sk_qwerty new file mode 100644 index 00000000..d434e226 --- /dev/null +++ b/symbols/sk_qwerty @@ -0,0 +1,21 @@ +// $XFree86$ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // This layout should work exactly as a sk with the exception + // of 'Z' and 'Y' keys, which are in the qwerty style (ie. swapped). + // 2001 by Kamil Toman <ktoman@email.cz> + + include "pc/sk(basic)" + + key <AB01> { [ z, Z, degree, NoSymbol ] }; + key <AD06> { [ y, Y, NoSymbol, NoSymbol ] }; +}; + +// Use <BKSL> instead of <LSGT> (useful for keyboard without <LSGT> key) +xkb_symbols "bksl" { + include "pc/sk_qwerty(basic)" + + key <BKSL> { [ backslash, bar, slash, NoSymbol ] }; +}; diff --git a/symbols/sony.vndr/us b/symbols/sony.vndr/us new file mode 100644 index 00000000..76d41053 --- /dev/null +++ b/symbols/sony.vndr/us @@ -0,0 +1,93 @@ +// $Xorg: us,v 1.4 2001/02/09 02:05:53 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// US/ASCII layout for a nwp5461 keyboard +xkb_symbols "nwp5461" { + include "us(basic)" + + key <LALT> { [ Alt_L, Meta_L ] }; + key <RTSH> { [ Shift_R ] }; + key <AB11> { [ NoSymbol ] }; + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ] }; + key <FK12> { [ F12 ] }; + key <HELP> { [ Help ] }; + key <STOP> { [ Cancel ] }; + key <CUT> { [ Select ] }; + key <EXEC> { [ Execute ] }; + key <DELE> { [ Delete ] }; + key <LEFT> { [ Left ] }; + key <RGHT> { [ Right ] }; + key <UP> { [ Up ] }; + key <DOWN> { [ Down ] }; + key <PGUP> { [ Prior ] }; + key <PGDN> { [ Next ] }; + key <INS> { [ Insert ] }; + key <CLR> { [ Clear ] }; + // End "Function" section + + // Begin "Keypad" section + key <KPMU> { [ KP_Multiply ] }; + key <KPDV> { [ KP_Divide ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP7> { [ KP_7 ] }; + key <KP8> { [ KP_8 ] }; + key <KP9> { [ KP_9 ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP4> { [ KP_4 ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_6 ] }; + key <KPSP> { [ KP_Separator ] }; + + key <KP1> { [ KP_1 ] }; + key <KP2> { [ KP_2 ] }; + key <KP3> { [ KP_3 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_0 ] }; + key <KPDC> { [ KP_Decimal ] }; + key <KPTB> { [ KP_Tab ] }; + // End "Keypad" section + + + // begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod3 { Alt_L }; +}; + diff --git a/symbols/sr b/symbols/sr new file mode 100644 index 00000000..ee1b1f9c --- /dev/null +++ b/symbols/sr @@ -0,0 +1,211 @@ +// $XFree86$ +// Serbian XKB keyboard mapping (derived from "Danube" D.2) +// +// Danube D.2 from 2003-05-12 is available at http://srpski.org/dunav/ +// +// Original authors: +// Danilo Segan (Данило Шеган) <dsegan@gmx.net> +// Chusslove Illich (Часлав Илић) <chaslav@sezampro.yu> +// +// Modified for inclusion in XFree86 by Danilo Segan <dsegan@gmx.net> +// +// + +default partial alphanumeric_keys +xkb_symbols "default" { + + name[Group1]= "Serbian Cyrillic"; + + include "pc/sr(level3)" + include "pc/sr(common)" + include "pc/sr(cyralpha)" + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "yz" { + // Cyrillic_zhe and Cyrillic_ze swapped. + + name[Group1]= "Serbian Cyrillic (swap Zhe, Ze)"; + + include "pc/sr(default)" + + key <AD06> { [ Cyrillic_zhe, Cyrillic_ZHE, any,any ] }; // y + key <AB01> { [ Cyrillic_ze, Cyrillic_ZE, any,any ] }; // z +}; + +partial alphanumeric_keys +xkb_symbols "common" { + // "Common" keys: keys which are same for both latin and cyrillic keyboards + + key.type[Group1] = "FOUR_LEVEL"; + + key <TLDE> { [ quoteleft, asciitilde, any,any ] }; // + key <AE01> { [ 1, exclam, any,any ] }; // + key <AE02> { [ 2, quotedbl, any,any ] }; // + key <AE03> { [ 3, numbersign, any,any ] }; // + key <AE04> { [ 4, dollar, any,any ] }; // + key <AE05> { [ 5, percent, any,any ] }; // + key <AE06> { [ 6, ampersand, any,any ] }; // + key <AE07> { [ 7, slash, any,any ] }; // + key <AE08> { [ 8, parenleft, any,any ] }; // + key <AE09> { [ 9, parenright, any,any ] }; // + key <AE10> { [ 0, equal, any,any ] }; // + key <AE11> { [ apostrophe, question, any,any ] }; // + key <AE12> { [ plus, asterisk, any,any ] }; // + + key <AB08> { [ comma, semicolon, any,any ] }; // + key <AB09> { [ period, colon, any,any ] }; // + key <AB10> { [ minus, underscore, any,any ] }; // +}; + +partial alphanumeric_keys +xkb_symbols "cyralpha" { + + key.type[Group1] = "FOUR_LEVEL_ALPHABETIC"; + + key <AD01> { [ Cyrillic_lje, Cyrillic_LJE, any,any ] }; // q + key <AD02> { [ Cyrillic_nje, Cyrillic_NJE, any,any ] }; // w + key <AD03> { [ Cyrillic_ie, Cyrillic_IE, any,any ] }; // e + key <AD04> { [ Cyrillic_er, Cyrillic_ER, any,any ] }; // r + key <AD05> { [ Cyrillic_te, Cyrillic_TE, any,any ] }; // t + key <AD06> { [ Cyrillic_ze, Cyrillic_ZE, any,any ] }; // y + key <AD07> { [ Cyrillic_u, Cyrillic_U, any,any ] }; // u + key <AD08> { [ Cyrillic_i, Cyrillic_I, any,any ] }; // i + key <AD09> { [ Cyrillic_o, Cyrillic_O, any,any ] }; // o + key <AD10> { [ Cyrillic_pe, Cyrillic_PE, any,any ] }; // p + key <AD11> { [ Cyrillic_sha, Cyrillic_SHA, any,any ] }; // [ { + key <AD12> { [ Serbian_dje, Serbian_DJE, any,any ] }; // ] } + + key <AC01> { [ Cyrillic_a, Cyrillic_A, any,any ] }; // a + key <AC02> { [ Cyrillic_es, Cyrillic_ES, any,any ] }; // s + key <AC03> { [ Cyrillic_de, Cyrillic_DE, any,any ] }; // d + key <AC04> { [ Cyrillic_ef, Cyrillic_EF, any,any ] }; // f + key <AC05> { [ Cyrillic_ghe, Cyrillic_GHE, any,any ] }; // g + key <AC06> { [ Cyrillic_ha, Cyrillic_HA, any,any ] }; // h + key <AC07> { [ Cyrillic_je, Cyrillic_JE, any,any ] }; // j + key <AC08> { [ Cyrillic_ka, Cyrillic_KA, any,any ] }; // k + key <AC09> { [ Cyrillic_el, Cyrillic_EL, any,any ] }; // l + key <AC10> { [ Cyrillic_che, Cyrillic_CHE, any,any ] }; // ; : + key <AC11> { [ Serbian_tshe, Serbian_TSHE, any,any ] }; // ' " + key <BKSL> { [ Cyrillic_zhe, Cyrillic_ZHE, any,any ] }; // \ | + + key <AB01> { [ Cyrillic_zhe, Cyrillic_ZHE, any,any ] }; // z + key <AB02> { [ Cyrillic_dzhe, Cyrillic_DZHE, any,any ] }; // x + key <AB03> { [ Cyrillic_tse, Cyrillic_TSE, any,any ] }; // c + key <AB04> { [ Cyrillic_ve, Cyrillic_VE, any,any ] }; // v + key <AB05> { [ Cyrillic_be, Cyrillic_BE, any,any ] }; // b + key <AB06> { [ Cyrillic_en, Cyrillic_EN, any,any ] }; // n + key <AB07> { [ Cyrillic_em, Cyrillic_EM, any,any ] }; // m +}; + + +partial alphanumeric_keys +xkb_symbols "latalpha" { + + key.type[Group1] = "SERBIAN_ALPHABETIC"; + + key <AD01> { [ q, Q, any,any ] }; // + key <AD02> { [ w, W, any,any ] }; // + key <AD03> { [ e, E, any,any ] }; // + key <AD04> { [ r, R, any,any ] }; // + key <AD05> { [ t, T, any,any ] }; // + key <AD06> { [ z, Z, any,any ] }; // + key <AD07> { [ u, U, any,any ] }; // + key <AD08> { [ i, I, any,any ] }; // + key <AD09> { [ o, O, any,any ] }; // + key <AD10> { [ p, P, any,any ] }; // + key <AD11> { [ scaron, Scaron, any,any ] }; // + key <AD12> { [ dstroke, Dstroke, any,any ] }; // + + key <AC01> { [ a, A, any,any ] }; // + key <AC02> { [ s, S, any,any ] }; // + key <AC03> { [ d, D, any,any ] }; // + key <AC04> { [ f, F, any,any ] }; // + key <AC05> { [ g, G, any,any ] }; // + key <AC06> { [ h, H, any,any ] }; // + key <AC07> { [ j, J, any,any ] }; // + key <AC08> { [ k, K, any,any ] }; // + key <AC09> { [ l, L, any,any ] }; // + key <AC10> { [ ccaron, Ccaron, any,any ] }; // + key <AC11> { [ cacute, Cacute, any,any ] }; // + key <BKSL> { [ zcaron, Zcaron, any,any ] }; // + + key <AB01> { [ y, Y, any,any ] }; // + key <AB02> { [ x, X, any,any ] }; // + key <AB03> { [ c, C, any,any ] }; // + key <AB04> { [ v, V, any,any ] }; // + key <AB05> { [ b, B, any,any ] }; // + key <AB06> { [ n, N, any,any ] }; // + key <AB07> { [ m, M, any,any ] }; // +}; + +partial alphanumeric_keys +xkb_symbols "twoletter" { + // These are letters which are written in latin transcription with two-characters. + + key <AD01> { type[Group1] = "SERBIAN_CAPS", + [ U1C9, U1C8, any, U1C7 ] }; // q + key <AD02> { type[Group1] = "SERBIAN_CAPS", + [ U1CC, U1CB, any, U1CA ] }; // w + key <AB02> { type[Group1] = "SERBIAN_CAPS", + [ U1C6, U1C5, any, U1C4 ] }; // x + + // Also replace letter Y with Zcaron, since Y is of no use any longer + key <AB01> { [ zcaron, Zcaron, any,any ] }; // +}; + +partial alphanumeric_keys +xkb_symbols "level3" { + key <TLDE> { [ any,any, NoSymbol, NoSymbol ] }; // ` ~ + key <AE01> { [ any,any, dead_tilde, NoSymbol ] }; // 1 ! + key <AE02> { [ any,any, dead_caron, NoSymbol ] }; // 2 @ + key <AE03> { [ any,any, dead_circumflex, NoSymbol ] }; // 3 # + key <AE04> { [ any,any, dead_breve, NoSymbol ] }; // 4 $ + key <AE05> { [ any,any, dead_abovering, NoSymbol ] }; // 5 % + key <AE06> { [ any,any, dead_ogonek, NoSymbol ] }; // 6 ^ + key <AE07> { [ any,any, dead_grave, NoSymbol ] }; // 7 & + key <AE08> { [ any,any, dead_abovedot, NoSymbol ] }; // 8 * + key <AE09> { [ any,any, dead_acute, NoSymbol ] }; // 9 ( + key <AE10> { [ any,any, dead_doubleacute, NoSymbol ] }; // 0 ) + key <AE11> { [ any,any, dead_diaeresis, NoSymbol ] }; // - _ + key <AE12> { [ any,any, dead_cedilla, NoSymbol ] }; // = + + + key <AD01> { [ any,any, backslash, NoSymbol ] }; // q + key <AD02> { [ any,any, bar, NoSymbol ] }; // w + key <AD03> { [ any,any, EuroSign, NoSymbol ] }; // e + key <AD04> { [ any,any, NoSymbol, NoSymbol ] }; // r + key <AD05> { [ any,any, NoSymbol, NoSymbol ] }; // t + key <AD06> { [ any,any, NoSymbol, NoSymbol ] }; // y + key <AD07> { [ any,any, NoSymbol, NoSymbol ] }; // u + key <AD08> { [ any,any, NoSymbol, NoSymbol ] }; // i + key <AD09> { [ any,any, NoSymbol, NoSymbol ] }; // o + key <AD10> { [ any,any, NoSymbol, NoSymbol ] }; // p + key <AD11> { [ any,any, NoSymbol, NoSymbol ] }; // [ + key <AD12> { [ any,any, NoSymbol, NoSymbol ] }; // ] + + key <AC01> { [ any,any, NoSymbol, NoSymbol ] }; // a + key <AC02> { [ any,any, doublelowquotemark, NoSymbol ] }; // s + key <AC03> { [ any,any, leftdoublequotemark, NoSymbol ] }; // d + key <AC04> { [ any,any, bracketleft, NoSymbol ] }; // f + key <AC05> { [ any,any, bracketright, NoSymbol ] }; // g + key <AC06> { [ any,any, NoSymbol, NoSymbol ] }; // h + key <AC07> { [ any,any, NoSymbol, NoSymbol ] }; // j + key <AC08> { [ any,any, NoSymbol, NoSymbol ] }; // k + key <AC09> { [ any,any, NoSymbol, NoSymbol ] }; // l + key <AC10> { [ any,any, NoSymbol, NoSymbol ] }; // ; + key <AC11> { [ any,any, NoSymbol, NoSymbol ] }; // ' + key <BKSL> { [ any,any, NoSymbol, NoSymbol ] }; // \ + + key <AB01> { [ any,any, leftsinglequotemark, NoSymbol ] }; // z + key <AB02> { [ any,any, rightsinglequotemark,NoSymbol ] }; // x + key <AB03> { [ any,any, NoSymbol, NoSymbol ] }; // c + key <AB04> { [ any,any, at, NoSymbol ] }; // v + key <AB05> { [ any,any, braceleft, NoSymbol ] }; // b + key <AB06> { [ any,any, braceright, NoSymbol ] }; // n + key <AB07> { [ any,any, asciicircum, NoSymbol ] }; // m + key <AB08> { [ any,any, less, NoSymbol ] }; // , < + key <AB09> { [ any,any, greater, NoSymbol ] }; // . > + key <AB10> { [ any,any, emdash, endash ] }; // / ? + +}; diff --git a/symbols/sun.vndr/se b/symbols/sun.vndr/se new file mode 100644 index 00000000..40e8a875 --- /dev/null +++ b/symbols/sun.vndr/se @@ -0,0 +1,193 @@ +// $XFree86: xc/programs/xkbcomp/symbols/sun/se,v 1.2 1998/12/20 09:40:28 dawes Exp $ +// +// Swedish layout for a Type 5/5c Sun keyboard +xkb_symbols "sun5" { + include "en_US(basic)+se(basic)" + + // Begin alphanumeric section + // These two are not supposed to be dead. + // A few others supposedly ARE dead, but don't care for now. + key <AC12> { [ apostrophe, asterisk ], [ grave ] }; + key <AD12> { [ ], [ asciitilde ] }; + + key <RTSH> { [ Shift_R ] }; + + key <LALT> { [ Alt_L ] }; + key <ALGR> { [ Mode_switch ] }; + key <LMTA> { [ Meta_L ] }; + key <RMTA> { [ Meta_R ] }; + key <COMP> { [ Multi_key ] }; + // End alphanumeric section + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ], [ SunF36] }; + key <FK12> { [ F12 ], [ SunF37] }; + key <STOP> { [ Cancel ], [ F11 ] }; + key <AGAI> { [ Redo ], [ F12 ] }; + key <PROP> { [ SunProps ], [ F13 ] }; + key <UNDO> { [ Undo ], [ F14 ] }; + key <FRNT> { [ SunFront ], [ F15 ] }; + key <COPY> { [ SunCopy ], [ F16 ] }; + key <OPEN> { [ SunOpen ], [ F17 ] }; + key <PAST> { [ SunPaste ], [ F18 ] }; + key <FIND> { [ Find ], [ F19 ] }; + key <CUT> { [ SunCut ], [ F20 ] }; + // End "Function" section + + // Begin "Editing" section + key <PRSC> { [ Print ], [ Sys_Req, SunSys_Req ] }; + key <SCLK> { [ Scroll_Lock ] }; + key <PAUS> { [ Pause ], [ Break ] }; + key <LEFT> { [ Left ] }; + key <RGHT> { [ Right ] }; + key <UP> { [ Up ] }; + key <DOWN> { [ Down ] }; + + key <DELE> { [ Delete ] }; + key <INS> { [ Insert ] }; + key <PGUP> { [ Prior ] }; + key <PGDN> { [ Next ] }; + key <HOME> { [ Home ] }; + key <END> { [ End ] }; + key <HELP> { [ Help ] }; + // End "Editing" section + + // Begin "Keypad" section + key <NMLK> { [ Num_Lock ] }; + key <KPDV> { [ KP_Divide ], [ F25 ] }; + key <KPMU> { [ KP_Multiply ], [ F26 ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP7> { [ KP_Home, KP_7 ], [ F27 ] }; + key <KP8> { [ KP_Up, KP_8 ], [ F28 ] }; + key <KP9> { [ KP_Prior, KP_9 ], [ F29 ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP4> { [ KP_Left, KP_4 ], [ F30 ] }; + key <KP5> { [ KP_Begin, KP_5 ], [ F31 ] }; + key <KP6> { [ KP_Right, KP_6 ], [ F32 ] }; + + key <KP1> { [ KP_End, KP_1 ], [ F33 ] }; + key <KP2> { [ KP_Down, KP_2 ], [ F34 ] }; + key <KP3> { [ KP_Next, KP_3 ], [ F35 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_Insert, KP_0 ] }; + key <KPDL> { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section, + + // Begin "four keys up on the right" + key <MUTE> { [ SunAudioMute, SunVideoDegauss ] }; + key <VOL-> { [ SunAudioLowerVolume,SunVideoLowerBrightness ] }; + key <VOL+> { [ SunAudioRaiseVolume,SunVideoRaiseBrightness ] }; + key <POWR> { [ SunPowerSwitch, SunPowerSwitchShift ] }; + // End "four keys up on the right" + + // Begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Meta_L, Meta_R }; + modifier_map Mod2 { Alt_L }; + modifier_map Mod3 { Mode_switch }; + modifier_map Mod4 { Num_Lock }; + // End modifier mappings +}; + +// Swedish layout for a Type 4 Sun keyboard +xkb_symbols "sun4" { + include "en_US(basic)+se(basic)" + + // Begin alphanumeric section + // These two are not supposed to be dead. + // A few others supposedly ARE dead, but don't care for now. + key <AC12> { [ apostrophe, asterisk ], [ grave ] }; + key <AD12> { [ ], [ asciitilde ] }; + + key <AF14> { [ asciitilde, asciicircum ] }; + + key <RTSH> { [ Shift_R ] }; + + key <LALT> { [ Alt_L ] }; + key <ALGR> { [ Mode_switch ] }; + key <LMTA> { [ Meta_L ] }; + key <RMTA> { [ Meta_R ] }; + key <COMP> { [ Multi_key ] }; + // End alphanumeric section + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ], [ SunF36] }; + key <FK12> { [ F12 ], [ SunF37] }; + key <STOP> { [ Cancel ], [ F11 ] }; + key <AGAI> { [ Redo ], [ F12 ] }; + key <PROP> { [ SunProps ], [ F13 ] }; + key <UNDO> { [ Undo ], [ F14 ] }; + key <FRNT> { [ SunFront ], [ F15 ] }; + key <COPY> { [ SunCopy ], [ F16 ] }; + key <OPEN> { [ SunOpen ], [ F17 ] }; + key <PAST> { [ SunPaste ], [ F18 ] }; + key <FIND> { [ Find ], [ F19 ] }; + key <CUT> { [ SunCut ], [ F20 ] }; + // End "Function" section + + // Begin "Editing" section + key <LNFD> { [ Linefeed ] }; + key <DELE> { [ Delete ] }; + key <PRSC> { [ Print ], [ Sys_Req, SunSys_Req ] }; + key <SCLK> { [ Scroll_Lock ] }; + key <PAUS> { [ Pause ], [ Break ] }; + key <HELP> { [ Help ] }; + // End "Editing" section + + // Begin "Keypad" section + key <NMLK> { [ Num_Lock ] }; + key <KPEQ> { [ KP_Equal ] }; + key <KPDV> { [ KP_Divide ], [ F25 ] }; + key <KPMU> { [ KP_Multiply ], [ F26 ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP7> { [ KP_Home, KP_7 ], [ F27 ] }; + key <KP8> { [ KP_Up, KP_8 ], [ F28 ] }; + key <KP9> { [ KP_Prior, KP_9 ], [ F29 ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP4> { [ KP_Left, KP_4 ], [ F30 ] }; + key <KP5> { [ KP_Begin, KP_5 ], [ F31 ] }; + key <KP6> { [ KP_Right, KP_6 ], [ F32 ] }; + + key <KP1> { [ KP_End, KP_1 ], [ F33 ] }; + key <KP2> { [ KP_Down, KP_2 ], [ F34 ] }; + key <KP3> { [ KP_Next, KP_3 ], [ F35 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_Insert, KP_0 ] }; + key <KPDL> { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section, + + // Begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Alt_L }; + modifier_map Mod2 { Num_Lock }; + modifier_map Mod3 { Mode_switch }; + modifier_map Mod4 { Meta_L }; + modifier_map Mod5 { Meta_R }; + // End modifier mappings +}; diff --git a/symbols/sun.vndr/us b/symbols/sun.vndr/us new file mode 100644 index 00000000..520e0216 --- /dev/null +++ b/symbols/sun.vndr/us @@ -0,0 +1,338 @@ +// $Xorg: us,v 1.4 2001/02/09 02:05:53 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/symbols/sun/us,v 1.6 2001/12/14 20:02:05 dawes Exp $ +// +// US/ASCII layout for a Type 4 Sun keyboard +xkb_symbols "sun4" { + include "us(basic)" + + // A few alphanumeric keys are different + key <TLDE> { [ grave, asciitilde ], [ acute ] }; + key <AC11> { [ apostrophe, quotedbl ], [ acute ] }; + + key <RTSH> { [ Shift_R ] }; + key <LALT> { [ Alt_L ] }; + key <ALGR> { [ Mode_switch ] }; + key <LMTA> { [ Meta_L ] }; + key <RMTA> { [ Meta_R ] }; + key <LNFD> { [ Linefeed ] }; + key <COMP> { [ Multi_key ] }; + // End alphanumeric section + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ], [ SunF36] }; + key <FK12> { [ F12 ], [ SunF37] }; + key <STOP> { [ Cancel ], [ F11 ] }; + key <AGAI> { [ Redo ], [ F12 ] }; + key <PROP> { [ SunProps ], [ F13 ] }; + key <UNDO> { [ Undo ], [ F14 ] }; + key <FRNT> { [ SunFront ], [ F15 ] }; + key <COPY> { [ SunCopy ], [ F16 ] }; + key <OPEN> { [ SunOpen ], [ F17 ] }; + key <PAST> { [ SunPaste ], [ F18 ] }; + key <FIND> { [ Find ], [ F19 ] }; + key <CUT> { [ SunCut ], [ F20 ] }; + // End "Function" section + + // Begin "Editing" section + key <PRSC> { [ Print ],[ F21 ] }; + key <SCLK> { [ Break, Scroll_Lock ],[ F22 ] }; + key <PAUS> { [ Pause ],[ F23 ] }; + key <DELE> { [ Delete ] }; + key <HELP> { [ Help ] }; + + // End "Editing" section, begin "Keypad" + key <NMLK> { [ Num_Lock ] }; + key <KPEQ> { [ KP_Equal ], [ F24 ] }; + key <KPDV> { [ KP_Divide ], [ F25 ] }; + key <KPMU> { [ KP_Multiply ], [ F26 ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP7> { [ KP_Home, KP_7 ], [ F27 ] }; + key <KP8> { [ KP_Up, KP_8 ], [ F28 ] }; + key <KP9> { [ KP_Prior, KP_9 ], [ F29 ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP4> { [ KP_Left, KP_4 ], [ F30 ] }; + key <KP5> { [ KP_Begin, KP_5 ], [ F31 ] }; + key <KP6> { [ KP_Right, KP_6 ], [ F32 ] }; + + key <KP1> { [ KP_End, KP_1 ], [ F33 ] }; + key <KP2> { [ KP_Down, KP_2 ], [ F34 ] }; + key <KP3> { [ KP_Next, KP_3 ], [ F35 ] }; + key <KPEN> { [ KP_Enter ] }; + key <KP0> { [ KP_Insert, KP_0 ] }; + key <KPDL> { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section + + + // begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Meta_L, Meta_R }; + modifier_map Mod2 { Alt_L }; + modifier_map Mod3 { Mode_switch }; + modifier_map Mod4 { Num_Lock }; + modifier_map Mod5 { F13, F18, F20 }; +}; + +hidden partial function_keys xkb_symbols "broken_openlook_map" { + key <STOP> { [ F11 ], [ Cancel ] }; + key <AGAI> { [ F12 ], [ Redo ] }; + key <PROP> { [ F13 ], [ SunProps ] }; + key <UNDO> { [ F14 ], [ Undo ] }; + key <FRNT> { [ F15 ], [ SunFront ] }; + key <COPY> { [ F16 ], [ SunCopy ] }; + key <OPEN> { [ F17 ], [ SunOpen ] }; + key <PAST> { [ F18 ], [ SunPaste ] }; + key <FIND> { [ F19 ], [ Find ] }; + key <CUT> { [ F20 ], [ SunCut ] }; +}; + +// US/ASCII layout for a Type 4 Sun keyboard w/ broken OpenLook keymap +xkb_symbols "sun4ol" { + override "sun/us(sun4)" + include "sun/us(broken_openlook_map)" +}; + +// US/ASCII layout for a Type 5 Sun keyboard +xkb_symbols "sun5" { + augment "us(basic)" + + // A alphanumeric keys are different + key <TLDE> { [ grave, asciitilde ], [ acute ] }; + key <AC11> { [ apostrophe, quotedbl ], [ acute ] }; + + key <RTSH> { [ Shift_R ] }; + + key <LALT> { [ Alt_L ] }; + key <ALGR> { [ Mode_switch ] }; + key <LMTA> { [ Meta_L ] }; + key <RMTA> { [ Meta_R ] }; + key <COMP> { [ Multi_key ] }; + // End alphanumeric section + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ], [ SunF36] }; + key <FK12> { [ F12 ], [ SunF37] }; + key <STOP> { [ Cancel ], [ F11 ] }; + key <AGAI> { [ Redo ], [ F12 ] }; + key <PROP> { [ SunProps ], [ F13 ] }; + key <UNDO> { [ Undo ], [ F14 ] }; + key <FRNT> { [ SunFront ], [ F15 ] }; + key <COPY> { [ SunCopy ], [ F16 ] }; + key <OPEN> { [ SunOpen ], [ F17 ] }; + key <PAST> { [ SunPaste ], [ F18 ] }; + key <FIND> { [ Find ], [ F19 ] }; + key <CUT> { [ SunCut ], [ F20 ] }; + // End "Function" section + + // Begin "Editing" section + key <PRSC> { [ Print ], [ Sys_Req, SunSys_Req ] }; + key <SCLK> { [ Scroll_Lock ] }; + key <PAUS> { [ Pause ], [ Break ] }; + key <LEFT> { [ Left ] }; + key <RGHT> { [ Right ] }; + key <UP> { [ Up ] }; + key <DOWN> { [ Down ] }; + + key <DELE> { [ Delete ] }; + key <INS> { [ Insert ] }; + key <PGUP> { [ Prior ] }; + key <PGDN> { [ Next ] }; + key <HOME> { [ Home ] }; + key <END> { [ End ] }; + key <HELP> { [ Help ] }; + + // End "Editing" section, begin "Keypad" + key <NMLK> { [ Num_Lock ] }; + key <KPDV> { [ KP_Divide ], [ F25 ] }; + key <KPMU> { [ KP_Multiply ], [ F26 ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP7> { [ KP_Home, KP_7 ], [ F27 ] }; + key <KP8> { [ KP_Up, KP_8 ], [ F28 ] }; + key <KP9> { [ KP_Prior, KP_9 ], [ F29 ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP4> { [ KP_Left, KP_4 ], [ F30 ] }; + key <KP5> { [ KP_Begin, KP_5 ], [ F31 ] }; + key <KP6> { [ KP_Right, KP_6 ], [ F32 ] }; + + key <KP1> { [ KP_End, KP_1 ], [ F33 ] }; + key <KP2> { [ KP_Down, KP_2 ], [ F34 ] }; + key <KP3> { [ KP_Next, KP_3 ], [ F35 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_Insert, KP_0 ] }; + key <KPDL> { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section, + // begin "four keys up on the right" + + key <MUTE> { [ SunAudioMute, SunVideoDegauss ] }; + key <VOL-> { [ SunAudioLowerVolume,SunVideoLowerBrightness ] }; + key <VOL+> { [ SunAudioRaiseVolume,SunVideoRaiseBrightness ] }; + key <POWR> { [ SunPowerSwitch, SunPowerSwitchShift ] }; + + // begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Alt_L }; + modifier_map Mod2 { Num_Lock }; + modifier_map Mod3 { Mode_switch }; + modifier_map Mod4 { Meta_L, Meta_R}; + modifier_map Mod5 { Scroll_Lock }; +}; + +// US/ASCII layout for a Type 5 Sun keyboard w/ broken OpenLook keymap +xkb_symbols "sun5ol" { + override "sun/us(sun5)" + include "sun/us(broken_openlook_map)" +}; + +// US/ASCII layout for a Type 6 Sun keyboard +xkb_symbols "sun6" { + augment "us(basic)" + + key <RTSH> { [ Shift_R ] }; + key <LALT> { [ Alt_L ] }; + key <RCTL> { [ Control_R ] }; + key <RALT> { [ Alt_R ] }; + key <LMTA> { [ Meta_L ] }; + key <RMTA> { [ Meta_R ] }; + key <COMP> { [ Multi_key ] }; + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + key <FK11> { [ F11 ] }; + key <FK12> { [ F12 ] }; + // End "Function" section + + // Begin "Editing" section + key <PRSC> { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Execute ] + }; + key <SCLK> { [ Scroll_Lock ] }; + key <PAUS> { + type= "PC_BREAK", + symbols[Group1]= [ Pause, Break ] + }; + key <INS> { [ Insert ] }; + key <HOME> { [ Home ] }; + key <PGUP> { [ Prior ] }; + key <DELE> { [ Delete ] }; + key <END> { [ End ] }; + key <PGDN> { [ Next ] }; + + key <UP> { [ Up ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <RGHT> { [ Right ] }; + + // End "Editing" section, begin "Keypad" + key <NMLK> { [ Num_Lock, Pointer_EnableKeys ] }; + key <KPDV> { [ KP_Divide ] }; + key <KPMU> { [ KP_Multiply ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP7> { [ KP_Home, KP_7 ] }; + key <KP8> { [ KP_Up, KP_8 ] }; + key <KP9> { [ KP_Prior, KP_9 ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP4> { [ KP_Left, KP_4 ] }; + key <KP5> { [ KP_Begin, KP_5 ] }; + key <KP6> { [ KP_Right, KP_6 ] }; + + key <KP1> { [ KP_End, KP_1 ] }; + key <KP2> { [ KP_Down, KP_2 ] }; + key <KP3> { [ KP_Next, KP_3 ] }; + key <KPEN> { [ KP_Enter ] }; + + key <KP0> { [ KP_Insert, KP_0 ] }; + key <KPDL> { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section + + key <MUTE> { [ SunAudioMute, SunVideoDegauss ] }; + key <VOL-> { [ SunAudioLowerVolume,SunVideoLowerBrightness ] }; + key <VOL+> { [ SunAudioRaiseVolume,SunVideoRaiseBrightness ] }; + key <POWR> { [ SunPowerSwitch, SunPowerSwitchShift ] }; + + // from symbols/sun/us(type5) + key <STOP> { [ Cancel ], [ F11 ] }; + key <AGAI> { [ Redo ], [ F12 ] }; + key <PROP> { [ SunProps ], [ F13 ] }; + key <UNDO> { [ Undo ], [ F14 ] }; + key <FRNT> { [ SunFront ], [ F15 ] }; + key <COPY> { [ SunCopy ], [ F16 ] }; + key <OPEN> { [ SunOpen ], [ F17 ] }; + key <PAST> { [ SunPaste ], [ F18 ] }; + key <FIND> { [ Find ], [ F19 ] }; + key <CUT> { [ SunCut ], [ F20 ] }; + key <HELP> { [ Help ] }; + + // begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Meta_L, Meta_R }; + modifier_map Mod2 { Alt_L }; + modifier_map Mod3 { Mode_switch }; + modifier_map Mod4 { Num_Lock }; +}; + +// US/ASCII layout for a Type 6 Sun keyboard w/ broken OpenLook keymap +xkb_symbols "sun6ol" { + override "sun/us(sun6)" + include "sun/us(broken_openlook_map)" +}; diff --git a/symbols/sun.vndr/usb b/symbols/sun.vndr/usb new file mode 100644 index 00000000..067c4af1 --- /dev/null +++ b/symbols/sun.vndr/usb @@ -0,0 +1,28 @@ +// $XFree86$ +// +// Additional keys for Sun USB keyboard + +xkb_symbols "sun_usb" { + + key <STOP> { [ Cancel ], [ F11 ] }; + key <AGAI> { [ Redo ], [ F12 ] }; + key <PROP> { [ SunProps ], [ F13 ] }; + key <UNDO> { [ Undo ], [ F14 ] }; + key <FRNT> { [ SunFront ], [ F15 ] }; + key <COPY> { [ SunCopy ], [ F16 ] }; + key <OPEN> { [ SunOpen ], [ F17 ] }; + key <PAST> { [ SunPaste ], [ F18 ] }; + key <FIND> { [ Find ], [ F19 ] }; + key <CUT> { [ SunCut ], [ F20 ] }; + key <HELP> { [ Help ] }; + + key <MUTE> { [ SunAudioMute, SunVideoDegauss ] }; + key <VOL-> { [ SunAudioLowerVolume,SunVideoLowerBrightness ] }; + key <VOL+> { [ SunAudioRaiseVolume,SunVideoRaiseBrightness ] }; + key <POWR> { [ SunPowerSwitch, SunPowerSwitchShift ] }; + + key <LMTA> { [ Meta_L ] }; + key <RMTA> { [ Meta_R ] }; + key <COMP> { [ Multi_key ] }; +}; + diff --git a/symbols/syr b/symbols/syr new file mode 100644 index 00000000..4be65aa5 --- /dev/null +++ b/symbols/syr @@ -0,0 +1,72 @@ +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/syr,v 1.1 2002/11/22 03:06:50 dawes Exp $ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Syriac"; + + key <TLDE> { [ 0x100070F, 0x100032E, Arabic_shadda ] }; + key <AE01> { [ 1, exclam, 0x1000701 ] }; + key <AE02> { [ 2, 0x100030A, 0x1000702 ] }; + key <AE03> { [ 3, 0x1000325, 0x1000703 ] }; + key <AE04> { [ 4, 0x1000749, 0x1000704 ] }; + key <AE05> { [ 5, 0x1002670, 0x1000705 ] }; + key <AE06> { [ 6, 0x1002671, 0x1000708 ] }; + key <AE07> { [ 7, 0x100070A, 0x1000709 ] }; + key <AE08> { [ 8, 0x10000BB, 0x100070B ] }; + key <AE09> { [ 9, parenright, 0x100070C ] }; + key <AE10> { [ 0, parenleft, 0x100070D ] }; + key <AE11> { [ minus, 0x10000AB, 0x100250C ] }; + key <AE12> { [ equal, plus, 0x1002510 ] }; + + key <AD01> { [ 0x1000714, 0x1000730, Arabic_fatha ] }; + key <AD02> { [ 0x1000728, 0x1000733, Arabic_fathatan ] }; + key <AD03> { [ 0x1000716, 0x1000736, Arabic_damma ] }; + key <AD04> { [ 0x1000729, 0x100073A, Arabic_dammatan ] }; + key <AD05> { [ 0x1000726, 0x100073D, Arabic_madda_above ] }; + key <AD06> { [ 0x100071C, 0x1000740, Arabic_hamza_above ] }; + key <AD07> { [ 0x1000725, 0x1000741, 0x1000747 ] }; + key <AD08> { [ 0x1000717, 0x1000308, 0x1000743 ] }; + key <AD09> { [ 0x100071E, 0x1000304, 0x1000745 ] }; + key <AD10> { [ 0x100071A, 0x1000307, 0x100032D ] }; + key <AD11> { [ 0x1000713, 0x1000303 ] }; + key <AD12> { [ 0x1000715, 0x100074A ] }; + key <BKSL> { [ 0x1000706, colon ] }; + + key <AC01> { [ 0x100072B, 0x1000731, Arabic_kasra ] }; + key <AC02> { [ 0x1000723, 0x1000734, Arabic_kasratan ] }; + key <AC03> { [ 0x100071D, 0x1000737 ] }; + key <AC04> { [ 0x1000712, 0x100073B, Arabic_hamza ] }; + key <AC05> { [ 0x1000720, 0x100073E, Arabic_hamza_below ] }; + key <AC06> { [ 0x1000710, 0x1000711, Arabic_superscript_alef ] }; + key <AC07> { [ 0x100072C, Arabic_tatweel, 0x1000748 ] }; + key <AC08> { [ 0x1000722, 0x1000324, 0x1000744 ] }; + key <AC09> { [ 0x1000721, 0x1000331, 0x1000746 ] }; + key <AC10> { [ 0x100071F, 0x1000323 ] }; + key <AC11> { [ 0x100071B, 0x1000330 ] }; + + key <SPCE> { [ space, 0x100200c ] }; + key <AB01> { [ bracketright, 0x1000732, Arabic_sukun ] }; + key <AB02> { [ bracketleft, 0x1000735 ] }; + key <AB03> { [ 0x1000724, 0x1000738, 0x100200D ] }; + key <AB04> { [ 0x100072A, 0x100073C, 0x100200C ] }; + key <AB05> { [ 0x1000727, 0x100073F, 0x100200E ] }; + key <AB06> { [ 0x1000700, 0x1000739, 0x100200F ] }; + key <AB07> { [ 0x100002E, 0x1000742 ] }; + key <AB08> { [ 0x1000718, Arabic_comma ] }; + key <AB09> { [ 0x1000719, Arabic_semicolon ] }; + key <AB10> { [ 0x1000707, Arabic_question_mark ] }; + + // End Alphanumeric Section + + + // Begin Modifier Mappings + + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R }; + modifier_map Mod2 { Mode_switch }; + +}; diff --git a/symbols/syr_phonetic b/symbols/syr_phonetic new file mode 100644 index 00000000..ac20ad01 --- /dev/null +++ b/symbols/syr_phonetic @@ -0,0 +1,72 @@ +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/syr_phonetic,v 1.1 2002/11/22 03:06:50 dawes Exp $ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Syriac(phonetic)"; + + key <TLDE> { [ 0x100070F, 0x100032E, Arabic_shadda ] }; + key <AE01> { [ 1, exclam, 0x1000701 ] }; + key <AE02> { [ 2, 0x100030A, 0x1000702 ] }; + key <AE03> { [ 3, 0x1000325, 0x1000703 ] }; + key <AE04> { [ 4, 0x1000749, 0x1000704 ] }; + key <AE05> { [ 5, 0x1002670, 0x1000705 ] }; + key <AE06> { [ 6, 0x1002671, 0x1000708 ] }; + key <AE07> { [ 7, 0x100070A, 0x1000709 ] }; + key <AE08> { [ 8, 0x10000BB, 0x100070B ] }; + key <AE09> { [ 9, parenright, 0x100070C ] }; + key <AE10> { [ 0, parenleft, 0x100070D ] }; + key <AE11> { [ minus, 0x10000AB, 0x100250C ] }; + key <AE12> { [ equal, plus, 0x1002510 ] }; + + key <AD01> { [ 0x1000729, 0x1000730, Arabic_fatha ] }; + key <AD02> { [ 0x1000718, 0x1000733, Arabic_fathatan ] }; + key <AD03> { [ 0x1000716, 0x1000736, Arabic_damma ] }; + key <AD04> { [ 0x100072A, 0x100073A, Arabic_dammatan ] }; + key <AD05> { [ 0x100072C, 0x100073D, Arabic_madda_above ] }; + key <AD06> { [ 0x100071D, 0x1000740, Arabic_hamza_above ] }; + key <AD07> { [ 0x100071C, 0x1000741, 0x1000747 ] }; + key <AD08> { [ 0x1000725, 0x1000308, 0x1000743 ] }; + key <AD09> { [ 0x1000727, 0x1000304, 0x1000745 ] }; + key <AD10> { [ 0x1000726, 0x1000307, 0x100032D ] }; + key <AD11> { [ bracketright, 0x1000303 ] }; + key <AD12> { [ bracketleft, 0x100074A ] }; + key <BKSL> { [ 0x1000706, colon ] }; + + key <AC01> { [ 0x1000710, 0x1000731, Arabic_kasra ] }; + key <AC02> { [ 0x1000723, 0x1000734, Arabic_kasratan ] }; + key <AC03> { [ 0x1000715, 0x1000737 ] }; + key <AC04> { [ 0x1000714, 0x100073B, Arabic_hamza ] }; + key <AC05> { [ 0x1000713, 0x100073E, Arabic_hamza_below ] }; + key <AC06> { [ 0x1000717, 0x1000711, Arabic_superscript_alef ] }; + key <AC07> { [ 0x100071B, Arabic_tatweel, 0x1000748 ] }; + key <AC08> { [ 0x100071F, 0x1000324, 0x1000744 ] }; + key <AC09> { [ 0x1000720, 0x1000331, 0x1000746 ] }; + key <AC10> { [ 0x100071A, 0x1000323 ] }; + key <AC11> { [ 0x100071E, 0x1000330 ] }; + + key <SPCE> { [ space, 0x100200c ] }; + key <AB01> { [ 0x1000719, 0x1000732, Arabic_sukun ] }; + key <AB02> { [ 0x1000728, 0x1000735 ] }; + key <AB03> { [ 0x1000724, 0x1000738, 0x100200D ] }; + key <AB04> { [ 0x100072B, 0x100073C, 0x100200C ] }; + key <AB05> { [ 0x1000712, 0x100073F, 0x100200E ] }; + key <AB06> { [ 0x1000722, 0x1000739, 0x100200F ] }; + key <AB07> { [ 0x1000721, 0x1000742 ] }; + key <AB08> { [ 0x1000700, Arabic_comma ] }; + key <AB09> { [ 0x100002E, Arabic_semicolon ] }; + key <AB10> { [ 0x1000707, Arabic_question_mark ] }; + + // End Alphanumeric Section + + + // Begin Modifier Mappings + + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R }; + modifier_map Mod2 { Mode_switch }; + +}; diff --git a/symbols/tel b/symbols/tel new file mode 100644 index 00000000..b7a34def --- /dev/null +++ b/symbols/tel @@ -0,0 +1,69 @@ +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Inscript layout for Telugu using Unicode + // Author: G Karunakar <karunakar@freedomink.org> + // Date: + // See layout at http://www.indlinux.org/keymap/telugu.php + + name[Group1]= "Telugu"; + + key <TLDE> { [ 0x01000c4a, 0x01000c12 ] }; + key <AE01> { [ 0x01000c67, 0x01000c0d ] }; + key <AE02> { [ 0x01000c68, 0x01000c45 ] }; + key <AE03> { [ 0x01000c69, numbersign ] }; + key <AE04> { [ 0x01000c6a, dollar ] }; + key <AE05> { [ 0x01000c6b, percent ] }; + key <AE06> { [ 0x01000c6c, asciicircum ] }; + key <AE07> { [ 0x01000c6d, ampersand ] }; + key <AE08> { [ 0x01000c6e, asterisk ] }; + key <AE09> { [ 0x01000c6f, parenleft ] }; + key <AE10> { [ 0x01000c66, parenright ] }; + key <AE11> { [ 0x01000c03, underscore ] }; + key <AE12> { [ 0x01000c43, 0x01000c0b ] }; + key <BKSP> { [ BackSpace ] }; + + key <AD01> { [ 0x01000c4c, 0x01000c14 ] }; + key <AD02> { [ 0x01000c48, 0x01000c10 ] }; + key <AD03> { [ 0x01000c3e, 0x01000c06 ] }; + key <AD04> { [ 0x01000c40, 0x01000c08 ] }; + key <AD05> { [ 0x01000c42, 0x01000c0a ] }; + key <AD06> { [ 0x01000c2c, 0x01000c2d ] }; + key <AD07> { [ 0x01000c39, 0x01000c19 ] }; + key <AD08> { [ 0x01000c17, 0x01000c18 ] }; + key <AD09> { [ 0x01000c26, 0x01000c27 ] }; + key <AD10> { [ 0x01000c1c, 0x01000c1d ] }; + key <AD11> { [ 0x01000c21, 0x01000c22 ] }; + key <AD12> { [ 0x01000c3c, 0x01000c1e ] }; + + key <AC01> { [ 0x01000c4b, 0x01000c13 ] }; + key <AC02> { [ 0x01000c47, 0x01000c0f ] }; + key <AC03> { [ 0x01000c4d, 0x01000c05 ] }; + key <AC04> { [ 0x01000c3f, 0x01000c07 ] }; + key <AC05> { [ 0x01000c41, 0x01000c09 ] }; + key <AC06> { [ 0x01000c2a, 0x01000c2b ] }; + key <AC07> { [ 0x01000c30, 0x01000c31 ] }; + key <AC08> { [ 0x01000c15, 0x01000c16 ] }; + key <AC09> { [ 0x01000c24, 0x01000c25 ] }; + key <AC10> { [ 0x01000c1a, 0x01000c1b ] }; + key <AC11> { [ 0x01000c1f, 0x01000c20 ] }; + + key <AB01> { [ 0x01000c46, 0x01000c0e ] }; + key <AB02> { [ 0x01000c02, 0x01000c01 ] }; + key <AB03> { [ 0x01000c2e, 0x01000c23 ] }; + key <AB04> { [ 0x01000c28, 0x01000c29 ] }; + key <AB05> { [ 0x01000c35, 0x01000c34 ] }; + key <AB06> { [ 0x01000c32, 0x01000c33 ] }; + key <AB07> { [ 0x01000c38, 0x01000c36 ] }; + key <AB08> { [ comma , 0x01000c37 ] }; + key <AB09> { [ period , 0x01000c64 ] }; + key <AB10> { [ 0x01000c2f, 0x01000040 ] }; + key <BKSL> { [ 0x01000c49, 0x01000c11 ] }; + + key <RALT> { + symbols[Group1] = [ Mode_switch , Multi_key ], + virtualMods = AltGr + }; +}; diff --git a/symbols/th b/symbols/th new file mode 100644 index 00000000..7b8297fb --- /dev/null +++ b/symbols/th @@ -0,0 +1,63 @@ + +// based on a keyboard map from an 'xkb/symbols/th' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/th,v 1.3 2003/04/03 16:34:51 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Thai (Kedmanee)"; + + // converted to THai keysysms - Pablo Saratxaga <pablo@mandrakesoft.com> + + key <TLDE> { [ underscore, percent ] }; + key <AE01> { [ Thai_lakkhangyao, plus ] }; + key <AE02> { [ slash, Thai_leknung ] }; + key <AE03> { [ minus, Thai_leksong ] }; + key <AE04> { [ Thai_phosamphao, Thai_leksam ] }; + key <AE05> { [ Thai_thothung, Thai_leksi ] }; + key <AE06> { [ Thai_sarau, Thai_sarauu ] }; + key <AE07> { [ Thai_saraue, Thai_baht ] }; + key <AE08> { [ Thai_khokhwai, Thai_lekha ] }; + key <AE09> { [ Thai_totao, Thai_lekhok ] }; + key <AE10> { [ Thai_chochan, Thai_lekchet ] }; + key <AE11> { [ Thai_khokhai, Thai_lekpaet ] }; + key <AE12> { [ Thai_chochang, Thai_lekkao ] }; + + key <AD01> { [ Thai_maiyamok, Thai_leksun ] }; + key <AD02> { [ Thai_saraaimaimalai, quotedbl ] }; + key <AD03> { [ Thai_saraam, Thai_dochada ] }; + key <AD04> { [ Thai_phophan, Thai_thonangmontho ] }; + key <AD05> { [ Thai_saraa, Thai_thothong ] }; + key <AD06> { [ Thai_maihanakat, Thai_nikhahit ] }; + key <AD07> { [ Thai_saraii, Thai_maitri ] }; + key <AD08> { [ Thai_rorua, Thai_nonen ] }; + key <AD09> { [ Thai_nonu, Thai_paiyannoi ] }; + key <AD10> { [ Thai_yoyak, Thai_yoying ] }; + key <AD11> { [ Thai_bobaimai, Thai_thothan ] }; + key <AD12> { [ Thai_loling, comma ] }; + + key <AC01> { [ Thai_fofan, Thai_ru ] }; + key <AC02> { [ Thai_hohip, Thai_khorakhang ] }; + key <AC03> { [ Thai_kokai, Thai_topatak ] }; + key <AC04> { [ Thai_dodek, Thai_sarao ] }; + key <AC05> { [ Thai_sarae, Thai_chochoe ] }; + key <AC06> { [ Thai_maitho, Thai_maitaikhu ] }; + key <AC07> { [ Thai_maiek, Thai_maichattawa ] }; + key <AC08> { [ Thai_saraaa, Thai_sorusi ] }; + key <AC09> { [ Thai_sosua, Thai_sosala ] }; + key <AC10> { [ Thai_wowaen, Thai_soso ] }; + key <AC11> { [ Thai_ngongu, period ] }; + + key <AB01> { [ Thai_phophung, parenleft ] }; + key <AB02> { [ Thai_popla, parenright ] }; + key <AB03> { [ Thai_saraae, Thai_choching ] }; + key <AB04> { [ Thai_oang, Thai_honokhuk ] }; + key <AB05> { [ Thai_sarai, Thai_phinthu ] }; + key <AB06> { [ Thai_sarauee, Thai_thanthakhat ] }; + key <AB07> { [ Thai_thothahan, question ] }; + key <AB08> { [ Thai_moma, Thai_thophuthao ] }; + key <AB09> { [ Thai_saraaimaimuan, Thai_lochula ] }; + key <AB10> { [ Thai_fofa, Thai_lu ] }; + + key <BKSL> { [ Thai_khokhuat, Thai_khokhon ] }; +}; diff --git a/symbols/th_pat b/symbols/th_pat new file mode 100644 index 00000000..1f733dbf --- /dev/null +++ b/symbols/th_pat @@ -0,0 +1,64 @@ +// $XFree86$ +// +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Thai (Pattachote)"; + // The thai layout defines a second keyboard group and changes + // the behavior of a few modifier keys. + + // converted to THai keysysms - Pablo Saratxaga pablo@mandrakesoft.com + // Pattachote modification by Visanu Euarchukiati -- visanu@inet.co.th + key <TLDE> { [ underscore, Thai_baht ] }; + key <AE01> { [ equal, plus ] }; + key <AE02> { [ Thai_leksong, quotedbl ] }; + key <AE03> { [ Thai_leksam, slash ] }; + key <AE04> { [ Thai_leksi, comma ] }; + key <AE05> { [ Thai_lekha, question ] }; + key <AE06> { [ Thai_sarauu, Thai_sarau ] }; + key <AE07> { [ Thai_lekchet, underscore ] }; + key <AE08> { [ Thai_lekpaet, period ] }; + key <AE09> { [ Thai_lekkao, parenleft ] }; + key <AE10> { [ Thai_leksun, parenright ] }; + key <AE11> { [ Thai_leknung, minus ] }; + key <AE12> { [ Thai_lekhok, percent ] }; + + key <AD01> { [ Thai_maitaikhu, Thai_maitri ] }; + key <AD02> { [ Thai_totao, Thai_ru ] }; + key <AD03> { [ Thai_yoyak, Thai_maiyamok ] }; + key <AD04> { [ Thai_oang, Thai_yoying ] }; + key <AD05> { [ Thai_rorua, Thai_sorusi ] }; + key <AD06> { [ Thai_maiek, Thai_saraue ] }; + key <AD07> { [ Thai_dodek, Thai_fofa ] }; + key <AD08> { [ Thai_moma, Thai_soso ] }; + key <AD09> { [ Thai_wowaen, Thai_thothung ] }; + key <AD10> { [ Thai_saraae, Thai_thophuthao ] }; + key <AD11> { [ Thai_saraaimaimuan, Thai_paiyannoi ] }; + key <AD12> { [ Thai_chochoe, Thai_lu ] }; + + key <AC01> { [ Thai_maitho, Thai_maichattawa] }; + key <AC02> { [ Thai_thothahan, Thai_thothong ] }; + key <AC03> { [ Thai_ngongu, Thai_saraam ] }; + key <AC04> { [ Thai_kokai, Thai_nonen ] }; + key <AC05> { [ Thai_maihanakat, Thai_thanthakhat] }; + key <AC06> { [ Thai_saraii, Thai_sarauee ] }; + key <AC07> { [ Thai_saraaa, Thai_phophung ] }; + key <AC08> { [ Thai_nonu, Thai_chochang ] }; + key <AC09> { [ Thai_sarae, Thai_sarao ] }; + key <AC10> { [ Thai_saraaimaimalai, Thai_khorakhang ] }; + key <AC11> { [ Thai_khokhai, Thai_thonangmontho ] }; + + key <AB01> { [ Thai_bobaimai, Thai_dochada ] }; + key <AB02> { [ Thai_popla, Thai_topatak ] }; + key <AB03> { [ Thai_loling, Thai_thothan ] }; + key <AB04> { [ Thai_hohip, Thai_phosamphao ] }; + key <AB05> { [ Thai_sarai, Thai_phinthu ] }; + key <AB06> { [ Thai_khokhwai, Thai_sosala ] }; + key <AB07> { [ Thai_sosua, Thai_honokhuk ] }; + key <AB08> { [ Thai_saraa, Thai_fofan ] }; + key <AB09> { [ Thai_chochan, Thai_choching ] }; + key <AB10> { [ Thai_phophan, Thai_lochula ] }; + + key <BKSL> { [ Thai_lakkhangyao, Thai_nikhahit ] }; +}; + + diff --git a/symbols/th_tis b/symbols/th_tis new file mode 100644 index 00000000..4ba166cb --- /dev/null +++ b/symbols/th_tis @@ -0,0 +1,63 @@ +// $XFree86$ +// +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Thai (TIS-820.2538)"; + // The thai layout defines a second keyboard group and changes + // the behavior of a few modifier keys. + + // converted to THai keysysms - Pablo Saratxaga <pablo@mandrakesoft.com> + // modified to TIS-820.2538 - Theppitak Karoonboonyanan <thep@linux.thai.net> + key <TLDE> { [ 0x1000e4f, 0x1000e5b ] }; + key <AE01> { [ Thai_baht, Thai_lakkhangyao] }; + key <AE02> { [ slash, Thai_leknung ] }; + key <AE03> { [ minus, Thai_leksong ] }; + key <AE04> { [ Thai_phosamphao, Thai_leksam ] }; + key <AE05> { [ Thai_thothung, Thai_leksi ] }; + key <AE06> { [ Thai_sarau, Thai_sarauu ] }; + key <AE07> { [ Thai_saraue, 0x1000e4e ] }; + key <AE08> { [ Thai_khokhwai, Thai_lekha ] }; + key <AE09> { [ Thai_totao, Thai_lekhok ] }; + key <AE10> { [ Thai_chochan, Thai_lekchet ] }; + key <AE11> { [ Thai_khokhai, Thai_lekpaet ] }; + key <AE12> { [ Thai_chochang, Thai_lekkao ] }; + + key <AD01> { [ Thai_maiyamok, Thai_leksun ] }; + key <AD02> { [ Thai_saraaimaimalai, quotedbl ] }; + key <AD03> { [ Thai_saraam, Thai_dochada ] }; + key <AD04> { [ Thai_phophan, Thai_thonangmontho ] }; + key <AD05> { [ Thai_saraa, Thai_thothong ] }; + key <AD06> { [ Thai_maihanakat, Thai_nikhahit ] }; + key <AD07> { [ Thai_saraii, Thai_maitri ] }; + key <AD08> { [ Thai_rorua, Thai_nonen ] }; + key <AD09> {type[Group1]="THREE_LEVEL", + [ Thai_nonu, Thai_paiyannoi, 0x1000e5a] }; + key <AD10> { [ Thai_yoyak, Thai_yoying ] }; + key <AD11> { [ Thai_bobaimai, Thai_thothan ] }; + key <AD12> { [ Thai_loling, comma ] }; + + key <AC01> { [ Thai_fofan, Thai_ru ] }; + key <AC02> { [ Thai_hohip, Thai_khorakhang ] }; + key <AC03> { [ Thai_kokai, Thai_topatak ] }; + key <AC04> { [ Thai_dodek, Thai_sarao ] }; + key <AC05> { [ Thai_sarae, Thai_chochoe ] }; + key <AC06> { [ Thai_maitho, Thai_maitaikhu ] }; + key <AC07> { [ Thai_maiek, Thai_maichattawa ] }; + key <AC08> { [ Thai_saraaa, Thai_sorusi ] }; + key <AC09> { [ Thai_sosua, Thai_sosala ] }; + key <AC10> { [ Thai_wowaen, Thai_soso ] }; + key <AC11> { [ Thai_ngongu, period ] }; + + key <AB01> { [ Thai_phophung, parenleft ] }; + key <AB02> { [ Thai_popla, parenright ] }; + key <AB03> { [ Thai_saraae, Thai_choching ] }; + key <AB04> { [ Thai_oang, Thai_honokhuk ] }; + key <AB05> { [ Thai_sarai, Thai_phinthu ] }; + key <AB06> { [ Thai_sarauee, Thai_thanthakhat ] }; + key <AB07> { [ Thai_thothahan, question ] }; + key <AB08> { [ Thai_moma, Thai_thophuthao ] }; + key <AB09> { [ Thai_saraaimaimuan, Thai_lochula ] }; + key <AB10> { [ Thai_fofa, Thai_lu ] }; + + key <BKSL> { [ Thai_khokhon, Thai_khokhuat ] }; +}; diff --git a/symbols/tj b/symbols/tj new file mode 100644 index 00000000..aed9adef --- /dev/null +++ b/symbols/tj @@ -0,0 +1,82 @@ + +// based on +// Tajik keyboard +// it is a Russian layout keyboard, with SHCHA replaced with +// dead_cedilla/dead_macron +// that allows to type the SHCHA with dead_cedilla + SHA +// and all the extra Tajik keys: +// dead_cedilla + KA, HA --> KA descender, HA descender +// dead_macron + I, U, GHE --> I macron, U macron, GHE horizontal stroke +// it requires proper dead_cedilla and dead_macron entries in Compose file +// it also allows to use Mode_switch when in cyrillic mode to enter +// special letters by doing Mode_switch + base letter +// +// AEN <aen@logic.ru> (for the Russian layout) +// Pablo Saratxaga <pablo@mandrakesoft> (for the dead keys changes) +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Tajik"; + + key <TLDE> { [ Cyrillic_io, Cyrillic_IO ] }; + key <LSGT> { [ bar, brokenbar ] }; + key <AD01> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <AE01> { [ 1, exclam ] }; + key <AB01> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <AC02> { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key <AC01> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <AD02> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <AE02> { [ 2, quotedbl ] }; + key <AB03> { [ Cyrillic_es, Cyrillic_ES ] }; + key <AB02> { [ Cyrillic_che, Cyrillic_CHE ], + [ 0x010004b7, 0x010004b6 ] }; + key <AC03> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <AD03> { [ Cyrillic_u, Cyrillic_U ], + [ 0x010004ef, 0x010004ee ] }; + key <AE04> { [ 4, asterisk ] }; + key <AE03> { [ 3, apostrophe ] }; + key <AB04> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AC04> { [ Cyrillic_a, Cyrillic_A ] }; + key <AD05> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <AD04> { [ Cyrillic_ka, Cyrillic_KA ], + [ 0x0100049b, 0x0100049a ] }; + key <AE05> { [ 5, colon ] }; + key <AB06> { [ Cyrillic_te, Cyrillic_TE ] }; + key <AB05> { [ Cyrillic_i, Cyrillic_I ], + [ 0x010004e3, 0x010004e2 ] }; + key <AC06> { [ Cyrillic_er, Cyrillic_ER ] }; + key <AC05> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AD06> { [ Cyrillic_en, Cyrillic_EN ] }; + key <AE06> { [ 6, comma ] }; + key <AB07> { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key <AC07> { [ Cyrillic_o, Cyrillic_O ] }; + key <AD07> { [ Cyrillic_ghe, Cyrillic_GHE ], + [ 0x01000493, 0x01000492 ] }; + key <AE07> { [ 7, period ] }; + key <AE08> { [ 8, semicolon ] }; + key <AB08> { [ Cyrillic_be, Cyrillic_BE ] }; + key <AC08> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AD08> { [ Cyrillic_sha, Cyrillic_SHA ], + [ Cyrillic_shcha, Cyrillic_SHCHA] }; + key <AD09> { [ dead_cedilla, dead_macron ] }; + key <AE10> { [ 0, parenright ] }; + key <AE09> { [ 9, parenleft ] }; + key <AB09> { [ Cyrillic_yu, Cyrillic_YU ] }; + key <AB10> { [ slash, question ] }; + key <AC09> { [ Cyrillic_de, Cyrillic_DE ] }; + key <AC10> { [ Cyrillic_zhe, Cyrillic_ZHE ], + [ 0x01000497, 0x01000496 ] }; + key <AD10> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <AE11> { [ minus, underscore ] }; + key <AC11> { [ Cyrillic_e, Cyrillic_E ] }; + key <AD11> { [ Cyrillic_ha, Cyrillic_HA ], + [ 0x010004b3, 0x010004b2 ] }; + key <AE12> { [ equal, plus ] }; + key <AD12> { [Cyrillic_hardsign,Cyrillic_HARDSIGN ] }; + + // End alphanumeric section + +}; diff --git a/symbols/tml b/symbols/tml new file mode 100644 index 00000000..973b0817 --- /dev/null +++ b/symbols/tml @@ -0,0 +1,234 @@ + +// based on a keyboard map from an 'xkb/symbols/tml' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/tml,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "TSCII" { + +// Description : A Tamil typewrite-style keymap +// loosely based on TamilNet'99 reommendations +// Encoding : TSCII (http://www.tscii.org) +// Author : Thuraiappah Vaseeharan <vasee@ieee.org> +// Last Modified: Sat Jan 5 17:11:26 CST 2002 + + name[Group1]= "TSCII"; + + key <AE01> { [ 0x10000b7, 0x10000a4 ] }; // aytham + key <AE02> { [ 0x1000082, 0x10000a5 ] }; // shri + key <AE03> { [ 0x1000083, 0x1000088 ] }; // ja + key <AE04> { [ 0x1000084, 0x1000089 ] }; // sha + key <AE05> { [ 0x1000085, 0x100008a ] }; // sa + key <AE06> { [ 0x1000086, 0x100008b ] }; // ha + key <AE07> { [ 0x1000087, 0x100008c ] }; // ksha + + // Qrow + key <AD01> { [ 0x10000bb, 0x100009a ] }; // nja + key <AD02> { [ 0x10000c8, 0x10000da ] }; // Ra + key <AD03> { [ 0x10000bf, 0x10000d1 ] }; // NNa + key <AD04> { [ 0x10000ba, 0x10000cd ] }; // ca + key <AD05> { [ 0x10000c5, 0x10000d7 ] }; // va + key <AD06> { [ 0x10000c4, 0x10000d6 ] }; // la + key <AD07> { [ 0x10000c3, 0x10000d5 ] }; // ra + key <AD08> { [ 0x10000a8, 0x10000b3 ] }; // sangili, ai + key <AD09> { [ 0x10000ca, 0x10000cb ] }; // di, dI + key <AD10> { [ 0x10000a2, 0x10000a3 ] }; // visiri + key <AD11> { [ dead_acute, 0x10000a3 ] }; // Ukaaram + + // Arow + key <AC01> { [ 0x10000c2, 0x10000d4 ] }; // ya + key <AC02> { [ 0x10000c7, 0x10000d9 ] }; // La + key <AC03> { [ 0x10000c9, 0x10000db ] }; // na + key <AC04> { [ 0x10000b8, 0x10000cc ] }; // ka + key <AC05> { [ 0x10000c0, 0x10000d2 ] }; // pa + key <AC06> { [ dead_grave,0x10000a1 ] }; // pulli,aravu + key <AC07> { [ 0x10000be, 0x10000d0 ] }; // tha + key <AC08> { [ 0x10000c1, 0x10000d3 ] }; // ma + key <AC09> { [ 0x10000bc, 0x10000ce ] }; // da + key <AC10> { [ 0x10000c6, 0x10000d8 ] }; // zha + key <AC11> { [ 0x10000b9, 0x1000099 ] }; // nga + + // Zrow + key <AB01> { [ 0x10000bd, 0x10000cf ] }; // Na + key <AB02> { [ 0x10000b4, 0x10000b5 ] }; // o, O + key <AB03> { [ 0x10000af, 0x10000b0 ] }; // u, U + key <AB04> { [ 0x10000b1, 0x10000b2 ] }; // e, E + key <AB05> { [ 0x10000a6, 0x10000a7 ] }; // kombus + key <AB06> { [ 0x10000b6, 0x10000aa ] }; // au + key <AB07> { [ 0x10000ab, 0x10000ac ] }; // a, A + key <AB08> { [ 0x10000fe, 0x10000ae ] }; // i, I + +}; + +partial alphanumeric_keys +xkb_symbols "TAB" { + +// Description: A keymap based on the TamilNet'99 typewriter keyboard +// Encoding: TAB (http://www.tamilnet99.org) +// Author: Thuraiappah Vaseeharan <t_vasee@yahoo.com> +// Date : Sun Aug 12 02:23:00 CDT 2001 + + name[Group1]= "Tamil"; + + // numeral row + key <AE01> { [ 0x10000e7, 0x10000a7 ] } ; + key <AE02> { [ 0x10000fa, 0x10000a8 ] } ; + key <AE03> { [ 0x10000fb ] } ; + key <AE04> { [ 0x10000fc ] } ; + key <AE05> { [ 0x10000fd ] } ; + key <AE06> { [ 0x10000fe ] } ; + key <AE07> { [ 0x10000ff ] } ; + + // q-row + key <AD01> { [ 0x10000eb, 0x10000b3 ] }; + key <AD02> { [ 0x10000f8, 0x10000c1 ] }; + key <AD03> { [ 0x10000ef, 0x10000b8 ] }; + key <AD04> { [ 0x10000ea, 0x10000b2 ] }; + key <AD05> { [ 0x10000f5, 0x10000be ] }; + key <AD06> { [ 0x10000f4, 0x10000bd ] }; + key <AD07> { [ 0x10000f3, 0x10000bc ] }; + key <AD08> { [ 0x10000ac, 0x10000e4 ] }; + key <AD09> { [ 0x10000ae, 0x10000af ] }; + key <AD10> { [ 0x10000a4, 0x10000a6 ] }; + key <AD11> { [ dead_circumflex, 0x10000a6 ] }; // Ukaaram + + // a-row + key <AC01> { [ 0x10000f2, 0x10000bb ] }; + key <AC02> { [ 0x10000f7, 0x10000c0 ] }; + key <AC03> { [ 0x10000f9, 0x10000c2 ] }; + key <AC04> { [ 0x10000e8, 0x10000b0 ] }; + key <AC05> { [ 0x10000f0, 0x10000b9 ] }; + key <AC06> { [ 0x10000a2, 0x10000a3 ] }; + key <AC07> { [ 0x10000ee, 0x10000b6 ] }; + key <AC08> { [ 0x10000f1, 0x10000ba ] }; + key <AC09> { [ 0x10000ec, 0x10000b4 ] }; + key <AC10> { [ 0x10000f6, 0x10000bf ] }; + key <AC11> { [ 0x10000e9, 0x10000b1 ] }; + + // z-row + key <AB01> { [ 0x10000ed, 0x10000b5 ] }; + key <AB02> { [ 0x10000e5, 0x10000e6 ] }; + key <AB03> { [ 0x10000e0, 0x10000e1 ] }; + key <AB04> { [ 0x10000e2, 0x10000e3 ] }; + key <AB05> { [ 0x10000aa, 0x10000ab ] }; + key <AB06> { [ 0x10000ac, 0x10000a3 ] }; + key <AB07> { [ 0x10000dc, 0x10000dd ] }; + key <AB08> { [ 0x10000de, 0x10000df ] }; +}; + +partial alphanumeric_keys +xkb_symbols "UNI" { + +// Description: A keymap based on the TamilNet'99 typewriter keyboard +// Encoding: Unicode (http://www.unicode.org) +// Author: Thuraiappah Vaseeharan <vasee@ieee.org> +// Date : Sat Feb 9 21:10:48 CST 2002 +// Mapping: + + name[Group1]= "Tamil"; + + // granthas + key <AE01> { [ 0x1000b83 ] } ; + key <AE03> { [ 0x1000b9c ] } ; + key <AE04> { [ 0x1000bb7 ] } ; + key <AE05> { [ 0x1000bb8 ] } ; + key <AE06> { [ 0x1000bb9 ] } ; + + // Qrow + key <AD01> { [ 0x1000b9e ] }; + key <AD02> { [ 0x1000bb1 ] }; + key <AD03> { [ 0x1000ba8 ] }; + key <AD04> { [ 0x1000b9a ] }; + key <AD05> { [ 0x1000bb5 ] }; + key <AD06> { [ 0x1000bb2 ] }; + key <AD07> { [ 0x1000bb0 ] }; + key <AD08> { [ 0x1000bc8, 0x1000b90 ] }; + key <AD09> { [ 0x1000bca, 0x1000bcb ] }; + key <AD10> { [ 0x1000bbf, 0x1000bc0 ] }; + key <AD11> { [ 0x1000bc1, 0x1000bc2 ] }; + + // Arow + key <AC01> { [ 0x1000baf ] }; + key <AC02> { [ 0x1000bb3 ] }; + key <AC03> { [ 0x1000ba9 ] }; + key <AC04> { [ 0x1000b95 ] }; + key <AC05> { [ 0x1000baa ] }; + key <AC06> { [ 0x1000bbe, 0x1000bb4 ] }; + key <AC07> { [ 0x1000ba4 ] }; + key <AC08> { [ 0x1000bae ] }; + key <AC09> { [ 0x1000b9f ] }; + key <AC10> { [ 0x1000bcd ] }; + key <AC11> { [ 0x1000b99 ] }; + + // Zrow + key <AB01> { [ 0x1000ba3 ] }; + key <AB02> { [ 0x1000b92, 0x1000b93 ] }; + key <AB03> { [ 0x1000b89, 0x1000b8a ] }; + key <AB04> { [ 0x1000b8e, 0x1000b8f ] }; + key <AB05> { [ 0x1000bc6, 0x1000bc7 ] }; + key <AB06> { [ 0x1000b94, 0x1000bcc ] }; + key <AB07> { [ 0x1000b85, 0x1000b86 ] }; + key <AB08> { [ 0x1000b87, 0x1000b88 ] }; +}; + +partial alphanumeric_keys +xkb_symbols "INSCRIPT" { + name[Group1]= "Tamil"; + + key <TLDE> { [ 0x1000BCA, 0x1000B92 ] }; + + // Mainly numbers. + key <AE01> { [ 0x1000BE7 ] }; + key <AE02> { [ 0x1000BE8 ] }; + key <AE03> { [ 0x1000BE9 ] }; + key <AE04> { [ 0x1000BEA ] }; + key <AE05> { [ 0x1000BEB ] }; + key <AE06> { [ 0x1000BEC ] }; + key <AE07> { [ 0x1000BED ] }; + key <AE08> { [ 0x1000BEE ] }; + key <AE09> { [ 0x1000BEF, parenleft ] }; + key <AE10> { [ 0x1000BF0, parenright ] }; + key <AE11> { [ 0x1000BF1, 0x1000B83 ] }; + key <AE12> { [ 0x1000BF2, plus ] }; + +// Mainly long vowels + + key <AD01> { [ 0x1000BCC, 0x1000B94 ] }; + key <AD02> { [ 0x1000BC8, 0x1000B90 ] }; + key <AD03> { [ 0x1000BBE, 0x1000B86 ] }; + key <AD04> { [ 0x1000BC0, 0x1000B88 ] }; + key <AD05> { [ 0x1000BC2, 0x1000B8A ] }; + +// Mainly voiced consonants + + key <AD07> { [ 0x1000BB9, 0x1000B99 ] }; + key <AD12> { [ 0x1000BBC, 0x1000B9E ] }; + +// Mainly short vowels + key <AC01> { [ 0x1000BCB, 0x1000B93 ] }; + key <AC02> { [ 0x1000BC7, 0x1000B8F ] }; + key <AC03> { [ 0x1000BCD, 0x1000B85 ] }; + key <AC04> { [ 0x1000BBF, 0x1000B87 ] }; + key <AC05> { [ 0x1000BC1, 0x1000B89 ] }; + +// Mainly unvoiced consonants + + key <AC06> { [ 0x1000BAA ] }; + key <AC07> { [ 0x1000BB0, 0x1000BB1 ] }; + key <AC08> { [ 0x1000B95 ] }; + key <AC09> { [ 0x1000BA4 ] }; + key <AC10> { [ 0x1000B9A ] }; + key <AC11> { [ 0x1000B9F ] }; + key <BKSL> { [ backslash, bar ] }; + + key <AB01> { [ 0x1000BC6, 0x1000B8E ] }; + key <AB02> { [ 0x1000B82 ] }; + key <AB03> { [ 0x1000BAE, 0x1000BA3 ] }; + key <AB04> { [ 0x1000BA8, 0x1000BA9 ] }; + key <AB05> { [ 0x1000BB5, 0x1000BB4 ] }; + key <AB06> { [ 0x1000BB2, 0x1000BB3 ] }; + key <AB07> { [ 0x1000BB8 ] }; + key <AB08> { [ comma, 0x1000BB7 ] }; + key <AB09> { [ period, 0x1000964 ] }; + key <AB10> { [ 0x1000BAF, question ] }; +}; diff --git a/symbols/tr b/symbols/tr new file mode 100644 index 00000000..b74a1748 --- /dev/null +++ b/symbols/tr @@ -0,0 +1,153 @@ + +// based on +// Turkish keyboard symbols for PC and xkb +// This file distributed without any expressed or implied warranty +// Nilgün Belma Bugüner <nilgun@superonline.com>, 2002 +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/tr,v 1.5 2003/04/19 12:22:12 pascal Exp $ + +//Default Layout (Turkish Q) +default partial +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Turkish"; + + key <AE01> { [ 1, exclam, onesuperior, exclamdown ] }; + key <AE02> { [ 2, apostrophe, sterling, twosuperior ] }; + key <AE03> { [ 3, asciicircum, numbersign, threesuperior ] }; + key <AE04> { [ 4, plus, dollar, onequarter ] }; + key <AE06> { [ 6, ampersand, threequarters, VoidSymbol ] }; + key <AE07> { [ 7, slash, braceleft, VoidSymbol ] }; + key <AE08> { [ 8, parenleft, bracketleft, VoidSymbol ] }; + key <AE09> { [ 9, parenright, bracketright, plusminus ] }; + key <AE10> { [ 0, equal, braceright, degree ] }; + key <AE11> { [ asterisk, question, backslash, questiondown ] }; + key <AE12> { [ minus, underscore, division, VoidSymbol ] }; + + key <AD02> { [ w, W, VoidSymbol, VoidSymbol ] }; + key <AD03> { [ e, E, EuroSign, VoidSymbol ] }; + key <AD05> { [ t, T, trademark, VoidSymbol ] }; + key <AD07> { [ u, U, ucircumflex, Ucircumflex ] }; + key <AD08> { [ idotless, I, icircumflex, Icircumflex ] }; + key <AD09> { [ o, O, ocircumflex, Ocircumflex ] }; + key <AD10> { [ p, P, VoidSymbol, VoidSymbol ] }; + key <AD11> { [ gbreve, Gbreve ] }; + key <AD12> { [udiaeresis, Udiaeresis, asciitilde, dead_macron ] }; + + key <AC01> { [ a, A, acircumflex, Acircumflex ] }; + key <AC02> { [ s, S, section, VoidSymbol ] }; + key <AC03> { [ d, D, VoidSymbol, VoidSymbol ] }; + key <AC04> { [ f, F, ordfeminine, VoidSymbol ] }; + key <AC05> { [ g, G, VoidSymbol, VoidSymbol ] }; + key <AC06> { [ h, H, VoidSymbol, VoidSymbol ] }; + key <AC08> { [ k, K, VoidSymbol, VoidSymbol ] }; + key <AC09> { [ l, L, VoidSymbol, VoidSymbol ] }; + key <AC10> { [ scedilla, Scedilla, acute, dead_acute ] }; + key <AC11> { [ i, Iabovedot, apostrophe, dead_caron ] }; + key <TLDE> { [ quotedbl, backslash, plusminus, degree ] }; + + key <BKSL> { [ comma, semicolon, grave, dead_grave ] }; + key <LSGT> { [ less, greater, bar, brokenbar ] }; + key <AB08> { [odiaeresis, Odiaeresis, multiply, VoidSymbol ] }; + key <AB09> { [ ccedilla, Ccedilla, periodcentered, division ] }; + key <AB10> { [ period, colon, dead_abovedot, dead_abovedot ] }; + key <SPCE> { [ space, space, nobreakspace, nobreakspace ] }; + + include "level3(ralt_switch_multikey)" +}; + + +// Turkish F Layout +partial +xkb_symbols "tr_f" { + + include "pc/latin" + + name[Group1]="Turkish"; + + key <AE01> { [ 1, exclam, onesuperior, exclamdown ] }; + key <AE02> { [ 2, quotedbl, twosuperior, VoidSymbol ] }; + key <AE03> { [ 3, asciicircum, numbersign, threesuperior ] }; + key <AE04> { [ 4, dollar, onequarter, VoidSymbol ] }; + key <AE06> { [ 6, ampersand, threequarters, VoidSymbol ] }; + key <AE07> { [ 7, apostrophe, braceleft, VoidSymbol ] }; + key <AE08> { [ 8, parenleft, bracketleft, VoidSymbol ] }; + key <AE09> { [ 9, parenright, bracketright, plusminus ] }; + key <AE10> { [ 0, equal, braceright, degree ] }; + key <AE11> { [ slash, question, backslash, questiondown ] }; + key <AE12> { [ minus, underscore, division, VoidSymbol ] }; + + key <AD01> { [ f, F, at, VoidSymbol ] }; + key <AD02> { [ g, G, VoidSymbol, VoidSymbol ] }; + key <AD03> { [ gbreve, Gbreve, VoidSymbol, VoidSymbol ] }; + key <AD04> { [ idotless, I, paragraph, VoidSymbol ] }; + key <AD05> { [ o, O, ocircumflex, Ocircumflex ] }; + key <AD06> { [ d, D, yen, VoidSymbol ] }; + key <AD07> { [ r, R, registered, VoidSymbol ] }; + key <AD08> { [ n, N, VoidSymbol, VoidSymbol ] }; + key <AD09> { [ h, H, degree, VoidSymbol ] }; + key <AD10> { [ p, P, sterling, VoidSymbol ] }; + key <AD11> { [ q, Q, dead_diaeresis, dead_abovering ] }; + key <AD12> { [ w, W, asciitilde, dead_breve ] }; + + key <AC01> { [ u, U, ucircumflex, Ucircumflex ] }; + key <AC02> { [ i, Iabovedot, icircumflex, Icircumflex ] }; + key <AC03> { [ e, E, EuroSign, VoidSymbol ] }; + key <AC04> { [ a, A, acircumflex, Acircumflex ] }; + key <AC05> { [udiaeresis, Udiaeresis, ucircumflex, Ucircumflex ] }; + key <AC06> { [ t, T, trademark, VoidSymbol ] }; + key <AC07> { [ k, K, VoidSymbol, VoidSymbol ] }; + key <AC08> { [ m, M, mu, VoidSymbol ] }; + key <AC09> { [ l, L, VoidSymbol, VoidSymbol ] }; + key <AC10> { [ y, Y, acute, dead_acute ] }; + key <AC11> { [ scedilla, Scedilla, numbersign, dead_caron ] }; + key <TLDE> { [ plus, asterisk, notsign, plusminus ] }; + + key <BKSL> { [ x, X, grave, dead_grave ] }; + key <AB01> { [ j, J, guillemotleft, VoidSymbol ] }; + key <AB02> { [odiaeresis, Odiaeresis, guillemotright, VoidSymbol ] }; + key <AB03> { [ v, V, leftdoublequotemark, VoidSymbol ] }; + key <AB04> { [ c, C, cent, copyright ] }; + key <AB05> { [ ccedilla, Ccedilla, rightdoublequotemark, VoidSymbol] }; + key <AB06> { [ z, Z, VoidSymbol, VoidSymbol ] }; + key <AB07> { [ s, S, section, VoidSymbol ] }; + key <AB08> { [ b, B, multiply, nobreakspace ] }; + key <AB09> { [ period, colon, division, dead_abovedot] }; + key <AB10> { [ comma, semicolon, periodcentered, VoidSymbol ] }; + key <SPCE> { [ space, space, nobreakspace, nobreakspace ] }; + key <LSGT> { [ less, greater, bar, brokenbar ] }; + + include "level3(ralt_switch_multikey)" +}; + +// Turkish Alt-Q Layout +partial +xkb_symbols "tr_alt" { + + include "pc/latin" + + name[Group1]="Turkish"; + + key <AE07> { [ 7, ampersand, lowleftcorner, upleftcorner ] }; + key <AE08> { [ 8, asterisk, leftt, topt ] }; + key <AE09> { [ 9, parenleft, rightt, bott ] }; + key <AE10> { [ 0, parenright, lowrightcorner, uprightcorner ] }; + key <AE11> { [ minus, underscore, horizlinescan5, vertbar ] }; + key <AE12> { [ equal, plus, crossinglines ] }; + + key <AD03> { [ e, E, EuroSign, VoidSymbol ] }; +// key <AD05> { [ t, T, trademark, VoidSymbol > + key <AD07> { [ u, U, udiaeresis, Udiaeresis ] }; + key <AD08> { [ i, I, idotless, Iabovedot ] }; + key <AD09> { [ o, O, odiaeresis, Odiaeresis ] }; + key <AC01> { [ a, A, acircumflex, Acircumflex ] }; + key <AC02> { [ s, S, scedilla, Scedilla ] }; + key <AC05> { [ g, G, gbreve, Gbreve ] }; + + key <AB03> { [ c, C, ccedilla, Ccedilla ] }; + key <SPCE> { [ space, space, nobreakspace, nobreakspace ] }; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/ua b/symbols/ua new file mode 100644 index 00000000..1f398c69 --- /dev/null +++ b/symbols/ua @@ -0,0 +1,149 @@ + +// based on +// ukrainian standard keyboard +// AEN <aen@logic.ru> & Leon Kanter <leon@geon.donetsk.ua> +// Last Changes 2003/09/03 by Andriy Rysin <arysin@yahoo.com> +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/ua,v 1.4 2003/05/15 11:29:47 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Ukrainian"; + + key <TLDE> { [ apostrophe, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, quotedbl ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, asterisk ] }; + key <AE05> { [ 5, colon ] }; + key <AE06> { [ 6, comma ] }; + key <AE07> { [ 7, period ] }; + key <AE08> { [ 8, semicolon ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + + key <AD01> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <AD02> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <AD03> { [ Cyrillic_u, Cyrillic_U ] }; + key <AD04> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <AD05> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <AD06> { [ Cyrillic_en, Cyrillic_EN ] }; + key <AD07> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <AD08> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AD09> { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key <AD10> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <AD11> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <AD12> { [ Ukrainian_yi, Ukrainian_YI ] }; + key <BKSL> { [ Ukrainian_ghe_with_upturn, Ukrainian_GHE_WITH_UPTURN ] }; + + key <AC01> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <AC02> { [ Ukrainian_i, Ukrainian_I ] }; + key <AC03> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <AC04> { [ Cyrillic_a, Cyrillic_A ] }; + key <AC05> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AC06> { [ Cyrillic_er, Cyrillic_ER ] }; + key <AC07> { [ Cyrillic_o, Cyrillic_O ] }; + key <AC08> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AC09> { [ Cyrillic_de, Cyrillic_DE ] }; + key <AC10> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <AC11> { [ Ukrainian_ie, Ukrainian_IE ] }; + + key <AB01> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <AB02> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <AB03> { [ Cyrillic_es, Cyrillic_ES ] }; + key <AB04> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AB06> { [ Cyrillic_te, Cyrillic_TE ] }; + key <AB05> { [ Cyrillic_i, Cyrillic_I ] }; + key <AB07> { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key <AB08> { [ Cyrillic_be, Cyrillic_BE ] }; + key <AB09> { [ Cyrillic_yu, Cyrillic_YU ] }; + key <AB10> { [ slash, question ] }; + + key <LSGT> { [ slash, bar ] }; + // End alphanumeric section +}; + +partial alphanumeric_keys +xkb_symbols "winkeys" { + include "pc/ua(basic)" + + key <AE03> { [ 3, numerosign ] }; + key <AE04> { [ 4, semicolon ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, colon ] }; + key <AE07> { [ 7, question ] }; + key <AE08> { [ 8, asterisk ] }; + key <AB10> { [ period, comma ] }; +}; + +partial alphanumeric_keys +xkb_symbols "typewriter" { + include "pc/ua(basic)" + + key <TLDE> { [ apostrophe, quotedbl ] }; + key <AE01> { [ exclam, 1 ] }; + key <AE02> { [ numerosign, 2 ] }; + key <AE03> { [ slash, 3 ] }; + key <AE04> { [ semicolon, 4 ] }; + key <AE05> { [ colon, 5 ] }; + key <AE06> { [ comma, 6 ] }; + key <AE07> { [ period, 7 ] }; + key <AE08> { [ underscore, 8 ] }; + key <AE09> { [ question, 9 ] }; + key <AE10> { [ percent, 0 ] }; + + key <AD12> { [ Ukrainian_ghe_with_upturn, Ukrainian_GHE_WITH_UPTURN ] }; + + key <AC02> { [ Cyrillic_i, Cyrillic_I ] }; + + key <AB05> { [ Ukrainian_i, Ukrainian_I ] }; + + key <AB10> { [ Ukrainian_yi, Ukrainian_YI ] }; + + key <BKSL> { [ parenleft, parenright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "phonetic" { + include "pc/ua(basic)" + + key <LatQ> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <LatW> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <LatE> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <LatR> { [ Cyrillic_er, Cyrillic_ER ] }; + key <LatT> { [ Cyrillic_te, Cyrillic_TE ] }; + key <LatY> { [ Cyrillic_i, Cyrillic_i ] }; + key <LatU> { [ Cyrillic_u, Cyrillic_U ] }; + key <LatI> { [ Ukrainian_i, Ukrainian_I ] }; + key <LatO> { [ Cyrillic_o, Cyrillic_O ] }; + key <LatP> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AD11> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AD12> { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + + key <LatA> { [ Cyrillic_a, Cyrillic_A ] }; + key <LatS> { [ Cyrillic_es, Cyrillic_ES ] }; + key <LatD> { [ Cyrillic_de, Cyrillic_DE ] }; + key <LatF> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <LatG> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <LatH> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <LatJ> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <LatK> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <LatL> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AC10> { [ Ukrainian_ghe_with_upturn, Ukrainian_GHE_WITH_UPTURN ] }; + key <AC11> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <BKSL> { [ Cyrillic_yu, Cyrillic_YU ] }; + + key <LatZ> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <LatX> { [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key <LatC> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <LatV> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <LatB> { [ Cyrillic_be, Cyrillic_BE ] }; + key <LatN> { [ Cyrillic_en, Cyrillic_EN ] }; + key <LatM> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AB08> { [ Ukrainian_yi, Ukrainian_YI ] }; + key <AB09> { [ Ukrainian_ie, Ukrainian_IE ] }; + key <AB10> { [ slash, question ] }; +}; diff --git a/symbols/us b/symbols/us new file mode 100644 index 00000000..6d1b13ae --- /dev/null +++ b/symbols/us @@ -0,0 +1,122 @@ +// +// $XdotOrg: xc/programs/xkbcomp/symbols/pc/us,v 1.1.4.3 2004/03/05 13:41:33 eich Exp $ +// $XFree86: xc/programs/xkbcomp/symbols/pc/us,v 1.6 2003/10/31 14:32:05 pascal Exp $ + +default +partial hidden alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + name[Group1]= "US/ASCII"; + + include "pc/pc(common)" + + // Alphanumeric section + key <TLDE> { [ grave, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + + key <AD01> { [ q, Q ] }; + key <AD02> { [ w, W ] }; + key <AD03> { [ e, E ] }; + key <AD04> { [ r, R ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ y, Y ] }; + key <AD07> { [ u, U ] }; + key <AD08> { [ i, I ] }; + key <AD09> { [ o, O ] }; + key <AD10> { [ p, P ] }; + key <AD11> { [ bracketleft, braceleft ] }; + key <AD12> { [ bracketright, braceright ] }; + + key <AC01> { [ a, A ] }; + key <AC02> { [ s, S ] }; + key <AC03> { [ d, D ] }; + key <AC04> { [ f, F ] }; + key <AC05> { [ g, G ] }; + key <AC06> { [ h, H ] }; + key <AC07> { [ j, J ] }; + key <AC08> { [ k, K ] }; + key <AC09> { [ l, L ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ apostrophe, quotedbl ] }; + + key <AB01> { [ z, Z ] }; + key <AB02> { [ x, X ] }; + key <AB03> { [ c, C ] }; + key <AB04> { [ v, V ] }; + key <AB05> { [ b, B ] }; + key <AB06> { [ n, N ] }; + key <AB07> { [ m, M ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; + + key <BKSL> { [ backslash, bar ] }; + // End alphanumeric section +}; + + +partial alphanumeric_keys +xkb_symbols "intl" { + + name[Group1]= "US International"; + + include "pc/us(basic)" + + // Alphanumeric section + key <TLDE> { [dead_grave, dead_tilde, grave, asciitilde ] }; + key <AE01> { [ 1, exclam, exclamdown, onesuperior ] }; + key <AE02> { [ 2, at, twosuperior, dead_doubleacute ] }; + key <AE03> { [ 3, numbersign, threesuperior, dead_macron ] }; + key <AE04> { [ 4, dollar, currency, sterling ] }; + key <AE05> { [ 5, percent, EuroSign ] }; + key <AE06> { [ 6, dead_circumflex, onequarter, asciicircum ] }; + key <AE07> { [ 7, ampersand, onehalf, dead_horn ] }; + key <AE08> { [ 8, asterisk, threequarters, dead_ogonek ] }; + key <AE09> { [ 9, parenleft, leftsinglequotemark, dead_breve ] }; + key <AE10> { [ 0, parenright, rightsinglequotemark, dead_abovering ] }; + key <AE11> { [ minus, underscore, yen, dead_belowdot ] }; + key <AE12> { [ equal, plus, multiply, division ] }; + + key <AD01> { [ q, Q, adiaeresis, Adiaeresis ] }; + key <AD02> { [ w, W, aring, Aring ] }; + key <AD03> { [ e, E, eacute, Eacute ] }; + key <AD04> { [ r, R, registered, registered ] }; + key <AD05> { [ t, T, thorn, THORN ] }; + key <AD06> { [ y, Y, udiaeresis, Udiaeresis ] }; + key <AD07> { [ u, U, uacute, Uacute ] }; + key <AD08> { [ i, I, iacute, Iacute ] }; + key <AD09> { [ o, O, oacute, Oacute ] }; + key <AD10> { [ p, P, odiaeresis, Odiaeresis ] }; + key <AD11> { [ bracketleft, braceleft, guillemotleft, guillemotleft ] }; + key <AD12> { [bracketright, braceright, guillemotright,guillemotright ] }; + + key <AC01> { [ a, A, aacute, Aacute ] }; + key <AC02> { [ s, S, ssharp, section ] }; + key <AC03> { [ d, D, eth, ETH ] }; + + key <AC09> { [ l, L, oslash, Ooblique ] }; + key <AC10> { [ semicolon, colon, paragraph, degree ] }; + key <AC11> { [dead_acute, dead_diaeresis, apostrophe, quotedbl ] }; + + key <AB01> { [ z, Z, ae, AE ] }; + key <AB03> { [ c, C, copyright, cent ] }; + key <AB06> { [ n, N, ntilde, Ntilde ] }; + key <AB07> { [ m, M, mu, mu ] }; + key <AB08> { [ comma, less, ccedilla, Ccedilla ] }; + key <AB09> { [ period, greater, dead_abovedot, dead_caron ] }; + key <AB10> { [ slash, question, questiondown, dead_hook ] }; + key <BKSL> { [ backslash, bar, notsign, brokenbar ] }; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/us_intl b/symbols/us_intl new file mode 100644 index 00000000..d33058b8 --- /dev/null +++ b/symbols/us_intl @@ -0,0 +1,54 @@ +// $XFree86$ + +// Based on symbols/us_intl keyboard map: +// Dead-keys definition for a very simple US/ASCII layout. +// by Conectiva (http://www.conectiva.com.br) +// modified by Ricardo Y. Igarashi (iga@that.com.br) + +// Added the following deadkeys, to make it truly international: +// +// dead_macron: on AltGr-minus +// dead_breve: on AltGr-parenleft +// dead_abovedot: on AltGr-period +// dead_abovering: on AltGr-0 +// dead_doubleacute: on AltGr-equal (as quotedbl is already used) +// dead_caron: on AltGr-less (AltGr-shift-comma) +// dead_cedilla: on AltGr-comma +// dead_ogonek: on AltGr-semicolon +// dead_belowdot: on AltGr-underscore (AltGr-shift-minus) +// dead_hook: on AltGr-question +// dead_horn: on AltGr-plus (AltGr-shift-equal) +// dead_diaeresis: on AltGr-colon (Alt-shift-semicolon) +// +// those were already there: +// dead_grave +// dead_acute +// dead_circumflex +// dead_tilde +// dead_diaeresis + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "US/ASCII"; + include "pc/us" + + key <TLDE> { [ dead_grave, dead_tilde, grave, asciitilde ] }; + key <AE05> { [ 5, percent, EuroSign ] }; + key <AE06> { [ 6, dead_circumflex, asciicircum, asciicircum ] }; + key <AE09> { [ 9, parenleft, dead_breve, dead_breve ] }; + key <AE10> { [ 0, parenright, dead_abovering, dead_abovering] }; + key <AE11> { [ minus, underscore, dead_macron, dead_belowdot ] }; + key <AE12> { [ equal, plus, dead_doubleacute, dead_horn ] }; + + key <AD03> { [ e, E, EuroSign, cent ] }; + + key <AC10> { [ semicolon, colon, dead_ogonek, dead_diaeresis ] }; + key <AC11> { [ dead_acute, dead_diaeresis, apostrophe, quotedbl ] }; + + key <AB08> { [ comma, less, dead_cedilla, dead_caron ] }; + key <AB09> { [ period, greater, dead_abovedot, dead_circumflex ] }; + key <AB10> { [ slash, question, dead_hook, dead_hook ] }; + + include "level3(ralt_switch_multikey)" +}; diff --git a/symbols/uz b/symbols/uz new file mode 100644 index 00000000..82e2e90f --- /dev/null +++ b/symbols/uz @@ -0,0 +1,81 @@ +// Uzbek standard keyboard +// +// Mashrab Kuvatov <kmashrab@uni-bremen.de> +// +// History: +// +// Jun 2, 2003. Mashrab Kuvatov <kmashrab@uni-bremen.de> +// +// Created based on Russian standard keyboard. AEN <aen@logic.ru> +// The following symbols of Russian standard keyboard were replaced: +// minus (key <AE11>) with Cyrillic_shortu (U045e), +// equal (key <AE12>) with Cyrillic_kadescender (U049b) +// Cyrillic_ha (key <AD11>) with Cyrillic_ghestoke (U0493) +// Cyrillic_hardsign (key <AD11>) with Cyrillic_hadescender (U0493) +// The following symbols of Russian standard keyboard were moved: +// Cyrillic_ze to key <AC02> (english 's'), +// Cyrillic_sha to key <AD08> (english 'i'), +// Cyrillic_ha to key <AD09> (english 'o'), +// Cyrillic_hardsign to key <AD10> (english 'p'). +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/uz,v 1.2 2003/06/21 13:01:59 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Uzbek"; + + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, quotedbl ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, semicolon ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, colon ] }; + key <AE07> { [ 7, question ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <BKSL> { [ backslash, bar ] }; + key <AB10> { [ period, comma ] }; + key <LSGT> { [ slash, bar ] }; + +key.type[group1]="ALPHABETIC"; + + key <AE11> { [ U045e, U040e ] }; + key <AE12> { [ U049b, U049a ] }; + key <TLDE> { [ Cyrillic_io, Cyrillic_IO ] }; + key <AD01> { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key <AD02> { [ Cyrillic_tse, Cyrillic_TSE ] }; + key <AD03> { [ Cyrillic_u, Cyrillic_U ] }; + key <AD04> { [ Cyrillic_ka, Cyrillic_KA ] }; + key <AD05> { [ Cyrillic_ie, Cyrillic_IE ] }; + key <AD06> { [ Cyrillic_en, Cyrillic_EN ] }; + key <AD07> { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key <AD08> { [ Cyrillic_sha, Cyrillic_SHA ] }; + key <AD09> { [ Cyrillic_ha, Cyrillic_HA ] }; + key <AD10> { [Cyrillic_hardsign,Cyrillic_HARDSIGN ] }; + key <AD11> { [ U0493, U0492 ] }; + key <AD12> { [ U04b3, U04b2 ] }; + key <AC01> { [ Cyrillic_ef, Cyrillic_EF ] }; + key <AC02> { [ Cyrillic_ze, Cyrillic_ZE ] }; + key <AC03> { [ Cyrillic_ve, Cyrillic_VE ] }; + key <AC04> { [ Cyrillic_a, Cyrillic_A ] }; + key <AC05> { [ Cyrillic_pe, Cyrillic_PE ] }; + key <AC06> { [ Cyrillic_er, Cyrillic_ER ] }; + key <AC07> { [ Cyrillic_o, Cyrillic_O ] }; + key <AC08> { [ Cyrillic_el, Cyrillic_EL ] }; + key <AC09> { [ Cyrillic_de, Cyrillic_DE ] }; + key <AC10> { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key <AC11> { [ Cyrillic_e, Cyrillic_E ] }; + key <AB01> { [ Cyrillic_ya, Cyrillic_YA ] }; + key <AB02> { [ Cyrillic_che, Cyrillic_CHE ] }; + key <AB03> { [ Cyrillic_es, Cyrillic_ES ] }; + key <AB04> { [ Cyrillic_em, Cyrillic_EM ] }; + key <AB06> { [ Cyrillic_te, Cyrillic_TE ] }; + key <AB05> { [ Cyrillic_i, Cyrillic_I ] }; + key <AB07> { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key <AB08> { [ Cyrillic_be, Cyrillic_BE ] }; + key <AB09> { [ Cyrillic_yu, Cyrillic_YU ] }; + + // End alphanumeric section +}; diff --git a/symbols/xfree68.vndr/amiga b/symbols/xfree68.vndr/amiga new file mode 100644 index 00000000..dcc143bb --- /dev/null +++ b/symbols/xfree68.vndr/amiga @@ -0,0 +1,132 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:46 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/symbols/xfree68/amiga,v 1.2 2000/06/23 00:44:37 dawes Exp $ + +default xkb_symbols "usa1" { + + name[Group1]= "usa1"; + key <ESC> { [ Escape ] }; + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + // End "Function" section + + // Alphanumeric section + key <TLDE> { [ quoteleft, asciitilde ] }; + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + key <BKSL> { [ backslash, bar ] }; + key <BKSP> { [ BackSpace ] }; + + key <TAB> { [ Tab, ISO_Left_Tab ] }; + key <AD01> { [ q, Q ] }; + key <AD02> { [ w, W ] }; + key <AD03> { [ e, E ] }; + key <AD04> { [ r, R ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ y, Y ] }; + key <AD07> { [ u, U ] }; + key <AD08> { [ i, I ] }; + key <AD09> { [ o, O ] }; + key <AD10> { [ p, P ] }; + key <AD11> { [ bracketleft, braceleft ] }; + key <AD12> { [ bracketright, braceright ] }; + key <RTRN> { [ Return ] }; + + key <LCTL> { [ Control_L ] }; + key <CAPS> { [ Caps_Lock ] }; + key <AC01> { [ a, A ] }; + key <AC02> { [ s, S ] }; + key <AC03> { [ d, D ] }; + key <AC04> { [ f, F ] }; + key <AC05> { [ g, G ] }; + key <AC06> { [ h, H ] }; + key <AC07> { [ j, J ] }; + key <AC08> { [ k, K ] }; + key <AC09> { [ l, L ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ quoteright, quotedbl ] }; + + key <LFSH> { [ Shift_L ] }; + key <AB01> { [ z, Z ] }; + key <AB02> { [ x, X ] }; + key <AB03> { [ c, C ] }; + key <AB04> { [ v, V ] }; + key <AB05> { [ b, B ] }; + key <AB06> { [ n, N ] }; + key <AB07> { [ m, M ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; + key <RTSH> { [ Shift_R ] }; + + key <LALT> { [ Alt_L, Meta_L ] }; + key <LAMI> { [ Mode_switch ] }; + key <SPCE> { [ space ] }; + key <RAMI> { [ Multi_key ] }; + key <RALT> { [ Alt_R, Meta_R ] }; + // End alphanumeric section + + // Begin "Editing" section + key <DELE> { [ Delete ] }; + key <HELP> { [ Help ] }; + key <UP> { [ Up ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <RGHT> { [ Right ] }; + // End "Editing" section + + // Begin "Keypad" section + key <KPLP> { [ Num_Lock ] }; + key <KPRP> { [ Scroll_Lock ] }; + key <KPDV> { [ KP_Divide ] }; + key <KPMU> { [ KP_Multiply, Print ] }; + + key <KP7> { [ KP_7, KP_Home ] }; + key <KP8> { [ KP_8, KP_Up ] }; + key <KP9> { [ KP_9, KP_Prior ] }; + key <KPSU> { [ KP_Subtract ] }; + + key <KP4> { [ KP_4, KP_Left ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_6, KP_Right ] }; + key <KPAD> { [ KP_Add ] }; + + key <KP1> { [ KP_1, KP_End ] }; + key <KP2> { [ KP_2, KP_Down ] }; + key <KP3> { [ KP_3, KP_Next ] }; + + key <KP0> { [ KP_0, KP_Insert ] }; + key <KPDC> { [ KP_Decimal, KP_Delete ] }; + key <KPEN> { [ KP_Enter ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod1 { Alt_L, Alt_R }; + modifier_map Mod2 { Mode_switch }; + modifier_map Mod3 { Meta_L, Meta_R }; +}; diff --git a/symbols/xfree68.vndr/ataritt b/symbols/xfree68.vndr/ataritt new file mode 100644 index 00000000..c06431fb --- /dev/null +++ b/symbols/xfree68.vndr/ataritt @@ -0,0 +1,161 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:46 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/symbols/xfree68/ataritt,v 1.2 2000/06/23 00:44:37 dawes Exp $ + +default xkb_symbols "us" { + + name[Group1]= "US/ASCII"; + key <ESC> { [ Escape ] }; + + // Alphanumeric section + key <AE01> { [ 1, exclam ] }; + key <AE02> { [ 2, at ] }; + key <AE03> { [ 3, numbersign ] }; + key <AE04> { [ 4, dollar ] }; + key <AE05> { [ 5, percent ] }; + key <AE06> { [ 6, asciicircum ] }; + key <AE07> { [ 7, ampersand ] }; + key <AE08> { [ 8, asterisk ] }; + key <AE09> { [ 9, parenleft ] }; + key <AE10> { [ 0, parenright ] }; + key <AE11> { [ minus, underscore ] }; + key <AE12> { [ equal, plus ] }; + key <TLDE> { [ quoteleft, asciitilde ] }; + key <BKSP> { [ BackSpace ] }; + + key <TAB> { [ Tab, ISO_Left_Tab ] }; + key <AD01> { [ q, Q ] }; + key <AD02> { [ w, W ] }; + key <AD03> { [ e, E ] }; + key <AD04> { [ r, R ] }; + key <AD05> { [ t, T ] }; + key <AD06> { [ y, Y ] }; + key <AD07> { [ u, U ] }; + key <AD08> { [ i, I ] }; + key <AD09> { [ o, O ] }; + key <AD10> { [ p, P ] }; + key <AD11> { [ bracketleft, braceleft ] }; + key <AD12> { [ bracketright, braceright ] }; + key <RTRN> { [ Return ] }; + key <DELE> { [ Delete ] }; + + key <LCTL> { [ Control_L ] }; + key <AC01> { [ a, A ] }; + key <AC02> { [ s, S ] }; + key <AC03> { [ d, D ] }; + key <AC04> { [ f, F ] }; + key <AC05> { [ g, G ] }; + key <AC06> { [ h, H ] }; + key <AC07> { [ j, J ] }; + key <AC08> { [ k, K ] }; + key <AC09> { [ l, L ] }; + key <AC10> { [ semicolon, colon ] }; + key <AC11> { [ quoteright, quotedbl ] }; + key <BKSL> { [ backslash, bar ] }; + + key <LFSH> { [ Shift_L ] }; + key <AB01> { [ z, Z ] }; + key <AB02> { [ x, X ] }; + key <AB03> { [ c, C ] }; + key <AB04> { [ v, V ] }; + key <AB05> { [ b, B ] }; + key <AB06> { [ n, N ] }; + key <AB07> { [ m, M ] }; + key <AB08> { [ comma, less ] }; + key <AB09> { [ period, greater ] }; + key <AB10> { [ slash, question ] }; + key <RTSH> { [ Shift_R ] }; + + key <ALT> { [ Meta_L ] }; + key <SPCE> { [ space ] }; + key <CAPS> { [ Caps_Lock ] }; + // End alphanumeric section + + // Begin "Function" section + key <FK01> { [ F1 ] }; + key <FK02> { [ F2 ] }; + key <FK03> { [ F3 ] }; + key <FK04> { [ F4 ] }; + key <FK05> { [ F5 ] }; + key <FK06> { [ F6 ] }; + key <FK07> { [ F7 ] }; + key <FK08> { [ F8 ] }; + key <FK09> { [ F9 ] }; + key <FK10> { [ F10 ] }; + // End "Function" section + + // Begin "Editing" section + key <HELP> { [ Help ] }; + key <UNDO> { [ Undo ] }; + key <INS> { [ Insert ] }; + key <UP> { [ Up ] }; + key <HOME> { [ Home, Clear ] }; + key <LEFT> { [ Left ] }; + key <DOWN> { [ Down ] }; + key <RGHT> { [ Right ] }; + // End "Editing" section + + // Begin "Keypad" section + key <KPLP> { [ KP_F1 ] }; + key <KPRP> { [ KP_F2 ] }; + key <KPDV> { [ KP_Divide ] }; + key <KPMU> { [ KP_Multiply ] }; + key <KP7> { [ KP_7 ] }; + key <KP8> { [ KP_8 ] }; + key <KP9> { [ KP_9 ] }; + key <KPSU> { [ KP_Subtract ] }; + key <KP4> { [ KP_4 ] }; + key <KP5> { [ KP_5 ] }; + key <KP6> { [ KP_6 ] }; + key <KPAD> { [ KP_Add ] }; + key <KP1> { [ KP_1 ] }; + key <KP2> { [ KP_2 ] }; + key <KP3> { [ KP_3 ] }; + key <KP0> { [ KP_0 ] }; + key <KPDC> { [ KP_Decimal ] }; + key <KPEN> { [ KP_Enter ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod1 { Meta_L }; +}; + +xkb_symbols "de" { + include "ataritt(us)" + + name[Group1]= "German"; + + // Alphanumeric section + key <AE02> { [ 2, quotedbl ] }; + key <AE03> { [ 3, section ] }; + key <AE06> { [ 6, ampersand ] }; + key <AE07> { [ 7, slash ] }; + key <AE08> { [ 8, parenleft ] }; + key <AE09> { [ 9, parenright ] }; + key <AE10> { [ 0, equal ] }; + key <AE11> { [ ssharp, question ] }; + key <AE12> { [ quoteright, quoteleft ] }; + key <TLDE> { [ numbersign, asciicircum ] }; + + key <AD06> { [ z, Z ] }; + key <AD11> { [ udiaeresis, Udiaeresis ], + [ at, backslash ] }; + key <AD12> { [ plus, asterisk ] }; + + key <AC10> { [ odiaeresis, Odiaeresis ], + [ bracketleft, braceleft ] }; + key <AC11> { [ adiaeresis, Adiaeresis ], + [ bracketright, braceright ] }; + key <BKSL> { [ asciitilde, bar ] }; + + key <LSGT> { [ less, greater ] }; + key <AB01> { [ y, Y ] }; + key <AB08> { [ comma, semicolon ] }; + key <AB09> { [ period, colon ] }; + key <AB10> { [ minus, underscore ] }; +}; diff --git a/symbols/yu b/symbols/yu new file mode 100644 index 00000000..3d6de22a --- /dev/null +++ b/symbols/yu @@ -0,0 +1,58 @@ +// $XFree86$ +// Serbian XKB keyboard mapping (derived from "Danube" D.2) +// +// Danube D.2 from 2003-05-12 is available at http://srpski.org/dunav/ +// +// Original authors: +// Danilo Segan (Данило Шеган) <dsegan@gmx.net> +// Chusslove Illich (Часлав Илић) <chaslav@sezampro.yu> +// +// Modified for inclusion in XFree86 by Danilo Segan <dsegan@gmx.net> +// +// + +default partial alphanumeric_keys +xkb_symbols "default" { + + name[Group1]= "Serbian Latin"; + + include "pc/sr(level3)" + include "pc/sr(common)" + include "pc/sr(latalpha)" + include "level3(ralt_switch_multikey)" +}; + +partial alphanumeric_keys +xkb_symbols "unicode" { + // This mapping supports the Unicode characters 0x1c4-0x1cc (dz, lj, and nj + // as single character). You get the title form with AltGr+Shift. + + name[Group1]= "Serbian Latin Unicode"; + + include "pc/yu(default)" + include "pc/sr(twoletter)" +}; + +partial alphanumeric_keys +xkb_symbols "yz" { + // For those who insist on using "english-position" Z and Y. + + name[Group1]= "Serbian Latin (swap Y, Z)"; + + include "pc/yu(default)" + + key <AD06> { [ y, Y, any,any ] }; // y + key <AB01> { [ z, Z, any,any ] }; // z +}; + +partial alphanumeric_keys +xkb_symbols "unicodeyz" { + // Unicode, ZHE and Z swapped. + + name[Group1]= "Serbian Latin Unicode (swap ZHE, Z)"; + + include "pc/yu(unicode)" + + key <AD06> { [ zcaron, Zcaron, any,any ] }; // y + key <AB01> { [ z, Z, any,any ] }; // z +}; diff --git a/types/README b/types/README new file mode 100644 index 00000000..039d8f42 --- /dev/null +++ b/types/README @@ -0,0 +1,8 @@ +The types component of a keyboard mapping specifies the key types that can be +associated with the various keyboard keys. The types component can also +optionally contain real modifiers binding and symbolic names for one +or more virtual modifiers. + + + +/* $XFree86$ */ diff --git a/types/basic b/types/basic new file mode 100644 index 00000000..735fe03d --- /dev/null +++ b/types/basic @@ -0,0 +1,40 @@ +// $Xorg: basic,v 1.3 2000/08/17 19:54:48 cpqbld Exp $ +// $XFree86$ +default xkb_types "basic" { + + // Fairly standard definitions for + // the four required key types + + virtual_modifiers NumLock; + + type "ONE_LEVEL" { + modifiers = None; + map[None] = Level1; + level_name[Level1]= "Any"; + }; + + type "TWO_LEVEL" { + modifiers = Shift; + map[Shift] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + }; + + type "ALPHABETIC" { + modifiers = Shift+Lock; + map[Shift] = Level2; + map[Lock] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Caps"; + }; + + type "KEYPAD" { + modifiers = Shift+NumLock; + map[None] = Level1; + map[Shift] = Level2; + map[NumLock] = Level2; + map[Shift+NumLock] = Level1; + level_name[Level1] = "Base"; + level_name[Level2] = "Number"; + }; +}; diff --git a/types/cancel b/types/cancel new file mode 100644 index 00000000..478c99c4 --- /dev/null +++ b/types/cancel @@ -0,0 +1,12 @@ +// $Xorg: cancel,v 1.3 2000/08/17 19:54:48 cpqbld Exp $ +partial default xkb_types "Shift_Cancels_Caps" { + +override type "TWO_LEVEL" { + modifiers = Shift+Lock; + map[Shift] = Level2; + preserve[Lock]= Lock; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; +}; + +}; diff --git a/types/caps b/types/caps new file mode 100644 index 00000000..efcae864 --- /dev/null +++ b/types/caps @@ -0,0 +1,170 @@ +// $XFree86: xc/programs/xkbcomp/types/caps,v 1.3 2002/11/26 02:14:02 dawes Exp $ + +// CapsLock uses internal capitalization rules +// Shift cancels CapsLock +partial xkb_types "internal" { + type "ALPHABETIC" { + modifiers = Shift+Lock; + map[Shift] = Level2; + preserve[Lock] = Lock; + level_name[Level1] = "Base"; + level_name[Level2] = "Caps"; + }; + + type "FOUR_LEVEL_ALPHABETIC" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + preserve[Lock] = Lock; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level3; + map[Lock+Shift+LevelThree] = Level3; + preserve[Lock+LevelThree] = Lock; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; + + type "FOUR_LEVEL_SEMIALPHABETIC" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + preserve[Lock] = Lock; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level3; + map[Lock+Shift+LevelThree] = Level4; + preserve[Lock+LevelThree] = Lock; + preserve[Lock+Shift+LevelThree] = Lock; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; +}; +// CapsLock uses internal capitalization rules +// Shift doesn't cancel CapsLock +partial xkb_types "internal_nocancel" { + type "ALPHABETIC" { + modifiers = Shift; + map[Shift] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Caps"; + }; + + type "FOUR_LEVEL_ALPHABETIC" { + modifiers = Shift+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; + + type "FOUR_LEVEL_SEMIALPHABETIC" { + // the same as FOUR_LEVEL_ALPHABETIC + modifiers = Shift+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; +}; +// CapsLock acts as Shift with locking +// Shift cancels CapsLock +partial xkb_types "shift" { + type "ALPHABETIC" { + modifiers = Shift+Lock; + map[Shift] = Level2; + map[Lock] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Caps"; + }; + + type "FOUR_LEVEL_ALPHABETIC" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[Lock] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level4; + map[Shift+Lock+LevelThree] = Level3; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; + + type "FOUR_LEVEL_SEMIALPHABETIC" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[Lock] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level3; + map[Lock+Shift+LevelThree] = Level4; + preserve[Lock+LevelThree] = Lock; + preserve[Lock+Shift+LevelThree] = Lock; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; +}; +// CapsLock acts as Shift with locking +// Shift doesn't cancel CapsLock +partial xkb_types "shift_nocancel" { + type "ALPHABETIC" { + modifiers = Shift+Lock; + map[Shift] = Level2; + map[Lock] = Level2; + map[Shift+Lock] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Caps"; + }; + + type "FOUR_LEVEL_ALPHABETIC" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[Lock] = Level2; + map[Shift+Lock] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level4; + map[Shift+Lock+LevelThree] = Level4; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; + + type "FOUR_LEVEL_SEMIALPHABETIC" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[Lock] = Level2; + map[Shift+Lock] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level3; + map[Lock+Shift+LevelThree] = Level4; + preserve[Lock+LevelThree] = Lock; + preserve[Lock+Shift+LevelThree] = Lock; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; +}; diff --git a/types/complete b/types/complete new file mode 100644 index 00000000..ecf6ec13 --- /dev/null +++ b/types/complete @@ -0,0 +1,14 @@ +// $Xorg: complete,v 1.3 2000/08/17 19:54:48 cpqbld Exp $ +// +// +// +// +// $XFree86: xc/programs/xkbcomp/types/complete,v 1.2 2001/05/18 23:35:35 dawes Exp $ + +default xkb_types "complete" { + include "basic" + include "mousekeys" + include "pc" + include "iso9995" + include "extra" +}; diff --git a/types/default b/types/default new file mode 100644 index 00000000..5d6ba744 --- /dev/null +++ b/types/default @@ -0,0 +1,14 @@ +// $Xorg: default,v 1.3 2000/08/17 19:54:48 cpqbld Exp $ +// +// +// +// +// $XFree86$ + +default xkb_types "default" { + include "basic" + include "pc" + include "iso9995" + include "extra" + include "mousekeys" +}; diff --git a/types/extra b/types/extra new file mode 100644 index 00000000..d9907e56 --- /dev/null +++ b/types/extra @@ -0,0 +1,96 @@ +// $XFree86: xc/programs/xkbcomp/types/extra,v 1.3 2002/11/26 02:14:02 dawes Exp $ + +partial default xkb_types "default" { + // Definition for a key type used for the czech keymap, for instance. + // Defines style a with four level shift. It is similar to three_level + // type used for iso9995 but it lets the shift key behave "normally". + + virtual_modifiers LevelThree; + + type "FOUR_LEVEL" { + modifiers = Shift+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; + + type "FOUR_LEVEL_ALPHABETIC" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[Lock] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level4; + map[Shift+Lock+LevelThree] = Level3; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; + + type "FOUR_LEVEL_SEMIALPHABETIC" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[Lock] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level3; + map[Lock+Shift+LevelThree] = Level4; + preserve[Lock+LevelThree] = Lock; + preserve[Lock+Shift+LevelThree] = Lock; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Shift Alt"; + }; + + // This enables the four level shifting also for the keypad. + type "FOUR_LEVEL_KEYPAD" { + modifiers = Shift+NumLock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[NumLock] = Level2; + map[Shift+NumLock] = Level1; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[NumLock+LevelThree] = Level4; + map[Shift+NumLock+LevelThree] = Level3; + level_name[Level1] = "Base"; + level_name[Level2] = "Number"; + level_name[Level3] = "Alt Base"; + level_name[Level4] = "Alt Number"; + }; + +// Special type for keys used in Serbian Latin Unicode map +// It makes it possible to use all three forms of latin letters +// present in Unicode that are made up of two separate letters +// (forms like LJ, Lj, and lj; NJ, Nj, and nj; etc) +// +// Could probably prove useful for other languages too, so it +// better be renamed + + type "SERBIAN_CAPS" { + modifiers = Shift+Lock+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[Lock] = Level4; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level4; + map[Lock+LevelThree] = Level3; + map[Lock+Shift+LevelThree] = Level3; + preserve[Lock]= Lock; + preserve[Lock+LevelThree]= Lock; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "AltGr Base"; + level_name[Level4] = "Shift AltGr"; + }; +}; + diff --git a/types/iso9995 b/types/iso9995 new file mode 100644 index 00000000..80f3ee5c --- /dev/null +++ b/types/iso9995 @@ -0,0 +1,20 @@ +// $Xorg: iso9995,v 1.3 2000/08/17 19:54:48 cpqbld Exp $ +partial default xkb_types "default" { + + // Definition for a key type which + // can be used to implement ISO9995 + // style level three shift + virtual_modifiers LevelThree; + + type "THREE_LEVEL" { + modifiers = Shift+LevelThree; + map[None] = Level1; + map[Shift] = Level2; + map[LevelThree] = Level3; + map[Shift+LevelThree] = Level3; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift"; + level_name[Level3] = "Level3"; + }; +}; + diff --git a/types/mousekeys b/types/mousekeys new file mode 100644 index 00000000..85440ca7 --- /dev/null +++ b/types/mousekeys @@ -0,0 +1,13 @@ +// $Xorg: mousekeys,v 1.3 2000/08/17 19:54:48 cpqbld Exp $ +// +partial default xkb_types "default" { + virtual_modifiers Alt; + + type "SHIFT+ALT" { + modifiers = Shift+Alt; + map[Shift+Alt] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Shift+Alt"; + }; +}; + diff --git a/types/numpad b/types/numpad new file mode 100644 index 00000000..46b6822c --- /dev/null +++ b/types/numpad @@ -0,0 +1,13 @@ +// $XFree86$ + +xkb_types "microsoft" { + + type "KEYPAD" { + modifiers = Shift+NumLock; + map[None] = Level1; + preserve[Shift] = Shift; + map[NumLock] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Number"; + }; +}; diff --git a/types/pc b/types/pc new file mode 100644 index 00000000..5671f426 --- /dev/null +++ b/types/pc @@ -0,0 +1,33 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:48 cpqbld Exp $ +// + +partial default xkb_types "default" { + + // Some types that are necessary + // for a full implementation of + // a PC compatible keyboard. + virtual_modifiers Alt; + + type "PC_BREAK" { + modifiers = Control; + map[None] = Level1; + map[Control] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Control"; + }; + + type "PC_SYSRQ" { + modifiers = Alt; + map[None] = Level1; + map[Alt] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Alt"; + }; + + type "CTRL+ALT" { + modifiers = Control+Alt; + map[Control+Alt] = Level2; + level_name[Level1] = "Base"; + level_name[Level2] = "Ctrl+Alt"; + }; +}; diff --git a/xfree86_xkb_xml.spec.in b/xkbdesc.spec.in index b0e8f44c..b0e8f44c 100644 --- a/xfree86_xkb_xml.spec.in +++ b/xkbdesc.spec.in |