diff options
author | Chanho Park <chanho61.park@samsung.com> | 2014-12-11 18:55:56 +0900 |
---|---|---|
committer | Chanho Park <chanho61.park@samsung.com> | 2014-12-11 18:55:56 +0900 |
commit | 08c1e93fa36a49f49325a07fe91ff92c964c2b6c (patch) | |
tree | 7a7053ceb8874b28ec4b868d4c49b500008a102e /boost/math | |
parent | bb4dd8289b351fae6b55e303f189127a394a1edd (diff) | |
download | boost-08c1e93fa36a49f49325a07fe91ff92c964c2b6c.tar.gz boost-08c1e93fa36a49f49325a07fe91ff92c964c2b6c.tar.bz2 boost-08c1e93fa36a49f49325a07fe91ff92c964c2b6c.zip |
Imported Upstream version 1.57.0upstream/1.57.0
Diffstat (limited to 'boost/math')
245 files changed, 12230 insertions, 5226 deletions
diff --git a/boost/math/bindings/detail/big_digamma.hpp b/boost/math/bindings/detail/big_digamma.hpp index 3d7819b500..bbddb23f04 100644 --- a/boost/math/bindings/detail/big_digamma.hpp +++ b/boost/math/bindings/detail/big_digamma.hpp @@ -9,6 +9,7 @@ #include <boost/math/tools/rational.hpp> #include <boost/math/policies/error_handling.hpp> #include <boost/math/constants/constants.hpp> +#include <boost/lexical_cast.hpp> namespace boost{ namespace math{ namespace detail{ diff --git a/boost/math/bindings/detail/big_lanczos.hpp b/boost/math/bindings/detail/big_lanczos.hpp index 314b4f88c4..573f9ec1af 100644 --- a/boost/math/bindings/detail/big_lanczos.hpp +++ b/boost/math/bindings/detail/big_lanczos.hpp @@ -7,7 +7,6 @@ #define BOOST_BIG_LANCZOS_HPP #include <boost/math/special_functions/lanczos.hpp> -#include <boost/lexical_cast.hpp> namespace boost{ namespace math{ namespace lanczos{ @@ -58,7 +57,7 @@ struct lanczos22UDT : public mpl::int_<120> static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 2.50662827463100050241576528481104525333)) }; static const T denom[22] = { - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 0.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 2432902008176640000.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 8752948036761600000.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 13803759753640704000.0)), @@ -75,11 +74,11 @@ struct lanczos22UDT : public mpl::int_<120> static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 756111184500.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 40171771630.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1672280820.0)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 53327946)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1256850)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 20615)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 210)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1)) + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 53327946.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1256850.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 20615.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 210.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1.0)) }; return boost::math::tools::evaluate_rational(num, denom, z); } @@ -113,7 +112,7 @@ struct lanczos22UDT : public mpl::int_<120> static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 0.3765495513732730583386223384116545391759e-9)) }; static const T denom[22] = { - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 0.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 2432902008176640000.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 8752948036761600000.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 13803759753640704000.0)), @@ -132,9 +131,9 @@ struct lanczos22UDT : public mpl::int_<120> static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1672280820.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 53327946.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1256850.0)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 20615)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 210)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1)) + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 20615.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 210.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 120, 1.0)) }; return boost::math::tools::evaluate_rational(num, denom, z); } diff --git a/boost/math/bindings/e_float.hpp b/boost/math/bindings/e_float.hpp index d7f9a73508..4068e35922 100644 --- a/boost/math/bindings/e_float.hpp +++ b/boost/math/bindings/e_float.hpp @@ -25,6 +25,7 @@ #include <boost/math/special_functions/fpclassify.hpp> #include <boost/math/bindings/detail/big_digamma.hpp> #include <boost/math/bindings/detail/big_lanczos.hpp> +#include <boost/lexical_cast.hpp> namespace boost{ namespace math{ namespace ef{ @@ -714,7 +715,7 @@ boost::math::ef::e_float bessel_i0(boost::math::ef::e_float x) } else // x in (15, \infty) { - boost::math::ef::e_float y = 1 / x - 1 / 15; + boost::math::ef::e_float y = 1 / x - boost::math::ef::e_float(1) / 15; r = evaluate_polynomial(P2, y) / evaluate_polynomial(Q2, y); factor = exp(x) / sqrt(x); value = factor * r; diff --git a/boost/math/bindings/mpfr.hpp b/boost/math/bindings/mpfr.hpp index e5c6ba071d..5edc0ae44c 100644 --- a/boost/math/bindings/mpfr.hpp +++ b/boost/math/bindings/mpfr.hpp @@ -12,6 +12,7 @@ #define BOOST_MATH_MPLFR_BINDINGS_HPP #include <boost/config.hpp> +#include <boost/lexical_cast.hpp> #ifdef BOOST_MSVC // @@ -35,19 +36,31 @@ #include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/bindings/detail/big_digamma.hpp> #include <boost/math/bindings/detail/big_lanczos.hpp> +#include <boost/math/tools/big_constant.hpp> inline mpfr_class fabs(const mpfr_class& v) { return abs(v); } +template <class T, class U> +inline mpfr_class fabs(const __gmp_expr<T,U>& v) +{ + return abs(static_cast<mpfr_class>(v)); +} -inline mpfr_class pow(const mpfr_class& b, const mpfr_class e) +inline mpfr_class pow(const mpfr_class& b, const mpfr_class& e) { mpfr_class result; mpfr_pow(result.__get_mp(), b.__get_mp(), e.__get_mp(), GMP_RNDN); return result; } - +/* +template <class T, class U, class V, class W> +inline mpfr_class pow(const __gmp_expr<T,U>& b, const __gmp_expr<V,W>& e) +{ + return pow(static_cast<mpfr_class>(b), static_cast<mpfr_class>(e)); +} +*/ inline mpfr_class ldexp(const mpfr_class& v, int e) { //int e = mpfr_get_exp(*v.__get_mp()); @@ -55,6 +68,11 @@ inline mpfr_class ldexp(const mpfr_class& v, int e) mpfr_set_exp(result.__get_mp(), e); return result; } +template <class T, class U> +inline mpfr_class ldexp(const __gmp_expr<T,U>& v, int e) +{ + return ldexp(static_cast<mpfr_class>(v), e); +} inline mpfr_class frexp(const mpfr_class& v, int* expon) { @@ -64,6 +82,11 @@ inline mpfr_class frexp(const mpfr_class& v, int* expon) *expon = e; return result; } +template <class T, class U> +inline mpfr_class frexp(const __gmp_expr<T,U>& v, int* expon) +{ + return frexp(static_cast<mpfr_class>(v), expon); +} inline mpfr_class fmod(const mpfr_class& v1, const mpfr_class& v2) { @@ -74,6 +97,11 @@ inline mpfr_class fmod(const mpfr_class& v1, const mpfr_class& v2) n = floor(v1 / v2); return v1 - n * v2; } +template <class T, class U, class V, class W> +inline mpfr_class fmod(const __gmp_expr<T,U>& v1, const __gmp_expr<V,W>& v2) +{ + return fmod(static_cast<mpfr_class>(v1), static_cast<mpfr_class>(v2)); +} template <class Policy> inline mpfr_class modf(const mpfr_class& v, long long* ipart, const Policy& pol) @@ -81,43 +109,86 @@ inline mpfr_class modf(const mpfr_class& v, long long* ipart, const Policy& pol) *ipart = lltrunc(v, pol); return v - boost::math::tools::real_cast<mpfr_class>(*ipart); } +template <class T, class U, class Policy> +inline mpfr_class modf(const __gmp_expr<T,U>& v, long long* ipart, const Policy& pol) +{ + return modf(static_cast<mpfr_class>(v), ipart, pol); +} + template <class Policy> -inline int iround(mpfr_class const& x, const Policy& pol) +inline int iround(mpfr_class const& x, const Policy&) { - return boost::math::tools::real_cast<int>(boost::math::round(x, pol)); + return boost::math::tools::real_cast<int>(boost::math::round(x, typename boost::math::policies::normalise<Policy, boost::math::policies::rounding_error< boost::math::policies::throw_on_error> >::type())); +} +template <class T, class U, class Policy> +inline int iround(__gmp_expr<T,U> const& x, const Policy& pol) +{ + return iround(static_cast<mpfr_class>(x), pol); } template <class Policy> -inline long lround(mpfr_class const& x, const Policy& pol) +inline long lround(mpfr_class const& x, const Policy&) +{ + return boost::math::tools::real_cast<long>(boost::math::round(x, typename boost::math::policies::normalise<Policy, boost::math::policies::rounding_error< boost::math::policies::throw_on_error> >::type())); +} +template <class T, class U, class Policy> +inline long lround(__gmp_expr<T,U> const& x, const Policy& pol) { - return boost::math::tools::real_cast<long>(boost::math::round(x, pol)); + return lround(static_cast<mpfr_class>(x), pol); } template <class Policy> -inline long long llround(mpfr_class const& x, const Policy& pol) +inline long long llround(mpfr_class const& x, const Policy&) { - return boost::math::tools::real_cast<long long>(boost::math::round(x, pol)); + return boost::math::tools::real_cast<long long>(boost::math::round(x, typename boost::math::policies::normalise<Policy, boost::math::policies::rounding_error< boost::math::policies::throw_on_error> >::type())); +} +template <class T, class U, class Policy> +inline long long llround(__gmp_expr<T,U> const& x, const Policy& pol) +{ + return llround(static_cast<mpfr_class>(x), pol); } template <class Policy> -inline int itrunc(mpfr_class const& x, const Policy& pol) +inline int itrunc(mpfr_class const& x, const Policy&) +{ + return boost::math::tools::real_cast<int>(boost::math::trunc(x, typename boost::math::policies::normalise<Policy, boost::math::policies::rounding_error< boost::math::policies::throw_on_error> >::type())); +} +template <class T, class U, class Policy> +inline int itrunc(__gmp_expr<T,U> const& x, const Policy& pol) { - return boost::math::tools::real_cast<int>(boost::math::trunc(x, pol)); + return itrunc(static_cast<mpfr_class>(x), pol); } template <class Policy> -inline long ltrunc(mpfr_class const& x, const Policy& pol) +inline long ltrunc(mpfr_class const& x, const Policy&) { - return boost::math::tools::real_cast<long>(boost::math::trunc(x, pol)); + return boost::math::tools::real_cast<long>(boost::math::trunc(x, typename boost::math::policies::normalise<Policy, boost::math::policies::rounding_error< boost::math::policies::throw_on_error> >::type())); +} +template <class T, class U, class Policy> +inline long ltrunc(__gmp_expr<T,U> const& x, const Policy& pol) +{ + return ltrunc(static_cast<mpfr_class>(x), pol); } template <class Policy> -inline long long lltrunc(mpfr_class const& x, const Policy& pol) +inline long long lltrunc(mpfr_class const& x, const Policy&) +{ + return boost::math::tools::real_cast<long long>(boost::math::trunc(x, typename boost::math::policies::normalise<Policy, boost::math::policies::rounding_error< boost::math::policies::throw_on_error> >::type())); +} +template <class T, class U, class Policy> +inline long long lltrunc(__gmp_expr<T,U> const& x, const Policy& pol) { - return boost::math::tools::real_cast<long long>(boost::math::trunc(x, pol)); + return lltrunc(static_cast<mpfr_class>(x), pol); } -namespace boost{ namespace math{ +namespace boost{ + +#ifdef BOOST_MATH_USE_FLOAT128 + template<> struct is_convertible<BOOST_MATH_FLOAT128_TYPE, mpfr_class> : public boost::integral_constant<bool, false>{}; +#endif + template<> struct is_convertible<long long, mpfr_class> : public boost::integral_constant<bool, false>{}; + +namespace math{ #if defined(__GNUC__) && (__GNUC__ < 4) using ::iround; @@ -203,6 +274,19 @@ struct lanczos<mpfr_class, Policy> } // namespace lanczos +namespace constants{ + +template <class Real, class Policy> +struct construction_traits; + +template <class Policy> +struct construction_traits<mpfr_class, Policy> +{ + typedef mpl::int_<0> type; +}; + +} + namespace tools { @@ -771,7 +855,7 @@ inline mpfr_class bessel_i0(mpfr_class x) } else // x in (15, \infty) { - mpfr_class y = 1 / x - 1 / 15; + mpfr_class y = 1 / x - mpfr_class(1) / 15; r = evaluate_polynomial(P2, y) / evaluate_polynomial(Q2, y); factor = exp(x) / sqrt(x); value = factor * r; diff --git a/boost/math/bindings/mpreal.hpp b/boost/math/bindings/mpreal.hpp index 82f7950b92..80ed81946d 100644 --- a/boost/math/bindings/mpreal.hpp +++ b/boost/math/bindings/mpreal.hpp @@ -736,7 +736,7 @@ mpfr::mpreal erf_inv_imp(const mpfr::mpreal& p, const mpfr::mpreal& q, const Pol return result; } -mpfr::mpreal bessel_i0(mpfr::mpreal x) +inline mpfr::mpreal bessel_i0(mpfr::mpreal x) { static const mpfr::mpreal P1[] = { boost::lexical_cast<mpfr::mpreal>("-2.2335582639474375249e+15"), @@ -802,7 +802,7 @@ mpfr::mpreal bessel_i0(mpfr::mpreal x) } else // x in (15, \infty) { - mpfr::mpreal y = 1 / x - 1 / 15; + mpfr::mpreal y = 1 / x - mpfr::mpreal(1) / 15; r = evaluate_polynomial(P2, y) / evaluate_polynomial(Q2, y); factor = exp(x) / sqrt(x); value = factor * r; @@ -811,7 +811,7 @@ mpfr::mpreal bessel_i0(mpfr::mpreal x) return value; } -mpfr::mpreal bessel_i1(mpfr::mpreal x) +inline mpfr::mpreal bessel_i1(mpfr::mpreal x) { static const mpfr::mpreal P1[] = { static_cast<mpfr::mpreal>("-1.4577180278143463643e+15"), diff --git a/boost/math/common_factor_ct.hpp b/boost/math/common_factor_ct.hpp index 848c925290..bf58b94eb2 100644 --- a/boost/math/common_factor_ct.hpp +++ b/boost/math/common_factor_ct.hpp @@ -23,7 +23,6 @@ namespace math namespace detail { -#ifndef BOOST_NO_TEMPLATE_PARTIAL_SPECIALIZATION // Build GCD with Euclid's recursive algorithm template < static_gcd_type Value1, static_gcd_type Value2 > struct static_gcd_helper_t @@ -54,48 +53,7 @@ namespace detail { BOOST_STATIC_CONSTANT( static_gcd_type, value = Value1 ); }; -#else - // Use inner class template workaround from Peter Dimov - template < static_gcd_type Value1 > - struct static_gcd_helper2_t - { - template < static_gcd_type Value2 > - struct helper - { - BOOST_STATIC_CONSTANT( static_gcd_type, value - = static_gcd_helper2_t<Value2>::BOOST_NESTED_TEMPLATE - helper<Value1 % Value2>::value ); - }; - - template < > - struct helper< 0UL > - { - BOOST_STATIC_CONSTANT( static_gcd_type, value = Value1 ); - }; - }; - - // Special case - template < > - struct static_gcd_helper2_t< 0UL > - { - template < static_gcd_type Value2 > - struct helper - { - BOOST_STATIC_CONSTANT( static_gcd_type, value = Value2 ); - }; - }; - - // Build the GCD from the above template(s) - template < static_gcd_type Value1, static_gcd_type Value2 > - struct static_gcd_helper_t - { - BOOST_STATIC_CONSTANT( static_gcd_type, value - = static_gcd_helper2_t<Value1>::BOOST_NESTED_TEMPLATE - helper<Value2>::value ); - }; -#endif -#ifndef BOOST_NO_TEMPLATE_PARTIAL_SPECIALIZATION // Build the LCM from the GCD template < static_gcd_type Value1, static_gcd_type Value2 > struct static_lcm_helper_t @@ -112,47 +70,6 @@ namespace detail { BOOST_STATIC_CONSTANT( static_gcd_type, value = 0UL ); }; -#else - // Adapt GCD's inner class template workaround for LCM - template < static_gcd_type Value1 > - struct static_lcm_helper2_t - { - template < static_gcd_type Value2 > - struct helper - { - typedef static_gcd_helper_t<Value1, Value2> gcd_type; - - BOOST_STATIC_CONSTANT( static_gcd_type, value = Value1 - / gcd_type::value * Value2 ); - }; - - template < > - struct helper< 0UL > - { - BOOST_STATIC_CONSTANT( static_gcd_type, value = 0UL ); - }; - }; - - // Special case - template < > - struct static_lcm_helper2_t< 0UL > - { - template < static_gcd_type Value2 > - struct helper - { - BOOST_STATIC_CONSTANT( static_gcd_type, value = 0UL ); - }; - }; - - // Build the LCM from the above template(s) - template < static_gcd_type Value1, static_gcd_type Value2 > - struct static_lcm_helper_t - { - BOOST_STATIC_CONSTANT( static_gcd_type, value - = static_lcm_helper2_t<Value1>::BOOST_NESTED_TEMPLATE - helper<Value2>::value ); - }; -#endif } // namespace detail diff --git a/boost/math/common_factor_rt.hpp b/boost/math/common_factor_rt.hpp index 4582a96c7b..10a92ebf56 100644 --- a/boost/math/common_factor_rt.hpp +++ b/boost/math/common_factor_rt.hpp @@ -222,7 +222,6 @@ namespace detail // Function objects to find the best way of computing GCD or LCM #ifndef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS -#ifndef BOOST_NO_TEMPLATE_PARTIAL_SPECIALIZATION template < typename T, bool IsSpecialized, bool IsSigned > struct gcd_optimal_evaluator_helper_t { @@ -240,40 +239,6 @@ namespace detail return gcd_integer( a, b ); } }; -#else - template < bool IsSpecialized, bool IsSigned > - struct gcd_optimal_evaluator_helper2_t - { - template < typename T > - struct helper - { - T operator ()( T const &a, T const &b ) - { - return gcd_euclidean( a, b ); - } - }; - }; - - template < > - struct gcd_optimal_evaluator_helper2_t< true, true > - { - template < typename T > - struct helper - { - T operator ()( T const &a, T const &b ) - { - return gcd_integer( a, b ); - } - }; - }; - - template < typename T, bool IsSpecialized, bool IsSigned > - struct gcd_optimal_evaluator_helper_t - : gcd_optimal_evaluator_helper2_t<IsSpecialized, IsSigned> - ::BOOST_NESTED_TEMPLATE helper<T> - { - }; -#endif template < typename T > struct gcd_optimal_evaluator @@ -348,7 +313,6 @@ namespace detail #undef BOOST_PRIVATE_GCD_SF #ifndef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS -#ifndef BOOST_NO_TEMPLATE_PARTIAL_SPECIALIZATION template < typename T, bool IsSpecialized, bool IsSigned > struct lcm_optimal_evaluator_helper_t { @@ -366,40 +330,6 @@ namespace detail return lcm_integer( a, b ); } }; -#else - template < bool IsSpecialized, bool IsSigned > - struct lcm_optimal_evaluator_helper2_t - { - template < typename T > - struct helper - { - T operator ()( T const &a, T const &b ) - { - return lcm_euclidean( a, b ); - } - }; - }; - - template < > - struct lcm_optimal_evaluator_helper2_t< true, true > - { - template < typename T > - struct helper - { - T operator ()( T const &a, T const &b ) - { - return lcm_integer( a, b ); - } - }; - }; - - template < typename T, bool IsSpecialized, bool IsSigned > - struct lcm_optimal_evaluator_helper_t - : lcm_optimal_evaluator_helper2_t<IsSpecialized, IsSigned> - ::BOOST_NESTED_TEMPLATE helper<T> - { - }; -#endif template < typename T > struct lcm_optimal_evaluator diff --git a/boost/math/complex/acos.hpp b/boost/math/complex/acos.hpp index 466dcc63f1..a911756949 100644 --- a/boost/math/complex/acos.hpp +++ b/boost/math/complex/acos.hpp @@ -31,12 +31,13 @@ std::complex<T> acos(const std::complex<T>& z) // // - // These static constants should really be in a maths constants library: + // These static constants should really be in a maths constants library, + // note that we have tweaked a_crossover as per: https://svn.boost.org/trac/boost/ticket/7290 // static const T one = static_cast<T>(1); //static const T two = static_cast<T>(2); static const T half = static_cast<T>(0.5L); - static const T a_crossover = static_cast<T>(1.5L); + static const T a_crossover = static_cast<T>(10); static const T b_crossover = static_cast<T>(0.6417L); static const T s_pi = boost::math::constants::pi<T>(); static const T half_pi = s_pi / 2; @@ -172,14 +173,16 @@ std::complex<T> acos(const std::complex<T>& z) } else { - real = 0; + // This deviates from Hull et al's paper as per https://svn.boost.org/trac/boost/ticket/7290 if(((std::numeric_limits<T>::max)() / xp1) > xm1) { // xp1 * xm1 won't overflow: + real = y / std::sqrt(xm1*xp1); imag = boost::math::log1p(xm1 + std::sqrt(xp1*xm1)); } else { + real = y / x; imag = log_two + std::log(x); } } diff --git a/boost/math/complex/asin.hpp b/boost/math/complex/asin.hpp index 1d20795217..087c3b51ef 100644 --- a/boost/math/complex/asin.hpp +++ b/boost/math/complex/asin.hpp @@ -31,12 +31,13 @@ inline std::complex<T> asin(const std::complex<T>& z) // // - // These static constants should really be in a maths constants library: + // These static constants should really be in a maths constants library, + // note that we have tweaked the value of a_crossover as per https://svn.boost.org/trac/boost/ticket/7290: // static const T one = static_cast<T>(1); //static const T two = static_cast<T>(2); static const T half = static_cast<T>(0.5L); - static const T a_crossover = static_cast<T>(1.5L); + static const T a_crossover = static_cast<T>(10); static const T b_crossover = static_cast<T>(0.6417L); static const T s_pi = boost::math::constants::pi<T>(); static const T half_pi = s_pi / 2; diff --git a/boost/math/complex/atanh.hpp b/boost/math/complex/atanh.hpp index 4ecb4e199f..66f4599e52 100644 --- a/boost/math/complex/atanh.hpp +++ b/boost/math/complex/atanh.hpp @@ -36,6 +36,8 @@ std::complex<T> atanh(const std::complex<T>& z) // Also "Abramowitz and Stegun. Handbook of Mathematical Functions." // at : http://jove.prohosting.com/~skripty/toc.htm // + // See also: https://svn.boost.org/trac/boost/ticket/7291 + // static const T pi = boost::math::constants::pi<T>(); static const T half_pi = pi / 2; @@ -43,7 +45,7 @@ std::complex<T> atanh(const std::complex<T>& z) static const T two = static_cast<T>(2.0L); static const T four = static_cast<T>(4.0L); static const T zero = static_cast<T>(0); - static const T a_crossover = static_cast<T>(0.3L); + static const T log_two = boost::math::constants::ln_two<T>(); #ifdef BOOST_MSVC #pragma warning(push) @@ -82,45 +84,19 @@ std::complex<T> atanh(const std::complex<T>& z) else if((x > safe_lower) && (x < safe_upper) && (y > safe_lower) && (y < safe_upper)) { - T xx = x*x; T yy = y*y; - T x2 = x * two; - + T mxm1 = one - x; /// // The real part is given by: // - // real(atanh(z)) == log((1 + x^2 + y^2 + 2x) / (1 + x^2 + y^2 - 2x)) + // real(atanh(z)) == log1p(4*x / ((x-1)*(x-1) + y^2)) // - // However, when x is either large (x > 1/E) or very small - // (x < E) then this effectively simplifies - // to log(1), leading to wildly inaccurate results. - // By dividing the above (top and bottom) by (1 + x^2 + y^2) we get: - // - // real(atanh(z)) == log((1 + (2x / (1 + x^2 + y^2))) / (1 - (-2x / (1 + x^2 + y^2)))) - // - // which is much more sensitive to the value of x, when x is not near 1 - // (remember we can compute log(1+x) for small x very accurately). - // - // The cross-over from one method to the other has to be determined - // experimentally, the value used below appears correct to within a - // factor of 2 (and there are larger errors from other parts - // of the input domain anyway). - // - T alpha = two*x / (one + xx + yy); - if(alpha < a_crossover) - { - real = boost::math::log1p(alpha) - boost::math::log1p((boost::math::changesign)(alpha)); - } - else - { - T xm1 = x - one; - real = boost::math::log1p(x2 + xx + yy) - std::log(xm1*xm1 + yy); - } + real = boost::math::log1p(four * x / (mxm1*mxm1 + yy)); real /= four; if((boost::math::signbit)(z.real())) real = (boost::math::changesign)(real); - imag = std::atan2((y * two), (one - xx - yy)); + imag = std::atan2((y * two), (mxm1*(one+x) - yy)); imag /= two; if(z.imag() < 0) imag = (boost::math::changesign)(imag); @@ -132,30 +108,31 @@ std::complex<T> atanh(const std::complex<T>& z) // underflow or overflow in the main formulas. // // Begin by working out the real part, we need to approximate - // alpha = 2x / (1 + x^2 + y^2) + // real = boost::math::log1p(4x / ((x-1)^2 + y^2)) // without either overflow or underflow in the squared terms. // - T alpha = 0; + T mxm1 = one - x; if(x >= safe_upper) { + // x-1 = x to machine precision: if((boost::math::isinf)(x) || (boost::math::isinf)(y)) { - alpha = 0; + real = 0; } else if(y >= safe_upper) { - // Big x and y: divide alpha through by x*y: - alpha = (two/y) / (x/y + y/x); + // Big x and y: divide through by x*y: + real = boost::math::log1p((four/y) / (x/y + y/x)); } else if(y > one) { // Big x: divide through by x: - alpha = two / (x + y*y/x); + real = boost::math::log1p(four / (x + y*y/x)); } else { // Big x small y, as above but neglect y^2/x: - alpha = two/x; + real = boost::math::log1p(four/x); } } else if(y >= safe_upper) @@ -163,39 +140,25 @@ std::complex<T> atanh(const std::complex<T>& z) if(x > one) { // Big y, medium x, divide through by y: - alpha = (two*x/y) / (y + x*x/y); + real = boost::math::log1p((four*x/y) / (y + mxm1*mxm1/y)); } else { - // Small x and y, whatever alpha is, it's too small to calculate: - alpha = 0; + // Small or medium x, large y: + real = four*x/y/y; } } - else + else if (x != one) { - // one or both of x and y are small, calculate divisor carefully: - T div = one; - if(x > safe_lower) - div += x*x; + // y is small, calculate divisor carefully: + T div = mxm1*mxm1; if(y > safe_lower) div += y*y; - alpha = two*x/div; - } - if(alpha < a_crossover) - { - real = boost::math::log1p(alpha) - boost::math::log1p((boost::math::changesign)(alpha)); + real = boost::math::log1p(four*x/div); } else - { - // We can only get here as a result of small y and medium sized x, - // we can simply neglect the y^2 terms: - BOOST_ASSERT(x >= safe_lower); - BOOST_ASSERT(x <= safe_upper); - //BOOST_ASSERT(y <= safe_lower); - T xm1 = x - one; - real = std::log(1 + two*x + x*x) - std::log(xm1*xm1); - } - + real = boost::math::changesign(two * (std::log(y) - log_two)); + real /= four; if((boost::math::signbit)(z.real())) real = (boost::math::changesign)(real); @@ -203,7 +166,7 @@ std::complex<T> atanh(const std::complex<T>& z) // // Now handle imaginary part, this is much easier, // if x or y are large, then the formula: - // atan2(2y, 1 - x^2 - y^2) + // atan2(2y, (1-x)*(1+x) - y^2) // evaluates to +-(PI - theta) where theta is negligible compared to PI. // if((x >= safe_upper) || (y >= safe_upper)) @@ -234,7 +197,7 @@ std::complex<T> atanh(const std::complex<T>& z) if((y == zero) && (x == one)) imag = 0; else - imag = std::atan2(two*y, 1 - x*x); + imag = std::atan2(two*y, mxm1*(one+x)); } imag /= two; if((boost::math::signbit)(z.imag())) diff --git a/boost/math/concepts/real_concept.hpp b/boost/math/concepts/real_concept.hpp index 1ed2c1df00..2267271a00 100644 --- a/boost/math/concepts/real_concept.hpp +++ b/boost/math/concepts/real_concept.hpp @@ -84,6 +84,9 @@ public: real_concept(float c) : m_value(c){} real_concept(double c) : m_value(c){} real_concept(long double c) : m_value(c){} +#ifdef BOOST_MATH_USE_FLOAT128 + real_concept(BOOST_MATH_FLOAT128_TYPE c) : m_value(c){} +#endif // Assignment: real_concept& operator=(char c) { m_value = c; return *this; } @@ -304,7 +307,7 @@ inline std::basic_istream<charT, traits>& operator>>(std::basic_istream<charT, t is >> v; a = v; return is; -#elif defined(__SGI_STL_PORT) || defined(_RWSTD_VER) || defined(__LIBCOMO__) +#elif defined(__SGI_STL_PORT) || defined(_RWSTD_VER) || defined(__LIBCOMO__) || defined(_LIBCPP_VERSION) std::string s; real_concept_base_type d; is >> s; @@ -325,7 +328,7 @@ namespace tools { template <> -inline concepts::real_concept make_big_value<concepts::real_concept>(long double val, const char* , mpl::false_ const&, mpl::false_ const&) +inline concepts::real_concept make_big_value<concepts::real_concept>(boost::floatmax_t val, const char* , mpl::false_ const&, mpl::false_ const&) { return val; // Can't use lexical_cast here, sometimes it fails.... } @@ -366,7 +369,7 @@ inline concepts::real_concept epsilon<concepts::real_concept>(BOOST_MATH_EXPLICI template <> inline int digits<concepts::real_concept>(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(concepts::real_concept)) -{ +{ // Assume number of significand bits is same as real_concept_base_type, // unless std::numeric_limits<T>::is_specialized to provide digits. return tools::digits<concepts::real_concept_base_type>(); @@ -432,7 +435,7 @@ inline long double real_cast<long double, concepts::real_concept>(concepts::real #if BOOST_WORKAROUND(BOOST_MSVC, <= 1310) // -// For some strange reason ADL sometimes fails to find the +// For some strange reason ADL sometimes fails to find the // correct overloads, unless we bring these declarations into scope: // using concepts::itrunc; diff --git a/boost/math/concepts/std_real_concept.hpp b/boost/math/concepts/std_real_concept.hpp index 4c4eb6ac32..b4f75bcadb 100644 --- a/boost/math/concepts/std_real_concept.hpp +++ b/boost/math/concepts/std_real_concept.hpp @@ -67,6 +67,9 @@ public: std_real_concept(float c) : m_value(c){} std_real_concept(double c) : m_value(c){} std_real_concept(long double c) : m_value(c){} +#ifdef BOOST_MATH_USE_FLOAT128 + std_real_concept(BOOST_MATH_FLOAT128_TYPE c) : m_value(c){} +#endif // Assignment: std_real_concept& operator=(char c) { m_value = c; return *this; } @@ -313,10 +316,19 @@ inline std::basic_ostream<charT, traits>& operator<<(std::basic_ostream<charT, t template <class charT, class traits> inline std::basic_istream<charT, traits>& operator>>(std::basic_istream<charT, traits>& is, std_real_concept& a) { +#if defined(__SGI_STL_PORT) || defined(_RWSTD_VER) || defined(__LIBCOMO__) || defined(_LIBCPP_VERSION) + std::string s; + std_real_concept_base_type d; + is >> s; + std::sscanf(s.c_str(), "%Lf", &d); + a = d; + return is; +#else std_real_concept_base_type v; is >> v; a = v; return is; +#endif } } // namespace concepts @@ -330,7 +342,7 @@ namespace tools { template <> -inline concepts::std_real_concept make_big_value<concepts::std_real_concept>(long double val, const char* , mpl::false_ const&, mpl::false_ const&) +inline concepts::std_real_concept make_big_value<concepts::std_real_concept>(boost::floatmax_t val, const char*, mpl::false_ const&, mpl::false_ const&) { return val; // Can't use lexical_cast here, sometimes it fails.... } diff --git a/boost/math/constants/calculate_constants.hpp b/boost/math/constants/calculate_constants.hpp index 0b78929e71..2dcdb9a02b 100644 --- a/boost/math/constants/calculate_constants.hpp +++ b/boost/math/constants/calculate_constants.hpp @@ -85,6 +85,7 @@ template <class T> // sqrt(2/pi) template <int N> inline T constant_root_two_div_pi<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>)) { + BOOST_MATH_STD_USING return sqrt((2 / pi<T, policies::policy<policies::digits2<N> > >())); } @@ -121,6 +122,14 @@ inline T constant_root_two_pi<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC template <class T> template<int N> +inline T constant_log_root_two_pi<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>)) +{ + BOOST_MATH_STD_USING + return log(root_two_pi<T, policies::policy<policies::digits2<N> > >()); +} + +template <class T> +template<int N> inline T constant_root_ln_four<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>)) { BOOST_MATH_STD_USING @@ -156,11 +165,11 @@ inline T constant_euler<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl:: // This is the method described in: // "Some New Algorithms for High-Precision Computation of Euler's Constant" // Richard P Brent and Edwin M McMillan. - // Mathematics of Comnputation, Volume 34, Number 149, Jan 1980, pages 305-312. + // Mathematics of Computation, Volume 34, Number 149, Jan 1980, pages 305-312. // See equation 17 with p = 2. // T n = 3 + (M ? (std::min)(M, tools::digits<T>()) : tools::digits<T>()) / 4; - T lim = M ? ldexp(T(1), (std::min)(M, tools::digits<T>())) : tools::epsilon<T>(); + T lim = M ? ldexp(T(1), 1 - (std::min)(M, tools::digits<T>())) : tools::epsilon<T>(); T lnn = log(n); T term = 1; T N = -lnn; @@ -301,13 +310,13 @@ inline T constant_four_minus_pi<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SP return static_cast<T>(4) - pi<T, policies::policy<policies::digits2<N> > >(); } -template <class T> -template<int N> -inline T constant_pow23_four_minus_pi<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>)) -{ - BOOST_MATH_STD_USING - return pow(four_minus_pi<T, policies::policy<policies::digits2<N> > >(), static_cast<T>(1.5)); -} +//template <class T> +//template<int N> +//inline T constant_pow23_four_minus_pi<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>)) +//{ +// BOOST_MATH_STD_USING +// return pow(four_minus_pi<T, policies::policy<policies::digits2<N> > >(), static_cast<T>(1.5)); +//} template <class T> template<int N> @@ -595,7 +604,7 @@ inline T constant_zeta_three<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC( //"1.202056903159594285399738161511449990, 76498629234049888179227155534183820578631309018645587360933525814619915" A002117 // 1.202056903159594285399738161511449990, 76498629234049888179227155534183820578631309018645587360933525814619915780, +00); //"1.2020569031595942 double - // http://www.spaennare.se/SSPROG/ssnum.pdf // section 11, Algorithmfor Apery’s constant zeta(3). + // http://www.spaennare.se/SSPROG/ssnum.pdf // section 11, Algorithm for Apery's constant zeta(3). // Programs to Calculate some Mathematical Constants to Large Precision, Document Version 1.50 // by Stefan Spannare September 19, 2007 @@ -928,7 +937,7 @@ template <class T> template<int N> inline T constant_rayleigh_kurtosis_excess<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>)) { // - (6 Pi^2 - 24 Pi + 16)/((Pi - 4)^2) - // Might provide provide and calculate this using pi_minus_four. + // Might provide and calculate this using pi_minus_four. BOOST_MATH_STD_USING return - (((static_cast<T>(6) * pi<T, policies::policy<policies::digits2<N> > >() * pi<T, policies::policy<policies::digits2<N> > >()) @@ -943,7 +952,7 @@ template <class T> template<int N> inline T constant_rayleigh_kurtosis<T>::compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>)) { // 3 - (6 Pi^2 - 24 Pi + 16)/((Pi - 4)^2) - // Might provide provide and calculate this using pi_minus_four. + // Might provide and calculate this using pi_minus_four. BOOST_MATH_STD_USING return static_cast<T>(3) - (((static_cast<T>(6) * pi<T, policies::policy<policies::digits2<N> > >() * pi<T, policies::policy<policies::digits2<N> > >()) diff --git a/boost/math/constants/constants.hpp b/boost/math/constants/constants.hpp index bb2260e7a7..e9381adeb6 100644 --- a/boost/math/constants/constants.hpp +++ b/boost/math/constants/constants.hpp @@ -14,7 +14,9 @@ #pragma warning(push) #pragma warning(disable: 4127 4701) #endif +#ifndef BOOST_MATH_NO_LEXICAL_CAST #include <boost/lexical_cast.hpp> +#endif #ifdef BOOST_MSVC #pragma warning(pop) #endif @@ -22,12 +24,14 @@ #include <boost/mpl/and.hpp> #include <boost/mpl/int.hpp> #include <boost/type_traits/is_convertible.hpp> +#include <boost/utility/declval.hpp> + namespace boost{ namespace math { namespace constants { - // To permit other calculations at about 100 decimal digits with NTL::RR type, + // To permit other calculations at about 100 decimal digits with some UDT, // it is obviously necessary to define constants to this accuracy. // However, some compilers do not accept decimal digits strings as long as this. @@ -46,7 +50,33 @@ namespace boost{ namespace math construct_from_float = 1, construct_from_double = 2, construct_from_long_double = 3, - construct_from_string = 4 + construct_from_string = 4, + construct_from_float128 = 5, + // Must be the largest value above: + construct_max = construct_from_float128 + }; + + // + // Traits class determines how to convert from string based on whether T has a constructor + // from const char* or not: + // + template <int N> + struct dummy_size{}; + + template <class T> + struct is_explicitly_convertible_from_string + { +#ifndef BOOST_NO_SFINAE_EXPR + template<typename S1, typename T1> + static type_traits::yes_type selector(dummy_size<sizeof(static_cast<T1>(declval<S1>()))>*); + + template<typename S1, typename T1> + static type_traits::no_type selector(...); + + static const bool value = sizeof(selector<const char*, T>(0)) == sizeof(type_traits::yes_type); +#else + static const bool value = false; +#endif }; // @@ -63,6 +93,9 @@ namespace boost{ namespace math typedef typename policies::precision<float, Policy>::type t2; typedef typename policies::precision<double, Policy>::type t3; typedef typename policies::precision<long double, Policy>::type t4; +#ifdef BOOST_MATH_USE_FLOAT128 + typedef mpl::int_<113> t5; +#endif public: typedef typename mpl::if_< mpl::and_<boost::is_convertible<float, Real>, mpl::bool_< t1::value <= t2::value>, mpl::bool_<0 != t1::value> >, @@ -73,11 +106,23 @@ namespace boost{ namespace math typename mpl::if_< mpl::and_<boost::is_convertible<long double, Real>, mpl::bool_< t1::value <= t4::value>, mpl::bool_<0 != t1::value> >, mpl::int_<construct_from_long_double>, +#ifdef BOOST_MATH_USE_FLOAT128 + typename mpl::if_< + mpl::and_<boost::is_convertible<BOOST_MATH_FLOAT128_TYPE, Real>, mpl::bool_< t1::value <= t5::value>, mpl::bool_<0 != t1::value> >, + mpl::int_<construct_from_float128>, + typename mpl::if_< + mpl::and_<mpl::bool_< t1::value <= max_string_digits>, mpl::bool_<0 != t1::value> >, + mpl::int_<construct_from_string>, + mpl::int_<t1::value> + >::type + >::type +#else typename mpl::if_< mpl::and_<mpl::bool_< t1::value <= max_string_digits>, mpl::bool_<0 != t1::value> >, mpl::int_<construct_from_string>, mpl::int_<t1::value> >::type +#endif >::type >::type >::type type; @@ -93,10 +138,24 @@ namespace boost{ namespace math namespace detail{ + template <class Real, class Policy = boost::math::policies::policy<> > + struct constant_return + { + typedef typename construction_traits<Real, Policy>::type construct_type; + typedef typename mpl::if_c< + (construct_type::value == construct_from_string) || (construct_type::value > construct_max), + const Real&, Real>::type type; + }; + template <class Real> Real convert_from_string(const char* p, const mpl::false_&) { +#ifdef BOOST_MATH_NO_LEXICAL_CAST + // This function should not compile, we don't have the necesary functionality to support it: + BOOST_STATIC_ASSERT(sizeof(Real) == 0); +#else return boost::lexical_cast<Real>(p); +#endif } template <class Real> const char* convert_from_string(const char* p, const mpl::true_&) @@ -104,7 +163,7 @@ namespace boost{ namespace math return p; } - template <class T, T (*F)(BOOST_EXPLICIT_TEMPLATE_TYPE_SPEC(T))> + template <class T, const T& (*F)()> struct constant_initializer { static void force_instantiate() @@ -116,21 +175,17 @@ namespace boost{ namespace math { initializer() { - F( - #ifdef BOOST_NO_EXPLICIT_FUNCTION_TEMPLATE_ARGUMENTS - 0 - #endif - ); + F(); } void force_instantiate()const{} }; static const initializer init; }; - template <class T, T (*F)(BOOST_EXPLICIT_TEMPLATE_TYPE_SPEC(T))> + template <class T, const T& (*F)()> typename constant_initializer<T, F>::initializer const constant_initializer<T, F>::init; - template <class T, int N, T (*F)(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>) BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(T))> + template <class T, int N, const T& (*F)(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>) BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(T))> struct constant_initializer2 { static void force_instantiate() @@ -142,37 +197,47 @@ namespace boost{ namespace math { initializer() { - F( - #ifdef BOOST_NO_EXPLICIT_FUNCTION_TEMPLATE_ARGUMENTS - mpl::int_<N>() , 0 - #endif - ); + F(); } void force_instantiate()const{} }; static const initializer init; }; - template <class T, int N, T (*F)(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>) BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(T))> + template <class T, int N, const T& (*F)(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>) BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(T))> typename constant_initializer2<T, N, F>::initializer const constant_initializer2<T, N, F>::init; } - #define BOOST_DEFINE_MATH_CONSTANT(name, x, y)\ +#ifdef BOOST_MATH_USE_FLOAT128 +# define BOOST_MATH_FLOAT128_CONSTANT_OVERLOAD(x) \ + static inline BOOST_CONSTEXPR T get(const mpl::int_<construct_from_float128>&)\ + { return BOOST_JOIN(x, Q); } +#else +# define BOOST_MATH_FLOAT128_CONSTANT_OVERLOAD(x) +#endif + +#define BOOST_DEFINE_MATH_CONSTANT(name, x, y)\ namespace detail{\ template <class T> struct BOOST_JOIN(constant_, name){\ private:\ /* The default implementations come next: */ \ - static inline T get_from_string()\ + static inline const T& get_from_string()\ {\ - static const T result = convert_from_string<T>(y, boost::is_convertible<const char*, T>());\ + typedef mpl::bool_<boost::is_convertible<const char*, T>::value || boost::math::constants::is_explicitly_convertible_from_string<T>::value> tag_type;\ + static const T result(convert_from_string<T>(y, tag_type()));\ return result;\ }\ /* This one is for very high precision that is none the less known at compile time: */ \ template <int N> static T compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>));\ + template <int N> static inline const T& get_from_compute(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(mpl::int_<N>))\ + {\ + static const T result = compute<N>();\ + return result;\ + }\ /* public getters come next */\ public:\ - static inline T get(const mpl::int_<construct_from_string>&)\ + static inline const T& get(const mpl::int_<construct_from_string>&)\ {\ constant_initializer<T, & BOOST_JOIN(constant_, name)<T>::get_from_string >::force_instantiate();\ return get_from_string();\ @@ -183,10 +248,11 @@ namespace boost{ namespace math { return x; }\ static inline BOOST_CONSTEXPR T get(const mpl::int_<construct_from_long_double>&)\ { return BOOST_JOIN(x, L); }\ - template <int N> static inline T get(const mpl::int_<N>& n)\ + BOOST_MATH_FLOAT128_CONSTANT_OVERLOAD(x) \ + template <int N> static inline const T& get(const mpl::int_<N>&)\ {\ - constant_initializer2<T, N, & BOOST_JOIN(constant_, name)<T>::template compute<N> >::force_instantiate();\ - return compute<N>(); \ + constant_initializer2<T, N, & BOOST_JOIN(constant_, name)<T>::template get_from_compute<N> >::force_instantiate();\ + return get_from_compute<N>(); \ }\ /* This one is for true arbitary precision, which may well vary at runtime: */ \ static inline T get(const mpl::int_<0>&)\ @@ -196,9 +262,9 @@ namespace boost{ namespace math \ \ /* The actual forwarding function: */ \ - template <class T, class Policy> inline BOOST_CONSTEXPR T name(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(T) BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(Policy))\ + template <class T, class Policy> inline BOOST_CONSTEXPR typename detail::constant_return<T, Policy>::type name(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(T) BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(Policy))\ { return detail:: BOOST_JOIN(constant_, name)<T>::get(typename construction_traits<T, Policy>::type()); }\ - template <class T> inline BOOST_CONSTEXPR T name(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(T))\ + template <class T> inline BOOST_CONSTEXPR typename detail::constant_return<T>::type name(BOOST_MATH_EXPLICIT_TEMPLATE_TYPE_SPEC(T))\ { return name<T, boost::math::policies::policy<> >(); }\ \ \ @@ -233,11 +299,12 @@ namespace boost{ namespace math BOOST_DEFINE_MATH_CONSTANT(root_pi, 1.772453850905516027298167483341145182e+00, "1.77245385090551602729816748334114518279754945612238712821380778985291128459103218137495065673854466541622682362e+00") BOOST_DEFINE_MATH_CONSTANT(root_half_pi, 1.253314137315500251207882642405522626e+00, "1.25331413731550025120788264240552262650349337030496915831496178817114682730392098747329791918902863305800498633e+00") BOOST_DEFINE_MATH_CONSTANT(root_two_pi, 2.506628274631000502415765284811045253e+00, "2.50662827463100050241576528481104525300698674060993831662992357634229365460784197494659583837805726611600997267e+00") + BOOST_DEFINE_MATH_CONSTANT(log_root_two_pi, 9.189385332046727417803297364056176398e-01, "9.18938533204672741780329736405617639861397473637783412817151540482765695927260397694743298635954197622005646625e-01") BOOST_DEFINE_MATH_CONSTANT(one_div_root_pi, 5.641895835477562869480794515607725858e-01, "5.64189583547756286948079451560772585844050629328998856844085721710642468441493414486743660202107363443028347906e-01") BOOST_DEFINE_MATH_CONSTANT(root_one_div_pi, 5.641895835477562869480794515607725858e-01, "5.64189583547756286948079451560772585844050629328998856844085721710642468441493414486743660202107363443028347906e-01") BOOST_DEFINE_MATH_CONSTANT(pi_minus_three, 1.415926535897932384626433832795028841e-01, "1.41592653589793238462643383279502884197169399375105820974944592307816406286208998628034825342117067982148086513e-01") BOOST_DEFINE_MATH_CONSTANT(four_minus_pi, 8.584073464102067615373566167204971158e-01, "8.58407346410206761537356616720497115802830600624894179025055407692183593713791001371965174657882932017851913487e-01") - BOOST_DEFINE_MATH_CONSTANT(pow23_four_minus_pi, 7.953167673715975443483953350568065807e-01, "7.95316767371597544348395335056806580727639173327713205445302234388856268267518187590758006888600828436839800178e-01") + //BOOST_DEFINE_MATH_CONSTANT(pow23_four_minus_pi, 7.953167673715975443483953350568065807e-01, "7.95316767371597544348395335056806580727639173327713205445302234388856268267518187590758006888600828436839800178e-01") BOOST_DEFINE_MATH_CONSTANT(pi_pow_e, 2.245915771836104547342715220454373502e+01, "2.24591577183610454734271522045437350275893151339966922492030025540669260403991179123185197527271430315314500731e+01") BOOST_DEFINE_MATH_CONSTANT(pi_sqr, 9.869604401089358618834490999876151135e+00, "9.86960440108935861883449099987615113531369940724079062641334937622004482241920524300177340371855223182402591377e+00") BOOST_DEFINE_MATH_CONSTANT(pi_sqr_div_six, 1.644934066848226436472415166646025189e+00, "1.64493406684822643647241516664602518921894990120679843773555822937000747040320087383362890061975870530400431896e+00") @@ -272,7 +339,7 @@ namespace boost{ namespace math BOOST_DEFINE_MATH_CONSTANT(rayleigh_skewness, 6.311106578189371381918993515442277798e-01, "6.31110657818937138191899351544227779844042203134719497658094585692926819617473725459905027032537306794400047264e-01") BOOST_DEFINE_MATH_CONSTANT(rayleigh_kurtosis, 3.245089300687638062848660410619754415e+00, "3.24508930068763806284866041061975441541706673178920936177133764493367904540874159051490619368679348977426462633e+00") BOOST_DEFINE_MATH_CONSTANT(rayleigh_kurtosis_excess, 2.450893006876380628486604106197544154e-01, "2.45089300687638062848660410619754415417066731789209361771337644933679045408741590514906193686793489774264626328e-01") - + BOOST_DEFINE_MATH_CONSTANT(two_div_pi, 6.366197723675813430755350534900574481e-01, "6.36619772367581343075535053490057448137838582961825794990669376235587190536906140360455211065012343824291370907e-01") BOOST_DEFINE_MATH_CONSTANT(root_two_div_pi, 7.978845608028653558798921198687637369e-01, "7.97884560802865355879892119868763736951717262329869315331851659341315851798603677002504667814613872860605117725e-01") diff --git a/boost/math/constants/generate.hpp b/boost/math/constants/generate.hpp deleted file mode 100644 index dfb15633a5..0000000000 --- a/boost/math/constants/generate.hpp +++ /dev/null @@ -1,76 +0,0 @@ -// Copyright John Maddock 2010. -// Use, modification and distribution are subject to the -// Boost Software License, Version 1.0. (See accompanying file -// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) - -#ifndef BOOST_MATH_CONSTANTS_GENERATE_INCLUDED -#define BOOST_MATH_CONSTANTS_GENERATE_INCLUDED - -#include <boost/math/constants/constants.hpp> -#include <boost/regex.hpp> -#include <iostream> -#include <iomanip> -#include <sstream> - -#ifdef USE_MPFR -#include <boost/math/bindings/mpfr.hpp> -#elif defined(USE_MPREAL) -#include <boost/math/bindings/mpreal.hpp> -#elif defined(USE_CPP_FLOAT) -#include <boost/multiprecision/cpp_float.hpp> -#else -#include <boost/math/bindings/rr.hpp> -#endif - -namespace boost{ namespace math{ namespace constants{ - -#ifdef USE_MPFR -typedef mpfr_class generator_type; -#elif defined(USE_MPREAL) -typedef mpfr::mpreal generator_type; -#elif defined(USE_CPP_FLOAT) -typedef boost::multiprecision::mp_number<boost::multiprecision::cpp_float<500> > generator_type; -#else -typedef ntl::RR generator_type; -#endif - -inline void print_constant(const char* name, generator_type(*f)(const mpl::int_<0>&)) -{ -#ifdef USE_MPFR - mpfr_class::set_dprec(((200 + 1) * 1000L) / 301L); -#elif defined(USE_MPREAL) - mpfr::mpreal::set_default_prec(((200 + 1) * 1000L) / 301L); -#elif defined(USE_CPP_FLOAT) - // Nothing to do, precision is already set. -#else - ntl::RR::SetPrecision(((200 + 1) * 1000L) / 301L); - ntl::RR::SetOutputPrecision(102); -#endif - generator_type value = f(boost::mpl::int_<0>()); - std::stringstream os; - os << std::setprecision(110) << std::scientific; - os << value; - std::string s = os.str(); - static const regex e("([+-]?\\d+(?:\\.\\d{0,36})?)(\\d*)(?:e([+-]?\\d+))?"); - smatch what; - if(regex_match(s, what, e)) - { - std::cout << - "BOOST_DEFINE_MATH_CONSTANT(" << name << ", " - << what[1] << "e" << (what[3].length() ? what[3].str() : std::string("0")) << ", " - << "\"" << what[1] << what[2] << "e" << (what[3].length() ? what[3].str() : std::string("0")) - << "\");" << std::endl; - } - else - { - std::cout << "Format of numeric constant was not recognised!!" << std::endl; - } -} - -#define BOOST_CONSTANTS_GENERATE(name) \ - boost::math::constants::print_constant(#name, \ - & boost::math::constants::detail::BOOST_JOIN(constant_, name)<boost::math::constants::generator_type>::get) - -}}} // namespaces - -#endif // BOOST_MATH_CONSTANTS_GENERATE_INCLUDED diff --git a/boost/math/cstdfloat/cstdfloat_cmath.hpp b/boost/math/cstdfloat/cstdfloat_cmath.hpp new file mode 100644 index 0000000000..3043d90567 --- /dev/null +++ b/boost/math/cstdfloat/cstdfloat_cmath.hpp @@ -0,0 +1,600 @@ +/////////////////////////////////////////////////////////////////////////////// +// Copyright Christopher Kormanyos 2014. +// Copyright John Maddock 2014. +// Copyright Paul Bristow 2014. +// Distributed under the Boost Software License, +// Version 1.0. (See accompanying file LICENSE_1_0.txt +// or copy at http://www.boost.org/LICENSE_1_0.txt) +// + +// Implement quadruple-precision <cmath> support. + +#ifndef _BOOST_CSTDFLOAT_CMATH_2014_02_15_HPP_ + #define _BOOST_CSTDFLOAT_CMATH_2014_02_15_HPP_ + + #include <boost/math/cstdfloat/cstdfloat_types.hpp> + #include <boost/math/cstdfloat/cstdfloat_limits.hpp> + + #if defined(BOOST_CSTDFLOAT_HAS_INTERNAL_FLOAT128_T) && defined(BOOST_MATH_USE_FLOAT128) && !defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT) + + #include <cmath> + #include <stdexcept> + #include <boost/cstdint.hpp> + #include <boost/static_assert.hpp> + #include <boost/throw_exception.hpp> + + #if defined(_WIN32) && defined(__GNUC__) + // Several versions of Mingw and probably cygwin too have broken + // libquadmath implementations that segfault as soon as you call + // expq or any function that depends on it. + #define BOOST_CSTDFLOAT_BROKEN_FLOAT128_MATH_FUNCTIONS + #endif + + // Here is a helper function used for raising the value of a given + // floating-point type to the power of n, where n has integral type. + namespace boost { namespace math { namespace cstdfloat { namespace detail { + + template<class float_type, class integer_type> + inline float_type pown(const float_type& x, const integer_type p) + { + const bool isneg = (x < 0); + const bool isnan = (x != x); + const bool isinf = ((!isneg) ? bool(+x > (std::numeric_limits<float_type>::max)()) + : bool(-x > (std::numeric_limits<float_type>::max)())); + + if(isnan) { return x; } + + if(isinf) { return std::numeric_limits<float_type>::quiet_NaN(); } + + const bool x_is_neg = (x < 0); + const float_type abs_x = (x_is_neg ? -x : x); + + if(p < static_cast<integer_type>(0)) + { + if(abs_x < (std::numeric_limits<float_type>::min)()) + { + return (x_is_neg ? -std::numeric_limits<float_type>::infinity() + : +std::numeric_limits<float_type>::infinity()); + } + else + { + return float_type(1) / pown(x, static_cast<integer_type>(-p)); + } + } + + if(p == static_cast<integer_type>(0)) + { + return float_type(1); + } + else + { + if(p == static_cast<integer_type>(1)) { return x; } + + if(abs_x > (std::numeric_limits<float_type>::max)()) + { + return (x_is_neg ? -std::numeric_limits<float_type>::infinity() + : +std::numeric_limits<float_type>::infinity()); + } + + if (p == static_cast<integer_type>(2)) { return (x * x); } + else if(p == static_cast<integer_type>(3)) { return ((x * x) * x); } + else if(p == static_cast<integer_type>(4)) { const float_type x2 = (x * x); return (x2 * x2); } + else + { + // The variable xn stores the binary powers of x. + float_type result(((p % integer_type(2)) != integer_type(0)) ? x : float_type(1)); + float_type xn (x); + + integer_type p2 = p; + + while(integer_type(p2 /= 2) != integer_type(0)) + { + // Square xn for each binary power. + xn *= xn; + + const bool has_binary_power = (integer_type(p2 % integer_type(2)) != integer_type(0)); + + if(has_binary_power) + { + // Multiply the result with each binary power contained in the exponent. + result *= xn; + } + } + + return result; + } + } + } + + } } } } // boost::math::cstdfloat::detail + + // We will now define preprocessor symbols representing quadruple-precision <cmath> functions. + #if defined(BOOST_INTEL) + #define BOOST_CSTDFLOAT_FLOAT128_LDEXP __ldexpq + #define BOOST_CSTDFLOAT_FLOAT128_FREXP __frexpq + #define BOOST_CSTDFLOAT_FLOAT128_FABS __fabsq + #define BOOST_CSTDFLOAT_FLOAT128_FLOOR __floorq + #define BOOST_CSTDFLOAT_FLOAT128_CEIL __ceilq + #if !defined(BOOST_CSTDFLOAT_FLOAT128_SQRT) + #define BOOST_CSTDFLOAT_FLOAT128_SQRT __sqrtq + #endif + #define BOOST_CSTDFLOAT_FLOAT128_TRUNC __truncq + #define BOOST_CSTDFLOAT_FLOAT128_EXP __expq + #define BOOST_CSTDFLOAT_FLOAT128_EXPM1 __expm1q + #define BOOST_CSTDFLOAT_FLOAT128_POW __powq + #define BOOST_CSTDFLOAT_FLOAT128_LOG __logq + #define BOOST_CSTDFLOAT_FLOAT128_LOG10 __log10q + #define BOOST_CSTDFLOAT_FLOAT128_SIN __sinq + #define BOOST_CSTDFLOAT_FLOAT128_COS __cosq + #define BOOST_CSTDFLOAT_FLOAT128_TAN __tanq + #define BOOST_CSTDFLOAT_FLOAT128_ASIN __asinq + #define BOOST_CSTDFLOAT_FLOAT128_ACOS __acosq + #define BOOST_CSTDFLOAT_FLOAT128_ATAN __atanq + #define BOOST_CSTDFLOAT_FLOAT128_SINH __sinhq + #define BOOST_CSTDFLOAT_FLOAT128_COSH __coshq + #define BOOST_CSTDFLOAT_FLOAT128_TANH __tanhq + #define BOOST_CSTDFLOAT_FLOAT128_ASINH __asinhq + #define BOOST_CSTDFLOAT_FLOAT128_ACOSH __acoshq + #define BOOST_CSTDFLOAT_FLOAT128_ATANH __atanhq + #define BOOST_CSTDFLOAT_FLOAT128_FMOD __fmodq + #define BOOST_CSTDFLOAT_FLOAT128_ATAN2 __atan2q + #define BOOST_CSTDFLOAT_FLOAT128_LGAMMA __lgammaq + #define BOOST_CSTDFLOAT_FLOAT128_TGAMMA __tgammaq + #elif defined(__GNUC__) + #define BOOST_CSTDFLOAT_FLOAT128_LDEXP ldexpq + #define BOOST_CSTDFLOAT_FLOAT128_FREXP frexpq + #define BOOST_CSTDFLOAT_FLOAT128_FABS fabsq + #define BOOST_CSTDFLOAT_FLOAT128_FLOOR floorq + #define BOOST_CSTDFLOAT_FLOAT128_CEIL ceilq + #if !defined(BOOST_CSTDFLOAT_FLOAT128_SQRT) + #define BOOST_CSTDFLOAT_FLOAT128_SQRT sqrtq + #endif + #define BOOST_CSTDFLOAT_FLOAT128_TRUNC truncq + #define BOOST_CSTDFLOAT_FLOAT128_POW powq + #define BOOST_CSTDFLOAT_FLOAT128_LOG logq + #define BOOST_CSTDFLOAT_FLOAT128_LOG10 log10q + #define BOOST_CSTDFLOAT_FLOAT128_SIN sinq + #define BOOST_CSTDFLOAT_FLOAT128_COS cosq + #define BOOST_CSTDFLOAT_FLOAT128_TAN tanq + #define BOOST_CSTDFLOAT_FLOAT128_ASIN asinq + #define BOOST_CSTDFLOAT_FLOAT128_ACOS acosq + #define BOOST_CSTDFLOAT_FLOAT128_ATAN atanq + #define BOOST_CSTDFLOAT_FLOAT128_FMOD fmodq + #define BOOST_CSTDFLOAT_FLOAT128_ATAN2 atan2q + #define BOOST_CSTDFLOAT_FLOAT128_LGAMMA lgammaq + #if !defined(BOOST_CSTDFLOAT_BROKEN_FLOAT128_MATH_FUNCTIONS) + #define BOOST_CSTDFLOAT_FLOAT128_EXP expq + #define BOOST_CSTDFLOAT_FLOAT128_EXPM1 expm1q_internal + #define BOOST_CSTDFLOAT_FLOAT128_SINH sinhq + #define BOOST_CSTDFLOAT_FLOAT128_COSH coshq + #define BOOST_CSTDFLOAT_FLOAT128_TANH tanhq + #define BOOST_CSTDFLOAT_FLOAT128_ASINH asinhq + #define BOOST_CSTDFLOAT_FLOAT128_ACOSH acoshq + #define BOOST_CSTDFLOAT_FLOAT128_ATANH atanhq + #define BOOST_CSTDFLOAT_FLOAT128_TGAMMA tgammaq + #else // BOOST_CSTDFLOAT_BROKEN_FLOAT128_MATH_FUNCTIONS + #define BOOST_CSTDFLOAT_FLOAT128_EXP expq_patch + #define BOOST_CSTDFLOAT_FLOAT128_SINH sinhq_patch + #define BOOST_CSTDFLOAT_FLOAT128_COSH coshq_patch + #define BOOST_CSTDFLOAT_FLOAT128_TANH tanhq_patch + #define BOOST_CSTDFLOAT_FLOAT128_ASINH asinhq_patch + #define BOOST_CSTDFLOAT_FLOAT128_ACOSH acoshq_patch + #define BOOST_CSTDFLOAT_FLOAT128_ATANH atanhq_patch + #define BOOST_CSTDFLOAT_FLOAT128_TGAMMA tgammaq_patch + #endif // BOOST_CSTDFLOAT_BROKEN_FLOAT128_MATH_FUNCTIONS + #endif + + // Implement quadruple-precision <cmath> functions in the namespace + // boost::math::cstdfloat::detail. Subsequently inject these into the + // std namespace via *using* directive. + + // Begin with some forward function declarations. Also implement patches + // for compilers that have broken float128 exponential functions. + + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_LDEXP (boost::math::cstdfloat::detail::float_internal128_t, int) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_FREXP (boost::math::cstdfloat::detail::float_internal128_t, int*) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_FABS (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_FLOOR (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_CEIL (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_SQRT (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_TRUNC (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_POW (boost::math::cstdfloat::detail::float_internal128_t, boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_LOG (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_LOG10 (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_SIN (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_COS (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_TAN (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ASIN (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ACOS (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ATAN (boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_FMOD (boost::math::cstdfloat::detail::float_internal128_t, boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ATAN2 (boost::math::cstdfloat::detail::float_internal128_t, boost::math::cstdfloat::detail::float_internal128_t) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_LGAMMA(boost::math::cstdfloat::detail::float_internal128_t) throw(); + + #if !defined(BOOST_CSTDFLOAT_BROKEN_FLOAT128_MATH_FUNCTIONS) + + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_EXP (boost::math::cstdfloat::detail::float_internal128_t x) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_SINH (boost::math::cstdfloat::detail::float_internal128_t x) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_COSH (boost::math::cstdfloat::detail::float_internal128_t x) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_TANH (boost::math::cstdfloat::detail::float_internal128_t x) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ASINH (boost::math::cstdfloat::detail::float_internal128_t x) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ACOSH (boost::math::cstdfloat::detail::float_internal128_t x) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ATANH (boost::math::cstdfloat::detail::float_internal128_t x) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_TGAMMA(boost::math::cstdfloat::detail::float_internal128_t x) throw(); + + #else // BOOST_CSTDFLOAT_BROKEN_FLOAT128_MATH_FUNCTIONS + + // Forward declaration of the patched exponent function, exp(x). + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_EXP (boost::math::cstdfloat::detail::float_internal128_t x); + + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_EXPM1 (boost::math::cstdfloat::detail::float_internal128_t x) + { + // Compute exp(x) - 1 for x small. + + // Use an order-36 polynomial approximation of the exponential function + // in the range of (-ln2 < x < ln2). Scale the argument to this range + // and subsequently multiply the result by 2^n accordingly. + + // Derive the polynomial coefficients with Mathematica(R) by generating + // a table of high-precision values of exp(x) in the range (-ln2 < x < ln2) + // and subsequently applying the built-in *Fit* function. + + // Table[{x, Exp[x] - 1}, {x, -Log[2], Log[2], 1/180}] + // N[%, 120] + // Fit[%, {x, x^2, x^3, x^4, x^5, x^6, x^7, x^8, x^9, x^10, x^11, x^12, + // x^13, x^14, x^15, x^16, x^17, x^18, x^19, x^20, x^21, x^22, + // x^23, x^24, x^25, x^26, x^27, x^28, x^29, x^30, x^31, x^32, + // x^33, x^34, x^35, x^36}, x] + + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + + float_type sum; + + if(x > BOOST_FLOAT128_C(0.693147180559945309417232121458176568075500134360255)) + { + sum = ::BOOST_CSTDFLOAT_FLOAT128_EXP(x) - float_type(1); + } + else + { + // Compute the polynomial approximation of exp(alpha). + sum = (((((((((((((((((((((((((((((((((((( float_type(BOOST_FLOAT128_C(2.69291698127774166063293705964720493864630783729857438187365E-42)) * x + + float_type(BOOST_FLOAT128_C(9.70937085471487654794114679403710456028986572118859594614033E-41))) * x + + float_type(BOOST_FLOAT128_C(3.38715585158055097155585505318085512156885389014410753080500E-39))) * x + + float_type(BOOST_FLOAT128_C(1.15162718532861050809222658798662695267019717760563645440433E-37))) * x + + float_type(BOOST_FLOAT128_C(3.80039074689434663295873584133017767349635602413675471702393E-36))) * x + + float_type(BOOST_FLOAT128_C(1.21612504934087520075905434734158045947460467096773246215239E-34))) * x + + float_type(BOOST_FLOAT128_C(3.76998762883139753126119821241037824830069851253295480396224E-33))) * x + + float_type(BOOST_FLOAT128_C(1.13099628863830344684998293828608215735777107850991029729440E-31))) * x + + float_type(BOOST_FLOAT128_C(3.27988923706982293204067897468714277771890104022419696770352E-30))) * x + + float_type(BOOST_FLOAT128_C(9.18368986379558482800593745627556950089950023355628325088207E-29))) * x + + float_type(BOOST_FLOAT128_C(2.47959626322479746949155352659617642905315302382639380521497E-27))) * x + + float_type(BOOST_FLOAT128_C(6.44695028438447337900255966737803112935639344283098705091949E-26))) * x + + float_type(BOOST_FLOAT128_C(1.61173757109611834904452725462599961406036904573072897122957E-24))) * x + + float_type(BOOST_FLOAT128_C(3.86817017063068403772269360016918092488847584660382953555804E-23))) * x + + float_type(BOOST_FLOAT128_C(8.89679139245057328674891109315654704307721758924206107351744E-22))) * x + + float_type(BOOST_FLOAT128_C(1.95729410633912612308475595397946731738088422488032228717097E-20))) * x + + float_type(BOOST_FLOAT128_C(4.11031762331216485847799061511674191805055663711439605760231E-19))) * x + + float_type(BOOST_FLOAT128_C(8.22063524662432971695598123977873600603370758794431071426640E-18))) * x + + float_type(BOOST_FLOAT128_C(1.56192069685862264622163643500633782667263448653185159383285E-16))) * x + + float_type(BOOST_FLOAT128_C(2.81145725434552076319894558300988749849555291507956994126835E-15))) * x + + float_type(BOOST_FLOAT128_C(4.77947733238738529743820749111754320727153728139716409114011E-14))) * x + + float_type(BOOST_FLOAT128_C(7.64716373181981647590113198578807092707697416852226691068627E-13))) * x + + float_type(BOOST_FLOAT128_C(1.14707455977297247138516979786821056670509688396295740818677E-11))) * x + + float_type(BOOST_FLOAT128_C(1.60590438368216145993923771701549479323291461578567184216302E-10))) * x + + float_type(BOOST_FLOAT128_C(2.08767569878680989792100903212014323125428376052986408239620E-09))) * x + + float_type(BOOST_FLOAT128_C(2.50521083854417187750521083854417187750523408006206780016659E-08))) * x + + float_type(BOOST_FLOAT128_C(2.75573192239858906525573192239858906525573195144226062684604E-07))) * x + + float_type(BOOST_FLOAT128_C(2.75573192239858906525573192239858906525573191310049321957902E-06))) * x + + float_type(BOOST_FLOAT128_C(0.00002480158730158730158730158730158730158730158730149317774))) * x + + float_type(BOOST_FLOAT128_C(0.00019841269841269841269841269841269841269841269841293575920))) * x + + float_type(BOOST_FLOAT128_C(0.00138888888888888888888888888888888888888888888888889071045))) * x + + float_type(BOOST_FLOAT128_C(0.00833333333333333333333333333333333333333333333333332986595))) * x + + float_type(BOOST_FLOAT128_C(0.04166666666666666666666666666666666666666666666666666664876))) * x + + float_type(BOOST_FLOAT128_C(0.16666666666666666666666666666666666666666666666666666669048))) * x + + float_type(BOOST_FLOAT128_C(0.50000000000000000000000000000000000000000000000000000000006))) * x + + float_type(BOOST_FLOAT128_C(0.99999999999999999999999999999999999999999999999999999999995))) * x); + } + + return sum; + } + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_EXP (boost::math::cstdfloat::detail::float_internal128_t x) + { + // Patch the expq() function for a subset of broken GCC compilers + // like GCC 4.7, 4.8 on MinGW. + + // Use an order-36 polynomial approximation of the exponential function + // in the range of (-ln2 < x < ln2). Scale the argument to this range + // and subsequently multiply the result by 2^n accordingly. + + // Derive the polynomial coefficients with Mathematica(R) by generating + // a table of high-precision values of exp(x) in the range (-ln2 < x < ln2) + // and subsequently applying the built-in *Fit* function. + + // Table[{x, Exp[x] - 1}, {x, -Log[2], Log[2], 1/180}] + // N[%, 120] + // Fit[%, {x, x^2, x^3, x^4, x^5, x^6, x^7, x^8, x^9, x^10, x^11, x^12, + // x^13, x^14, x^15, x^16, x^17, x^18, x^19, x^20, x^21, x^22, + // x^23, x^24, x^25, x^26, x^27, x^28, x^29, x^30, x^31, x^32, + // x^33, x^34, x^35, x^36}, x] + + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + + // Scale the argument x to the range (-ln2 < x < ln2). + BOOST_CONSTEXPR_OR_CONST float_type one_over_ln2 = float_type(BOOST_FLOAT128_C(1.44269504088896340735992468100189213742664595415299)); + const float_type x_over_ln2 = x * one_over_ln2; + + boost::int_fast32_t n; + + if(x != x) + { + // The argument is NaN. + return std::numeric_limits<float_type>::quiet_NaN(); + } + else if(::BOOST_CSTDFLOAT_FLOAT128_FABS(x) > BOOST_FLOAT128_C(+0.693147180559945309417232121458176568075500134360255)) + { + // The absolute value of the argument exceeds ln2. + n = static_cast<boost::int_fast32_t>(::BOOST_CSTDFLOAT_FLOAT128_FLOOR(x_over_ln2)); + } + else if(::BOOST_CSTDFLOAT_FLOAT128_FABS(x) < BOOST_FLOAT128_C(+0.693147180559945309417232121458176568075500134360255)) + { + // The absolute value of the argument is less than ln2. + n = static_cast<boost::int_fast32_t>(0); + } + else + { + // The absolute value of the argument is exactly equal to ln2 (in the sense of floating-point equality). + return float_type(2); + } + + // Check if the argument is very near an integer. + const float_type floor_of_x = ::BOOST_CSTDFLOAT_FLOAT128_FLOOR(x); + + if(::BOOST_CSTDFLOAT_FLOAT128_FABS(x - floor_of_x) < float_type(BOOST_CSTDFLOAT_FLOAT128_EPS)) + { + // Return e^n for arguments very near an integer. + return boost::math::cstdfloat::detail::pown(BOOST_FLOAT128_C(2.71828182845904523536028747135266249775724709369996), static_cast<boost::int_fast32_t>(floor_of_x)); + } + + // Compute the scaled argument alpha. + const float_type alpha = x - (n * BOOST_FLOAT128_C(0.693147180559945309417232121458176568075500134360255)); + + // Compute the polynomial approximation of expm1(alpha) and add to it + // in order to obtain the scaled result. + const float_type scaled_result = ::BOOST_CSTDFLOAT_FLOAT128_EXPM1(alpha) + float_type(1); + + // Rescale the result and return it. + return scaled_result * boost::math::cstdfloat::detail::pown(float_type(2), n); + } + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_SINH (boost::math::cstdfloat::detail::float_internal128_t x) + { + // Patch the sinhq() function for a subset of broken GCC compilers + // like GCC 4.7, 4.8 on MinGW. + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + + // Here, we use the following: + // Set: ex = exp(x) + // Set: em1 = expm1(x) + // Then + // sinh(x) = (ex - 1/ex) / 2 ; for |x| >= 1 + // sinh(x) = (2em1 + em1^2) / (2ex) ; for |x| < 1 + + const float_type ex = ::BOOST_CSTDFLOAT_FLOAT128_EXP(x); + + if(::BOOST_CSTDFLOAT_FLOAT128_FABS(x) < float_type(+1)) + { + const float_type em1 = ::BOOST_CSTDFLOAT_FLOAT128_EXPM1(x); + + return ((em1 * 2) + (em1 * em1)) / (ex * 2); + } + else + { + return (ex - (float_type(1) / ex)) / 2; + } + } + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_COSH (boost::math::cstdfloat::detail::float_internal128_t x) + { + // Patch the coshq() function for a subset of broken GCC compilers + // like GCC 4.7, 4.8 on MinGW. + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + const float_type ex = ::BOOST_CSTDFLOAT_FLOAT128_EXP(x); + return (ex + (float_type(1) / ex)) / 2; + } + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_TANH (boost::math::cstdfloat::detail::float_internal128_t x) + { + // Patch the tanhq() function for a subset of broken GCC compilers + // like GCC 4.7, 4.8 on MinGW. + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + const float_type ex_plus = ::BOOST_CSTDFLOAT_FLOAT128_EXP(x); + const float_type ex_minus = (float_type(1) / ex_plus); + return (ex_plus - ex_minus) / (ex_plus + ex_minus); + } + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ASINH(boost::math::cstdfloat::detail::float_internal128_t x) throw() + { + // Patch the asinh() function since quadmath does not have it. + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + return ::BOOST_CSTDFLOAT_FLOAT128_LOG(x + ::BOOST_CSTDFLOAT_FLOAT128_SQRT((x * x) + float_type(1))); + } + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ACOSH(boost::math::cstdfloat::detail::float_internal128_t x) throw() + { + // Patch the acosh() function since quadmath does not have it. + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + const float_type zp(x + float_type(1)); + const float_type zm(x - float_type(1)); + + return ::BOOST_CSTDFLOAT_FLOAT128_LOG(x + (zp * ::BOOST_CSTDFLOAT_FLOAT128_SQRT(zm / zp))); + } + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_ATANH(boost::math::cstdfloat::detail::float_internal128_t x) throw() + { + // Patch the atanh() function since quadmath does not have it. + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + return ( ::BOOST_CSTDFLOAT_FLOAT128_LOG(float_type(1) + x) + - ::BOOST_CSTDFLOAT_FLOAT128_LOG(float_type(1) - x)) / 2; + } + inline boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_TGAMMA(boost::math::cstdfloat::detail::float_internal128_t x) throw() + { + // Patch the tgammaq() function for a subset of broken GCC compilers + // like GCC 4.7, 4.8 on MinGW. + typedef boost::math::cstdfloat::detail::float_internal128_t float_type; + + if(x > float_type(0)) + { + return ::BOOST_CSTDFLOAT_FLOAT128_EXP(::BOOST_CSTDFLOAT_FLOAT128_LGAMMA(x)); + } + else if(x < float_type(0)) + { + // For x < 0, compute tgamma(-x) and use the reflection formula. + const float_type positive_x = -x; + float_type gamma_value = ::BOOST_CSTDFLOAT_FLOAT128_TGAMMA(positive_x); + const float_type floor_of_positive_x = ::BOOST_CSTDFLOAT_FLOAT128_FLOOR (positive_x); + + // Take the reflection checks (slightly adapted) from <boost/math/gamma.hpp>. + const bool floor_of_z_is_equal_to_z = (positive_x == ::BOOST_CSTDFLOAT_FLOAT128_FLOOR(positive_x)); + + BOOST_CONSTEXPR_OR_CONST float_type my_pi = BOOST_FLOAT128_C(3.14159265358979323846264338327950288419716939937511); + + if(floor_of_z_is_equal_to_z) + { + const bool is_odd = ((boost::int32_t(floor_of_positive_x) % boost::int32_t(2)) != boost::int32_t(0)); + + return (is_odd ? -std::numeric_limits<float_type>::infinity() + : +std::numeric_limits<float_type>::infinity()); + } + + const float_type sinpx_value = x * ::BOOST_CSTDFLOAT_FLOAT128_SIN(my_pi * x); + + gamma_value *= sinpx_value; + + const bool result_is_too_large_to_represent = ( (::BOOST_CSTDFLOAT_FLOAT128_FABS(gamma_value) < float_type(1)) + && (((std::numeric_limits<float_type>::max)() * ::BOOST_CSTDFLOAT_FLOAT128_FABS(gamma_value)) < my_pi)); + + if(result_is_too_large_to_represent) + { + const bool is_odd = ((boost::int32_t(floor_of_positive_x) % boost::int32_t(2)) != boost::int32_t(0)); + + return (is_odd ? -std::numeric_limits<float_type>::infinity() + : +std::numeric_limits<float_type>::infinity()); + } + + gamma_value = -my_pi / gamma_value; + + if((gamma_value > float_type(0)) || (gamma_value < float_type(0))) + { + return gamma_value; + } + else + { + // The value of gamma is too small to represent. Return 0.0 here. + return float_type(0); + } + } + else + { + // Gamma of zero is complex infinity. Return NaN here. + return std::numeric_limits<float_type>::quiet_NaN(); + } + } + #endif // BOOST_CSTDFLOAT_BROKEN_FLOAT128_MATH_FUNCTIONS + + // Define the quadruple-precision <cmath> functions in the namespace boost::math::cstdfloat::detail. + + namespace boost { namespace math { namespace cstdfloat { namespace detail { + inline boost::math::cstdfloat::detail::float_internal128_t ldexp (boost::math::cstdfloat::detail::float_internal128_t x, int n) { return ::BOOST_CSTDFLOAT_FLOAT128_LDEXP (x, n); } + inline boost::math::cstdfloat::detail::float_internal128_t frexp (boost::math::cstdfloat::detail::float_internal128_t x, int* pn) { return ::BOOST_CSTDFLOAT_FLOAT128_FREXP (x, pn); } + inline boost::math::cstdfloat::detail::float_internal128_t fabs (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_FABS (x); } + inline boost::math::cstdfloat::detail::float_internal128_t abs (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_FABS (x); } + inline boost::math::cstdfloat::detail::float_internal128_t floor (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_FLOOR (x); } + inline boost::math::cstdfloat::detail::float_internal128_t ceil (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_CEIL (x); } + inline boost::math::cstdfloat::detail::float_internal128_t sqrt (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_SQRT (x); } + inline boost::math::cstdfloat::detail::float_internal128_t trunc (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_TRUNC (x); } + inline boost::math::cstdfloat::detail::float_internal128_t exp (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_EXP (x); } + inline boost::math::cstdfloat::detail::float_internal128_t pow (boost::math::cstdfloat::detail::float_internal128_t x, boost::math::cstdfloat::detail::float_internal128_t a) { return ::BOOST_CSTDFLOAT_FLOAT128_POW (x, a); } + inline boost::math::cstdfloat::detail::float_internal128_t pow (boost::math::cstdfloat::detail::float_internal128_t x, int a) { return ::BOOST_CSTDFLOAT_FLOAT128_POW (x, boost::math::cstdfloat::detail::float_internal128_t(a)); } + inline boost::math::cstdfloat::detail::float_internal128_t log (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_LOG (x); } + inline boost::math::cstdfloat::detail::float_internal128_t log10 (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_LOG10 (x); } + inline boost::math::cstdfloat::detail::float_internal128_t sin (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_SIN (x); } + inline boost::math::cstdfloat::detail::float_internal128_t cos (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_COS (x); } + inline boost::math::cstdfloat::detail::float_internal128_t tan (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_TAN (x); } + inline boost::math::cstdfloat::detail::float_internal128_t asin (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_ASIN (x); } + inline boost::math::cstdfloat::detail::float_internal128_t acos (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_ACOS (x); } + inline boost::math::cstdfloat::detail::float_internal128_t atan (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_ATAN (x); } + inline boost::math::cstdfloat::detail::float_internal128_t sinh (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_SINH (x); } + inline boost::math::cstdfloat::detail::float_internal128_t cosh (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_COSH (x); } + inline boost::math::cstdfloat::detail::float_internal128_t tanh (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_TANH (x); } + inline boost::math::cstdfloat::detail::float_internal128_t asinh (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_ASINH (x); } + inline boost::math::cstdfloat::detail::float_internal128_t acosh (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_ACOSH (x); } + inline boost::math::cstdfloat::detail::float_internal128_t atanh (boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_ATANH (x); } + inline boost::math::cstdfloat::detail::float_internal128_t fmod (boost::math::cstdfloat::detail::float_internal128_t a, boost::math::cstdfloat::detail::float_internal128_t b) { return ::BOOST_CSTDFLOAT_FLOAT128_FMOD (a, b); } + inline boost::math::cstdfloat::detail::float_internal128_t atan2 (boost::math::cstdfloat::detail::float_internal128_t y, boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_ATAN2 (y, x); } + inline boost::math::cstdfloat::detail::float_internal128_t lgamma(boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_LGAMMA(x); } + inline boost::math::cstdfloat::detail::float_internal128_t tgamma(boost::math::cstdfloat::detail::float_internal128_t x) { return ::BOOST_CSTDFLOAT_FLOAT128_TGAMMA(x); } + } } } } // boost::math::cstdfloat::detail + + // We will now inject the quadruple-precision <cmath> functions + // into the std namespace. This is done via *using* directive. + namespace std + { + using boost::math::cstdfloat::detail::ldexp; + using boost::math::cstdfloat::detail::frexp; + using boost::math::cstdfloat::detail::fabs; + using boost::math::cstdfloat::detail::abs; + using boost::math::cstdfloat::detail::floor; + using boost::math::cstdfloat::detail::ceil; + using boost::math::cstdfloat::detail::sqrt; + using boost::math::cstdfloat::detail::trunc; + using boost::math::cstdfloat::detail::exp; + using boost::math::cstdfloat::detail::pow; + using boost::math::cstdfloat::detail::log; + using boost::math::cstdfloat::detail::log10; + using boost::math::cstdfloat::detail::sin; + using boost::math::cstdfloat::detail::cos; + using boost::math::cstdfloat::detail::tan; + using boost::math::cstdfloat::detail::asin; + using boost::math::cstdfloat::detail::acos; + using boost::math::cstdfloat::detail::atan; + using boost::math::cstdfloat::detail::sinh; + using boost::math::cstdfloat::detail::cosh; + using boost::math::cstdfloat::detail::tanh; + using boost::math::cstdfloat::detail::asinh; + using boost::math::cstdfloat::detail::acosh; + using boost::math::cstdfloat::detail::atanh; + using boost::math::cstdfloat::detail::fmod; + using boost::math::cstdfloat::detail::atan2; + using boost::math::cstdfloat::detail::lgamma; + using boost::math::cstdfloat::detail::tgamma; + } // namespace std + + // We will now remove the preprocessor symbols representing quadruple-precision <cmath> + // functions from the preprocessor. + + #undef BOOST_CSTDFLOAT_FLOAT128_LDEXP + #undef BOOST_CSTDFLOAT_FLOAT128_FREXP + #undef BOOST_CSTDFLOAT_FLOAT128_FABS + #undef BOOST_CSTDFLOAT_FLOAT128_FLOOR + #undef BOOST_CSTDFLOAT_FLOAT128_CEIL + #undef BOOST_CSTDFLOAT_FLOAT128_SQRT + #undef BOOST_CSTDFLOAT_FLOAT128_TRUNC + #undef BOOST_CSTDFLOAT_FLOAT128_EXP + #undef BOOST_CSTDFLOAT_FLOAT128_EXPM1 + #undef BOOST_CSTDFLOAT_FLOAT128_POW + #undef BOOST_CSTDFLOAT_FLOAT128_LOG + #undef BOOST_CSTDFLOAT_FLOAT128_LOG10 + #undef BOOST_CSTDFLOAT_FLOAT128_SIN + #undef BOOST_CSTDFLOAT_FLOAT128_COS + #undef BOOST_CSTDFLOAT_FLOAT128_TAN + #undef BOOST_CSTDFLOAT_FLOAT128_ASIN + #undef BOOST_CSTDFLOAT_FLOAT128_ACOS + #undef BOOST_CSTDFLOAT_FLOAT128_ATAN + #undef BOOST_CSTDFLOAT_FLOAT128_SINH + #undef BOOST_CSTDFLOAT_FLOAT128_COSH + #undef BOOST_CSTDFLOAT_FLOAT128_TANH + #undef BOOST_CSTDFLOAT_FLOAT128_ASINH + #undef BOOST_CSTDFLOAT_FLOAT128_ACOSH + #undef BOOST_CSTDFLOAT_FLOAT128_ATANH + #undef BOOST_CSTDFLOAT_FLOAT128_FMOD + #undef BOOST_CSTDFLOAT_FLOAT128_ATAN2 + #undef BOOST_CSTDFLOAT_FLOAT128_LGAMMA + #undef BOOST_CSTDFLOAT_FLOAT128_TGAMMA + + #endif // Not BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT (i.e., the user would like to have libquadmath support) + +#endif // _BOOST_CSTDFLOAT_CMATH_2014_02_15_HPP_ diff --git a/boost/math/cstdfloat/cstdfloat_complex.hpp b/boost/math/cstdfloat/cstdfloat_complex.hpp new file mode 100644 index 0000000000..b3f4314280 --- /dev/null +++ b/boost/math/cstdfloat/cstdfloat_complex.hpp @@ -0,0 +1,38 @@ +/////////////////////////////////////////////////////////////////////////////// +// Copyright Christopher Kormanyos 2014. +// Copyright John Maddock 2014. +// Copyright Paul Bristow 2014. +// Distributed under the Boost Software License, +// Version 1.0. (See accompanying file LICENSE_1_0.txt +// or copy at http://www.boost.org/LICENSE_1_0.txt) +// + +// Implement quadruple-precision (and extended) support for <complex>. + +#ifndef _BOOST_CSTDFLOAT_COMPLEX_2014_02_15_HPP_ + #define _BOOST_CSTDFLOAT_COMPLEX_2014_02_15_HPP_ + + #include <boost/math/cstdfloat/cstdfloat_types.hpp> + #include <boost/math/cstdfloat/cstdfloat_limits.hpp> + #include <boost/math/cstdfloat/cstdfloat_cmath.hpp> + #include <boost/math/cstdfloat/cstdfloat_iostream.hpp> + + #if defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_LIMITS) + #error You can not use <boost/math/cstdfloat/cstdfloat_complex.hpp> with BOOST_CSTDFLOAT_NO_LIBQUADMATH_LIMITS defined. + #endif + #if defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_CMATH) + #error You can not use <boost/math/cstdfloat/cstdfloat_complex.hpp> with BOOST_CSTDFLOAT_NO_LIBQUADMATH_CMATH defined. + #endif + #if defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_IOSTREAM) + #error You can not use <boost/math/cstdfloat/cstdfloat_complex.hpp> with BOOST_CSTDFLOAT_NO_LIBQUADMATH_IOSTREAM defined. + #endif + + #if defined(BOOST_CSTDFLOAT_HAS_INTERNAL_FLOAT128_T) && defined(BOOST_MATH_USE_FLOAT128) && !defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT) + + #define BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE boost::math::cstdfloat::detail::float_internal128_t + #include <boost/math/cstdfloat/cstdfloat_complex_std.hpp> + #undef BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE + + #endif // Not BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT (i.e., the user would like to have libquadmath support) + +#endif // _BOOST_CSTDFLOAT_COMPLEX_2014_02_15_HPP_ diff --git a/boost/math/cstdfloat/cstdfloat_complex_std.hpp b/boost/math/cstdfloat/cstdfloat_complex_std.hpp new file mode 100644 index 0000000000..f949a9aa46 --- /dev/null +++ b/boost/math/cstdfloat/cstdfloat_complex_std.hpp @@ -0,0 +1,641 @@ +/////////////////////////////////////////////////////////////////////////////// +// Copyright Christopher Kormanyos 2014. +// Copyright John Maddock 2014. +// Copyright Paul Bristow 2014. +// Distributed under the Boost Software License, +// Version 1.0. (See accompanying file LICENSE_1_0.txt +// or copy at http://www.boost.org/LICENSE_1_0.txt) +// + +// Implement a specialization of std::complex<> for *anything* that +// is defined as BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE. + +#ifndef _BOOST_CSTDFLOAT_COMPLEX_STD_2014_02_15_HPP_ + #define _BOOST_CSTDFLOAT_COMPLEX_STD_2014_02_15_HPP_ + + #if defined(__GNUC__) + #pragma GCC system_header + #endif + + #include <complex> + #include <boost/math/constants/constants.hpp> + + namespace std + { + // Forward declarations. + template<class float_type> + class complex; + + template<> + class complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>; + + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE real(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE imag(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE abs (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE arg (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE norm(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> conj (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> proj (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> polar(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE&, + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& = 0); + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> sqrt (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> sin (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> cos (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> tan (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> asin (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> acos (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> atan (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> exp (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> log (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> log10(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> pow (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&, + int); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> pow (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&, + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> pow (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&, + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> pow (const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE&, + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> sinh (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> cosh (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> tanh (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> asinh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> acosh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> atanh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + template<class char_type, class traits_type> + inline std::basic_ostream<char_type, traits_type>& operator<<(std::basic_ostream<char_type, traits_type>&, const std::complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + template<class char_type, class traits_type> + inline std::basic_istream<char_type, traits_type>& operator>>(std::basic_istream<char_type, traits_type>&, std::complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>&); + + // Template specialization of the complex class. + template<> + class complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> + { + public: + typedef BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE value_type; + + explicit complex(const complex<float>&); + explicit complex(const complex<double>&); + explicit complex(const complex<long double>&); + + #if defined(BOOST_NO_CXX11_CONSTEXPR) + complex(const value_type& r = value_type(), + const value_type& i = value_type()) : re(r), + im(i) { } + + template<typename X> + complex(const complex<X>& x) : re(x.real()), + im(x.imag()) { } + + const value_type& real() const { return re; } + const value_type& imag() const { return im; } + + value_type& real() { return re; } + value_type& imag() { return im; } + #else + BOOST_CONSTEXPR complex(const value_type& r = value_type(), + const value_type& i = value_type()) : re(r), + im(i) { } + + template<typename X> + BOOST_CONSTEXPR complex(const complex<X>& x) : re(x.real()), + im(x.imag()) { } + + value_type real() const { return re; } + value_type imag() const { return im; } + #endif + + void real(value_type r) { re = r; } + void imag(value_type i) { im = i; } + + complex<value_type>& operator=(const value_type& v) + { + re = v; + im = value_type(0); + return *this; + } + + complex<value_type>& operator+=(const value_type& v) + { + re += v; + return *this; + } + + complex<value_type>& operator-=(const value_type& v) + { + re -= v; + return *this; + } + + complex<value_type>& operator*=(const value_type& v) + { + re *= v; + im *= v; + return *this; + } + + complex<value_type>& operator/=(const value_type& v) + { + re /= v; + im /= v; + return *this; + } + + template<typename X> + complex<value_type>& operator=(const complex<X>& x) + { + re = x.real(); + im = x.imag(); + return *this; + } + + template<typename X> + complex<value_type>& operator+=(const complex<X>& x) + { + re += x.real(); + im += x.imag(); + return *this; + } + + template<typename X> + complex<value_type>& operator-=(const complex<X>& x) + { + re -= x.real(); + im -= x.imag(); + return *this; + } + + template<typename X> + complex<value_type>& operator*=(const complex<X>& x) + { + const value_type tmp_real = (re * x.real()) - (im * x.imag()); + im = (re * x.imag()) + (im * x.real()); + re = tmp_real; + return *this; + } + + template<typename X> + complex<value_type>& operator/=(const complex<X>& x) + { + const value_type tmp_real = (re * x.real()) + (im * x.imag()); + const value_type the_norm = std::norm(x); + im = ((im * x.real()) - (re * x.imag())) / the_norm; + re = tmp_real / the_norm; + return *this; + } + + private: + value_type re; + value_type im; + }; + + // Constructors from built-in complex representation of floating-point types. + complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::complex(const complex<float>& f) : re(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE( f.real())), im(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE( f.imag())) { } + complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::complex(const complex<double>& d) : re(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE( d.real())), im(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE( d.imag())) { } + complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::complex(const complex<long double>& ld) : re(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(ld.real())), im(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(ld.imag())) { } + } // namespace std + + namespace boost { namespace math { namespace cstdfloat { namespace detail { + template<class float_type> std::complex<float_type> multiply_by_i(const std::complex<float_type>& x) + { + // Multiply x (in C) by I (the imaginary component), and return the result. + return std::complex<float_type>(-x.imag(), x.real()); + } + } } } } // boost::math::cstdfloat::detail + + namespace std + { + // ISO/IEC 14882:2011, Section 26.4.7, specific values. + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE real(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) { return x.real(); } + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE imag(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) { return x.imag(); } + + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE abs (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) { using std::sqrt; return sqrt ((real(x) * real(x)) + (imag(x) * imag(x))); } + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE arg (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) { using std::atan2; return atan2(x.imag(), x.real()); } + inline BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE norm(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) { return (real(x) * real(x)) + (imag(x) * imag(x)); } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> conj (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(x.real(), -x.imag()); } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> proj (const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE m = (std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::max)(); + if ((x.real() > m) + || (x.real() < -m) + || (x.imag() > m) + || (x.imag() < -m)) + { + // We have an infinity, return a normalized infinity, respecting the sign of the imaginary part: + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::infinity(), x.imag() < 0 ? -0 : 0); + } + return x; + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> polar(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& rho, + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& theta) + { + using std::sin; + using std::cos; + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(rho * cos(theta), rho * sin(theta)); + } + + // Global add, sub, mul, div. + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator+(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u.real() + v.real(), u.imag() + v.imag()); } + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator-(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u.real() - v.real(), u.imag() - v.imag()); } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator*(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& v) + { + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>((u.real() * v.real()) - (u.imag() * v.imag()), + (u.real() * v.imag()) + (u.imag() * v.real())); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator/(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& v) + { + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE the_norm = std::norm(v); + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(((u.real() * v.real()) + (u.imag() * v.imag())) / the_norm, + ((u.imag() * v.real()) - (u.real() * v.imag())) / the_norm); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator+(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u, const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u.real() + v, u.imag()); } + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator-(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u, const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u.real() - v, u.imag()); } + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator*(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u, const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u.real() * v, u.imag() * v); } + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator/(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u, const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u.real() / v, u.imag() / v); } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator+(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& u, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u + v.real(), v.imag()); } + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator-(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& u, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u - v.real(), -v.imag()); } + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator*(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& u, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& v) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(u * v.real(), u * v.imag()); } + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator/(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& u, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& v) { const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE v_norm = norm(v); return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>((u * v.real()) / v_norm, (-u * v.imag()) / v_norm); } + + // Unary plus / minus. + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator+(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u) { return u; } + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> operator-(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& u) { return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(-u.real(), -u.imag()); } + + // Equality and inequality. + inline bool operator==(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& y) { return ((x.real() == y.real()) && (x.imag() == y.imag())); } + inline bool operator==(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x, const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& y) { return ((x.real() == y) && (x.imag() == BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(0))); } + inline bool operator==(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& x, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& y) { return ((x == y.real()) && (y.imag() == BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(0))); } + inline bool operator!=(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& y) { return ((x.real() != y.real()) || (x.imag() != y.imag())); } + inline bool operator!=(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x, const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& y) { return ((x.real() != y) || (x.imag() != BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(0))); } + inline bool operator!=(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& x, const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& y) { return ((x != y.real()) || (y.imag() != BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(0))); } + + // ISO/IEC 14882:2011, Section 26.4.8, transcendentals. + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> sqrt(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + using std::fabs; + using std::sqrt; + + // Compute sqrt(x) for x in C: + // sqrt(x) = (s , xi / 2s) : for xr > 0, + // (|xi| / 2s, +-s) : for xr < 0, + // (sqrt(xi), sqrt(xi) : for xr = 0, + // where s = sqrt{ [ |xr| + sqrt(xr^2 + xi^2) ] / 2 }, + // and the +- sign is the same as the sign of xi. + + if(x.real() > 0) + { + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE s = sqrt((fabs(x.real()) + std::abs(x)) / 2); + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(s, x.imag() / (s * 2)); + } + else if(x.real() < 0) + { + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE s = sqrt((fabs(x.real()) + std::abs(x)) / 2); + + const bool imag_is_neg = (x.imag() < 0); + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(fabs(x.imag()) / (s * 2), (imag_is_neg ? -s : s)); + } + else + { + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sqrt_xi_half = sqrt(x.imag() / 2); + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(sqrt_xi_half, sqrt_xi_half); + } + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> sin(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + using std::sin; + using std::cos; + using std::exp; + + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sin_x = sin (x.real()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cos_x = cos (x.real()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_yp = exp (x.imag()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_ym = BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) / exp_yp; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sinh_y = (exp_yp - exp_ym) / 2; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cosh_y = (exp_yp + exp_ym) / 2; + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(sin_x * cosh_y, cos_x * sinh_y); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> cos(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + using std::sin; + using std::cos; + using std::exp; + + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sin_x = sin (x.real()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cos_x = cos (x.real()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_yp = exp (x.imag()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_ym = BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) / exp_yp; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sinh_y = (exp_yp - exp_ym) / 2; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cosh_y = (exp_yp + exp_ym) / 2; + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(cos_x * cosh_y, -(sin_x * sinh_y)); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> tan(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + using std::sin; + using std::cos; + using std::exp; + + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sin_x = sin (x.real()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cos_x = cos (x.real()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_yp = exp (x.imag()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_ym = BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) / exp_yp; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sinh_y = (exp_yp - exp_ym) / 2; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cosh_y = (exp_yp + exp_ym) / 2; + + return ( complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(sin_x * cosh_y, cos_x * sinh_y) + / complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(cos_x * cosh_y, -sin_x * sinh_y)); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> asin(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + return -boost::math::cstdfloat::detail::multiply_by_i(std::log(boost::math::cstdfloat::detail::multiply_by_i(x) + std::sqrt(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) - (x * x)))); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> acos(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + return boost::math::constants::half_pi<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>() - std::asin(x); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> atan(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> izz = boost::math::cstdfloat::detail::multiply_by_i(x); + + return boost::math::cstdfloat::detail::multiply_by_i(std::log(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) - izz) - std::log(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) + izz)) / 2; + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> exp(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + using std::exp; + + return std::polar(exp(x.real()), x.imag()); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> log(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + using std::atan2; + using std::log; + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(log(std::norm(x)) / 2, atan2(x.imag(), x.real())); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> log10(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + return std::log(x) / boost::math::constants::ln_ten<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> pow(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x, + int p) + { + const bool re_isneg = (x.real() < 0); + const bool re_isnan = (x.real() != x.real()); + const bool re_isinf = ((!re_isneg) ? bool(+x.real() > (std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::max)()) + : bool(-x.real() > (std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::max)())); + + const bool im_isneg = (x.imag() < 0); + const bool im_isnan = (x.imag() != x.imag()); + const bool im_isinf = ((!im_isneg) ? bool(+x.imag() > (std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::max)()) + : bool(-x.imag() > (std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::max)())); + + if(re_isnan || im_isnan) { return x; } + + if(re_isinf || im_isinf) + { + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::quiet_NaN(), + std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::quiet_NaN()); + } + + if(p < 0) + { + if(std::abs(x) < (std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::min)()) + { + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::infinity(), + std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::infinity()); + } + else + { + return BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) / std::pow(x, -p); + } + } + + if(p == 0) + { + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1)); + } + else + { + if(p == 1) { return x; } + + if(std::abs(x) > (std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::max)()) + { + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE re = (re_isneg ? -std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::infinity() + : +std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::infinity()); + + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE im = (im_isneg ? -std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::infinity() + : +std::numeric_limits<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>::infinity()); + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(re, im); + } + + if (p == 2) { return (x * x); } + else if(p == 3) { return ((x * x) * x); } + else if(p == 4) { const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> x2 = (x * x); return (x2 * x2); } + else + { + // The variable xn stores the binary powers of x. + complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> result(((p % 2) != 0) ? x : complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1))); + complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> xn (x); + + int p2 = p; + + while((p2 /= 2) != 0) + { + // Square xn for each binary power. + xn *= xn; + + const bool has_binary_power = ((p2 % 2) != 0); + + if(has_binary_power) + { + // Multiply the result with each binary power contained in the exponent. + result *= xn; + } + } + + return result; + } + } + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> pow(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x, + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& a) + { + return std::exp(a * std::log(x)); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> pow(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x, + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& a) + { + return std::exp(a * std::log(x)); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> pow(const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE& x, + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& a) + { + return std::exp(a * std::log(x)); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> sinh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + using std::sin; + using std::cos; + using std::exp; + + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sin_y = sin (x.imag()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cos_y = cos (x.imag()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_xp = exp (x.real()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_xm = BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) / exp_xp; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sinh_x = (exp_xp - exp_xm) / 2; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cosh_x = (exp_xp + exp_xm) / 2; + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(cos_y * sinh_x, cosh_x * sin_y); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> cosh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + using std::sin; + using std::cos; + using std::exp; + + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sin_y = sin (x.imag()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cos_y = cos (x.imag()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_xp = exp (x.real()); + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE exp_xm = BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) / exp_xp; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE sinh_x = (exp_xp - exp_xm) / 2; + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE cosh_x = (exp_xp + exp_xm) / 2; + + return complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(cos_y * cosh_x, sin_y * sinh_x); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> tanh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> ex_plus = std::exp(x); + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> ex_minus = BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) / ex_plus; + + return (ex_plus - ex_minus) / (ex_plus + ex_minus); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> asinh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + return std::log(x + std::sqrt((x * x) + BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1))); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> acosh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + const BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE my_one(1); + + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> zp(x.real() + my_one, x.imag()); + const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> zm(x.real() - my_one, x.imag()); + + return std::log(x + (zp * std::sqrt(zm / zp))); + } + + inline complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE> atanh(const complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + return (std::log(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) + x) - std::log(BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE(1) - x)) / 2.0; + } + + template<class char_type, class traits_type> + inline std::basic_ostream<char_type, traits_type>& operator<<(std::basic_ostream<char_type, traits_type>& os, const std::complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + std::basic_ostringstream<char_type, traits_type> ostr; + + ostr.flags(os.flags()); + ostr.imbue(os.getloc()); + ostr.precision(os.precision()); + + ostr << char_type('(') + << x.real() + << char_type(',') + << x.imag() + << char_type(')'); + + return (os << ostr.str()); + } + + template<class char_type, class traits_type> + inline std::basic_istream<char_type, traits_type>& operator>>(std::basic_istream<char_type, traits_type>& is, std::complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>& x) + { + BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE rx; + BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE ix; + + char_type the_char; + + static_cast<void>(is >> the_char); + + if(the_char == static_cast<char_type>('(')) + { + static_cast<void>(is >> rx >> the_char); + + if(the_char == static_cast<char_type>(',')) + { + static_cast<void>(is >> ix >> the_char); + + if(the_char == static_cast<char_type>(')')) + { + x = complex<BOOST_CSTDFLOAT_EXTENDED_COMPLEX_FLOAT_TYPE>(rx, ix); + } + else + { + is.setstate(ios_base::failbit); + } + } + else if(the_char == static_cast<char_type>(')')) + { + x = rx; + } + else + { + is.setstate(ios_base::failbit); + } + } + else + { + static_cast<void>(is.putback(the_char)); + + static_cast<void>(is >> rx); + + x = rx; + } + + return is; + } + } // namespace std + +#endif // _BOOST_CSTDFLOAT_COMPLEX_STD_2014_02_15_HPP_ diff --git a/boost/math/cstdfloat/cstdfloat_iostream.hpp b/boost/math/cstdfloat/cstdfloat_iostream.hpp new file mode 100644 index 0000000000..ac94fd35f9 --- /dev/null +++ b/boost/math/cstdfloat/cstdfloat_iostream.hpp @@ -0,0 +1,771 @@ +/////////////////////////////////////////////////////////////////////////////// +// Copyright Christopher Kormanyos 2014. +// Copyright John Maddock 2014. +// Copyright Paul Bristow 2014. +// Distributed under the Boost Software License, +// Version 1.0. (See accompanying file LICENSE_1_0.txt +// or copy at http://www.boost.org/LICENSE_1_0.txt) +// + +// Implement quadruple-precision I/O stream operations. + +#ifndef _BOOST_CSTDFLOAT_IOSTREAM_2014_02_15_HPP_ + #define _BOOST_CSTDFLOAT_IOSTREAM_2014_02_15_HPP_ + + #include <boost/math/cstdfloat/cstdfloat_types.hpp> + #include <boost/math/cstdfloat/cstdfloat_limits.hpp> + #include <boost/math/cstdfloat/cstdfloat_cmath.hpp> + + #if defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_CMATH) + #error You can not use <boost/math/cstdfloat/cstdfloat_iostream.hpp> with BOOST_CSTDFLOAT_NO_LIBQUADMATH_CMATH defined. + #endif + + #if defined(BOOST_CSTDFLOAT_HAS_INTERNAL_FLOAT128_T) && defined(BOOST_MATH_USE_FLOAT128) && !defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT) + + #include <cstddef> + #include <istream> + #include <ostream> + #include <sstream> + #include <stdexcept> + #include <string> + #include <boost/static_assert.hpp> + #include <boost/throw_exception.hpp> + +// #if (0) + #if defined(__GNUC__) + + // Forward declarations of quadruple-precision string functions. + extern "C" int quadmath_snprintf(char *str, size_t size, const char *format, ...) throw(); + extern "C" boost::math::cstdfloat::detail::float_internal128_t strtoflt128(const char*, char **) throw(); + + namespace std + { + template<typename char_type, class traits_type> + inline std::basic_ostream<char_type, traits_type>& operator<<(std::basic_ostream<char_type, traits_type>& os, const boost::math::cstdfloat::detail::float_internal128_t& x) + { + std::basic_ostringstream<char_type, traits_type> ostr; + ostr.flags(os.flags()); + ostr.imbue(os.getloc()); + ostr.precision(os.precision()); + + char my_buffer[64U]; + + const int my_prec = static_cast<int>(os.precision()); + const int my_digits = ((my_prec == 0) ? 36 : my_prec); + + const std::ios_base::fmtflags my_flags = os.flags(); + + char my_format_string[8U]; + + std::size_t my_format_string_index = 0U; + + my_format_string[my_format_string_index] = '%'; + ++my_format_string_index; + + if(my_flags & std::ios_base::showpos) { my_format_string[my_format_string_index] = '+'; ++my_format_string_index; } + if(my_flags & std::ios_base::showpoint) { my_format_string[my_format_string_index] = '#'; ++my_format_string_index; } + + my_format_string[my_format_string_index + 0U] = '.'; + my_format_string[my_format_string_index + 1U] = '*'; + my_format_string[my_format_string_index + 2U] = 'Q'; + + my_format_string_index += 3U; + + char the_notation_char; + + if (my_flags & std::ios_base::scientific) { the_notation_char = 'e'; } + else if(my_flags & std::ios_base::fixed) { the_notation_char = 'f'; } + else { the_notation_char = 'g'; } + + my_format_string[my_format_string_index + 0U] = the_notation_char; + my_format_string[my_format_string_index + 1U] = 0; + + const int v = ::quadmath_snprintf(my_buffer, + static_cast<int>(sizeof(my_buffer)), + my_format_string, + my_digits, + x); + + if(v < 0) { BOOST_THROW_EXCEPTION(std::runtime_error("Formatting of boost::float128_t failed internally in quadmath_snprintf().")); } + + if(v >= static_cast<int>(sizeof(my_buffer) - 1U)) + { + // Evidently there is a really long floating-point string here, + // such as a small decimal representation in non-scientific notation. + // So we have to use dynamic memory allocation for the output + // string buffer. + + char* my_buffer2 = static_cast<char*>(0U); + + try + { + my_buffer2 = new char[v + 3]; + } + catch(const std::bad_alloc&) + { + BOOST_THROW_EXCEPTION(std::runtime_error("Formatting of boost::float128_t failed while allocating memory.")); + } + + const int v2 = ::quadmath_snprintf(my_buffer2, + v + 3, + my_format_string, + my_digits, + x); + + if(v2 >= v + 3) + { + BOOST_THROW_EXCEPTION(std::runtime_error("Formatting of boost::float128_t failed.")); + } + + static_cast<void>(ostr << my_buffer2); + + delete [] my_buffer2; + } + else + { + static_cast<void>(ostr << my_buffer); + } + + return (os << ostr.str()); + } + + template<typename char_type, class traits_type> + inline std::basic_istream<char_type, traits_type>& operator>>(std::basic_istream<char_type, traits_type>& is, boost::math::cstdfloat::detail::float_internal128_t& x) + { + std::string str; + + static_cast<void>(is >> str); + + char* p_end; + + x = strtoflt128(str.c_str(), &p_end); + + if(static_cast<std::ptrdiff_t>(p_end - str.c_str()) != static_cast<std::ptrdiff_t>(str.length())) + { + for(std::string::const_reverse_iterator it = str.rbegin(); it != str.rend(); ++it) + { + static_cast<void>(is.putback(*it)); + } + + is.setstate(ios_base::failbit); + + BOOST_THROW_EXCEPTION(std::runtime_error("Unable to interpret input string as a boost::float128_t")); + } + + return is; + } + } + +// #elif defined(__GNUC__) + #elif defined(BOOST_INTEL) + + // The section for I/O stream support for the ICC compiler is particularly + // long, because these functions must be painstakingly synthesized from + // manually-written routines (ICC does not support I/O stream operations + // for its _Quad type). + + // The following string-extraction routines are based on the methodology + // used in Boost.Multiprecision by John Maddock and Christopher Kormanyos. + // This methodology has been slightly modified here for boost::float128_t. + + #include <cstring> + #include <cctype> + #include <boost/lexical_cast.hpp> + + namespace boost { namespace math { namespace cstdfloat { namespace detail { + + template<class string_type> + void format_float_string(string_type& str, + int my_exp, + int digits, + const std::ios_base::fmtflags f, + const bool iszero) + { + typedef typename string_type::size_type size_type; + + const bool scientific = ((f & std::ios_base::scientific) == std::ios_base::scientific); + const bool fixed = ((f & std::ios_base::fixed) == std::ios_base::fixed); + const bool showpoint = ((f & std::ios_base::showpoint) == std::ios_base::showpoint); + const bool showpos = ((f & std::ios_base::showpos) == std::ios_base::showpos); + + const bool b_neg = ((str.size() != 0U) && (str[0] == '-')); + + if(b_neg) + { + str.erase(0, 1); + } + + if(digits == 0) + { + digits = static_cast<int>((std::max)(str.size(), size_type(16))); + } + + if(iszero || str.empty() || (str.find_first_not_of('0') == string_type::npos)) + { + // We will be printing zero, even though the value might not + // actually be zero (it just may have been rounded to zero). + str = "0"; + + if(scientific || fixed) + { + str.append(1, '.'); + str.append(size_type(digits), '0'); + + if(scientific) + { + str.append("e+00"); + } + } + else + { + if(showpoint) + { + str.append(1, '.'); + if(digits > 1) + { + str.append(size_type(digits - 1), '0'); + } + } + } + + if(b_neg) + { + str.insert(0U, 1U, '-'); + } + else if(showpos) + { + str.insert(0U, 1U, '+'); + } + + return; + } + + if(!fixed && !scientific && !showpoint) + { + // Suppress trailing zeros. + typename string_type::iterator pos = str.end(); + + while(pos != str.begin() && *--pos == '0') { ; } + + if(pos != str.end()) + { + ++pos; + } + + str.erase(pos, str.end()); + + if(str.empty()) + { + str = '0'; + } + } + else if(!fixed || (my_exp >= 0)) + { + // Pad out the end with zero's if we need to. + + int chars = static_cast<int>(str.size()); + chars = digits - chars; + + if(scientific) + { + ++chars; + } + + if(chars > 0) + { + str.append(static_cast<size_type>(chars), '0'); + } + } + + if(fixed || (!scientific && (my_exp >= -4) && (my_exp < digits))) + { + if((1 + my_exp) > static_cast<int>(str.size())) + { + // Just pad out the end with zeros. + str.append(static_cast<size_type>((1 + my_exp) - static_cast<int>(str.size())), '0'); + + if(showpoint || fixed) + { + str.append("."); + } + } + else if(my_exp + 1 < static_cast<int>(str.size())) + { + if(my_exp < 0) + { + str.insert(0U, static_cast<size_type>(-1 - my_exp), '0'); + str.insert(0U, "0."); + } + else + { + // Insert the decimal point: + str.insert(static_cast<size_type>(my_exp + 1), 1, '.'); + } + } + else if(showpoint || fixed) // we have exactly the digits we require to left of the point + { + str += "."; + } + + if(fixed) + { + // We may need to add trailing zeros. + int l = static_cast<int>(str.find('.') + 1U); + l = digits - (static_cast<int>(str.size()) - l); + + if(l > 0) + { + str.append(size_type(l), '0'); + } + } + } + else + { + // Scientific format: + if(showpoint || (str.size() > 1)) + { + str.insert(1U, 1U, '.'); + } + + str.append(1U, 'e'); + string_type e = boost::lexical_cast<string_type>(std::abs(my_exp)); + + if(e.size() < 2U) + { + e.insert(0U, 2U - e.size(), '0'); + } + + if(my_exp < 0) + { + e.insert(0U, 1U, '-'); + } + else + { + e.insert(0U, 1U, '+'); + } + + str.append(e); + } + + if(b_neg) + { + str.insert(0U, 1U, '-'); + } + else if(showpos) + { + str.insert(0U, 1U, '+'); + } + } + + template<class float_type, class type_a> inline void eval_convert_to(type_a* pa, const float_type& cb) { *pa = static_cast<type_a>(cb); } + template<class float_type, class type_a> inline void eval_add (float_type& b, const type_a& a) { b += a; } + template<class float_type, class type_a> inline void eval_subtract (float_type& b, const type_a& a) { b -= a; } + template<class float_type, class type_a> inline void eval_multiply (float_type& b, const type_a& a) { b *= a; } + template<class float_type> inline void eval_multiply (float_type& b, const float_type& cb, const float_type& cb2) { b = (cb * cb2); } + template<class float_type, class type_a> inline void eval_divide (float_type& b, const type_a& a) { b /= a; } + template<class float_type> inline void eval_log10 (float_type& b, const float_type& cb) { b = std::log10(cb); } + template<class float_type> inline void eval_floor (float_type& b, const float_type& cb) { b = std::floor(cb); } + + inline void round_string_up_at(std::string& s, int pos, int& expon) + { + // This subroutine rounds up a string representation of a + // number at the given position pos. + + if(pos < 0) + { + s.insert(0U, 1U, '1'); + s.erase(s.size() - 1U); + ++expon; + } + else if(s[pos] == '9') + { + s[pos] = '0'; + round_string_up_at(s, pos - 1, expon); + } + else + { + if((pos == 0) && (s[pos] == '0') && (s.size() == 1)) + { + ++expon; + } + + ++s[pos]; + } + } + + template<class float_type> + std::string convert_to_string(float_type& x, + std::streamsize digits, + const std::ios_base::fmtflags f) + { + const bool isneg = (x < 0); + const bool iszero = ((!isneg) ? bool(+x < (std::numeric_limits<float_type>::min)()) + : bool(-x < (std::numeric_limits<float_type>::min)())); + const bool isnan = (x != x); + const bool isinf = ((!isneg) ? bool(+x > (std::numeric_limits<float_type>::max)()) + : bool(-x > (std::numeric_limits<float_type>::max)())); + + int expon = 0; + + if(digits <= 0) { digits = std::numeric_limits<float_type>::max_digits10; } + + const int org_digits = static_cast<int>(digits); + + std::string result; + + if(iszero) + { + result = "0"; + } + else if(isinf) + { + if(x < 0) + { + return "-inf"; + } + else + { + return ((f & std::ios_base::showpos) == std::ios_base::showpos) ? "+inf" : "inf"; + } + } + else if(isnan) + { + return "nan"; + } + else + { + // Start by figuring out the base-10 exponent. + if(isneg) { x = -x; } + + float_type t; + float_type ten = 10; + + eval_log10(t, x); + eval_floor(t, t); + eval_convert_to(&expon, t); + + if(-expon > std::numeric_limits<float_type>::max_exponent10 - 3) + { + int e = -expon / 2; + + const float_type t2 = boost::math::cstdfloat::detail::pown(ten, e); + + eval_multiply(t, t2, x); + eval_multiply(t, t2); + + if((expon & 1) != 0) + { + eval_multiply(t, ten); + } + } + else + { + t = boost::math::cstdfloat::detail::pown(ten, -expon); + eval_multiply(t, x); + } + + // Make sure that the value lies between [1, 10), and adjust if not. + if(t < 1) + { + eval_multiply(t, 10); + + --expon; + } + else if(t >= 10) + { + eval_divide(t, 10); + + ++expon; + } + + float_type digit; + int cdigit; + + // Adjust the number of digits required based on formatting options. + if(((f & std::ios_base::fixed) == std::ios_base::fixed) && (expon != -1)) + { + digits += (expon + 1); + } + + if((f & std::ios_base::scientific) == std::ios_base::scientific) + { + ++digits; + } + + // Extract the base-10 digits one at a time. + for(int i = 0; i < digits; ++i) + { + eval_floor(digit, t); + eval_convert_to(&cdigit, digit); + + result += static_cast<char>('0' + cdigit); + + eval_subtract(t, digit); + eval_multiply(t, ten); + } + + // Possibly round the result. + if(digits >= 0) + { + eval_floor(digit, t); + eval_convert_to(&cdigit, digit); + eval_subtract(t, digit); + + if((cdigit == 5) && (t == 0)) + { + // Use simple bankers rounding. + + if((static_cast<int>(*result.rbegin() - '0') & 1) != 0) + { + round_string_up_at(result, static_cast<int>(result.size() - 1U), expon); + } + } + else if(cdigit >= 5) + { + round_string_up_at(result, static_cast<int>(result.size() - 1), expon); + } + } + } + + while((result.size() > static_cast<std::string::size_type>(digits)) && result.size()) + { + // We may get here as a result of rounding. + + if(result.size() > 1U) + { + result.erase(result.size() - 1U); + } + else + { + if(expon > 0) + { + --expon; // so we put less padding in the result. + } + else + { + ++expon; + } + + ++digits; + } + } + + if(isneg) + { + result.insert(0U, 1U, '-'); + } + + format_float_string(result, expon, org_digits, f, iszero); + + return result; + } + + template <class float_type> + bool convert_from_string(float_type& value, const char* p) + { + value = 0; + + if((p == static_cast<const char*>(0U)) || (*p == static_cast<char>(0))) + { + return; + } + + bool is_neg = false; + bool is_neg_expon = false; + + BOOST_CONSTEXPR_OR_CONST int ten = 10; + + int expon = 0; + int digits_seen = 0; + + BOOST_CONSTEXPR_OR_CONST int max_digits = std::numeric_limits<float_type>::max_digits10 + 1; + + if(*p == static_cast<char>('+')) + { + ++p; + } + else if(*p == static_cast<char>('-')) + { + is_neg = true; + ++p; + } + + const bool isnan = ((std::strcmp(p, "nan") == 0) || (std::strcmp(p, "NaN") == 0) || (std::strcmp(p, "NAN") == 0)); + + if(isnan) + { + eval_divide(value, 0); + + if(is_neg) + { + value = -value; + } + + return true; + } + + const bool isinf = ((std::strcmp(p, "inf") == 0) || (std::strcmp(p, "Inf") == 0) || (std::strcmp(p, "INF") == 0)); + + if(isinf) + { + value = 1; + eval_divide(value, 0); + + if(is_neg) + { + value = -value; + } + + return true; + } + + // Grab all the leading digits before the decimal point. + while(std::isdigit(*p)) + { + eval_multiply(value, ten); + eval_add(value, static_cast<int>(*p - '0')); + ++p; + ++digits_seen; + } + + if(*p == static_cast<char>('.')) + { + // Grab everything after the point, stop when we've seen + // enough digits, even if there are actually more available. + + ++p; + + while(std::isdigit(*p)) + { + eval_multiply(value, ten); + eval_add(value, static_cast<int>(*p - '0')); + ++p; + --expon; + + if(++digits_seen > max_digits) + { + break; + } + } + + while(std::isdigit(*p)) + { + ++p; + } + } + + // Parse the exponent. + if((*p == static_cast<char>('e')) || (*p == static_cast<char>('E'))) + { + ++p; + + if(*p == static_cast<char>('+')) + { + ++p; + } + else if(*p == static_cast<char>('-')) + { + is_neg_expon = true; + ++p; + } + + int e2 = 0; + + while(std::isdigit(*p)) + { + e2 *= 10; + e2 += (*p - '0'); + ++p; + } + + if(is_neg_expon) + { + e2 = -e2; + } + + expon += e2; + } + + if(expon) + { + // Scale by 10^expon. Note that 10^expon can be outside the range + // of our number type, even though the result is within range. + // If that looks likely, then split the calculation in two parts. + float_type t; + t = ten; + + if(expon > (std::numeric_limits<float_type>::min_exponent10 + 2)) + { + t = boost::math::cstdfloat::detail::pown(t, expon); + eval_multiply(value, t); + } + else + { + t = boost::math::cstdfloat::detail::pown(t, (expon + digits_seen + 1)); + eval_multiply(value, t); + t = ten; + t = boost::math::cstdfloat::detail::pown(t, (-digits_seen - 1)); + eval_multiply(value, t); + } + } + + if(is_neg) + { + value = -value; + } + + return (*p == static_cast<char>(0)); + } + } } } } // boost::math::cstdfloat::detail + + namespace std + { + template<typename char_type, class traits_type> + inline std::basic_ostream<char_type, traits_type>& operator<<(std::basic_ostream<char_type, traits_type>& os, const boost::math::cstdfloat::detail::float_internal128_t& x) + { + boost::math::cstdfloat::detail::float_internal128_t non_const_x = x; + + const std::string str = boost::math::cstdfloat::detail::convert_to_string(non_const_x, + os.precision(), + os.flags()); + + std::basic_ostringstream<char_type, traits_type> ostr; + ostr.flags(os.flags()); + ostr.imbue(os.getloc()); + ostr.precision(os.precision()); + + static_cast<void>(ostr << str); + + return (os << ostr.str()); + } + + template<typename char_type, class traits_type> + inline std::basic_istream<char_type, traits_type>& operator>>(std::basic_istream<char_type, traits_type>& is, boost::math::cstdfloat::detail::float_internal128_t& x) + { + std::string str; + + static_cast<void>(is >> str); + + const bool conversion_is_ok = boost::math::cstdfloat::detail::convert_from_string(x, str.c_str()); + + if(false == conversion_is_ok) + { + for(std::string::const_reverse_iterator it = str.rbegin(); it != str.rend(); ++it) + { + static_cast<void>(is.putback(*it)); + } + + is.setstate(ios_base::failbit); + + BOOST_THROW_EXCEPTION(std::runtime_error("Unable to interpret input string as a boost::float128_t")); + } + + return is; + } + } + + #endif // Use __GNUC__ or BOOST_INTEL libquadmath + + #endif // Not BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT (i.e., the user would like to have libquadmath support) + +#endif // _BOOST_CSTDFLOAT_IOSTREAM_2014_02_15_HPP_ diff --git a/boost/math/cstdfloat/cstdfloat_limits.hpp b/boost/math/cstdfloat/cstdfloat_limits.hpp new file mode 100644 index 0000000000..c04062639a --- /dev/null +++ b/boost/math/cstdfloat/cstdfloat_limits.hpp @@ -0,0 +1,75 @@ +/////////////////////////////////////////////////////////////////////////////// +// Copyright Christopher Kormanyos 2014. +// Copyright John Maddock 2014. +// Copyright Paul Bristow 2014. +// Distributed under the Boost Software License, +// Version 1.0. (See accompanying file LICENSE_1_0.txt +// or copy at http://www.boost.org/LICENSE_1_0.txt) +// + +// Implement quadruple-precision std::numeric_limits<> support. + +#ifndef _BOOST_CSTDFLOAT_LIMITS_2014_01_09_HPP_ + #define _BOOST_CSTDFLOAT_LIMITS_2014_01_09_HPP_ + + #include <boost/math/cstdfloat/cstdfloat_types.hpp> + + #if defined(BOOST_CSTDFLOAT_HAS_INTERNAL_FLOAT128_T) && defined(BOOST_MATH_USE_FLOAT128) && !defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT) + + #include <limits> + + // Define the name of the global quadruple-precision function to be used for + // calculating quiet_NaN() in the specialization of std::numeric_limits<>. + #if defined(BOOST_INTEL) + #define BOOST_CSTDFLOAT_FLOAT128_SQRT __sqrtq + #elif defined(__GNUC__) + #define BOOST_CSTDFLOAT_FLOAT128_SQRT sqrtq + #endif + + // Forward declaration of the quadruple-precision square root function. + extern "C" boost::math::cstdfloat::detail::float_internal128_t BOOST_CSTDFLOAT_FLOAT128_SQRT(boost::math::cstdfloat::detail::float_internal128_t) throw(); + + namespace std + { + template<> + class numeric_limits<boost::math::cstdfloat::detail::float_internal128_t> + { + public: + BOOST_STATIC_CONSTEXPR bool is_specialized = true; + static boost::math::cstdfloat::detail::float_internal128_t (min) () BOOST_NOEXCEPT { return BOOST_CSTDFLOAT_FLOAT128_MIN; } + static boost::math::cstdfloat::detail::float_internal128_t (max) () BOOST_NOEXCEPT { return BOOST_CSTDFLOAT_FLOAT128_MAX; } + static boost::math::cstdfloat::detail::float_internal128_t lowest() BOOST_NOEXCEPT { return -(max)(); } + BOOST_STATIC_CONSTEXPR int digits = 113; + BOOST_STATIC_CONSTEXPR int digits10 = 34; + BOOST_STATIC_CONSTEXPR int max_digits10 = 36; + BOOST_STATIC_CONSTEXPR bool is_signed = true; + BOOST_STATIC_CONSTEXPR bool is_integer = false; + BOOST_STATIC_CONSTEXPR bool is_exact = false; + BOOST_STATIC_CONSTEXPR int radix = 2; + static boost::math::cstdfloat::detail::float_internal128_t epsilon () { return BOOST_CSTDFLOAT_FLOAT128_EPS; } + static boost::math::cstdfloat::detail::float_internal128_t round_error() { return BOOST_FLOAT128_C(0.5); } + BOOST_STATIC_CONSTEXPR int min_exponent = -16381; + BOOST_STATIC_CONSTEXPR int min_exponent10 = static_cast<int>((min_exponent * 301L) / 1000L); + BOOST_STATIC_CONSTEXPR int max_exponent = +16384; + BOOST_STATIC_CONSTEXPR int max_exponent10 = static_cast<int>((max_exponent * 301L) / 1000L); + BOOST_STATIC_CONSTEXPR bool has_infinity = true; + BOOST_STATIC_CONSTEXPR bool has_quiet_NaN = true; + BOOST_STATIC_CONSTEXPR bool has_signaling_NaN = false; + BOOST_STATIC_CONSTEXPR float_denorm_style has_denorm = denorm_absent; + BOOST_STATIC_CONSTEXPR bool has_denorm_loss = false; + static boost::math::cstdfloat::detail::float_internal128_t infinity () { return BOOST_FLOAT128_C(1.0) / BOOST_FLOAT128_C(0.0); } + static boost::math::cstdfloat::detail::float_internal128_t quiet_NaN () { return ::BOOST_CSTDFLOAT_FLOAT128_SQRT(BOOST_FLOAT128_C(-1.0)); } + static boost::math::cstdfloat::detail::float_internal128_t signaling_NaN() { return BOOST_FLOAT128_C(0.0); } + static boost::math::cstdfloat::detail::float_internal128_t denorm_min () { return BOOST_FLOAT128_C(0.0); } + BOOST_STATIC_CONSTEXPR bool is_iec559 = true; + BOOST_STATIC_CONSTEXPR bool is_bounded = false; + BOOST_STATIC_CONSTEXPR bool is_modulo = false; + BOOST_STATIC_CONSTEXPR bool traps = false; + BOOST_STATIC_CONSTEXPR bool tinyness_before = false; + BOOST_STATIC_CONSTEXPR float_round_style round_style = round_to_nearest; + }; + } // namespace std + + #endif // Not BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT (i.e., the user would like to have libquadmath support) + +#endif // _BOOST_CSTDFLOAT_LIMITS_2014_01_09_HPP_ diff --git a/boost/math/cstdfloat/cstdfloat_types.hpp b/boost/math/cstdfloat/cstdfloat_types.hpp new file mode 100644 index 0000000000..3ffcce21db --- /dev/null +++ b/boost/math/cstdfloat/cstdfloat_types.hpp @@ -0,0 +1,431 @@ +/////////////////////////////////////////////////////////////////////////////// +// Copyright Christopher Kormanyos 2014. +// Copyright John Maddock 2014. +// Copyright Paul Bristow 2014. +// Distributed under the Boost Software License, +// Version 1.0. (See accompanying file LICENSE_1_0.txt +// or copy at http://www.boost.org/LICENSE_1_0.txt) +// + +// Implement the types for floating-point typedefs having specified widths. + +#ifndef _BOOST_CSTDFLOAT_TYPES_2014_01_09_HPP_ + #define _BOOST_CSTDFLOAT_TYPES_2014_01_09_HPP_ + + #include <float.h> + #include <limits> + #include <boost/static_assert.hpp> + #include <boost/math/tools/config.hpp> + + // This is the beginning of the preamble. + + // In this preamble, the preprocessor is used to query certain + // preprocessor definitions from <float.h>. Based on the results + // of these queries, an attempt is made to automatically detect + // the presence of built-in floating-point types having specified + // widths. These are *thought* to be conformant with IEEE-754, + // whereby an unequivocal test based on std::numeric_limits<> + // follows below. + + // In addition, various macros that are used for initializing + // floating-point literal values having specified widths and + // some basic min/max values are defined. + + // First, we will pre-load certain preprocessor definitions + // with a dummy value. + + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 0 + + #define BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE 0 + #define BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE 0 + #define BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE 0 + #define BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE 0 + #define BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE 0 + + // Ensure that the compiler has a radix-2 floating-point representation. + #if (!defined(FLT_RADIX) || ((defined(FLT_RADIX) && (FLT_RADIX != 2)))) + #error The compiler does not support any radix-2 floating-point types required for <boost/cstdfloat.hpp>. + #endif + + // Check if built-in float is equivalent to float16_t, float32_t, float64_t, float80_t, or float128_t. + #if(defined(FLT_MANT_DIG) && defined(FLT_MAX_EXP)) + #if ((FLT_MANT_DIG == 11) && (FLT_MAX_EXP == 16) && (BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT16_NATIVE_TYPE float + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 16 + #undef BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE 1 + #define BOOST_FLOAT16_C(x) (x ## F) + #define BOOST_CSTDFLOAT_FLOAT_16_MIN FLT_MIN + #define BOOST_CSTDFLOAT_FLOAT_16_MAX FLT_MAX + #elif((FLT_MANT_DIG == 24) && (FLT_MAX_EXP == 128) && (BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT32_NATIVE_TYPE float + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 32 + #undef BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE 1 + #define BOOST_FLOAT32_C(x) (x ## F) + #define BOOST_CSTDFLOAT_FLOAT_32_MIN FLT_MIN + #define BOOST_CSTDFLOAT_FLOAT_32_MAX FLT_MAX + #elif((FLT_MANT_DIG == 53) && (FLT_MAX_EXP == 1024) && (BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT64_NATIVE_TYPE float + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 64 + #undef BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE 1 + #define BOOST_FLOAT64_C(x) (x ## F) + #define BOOST_CSTDFLOAT_FLOAT_64_MIN FLT_MIN + #define BOOST_CSTDFLOAT_FLOAT_64_MAX FLT_MAX + #elif((FLT_MANT_DIG == 64) && (FLT_MAX_EXP == 16384) && (BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT80_NATIVE_TYPE float + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 80 + #undef BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE 1 + #define BOOST_FLOAT80_C(x) (x ## F) + #define BOOST_CSTDFLOAT_FLOAT_80_MIN FLT_MIN + #define BOOST_CSTDFLOAT_FLOAT_80_MAX FLT_MAX + #elif((FLT_MANT_DIG == 113) && (FLT_MAX_EXP == 16384) && (BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT128_NATIVE_TYPE float + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 128 + #undef BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE 1 + #define BOOST_FLOAT128_C(x) (x ## F) + #define BOOST_CSTDFLOAT_FLOAT_128_MIN FLT_MIN + #define BOOST_CSTDFLOAT_FLOAT_128_MAX FLT_MAX + #endif + #endif + + // Check if built-in double is equivalent to float16_t, float32_t, float64_t, float80_t, or float128_t. + #if(defined(DBL_MANT_DIG) && defined(DBL_MAX_EXP)) + #if ((DBL_MANT_DIG == 11) && (DBL_MAX_EXP == 16) && (BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT16_NATIVE_TYPE double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 16 + #undef BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE 1 + #define BOOST_FLOAT16_C(x) (x) + #define BOOST_CSTDFLOAT_FLOAT_16_MIN DBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_16_MAX DBL_MAX + #elif((DBL_MANT_DIG == 24) && (DBL_MAX_EXP == 128) && (BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT32_NATIVE_TYPE double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 32 + #undef BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE 1 + #define BOOST_FLOAT32_C(x) (x) + #define BOOST_CSTDFLOAT_FLOAT_32_MIN DBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_32_MAX DBL_MAX + #elif((DBL_MANT_DIG == 53) && (DBL_MAX_EXP == 1024) && (BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT64_NATIVE_TYPE double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 64 + #undef BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE 1 + #define BOOST_FLOAT64_C(x) (x) + #define BOOST_CSTDFLOAT_FLOAT_64_MIN DBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_64_MAX DBL_MAX + #elif((DBL_MANT_DIG == 64) && (DBL_MAX_EXP == 16384) && (BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT80_NATIVE_TYPE double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 80 + #undef BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE 1 + #define BOOST_FLOAT80_C(x) (x) + #define BOOST_CSTDFLOAT_FLOAT_80_MIN DBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_80_MAX DBL_MAX + #elif((DBL_MANT_DIG == 113) && (DBL_MAX_EXP == 16384) && (BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT128_NATIVE_TYPE double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 128 + #undef BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE 1 + #define BOOST_FLOAT128_C(x) (x) + #define BOOST_CSTDFLOAT_FLOAT_128_MIN DBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_128_MAX DBL_MAX + #endif + #endif + + // Disable check long double capability even if supported by compiler since some math runtime + // implementations are broken for long double. + #ifndef BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS + // Check if built-in long double is equivalent to float16_t, float32_t, float64_t, float80_t, or float128_t. + #if(defined(LDBL_MANT_DIG) && defined(LDBL_MAX_EXP)) + #if ((LDBL_MANT_DIG == 11) && (LDBL_MAX_EXP == 16) && (BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT16_NATIVE_TYPE long double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 16 + #undef BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE 1 + #define BOOST_FLOAT16_C(x) (x ## L) + #define BOOST_CSTDFLOAT_FLOAT_16_MIN LDBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_16_MAX LDBL_MAX + #elif((LDBL_MANT_DIG == 24) && (LDBL_MAX_EXP == 128) && (BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT32_NATIVE_TYPE long double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 32 + #undef BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE 1 + #define BOOST_FLOAT32_C(x) (x ## L) + #define BOOST_CSTDFLOAT_FLOAT_32_MIN LDBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_32_MAX LDBL_MAX + #elif((LDBL_MANT_DIG == 53) && (LDBL_MAX_EXP == 1024) && (BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT64_NATIVE_TYPE long double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 64 + #undef BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE 1 + #define BOOST_FLOAT64_C(x) (x ## L) + #define BOOST_CSTDFLOAT_FLOAT_64_MIN LDBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_64_MAX LDBL_MAX + #elif((LDBL_MANT_DIG == 64) && (LDBL_MAX_EXP == 16384) && (BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT80_NATIVE_TYPE long double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 80 + #undef BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE 1 + #define BOOST_FLOAT80_C(x) (x ## L) + #define BOOST_CSTDFLOAT_FLOAT_80_MIN LDBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_80_MAX LDBL_MAX + #elif((LDBL_MANT_DIG == 113) && (LDBL_MAX_EXP == 16384) && (BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE == 0)) + #define BOOST_CSTDFLOAT_FLOAT128_NATIVE_TYPE long double + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 128 + #undef BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE 1 + #define BOOST_FLOAT128_C(x) (x ## L) + #define BOOST_CSTDFLOAT_FLOAT_128_MIN LDBL_MIN + #define BOOST_CSTDFLOAT_FLOAT_128_MAX LDBL_MAX + #endif + #endif + #endif + + // Check if quadruple-precision is supported. Here, we are checking + // for the presence of __float128 from GCC's quadmath.h or _Quad + // from ICC's /Qlong-double flag). To query these, we use the + // BOOST_MATH_USE_FLOAT128 pre-processor definition from + // <boost/math/tools/config.hpp>. + + #if (BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE == 0) && defined(BOOST_MATH_USE_FLOAT128) && !defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT) + + // Specify the underlying name of the internal 128-bit floating-point type definition. + namespace boost { namespace math { namespace cstdfloat { namespace detail { + #if defined(BOOST_INTEL) + typedef _Quad float_internal128_t; + #elif defined(__GNUC__) + typedef __float128 float_internal128_t; + #else + #error "Sorry, the compiler is neither GCC, nor Intel, I don't know how to configure <boost/cstdfloat.hpp>." + #endif + } } } } // boost::math::cstdfloat::detail + + #define BOOST_CSTDFLOAT_FLOAT128_NATIVE_TYPE boost::math::cstdfloat::detail::float_internal128_t + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + #define BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH 128 + #undef BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE + #define BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE 1 + #define BOOST_FLOAT128_C(x) (x ## Q) + #define BOOST_CSTDFLOAT_FLOAT128_MIN 3.36210314311209350626267781732175260e-4932Q + #define BOOST_CSTDFLOAT_FLOAT128_MAX 1.18973149535723176508575932662800702e+4932Q + #define BOOST_CSTDFLOAT_FLOAT128_EPS 1.92592994438723585305597794258492732e-0034Q + + #endif // Not BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT (i.e., the user would like to have libquadmath support) + + // This is the end of the preamble, and also the end of the + // sections providing support for the C++ standard library + // for quadruple-precision. + + // Now we use the results of the queries that have been obtained + // in the preamble (far above) for the final type definitions in + // the namespace boost. + + // Make sure that the compiler has any floating-point type(s) whatsoever. + #if ( (BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE == 0) \ + && (BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE == 0) \ + && (BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE == 0) \ + && (BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE == 0) \ + && (BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE == 0)) + #error The compiler does not support any of the floating-point types required for <boost/cstdfloat.hpp>. + #endif + + // The following section contains the various min/max macros + // for the *leastN and *fastN types. + + #if(BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE == 1) + #define BOOST_FLOAT_FAST16_MIN BOOST_CSTDFLOAT_FLOAT_16_MIN + #define BOOST_FLOAT_LEAST16_MIN BOOST_CSTDFLOAT_FLOAT_16_MIN + #define BOOST_FLOAT_FAST16_MAX BOOST_CSTDFLOAT_FLOAT_16_MAX + #define BOOST_FLOAT_LEAST16_MAX BOOST_CSTDFLOAT_FLOAT_16_MAX + #endif + + #if(BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE == 1) + #define BOOST_FLOAT_FAST32_MIN BOOST_CSTDFLOAT_FLOAT_32_MIN + #define BOOST_FLOAT_LEAST32_MIN BOOST_CSTDFLOAT_FLOAT_32_MIN + #define BOOST_FLOAT_FAST32_MAX BOOST_CSTDFLOAT_FLOAT_32_MAX + #define BOOST_FLOAT_LEAST32_MAX BOOST_CSTDFLOAT_FLOAT_32_MAX + #endif + + #if(BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE == 1) + #define BOOST_FLOAT_FAST64_MIN BOOST_CSTDFLOAT_FLOAT_64_MIN + #define BOOST_FLOAT_LEAST64_MIN BOOST_CSTDFLOAT_FLOAT_64_MIN + #define BOOST_FLOAT_FAST64_MAX BOOST_CSTDFLOAT_FLOAT_64_MAX + #define BOOST_FLOAT_LEAST64_MAX BOOST_CSTDFLOAT_FLOAT_64_MAX + #endif + + #if(BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE == 1) + #define BOOST_FLOAT_FAST80_MIN BOOST_CSTDFLOAT_FLOAT_80_MIN + #define BOOST_FLOAT_LEAST80_MIN BOOST_CSTDFLOAT_FLOAT_80_MIN + #define BOOST_FLOAT_FAST80_MAX BOOST_CSTDFLOAT_FLOAT_80_MAX + #define BOOST_FLOAT_LEAST80_MAX BOOST_CSTDFLOAT_FLOAT_80_MAX + #endif + + #if(BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE == 1) + #define BOOST_CSTDFLOAT_HAS_INTERNAL_FLOAT128_T + + #define BOOST_FLOAT_FAST128_MIN BOOST_CSTDFLOAT_FLOAT_128_MIN + #define BOOST_FLOAT_LEAST128_MIN BOOST_CSTDFLOAT_FLOAT_128_MIN + #define BOOST_FLOAT_FAST128_MAX BOOST_CSTDFLOAT_FLOAT_128_MAX + #define BOOST_FLOAT_LEAST128_MAX BOOST_CSTDFLOAT_FLOAT_128_MAX + #endif + + // The following section contains the various min/max macros + // for the *floatmax types. + + #if (BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 16) + #define BOOST_FLOATMAX_C(x) BOOST_FLOAT16_C(x) + #define BOOST_FLOATMAX_MIN BOOST_CSTDFLOAT_FLOAT_16_MIN + #define BOOST_FLOATMAX_MAX BOOST_CSTDFLOAT_FLOAT_16_MAX + #elif(BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 32) + #define BOOST_FLOATMAX_C(x) BOOST_FLOAT32_C(x) + #define BOOST_FLOATMAX_MIN BOOST_CSTDFLOAT_FLOAT_32_MIN + #define BOOST_FLOATMAX_MAX BOOST_CSTDFLOAT_FLOAT_32_MAX + #elif(BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 64) + #define BOOST_FLOATMAX_C(x) BOOST_FLOAT64_C(x) + #define BOOST_FLOATMAX_MIN BOOST_CSTDFLOAT_FLOAT_64_MIN + #define BOOST_FLOATMAX_MAX BOOST_CSTDFLOAT_FLOAT_64_MAX + #elif(BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 80) + #define BOOST_FLOATMAX_C(x) BOOST_FLOAT80_C(x) + #define BOOST_FLOATMAX_MIN BOOST_CSTDFLOAT_FLOAT_80_MIN + #define BOOST_FLOATMAX_MAX BOOST_CSTDFLOAT_FLOAT_80_MAX + #elif(BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 128) + #define BOOST_FLOATMAX_C(x) BOOST_FLOAT128_C(x) + #define BOOST_FLOATMAX_MIN BOOST_CSTDFLOAT_FLOAT_128_MIN + #define BOOST_FLOATMAX_MAX BOOST_CSTDFLOAT_FLOAT_128_MAX + #else + #error The maximum available floating-point width for <boost/cstdfloat.hpp> is undefined. + #endif + + // And finally..., we define the floating-point typedefs having + // specified widths. The types are defined in the namespace boost. + + // For simplicity, the least and fast types are type defined identically + // as the corresponding fixed-width type. This behavior may, however, + // be modified when being optimized for a given compiler implementation. + + // In addition, a clear assessment of IEEE-754 comformance is carried out + // using compile-time assertion. + + namespace boost + { + #if(BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE == 1) + typedef BOOST_CSTDFLOAT_FLOAT16_NATIVE_TYPE float16_t; + typedef boost::float16_t float_fast16_t; + typedef boost::float16_t float_least16_t; + + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float16_t>::is_iec559 == true, "boost::float16_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float16_t>::radix == 2, "boost::float16_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float16_t>::digits == 11, "boost::float16_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float16_t>::max_exponent == 16, "boost::float16_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + + #undef BOOST_CSTDFLOAT_FLOAT_16_MIN + #undef BOOST_CSTDFLOAT_FLOAT_16_MAX + #endif + + #if(BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE == 1) + typedef BOOST_CSTDFLOAT_FLOAT32_NATIVE_TYPE float32_t; + typedef boost::float32_t float_fast32_t; + typedef boost::float32_t float_least32_t; + + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float32_t>::is_iec559 == true, "boost::float32_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float32_t>::radix == 2, "boost::float32_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float32_t>::digits == 24, "boost::float32_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float32_t>::max_exponent == 128, "boost::float32_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + + #undef BOOST_CSTDFLOAT_FLOAT_32_MIN + #undef BOOST_CSTDFLOAT_FLOAT_32_MAX + #endif + + #if(BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE == 1) + typedef BOOST_CSTDFLOAT_FLOAT64_NATIVE_TYPE float64_t; + typedef boost::float64_t float_fast64_t; + typedef boost::float64_t float_least64_t; + + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float64_t>::is_iec559 == true, "boost::float64_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float64_t>::radix == 2, "boost::float64_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float64_t>::digits == 53, "boost::float64_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float64_t>::max_exponent == 1024, "boost::float64_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + + #undef BOOST_CSTDFLOAT_FLOAT_64_MIN + #undef BOOST_CSTDFLOAT_FLOAT_64_MAX + #endif + + #if(BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE == 1) + typedef BOOST_CSTDFLOAT_FLOAT80_NATIVE_TYPE float80_t; + typedef boost::float80_t float_fast80_t; + typedef boost::float80_t float_least80_t; + + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float80_t>::is_iec559 == true, "boost::float80_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float80_t>::radix == 2, "boost::float80_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float80_t>::digits == 64, "boost::float80_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float80_t>::max_exponent == 16384, "boost::float80_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + + #undef BOOST_CSTDFLOAT_FLOAT_80_MIN + #undef BOOST_CSTDFLOAT_FLOAT_80_MAX + #endif + + #if(BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE == 1) + typedef BOOST_CSTDFLOAT_FLOAT128_NATIVE_TYPE float128_t; + typedef boost::float128_t float_fast128_t; + typedef boost::float128_t float_least128_t; + + #if defined(BOOST_CSTDFLOAT_HAS_INTERNAL_FLOAT128_T) && defined(BOOST_MATH_USE_FLOAT128) && !defined(BOOST_CSTDFLOAT_NO_LIBQUADMATH_SUPPORT) + // This configuration does not *yet* support std::numeric_limits<boost::float128_t>. + // Support for std::numeric_limits<boost::float128_t> is added in the detail + // file <boost/math/cstdfloat/cstdfloat_limits.hpp>. + #else + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float128_t>::is_iec559 == true, "boost::float128_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float128_t>::radix == 2, "boost::float128_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float128_t>::digits == 113, "boost::float128_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + BOOST_STATIC_ASSERT_MSG(std::numeric_limits<boost::float128_t>::max_exponent == 16384, "boost::float128_t has been detected in <boost/cstdfloat>, but verification with std::numeric_limits fails"); + #endif + + #undef BOOST_CSTDFLOAT_FLOAT_128_MIN + #undef BOOST_CSTDFLOAT_FLOAT_128_MAX + #endif + + #if (BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 16) + typedef boost::float16_t floatmax_t; + #elif(BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 32) + typedef boost::float32_t floatmax_t; + #elif(BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 64) + typedef boost::float64_t floatmax_t; + #elif(BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 80) + typedef boost::float80_t floatmax_t; + #elif(BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH == 128) + typedef boost::float128_t floatmax_t; + #else + #error The maximum available floating-point width for <boost/cstdfloat.hpp> is undefined. + #endif + + #undef BOOST_CSTDFLOAT_HAS_FLOAT16_NATIVE_TYPE + #undef BOOST_CSTDFLOAT_HAS_FLOAT32_NATIVE_TYPE + #undef BOOST_CSTDFLOAT_HAS_FLOAT64_NATIVE_TYPE + #undef BOOST_CSTDFLOAT_HAS_FLOAT80_NATIVE_TYPE + #undef BOOST_CSTDFLOAT_HAS_FLOAT128_NATIVE_TYPE + + #undef BOOST_CSTDFLOAT_MAXIMUM_AVAILABLE_WIDTH + } + // namespace boost + +#endif // _BOOST_CSTDFLOAT_BASE_TYPES_2014_01_09_HPP_ diff --git a/boost/math/distributions.hpp b/boost/math/distributions.hpp index 37cf027a80..cbcc0ace88 100644 --- a/boost/math/distributions.hpp +++ b/boost/math/distributions.hpp @@ -23,6 +23,7 @@ #include <boost/math/distributions/fisher_f.hpp> #include <boost/math/distributions/gamma.hpp> #include <boost/math/distributions/geometric.hpp> +#include <boost/math/distributions/hyperexponential.hpp> #include <boost/math/distributions/hypergeometric.hpp> #include <boost/math/distributions/inverse_chi_squared.hpp> #include <boost/math/distributions/inverse_gamma.hpp> @@ -39,6 +40,7 @@ #include <boost/math/distributions/pareto.hpp> #include <boost/math/distributions/poisson.hpp> #include <boost/math/distributions/rayleigh.hpp> +#include <boost/math/distributions/skew_normal.hpp> #include <boost/math/distributions/students_t.hpp> #include <boost/math/distributions/triangular.hpp> #include <boost/math/distributions/uniform.hpp> diff --git a/boost/math/distributions/beta.hpp b/boost/math/distributions/beta.hpp index cfadd7bff5..5ecf902d99 100644 --- a/boost/math/distributions/beta.hpp +++ b/boost/math/distributions/beta.hpp @@ -156,7 +156,7 @@ namespace boost typedef RealType value_type; typedef Policy policy_type; - beta_distribution(RealType alpha = 1, RealType beta = 1) : m_alpha(alpha), m_beta(beta) + beta_distribution(RealType l_alpha = 1, RealType l_beta = 1) : m_alpha(l_alpha), m_beta(l_beta) { RealType result; beta_detail::check_dist( @@ -189,11 +189,10 @@ namespace boost static const char* function = "boost::math::beta_distribution<%1%>::find_alpha"; RealType result = 0; // of error checks. if(false == - beta_detail::check_mean( - function, mean, &result, Policy()) - && - beta_detail::check_variance( - function, variance, &result, Policy()) + ( + beta_detail::check_mean(function, mean, &result, Policy()) + && beta_detail::check_variance(function, variance, &result, Policy()) + ) ) { return result; @@ -208,11 +207,11 @@ namespace boost static const char* function = "boost::math::beta_distribution<%1%>::find_beta"; RealType result = 0; // of error checks. if(false == - beta_detail::check_mean( - function, mean, &result, Policy()) - && - beta_detail::check_variance( - function, variance, &result, Policy()) + ( + beta_detail::check_mean(function, mean, &result, Policy()) + && + beta_detail::check_variance(function, variance, &result, Policy()) + ) ) { return result; @@ -231,14 +230,13 @@ namespace boost static const char* function = "boost::math::beta_distribution<%1%>::find_alpha"; RealType result = 0; // of error checks. if(false == - beta_detail::check_prob( - function, probability, &result, Policy()) - && - beta_detail::check_beta( - function, beta, &result, Policy()) - && - beta_detail::check_x( - function, x, &result, Policy()) + ( + beta_detail::check_prob(function, probability, &result, Policy()) + && + beta_detail::check_beta(function, beta, &result, Policy()) + && + beta_detail::check_x(function, x, &result, Policy()) + ) ) { return result; @@ -255,14 +253,13 @@ namespace boost static const char* function = "boost::math::beta_distribution<%1%>::find_beta"; RealType result = 0; // of error checks. if(false == - beta_detail::check_prob( - function, probability, &result, Policy()) - && - beta_detail::check_alpha( - function, alpha, &result, Policy()) - && - beta_detail::check_x( - function, x, &result, Policy()) + ( + beta_detail::check_prob(function, probability, &result, Policy()) + && + beta_detail::check_alpha(function, alpha, &result, Policy()) + && + beta_detail::check_x(function, x, &result, Policy()) + ) ) { return result; diff --git a/boost/math/distributions/binomial.hpp b/boost/math/distributions/binomial.hpp index 5ab3928949..a48c89c5b9 100644 --- a/boost/math/distributions/binomial.hpp +++ b/boost/math/distributions/binomial.hpp @@ -196,7 +196,7 @@ namespace boost } template <class RealType, class Policy> - RealType quantile_imp(const binomial_distribution<RealType, Policy>& dist, const RealType& p, const RealType& q) + RealType quantile_imp(const binomial_distribution<RealType, Policy>& dist, const RealType& p, const RealType& q, bool comp) { // Quantile or Percent Point Binomial function. // Return the number of expected successes k, // for a given probability p. @@ -264,8 +264,8 @@ namespace boost boost::uintmax_t max_iter = policies::get_max_root_iterations<Policy>(); return detail::inverse_discrete_quantile( dist, - p, - q, + comp ? q : p, + comp, guess, factor, RealType(1), @@ -653,13 +653,13 @@ namespace boost template <class RealType, class Policy> inline RealType quantile(const binomial_distribution<RealType, Policy>& dist, const RealType& p) { - return binomial_detail::quantile_imp(dist, p, RealType(1-p)); + return binomial_detail::quantile_imp(dist, p, RealType(1-p), false); } // quantile template <class RealType, class Policy> RealType quantile(const complemented2_type<binomial_distribution<RealType, Policy>, RealType>& c) { - return binomial_detail::quantile_imp(c.dist, RealType(1-c.param), c.param); + return binomial_detail::quantile_imp(c.dist, RealType(1-c.param), c.param, true); } // quantile template <class RealType, class Policy> diff --git a/boost/math/distributions/cauchy.hpp b/boost/math/distributions/cauchy.hpp index 0c93febaa5..5a3a64f0f2 100644 --- a/boost/math/distributions/cauchy.hpp +++ b/boost/math/distributions/cauchy.hpp @@ -152,13 +152,13 @@ public: typedef RealType value_type; typedef Policy policy_type; - cauchy_distribution(RealType location = 0, RealType scale = 1) - : m_a(location), m_hg(scale) + cauchy_distribution(RealType l_location = 0, RealType l_scale = 1) + : m_a(l_location), m_hg(l_scale) { static const char* function = "boost::math::cauchy_distribution<%1%>::cauchy_distribution"; RealType result; - detail::check_location(function, location, &result, Policy()); - detail::check_scale(function, scale, &result, Policy()); + detail::check_location(function, l_location, &result, Policy()); + detail::check_scale(function, l_scale, &result, Policy()); } // cauchy_distribution RealType location()const @@ -180,15 +180,30 @@ typedef cauchy_distribution<double> cauchy; template <class RealType, class Policy> inline const std::pair<RealType, RealType> range(const cauchy_distribution<RealType, Policy>&) { // Range of permissible values for random variable x. + if (std::numeric_limits<RealType>::has_infinity) + { + return std::pair<RealType, RealType>(-std::numeric_limits<RealType>::infinity(), std::numeric_limits<RealType>::infinity()); // - to + infinity. + } + else + { // Can only use max_value. using boost::math::tools::max_value; - return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + infinity. + return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + max. + } } template <class RealType, class Policy> inline const std::pair<RealType, RealType> support(const cauchy_distribution<RealType, Policy>& ) { // Range of supported values for random variable x. // This is range where cdf rises from 0 to 1, and outside it, the pdf is zero. - return std::pair<RealType, RealType>(-tools::max_value<RealType>(), tools::max_value<RealType>()); // - to + infinity. + if (std::numeric_limits<RealType>::has_infinity) + { + return std::pair<RealType, RealType>(-std::numeric_limits<RealType>::infinity(), std::numeric_limits<RealType>::infinity()); // - to + infinity. + } + else + { // Can only use max_value. + using boost::math::tools::max_value; + return std::pair<RealType, RealType>(-tools::max_value<RealType>(), max_value<RealType>()); // - to + max. + } } template <class RealType, class Policy> diff --git a/boost/math/distributions/chi_squared.hpp b/boost/math/distributions/chi_squared.hpp index 367a7154a3..071c7756f4 100644 --- a/boost/math/distributions/chi_squared.hpp +++ b/boost/math/distributions/chi_squared.hpp @@ -50,18 +50,34 @@ private: // // Data member: // - RealType m_df; // degrees of freedom are a real number. + RealType m_df; // degrees of freedom is a positive real number. }; // class chi_squared_distribution typedef chi_squared_distribution<double> chi_squared; +#ifdef BOOST_MSVC +#pragma warning(push) +#pragma warning(disable:4127) +#endif + template <class RealType, class Policy> inline const std::pair<RealType, RealType> range(const chi_squared_distribution<RealType, Policy>& /*dist*/) { // Range of permissible values for random variable x. - using boost::math::tools::max_value; - return std::pair<RealType, RealType>(static_cast<RealType>(0), max_value<RealType>()); // 0 to + infinity. + if (std::numeric_limits<RealType>::has_infinity) + { + return std::pair<RealType, RealType>(static_cast<RealType>(0), std::numeric_limits<RealType>::infinity()); // 0 to + infinity. + } + else + { + using boost::math::tools::max_value; + return std::pair<RealType, RealType>(static_cast<RealType>(0), max_value<RealType>()); // 0 to + max. + } } +#ifdef BOOST_MSVC +#pragma warning(pop) +#endif + template <class RealType, class Policy> inline const std::pair<RealType, RealType> support(const chi_squared_distribution<RealType, Policy>& /*dist*/) { // Range of supported values for random variable x. @@ -138,11 +154,12 @@ inline RealType quantile(const chi_squared_distribution<RealType, Policy>& dist, static const char* function = "boost::math::quantile(const chi_squared_distribution<%1%>&, %1%)"; // Error check: RealType error_result; - if(false == detail::check_df( - function, degrees_of_freedom, &error_result, Policy()) - && detail::check_probability( - function, p, &error_result, Policy())) - return error_result; + if(false == + ( + detail::check_df(function, degrees_of_freedom, &error_result, Policy()) + && detail::check_probability(function, p, &error_result, Policy())) + ) + return error_result; return 2 * boost::math::gamma_p_inv(degrees_of_freedom / 2, p, Policy()); } // quantile @@ -176,11 +193,11 @@ inline RealType quantile(const complemented2_type<chi_squared_distribution<RealT static const char* function = "boost::math::quantile(const chi_squared_distribution<%1%>&, %1%)"; // Error check: RealType error_result; - if(false == detail::check_df( - function, degrees_of_freedom, &error_result, Policy()) - && detail::check_probability( - function, q, &error_result, Policy())) - return error_result; + if(false == ( + detail::check_df(function, degrees_of_freedom, &error_result, Policy()) + && detail::check_probability(function, q, &error_result, Policy())) + ) + return error_result; return 2 * boost::math::gamma_q_inv(degrees_of_freedom / 2, q, Policy()); } diff --git a/boost/math/distributions/detail/common_error_handling.hpp b/boost/math/distributions/detail/common_error_handling.hpp index 46ded33cde..71a771e5a1 100644 --- a/boost/math/distributions/detail/common_error_handling.hpp +++ b/boost/math/distributions/detail/common_error_handling.hpp @@ -1,5 +1,5 @@ // Copyright John Maddock 2006, 2007. -// Copyright Paul A. Bristow 2006, 2007. +// Copyright Paul A. Bristow 2006, 2007, 2012. // Use, modification and distribution are subject to the // Boost Software License, Version 1.0. @@ -12,6 +12,7 @@ #include <boost/math/policies/error_handling.hpp> #include <boost/math/special_functions/fpclassify.hpp> // using boost::math::isfinite; +// using boost::math::isnan; namespace boost{ namespace math{ namespace detail { @@ -31,7 +32,7 @@ inline bool check_probability(const char* function, RealType const& prob, RealTy template <class RealType, class Policy> inline bool check_df(const char* function, RealType const& df, RealType* result, const Policy& pol) -{ +{ // df > 0 but NOT +infinity allowed. if((df <= 0) || !(boost::math::isfinite)(df)) { *result = policies::raise_domain_error<RealType>( @@ -43,6 +44,20 @@ inline bool check_df(const char* function, RealType const& df, RealType* result, } template <class RealType, class Policy> +inline bool check_df_gt0_to_inf(const char* function, RealType const& df, RealType* result, const Policy& pol) +{ // df > 0 or +infinity are allowed. + if( (df <= 0) || (boost::math::isnan)(df) ) + { // is bad df <= 0 or NaN or -infinity. + *result = policies::raise_domain_error<RealType>( + function, + "Degrees of freedom argument is %1%, but must be > 0 !", df, pol); + return false; + } + return true; +} // check_df_gt0_to_inf + + +template <class RealType, class Policy> inline bool check_scale( const char* function, RealType scale, @@ -83,6 +98,10 @@ inline bool check_x( RealType* result, const Policy& pol) { + // Note that this test catches both infinity and NaN. + // Some distributions permit x to be infinite, so these must be tested 1st and return, + // leaving this test to catch any NaNs. + // See Normal, Logistic, Laplace and Cauchy for example. if(!(boost::math::isfinite)(x)) { *result = policies::raise_domain_error<RealType>( @@ -91,9 +110,6 @@ inline bool check_x( return false; } return true; - // Note that this test catches both infinity and NaN. - // Some special cases permit x to be infinite, so these must be tested 1st, - // leaving this test to catch any NaNs. see Normal and cauchy for example. } // bool check_x template <class RealType, class Policy> diff --git a/boost/math/distributions/detail/generic_mode.hpp b/boost/math/distributions/detail/generic_mode.hpp index 085dc691cd..3857c9f2ec 100644 --- a/boost/math/distributions/detail/generic_mode.hpp +++ b/boost/math/distributions/detail/generic_mode.hpp @@ -47,7 +47,7 @@ typename Dist::value_type generic_find_mode(const Dist& dist, typename Dist::val // Oops we don't know how to handle this, or even in which // direction we should move in, treat as an evaluation error: // - policies::raise_evaluation_error( + return policies::raise_evaluation_error( function, "Could not locate a starting location for the search for the mode, original guess was %1%", guess, policy_type()); } diff --git a/boost/math/distributions/detail/generic_quantile.hpp b/boost/math/distributions/detail/generic_quantile.hpp index b36f31c8b9..afde2cacb7 100644 --- a/boost/math/distributions/detail/generic_quantile.hpp +++ b/boost/math/distributions/detail/generic_quantile.hpp @@ -78,7 +78,7 @@ typename Dist::value_type generic_quantile(const Dist& dist, const typename Dist value_type result = ir.first + (ir.second - ir.first) / 2; if(max_iter >= policies::get_max_root_iterations<forwarding_policy>()) { - policies::raise_evaluation_error<value_type>(function, "Unable to locate solution in a reasonable time:" + return policies::raise_evaluation_error<value_type>(function, "Unable to locate solution in a reasonable time:" " either there is no answer to quantile" " or the answer is infinite. Current best guess is %1%", result, forwarding_policy()); } diff --git a/boost/math/distributions/detail/hypergeometric_pdf.hpp b/boost/math/distributions/detail/hypergeometric_pdf.hpp index 895a2f1c94..1e6a5ca20d 100644 --- a/boost/math/distributions/detail/hypergeometric_pdf.hpp +++ b/boost/math/distributions/detail/hypergeometric_pdf.hpp @@ -61,15 +61,15 @@ T hypergeometric_pdf_lanczos_imp(T /*dummy*/, unsigned x, unsigned r, unsigned n BOOST_MATH_INSTRUMENT_VARIABLE(typeid(Lanczos).name()); T bases[9] = { - T(n) + Lanczos::g() + 0.5f, - T(r) + Lanczos::g() + 0.5f, - T(N - n) + Lanczos::g() + 0.5f, - T(N - r) + Lanczos::g() + 0.5f, - 1 / (T(N) + Lanczos::g() + 0.5f), - 1 / (T(x) + Lanczos::g() + 0.5f), - 1 / (T(n - x) + Lanczos::g() + 0.5f), - 1 / (T(r - x) + Lanczos::g() + 0.5f), - 1 / (T(N - n - r + x) + Lanczos::g() + 0.5f) + T(n) + static_cast<T>(Lanczos::g()) + 0.5f, + T(r) + static_cast<T>(Lanczos::g()) + 0.5f, + T(N - n) + static_cast<T>(Lanczos::g()) + 0.5f, + T(N - r) + static_cast<T>(Lanczos::g()) + 0.5f, + 1 / (T(N) + static_cast<T>(Lanczos::g()) + 0.5f), + 1 / (T(x) + static_cast<T>(Lanczos::g()) + 0.5f), + 1 / (T(n - x) + static_cast<T>(Lanczos::g()) + 0.5f), + 1 / (T(r - x) + static_cast<T>(Lanczos::g()) + 0.5f), + 1 / (T(N - n - r + x) + static_cast<T>(Lanczos::g()) + 0.5f) }; T exponents[9] = { n + T(0.5f), @@ -392,7 +392,7 @@ template <class T, class Policy> T hypergeometric_pdf_factorial_imp(unsigned x, unsigned r, unsigned n, unsigned N, const Policy&) { BOOST_MATH_STD_USING - BOOST_ASSERT(N < boost::math::max_factorial<T>::value); + BOOST_ASSERT(N <= boost::math::max_factorial<T>::value); T result = boost::math::unchecked_factorial<T>(n); T num[3] = { boost::math::unchecked_factorial<T>(r), diff --git a/boost/math/distributions/detail/inv_discrete_quantile.hpp b/boost/math/distributions/detail/inv_discrete_quantile.hpp index 9397e7c7c2..23e00b8e03 100644 --- a/boost/math/distributions/detail/inv_discrete_quantile.hpp +++ b/boost/math/distributions/detail/inv_discrete_quantile.hpp @@ -19,8 +19,8 @@ struct distribution_quantile_finder typedef typename Dist::value_type value_type; typedef typename Dist::policy_type policy_type; - distribution_quantile_finder(const Dist d, value_type p, value_type q) - : dist(d), target(p < q ? p : q), comp(p < q ? false : true) {} + distribution_quantile_finder(const Dist d, value_type p, bool c) + : dist(d), target(p), comp(c) {} value_type operator()(value_type const& x) { @@ -73,7 +73,7 @@ typename Dist::value_type do_inverse_discrete_quantile( const Dist& dist, const typename Dist::value_type& p, - const typename Dist::value_type& q, + bool comp, typename Dist::value_type guess, const typename Dist::value_type& multiplier, typename Dist::value_type adder, @@ -87,7 +87,7 @@ typename Dist::value_type BOOST_MATH_STD_USING - distribution_quantile_finder<Dist> f(dist, p, q); + distribution_quantile_finder<Dist> f(dist, p, comp); // // Max bounds of the distribution: // @@ -215,7 +215,7 @@ typename Dist::value_type while(((boost::math::sign)(fb) == (boost::math::sign)(fa)) && (a != b)) { if(count == 0) - policies::raise_evaluation_error(function, "Unable to bracket root, last nearest value was %1%", b, policy_type()); + return policies::raise_evaluation_error(function, "Unable to bracket root, last nearest value was %1%", b, policy_type()); a = b; fa = fb; b *= multiplier; @@ -242,7 +242,7 @@ typename Dist::value_type return 0; } if(count == 0) - policies::raise_evaluation_error(function, "Unable to bracket root, last nearest value was %1%", a, policy_type()); + return policies::raise_evaluation_error(function, "Unable to bracket root, last nearest value was %1%", a, policy_type()); b = a; fb = fa; a /= multiplier; @@ -280,6 +280,80 @@ typename Dist::value_type return (r.first + r.second) / 2; } // +// Some special routine for rounding up and down: +// We want to check and see if we are very close to an integer, and if so test to see if +// that integer is an exact root of the cdf. We do this because our root finder only +// guarantees to find *a root*, and there can sometimes be many consecutive floating +// point values which are all roots. This is especially true if the target probability +// is very close 1. +// +template <class Dist> +inline typename Dist::value_type round_to_floor(const Dist& d, typename Dist::value_type result, typename Dist::value_type p, bool c) +{ + BOOST_MATH_STD_USING + typename Dist::value_type cc = ceil(result); + typename Dist::value_type pp = cc <= support(d).second ? c ? cdf(complement(d, cc)) : cdf(d, cc) : 1; + if(pp == p) + result = cc; + else + result = floor(result); + // + // Now find the smallest integer <= result for which we get an exact root: + // + while(result != 0) + { + cc = result - 1; + if(cc < support(d).first) + break; + pp = c ? cdf(complement(d, cc)) : cdf(d, cc); + if(pp == p) + result = cc; + else if(c ? pp > p : pp < p) + break; + result -= 1; + } + + return result; +} + +#ifdef BOOST_MSVC +#pragma warning(push) +#pragma warning(disable:4127) +#endif + +template <class Dist> +inline typename Dist::value_type round_to_ceil(const Dist& d, typename Dist::value_type result, typename Dist::value_type p, bool c) +{ + BOOST_MATH_STD_USING + typename Dist::value_type cc = floor(result); + typename Dist::value_type pp = cc >= support(d).first ? c ? cdf(complement(d, cc)) : cdf(d, cc) : 0; + if(pp == p) + result = cc; + else + result = ceil(result); + // + // Now find the largest integer >= result for which we get an exact root: + // + while(true) + { + cc = result + 1; + if(cc > support(d).second) + break; + pp = c ? cdf(complement(d, cc)) : cdf(d, cc); + if(pp == p) + result = cc; + else if(c ? pp < p : pp > p) + break; + result += 1; + } + + return result; +} + +#ifdef BOOST_MSVC +#pragma warning(pop) +#endif +// // Now finally are the public API functions. // There is one overload for each policy, // each one is responsible for selecting the correct @@ -290,20 +364,26 @@ template <class Dist> inline typename Dist::value_type inverse_discrete_quantile( const Dist& dist, - const typename Dist::value_type& p, - const typename Dist::value_type& q, + typename Dist::value_type p, + bool c, const typename Dist::value_type& guess, const typename Dist::value_type& multiplier, const typename Dist::value_type& adder, const policies::discrete_quantile<policies::real>&, boost::uintmax_t& max_iter) { - if(p <= pdf(dist, 0)) + if(p > 0.5) + { + p = 1 - p; + c = !c; + } + typename Dist::value_type pp = c ? 1 - p : p; + if(pp <= pdf(dist, 0)) return 0; return do_inverse_discrete_quantile( dist, p, - q, + c, guess, multiplier, adder, @@ -316,7 +396,7 @@ inline typename Dist::value_type inverse_discrete_quantile( const Dist& dist, const typename Dist::value_type& p, - const typename Dist::value_type& q, + bool c, const typename Dist::value_type& guess, const typename Dist::value_type& multiplier, const typename Dist::value_type& adder, @@ -325,32 +405,33 @@ inline typename Dist::value_type { typedef typename Dist::value_type value_type; BOOST_MATH_STD_USING - if(p <= pdf(dist, 0)) + typename Dist::value_type pp = c ? 1 - p : p; + if(pp <= pdf(dist, 0)) return 0; // // What happens next depends on whether we're looking for an // upper or lower quantile: // - if(p < 0.5f) - return floor(do_inverse_discrete_quantile( + if(pp < 0.5f) + return round_to_floor(dist, do_inverse_discrete_quantile( dist, p, - q, + c, (guess < 1 ? value_type(1) : (value_type)floor(guess)), multiplier, adder, tools::equal_floor(), - max_iter)); + max_iter), p, c); // else: - return ceil(do_inverse_discrete_quantile( + return round_to_ceil(dist, do_inverse_discrete_quantile( dist, p, - q, + c, (value_type)ceil(guess), multiplier, adder, tools::equal_ceil(), - max_iter)); + max_iter), p, c); } template <class Dist> @@ -358,7 +439,7 @@ inline typename Dist::value_type inverse_discrete_quantile( const Dist& dist, const typename Dist::value_type& p, - const typename Dist::value_type& q, + bool c, const typename Dist::value_type& guess, const typename Dist::value_type& multiplier, const typename Dist::value_type& adder, @@ -367,32 +448,33 @@ inline typename Dist::value_type { typedef typename Dist::value_type value_type; BOOST_MATH_STD_USING - if(p <= pdf(dist, 0)) + typename Dist::value_type pp = c ? 1 - p : p; + if(pp <= pdf(dist, 0)) return 0; // // What happens next depends on whether we're looking for an // upper or lower quantile: // - if(p < 0.5f) - return ceil(do_inverse_discrete_quantile( + if(pp < 0.5f) + return round_to_ceil(dist, do_inverse_discrete_quantile( dist, p, - q, + c, ceil(guess), multiplier, adder, tools::equal_ceil(), - max_iter)); + max_iter), p, c); // else: - return floor(do_inverse_discrete_quantile( + return round_to_floor(dist, do_inverse_discrete_quantile( dist, p, - q, + c, (guess < 1 ? value_type(1) : floor(guess)), multiplier, adder, tools::equal_floor(), - max_iter)); + max_iter), p, c); } template <class Dist> @@ -400,7 +482,7 @@ inline typename Dist::value_type inverse_discrete_quantile( const Dist& dist, const typename Dist::value_type& p, - const typename Dist::value_type& q, + bool c, const typename Dist::value_type& guess, const typename Dist::value_type& multiplier, const typename Dist::value_type& adder, @@ -409,17 +491,18 @@ inline typename Dist::value_type { typedef typename Dist::value_type value_type; BOOST_MATH_STD_USING - if(p <= pdf(dist, 0)) + typename Dist::value_type pp = c ? 1 - p : p; + if(pp <= pdf(dist, 0)) return 0; - return floor(do_inverse_discrete_quantile( + return round_to_floor(dist, do_inverse_discrete_quantile( dist, p, - q, + c, (guess < 1 ? value_type(1) : floor(guess)), multiplier, adder, tools::equal_floor(), - max_iter)); + max_iter), p, c); } template <class Dist> @@ -427,7 +510,7 @@ inline typename Dist::value_type inverse_discrete_quantile( const Dist& dist, const typename Dist::value_type& p, - const typename Dist::value_type& q, + bool c, const typename Dist::value_type& guess, const typename Dist::value_type& multiplier, const typename Dist::value_type& adder, @@ -435,17 +518,18 @@ inline typename Dist::value_type boost::uintmax_t& max_iter) { BOOST_MATH_STD_USING - if(p <= pdf(dist, 0)) + typename Dist::value_type pp = c ? 1 - p : p; + if(pp <= pdf(dist, 0)) return 0; - return ceil(do_inverse_discrete_quantile( + return round_to_ceil(dist, do_inverse_discrete_quantile( dist, p, - q, + c, ceil(guess), multiplier, adder, tools::equal_ceil(), - max_iter)); + max_iter), p, c); } template <class Dist> @@ -453,7 +537,7 @@ inline typename Dist::value_type inverse_discrete_quantile( const Dist& dist, const typename Dist::value_type& p, - const typename Dist::value_type& q, + bool c, const typename Dist::value_type& guess, const typename Dist::value_type& multiplier, const typename Dist::value_type& adder, @@ -462,26 +546,26 @@ inline typename Dist::value_type { typedef typename Dist::value_type value_type; BOOST_MATH_STD_USING - if(p <= pdf(dist, 0)) + typename Dist::value_type pp = c ? 1 - p : p; + if(pp <= pdf(dist, 0)) return 0; // // Note that we adjust the guess to the nearest half-integer: // this increase the chances that we will bracket the root // with two results that both round to the same integer quickly. // - return floor(do_inverse_discrete_quantile( + return round_to_floor(dist, do_inverse_discrete_quantile( dist, p, - q, + c, (guess < 0.5f ? value_type(1.5f) : floor(guess + 0.5f) + 0.5f), multiplier, adder, tools::equal_nearest_integer(), - max_iter) + 0.5f); + max_iter) + 0.5f, p, c); } }}} // namespaces #endif // BOOST_MATH_DISTRIBUTIONS_DETAIL_INV_DISCRETE_QUANTILE - diff --git a/boost/math/distributions/exponential.hpp b/boost/math/distributions/exponential.hpp index 62b858c873..bfe7e6b4ac 100644 --- a/boost/math/distributions/exponential.hpp +++ b/boost/math/distributions/exponential.hpp @@ -16,6 +16,7 @@ #ifdef BOOST_MSVC # pragma warning(push) +# pragma warning(disable: 4127) // conditional expression is constant # pragma warning(disable: 4702) // unreachable code (return after domain_error throw). #endif @@ -30,7 +31,7 @@ namespace detail{ template <class RealType, class Policy> inline bool verify_lambda(const char* function, RealType l, RealType* presult, const Policy& pol) { - if(l <= 0) + if((l <= 0) || !(boost::math::isfinite)(l)) { *presult = policies::raise_domain_error<RealType>( function, @@ -43,7 +44,7 @@ inline bool verify_lambda(const char* function, RealType l, RealType* presult, c template <class RealType, class Policy> inline bool verify_exp_x(const char* function, RealType x, RealType* presult, const Policy& pol) { - if(x < 0) + if((x < 0) || (boost::math::isnan)(x)) { *presult = policies::raise_domain_error<RealType>( function, @@ -62,11 +63,11 @@ public: typedef RealType value_type; typedef Policy policy_type; - exponential_distribution(RealType lambda = 1) - : m_lambda(lambda) + exponential_distribution(RealType l_lambda = 1) + : m_lambda(l_lambda) { RealType err; - detail::verify_lambda("boost::math::exponential_distribution<%1%>::exponential_distribution", lambda, &err, Policy()); + detail::verify_lambda("boost::math::exponential_distribution<%1%>::exponential_distribution", l_lambda, &err, Policy()); } // exponential_distribution RealType lambda()const { return m_lambda; } @@ -80,8 +81,15 @@ typedef exponential_distribution<double> exponential; template <class RealType, class Policy> inline const std::pair<RealType, RealType> range(const exponential_distribution<RealType, Policy>& /*dist*/) { // Range of permissible values for random variable x. + if (std::numeric_limits<RealType>::has_infinity) + { + return std::pair<RealType, RealType>(static_cast<RealType>(0), std::numeric_limits<RealType>::infinity()); // 0 to + infinity. + } + else + { using boost::math::tools::max_value; - return std::pair<RealType, RealType>(static_cast<RealType>(0), max_value<RealType>()); + return std::pair<RealType, RealType>(static_cast<RealType>(0), max_value<RealType>()); // 0 to + max + } } template <class RealType, class Policy> @@ -107,6 +115,9 @@ inline RealType pdf(const exponential_distribution<RealType, Policy>& dist, cons return result; if(0 == detail::verify_exp_x(function, x, &result, Policy())) return result; + // Workaround for VC11/12 bug: + if ((boost::math::isinf)(x)) + return 0; result = lambda * exp(-lambda * x); return result; } // pdf @@ -165,6 +176,9 @@ inline RealType cdf(const complemented2_type<exponential_distribution<RealType, return result; if(0 == detail::verify_exp_x(function, c.param, &result, Policy())) return result; + // Workaround for VC11/12 bug: + if (c.param >= tools::max_value<RealType>()) + return 0; result = exp(-c.param * lambda); return result; diff --git a/boost/math/distributions/extreme_value.hpp b/boost/math/distributions/extreme_value.hpp index 3cf94d4b39..ef9fbe817d 100644 --- a/boost/math/distributions/extreme_value.hpp +++ b/boost/math/distributions/extreme_value.hpp @@ -37,11 +37,11 @@ namespace detail{ template <class RealType, class Policy> inline bool verify_scale_b(const char* function, RealType b, RealType* presult, const Policy& pol) { - if(b <= 0) + if((b <= 0) || !(boost::math::isfinite)(b)) { *presult = policies::raise_domain_error<RealType>( function, - "The scale parameter \"b\" must be > 0, but was: %1%.", b, pol); + "The scale parameter \"b\" must be finite and > 0, but was: %1%.", b, pol); return false; } return true; @@ -61,6 +61,7 @@ public: { RealType err; detail::verify_scale_b("boost::math::extreme_value_distribution<%1%>::extreme_value_distribution", b, &err, Policy()); + detail::check_finite("boost::math::extreme_value_distribution<%1%>::extreme_value_distribution", a, &err, Policy()); } // extreme_value_distribution RealType location()const { return m_a; } @@ -76,7 +77,9 @@ template <class RealType, class Policy> inline const std::pair<RealType, RealType> range(const extreme_value_distribution<RealType, Policy>& /*dist*/) { // Range of permissible values for random variable x. using boost::math::tools::max_value; - return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); + return std::pair<RealType, RealType>( + std::numeric_limits<RealType>::has_infinity ? -std::numeric_limits<RealType>::infinity() : -max_value<RealType>(), + std::numeric_limits<RealType>::has_infinity ? std::numeric_limits<RealType>::infinity() : max_value<RealType>()); } template <class RealType, class Policy> @@ -92,10 +95,18 @@ inline RealType pdf(const extreme_value_distribution<RealType, Policy>& dist, co { BOOST_MATH_STD_USING // for ADL of std functions + static const char* function = "boost::math::pdf(const extreme_value_distribution<%1%>&, %1%)"; + RealType a = dist.location(); RealType b = dist.scale(); RealType result = 0; - if(0 == detail::verify_scale_b("boost::math::pdf(const extreme_value_distribution<%1%>&, %1%)", b, &result, Policy())) + if((boost::math::isinf)(x)) + return 0.0f; + if(0 == detail::verify_scale_b(function, b, &result, Policy())) + return result; + if(0 == detail::check_finite(function, a, &result, Policy())) + return result; + if(0 == detail::check_x(function, x, &result, Policy())) return result; result = exp((a-x)/b) * exp(-exp((a-x)/b)) / b; return result; @@ -106,10 +117,20 @@ inline RealType cdf(const extreme_value_distribution<RealType, Policy>& dist, co { BOOST_MATH_STD_USING // for ADL of std functions + static const char* function = "boost::math::cdf(const extreme_value_distribution<%1%>&, %1%)"; + + if((boost::math::isinf)(x)) + return x < 0 ? 0.0f : 1.0f; RealType a = dist.location(); RealType b = dist.scale(); RealType result = 0; - if(0 == detail::verify_scale_b("boost::math::cdf(const extreme_value_distribution<%1%>&, %1%)", b, &result, Policy())) + if(0 == detail::verify_scale_b(function, b, &result, Policy())) + return result; + if(0 == detail::check_finite(function, a, &result, Policy())) + return result; + if(0 == detail::check_finite(function, a, &result, Policy())) + return result; + if(0 == detail::check_x("boost::math::cdf(const extreme_value_distribution<%1%>&, %1%)", x, &result, Policy())) return result; result = exp(-exp((a-x)/b)); @@ -129,6 +150,8 @@ RealType quantile(const extreme_value_distribution<RealType, Policy>& dist, cons RealType result = 0; if(0 == detail::verify_scale_b(function, b, &result, Policy())) return result; + if(0 == detail::check_finite(function, a, &result, Policy())) + return result; if(0 == detail::check_probability(function, p, &result, Policy())) return result; @@ -147,10 +170,18 @@ inline RealType cdf(const complemented2_type<extreme_value_distribution<RealType { BOOST_MATH_STD_USING // for ADL of std functions + static const char* function = "boost::math::cdf(const extreme_value_distribution<%1%>&, %1%)"; + + if((boost::math::isinf)(c.param)) + return c.param < 0 ? 1.0f : 0.0f; RealType a = c.dist.location(); RealType b = c.dist.scale(); RealType result = 0; - if(0 == detail::verify_scale_b("boost::math::cdf(const extreme_value_distribution<%1%>&, %1%)", b, &result, Policy())) + if(0 == detail::verify_scale_b(function, b, &result, Policy())) + return result; + if(0 == detail::check_finite(function, a, &result, Policy())) + return result; + if(0 == detail::check_x(function, c.param, &result, Policy())) return result; result = -boost::math::expm1(-exp((a-c.param)/b), Policy()); @@ -171,6 +202,8 @@ RealType quantile(const complemented2_type<extreme_value_distribution<RealType, RealType result = 0; if(0 == detail::verify_scale_b(function, b, &result, Policy())) return result; + if(0 == detail::check_finite(function, a, &result, Policy())) + return result; if(0 == detail::check_probability(function, q, &result, Policy())) return result; @@ -192,6 +225,8 @@ inline RealType mean(const extreme_value_distribution<RealType, Policy>& dist) RealType result = 0; if(0 == detail::verify_scale_b("boost::math::mean(const extreme_value_distribution<%1%>&)", b, &result, Policy())) return result; + if(0 == detail::check_scale("boost::math::mean(const extreme_value_distribution<%1%>&)", a, &result, Policy())) + return result; return a + constants::euler<RealType>() * b; } @@ -204,6 +239,8 @@ inline RealType standard_deviation(const extreme_value_distribution<RealType, Po RealType result = 0; if(0 == detail::verify_scale_b("boost::math::standard_deviation(const extreme_value_distribution<%1%>&)", b, &result, Policy())) return result; + if(0 == detail::check_scale("boost::math::standard_deviation(const extreme_value_distribution<%1%>&)", dist.location(), &result, Policy())) + return result; return constants::pi<RealType>() * b / sqrt(static_cast<RealType>(6)); } diff --git a/boost/math/distributions/fisher_f.hpp b/boost/math/distributions/fisher_f.hpp index 07bcc81a6a..9e259bcc96 100644 --- a/boost/math/distributions/fisher_f.hpp +++ b/boost/math/distributions/fisher_f.hpp @@ -169,12 +169,12 @@ inline RealType quantile(const fisher_f_distribution<RealType, Policy>& dist, co RealType df2 = dist.degrees_of_freedom2(); // Error check: RealType error_result = 0; - if(false == detail::check_df( + if(false == (detail::check_df( function, df1, &error_result, Policy()) && detail::check_df( function, df2, &error_result, Policy()) && detail::check_probability( - function, p, &error_result, Policy())) + function, p, &error_result, Policy()))) return error_result; // With optimizations turned on, gcc wrongly warns about y being used @@ -231,12 +231,12 @@ inline RealType quantile(const complemented2_type<fisher_f_distribution<RealType RealType p = c.param; // Error check: RealType error_result = 0; - if(false == detail::check_df( + if(false == (detail::check_df( function, df1, &error_result, Policy()) && detail::check_df( function, df2, &error_result, Policy()) && detail::check_probability( - function, p, &error_result, Policy())) + function, p, &error_result, Policy()))) return error_result; RealType x, y; diff --git a/boost/math/distributions/fwd.hpp b/boost/math/distributions/fwd.hpp index 35ccc8cbaa..d2b50ad010 100644 --- a/boost/math/distributions/fwd.hpp +++ b/boost/math/distributions/fwd.hpp @@ -1,6 +1,6 @@ // fwd.hpp Forward declarations of Boost.Math distributions. -// Copyright Paul A. Bristow 2007, 2010. +// Copyright Paul A. Bristow 2007, 2010, 2012. // Copyright John Maddock 2007. // Use, modification and distribution are subject to the @@ -11,6 +11,8 @@ #ifndef BOOST_MATH_DISTRIBUTIONS_FWD_HPP #define BOOST_MATH_DISTRIBUTIONS_FWD_HPP +// 31 distributions at Boost 1.52 + namespace boost{ namespace math{ template <class RealType, class Policy> @@ -44,6 +46,9 @@ template <class RealType, class Policy> class geometric_distribution; template <class RealType, class Policy> +class hyperexponential_distribution; + +template <class RealType, class Policy> class hypergeometric_distribution; template <class RealType, class Policy> @@ -56,9 +61,6 @@ template <class RealType, class Policy> class inverse_gaussian_distribution; template <class RealType, class Policy> -class inverse_uniform_distribution; - -template <class RealType, class Policy> class laplace_distribution; template <class RealType, class Policy> @@ -71,10 +73,10 @@ template <class RealType, class Policy> class negative_binomial_distribution; template <class RealType, class Policy> -class non_central_chi_squared_distribution; +class non_central_beta_distribution; template <class RealType, class Policy> -class non_central_beta_distribution; +class non_central_chi_squared_distribution; template <class RealType, class Policy> class non_central_f_distribution; @@ -95,6 +97,9 @@ template <class RealType, class Policy> class rayleigh_distribution; template <class RealType, class Policy> +class skew_normal_distribution; + +template <class RealType, class Policy> class students_t_distribution; template <class RealType, class Policy> @@ -118,27 +123,27 @@ class weibull_distribution; typedef boost::math::extreme_value_distribution<Type, Policy> extreme_value;\ typedef boost::math::fisher_f_distribution<Type, Policy> fisher_f;\ typedef boost::math::gamma_distribution<Type, Policy> gamma;\ + typedef boost::math::geometric_distribution<Type, Policy> geometric;\ + typedef boost::math::hypergeometric_distribution<Type, Policy> hypergeometric;\ + typedef boost::math::inverse_chi_squared_distribution<Type, Policy> inverse_chi_squared;\ + typedef boost::math::inverse_gaussian_distribution<Type, Policy> inverse_gaussian;\ + typedef boost::math::inverse_gamma_distribution<Type, Policy> inverse_gamma;\ typedef boost::math::laplace_distribution<Type, Policy> laplace;\ typedef boost::math::logistic_distribution<Type, Policy> logistic;\ typedef boost::math::lognormal_distribution<Type, Policy> lognormal;\ typedef boost::math::negative_binomial_distribution<Type, Policy> negative_binomial;\ + typedef boost::math::non_central_beta_distribution<Type, Policy> non_central_beta;\ + typedef boost::math::non_central_chi_squared_distribution<Type, Policy> non_central_chi_squared;\ + typedef boost::math::non_central_f_distribution<Type, Policy> non_central_f;\ + typedef boost::math::non_central_t_distribution<Type, Policy> non_central_t;\ typedef boost::math::normal_distribution<Type, Policy> normal;\ typedef boost::math::pareto_distribution<Type, Policy> pareto;\ typedef boost::math::poisson_distribution<Type, Policy> poisson;\ typedef boost::math::rayleigh_distribution<Type, Policy> rayleigh;\ + typedef boost::math::skew_normal_distribution<Type, Policy> skew_normal;\ typedef boost::math::students_t_distribution<Type, Policy> students_t;\ typedef boost::math::triangular_distribution<Type, Policy> triangular;\ typedef boost::math::uniform_distribution<Type, Policy> uniform;\ - typedef boost::math::weibull_distribution<Type, Policy> weibull;\ - typedef boost::math::non_central_chi_squared_distribution<Type, Policy> non_central_chi_squared;\ - typedef boost::math::non_central_beta_distribution<Type, Policy> non_central_beta;\ - typedef boost::math::non_central_f_distribution<Type, Policy> non_central_f;\ - typedef boost::math::non_central_t_distribution<Type, Policy> non_central_t;\ - typedef boost::math::hypergeometric_distribution<Type, Policy> hypergeometric;\ - typedef boost::math::inverse_uniform_distribution<Type, Policy> inverse_uniform;\ - typedef boost::math::geometric_distribution<Type, Policy> geometric;\ - typedef boost::math::inverse_chi_squared_distribution<Type, Policy> inverse_chi_squared;\ - typedef boost::math::inverse_gamma_distribution<Type, Policy> inverse_gamma;\ - typedef boost::math::inverse_gaussian_distribution<Type, Policy> inverse_gaussian;\ + typedef boost::math::weibull_distribution<Type, Policy> weibull; #endif // BOOST_MATH_DISTRIBUTIONS_FWD_HPP diff --git a/boost/math/distributions/gamma.hpp b/boost/math/distributions/gamma.hpp index c15973bac0..9a9e2a4f52 100644 --- a/boost/math/distributions/gamma.hpp +++ b/boost/math/distributions/gamma.hpp @@ -73,11 +73,11 @@ public: typedef RealType value_type; typedef Policy policy_type; - gamma_distribution(RealType shape, RealType scale = 1) - : m_shape(shape), m_scale(scale) + gamma_distribution(RealType l_shape, RealType l_scale = 1) + : m_shape(l_shape), m_scale(l_scale) { RealType result; - detail::check_gamma("boost::math::gamma_distribution<%1%>::gamma_distribution", scale, shape, &result, Policy()); + detail::check_gamma("boost::math::gamma_distribution<%1%>::gamma_distribution", l_scale, l_shape, &result, Policy()); } RealType shape()const diff --git a/boost/math/distributions/geometric.hpp b/boost/math/distributions/geometric.hpp index 51e55e69fa..88947d6c57 100644 --- a/boost/math/distributions/geometric.hpp +++ b/boost/math/distributions/geometric.hpp @@ -372,8 +372,8 @@ namespace boost //RealType q = 1 - p; // Bad for small p //RealType probability = 1 - std::pow(q, k+1); - RealType z = boost::math::log1p(-p) * (k+1); - RealType probability = -boost::math::expm1(z); + RealType z = boost::math::log1p(-p, Policy()) * (k + 1); + RealType probability = -boost::math::expm1(z, Policy()); return probability; } // cdf Cumulative Distribution Function geometric. @@ -398,7 +398,7 @@ namespace boost { return result; } - RealType z = boost::math::log1p(-p) * (k+1); + RealType z = boost::math::log1p(-p, Policy()) * (k+1); RealType probability = exp(z); return probability; } // cdf Complemented Cumulative Distribution Function geometric. @@ -448,7 +448,7 @@ namespace boost } // log(1-x) /log(1-success_fraction) -1; but use log1p in case success_fraction is small - result = boost::math::log1p(-x) / boost::math::log1p(-success_fraction) -1; + result = boost::math::log1p(-x, Policy()) / boost::math::log1p(-success_fraction, Policy()) - 1; // Subtract a few epsilons here too? // to make sure it doesn't slip over, so ceil would be one too many. return result; @@ -496,7 +496,7 @@ namespace boost // unless #define BOOST_MATH_THROW_ON_OVERFLOW_ERROR } // log(x) /log(1-success_fraction) -1; but use log1p in case success_fraction is small - result = log(x) / boost::math::log1p(-success_fraction) -1; + result = log(x) / boost::math::log1p(-success_fraction, Policy()) - 1; return result; } // quantile complement diff --git a/boost/math/distributions/hyperexponential.hpp b/boost/math/distributions/hyperexponential.hpp new file mode 100644 index 0000000000..4ed281c662 --- /dev/null +++ b/boost/math/distributions/hyperexponential.hpp @@ -0,0 +1,634 @@ +// Copyright 2014 Marco Guazzone (marco.guazzone@gmail.com) +// +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) +// +// This module implements the Hyper-Exponential distribution. +// +// References: +// - "Queueing Theory in Manufacturing Systems Analysis and Design" by H.T. Papadopolous, C. Heavey and J. Browne (Chapman & Hall/CRC, 1993) +// - http://reference.wolfram.com/language/ref/HyperexponentialDistribution.html +// - http://en.wikipedia.org/wiki/Hyperexponential_distribution +// + +#ifndef BOOST_MATH_DISTRIBUTIONS_HYPEREXPONENTIAL_HPP +#define BOOST_MATH_DISTRIBUTIONS_HYPEREXPONENTIAL_HPP + + +#include <boost/config.hpp> +#include <boost/math/distributions/complement.hpp> +#include <boost/math/distributions/detail/common_error_handling.hpp> +#include <boost/math/distributions/exponential.hpp> +#include <boost/math/policies/policy.hpp> +#include <boost/math/special_functions/fpclassify.hpp> +#include <boost/math/tools/precision.hpp> +#include <boost/math/tools/roots.hpp> +#include <boost/range/begin.hpp> +#include <boost/range/end.hpp> +#include <boost/range/size.hpp> +#include <boost/type_traits/has_pre_increment.hpp> +#include <cstddef> +#include <iterator> +#include <limits> +#include <numeric> +#include <utility> +#include <vector> + +#if !defined(BOOST_NO_CXX11_HDR_INITIALIZER_LIST) +# include <initializer_list> +#endif + +#ifdef _MSC_VER +# pragma warning (push) +# pragma warning(disable:4127) // conditional expression is constant +# pragma warning(disable:4389) // '==' : signed/unsigned mismatch in test_tools +#endif // _MSC_VER + +namespace boost { namespace math { + +namespace detail { + +template <typename Dist> +typename Dist::value_type generic_quantile(const Dist& dist, const typename Dist::value_type& p, const typename Dist::value_type& guess, bool comp, const char* function); + +} // Namespace detail + + +template <typename RealT, typename PolicyT> +class hyperexponential_distribution; + + +namespace /*<unnamed>*/ { namespace hyperexp_detail { + +template <typename T> +void normalize(std::vector<T>& v) +{ + if(!v.size()) + return; // Our error handlers will get this later + const T sum = std::accumulate(v.begin(), v.end(), static_cast<T>(0)); + T final_sum = 0; + const typename std::vector<T>::iterator end = --v.end(); + for (typename std::vector<T>::iterator it = v.begin(); + it != end; + ++it) + { + *it /= sum; + final_sum += *it; + } + *end = 1 - final_sum; // avoids round off errors, ensures the probs really do sum to 1. +} + +template <typename RealT, typename PolicyT> +bool check_probabilities(char const* function, std::vector<RealT> const& probabilities, RealT* presult, PolicyT const& pol) +{ + BOOST_MATH_STD_USING + const std::size_t n = probabilities.size(); + RealT sum = 0; + for (std::size_t i = 0; i < n; ++i) + { + if (probabilities[i] < 0 + || probabilities[i] > 1 + || !(boost::math::isfinite)(probabilities[i])) + { + *presult = policies::raise_domain_error<RealT>(function, + "The elements of parameter \"probabilities\" must be >= 0 and <= 1, but at least one of them was: %1%.", + probabilities[i], + pol); + return false; + } + sum += probabilities[i]; + } + + // + // We try to keep phase probabilities correctly normalized in the distribution constructors, + // however in practice we have to allow for a very slight divergence from a sum of exactly 1: + // + if (fabs(sum - 1) > tools::epsilon<RealT>() * 2) + { + *presult = policies::raise_domain_error<RealT>(function, + "The elements of parameter \"probabilities\" must sum to 1, but their sum is: %1%.", + sum, + pol); + return false; + } + + return true; +} + +template <typename RealT, typename PolicyT> +bool check_rates(char const* function, std::vector<RealT> const& rates, RealT* presult, PolicyT const& pol) +{ + const std::size_t n = rates.size(); + for (std::size_t i = 0; i < n; ++i) + { + if (rates[i] <= 0 + || !(boost::math::isfinite)(rates[i])) + { + *presult = policies::raise_domain_error<RealT>(function, + "The elements of parameter \"rates\" must be > 0, but at least one of them is: %1%.", + rates[i], + pol); + return false; + } + } + return true; +} + +template <typename RealT, typename PolicyT> +bool check_dist(char const* function, std::vector<RealT> const& probabilities, std::vector<RealT> const& rates, RealT* presult, PolicyT const& pol) +{ + BOOST_MATH_STD_USING + if (probabilities.size() != rates.size()) + { + *presult = policies::raise_domain_error<RealT>(function, + "The parameters \"probabilities\" and \"rates\" must have the same length, but their size differ by: %1%.", + fabs(static_cast<RealT>(probabilities.size())-static_cast<RealT>(rates.size())), + pol); + return false; + } + + return check_probabilities(function, probabilities, presult, pol) + && check_rates(function, rates, presult, pol); +} + +template <typename RealT, typename PolicyT> +bool check_x(char const* function, RealT x, RealT* presult, PolicyT const& pol) +{ + if (x < 0 || (boost::math::isnan)(x)) + { + *presult = policies::raise_domain_error<RealT>(function, "The random variable must be >= 0, but is: %1%.", x, pol); + return false; + } + return true; +} + +template <typename RealT, typename PolicyT> +bool check_probability(char const* function, RealT p, RealT* presult, PolicyT const& pol) +{ + if (p < 0 || p > 1 || (boost::math::isnan)(p)) + { + *presult = policies::raise_domain_error<RealT>(function, "The probability be >= 0 and <= 1, but is: %1%.", p, pol); + return false; + } + return true; +} + +template <typename RealT, typename PolicyT> +RealT quantile_impl(hyperexponential_distribution<RealT, PolicyT> const& dist, RealT const& p, bool comp) +{ + // Don't have a closed form so try to numerically solve the inverse CDF... + + typedef typename policies::evaluation<RealT, PolicyT>::type value_type; + typedef typename policies::normalise<PolicyT, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + static const char* function = comp ? "boost::math::quantile(const boost::math::complemented2_type<boost::math::hyperexponential_distribution<%1%>, %1%>&)" + : "boost::math::quantile(const boost::math::hyperexponential_distribution<%1%>&, %1%)"; + + RealT result = 0; + + if (!check_probability(function, p, &result, PolicyT())) + { + return result; + } + + const std::size_t n = dist.num_phases(); + const std::vector<RealT> probs = dist.probabilities(); + const std::vector<RealT> rates = dist.rates(); + + // A possible (but inaccurate) approximation is given below, where the + // quantile is given by the weighted sum of exponential quantiles: + RealT guess = 0; + if (comp) + { + for (std::size_t i = 0; i < n; ++i) + { + const exponential_distribution<RealT,PolicyT> exp(rates[i]); + + guess += probs[i]*quantile(complement(exp, p)); + } + } + else + { + for (std::size_t i = 0; i < n; ++i) + { + const exponential_distribution<RealT,PolicyT> exp(rates[i]); + + guess += probs[i]*quantile(exp, p); + } + } + + // Fast return in case the Hyper-Exponential is essentially an Exponential + if (n == 1) + { + return guess; + } + + value_type q; + q = detail::generic_quantile(hyperexponential_distribution<RealT,forwarding_policy>(probs, rates), + p, + guess, + comp, + function); + + result = policies::checked_narrowing_cast<RealT,forwarding_policy>(q, function); + + return result; +} + +}} // Namespace <unnamed>::hyperexp_detail + + +template <typename RealT = double, typename PolicyT = policies::policy<> > +class hyperexponential_distribution +{ + public: typedef RealT value_type; + public: typedef PolicyT policy_type; + + + public: hyperexponential_distribution() + : probs_(1, 1), + rates_(1, 1) + { + RealT err; + hyperexp_detail::check_dist("boost::math::hyperexponential_distribution<%1%>::hyperexponential_distribution", + probs_, + rates_, + &err, + PolicyT()); + } + + // Four arg constructor: no ambiguity here, the arguments must be two pairs of iterators: + public: template <typename ProbIterT, typename RateIterT> + hyperexponential_distribution(ProbIterT prob_first, ProbIterT prob_last, + RateIterT rate_first, RateIterT rate_last) + : probs_(prob_first, prob_last), + rates_(rate_first, rate_last) + { + hyperexp_detail::normalize(probs_); + RealT err; + hyperexp_detail::check_dist("boost::math::hyperexponential_distribution<%1%>::hyperexponential_distribution", + probs_, + rates_, + &err, + PolicyT()); + } + + // Two arg constructor from 2 ranges, we SFINAE this out of existance if + // either argument type is incrementable as in that case the type is + // probably an iterator: + public: template <typename ProbRangeT, typename RateRangeT> + hyperexponential_distribution(ProbRangeT const& prob_range, + RateRangeT const& rate_range, + typename boost::disable_if_c<boost::has_pre_increment<ProbRangeT>::value || boost::has_pre_increment<RateRangeT>::value>::type* = 0) + : probs_(boost::begin(prob_range), boost::end(prob_range)), + rates_(boost::begin(rate_range), boost::end(rate_range)) + { + hyperexp_detail::normalize(probs_); + + RealT err; + hyperexp_detail::check_dist("boost::math::hyperexponential_distribution<%1%>::hyperexponential_distribution", + probs_, + rates_, + &err, + PolicyT()); + } + + // Two arg constructor for a pair of iterators: we SFINAE this out of + // existance if neither argument types are incrementable. + // Note that we allow different argument types here to allow for + // construction from an array plus a pointer into that array. + public: template <typename RateIterT, typename RateIterT2> + hyperexponential_distribution(RateIterT const& rate_first, + RateIterT2 const& rate_last, + typename boost::enable_if_c<boost::has_pre_increment<RateIterT>::value || boost::has_pre_increment<RateIterT2>::value>::type* = 0) + : probs_(std::distance(rate_first, rate_last), 1), // will be normalized below + rates_(rate_first, rate_last) + { + hyperexp_detail::normalize(probs_); + + RealT err; + hyperexp_detail::check_dist("boost::math::hyperexponential_distribution<%1%>::hyperexponential_distribution", + probs_, + rates_, + &err, + PolicyT()); + } + +#if !defined(BOOST_NO_CXX11_HDR_INITIALIZER_LIST) + // Initializer list constructor: allows for construction from array literals: +public: hyperexponential_distribution(std::initializer_list<RealT> l1, std::initializer_list<RealT> l2) + : probs_(l1.begin(), l1.end()), + rates_(l2.begin(), l2.end()) + { + hyperexp_detail::normalize(probs_); + + RealT err; + hyperexp_detail::check_dist("boost::math::hyperexponential_distribution<%1%>::hyperexponential_distribution", + probs_, + rates_, + &err, + PolicyT()); + } + +public: hyperexponential_distribution(std::initializer_list<RealT> l1) + : probs_(l1.size(), 1), + rates_(l1.begin(), l1.end()) + { + hyperexp_detail::normalize(probs_); + + RealT err; + hyperexp_detail::check_dist("boost::math::hyperexponential_distribution<%1%>::hyperexponential_distribution", + probs_, + rates_, + &err, + PolicyT()); + } +#endif // !defined(BOOST_NO_CXX11_HDR_INITIALIZER_LIST) + + // Single argument constructor: argument must be a range. + public: template <typename RateRangeT> + hyperexponential_distribution(RateRangeT const& rate_range) + : probs_(boost::size(rate_range), 1), // will be normalized below + rates_(boost::begin(rate_range), boost::end(rate_range)) + { + hyperexp_detail::normalize(probs_); + + RealT err; + hyperexp_detail::check_dist("boost::math::hyperexponential_distribution<%1%>::hyperexponential_distribution", + probs_, + rates_, + &err, + PolicyT()); + } + + public: std::vector<RealT> probabilities() const + { + return probs_; + } + + public: std::vector<RealT> rates() const + { + return rates_; + } + + public: std::size_t num_phases() const + { + return rates_.size(); + } + + + private: std::vector<RealT> probs_; + private: std::vector<RealT> rates_; +}; // class hyperexponential_distribution + + +// Convenient type synonym for double. +typedef hyperexponential_distribution<double> hyperexponential; + + +// Range of permissible values for random variable x +template <typename RealT, typename PolicyT> +std::pair<RealT,RealT> range(hyperexponential_distribution<RealT,PolicyT> const&) +{ + if (std::numeric_limits<RealT>::has_infinity) + { + return std::make_pair(static_cast<RealT>(0), std::numeric_limits<RealT>::infinity()); // 0 to +inf. + } + + return std::make_pair(static_cast<RealT>(0), tools::max_value<RealT>()); // 0 to +<max value> +} + +// Range of supported values for random variable x. +// This is range where cdf rises from 0 to 1, and outside it, the pdf is zero. +template <typename RealT, typename PolicyT> +std::pair<RealT,RealT> support(hyperexponential_distribution<RealT,PolicyT> const&) +{ + return std::make_pair(tools::min_value<RealT>(), tools::max_value<RealT>()); // <min value> to +<max value>. +} + +template <typename RealT, typename PolicyT> +RealT pdf(hyperexponential_distribution<RealT, PolicyT> const& dist, RealT const& x) +{ + BOOST_MATH_STD_USING + RealT result = 0; + + if (!hyperexp_detail::check_x("boost::math::pdf(const boost::math::hyperexponential_distribution<%1%>&, %1%)", x, &result, PolicyT())) + { + return result; + } + + const std::size_t n = dist.num_phases(); + const std::vector<RealT> probs = dist.probabilities(); + const std::vector<RealT> rates = dist.rates(); + + for (std::size_t i = 0; i < n; ++i) + { + const exponential_distribution<RealT,PolicyT> exp(rates[i]); + + result += probs[i]*pdf(exp, x); + //result += probs[i]*rates[i]*exp(-rates[i]*x); + } + + return result; +} + +template <typename RealT, typename PolicyT> +RealT cdf(hyperexponential_distribution<RealT, PolicyT> const& dist, RealT const& x) +{ + RealT result = 0; + + if (!hyperexp_detail::check_x("boost::math::cdf(const boost::math::hyperexponential_distribution<%1%>&, %1%)", x, &result, PolicyT())) + { + return result; + } + + const std::size_t n = dist.num_phases(); + const std::vector<RealT> probs = dist.probabilities(); + const std::vector<RealT> rates = dist.rates(); + + for (std::size_t i = 0; i < n; ++i) + { + const exponential_distribution<RealT,PolicyT> exp(rates[i]); + + result += probs[i]*cdf(exp, x); + } + + return result; +} + +template <typename RealT, typename PolicyT> +RealT quantile(hyperexponential_distribution<RealT, PolicyT> const& dist, RealT const& p) +{ + return hyperexp_detail::quantile_impl(dist, p , false); +} + +template <typename RealT, typename PolicyT> +RealT cdf(complemented2_type<hyperexponential_distribution<RealT,PolicyT>, RealT> const& c) +{ + RealT const& x = c.param; + hyperexponential_distribution<RealT,PolicyT> const& dist = c.dist; + + RealT result = 0; + + if (!hyperexp_detail::check_x("boost::math::cdf(boost::math::complemented2_type<const boost::math::hyperexponential_distribution<%1%>&, %1%>)", x, &result, PolicyT())) + { + return result; + } + + const std::size_t n = dist.num_phases(); + const std::vector<RealT> probs = dist.probabilities(); + const std::vector<RealT> rates = dist.rates(); + + for (std::size_t i = 0; i < n; ++i) + { + const exponential_distribution<RealT,PolicyT> exp(rates[i]); + + result += probs[i]*cdf(complement(exp, x)); + } + + return result; +} + + +template <typename RealT, typename PolicyT> +RealT quantile(complemented2_type<hyperexponential_distribution<RealT, PolicyT>, RealT> const& c) +{ + RealT const& p = c.param; + hyperexponential_distribution<RealT,PolicyT> const& dist = c.dist; + + return hyperexp_detail::quantile_impl(dist, p , true); +} + +template <typename RealT, typename PolicyT> +RealT mean(hyperexponential_distribution<RealT, PolicyT> const& dist) +{ + RealT result = 0; + + const std::size_t n = dist.num_phases(); + const std::vector<RealT> probs = dist.probabilities(); + const std::vector<RealT> rates = dist.rates(); + + for (std::size_t i = 0; i < n; ++i) + { + const exponential_distribution<RealT,PolicyT> exp(rates[i]); + + result += probs[i]*mean(exp); + } + + return result; +} + +template <typename RealT, typename PolicyT> +RealT variance(hyperexponential_distribution<RealT, PolicyT> const& dist) +{ + RealT result = 0; + + const std::size_t n = dist.num_phases(); + const std::vector<RealT> probs = dist.probabilities(); + const std::vector<RealT> rates = dist.rates(); + + for (std::size_t i = 0; i < n; ++i) + { + result += probs[i]/(rates[i]*rates[i]); + } + + const RealT mean = boost::math::mean(dist); + + result = 2*result-mean*mean; + + return result; +} + +template <typename RealT, typename PolicyT> +RealT skewness(hyperexponential_distribution<RealT,PolicyT> const& dist) +{ + BOOST_MATH_STD_USING + const std::size_t n = dist.num_phases(); + const std::vector<RealT> probs = dist.probabilities(); + const std::vector<RealT> rates = dist.rates(); + + RealT s1 = 0; // \sum_{i=1}^n \frac{p_i}{\lambda_i} + RealT s2 = 0; // \sum_{i=1}^n \frac{p_i}{\lambda_i^2} + RealT s3 = 0; // \sum_{i=1}^n \frac{p_i}{\lambda_i^3} + for (std::size_t i = 0; i < n; ++i) + { + const RealT p = probs[i]; + const RealT r = rates[i]; + const RealT r2 = r*r; + const RealT r3 = r2*r; + + s1 += p/r; + s2 += p/r2; + s3 += p/r3; + } + + const RealT s1s1 = s1*s1; + + const RealT num = (6*s3 - (3*(2*s2 - s1s1) + s1s1)*s1); + const RealT den = (2*s2 - s1s1); + + return num / pow(den, static_cast<RealT>(1.5)); +} + +template <typename RealT, typename PolicyT> +RealT kurtosis(hyperexponential_distribution<RealT,PolicyT> const& dist) +{ + const std::size_t n = dist.num_phases(); + const std::vector<RealT> probs = dist.probabilities(); + const std::vector<RealT> rates = dist.rates(); + + RealT s1 = 0; // \sum_{i=1}^n \frac{p_i}{\lambda_i} + RealT s2 = 0; // \sum_{i=1}^n \frac{p_i}{\lambda_i^2} + RealT s3 = 0; // \sum_{i=1}^n \frac{p_i}{\lambda_i^3} + RealT s4 = 0; // \sum_{i=1}^n \frac{p_i}{\lambda_i^4} + for (std::size_t i = 0; i < n; ++i) + { + const RealT p = probs[i]; + const RealT r = rates[i]; + const RealT r2 = r*r; + const RealT r3 = r2*r; + const RealT r4 = r3*r; + + s1 += p/r; + s2 += p/r2; + s3 += p/r3; + s4 += p/r4; + } + + const RealT s1s1 = s1*s1; + + const RealT num = (24*s4 - 24*s3*s1 + 3*(2*(2*s2 - s1s1) + s1s1)*s1s1); + const RealT den = (2*s2 - s1s1); + + return num/(den*den); +} + +template <typename RealT, typename PolicyT> +RealT kurtosis_excess(hyperexponential_distribution<RealT,PolicyT> const& dist) +{ + return kurtosis(dist) - 3; +} + +template <typename RealT, typename PolicyT> +RealT mode(hyperexponential_distribution<RealT,PolicyT> const& /*dist*/) +{ + return 0; +} + +}} // namespace boost::math + +#ifdef BOOST_MSVC +#pragma warning (pop) +#endif +// This include must be at the end, *after* the accessors +// for this distribution have been defined, in order to +// keep compilers that support two-phase lookup happy. +#include <boost/math/distributions/detail/derived_accessors.hpp> +#include <boost/math/distributions/detail/generic_quantile.hpp> + +#endif // BOOST_MATH_DISTRIBUTIONS_HYPEREXPONENTIAL diff --git a/boost/math/distributions/hypergeometric.hpp b/boost/math/distributions/hypergeometric.hpp index e30d438f31..5d1ebc7388 100644 --- a/boost/math/distributions/hypergeometric.hpp +++ b/boost/math/distributions/hypergeometric.hpp @@ -136,7 +136,7 @@ namespace boost { namespace math { BOOST_MATH_STD_USING static const char* function = "boost::math::pdf(const hypergeometric_distribution<%1%>&, const %1%&)"; RealType r = static_cast<RealType>(x); - unsigned u = itrunc(r); + unsigned u = itrunc(r, typename policies::normalise<Policy, policies::rounding_error<policies::ignore_error> >::type()); if(u != r) { return boost::math::policies::raise_domain_error<RealType>( @@ -165,7 +165,7 @@ namespace boost { namespace math { BOOST_MATH_STD_USING static const char* function = "boost::math::cdf(const hypergeometric_distribution<%1%>&, const %1%&)"; RealType r = static_cast<RealType>(x); - unsigned u = itrunc(r); + unsigned u = itrunc(r, typename policies::normalise<Policy, policies::rounding_error<policies::ignore_error> >::type()); if(u != r) { return boost::math::policies::raise_domain_error<RealType>( @@ -194,7 +194,7 @@ namespace boost { namespace math { BOOST_MATH_STD_USING static const char* function = "boost::math::cdf(const hypergeometric_distribution<%1%>&, const %1%&)"; RealType r = static_cast<RealType>(c.param); - unsigned u = itrunc(r); + unsigned u = itrunc(r, typename policies::normalise<Policy, policies::rounding_error<policies::ignore_error> >::type()); if(u != r) { return boost::math::policies::raise_domain_error<RealType>( diff --git a/boost/math/distributions/inverse_chi_squared.hpp b/boost/math/distributions/inverse_chi_squared.hpp index 8fc13e39e7..c1e54905da 100644 --- a/boost/math/distributions/inverse_chi_squared.hpp +++ b/boost/math/distributions/inverse_chi_squared.hpp @@ -51,7 +51,7 @@ public: typedef RealType value_type; typedef Policy policy_type; - inverse_chi_squared_distribution(RealType df, RealType scale) : m_df(df), m_scale (scale) + inverse_chi_squared_distribution(RealType df, RealType l_scale) : m_df(df), m_scale (l_scale) { RealType result; detail::check_df( diff --git a/boost/math/distributions/inverse_gamma.hpp b/boost/math/distributions/inverse_gamma.hpp index 88083e084f..fa5d357ac7 100644 --- a/boost/math/distributions/inverse_gamma.hpp +++ b/boost/math/distributions/inverse_gamma.hpp @@ -91,13 +91,13 @@ public: typedef RealType value_type; typedef Policy policy_type; - inverse_gamma_distribution(RealType shape = 1, RealType scale = 1) - : m_shape(shape), m_scale(scale) + inverse_gamma_distribution(RealType l_shape = 1, RealType l_scale = 1) + : m_shape(l_shape), m_scale(l_scale) { RealType result; detail::check_inverse_gamma( "boost::math::inverse_gamma_distribution<%1%>::inverse_gamma_distribution", - scale, shape, &result, Policy()); + l_scale, l_shape, &result, Policy()); } RealType shape()const @@ -259,6 +259,9 @@ inline RealType cdf(const complemented2_type<inverse_gamma_distribution<RealType if(false == detail::check_inverse_gamma_x(function, c.param, &result, Policy())) return result; + if(c.param == 0) + return 1; // Avoid division by zero + //result = 1. - gamma_q(shape, c.param / scale, Policy()); result = gamma_p(shape, scale/c.param, Policy()); return result; diff --git a/boost/math/distributions/inverse_gaussian.hpp b/boost/math/distributions/inverse_gaussian.hpp index 67c1b4109c..eeca12ad48 100644 --- a/boost/math/distributions/inverse_gaussian.hpp +++ b/boost/math/distributions/inverse_gaussian.hpp @@ -74,14 +74,14 @@ public: typedef RealType value_type; typedef Policy policy_type; - inverse_gaussian_distribution(RealType mean = 1, RealType scale = 1) - : m_mean(mean), m_scale(scale) + inverse_gaussian_distribution(RealType l_mean = 1, RealType l_scale = 1) + : m_mean(l_mean), m_scale(l_scale) { // Default is a 1,1 inverse_gaussian distribution. static const char* function = "boost::math::inverse_gaussian_distribution<%1%>::inverse_gaussian_distribution"; RealType result; - detail::check_scale(function, scale, &result, Policy()); - detail::check_location(function, mean, &result, Policy()); + detail::check_scale(function, l_scale, &result, Policy()); + detail::check_location(function, l_mean, &result, Policy()); } RealType mean()const @@ -207,11 +207,11 @@ inline RealType cdf(const inverse_gaussian_distribution<RealType, Policy>& dist, return result; } // cdf -template <class RealType> +template <class RealType, class Policy> struct inverse_gaussian_quantile_functor { - inverse_gaussian_quantile_functor(const boost::math::inverse_gaussian_distribution<RealType> dist, RealType const& p) + inverse_gaussian_quantile_functor(const boost::math::inverse_gaussian_distribution<RealType, Policy> dist, RealType const& p) : distribution(dist), prob(p) { } @@ -224,14 +224,14 @@ struct inverse_gaussian_quantile_functor return boost::math::make_tuple(fx, dx); } private: - const boost::math::inverse_gaussian_distribution<RealType> distribution; + const boost::math::inverse_gaussian_distribution<RealType, Policy> distribution; RealType prob; }; -template <class RealType> +template <class RealType, class Policy> struct inverse_gaussian_quantile_complement_functor { - inverse_gaussian_quantile_complement_functor(const boost::math::inverse_gaussian_distribution<RealType> dist, RealType const& p) + inverse_gaussian_quantile_complement_functor(const boost::math::inverse_gaussian_distribution<RealType, Policy> dist, RealType const& p) : distribution(dist), prob(p) { } @@ -245,7 +245,7 @@ struct inverse_gaussian_quantile_complement_functor return boost::math::make_tuple(fx, dx); } private: - const boost::math::inverse_gaussian_distribution<RealType> distribution; + const boost::math::inverse_gaussian_distribution<RealType, Policy> distribution; RealType prob; }; @@ -286,7 +286,7 @@ namespace detail // Define the distribution, using gamma_nooverflow: typedef gamma_distribution<RealType, no_overthrow_policy> gamma_nooverflow; - gamma_distribution<RealType, no_overthrow_policy> g(static_cast<RealType>(0.5), static_cast<RealType>(1.)); + gamma_nooverflow g(static_cast<RealType>(0.5), static_cast<RealType>(1.)); // gamma_nooverflow g(static_cast<RealType>(0.5), static_cast<RealType>(1.)); // R qgamma(0.2, 0.5, 1) 0.0320923 @@ -347,7 +347,7 @@ inline RealType quantile(const inverse_gaussian_distribution<RealType, Policy>& boost::uintmax_t m = policies::get_max_root_iterations<Policy>(); // and max iterations. using boost::math::tools::newton_raphson_iterate; result = - newton_raphson_iterate(inverse_gaussian_quantile_functor<RealType>(dist, p), guess, min, max, get_digits, m); + newton_raphson_iterate(inverse_gaussian_quantile_functor<RealType, Policy>(dist, p), guess, min, max, get_digits, m); return result; } // quantile @@ -380,7 +380,7 @@ inline RealType cdf(const complemented2_type<inverse_gaussian_distribution<RealT return result; if(false == detail::check_location(function, mean, &result, Policy())) return result; - if(false == detail::check_x(function, x, &result, Policy())) + if(false == detail::check_positive_x(function, x, &result, Policy())) return result; normal_distribution<RealType> n01; @@ -428,7 +428,7 @@ inline RealType quantile(const complemented2_type<inverse_gaussian_distribution< boost::uintmax_t m = policies::get_max_root_iterations<Policy>(); using boost::math::tools::newton_raphson_iterate; result = - newton_raphson_iterate(inverse_gaussian_quantile_complement_functor<RealType>(c.dist, q), guess, min, max, get_digits, m); + newton_raphson_iterate(inverse_gaussian_quantile_complement_functor<RealType, Policy>(c.dist, q), guess, min, max, get_digits, m); return result; } // quantile diff --git a/boost/math/distributions/laplace.hpp b/boost/math/distributions/laplace.hpp index a872b16839..09b24c868b 100644 --- a/boost/math/distributions/laplace.hpp +++ b/boost/math/distributions/laplace.hpp @@ -1,6 +1,6 @@ // Copyright Thijs van den Berg, 2008. // Copyright John Maddock 2008. -// Copyright Paul A. Bristow 2008. +// Copyright Paul A. Bristow 2008, 2014. // Use, modification and distribution are subject to the // Boost Software License, Version 1.0. (See accompanying file @@ -24,6 +24,11 @@ namespace boost{ namespace math{ +#ifdef BOOST_MSVC +# pragma warning(push) +# pragma warning(disable:4127) // conditional expression is constant +#endif + template <class RealType = double, class Policy = policies::policy<> > class laplace_distribution { @@ -37,8 +42,8 @@ public: // ---------------------------------- // Constructor(s) // ---------------------------------- - laplace_distribution(RealType location = 0, RealType scale = 1) - : m_location(location), m_scale(scale) + laplace_distribution(RealType l_location = 0, RealType l_scale = 1) + : m_location(l_location), m_scale(l_scale) { RealType result; check_parameters("boost::math::laplace_distribution<%1%>::laplace_distribution()", &result); @@ -72,23 +77,38 @@ private: }; // class laplace_distribution // -// Convenient type synonym for double +// Convenient type synonym for double. typedef laplace_distribution<double> laplace; // -// Non member functions +// Non-member functions. template <class RealType, class Policy> inline const std::pair<RealType, RealType> range(const laplace_distribution<RealType, Policy>&) { - using boost::math::tools::max_value; - return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); + if (std::numeric_limits<RealType>::has_infinity) + { // Can use infinity. + return std::pair<RealType, RealType>(-std::numeric_limits<RealType>::infinity(), std::numeric_limits<RealType>::infinity()); // - to + infinity. + } + else + { // Can only use max_value. + using boost::math::tools::max_value; + return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + max value. + } + } template <class RealType, class Policy> inline const std::pair<RealType, RealType> support(const laplace_distribution<RealType, Policy>&) { - using boost::math::tools::max_value; - return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); + if (std::numeric_limits<RealType>::has_infinity) + { // Can Use infinity. + return std::pair<RealType, RealType>(-std::numeric_limits<RealType>::infinity(), std::numeric_limits<RealType>::infinity()); // - to + infinity. + } + else + { // Can only use max_value. + using boost::math::tools::max_value; + return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + max value. + } } template <class RealType, class Policy> @@ -99,12 +119,15 @@ inline RealType pdf(const laplace_distribution<RealType, Policy>& dist, const Re // Checking function argument RealType result = 0; const char* function = "boost::math::pdf(const laplace_distribution<%1%>&, %1%))"; - if (false == dist.check_parameters(function, &result)) return result; - if (false == detail::check_x(function, x, &result, Policy())) return result; - // Special pdf values + // Check scale and location. + if (false == dist.check_parameters(function, &result)) return result; + // Special pdf values. if((boost::math::isinf)(x)) + { return 0; // pdf + and - infinity is zero. + } + if (false == detail::check_x(function, x, &result, Policy())) return result; // General case RealType scale( dist.scale() ); @@ -123,20 +146,21 @@ inline RealType pdf(const laplace_distribution<RealType, Policy>& dist, const Re template <class RealType, class Policy> inline RealType cdf(const laplace_distribution<RealType, Policy>& dist, const RealType& x) { - BOOST_MATH_STD_USING // for ADL of std functions + BOOST_MATH_STD_USING // For ADL of std functions. - // Checking function argument RealType result = 0; + // Checking function argument. const char* function = "boost::math::cdf(const laplace_distribution<%1%>&, %1%)"; + // Check scale and location. if (false == dist.check_parameters(function, &result)) return result; - if (false == detail::check_x(function, x, &result, Policy())) return result; // Special cdf values: if((boost::math::isinf)(x)) { - if(x < 0) return 0; // -infinity - return 1; // + infinity + if(x < 0) return 0; // -infinity. + return 1; // + infinity. } + if (false == detail::check_x(function, x, &result, Policy())) return result; // General cdf values RealType scale( dist.scale() ); @@ -195,25 +219,29 @@ inline RealType quantile(const laplace_distribution<RealType, Policy>& dist, con template <class RealType, class Policy> inline RealType cdf(const complemented2_type<laplace_distribution<RealType, Policy>, RealType>& c) { + // Calculate complement of cdf. BOOST_MATH_STD_USING // for ADL of std functions RealType scale = c.dist.scale(); RealType location = c.dist.location(); RealType x = c.param; - - // Checking function argument RealType result = 0; + + // Checking function argument. const char* function = "boost::math::cdf(const complemented2_type<laplace_distribution<%1%>, %1%>&)"; - if(false == detail::check_x(function, x, &result, Policy()))return result; - // Calculate complement of cdf. + // Check scale and location. + //if(false == detail::check_scale(function, scale, result, Policy())) return false; + //if(false == detail::check_location(function, location, result, Policy())) return false; + if (false == c.dist.check_parameters(function, &result)) return result; - // Special cdf value + // Special cdf values. if((boost::math::isinf)(x)) { if(x < 0) return 1; // cdf complement -infinity is unity. return 0; // cdf complement +infinity is zero. } + if(false == detail::check_x(function, x, &result, Policy()))return result; // Cdf interval value. if (-x < -location) @@ -237,17 +265,23 @@ inline RealType quantile(const complemented2_type<laplace_distribution<RealType, RealType scale = c.dist.scale(); RealType location = c.dist.location(); RealType q = c.param; + RealType result = 0; // Checking function argument. - RealType result = 0; const char* function = "quantile(const complemented2_type<laplace_distribution<%1%>, %1%>&)"; + if (false == c.dist.check_parameters(function, &result)) return result; + + // Extreme values. + if(q == 0) + { + return std::numeric_limits<RealType>::infinity(); + } + if(q == 1) + { + return -std::numeric_limits<RealType>::infinity(); + } if(false == detail::check_probability(function, q, &result, Policy())) return result; - - // extreme values - if(q == 0) return std::numeric_limits<RealType>::infinity(); - if(q == 1) return -std::numeric_limits<RealType>::infinity(); - if (0.5 - q < 0.0) result = location + scale*log( static_cast<RealType>(-q*2 + 2) ); else @@ -299,6 +333,10 @@ inline RealType kurtosis_excess(const laplace_distribution<RealType, Policy>& /* return 3; } +#ifdef BOOST_MSVC +# pragma warning(pop) +#endif + } // namespace math } // namespace boost diff --git a/boost/math/distributions/logistic.hpp b/boost/math/distributions/logistic.hpp index e48f0b4f49..b3d16b7197 100644 --- a/boost/math/distributions/logistic.hpp +++ b/boost/math/distributions/logistic.hpp @@ -5,6 +5,9 @@ // (See accompanying file LICENSE_1_0.txt // or copy at http://www.boost.org/LICENSE_1_0.txt) +#ifndef BOOST_MATH_DISTRIBUTIONS_LOGISTIC +#define BOOST_MATH_DISTRIBUTIONS_LOGISTIC + #include <boost/math/distributions/fwd.hpp> #include <boost/math/distributions/detail/common_error_handling.hpp> #include <boost/math/distributions/complement.hpp> @@ -21,14 +24,14 @@ namespace boost { namespace math { typedef RealType value_type; typedef Policy policy_type; - logistic_distribution(RealType location=0, RealType scale=1) // Constructor. - : m_location(location), m_scale(scale) + logistic_distribution(RealType l_location=0, RealType l_scale=1) // Constructor. + : m_location(l_location), m_scale(l_scale) { static const char* function = "boost::math::logistic_distribution<%1%>::logistic_distribution"; RealType result; - detail::check_scale(function, scale, &result, Policy()); - detail::check_location(function, location, &result, Policy()); + detail::check_scale(function, l_scale, &result, Policy()); + detail::check_location(function, l_location, &result, Policy()); } // Accessor functions. RealType scale()const @@ -53,7 +56,9 @@ namespace boost { namespace math { inline const std::pair<RealType, RealType> range(const logistic_distribution<RealType, Policy>& /* dist */) { // Range of permissible values for random variable x. using boost::math::tools::max_value; - return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + infinity + return std::pair<RealType, RealType>( + std::numeric_limits<RealType>::has_infinity ? -std::numeric_limits<RealType>::infinity() : -max_value<RealType>(), + std::numeric_limits<RealType>::has_infinity ? std::numeric_limits<RealType>::infinity() : max_value<RealType>()); } template <class RealType, class Policy> @@ -63,21 +68,15 @@ namespace boost { namespace math { using boost::math::tools::max_value; return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + infinity } - - + template <class RealType, class Policy> inline RealType pdf(const logistic_distribution<RealType, Policy>& dist, const RealType& x) { + static const char* function = "boost::math::pdf(const logistic_distribution<%1%>&, %1%)"; RealType scale = dist.scale(); RealType location = dist.location(); - - static const char* function = "boost::math::pdf(const logistic_distribution<%1%>&, %1%)"; - if((boost::math::isinf)(x)) - { - return 0; // pdf + and - infinity is zero. - } - RealType result = 0; + if(false == detail::check_scale(function, scale , &result, Policy())) { return result; @@ -86,6 +85,12 @@ namespace boost { namespace math { { return result; } + + if((boost::math::isinf)(x)) + { + return 0; // pdf + and - infinity is zero. + } + if(false == detail::check_x(function, x, &result, Policy())) { return result; @@ -181,18 +186,24 @@ namespace boost { namespace math { RealType x = c.param; static const char* function = "boost::math::cdf(const complement(logistic_distribution<%1%>&), %1%)"; - if((boost::math::isinf)(x)) - { - if(x < 0) return 1; // cdf complement -infinity is unity. - return 0; // cdf complement +infinity is zero - } RealType result = 0; if(false == detail::check_scale(function, scale, &result, Policy())) + { return result; + } if(false == detail::check_location(function, location, &result, Policy())) + { return result; + } + if((boost::math::isinf)(x)) + { + if(x < 0) return 1; // cdf complement -infinity is unity. + return 0; // cdf complement +infinity is zero. + } if(false == detail::check_x(function, x, &result, Policy())) + { return result; + } RealType power = (x - location) / scale; if(power > tools::log_max_value<RealType>()) return 0; @@ -285,3 +296,4 @@ namespace boost { namespace math { // Must come at the end: #include <boost/math/distributions/detail/derived_accessors.hpp> +#endif // BOOST_MATH_DISTRIBUTIONS_LOGISTIC diff --git a/boost/math/distributions/lognormal.hpp b/boost/math/distributions/lognormal.hpp index a6cfa17a2e..4e6c0610d4 100644 --- a/boost/math/distributions/lognormal.hpp +++ b/boost/math/distributions/lognormal.hpp @@ -48,11 +48,12 @@ public: typedef RealType value_type; typedef Policy policy_type; - lognormal_distribution(RealType location = 0, RealType scale = 1) - : m_location(location), m_scale(scale) + lognormal_distribution(RealType l_location = 0, RealType l_scale = 1) + : m_location(l_location), m_scale(l_scale) { RealType result; - detail::check_scale("boost::math::lognormal_distribution<%1%>::lognormal_distribution", scale, &result, Policy()); + detail::check_scale("boost::math::lognormal_distribution<%1%>::lognormal_distribution", l_scale, &result, Policy()); + detail::check_location("boost::math::lognormal_distribution<%1%>::lognormal_distribution", l_location, &result, Policy()); } RealType location()const @@ -102,6 +103,8 @@ RealType pdf(const lognormal_distribution<RealType, Policy>& dist, const RealTyp RealType result = 0; if(0 == detail::check_scale(function, sigma, &result, Policy())) return result; + if(0 == detail::check_location(function, mu, &result, Policy())) + return result; if(0 == detail::check_lognormal_x(function, x, &result, Policy())) return result; @@ -126,6 +129,10 @@ inline RealType cdf(const lognormal_distribution<RealType, Policy>& dist, const static const char* function = "boost::math::cdf(const lognormal_distribution<%1%>&, %1%)"; RealType result = 0; + if(0 == detail::check_scale(function, dist.scale(), &result, Policy())) + return result; + if(0 == detail::check_location(function, dist.location(), &result, Policy())) + return result; if(0 == detail::check_lognormal_x(function, x, &result, Policy())) return result; @@ -144,6 +151,10 @@ inline RealType quantile(const lognormal_distribution<RealType, Policy>& dist, c static const char* function = "boost::math::quantile(const lognormal_distribution<%1%>&, %1%)"; RealType result = 0; + if(0 == detail::check_scale(function, dist.scale(), &result, Policy())) + return result; + if(0 == detail::check_location(function, dist.location(), &result, Policy())) + return result; if(0 == detail::check_probability(function, p, &result, Policy())) return result; @@ -164,6 +175,10 @@ inline RealType cdf(const complemented2_type<lognormal_distribution<RealType, Po static const char* function = "boost::math::cdf(const lognormal_distribution<%1%>&, %1%)"; RealType result = 0; + if(0 == detail::check_scale(function, c.dist.scale(), &result, Policy())) + return result; + if(0 == detail::check_location(function, c.dist.location(), &result, Policy())) + return result; if(0 == detail::check_lognormal_x(function, c.param, &result, Policy())) return result; @@ -182,6 +197,10 @@ inline RealType quantile(const complemented2_type<lognormal_distribution<RealTyp static const char* function = "boost::math::quantile(const lognormal_distribution<%1%>&, %1%)"; RealType result = 0; + if(0 == detail::check_scale(function, c.dist.scale(), &result, Policy())) + return result; + if(0 == detail::check_location(function, c.dist.location(), &result, Policy())) + return result; if(0 == detail::check_probability(function, c.param, &result, Policy())) return result; @@ -205,6 +224,8 @@ inline RealType mean(const lognormal_distribution<RealType, Policy>& dist) RealType result = 0; if(0 == detail::check_scale("boost::math::mean(const lognormal_distribution<%1%>&)", sigma, &result, Policy())) return result; + if(0 == detail::check_location("boost::math::mean(const lognormal_distribution<%1%>&)", mu, &result, Policy())) + return result; return exp(mu + sigma * sigma / 2); } @@ -220,6 +241,8 @@ inline RealType variance(const lognormal_distribution<RealType, Policy>& dist) RealType result = 0; if(0 == detail::check_scale("boost::math::variance(const lognormal_distribution<%1%>&)", sigma, &result, Policy())) return result; + if(0 == detail::check_location("boost::math::variance(const lognormal_distribution<%1%>&)", mu, &result, Policy())) + return result; return boost::math::expm1(sigma * sigma, Policy()) * exp(2 * mu + sigma * sigma); } @@ -235,6 +258,8 @@ inline RealType mode(const lognormal_distribution<RealType, Policy>& dist) RealType result = 0; if(0 == detail::check_scale("boost::math::mode(const lognormal_distribution<%1%>&)", sigma, &result, Policy())) return result; + if(0 == detail::check_location("boost::math::mode(const lognormal_distribution<%1%>&)", mu, &result, Policy())) + return result; return exp(mu - sigma * sigma); } @@ -261,6 +286,8 @@ inline RealType skewness(const lognormal_distribution<RealType, Policy>& dist) RealType result = 0; if(0 == detail::check_scale("boost::math::skewness(const lognormal_distribution<%1%>&)", sigma, &result, Policy())) return result; + if(0 == detail::check_location("boost::math::skewness(const lognormal_distribution<%1%>&)", dist.location(), &result, Policy())) + return result; return (ess + 2) * sqrt(boost::math::expm1(ss, Policy())); } @@ -277,6 +304,8 @@ inline RealType kurtosis(const lognormal_distribution<RealType, Policy>& dist) RealType result = 0; if(0 == detail::check_scale("boost::math::kurtosis(const lognormal_distribution<%1%>&)", sigma, &result, Policy())) return result; + if(0 == detail::check_location("boost::math::kurtosis(const lognormal_distribution<%1%>&)", dist.location(), &result, Policy())) + return result; return exp(4 * ss) + 2 * exp(3 * ss) + 3 * exp(2 * ss) - 3; } @@ -293,6 +322,8 @@ inline RealType kurtosis_excess(const lognormal_distribution<RealType, Policy>& RealType result = 0; if(0 == detail::check_scale("boost::math::kurtosis_excess(const lognormal_distribution<%1%>&)", sigma, &result, Policy())) return result; + if(0 == detail::check_location("boost::math::kurtosis_excess(const lognormal_distribution<%1%>&)", dist.location(), &result, Policy())) + return result; return exp(4 * ss) + 2 * exp(3 * ss) + 3 * exp(2 * ss) - 6; } diff --git a/boost/math/distributions/negative_binomial.hpp b/boost/math/distributions/negative_binomial.hpp index 28ce4b996c..ca5723fa7d 100644 --- a/boost/math/distributions/negative_binomial.hpp +++ b/boost/math/distributions/negative_binomial.hpp @@ -460,6 +460,15 @@ namespace boost { // p <= pdf(dist, 0) == cdf(dist, 0) return 0; } + if(p == 0) + { // Would need +infinity failures for total confidence. + result = policies::raise_overflow_error<RealType>( + function, + "Success fraction is 0, which implies infinite failures !", Policy()); + return result; + // usually means return +std::numeric_limits<RealType>::infinity(); + // unless #define BOOST_MATH_THROW_ON_OVERFLOW_ERROR + } /* // Calculate quantile of negative_binomial using the inverse incomplete beta function. using boost::math::ibeta_invb; @@ -488,7 +497,7 @@ namespace boost return detail::inverse_discrete_quantile( dist, P, - 1-P, + false, guess, factor, RealType(1), @@ -527,16 +536,26 @@ namespace boost // since the probability of zero failures may be non-zero, return 0; // but zero is the best we can do: } + if(Q == 0) + { // Probability 1 - Q == 1 so infinite failures to achieve certainty. + // Would need +infinity failures for total confidence. + result = policies::raise_overflow_error<RealType>( + function, + "Probability argument complement is 0, which implies infinite failures !", Policy()); + return result; + // usually means return +std::numeric_limits<RealType>::infinity(); + // unless #define BOOST_MATH_THROW_ON_OVERFLOW_ERROR + } if (-Q <= boost::math::powm1(dist.success_fraction(), dist.successes(), Policy())) { // q <= cdf(complement(dist, 0)) == pdf(dist, 0) return 0; // } - if(Q == 0) - { // Probability 1 - Q == 1 so infinite failures to achieve certainty. + if(p == 0) + { // Success fraction is 0 so infinite failures to achieve certainty. // Would need +infinity failures for total confidence. result = policies::raise_overflow_error<RealType>( function, - "Probability argument complement is 0, which implies infinite failures !", Policy()); + "Success fraction is 0, which implies infinite failures !", Policy()); return result; // usually means return +std::numeric_limits<RealType>::infinity(); // unless #define BOOST_MATH_THROW_ON_OVERFLOW_ERROR @@ -564,8 +583,8 @@ namespace boost typedef typename Policy::discrete_quantile_type discrete_type; return detail::inverse_discrete_quantile( dist, - 1-Q, Q, + true, guess, factor, RealType(1), diff --git a/boost/math/distributions/non_central_beta.hpp b/boost/math/distributions/non_central_beta.hpp index ebb6e91fa1..6e699e509f 100644 --- a/boost/math/distributions/non_central_beta.hpp +++ b/boost/math/distributions/non_central_beta.hpp @@ -51,17 +51,8 @@ namespace boost int k = itrunc(l2); if(k == 0) k = 1; - T pois; - if(k == 0) - { // Starting Poisson weight: - pois = exp(-l2); - } - else - { - // Starting Poisson weight: - pois = gamma_p_derivative(T(k+1), l2, pol); - } + T pois = gamma_p_derivative(T(k+1), l2, pol); if(pois == 0) return init_val; // recurance term: diff --git a/boost/math/distributions/non_central_chi_squared.hpp b/boost/math/distributions/non_central_chi_squared.hpp index a3f98982b9..88933c1956 100644 --- a/boost/math/distributions/non_central_chi_squared.hpp +++ b/boost/math/distributions/non_central_chi_squared.hpp @@ -101,7 +101,7 @@ namespace boost } //Error check: if(static_cast<boost::uintmax_t>(i-k) >= max_iter) - policies::raise_evaluation_error( + return policies::raise_evaluation_error( "cdf(non_central_chi_squared_distribution<%1%>, %1%)", "Series did not converge, closest value was %1%", sum, pol); // @@ -175,7 +175,7 @@ namespace boost } //Error check: if(static_cast<boost::uintmax_t>(i) >= max_iter) - policies::raise_evaluation_error( + return policies::raise_evaluation_error( "cdf(non_central_chi_squared_distribution<%1%>, %1%)", "Series did not converge, closest value was %1%", sum, pol); return sum; @@ -274,7 +274,7 @@ namespace boost //Error check: if(static_cast<boost::uintmax_t>(i) >= max_iter) - policies::raise_evaluation_error( + return policies::raise_evaluation_error( "cdf(non_central_chi_squared_distribution<%1%>, %1%)", "Series did not converge, closest value was %1%", sum, pol); @@ -400,6 +400,7 @@ namespace boost template <class RealType, class Policy> RealType nccs_quantile(const non_central_chi_squared_distribution<RealType, Policy>& dist, const RealType& p, bool comp) { + BOOST_MATH_STD_USING static const char* function = "quantile(non_central_chi_squared_distribution<%1%>, %1%)"; typedef typename policies::evaluation<RealType, Policy>::type value_type; typedef typename policies::normalise< @@ -428,25 +429,57 @@ namespace boost &r, Policy())) return (RealType)r; - - value_type b = (l * l) / (k + 3 * l); + // + // Special cases get short-circuited first: + // + if(p == 0) + return comp ? policies::raise_overflow_error<RealType>(function, 0, Policy()) : 0; + if(p == 1) + return comp ? 0 : policies::raise_overflow_error<RealType>(function, 0, Policy()); + // + // This is Pearson's approximation to the quantile, see + // Pearson, E. S. (1959) "Note on an approximation to the distribution of + // noncentral chi squared", Biometrika 46: 364. + // See also: + // "A comparison of approximations to percentiles of the noncentral chi2-distribution", + // Hardeo Sahai and Mario Miguel Ojeda, Revista de Matematica: Teoria y Aplicaciones 2003 10(1–2) : 57–76. + // Note that the latter reference refers to an approximation of the CDF, when they really mean the quantile. + // + value_type b = -(l * l) / (k + 3 * l); value_type c = (k + 3 * l) / (k + 2 * l); value_type ff = (k + 2 * l) / (c * c); value_type guess; if(comp) + { guess = b + c * quantile(complement(chi_squared_distribution<value_type, forwarding_policy>(ff), p)); + } else + { guess = b + c * quantile(chi_squared_distribution<value_type, forwarding_policy>(ff), p); - - if(guess < 0) - guess = tools::min_value<value_type>(); - + } + // + // Sometimes guess goes very small or negative, in that case we have + // to do something else for the initial guess, this approximation + // was provided in a private communication from Thomas Luu, PhD candidate, + // University College London. It's an asymptotic expansion for the + // quantile which usually gets us within an order of magnitude of the + // correct answer. + // + if(guess < 0.005) + { + value_type pp = comp ? 1 - p : p; + //guess = pow(pow(value_type(2), (k / 2 - 1)) * exp(l / 2) * pp * k, 2 / k); + guess = pow(pow(value_type(2), (k / 2 - 1)) * exp(l / 2) * pp * k * boost::math::tgamma(k / 2, forwarding_policy()), (2 / k)); + if(guess == 0) + guess = tools::min_value<value_type>(); + } value_type result = detail::generic_quantile( non_central_chi_squared_distribution<value_type, forwarding_policy>(k, l), p, guess, comp, function); + return policies::checked_narrowing_cast<RealType, forwarding_policy>( result, function); @@ -564,7 +597,7 @@ namespace boost RealType result = ir.first + (ir.second - ir.first) / 2; if(max_iter >= policies::get_max_root_iterations<Policy>()) { - policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" + return policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" " or there is no answer to problem. Current best guess is %1%", result, Policy()); } return result; @@ -620,7 +653,7 @@ namespace boost RealType result = ir.first + (ir.second - ir.first) / 2; if(max_iter >= policies::get_max_root_iterations<Policy>()) { - policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" + return policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" " or there is no answer to problem. Current best guess is %1%", result, Policy()); } return result; diff --git a/boost/math/distributions/non_central_f.hpp b/boost/math/distributions/non_central_f.hpp index 0549f38fe5..780dbff9a7 100644 --- a/boost/math/distributions/non_central_f.hpp +++ b/boost/math/distributions/non_central_f.hpp @@ -133,9 +133,10 @@ namespace boost &r, Policy())) return r; + RealType guess = m > 2 ? RealType(m * (n + l) / (n * (m - 2))) : RealType(1); return detail::generic_find_mode( dist, - m * (n + l) / (n * (m - 2)), + guess, function); } diff --git a/boost/math/distributions/non_central_t.hpp b/boost/math/distributions/non_central_t.hpp index e46980fc2d..df7a58e575 100644 --- a/boost/math/distributions/non_central_t.hpp +++ b/boost/math/distributions/non_central_t.hpp @@ -27,7 +27,7 @@ namespace boost namespace detail{ template <class T, class Policy> - T non_central_t2_p(T n, T delta, T x, T y, const Policy& pol, T init_val) + T non_central_t2_p(T v, T delta, T x, T y, const Policy& pol, T init_val) { BOOST_MATH_STD_USING // @@ -38,43 +38,26 @@ namespace boost T d2 = delta * delta / 2; // // k is the starting point for iteration, and is the - // maximum of the poisson weighting term: + // maximum of the poisson weighting term, we don't + // ever allow k == 0 as this can lead to catastrophic + // cancellation errors later (test case is v = 1621286869049072.3 + // delta = 0.16212868690490723, x = 0.86987415482475994). // int k = itrunc(d2); T pois; - if(k < 15) - { - // Since we'll likely need 30-40 terms anyway, start from zero - // since this simplifies the arithmetic, don't go too overboard though - // as this is the *unstable* direction: - k = 0; - // Starting Poisson weight: - pois = exp(-d2) * 2 / constants::root_pi<T>(); - pois *= delta / constants::root_two<T>(); - } - else - { - // Starting Poisson weight: - pois = gamma_p_derivative(T(k+1), d2, pol) - * tgamma_delta_ratio(T(k + 1), T(0.5f)) - * delta / constants::root_two<T>(); - } + if(k == 0) k = 1; + // Starting Poisson weight: + pois = gamma_p_derivative(T(k+1), d2, pol) + * tgamma_delta_ratio(T(k + 1), T(0.5f)) + * delta / constants::root_two<T>(); if(pois == 0) return init_val; T xterm, beta; // Recurrance & starting beta terms: - if(k == 0) - { - beta = -boost::math::powm1(y, n / 2, pol); - xterm = beta > 0.5f ? T(pow(y, n / 2)) : T(1 - beta); - } - else - { - beta = x < y - ? detail::ibeta_imp(T(k + 1), T(n / 2), x, pol, false, true, &xterm) - : detail::ibeta_imp(T(n / 2), T(k + 1), y, pol, true, true, &xterm); - xterm *= y / (n / 2 + k); - } + beta = x < y + ? detail::ibeta_imp(T(k + 1), T(v / 2), x, pol, false, true, &xterm) + : detail::ibeta_imp(T(v / 2), T(k + 1), y, pol, true, true, &xterm); + xterm *= y / (v / 2 + k); T poisf(pois), betaf(beta), xtermf(xterm); T sum = init_val; if((xterm == 0) && (beta == 0)) @@ -85,26 +68,31 @@ namespace boost // direction for recursion: // boost::uintmax_t count = 0; + T last_term = 0; for(int i = k; i >= 0; --i) { T term = beta * pois; sum += term; - if(fabs(term/sum) < errtol) + // Don't terminate on first term in case we "fixed" k above: + if((fabs(last_term) > fabs(term)) && fabs(term/sum) < errtol) break; + last_term = term; pois *= (i + 0.5f) / d2; beta += xterm; - xterm *= (i) / (x * (n / 2 + i - 1)); + xterm *= (i) / (x * (v / 2 + i - 1)); ++count; } + last_term = 0; for(int i = k + 1; ; ++i) { poisf *= d2 / (i + 0.5f); - xtermf *= (x * (n / 2 + i - 1)) / (i); + xtermf *= (x * (v / 2 + i - 1)) / (i); betaf -= xtermf; T term = poisf * betaf; sum += term; - if(fabs(term/sum) < errtol) + if((fabs(last_term) > fabs(term)) && (fabs(term/sum) < errtol)) break; + last_term = term; ++count; if(count > max_iter) { @@ -117,7 +105,7 @@ namespace boost } template <class T, class Policy> - T non_central_t2_q(T n, T delta, T x, T y, const Policy& pol, T init_val) + T non_central_t2_q(T v, T delta, T x, T y, const Policy& pol, T init_val) { BOOST_MATH_STD_USING // @@ -128,23 +116,16 @@ namespace boost T d2 = delta * delta / 2; // // k is the starting point for iteration, and is the - // maximum of the poisson weighting term: + // maximum of the poisson weighting term, we don't allow + // k == 0 as this can cause catastrophic cancellation errors + // (test case is v = 561908036470413.25, delta = 0.056190803647041321, + // x = 1.6155232703966216): // int k = itrunc(d2); - if(k < 30) - { - // We typically need around 40 terms so may as well start at 0 - // and gain faster computation of starting conditions: - k = 0; - } + if(k == 0) k = 1; // Starting Poisson weight: T pois; - if(k == 0) - { - pois = exp(-d2) * 2 / constants::root_pi<T>(); - pois *= delta / constants::root_two<T>(); - } - else if((k < (int)(max_factorial<T>::value)) && (d2 < tools::log_max_value<T>()) && (log(d2) * k < tools::log_max_value<T>())) + if((k < (int)(max_factorial<T>::value)) && (d2 < tools::log_max_value<T>()) && (log(d2) * k < tools::log_max_value<T>())) { // // For small k we can optimise this calculation by using @@ -170,14 +151,14 @@ namespace boost if(k != 0) { beta = x < y - ? detail::ibeta_imp(T(k + 1), T(n / 2), x, pol, true, true, &xterm) - : detail::ibeta_imp(T(n / 2), T(k + 1), y, pol, false, true, &xterm); + ? detail::ibeta_imp(T(k + 1), T(v / 2), x, pol, true, true, &xterm) + : detail::ibeta_imp(T(v / 2), T(k + 1), y, pol, false, true, &xterm); - xterm *= y / (n / 2 + k); + xterm *= y / (v / 2 + k); } else { - beta = pow(y, n / 2); + beta = pow(y, v / 2); xterm = beta; } T poisf(pois), betaf(beta), xtermf(xterm); @@ -189,10 +170,11 @@ namespace boost // Fused forward and backwards recursion: // boost::uintmax_t count = 0; + T last_term = 0; for(int i = k + 1, j = k; ; ++i, --j) { poisf *= d2 / (i + 0.5f); - xtermf *= (x * (n / 2 + i - 1)) / (i); + xtermf *= (x * (v / 2 + i - 1)) / (i); betaf += xtermf; T term = poisf * betaf; @@ -201,12 +183,14 @@ namespace boost term += beta * pois; pois *= (j + 0.5f) / d2; beta -= xterm; - xterm *= (j) / (x * (n / 2 + j - 1)); + xterm *= (j) / (x * (v / 2 + j - 1)); } sum += term; - if(fabs(term/sum) < errtol) + // Don't terminate on first term in case we "fixed" the value of k above: + if((fabs(last_term) > fabs(term)) && fabs(term/sum) < errtol) break; + last_term = term; if(count > max_iter) { return policies::raise_evaluation_error( @@ -219,27 +203,47 @@ namespace boost } template <class T, class Policy> - T non_central_t_cdf(T n, T delta, T t, bool invert, const Policy& pol) + T non_central_t_cdf(T v, T delta, T t, bool invert, const Policy& pol) { + BOOST_MATH_STD_USING + if ((boost::math::isinf)(v)) + { // Infinite degrees of freedom, so use normal distribution located at delta. + normal_distribution<T, Policy> n(delta, 1); + return cdf(n, t); + } // - // For t < 0 we have to use reflect: - // + // Otherwise, for t < 0 we have to use the reflection formula: if(t < 0) { t = -t; delta = -delta; invert = !invert; } + if(fabs(delta / (4 * v)) < policies::get_epsilon<T, Policy>()) + { + // Approximate with a Student's T centred on delta, + // the crossover point is based on eq 2.6 from + // "A Comparison of Approximations To Percentiles of the + // Noncentral t-Distribution". H. Sahai and M. M. Ojeda, + // Revista Investigacion Operacional Vol 21, No 2, 2000. + // Original sources referenced in the above are: + // "Some Approximations to the Percentage Points of the Noncentral + // t-Distribution". C. van Eeden. International Statistical Review, 29, 4-31. + // "Continuous Univariate Distributions". N.L. Johnson, S. Kotz and + // N. Balkrishnan. 1995. John Wiley and Sons New York. + T result = cdf(students_t_distribution<T, Policy>(v), t - delta); + return invert ? 1 - result : result; + } // // x and y are the corresponding random // variables for the noncentral beta distribution, // with y = 1 - x: // - T x = t * t / (n + t * t); - T y = n / (n + t * t); + T x = t * t / (v + t * t); + T y = v / (v + t * t); T d2 = delta * delta; T a = 0.5f; - T b = n / 2; + T b = v / 2; T c = a + b + d2 / 2; // // Crossover point for calculating p or q is the same @@ -255,7 +259,7 @@ namespace boost if(x != 0) { result = non_central_beta_p(a, b, d2, x, y, pol); - result = non_central_t2_p(n, delta, x, y, pol, result); + result = non_central_t2_p(v, delta, x, y, pol, result); result /= 2; } else @@ -271,10 +275,10 @@ namespace boost if(x != 0) { result = non_central_beta_q(a, b, d2, x, y, pol); - result = non_central_t2_q(n, delta, x, y, pol, result); + result = non_central_t2_q(v, delta, x, y, pol, result); result /= 2; } - else + else // x == 0 result = cdf(complement(boost::math::normal_distribution<T, Policy>(), -delta)); } if(invert) @@ -283,10 +287,11 @@ namespace boost } template <class T, class Policy> - T non_central_t_quantile(T v, T delta, T p, T q, const Policy&) + T non_central_t_quantile(const char* function, T v, T delta, T p, T q, const Policy&) { BOOST_MATH_STD_USING - static const char* function = "quantile(non_central_t_distribution<%1%>, %1%)"; + // static const char* function = "quantile(non_central_t_distribution<%1%>, %1%)"; + // now passed as function typedef typename policies::evaluation<T, Policy>::type value_type; typedef typename policies::normalise< Policy, @@ -296,7 +301,7 @@ namespace boost policies::assert_undefined<> >::type forwarding_policy; T r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -313,11 +318,24 @@ namespace boost Policy())) return r; + value_type guess = 0; - if(v > 3) - { - value_type mean = delta * sqrt(v / 2) * tgamma_delta_ratio((v - 1) * 0.5f, T(0.5f)); - value_type var = ((delta * delta + 1) * v) / (v - 2) - mean * mean; + if ( ((boost::math::isinf)(v)) || (v > 1 / boost::math::tools::epsilon<T>()) ) + { // Infinite or very large degrees of freedom, so use normal distribution located at delta. + normal_distribution<T, Policy> n(delta, 1); + if (p < q) + { + return quantile(n, p); + } + else + { + return quantile(complement(n, q)); + } + } + else if(v > 3) + { // Use normal distribution to calculate guess. + value_type mean = (v > 1 / policies::get_epsilon<T, Policy>()) ? delta : delta * sqrt(v / 2) * tgamma_delta_ratio((v - 1) * 0.5f, T(0.5f)); + value_type var = (v > 1 / policies::get_epsilon<T, Policy>()) ? value_type(1) : (((delta * delta + 1) * v) / (v - 2) - mean * mean); if(p < q) guess = quantile(normal_distribution<value_type, forwarding_policy>(mean, var), p); else @@ -370,31 +388,16 @@ namespace boost // int k = itrunc(d2); T pois, xterm; - if(k < 30) - { - // - // Since we'll need at least 30-40 terms anyway, start from 0 - // since this simplifies the starting arithmetic: - // - k = 0; - // Starting Poisson weight: - pois = exp(-d2) - * (2 / constants::root_pi<T>()) - * delta / constants::root_two<T>(); - // Starting beta term: - xterm = pow(y, n / 2 - 1) * n / 2; - } - else - { - // Starting Poisson weight: - pois = gamma_p_derivative(T(k+1), d2, pol) - * tgamma_delta_ratio(T(k + 1), T(0.5f)) - * delta / constants::root_two<T>(); - // Starting beta term: - xterm = x < y - ? ibeta_derivative(T(k + 1), n / 2, x, pol) - : ibeta_derivative(n / 2, T(k + 1), y, pol); - } + if(k == 0) + k = 1; + // Starting Poisson weight: + pois = gamma_p_derivative(T(k+1), d2, pol) + * tgamma_delta_ratio(T(k + 1), T(0.5f)) + * delta / constants::root_two<T>(); + // Starting beta term: + xterm = x < y + ? ibeta_derivative(T(k + 1), n / 2, x, pol) + : ibeta_derivative(n / 2, T(k + 1), y, pol); T poisf(pois), xtermf(xterm); T sum = init_val; if((pois == 0) || (xterm == 0)) @@ -409,7 +412,7 @@ namespace boost { T term = xterm * pois; sum += term; - if((fabs(term/sum) < errtol) || (term == 0)) + if(((fabs(term/sum) < errtol) && (i != k)) || (term == 0)) break; pois *= (i + 0.5f) / d2; xterm *= (i) / (x * (n / 2 + i)); @@ -444,9 +447,13 @@ namespace boost T non_central_t_pdf(T n, T delta, T t, const Policy& pol) { BOOST_MATH_STD_USING + if ((boost::math::isinf)(n)) + { // Infinite degrees of freedom, so use normal distribution located at delta. + normal_distribution<T, Policy> norm(delta, 1); + return pdf(norm, t); + } // - // For t < 0 we have to use the reflection formula: - // + // Otherwise, for t < 0 we have to use the reflection formula: if(t < 0) { t = -t; @@ -468,6 +475,20 @@ namespace boost * sqrt(n / constants::pi<T>()) * exp(-delta * delta / 2) / 2; } + if(fabs(delta / (4 * n)) < policies::get_epsilon<T, Policy>()) + { + // Approximate with a Student's T centred on delta, + // the crossover point is based on eq 2.6 from + // "A Comparison of Approximations To Percentiles of the + // Noncentral t-Distribution". H. Sahai and M. M. Ojeda, + // Revista Investigacion Operacional Vol 21, No 2, 2000. + // Original sources referenced in the above are: + // "Some Approximations to the Percentage Points of the Noncentral + // t-Distribution". C. van Eeden. International Statistical Review, 29, 4-31. + // "Continuous Univariate Distributions". N.L. Johnson, S. Kotz and + // N. Balkrishnan. 1995. John Wiley and Sons New York. + return pdf(students_t_distribution<T, Policy>(n), t - delta); + } // // x and y are the corresponding random // variables for the noncentral beta distribution, @@ -494,13 +515,35 @@ namespace boost template <class T, class Policy> T mean(T v, T delta, const Policy& pol) { + if ((boost::math::isinf)(v)) + { + return delta; + } BOOST_MATH_STD_USING - return delta * sqrt(v / 2) * tgamma_delta_ratio((v - 1) * 0.5f, T(0.5f), pol); + if (v > 1 / boost::math::tools::epsilon<T>() ) + { + //normal_distribution<T, Policy> n(delta, 1); + //return boost::math::mean(n); + return delta; + } + else + { + return delta * sqrt(v / 2) * tgamma_delta_ratio((v - 1) * 0.5f, T(0.5f), pol); + } + // Other moments use mean so using normal distribution is propagated. } template <class T, class Policy> T variance(T v, T delta, const Policy& pol) { + if ((boost::math::isinf)(v)) + { + return 1; + } + if (delta == 0) + { // == Student's t + return v / (v - 2); + } T result = ((delta * delta + 1) * v) / (v - 2); T m = mean(v, delta, pol); result -= m * m; @@ -511,6 +554,14 @@ namespace boost T skewness(T v, T delta, const Policy& pol) { BOOST_MATH_STD_USING + if ((boost::math::isinf)(v)) + { + return 0; + } + if(delta == 0) + { // == Student's t + return 0; + } T mean = boost::math::detail::mean(v, delta, pol); T l2 = delta * delta; T var = ((l2 + 1) * v) / (v - 2) - mean * mean; @@ -525,6 +576,14 @@ namespace boost T kurtosis_excess(T v, T delta, const Policy& pol) { BOOST_MATH_STD_USING + if ((boost::math::isinf)(v)) + { + return 3; + } + if (delta == 0) + { // == Student's t + return 3; + } T mean = boost::math::detail::mean(v, delta, pol); T l2 = delta * delta; T var = ((l2 + 1) * v) / (v - 2) - mean * mean; @@ -588,7 +647,7 @@ namespace boost RealType result = ir.first + (ir.second - ir.first) / 2; if(max_iter >= policies::get_max_root_iterations<Policy>()) { - policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" + return policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" " or there is no answer to problem. Current best guess is %1%", result, Policy()); } return result; @@ -626,7 +685,7 @@ namespace boost // Can't do a thing if one of p and q is zero: // return policies::raise_evaluation_error<RealType>(function, - "Can't find non centrality parameter when the probability is 0 or 1, only possible answer is %1%", + "Can't find non-centrality parameter when the probability is 0 or 1, only possible answer is %1%", RealType(std::numeric_limits<RealType>::quiet_NaN()), Policy()); } t_non_centrality_finder<RealType, Policy> f(v, x, p < q ? p : q, p < q ? false : true); @@ -646,13 +705,13 @@ namespace boost RealType result = ir.first + (ir.second - ir.first) / 2; if(max_iter >= policies::get_max_root_iterations<Policy>()) { - policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" + return policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" " or there is no answer to problem. Current best guess is %1%", result, Policy()); } return result; } #endif - } // namespace detail + } // namespace detail ====================================================================== template <class RealType = double, class Policy = policies::policy<> > class non_central_t_distribution @@ -665,7 +724,7 @@ namespace boost { const char* function = "boost::math::non_central_t_distribution<%1%>::non_central_t_distribution(%1%,%1%)"; RealType r; - detail::check_df( + detail::check_df_gt0_to_inf( function, v, &r, Policy()); detail::check_finite( @@ -803,7 +862,7 @@ namespace boost RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); RealType r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -841,7 +900,7 @@ namespace boost RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); RealType r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -854,7 +913,7 @@ namespace boost if(v <= 1) return policies::raise_domain_error<RealType>( function, - "The non central t distribution has no defined mean for degrees of freedom <= 1: got v=%1%.", v, Policy()); + "The non-central t distribution has no defined mean for degrees of freedom <= 1: got v=%1%.", v, Policy()); // return l * sqrt(v / 2) * tgamma_delta_ratio((v - 1) * 0.5f, RealType(0.5f)); return policies::checked_narrowing_cast<RealType, forwarding_policy>( detail::mean(static_cast<value_type>(v), static_cast<value_type>(l), forwarding_policy()), function); @@ -876,7 +935,7 @@ namespace boost RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); RealType r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -889,7 +948,7 @@ namespace boost if(v <= 2) return policies::raise_domain_error<RealType>( function, - "The non central t distribution has no defined variance for degrees of freedom <= 2: got v=%1%.", v, Policy()); + "The non-central t distribution has no defined variance for degrees of freedom <= 2: got v=%1%.", v, Policy()); return policies::checked_narrowing_cast<RealType, forwarding_policy>( detail::variance(static_cast<value_type>(v), static_cast<value_type>(l), forwarding_policy()), function); } @@ -911,7 +970,7 @@ namespace boost RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); RealType r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -924,7 +983,7 @@ namespace boost if(v <= 3) return policies::raise_domain_error<RealType>( function, - "The non central t distribution has no defined skewness for degrees of freedom <= 3: got v=%1%.", v, Policy());; + "The non-central t distribution has no defined skewness for degrees of freedom <= 3: got v=%1%.", v, Policy());; return policies::checked_narrowing_cast<RealType, forwarding_policy>( detail::skewness(static_cast<value_type>(v), static_cast<value_type>(l), forwarding_policy()), function); } @@ -943,7 +1002,7 @@ namespace boost RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); RealType r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -956,7 +1015,7 @@ namespace boost if(v <= 4) return policies::raise_domain_error<RealType>( function, - "The non central t distribution has no defined kurtosis for degrees of freedom <= 4: got v=%1%.", v, Policy());; + "The non-central t distribution has no defined kurtosis for degrees of freedom <= 4: got v=%1%.", v, Policy());; return policies::checked_narrowing_cast<RealType, forwarding_policy>( detail::kurtosis_excess(static_cast<value_type>(v), static_cast<value_type>(l), forwarding_policy()), function); } // kurtosis_excess @@ -970,7 +1029,7 @@ namespace boost template <class RealType, class Policy> inline RealType pdf(const non_central_t_distribution<RealType, Policy>& dist, const RealType& t) { // Probability Density/Mass Function. - const char* function = "cdf(non_central_t_distribution<%1%>, %1%)"; + const char* function = "pdf(non_central_t_distribution<%1%>, %1%)"; typedef typename policies::evaluation<RealType, Policy>::type value_type; typedef typename policies::normalise< Policy, @@ -982,7 +1041,7 @@ namespace boost RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); RealType r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -1009,7 +1068,8 @@ namespace boost template <class RealType, class Policy> RealType cdf(const non_central_t_distribution<RealType, Policy>& dist, const RealType& x) { - const char* function = "boost::math::non_central_t_distribution<%1%>::cdf(%1%)"; + const char* function = "boost::math::cdf(non_central_t_distribution<%1%>&, %1%)"; +// was const char* function = "boost::math::non_central_t_distribution<%1%>::cdf(%1%)"; typedef typename policies::evaluation<RealType, Policy>::type value_type; typedef typename policies::normalise< Policy, @@ -1021,7 +1081,7 @@ namespace boost RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); RealType r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -1037,10 +1097,17 @@ namespace boost &r, Policy())) return (RealType)r; + if ((boost::math::isinf)(v)) + { // Infinite degrees of freedom, so use normal distribution located at delta. + normal_distribution<RealType, Policy> n(l, 1); + cdf(n, x); + //return cdf(normal_distribution<RealType, Policy>(l, 1), x); + } if(l == 0) + { // NO non-centrality, so use Student's t instead. return cdf(students_t_distribution<RealType, Policy>(v), x); - + } return policies::checked_narrowing_cast<RealType, forwarding_policy>( detail::non_central_t_cdf( static_cast<value_type>(v), @@ -1053,7 +1120,8 @@ namespace boost template <class RealType, class Policy> RealType cdf(const complemented2_type<non_central_t_distribution<RealType, Policy>, RealType>& c) { // Complemented Cumulative Distribution Function - const char* function = "boost::math::non_central_t_distribution<%1%>::cdf(%1%)"; + // was const char* function = "boost::math::non_central_t_distribution<%1%>::cdf(%1%)"; + const char* function = "boost::math::cdf(const complement(non_central_t_distribution<%1%>&), %1%)"; typedef typename policies::evaluation<RealType, Policy>::type value_type; typedef typename policies::normalise< Policy, @@ -1065,9 +1133,9 @@ namespace boost non_central_t_distribution<RealType, Policy> const& dist = c.dist; RealType x = c.param; RealType v = dist.degrees_of_freedom(); - RealType l = dist.non_centrality(); + RealType l = dist.non_centrality(); // aka delta RealType r; - if(!detail::check_df( + if(!detail::check_df_gt0_to_inf( function, v, &r, Policy()) || @@ -1084,9 +1152,15 @@ namespace boost Policy())) return (RealType)r; + if ((boost::math::isinf)(v)) + { // Infinite degrees of freedom, so use normal distribution located at delta. + normal_distribution<RealType, Policy> n(l, 1); + return cdf(complement(n, x)); + } if(l == 0) + { // zero non-centrality so use Student's t distribution. return cdf(complement(students_t_distribution<RealType, Policy>(v), x)); - + } return policies::checked_narrowing_cast<RealType, forwarding_policy>( detail::non_central_t_cdf( static_cast<value_type>(v), @@ -1099,19 +1173,21 @@ namespace boost template <class RealType, class Policy> inline RealType quantile(const non_central_t_distribution<RealType, Policy>& dist, const RealType& p) { // Quantile (or Percent Point) function. + static const char* function = "quantile(const non_central_t_distribution<%1%>, %1%)"; RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); - return detail::non_central_t_quantile(v, l, p, RealType(1-p), Policy()); + return detail::non_central_t_quantile(function, v, l, p, RealType(1-p), Policy()); } // quantile template <class RealType, class Policy> inline RealType quantile(const complemented2_type<non_central_t_distribution<RealType, Policy>, RealType>& c) { // Quantile (or Percent Point) function. + static const char* function = "quantile(const complement(non_central_t_distribution<%1%>, %1%))"; non_central_t_distribution<RealType, Policy> const& dist = c.dist; RealType q = c.param; RealType v = dist.degrees_of_freedom(); RealType l = dist.non_centrality(); - return detail::non_central_t_quantile(v, l, RealType(1-q), q, Policy()); + return detail::non_central_t_quantile(function, v, l, RealType(1-q), q, Policy()); } // quantile complement. } // namespace math diff --git a/boost/math/distributions/normal.hpp b/boost/math/distributions/normal.hpp index baeecf6348..32cf66e3ef 100644 --- a/boost/math/distributions/normal.hpp +++ b/boost/math/distributions/normal.hpp @@ -31,14 +31,14 @@ public: typedef RealType value_type; typedef Policy policy_type; - normal_distribution(RealType mean = 0, RealType sd = 1) - : m_mean(mean), m_sd(sd) + normal_distribution(RealType l_mean = 0, RealType sd = 1) + : m_mean(l_mean), m_sd(sd) { // Default is a 'standard' normal distribution N01. static const char* function = "boost::math::normal_distribution<%1%>::normal_distribution"; RealType result; detail::check_scale(function, sd, &result, Policy()); - detail::check_location(function, mean, &result, Policy()); + detail::check_location(function, l_mean, &result, Policy()); } RealType mean()const @@ -71,22 +71,43 @@ private: typedef normal_distribution<double> normal; +#ifdef BOOST_MSVC +#pragma warning(push) +#pragma warning(disable:4127) +#endif + template <class RealType, class Policy> inline const std::pair<RealType, RealType> range(const normal_distribution<RealType, Policy>& /*dist*/) { // Range of permissible values for random variable x. - using boost::math::tools::max_value; - return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + max value. + if (std::numeric_limits<RealType>::has_infinity) + { + return std::pair<RealType, RealType>(-std::numeric_limits<RealType>::infinity(), std::numeric_limits<RealType>::infinity()); // - to + infinity. + } + else + { // Can only use max_value. + using boost::math::tools::max_value; + return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + max value. + } } template <class RealType, class Policy> inline const std::pair<RealType, RealType> support(const normal_distribution<RealType, Policy>& /*dist*/) -{ // Range of supported values for random variable x. - // This is range where cdf rises from 0 to 1, and outside it, the pdf is zero. - +{ // This is range values for random variable x where cdf rises from 0 to 1, and outside it, the pdf is zero. + if (std::numeric_limits<RealType>::has_infinity) + { + return std::pair<RealType, RealType>(-std::numeric_limits<RealType>::infinity(), std::numeric_limits<RealType>::infinity()); // - to + infinity. + } + else + { // Can only use max_value. using boost::math::tools::max_value; return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + max value. + } } +#ifdef BOOST_MSVC +#pragma warning(pop) +#endif + template <class RealType, class Policy> inline RealType pdf(const normal_distribution<RealType, Policy>& dist, const RealType& x) { @@ -96,15 +117,6 @@ inline RealType pdf(const normal_distribution<RealType, Policy>& dist, const Rea RealType mean = dist.mean(); static const char* function = "boost::math::pdf(const normal_distribution<%1%>&, %1%)"; - if((boost::math::isinf)(x)) - { - return 0; // pdf + and - infinity is zero. - } - // Below produces MSVC 4127 warnings, so the above used instead. - //if(std::numeric_limits<RealType>::has_infinity && abs(x) == std::numeric_limits<RealType>::infinity()) - //{ // pdf + and - infinity is zero. - // return 0; - //} RealType result = 0; if(false == detail::check_scale(function, sd, &result, Policy())) @@ -115,6 +127,15 @@ inline RealType pdf(const normal_distribution<RealType, Policy>& dist, const Rea { return result; } + if((boost::math::isinf)(x)) + { + return 0; // pdf + and - infinity is zero. + } + // Below produces MSVC 4127 warnings, so the above used instead. + //if(std::numeric_limits<RealType>::has_infinity && abs(x) == std::numeric_limits<RealType>::infinity()) + //{ // pdf + and - infinity is zero. + // return 0; + //} if(false == detail::check_x(function, x, &result, Policy())) { return result; @@ -204,6 +225,11 @@ inline RealType cdf(const complemented2_type<normal_distribution<RealType, Polic RealType x = c.param; static const char* function = "boost::math::cdf(const complement(normal_distribution<%1%>&), %1%)"; + RealType result = 0; + if(false == detail::check_scale(function, sd, &result, Policy())) + return result; + if(false == detail::check_location(function, mean, &result, Policy())) + return result; if((boost::math::isinf)(x)) { if(x < 0) return 1; // cdf complement -infinity is unity. @@ -218,11 +244,6 @@ inline RealType cdf(const complemented2_type<normal_distribution<RealType, Polic //{ // cdf complement -infinity is unity. // return 1; //} - RealType result = 0; - if(false == detail::check_scale(function, sd, &result, Policy())) - return result; - if(false == detail::check_location(function, mean, &result, Policy())) - return result; if(false == detail::check_x(function, x, &result, Policy())) return result; diff --git a/boost/math/distributions/pareto.hpp b/boost/math/distributions/pareto.hpp index ff7082e2de..1c6cf350f8 100644 --- a/boost/math/distributions/pareto.hpp +++ b/boost/math/distributions/pareto.hpp @@ -136,11 +136,11 @@ namespace boost typedef RealType value_type; typedef Policy policy_type; - pareto_distribution(RealType scale = 1, RealType shape = 1) - : m_scale(scale), m_shape(shape) + pareto_distribution(RealType l_scale = 1, RealType l_shape = 1) + : m_scale(l_scale), m_shape(l_shape) { // Constructor. RealType result = 0; - detail::check_pareto("boost::math::pareto_distribution<%1%>::pareto_distribution", scale, shape, &result, Policy()); + detail::check_pareto("boost::math::pareto_distribution<%1%>::pareto_distribution", l_scale, l_shape, &result, Policy()); } RealType scale()const @@ -236,7 +236,7 @@ namespace boost } if (p == 1) { - return tools::max_value<RealType>(); // x = + infinity. + return policies::raise_overflow_error<RealType>(function, 0, Policy()); // x = + infinity. } result = scale / (pow((1 - p), 1 / shape)); @@ -286,7 +286,7 @@ namespace boost } if (q == 0) { - return tools::max_value<RealType>(); // x = + infinity. + return policies::raise_overflow_error<RealType>(function, 0, Policy()); // x = + infinity. } result = scale / (pow(q, 1 / shape)); // K. Krishnamoorthy, ISBN 1-58488-635-8 eq 23.1.3 diff --git a/boost/math/distributions/poisson.hpp b/boost/math/distributions/poisson.hpp index 3dd58f80cb..e4665bff69 100644 --- a/boost/math/distributions/poisson.hpp +++ b/boost/math/distributions/poisson.hpp @@ -52,68 +52,6 @@ namespace boost { namespace math { - namespace detail{ - template <class Dist> - inline typename Dist::value_type - inverse_discrete_quantile( - const Dist& dist, - const typename Dist::value_type& p, - const typename Dist::value_type& guess, - const typename Dist::value_type& multiplier, - const typename Dist::value_type& adder, - const policies::discrete_quantile<policies::integer_round_nearest>&, - boost::uintmax_t& max_iter); - template <class Dist> - inline typename Dist::value_type - inverse_discrete_quantile( - const Dist& dist, - const typename Dist::value_type& p, - const typename Dist::value_type& guess, - const typename Dist::value_type& multiplier, - const typename Dist::value_type& adder, - const policies::discrete_quantile<policies::integer_round_up>&, - boost::uintmax_t& max_iter); - template <class Dist> - inline typename Dist::value_type - inverse_discrete_quantile( - const Dist& dist, - const typename Dist::value_type& p, - const typename Dist::value_type& guess, - const typename Dist::value_type& multiplier, - const typename Dist::value_type& adder, - const policies::discrete_quantile<policies::integer_round_down>&, - boost::uintmax_t& max_iter); - template <class Dist> - inline typename Dist::value_type - inverse_discrete_quantile( - const Dist& dist, - const typename Dist::value_type& p, - const typename Dist::value_type& guess, - const typename Dist::value_type& multiplier, - const typename Dist::value_type& adder, - const policies::discrete_quantile<policies::integer_round_outwards>&, - boost::uintmax_t& max_iter); - template <class Dist> - inline typename Dist::value_type - inverse_discrete_quantile( - const Dist& dist, - const typename Dist::value_type& p, - const typename Dist::value_type& guess, - const typename Dist::value_type& multiplier, - const typename Dist::value_type& adder, - const policies::discrete_quantile<policies::integer_round_inwards>&, - boost::uintmax_t& max_iter); - template <class Dist> - inline typename Dist::value_type - inverse_discrete_quantile( - const Dist& dist, - const typename Dist::value_type& p, - const typename Dist::value_type& guess, - const typename Dist::value_type& multiplier, - const typename Dist::value_type& adder, - const policies::discrete_quantile<policies::real>&, - boost::uintmax_t& max_iter); - } namespace poisson_detail { // Common error checking routines for Poisson distribution functions. @@ -209,7 +147,7 @@ namespace boost typedef RealType value_type; typedef Policy policy_type; - poisson_distribution(RealType mean = 1) : m_l(mean) // mean (lambda). + poisson_distribution(RealType l_mean = 1) : m_l(l_mean) // mean (lambda). { // Expected mean number of events that occur during the given interval. RealType r; poisson_detail::check_dist( @@ -443,9 +381,10 @@ namespace boost inline RealType quantile(const poisson_distribution<RealType, Policy>& dist, const RealType& p) { // Quantile (or Percent Point) Poisson function. // Return the number of expected events k for a given probability p. + static const char* function = "boost::math::quantile(const poisson_distribution<%1%>&, %1%)"; RealType result = 0; // of Argument checks: if(false == poisson_detail::check_prob( - "boost::math::quantile(const poisson_distribution<%1%>&, %1%)", + function, p, &result, Policy())) { @@ -455,23 +394,21 @@ namespace boost if (dist.mean() == 0) { // if mean = 0 then p = 0, so k can be anything? if (false == poisson_detail::check_mean_NZ( - "boost::math::quantile(const poisson_distribution<%1%>&, %1%)", + function, dist.mean(), &result, Policy())) { return result; } } - /* - BOOST_MATH_STD_USING // ADL of std functions. - // if(p == 0) NOT necessarily zero! - // Not necessarily any special value of k because is unlimited. - if (p <= exp(-dist.mean())) - { // if p <= cdf for 0 events (== pdf for 0 events), then quantile must be zero. - return 0; + if(p == 0) + { + return 0; // Exact result regardless of discrete-quantile Policy + } + if(p == 1) + { + return policies::raise_overflow_error<RealType>(function, 0, Policy()); } - return gamma_q_inva(dist.mean(), p, Policy()) - 1; - */ typedef typename Policy::discrete_quantile_type discrete_type; boost::uintmax_t max_iter = policies::get_max_root_iterations<Policy>(); RealType guess, factor = 8; @@ -497,7 +434,7 @@ namespace boost return detail::inverse_discrete_quantile( dist, p, - 1-p, + false, guess, factor, RealType(1), @@ -512,11 +449,12 @@ namespace boost // complement of the probability q. // // Error checks: + static const char* function = "boost::math::quantile(complement(const poisson_distribution<%1%>&, %1%))"; RealType q = c.param; const poisson_distribution<RealType, Policy>& dist = c.dist; RealType result = 0; // of argument checks. if(false == poisson_detail::check_prob( - "boost::math::quantile(const poisson_distribution<%1%>&, %1%)", + function, q, &result, Policy())) { @@ -526,20 +464,21 @@ namespace boost if (dist.mean() == 0) { // if mean = 0 then p = 0, so k can be anything? if (false == poisson_detail::check_mean_NZ( - "boost::math::quantile(const poisson_distribution<%1%>&, %1%)", + function, dist.mean(), &result, Policy())) { return result; } } - /* - if (-q <= boost::math::expm1(-dist.mean())) - { // if q <= cdf(complement for 0 events, then quantile must be zero. - return 0; + if(q == 0) + { + return policies::raise_overflow_error<RealType>(function, 0, Policy()); + } + if(q == 1) + { + return 0; // Exact result regardless of discrete-quantile Policy } - return gamma_p_inva(dist.mean(), q, Policy()) -1; - */ typedef typename Policy::discrete_quantile_type discrete_type; boost::uintmax_t max_iter = policies::get_max_root_iterations<Policy>(); RealType guess, factor = 8; @@ -564,8 +503,8 @@ namespace boost return detail::inverse_discrete_quantile( dist, - 1-q, q, + true, guess, factor, RealType(1), diff --git a/boost/math/distributions/rayleigh.hpp b/boost/math/distributions/rayleigh.hpp index 1ffb9dc0ad..01f38c0b01 100644 --- a/boost/math/distributions/rayleigh.hpp +++ b/boost/math/distributions/rayleigh.hpp @@ -28,11 +28,11 @@ namespace detail template <class RealType, class Policy> inline bool verify_sigma(const char* function, RealType sigma, RealType* presult, const Policy& pol) { - if(sigma <= 0) + if((sigma <= 0) || (!(boost::math::isfinite)(sigma))) { *presult = policies::raise_domain_error<RealType>( function, - "The scale parameter \"sigma\" must be > 0, but was: %1%.", sigma, pol); + "The scale parameter \"sigma\" must be > 0 and finite, but was: %1%.", sigma, pol); return false; } return true; @@ -41,7 +41,7 @@ namespace detail template <class RealType, class Policy> inline bool verify_rayleigh_x(const char* function, RealType x, RealType* presult, const Policy& pol) { - if(x < 0) + if((x < 0) || (boost::math::isnan)(x)) { *presult = policies::raise_domain_error<RealType>( function, @@ -59,11 +59,11 @@ public: typedef RealType value_type; typedef Policy policy_type; - rayleigh_distribution(RealType sigma = 1) - : m_sigma(sigma) + rayleigh_distribution(RealType l_sigma = 1) + : m_sigma(l_sigma) { RealType err; - detail::verify_sigma("boost::math::rayleigh_distribution<%1%>::rayleigh_distribution", sigma, &err, Policy()); + detail::verify_sigma("boost::math::rayleigh_distribution<%1%>::rayleigh_distribution", l_sigma, &err, Policy()); } // rayleigh_distribution RealType sigma()const @@ -81,7 +81,7 @@ template <class RealType, class Policy> inline const std::pair<RealType, RealType> range(const rayleigh_distribution<RealType, Policy>& /*dist*/) { // Range of permissible values for random variable x. using boost::math::tools::max_value; - return std::pair<RealType, RealType>(static_cast<RealType>(0), max_value<RealType>()); + return std::pair<RealType, RealType>(static_cast<RealType>(0), std::numeric_limits<RealType>::has_infinity ? std::numeric_limits<RealType>::infinity() : max_value<RealType>()); } template <class RealType, class Policy> @@ -108,6 +108,10 @@ inline RealType pdf(const rayleigh_distribution<RealType, Policy>& dist, const R { return result; } + if((boost::math::isinf)(x)) + { + return 0; + } RealType sigmasqr = sigma * sigma; result = x * (exp(-(x * x) / ( 2 * sigmasqr))) / sigmasqr; return result; @@ -175,7 +179,11 @@ inline RealType cdf(const complemented2_type<rayleigh_distribution<RealType, Pol { return result; } - result = exp(-x * x / ( 2 * sigma * sigma)); + RealType ea = x * x / (2 * sigma * sigma); + // Fix for VC11/12 x64 bug in exp(float): + if (ea >= tools::max_value<RealType>()) + return 0; + result = exp(-ea); return result; } // cdf complement diff --git a/boost/math/distributions/skew_normal.hpp b/boost/math/distributions/skew_normal.hpp index 58526defdb..98348e59bb 100644 --- a/boost/math/distributions/skew_normal.hpp +++ b/boost/math/distributions/skew_normal.hpp @@ -1,4 +1,4 @@ -// (C) Benjamin Sobotta 2012 +// Copyright Benjamin Sobotta 2012 // Use, modification and distribution are subject to the // Boost Software License, Version 1.0. (See accompanying file @@ -58,15 +58,15 @@ namespace boost{ namespace math{ typedef RealType value_type; typedef Policy policy_type; - skew_normal_distribution(RealType location = 0, RealType scale = 1, RealType shape = 0) - : location_(location), scale_(scale), shape_(shape) + skew_normal_distribution(RealType l_location = 0, RealType l_scale = 1, RealType l_shape = 0) + : location_(l_location), scale_(l_scale), shape_(l_shape) { // Default is a 'standard' normal distribution N01. (shape=0 results in the normal distribution with no skew) static const char* function = "boost::math::skew_normal_distribution<%1%>::skew_normal_distribution"; RealType result; - detail::check_scale(function, scale, &result, Policy()); - detail::check_location(function, location, &result, Policy()); - detail::check_skew_normal_shape(function, shape, &result, Policy()); + detail::check_scale(function, l_scale, &result, Policy()); + detail::check_location(function, l_location, &result, Policy()); + detail::check_skew_normal_shape(function, l_shape, &result, Policy()); } RealType location()const @@ -100,7 +100,9 @@ namespace boost{ namespace math{ inline const std::pair<RealType, RealType> range(const skew_normal_distribution<RealType, Policy>& /*dist*/) { // Range of permissible values for random variable x. using boost::math::tools::max_value; - return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); // - to + max value. + return std::pair<RealType, RealType>( + std::numeric_limits<RealType>::has_infinity ? -std::numeric_limits<RealType>::infinity() : -max_value<RealType>(), + std::numeric_limits<RealType>::has_infinity ? std::numeric_limits<RealType>::infinity() : max_value<RealType>()); // - to + max value. } template <class RealType, class Policy> @@ -476,50 +478,51 @@ namespace boost{ namespace math{ // 21 elements static const RealType shapes[] = { 0.0, - 1.000000000000000e-004, - 2.069138081114790e-004, - 4.281332398719396e-004, - 8.858667904100824e-004, - 1.832980710832436e-003, - 3.792690190732250e-003, - 7.847599703514606e-003, - 1.623776739188722e-002, - 3.359818286283781e-002, - 6.951927961775606e-002, - 1.438449888287663e-001, - 2.976351441631319e-001, - 6.158482110660261e-001, - 1.274274985703135e+000, - 2.636650898730361e+000, - 5.455594781168514e+000, - 1.128837891684688e+001, - 2.335721469090121e+001, - 4.832930238571753e+001, - 1.000000000000000e+002}; + static_cast<RealType>(1.000000000000000e-004), + static_cast<RealType>(2.069138081114790e-004), + static_cast<RealType>(4.281332398719396e-004), + static_cast<RealType>(8.858667904100824e-004), + static_cast<RealType>(1.832980710832436e-003), + static_cast<RealType>(3.792690190732250e-003), + static_cast<RealType>(7.847599703514606e-003), + static_cast<RealType>(1.623776739188722e-002), + static_cast<RealType>(3.359818286283781e-002), + static_cast<RealType>(6.951927961775606e-002), + static_cast<RealType>(1.438449888287663e-001), + static_cast<RealType>(2.976351441631319e-001), + static_cast<RealType>(6.158482110660261e-001), + static_cast<RealType>(1.274274985703135e+000), + static_cast<RealType>(2.636650898730361e+000), + static_cast<RealType>(5.455594781168514e+000), + static_cast<RealType>(1.128837891684688e+001), + static_cast<RealType>(2.335721469090121e+001), + static_cast<RealType>(4.832930238571753e+001), + static_cast<RealType>(1.000000000000000e+002) + }; // 21 elements static const RealType guess[] = { 0.0, - 5.000050000525391e-005, - 1.500015000148736e-004, - 3.500035000350010e-004, - 7.500075000752560e-004, - 1.450014500145258e-003, - 3.050030500305390e-003, - 6.250062500624765e-003, - 1.295012950129504e-002, - 2.675026750267495e-002, - 5.525055250552491e-002, - 1.132511325113255e-001, - 2.249522495224952e-001, - 3.992539925399257e-001, - 5.353553535535358e-001, - 4.954549545495457e-001, - 3.524535245352451e-001, - 2.182521825218249e-001, - 1.256512565125654e-001, - 6.945069450694508e-002, - 3.735037350373460e-002 + static_cast<RealType>(5.000050000525391e-005), + static_cast<RealType>(1.500015000148736e-004), + static_cast<RealType>(3.500035000350010e-004), + static_cast<RealType>(7.500075000752560e-004), + static_cast<RealType>(1.450014500145258e-003), + static_cast<RealType>(3.050030500305390e-003), + static_cast<RealType>(6.250062500624765e-003), + static_cast<RealType>(1.295012950129504e-002), + static_cast<RealType>(2.675026750267495e-002), + static_cast<RealType>(5.525055250552491e-002), + static_cast<RealType>(1.132511325113255e-001), + static_cast<RealType>(2.249522495224952e-001), + static_cast<RealType>(3.992539925399257e-001), + static_cast<RealType>(5.353553535535358e-001), + static_cast<RealType>(4.954549545495457e-001), + static_cast<RealType>(3.524535245352451e-001), + static_cast<RealType>(2.182521825218249e-001), + static_cast<RealType>(1.256512565125654e-001), + static_cast<RealType>(6.945069450694508e-002), + static_cast<RealType>(3.735037350373460e-002) }; const RealType* result_ptr = std::lower_bound(shapes, shapes+21, shape); @@ -532,7 +535,7 @@ namespace boost{ namespace math{ // TODO: make the search bounds smarter, depending on the shape parameter RealType search_min = 0; // below zero was caught above - RealType search_max = 0.55; // will never go above 0.55 + RealType search_max = 0.55f; // will never go above 0.55 // refine if(d < static_cast<diff_type>(21)) // shape smaller 100 @@ -544,7 +547,7 @@ namespace boost{ namespace math{ } else // shape greater 100 { - result = 1e-4; + result = 1e-4f; search_max = guess[19]; // set 19 instead of 20 to have a safety margin because the table may not be exact @ shape=100 } @@ -642,23 +645,23 @@ namespace boost{ namespace math{ if(false == detail::check_probability(function, p, &result, Policy())) return result; - // compute initial guess via Cornish-Fisher expansion + // Compute initial guess via Cornish-Fisher expansion. RealType x = -boost::math::erfc_inv(2 * p, Policy()) * constants::root_two<RealType>(); - // avoid unnecessary computations if there is no skew + // Avoid unnecessary computations if there is no skew. if(shape != 0) { const RealType skew = skewness(dist); const RealType exk = kurtosis_excess(dist); x = x + (x*x-static_cast<RealType>(1))*skew/static_cast<RealType>(6) - + x*(x*x-static_cast<RealType>(3))*exk/static_cast<RealType>(24) - - x*(static_cast<RealType>(2)*x*x-static_cast<RealType>(5))*skew*skew/static_cast<RealType>(36); + + x*(x*x-static_cast<RealType>(3))*exk/static_cast<RealType>(24) + - x*(static_cast<RealType>(2)*x*x-static_cast<RealType>(5))*skew*skew/static_cast<RealType>(36); } // if(shape != 0) result = standard_deviation(dist)*x+mean(dist); - // handle special case of non-skew normal distribution + // handle special case of non-skew normal distribution. if(shape == 0) return result; @@ -678,7 +681,7 @@ namespace boost{ namespace math{ template <class RealType, class Policy> inline RealType quantile(const complemented2_type<skew_normal_distribution<RealType, Policy>, RealType>& c) - { + { const RealType scale = c.dist.scale(); const RealType location = c.dist.location(); const RealType shape = c.dist.shape(); diff --git a/boost/math/distributions/students_t.hpp b/boost/math/distributions/students_t.hpp index 38df1b6287..0d6a646691 100644 --- a/boost/math/distributions/students_t.hpp +++ b/boost/math/distributions/students_t.hpp @@ -1,5 +1,7 @@ // Copyright John Maddock 2006. -// Copyright Paul A. Bristow 2006. +// Copyright Paul A. Bristow 2006, 2012. +// Copyright Thomas Mang 2012. + // Use, modification and distribution are subject to the // Boost Software License, Version 1.0. (See accompanying file // LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) @@ -14,6 +16,7 @@ #include <boost/math/special_functions/beta.hpp> // for ibeta(a, b, x). #include <boost/math/distributions/complement.hpp> #include <boost/math/distributions/detail/common_error_handling.hpp> +#include <boost/math/distributions/normal.hpp> #include <utility> @@ -31,16 +34,16 @@ public: typedef RealType value_type; typedef Policy policy_type; - students_t_distribution(RealType i) : m_df(i) + students_t_distribution(RealType df) : df_(df) { // Constructor. RealType result; - detail::check_df( - "boost::math::students_t_distribution<%1%>::students_t_distribution", m_df, &result, Policy()); + detail::check_df_gt0_to_inf( // Checks that df > 0 or df == inf. + "boost::math::students_t_distribution<%1%>::students_t_distribution", df_, &result, Policy()); } // students_t_distribution RealType degrees_of_freedom()const { - return m_df; + return df_; } // Parameter estimation: @@ -52,17 +55,16 @@ public: RealType hint = 100); private: - // - // Data members: - // - RealType m_df; // degrees of freedom are a real number. + // Data member: + RealType df_; // degrees of freedom is a real number or +infinity. }; -typedef students_t_distribution<double> students_t; +typedef students_t_distribution<double> students_t; // Convenience typedef for double version. template <class RealType, class Policy> inline const std::pair<RealType, RealType> range(const students_t_distribution<RealType, Policy>& /*dist*/) { // Range of permissible values for random variable x. + // NOT including infinity. using boost::math::tools::max_value; return std::pair<RealType, RealType>(-max_value<RealType>(), max_value<RealType>()); } @@ -76,77 +78,124 @@ inline const std::pair<RealType, RealType> support(const students_t_distribution } template <class RealType, class Policy> -inline RealType pdf(const students_t_distribution<RealType, Policy>& dist, const RealType& t) +inline RealType pdf(const students_t_distribution<RealType, Policy>& dist, const RealType& x) { BOOST_FPU_EXCEPTION_GUARD - BOOST_MATH_STD_USING // for ADL of std functions + BOOST_MATH_STD_USING // for ADL of std functions. - RealType degrees_of_freedom = dist.degrees_of_freedom(); - // Error check: RealType error_result; - if(false == detail::check_df( - "boost::math::pdf(const students_t_distribution<%1%>&, %1%)", degrees_of_freedom, &error_result, Policy())) + if(false == detail::check_x( + "boost::math::pdf(const students_t_distribution<%1%>&, %1%)", x, &error_result, Policy())) + return error_result; + RealType df = dist.degrees_of_freedom(); + if(false == detail::check_df_gt0_to_inf( // Check that df > 0 or == +infinity. + "boost::math::pdf(const students_t_distribution<%1%>&, %1%)", df, &error_result, Policy())) return error_result; - // Might conceivably permit df = +infinity and use normal distribution. + RealType result; - RealType basem1 = t * t / degrees_of_freedom; - if(basem1 < 0.125) - { - result = exp(-boost::math::log1p(basem1, Policy()) * (1+degrees_of_freedom) / 2); + if ((boost::math::isinf)(x)) + { // +infinity. + normal_distribution<RealType, Policy> n(0, 1); + result = pdf(n, x); + return result; + } + RealType limit = policies::get_epsilon<RealType, Policy>(); + // Use policies so that if policy requests lower precision, + // then get the normal distribution approximation earlier. + limit = static_cast<RealType>(1) / limit; // 1/eps + // for 64-bit double 1/eps = 4503599627370496 + if (df > limit) + { // Special case for really big degrees_of_freedom > 1 / eps + // - use normal distribution which is much faster and more accurate. + normal_distribution<RealType, Policy> n(0, 1); + result = pdf(n, x); } else - { - result = pow(1 / (1 + basem1), (degrees_of_freedom + 1) / 2); + { // + RealType basem1 = x * x / df; + if(basem1 < 0.125) + { + result = exp(-boost::math::log1p(basem1, Policy()) * (1+df) / 2); + } + else + { + result = pow(1 / (1 + basem1), (df + 1) / 2); + } + result /= sqrt(df) * boost::math::beta(df / 2, RealType(0.5f), Policy()); } - result /= sqrt(degrees_of_freedom) * boost::math::beta(degrees_of_freedom / 2, RealType(0.5f), Policy()); return result; } // pdf template <class RealType, class Policy> -inline RealType cdf(const students_t_distribution<RealType, Policy>& dist, const RealType& t) +inline RealType cdf(const students_t_distribution<RealType, Policy>& dist, const RealType& x) { - RealType degrees_of_freedom = dist.degrees_of_freedom(); - // Error check: RealType error_result; - if(false == detail::check_df( - "boost::math::cdf(const students_t_distribution<%1%>&, %1%)", degrees_of_freedom, &error_result, Policy())) + if(false == detail::check_x( + "boost::math::pdf(const students_t_distribution<%1%>&, %1%)", x, &error_result, Policy())) return error_result; + RealType df = dist.degrees_of_freedom(); + // Error check: - if (t == 0) - { - return 0.5; + if(false == detail::check_df_gt0_to_inf( // Check that df > 0 or == +infinity. + "boost::math::cdf(const students_t_distribution<%1%>&, %1%)", df, &error_result, Policy())) + return error_result; + + if (x == 0) + { // Special case with exact result. + return static_cast<RealType>(0.5); } - // - // Calculate probability of Student's t using the incomplete beta function. - // probability = ibeta(degrees_of_freedom / 2, 1/2, degrees_of_freedom / (degrees_of_freedom + t*t)) - // - // However when t is small compared to the degrees of freedom, that formula - // suffers from rounding error, use the identity formula to work around - // the problem: - // - // I[x](a,b) = 1 - I[1-x](b,a) - // - // and: - // - // x = df / (df + t^2) - // - // so: - // - // 1 - x = t^2 / (df + t^2) - // - RealType t2 = t * t; - RealType probability; - if(degrees_of_freedom > 2 * t2) - { - RealType z = t2 / (degrees_of_freedom + t2); - probability = ibetac(static_cast<RealType>(0.5), degrees_of_freedom / 2, z, Policy()) / 2; + if ((boost::math::isinf)(x)) + { // +infinity. + normal_distribution<RealType, Policy> n(0, 1); + RealType result = cdf(n, x); + return result; } - else - { - RealType z = degrees_of_freedom / (degrees_of_freedom + t2); - probability = ibeta(degrees_of_freedom / 2, static_cast<RealType>(0.5), z, Policy()) / 2; + RealType limit = policies::get_epsilon<RealType, Policy>(); + // Use policies so that if policy requests lower precision, + // then get the normal distribution approximation earlier. + limit = static_cast<RealType>(1) / limit; // 1/eps + // for 64-bit double 1/eps = 4503599627370496 + if (df > limit) + { // Special case for really big degrees_of_freedom > 1 / eps (perhaps infinite?) + // - use normal distribution which is much faster and more accurate. + normal_distribution<RealType, Policy> n(0, 1); + RealType result = cdf(n, x); + return result; } - return (t > 0 ? 1 - probability : probability); + else + { // normal df case. + // + // Calculate probability of Student's t using the incomplete beta function. + // probability = ibeta(degrees_of_freedom / 2, 1/2, degrees_of_freedom / (degrees_of_freedom + t*t)) + // + // However when t is small compared to the degrees of freedom, that formula + // suffers from rounding error, use the identity formula to work around + // the problem: + // + // I[x](a,b) = 1 - I[1-x](b,a) + // + // and: + // + // x = df / (df + t^2) + // + // so: + // + // 1 - x = t^2 / (df + t^2) + // + RealType x2 = x * x; + RealType probability; + if(df > 2 * x2) + { + RealType z = x2 / (df + x2); + probability = ibetac(static_cast<RealType>(0.5), df / 2, z, Policy()) / 2; + } + else + { + RealType z = df / (df + x2); + probability = ibeta(df / 2, static_cast<RealType>(0.5), z, Policy()) / 2; + } + return (x > 0 ? 1 - probability : probability); + } } // cdf template <class RealType, class Policy> @@ -155,31 +204,27 @@ inline RealType quantile(const students_t_distribution<RealType, Policy>& dist, BOOST_MATH_STD_USING // for ADL of std functions // // Obtain parameters: - // - RealType degrees_of_freedom = dist.degrees_of_freedom(); RealType probability = p; - // + // Check for domain errors: - // + RealType df = dist.degrees_of_freedom(); static const char* function = "boost::math::quantile(const students_t_distribution<%1%>&, %1%)"; RealType error_result; - if(false == detail::check_df( - function, degrees_of_freedom, &error_result, Policy()) - && detail::check_probability(function, probability, &error_result, Policy())) + if(false == (detail::check_df_gt0_to_inf( // Check that df > 0 or == +infinity. + function, df, &error_result, Policy()) + && detail::check_probability(function, probability, &error_result, Policy()))) return error_result; - // Special cases, regardless of degrees_of_freedom. if (probability == 0) return -policies::raise_overflow_error<RealType>(function, 0, Policy()); if (probability == 1) return policies::raise_overflow_error<RealType>(function, 0, Policy()); if (probability == static_cast<RealType>(0.5)) - return 0; - // - // This next block is disabled in favour of a faster method than - // incomplete beta inverse, code retained for future reference: + return 0; // // #if 0 + // This next block is disabled in favour of a faster method than + // incomplete beta inverse, but code retained for future reference: // // Calculate quantile of Student's t using the incomplete beta function inverse: // @@ -205,7 +250,7 @@ inline RealType quantile(const students_t_distribution<RealType, Policy>& dist, // and a couple of epsilon at double precision and in the central // region where most use cases will occur... // - return boost::math::detail::fast_students_t_quantile(degrees_of_freedom, probability, Policy()); + return boost::math::detail::fast_students_t_quantile(df, probability, Policy()); } // quantile template <class RealType, class Policy> @@ -236,7 +281,9 @@ struct sample_size_func RealType operator()(const RealType& df) { if(df <= tools::min_value<RealType>()) + { // return 1; + } students_t_distribution<RealType, Policy> t(df); RealType qa = quantile(complement(t, alpha)); RealType qb = quantile(complement(t, beta)); @@ -279,7 +326,7 @@ RealType students_t_distribution<RealType, Policy>::find_degrees_of_freedom( RealType result = r.first + (r.second - r.first) / 2; if(max_iter >= policies::get_max_root_iterations<Policy>()) { - policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" + return policies::raise_evaluation_error<RealType>(function, "Unable to locate solution in a reasonable time:" " either there is no answer to how many degrees of freedom are required" " or the answer is infinite. Current best guess is %1%", result, Policy()); } @@ -287,76 +334,145 @@ RealType students_t_distribution<RealType, Policy>::find_degrees_of_freedom( } template <class RealType, class Policy> -inline RealType mean(const students_t_distribution<RealType, Policy>& ) +inline RealType mode(const students_t_distribution<RealType, Policy>& /*dist*/) { - return 0; + // Assume no checks on degrees of freedom are useful (unlike mean). + return 0; // Always zero by definition. } template <class RealType, class Policy> -inline RealType variance(const students_t_distribution<RealType, Policy>& dist) +inline RealType median(const students_t_distribution<RealType, Policy>& /*dist*/) { - // Error check: - RealType error_result; - if(false == detail::check_df( - "boost::math::variance(students_t_distribution<%1%> const&, %1%)", dist.degrees_of_freedom(), &error_result, Policy())) - return error_result; - - RealType v = dist.degrees_of_freedom(); - return v / (v - 2); + // Assume no checks on degrees of freedom are useful (unlike mean). + return 0; // Always zero by definition. } +// See section 5.1 on moments at http://en.wikipedia.org/wiki/Student%27s_t-distribution + template <class RealType, class Policy> -inline RealType mode(const students_t_distribution<RealType, Policy>& /*dist*/) -{ +inline RealType mean(const students_t_distribution<RealType, Policy>& dist) +{ // Revised for https://svn.boost.org/trac/boost/ticket/7177 + RealType df = dist.degrees_of_freedom(); + if(((boost::math::isnan)(df)) || (df <= 1) ) + { // mean is undefined for moment <= 1! + return policies::raise_domain_error<RealType>( + "boost::math::mean(students_t_distribution<%1%> const&, %1%)", + "Mean is undefined for degrees of freedom < 1 but got %1%.", df, Policy()); + return std::numeric_limits<RealType>::quiet_NaN(); + } return 0; -} +} // mean template <class RealType, class Policy> -inline RealType median(const students_t_distribution<RealType, Policy>& /*dist*/) -{ - return 0; -} +inline RealType variance(const students_t_distribution<RealType, Policy>& dist) +{ // http://en.wikipedia.org/wiki/Student%27s_t-distribution + // Revised for https://svn.boost.org/trac/boost/ticket/7177 + RealType df = dist.degrees_of_freedom(); + if ((boost::math::isnan)(df) || (df <= 2)) + { // NaN or undefined for <= 2. + return policies::raise_domain_error<RealType>( + "boost::math::variance(students_t_distribution<%1%> const&, %1%)", + "variance is undefined for degrees of freedom <= 2, but got %1%.", + df, Policy()); + return std::numeric_limits<RealType>::quiet_NaN(); // Undefined. + } + if ((boost::math::isinf)(df)) + { // +infinity. + return 1; + } + RealType limit = policies::get_epsilon<RealType, Policy>(); + // Use policies so that if policy requests lower precision, + // then get the normal distribution approximation earlier. + limit = static_cast<RealType>(1) / limit; // 1/eps + // for 64-bit double 1/eps = 4503599627370496 + if (df > limit) + { // Special case for really big degrees_of_freedom > 1 / eps. + return 1; + } + else + { + return df / (df - 2); + } +} // variance template <class RealType, class Policy> inline RealType skewness(const students_t_distribution<RealType, Policy>& dist) { - if(dist.degrees_of_freedom() <= 3) - { - policies::raise_domain_error<RealType>( + RealType df = dist.degrees_of_freedom(); + if( ((boost::math::isnan)(df)) || (dist.degrees_of_freedom() <= 3)) + { // Undefined for moment k = 3. + return policies::raise_domain_error<RealType>( "boost::math::skewness(students_t_distribution<%1%> const&, %1%)", "Skewness is undefined for degrees of freedom <= 3, but got %1%.", dist.degrees_of_freedom(), Policy()); + return std::numeric_limits<RealType>::quiet_NaN(); } - return 0; -} + return 0; // For all valid df, including infinity. +} // skewness template <class RealType, class Policy> inline RealType kurtosis(const students_t_distribution<RealType, Policy>& dist) { RealType df = dist.degrees_of_freedom(); - if(df <= 3) + if(((boost::math::isnan)(df)) || (df <= 4)) + { // Undefined or infinity for moment k = 4. + return policies::raise_domain_error<RealType>( + "boost::math::kurtosis(students_t_distribution<%1%> const&, %1%)", + "Kurtosis is undefined for degrees of freedom <= 4, but got %1%.", + df, Policy()); + return std::numeric_limits<RealType>::quiet_NaN(); // Undefined. + } + if ((boost::math::isinf)(df)) + { // +infinity. + return 3; + } + RealType limit = policies::get_epsilon<RealType, Policy>(); + // Use policies so that if policy requests lower precision, + // then get the normal distribution approximation earlier. + limit = static_cast<RealType>(1) / limit; // 1/eps + // for 64-bit double 1/eps = 4503599627370496 + if (df > limit) + { // Special case for really big degrees_of_freedom > 1 / eps. + return 3; + } + else { - policies::raise_domain_error<RealType>( - "boost::math::kurtosis(students_t_distribution<%1%> const&, %1%)", - "Skewness is undefined for degrees of freedom <= 3, but got %1%.", - df, Policy()); + //return 3 * (df - 2) / (df - 4); re-arranged to + return 6 / (df - 4) + 3; } - return 3 * (df - 2) / (df - 4); -} +} // kurtosis template <class RealType, class Policy> inline RealType kurtosis_excess(const students_t_distribution<RealType, Policy>& dist) { // see http://mathworld.wolfram.com/Kurtosis.html + RealType df = dist.degrees_of_freedom(); - if(df <= 3) + if(((boost::math::isnan)(df)) || (df <= 4)) + { // Undefined or infinity for moment k = 4. + return policies::raise_domain_error<RealType>( + "boost::math::kurtosis_excess(students_t_distribution<%1%> const&, %1%)", + "Kurtosis_excess is undefined for degrees of freedom <= 4, but got %1%.", + df, Policy()); + return std::numeric_limits<RealType>::quiet_NaN(); // Undefined. + } + if ((boost::math::isinf)(df)) + { // +infinity. + return 0; + } + RealType limit = policies::get_epsilon<RealType, Policy>(); + // Use policies so that if policy requests lower precision, + // then get the normal distribution approximation earlier. + limit = static_cast<RealType>(1) / limit; // 1/eps + // for 64-bit double 1/eps = 4503599627370496 + if (df > limit) + { // Special case for really big degrees_of_freedom > 1 / eps. + return 0; + } + else { - policies::raise_domain_error<RealType>( - "boost::math::kurtosis_excess(students_t_distribution<%1%> const&, %1%)", - "Skewness is undefined for degrees of freedom <= 3, but got %1%.", - df, Policy()); + return 6 / (df - 4); } - return 6 / (df - 4); } } // namespace math diff --git a/boost/math/distributions/triangular.hpp b/boost/math/distributions/triangular.hpp index 735d20235c..78ef0df744 100644 --- a/boost/math/distributions/triangular.hpp +++ b/boost/math/distributions/triangular.hpp @@ -147,14 +147,14 @@ namespace boost{ namespace math typedef RealType value_type; typedef Policy policy_type; - triangular_distribution(RealType lower = -1, RealType mode = 0, RealType upper = 1) - : m_lower(lower), m_mode(mode), m_upper(upper) // Constructor. + triangular_distribution(RealType l_lower = -1, RealType l_mode = 0, RealType l_upper = 1) + : m_lower(l_lower), m_mode(l_mode), m_upper(l_upper) // Constructor. { // Evans says 'standard triangular' is lower 0, mode 1/2, upper 1, // has median sqrt(c/2) for c <=1/2 and 1 - sqrt(1-c)/2 for c >= 1/2 // But this -1, 0, 1 is more useful in most applications to approximate normal distribution, // where the central value is the most likely and deviations either side equally likely. RealType result; - detail::check_triangular("boost::math::triangular_distribution<%1%>::triangular_distribution",lower, mode, upper, &result, Policy()); + detail::check_triangular("boost::math::triangular_distribution<%1%>::triangular_distribution",l_lower, l_mode, l_upper, &result, Policy()); } // Accessor functions. RealType lower()const diff --git a/boost/math/distributions/uniform.hpp b/boost/math/distributions/uniform.hpp index 3645b2039b..a20597a66a 100644 --- a/boost/math/distributions/uniform.hpp +++ b/boost/math/distributions/uniform.hpp @@ -116,11 +116,11 @@ namespace boost{ namespace math typedef RealType value_type; typedef Policy policy_type; - uniform_distribution(RealType lower = 0, RealType upper = 1) // Constructor. - : m_lower(lower), m_upper(upper) // Default is standard uniform distribution. + uniform_distribution(RealType l_lower = 0, RealType l_upper = 1) // Constructor. + : m_lower(l_lower), m_upper(l_upper) // Default is standard uniform distribution. { RealType result; - detail::check_uniform("boost::math::uniform_distribution<%1%>::uniform_distribution", lower, upper, &result, Policy()); + detail::check_uniform("boost::math::uniform_distribution<%1%>::uniform_distribution", l_lower, l_upper, &result, Policy()); } // Accessor functions. RealType lower()const diff --git a/boost/math/distributions/weibull.hpp b/boost/math/distributions/weibull.hpp index 6b5c7db34c..da1189090c 100644 --- a/boost/math/distributions/weibull.hpp +++ b/boost/math/distributions/weibull.hpp @@ -28,7 +28,7 @@ inline bool check_weibull_shape( RealType shape, RealType* result, const Policy& pol) { - if((shape < 0) || !(boost::math::isfinite)(shape)) + if((shape <= 0) || !(boost::math::isfinite)(shape)) { *result = policies::raise_domain_error<RealType>( function, @@ -73,11 +73,11 @@ public: typedef RealType value_type; typedef Policy policy_type; - weibull_distribution(RealType shape, RealType scale = 1) - : m_shape(shape), m_scale(scale) + weibull_distribution(RealType l_shape, RealType l_scale = 1) + : m_shape(l_shape), m_scale(l_scale) { RealType result; - detail::check_weibull("boost::math::weibull_distribution<%1%>::weibull_distribution", scale, shape, &result, Policy()); + detail::check_weibull("boost::math::weibull_distribution<%1%>::weibull_distribution", l_scale, l_shape, &result, Policy()); } RealType shape()const @@ -133,11 +133,19 @@ inline RealType pdf(const weibull_distribution<RealType, Policy>& dist, const Re return result; if(x == 0) - { // Special case, but x == min, pdf = 1 for shape = 1, - return 0; + { + if(shape == 1) + { + return 1 / scale; + } + if(shape > 1) + { + return 0; + } + return policies::raise_overflow_error<RealType>(function, 0, Policy()); } result = exp(-pow(x / scale, shape)); - result *= pow(x / scale, shape) * shape / x; + result *= pow(x / scale, shape - 1) * shape / scale; return result; } diff --git a/boost/math/octonion.hpp b/boost/math/octonion.hpp index ce1b66f1da..fba9aff273 100644 --- a/boost/math/octonion.hpp +++ b/boost/math/octonion.hpp @@ -18,23 +18,6 @@ namespace boost { namespace math { -#if BOOST_WORKAROUND(__GNUC__, < 3) - // gcc 2.95.x uses expression templates for valarray calculations, but - // the result is not conforming. We need BOOST_GET_VALARRAY to get an - // actual valarray result when we need to call a member function - #define BOOST_GET_VALARRAY(T,x) ::std::valarray<T>(x) - // gcc 2.95.x has an "std::ios" class that is similar to - // "std::ios_base", so we just use a #define - #define BOOST_IOS_BASE ::std::ios - // gcc 2.x ignores function scope using declarations, - // put them in the scope of the enclosing namespace instead: - using ::std::valarray; - using ::std::sqrt; - using ::std::cos; - using ::std::sin; - using ::std::exp; - using ::std::cosh; -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ #define BOOST_OCTONION_ACCESSOR_GENERATOR(type) \ type real() const \ @@ -958,48 +941,7 @@ namespace boost return(*this); \ } -#if defined(__GNUC__) && (__GNUC__ < 3) - #define BOOST_OCTONION_MEMBER_DIV_GENERATOR_2(type) \ - octonion<type> & operator /= (::std::complex<type> const & rhs) \ - { \ - using ::std::valarray; \ - \ - valarray<type> tr(2); \ - \ - tr[0] = rhs.real(); \ - tr[1] = rhs.imag(); \ - \ - type mixam = (BOOST_GET_VALARRAY(type,static_cast<type>(1)/abs(tr)).max)(); \ - \ - tr *= mixam; \ - \ - valarray<type> tt(8); \ - \ - tt[0] = +a*tr[0]-b*tr[1]; \ - tt[1] = -a*tr[1]+b*tr[0]; \ - tt[2] = +c*tr[0]-d*tr[1]; \ - tt[3] = +c*tr[1]+d*tr[0]; \ - tt[4] = +e*tr[0]-f*tr[1]; \ - tt[5] = +e*tr[1]+f*tr[0]; \ - tt[6] = +g*tr[0]+h*tr[1]; \ - tt[7] = +g*tr[1]+h*tr[0]; \ - \ - tr *= tr; \ - \ - tt *= (mixam/tr.sum()); \ - \ - a = tt[0]; \ - b = tt[1]; \ - c = tt[2]; \ - d = tt[3]; \ - e = tt[4]; \ - f = tt[5]; \ - g = tt[6]; \ - h = tt[7]; \ - \ - return(*this); \ - } -#elif defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) +#if defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) #define BOOST_OCTONION_MEMBER_DIV_GENERATOR_2(type) \ octonion<type> & operator /= (::std::complex<type> const & rhs) \ { \ @@ -1082,52 +1024,9 @@ namespace boost \ return(*this); \ } -#endif /* defined(__GNUC__) && (__GNUC__ < 3) */ /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ +#endif /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ -#if defined(__GNUC__) && (__GNUC__ < 3) - #define BOOST_OCTONION_MEMBER_DIV_GENERATOR_3(type) \ - octonion<type> & operator /= (::boost::math::quaternion<type> const & rhs) \ - { \ - using ::std::valarray; \ - \ - valarray<type> tr(4); \ - \ - tr[0] = static_cast<type>(rhs.R_component_1()); \ - tr[1] = static_cast<type>(rhs.R_component_2()); \ - tr[2] = static_cast<type>(rhs.R_component_3()); \ - tr[3] = static_cast<type>(rhs.R_component_4()); \ - \ - type mixam = (BOOST_GET_VALARRAY(type,static_cast<type>(1)/abs(tr)).max)();\ - \ - tr *= mixam; \ - \ - valarray<type> tt(8); \ - \ - tt[0] = +a*tr[0]+b*tr[1]+c*tr[2]+d*tr[3]; \ - tt[1] = -a*tr[1]+b*tr[0]-c*tr[3]+d*tr[2]; \ - tt[2] = -a*tr[2]+b*tr[3]+c*tr[0]-d*tr[1]; \ - tt[3] = -a*tr[3]-b*tr[2]+c*tr[1]+d*tr[0]; \ - tt[4] = +e*tr[0]-f*tr[1]-g*tr[2]-h*tr[3]; \ - tt[5] = +e*tr[1]+f*tr[0]+g*tr[3]-h*tr[2]; \ - tt[6] = +e*tr[2]-f*tr[3]+g*tr[0]+h*tr[1]; \ - tt[7] = +e*tr[3]+f*tr[2]-g*tr[1]+h*tr[0]; \ - \ - tr *= tr; \ - \ - tt *= (mixam/tr.sum()); \ - \ - a = tt[0]; \ - b = tt[1]; \ - c = tt[2]; \ - d = tt[3]; \ - e = tt[4]; \ - f = tt[5]; \ - g = tt[6]; \ - h = tt[7]; \ - \ - return(*this); \ - } -#elif defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) +#if defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) #define BOOST_OCTONION_MEMBER_DIV_GENERATOR_3(type) \ octonion<type> & operator /= (::boost::math::quaternion<type> const & rhs) \ { \ @@ -1214,57 +1113,9 @@ namespace boost \ return(*this); \ } -#endif /* defined(__GNUC__) && (__GNUC__ < 3) */ /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ +#endif /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ -#if defined(__GNUC__) && (__GNUC__ < 3) - #define BOOST_OCTONION_MEMBER_DIV_GENERATOR_4(type) \ - template<typename X> \ - octonion<type> & operator /= (octonion<X> const & rhs) \ - { \ - using ::std::valarray; \ - \ - valarray<type> tr(8); \ - \ - tr[0] = static_cast<type>(rhs.R_component_1()); \ - tr[1] = static_cast<type>(rhs.R_component_2()); \ - tr[2] = static_cast<type>(rhs.R_component_3()); \ - tr[3] = static_cast<type>(rhs.R_component_4()); \ - tr[4] = static_cast<type>(rhs.R_component_5()); \ - tr[5] = static_cast<type>(rhs.R_component_6()); \ - tr[6] = static_cast<type>(rhs.R_component_7()); \ - tr[7] = static_cast<type>(rhs.R_component_8()); \ - \ - type mixam = (BOOST_GET_VALARRAY(type,static_cast<type>(1)/abs(tr)).max)();\ - \ - tr *= mixam; \ - \ - valarray<type> tt(8); \ - \ - tt[0] = +a*tr[0]+b*tr[1]+c*tr[2]+d*tr[3]+e*tr[4]+f*tr[5]+g*tr[6]+h*tr[7]; \ - tt[1] = -a*tr[1]+b*tr[0]-c*tr[3]+d*tr[2]-e*tr[5]+f*tr[4]+g*tr[7]-h*tr[6]; \ - tt[2] = -a*tr[2]+b*tr[3]+c*tr[0]-d*tr[1]-e*tr[6]-f*tr[7]+g*tr[4]+h*tr[5]; \ - tt[3] = -a*tr[3]-b*tr[2]+c*tr[1]+d*tr[0]-e*tr[7]+f*tr[6]-g*tr[5]+h*tr[4]; \ - tt[4] = -a*tr[4]+b*tr[5]+c*tr[6]+d*tr[7]+e*tr[0]-f*tr[1]-g*tr[2]-h*tr[3]; \ - tt[5] = -a*tr[5]-b*tr[4]+c*tr[7]-d*tr[6]+e*tr[1]+f*tr[0]+g*tr[3]-h*tr[2]; \ - tt[6] = -a*tr[6]-b*tr[7]-c*tr[4]+d*tr[5]+e*tr[2]-f*tr[3]+g*tr[0]+h*tr[1]; \ - tt[7] = -a*tr[7]+b*tr[6]-c*tr[5]-d*tr[4]+e*tr[3]+f*tr[2]-g*tr[1]+h*tr[0]; \ - \ - tr *= tr; \ - \ - tt *= (mixam/tr.sum()); \ - \ - a = tt[0]; \ - b = tt[1]; \ - c = tt[2]; \ - d = tt[3]; \ - e = tt[4]; \ - f = tt[5]; \ - g = tt[6]; \ - h = tt[7]; \ - \ - return(*this); \ - } -#elif defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) +#if defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) #define BOOST_OCTONION_MEMBER_DIV_GENERATOR_4(type) \ template<typename X> \ octonion<type> & operator /= (octonion<X> const & rhs) \ @@ -1361,7 +1212,7 @@ namespace boost \ return(*this); \ } -#endif /* defined(__GNUC__) && (__GNUC__ < 3) */ /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ +#endif /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ #define BOOST_OCTONION_MEMBER_ADD_GENERATOR(type) \ @@ -1856,21 +1707,10 @@ namespace boost // Note: the default values in the constructors of the complex and quaternions make for // a very complex and ambiguous situation; we have made choices to disambiguate. - -#if BOOST_WORKAROUND(__GNUC__, < 3) - template<typename T> - ::std::istream & operator >> ( ::std::istream & is, - octonion<T>& o) -#else template<typename T, typename charT, class traits> ::std::basic_istream<charT,traits> & operator >> ( ::std::basic_istream<charT,traits> & is, octonion<T> & o) -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ { -#if BOOST_WORKAROUND(__GNUC__, < 3) - typedef char charT; -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ - #ifdef BOOST_NO_STD_LOCALE #else const ::std::ctype<charT> & ct = ::std::use_facet< ::std::ctype<charT> >(is.getloc()); @@ -1988,20 +1828,12 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc ==',') // read "((u," @@ -2060,38 +1892,22 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "((a" @@ -2180,11 +1996,7 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "((a),(c" or "((a),(e" @@ -2267,29 +2079,17 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "((a),(c," or "((a),(e," @@ -2342,20 +2142,12 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "((a),(c,d" or "((a),(e,f" @@ -2438,29 +2230,17 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "((a),(e,f," (ambiguity resolution) @@ -2501,11 +2281,7 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "((a),(e,f,g," @@ -2544,48 +2320,28 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } @@ -2651,39 +2407,23 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc ==',') // read "((a," @@ -2758,29 +2498,17 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else @@ -2869,11 +2597,7 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "((a,b),(c" or "((a,b),(e" @@ -2956,29 +2680,17 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "((a,b),(c," or "((a,b),(e," @@ -3033,20 +2745,12 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "((a,b),(c,d" or "((a,b),(e,f" @@ -3129,29 +2833,17 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "((a,b),(e,f," (ambiguity resolution) @@ -3192,11 +2884,7 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "((a,b),(e,f,g," @@ -3235,67 +2923,39 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "((a,b," @@ -3354,20 +3014,12 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "((a,b,c," @@ -3426,57 +3078,33 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } @@ -3554,11 +3182,7 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "(a,(c" or "(a,(e" @@ -3641,29 +3265,17 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "(a,(c," or "(a,(e," @@ -3718,20 +3330,12 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "(a,(c,d" or "(a,(e,f" @@ -3814,29 +3418,17 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "(a,(e,f," (ambiguity resolution) @@ -3877,11 +3469,7 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else if (cc == ',') // read "(a,(e,f,g," @@ -3920,48 +3508,28 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } @@ -4047,20 +3615,12 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "(a,b,c" or "(a,c,e" @@ -4127,11 +3687,7 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "(a,b,c,d" (ambiguity resolution) @@ -4238,77 +3794,45 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } @@ -4328,21 +3852,11 @@ namespace boost } -#if BOOST_WORKAROUND(__GNUC__, < 3) - template<typename T> - ::std::ostream & operator << ( ::std::ostream & os, - octonion<T> const & o) -#else template<typename T, typename charT, class traits> ::std::basic_ostream<charT,traits> & operator << ( ::std::basic_ostream<charT,traits> & os, octonion<T> const & o) -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ { -#if BOOST_WORKAROUND(__GNUC__, < 3) - ::std::ostringstream s; -#else ::std::basic_ostringstream<charT,traits> s; -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ s.flags(os.flags()); #ifdef BOOST_NO_STD_LOCALE @@ -4404,11 +3918,7 @@ namespace boost BOOST_OCTONION_VALARRAY_LOADER -#if BOOST_WORKAROUND(__GNUC__, < 3) - return((BOOST_GET_VALARRAY(T, abs(temp)).max)()); -#else return((abs(temp).max)()); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } @@ -4421,11 +3931,7 @@ namespace boost BOOST_OCTONION_VALARRAY_LOADER -#if BOOST_WORKAROUND(__GNUC__, < 3) - return(BOOST_GET_VALARRAY(T, abs(temp)).sum()); -#else return(abs(temp).sum()); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } @@ -4440,11 +3946,7 @@ namespace boost BOOST_OCTONION_VALARRAY_LOADER -#if BOOST_WORKAROUND(__GNUC__, < 3) - T maxim = (BOOST_GET_VALARRAY(T,abs(temp)).max)(); // overflow protection -#else T maxim = (abs(temp).max)(); // overflow protection -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ if (maxim == static_cast<T>(0)) { @@ -4745,10 +4247,4 @@ namespace boost } } - -#if BOOST_WORKAROUND(__GNUC__, < 3) - #undef BOOST_GET_VALARRAY -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ - - #endif /* BOOST_OCTONION_HPP */ diff --git a/boost/math/policies/error_handling.hpp b/boost/math/policies/error_handling.hpp index d4306c6006..674759006e 100644 --- a/boost/math/policies/error_handling.hpp +++ b/boost/math/policies/error_handling.hpp @@ -12,7 +12,7 @@ #include <iomanip> #include <string> #include <cerrno> -#include <complex> +#include <boost/config/no_tr1/complex.hpp> #include <boost/config/no_tr1/cmath.hpp> #include <stdexcept> #include <boost/math/tools/config.hpp> @@ -24,7 +24,7 @@ # pragma warning(disable: 4996) // _SCL_SECURE_NO_DEPRECATE # pragma warning(disable: 4512) // assignment operator could not be generated. // And warnings in error handling: -# pragma warning(disable: 4702) // unreachable code +# pragma warning(disable: 4702) // unreachable code. // Note that this only occurs when the compiler can deduce code is unreachable, // for example when policy macros are used to ignore errors rather than throw. #endif @@ -46,7 +46,7 @@ public: namespace policies{ // -// Forward declarations of user error handlers, +// Forward declarations of user error handlers, // it's up to the user to provide the definition of these: // template <class T> @@ -70,7 +70,7 @@ namespace detail { // // Helper function to avoid binding rvalue to non-const-reference, -// in other words a warning suppression mechansim: +// in other words a warning suppression mechanism: // template <class Formatter, class Group> inline std::string do_format(Formatter f, const Group& g) @@ -78,6 +78,27 @@ inline std::string do_format(Formatter f, const Group& g) return (f % g).str(); } +template <class T> +inline const char* name_of() +{ +#ifndef BOOST_NO_RTTI + return typeid(T).name(); +#else + return "unknown"; +#endif +} +template <> inline const char* name_of<float>(){ return "float"; } +template <> inline const char* name_of<double>(){ return "double"; } +template <> inline const char* name_of<long double>(){ return "long double"; } + +#ifdef BOOST_MATH_USE_FLOAT128 +template <> +inline const char* name_of<BOOST_MATH_FLOAT128_TYPE>() +{ + return "__float128"; +} +#endif + template <class E, class T> void raise_error(const char* function, const char* message) { @@ -87,7 +108,11 @@ void raise_error(const char* function, const char* message) message = "Cause unknown"; std::string msg("Error in function "); - msg += (boost::format(function) % typeid(T).name()).str(); +#ifndef BOOST_NO_RTTI + msg += (boost::format(function) % boost::math::policies::detail::name_of<T>()).str(); +#else + msg += function; +#endif msg += ": "; msg += message; @@ -104,7 +129,11 @@ void raise_error(const char* function, const char* message, const T& val) message = "Cause unknown: error caused by bad argument with value %1%"; std::string msg("Error in function "); - msg += (boost::format(function) % typeid(T).name()).str(); +#ifndef BOOST_NO_RTTI + msg += (boost::format(function) % boost::math::policies::detail::name_of<T>()).str(); +#else + msg += function; +#endif msg += ": "; msg += message; @@ -117,9 +146,9 @@ void raise_error(const char* function, const char* message, const T& val) template <class T> inline T raise_domain_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const ::boost::math::policies::domain_error< ::boost::math::policies::throw_on_error>&) { raise_error<std::domain_error, T>(function, message, val); @@ -129,9 +158,9 @@ inline T raise_domain_error( template <class T> inline T raise_domain_error( - const char* , - const char* , - const T& , + const char* , + const char* , + const T& , const ::boost::math::policies::domain_error< ::boost::math::policies::ignore_error>&) { // This may or may not do the right thing, but the user asked for the error @@ -141,9 +170,9 @@ inline T raise_domain_error( template <class T> inline T raise_domain_error( - const char* , - const char* , - const T& , + const char* , + const char* , + const T& , const ::boost::math::policies::domain_error< ::boost::math::policies::errno_on_error>&) { errno = EDOM; @@ -154,9 +183,9 @@ inline T raise_domain_error( template <class T> inline T raise_domain_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const ::boost::math::policies::domain_error< ::boost::math::policies::user_error>&) { return user_domain_error(function, message, val); @@ -164,9 +193,9 @@ inline T raise_domain_error( template <class T> inline T raise_pole_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const ::boost::math::policies::pole_error< ::boost::math::policies::throw_on_error>&) { return boost::math::policies::detail::raise_domain_error(function, message, val, ::boost::math::policies::domain_error< ::boost::math::policies::throw_on_error>()); @@ -174,9 +203,9 @@ inline T raise_pole_error( template <class T> inline T raise_pole_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const ::boost::math::policies::pole_error< ::boost::math::policies::ignore_error>&) { return ::boost::math::policies::detail::raise_domain_error(function, message, val, ::boost::math::policies::domain_error< ::boost::math::policies::ignore_error>()); @@ -184,9 +213,9 @@ inline T raise_pole_error( template <class T> inline T raise_pole_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const ::boost::math::policies::pole_error< ::boost::math::policies::errno_on_error>&) { return ::boost::math::policies::detail::raise_domain_error(function, message, val, ::boost::math::policies::domain_error< ::boost::math::policies::errno_on_error>()); @@ -194,29 +223,54 @@ inline T raise_pole_error( template <class T> inline T raise_pole_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const ::boost::math::policies::pole_error< ::boost::math::policies::user_error>&) { return user_pole_error(function, message, val); } + template <class T> inline T raise_overflow_error( - const char* function, - const char* message, + const char* function, + const char* message, const ::boost::math::policies::overflow_error< ::boost::math::policies::throw_on_error>&) { raise_error<std::overflow_error, T>(function, message ? message : "numeric overflow"); - // we never get here: + // We should never get here: return std::numeric_limits<T>::has_infinity ? std::numeric_limits<T>::infinity() : boost::math::tools::max_value<T>(); } template <class T> inline T raise_overflow_error( - const char* , - const char* , + const char* function, + const char* message, + const T& val, + const ::boost::math::policies::overflow_error< ::boost::math::policies::throw_on_error>&) +{ + raise_error<std::overflow_error, T>(function, message ? message : "numeric overflow", val); + // We should never get here: + return std::numeric_limits<T>::has_infinity ? std::numeric_limits<T>::infinity() : boost::math::tools::max_value<T>(); +} + +template <class T> +inline T raise_overflow_error( + const char* , + const char* , + const ::boost::math::policies::overflow_error< ::boost::math::policies::ignore_error>&) +{ + // This may or may not do the right thing, but the user asked for the error + // to be ignored so here we go anyway: + return std::numeric_limits<T>::has_infinity ? std::numeric_limits<T>::infinity() : boost::math::tools::max_value<T>(); +} + +template <class T> +inline T raise_overflow_error( + const char* , + const char* , + const T&, const ::boost::math::policies::overflow_error< ::boost::math::policies::ignore_error>&) { // This may or may not do the right thing, but the user asked for the error @@ -226,8 +280,8 @@ inline T raise_overflow_error( template <class T> inline T raise_overflow_error( - const char* , - const char* , + const char* , + const char* , const ::boost::math::policies::overflow_error< ::boost::math::policies::errno_on_error>&) { errno = ERANGE; @@ -238,28 +292,59 @@ inline T raise_overflow_error( template <class T> inline T raise_overflow_error( - const char* function, - const char* message, + const char* , + const char* , + const T&, + const ::boost::math::policies::overflow_error< ::boost::math::policies::errno_on_error>&) +{ + errno = ERANGE; + // This may or may not do the right thing, but the user asked for the error + // to be silent so here we go anyway: + return std::numeric_limits<T>::has_infinity ? std::numeric_limits<T>::infinity() : boost::math::tools::max_value<T>(); +} + +template <class T> +inline T raise_overflow_error( + const char* function, + const char* message, const ::boost::math::policies::overflow_error< ::boost::math::policies::user_error>&) { return user_overflow_error(function, message, std::numeric_limits<T>::infinity()); } template <class T> +inline T raise_overflow_error( + const char* function, + const char* message, + const T& val, + const ::boost::math::policies::overflow_error< ::boost::math::policies::user_error>&) +{ + std::string fmsg("Error in function "); +#ifndef BOOST_NO_RTTI + fmsg += (boost::format(function) % boost::math::policies::detail::name_of<T>()).str(); +#else + fmsg += function; +#endif + int prec = 2 + (boost::math::policies::digits<T, boost::math::policies::policy<> >() * 30103UL) / 100000UL; + std::string msg = do_format(boost::format(message), boost::io::group(std::setprecision(prec), val)); + return user_overflow_error(fmsg.c_str(), msg.c_str(), std::numeric_limits<T>::infinity()); +} + +template <class T> inline T raise_underflow_error( - const char* function, - const char* message, + const char* function, + const char* message, const ::boost::math::policies::underflow_error< ::boost::math::policies::throw_on_error>&) { raise_error<std::underflow_error, T>(function, message ? message : "numeric underflow"); - // we never get here: + // We should never get here: return 0; } template <class T> inline T raise_underflow_error( - const char* , - const char* , + const char* , + const char* , const ::boost::math::policies::underflow_error< ::boost::math::policies::ignore_error>&) { // This may or may not do the right thing, but the user asked for the error @@ -269,8 +354,8 @@ inline T raise_underflow_error( template <class T> inline T raise_underflow_error( - const char* /* function */, - const char* /* message */, + const char* /* function */, + const char* /* message */, const ::boost::math::policies::underflow_error< ::boost::math::policies::errno_on_error>&) { errno = ERANGE; @@ -281,8 +366,8 @@ inline T raise_underflow_error( template <class T> inline T raise_underflow_error( - const char* function, - const char* message, + const char* function, + const char* message, const ::boost::math::policies::underflow_error< ::boost::math::policies::user_error>&) { return user_underflow_error(function, message, T(0)); @@ -290,8 +375,8 @@ inline T raise_underflow_error( template <class T> inline T raise_denorm_error( - const char* function, - const char* message, + const char* function, + const char* message, const T& /* val */, const ::boost::math::policies::denorm_error< ::boost::math::policies::throw_on_error>&) { @@ -302,8 +387,8 @@ inline T raise_denorm_error( template <class T> inline T raise_denorm_error( - const char* , - const char* , + const char* , + const char* , const T& val, const ::boost::math::policies::denorm_error< ::boost::math::policies::ignore_error>&) { @@ -314,8 +399,8 @@ inline T raise_denorm_error( template <class T> inline T raise_denorm_error( - const char* , - const char* , + const char* , + const char* , const T& val, const ::boost::math::policies::denorm_error< ::boost::math::policies::errno_on_error>&) { @@ -327,8 +412,8 @@ inline T raise_denorm_error( template <class T> inline T raise_denorm_error( - const char* function, - const char* message, + const char* function, + const char* message, const T& val, const ::boost::math::policies::denorm_error< ::boost::math::policies::user_error>&) { @@ -337,9 +422,9 @@ inline T raise_denorm_error( template <class T> inline T raise_evaluation_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const ::boost::math::policies::evaluation_error< ::boost::math::policies::throw_on_error>&) { raise_error<boost::math::evaluation_error, T>(function, message, val); @@ -349,9 +434,9 @@ inline T raise_evaluation_error( template <class T> inline T raise_evaluation_error( - const char* , - const char* , - const T& val, + const char* , + const char* , + const T& val, const ::boost::math::policies::evaluation_error< ::boost::math::policies::ignore_error>&) { // This may or may not do the right thing, but the user asked for the error @@ -361,9 +446,9 @@ inline T raise_evaluation_error( template <class T> inline T raise_evaluation_error( - const char* , - const char* , - const T& val, + const char* , + const char* , + const T& val, const ::boost::math::policies::evaluation_error< ::boost::math::policies::errno_on_error>&) { errno = EDOM; @@ -374,59 +459,61 @@ inline T raise_evaluation_error( template <class T> inline T raise_evaluation_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const ::boost::math::policies::evaluation_error< ::boost::math::policies::user_error>&) { return user_evaluation_error(function, message, val); } template <class T, class TargetType> -inline T raise_rounding_error( - const char* function, - const char* message, - const T& val, +inline TargetType raise_rounding_error( + const char* function, + const char* message, + const T& val, const TargetType&, const ::boost::math::policies::rounding_error< ::boost::math::policies::throw_on_error>&) { raise_error<boost::math::rounding_error, T>(function, message, val); // we never get here: - return T(0); + return TargetType(0); } template <class T, class TargetType> -inline T raise_rounding_error( - const char* , - const char* , - const T& val, +inline TargetType raise_rounding_error( + const char* , + const char* , + const T& val, const TargetType&, const ::boost::math::policies::rounding_error< ::boost::math::policies::ignore_error>&) { // This may or may not do the right thing, but the user asked for the error // to be ignored so here we go anyway: - return std::numeric_limits<T>::is_specialized ? (val > 0 ? (std::numeric_limits<T>::max)() : -(std::numeric_limits<T>::max)()): val; + BOOST_STATIC_ASSERT(std::numeric_limits<TargetType>::is_specialized); + return val > 0 ? (std::numeric_limits<TargetType>::max)() : (std::numeric_limits<TargetType>::is_integer ? (std::numeric_limits<TargetType>::min)() : -(std::numeric_limits<TargetType>::max)()); } template <class T, class TargetType> -inline T raise_rounding_error( - const char* , - const char* , - const T& val, +inline TargetType raise_rounding_error( + const char* , + const char* , + const T& val, const TargetType&, const ::boost::math::policies::rounding_error< ::boost::math::policies::errno_on_error>&) { errno = ERANGE; // This may or may not do the right thing, but the user asked for the error // to be silent so here we go anyway: - return std::numeric_limits<T>::is_specialized ? (val > 0 ? (std::numeric_limits<T>::max)() : -(std::numeric_limits<T>::max)()): val; + BOOST_STATIC_ASSERT(std::numeric_limits<TargetType>::is_specialized); + return val > 0 ? (std::numeric_limits<TargetType>::max)() : (std::numeric_limits<TargetType>::is_integer ? (std::numeric_limits<TargetType>::min)() : -(std::numeric_limits<TargetType>::max)()); } template <class T, class TargetType> -inline T raise_rounding_error( - const char* function, - const char* message, - const T& val, +inline TargetType raise_rounding_error( + const char* function, + const char* message, + const T& val, const TargetType& t, const ::boost::math::policies::rounding_error< ::boost::math::policies::user_error>&) { @@ -435,9 +522,9 @@ inline T raise_rounding_error( template <class T, class R> inline T raise_indeterminate_result_error( - const char* function, - const char* message, - const T& val, + const char* function, + const char* message, + const T& val, const R& , const ::boost::math::policies::indeterminate_result_error< ::boost::math::policies::throw_on_error>&) { @@ -448,10 +535,10 @@ inline T raise_indeterminate_result_error( template <class T, class R> inline T raise_indeterminate_result_error( - const char* , - const char* , - const T& , - const R& result, + const char* , + const char* , + const T& , + const R& result, const ::boost::math::policies::indeterminate_result_error< ::boost::math::policies::ignore_error>&) { // This may or may not do the right thing, but the user asked for the error @@ -461,10 +548,10 @@ inline T raise_indeterminate_result_error( template <class T, class R> inline T raise_indeterminate_result_error( - const char* , - const char* , - const T& , - const R& result, + const char* , + const char* , + const T& , + const R& result, const ::boost::math::policies::indeterminate_result_error< ::boost::math::policies::errno_on_error>&) { errno = EDOM; @@ -475,10 +562,10 @@ inline T raise_indeterminate_result_error( template <class T, class R> inline T raise_indeterminate_result_error( - const char* function, - const char* message, - const T& val, - const R& , + const char* function, + const char* message, + const T& val, + const R& , const ::boost::math::policies::indeterminate_result_error< ::boost::math::policies::user_error>&) { return user_indeterminate_result_error(function, message, val); @@ -491,7 +578,7 @@ inline T raise_domain_error(const char* function, const char* message, const T& { typedef typename Policy::domain_error_type policy_type; return detail::raise_domain_error( - function, message ? message : "Domain Error evaluating function at %1%", + function, message ? message : "Domain Error evaluating function at %1%", val, policy_type()); } @@ -500,7 +587,7 @@ inline T raise_pole_error(const char* function, const char* message, const T& va { typedef typename Policy::pole_error_type policy_type; return detail::raise_pole_error( - function, message ? message : "Evaluation of function at pole %1%", + function, message ? message : "Evaluation of function at pole %1%", val, policy_type()); } @@ -509,16 +596,25 @@ inline T raise_overflow_error(const char* function, const char* message, const P { typedef typename Policy::overflow_error_type policy_type; return detail::raise_overflow_error<T>( - function, message ? message : "Overflow Error", + function, message ? message : "Overflow Error", policy_type()); } template <class T, class Policy> +inline T raise_overflow_error(const char* function, const char* message, const T& val, const Policy&) +{ + typedef typename Policy::overflow_error_type policy_type; + return detail::raise_overflow_error( + function, message ? message : "Overflow evaluating function at %1%", + val, policy_type()); +} + +template <class T, class Policy> inline T raise_underflow_error(const char* function, const char* message, const Policy&) { typedef typename Policy::underflow_error_type policy_type; return detail::raise_underflow_error<T>( - function, message ? message : "Underflow Error", + function, message ? message : "Underflow Error", policy_type()); } @@ -527,7 +623,7 @@ inline T raise_denorm_error(const char* function, const char* message, const T& { typedef typename Policy::denorm_error_type policy_type; return detail::raise_denorm_error<T>( - function, message ? message : "Denorm Error", + function, message ? message : "Denorm Error", val, policy_type()); } @@ -537,16 +633,16 @@ inline T raise_evaluation_error(const char* function, const char* message, const { typedef typename Policy::evaluation_error_type policy_type; return detail::raise_evaluation_error( - function, message ? message : "Internal Evaluation Error, best value so far was %1%", + function, message ? message : "Internal Evaluation Error, best value so far was %1%", val, policy_type()); } template <class T, class TargetType, class Policy> -inline T raise_rounding_error(const char* function, const char* message, const T& val, const TargetType& t, const Policy&) +inline TargetType raise_rounding_error(const char* function, const char* message, const T& val, const TargetType& t, const Policy&) { typedef typename Policy::rounding_error_type policy_type; return detail::raise_rounding_error( - function, message ? message : "Value %1% can not be represented in the target integer type.", + function, message ? message : "Value %1% can not be represented in the target integer type.", val, t, policy_type()); } @@ -571,7 +667,8 @@ inline bool check_overflow(T val, R* result, const char* function, const Policy& BOOST_MATH_STD_USING if(fabs(val) > tools::max_value<R>()) { - *result = static_cast<R>(boost::math::policies::detail::raise_overflow_error<R>(function, 0, pol)); + boost::math::policies::detail::raise_overflow_error<R>(function, 0, pol); + *result = static_cast<R>(val); return true; } return false; @@ -581,7 +678,8 @@ inline bool check_overflow(std::complex<T> val, R* result, const char* function, { typedef typename R::value_type r_type; r_type re, im; - bool r = check_overflow<r_type>(val.real(), &re, function, pol) || check_overflow<r_type>(val.imag(), &im, function, pol); + bool r = check_overflow<r_type>(val.real(), &re, function, pol); + r = check_overflow<r_type>(val.imag(), &im, function, pol) || r; *result = R(re, im); return r; } @@ -600,7 +698,8 @@ inline bool check_underflow(std::complex<T> val, R* result, const char* function { typedef typename R::value_type r_type; r_type re, im; - bool r = check_underflow<r_type>(val.real(), &re, function, pol) || check_underflow<r_type>(val.imag(), &im, function, pol); + bool r = check_underflow<r_type>(val.real(), &re, function, pol); + r = check_underflow<r_type>(val.imag(), &im, function, pol) || r; *result = R(re, im); return r; } @@ -620,7 +719,8 @@ inline bool check_denorm(std::complex<T> val, R* result, const char* function, c { typedef typename R::value_type r_type; r_type re, im; - bool r = check_denorm<r_type>(val.real(), &re, function, pol) || check_denorm<r_type>(val.imag(), &im, function, pol); + bool r = check_denorm<r_type>(val.real(), &re, function, pol); + r = check_denorm<r_type>(val.imag(), &im, function, pol) || r; *result = R(re, im); return r; } @@ -681,6 +781,20 @@ inline void check_root_iterations(const char* function, boost::uintmax_t max_ite } //namespace policies +namespace detail{ + +// +// Simple helper function to assist in returning a pair from a single value, +// that value usually comes from one of the error handlers above: +// +template <class T> +std::pair<T, T> pair_from_single(const T& val) +{ + return std::make_pair(val, val); +} + +} + #ifdef BOOST_MSVC # pragma warning(pop) #endif diff --git a/boost/math/policies/policy.hpp b/boost/math/policies/policy.hpp index 70e67c70ba..49068a6ed5 100644 --- a/boost/math/policies/policy.hpp +++ b/boost/math/policies/policy.hpp @@ -94,8 +94,7 @@ namespace policies{ #define BOOST_MATH_MAX_ROOT_ITERATION_POLICY 200 #endif -#if !defined(__BORLANDC__) \ - && !(defined(__GNUC__) && (__GNUC__ == 3) && (__GNUC_MINOR__ <= 2)) +#if !defined(__BORLANDC__) #define BOOST_MATH_META_INT(type, name, Default)\ template <type N = Default> struct name : public boost::mpl::int_<N>{};\ namespace detail{\ @@ -431,7 +430,7 @@ public: // // Mathematically undefined properties: // - typedef typename detail::find_arg<arg_list, is_assert_undefined<mpl::_1>, discrete_quantile<> >::type assert_undefined_type; + typedef typename detail::find_arg<arg_list, is_assert_undefined<mpl::_1>, assert_undefined<> >::type assert_undefined_type; // // Max iterations: // @@ -537,12 +536,12 @@ private: // // Mathematically undefined properties: // - typedef typename detail::find_arg<arg_list, is_assert_undefined<mpl::_1>, discrete_quantile<> >::type assert_undefined_type; + typedef typename detail::find_arg<arg_list, is_assert_undefined<mpl::_1>, typename Policy::assert_undefined_type >::type assert_undefined_type; // // Max iterations: // - typedef typename detail::find_arg<arg_list, is_max_series_iterations<mpl::_1>, max_series_iterations<> >::type max_series_iterations_type; - typedef typename detail::find_arg<arg_list, is_max_root_iterations<mpl::_1>, max_root_iterations<> >::type max_root_iterations_type; + typedef typename detail::find_arg<arg_list, is_max_series_iterations<mpl::_1>, typename Policy::max_series_iterations_type>::type max_series_iterations_type; + typedef typename detail::find_arg<arg_list, is_max_root_iterations<mpl::_1>, typename Policy::max_root_iterations_type>::type max_root_iterations_type; // // Define a typelist of the policies: // @@ -813,6 +812,16 @@ struct precision #endif +#ifdef BOOST_MATH_USE_FLOAT128 + +template <class Policy> +struct precision<BOOST_MATH_FLOAT128_TYPE, Policy> +{ + typedef mpl::int_<113> type; +}; + +#endif + namespace detail{ template <class T, class Policy> diff --git a/boost/math/quaternion.hpp b/boost/math/quaternion.hpp index bbe767d22b..d816a767cb 100644 --- a/boost/math/quaternion.hpp +++ b/boost/math/quaternion.hpp @@ -33,23 +33,6 @@ namespace boost { namespace math { -#if BOOST_WORKAROUND(__GNUC__, < 3) - // gcc 2.95.x uses expression templates for valarray calculations, but - // the result is not conforming. We need BOOST_GET_VALARRAY to get an - // actual valarray result when we need to call a member function - #define BOOST_GET_VALARRAY(T,x) ::std::valarray<T>(x) - // gcc 2.95.x has an "std::ios" class that is similar to - // "std::ios_base", so we just use a #define - #define BOOST_IOS_BASE ::std::ios - // gcc 2.x ignores function scope using declarations, - // put them in the scope of the enclosing namespace instead: - using ::std::valarray; - using ::std::sqrt; - using ::std::cos; - using ::std::sin; - using ::std::exp; - using ::std::cosh; -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ #define BOOST_QUATERNION_ACCESSOR_GENERATOR(type) \ type real() const \ @@ -601,40 +584,7 @@ namespace boost return(*this); \ } -#if defined(__GNUC__) && (__GNUC__ < 3) - #define BOOST_QUATERNION_MEMBER_DIV_GENERATOR_2(type) \ - quaternion<type> & operator /= (::std::complex<type> const & rhs) \ - { \ - using ::std::valarray; \ - \ - valarray<type> tr(2); \ - \ - tr[0] = rhs.real(); \ - tr[1] = rhs.imag(); \ - \ - type mixam = (BOOST_GET_VALARRAY(type,static_cast<type>(1)/abs(tr)).max)(); \ - \ - tr *= mixam; \ - \ - valarray<type> tt(4); \ - \ - tt[0] = +a*tr[0]+b*tr[1]; \ - tt[1] = -a*tr[1]+b*tr[0]; \ - tt[2] = +c*tr[0]-d*tr[1]; \ - tt[3] = +c*tr[1]+d*tr[0]; \ - \ - tr *= tr; \ - \ - tt *= (mixam/tr.sum()); \ - \ - a = tt[0]; \ - b = tt[1]; \ - c = tt[2]; \ - d = tt[3]; \ - \ - return(*this); \ - } -#elif defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) +#if defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) #define BOOST_QUATERNION_MEMBER_DIV_GENERATOR_2(type) \ quaternion<type> & operator /= (::std::complex<type> const & rhs) \ { \ @@ -701,45 +651,9 @@ namespace boost \ return(*this); \ } -#endif /* defined(__GNUC__) && (__GNUC__ < 3) */ /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ +#endif /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ -#if defined(__GNUC__) && (__GNUC__ < 3) - #define BOOST_QUATERNION_MEMBER_DIV_GENERATOR_3(type) \ - template<typename X> \ - quaternion<type> & operator /= (quaternion<X> const & rhs) \ - { \ - using ::std::valarray; \ - \ - valarray<type> tr(4); \ - \ - tr[0] = static_cast<type>(rhs.R_component_1()); \ - tr[1] = static_cast<type>(rhs.R_component_2()); \ - tr[2] = static_cast<type>(rhs.R_component_3()); \ - tr[3] = static_cast<type>(rhs.R_component_4()); \ - \ - type mixam = (BOOST_GET_VALARRAY(type,static_cast<type>(1)/abs(tr)).max)(); \ - \ - tr *= mixam; \ - \ - valarray<type> tt(4); \ - \ - tt[0] = +a*tr[0]+b*tr[1]+c*tr[2]+d*tr[3]; \ - tt[1] = -a*tr[1]+b*tr[0]-c*tr[3]+d*tr[2]; \ - tt[2] = -a*tr[2]+b*tr[3]+c*tr[0]-d*tr[1]; \ - tt[3] = -a*tr[3]-b*tr[2]+c*tr[1]+d*tr[0]; \ - \ - tr *= tr; \ - \ - tt *= (mixam/tr.sum()); \ - \ - a = tt[0]; \ - b = tt[1]; \ - c = tt[2]; \ - d = tt[3]; \ - \ - return(*this); \ - } -#elif defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) +#if defined(BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP) #define BOOST_QUATERNION_MEMBER_DIV_GENERATOR_3(type) \ template<typename X> \ quaternion<type> & operator /= (quaternion<X> const & rhs) \ @@ -812,7 +726,7 @@ namespace boost \ return(*this); \ } -#endif /* defined(__GNUC__) && (__GNUC__ < 3) */ /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ +#endif /* BOOST_NO_ARGUMENT_DEPENDENT_LOOKUP */ #define BOOST_QUATERNION_MEMBER_ADD_GENERATOR(type) \ BOOST_QUATERNION_MEMBER_ADD_GENERATOR_1(type) \ @@ -1219,19 +1133,10 @@ namespace boost // a // (a), (a,b), (a,b,c), (a,b,c,d) // (a,(c)), (a,(c,d)), ((a)), ((a),c), ((a),(c)), ((a),(c,d)), ((a,b)), ((a,b),c), ((a,b),(c)), ((a,b),(c,d)) -#if BOOST_WORKAROUND(__GNUC__, < 3) - template<typename T> - std::istream & operator >> ( ::std::istream & is, - quaternion<T> & q) -#else template<typename T, typename charT, class traits> ::std::basic_istream<charT,traits> & operator >> ( ::std::basic_istream<charT,traits> & is, quaternion<T> & q) -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ { -#if BOOST_WORKAROUND(__GNUC__, < 3) - typedef char charT; -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ #ifdef BOOST_NO_STD_LOCALE #else @@ -1319,20 +1224,12 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "(a", possible: (a), (a,b), (a,b,c), (a,b,c,d), (a,(c)), (a,(c,d)) @@ -1396,11 +1293,7 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // read "(a,b", possible: (a,b), (a,b,c), (a,b,c,d) @@ -1467,39 +1360,23 @@ namespace boost } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } else // error { -#if BOOST_WORKAROUND(__GNUC__, < 3) - is.setstate(::std::ios::failbit); -#else is.setstate(::std::ios_base::failbit); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } } } @@ -1519,22 +1396,12 @@ namespace boost } -#if BOOST_WORKAROUND(__GNUC__, < 3) - template<typename T> - ::std::ostream & operator << ( ::std::ostream & os, - quaternion<T> const & q) -#else template<typename T, typename charT, class traits> ::std::basic_ostream<charT,traits> & operator << ( ::std::basic_ostream<charT,traits> & os, quaternion<T> const & q) -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ { -#if BOOST_WORKAROUND(__GNUC__, < 3) - ::std::ostringstream s; -#else ::std::basic_ostringstream<charT,traits> s; -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ - + s.flags(os.flags()); #ifdef BOOST_NO_STD_LOCALE #else @@ -1587,11 +1454,7 @@ namespace boost BOOST_QUATERNION_VALARRAY_LOADER -#if BOOST_WORKAROUND(__GNUC__, < 3) - return((BOOST_GET_VALARRAY(T, abs(temp)).max)()); -#else return((abs(temp).max)()); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } @@ -1604,11 +1467,7 @@ namespace boost BOOST_QUATERNION_VALARRAY_LOADER -#if BOOST_WORKAROUND(__GNUC__, < 3) - return(BOOST_GET_VALARRAY(T, abs(temp)).sum()); -#else return(abs(temp).sum()); -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ } @@ -1623,11 +1482,7 @@ namespace boost BOOST_QUATERNION_VALARRAY_LOADER -#if BOOST_WORKAROUND(__GNUC__, < 3) - T maxim = (BOOST_GET_VALARRAY(T, abs(temp)).max)(); // overflow protection -#else T maxim = (abs(temp).max)(); // overflow protection -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ if (maxim == static_cast<T>(0)) { @@ -1915,10 +1770,4 @@ namespace boost } } - -#if BOOST_WORKAROUND(__GNUC__, < 3) - #undef BOOST_GET_VALARRAY -#endif /* BOOST_WORKAROUND(__GNUC__, < 3) */ - - #endif /* BOOST_QUATERNION_HPP */ diff --git a/boost/math/special_functions.hpp b/boost/math/special_functions.hpp index 00fe866f4a..aa7019a1eb 100644 --- a/boost/math/special_functions.hpp +++ b/boost/math/special_functions.hpp @@ -1,5 +1,5 @@ -// Copyright John Maddock 2006, 2007. -// Copyright Paul A. Bristow 2006, 2007. +// Copyright John Maddock 2006, 2007, 2012. +// Copyright Paul A. Bristow 2006, 2007, 2012 // Use, modification and distribution are subject to the // Boost Software License, Version 1.0. (See accompanying file @@ -12,10 +12,13 @@ #ifndef BOOST_MATH_SPECIAL_FUNCTIONS_HPP #define BOOST_MATH_SPECIAL_FUNCTIONS_HPP +#include <boost/math/special_functions/airy.hpp> #include <boost/math/special_functions/acosh.hpp> #include <boost/math/special_functions/asinh.hpp> #include <boost/math/special_functions/atanh.hpp> +#include <boost/math/special_functions/bernoulli.hpp> #include <boost/math/special_functions/bessel.hpp> +#include <boost/math/special_functions/bessel_prime.hpp> #include <boost/math/special_functions/beta.hpp> #include <boost/math/special_functions/binomial.hpp> #include <boost/math/special_functions/cbrt.hpp> @@ -36,12 +39,14 @@ #include <boost/math/special_functions/gamma.hpp> #include <boost/math/special_functions/hermite.hpp> #include <boost/math/special_functions/hypot.hpp> +#include <boost/math/special_functions/jacobi_elliptic.hpp> #include <boost/math/special_functions/laguerre.hpp> #include <boost/math/special_functions/lanczos.hpp> #include <boost/math/special_functions/legendre.hpp> #include <boost/math/special_functions/log1p.hpp> #include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/next.hpp> +#include <boost/math/special_functions/owens_t.hpp> #include <boost/math/special_functions/powm1.hpp> #include <boost/math/special_functions/sign.hpp> #include <boost/math/special_functions/sin_pi.hpp> diff --git a/boost/math/special_functions/acosh.hpp b/boost/math/special_functions/acosh.hpp index 40ca985edc..0af5c94c14 100644 --- a/boost/math/special_functions/acosh.hpp +++ b/boost/math/special_functions/acosh.hpp @@ -21,6 +21,7 @@ #include <boost/math/policies/error_handling.hpp> #include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/log1p.hpp> +#include <boost/math/constants/constants.hpp> // This is the inverse of the hyperbolic cosine function. @@ -30,17 +31,6 @@ namespace boost { namespace detail { -#if defined(__GNUC__) && (__GNUC__ < 3) - // gcc 2.x ignores function scope using declarations, - // put them in the scope of the enclosing namespace instead: - - using ::std::abs; - using ::std::sqrt; - using ::std::log; - - using ::std::numeric_limits; -#endif - template<typename T, typename Policy> inline T acosh_imp(const T x, const Policy& pol) { @@ -58,7 +48,7 @@ namespace boost { // http://functions.wolfram.com/ElementaryFunctions/ArcCosh/06/01/06/01/0001/ // approximation by laurent series in 1/x at 0+ order from -1 to 0 - return( log( x * 2) ); + return log(x) + constants::ln_two<T>(); } else if(x < 1.5f) { diff --git a/boost/math/special_functions/airy.hpp b/boost/math/special_functions/airy.hpp new file mode 100644 index 0000000000..82167dc5f0 --- /dev/null +++ b/boost/math/special_functions/airy.hpp @@ -0,0 +1,469 @@ +// Copyright John Maddock 2012. +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. +// (See accompanying file LICENSE_1_0.txt +// or copy at http://www.boost.org/LICENSE_1_0.txt) + +#ifndef BOOST_MATH_AIRY_HPP +#define BOOST_MATH_AIRY_HPP + +#include <limits> +#include <boost/math/special_functions/math_fwd.hpp> +#include <boost/math/special_functions/bessel.hpp> +#include <boost/math/special_functions/cbrt.hpp> +#include <boost/math/special_functions/detail/airy_ai_bi_zero.hpp> +#include <boost/math/tools/roots.hpp> + +namespace boost{ namespace math{ + +namespace detail{ + +template <class T, class Policy> +T airy_ai_imp(T x, const Policy& pol) +{ + BOOST_MATH_STD_USING + + if(x < 0) + { + T p = (-x * sqrt(-x) * 2) / 3; + T v = T(1) / 3; + T j1 = boost::math::cyl_bessel_j(v, p, pol); + T j2 = boost::math::cyl_bessel_j(-v, p, pol); + T ai = sqrt(-x) * (j1 + j2) / 3; + //T bi = sqrt(-x / 3) * (j2 - j1); + return ai; + } + else if(fabs(x * x * x) / 6 < tools::epsilon<T>()) + { + T tg = boost::math::tgamma(constants::twothirds<T>(), pol); + T ai = 1 / (pow(T(3), constants::twothirds<T>()) * tg); + //T bi = 1 / (sqrt(boost::math::cbrt(T(3))) * tg); + return ai; + } + else + { + T p = 2 * x * sqrt(x) / 3; + T v = T(1) / 3; + //T j1 = boost::math::cyl_bessel_i(-v, p, pol); + //T j2 = boost::math::cyl_bessel_i(v, p, pol); + // + // Note that although we can calculate ai from j1 and j2, the accuracy is horrible + // as we're subtracting two very large values, so use the Bessel K relation instead: + // + T ai = cyl_bessel_k(v, p, pol) * sqrt(x / 3) / boost::math::constants::pi<T>(); //sqrt(x) * (j1 - j2) / 3; + //T bi = sqrt(x / 3) * (j1 + j2); + return ai; + } +} + +template <class T, class Policy> +T airy_bi_imp(T x, const Policy& pol) +{ + BOOST_MATH_STD_USING + + if(x < 0) + { + T p = (-x * sqrt(-x) * 2) / 3; + T v = T(1) / 3; + T j1 = boost::math::cyl_bessel_j(v, p, pol); + T j2 = boost::math::cyl_bessel_j(-v, p, pol); + //T ai = sqrt(-x) * (j1 + j2) / 3; + T bi = sqrt(-x / 3) * (j2 - j1); + return bi; + } + else if(fabs(x * x * x) / 6 < tools::epsilon<T>()) + { + T tg = boost::math::tgamma(constants::twothirds<T>(), pol); + //T ai = 1 / (pow(T(3), constants::twothirds<T>()) * tg); + T bi = 1 / (sqrt(boost::math::cbrt(T(3))) * tg); + return bi; + } + else + { + T p = 2 * x * sqrt(x) / 3; + T v = T(1) / 3; + T j1 = boost::math::cyl_bessel_i(-v, p, pol); + T j2 = boost::math::cyl_bessel_i(v, p, pol); + T bi = sqrt(x / 3) * (j1 + j2); + return bi; + } +} + +template <class T, class Policy> +T airy_ai_prime_imp(T x, const Policy& pol) +{ + BOOST_MATH_STD_USING + + if(x < 0) + { + T p = (-x * sqrt(-x) * 2) / 3; + T v = T(2) / 3; + T j1 = boost::math::cyl_bessel_j(v, p, pol); + T j2 = boost::math::cyl_bessel_j(-v, p, pol); + T aip = -x * (j1 - j2) / 3; + return aip; + } + else if(fabs(x * x) / 2 < tools::epsilon<T>()) + { + T tg = boost::math::tgamma(constants::third<T>(), pol); + T aip = 1 / (boost::math::cbrt(T(3)) * tg); + return -aip; + } + else + { + T p = 2 * x * sqrt(x) / 3; + T v = T(2) / 3; + //T j1 = boost::math::cyl_bessel_i(-v, p, pol); + //T j2 = boost::math::cyl_bessel_i(v, p, pol); + // + // Note that although we can calculate ai from j1 and j2, the accuracy is horrible + // as we're subtracting two very large values, so use the Bessel K relation instead: + // + T aip = -cyl_bessel_k(v, p, pol) * x / (boost::math::constants::root_three<T>() * boost::math::constants::pi<T>()); + return aip; + } +} + +template <class T, class Policy> +T airy_bi_prime_imp(T x, const Policy& pol) +{ + BOOST_MATH_STD_USING + + if(x < 0) + { + T p = (-x * sqrt(-x) * 2) / 3; + T v = T(2) / 3; + T j1 = boost::math::cyl_bessel_j(v, p, pol); + T j2 = boost::math::cyl_bessel_j(-v, p, pol); + T aip = -x * (j1 + j2) / constants::root_three<T>(); + return aip; + } + else if(fabs(x * x) / 2 < tools::epsilon<T>()) + { + T tg = boost::math::tgamma(constants::third<T>(), pol); + T bip = sqrt(boost::math::cbrt(T(3))) / tg; + return bip; + } + else + { + T p = 2 * x * sqrt(x) / 3; + T v = T(2) / 3; + T j1 = boost::math::cyl_bessel_i(-v, p, pol); + T j2 = boost::math::cyl_bessel_i(v, p, pol); + T aip = x * (j1 + j2) / boost::math::constants::root_three<T>(); + return aip; + } +} + +template <class T, class Policy> +T airy_ai_zero_imp(int m, const Policy& pol) +{ + BOOST_MATH_STD_USING // ADL of std names, needed for log, sqrt. + + // Handle cases when a negative zero (negative rank) is requested. + if(m < 0) + { + return policies::raise_domain_error<T>("boost::math::airy_ai_zero<%1%>(%1%, int)", + "Requested the %1%'th zero, but the rank must be 1 or more !", m, pol); + } + + // Handle case when the zero'th zero is requested. + if(m == 0U) + { + return policies::raise_domain_error<T>("boost::math::airy_ai_zero<%1%>(%1%,%1%)", + "The requested rank of the zero is %1%, but must be 1 or more !", static_cast<T>(m), pol); + } + + // Set up the initial guess for the upcoming root-finding. + const T guess_root = boost::math::detail::airy_zero::airy_ai_zero_detail::initial_guess<T>(m); + + // Select the maximum allowed iterations based on the number + // of decimal digits in the numeric type T, being at least 12. + const int my_digits10 = static_cast<int>(static_cast<float>(policies::digits<T, Policy>() * 0.301F)); + + const boost::uintmax_t iterations_allowed = static_cast<boost::uintmax_t>((std::max)(12, my_digits10 * 2)); + + boost::uintmax_t iterations_used = iterations_allowed; + + // Use a dynamic tolerance because the roots get closer the higher m gets. + T tolerance; + + if (m <= 10) { tolerance = T(0.3F); } + else if(m <= 100) { tolerance = T(0.1F); } + else if(m <= 1000) { tolerance = T(0.05F); } + else { tolerance = T(1) / sqrt(T(m)); } + + // Perform the root-finding using Newton-Raphson iteration from Boost.Math. + const T am = + boost::math::tools::newton_raphson_iterate( + boost::math::detail::airy_zero::airy_ai_zero_detail::function_object_ai_and_ai_prime<T, Policy>(pol), + guess_root, + T(guess_root - tolerance), + T(guess_root + tolerance), + policies::digits<T, Policy>(), + iterations_used); + + static_cast<void>(iterations_used); + + return am; +} + +template <class T, class Policy> +T airy_bi_zero_imp(int m, const Policy& pol) +{ + BOOST_MATH_STD_USING // ADL of std names, needed for log, sqrt. + + // Handle cases when a negative zero (negative rank) is requested. + if(m < 0) + { + return policies::raise_domain_error<T>("boost::math::airy_bi_zero<%1%>(%1%, int)", + "Requested the %1%'th zero, but the rank must 1 or more !", m, pol); + } + + // Handle case when the zero'th zero is requested. + if(m == 0U) + { + return policies::raise_domain_error<T>("boost::math::airy_bi_zero<%1%>(%1%,%1%)", + "The requested rank of the zero is %1%, but must be 1 or more !", static_cast<T>(m), pol); + } + // Set up the initial guess for the upcoming root-finding. + const T guess_root = boost::math::detail::airy_zero::airy_bi_zero_detail::initial_guess<T>(m); + + // Select the maximum allowed iterations based on the number + // of decimal digits in the numeric type T, being at least 12. + const int my_digits10 = static_cast<int>(static_cast<float>(policies::digits<T, Policy>() * 0.301F)); + + const boost::uintmax_t iterations_allowed = static_cast<boost::uintmax_t>((std::max)(12, my_digits10 * 2)); + + boost::uintmax_t iterations_used = iterations_allowed; + + // Use a dynamic tolerance because the roots get closer the higher m gets. + T tolerance; + + if (m <= 10) { tolerance = T(0.3F); } + else if(m <= 100) { tolerance = T(0.1F); } + else if(m <= 1000) { tolerance = T(0.05F); } + else { tolerance = T(1) / sqrt(T(m)); } + + // Perform the root-finding using Newton-Raphson iteration from Boost.Math. + const T bm = + boost::math::tools::newton_raphson_iterate( + boost::math::detail::airy_zero::airy_bi_zero_detail::function_object_bi_and_bi_prime<T, Policy>(pol), + guess_root, + T(guess_root - tolerance), + T(guess_root + tolerance), + policies::digits<T, Policy>(), + iterations_used); + + static_cast<void>(iterations_used); + + return bm; +} + +} // namespace detail + +template <class T, class Policy> +inline typename tools::promote_args<T>::type airy_ai(T x, const Policy&) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename tools::promote_args<T>::type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + return policies::checked_narrowing_cast<result_type, Policy>(detail::airy_ai_imp<value_type>(static_cast<value_type>(x), forwarding_policy()), "boost::math::airy<%1%>(%1%)"); +} + +template <class T> +inline typename tools::promote_args<T>::type airy_ai(T x) +{ + return airy_ai(x, policies::policy<>()); +} + +template <class T, class Policy> +inline typename tools::promote_args<T>::type airy_bi(T x, const Policy&) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename tools::promote_args<T>::type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + return policies::checked_narrowing_cast<result_type, Policy>(detail::airy_bi_imp<value_type>(static_cast<value_type>(x), forwarding_policy()), "boost::math::airy<%1%>(%1%)"); +} + +template <class T> +inline typename tools::promote_args<T>::type airy_bi(T x) +{ + return airy_bi(x, policies::policy<>()); +} + +template <class T, class Policy> +inline typename tools::promote_args<T>::type airy_ai_prime(T x, const Policy&) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename tools::promote_args<T>::type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + return policies::checked_narrowing_cast<result_type, Policy>(detail::airy_ai_prime_imp<value_type>(static_cast<value_type>(x), forwarding_policy()), "boost::math::airy<%1%>(%1%)"); +} + +template <class T> +inline typename tools::promote_args<T>::type airy_ai_prime(T x) +{ + return airy_ai_prime(x, policies::policy<>()); +} + +template <class T, class Policy> +inline typename tools::promote_args<T>::type airy_bi_prime(T x, const Policy&) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename tools::promote_args<T>::type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + return policies::checked_narrowing_cast<result_type, Policy>(detail::airy_bi_prime_imp<value_type>(static_cast<value_type>(x), forwarding_policy()), "boost::math::airy<%1%>(%1%)"); +} + +template <class T> +inline typename tools::promote_args<T>::type airy_bi_prime(T x) +{ + return airy_bi_prime(x, policies::policy<>()); +} + +template <class T, class Policy> +inline T airy_ai_zero(int m, const Policy& /*pol*/) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename policies::evaluation<T, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Airy value type must be a floating-point type."); + + return policies::checked_narrowing_cast<T, Policy>(detail::airy_ai_zero_imp<value_type>(m, forwarding_policy()), "boost::math::airy_ai_zero<%1%>(unsigned)"); +} + +template <class T> +inline T airy_ai_zero(int m) +{ + return airy_ai_zero<T>(m, policies::policy<>()); +} + +template <class T, class OutputIterator, class Policy> +inline OutputIterator airy_ai_zero( + int start_index, + unsigned number_of_zeros, + OutputIterator out_it, + const Policy& pol) +{ + typedef T result_type; + + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Airy value type must be a floating-point type."); + + for(unsigned i = 0; i < number_of_zeros; ++i) + { + *out_it = boost::math::airy_ai_zero<result_type>(start_index + i, pol); + ++out_it; + } + return out_it; +} + +template <class T, class OutputIterator> +inline OutputIterator airy_ai_zero( + int start_index, + unsigned number_of_zeros, + OutputIterator out_it) +{ + return airy_ai_zero<T>(start_index, number_of_zeros, out_it, policies::policy<>()); +} + +template <class T, class Policy> +inline T airy_bi_zero(int m, const Policy& /*pol*/) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename policies::evaluation<T, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Airy value type must be a floating-point type."); + + return policies::checked_narrowing_cast<T, Policy>(detail::airy_bi_zero_imp<value_type>(m, forwarding_policy()), "boost::math::airy_bi_zero<%1%>(unsigned)"); +} + +template <typename T> +inline T airy_bi_zero(int m) +{ + return airy_bi_zero<T>(m, policies::policy<>()); +} + +template <class T, class OutputIterator, class Policy> +inline OutputIterator airy_bi_zero( + int start_index, + unsigned number_of_zeros, + OutputIterator out_it, + const Policy& pol) +{ + typedef T result_type; + + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Airy value type must be a floating-point type."); + + for(unsigned i = 0; i < number_of_zeros; ++i) + { + *out_it = boost::math::airy_bi_zero<result_type>(start_index + i, pol); + ++out_it; + } + return out_it; +} + +template <class T, class OutputIterator> +inline OutputIterator airy_bi_zero( + int start_index, + unsigned number_of_zeros, + OutputIterator out_it) +{ + return airy_bi_zero<T>(start_index, number_of_zeros, out_it, policies::policy<>()); +} + +}} // namespaces + +#endif // BOOST_MATH_AIRY_HPP diff --git a/boost/math/special_functions/asinh.hpp b/boost/math/special_functions/asinh.hpp index 14289688b4..a863e68854 100644 --- a/boost/math/special_functions/asinh.hpp +++ b/boost/math/special_functions/asinh.hpp @@ -22,6 +22,7 @@ #include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/sqrt1pm1.hpp> #include <boost/math/special_functions/log1p.hpp> +#include <boost/math/constants/constants.hpp> // This is the inverse of the hyperbolic sine function. @@ -30,17 +31,6 @@ namespace boost namespace math { namespace detail{ -#if defined(__GNUC__) && (__GNUC__ < 3) - // gcc 2.x ignores function scope using declarations, - // put them in the scope of the enclosing namespace instead: - - using ::std::abs; - using ::std::sqrt; - using ::std::log; - - using ::std::numeric_limits; -#endif - template<typename T, class Policy> inline T asinh_imp(const T x, const Policy& pol) { @@ -52,7 +42,7 @@ namespace boost { // http://functions.wolfram.com/ElementaryFunctions/ArcSinh/06/01/06/01/0001/ // approximation by laurent series in 1/x at 0+ order from -1 to 1 - return log(x * 2) + 1/ (4 * x * x); + return constants::ln_two<T>() + log(x) + 1/ (4 * x * x); } else if(x < 0.5f) { @@ -67,7 +57,7 @@ namespace boost } else if (x <= -tools::forth_root_epsilon<T>()) { - return(-asinh(-x)); + return(-asinh(-x, pol)); } else { diff --git a/boost/math/special_functions/atanh.hpp b/boost/math/special_functions/atanh.hpp index d447e2057b..2c5e3f4b78 100644 --- a/boost/math/special_functions/atanh.hpp +++ b/boost/math/special_functions/atanh.hpp @@ -31,17 +31,6 @@ namespace boost { namespace detail { -#if defined(__GNUC__) && (__GNUC__ < 3) - // gcc 2.x ignores function scope using declarations, - // put them in the scope of the enclosing namespace instead: - - using ::std::abs; - using ::std::sqrt; - using ::std::log; - - using ::std::numeric_limits; -#endif - // This is the main fare template<typename T, typename Policy> @@ -56,6 +45,12 @@ namespace boost function, "atanh requires x >= -1, but got x = %1%.", x, pol); } + else if(x > 1) + { + return policies::raise_domain_error<T>( + function, + "atanh requires x <= 1, but got x = %1%.", x, pol); + } else if(x < -1 + tools::epsilon<T>()) { // -Infinity: @@ -66,12 +61,6 @@ namespace boost // Infinity: return policies::raise_overflow_error<T>(function, 0, pol); } - else if(x > 1) - { - return policies::raise_domain_error<T>( - function, - "atanh requires x <= 1, but got x = %1%.", x, pol); - } else if(abs(x) >= tools::forth_root_epsilon<T>()) { // http://functions.wolfram.com/ElementaryFunctions/ArcTanh/02/ diff --git a/boost/math/special_functions/bernoulli.hpp b/boost/math/special_functions/bernoulli.hpp new file mode 100644 index 0000000000..2c2ccd5236 --- /dev/null +++ b/boost/math/special_functions/bernoulli.hpp @@ -0,0 +1,143 @@ + +/////////////////////////////////////////////////////////////////////////////// +// Copyright 2013 Nikhar Agrawal +// Copyright 2013 Christopher Kormanyos +// Copyright 2013 John Maddock +// Copyright 2013 Paul Bristow +// Distributed under the Boost +// Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) + +#ifndef _BOOST_BERNOULLI_B2N_2013_05_30_HPP_ +#define _BOOST_BERNOULLI_B2N_2013_05_30_HPP_ + +#include <boost/math/special_functions/math_fwd.hpp> +#include <boost/math/special_functions/detail/unchecked_bernoulli.hpp> +#include <boost/math/special_functions/detail/bernoulli_details.hpp> + +namespace boost { namespace math { + +namespace detail { + +template <class T, class OutputIterator, class Policy, int N> +OutputIterator bernoulli_number_imp(OutputIterator out, std::size_t start, std::size_t n, const Policy& pol, const mpl::int_<N>& tag) +{ + for(std::size_t i = start; (i <= max_bernoulli_b2n<T>::value) && (i < start + n); ++i) + { + *out = unchecked_bernoulli_imp<T>(i, tag); + ++out; + } + + for(std::size_t i = (std::max)(static_cast<std::size_t>(max_bernoulli_b2n<T>::value + 1), start); i < start + n; ++i) + { + // We must overflow: + *out = (i & 1 ? 1 : -1) * policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(n)", 0, T(i), pol); + ++out; + } + return out; +} + +template <class T, class OutputIterator, class Policy> +OutputIterator bernoulli_number_imp(OutputIterator out, std::size_t start, std::size_t n, const Policy& pol, const mpl::int_<0>& tag) +{ + for(std::size_t i = start; (i <= max_bernoulli_b2n<T>::value) && (i < start + n); ++i) + { + *out = unchecked_bernoulli_imp<T>(i, tag); + ++out; + } + // + // Short circuit return so we don't grab the mutex below unless we have to: + // + if(start + n <= max_bernoulli_b2n<T>::value) + return out; + + return get_bernoulli_numbers_cache<T, Policy>().copy_bernoulli_numbers(out, start, n, pol); +} + +} // namespace detail + +template <class T, class Policy> +inline T bernoulli_b2n(const int i, const Policy &pol) +{ + typedef mpl::int_<detail::bernoulli_imp_variant<T>::value> tag_type; + if(i < 0) + return policies::raise_domain_error<T>("boost::math::bernoulli_b2n<%1%>", "Index should be >= 0 but got %1%", T(i), pol); + + T result; + boost::math::detail::bernoulli_number_imp<T>(&result, static_cast<std::size_t>(i), 1u, pol, tag_type()); + return result; +} + +template <class T> +inline T bernoulli_b2n(const int i) +{ + return boost::math::bernoulli_b2n<T>(i, policies::policy<>()); +} + +template <class T, class OutputIterator, class Policy> +inline OutputIterator bernoulli_b2n(const int start_index, + const unsigned number_of_bernoullis_b2n, + OutputIterator out_it, + const Policy& pol) +{ + typedef mpl::int_<detail::bernoulli_imp_variant<T>::value> tag_type; + if(start_index < 0) + { + *out_it = policies::raise_domain_error<T>("boost::math::bernoulli_b2n<%1%>", "Index should be >= 0 but got %1%", T(start_index), pol); + return ++out_it; + } + + return boost::math::detail::bernoulli_number_imp<T>(out_it, start_index, number_of_bernoullis_b2n, pol, tag_type()); +} + +template <class T, class OutputIterator> +inline OutputIterator bernoulli_b2n(const int start_index, + const unsigned number_of_bernoullis_b2n, + OutputIterator out_it) +{ + return boost::math::bernoulli_b2n<T, OutputIterator>(start_index, number_of_bernoullis_b2n, out_it, policies::policy<>()); +} + +template <class T, class Policy> +inline T tangent_t2n(const int i, const Policy &pol) +{ + if(i < 0) + return policies::raise_domain_error<T>("boost::math::tangent_t2n<%1%>", "Index should be >= 0 but got %1%", T(i), pol); + + T result; + boost::math::detail::get_bernoulli_numbers_cache<T, Policy>().copy_tangent_numbers(&result, i, 1, pol); + return result; +} + +template <class T> +inline T tangent_t2n(const int i) +{ + return boost::math::tangent_t2n<T>(i, policies::policy<>()); +} + +template <class T, class OutputIterator, class Policy> +inline OutputIterator tangent_t2n(const int start_index, + const unsigned number_of_tangent_t2n, + OutputIterator out_it, + const Policy& pol) +{ + if(start_index < 0) + { + *out_it = policies::raise_domain_error<T>("boost::math::tangent_t2n<%1%>", "Index should be >= 0 but got %1%", T(start_index), pol); + return ++out_it; + } + + return boost::math::detail::get_bernoulli_numbers_cache<T, Policy>().copy_tangent_numbers(out_it, start_index, number_of_tangent_t2n, pol); +} + +template <class T, class OutputIterator> +inline OutputIterator tangent_t2n(const int start_index, + const unsigned number_of_tangent_t2n, + OutputIterator out_it) +{ + return boost::math::tangent_t2n<T, OutputIterator>(start_index, number_of_tangent_t2n, out_it, policies::policy<>()); +} + +} } // namespace boost::math + +#endif // _BOOST_BERNOULLI_B2N_2013_05_30_HPP_ diff --git a/boost/math/special_functions/bessel.hpp b/boost/math/special_functions/bessel.hpp index d9d3c60bd0..438b763ab7 100644 --- a/boost/math/special_functions/bessel.hpp +++ b/boost/math/special_functions/bessel.hpp @@ -1,4 +1,5 @@ -// Copyright (c) 2007 John Maddock +// Copyright (c) 2007, 2013 John Maddock +// Copyright Christopher Kormanyos 2013. // Use, modification and distribution are subject to the // Boost Software License, Version 1.0. (See accompanying file // LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) @@ -11,12 +12,15 @@ #define BOOST_MATH_BESSEL_HPP #ifdef _MSC_VER -#pragma once +# pragma once #endif +#include <limits> +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/detail/bessel_jy.hpp> #include <boost/math/special_functions/detail/bessel_jn.hpp> #include <boost/math/special_functions/detail/bessel_yn.hpp> +#include <boost/math/special_functions/detail/bessel_jy_zero.hpp> #include <boost/math/special_functions/detail/bessel_ik.hpp> #include <boost/math/special_functions/detail/bessel_i0.hpp> #include <boost/math/special_functions/detail/bessel_i1.hpp> @@ -30,6 +34,7 @@ #include <boost/math/tools/rational.hpp> #include <boost/math/tools/promotion.hpp> #include <boost/math/tools/series.hpp> +#include <boost/math/tools/roots.hpp> namespace boost{ namespace math{ @@ -45,7 +50,13 @@ struct sph_bessel_j_small_z_series_term { BOOST_MATH_STD_USING mult = x / 2; - term = pow(mult, T(v)) / boost::math::tgamma(v+1+T(0.5f), Policy()); + if(v + 3 > max_factorial<T>::value) + { + term = v * log(mult) - boost::math::lgamma(v+1+T(0.5f), Policy()); + term = exp(term); + } + else + term = pow(mult, T(v)) / boost::math::tgamma(v+1+T(0.5f), Policy()); mult *= -mult; } T operator()() @@ -98,22 +109,6 @@ T cyl_bessel_j_imp(T v, T x, const bessel_no_int_tag& t, const Policy& pol) function, "Got x = %1%, but we need x >= 0", x, pol); } - if(x == 0) - return (v == 0) ? 1 : (v > 0) ? 0 : - policies::raise_domain_error<T>( - function, - "Got v = %1%, but require v >= 0 or a negative integer: the result would be complex.", v, pol); - - - if((v >= 0) && ((x < 1) || (v > x * x / 4) || (x < 5))) - { - // - // This series will actually converge rapidly for all small - // x - say up to x < 20 - but the first few terms are large - // and divergent which leads to large errors :-( - // - return bessel_j_small_z_series(v, x, pol); - } T j, y; bessel_jy(v, x, &j, &y, need_j, pol); @@ -125,9 +120,11 @@ inline T cyl_bessel_j_imp(T v, T x, const bessel_maybe_int_tag&, const Policy& p { BOOST_MATH_STD_USING // ADL of std names. int ival = detail::iconv(v, pol); - if((abs(ival) < 200) && (0 == v - ival)) + // If v is an integer, use the integer recursion + // method, both that and Steeds method are O(v): + if((0 == v - ival)) { - return bessel_jn(ival/*iround(v, pol)*/, x, pol); + return bessel_jn(ival, x, pol); } return cyl_bessel_j_imp(v, x, bessel_no_int_tag(), pol); } @@ -153,6 +150,11 @@ inline T sph_bessel_j_imp(unsigned n, T x, const Policy& pol) if(n == 0) return boost::math::sinc_pi(x, pol); // + // Special case for x == 0: + // + if(x == 0) + return 0; + // // When x is small we may end up with 0/0, use series evaluation // instead, especially as it converges rapidly: // @@ -294,14 +296,13 @@ template <class T, class Policy> inline T cyl_neumann_imp(T v, T x, const bessel_maybe_int_tag&, const Policy& pol) { BOOST_MATH_STD_USING - typedef typename bessel_asymptotic_tag<T, Policy>::type tag_type; BOOST_MATH_INSTRUMENT_VARIABLE(v); BOOST_MATH_INSTRUMENT_VARIABLE(x); if(floor(v) == v) { - if((fabs(x) > asymptotic_bessel_y_limit<T>(tag_type())) && (fabs(x) > 5 * abs(v))) + if(asymptotic_bessel_large_x_limit(v, x)) { T r = asymptotic_bessel_y_large_x_2(static_cast<T>(abs(v)), x); if((v < 0) && (itrunc(v, pol) & 1)) @@ -325,12 +326,11 @@ template <class T, class Policy> inline T cyl_neumann_imp(int v, T x, const bessel_int_tag&, const Policy& pol) { BOOST_MATH_STD_USING - typedef typename bessel_asymptotic_tag<T, Policy>::type tag_type; BOOST_MATH_INSTRUMENT_VARIABLE(v); BOOST_MATH_INSTRUMENT_VARIABLE(x); - if((fabs(x) > asymptotic_bessel_y_limit<T>(tag_type())) && (fabs(x) > 5 * abs(v))) + if(asymptotic_bessel_large_x_limit(T(v), x)) { T r = asymptotic_bessel_y_large_x_2(static_cast<T>(abs(v)), x); if((v < 0) && (v & 1)) @@ -367,16 +367,180 @@ inline T sph_neumann_imp(unsigned v, T x, const Policy& pol) return result * tx; } +template <class T, class Policy> +inline T cyl_bessel_j_zero_imp(T v, int m, const Policy& pol) +{ + BOOST_MATH_STD_USING // ADL of std names, needed for floor. + + static const char* function = "boost::math::cyl_bessel_j_zero<%1%>(%1%, int)"; + + const T half_epsilon(boost::math::tools::epsilon<T>() / 2U); + + // Handle non-finite order. + if (!(boost::math::isfinite)(v) ) + { + return policies::raise_domain_error<T>(function, "Order argument is %1%, but must be finite >= 0 !", v, pol); + } + + // Handle negative rank. + if(m < 0) + { + // Zeros of Jv(x) with negative rank are not defined and requesting one raises a domain error. + return policies::raise_domain_error<T>(function, "Requested the %1%'th zero, but the rank must be positive !", m, pol); + } + + // Get the absolute value of the order. + const bool order_is_negative = (v < 0); + const T vv((!order_is_negative) ? v : T(-v)); + + // Check if the order is very close to zero or very close to an integer. + const bool order_is_zero = (vv < half_epsilon); + const bool order_is_integer = ((vv - floor(vv)) < half_epsilon); + + if(m == 0) + { + if(order_is_zero) + { + // The zero'th zero of J0(x) is not defined and requesting it raises a domain error. + return policies::raise_domain_error<T>(function, "Requested the %1%'th zero of J0, but the rank must be > 0 !", m, pol); + } + + // The zero'th zero of Jv(x) for v < 0 is not defined + // unless the order is a negative integer. + if(order_is_negative && (!order_is_integer)) + { + // For non-integer, negative order, requesting the zero'th zero raises a domain error. + return policies::raise_domain_error<T>(function, "Requested the %1%'th zero of Jv for negative, non-integer order, but the rank must be > 0 !", m, pol); + } + + // The zero'th zero does exist and its value is zero. + return T(0); + } + + // Set up the initial guess for the upcoming root-finding. + // If the order is a negative integer, then use the corresponding + // positive integer for the order. + const T guess_root = boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::initial_guess<T, Policy>((order_is_integer ? vv : v), m, pol); + + // Select the maximum allowed iterations from the policy. + boost::uintmax_t number_of_iterations = policies::get_max_root_iterations<Policy>(); + + const T delta_lo = ((guess_root > 0.2F) ? T(0.2) : T(guess_root / 2U)); + + // Perform the root-finding using Newton-Raphson iteration from Boost.Math. + const T jvm = + boost::math::tools::newton_raphson_iterate( + boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::function_object_jv_and_jv_prime<T, Policy>((order_is_integer ? vv : v), order_is_zero, pol), + guess_root, + T(guess_root - delta_lo), + T(guess_root + 0.2F), + policies::digits<T, Policy>(), + number_of_iterations); + + if(number_of_iterations >= policies::get_max_root_iterations<Policy>()) + { + return policies::raise_evaluation_error<T>(function, "Unable to locate root in a reasonable time:" + " Current best guess is %1%", jvm, Policy()); + } + + return jvm; +} + +template <class T, class Policy> +inline T cyl_neumann_zero_imp(T v, int m, const Policy& pol) +{ + BOOST_MATH_STD_USING // ADL of std names, needed for floor. + + static const char* function = "boost::math::cyl_neumann_zero<%1%>(%1%, int)"; + + // Handle non-finite order. + if (!(boost::math::isfinite)(v) ) + { + return policies::raise_domain_error<T>(function, "Order argument is %1%, but must be finite >= 0 !", v, pol); + } + + // Handle negative rank. + if(m < 0) + { + return policies::raise_domain_error<T>(function, "Requested the %1%'th zero, but the rank must be positive !", m, pol); + } + + const T half_epsilon(boost::math::tools::epsilon<T>() / 2U); + + // Get the absolute value of the order. + const bool order_is_negative = (v < 0); + const T vv((!order_is_negative) ? v : T(-v)); + + const bool order_is_integer = ((vv - floor(vv)) < half_epsilon); + + // For negative integers, use reflection to positive integer order. + if(order_is_negative && order_is_integer) + return boost::math::detail::cyl_neumann_zero_imp(vv, m, pol); + + // Check if the order is very close to a negative half-integer. + const T delta_half_integer(vv - (floor(vv) + 0.5F)); + + const bool order_is_negative_half_integer = + (order_is_negative && ((delta_half_integer > -half_epsilon) && (delta_half_integer < +half_epsilon))); + + // The zero'th zero of Yv(x) for v < 0 is not defined + // unless the order is a negative integer. + if((m == 0) && (!order_is_negative_half_integer)) + { + // For non-integer, negative order, requesting the zero'th zero raises a domain error. + return policies::raise_domain_error<T>(function, "Requested the %1%'th zero of Yv for negative, non-half-integer order, but the rank must be > 0 !", m, pol); + } + + // For negative half-integers, use the corresponding + // spherical Bessel function of positive half-integer order. + if(order_is_negative_half_integer) + return boost::math::detail::cyl_bessel_j_zero_imp(vv, m, pol); + + // Set up the initial guess for the upcoming root-finding. + // If the order is a negative integer, then use the corresponding + // positive integer for the order. + const T guess_root = boost::math::detail::bessel_zero::cyl_neumann_zero_detail::initial_guess<T, Policy>(v, m, pol); + + // Select the maximum allowed iterations from the policy. + boost::uintmax_t number_of_iterations = policies::get_max_root_iterations<Policy>(); + + const T delta_lo = ((guess_root > 0.2F) ? T(0.2) : T(guess_root / 2U)); + + // Perform the root-finding using Newton-Raphson iteration from Boost.Math. + const T yvm = + boost::math::tools::newton_raphson_iterate( + boost::math::detail::bessel_zero::cyl_neumann_zero_detail::function_object_yv_and_yv_prime<T, Policy>(v, pol), + guess_root, + T(guess_root - delta_lo), + T(guess_root + 0.2F), + policies::digits<T, Policy>(), + number_of_iterations); + + if(number_of_iterations >= policies::get_max_root_iterations<Policy>()) + { + return policies::raise_evaluation_error<T>(function, "Unable to locate root in a reasonable time:" + " Current best guess is %1%", yvm, Policy()); + } + + return yvm; +} + } // namespace detail template <class T1, class T2, class Policy> -inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_j(T1 v, T2 x, const Policy& pol) +inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_j(T1 v, T2 x, const Policy& /* pol */) { BOOST_FPU_EXCEPTION_GUARD typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; typedef typename detail::bessel_traits<T1, T2, Policy>::optimisation_tag tag_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_j_imp<value_type>(v, static_cast<value_type>(x), tag_type(), pol), "boost::math::cyl_bessel_j<%1%>(%1%,%1%)"); + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_j_imp<value_type>(v, static_cast<value_type>(x), tag_type(), forwarding_policy()), "boost::math::cyl_bessel_j<%1%>(%1%,%1%)"); } template <class T1, class T2> @@ -386,12 +550,18 @@ inline typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type } template <class T, class Policy> -inline typename detail::bessel_traits<T, T, Policy>::result_type sph_bessel(unsigned v, T x, const Policy& pol) +inline typename detail::bessel_traits<T, T, Policy>::result_type sph_bessel(unsigned v, T x, const Policy& /* pol */) { BOOST_FPU_EXCEPTION_GUARD typedef typename detail::bessel_traits<T, T, Policy>::result_type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - return policies::checked_narrowing_cast<result_type, Policy>(detail::sph_bessel_j_imp<value_type>(v, static_cast<value_type>(x), pol), "boost::math::sph_bessel<%1%>(%1%,%1%)"); + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::sph_bessel_j_imp<value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::sph_bessel<%1%>(%1%,%1%)"); } template <class T> @@ -401,12 +571,18 @@ inline typename detail::bessel_traits<T, T, policies::policy<> >::result_type sp } template <class T1, class T2, class Policy> -inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_i(T1 v, T2 x, const Policy& pol) +inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_i(T1 v, T2 x, const Policy& /* pol */) { BOOST_FPU_EXCEPTION_GUARD typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_i_imp<value_type>(v, static_cast<value_type>(x), pol), "boost::math::cyl_bessel_i<%1%>(%1%,%1%)"); + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_i_imp<value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::cyl_bessel_i<%1%>(%1%,%1%)"); } template <class T1, class T2> @@ -416,13 +592,19 @@ inline typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type } template <class T1, class T2, class Policy> -inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_k(T1 v, T2 x, const Policy& pol) +inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_k(T1 v, T2 x, const Policy& /* pol */) { BOOST_FPU_EXCEPTION_GUARD typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; typedef typename detail::bessel_traits<T1, T2, Policy>::optimisation_tag tag_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_k_imp<value_type>(v, static_cast<value_type>(x), tag_type(), pol), "boost::math::cyl_bessel_k<%1%>(%1%,%1%)"); + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_k_imp<value_type>(v, static_cast<value_type>(x), tag_type(), forwarding_policy()), "boost::math::cyl_bessel_k<%1%>(%1%,%1%)"); } template <class T1, class T2> @@ -432,13 +614,19 @@ inline typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type } template <class T1, class T2, class Policy> -inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_neumann(T1 v, T2 x, const Policy& pol) +inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_neumann(T1 v, T2 x, const Policy& /* pol */) { BOOST_FPU_EXCEPTION_GUARD typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; typedef typename detail::bessel_traits<T1, T2, Policy>::optimisation_tag tag_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_neumann_imp<value_type>(v, static_cast<value_type>(x), tag_type(), pol), "boost::math::cyl_neumann<%1%>(%1%,%1%)"); + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_neumann_imp<value_type>(v, static_cast<value_type>(x), tag_type(), forwarding_policy()), "boost::math::cyl_neumann<%1%>(%1%,%1%)"); } template <class T1, class T2> @@ -448,12 +636,18 @@ inline typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type } template <class T, class Policy> -inline typename detail::bessel_traits<T, T, Policy>::result_type sph_neumann(unsigned v, T x, const Policy& pol) +inline typename detail::bessel_traits<T, T, Policy>::result_type sph_neumann(unsigned v, T x, const Policy& /* pol */) { BOOST_FPU_EXCEPTION_GUARD typedef typename detail::bessel_traits<T, T, Policy>::result_type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - return policies::checked_narrowing_cast<result_type, Policy>(detail::sph_neumann_imp<value_type>(v, static_cast<value_type>(x), pol), "boost::math::sph_neumann<%1%>(%1%,%1%)"); + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::sph_neumann_imp<value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::sph_neumann<%1%>(%1%,%1%)"); } template <class T> @@ -462,8 +656,131 @@ inline typename detail::bessel_traits<T, T, policies::policy<> >::result_type sp return sph_neumann(v, x, policies::policy<>()); } +template <class T, class Policy> +inline typename detail::bessel_traits<T, T, Policy>::result_type cyl_bessel_j_zero(T v, int m, const Policy& /* pol */) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename detail::bessel_traits<T, T, Policy>::result_type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Order must be a floating-point type."); + + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_j_zero_imp<value_type>(v, m, forwarding_policy()), "boost::math::cyl_bessel_j_zero<%1%>(%1%,%1%)"); +} + +template <class T> +inline typename detail::bessel_traits<T, T, policies::policy<> >::result_type cyl_bessel_j_zero(T v, int m) +{ + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Order must be a floating-point type."); + + return cyl_bessel_j_zero<T, policies::policy<> >(v, m, policies::policy<>()); +} + +template <class T, class OutputIterator, class Policy> +inline OutputIterator cyl_bessel_j_zero(T v, + int start_index, + unsigned number_of_zeros, + OutputIterator out_it, + const Policy& pol) +{ + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Order must be a floating-point type."); + + for(int i = 0; i < static_cast<int>(number_of_zeros); ++i) + { + *out_it = boost::math::cyl_bessel_j_zero(v, start_index + i, pol); + ++out_it; + } + return out_it; +} + +template <class T, class OutputIterator> +inline OutputIterator cyl_bessel_j_zero(T v, + int start_index, + unsigned number_of_zeros, + OutputIterator out_it) +{ + return cyl_bessel_j_zero(v, start_index, number_of_zeros, out_it, policies::policy<>()); +} + +template <class T, class Policy> +inline typename detail::bessel_traits<T, T, Policy>::result_type cyl_neumann_zero(T v, int m, const Policy& /* pol */) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename detail::bessel_traits<T, T, Policy>::result_type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Order must be a floating-point type."); + + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_neumann_zero_imp<value_type>(v, m, forwarding_policy()), "boost::math::cyl_neumann_zero<%1%>(%1%,%1%)"); +} + +template <class T> +inline typename detail::bessel_traits<T, T, policies::policy<> >::result_type cyl_neumann_zero(T v, int m) +{ + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Order must be a floating-point type."); + + return cyl_neumann_zero<T, policies::policy<> >(v, m, policies::policy<>()); +} + +template <class T, class OutputIterator, class Policy> +inline OutputIterator cyl_neumann_zero(T v, + int start_index, + unsigned number_of_zeros, + OutputIterator out_it, + const Policy& pol) +{ + BOOST_STATIC_ASSERT_MSG( false == std::numeric_limits<T>::is_specialized + || ( true == std::numeric_limits<T>::is_specialized + && false == std::numeric_limits<T>::is_integer), + "Order must be a floating-point type."); + + for(int i = 0; i < static_cast<int>(number_of_zeros); ++i) + { + *out_it = boost::math::cyl_neumann_zero(v, start_index + i, pol); + ++out_it; + } + return out_it; +} + +template <class T, class OutputIterator> +inline OutputIterator cyl_neumann_zero(T v, + int start_index, + unsigned number_of_zeros, + OutputIterator out_it) +{ + return cyl_neumann_zero(v, start_index, number_of_zeros, out_it, policies::policy<>()); +} + } // namespace math } // namespace boost #endif // BOOST_MATH_BESSEL_HPP + diff --git a/boost/math/special_functions/bessel_prime.hpp b/boost/math/special_functions/bessel_prime.hpp new file mode 100644 index 0000000000..c5f2d58c2b --- /dev/null +++ b/boost/math/special_functions/bessel_prime.hpp @@ -0,0 +1,359 @@ +// Copyright (c) 2013 Anton Bikineev +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) +// +#ifndef BOOST_MATH_BESSEL_DERIVATIVES_HPP +#define BOOST_MATH_BESSEL_DERIVATIVES_HPP + +#ifdef _MSC_VER +# pragma once +#endif + +#include <boost/math/special_functions/math_fwd.hpp> +#include <boost/math/special_functions/bessel.hpp> +#include <boost/math/special_functions/detail/bessel_jy_derivatives_asym.hpp> +#include <boost/math/special_functions/detail/bessel_jy_derivatives_series.hpp> +#include <boost/math/special_functions/detail/bessel_derivatives_linear.hpp> + +namespace boost{ namespace math{ + +namespace detail{ + +template <class Tag, class T, class Policy> +inline T cyl_bessel_j_prime_imp(T v, T x, const Policy& pol) +{ + static const char* const function = "boost::math::cyl_bessel_j_prime<%1%>(%1%,%1%)"; + BOOST_MATH_STD_USING + // + // Prevent complex result: + // + if (x < 0 && floor(v) != v) + return boost::math::policies::raise_domain_error<T>( + function, + "Got x = %1%, but function requires x >= 0", x, pol); + // + // Special cases for x == 0: + // + if (x == 0) + { + if (v == 1) + return 0.5; + else if (v == -1) + return -0.5; + else if (floor(v) == v || v > 1) + return 0; + else return boost::math::policies::raise_domain_error<T>( + function, + "Got x = %1%, but function is indeterminate for this order", x, pol); + } + // + // Special case for large x: use asymptotic expansion: + // + if (boost::math::detail::asymptotic_bessel_derivative_large_x_limit(v, x)) + return boost::math::detail::asymptotic_bessel_j_derivative_large_x_2(v, x); + // + // Special case for small x: use Taylor series: + // + if ((abs(x) < 5) || (abs(v) > x * x / 4)) + { + bool inversed = false; + if (floor(v) == v && v < 0) + { + v = -v; + if (itrunc(v, pol) & 1) + inversed = true; + } + T r = boost::math::detail::bessel_j_derivative_small_z_series(v, x, pol); + return inversed ? T(-r) : r; + } + // + // Special case for v == 0: + // + if (v == 0) + return -boost::math::detail::cyl_bessel_j_imp<T>(1, x, Tag(), pol); + // + // Default case: + // + return boost::math::detail::bessel_j_derivative_linear(v, x, Tag(), pol); +} + +template <class T, class Policy> +inline T sph_bessel_j_prime_imp(unsigned v, T x, const Policy& pol) +{ + static const char* const function = "boost::math::sph_bessel_prime<%1%>(%1%,%1%)"; + // + // Prevent complex result: + // + if (x < 0) + return boost::math::policies::raise_domain_error<T>( + function, + "Got x = %1%, but function requires x >= 0.", x, pol); + // + // Special case for v == 0: + // + if (v == 0) + return (x == 0) ? boost::math::policies::raise_overflow_error<T>(function, 0, pol) + : static_cast<T>(-boost::math::detail::sph_bessel_j_imp<T>(1, x, pol)); + // + // Special case for x == 0 and v > 0: + // + if (x == 0) + return boost::math::policies::raise_domain_error<T>( + function, + "Got x = %1%, but function is indeterminate for this order", x, pol); + // + // Default case: + // + return boost::math::detail::sph_bessel_j_derivative_linear(v, x, pol); +} + +template <class T, class Policy> +inline T cyl_bessel_i_prime_imp(T v, T x, const Policy& pol) +{ + static const char* const function = "boost::math::cyl_bessel_i_prime<%1%>(%1%,%1%)"; + BOOST_MATH_STD_USING + // + // Prevent complex result: + // + if (x < 0 && floor(v) != v) + return boost::math::policies::raise_domain_error<T>( + function, + "Got x = %1%, but function requires x >= 0", x, pol); + // + // Special cases for x == 0: + // + if (x == 0) + { + if (v == 1 || v == -1) + return 0.5; + else if (floor(v) == v || v > 1) + return 0; + else return boost::math::policies::raise_domain_error<T>( + function, + "Got x = %1%, but function is indeterminate for this order", x, pol); + } + // + // Special case for v == 0: + // + if (v == 0) + return boost::math::detail::cyl_bessel_i_imp<T>(1, x, pol); + // + // Default case: + // + return boost::math::detail::bessel_i_derivative_linear(v, x, pol); +} + +template <class Tag, class T, class Policy> +inline T cyl_bessel_k_prime_imp(T v, T x, const Policy& pol) +{ + // + // Prevent complex and indeterminate results: + // + if (x <= 0) + return boost::math::policies::raise_domain_error<T>( + "boost::math::cyl_bessel_k_prime<%1%>(%1%,%1%)", + "Got x = %1%, but function requires x > 0", x, pol); + // + // Special case for v == 0: + // + if (v == 0) + return -boost::math::detail::cyl_bessel_k_imp<T>(1, x, Tag(), pol); + // + // Default case: + // + return boost::math::detail::bessel_k_derivative_linear(v, x, Tag(), pol); +} + +template <class Tag, class T, class Policy> +inline T cyl_neumann_prime_imp(T v, T x, const Policy& pol) +{ + BOOST_MATH_STD_USING + // + // Prevent complex and indeterminate results: + // + if (x <= 0) + return boost::math::policies::raise_domain_error<T>( + "boost::math::cyl_neumann_prime<%1%>(%1%,%1%)", + "Got x = %1%, but function requires x > 0", x, pol); + // + // Special case for large x: use asymptotic expansion: + // + if (boost::math::detail::asymptotic_bessel_derivative_large_x_limit(v, x)) + return boost::math::detail::asymptotic_bessel_y_derivative_large_x_2(v, x); + // + // Special case for small x: use Taylor series: + // + if (v > 0 && floor(v) != v) + { + const T eps = boost::math::policies::get_epsilon<T, Policy>(); + if (log(eps / 2) > v * log((x * x) / (v * 4))) + return boost::math::detail::bessel_y_derivative_small_z_series(v, x, pol); + } + // + // Special case for v == 0: + // + if (v == 0) + return -boost::math::detail::cyl_neumann_imp<T>(1, x, Tag(), pol); + // + // Default case: + // + return boost::math::detail::bessel_y_derivative_linear(v, x, Tag(), pol); +} + +template <class T, class Policy> +inline T sph_neumann_prime_imp(unsigned v, T x, const Policy& pol) +{ + // + // Prevent complex and indeterminate result: + // + if (x <= 0) + return boost::math::policies::raise_domain_error<T>( + "boost::math::sph_neumann_prime<%1%>(%1%,%1%)", + "Got x = %1%, but function requires x > 0.", x, pol); + // + // Special case for v == 0: + // + if (v == 0) + return -boost::math::detail::sph_neumann_imp<T>(1, x, pol); + // + // Default case: + // + return boost::math::detail::sph_neumann_derivative_linear(v, x, pol); +} + +} // namespace detail + +template <class T1, class T2, class Policy> +inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_j_prime(T1 v, T2 x, const Policy& /* pol */) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; + typedef typename detail::bessel_traits<T1, T2, Policy>::optimisation_tag tag_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_j_prime_imp<tag_type, value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::cyl_bessel_j_prime<%1%,%1%>(%1%,%1%)"); +} + +template <class T1, class T2> +inline typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_j_prime(T1 v, T2 x) +{ + return cyl_bessel_j_prime(v, x, policies::policy<>()); +} + +template <class T, class Policy> +inline typename detail::bessel_traits<T, T, Policy>::result_type sph_bessel_prime(unsigned v, T x, const Policy& /* pol */) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename detail::bessel_traits<T, T, Policy>::result_type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::sph_bessel_j_prime_imp<value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::sph_bessel_j_prime<%1%>(%1%,%1%)"); +} + +template <class T> +inline typename detail::bessel_traits<T, T, policies::policy<> >::result_type sph_bessel_prime(unsigned v, T x) +{ + return sph_bessel_prime(v, x, policies::policy<>()); +} + +template <class T1, class T2, class Policy> +inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_i_prime(T1 v, T2 x, const Policy& /* pol */) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_i_prime_imp<value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::cyl_bessel_i_prime<%1%>(%1%,%1%)"); +} + +template <class T1, class T2> +inline typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_i_prime(T1 v, T2 x) +{ + return cyl_bessel_i_prime(v, x, policies::policy<>()); +} + +template <class T1, class T2, class Policy> +inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_k_prime(T1 v, T2 x, const Policy& /* pol */) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; + typedef typename detail::bessel_traits<T1, T2, Policy>::optimisation_tag tag_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_bessel_k_prime_imp<tag_type, value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::cyl_bessel_k_prime<%1%,%1%>(%1%,%1%)"); +} + +template <class T1, class T2> +inline typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_k_prime(T1 v, T2 x) +{ + return cyl_bessel_k_prime(v, x, policies::policy<>()); +} + +template <class T1, class T2, class Policy> +inline typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_neumann_prime(T1 v, T2 x, const Policy& /* pol */) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; + typedef typename detail::bessel_traits<T1, T2, Policy>::optimisation_tag tag_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::cyl_neumann_prime_imp<tag_type, value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::cyl_neumann_prime<%1%,%1%>(%1%,%1%)"); +} + +template <class T1, class T2> +inline typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_neumann_prime(T1 v, T2 x) +{ + return cyl_neumann_prime(v, x, policies::policy<>()); +} + +template <class T, class Policy> +inline typename detail::bessel_traits<T, T, Policy>::result_type sph_neumann_prime(unsigned v, T x, const Policy& /* pol */) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename detail::bessel_traits<T, T, Policy>::result_type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + return policies::checked_narrowing_cast<result_type, Policy>(detail::sph_neumann_prime_imp<value_type>(v, static_cast<value_type>(x), forwarding_policy()), "boost::math::sph_neumann_prime<%1%>(%1%,%1%)"); +} + +template <class T> +inline typename detail::bessel_traits<T, T, policies::policy<> >::result_type sph_neumann_prime(unsigned v, T x) +{ + return sph_neumann_prime(v, x, policies::policy<>()); +} + +} // namespace math +} // namespace boost + +#endif // BOOST_MATH_BESSEL_DERIVATIVES_HPP diff --git a/boost/math/special_functions/beta.hpp b/boost/math/special_functions/beta.hpp index 1177f44d60..8486b824f2 100644 --- a/boost/math/special_functions/beta.hpp +++ b/boost/math/special_functions/beta.hpp @@ -35,9 +35,9 @@ T beta_imp(T a, T b, const Lanczos&, const Policy& pol) BOOST_MATH_STD_USING // for ADL of std names if(a <= 0) - policies::raise_domain_error<T>("boost::math::beta<%1%>(%1%,%1%)", "The arguments to the beta function must be greater than zero (got a=%1%).", a, pol); + return policies::raise_domain_error<T>("boost::math::beta<%1%>(%1%,%1%)", "The arguments to the beta function must be greater than zero (got a=%1%).", a, pol); if(b <= 0) - policies::raise_domain_error<T>("boost::math::beta<%1%>(%1%,%1%)", "The arguments to the beta function must be greater than zero (got b=%1%).", b, pol); + return policies::raise_domain_error<T>("boost::math::beta<%1%>(%1%,%1%)", "The arguments to the beta function must be greater than zero (got b=%1%).", b, pol); T result; @@ -119,9 +119,9 @@ T beta_imp(T a, T b, const lanczos::undefined_lanczos& /* l */, const Policy& po BOOST_MATH_STD_USING if(a <= 0) - policies::raise_domain_error<T>("boost::math::beta<%1%>(%1%,%1%)", "The arguments to the beta function must be greater than zero (got a=%1%).", a, pol); + return policies::raise_domain_error<T>("boost::math::beta<%1%>(%1%,%1%)", "The arguments to the beta function must be greater than zero (got a=%1%).", a, pol); if(b <= 0) - policies::raise_domain_error<T>("boost::math::beta<%1%>(%1%,%1%)", "The arguments to the beta function must be greater than zero (got b=%1%).", b, pol); + return policies::raise_domain_error<T>("boost::math::beta<%1%>(%1%,%1%)", "The arguments to the beta function must be greater than zero (got b=%1%).", b, pol); T result; @@ -597,7 +597,7 @@ struct ibeta_fraction2_t { typedef std::pair<T, T> result_type; - ibeta_fraction2_t(T a_, T b_, T x_) : a(a_), b(b_), x(x_), m(0) {} + ibeta_fraction2_t(T a_, T b_, T x_, T y_) : a(a_), b(b_), x(x_), y(y_), m(0) {} result_type operator()() { @@ -607,7 +607,7 @@ struct ibeta_fraction2_t T bN = m; bN += (m * (b - m) * x) / (a + 2*m - 1); - bN += ((a + m) * (a - (a + b) * x + 1 + m *(2 - x))) / (a + 2*m + 1); + bN += ((a + m) * (a * y - b * x + 1 + m *(2 - x))) / (a + 2*m + 1); ++m; @@ -615,7 +615,7 @@ struct ibeta_fraction2_t } private: - T a, b, x; + T a, b, x, y; int m; }; // @@ -635,8 +635,10 @@ inline T ibeta_fraction2(T a, T b, T x, T y, const Policy& pol, bool normalised, if(result == 0) return result; - ibeta_fraction2_t<T> f(a, b, x); + ibeta_fraction2_t<T> f(a, b, x, y); T fract = boost::math::tools::continued_fraction_b(f, boost::math::policies::get_epsilon<T, Policy>()); + BOOST_MATH_INSTRUMENT_VARIABLE(fract); + BOOST_MATH_INSTRUMENT_VARIABLE(result); return result / fract; } // @@ -887,19 +889,19 @@ T ibeta_imp(T a, T b, T x, const Policy& pol, bool inv, bool normalised, T* p_de *p_derivative = -1; // value not set. if((x < 0) || (x > 1)) - policies::raise_domain_error<T>(function, "Parameter x outside the range [0,1] in the incomplete beta function (got x=%1%).", x, pol); + return policies::raise_domain_error<T>(function, "Parameter x outside the range [0,1] in the incomplete beta function (got x=%1%).", x, pol); if(normalised) { if(a < 0) - policies::raise_domain_error<T>(function, "The argument a to the incomplete beta function must be >= zero (got a=%1%).", a, pol); + return policies::raise_domain_error<T>(function, "The argument a to the incomplete beta function must be >= zero (got a=%1%).", a, pol); if(b < 0) - policies::raise_domain_error<T>(function, "The argument b to the incomplete beta function must be >= zero (got b=%1%).", b, pol); + return policies::raise_domain_error<T>(function, "The argument b to the incomplete beta function must be >= zero (got b=%1%).", b, pol); // extend to a few very special cases: if(a == 0) { if(b == 0) - policies::raise_domain_error<T>(function, "The arguments a and b to the incomplete beta function cannot both be zero, with x=%1%.", x, pol); + return policies::raise_domain_error<T>(function, "The arguments a and b to the incomplete beta function cannot both be zero, with x=%1%.", x, pol); if(b > 0) return inv ? 0 : 1; } @@ -912,9 +914,9 @@ T ibeta_imp(T a, T b, T x, const Policy& pol, bool inv, bool normalised, T* p_de else { if(a <= 0) - policies::raise_domain_error<T>(function, "The argument a to the incomplete beta function must be greater than zero (got a=%1%).", a, pol); + return policies::raise_domain_error<T>(function, "The argument a to the incomplete beta function must be greater than zero (got a=%1%).", a, pol); if(b <= 0) - policies::raise_domain_error<T>(function, "The argument b to the incomplete beta function must be greater than zero (got b=%1%).", b, pol); + return policies::raise_domain_error<T>(function, "The argument b to the incomplete beta function must be greater than zero (got b=%1%).", b, pol); } if(x == 0) @@ -933,6 +935,49 @@ T ibeta_imp(T a, T b, T x, const Policy& pol, bool inv, bool normalised, T* p_de } return (invert == 0 ? (normalised ? 1 : boost::math::beta(a, b, pol)) : 0); } + if((a == 0.5f) && (b == 0.5f)) + { + // We have an arcsine distribution: + if(p_derivative) + { + *p_derivative = 1 / constants::pi<T>() * sqrt(y * x); + } + T p = invert ? asin(sqrt(y)) / constants::half_pi<T>() : asin(sqrt(x)) / constants::half_pi<T>(); + if(!normalised) + p *= constants::pi<T>(); + return p; + } + if(a == 1) + { + std::swap(a, b); + std::swap(x, y); + invert = !invert; + } + if(b == 1) + { + // + // Special case see: http://functions.wolfram.com/GammaBetaErf/BetaRegularized/03/01/01/ + // + if(a == 1) + { + if(p_derivative) + *p_derivative = 1; + return invert ? y : x; + } + + if(p_derivative) + { + *p_derivative = a * pow(x, a - 1); + } + T p; + if(y < 0.5) + p = invert ? T(-boost::math::expm1(a * boost::math::log1p(-y, pol), pol)) : T(exp(a * boost::math::log1p(-y, pol))); + else + p = invert ? T(-boost::math::powm1(x, a, pol)) : T(pow(x, a)); + if(!normalised) + p /= a; + return p; + } if((std::min)(a, b) <= 1) { @@ -1115,7 +1160,7 @@ T ibeta_imp(T a, T b, T x, const Policy& pol, bool inv, bool normalised, T* p_de if(b < 40) { - if((floor(a) == a) && (floor(b) == b)) + if((floor(a) == a) && (floor(b) == b) && (a < (std::numeric_limits<int>::max)() - 100)) { // relate to the binomial distribution and use a finite sum: T k = a - 1; @@ -1236,11 +1281,11 @@ T ibeta_derivative_imp(T a, T b, T x, const Policy& pol) // start with the usual error checks: // if(a <= 0) - policies::raise_domain_error<T>(function, "The argument a to the incomplete beta function must be greater than zero (got a=%1%).", a, pol); + return policies::raise_domain_error<T>(function, "The argument a to the incomplete beta function must be greater than zero (got a=%1%).", a, pol); if(b <= 0) - policies::raise_domain_error<T>(function, "The argument b to the incomplete beta function must be greater than zero (got b=%1%).", b, pol); + return policies::raise_domain_error<T>(function, "The argument b to the incomplete beta function must be greater than zero (got b=%1%).", b, pol); if((x < 0) || (x > 1)) - policies::raise_domain_error<T>(function, "Parameter x outside the range [0,1] in the incomplete beta function (got x=%1%).", x, pol); + return policies::raise_domain_error<T>(function, "Parameter x outside the range [0,1] in the incomplete beta function (got x=%1%).", x, pol); // // Now the corner cases: // @@ -1329,7 +1374,6 @@ inline typename tools::promote_args<RT1, RT2, RT3>::type BOOST_FPU_EXCEPTION_GUARD typedef typename tools::promote_args<RT1, RT2, RT3>::type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; typedef typename policies::normalise< Policy, policies::promote_float<false>, @@ -1347,7 +1391,6 @@ inline typename tools::promote_args<RT1, RT2, RT3>::type BOOST_FPU_EXCEPTION_GUARD typedef typename tools::promote_args<RT1, RT2, RT3>::type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; typedef typename policies::normalise< Policy, policies::promote_float<false>, diff --git a/boost/math/special_functions/binomial.hpp b/boost/math/special_functions/binomial.hpp index 16b4f3305d..8fa2e26d84 100644 --- a/boost/math/special_functions/binomial.hpp +++ b/boost/math/special_functions/binomial.hpp @@ -10,6 +10,7 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/factorials.hpp> #include <boost/math/special_functions/beta.hpp> #include <boost/math/policies/error_handling.hpp> diff --git a/boost/math/special_functions/cos_pi.hpp b/boost/math/special_functions/cos_pi.hpp index 93102c1cb3..18d06c00df 100644 --- a/boost/math/special_functions/cos_pi.hpp +++ b/boost/math/special_functions/cos_pi.hpp @@ -10,6 +10,7 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/config/no_tr1/cmath.hpp> #include <boost/math/tools/config.hpp> #include <boost/math/special_functions/trunc.hpp> diff --git a/boost/math/special_functions/detail/airy_ai_bi_zero.hpp b/boost/math/special_functions/detail/airy_ai_bi_zero.hpp new file mode 100644 index 0000000000..dbb7388dda --- /dev/null +++ b/boost/math/special_functions/detail/airy_ai_bi_zero.hpp @@ -0,0 +1,160 @@ +// Copyright (c) 2013 Christopher Kormanyos +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) +// +// This work is based on an earlier work: +// "Algorithm 910: A Portable C++ Multiple-Precision System for Special-Function Calculations", +// in ACM TOMS, {VOL 37, ISSUE 4, (February 2011)} (C) ACM, 2011. http://doi.acm.org/10.1145/1916461.1916469 +// +// This header contains implementation details for estimating the zeros +// of the Airy functions airy_ai and airy_bi on the negative real axis. +// +#ifndef _AIRY_AI_BI_ZERO_2013_01_20_HPP_ + #define _AIRY_AI_BI_ZERO_2013_01_20_HPP_ + + #include <boost/math/constants/constants.hpp> + #include <boost/math/special_functions/cbrt.hpp> + + namespace boost { namespace math { + namespace detail + { + // Forward declarations of the needed Airy function implementations. + template <class T, class Policy> + T airy_ai_imp(T x, const Policy& pol); + template <class T, class Policy> + T airy_bi_imp(T x, const Policy& pol); + template <class T, class Policy> + T airy_ai_prime_imp(T x, const Policy& pol); + template <class T, class Policy> + T airy_bi_prime_imp(T x, const Policy& pol); + + namespace airy_zero + { + template<class T> + T equation_as_10_4_105(const T& z) + { + const T one_over_z (T(1) / z); + const T one_over_z_squared(one_over_z * one_over_z); + + const T z_pow_third (boost::math::cbrt(z)); + const T z_pow_two_thirds(z_pow_third * z_pow_third); + + // Implement the top line of Eq. 10.4.105. + const T fz(z_pow_two_thirds * ((((( + (T(162375596875.0) / 334430208UL) + * one_over_z_squared - ( T(108056875.0) / 6967296UL)) + * one_over_z_squared + ( T(77125UL) / 82944UL)) + * one_over_z_squared - ( T(5U) / 36U)) + * one_over_z_squared + ( T(5U) / 48U)) + * one_over_z_squared + (1))); + + return fz; + } + + namespace airy_ai_zero_detail + { + template<class T> + T initial_guess(const int m) + { + T guess; + + switch(m) + { + case 0: { guess = T(0); break; } + case 1: { guess = T(-2.33810741045976703849); break; } + case 2: { guess = T(-4.08794944413097061664); break; } + case 3: { guess = T(-5.52055982809555105913); break; } + case 4: { guess = T(-6.78670809007175899878); break; } + case 5: { guess = T(-7.94413358712085312314); break; } + case 6: { guess = T(-9.02265085334098038016); break; } + case 7: { guess = T(-10.0401743415580859306); break; } + case 8: { guess = T(-11.0085243037332628932); break; } + case 9: { guess = T(-11.9360155632362625170); break; } + case 10:{ guess = T(-12.8287767528657572004); break; } + default: + { + const T t(((boost::math::constants::pi<T>() * 3) * ((T(m) * 4) - 1)) / 8); + guess = -boost::math::detail::airy_zero::equation_as_10_4_105(t); + break; + } + } + + return guess; + } + + template<class T, class Policy> + class function_object_ai_and_ai_prime + { + public: + function_object_ai_and_ai_prime(const Policy pol) : my_pol(pol) { } + + boost::math::tuple<T, T> operator()(const T& x) const + { + // Return a tuple containing both Ai(x) and Ai'(x). + return boost::math::make_tuple( + boost::math::detail::airy_ai_imp (x, my_pol), + boost::math::detail::airy_ai_prime_imp(x, my_pol)); + } + + private: + const Policy& my_pol; + const function_object_ai_and_ai_prime& operator=(const function_object_ai_and_ai_prime&); + }; + } // namespace airy_ai_zero_detail + + namespace airy_bi_zero_detail + { + template<class T> + T initial_guess(const int m) + { + T guess; + + switch(m) + { + case 0: { guess = T(0); break; } + case 1: { guess = T(-1.17371322270912792492); break; } + case 2: { guess = T(-3.27109330283635271568); break; } + case 3: { guess = T(-4.83073784166201593267); break; } + case 4: { guess = T(-6.16985212831025125983); break; } + case 5: { guess = T(-7.37676207936776371360); break; } + case 6: { guess = T(-8.49194884650938801345); break; } + case 7: { guess = T(-9.53819437934623888663); break; } + case 8: { guess = T(-10.5299135067053579244); break; } + case 9: { guess = T(-11.4769535512787794379); break; } + case 10: { guess = T(-12.3864171385827387456); break; } + default: + { + const T t(((boost::math::constants::pi<T>() * 3) * ((T(m) * 4) - 3)) / 8); + guess = -boost::math::detail::airy_zero::equation_as_10_4_105(t); + break; + } + } + + return guess; + } + + template<class T, class Policy> + class function_object_bi_and_bi_prime + { + public: + function_object_bi_and_bi_prime(const Policy pol) : my_pol(pol) { } + + boost::math::tuple<T, T> operator()(const T& x) const + { + // Return a tuple containing both Bi(x) and Bi'(x). + return boost::math::make_tuple( + boost::math::detail::airy_bi_imp (x, my_pol), + boost::math::detail::airy_bi_prime_imp(x, my_pol)); + } + + private: + const Policy& my_pol; + const function_object_bi_and_bi_prime& operator=(const function_object_bi_and_bi_prime&); + }; + } // namespace airy_bi_zero_detail + } // namespace airy_zero + } // namespace detail + } // namespace math + } // namespaces boost + +#endif // _AIRY_AI_BI_ZERO_2013_01_20_HPP_ diff --git a/boost/math/special_functions/detail/bernoulli_details.hpp b/boost/math/special_functions/detail/bernoulli_details.hpp new file mode 100644 index 0000000000..f2d3c655c8 --- /dev/null +++ b/boost/math/special_functions/detail/bernoulli_details.hpp @@ -0,0 +1,653 @@ +/////////////////////////////////////////////////////////////////////////////// +// Copyright 2013 John Maddock +// Distributed under the Boost +// Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) + +#ifndef BOOST_MATH_BERNOULLI_DETAIL_HPP +#define BOOST_MATH_BERNOULLI_DETAIL_HPP + +#include <boost/config.hpp> +#include <boost/detail/lightweight_mutex.hpp> +#include <boost/utility/enable_if.hpp> +#include <boost/math/tools/toms748_solve.hpp> + +#ifdef BOOST_HAS_THREADS + +#ifndef BOOST_NO_CXX11_HDR_ATOMIC +# include <atomic> +# define BOOST_MATH_ATOMIC_NS std +#if ATOMIC_INT_LOCK_FREE == 2 +typedef std::atomic<int> atomic_counter_type; +typedef int atomic_integer_type; +#elif ATOMIC_SHORT_LOCK_FREE == 2 +typedef std::atomic<short> atomic_counter_type; +typedef short atomic_integer_type; +#elif ATOMIC_LONG_LOCK_FREE == 2 +typedef std::atomic<long> atomic_counter_type; +typedef long atomic_integer_type; +#elif ATOMIC_LLONG_LOCK_FREE == 2 +typedef std::atomic<long long> atomic_counter_type; +typedef long long atomic_integer_type; +#else +# define BOOST_MATH_NO_ATOMIC_INT +#endif + +#else // BOOST_NO_CXX11_HDR_ATOMIC +// +// We need Boost.Atomic, but on any platform that supports auto-linking we do +// not need to link against a separate library: +// +#define BOOST_ATOMIC_NO_LIB +#include <boost/atomic.hpp> +# define BOOST_MATH_ATOMIC_NS boost + +namespace boost{ namespace math{ namespace detail{ + +// +// We need a type to use as an atomic counter: +// +#if BOOST_ATOMIC_INT_LOCK_FREE == 2 +typedef boost::atomic<int> atomic_counter_type; +typedef int atomic_integer_type; +#elif BOOST_ATOMIC_SHORT_LOCK_FREE == 2 +typedef boost::atomic<short> atomic_counter_type; +typedef short atomic_integer_type; +#elif BOOST_ATOMIC_LONG_LOCK_FREE == 2 +typedef boost::atomic<long> atomic_counter_type; +typedef long atomic_integer_type; +#elif BOOST_ATOMIC_LLONG_LOCK_FREE == 2 +typedef boost::atomic<long long> atomic_counter_type; +typedef long long atomic_integer_type; +#else +# define BOOST_MATH_NO_ATOMIC_INT +#endif + +}}} // namespaces + +#endif // BOOST_NO_CXX11_HDR_ATOMIC + +#endif // BOOST_HAS_THREADS + +namespace boost{ namespace math{ namespace detail{ +// +// Asymptotic expansion for B2n due to +// Luschny LogB3 formula (http://www.luschny.de/math/primes/bernincl.html) +// +template <class T, class Policy> +T b2n_asymptotic(int n) +{ + BOOST_MATH_STD_USING + const T nx = static_cast<T>(n); + const T nx2(nx * nx); + + const T approximate_log_of_bernoulli_bn = + ((boost::math::constants::half<T>() + nx) * log(nx)) + + ((boost::math::constants::half<T>() - nx) * log(boost::math::constants::pi<T>())) + + (((T(3) / 2) - nx) * boost::math::constants::ln_two<T>()) + + ((nx * (T(2) - (nx2 * 7) * (1 + ((nx2 * 30) * ((nx2 * 12) - 1))))) / (((nx2 * nx2) * nx2) * 2520)); + return ((n / 2) & 1 ? 1 : -1) * (approximate_log_of_bernoulli_bn > tools::log_max_value<T>() + ? policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, nx, Policy()) + : static_cast<T>(exp(approximate_log_of_bernoulli_bn))); +} + +template <class T, class Policy> +T t2n_asymptotic(int n) +{ + BOOST_MATH_STD_USING + // Just get B2n and convert to a Tangent number: + T t2n = fabs(b2n_asymptotic<T, Policy>(2 * n)) / (2 * n); + T p2 = ldexp(T(1), n); + if(tools::max_value<T>() / p2 < t2n) + return policies::raise_overflow_error<T>("boost::math::tangent_t2n<%1%>(std::size_t)", 0, T(n), Policy()); + t2n *= p2; + p2 -= 1; + if(tools::max_value<T>() / p2 < t2n) + return policies::raise_overflow_error<T>("boost::math::tangent_t2n<%1%>(std::size_t)", 0, Policy()); + t2n *= p2; + return t2n; +} +// +// We need to know the approximate value of /n/ which will +// cause bernoulli_b2n<T>(n) to return infinity - this allows +// us to elude a great deal of runtime checking for values below +// n, and only perform the full overflow checks when we know that we're +// getting close to the point where our calculations will overflow. +// We use Luschny's LogB3 formula (http://www.luschny.de/math/primes/bernincl.html) +// to find the limit, and since we're dealing with the log of the Bernoulli numbers +// we need only perform the calculation at double precision and not with T +// (which may be a multiprecision type). The limit returned is within 1 of the true +// limit for all the types tested. Note that although the code below is basically +// the same as b2n_asymptotic above, it has been recast as a continuous real-valued +// function as this makes the root finding go smoother/faster. It also omits the +// sign of the Bernoulli number. +// +struct max_bernoulli_root_functor +{ + max_bernoulli_root_functor(long long t) : target(static_cast<double>(t)) {} + double operator()(double n) + { + BOOST_MATH_STD_USING + + // Luschny LogB3(n) formula. + + const double nx2(n * n); + + const double approximate_log_of_bernoulli_bn + = ((boost::math::constants::half<double>() + n) * log(n)) + + ((boost::math::constants::half<double>() - n) * log(boost::math::constants::pi<double>())) + + (((double(3) / 2) - n) * boost::math::constants::ln_two<double>()) + + ((n * (2 - (nx2 * 7) * (1 + ((nx2 * 30) * ((nx2 * 12) - 1))))) / (((nx2 * nx2) * nx2) * 2520)); + + return approximate_log_of_bernoulli_bn - target; + } +private: + double target; +}; + +template <class T, class Policy> +inline std::size_t find_bernoulli_overflow_limit(const mpl::false_&) +{ + long long t = lltrunc(boost::math::tools::log_max_value<T>()); + max_bernoulli_root_functor fun(t); + boost::math::tools::equal_floor tol; + boost::uintmax_t max_iter = boost::math::policies::get_max_root_iterations<Policy>(); + return static_cast<std::size_t>(boost::math::tools::toms748_solve(fun, sqrt(double(t)), double(t), tol, max_iter).first) / 2; +} + +template <class T, class Policy> +inline std::size_t find_bernoulli_overflow_limit(const mpl::true_&) +{ + return max_bernoulli_index<bernoulli_imp_variant<T>::value>::value; +} + +template <class T, class Policy> +std::size_t b2n_overflow_limit() +{ + // This routine is called at program startup if it's called at all: + // that guarantees safe initialization of the static variable. + typedef mpl::bool_<(bernoulli_imp_variant<T>::value >= 1) && (bernoulli_imp_variant<T>::value <= 3)> tag_type; + static const std::size_t lim = find_bernoulli_overflow_limit<T, Policy>(tag_type()); + return lim; +} + +// +// The tangent numbers grow larger much more rapidly than the Bernoulli numbers do.... +// so to compute the Bernoulli numbers from the tangent numbers, we need to avoid spurious +// overflow in the calculation, we can do this by scaling all the tangent number by some scale factor: +// +template <class T> +inline typename enable_if_c<std::numeric_limits<T>::is_specialized && (std::numeric_limits<T>::radix == 2), T>::type tangent_scale_factor() +{ + BOOST_MATH_STD_USING + return ldexp(T(1), std::numeric_limits<T>::min_exponent + 5); +} +template <class T> +inline typename disable_if_c<std::numeric_limits<T>::is_specialized && (std::numeric_limits<T>::radix == 2), T>::type tangent_scale_factor() +{ + return tools::min_value<T>() * 16; +} +// +// Initializer: ensure all our constants are initialized prior to the first call of main: +// +template <class T, class Policy> +struct bernoulli_initializer +{ + struct init + { + init() + { + // + // We call twice, once to initialize our static table, and once to + // initialize our dymanic table: + // + boost::math::bernoulli_b2n<T>(2, Policy()); + try{ + boost::math::bernoulli_b2n<T>(max_bernoulli_b2n<T>::value + 1, Policy()); + } catch(const std::overflow_error&){} + boost::math::tangent_t2n<T>(2, Policy()); + } + void force_instantiate()const{} + }; + static const init initializer; + static void force_instantiate() + { + initializer.force_instantiate(); + } +}; + +template <class T, class Policy> +const typename bernoulli_initializer<T, Policy>::init bernoulli_initializer<T, Policy>::initializer; + +// +// We need something to act as a cache for our calculated Bernoulli numbers. In order to +// ensure both fast access and thread safety, we need a stable table which may be extended +// in size, but which never reallocates: that way values already calculated may be accessed +// concurrently with another thread extending the table with new values. +// +// Very very simple vector class that will never allocate more than once, we could use +// boost::container::static_vector here, but that allocates on the stack, which may well +// cause issues for the amount of memory we want in the extreme case... +// +template <class T> +struct fixed_vector : private std::allocator<T> +{ + typedef unsigned size_type; + typedef T* iterator; + typedef const T* const_iterator; + fixed_vector() : m_used(0) + { + std::size_t overflow_limit = 5 + b2n_overflow_limit<T, policies::policy<> >(); + m_capacity = static_cast<unsigned>((std::min)(overflow_limit, static_cast<std::size_t>(100000u))); + m_data = this->allocate(m_capacity); + } + ~fixed_vector() + { + for(unsigned i = 0; i < m_used; ++i) + this->destroy(&m_data[i]); + this->deallocate(m_data, m_capacity); + } + T& operator[](unsigned n) { BOOST_ASSERT(n < m_used); return m_data[n]; } + const T& operator[](unsigned n)const { BOOST_ASSERT(n < m_used); return m_data[n]; } + unsigned size()const { return m_used; } + unsigned size() { return m_used; } + void resize(unsigned n, const T& val) + { + if(n > m_capacity) + throw std::runtime_error("Exhausted storage for Bernoulli numbers."); + for(unsigned i = m_used; i < n; ++i) + new (m_data + i) T(val); + m_used = n; + } + void resize(unsigned n) { resize(n, T()); } + T* begin() { return m_data; } + T* end() { return m_data + m_used; } + T* begin()const { return m_data; } + T* end()const { return m_data + m_used; } + unsigned capacity()const { return m_capacity; } +private: + T* m_data; + unsigned m_used, m_capacity; +}; + +template <class T, class Policy> +class bernoulli_numbers_cache +{ +public: + bernoulli_numbers_cache() : m_overflow_limit((std::numeric_limits<std::size_t>::max)()) +#if defined(BOOST_HAS_THREADS) && !defined(BOOST_MATH_NO_ATOMIC_INT) + , m_counter(0) +#endif + {} + + typedef fixed_vector<T> container_type; + + void tangent(std::size_t m) + { + static const std::size_t min_overflow_index = b2n_overflow_limit<T, Policy>() - 1; + tn.resize(static_cast<typename container_type::size_type>(m), T(0U)); + + BOOST_MATH_INSTRUMENT_VARIABLE(min_overflow_index); + + std::size_t prev_size = m_intermediates.size(); + m_intermediates.resize(m, T(0U)); + + if(prev_size == 0) + { + m_intermediates[1] = tangent_scale_factor<T>() /*T(1U)*/; + tn[0U] = T(0U); + tn[1U] = tangent_scale_factor<T>()/* T(1U)*/; + BOOST_MATH_INSTRUMENT_VARIABLE(tn[0]); + BOOST_MATH_INSTRUMENT_VARIABLE(tn[1]); + } + + for(std::size_t i = std::max<size_t>(2, prev_size); i < m; i++) + { + bool overflow_check = false; + if(i >= min_overflow_index && (boost::math::tools::max_value<T>() / (i-1) < m_intermediates[1]) ) + { + std::fill(tn.begin() + i, tn.end(), boost::math::tools::max_value<T>()); + break; + } + m_intermediates[1] = m_intermediates[1] * (i-1); + for(std::size_t j = 2; j <= i; j++) + { + overflow_check = + (i >= min_overflow_index) && ( + (boost::math::tools::max_value<T>() / (i - j) < m_intermediates[j]) + || (boost::math::tools::max_value<T>() / (i - j + 2) < m_intermediates[j-1]) + || (boost::math::tools::max_value<T>() - m_intermediates[j] * (i - j) < m_intermediates[j-1] * (i - j + 2)) + || ((boost::math::isinf)(m_intermediates[j])) + ); + + if(overflow_check) + { + std::fill(tn.begin() + i, tn.end(), boost::math::tools::max_value<T>()); + break; + } + m_intermediates[j] = m_intermediates[j] * (i - j) + m_intermediates[j-1] * (i - j + 2); + } + if(overflow_check) + break; // already filled the tn... + tn[static_cast<typename container_type::size_type>(i)] = m_intermediates[i]; + BOOST_MATH_INSTRUMENT_VARIABLE(i); + BOOST_MATH_INSTRUMENT_VARIABLE(tn[static_cast<typename container_type::size_type>(i)]); + } + } + + void tangent_numbers_series(const std::size_t m) + { + BOOST_MATH_STD_USING + static const std::size_t min_overflow_index = b2n_overflow_limit<T, Policy>() - 1; + + typename container_type::size_type old_size = bn.size(); + + tangent(m); + bn.resize(static_cast<typename container_type::size_type>(m)); + + if(!old_size) + { + bn[0] = 1; + old_size = 1; + } + + T power_two(ldexp(T(1), static_cast<int>(2 * old_size))); + + for(std::size_t i = old_size; i < m; i++) + { + T b(static_cast<T>(i * 2)); + // + // Not only do we need to take care to avoid spurious over/under flow in + // the calculation, but we also need to avoid overflow altogether in case + // we're calculating with a type where "bad things" happen in that case: + // + b = b / (power_two * tangent_scale_factor<T>()); + b /= (power_two - 1); + bool overflow_check = (i >= min_overflow_index) && (tools::max_value<T>() / tn[static_cast<typename container_type::size_type>(i)] < b); + if(overflow_check) + { + m_overflow_limit = i; + while(i < m) + { + b = std::numeric_limits<T>::has_infinity ? std::numeric_limits<T>::infinity() : tools::max_value<T>(); + bn[static_cast<typename container_type::size_type>(i)] = ((i % 2U) ? b : T(-b)); + ++i; + } + break; + } + else + { + b *= tn[static_cast<typename container_type::size_type>(i)]; + } + + power_two = ldexp(power_two, 2); + + const bool b_neg = i % 2 == 0; + + bn[static_cast<typename container_type::size_type>(i)] = ((!b_neg) ? b : T(-b)); + } + } + + template <class OutputIterator> + OutputIterator copy_bernoulli_numbers(OutputIterator out, std::size_t start, std::size_t n, const Policy& pol) + { + // + // There are basically 3 thread safety options: + // + // 1) There are no threads (BOOST_HAS_THREADS is not defined). + // 2) There are threads, but we do not have a true atomic integer type, + // in this case we just use a mutex to guard against race conditions. + // 3) There are threads, and we have an atomic integer: in this case we can + // use the double-checked locking pattern to avoid thread synchronisation + // when accessing values already in the cache. + // + // First off handle the common case for overflow and/or asymptotic expansion: + // + if(start + n > bn.capacity()) + { + if(start < bn.capacity()) + { + out = copy_bernoulli_numbers(out, start, bn.capacity() - start, pol); + n -= bn.capacity() - start; + start = static_cast<std::size_t>(bn.capacity()); + } + if(start < b2n_overflow_limit<T, Policy>() + 2u) + { + for(; n; ++start, --n) + { + *out = b2n_asymptotic<T, Policy>(static_cast<typename container_type::size_type>(start * 2U)); + ++out; + } + } + for(; n; ++start, --n) + { + *out = policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(start), pol); + ++out; + } + return out; + } + #if !defined(BOOST_HAS_THREADS) + // + // Single threaded code, very simple: + // + if(start + n >= bn.size()) + { + std::size_t new_size = (std::min)((std::max)((std::max)(start + n, std::size_t(bn.size() + 20)), std::size_t(50)), std::size_t(bn.capacity())); + tangent_numbers_series(new_size); + } + + for(std::size_t i = (std::max)(max_bernoulli_b2n<T>::value + 1, start); i < start + n; ++i) + { + *out = (i >= m_overflow_limit) ? policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol) : bn[i]; + ++out; + } + #elif defined(BOOST_MATH_NO_ATOMIC_INT) + // + // We need to grab a mutex every time we get here, for both readers and writers: + // + boost::detail::lightweight_mutex::scoped_lock l(m_mutex); + if(start + n >= bn.size()) + { + std::size_t new_size = (std::min)((std::max)((std::max)(start + n, std::size_t(bn.size() + 20)), std::size_t(50)), std::size_t(bn.capacity())); + tangent_numbers_series(new_size); + } + + for(std::size_t i = (std::max)(max_bernoulli_b2n<T>::value + 1, start); i < start + n; ++i) + { + *out = (i >= m_overflow_limit) ? policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol) : bn[i]; + ++out; + } + + #else + // + // Double-checked locking pattern, lets us access cached already cached values + // without locking: + // + // Get the counter and see if we need to calculate more constants: + // + if(static_cast<std::size_t>(m_counter.load(BOOST_MATH_ATOMIC_NS::memory_order_consume)) < start + n) + { + boost::detail::lightweight_mutex::scoped_lock l(m_mutex); + + if(static_cast<std::size_t>(m_counter.load(BOOST_MATH_ATOMIC_NS::memory_order_consume)) < start + n) + { + if(start + n >= bn.size()) + { + std::size_t new_size = (std::min)((std::max)((std::max)(start + n, std::size_t(bn.size() + 20)), std::size_t(50)), std::size_t(bn.capacity())); + tangent_numbers_series(new_size); + } + m_counter.store(static_cast<atomic_integer_type>(bn.size()), BOOST_MATH_ATOMIC_NS::memory_order_release); + } + } + + for(std::size_t i = (std::max)(static_cast<std::size_t>(max_bernoulli_b2n<T>::value + 1), start); i < start + n; ++i) + { + *out = (i >= m_overflow_limit) ? policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol) : bn[static_cast<typename container_type::size_type>(i)]; + ++out; + } + + #endif + return out; + } + + template <class OutputIterator> + OutputIterator copy_tangent_numbers(OutputIterator out, std::size_t start, std::size_t n, const Policy& pol) + { + // + // There are basically 3 thread safety options: + // + // 1) There are no threads (BOOST_HAS_THREADS is not defined). + // 2) There are threads, but we do not have a true atomic integer type, + // in this case we just use a mutex to guard against race conditions. + // 3) There are threads, and we have an atomic integer: in this case we can + // use the double-checked locking pattern to avoid thread synchronisation + // when accessing values already in the cache. + // + // + // First off handle the common case for overflow and/or asymptotic expansion: + // + if(start + n > bn.capacity()) + { + if(start < bn.capacity()) + { + out = copy_tangent_numbers(out, start, bn.capacity() - start, pol); + n -= bn.capacity() - start; + start = static_cast<std::size_t>(bn.capacity()); + } + if(start < b2n_overflow_limit<T, Policy>() + 2u) + { + for(; n; ++start, --n) + { + *out = t2n_asymptotic<T, Policy>(static_cast<typename container_type::size_type>(start)); + ++out; + } + } + for(; n; ++start, --n) + { + *out = policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(start), pol); + ++out; + } + return out; + } + #if !defined(BOOST_HAS_THREADS) + // + // Single threaded code, very simple: + // + if(start + n >= bn.size()) + { + std::size_t new_size = (std::min)((std::max)((std::max)(start + n, std::size_t(bn.size() + 20)), std::size_t(50)), std::size_t(bn.capacity())); + tangent_numbers_series(new_size); + } + + for(std::size_t i = start; i < start + n; ++i) + { + if(i >= m_overflow_limit) + *out = policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol); + else + { + if(tools::max_value<T>() * tangent_scale_factor<T>() < tn[static_cast<typename container_type::size_type>(i)]) + *out = policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol); + else + *out = tn[static_cast<typename container_type::size_type>(i)] / tangent_scale_factor<T>(); + } + ++out; + } + #elif defined(BOOST_MATH_NO_ATOMIC_INT) + // + // We need to grab a mutex every time we get here, for both readers and writers: + // + boost::detail::lightweight_mutex::scoped_lock l(m_mutex); + if(start + n >= bn.size()) + { + std::size_t new_size = (std::min)((std::max)((std::max)(start + n, std::size_t(bn.size() + 20)), std::size_t(50)), std::size_t(bn.capacity())); + tangent_numbers_series(new_size); + } + + for(std::size_t i = start; i < start + n; ++i) + { + if(i >= m_overflow_limit) + *out = policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol); + else + { + if(tools::max_value<T>() * tangent_scale_factor<T>() < tn[static_cast<typename container_type::size_type>(i)]) + *out = policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol); + else + *out = tn[static_cast<typename container_type::size_type>(i)] / tangent_scale_factor<T>(); + } + ++out; + } + + #else + // + // Double-checked locking pattern, lets us access cached already cached values + // without locking: + // + // Get the counter and see if we need to calculate more constants: + // + if(static_cast<std::size_t>(m_counter.load(BOOST_MATH_ATOMIC_NS::memory_order_consume)) < start + n) + { + boost::detail::lightweight_mutex::scoped_lock l(m_mutex); + + if(static_cast<std::size_t>(m_counter.load(BOOST_MATH_ATOMIC_NS::memory_order_consume)) < start + n) + { + if(start + n >= bn.size()) + { + std::size_t new_size = (std::min)((std::max)((std::max)(start + n, std::size_t(bn.size() + 20)), std::size_t(50)), std::size_t(bn.capacity())); + tangent_numbers_series(new_size); + } + m_counter.store(static_cast<atomic_integer_type>(bn.size()), BOOST_MATH_ATOMIC_NS::memory_order_release); + } + } + + for(std::size_t i = start; i < start + n; ++i) + { + if(i >= m_overflow_limit) + *out = policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol); + else + { + if(tools::max_value<T>() * tangent_scale_factor<T>() < tn[static_cast<typename container_type::size_type>(i)]) + *out = policies::raise_overflow_error<T>("boost::math::bernoulli_b2n<%1%>(std::size_t)", 0, T(i), pol); + else + *out = tn[static_cast<typename container_type::size_type>(i)] / tangent_scale_factor<T>(); + } + ++out; + } + + #endif + return out; + } + +private: + // + // The caches for Bernoulli and tangent numbers, once allocated, + // these must NEVER EVER reallocate as it breaks our thread + // safety guarentees: + // + fixed_vector<T> bn, tn; + std::vector<T> m_intermediates; + // The value at which we know overflow has already occured for the Bn: + std::size_t m_overflow_limit; +#if !defined(BOOST_HAS_THREADS) +#elif defined(BOOST_MATH_NO_ATOMIC_INT) + boost::detail::lightweight_mutex m_mutex; +#else + boost::detail::lightweight_mutex m_mutex; + atomic_counter_type m_counter; +#endif +}; + +template <class T, class Policy> +inline bernoulli_numbers_cache<T, Policy>& get_bernoulli_numbers_cache() +{ + // + // Force this function to be called at program startup so all the static variables + // get initailzed then (thread safety). + // + bernoulli_initializer<T, Policy>::force_instantiate(); + static bernoulli_numbers_cache<T, Policy> data; + return data; +} + +}}} + +#endif // BOOST_MATH_BERNOULLI_DETAIL_HPP diff --git a/boost/math/special_functions/detail/bessel_derivatives_linear.hpp b/boost/math/special_functions/detail/bessel_derivatives_linear.hpp new file mode 100644 index 0000000000..2ee86a03ee --- /dev/null +++ b/boost/math/special_functions/detail/bessel_derivatives_linear.hpp @@ -0,0 +1,75 @@ +// Copyright (c) 2013 Anton Bikineev +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) + +// +// This is a partial header, do not include on it's own!!! +// +// Linear combination for bessel derivatives are defined here +#ifndef BOOST_MATH_SF_DETAIL_BESSEL_DERIVATIVES_LINEAR_HPP +#define BOOST_MATH_SF_DETAIL_BESSEL_DERIVATIVES_LINEAR_HPP + +#ifdef _MSC_VER +#pragma once +#endif + +namespace boost{ namespace math{ namespace detail{ + +template <class T, class Tag, class Policy> +inline T bessel_j_derivative_linear(T v, T x, Tag tag, Policy pol) +{ + return (boost::math::detail::cyl_bessel_j_imp<T>(v-1, x, tag, pol) - boost::math::detail::cyl_bessel_j_imp<T>(v+1, x, tag, pol)) / 2; +} + +template <class T, class Policy> +inline T bessel_j_derivative_linear(T v, T x, const bessel_int_tag& tag, Policy pol) +{ + return (boost::math::detail::cyl_bessel_j_imp<T>(itrunc(v-1), x, tag, pol) - boost::math::detail::cyl_bessel_j_imp<T>(itrunc(v+1), x, tag, pol)) / 2; +} + +template <class T, class Policy> +inline T sph_bessel_j_derivative_linear(unsigned v, T x, Policy pol) +{ + return (v / x) * boost::math::detail::sph_bessel_j_imp<T>(v, x, pol) - boost::math::detail::sph_bessel_j_imp<T>(v+1, x, pol); +} + +template <class T, class Policy> +inline T bessel_i_derivative_linear(T v, T x, Policy pol) +{ + return (boost::math::detail::cyl_bessel_i_imp<T>(v-1, x, pol) + boost::math::detail::cyl_bessel_i_imp<T>(v+1, x, pol)) / 2; +} + +template <class T, class Tag, class Policy> +inline T bessel_k_derivative_linear(T v, T x, Tag tag, Policy pol) +{ + return (boost::math::detail::cyl_bessel_k_imp<T>(v-1, x, tag, pol) + boost::math::detail::cyl_bessel_k_imp<T>(v+1, x, tag, pol)) / -2; +} + +template <class T, class Policy> +inline T bessel_k_derivative_linear(T v, T x, const bessel_int_tag& tag, Policy pol) +{ + return (boost::math::detail::cyl_bessel_k_imp<T>(itrunc(v-1), x, tag, pol) + boost::math::detail::cyl_bessel_k_imp<T>(itrunc(v+1), x, tag, pol)) / -2; +} + +template <class T, class Tag, class Policy> +inline T bessel_y_derivative_linear(T v, T x, Tag tag, Policy pol) +{ + return (boost::math::detail::cyl_neumann_imp<T>(v-1, x, tag, pol) - boost::math::detail::cyl_neumann_imp<T>(v+1, x, tag, pol)) / 2; +} + +template <class T, class Policy> +inline T bessel_y_derivative_linear(T v, T x, const bessel_int_tag& tag, Policy pol) +{ + return (boost::math::detail::cyl_neumann_imp<T>(itrunc(v-1), x, tag, pol) - boost::math::detail::cyl_neumann_imp<T>(itrunc(v+1), x, tag, pol)) / 2; +} + +template <class T, class Policy> +inline T sph_neumann_derivative_linear(unsigned v, T x, Policy pol) +{ + return (v / x) * boost::math::detail::sph_neumann_imp<T>(v, x, pol) - boost::math::detail::sph_neumann_imp<T>(v+1, x, pol); +} + +}}} // namespaces + +#endif // BOOST_MATH_SF_DETAIL_BESSEL_DERIVATIVES_LINEAR_HPP diff --git a/boost/math/special_functions/detail/bessel_i0.hpp b/boost/math/special_functions/detail/bessel_i0.hpp index 7dc65d1a1b..676eb71511 100644 --- a/boost/math/special_functions/detail/bessel_i0.hpp +++ b/boost/math/special_functions/detail/bessel_i0.hpp @@ -102,10 +102,7 @@ T bessel_i0(T x) BOOST_MATH_STD_USING using namespace boost::math::tools; - if (x < 0) - { - x = -x; // even function - } + BOOST_ASSERT(x >= 0); // negative x is handled before we get here if (x == 0) { return static_cast<T>(1); diff --git a/boost/math/special_functions/detail/bessel_i1.hpp b/boost/math/special_functions/detail/bessel_i1.hpp index 47f1b79883..b85bc67546 100644 --- a/boost/math/special_functions/detail/bessel_i1.hpp +++ b/boost/math/special_functions/detail/bessel_i1.hpp @@ -103,6 +103,7 @@ T bessel_i1(T x) BOOST_MATH_STD_USING using namespace boost::math::tools; + BOOST_ASSERT(x >= 0); // negative x is handled before we get here w = abs(x); if (x == 0) { @@ -123,10 +124,6 @@ T bessel_i1(T x) value = factor * r; } - if (x < 0) - { - value *= -value; // odd function - } return value; } diff --git a/boost/math/special_functions/detail/bessel_ik.hpp b/boost/math/special_functions/detail/bessel_ik.hpp index a589673ffb..10118d9715 100644 --- a/boost/math/special_functions/detail/bessel_ik.hpp +++ b/boost/math/special_functions/detail/bessel_ik.hpp @@ -234,6 +234,7 @@ int CF2_ik(T v, T x, T* Kv, T* Kv1, const Policy& pol) BOOST_MATH_INSTRUMENT_VARIABLE(b); BOOST_MATH_INSTRUMENT_VARIABLE(D); BOOST_MATH_INSTRUMENT_VARIABLE(f); + for (k = 2; k < policies::get_max_series_iterations<Policy>(); k++) // starting from 2 { // continued fraction f = z1 / z0 @@ -250,10 +251,27 @@ int CF2_ik(T v, T x, T* Kv, T* Kv1, const Policy& pol) C *= -a / k; Q += C * q; S += Q * delta; + // + // Under some circumstances q can grow very small and C very + // large, leading to under/overflow. This is particularly an + // issue for types which have many digits precision but a narrow + // exponent range. A typical example being a "double double" type. + // To avoid this situation we can normalise q (and related prev/current) + // and C. All other variables remain unchanged in value. A typical + // test case occurs when x is close to 2, for example cyl_bessel_k(9.125, 2.125). + // + if(q < tools::epsilon<T>()) + { + C *= q; + prev /= q; + current /= q; + q = 1; + } // S converges slower than f BOOST_MATH_INSTRUMENT_VARIABLE(Q * delta); BOOST_MATH_INSTRUMENT_VARIABLE(abs(S) * tolerance); + BOOST_MATH_INSTRUMENT_VARIABLE(S); if (abs(Q * delta) < abs(S) * tolerance) { break; @@ -261,7 +279,10 @@ int CF2_ik(T v, T x, T* Kv, T* Kv1, const Policy& pol) } policies::check_series_iterations<T>("boost::math::bessel_ik<%1%>(%1%,%1%) in CF2_ik", k, pol); - *Kv = sqrt(pi<T>() / (2 * x)) * exp(-x) / S; + if(x >= tools::log_max_value<T>()) + *Kv = exp(0.5f * log(pi<T>() / (2 * x)) - x - log(S)); + else + *Kv = sqrt(pi<T>() / (2 * x)) * exp(-x) / S; *Kv1 = *Kv * (0.5f + v + x + (v * v - 0.25f) * f) / x; BOOST_MATH_INSTRUMENT_VARIABLE(*Kv); BOOST_MATH_INSTRUMENT_VARIABLE(*Kv1); diff --git a/boost/math/special_functions/detail/bessel_j0.hpp b/boost/math/special_functions/detail/bessel_j0.hpp index a07052d73e..ebcab17240 100644 --- a/boost/math/special_functions/detail/bessel_j0.hpp +++ b/boost/math/special_functions/detail/bessel_j0.hpp @@ -165,13 +165,23 @@ T bessel_j0(T x) { T y = 8 / x; T y2 = y * y; - T z = x - 0.25f * pi<T>(); BOOST_ASSERT(sizeof(PC) == sizeof(QC)); BOOST_ASSERT(sizeof(PS) == sizeof(QS)); rc = evaluate_rational(PC, QC, y2); rs = evaluate_rational(PS, QS, y2); - factor = sqrt(2 / (x * pi<T>())); - value = factor * (rc * cos(z) - y * rs * sin(z)); + factor = constants::one_div_root_pi<T>() / sqrt(x); + // + // What follows is really just: + // + // T z = x - pi/4; + // value = factor * (rc * cos(z) - y * rs * sin(z)); + // + // But using the addition formulae for sin and cos, plus + // the special values for sin/cos of pi/4. + // + T sx = sin(x); + T cx = cos(x); + value = factor * (rc * (cx + sx) - y * rs * (sx - cx)); } return value; diff --git a/boost/math/special_functions/detail/bessel_j1.hpp b/boost/math/special_functions/detail/bessel_j1.hpp index 09d862c240..91ecd2832d 100644 --- a/boost/math/special_functions/detail/bessel_j1.hpp +++ b/boost/math/special_functions/detail/bessel_j1.hpp @@ -166,13 +166,24 @@ T bessel_j1(T x) { T y = 8 / w; T y2 = y * y; - T z = w - 0.75f * pi<T>(); BOOST_ASSERT(sizeof(PC) == sizeof(QC)); BOOST_ASSERT(sizeof(PS) == sizeof(QS)); rc = evaluate_rational(PC, QC, y2); rs = evaluate_rational(PS, QS, y2); - factor = sqrt(2 / (w * pi<T>())); - value = factor * (rc * cos(z) - y * rs * sin(z)); + factor = 1 / (sqrt(w) * constants::root_pi<T>()); + // + // What follows is really just: + // + // T z = w - 0.75f * pi<T>(); + // value = factor * (rc * cos(z) - y * rs * sin(z)); + // + // but using the sin/cos addition rules plus constants + // for the values of sin/cos of 3PI/4 which then cancel + // out with corresponding terms in "factor". + // + T sx = sin(x); + T cx = cos(x); + value = factor * (rc * (sx - cx) + y * rs * (sx + cx)); } if (x < 0) diff --git a/boost/math/special_functions/detail/bessel_jn.hpp b/boost/math/special_functions/detail/bessel_jn.hpp index 2bf8d78b74..3f15f9cd87 100644 --- a/boost/math/special_functions/detail/bessel_jn.hpp +++ b/boost/math/special_functions/detail/bessel_jn.hpp @@ -42,6 +42,11 @@ T bessel_jn(int n, T x, const Policy& pol) { factor = 1; } + if(x < 0) + { + factor *= (n & 0x1) ? -1 : 1; // J_{n}(-z) = (-1)^n J_n(z) + x = -x; + } // // Special cases: // @@ -59,8 +64,7 @@ T bessel_jn(int n, T x, const Policy& pol) return static_cast<T>(0); } - typedef typename bessel_asymptotic_tag<T, Policy>::type tag_type; - if(fabs(x) > asymptotic_bessel_j_limit<T>(n, tag_type())) + if(asymptotic_bessel_large_x_limit(T(n), x)) return factor * asymptotic_bessel_j_large_x_2<T>(n, x); BOOST_ASSERT(n > 1); @@ -69,6 +73,7 @@ T bessel_jn(int n, T x, const Policy& pol) { prev = bessel_j0(x); current = bessel_j1(x); + policies::check_series_iterations<T>("boost::math::bessel_j_n<%1%>(%1%,%1%)", n, pol); for (int k = 1; k < n; k++) { T fact = 2 * k / x; @@ -86,7 +91,7 @@ T bessel_jn(int n, T x, const Policy& pol) current = value; } } - else if(x < 1) + else if((x < 1) || (n > x * x / 4) || (x < 5)) { return factor * bessel_j_small_z_series(T(n), x, pol); } @@ -97,6 +102,8 @@ T bessel_jn(int n, T x, const Policy& pol) boost::math::detail::CF1_jy(static_cast<T>(n), x, &fn, &s, pol); prev = fn; current = 1; + // Check recursion won't go on too far: + policies::check_series_iterations<T>("boost::math::bessel_j_n<%1%>(%1%,%1%)", n, pol); for (int k = n; k > 0; k--) { T fact = 2 * k / x; diff --git a/boost/math/special_functions/detail/bessel_jy.hpp b/boost/math/special_functions/detail/bessel_jy.hpp index d60dda2d41..b67d989b68 100644 --- a/boost/math/special_functions/detail/bessel_jy.hpp +++ b/boost/math/special_functions/detail/bessel_jy.hpp @@ -28,440 +28,464 @@ namespace boost { namespace math { -namespace detail { - -// -// Simultaneous calculation of A&S 9.2.9 and 9.2.10 -// for use in A&S 9.2.5 and 9.2.6. -// This series is quick to evaluate, but divergent unless -// x is very large, in fact it's pretty hard to figure out -// with any degree of precision when this series actually -// *will* converge!! Consequently, we may just have to -// try it and see... -// -template <class T, class Policy> -bool hankel_PQ(T v, T x, T* p, T* q, const Policy& ) -{ - BOOST_MATH_STD_USING - T tolerance = 2 * policies::get_epsilon<T, Policy>(); - *p = 1; - *q = 0; - T k = 1; - T z8 = 8 * x; - T sq = 1; - T mu = 4 * v * v; - T term = 1; - bool ok = true; - do - { - term *= (mu - sq * sq) / (k * z8); - *q += term; - k += 1; - sq += 2; - T mult = (sq * sq - mu) / (k * z8); - ok = fabs(mult) < 0.5f; - term *= mult; - *p += term; - k += 1; - sq += 2; - } - while((fabs(term) > tolerance * *p) && ok); - return ok; -} - -// Calculate Y(v, x) and Y(v+1, x) by Temme's method, see -// Temme, Journal of Computational Physics, vol 21, 343 (1976) -template <typename T, typename Policy> -int temme_jy(T v, T x, T* Y, T* Y1, const Policy& pol) -{ - T g, h, p, q, f, coef, sum, sum1, tolerance; - T a, d, e, sigma; - unsigned long k; - - BOOST_MATH_STD_USING - using namespace boost::math::tools; - using namespace boost::math::constants; - - BOOST_ASSERT(fabs(v) <= 0.5f); // precondition for using this routine - - T gp = boost::math::tgamma1pm1(v, pol); - T gm = boost::math::tgamma1pm1(-v, pol); - T spv = boost::math::sin_pi(v, pol); - T spv2 = boost::math::sin_pi(v/2, pol); - T xp = pow(x/2, v); - - a = log(x / 2); - sigma = -a * v; - d = abs(sigma) < tools::epsilon<T>() ? - T(1) : sinh(sigma) / sigma; - e = abs(v) < tools::epsilon<T>() ? T(v*pi<T>()*pi<T>() / 2) - : T(2 * spv2 * spv2 / v); - - T g1 = (v == 0) ? T(-euler<T>()) : T((gp - gm) / ((1 + gp) * (1 + gm) * 2 * v)); - T g2 = (2 + gp + gm) / ((1 + gp) * (1 + gm) * 2); - T vspv = (fabs(v) < tools::epsilon<T>()) ? T(1/constants::pi<T>()) : T(v / spv); - f = (g1 * cosh(sigma) - g2 * a * d) * 2 * vspv; - - p = vspv / (xp * (1 + gm)); - q = vspv * xp / (1 + gp); - - g = f + e * q; - h = p; - coef = 1; - sum = coef * g; - sum1 = coef * h; - - T v2 = v * v; - T coef_mult = -x * x / 4; - - // series summation - tolerance = policies::get_epsilon<T, Policy>(); - for (k = 1; k < policies::get_max_series_iterations<Policy>(); k++) - { - f = (k * f + p + q) / (k*k - v2); - p /= k - v; - q /= k + v; - g = f + e * q; - h = p - k * g; - coef *= coef_mult / k; - sum += coef * g; - sum1 += coef * h; - if (abs(coef * g) < abs(sum) * tolerance) - { - break; - } - } - policies::check_series_iterations<T>("boost::math::bessel_jy<%1%>(%1%,%1%) in temme_jy", k, pol); - *Y = -sum; - *Y1 = -2 * sum1 / x; - - return 0; -} - -// Evaluate continued fraction fv = J_(v+1) / J_v, see -// Abramowitz and Stegun, Handbook of Mathematical Functions, 1972, 9.1.73 -template <typename T, typename Policy> -int CF1_jy(T v, T x, T* fv, int* sign, const Policy& pol) -{ - T C, D, f, a, b, delta, tiny, tolerance; - unsigned long k; - int s = 1; - - BOOST_MATH_STD_USING - - // |x| <= |v|, CF1_jy converges rapidly - // |x| > |v|, CF1_jy needs O(|x|) iterations to converge - - // modified Lentz's method, see - // Lentz, Applied Optics, vol 15, 668 (1976) - tolerance = 2 * policies::get_epsilon<T, Policy>();; - tiny = sqrt(tools::min_value<T>()); - C = f = tiny; // b0 = 0, replace with tiny - D = 0; - for (k = 1; k < policies::get_max_series_iterations<Policy>() * 100; k++) - { - a = -1; - b = 2 * (v + k) / x; - C = b + a / C; - D = b + a * D; - if (C == 0) { C = tiny; } - if (D == 0) { D = tiny; } - D = 1 / D; - delta = C * D; - f *= delta; - if (D < 0) { s = -s; } - if (abs(delta - 1) < tolerance) - { break; } - } - policies::check_series_iterations<T>("boost::math::bessel_jy<%1%>(%1%,%1%) in CF1_jy", k / 100, pol); - *fv = -f; - *sign = s; // sign of denominator - - return 0; -} -// -// This algorithm was originally written by Xiaogang Zhang -// using std::complex to perform the complex arithmetic. -// However, that turns out to 10x or more slower than using -// all real-valued arithmetic, so it's been rewritten using -// real values only. -// -template <typename T, typename Policy> -int CF2_jy(T v, T x, T* p, T* q, const Policy& pol) -{ - BOOST_MATH_STD_USING - - T Cr, Ci, Dr, Di, fr, fi, a, br, bi, delta_r, delta_i, temp; - T tiny; - unsigned long k; - - // |x| >= |v|, CF2_jy converges rapidly - // |x| -> 0, CF2_jy fails to converge - BOOST_ASSERT(fabs(x) > 1); - - // modified Lentz's method, complex numbers involved, see - // Lentz, Applied Optics, vol 15, 668 (1976) - T tolerance = 2 * policies::get_epsilon<T, Policy>(); - tiny = sqrt(tools::min_value<T>()); - Cr = fr = -0.5f / x; - Ci = fi = 1; - //Dr = Di = 0; - T v2 = v * v; - a = (0.25f - v2) / x; // Note complex this one time only! - br = 2 * x; - bi = 2; - temp = Cr * Cr + 1; - Ci = bi + a * Cr / temp; - Cr = br + a / temp; - Dr = br; - Di = bi; - if (fabs(Cr) + fabs(Ci) < tiny) { Cr = tiny; } - if (fabs(Dr) + fabs(Di) < tiny) { Dr = tiny; } - temp = Dr * Dr + Di * Di; - Dr = Dr / temp; - Di = -Di / temp; - delta_r = Cr * Dr - Ci * Di; - delta_i = Ci * Dr + Cr * Di; - temp = fr; - fr = temp * delta_r - fi * delta_i; - fi = temp * delta_i + fi * delta_r; - for (k = 2; k < policies::get_max_series_iterations<Policy>(); k++) - { - a = k - 0.5f; - a *= a; - a -= v2; - bi += 2; - temp = Cr * Cr + Ci * Ci; - Cr = br + a * Cr / temp; - Ci = bi - a * Ci / temp; - Dr = br + a * Dr; - Di = bi + a * Di; - if (fabs(Cr) + fabs(Ci) < tiny) { Cr = tiny; } - if (fabs(Dr) + fabs(Di) < tiny) { Dr = tiny; } - temp = Dr * Dr + Di * Di; - Dr = Dr / temp; - Di = -Di / temp; - delta_r = Cr * Dr - Ci * Di; - delta_i = Ci * Dr + Cr * Di; - temp = fr; - fr = temp * delta_r - fi * delta_i; - fi = temp * delta_i + fi * delta_r; - if (fabs(delta_r - 1) + fabs(delta_i) < tolerance) - break; - } - policies::check_series_iterations<T>("boost::math::bessel_jy<%1%>(%1%,%1%) in CF2_jy", k, pol); - *p = fr; - *q = fi; - - return 0; -} - -enum -{ - need_j = 1, need_y = 2 -}; - -// Compute J(v, x) and Y(v, x) simultaneously by Steed's method, see -// Barnett et al, Computer Physics Communications, vol 8, 377 (1974) -template <typename T, typename Policy> -int bessel_jy(T v, T x, T* J, T* Y, int kind, const Policy& pol) -{ - BOOST_ASSERT(x >= 0); - - T u, Jv, Ju, Yv, Yv1, Yu, Yu1(0), fv, fu; - T W, p, q, gamma, current, prev, next; - bool reflect = false; - unsigned n, k; - int s; - int org_kind = kind; - T cp = 0; - T sp = 0; - - static const char* function = "boost::math::bessel_jy<%1%>(%1%,%1%)"; - - BOOST_MATH_STD_USING - using namespace boost::math::tools; - using namespace boost::math::constants; - - if (v < 0) - { - reflect = true; - v = -v; // v is non-negative from here - kind = need_j|need_y; // need both for reflection formula - } - n = iround(v, pol); - u = v - n; // -1/2 <= u < 1/2 - - if(reflect) - { - T z = (u + n % 2); - cp = boost::math::cos_pi(z, pol); - sp = boost::math::sin_pi(z, pol); - } - - if (x == 0) - { - *J = *Y = policies::raise_overflow_error<T>( - function, 0, pol); - return 1; - } - - // x is positive until reflection - W = T(2) / (x * pi<T>()); // Wronskian - T Yv_scale = 1; - if((x > 8) && (x < 1000) && hankel_PQ(v, x, &p, &q, pol)) - { - // - // Hankel approximation: note that this method works best when x - // is large, but in that case we end up calculating sines and cosines - // of large values, with horrendous resulting accuracy. It is fast though - // when it works.... - // - T chi = x - fmod(T(v / 2 + 0.25f), T(2)) * boost::math::constants::pi<T>(); - T sc = sin(chi); - T cc = cos(chi); - chi = sqrt(2 / (boost::math::constants::pi<T>() * x)); - Yv = chi * (p * sc + q * cc); - Jv = chi * (p * cc - q * sc); - } - else if((x < 1) && (u != 0) && (log(policies::get_epsilon<T, Policy>() / 2) > v * log((x/2) * (x/2) / v))) - { - // Evaluate using series representations. - // This is particularly important for x << v as in this - // area temme_jy may be slow to converge, if it converges at all. - // Requires x is not an integer. - if(kind&need_j) - Jv = bessel_j_small_z_series(v, x, pol); - else - Jv = std::numeric_limits<T>::quiet_NaN(); - if((org_kind&need_y && (!reflect || (cp != 0))) - || (org_kind & need_j && (reflect && (sp != 0)))) - { - // Only calculate if we need it, and if the reflection formula will actually use it: - Yv = bessel_y_small_z_series(v, x, &Yv_scale, pol); - } - else - Yv = std::numeric_limits<T>::quiet_NaN(); - } - else if((u == 0) && (x < policies::get_epsilon<T, Policy>())) - { - // Truncated series evaluation for small x and v an integer, - // much quicker in this area than temme_jy below. - if(kind&need_j) - Jv = bessel_j_small_z_series(v, x, pol); - else - Jv = std::numeric_limits<T>::quiet_NaN(); - if((org_kind&need_y && (!reflect || (cp != 0))) - || (org_kind & need_j && (reflect && (sp != 0)))) - { - // Only calculate if we need it, and if the reflection formula will actually use it: - Yv = bessel_yn_small_z(n, x, &Yv_scale, pol); - } - else - Yv = std::numeric_limits<T>::quiet_NaN(); - } - else if (x <= 2) // x in (0, 2] - { - if(temme_jy(u, x, &Yu, &Yu1, pol)) // Temme series - { - // domain error: - *J = *Y = Yu; - return 1; - } - prev = Yu; - current = Yu1; - T scale = 1; - for (k = 1; k <= n; k++) // forward recurrence for Y - { - T fact = 2 * (u + k) / x; - if((tools::max_value<T>() - fabs(prev)) / fact < fabs(current)) + namespace detail { + + // + // Simultaneous calculation of A&S 9.2.9 and 9.2.10 + // for use in A&S 9.2.5 and 9.2.6. + // This series is quick to evaluate, but divergent unless + // x is very large, in fact it's pretty hard to figure out + // with any degree of precision when this series actually + // *will* converge!! Consequently, we may just have to + // try it and see... + // + template <class T, class Policy> + bool hankel_PQ(T v, T x, T* p, T* q, const Policy& ) + { + BOOST_MATH_STD_USING + T tolerance = 2 * policies::get_epsilon<T, Policy>(); + *p = 1; + *q = 0; + T k = 1; + T z8 = 8 * x; + T sq = 1; + T mu = 4 * v * v; + T term = 1; + bool ok = true; + do + { + term *= (mu - sq * sq) / (k * z8); + *q += term; + k += 1; + sq += 2; + T mult = (sq * sq - mu) / (k * z8); + ok = fabs(mult) < 0.5f; + term *= mult; + *p += term; + k += 1; + sq += 2; + } + while((fabs(term) > tolerance * *p) && ok); + return ok; + } + + // Calculate Y(v, x) and Y(v+1, x) by Temme's method, see + // Temme, Journal of Computational Physics, vol 21, 343 (1976) + template <typename T, typename Policy> + int temme_jy(T v, T x, T* Y, T* Y1, const Policy& pol) + { + T g, h, p, q, f, coef, sum, sum1, tolerance; + T a, d, e, sigma; + unsigned long k; + + BOOST_MATH_STD_USING + using namespace boost::math::tools; + using namespace boost::math::constants; + + BOOST_ASSERT(fabs(v) <= 0.5f); // precondition for using this routine + + T gp = boost::math::tgamma1pm1(v, pol); + T gm = boost::math::tgamma1pm1(-v, pol); + T spv = boost::math::sin_pi(v, pol); + T spv2 = boost::math::sin_pi(v/2, pol); + T xp = pow(x/2, v); + + a = log(x / 2); + sigma = -a * v; + d = abs(sigma) < tools::epsilon<T>() ? + T(1) : sinh(sigma) / sigma; + e = abs(v) < tools::epsilon<T>() ? T(v*pi<T>()*pi<T>() / 2) + : T(2 * spv2 * spv2 / v); + + T g1 = (v == 0) ? T(-euler<T>()) : T((gp - gm) / ((1 + gp) * (1 + gm) * 2 * v)); + T g2 = (2 + gp + gm) / ((1 + gp) * (1 + gm) * 2); + T vspv = (fabs(v) < tools::epsilon<T>()) ? T(1/constants::pi<T>()) : T(v / spv); + f = (g1 * cosh(sigma) - g2 * a * d) * 2 * vspv; + + p = vspv / (xp * (1 + gm)); + q = vspv * xp / (1 + gp); + + g = f + e * q; + h = p; + coef = 1; + sum = coef * g; + sum1 = coef * h; + + T v2 = v * v; + T coef_mult = -x * x / 4; + + // series summation + tolerance = policies::get_epsilon<T, Policy>(); + for (k = 1; k < policies::get_max_series_iterations<Policy>(); k++) + { + f = (k * f + p + q) / (k*k - v2); + p /= k - v; + q /= k + v; + g = f + e * q; + h = p - k * g; + coef *= coef_mult / k; + sum += coef * g; + sum1 += coef * h; + if (abs(coef * g) < abs(sum) * tolerance) + { + break; + } + } + policies::check_series_iterations<T>("boost::math::bessel_jy<%1%>(%1%,%1%) in temme_jy", k, pol); + *Y = -sum; + *Y1 = -2 * sum1 / x; + + return 0; + } + + // Evaluate continued fraction fv = J_(v+1) / J_v, see + // Abramowitz and Stegun, Handbook of Mathematical Functions, 1972, 9.1.73 + template <typename T, typename Policy> + int CF1_jy(T v, T x, T* fv, int* sign, const Policy& pol) + { + T C, D, f, a, b, delta, tiny, tolerance; + unsigned long k; + int s = 1; + + BOOST_MATH_STD_USING + + // |x| <= |v|, CF1_jy converges rapidly + // |x| > |v|, CF1_jy needs O(|x|) iterations to converge + + // modified Lentz's method, see + // Lentz, Applied Optics, vol 15, 668 (1976) + tolerance = 2 * policies::get_epsilon<T, Policy>();; + tiny = sqrt(tools::min_value<T>()); + C = f = tiny; // b0 = 0, replace with tiny + D = 0; + for (k = 1; k < policies::get_max_series_iterations<Policy>() * 100; k++) + { + a = -1; + b = 2 * (v + k) / x; + C = b + a / C; + D = b + a * D; + if (C == 0) { C = tiny; } + if (D == 0) { D = tiny; } + D = 1 / D; + delta = C * D; + f *= delta; + if (D < 0) { s = -s; } + if (abs(delta - 1) < tolerance) + { break; } + } + policies::check_series_iterations<T>("boost::math::bessel_jy<%1%>(%1%,%1%) in CF1_jy", k / 100, pol); + *fv = -f; + *sign = s; // sign of denominator + + return 0; + } + // + // This algorithm was originally written by Xiaogang Zhang + // using std::complex to perform the complex arithmetic. + // However, that turns out to 10x or more slower than using + // all real-valued arithmetic, so it's been rewritten using + // real values only. + // + template <typename T, typename Policy> + int CF2_jy(T v, T x, T* p, T* q, const Policy& pol) + { + BOOST_MATH_STD_USING + + T Cr, Ci, Dr, Di, fr, fi, a, br, bi, delta_r, delta_i, temp; + T tiny; + unsigned long k; + + // |x| >= |v|, CF2_jy converges rapidly + // |x| -> 0, CF2_jy fails to converge + BOOST_ASSERT(fabs(x) > 1); + + // modified Lentz's method, complex numbers involved, see + // Lentz, Applied Optics, vol 15, 668 (1976) + T tolerance = 2 * policies::get_epsilon<T, Policy>(); + tiny = sqrt(tools::min_value<T>()); + Cr = fr = -0.5f / x; + Ci = fi = 1; + //Dr = Di = 0; + T v2 = v * v; + a = (0.25f - v2) / x; // Note complex this one time only! + br = 2 * x; + bi = 2; + temp = Cr * Cr + 1; + Ci = bi + a * Cr / temp; + Cr = br + a / temp; + Dr = br; + Di = bi; + if (fabs(Cr) + fabs(Ci) < tiny) { Cr = tiny; } + if (fabs(Dr) + fabs(Di) < tiny) { Dr = tiny; } + temp = Dr * Dr + Di * Di; + Dr = Dr / temp; + Di = -Di / temp; + delta_r = Cr * Dr - Ci * Di; + delta_i = Ci * Dr + Cr * Di; + temp = fr; + fr = temp * delta_r - fi * delta_i; + fi = temp * delta_i + fi * delta_r; + for (k = 2; k < policies::get_max_series_iterations<Policy>(); k++) + { + a = k - 0.5f; + a *= a; + a -= v2; + bi += 2; + temp = Cr * Cr + Ci * Ci; + Cr = br + a * Cr / temp; + Ci = bi - a * Ci / temp; + Dr = br + a * Dr; + Di = bi + a * Di; + if (fabs(Cr) + fabs(Ci) < tiny) { Cr = tiny; } + if (fabs(Dr) + fabs(Di) < tiny) { Dr = tiny; } + temp = Dr * Dr + Di * Di; + Dr = Dr / temp; + Di = -Di / temp; + delta_r = Cr * Dr - Ci * Di; + delta_i = Ci * Dr + Cr * Di; + temp = fr; + fr = temp * delta_r - fi * delta_i; + fi = temp * delta_i + fi * delta_r; + if (fabs(delta_r - 1) + fabs(delta_i) < tolerance) + break; + } + policies::check_series_iterations<T>("boost::math::bessel_jy<%1%>(%1%,%1%) in CF2_jy", k, pol); + *p = fr; + *q = fi; + + return 0; + } + + static const int need_j = 1; + static const int need_y = 2; + + // Compute J(v, x) and Y(v, x) simultaneously by Steed's method, see + // Barnett et al, Computer Physics Communications, vol 8, 377 (1974) + template <typename T, typename Policy> + int bessel_jy(T v, T x, T* J, T* Y, int kind, const Policy& pol) + { + BOOST_ASSERT(x >= 0); + + T u, Jv, Ju, Yv, Yv1, Yu, Yu1(0), fv, fu; + T W, p, q, gamma, current, prev, next; + bool reflect = false; + unsigned n, k; + int s; + int org_kind = kind; + T cp = 0; + T sp = 0; + + static const char* function = "boost::math::bessel_jy<%1%>(%1%,%1%)"; + + BOOST_MATH_STD_USING + using namespace boost::math::tools; + using namespace boost::math::constants; + + if (v < 0) + { + reflect = true; + v = -v; // v is non-negative from here + } + if (v > static_cast<T>((std::numeric_limits<int>::max)())) + { + *J = *Y = policies::raise_evaluation_error<T>(function, "Order of Bessel function is too large to evaluate: got %1%", v, pol); + return 1; + } + n = iround(v, pol); + u = v - n; // -1/2 <= u < 1/2 + + if(reflect) + { + T z = (u + n % 2); + cp = boost::math::cos_pi(z, pol); + sp = boost::math::sin_pi(z, pol); + if(u != 0) + kind = need_j|need_y; // need both for reflection formula + } + + if(x == 0) + { + if(v == 0) + *J = 1; + else if((u == 0) || !reflect) + *J = 0; + else if(kind & need_j) + *J = policies::raise_domain_error<T>(function, "Value of Bessel J_v(x) is complex-infinity at %1%", x, pol); // complex infinity + else + *J = std::numeric_limits<T>::quiet_NaN(); // any value will do, not using J. + + if((kind & need_y) == 0) + *Y = std::numeric_limits<T>::quiet_NaN(); // any value will do, not using Y. + else if(v == 0) + *Y = -policies::raise_overflow_error<T>(function, 0, pol); + else + *Y = policies::raise_domain_error<T>(function, "Value of Bessel Y_v(x) is complex-infinity at %1%", x, pol); // complex infinity + return 1; + } + + // x is positive until reflection + W = T(2) / (x * pi<T>()); // Wronskian + T Yv_scale = 1; + if(((kind & need_y) == 0) && ((x < 1) || (v > x * x / 4) || (x < 5))) + { + // + // This series will actually converge rapidly for all small + // x - say up to x < 20 - but the first few terms are large + // and divergent which leads to large errors :-( + // + Jv = bessel_j_small_z_series(v, x, pol); + Yv = std::numeric_limits<T>::quiet_NaN(); + } + else if((x < 1) && (u != 0) && (log(policies::get_epsilon<T, Policy>() / 2) > v * log((x/2) * (x/2) / v))) + { + // Evaluate using series representations. + // This is particularly important for x << v as in this + // area temme_jy may be slow to converge, if it converges at all. + // Requires x is not an integer. + if(kind&need_j) + Jv = bessel_j_small_z_series(v, x, pol); + else + Jv = std::numeric_limits<T>::quiet_NaN(); + if((org_kind&need_y && (!reflect || (cp != 0))) + || (org_kind & need_j && (reflect && (sp != 0)))) { - scale /= current; - prev /= current; - current = 1; + // Only calculate if we need it, and if the reflection formula will actually use it: + Yv = bessel_y_small_z_series(v, x, &Yv_scale, pol); } - next = fact * current - prev; - prev = current; - current = next; - } - Yv = prev; - Yv1 = current; - if(kind&need_j) + else + Yv = std::numeric_limits<T>::quiet_NaN(); + } + else if((u == 0) && (x < policies::get_epsilon<T, Policy>())) { - CF1_jy(v, x, &fv, &s, pol); // continued fraction CF1_jy - Jv = scale * W / (Yv * fv - Yv1); // Wronskian relation + // Truncated series evaluation for small x and v an integer, + // much quicker in this area than temme_jy below. + if(kind&need_j) + Jv = bessel_j_small_z_series(v, x, pol); + else + Jv = std::numeric_limits<T>::quiet_NaN(); + if((org_kind&need_y && (!reflect || (cp != 0))) + || (org_kind & need_j && (reflect && (sp != 0)))) + { + // Only calculate if we need it, and if the reflection formula will actually use it: + Yv = bessel_yn_small_z(n, x, &Yv_scale, pol); + } + else + Yv = std::numeric_limits<T>::quiet_NaN(); } - else - Jv = std::numeric_limits<T>::quiet_NaN(); // any value will do, we're not using it. - Yv_scale = scale; - } - else // x in (2, \infty) - { - // Get Y(u, x): - // define tag type that will dispatch to right limits: - typedef typename bessel_asymptotic_tag<T, Policy>::type tag_type; - - T lim, ratio; - switch(kind) - { - case need_j: - lim = asymptotic_bessel_j_limit<T>(v, tag_type()); - break; - case need_y: - lim = asymptotic_bessel_y_limit<T>(tag_type()); - break; - default: - lim = (std::max)( - asymptotic_bessel_j_limit<T>(v, tag_type()), - asymptotic_bessel_y_limit<T>(tag_type())); - break; - } - if(x > lim) - { - if(kind&need_y) - { - Yu = asymptotic_bessel_y_large_x_2(u, x); - Yu1 = asymptotic_bessel_y_large_x_2(T(u + 1), x); - } - else - Yu = std::numeric_limits<T>::quiet_NaN(); // any value will do, we're not using it. - if(kind&need_j) - { - Jv = asymptotic_bessel_j_large_x_2(v, x); - } - else - Jv = std::numeric_limits<T>::quiet_NaN(); // any value will do, we're not using it. - } - else - { - CF1_jy(v, x, &fv, &s, pol); - // tiny initial value to prevent overflow - T init = sqrt(tools::min_value<T>()); - prev = fv * s * init; - current = s * init; - if(v < max_factorial<T>::value) - { - for (k = n; k > 0; k--) // backward recurrence for J - { + else if(asymptotic_bessel_large_x_limit(v, x)) + { + if(kind&need_y) + { + Yv = asymptotic_bessel_y_large_x_2(v, x); + } + else + Yv = std::numeric_limits<T>::quiet_NaN(); // any value will do, we're not using it. + if(kind&need_j) + { + Jv = asymptotic_bessel_j_large_x_2(v, x); + } + else + Jv = std::numeric_limits<T>::quiet_NaN(); // any value will do, we're not using it. + } + else if((x > 8) && hankel_PQ(v, x, &p, &q, pol)) + { + // + // Hankel approximation: note that this method works best when x + // is large, but in that case we end up calculating sines and cosines + // of large values, with horrendous resulting accuracy. It is fast though + // when it works.... + // + // Normally we calculate sin/cos(chi) where: + // + // chi = x - fmod(T(v / 2 + 0.25f), T(2)) * boost::math::constants::pi<T>(); + // + // But this introduces large errors, so use sin/cos addition formulae to + // improve accuracy: + // + T mod_v = fmod(T(v / 2 + 0.25f), T(2)); + T sx = sin(x); + T cx = cos(x); + T sv = sin_pi(mod_v); + T cv = cos_pi(mod_v); + + T sc = sx * cv - sv * cx; // == sin(chi); + T cc = cx * cv + sx * sv; // == cos(chi); + T chi = boost::math::constants::root_two<T>() / (boost::math::constants::root_pi<T>() * sqrt(x)); //sqrt(2 / (boost::math::constants::pi<T>() * x)); + Yv = chi * (p * sc + q * cc); + Jv = chi * (p * cc - q * sc); + } + else if (x <= 2) // x in (0, 2] + { + if(temme_jy(u, x, &Yu, &Yu1, pol)) // Temme series + { + // domain error: + *J = *Y = Yu; + return 1; + } + prev = Yu; + current = Yu1; + T scale = 1; + policies::check_series_iterations<T>(function, n, pol); + for (k = 1; k <= n; k++) // forward recurrence for Y + { + T fact = 2 * (u + k) / x; + if((tools::max_value<T>() - fabs(prev)) / fact < fabs(current)) + { + scale /= current; + prev /= current; + current = 1; + } + next = fact * current - prev; + prev = current; + current = next; + } + Yv = prev; + Yv1 = current; + if(kind&need_j) + { + CF1_jy(v, x, &fv, &s, pol); // continued fraction CF1_jy + Jv = scale * W / (Yv * fv - Yv1); // Wronskian relation + } + else + Jv = std::numeric_limits<T>::quiet_NaN(); // any value will do, we're not using it. + Yv_scale = scale; + } + else // x in (2, \infty) + { + // Get Y(u, x): + + T ratio; + CF1_jy(v, x, &fv, &s, pol); + // tiny initial value to prevent overflow + T init = sqrt(tools::min_value<T>()); + BOOST_MATH_INSTRUMENT_VARIABLE(init); + prev = fv * s * init; + current = s * init; + if(v < max_factorial<T>::value) + { + policies::check_series_iterations<T>(function, n, pol); + for (k = n; k > 0; k--) // backward recurrence for J + { next = 2 * (u + k) * current / x - prev; prev = current; current = next; - } - ratio = (s * init) / current; // scaling ratio - // can also call CF1_jy() to get fu, not much difference in precision - fu = prev / current; - } - else - { - // - // When v is large we may get overflow in this calculation - // leading to NaN's and other nasty surprises: - // - bool over = false; - for (k = n; k > 0; k--) // backward recurrence for J - { + } + ratio = (s * init) / current; // scaling ratio + // can also call CF1_jy() to get fu, not much difference in precision + fu = prev / current; + } + else + { + // + // When v is large we may get overflow in this calculation + // leading to NaN's and other nasty surprises: + // + policies::check_series_iterations<T>(function, n, pol); + bool over = false; + for (k = n; k > 0; k--) // backward recurrence for J + { T t = 2 * (u + k) / x; - if(tools::max_value<T>() / t < current) + if((t > 1) && (tools::max_value<T>() / t < current)) { over = true; break; @@ -469,87 +493,95 @@ int bessel_jy(T v, T x, T* J, T* Y, int kind, const Policy& pol) next = t * current - prev; prev = current; current = next; - } - if(!over) - { - ratio = (s * init) / current; // scaling ratio - // can also call CF1_jy() to get fu, not much difference in precision - fu = prev / current; - } - else - { - ratio = 0; - fu = 1; - } - } - CF2_jy(u, x, &p, &q, pol); // continued fraction CF2_jy - T t = u / x - fu; // t = J'/J - gamma = (p - t) / q; - // - // We can't allow gamma to cancel out to zero competely as it messes up - // the subsequent logic. So pretend that one bit didn't cancel out - // and set to a suitably small value. The only test case we've been able to - // find for this, is when v = 8.5 and x = 4*PI. - // - if(gamma == 0) - { - gamma = u * tools::epsilon<T>() / x; - } - Ju = sign(current) * sqrt(W / (q + gamma * (p - t))); - - Jv = Ju * ratio; // normalization - - Yu = gamma * Ju; - Yu1 = Yu * (u/x - p - q/gamma); - } - if(kind&need_y) - { - // compute Y: - prev = Yu; - current = Yu1; - for (k = 1; k <= n; k++) // forward recurrence for Y - { - T fact = 2 * (u + k) / x; - if((tools::max_value<T>() - fabs(prev)) / fact < fabs(current)) + } + if(!over) { - prev /= current; - Yv_scale /= current; - current = 1; + ratio = (s * init) / current; // scaling ratio + // can also call CF1_jy() to get fu, not much difference in precision + fu = prev / current; } - next = fact * current - prev; - prev = current; - current = next; - } - Yv = prev; - } - else - Yv = std::numeric_limits<T>::quiet_NaN(); // any value will do, we're not using it. - } - - if (reflect) - { - if((sp != 0) && (tools::max_value<T>() * fabs(Yv_scale) < fabs(sp * Yv))) - *J = org_kind & need_j ? T(-sign(sp) * sign(Yv) * sign(Yv_scale) * policies::raise_overflow_error<T>(function, 0, pol)) : T(0); - else - *J = cp * Jv - (sp == 0 ? T(0) : T((sp * Yv) / Yv_scale)); // reflection formula - if((cp != 0) && (tools::max_value<T>() * fabs(Yv_scale) < fabs(cp * Yv))) - *Y = org_kind & need_y ? T(-sign(cp) * sign(Yv) * sign(Yv_scale) * policies::raise_overflow_error<T>(function, 0, pol)) : T(0); - else - *Y = sp * Jv + (cp == 0 ? T(0) : T((cp * Yv) / Yv_scale)); - } - else - { - *J = Jv; - if(tools::max_value<T>() * fabs(Yv_scale) < fabs(Yv)) - *Y = org_kind & need_y ? T(sign(Yv) * sign(Yv_scale) * policies::raise_overflow_error<T>(function, 0, pol)) : T(0); - else - *Y = Yv / Yv_scale; - } - - return 0; -} - -} // namespace detail + else + { + ratio = 0; + fu = 1; + } + } + CF2_jy(u, x, &p, &q, pol); // continued fraction CF2_jy + T t = u / x - fu; // t = J'/J + gamma = (p - t) / q; + // + // We can't allow gamma to cancel out to zero competely as it messes up + // the subsequent logic. So pretend that one bit didn't cancel out + // and set to a suitably small value. The only test case we've been able to + // find for this, is when v = 8.5 and x = 4*PI. + // + if(gamma == 0) + { + gamma = u * tools::epsilon<T>() / x; + } + BOOST_MATH_INSTRUMENT_VARIABLE(current); + BOOST_MATH_INSTRUMENT_VARIABLE(W); + BOOST_MATH_INSTRUMENT_VARIABLE(q); + BOOST_MATH_INSTRUMENT_VARIABLE(gamma); + BOOST_MATH_INSTRUMENT_VARIABLE(p); + BOOST_MATH_INSTRUMENT_VARIABLE(t); + Ju = sign(current) * sqrt(W / (q + gamma * (p - t))); + BOOST_MATH_INSTRUMENT_VARIABLE(Ju); + + Jv = Ju * ratio; // normalization + + Yu = gamma * Ju; + Yu1 = Yu * (u/x - p - q/gamma); + + if(kind&need_y) + { + // compute Y: + prev = Yu; + current = Yu1; + policies::check_series_iterations<T>(function, n, pol); + for (k = 1; k <= n; k++) // forward recurrence for Y + { + T fact = 2 * (u + k) / x; + if((tools::max_value<T>() - fabs(prev)) / fact < fabs(current)) + { + prev /= current; + Yv_scale /= current; + current = 1; + } + next = fact * current - prev; + prev = current; + current = next; + } + Yv = prev; + } + else + Yv = std::numeric_limits<T>::quiet_NaN(); // any value will do, we're not using it. + } + + if (reflect) + { + if((sp != 0) && (tools::max_value<T>() * fabs(Yv_scale) < fabs(sp * Yv))) + *J = org_kind & need_j ? T(-sign(sp) * sign(Yv) * sign(Yv_scale) * policies::raise_overflow_error<T>(function, 0, pol)) : T(0); + else + *J = cp * Jv - (sp == 0 ? T(0) : T((sp * Yv) / Yv_scale)); // reflection formula + if((cp != 0) && (tools::max_value<T>() * fabs(Yv_scale) < fabs(cp * Yv))) + *Y = org_kind & need_y ? T(-sign(cp) * sign(Yv) * sign(Yv_scale) * policies::raise_overflow_error<T>(function, 0, pol)) : T(0); + else + *Y = (sp != 0 ? sp * Jv : T(0)) + (cp == 0 ? T(0) : T((cp * Yv) / Yv_scale)); + } + else + { + *J = Jv; + if(tools::max_value<T>() * fabs(Yv_scale) < fabs(Yv)) + *Y = org_kind & need_y ? T(sign(Yv) * sign(Yv_scale) * policies::raise_overflow_error<T>(function, 0, pol)) : T(0); + else + *Y = Yv / Yv_scale; + } + + return 0; + } + + } // namespace detail }} // namespaces diff --git a/boost/math/special_functions/detail/bessel_jy_asym.hpp b/boost/math/special_functions/detail/bessel_jy_asym.hpp index 0021f8c86a..81f6238e58 100644 --- a/boost/math/special_functions/detail/bessel_jy_asym.hpp +++ b/boost/math/special_functions/detail/bessel_jy_asym.hpp @@ -21,61 +21,6 @@ namespace boost{ namespace math{ namespace detail{ template <class T> -inline T asymptotic_bessel_j_large_x_P(T v, T x) -{ - // A&S 9.2.9 - T s = 1; - T mu = 4 * v * v; - T ez2 = 8 * x; - ez2 *= ez2; - s -= (mu-1) * (mu-9) / (2 * ez2); - s += (mu-1) * (mu-9) * (mu-25) * (mu - 49) / (24 * ez2 * ez2); - return s; -} - -template <class T> -inline T asymptotic_bessel_j_large_x_Q(T v, T x) -{ - // A&S 9.2.10 - T s = 0; - T mu = 4 * v * v; - T ez = 8*x; - s += (mu-1) / ez; - s -= (mu-1) * (mu-9) * (mu-25) / (6 * ez*ez*ez); - return s; -} - -template <class T> -inline T asymptotic_bessel_j_large_x(T v, T x) -{ - // - // See http://functions.wolfram.com/BesselAiryStruveFunctions/BesselJ/06/02/02/0001/ - // - // Also A&S 9.2.5 - // - BOOST_MATH_STD_USING // ADL of std names - T chi = fabs(x) - constants::pi<T>() * (2 * v + 1) / 4; - return sqrt(2 / (constants::pi<T>() * x)) - * (asymptotic_bessel_j_large_x_P(v, x) * cos(chi) - - asymptotic_bessel_j_large_x_Q(v, x) * sin(chi)); -} - -template <class T> -inline T asymptotic_bessel_y_large_x(T v, T x) -{ - // - // See http://functions.wolfram.com/BesselAiryStruveFunctions/BesselJ/06/02/02/0001/ - // - // Also A&S 9.2.5 - // - BOOST_MATH_STD_USING // ADL of std names - T chi = fabs(x) - constants::pi<T>() * (2 * v + 1) / 4; - return sqrt(2 / (constants::pi<T>() * x)) - * (asymptotic_bessel_j_large_x_P(v, x) * sin(chi) - - asymptotic_bessel_j_large_x_Q(v, x) * cos(chi)); -} - -template <class T> inline T asymptotic_bessel_amplitude(T v, T x) { // Calculate the amplitude of J(v, x) and Y(v, x) for large @@ -99,13 +44,14 @@ T asymptotic_bessel_phase_mx(T v, T x) // // Calculate the phase of J(v, x) and Y(v, x) for large x. // See A&S 9.2.29. - // Note that the result returned is the phase less x. + // Note that the result returned is the phase less (x - PI(v/2 + 1/4)) + // which we'll factor in later when we calculate the sines/cosines of the result: // T mu = 4 * v * v; T denom = 4 * x; T denom_mult = denom * denom; - T s = -constants::pi<T>() * (v / 2 + 0.25f); + T s = 0; s += (mu - 1) / (2 * denom); denom *= denom_mult; s += (mu - 1) * (mu - 25) / (6 * denom); @@ -127,10 +73,16 @@ inline T asymptotic_bessel_y_large_x_2(T v, T x) BOOST_MATH_INSTRUMENT_VARIABLE(ampl); BOOST_MATH_INSTRUMENT_VARIABLE(phase); // - // Calculate the sine of the phase, using: - // sin(x+p) = sin(x)cos(p) + cos(x)sin(p) + // Calculate the sine of the phase, using + // sine/cosine addition rules to factor in + // the x - PI(v/2 + 1/4) term not added to the + // phase when we calculated it. // - T sin_phase = sin(phase) * cos(x) + cos(phase) * sin(x); + T cx = cos(x); + T sx = sin(x); + T ci = cos_pi(v / 2 + 0.25f); + T si = sin_pi(v / 2 + 0.25f); + T sin_phase = sin(phase) * (cx * ci + sx * si) + cos(phase) * (sx * ci - cx * si); BOOST_MATH_INSTRUMENT_CODE(sin(phase)); BOOST_MATH_INSTRUMENT_CODE(cos(x)); BOOST_MATH_INSTRUMENT_CODE(cos(phase)); @@ -149,101 +101,39 @@ inline T asymptotic_bessel_j_large_x_2(T v, T x) BOOST_MATH_INSTRUMENT_VARIABLE(ampl); BOOST_MATH_INSTRUMENT_VARIABLE(phase); // - // Calculate the sine of the phase, using: - // cos(x+p) = cos(x)cos(p) - sin(x)sin(p) + // Calculate the sine of the phase, using + // sine/cosine addition rules to factor in + // the x - PI(v/2 + 1/4) term not added to the + // phase when we calculated it. // BOOST_MATH_INSTRUMENT_CODE(cos(phase)); BOOST_MATH_INSTRUMENT_CODE(cos(x)); BOOST_MATH_INSTRUMENT_CODE(sin(phase)); BOOST_MATH_INSTRUMENT_CODE(sin(x)); - T sin_phase = cos(phase) * cos(x) - sin(phase) * sin(x); + T cx = cos(x); + T sx = sin(x); + T ci = cos_pi(v / 2 + 0.25f); + T si = sin_pi(v / 2 + 0.25f); + T sin_phase = cos(phase) * (cx * ci + sx * si) - sin(phase) * (sx * ci - cx * si); BOOST_MATH_INSTRUMENT_VARIABLE(sin_phase); return sin_phase * ampl; } -// -// Various limits for the J and Y asymptotics -// (the asympotic expansions are safe to use if -// x is less than the limit given). -// We assume that if we don't use these expansions then the -// error will likely be >100eps, so the limits given are chosen -// to lead to < 100eps truncation error. -// template <class T> -inline T asymptotic_bessel_y_limit(const mpl::int_<0>&) +inline bool asymptotic_bessel_large_x_limit(const T& v, const T& x) { - // default case: BOOST_MATH_STD_USING - return 2.25 / pow(100 * tools::epsilon<T>() / T(0.001f), T(0.2f)); -} -template <class T> -inline T asymptotic_bessel_y_limit(const mpl::int_<53>&) -{ - // double case: - return 304 /*780*/; -} -template <class T> -inline T asymptotic_bessel_y_limit(const mpl::int_<64>&) -{ - // 80-bit extended-double case: - return 1552 /*3500*/; -} -template <class T> -inline T asymptotic_bessel_y_limit(const mpl::int_<113>&) -{ - // 128-bit long double case: - return 1245243 /*3128000*/; -} - -template <class T, class Policy> -struct bessel_asymptotic_tag -{ - typedef typename policies::precision<T, Policy>::type precision_type; - typedef typename mpl::if_< - mpl::or_< - mpl::equal_to<precision_type, mpl::int_<0> >, - mpl::greater<precision_type, mpl::int_<113> > >, - mpl::int_<0>, - typename mpl::if_< - mpl::greater<precision_type, mpl::int_<64> >, - mpl::int_<113>, - typename mpl::if_< - mpl::greater<precision_type, mpl::int_<53> >, - mpl::int_<64>, - mpl::int_<53> - >::type - >::type - >::type type; -}; - -template <class T> -inline T asymptotic_bessel_j_limit(const T& v, const mpl::int_<0>&) -{ - // default case: - BOOST_MATH_STD_USING - T v2 = (std::max)(T(3), T(v * v)); - return v2 / pow(100 * tools::epsilon<T>() / T(2e-5f), T(0.17f)); -} -template <class T> -inline T asymptotic_bessel_j_limit(const T& v, const mpl::int_<53>&) -{ - // double case: - T v2 = (std::max)(T(3), T(v * v)); - return v2 * 33 /*73*/; -} -template <class T> -inline T asymptotic_bessel_j_limit(const T& v, const mpl::int_<64>&) -{ - // 80-bit extended-double case: - T v2 = (std::max)(T(3), T(v * v)); - return v2 * 121 /*266*/; -} -template <class T> -inline T asymptotic_bessel_j_limit(const T& v, const mpl::int_<113>&) -{ - // 128-bit long double case: - T v2 = (std::max)(T(3), T(v * v)); - return v2 * 39154 /*85700*/; + // + // Determines if x is large enough compared to v to take the asymptotic + // forms above. From A&S 9.2.28 we require: + // v < x * eps^1/8 + // and from A&S 9.2.29 we require: + // v^12/10 < 1.5 * x * eps^1/10 + // using the former seems to work OK in practice with broadly similar + // error rates either side of the divide for v < 10000. + // At double precision eps^1/8 ~= 0.01. + // + return (std::max)(T(fabs(v)), T(1)) < x * sqrt(tools::forth_root_epsilon<T>()); } template <class T, class Policy> diff --git a/boost/math/special_functions/detail/bessel_jy_derivatives_asym.hpp b/boost/math/special_functions/detail/bessel_jy_derivatives_asym.hpp new file mode 100644 index 0000000000..bdbfb9d0c1 --- /dev/null +++ b/boost/math/special_functions/detail/bessel_jy_derivatives_asym.hpp @@ -0,0 +1,141 @@ +// Copyright (c) 2013 Anton Bikineev +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) + +// +// This is a partial header, do not include on it's own!!! +// +// Contains asymptotic expansions for derivatives of Bessel J(v,x) and Y(v,x) +// functions, as x -> INF. +#ifndef BOOST_MATH_SF_DETAIL_BESSEL_JY_DERIVATIVES_ASYM_HPP +#define BOOST_MATH_SF_DETAIL_BESSEL_JY_DERIVATIVES_ASYM_HPP + +#ifdef _MSC_VER +#pragma once +#endif + +namespace boost{ namespace math{ namespace detail{ + +template <class T> +inline T asymptotic_bessel_derivative_amplitude(T v, T x) +{ + // Calculate the amplitude for J'(v,x) and I'(v,x) + // for large x: see A&S 9.2.30. + BOOST_MATH_STD_USING + T s = 1; + const T mu = 4 * v * v; + T txq = 2 * x; + txq *= txq; + + s -= (mu - 3) / (2 * txq); + s -= ((mu - 1) * (mu - 45)) / (txq * txq * 8); + + return sqrt(s * 2 / (boost::math::constants::pi<T>() * x)); +} + +template <class T> +inline T asymptotic_bessel_derivative_phase_mx(T v, T x) +{ + // Calculate the phase of J'(v, x) and Y'(v, x) for large x. + // See A&S 9.2.31. + // Note that the result returned is the phase less (x - PI(v/2 - 1/4)) + // which we'll factor in later when we calculate the sines/cosines of the result: + const T mu = 4 * v * v; + const T mu2 = mu * mu; + const T mu3 = mu2 * mu; + T denom = 4 * x; + T denom_mult = denom * denom; + + T s = 0; + s += (mu + 3) / (2 * denom); + denom *= denom_mult; + s += (mu2 + (46 * mu) - 63) / (6 * denom); + denom *= denom_mult; + s += (mu3 + (185 * mu2) - (2053 * mu) + 1899) / (5 * denom); + return s; +} + +template <class T> +inline T asymptotic_bessel_y_derivative_large_x_2(T v, T x) +{ + // See A&S 9.2.20. + BOOST_MATH_STD_USING + // Get the phase and amplitude: + const T ampl = asymptotic_bessel_derivative_amplitude(v, x); + const T phase = asymptotic_bessel_derivative_phase_mx(v, x); + BOOST_MATH_INSTRUMENT_VARIABLE(ampl); + BOOST_MATH_INSTRUMENT_VARIABLE(phase); + // + // Calculate the sine of the phase, using + // sine/cosine addition rules to factor in + // the x - PI(v/2 - 1/4) term not added to the + // phase when we calculated it. + // + const T cx = cos(x); + const T sx = sin(x); + const T vd2shifted = (v / 2) - 0.25f; + const T ci = cos_pi(vd2shifted); + const T si = sin_pi(vd2shifted); + const T sin_phase = sin(phase) * (cx * ci + sx * si) + cos(phase) * (sx * ci - cx * si); + BOOST_MATH_INSTRUMENT_CODE(sin(phase)); + BOOST_MATH_INSTRUMENT_CODE(cos(x)); + BOOST_MATH_INSTRUMENT_CODE(cos(phase)); + BOOST_MATH_INSTRUMENT_CODE(sin(x)); + return sin_phase * ampl; +} + +template <class T> +inline T asymptotic_bessel_j_derivative_large_x_2(T v, T x) +{ + // See A&S 9.2.20. + BOOST_MATH_STD_USING + // Get the phase and amplitude: + const T ampl = asymptotic_bessel_derivative_amplitude(v, x); + const T phase = asymptotic_bessel_derivative_phase_mx(v, x); + BOOST_MATH_INSTRUMENT_VARIABLE(ampl); + BOOST_MATH_INSTRUMENT_VARIABLE(phase); + // + // Calculate the sine of the phase, using + // sine/cosine addition rules to factor in + // the x - PI(v/2 - 1/4) term not added to the + // phase when we calculated it. + // + BOOST_MATH_INSTRUMENT_CODE(cos(phase)); + BOOST_MATH_INSTRUMENT_CODE(cos(x)); + BOOST_MATH_INSTRUMENT_CODE(sin(phase)); + BOOST_MATH_INSTRUMENT_CODE(sin(x)); + const T cx = cos(x); + const T sx = sin(x); + const T vd2shifted = (v / 2) - 0.25f; + const T ci = cos_pi(vd2shifted); + const T si = sin_pi(vd2shifted); + const T sin_phase = cos(phase) * (cx * ci + sx * si) - sin(phase) * (sx * ci - cx * si); + BOOST_MATH_INSTRUMENT_VARIABLE(sin_phase); + return sin_phase * ampl; +} + +template <class T> +inline bool asymptotic_bessel_derivative_large_x_limit(const T& v, const T& x) +{ + BOOST_MATH_STD_USING + // + // This function is the copy of math::asymptotic_bessel_large_x_limit + // It means that we use the same rules for determining how x is large + // compared to v. + // + // Determines if x is large enough compared to v to take the asymptotic + // forms above. From A&S 9.2.28 we require: + // v < x * eps^1/8 + // and from A&S 9.2.29 we require: + // v^12/10 < 1.5 * x * eps^1/10 + // using the former seems to work OK in practice with broadly similar + // error rates either side of the divide for v < 10000. + // At double precision eps^1/8 ~= 0.01. + // + return (std::max)(T(fabs(v)), T(1)) < x * sqrt(boost::math::tools::forth_root_epsilon<T>()); +} + +}}} // namespaces + +#endif // BOOST_MATH_SF_DETAIL_BESSEL_JY_DERIVATIVES_ASYM_HPP diff --git a/boost/math/special_functions/detail/bessel_jy_derivatives_series.hpp b/boost/math/special_functions/detail/bessel_jy_derivatives_series.hpp new file mode 100644 index 0000000000..0dc68fc73c --- /dev/null +++ b/boost/math/special_functions/detail/bessel_jy_derivatives_series.hpp @@ -0,0 +1,220 @@ +// Copyright (c) 2013 Anton Bikineev +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) + +#ifndef BOOST_MATH_BESSEL_JY_DERIVATIVES_SERIES_HPP +#define BOOST_MATH_BESSEL_JY_DERIVATIVES_SERIES_HPP + +#ifdef _MSC_VER +#pragma once +#endif + +namespace boost{ namespace math{ namespace detail{ + +template <class T, class Policy> +struct bessel_j_derivative_small_z_series_term +{ + typedef T result_type; + + bessel_j_derivative_small_z_series_term(T v_, T x) + : N(0), v(v_), term(1), mult(x / 2) + { + mult *= -mult; + // iterate if v == 0; otherwise result of + // first term is 0 and tools::sum_series stops + if (v == 0) + iterate(); + } + T operator()() + { + T r = term * (v + 2 * N); + iterate(); + return r; + } +private: + void iterate() + { + ++N; + term *= mult / (N * (N + v)); + } + unsigned N; + T v; + T term; + T mult; +}; +// +// Series evaluation for BesselJ'(v, z) as z -> 0. +// It's derivative of http://functions.wolfram.com/Bessel-TypeFunctions/BesselJ/06/01/04/01/01/0003/ +// Converges rapidly for all z << v. +// +template <class T, class Policy> +inline T bessel_j_derivative_small_z_series(T v, T x, const Policy& pol) +{ + BOOST_MATH_STD_USING + T prefix; + if (v < boost::math::max_factorial<T>::value) + { + prefix = pow(x / 2, v - 1) / 2 / boost::math::tgamma(v + 1, pol); + } + else + { + prefix = (v - 1) * log(x / 2) - constants::ln_two<T>() - boost::math::lgamma(v + 1, pol); + prefix = exp(prefix); + } + if (0 == prefix) + return prefix; + + bessel_j_derivative_small_z_series_term<T, Policy> s(v, x); + boost::uintmax_t max_iter = boost::math::policies::get_max_series_iterations<Policy>(); +#if BOOST_WORKAROUND(__BORLANDC__, BOOST_TESTED_AT(0x582)) + T zero = 0; + T result = boost::math::tools::sum_series(s, boost::math::policies::get_epsilon<T, Policy>(), max_iter, zero); +#else + T result = boost::math::tools::sum_series(s, boost::math::policies::get_epsilon<T, Policy>(), max_iter); +#endif + boost::math::policies::check_series_iterations<T>("boost::math::bessel_j_derivative_small_z_series<%1%>(%1%,%1%)", max_iter, pol); + return prefix * result; +} + +template <class T, class Policy> +struct bessel_y_derivative_small_z_series_term_a +{ + typedef T result_type; + + bessel_y_derivative_small_z_series_term_a(T v_, T x) + : N(0), v(v_) + { + mult = x / 2; + mult *= -mult; + term = 1; + } + T operator()() + { + T r = term * (-v + 2 * N); + ++N; + term *= mult / (N * (N - v)); + return r; + } +private: + unsigned N; + T v; + T mult; + T term; +}; + +template <class T, class Policy> +struct bessel_y_derivative_small_z_series_term_b +{ + typedef T result_type; + + bessel_y_derivative_small_z_series_term_b(T v_, T x) + : N(0), v(v_) + { + mult = x / 2; + mult *= -mult; + term = 1; + } + T operator()() + { + T r = term * (v + 2 * N); + ++N; + term *= mult / (N * (N + v)); + return r; + } +private: + unsigned N; + T v; + T mult; + T term; +}; +// +// Series form for BesselY' as z -> 0, +// It's derivative of http://functions.wolfram.com/Bessel-TypeFunctions/BesselY/06/01/04/01/01/0003/ +// This series is only useful when the second term is small compared to the first +// otherwise we get catestrophic cancellation errors. +// +// Approximating tgamma(v) by v^v, and assuming |tgamma(-z)| < eps we end up requiring: +// eps/2 * v^v(x/2)^-v > (x/2)^v or log(eps/2) > v log((x/2)^2/v) +// +template <class T, class Policy> +inline T bessel_y_derivative_small_z_series(T v, T x, const Policy& pol) +{ + BOOST_MATH_STD_USING + static const char* function = "bessel_y_derivative_small_z_series<%1%>(%1%,%1%)"; + T prefix; + T gam; + T p = log(x / 2); + T scale = 1; + bool need_logs = (v >= boost::math::max_factorial<T>::value) || (boost::math::tools::log_max_value<T>() / v < fabs(p)); + if (!need_logs) + { + gam = boost::math::tgamma(v, pol); + p = pow(x / 2, v + 1) * 2; + if (boost::math::tools::max_value<T>() * p < gam) + { + scale /= gam; + gam = 1; + if (boost::math::tools::max_value<T>() * p < gam) + { + return -boost::math::policies::raise_overflow_error<T>(function, 0, pol); + } + } + prefix = -gam / (boost::math::constants::pi<T>() * p); + } + else + { + gam = boost::math::lgamma(v, pol); + p = (v + 1) * p + constants::ln_two<T>(); + prefix = gam - log(boost::math::constants::pi<T>()) - p; + if (boost::math::tools::log_max_value<T>() < prefix) + { + prefix -= log(boost::math::tools::max_value<T>() / 4); + scale /= (boost::math::tools::max_value<T>() / 4); + if (boost::math::tools::log_max_value<T>() < prefix) + { + return -boost::math::policies::raise_overflow_error<T>(function, 0, pol); + } + } + prefix = -exp(prefix); + } + bessel_y_derivative_small_z_series_term_a<T, Policy> s(v, x); + boost::uintmax_t max_iter = boost::math::policies::get_max_series_iterations<Policy>(); +#if BOOST_WORKAROUND(__BORLANDC__, BOOST_TESTED_AT(0x582)) + T zero = 0; + T result = boost::math::tools::sum_series(s, boost::math::policies::get_epsilon<T, Policy>(), max_iter, zero); +#else + T result = boost::math::tools::sum_series(s, boost::math::policies::get_epsilon<T, Policy>(), max_iter); +#endif + boost::math::policies::check_series_iterations<T>("boost::math::bessel_y_derivative_small_z_series<%1%>(%1%,%1%)", max_iter, pol); + result *= prefix; + + p = pow(x / 2, v - 1) / 2; + if (!need_logs) + { + prefix = boost::math::tgamma(-v, pol) * boost::math::cos_pi(v) * p / boost::math::constants::pi<T>(); + } + else + { + int sgn; + prefix = boost::math::lgamma(-v, &sgn, pol) + (v - 1) * log(x / 2) - constants::ln_two<T>(); + prefix = exp(prefix) * sgn / boost::math::constants::pi<T>(); + } + bessel_y_derivative_small_z_series_term_b<T, Policy> s2(v, x); + max_iter = boost::math::policies::get_max_series_iterations<Policy>(); +#if BOOST_WORKAROUND(__BORLANDC__, BOOST_TESTED_AT(0x582)) + T b = boost::math::tools::sum_series(s2, boost::math::policies::get_epsilon<T, Policy>(), max_iter, zero); +#else + T b = boost::math::tools::sum_series(s2, boost::math::policies::get_epsilon<T, Policy>(), max_iter); +#endif + result += scale * prefix * b; + return result; +} + +// Calculating of BesselY'(v,x) with small x (x < epsilon) and integer x using derivatives +// of formulas in http://functions.wolfram.com/Bessel-TypeFunctions/BesselY/06/01/04/01/02/ +// seems to lose precision. Instead using linear combination of regular Bessel is preferred. + +}}} // namespaces + +#endif // BOOST_MATH_BESSEL_JY_DERIVATVIES_SERIES_HPP diff --git a/boost/math/special_functions/detail/bessel_jy_series.hpp b/boost/math/special_functions/detail/bessel_jy_series.hpp index b926366eb0..d50bef84e8 100644 --- a/boost/math/special_functions/detail/bessel_jy_series.hpp +++ b/boost/math/special_functions/detail/bessel_jy_series.hpp @@ -194,9 +194,9 @@ inline T bessel_y_small_z_series(T v, T x, T* pscale, const Policy& pol) } else { - int s; - prefix = boost::math::lgamma(-v, &s, pol) + p; - prefix = exp(prefix) * s / constants::pi<T>(); + int sgn; + prefix = boost::math::lgamma(-v, &sgn, pol) + p; + prefix = exp(prefix) * sgn / constants::pi<T>(); } bessel_y_small_z_series_term_b<T, Policy> s2(v, x); max_iter = policies::get_max_series_iterations<Policy>(); @@ -235,7 +235,7 @@ T bessel_yn_small_z(int n, T z, T* scale, const Policy& pol) { return (z * z) / (4 * constants::pi<T>()) * log(z / 2) - (4 / (constants::pi<T>() * z * z)) - - ((z * z) / (8 * constants::pi<T>())) * (3/2 - 2 * constants::euler<T>()); + - ((z * z) / (8 * constants::pi<T>())) * (T(3)/2 - 2 * constants::euler<T>()); } else { diff --git a/boost/math/special_functions/detail/bessel_jy_zero.hpp b/boost/math/special_functions/detail/bessel_jy_zero.hpp new file mode 100644 index 0000000000..ecd8696eee --- /dev/null +++ b/boost/math/special_functions/detail/bessel_jy_zero.hpp @@ -0,0 +1,617 @@ +// Copyright (c) 2013 Christopher Kormanyos +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) +// +// This work is based on an earlier work: +// "Algorithm 910: A Portable C++ Multiple-Precision System for Special-Function Calculations", +// in ACM TOMS, {VOL 37, ISSUE 4, (February 2011)} (C) ACM, 2011. http://doi.acm.org/10.1145/1916461.1916469 +// +// This header contains implementation details for estimating the zeros +// of cylindrical Bessel and Neumann functions on the positive real axis. +// Support is included for both positive as well as negative order. +// Various methods are used to estimate the roots. These include +// empirical curve fitting and McMahon's asymptotic approximation +// for small order, uniform asymptotic expansion for large order, +// and iteration and root interlacing for negative order. +// +#ifndef _BESSEL_JY_ZERO_2013_01_18_HPP_ + #define _BESSEL_JY_ZERO_2013_01_18_HPP_ + + #include <algorithm> + #include <boost/math/constants/constants.hpp> + #include <boost/math/special_functions/math_fwd.hpp> + #include <boost/math/special_functions/cbrt.hpp> + #include <boost/math/special_functions/detail/airy_ai_bi_zero.hpp> + + namespace boost { namespace math { + namespace detail + { + namespace bessel_zero + { + template<class T> + T equation_nist_10_21_19(const T& v, const T& a) + { + // Get the initial estimate of the m'th root of Jv or Yv. + // This subroutine is used for the order m with m > 1. + // The order m has been used to create the input parameter a. + + // This is Eq. 10.21.19 in the NIST Handbook. + const T mu = (v * v) * 4U; + const T mu_minus_one = mu - T(1); + const T eight_a_inv = T(1) / (a * 8U); + const T eight_a_inv_squared = eight_a_inv * eight_a_inv; + + const T term3 = ((mu_minus_one * 4U) * ((mu * 7U) - T(31U) )) / 3U; + const T term5 = ((mu_minus_one * 32U) * ((((mu * 83U) - T(982U) ) * mu) + T(3779U) )) / 15U; + const T term7 = ((mu_minus_one * 64U) * ((((((mu * 6949U) - T(153855UL)) * mu) + T(1585743UL)) * mu) - T(6277237UL))) / 105U; + + return a + (((( - term7 + * eight_a_inv_squared - term5) + * eight_a_inv_squared - term3) + * eight_a_inv_squared - mu_minus_one) + * eight_a_inv); + } + + template<typename T> + class equation_as_9_3_39_and_its_derivative + { + public: + equation_as_9_3_39_and_its_derivative(const T& zt) : zeta(zt) { } + + boost::math::tuple<T, T> operator()(const T& z) const + { + BOOST_MATH_STD_USING // ADL of std names, needed for acos, sqrt. + + // Return the function of zeta that is implicitly defined + // in A&S Eq. 9.3.39 as a function of z. The function is + // returned along with its derivative with respect to z. + + const T zsq_minus_one_sqrt = sqrt((z * z) - T(1)); + + const T the_function( + zsq_minus_one_sqrt + - ( acos(T(1) / z) + ((T(2) / 3U) * (zeta * sqrt(zeta))))); + + const T its_derivative(zsq_minus_one_sqrt / z); + + return boost::math::tuple<T, T>(the_function, its_derivative); + } + + private: + const equation_as_9_3_39_and_its_derivative& operator=(const equation_as_9_3_39_and_its_derivative&); + const T zeta; + }; + + template<class T> + static T equation_as_9_5_26(const T& v, const T& ai_bi_root) + { + BOOST_MATH_STD_USING // ADL of std names, needed for log, sqrt. + + // Obtain the estimate of the m'th zero of Jv or Yv. + // The order m has been used to create the input parameter ai_bi_root. + // Here, v is larger than about 2.2. The estimate is computed + // from Abramowitz and Stegun Eqs. 9.5.22 and 9.5.26, page 371. + // + // The inversion of z as a function of zeta is mentioned in the text + // following A&S Eq. 9.5.26. Here, we accomplish the inversion by + // performing a Taylor expansion of Eq. 9.3.39 for large z to order 2 + // and solving the resulting quadratic equation, thereby taking + // the positive root of the quadratic. + // In other words: (2/3)(-zeta)^(3/2) approx = z + 1/(2z) - pi/2. + // This leads to: z^2 - [(2/3)(-zeta)^(3/2) + pi/2]z + 1/2 = 0. + // + // With this initial estimate, Newton-Raphson iteration is used + // to refine the value of the estimate of the root of z + // as a function of zeta. + + const T v_pow_third(boost::math::cbrt(v)); + const T v_pow_minus_two_thirds(T(1) / (v_pow_third * v_pow_third)); + + // Obtain zeta using the order v combined with the m'th root of + // an airy function, as shown in A&S Eq. 9.5.22. + const T zeta = v_pow_minus_two_thirds * (-ai_bi_root); + + const T zeta_sqrt = sqrt(zeta); + + // Set up a quadratic equation based on the Taylor series + // expansion mentioned above. + const T b = -((((zeta * zeta_sqrt) * 2U) / 3U) + boost::math::constants::half_pi<T>()); + + // Solve the quadratic equation, taking the positive root. + const T z_estimate = (-b + sqrt((b * b) - T(2))) / 2U; + + // Establish the range, the digits, and the iteration limit + // for the upcoming root-finding. + const T range_zmin = (std::max<T>)(z_estimate - T(1), T(1)); + const T range_zmax = z_estimate + T(1); + + const int my_digits10 = static_cast<int>(static_cast<float>(boost::math::tools::digits<T>() * 0.301F)); + + // Select the maximum allowed iterations based on the number + // of decimal digits in the numeric type T, being at least 12. + const boost::uintmax_t iterations_allowed = static_cast<boost::uintmax_t>((std::max)(12, my_digits10 * 2)); + + boost::uintmax_t iterations_used = iterations_allowed; + + // Calculate the root of z as a function of zeta. + const T z = boost::math::tools::newton_raphson_iterate( + boost::math::detail::bessel_zero::equation_as_9_3_39_and_its_derivative<T>(zeta), + z_estimate, + range_zmin, + range_zmax, + (std::min)(boost::math::tools::digits<T>(), boost::math::tools::digits<float>()), + iterations_used); + + static_cast<void>(iterations_used); + + // Continue with the implementation of A&S Eq. 9.3.39. + const T zsq_minus_one = (z * z) - T(1); + const T zsq_minus_one_sqrt = sqrt(zsq_minus_one); + + // This is A&S Eq. 9.3.42. + const T b0_term_5_24 = T(5) / ((zsq_minus_one * zsq_minus_one_sqrt) * 24U); + const T b0_term_1_8 = T(1) / ( zsq_minus_one_sqrt * 8U); + const T b0_term_5_48 = T(5) / ((zeta * zeta) * 48U); + + const T b0 = -b0_term_5_48 + ((b0_term_5_24 + b0_term_1_8) / zeta_sqrt); + + // This is the second line of A&S Eq. 9.5.26 for f_k with k = 1. + const T f1 = ((z * zeta_sqrt) * b0) / zsq_minus_one_sqrt; + + // This is A&S Eq. 9.5.22 expanded to k = 1 (i.e., one term in the series). + return (v * z) + (f1 / v); + } + + namespace cyl_bessel_j_zero_detail + { + template<class T> + T equation_nist_10_21_40_a(const T& v) + { + const T v_pow_third(boost::math::cbrt(v)); + const T v_pow_minus_two_thirds(T(1) / (v_pow_third * v_pow_third)); + + return v * ((((( + T(0.043) + * v_pow_minus_two_thirds - T(0.0908)) + * v_pow_minus_two_thirds - T(0.00397)) + * v_pow_minus_two_thirds + T(1.033150)) + * v_pow_minus_two_thirds + T(1.8557571)) + * v_pow_minus_two_thirds + T(1)); + } + + template<class T, class Policy> + class function_object_jv + { + public: + function_object_jv(const T& v, + const Policy& pol) : my_v(v), + my_pol(pol) { } + + T operator()(const T& x) const + { + return boost::math::cyl_bessel_j(my_v, x, my_pol); + } + + private: + const T my_v; + const Policy& my_pol; + const function_object_jv& operator=(const function_object_jv&); + }; + + template<class T, class Policy> + class function_object_jv_and_jv_prime + { + public: + function_object_jv_and_jv_prime(const T& v, + const bool order_is_zero, + const Policy& pol) : my_v(v), + my_order_is_zero(order_is_zero), + my_pol(pol) { } + + boost::math::tuple<T, T> operator()(const T& x) const + { + // Obtain Jv(x) and Jv'(x). + // Chris's original code called the Bessel function implementation layer direct, + // but that circumvented optimizations for integer-orders. Call the documented + // top level functions instead, and let them sort out which implementation to use. + T j_v; + T j_v_prime; + + if(my_order_is_zero) + { + j_v = boost::math::cyl_bessel_j(0, x, my_pol); + j_v_prime = -boost::math::cyl_bessel_j(1, x, my_pol); + } + else + { + j_v = boost::math::cyl_bessel_j( my_v, x, my_pol); + const T j_v_m1 (boost::math::cyl_bessel_j(T(my_v - 1), x, my_pol)); + j_v_prime = j_v_m1 - ((my_v * j_v) / x); + } + + // Return a tuple containing both Jv(x) and Jv'(x). + return boost::math::make_tuple(j_v, j_v_prime); + } + + private: + const T my_v; + const bool my_order_is_zero; + const Policy& my_pol; + const function_object_jv_and_jv_prime& operator=(const function_object_jv_and_jv_prime&); + }; + + template<class T> bool my_bisection_unreachable_tolerance(const T&, const T&) { return false; } + + template<class T, class Policy> + T initial_guess(const T& v, const int m, const Policy& pol) + { + BOOST_MATH_STD_USING // ADL of std names, needed for floor. + + // Compute an estimate of the m'th root of cyl_bessel_j. + + T guess; + + // There is special handling for negative order. + if(v < 0) + { + if((m == 1) && (v > -0.5F)) + { + // For small, negative v, use the results of empirical curve fitting. + // Mathematica(R) session for the coefficients: + // Table[{n, BesselJZero[n, 1]}, {n, -(1/2), 0, 1/10}] + // N[%, 20] + // Fit[%, {n^0, n^1, n^2, n^3, n^4, n^5, n^6}, n] + guess = ((((( - T(0.2321156900729) + * v - T(0.1493247777488)) + * v - T(0.15205419167239)) + * v + T(0.07814930561249)) + * v - T(0.17757573537688)) + * v + T(1.542805677045663)) + * v + T(2.40482555769577277); + + return guess; + } + + // Create the positive order and extract its positive floor integer part. + const T vv(-v); + const T vv_floor(floor(vv)); + + // The to-be-found root is bracketed by the roots of the + // Bessel function whose reflected, positive integer order + // is less than, but nearest to vv. + + T root_hi = boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::initial_guess(vv_floor, m, pol); + T root_lo; + + if(m == 1) + { + // The estimate of the first root for negative order is found using + // an adaptive range-searching algorithm. + root_lo = T(root_hi - 0.1F); + + const bool hi_end_of_bracket_is_negative = (boost::math::cyl_bessel_j(v, root_hi, pol) < 0); + + while((root_lo > boost::math::tools::epsilon<T>())) + { + const bool lo_end_of_bracket_is_negative = (boost::math::cyl_bessel_j(v, root_lo, pol) < 0); + + if(hi_end_of_bracket_is_negative != lo_end_of_bracket_is_negative) + { + break; + } + + root_hi = root_lo; + + // Decrease the lower end of the bracket using an adaptive algorithm. + if(root_lo > 0.5F) + { + root_lo -= 0.5F; + } + else + { + root_lo *= 0.75F; + } + } + } + else + { + root_lo = boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::initial_guess(vv_floor, m - 1, pol); + } + + // Perform several steps of bisection iteration to refine the guess. + boost::uintmax_t number_of_iterations(12U); + + // Do the bisection iteration. + const boost::math::tuple<T, T> guess_pair = + boost::math::tools::bisect( + boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::function_object_jv<T, Policy>(v, pol), + root_lo, + root_hi, + boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::my_bisection_unreachable_tolerance<T>, + number_of_iterations); + + return (boost::math::get<0>(guess_pair) + boost::math::get<1>(guess_pair)) / 2U; + } + + if(m == 1U) + { + // Get the initial estimate of the first root. + + if(v < 2.2F) + { + // For small v, use the results of empirical curve fitting. + // Mathematica(R) session for the coefficients: + // Table[{n, BesselJZero[n, 1]}, {n, 0, 22/10, 1/10}] + // N[%, 20] + // Fit[%, {n^0, n^1, n^2, n^3, n^4, n^5, n^6}, n] + guess = ((((( - T(0.0008342379046010) + * v + T(0.007590035637410)) + * v - T(0.030640914772013)) + * v + T(0.078232088020106)) + * v - T(0.169668712590620)) + * v + T(1.542187960073750)) + * v + T(2.4048359915254634); + } + else + { + // For larger v, use the first line of Eqs. 10.21.40 in the NIST Handbook. + guess = boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::equation_nist_10_21_40_a(v); + } + } + else + { + if(v < 2.2F) + { + // Use Eq. 10.21.19 in the NIST Handbook. + const T a(((v + T(m * 2U)) - T(0.5)) * boost::math::constants::half_pi<T>()); + + guess = boost::math::detail::bessel_zero::equation_nist_10_21_19(v, a); + } + else + { + // Get an estimate of the m'th root of airy_ai. + const T airy_ai_root(boost::math::detail::airy_zero::airy_ai_zero_detail::initial_guess<T>(m)); + + // Use Eq. 9.5.26 in the A&S Handbook. + guess = boost::math::detail::bessel_zero::equation_as_9_5_26(v, airy_ai_root); + } + } + + return guess; + } + } // namespace cyl_bessel_j_zero_detail + + namespace cyl_neumann_zero_detail + { + template<class T> + T equation_nist_10_21_40_b(const T& v) + { + const T v_pow_third(boost::math::cbrt(v)); + const T v_pow_minus_two_thirds(T(1) / (v_pow_third * v_pow_third)); + + return v * ((((( - T(0.001) + * v_pow_minus_two_thirds - T(0.0060)) + * v_pow_minus_two_thirds + T(0.01198)) + * v_pow_minus_two_thirds + T(0.260351)) + * v_pow_minus_two_thirds + T(0.9315768)) + * v_pow_minus_two_thirds + T(1)); + } + + template<class T, class Policy> + class function_object_yv + { + public: + function_object_yv(const T& v, + const Policy& pol) : my_v(v), + my_pol(pol) { } + + T operator()(const T& x) const + { + return boost::math::cyl_neumann(my_v, x, my_pol); + } + + private: + const T my_v; + const Policy& my_pol; + const function_object_yv& operator=(const function_object_yv&); + }; + + template<class T, class Policy> + class function_object_yv_and_yv_prime + { + public: + function_object_yv_and_yv_prime(const T& v, + const Policy& pol) : my_v(v), + my_pol(pol) { } + + boost::math::tuple<T, T> operator()(const T& x) const + { + const T half_epsilon(boost::math::tools::epsilon<T>() / 2U); + + const bool order_is_zero = ((my_v > -half_epsilon) && (my_v < +half_epsilon)); + + // Obtain Yv(x) and Yv'(x). + // Chris's original code called the Bessel function implementation layer direct, + // but that circumvented optimizations for integer-orders. Call the documented + // top level functions instead, and let them sort out which implementation to use. + T y_v; + T y_v_prime; + + if(order_is_zero) + { + y_v = boost::math::cyl_neumann(0, x, my_pol); + y_v_prime = -boost::math::cyl_neumann(1, x, my_pol); + } + else + { + y_v = boost::math::cyl_neumann( my_v, x, my_pol); + const T y_v_m1 (boost::math::cyl_neumann(T(my_v - 1), x, my_pol)); + y_v_prime = y_v_m1 - ((my_v * y_v) / x); + } + + // Return a tuple containing both Yv(x) and Yv'(x). + return boost::math::make_tuple(y_v, y_v_prime); + } + + private: + const T my_v; + const Policy& my_pol; + const function_object_yv_and_yv_prime& operator=(const function_object_yv_and_yv_prime&); + }; + + template<class T> bool my_bisection_unreachable_tolerance(const T&, const T&) { return false; } + + template<class T, class Policy> + T initial_guess(const T& v, const int m, const Policy& pol) + { + BOOST_MATH_STD_USING // ADL of std names, needed for floor. + + // Compute an estimate of the m'th root of cyl_neumann. + + T guess; + + // There is special handling for negative order. + if(v < 0) + { + // Create the positive order and extract its positive floor and ceiling integer parts. + const T vv(-v); + const T vv_floor(floor(vv)); + + // The to-be-found root is bracketed by the roots of the + // Bessel function whose reflected, positive integer order + // is less than, but nearest to vv. + + // The special case of negative, half-integer order uses + // the relation between Yv and spherical Bessel functions + // in order to obtain the bracket for the root. + // In these special cases, cyl_neumann(-n/2, x) = sph_bessel_j(+n/2, x) + // for v = -n/2. + + T root_hi; + T root_lo; + + if(m == 1) + { + // The estimate of the first root for negative order is found using + // an adaptive range-searching algorithm. + // Take special precautions for the discontinuity at negative, + // half-integer orders and use different brackets above and below these. + if(T(vv - vv_floor) < 0.5F) + { + root_hi = boost::math::detail::bessel_zero::cyl_neumann_zero_detail::initial_guess(vv_floor, m, pol); + } + else + { + root_hi = boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::initial_guess(T(vv_floor + 0.5F), m, pol); + } + + root_lo = T(root_hi - 0.1F); + + const bool hi_end_of_bracket_is_negative = (boost::math::cyl_neumann(v, root_hi, pol) < 0); + + while((root_lo > boost::math::tools::epsilon<T>())) + { + const bool lo_end_of_bracket_is_negative = (boost::math::cyl_neumann(v, root_lo, pol) < 0); + + if(hi_end_of_bracket_is_negative != lo_end_of_bracket_is_negative) + { + break; + } + + root_hi = root_lo; + + // Decrease the lower end of the bracket using an adaptive algorithm. + if(root_lo > 0.5F) + { + root_lo -= 0.5F; + } + else + { + root_lo *= 0.75F; + } + } + } + else + { + if(T(vv - vv_floor) < 0.5F) + { + root_lo = boost::math::detail::bessel_zero::cyl_neumann_zero_detail::initial_guess(vv_floor, m - 1, pol); + root_hi = boost::math::detail::bessel_zero::cyl_neumann_zero_detail::initial_guess(vv_floor, m, pol); + root_lo += 0.01F; + root_hi += 0.01F; + } + else + { + root_lo = boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::initial_guess(T(vv_floor + 0.5F), m - 1, pol); + root_hi = boost::math::detail::bessel_zero::cyl_bessel_j_zero_detail::initial_guess(T(vv_floor + 0.5F), m, pol); + root_lo += 0.01F; + root_hi += 0.01F; + } + } + + // Perform several steps of bisection iteration to refine the guess. + boost::uintmax_t number_of_iterations(12U); + + // Do the bisection iteration. + const boost::math::tuple<T, T> guess_pair = + boost::math::tools::bisect( + boost::math::detail::bessel_zero::cyl_neumann_zero_detail::function_object_yv<T, Policy>(v, pol), + root_lo, + root_hi, + boost::math::detail::bessel_zero::cyl_neumann_zero_detail::my_bisection_unreachable_tolerance<T>, + number_of_iterations); + + return (boost::math::get<0>(guess_pair) + boost::math::get<1>(guess_pair)) / 2U; + } + + if(m == 1U) + { + // Get the initial estimate of the first root. + + if(v < 2.2F) + { + // For small v, use the results of empirical curve fitting. + // Mathematica(R) session for the coefficients: + // Table[{n, BesselYZero[n, 1]}, {n, 0, 22/10, 1/10}] + // N[%, 20] + // Fit[%, {n^0, n^1, n^2, n^3, n^4, n^5, n^6}, n] + guess = ((((( - T(0.0025095909235652) + * v + T(0.021291887049053)) + * v - T(0.076487785486526)) + * v + T(0.159110268115362)) + * v - T(0.241681668765196)) + * v + T(1.4437846310885244)) + * v + T(0.89362115190200490); + } + else + { + // For larger v, use the second line of Eqs. 10.21.40 in the NIST Handbook. + guess = boost::math::detail::bessel_zero::cyl_neumann_zero_detail::equation_nist_10_21_40_b(v); + } + } + else + { + if(v < 2.2F) + { + // Use Eq. 10.21.19 in the NIST Handbook. + const T a(((v + T(m * 2U)) - T(1.5)) * boost::math::constants::half_pi<T>()); + + guess = boost::math::detail::bessel_zero::equation_nist_10_21_19(v, a); + } + else + { + // Get an estimate of the m'th root of airy_bi. + const T airy_bi_root(boost::math::detail::airy_zero::airy_bi_zero_detail::initial_guess<T>(m)); + + // Use Eq. 9.5.26 in the A&S Handbook. + guess = boost::math::detail::bessel_zero::equation_as_9_5_26(v, airy_bi_root); + } + } + + return guess; + } + } // namespace cyl_neumann_zero_detail + } // namespace bessel_zero + } } } // namespace boost::math::detail + +#endif // _BESSEL_JY_ZERO_2013_01_18_HPP_ diff --git a/boost/math/special_functions/detail/bessel_kn.hpp b/boost/math/special_functions/detail/bessel_kn.hpp index 5f01460995..e3a5023c63 100644 --- a/boost/math/special_functions/detail/bessel_kn.hpp +++ b/boost/math/special_functions/detail/bessel_kn.hpp @@ -22,6 +22,7 @@ namespace boost { namespace math { namespace detail{ template <typename T, typename Policy> T bessel_kn(int n, T x, const Policy& pol) { + BOOST_MATH_STD_USING T value, current, prev; using namespace boost::math::tools; diff --git a/boost/math/special_functions/detail/bessel_y0.hpp b/boost/math/special_functions/detail/bessel_y0.hpp index 289bda5f18..533ab7c8a0 100644 --- a/boost/math/special_functions/detail/bessel_y0.hpp +++ b/boost/math/special_functions/detail/bessel_y0.hpp @@ -197,11 +197,22 @@ T bessel_y0(T x, const Policy& pol) { T y = 8 / x; T y2 = y * y; - T z = x - 0.25f * pi<T>(); rc = evaluate_rational(PC, QC, y2); rs = evaluate_rational(PS, QS, y2); - factor = sqrt(2 / (x * pi<T>())); - value = factor * (rc * sin(z) + y * rs * cos(z)); + factor = constants::one_div_root_pi<T>() / sqrt(x); + // + // The following code is really just: + // + // T z = x - 0.25f * pi<T>(); + // value = factor * (rc * sin(z) + y * rs * cos(z)); + // + // But using the sin/cos addition formulae and constant values for + // sin/cos of PI/4 which then cancel part of the "factor" term as they're all + // 1 / sqrt(2): + // + T sx = sin(x); + T cx = cos(x); + value = factor * (rc * (sx - cx) + y * rs * (cx + sx)); } return value; diff --git a/boost/math/special_functions/detail/bessel_y1.hpp b/boost/math/special_functions/detail/bessel_y1.hpp index caf09ffd26..8396f8fe11 100644 --- a/boost/math/special_functions/detail/bessel_y1.hpp +++ b/boost/math/special_functions/detail/bessel_y1.hpp @@ -170,11 +170,21 @@ T bessel_y1(T x, const Policy& pol) { T y = 8 / x; T y2 = y * y; - T z = x - 0.75f * pi<T>(); rc = evaluate_rational(PC, QC, y2); rs = evaluate_rational(PS, QS, y2); - factor = sqrt(2 / (x * pi<T>())); - value = factor * (rc * sin(z) + y * rs * cos(z)); + factor = 1 / (sqrt(x) * root_pi<T>()); + // + // This code is really just: + // + // T z = x - 0.75f * pi<T>(); + // value = factor * (rc * sin(z) + y * rs * cos(z)); + // + // But using the sin/cos addition rules, plus constants for sin/cos of 3PI/4 + // which then cancel out with corresponding terms in "factor". + // + T sx = sin(x); + T cx = cos(x); + value = factor * (y * rs * (sx - cx) - rc * (sx + cx)); } return value; diff --git a/boost/math/special_functions/detail/bessel_yn.hpp b/boost/math/special_functions/detail/bessel_yn.hpp index b4f9855a2f..0509062bbd 100644 --- a/boost/math/special_functions/detail/bessel_yn.hpp +++ b/boost/math/special_functions/detail/bessel_yn.hpp @@ -75,10 +75,11 @@ T bessel_yn(int n, T x, const Policy& pol) current = bessel_y1(x, pol); int k = 1; BOOST_ASSERT(k < n); + policies::check_series_iterations<T>("boost::math::bessel_y_n<%1%>(%1%,%1%)", n, pol); do { T fact = 2 * k / x; - if((tools::max_value<T>() - fabs(prev)) / fact < fabs(current)) + if((fact > 1) && ((tools::max_value<T>() - fabs(prev)) / fact < fabs(current))) { prev /= current; factor /= current; diff --git a/boost/math/special_functions/detail/erf_inv.hpp b/boost/math/special_functions/detail/erf_inv.hpp index d51db9d52f..77aa72fc26 100644 --- a/boost/math/special_functions/detail/erf_inv.hpp +++ b/boost/math/special_functions/detail/erf_inv.hpp @@ -50,7 +50,7 @@ T erf_inv_imp(const T& p, const T& q, const Policy&, const boost::mpl::int_<64>* BOOST_MATH_BIG_CONSTANT(T, 64, -0.00538772965071242932965) }; static const T Q[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, -0.970005043303290640362), BOOST_MATH_BIG_CONSTANT(T, 64, -1.56574558234175846809), BOOST_MATH_BIG_CONSTANT(T, 64, 1.56221558398423026363), @@ -92,7 +92,7 @@ T erf_inv_imp(const T& p, const T& q, const Policy&, const boost::mpl::int_<64>* BOOST_MATH_BIG_CONSTANT(T, 64, -3.67192254707729348546) }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 6.24264124854247537712), BOOST_MATH_BIG_CONSTANT(T, 64, 3.9713437953343869095), BOOST_MATH_BIG_CONSTANT(T, 64, -28.6608180499800029974), @@ -147,7 +147,7 @@ T erf_inv_imp(const T& p, const T& q, const Policy&, const boost::mpl::int_<64>* BOOST_MATH_BIG_CONSTANT(T, 64, -0.681149956853776992068e-9) }; static const T Q[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 3.46625407242567245975), BOOST_MATH_BIG_CONSTANT(T, 64, 5.38168345707006855425), BOOST_MATH_BIG_CONSTANT(T, 64, 4.77846592945843778382), @@ -176,7 +176,7 @@ T erf_inv_imp(const T& p, const T& q, const Policy&, const boost::mpl::int_<64>* BOOST_MATH_BIG_CONSTANT(T, 64, 0.266339227425782031962e-11) }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 1.3653349817554063097), BOOST_MATH_BIG_CONSTANT(T, 64, 0.762059164553623404043), BOOST_MATH_BIG_CONSTANT(T, 64, 0.220091105764131249824), @@ -204,7 +204,7 @@ T erf_inv_imp(const T& p, const T& q, const Policy&, const boost::mpl::int_<64>* BOOST_MATH_BIG_CONSTANT(T, 64, 0.99055709973310326855e-16) }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.591429344886417493481), BOOST_MATH_BIG_CONSTANT(T, 64, 0.138151865749083321638), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0160746087093676504695), @@ -231,7 +231,7 @@ T erf_inv_imp(const T& p, const T& q, const Policy&, const boost::mpl::int_<64>* BOOST_MATH_BIG_CONSTANT(T, 64, -0.116765012397184275695e-17) }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.207123112214422517181), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0169410838120975906478), BOOST_MATH_BIG_CONSTANT(T, 64, 0.000690538265622684595676), @@ -258,7 +258,7 @@ T erf_inv_imp(const T& p, const T& q, const Policy&, const boost::mpl::int_<64>* BOOST_MATH_BIG_CONSTANT(T, 64, -0.348890393399948882918e-21) }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0845746234001899436914), BOOST_MATH_BIG_CONSTANT(T, 64, 0.00282092984726264681981), BOOST_MATH_BIG_CONSTANT(T, 64, 0.468292921940894236786e-4), @@ -282,7 +282,7 @@ struct erf_roots BOOST_MATH_STD_USING T derivative = sign * (2 / sqrt(constants::pi<T>())) * exp(-(guess * guess)); T derivative2 = -2 * guess * derivative; - return boost::math::make_tuple(((sign > 0) ? boost::math::erf(guess, Policy()) : boost::math::erfc(guess, Policy())) - target, derivative, derivative2); + return boost::math::make_tuple(((sign > 0) ? static_cast<T>(boost::math::erf(guess, Policy()) - target) : static_cast<T>(boost::math::erfc(guess, Policy())) - target), derivative, derivative2); } erf_roots(T z, int s) : target(z), sign(s) {} private: @@ -331,18 +331,34 @@ struct erf_inv_initializer { do_init(); } + static bool is_value_non_zero(T); static void do_init() { boost::math::erf_inv(static_cast<T>(0.25), Policy()); boost::math::erf_inv(static_cast<T>(0.55), Policy()); boost::math::erf_inv(static_cast<T>(0.95), Policy()); boost::math::erfc_inv(static_cast<T>(1e-15), Policy()); - if(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-130)) != 0) + // These following initializations must not be called if + // type T can not hold the relevant values without + // underflow to zero. We check this at runtime because + // some tools such as valgrind silently change the precision + // of T at runtime, and numeric_limits basically lies! + if(is_value_non_zero(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-130)))) boost::math::erfc_inv(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-130)), Policy()); - if(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-800)) != 0) + + // Some compilers choke on constants that would underflow, even in code that isn't instantiated + // so try and filter these cases out in the preprocessor: +#if LDBL_MAX_10_EXP >= 800 + if(is_value_non_zero(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-800)))) boost::math::erfc_inv(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-800)), Policy()); - if(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-900)) != 0) + if(is_value_non_zero(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-900)))) boost::math::erfc_inv(static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 1e-900)), Policy()); +#else + if(is_value_non_zero(static_cast<T>(BOOST_MATH_HUGE_CONSTANT(T, 64, 1e-800)))) + boost::math::erfc_inv(static_cast<T>(BOOST_MATH_HUGE_CONSTANT(T, 64, 1e-800)), Policy()); + if(is_value_non_zero(static_cast<T>(BOOST_MATH_HUGE_CONSTANT(T, 64, 1e-900)))) + boost::math::erfc_inv(static_cast<T>(BOOST_MATH_HUGE_CONSTANT(T, 64, 1e-900)), Policy()); +#endif } void force_instantiate()const{} }; @@ -356,6 +372,15 @@ struct erf_inv_initializer template <class T, class Policy> const typename erf_inv_initializer<T, Policy>::init erf_inv_initializer<T, Policy>::initializer; +template <class T, class Policy> +bool erf_inv_initializer<T, Policy>::init::is_value_non_zero(T v) +{ + // This needs to be non-inline to detect whether v is non zero at runtime + // rather than at compile time, only relevant when running under valgrind + // which changes long double's to double's on the fly. + return v != 0; +} + } // namespace detail template <class T, class Policy> @@ -368,7 +393,7 @@ typename tools::promote_args<T>::type erfc_inv(T z, const Policy& pol) // static const char* function = "boost::math::erfc_inv<%1%>(%1%, %1%)"; if((z < 0) || (z > 2)) - policies::raise_domain_error<result_type>(function, "Argument outside range [0,2] in inverse erfc function (got p=%1%).", z, pol); + return policies::raise_domain_error<result_type>(function, "Argument outside range [0,2] in inverse erfc function (got p=%1%).", z, pol); if(z == 0) return policies::raise_overflow_error<result_type>(function, 0, pol); if(z == 2) @@ -432,7 +457,7 @@ typename tools::promote_args<T>::type erf_inv(T z, const Policy& pol) // static const char* function = "boost::math::erf_inv<%1%>(%1%, %1%)"; if((z < -1) || (z > 1)) - policies::raise_domain_error<result_type>(function, "Argument outside range [-1, 1] in inverse erf function (got p=%1%).", z, pol); + return policies::raise_domain_error<result_type>(function, "Argument outside range [-1, 1] in inverse erf function (got p=%1%).", z, pol); if(z == 1) return policies::raise_overflow_error<result_type>(function, 0, pol); if(z == -1) diff --git a/boost/math/special_functions/detail/fp_traits.hpp b/boost/math/special_functions/detail/fp_traits.hpp index 50c034d303..63ebf11ae0 100644 --- a/boost/math/special_functions/detail/fp_traits.hpp +++ b/boost/math/special_functions/detail/fp_traits.hpp @@ -351,6 +351,13 @@ struct fp_traits_non_native<long double, extended_double_precision> // the Intel extended double precision format (80 bits) and // the IEEE extended double precision format with 15 exponent bits (128 bits). +#elif defined(__GNUC__) && (LDBL_MANT_DIG == 106) + +// +// Define nothing here and fall though to generic_tag: +// We have GCC's "double double" in effect, and any attempt +// to handle it via bit-fiddling is pretty much doomed to fail... +// // long double (>64 bits), PowerPC --------------------------------------------- @@ -546,7 +553,9 @@ struct select_native<long double> && !defined(__DECCXX)\ && !defined(__osf__) \ && !defined(__SGI_STL_PORT) && !defined(_STLPORT_VERSION)\ - && !defined(BOOST_MATH_DISABLE_STD_FPCLASSIFY) + && !defined(__FAST_MATH__)\ + && !defined(BOOST_MATH_DISABLE_STD_FPCLASSIFY)\ + && !defined(BOOST_INTEL) # define BOOST_MATH_USE_STD_FPCLASSIFY #endif diff --git a/boost/math/special_functions/detail/gamma_inva.hpp b/boost/math/special_functions/detail/gamma_inva.hpp index 549bc3d552..7c32d2946c 100644 --- a/boost/math/special_functions/detail/gamma_inva.hpp +++ b/boost/math/special_functions/detail/gamma_inva.hpp @@ -75,7 +75,7 @@ T gamma_inva_imp(const T& z, const T& p, const T& q, const Policy& pol) // if(p == 0) { - return tools::max_value<T>(); + return policies::raise_overflow_error<T>("boost::math::gamma_p_inva<%1%>(%1%, %1%)", 0, Policy()); } if(q == 0) { @@ -144,7 +144,7 @@ T gamma_inva_imp(const T& z, const T& p, const T& q, const Policy& pol) // std::pair<T, T> r = bracket_and_solve_root(f, guess, factor, false, tol, max_iter, pol); if(max_iter >= policies::get_max_root_iterations<Policy>()) - policies::raise_evaluation_error<T>("boost::math::gamma_p_inva<%1%>(%1%, %1%)", "Unable to locate the root within a reasonable number of iterations, closest approximation so far was %1%", r.first, pol); + return policies::raise_evaluation_error<T>("boost::math::gamma_p_inva<%1%>(%1%, %1%)", "Unable to locate the root within a reasonable number of iterations, closest approximation so far was %1%", r.first, pol); return (r.first + r.second) / 2; } @@ -165,7 +165,7 @@ inline typename tools::promote_args<T1, T2>::type if(p == 0) { - return tools::max_value<result_type>(); + policies::raise_overflow_error<result_type>("boost::math::gamma_p_inva<%1%>(%1%, %1%)", 0, Policy()); } if(p == 1) { @@ -195,7 +195,7 @@ inline typename tools::promote_args<T1, T2>::type if(q == 1) { - return tools::max_value<result_type>(); + policies::raise_overflow_error<result_type>("boost::math::gamma_q_inva<%1%>(%1%, %1%)", 0, Policy()); } if(q == 0) { diff --git a/boost/math/special_functions/detail/ibeta_inv_ab.hpp b/boost/math/special_functions/detail/ibeta_inv_ab.hpp index 8318a28454..f5735a8495 100644 --- a/boost/math/special_functions/detail/ibeta_inv_ab.hpp +++ b/boost/math/special_functions/detail/ibeta_inv_ab.hpp @@ -153,7 +153,7 @@ T ibeta_inv_ab_imp(const T& b, const T& z, const T& p, const T& q, bool swap_ab, boost::uintmax_t max_iter = policies::get_max_root_iterations<Policy>(); std::pair<T, T> r = bracket_and_solve_root(f, guess, factor, swap_ab ? true : false, tol, max_iter, pol); if(max_iter >= policies::get_max_root_iterations<Policy>()) - policies::raise_evaluation_error<T>("boost::math::ibeta_invab_imp<%1%>(%1%,%1%,%1%)", "Unable to locate the root within a reasonable number of iterations, closest approximation so far was %1%", r.first, pol); + return policies::raise_evaluation_error<T>("boost::math::ibeta_invab_imp<%1%>(%1%,%1%,%1%)", "Unable to locate the root within a reasonable number of iterations, closest approximation so far was %1%", r.first, pol); return (r.first + r.second) / 2; } @@ -172,9 +172,10 @@ typename tools::promote_args<RT1, RT2, RT3>::type policies::discrete_quantile<>, policies::assert_undefined<> >::type forwarding_policy; + static const char* function = "boost::math::ibeta_inva<%1%>(%1%,%1%,%1%)"; if(p == 0) { - return tools::max_value<result_type>(); + return policies::raise_overflow_error<result_type>(function, 0, Policy()); } if(p == 1) { @@ -188,7 +189,7 @@ typename tools::promote_args<RT1, RT2, RT3>::type static_cast<value_type>(p), static_cast<value_type>(1 - static_cast<value_type>(p)), false, pol), - "boost::math::ibeta_inva<%1%>(%1%,%1%,%1%)"); + function); } template <class RT1, class RT2, class RT3, class Policy> @@ -204,9 +205,10 @@ typename tools::promote_args<RT1, RT2, RT3>::type policies::discrete_quantile<>, policies::assert_undefined<> >::type forwarding_policy; + static const char* function = "boost::math::ibetac_inva<%1%>(%1%,%1%,%1%)"; if(q == 1) { - return tools::max_value<result_type>(); + return policies::raise_overflow_error<result_type>(function, 0, Policy()); } if(q == 0) { @@ -220,7 +222,7 @@ typename tools::promote_args<RT1, RT2, RT3>::type static_cast<value_type>(1 - static_cast<value_type>(q)), static_cast<value_type>(q), false, pol), - "boost::math::ibetac_inva<%1%>(%1%,%1%,%1%)"); + function); } template <class RT1, class RT2, class RT3, class Policy> @@ -236,13 +238,14 @@ typename tools::promote_args<RT1, RT2, RT3>::type policies::discrete_quantile<>, policies::assert_undefined<> >::type forwarding_policy; + static const char* function = "boost::math::ibeta_invb<%1%>(%1%,%1%,%1%)"; if(p == 0) { return tools::min_value<result_type>(); } if(p == 1) { - return tools::max_value<result_type>(); + return policies::raise_overflow_error<result_type>(function, 0, Policy()); } return policies::checked_narrowing_cast<result_type, forwarding_policy>( @@ -252,13 +255,14 @@ typename tools::promote_args<RT1, RT2, RT3>::type static_cast<value_type>(p), static_cast<value_type>(1 - static_cast<value_type>(p)), true, pol), - "boost::math::ibeta_invb<%1%>(%1%,%1%,%1%)"); + function); } template <class RT1, class RT2, class RT3, class Policy> typename tools::promote_args<RT1, RT2, RT3>::type ibetac_invb(RT1 a, RT2 x, RT3 q, const Policy& pol) { + static const char* function = "boost::math::ibeta_invb<%1%>(%1%, %1%, %1%)"; typedef typename tools::promote_args<RT1, RT2, RT3>::type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; typedef typename policies::normalise< @@ -274,7 +278,7 @@ typename tools::promote_args<RT1, RT2, RT3>::type } if(q == 0) { - return tools::max_value<result_type>(); + return policies::raise_overflow_error<result_type>(function, 0, Policy()); } return policies::checked_narrowing_cast<result_type, forwarding_policy>( @@ -282,9 +286,9 @@ typename tools::promote_args<RT1, RT2, RT3>::type static_cast<value_type>(a), static_cast<value_type>(x), static_cast<value_type>(1 - static_cast<value_type>(q)), - static_cast<value_type>(q), + static_cast<value_type>(q), true, pol), - "boost::math::ibetac_invb<%1%>(%1%,%1%,%1%)"); + function); } template <class RT1, class RT2, class RT3> diff --git a/boost/math/special_functions/detail/ibeta_inverse.hpp b/boost/math/special_functions/detail/ibeta_inverse.hpp index ccfa9197d9..a9fe8cd49c 100644 --- a/boost/math/special_functions/detail/ibeta_inverse.hpp +++ b/boost/math/special_functions/detail/ibeta_inverse.hpp @@ -35,12 +35,12 @@ struct temme_root_finder if(y == 0) { T big = tools::max_value<T>() / 4; - return boost::math::make_tuple(-big, -big); + return boost::math::make_tuple(static_cast<T>(-big), static_cast<T>(-big)); } if(x == 0) { T big = tools::max_value<T>() / 4; - return boost::math::make_tuple(-big, big); + return boost::math::make_tuple(static_cast<T>(-big), big); } T f = log(x) + a * log(y) + t; T f1 = (1 / x) - (a / (y)); @@ -455,6 +455,11 @@ T ibeta_inv_imp(T a, T b, T p, T q, const Policy& pol, T* py) BOOST_MATH_STD_USING // For ADL of math functions. // + // The flag invert is set to true if we swap a for b and p for q, + // in which case the result has to be subtracted from 1: + // + bool invert = false; + // // Handle trivial cases first: // if(q == 0) @@ -467,17 +472,19 @@ T ibeta_inv_imp(T a, T b, T p, T q, const Policy& pol, T* py) if(py) *py = 1; return 0; } - else if((a == 1) && (b == 1)) + else if(a == 1) { - if(py) *py = 1 - p; - return p; + if(b == 1) + { + if(py) *py = 1 - p; + return p; + } + // Change things around so we can handle as b == 1 special case below: + std::swap(a, b); + std::swap(p, q); + invert = true; } // - // The flag invert is set to true if we swap a for b and p for q, - // in which case the result has to be subtracted from 1: - // - bool invert = false; - // // Depending upon which approximation method we use, we may end up // calculating either x or y initially (where y = 1-x): // @@ -495,21 +502,61 @@ T ibeta_inv_imp(T a, T b, T p, T q, const Policy& pol, T* py) // Student's T with b = 0.5 gets handled as a special case, swap // around if the arguments are in the "wrong" order: // - if((a == 0.5f) && (b >= 0.5f)) + if(a == 0.5f) { - std::swap(a, b); - std::swap(p, q); - invert = !invert; + if(b == 0.5f) + { + x = sin(p * constants::half_pi<T>()); + x *= x; + if(py) + { + *py = sin(q * constants::half_pi<T>()); + *py *= *py; + } + return x; + } + else if(b > 0.5f) + { + std::swap(a, b); + std::swap(p, q); + invert = !invert; + } } // // Select calculation method for the initial estimate: // - if((b == 0.5f) && (a >= 0.5f)) + if((b == 0.5f) && (a >= 0.5f) && (p != 1)) { // // We have a Student's T distribution: x = find_ibeta_inv_from_t_dist(a, p, q, &y, pol); } + else if(b == 1) + { + if(p < q) + { + if(a > 1) + { + x = pow(p, 1 / a); + y = -boost::math::expm1(log(p) / a, pol); + } + else + { + x = pow(p, 1 / a); + y = 1 - x; + } + } + else + { + x = exp(boost::math::log1p(-q, pol) / a); + y = -boost::math::expm1(boost::math::log1p(-q, pol) / a, pol); + } + if(invert) + std::swap(x, y); + if(py) + *py = y; + return x; + } else if(a + b > 5) { // @@ -866,14 +913,16 @@ template <class T1, class T2, class T3> inline typename tools::promote_args<T1, T2, T3>::type ibeta_inv(T1 a, T2 b, T3 p) { - return ibeta_inv(a, b, p, static_cast<T1*>(0), policies::policy<>()); + typedef typename tools::promote_args<T1, T2, T3>::type result_type; + return ibeta_inv(a, b, p, static_cast<result_type*>(0), policies::policy<>()); } template <class T1, class T2, class T3, class Policy> inline typename tools::promote_args<T1, T2, T3>::type ibeta_inv(T1 a, T2 b, T3 p, const Policy& pol) { - return ibeta_inv(a, b, p, static_cast<T1*>(0), pol); + typedef typename tools::promote_args<T1, T2, T3>::type result_type; + return ibeta_inv(a, b, p, static_cast<result_type*>(0), pol); } template <class T1, class T2, class T3, class T4, class Policy> @@ -892,11 +941,11 @@ inline typename tools::promote_args<T1, T2, T3, T4>::type policies::assert_undefined<> >::type forwarding_policy; if(a <= 0) - policies::raise_domain_error<result_type>(function, "The argument a to the incomplete beta function inverse must be greater than zero (got a=%1%).", a, pol); + return policies::raise_domain_error<result_type>(function, "The argument a to the incomplete beta function inverse must be greater than zero (got a=%1%).", a, pol); if(b <= 0) - policies::raise_domain_error<result_type>(function, "The argument b to the incomplete beta function inverse must be greater than zero (got b=%1%).", b, pol); + return policies::raise_domain_error<result_type>(function, "The argument b to the incomplete beta function inverse must be greater than zero (got b=%1%).", b, pol); if((q < 0) || (q > 1)) - policies::raise_domain_error<result_type>(function, "Argument q outside the range [0,1] in the incomplete beta function inverse (got q=%1%).", q, pol); + return policies::raise_domain_error<result_type>(function, "Argument q outside the range [0,1] in the incomplete beta function inverse (got q=%1%).", q, pol); value_type rx, ry; @@ -922,16 +971,16 @@ template <class RT1, class RT2, class RT3> inline typename tools::promote_args<RT1, RT2, RT3>::type ibetac_inv(RT1 a, RT2 b, RT3 q) { - typedef typename remove_cv<RT1>::type dummy; - return ibetac_inv(a, b, q, static_cast<dummy*>(0), policies::policy<>()); + typedef typename tools::promote_args<RT1, RT2, RT3>::type result_type; + return ibetac_inv(a, b, q, static_cast<result_type*>(0), policies::policy<>()); } template <class RT1, class RT2, class RT3, class Policy> inline typename tools::promote_args<RT1, RT2, RT3>::type ibetac_inv(RT1 a, RT2 b, RT3 q, const Policy& pol) { - typedef typename remove_cv<RT1>::type dummy; - return ibetac_inv(a, b, q, static_cast<dummy*>(0), pol); + typedef typename tools::promote_args<RT1, RT2, RT3>::type result_type; + return ibetac_inv(a, b, q, static_cast<result_type*>(0), pol); } } // namespace math diff --git a/boost/math/special_functions/detail/igamma_inverse.hpp b/boost/math/special_functions/detail/igamma_inverse.hpp index 53875ff83e..fd0189ca6d 100644 --- a/boost/math/special_functions/detail/igamma_inverse.hpp +++ b/boost/math/special_functions/detail/igamma_inverse.hpp @@ -281,11 +281,11 @@ T find_inverse_gamma(T a, T p, T q, const Policy& pol, bool* p_has_10_digits) // DiDonato and Morris Eq 35: T v = log(p) + boost::math::lgamma(ap1, pol); z = exp((v + w) / a); - s = boost::math::log1p(z / ap1 * (1 + z / ap2)); + s = boost::math::log1p(z / ap1 * (1 + z / ap2), pol); z = exp((v + z - s) / a); - s = boost::math::log1p(z / ap1 * (1 + z / ap2)); + s = boost::math::log1p(z / ap1 * (1 + z / ap2), pol); z = exp((v + z - s) / a); - s = boost::math::log1p(z / ap1 * (1 + z / ap2 * (1 + z / (a + 3)))); + s = boost::math::log1p(z / ap1 * (1 + z / ap2 * (1 + z / (a + 3))), pol); z = exp((v + z - s) / a); BOOST_MATH_INSTRUMENT_VARIABLE(z); } @@ -341,7 +341,7 @@ struct gamma_p_inverse_func // flag is set, then Q(x) - q and it's derivatives. // typedef typename policies::evaluation<T, Policy>::type value_type; - typedef typename lanczos::lanczos<T, Policy>::type evaluation_type; + // typedef typename lanczos::lanczos<T, Policy>::type evaluation_type; typedef typename policies::normalise< Policy, policies::promote_float<false>, @@ -378,7 +378,7 @@ struct gamma_p_inverse_func f2 = -f2; } - return boost::math::make_tuple(f - p, f1, f2); + return boost::math::make_tuple(static_cast<T>(f - p), f1, f2); } private: T a, p; @@ -396,11 +396,11 @@ T gamma_p_inv_imp(T a, T p, const Policy& pol) BOOST_MATH_INSTRUMENT_VARIABLE(p); if(a <= 0) - policies::raise_domain_error<T>(function, "Argument a in the incomplete gamma function inverse must be >= 0 (got a=%1%).", a, pol); + return policies::raise_domain_error<T>(function, "Argument a in the incomplete gamma function inverse must be >= 0 (got a=%1%).", a, pol); if((p < 0) || (p > 1)) - policies::raise_domain_error<T>(function, "Probabilty must be in the range [0,1] in the incomplete gamma function inverse (got p=%1%).", p, pol); + return policies::raise_domain_error<T>(function, "Probabilty must be in the range [0,1] in the incomplete gamma function inverse (got p=%1%).", p, pol); if(p == 1) - return tools::max_value<T>(); + return policies::raise_overflow_error<T>(function, 0, Policy()); if(p == 0) return 0; bool has_10_digits; @@ -456,11 +456,11 @@ T gamma_q_inv_imp(T a, T q, const Policy& pol) static const char* function = "boost::math::gamma_q_inv<%1%>(%1%, %1%)"; if(a <= 0) - policies::raise_domain_error<T>(function, "Argument a in the incomplete gamma function inverse must be >= 0 (got a=%1%).", a, pol); + return policies::raise_domain_error<T>(function, "Argument a in the incomplete gamma function inverse must be >= 0 (got a=%1%).", a, pol); if((q < 0) || (q > 1)) - policies::raise_domain_error<T>(function, "Probabilty must be in the range [0,1] in the incomplete gamma function inverse (got q=%1%).", q, pol); + return policies::raise_domain_error<T>(function, "Probabilty must be in the range [0,1] in the incomplete gamma function inverse (got q=%1%).", q, pol); if(q == 0) - return tools::max_value<T>(); + return policies::raise_overflow_error<T>(function, 0, Policy()); if(q == 1) return 0; bool has_10_digits; diff --git a/boost/math/special_functions/detail/lanczos_sse2.hpp b/boost/math/special_functions/detail/lanczos_sse2.hpp index f8846bf376..edef3a0412 100644 --- a/boost/math/special_functions/detail/lanczos_sse2.hpp +++ b/boost/math/special_functions/detail/lanczos_sse2.hpp @@ -51,11 +51,11 @@ inline double lanczos13m53::lanczos_sum<double>(const double& x) static_cast<double>(23531376880.41075968857200767445163675473L), static_cast<double>(0u) }; - register __m128d vx = _mm_load1_pd(&x); - register __m128d sum_even = _mm_load_pd(coeff); - register __m128d sum_odd = _mm_load_pd(coeff+2); - register __m128d nc_odd, nc_even; - register __m128d vx2 = _mm_mul_pd(vx, vx); + __m128d vx = _mm_load1_pd(&x); + __m128d sum_even = _mm_load_pd(coeff); + __m128d sum_odd = _mm_load_pd(coeff+2); + __m128d nc_odd, nc_even; + __m128d vx2 = _mm_mul_pd(vx, vx); sum_even = _mm_mul_pd(sum_even, vx2); nc_even = _mm_load_pd(coeff + 4); @@ -136,11 +136,11 @@ inline double lanczos13m53::lanczos_sum_expG_scaled<double>(const double& x) static_cast<double>(56906521.91347156388090791033559122686859L), static_cast<double>(0u) }; - register __m128d vx = _mm_load1_pd(&x); - register __m128d sum_even = _mm_load_pd(coeff); - register __m128d sum_odd = _mm_load_pd(coeff+2); - register __m128d nc_odd, nc_even; - register __m128d vx2 = _mm_mul_pd(vx, vx); + __m128d vx = _mm_load1_pd(&x); + __m128d sum_even = _mm_load_pd(coeff); + __m128d sum_odd = _mm_load_pd(coeff+2); + __m128d nc_odd, nc_even; + __m128d vx2 = _mm_mul_pd(vx, vx); sum_even = _mm_mul_pd(sum_even, vx2); nc_even = _mm_load_pd(coeff + 4); diff --git a/boost/math/special_functions/detail/lgamma_small.hpp b/boost/math/special_functions/detail/lgamma_small.hpp index ec28ed2adf..e65f8b7e98 100644 --- a/boost/math/special_functions/detail/lgamma_small.hpp +++ b/boost/math/special_functions/detail/lgamma_small.hpp @@ -87,7 +87,7 @@ T lgamma_small_imp(T z, T zm1, T zm2, const mpl::int_<64>&, const Policy& /* l * static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, -0.324588649825948492091e-4)) }; static const T Q[] = { - static_cast<T>(0.1e1), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 0.1e1)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 0.196202987197795200688e1)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 0.148019669424231326694e1)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 0.541391432071720958364e0)), @@ -198,7 +198,7 @@ T lgamma_small_imp(T z, T zm1, T zm2, const mpl::int_<64>&, const Policy& /* l * static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 0.431171342679297331241e-3)) }; static const T Q[] = { - static_cast<T>(0.1e1), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 0.1e1)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, -0.150169356054485044494e1)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, 0.846973248876495016101e0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 64, -0.220095151814995745555e0)), @@ -278,7 +278,7 @@ T lgamma_small_imp(T z, T zm1, T zm2, const mpl::int_<113>&, const Policy& /* l BOOST_MATH_BIG_CONSTANT(T, 113, -0.70529798686542184668416911331718963364e-8) }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 2.5877485070422317542808137697939233685), BOOST_MATH_BIG_CONSTANT(T, 113, 2.8797959228352591788629602533153837126), BOOST_MATH_BIG_CONSTANT(T, 113, 1.8030885955284082026405495275461180977), @@ -357,7 +357,7 @@ T lgamma_small_imp(T z, T zm1, T zm2, const mpl::int_<113>&, const Policy& /* l BOOST_MATH_BIG_CONSTANT(T, 113, 0.13680157145361387405588201461036338274e-8) }; static const T Q[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 4.9106336261005990534095838574132225599), BOOST_MATH_BIG_CONSTANT(T, 113, 10.258804800866438510889341082793078432), BOOST_MATH_BIG_CONSTANT(T, 113, 11.88588976846826108836629960537466889), @@ -408,7 +408,7 @@ T lgamma_small_imp(T z, T zm1, T zm2, const mpl::int_<113>&, const Policy& /* l BOOST_MATH_BIG_CONSTANT(T, 113, 0.8207548771933585614380644961342925976e-6) }; static const T Q[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, -2.9629552288944259229543137757200262073), BOOST_MATH_BIG_CONSTANT(T, 113, 3.7118380799042118987185957298964772755), BOOST_MATH_BIG_CONSTANT(T, 113, -2.5569815272165399297600586376727357187), @@ -449,7 +449,7 @@ T lgamma_small_imp(T z, T zm1, T zm2, const mpl::int_<113>&, const Policy& /* l BOOST_MATH_BIG_CONSTANT(T, 113, 0.13240510580220763969511741896361984162e-6) }; static const T Q[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, -2.4240003754444040525462170802796471996), BOOST_MATH_BIG_CONSTANT(T, 113, 2.4868383476933178722203278602342786002), BOOST_MATH_BIG_CONSTANT(T, 113, -1.4047068395206343375520721509193698547), diff --git a/boost/math/special_functions/detail/round_fwd.hpp b/boost/math/special_functions/detail/round_fwd.hpp index 952259ae93..8c45a7d75a 100644 --- a/boost/math/special_functions/detail/round_fwd.hpp +++ b/boost/math/special_functions/detail/round_fwd.hpp @@ -9,6 +9,7 @@ #define BOOST_MATH_SPECIAL_ROUND_FWD_HPP #include <boost/config.hpp> +#include <boost/math/tools/promotion.hpp> #ifdef _MSC_VER #pragma once @@ -20,9 +21,9 @@ namespace boost { template <class T, class Policy> - T trunc(const T& v, const Policy& pol); + typename tools::promote_args<T>::type trunc(const T& v, const Policy& pol); template <class T> - T trunc(const T& v); + typename tools::promote_args<T>::type trunc(const T& v); template <class T, class Policy> int itrunc(const T& v, const Policy& pol); template <class T> @@ -38,9 +39,9 @@ namespace boost boost::long_long_type lltrunc(const T& v); #endif template <class T, class Policy> - T round(const T& v, const Policy& pol); + typename tools::promote_args<T>::type round(const T& v, const Policy& pol); template <class T> - T round(const T& v); + typename tools::promote_args<T>::type round(const T& v); template <class T, class Policy> int iround(const T& v, const Policy& pol); template <class T> @@ -76,5 +77,17 @@ namespace boost } } + +#undef BOOST_MATH_STD_USING +#define BOOST_MATH_STD_USING BOOST_MATH_STD_USING_CORE\ + using boost::math::round;\ + using boost::math::iround;\ + using boost::math::lround;\ + using boost::math::trunc;\ + using boost::math::itrunc;\ + using boost::math::ltrunc;\ + using boost::math::modf; + + #endif // BOOST_MATH_SPECIAL_ROUND_FWD_HPP diff --git a/boost/math/special_functions/detail/t_distribution_inv.hpp b/boost/math/special_functions/detail/t_distribution_inv.hpp index 4e0d2d1b79..72f6f0c646 100644 --- a/boost/math/special_functions/detail/t_distribution_inv.hpp +++ b/boost/math/special_functions/detail/t_distribution_inv.hpp @@ -372,7 +372,13 @@ T inverse_students_t(T df, T u, T v, const Policy& pol, bool* pexact = 0) else { calculate_real: - if(df < 3) + if(df > 0x10000000) + { + result = -boost::math::erfc_inv(2 * u, pol) * constants::root_two<T>(); + if((pexact) && (df >= 1e20)) + *pexact = true; + } + else if(df < 3) { // // Use a roughly linear scheme to choose between Shaw's @@ -395,7 +401,7 @@ calculate_real: // where we use Shaw's tail series. // The crossover point is roughly exponential in -df: // - T crossover = ldexp(1.0f, iround(T(df / -0.654f), pol)); + T crossover = ldexp(1.0f, iround(T(df / -0.654f), typename policies::normalise<Policy, policies::rounding_error<policies::ignore_error> >::type())); if(u > crossover) { result = boost::math::detail::inverse_students_t_hill(df, u, pol); @@ -410,15 +416,14 @@ calculate_real: } template <class T, class Policy> -inline T find_ibeta_inv_from_t_dist(T a, T p, T q, T* py, const Policy& pol) +inline T find_ibeta_inv_from_t_dist(T a, T p, T /*q*/, T* py, const Policy& pol) { - T u = (p > q) ? T(0.5f - q) / T(2) : T(p / 2); - T v = 1 - u; // u < 0.5 so no cancellation error + T u = p / 2; + T v = 1 - u; T df = a * 2; T t = boost::math::detail::inverse_students_t(df, u, v, pol); - T x = df / (df + t * t); *py = t * t / (df + t * t); - return x; + return df / (df + t * t); } template <class T, class Policy> diff --git a/boost/math/special_functions/detail/unchecked_bernoulli.hpp b/boost/math/special_functions/detail/unchecked_bernoulli.hpp new file mode 100644 index 0000000000..03c376678d --- /dev/null +++ b/boost/math/special_functions/detail/unchecked_bernoulli.hpp @@ -0,0 +1,700 @@ + +/////////////////////////////////////////////////////////////////////////////// +// Copyright 2013 Nikhar Agrawal +// Copyright 2013 Christopher Kormanyos +// Copyright 2013 John Maddock +// Copyright 2013 Paul Bristow +// Distributed under the Boost +// Software License, Version 1.0. (See accompanying file +// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) + +#ifndef BOOST_MATH_UNCHECKED_BERNOULLI_HPP +#define BOOST_MATH_UNCHECKED_BERNOULLI_HPP + +#include <limits> +#include <cmath> +#include <boost/math/policies/error_handling.hpp> +#include <boost/math/constants/constants.hpp> +#include <boost/math/special_functions/math_fwd.hpp> +#include <boost/mpl/int.hpp> +#include <boost/type_traits/is_convertible.hpp> + +namespace boost { namespace math { + +namespace detail { + +template <unsigned N> +struct max_bernoulli_index +{ + BOOST_STATIC_CONSTANT(unsigned, value = 17); +}; + +template <> +struct max_bernoulli_index<1> +{ + BOOST_STATIC_CONSTANT(unsigned, value = 32); +}; + +template <> +struct max_bernoulli_index<2> +{ + BOOST_STATIC_CONSTANT(unsigned, value = 129); +}; + +template <> +struct max_bernoulli_index<3> +{ + BOOST_STATIC_CONSTANT(unsigned, value = 1156); +}; + +template <> +struct max_bernoulli_index<4> +{ + BOOST_STATIC_CONSTANT(unsigned, value = 11); +}; + +template <class T> +struct bernoulli_imp_variant +{ + static const unsigned value = + (std::numeric_limits<T>::max_exponent == 128) + && (std::numeric_limits<T>::radix == 2) + && (std::numeric_limits<T>::digits <= std::numeric_limits<float>::digits) + && (boost::is_convertible<float, T>::value) ? 1 : + ( + (std::numeric_limits<T>::max_exponent == 1024) + && (std::numeric_limits<T>::radix == 2) + && (std::numeric_limits<T>::digits <= std::numeric_limits<double>::digits) + && (boost::is_convertible<double, T>::value) ? 2 : + ( + (std::numeric_limits<T>::max_exponent == 16384) + && (std::numeric_limits<T>::radix == 2) + && (std::numeric_limits<T>::digits <= std::numeric_limits<long double>::digits) + && (boost::is_convertible<long double, T>::value) ? 3 : (!is_convertible<boost::int64_t, T>::value ? 4 : 0) + ) + ); +}; + +} // namespace detail + +template <class T> +struct max_bernoulli_b2n : public detail::max_bernoulli_index<detail::bernoulli_imp_variant<T>::value>{}; + +namespace detail{ + +template <class T> +inline T unchecked_bernoulli_imp(std::size_t n, const mpl::int_<0>& ) +{ + static const boost::array<boost::int64_t, 1 + max_bernoulli_b2n<T>::value> numerators = + {{ + boost::int64_t( +1LL), + boost::int64_t( +1LL), + boost::int64_t( -1LL), + boost::int64_t( +1LL), + boost::int64_t( -1LL), + boost::int64_t( +5LL), + boost::int64_t( -691LL), + boost::int64_t( +7LL), + boost::int64_t( -3617LL), + boost::int64_t( +43867LL), + boost::int64_t( -174611LL), + boost::int64_t( +854513LL), + boost::int64_t( -236364091LL), + boost::int64_t( +8553103LL), + boost::int64_t( -23749461029LL), + boost::int64_t(+8615841276005LL), + boost::int64_t(-7709321041217LL), + boost::int64_t(+2577687858367LL) + }}; + + static const boost::array<boost::int64_t, 1 + max_bernoulli_b2n<T>::value> denominators = + {{ + boost::int64_t( 1LL), + boost::int64_t( 6LL), + boost::int64_t( 30LL), + boost::int64_t( 42LL), + boost::int64_t( 30LL), + boost::int64_t( 66LL), + boost::int64_t( 2730LL), + boost::int64_t( 6LL), + boost::int64_t( 510LL), + boost::int64_t( 798LL), + boost::int64_t( 330LL), + boost::int64_t( 138LL), + boost::int64_t( 2730LL), + boost::int64_t( 6LL), + boost::int64_t( 870LL), + boost::int64_t( 14322LL), + boost::int64_t( 510LL), + boost::int64_t( 6LL) + }}; + return T(numerators[n]) / denominators[n]; +} + +template <class T> +inline T unchecked_bernoulli_imp(std::size_t n, const mpl::int_<1>& ) +{ + static const boost::array<float, 1 + max_bernoulli_b2n<T>::value> bernoulli_data = + {{ + +1.00000000000000000000000000000000000000000F, + +0.166666666666666666666666666666666666666667F, + -0.0333333333333333333333333333333333333333333F, + +0.0238095238095238095238095238095238095238095F, + -0.0333333333333333333333333333333333333333333F, + +0.0757575757575757575757575757575757575757576F, + -0.253113553113553113553113553113553113553114F, + +1.16666666666666666666666666666666666666667F, + -7.09215686274509803921568627450980392156863F, + +54.9711779448621553884711779448621553884712F, + -529.124242424242424242424242424242424242424F, + +6192.12318840579710144927536231884057971014F, + -86580.2531135531135531135531135531135531136F, + +1.42551716666666666666666666666666666666667e6F, + -2.72982310678160919540229885057471264367816e7F, + +6.01580873900642368384303868174835916771401e8F, + -1.51163157670921568627450980392156862745098e10F, + +4.29614643061166666666666666666666666666667e11F, + -1.37116552050883327721590879485616327721591e13F, + +4.88332318973593166666666666666666666666667e14F, + -1.92965793419400681486326681448632668144863e16F, + +8.41693047573682615000553709856035437430786e17F, + -4.03380718540594554130768115942028985507246e19F, + +2.11507486380819916056014539007092198581560e21F, + -1.20866265222965259346027311937082525317819e23F, + +7.50086674607696436685572007575757575757576e24F, + -5.03877810148106891413789303052201257861635e26F, + +3.65287764848181233351104308429711779448622e28F, + -2.84987693024508822262691464329106781609195e30F, + +2.38654274996836276446459819192192149717514e32F, + -2.13999492572253336658107447651910973926742e34F, + +2.05009757234780975699217330956723102516667e36F, + -2.09380059113463784090951852900279701847092e38F, + }}; + + return bernoulli_data[n]; +} + + +template <class T> +inline T unchecked_bernoulli_imp(std::size_t n, const mpl::int_<2>& ) +{ + static const boost::array<double, 1 + max_bernoulli_b2n<T>::value> bernoulli_data = + {{ + +1.00000000000000000000000000000000000000000, + +0.166666666666666666666666666666666666666667, + -0.0333333333333333333333333333333333333333333, + +0.0238095238095238095238095238095238095238095, + -0.0333333333333333333333333333333333333333333, + +0.0757575757575757575757575757575757575757576, + -0.253113553113553113553113553113553113553114, + +1.16666666666666666666666666666666666666667, + -7.09215686274509803921568627450980392156863, + +54.9711779448621553884711779448621553884712, + -529.124242424242424242424242424242424242424, + +6192.12318840579710144927536231884057971014, + -86580.2531135531135531135531135531135531136, + +1.42551716666666666666666666666666666666667e6, + -2.72982310678160919540229885057471264367816e7, + +6.01580873900642368384303868174835916771401e8, + -1.51163157670921568627450980392156862745098e10, + +4.29614643061166666666666666666666666666667e11, + -1.37116552050883327721590879485616327721591e13, + +4.88332318973593166666666666666666666666667e14, + -1.92965793419400681486326681448632668144863e16, + +8.41693047573682615000553709856035437430786e17, + -4.03380718540594554130768115942028985507246e19, + +2.11507486380819916056014539007092198581560e21, + -1.20866265222965259346027311937082525317819e23, + +7.50086674607696436685572007575757575757576e24, + -5.03877810148106891413789303052201257861635e26, + +3.65287764848181233351104308429711779448622e28, + -2.84987693024508822262691464329106781609195e30, + +2.38654274996836276446459819192192149717514e32, + -2.13999492572253336658107447651910973926742e34, + +2.05009757234780975699217330956723102516667e36, + -2.09380059113463784090951852900279701847092e38, + +2.27526964884635155596492603527692645814700e40, + -2.62577102862395760473030497361582020814490e42, + +3.21250821027180325182047923042649852435219e44, + -4.15982781667947109139170744952623589366896e46, + +5.69206954820352800238834562191210586444805e48, + -8.21836294197845756922906534686173330145509e50, + +1.25029043271669930167323398297028955241772e53, + -2.00155832332483702749253291988132987687242e55, + +3.36749829153643742333966769033387530162196e57, + -5.94709705031354477186604968440515408405791e59, + +1.10119103236279775595641307904376916046305e62, + -2.13552595452535011886583850190410656789733e64, + +4.33288969866411924196166130593792062184514e66, + -9.18855282416693282262005552155018971389604e68, + +2.03468967763290744934550279902200200659751e71, + -4.70038339580357310785752555350060606545967e73, + +1.13180434454842492706751862577339342678904e76, + -2.83822495706937069592641563364817647382847e78, + +7.40642489796788506297508271409209841768797e80, + -2.00964548027566044834656196727153631868673e83, + +5.66571700508059414457193460305193569614195e85, + -1.65845111541362169158237133743199123014950e88, + +5.03688599504923774192894219151801548124424e90, + -1.58614682376581863693634015729664387827410e93, + +5.17567436175456269840732406825071225612408e95, + -1.74889218402171173396900258776181591451415e98, + +6.11605199949521852558245252642641677807677e100, + -2.21227769127078349422883234567129324455732e103, + +8.27227767987709698542210624599845957312047e105, + -3.19589251114157095835916343691808148735263e108, + +1.27500822233877929823100243029266798669572e111, + -5.25009230867741338994028246245651754469199e113, + +2.23018178942416252098692981988387281437383e116, + -9.76845219309552044386335133989802393011669e118, + +4.40983619784529542722726228748131691918758e121, + -2.05085708864640888397293377275830154864566e124, + +9.82144332797912771075729696020975210414919e126, + -4.84126007982088805087891967099634127611305e129, + +2.45530888014809826097834674040886903996737e132, + -1.28069268040847475487825132786017857218118e135, + +6.86761671046685811921018885984644004360924e137, + -3.78464685819691046949789954163795568144895e140, + +2.14261012506652915508713231351482720966602e143, + -1.24567271371836950070196429616376072194583e146, + +7.43457875510001525436796683940520613117807e148, + -4.55357953046417048940633332233212748767721e151, + +2.86121128168588683453638472510172325229190e154, + -1.84377235520338697276882026536287854875414e157, + +1.21811545362210466995013165065995213558174e160, + -8.24821871853141215484818457296893447301419e162, + +5.72258779378329433296516498142978615918685e165, + -4.06685305250591047267679693831158655602196e168, + +2.95960920646420500628752695815851870426379e171, + -2.20495225651894575090311752273445984836379e174, + +1.68125970728895998058311525151360665754464e177, + -1.31167362135569576486452806355817153004431e180, + +1.04678940094780380821832853929823089643829e183, + -8.54328935788337077185982546299082774593270e185, + +7.12878213224865423522884066771438224721245e188, + -6.08029314555358993000847118686477458461988e191, + +5.29967764248499239300942910043247266228490e194, + -4.71942591687458626443646229013379911103761e197, + +4.29284137914029810894168296541074669045521e200, + -3.98767449682322074434477655542938795106651e203, + +3.78197804193588827138944181161393327898220e206, + -3.66142336836811912436858082151197348755196e209, + +3.61760902723728623488554609298914089477541e212, + -3.64707726451913543621383088655499449048682e215, + +3.75087554364544090983452410104814189306842e218, + -3.93458672964390282694891288533713429355657e221, + +4.20882111481900820046571171111494898242731e224, + -4.59022962206179186559802940573325591059371e227, + +5.10317257726295759279198185106496768539760e230, + -5.78227623036569554015377271242917142512200e233, + +6.67624821678358810322637794412809363451080e236, + -7.85353076444504163225916259639312444428230e239, + +9.41068940670587255245443288258762485293948e242, + -1.14849338734651839938498599206805592548354e246, + +1.42729587428487856771416320087122499897180e249, + -1.80595595869093090142285728117654560926719e252, + +2.32615353076608052161297985184708876161736e255, + -3.04957517154995947681942819261542593785327e258, + +4.06858060764339734424012124124937318633684e261, + -5.52310313219743616252320044093186392324280e264, + +7.62772793964343924869949690204961215533859e267, + -1.07155711196978863132793524001065396932667e271, + +1.53102008959691884453440916153355334355847e274, + -2.22448916821798346676602348865048510824835e277, + +3.28626791906901391668189736436895275365183e280, + -4.93559289559603449020711938191575963496999e283, + +7.53495712008325067212266049779283956727824e286, + -1.16914851545841777278088924731655041783900e290, + +1.84352614678389394126646201597702232396492e293, + -2.95368261729680829728014917350525183485207e296, + +4.80793212775015697668878704043264072227967e299, + -7.95021250458852528538243631671158693036798e302, + +1.33527841873546338750122832017820518292039e306 + }}; + + return bernoulli_data[n]; +} + +template <class T> +inline T unchecked_bernoulli_imp(std::size_t n, const mpl::int_<3>& ) +{ + static const boost::array<long double, 1 + max_bernoulli_b2n<T>::value> bernoulli_data = + {{ + +1.00000000000000000000000000000000000000000L, + +0.166666666666666666666666666666666666666667L, + -0.0333333333333333333333333333333333333333333L, + +0.0238095238095238095238095238095238095238095L, + -0.0333333333333333333333333333333333333333333L, + +0.0757575757575757575757575757575757575757576L, + -0.253113553113553113553113553113553113553114L, + +1.16666666666666666666666666666666666666667L, + -7.09215686274509803921568627450980392156863L, + +54.9711779448621553884711779448621553884712L, + -529.124242424242424242424242424242424242424L, + +6192.12318840579710144927536231884057971014L, + -86580.2531135531135531135531135531135531136L, + +1.42551716666666666666666666666666666666667E6L, + -2.72982310678160919540229885057471264367816E7L, + +6.01580873900642368384303868174835916771401E8L, + -1.51163157670921568627450980392156862745098E10L, + +4.29614643061166666666666666666666666666667E11L, + -1.37116552050883327721590879485616327721591E13L, + +4.88332318973593166666666666666666666666667E14L, + -1.92965793419400681486326681448632668144863E16L, + +8.41693047573682615000553709856035437430786E17L, + -4.03380718540594554130768115942028985507246E19L, + +2.11507486380819916056014539007092198581560E21L, + -1.20866265222965259346027311937082525317819E23L, + +7.50086674607696436685572007575757575757576E24L, + -5.03877810148106891413789303052201257861635E26L, + +3.65287764848181233351104308429711779448622E28L, + -2.84987693024508822262691464329106781609195E30L, + +2.38654274996836276446459819192192149717514E32L, + -2.13999492572253336658107447651910973926742E34L, + +2.05009757234780975699217330956723102516667E36L, + -2.09380059113463784090951852900279701847092E38L, + +2.27526964884635155596492603527692645814700E40L, + -2.62577102862395760473030497361582020814490E42L, + +3.21250821027180325182047923042649852435219E44L, + -4.15982781667947109139170744952623589366896E46L, + +5.69206954820352800238834562191210586444805E48L, + -8.21836294197845756922906534686173330145509E50L, + +1.25029043271669930167323398297028955241772E53L, + -2.00155832332483702749253291988132987687242E55L, + +3.36749829153643742333966769033387530162196E57L, + -5.94709705031354477186604968440515408405791E59L, + +1.10119103236279775595641307904376916046305E62L, + -2.13552595452535011886583850190410656789733E64L, + +4.33288969866411924196166130593792062184514E66L, + -9.18855282416693282262005552155018971389604E68L, + +2.03468967763290744934550279902200200659751E71L, + -4.70038339580357310785752555350060606545967E73L, + +1.13180434454842492706751862577339342678904E76L, + -2.83822495706937069592641563364817647382847E78L, + +7.40642489796788506297508271409209841768797E80L, + -2.00964548027566044834656196727153631868673E83L, + +5.66571700508059414457193460305193569614195E85L, + -1.65845111541362169158237133743199123014950E88L, + +5.03688599504923774192894219151801548124424E90L, + -1.58614682376581863693634015729664387827410E93L, + +5.17567436175456269840732406825071225612408E95L, + -1.74889218402171173396900258776181591451415E98L, + +6.11605199949521852558245252642641677807677E100L, + -2.21227769127078349422883234567129324455732E103L, + +8.27227767987709698542210624599845957312047E105L, + -3.19589251114157095835916343691808148735263E108L, + +1.27500822233877929823100243029266798669572E111L, + -5.25009230867741338994028246245651754469199E113L, + +2.23018178942416252098692981988387281437383E116L, + -9.76845219309552044386335133989802393011669E118L, + +4.40983619784529542722726228748131691918758E121L, + -2.05085708864640888397293377275830154864566E124L, + +9.82144332797912771075729696020975210414919E126L, + -4.84126007982088805087891967099634127611305E129L, + +2.45530888014809826097834674040886903996737E132L, + -1.28069268040847475487825132786017857218118E135L, + +6.86761671046685811921018885984644004360924E137L, + -3.78464685819691046949789954163795568144895E140L, + +2.14261012506652915508713231351482720966602E143L, + -1.24567271371836950070196429616376072194583E146L, + +7.43457875510001525436796683940520613117807E148L, + -4.55357953046417048940633332233212748767721E151L, + +2.86121128168588683453638472510172325229190E154L, + -1.84377235520338697276882026536287854875414E157L, + +1.21811545362210466995013165065995213558174E160L, + -8.24821871853141215484818457296893447301419E162L, + +5.72258779378329433296516498142978615918685E165L, + -4.06685305250591047267679693831158655602196E168L, + +2.95960920646420500628752695815851870426379E171L, + -2.20495225651894575090311752273445984836379E174L, + +1.68125970728895998058311525151360665754464E177L, + -1.31167362135569576486452806355817153004431E180L, + +1.04678940094780380821832853929823089643829E183L, + -8.54328935788337077185982546299082774593270E185L, + +7.12878213224865423522884066771438224721245E188L, + -6.08029314555358993000847118686477458461988E191L, + +5.29967764248499239300942910043247266228490E194L, + -4.71942591687458626443646229013379911103761E197L, + +4.29284137914029810894168296541074669045521E200L, + -3.98767449682322074434477655542938795106651E203L, + +3.78197804193588827138944181161393327898220E206L, + -3.66142336836811912436858082151197348755196E209L, + +3.61760902723728623488554609298914089477541E212L, + -3.64707726451913543621383088655499449048682E215L, + +3.75087554364544090983452410104814189306842E218L, + -3.93458672964390282694891288533713429355657E221L, + +4.20882111481900820046571171111494898242731E224L, + -4.59022962206179186559802940573325591059371E227L, + +5.10317257726295759279198185106496768539760E230L, + -5.78227623036569554015377271242917142512200E233L, + +6.67624821678358810322637794412809363451080E236L, + -7.85353076444504163225916259639312444428230E239L, + +9.41068940670587255245443288258762485293948E242L, + -1.14849338734651839938498599206805592548354E246L, + +1.42729587428487856771416320087122499897180E249L, + -1.80595595869093090142285728117654560926719E252L, + +2.32615353076608052161297985184708876161736E255L, + -3.04957517154995947681942819261542593785327E258L, + +4.06858060764339734424012124124937318633684E261L, + -5.52310313219743616252320044093186392324280E264L, + +7.62772793964343924869949690204961215533859E267L, + -1.07155711196978863132793524001065396932667E271L, + +1.53102008959691884453440916153355334355847E274L, + -2.22448916821798346676602348865048510824835E277L, + +3.28626791906901391668189736436895275365183E280L, + -4.93559289559603449020711938191575963496999E283L, + +7.53495712008325067212266049779283956727824E286L, + -1.16914851545841777278088924731655041783900E290L, + +1.84352614678389394126646201597702232396492E293L, + -2.95368261729680829728014917350525183485207E296L, + +4.80793212775015697668878704043264072227967E299L, + -7.95021250458852528538243631671158693036798E302L, + +1.33527841873546338750122832017820518292039E306L, +#if LDBL_MAX_EXP == 16384 + // Entries 260 - 600 http://www.wolframalpha.com/input/?i=TABLE[N[Bernoulli[i]%2C40]%2C+{i%2C258%2C600%2C2}] + -2.277640649601959593875058983506938037019e309L, + 3.945184036046326234163525556422667595884e312L, + -6.938525772130602106071724989641405550473e315L, + 1.238896367577564823729057820219210929986e319L, + -2.245542599169309759499987966025604480745e322L, + 4.131213176073842359732511639489669404266e325L, + -7.713581346815269584960928069762882771369e328L, + 1.461536066837669600638613788471335541313e332L, + -2.809904606225532896862935642992712059631e335L, + 5.480957121318876639512096994413992284327e338L, + -1.084573284087686110518125291186079616320e342L, + 2.176980775647663539729165173863716459962e345L, + -4.431998786117553751947439433256752608068e348L, + 9.150625657715535047417756278073770096073e351L, + -1.915867353003157351316577579148683133613e355L, + 4.067256303542212258698836003682016040629e358L, + -8.754223791037736616228150209910348734629e361L, + 1.910173688735533667244373747124109379826e365L, + -4.225001320265091714631115064713174404607e368L, + 9.471959352547827678466770796787503034505e371L, + -2.152149973279986829719817376756088198573e375L, + 4.955485775334221051344839716507812871361e378L, + -1.156225941759134696630956889716381968142e382L, + 2.733406597646137698610991926705098514017e385L, + -6.546868135325176947099912523279938546333e388L, + 1.588524912441221472814692121069821695547e392L, + -3.904354800861715180218598151050191841308e395L, + 9.719938686092045781827273411668132975319e398L, + -2.450763621049522051234479737511375679283e402L, + 6.257892098396815305085674126334317095277e405L, + -1.618113552083806592527989531636955084420e409L, + 4.236528795217618357348618613216833722648e412L, + -1.123047068199051008086174989124136878992e416L, + 3.013971787525654770217283559392286666886e419L, + -8.188437573221553030375681429202969070420e422L, + 2.251910591336716809153958146725775718707e426L, + -6.268411292043789823075314151509139413399e429L, + 1.765990845202322642693572112511312471527e433L, + -5.035154436231331651259071296731160882240e436L, + 1.452779356460483245253765356664402207266e440L, + -4.241490890130137339052414960684151515166e443L, + 1.252966001692427774088293833338841893293e447L, + -3.744830047478272947978103227876747240343e450L, + 1.132315806695710930595876001089232216024e454L, + -3.463510845942701805991786197773934662578e457L, + 1.071643382649675572086865465873916611537e461L, + -3.353824475439933688957233489984711465335e464L, + 1.061594257145875875963152734129803268488e468L, + -3.398420969215528955528654193586189805265e471L, + 1.100192502000434096206138068020551065890e475L, + -3.601686379213993374332690210094863486472e478L, + 1.192235170430164900533187239994513019475e482L, + -3.990342751779668381699052942504119409180e485L, + 1.350281800938769780891258894167663309221e489L, + -4.619325443466054312873093650888507562249e492L, + 1.597522243968586548227514639959727696694e496L, + -5.584753729092155108530929002119620487652e499L, + 1.973443623104646193229794524759543752089e503L, + -7.048295441989615807045620880311201930244e506L, + 2.544236702499719094591873151590280263560e510L, + -9.281551595258615205927443367289948150345e513L, + 3.421757163154453657766296828520235351572e517L, + -1.274733639384538364282697627345068947433e521L, + 4.798524805311016034711205886780460173566e524L, + -1.825116948422858388787806917284878870034e528L, + 7.013667442807288452441777981425055613982e531L, + -2.723003862685989740898815670978399383114e535L, + 1.068014853917260290630122222858884658850e539L, + -4.231650952273697842269381683768681118533e542L, + 1.693650052202594386658903598564772900388e546L, + -6.846944855806453360616258582310883597678e549L, + 2.795809132238082267120232174243715559601e553L, + -1.153012972808983269106716828311318981951e557L, + 4.802368854268746357511997492039592697149e560L, + -2.019995255271910836389761734035403905781e564L, + 8.580207235032617856059250643095019760968e567L, + -3.680247942263468164408192134916355198549e571L, + 1.593924457586765331397457407661306895942e575L, + -6.970267175232643679233530367569943057501e578L, + 3.077528087427698518703282907890556154309e582L, + -1.371846760052887888926055417297342106614e586L, + 6.173627360829553396851763207025505289166e589L, + -2.804703130495506384463249394043486916669e593L, + 1.286250900087150126167490951216207186092e597L, + -5.954394420063617872366818601092036543220e600L, + 2.782297785278756426177542270854984091406e604L, + -1.312214674935307746141207680066262384215e608L, + 6.246299145383554153167974732783934504370e611L, + -3.000812007679574430883792565577444226490e615L, + 1.454904877136007844493861746476079537075e619L, + -7.118558521873800304612781121044077357278e622L, + 3.514739820897817389472822276832677887997e626L, + -1.751137068816377401163011262831890828437e630L, + 8.803498091818800678575314081978951179602e633L, + -4.465612911700593572269200981612564161010e637L, + 2.285494565287530681465757798517033542888e641L, + -1.180145168917737098025683613598595411329e645L, + 6.147941849198393232663105284575149616925e648L, + -3.231069156963603593233679426198974663352e652L, + 1.713042725635435041806895849197608270935e656L, + -9.161761363270648920537613435771882898051e659L, + 4.942675965960539112005679080810117766825e663L, + -2.689684712697383518131267222872386600031e667L, + 1.476320014229917759615308193449511534656e671L, + -8.173037740864781506597184122049453514594e674L, + 4.563462313190521363235182420178784459580e678L, + -2.569790015236158475703055501886439298708e682L, + 1.459410219452119981958355737832022375085e686L, + -8.358304882556983795372406183642486436653e689L, + 4.827305091483557818593092377664570208355e693L, + -2.811394311081493166793414157061950132403e697L, + 1.651026863340675349245561261339568827739e701L, + -9.776578579336866764167878646459810047899e704L, + 5.837207965197521880181236529616560780535e708L, + -3.513938957938032127105389702846371181520e712L, + 2.132747371360190507595748444536911078788e716L, + -1.305047363239192640729466563372665311602e720L, + 8.050825342678337497636292798039996484780e723L, + -5.006884161223862543665524155681082112689e727L, + 3.139016066011452177570812014513491361235e731L, + -1.983829535212711378291469356666001365873e735L, + 1.263822427649676371257598052486237628698e739L, + -8.115678659900522918802121684491754629503e742L, + 5.252995164972075271667364371449050412435e746L, + -3.427038125662404660056511738625477058135e750L, + 2.253446011834352733279946306835940729858e754L, + -1.493407341897034717876962786798831719683e758L, + 9.974681322653365118752729509398728354442e761L, + -6.714230142773850863927710112350816379426e765L, + 4.554668668931723346600337564274944733530e769L, + -3.113635386023220127834102980385275379533e773L, + 2.144945411287666204679363498162954050208e777L, + -1.488982121181387164932397544378555256016e781L, + 1.041537218854627455352298173588983048748e785L, + -7.341073881786613676177562822942175683993e788L, + 5.213524272587199574980117351016322518428e792L, + -3.730592531776514409283897139216167197989e796L, + 2.689592876341877079083449497724049500175e800L, + -1.953643788231947582529884602972233135002e804L, + 1.429691073080500563348668321308878246277e808L, + -1.054059177095488639836063073070536825675e812L, + 7.828919160938693948399336431565350676613e815L, + -5.857884457184396382550955498026762014753e819L, + 4.415401588264172474136969345712659422380e823L, + -3.352573884181287635796498822858109969161e827L, + 2.564210385719224000156548240934108974447e831L, + -1.975534392116037602837941409848663077528e835L, + 1.533062123975940045180943006948008486466e839L, + -1.198306160488763291730059994812781226903e843L, + 9.434034267770711698676321369174735725321e846L, + -7.480619200038505368468483892246806488879e850L, + 5.974161898439971564124576801455052907638e854L, + -4.805125663714699771668630995361572639386e858L, + 3.892332138028039952403812726744593073776e862L, + -3.175276505779699340738548328810180869575e866L, + 2.608608681939322393581069188271626122519e870L, + -2.158148554392732439392868052394994052628e874L, + 1.797993483301448477700600221980862686033e878L, + -1.508407575089108597171576068862286462909e882L, + 1.274273406242459482708930389008701147244e886L, + -1.083950475353171986748233157909397370193e890L, + 9.284292630726328432038470356821265395331e893L, + -8.007012115449516364480417355063446317414e897L, + 6.952871948429568933888979915833266241471e901L, + -6.078828929473797621198666799700739891205e905L, + 5.350908089710964244671334224708057812633e909L, + -4.742168072503284973969982758434401589090e913L, + 4.231149239401967697257534662010605751136e917L, + -3.800684612827828851942743291026898158947e921L, + 3.436984796314246158361599955909956583986e925L, + -3.128930718993658356398482705317381808301e929L, + // + // 602-1300: http://www.wolframalpha.com/input/?i=TABLE[N[Bernoulli[i]%2C40]%2C+{i%2C602%2C1300%2C2}] + 2.867524740577223817164663595437919813239e933L, -2.645462974939090580963101220449509725942e937L, 2.456800827789169780295419018499543141869e941L, -2.296690549725790064673528302231294870532e945L, 2.161174697699793265715182091764676666457e949L, -2.047023224586087259305754002882269123194e953L, 1.951604806042481282712736234132803700277e957L, -1.872785206668284042110390583158639495143e961L, 1.808847160923282257302788929692654262867e965L, -1.758427529634609613399327744595257497188e969L, 1.720468488019528147087036246754294757647e973L, -1.694180279355332648057740852839804839425e977L, 1.679013685251183870616469618951463869496e981L, -1.674640861433092946269144173974414945664e985L, 1.680943600147858322148767806987527412112e989L, -1.698008433134805056489370119323402510305e993L, 1.726128304411348354183882648263448448633e997L, -1.765810838736918108045764015629875016219e1001L, 1.817793526882665071123822455897912718293e1005L, -1.883066459765807128944897377914669600374e1009L, 1.962903588035940537938222992228124233567e1013L, -2.058903881920696086033171142046100185783e1017L, 2.173044241735786946064676598703393618281e1021L, -2.307746591425236218893160658331303115253e1025L, 2.465962312241418731528973526597433097256e1029L, -2.651278087802503406316742676403301581549e1033L, 2.868048395658440423778896607880692085708e1037L, -3.121561373094393453726645989392054731637e1041L, 3.418246710091027042099932753084126095820e1045L, -3.765936717592482928796920675282930034018e1049L, 4.174194967165213973474293718362757753877e1053L, -4.654731142471753017867105249805137855862e1057L, 5.221926310090434518253178454907900079787e1061L, -5.893500145664015254409680930288710794031e1065L, 6.691361332576333738130720616841706994101e1069L, -7.642695184575063524608775697714741180954e1073L, 8.781359617440634128952082759434723165820e1077L, -1.014968338800868135594698909567734048618e1082L, 1.180079105471061498849752479044520598414e1086L, -1.380162016721660241308046692646452732446e1090L, 1.623685158291375662775444238282343536948e1094L, -1.921404880943289359290531906131400049399e1098L, 2.287040419533950152851434188305457266969e1102L, -2.738162880206032093123060939173765335255e1106L, 3.297371307848643161532227459901386725801e1110L, -3.993854689967542662299211323085023297602e1114L, 4.865474805885735467044047308902313673643e1118L, -5.961554732739027308247618738765152679497e1122L, 7.346627151757492821447573639763873833441e1126L, -9.105493288459908620636712748727395637965e1130L, 1.135007867626164861991621396462821975167e1135L, -1.422876214067403769204874786137232627418e1139L, 1.793912271573925309173135913914667878908e1143L, -2.274542916104231188526120123855259514144e1147L, 2.900273688809987694128857655036783261991e1151L, -3.719022795563122339874875448447744493398e1155L, 4.795753420982845153626611023078973364321e1159L, -6.218937220186281310109009529226561379773e1163L, 8.109611247999584815668395828940708619394e1167L, -1.063412316303440216539797215354141158589e1172L, 1.402214363674117662460496032135704328989e1176L, -1.859223235464558752766840772026058694872e1180L, 2.478828203789903637835992128856742276028e1184L, -3.323169416193176673655321536761413885767e1188L, 4.479640207312477092938541546776915956580e1192L, -6.071721672924085739424644485636889518799e1196L, 8.274698015123579607850404326757887762270e1200L, -1.133855131459773018024052539697784205966e1205L, 1.562146222050424344025824344480153248984e1209L, -2.163904570724750459592352173471446831752e1213L, 3.013703210722669908901286635073603018696e1217L, -4.219903244242308803914269531001720703294e1221L, 5.940703220571043642186808904696174833998e1225L, -8.408147464216029127243257448169774333631e1229L, 1.196419999747411909144144315499654470715e1234L, -1.711518922741148710381740436694440587059e1238L, 2.461434539630850545757453894977350505251e1242L, -3.558748530932574002484841810677232366801e1246L, 5.172525606281917297657859608800373729529e1250L, -7.557850217376323621984784308774476917753e1254L, 1.110141075986004209769735296234549704181e1259L, -1.639216556732622481406083885926912451281e1263L, 2.433138328152562628385514545400044125983e1267L, -3.630476645219033020888837165221286413171e1271L, 5.445289518636306992942604775585977779418e1275L, -8.209806424989072060381590985042272020067e1279L, 1.244209849774134691374848390346442737613e1284L, -1.895384488692308848372754844910263931874e1288L, 2.902272596647764894203369746806169285113e1292L, -4.466944174025026625137032739317650862593e1296L, 6.910485739507636504313238347702354354916e1300L, -1.074550085668784170644854815272144687769e1305L, 1.679419258904938802199084915274175753529e1309L, -2.638155207645646220849795321076977230763e1313L, 4.165284786632654168563096850610185378233e1317L, -6.609774274649031371770290191295685774584e1321L, 1.054194100570841329575393359295845860860e1326L, -1.689822316104196916970708778265725885275e1330L, 2.722340957904912685605914893019783431164e1334L, -4.407776313964403233676810178851005163725e1338L, 7.172436210641903635864868181569129834361e1342L, -1.172947440100495955246356688225986736990e1347L, 1.927745674072824377954824961348211728006e1351L, -3.184013467435655962214317208087993711563e1355L, 5.285045125125832341263897233405196808096e1359L, -8.815883582819232027207118521581424783107e1363L, 1.477818368424505276711779171224799759099e1368L, -2.489482576496570159333357550363134602876e1372L, 4.214292881345076419678976329218843808204e1376L, -7.169068531615459070909644981451297906220e1380L, 1.225513133750594558180516896275774441895e1385L, -2.105160827387119480607950260289853896637e1389L, 3.633787605672960549893307203363402915249e1393L, -6.302830804027849515239463308430185990705e1397L, 1.098521433860299633481449685364914115468e1402L, -1.923858597401607622723144320370279518600e1406L, 3.385512828549942051667348582951554570164e1410L, -5.986286250836771248147827011780631183980e1414L, 1.063572794668186370728928272374836554300e1419L, -1.898666684876492795233907174493757572290e1423L, 3.405627002840442789235393111726609930533e1427L, -6.137724140284450036591063946055819333244e1431L, 1.111411024660941507986132154479364267486e1436L, -2.022060876221034821890406900217875915949e1440L, 3.696248025817144690840539132103538834108e1444L, -6.788448439024998306316860676030442691610e1448L, 1.252615233049059554031883468823648511657e1453L, -2.322190433141265975888955985950824418729e1457L, 4.325200102353909846882217732999001735342e1461L, -8.093531903011880118699218269369570178812e1465L, 1.521558881878323790120983450270946857209e1470L, -2.873780311010933807686415826253380907421e1474L, 5.452903697278823304173192839252276211670e1478L, -1.039457922537509500320638240809547113575e1483L, 1.990610112724715126895008793014214505760e1487L, -3.829667853173777076954453401761025071562e1491L, 7.401624504283011888971231756333356050310e1495L, -1.437075122764477911733220492562365990710e1500L, 2.802940275035867428066581228962104019228e1504L, -5.491938363067613321364335249495394164430e1508L, 1.080961960603953462180593404647115933651e1513L, -2.137290931892412298654741768897581319007e1517L, 4.245031321673807283498263276791307370788e1521L, -8.469499523038763989328773224520912663309e1525L, 1.697421812794203793865032206191322699261e1530L, -3.417217332563937242285349373774004020539e1534L, 6.910378594841763785923780822895851271770e1538L, -1.403696282437585785557998429691459557649e1543L, 2.864060533055333035232343601021192111053e1547L, -5.869818290384811353182423286543086530728e1551L, 1.208359745327224593486268988808338456906e1556L, -2.498576742140453770373914215325521001990e1560L, 5.189311407347546310078739863704346083861e1564L, -1.082537954843916294257278789980768336964e1569L, 2.268238255751421312559806122980932952706e1573L, -4.773557403917983369065731568732198697502e1577L, 1.009019097334998841920279535262007639746e1582L, -2.142181266523235177327239693359275472557e1586L, 4.567814904130855969979178320003286614868e1590L, -9.782550516204803195398428611221899469345e1594L, 2.104180123097086948576304557651398411373e1599L, -4.545658958087323864004652894518442709646e1603L, 9.862563944609427542603740078470901803131e1607L, -2.149105846582226970866569209122813809019e1612L, 4.703235567543888152049628411354542509156e1616L, -1.033719212601584878353206879472796545848e1621L, 2.281767401903848796732740825793310514456e1625L, -5.058236070813950229238666252351966279306e1629L, 1.126112519657857205642546937554224492775e1634L, -2.517766761987679577706779689880657777343e1638L, 5.653225190181653388317503182908983211029e1642L, -1.274735955461074142223278576503188429497e1647L, 2.886578974679460464298863945016671299242e1651L, -6.564203307141426181809363135003467581753e1655L, 1.499036144473064593308260681782048262301e1660L, -3.437714715599902386917108442954580869236e1664L, 7.916830957072777234152907034541325149479e1668L, -1.830850567422571420661248197094782575285e1673L, 4.251778280827419894527511469762091846660e1677L, -9.915182507286989818033146623995507108134e1681L, 2.321878208636697663781227497233334385222e1686L, -5.459879022461660582811365437190884471726e1690L, 1.289222044549922720398543474297554204559e1695L, -3.056819658344217799458557578658863826289e1699L, 7.277891759142725294172926258364455941365e1703L, -1.739928293433385104144012025546489673795e1708L, 4.176797408823713136137404972612780406904e1712L, -1.006788178307821554781930741698052910780e1717L, 2.436754569909644399766538111317379484511e1721L, -5.921896599028498715774458493117079340155e1725L, 1.445045688171565118619109316933316429671e1730L, -3.540547766876069233350621578795319652040e1734L, 8.710114552028472554054293344204504325978e1738L, -2.151484527880464463303897113553085899101e1743L, 5.335928195512405709733771642389502809087e1747L, -1.328726408335015910030370523083559660016e1752L, 3.322090527232917400247098823651437597786e1756L, -8.339387326241218096865362177688582376376e1760L, 2.101842203781264395369771906884644062395e1765L, -5.318704469415522036482913743767085545209e1769L, 1.351288005941730688647540059088127991581e1774L, -3.446853546858473171100748720136784228698e1778L, 8.827284762030783576089954173424852998700e1782L, -2.269642226090373319660782216907175419317e1787L, 5.858820683661708553422363777419430816755e1791L, -1.518385813684321665045387969920683656625e1796L, 3.950661327164595923092260035122668890334e1800L, -1.031976516347387969958181456058243183780e1805L, 2.706317892325103782207094286049104555552e1809L, -7.125140422584701175967252533378906957380e1813L, 1.883260203116768075569432925204868418472e1818L, -4.997193687108743666000994570700725873035e1822L, 1.331182722092654526185433799891693838871e1827L, -3.559930289076558484535632566755216035553e1831L, 9.557281027056970446117541983785660301558e1835L, -2.575805002229372523547972911961335317502e1840L, 6.969058431277067406841032797913179025984e1844L, -1.892842481279278678390672746902260183506e1849L, 5.160964211693777744707760614147460787285e1853L, -1.412602588198037643242529860614298968137e1858L, 3.881313379962387603749693387037174052146e1862L, -1.070542170988009009334148472388319844527e1867L, 2.964094312414144330805731101996829908435e1871L, -8.238350132106899955856124602934281976453e1875L, 2.298504171050560756192352106062598639825e1880L, -6.437303944649223478093890316531995121228e1884L, 1.809727811843121957353712606428292269805e1889L, -5.107047553992257935533518628886728031061e1893L, 1.446674478990385642488446075734631327506e1898L, -4.113513327511444762766719175770513771122e1902L, 1.174067517257431444028448391638451935667e1907L, -3.363630086409895071362533854123306097827e1911L, 9.672868956071838221096869293070568259792e1915L, -2.792101741911955365960369780457612630184e1920L, 8.089710604557382430162031502761771390568e1924L, -2.352650988877130983061761312962677887796e1929L, 6.867549079740051556501575104006222995568e1933L, -2.012161201632998475706904405535757516336e1938L, 5.917489529279588702317256137229398357271e1942L, -1.746718667239329545125902248821502764273e1947L, 5.175069416058975040990816515838893249437e1951L, -1.538913401594651457295303469904084052963e1956L, 4.593185746210984655636051293374195150815e1960L, -1.375981868450401919299150690829612124045e1965L, 4.137207965217520410530508053863759216958e1969L, -1.248518564582257710069294326648626362439e1974L, 3.781575291117895093413381897917341286951e1978L, -1.149575999691408110085856948595444100435e1983L, 3.507413095836612229403470531176947165451e1987L, -1.074032838410645352804690949680310176413e1992L, 3.300857202456564870338466973024760446263e1996L, -1.018149578840803516349758843017979498322e2001L, 3.151876950233613792531594490714752800621e2005L, -9.792574827376149360558532022944033224780e2009L, 3.053456145978161645823454710737904504036e2014L, -9.555442346102849014299990542596620094035e2018L, 3.001037449298122384017009412541525703002e2023L, -9.459120112371096268275049056229023773120e2027L, 2.992168042152196502453442556462819104060e2032L, -9.498922680869041470681858599915282791899e2036L, 3.026307717971075309746179763189393755074e2041L, -9.676079238806159594565350708123427510151e2045L, 3.104778286352798464772361361434013339088e2050L, -9.997786802782252742109475924344598057966e2054L, 3.230847952724856366943939804248186203776e2059L, -1.047769651900498931701604323213605884945e2064L, 3.409958102134053489747140426163802214042e2068L, -1.113687894644055086152064258459886518528e2073L, 3.650114509271160332136458711252217684956e2077L, -1.200536387553969483433239131469825141412e2082L, 3.962482337718333099498977337189304099484e2086L, -1.312441206957064803437100929905979391106e2091L, 4.362246723746013772563799740886664288515e2095L, -1.454975881895253548422481637083633839534e2100L, 4.869831412214692119172895822285084162147e2104L, -1.635618419512383251104125916207188960680e2109L, 5.512611314145041257838234038980389596534e2113L, -1.864392957231340288547618808749072127289e2118L, 6.327317613106621547060670091824665547127e2122L, -2.154772001506498703267302897994526372056e2127L, 7.363426139490286496267931634843475368903e2131L, -2.524950643808031915843604894357998905460e2136L, 8.687956390288096215918373666581638675156e2140L, -2.999656978200020459428228924242615592768e2145L, 1.039231328851609224822335039430898644149e2150L, -3.612742437616019936358910410005123924796e2154L, 1.260211309932738404790711574105022002093e2159L, -4.410916378453971105434385837025433805752e2163L, 1.549140617923265948720013792673729394719e2168L, -5.459173749226782924959103886664322964926e2172L, 1.930343307630952098252884031069043541182e2177L, -6.848749229218425353808144618581305978045e2181L, 2.438117138001365487681440577590059588102e2186L, -8.708873656769794358508423272379627581292e2190L, 3.121268068338199458891764932384819739714e2195L, -1.122430216307539309816165910733145404999e2200L, 4.049900779207199370582177687160985635615e2204L, -1.466167983141158219266077836130256565915e2209L, 5.325678718693772500250292767751070974887e2213L, -1.940955845102272053048140384364058448998e2218L, 7.097467198361219669927211698104447309186e2222L, -2.603968771680987683436428778397387110896e2227L, 9.585403285394812946713320044815117440444e2231L, -3.540176030547640510648455468270569908446e2236L, 1.311827683984025111744358347783996339730e2241L, -4.877124229155333857009747836542843294702e2245L, 1.819213075760490882591173222316749809951e2250L, -6.808221630329265915405178596748950929642e2254L, 2.556299969544109052724772800143396857058e2259L, -9.629763347675306704861859899230073979116e2263L, 3.639508580119285595844040783082958425575e2268L, -1.380037493555816309137481185927387732499e2273L, 5.249980712165216709135893538080020409581e2277L, -2.003737844109055078145975651407367170529e2282L, 7.672522280806944397358668566379646540213e2286L, -2.947454993639165318799389781921184991045e2291L, 1.135966912801707623489383623092951142963e2296L, -4.392293711194501621873299212059053651432e2300L, 1.703813210168560937608104155973968112409e2305L, -6.630636743874062041158387022015853902938e2309L, 2.588742636486379690203698247275411406029e2314L, -1.013959594068423546627946242481463893979e2319L, 3.984265821528043268586235974854766821078e2323L, -1.570614519682157047612769672066387881154e2328L, 6.211297381339606877062824459742129064477e2332L, -2.464246931985476159686671650962783785426e2337L, 9.807833742601662212615240518855757197483e2341L, -3.916036434571217691317276306031837539092e2346L, 1.568566392975837368624727722120313955274e2351L, -6.302885887601142677858008037129298948063e2355L, 2.540704455306077495480843691828334210014e2360L, -1.027412480318234348899627142408950111875e2365L, 4.167823618450297116765978030480648316769e2369L, -1.696076602731914277275203926124423530377e2374L, 6.923904505633301788461482786634220738504e2378L, -2.835463065742506394026733592206185459035e2383L, 1.164828772275756526225951620927486307632e2388L, -4.800242878545012539781545966693324656699e2392L, 1.984381759611877246529319121941597679107e2397L, -8.228979942542641498511023600269641046627e2401L, 3.423130231367101727862739208673375060101e2406L, -1.428418168129733054582191895023094524495e2411L, 5.979153801634459282232521647160044877770e2415L, -2.510581926948409809562349588087762800160e2420L, 1.057443785053915411991029410076722022815e2425L, -4.467723713549428749678277264414266162837e2429L, 1.893474116528533144079731251913008472748e2434L, -8.049601965052954947260081891142509464888e2438L, 3.432648527503971149009691133946275281368e2443L, -1.468324699963694393989960228042259134294e2448L, + // + // 1302-1600: http://www.wolframalpha.com/input/?i=TABLE[N[Bernoulli[i]%2C40]%2C+{i%2C1302%2C1600%2C2}] + 6.300146502435743791500010801885493871234e2452L, -2.711520667146768856688291798851999580833e2457L, 1.170595555513900137297344452318266434006e2462L, -5.069095411973246242900074508988493530542e2466L, 2.201819284807954055092117706033113168896e2471L, -9.593088725189386197503123561368325167085e2475L, 4.192362385909155628936230811010649614060e2480L, -1.837725836941968309866675158105812946762e2485L, 8.080201101491972605313807752565294881374e2489L, -3.563536075527215702966392543784039539240e2494L, 1.576361051321107275181955665159661781175e2499L, -6.994292466180175594372663323941761853364e2503L, 3.112744353537336702834647901141392426258e2508L, -1.389481328370627358752727485697345194612e2513L, 6.221134636655213696041740685131223999953e2517L, -2.793779613656947577224654924852010601105e2522L, 1.258399062987759035354039924686781081603e2527L, -5.685208194704131918461885165870560583895e2531L, 2.576167857759537340210434756292816456179e2536L, -1.170846052338591953257169251219597581763e2541L, 5.337296787116189575571202979672747140313e2545L, -2.440264475369219459038748840841422948951e2550L, 1.119037151526195093932933161706501865175e2555L, -5.146858829220973887154576240993607686435e2559L, 2.374259791963193693837576781321391741634e2564L, -1.098501215269400934956638118646657823799e2569L, 5.097500369683616795005376807036889542869e2573L, -2.372446971688020647583535886090779018865e2578L, 1.107430282014636546248612381377039463753e2583L, -5.184597227131050012643138079903381280471e2587L, 2.434392040100910394476893838832599310265e2592L, -1.146412753331162872665743308094817095949e2597L, 5.414578104816988124950636101250217797539e2601L, -2.564835392810685332173156758121489913946e2606L, 1.218495070518549208066544111736985586178e2611L, -5.805713573821806672815019495319510297824e2615L, 2.774298194574319430697819781128985128618e2620L, -1.329580186505564627453485444017911980430e2625L, 6.390545858902318479863947547243743500916e2629L, -3.080502542499571035376377703435361520427e2634L, 1.489236104239976282318361008292980814533e2639L, -7.220413839991892382038608955317126799684e2643L, 3.510874916591640642524021216241607185085e2648L, -1.712070118580404599831061485055269100525e2653L, 8.372956919832386730490070625622785478703e2657L, -4.106629146981883685523102256292669054596e2662L, 2.019945438530802964718619732330776495740e2667L, -9.964133277392242111939720494354938982970e2671L, 4.929278642971447854669801547226335041410e2676L, -2.445509657169810919463982615395074704130e2681L, 1.216734421265677299127016883839223226884e2686L, -6.071008437677720186241562251151490713584e2690L, 3.037824949882992896564570441252792097027e2695L, -1.524402878612630565501569310883356490225e2700L, 7.671320530781999359200097739951316234193e2704L, -3.871436167706734376478728954716915204399e2709L, 1.959313530432202158587932399068682252335e2714L, -9.944063618400630821320953821427307024297e2718L, 5.061161998202463346818982228476199873781e2723L, -2.583219090831132705328958245740715185448e2728L, 1.322193991367293532684189527174543501836e2733L, -6.786569982732483290873213417465458376706e2737L, 3.493212334804776543395067018414547811062e2742L, -1.803090099978261928508495412750404640933e2747L, 9.333100843930216567894508007158644926767e2751L, -4.844499031405982604449146511179496492045e2756L, 2.521648090959971240812330574936006906830e2761L, -1.316227870932708474838173333385377250286e2766L, 6.889488826832738674261056521130795910494e2770L, -3.616184242864384509259984293501533623932e2775L, 1.903356124758119137116543283603627028779e2780L, -1.004601544584640657081847200643996069583e2785L, 5.317043885597842225603585588404817559596e2789L, -2.821938866752488868682751438901900485500e2794L, 1.501842023003449590337997900945924161741e2799L, -8.014908048137216649348740300633172710524e2803L, 4.289126235121619907138036129192558937445e2808L, -2.301619137231461344870820700320913118444e2813L, 1.238485136850053215006962645111854705210e2818L, -6.682503731149007943059244518074044280490e2822L, 3.615572393938012932030234169574978859655e2827L, -1.961565108627429629104703146282982075623e2832L, 1.067123259692924564435881096382837264046e2837L, -5.821179870182035246401397327057170726418e2841L, 3.184127229476322727732208017279268211356e2846L, -1.746429902183019597973436257300843998825e2851L, 9.604873565299766333876882842813498685054e2855L, -5.296759978724702692134960752308186890356e2860L, 2.928906353338652198977536576170287112391e2865L, -1.623961162577704769945821804737884742792e2870L, 9.028574047002736235613238355032484299017e2874L, -5.033087486357905828950503441308068892610e2879L, 2.813325650062267479031371852434194635210e2884L, -1.576791132296320840138263753339056345362e2889L, 8.861258343945925667272164531504265693289e2893L, -4.993236404321511029440212686547068244002e2898L, 2.821192993950901287717082243608730217471e2903L, -1.598254169674379493385730199445427966752e2908L, 9.078617590346932363947095804057608979359e2912L, -5.170742114456472142154347566092068443393e2917L, 2.952866185102528847516095880416675972086e2922L, -1.690794578626103552690094140317813413244e2927L, 9.707168799669516048238542260085175133847e2931L, -5.587884732306715493795271931175883605707e2936L, 3.225179489154957423492905957887744116530e2941L, -1.866424419669188178697802576490431604300e2946L, 1.082967626854618222657109354056973072044e2951L, -6.300392007169862865282706277272018077291e2955L, 3.675066377245428685118763485986517510658e2960L, -2.149348371085132073107516253339849053182e2965L, 1.260349351812619395000600434630904474324e2970L, -7.409963623771231302980906971935254993610e2974L, 4.367980758467862686643231700861155889684e2979L, -2.581566823350789671250829457603555544100e2984L, 1.529757357568342629912560827243282062227e2989L, -9.088595394263364554625061567617375176719e2993L, 5.413829169254585648363594604231030415354e2998L, -3.233288119606092759447005827969216281573e3003L, 1.936042437734875803183915765854038424658e3008L, -1.162289934202291715747729318797398221667e3013L, 6.995870350500567071550614251287615697508e3017L, -4.221776496490106417392945233048068288503e3022L, 2.554309239868912570382343877718991746122e3027L, -1.549440871550119801225143558087410562418e3032L, 9.423199525954784955533959981278992475051e3036L, -5.745689660772387668861183913170050552119e3041L, 3.512407521007240798565045328376471603253e3046L, -2.152708113797517364614914569890010876143e3051L, 1.322761289733739440340237168659770154654e3056L, -8.148777388506488753591136948542248584098e3060L, 5.032880858479326069741729004270784264612e3065L, -3.116396010103058126269735274818345780360e3070L, 1.934634831148214353514796782480703021435e3075L, -1.204077166243116651938489240924641810276e3080L, 7.513065583444964704795707060501161621868e3084L, -4.699873512563164914493150520500838535415e3089L, 2.947541197349762411713872934523813866703e3094L, -1.853262416286420077763886100673646141885e3099L, 1.168196427912100545575264493997591040800e3104L, -7.382362285873345348505276546404015842875e3108L, 4.677071041058096429847797962954927487730e3113L, -2.970642034084362431442183248944824506476e3118L, 1.891572688282564476274920103912259755482e3123L, -1.207509963440193713810418554061532113326e3128L, 7.727731208240101791845515599659441557781e3132L, -4.957988488048495669466804712012179891532e3137L, 3.188965862446236259925047956715566822864e3142L, -2.056286895821370106507670239256782411337e3147L, 1.329246918771714093479509313343886287414e3152L, -8.614188519577835653765633797787633659253e3156L, + // + // 1602-1900: http://www.wolframalpha.com/input/?i=TABLE[N[Bernoulli[i]%2C40]%2C+{i%2C1602%2C1900%2C2}] + 5.596396533621874175909933615343145642161e3161L, -3.644908483469388437457938883454376864180e3166L, 2.379838409026860469990569665632800095988e3171L, -1.557720925267669865362152155022069166772e3176L, 1.022143420270029721682551084917730373739e3181L, -6.723767358891570842116651998814252095792e3185L, 4.433950491570308179905446963723780229747e3190L, -2.931196854668917448553150023532223509373e3195L, 1.942557068752664549549945921392100172355e3200L, -1.290553202978622786891265558106235068695e3205L, 8.595082329732118303768775883557789195136e3209L, -5.738453265222970049867280061719670658457e3214L, 3.840687915100689856736926915331157331684e3219L, -2.576862441955523551149886625900059307506e3224L, 1.733166107320377310388765047659987844208e3229L, -1.168569552450178559412843683052610870569e3234L, 7.898289836694980777809433306209459851871e3238L, -5.351485909164216694400535493924387979018e3243L, 3.634772439350395177931952925644409735777e3248L, -2.474801048002975145046569303233576339695e3253L, 1.689126939254790850063878942448569759390e3258L, -1.155691524500722774057997965355407962525e3263L, 7.926435404542361405718288670391575676323e3267L, -5.449654814183048796524718620178906854846e3272L, 3.755898589900254795894812942275711835138e3277L, -2.594843902682143854622514329649211211808e3282L, 1.797048752397789969347915328338360264536e3287L, -1.247551415074438712713815166107969504456e3292L, 8.681719521514448143910215886388510318746e3296L, -6.056203898213120922016159444227958572276e3301L, 4.234882876331814099029781995617143573641e3306L, -2.968432911643338866295929748049749932906e3311L, 2.085723508930484816454740610260790948864e3316L, -1.469023169879432026361623513301566735138e3321L, 1.037150346505052892302077637883522696572e3326L, -7.339977067836656769144838365069396168014e3330L, 5.206985412168234130596004552956337839140e3335L, -3.702673773319239583641029108403509825141e3340L, 2.639251227995760315076225206168354089692e3345L, -1.885736353072698581595150856674914203383e3350L, 1.350563292338261784288559687678302458996e3355L, -9.695749980998301526113046898985991802000e3359L, 6.977167462628398202151721319169989304520e3364L, -5.032768280399753942925624560483352299263e3369L, 3.638844963651800168080623511900705036698e3374L, -2.637228631269251606169613775399022890118e3379L, 1.915836351653767108720464847696767898597e3384L, -1.395064293615007319328267865803567670760e3389L, 1.018249052614943190644465556486933211307e3394L, -7.449662162606857550867922631658930320805e3398L, 5.463119632208085241594107781601567713991e3403L, -4.015736541676989144201935890497836963875e3408L, 2.958754190183866660901503059509579790900e3413L, -2.185096074054288399312733179064098492511e3418L, 1.617517444557020250864919655301189186103e3423L, -1.200170662015511746748935675940010250555e3428L, 8.925888349899029449015791684428724952411e3432L, -6.653851763691885517669938275618991145962e3437L, 4.971722031098457895973348076474071155918e3442L, -3.723500582577984967442020337848702786829e3447L, 2.795153783541721373364976034391375710110e3452L, -2.103141577212720698169118819883801186873e3457L, 1.586129575320959267959148073466004084241e3462L, -1.198988457279648730711646682156242973137e3467L, 9.084402368157025658430300252246526602197e3471L, -6.898927494435965163817354296023108913714e3476L, 5.251332286149361587885046891266325872375e3481L, -4.006442950956739933884502808470603581850e3486L, 3.063718202820270282280659950794978994604e3491L, -2.348215284130973783732145823834807395920e3496L, 1.803952490148087317330011096671019781340e3501L, -1.389022326803437345760911068933754707688e3506L, 1.071986115818329525986099441493200866389e3511L, -8.292085224650940719705699485423856363908e3515L, 6.428829064452939640541475198655560890344e3520L, -4.995654440302797445368056643032307686314e3525L, 3.890847042582299188849273838681034339406e3530L, -3.037288555751484681537442833929275697351e3535L, 2.376385803695694695338601696534348875191e3540L, -1.863527130251861900692886008704804849076e3545L, 1.464674913498036269270793715104706378182e3550L, -1.153804954579033578659954846698233083197e3555L, 9.109783835348935092264268296199541780964e3559L, -7.208869193983001804305451104827153729326e3564L, 5.717530734277611949162917337810749919265e3569L, -4.544970302634007326980094771330550661605e3574L, 3.621042850825283032134228901678636353355e3579L, -2.891447067949778492831490654980043715471e3584L, 2.314060419397710657435821461707043283167e3589L, -1.856140759923563235273220981623595304434e3594L, 1.492185412981476596273279338314204171587e3599L, -1.202290032627175365810126250991853594801e3604L, 9.708881154579770196658265042625239421053e3608L, -7.857809850747029705680072304049448493252e3613L, 6.373898598298513400228819113197728735438e3618L, -5.181780406472117449048907989647202286666e3623L, 4.222036621953044040518942750638183171221e3628L, -3.447728386429130175025813550845575613047e3633L, 2.821701521717856346224159586852612710800e3638L, -2.314488376711998526455043944505424906920e3643L, 1.902671298033180765286213227393060711096e3648L, -1.567603736821312488140289549008391847440e3653L, 1.294408945316538946551785312385509945367e3658L, -1.071194533081615830960091702262923009420e3663L, 8.884351908108581551151252566466606126397e3667L, -7.384866682828103669170236267589653324531e3672L, 6.152023838008155718180876735217718355563e3677L, -5.136304310431705506236573876510219357975e3682L, 4.297736808124296434723193397876220759378e3687L, -3.603994887745884762510172194982172483480e3692L, 3.028884745605031552399167746007361297342e3697L, -2.551141302205187365552982635794121855138e3702L, 2.153467982869535549299173317536193051608e3707L, -1.821769476343602094059466497311600827296e3712L, 1.544537580582347892980177956984101211006e3717L, -1.312358705945937257247030754517293537539e3722L, 1.117518229297781388884979995402355617235e3727L, -9.536820860779441793021624381677086661097e3731L, 8.156400668831968026931547065507466530546e3736L, -6.990984948728184142718575396052260691181e3741L, 6.005124901126818071638224144541102727563e3746L, -5.169500241880947716732682089328427995109e3751L, 4.459815478235310026240134567325749844182e3756L, -3.855902253361684187081283218890336962427e3761L, 3.340988024176995223515640815937037040546e3766L, -2.901099226680215736735094376078800376829e3771L, 2.524573363444334459448089563912567842927e3776L, -2.201659455716348555524529213295341212492e3781L, 1.924190302190936448078364755844591374353e3786L, -1.685313186099770223843319514432495898517e3791L, 1.479268235966730475749985741048766689808e3796L, -1.301205702893883803117530921635013780575e3801L, 1.147035071153450453405384269242743907426e3806L, -1.013300250456366849150496776951686112298e3811L, 8.970761720605591762300958007557533865346e3815L, -7.958829781488943084496783248922217392838e3820L, 7.076146954685024795720193943027902028642e3825L, -6.304798526260409199660290516451546966159e3830L, 5.629519616664188107056583939722984509867e3835L, -5.037281594099054092767959480843344929292e3840L, 4.516946091316834843581919268794683123349e3845L, -4.058975118925834202620358386772092359951e3850L, 3.655187798978978909014603682039470653549e3855L, -3.298555903041546671060101785513812175322e3860L, 2.983031738662727912016882399515879119620e3865L, -2.703403043317732979516341931451317866898e3870L, 2.455170460800096241793872443768546335444e3875L, -2.234443928432490538417605502448376856290e3880L, 2.037854924078003280537856980560782325730e3885L, -1.862482033918775734840779765743099458137e3890L, + // + // 1902-2200: http://www.wolframalpha.com/input/?i=TABLE[N[Bernoulli[i]%2C40]%2C+{i%2C1902%2C2200%2C2}] + 1.705787724951999960095629912416210969679e3895L, -1.565564556110550991891247404758895970376e3900L, 1.439889351869832939488618785632174464789e3905L, -1.327084102784257406218693901793045990520e3910L, 1.225682557296027075027021534960026145706e3915L, -1.134401635488994148555787301654561211982e3920L, 1.052116934052356802920509999705307165985e3925L, -9.778417073593082219082361206542342793584e3929L, 9.107088061888562704837019028349522303725e3934L, -8.499551364633102138471246155980056936129e3939L, 7.949082681085658044610890152056533167407e3944L, -7.449748809722797718736397140511396011691e3949L, 6.996307824769340144608141799981589288378e3954L, -6.584122718472954006131003060359621706243e3959L, 6.209086595833487707192492087176843233407e3964L, -5.867557793863165391821489909125720982339e3969L, 5.556303538475260373917478405626416604297e3974L, -5.272450955936249442242634142613834212778e3979L, 5.013444428433789818228792126117223030641e3984L, -4.777008429684552423800736200488532033034e3989L, 4.561115100786341787876705283291018781137e3994L, -4.363955932181992701667719449097126840439e3999L, 4.183917007557000586305945495258591147615e4004L, -4.019557342177353010692923286760895584096e4009L, 3.869589913635745758786275231296652917580e4014L, -3.732865038934070181861017140563175000872e4019L, 3.608355799736107390800162778737339576843e4024L, -3.495145258697474565347261083975193776541e4029L, 3.392415245050326563747729613872524362741e4034L, -3.299436517958948801426629481782413630714e4039L, 3.215560142306355508598119430378551642857e4044L, -3.140209934146377815556058799557727461298e4049L, 3.072875852591406752692761744649563131272e4054L, -3.013108231854799187724018548255922550991e4059L, 2.960512761914376268185064129600549308882e4064L, -2.914746139139036596123006476633770383901e4069L, 2.875512319506974985103149834921665445532e4074L, -2.842559316984704569380036093537576068104e4079L, 2.815676498441436148701483904115879856704e4084L, -2.794692334326268275058539147656334465534e4089L, 2.779472571396106785963004020814493340829e4094L, -2.769918800191406321625251621260024635680e4099L, 2.765967395840433013288935879837390099329e4104L, -2.767588816244119880300161388073836623878e4109L, 2.774787246856347651152278076466043136230e4114L, -2.787600586224957950622601135620189837948e4119L, 2.806100771288225169339048358106052817280e4124L, -2.830394446218080573456394167711739786431e4129L, 2.860623983452244712039094143642843717029e4134L, -2.896968870550611723525738907034588104300e4139L, 2.939647481737606306044335918078617963078e4144L, -2.988919258547518526076380181812161398808e4149L, 3.045087329976721023952450383837883029431e4154L, -3.108501609077197464748958150625867523408e4159L, 3.179562410123820875787052833975010965963e4164L, -3.258724638491880104953913719767939138170e4169L, 3.346502614347964869115073881474258766546e4174L, -3.443475601364631413158991572423086599816e4179L, 3.550294123121350747300886840907918182129e4184L, -3.667687162886053419715985091863398517145e4189L, 3.796470357354794420044278000297864085607e4194L, -3.937555311976846882455930574021795626971e4199L, 4.091960185075595842547638450930710467324e4204L, -4.260821710519620959138720129506770036460e4209L, 4.445408854703156440576808070360934740837e4214L, -4.647138333645908068599900650548418672065e4219L, 4.867592250805288922190809906525766574205e4224L, -5.108538156515551259475573296900660666192e4229L, 5.371951876776035157276013631113314852508e4234L, -5.660043513521220243900043448456234873940e4239L, 5.975287081834808618140945840817834710330e4244L, -6.320454323372684034118816565375206053746e4249L, 6.698653321371992324876559665938996023646e4254L, -7.113372643219128807424340495235606473967e4259L, 7.568531854202750881338746432078817214052e4264L, -8.068539383842553693076672384509126681464e4269L, 8.618358887685935324188596304168259394311e4274L, -9.223585437012291673660319256730398171887e4279L, 9.890533091606747031464718533600572123091e4284L, -1.062633567277107015128545384570274268438e4290L, 1.143906286231591191271274413511275981288e4295L, -1.233785411712565904499340744089870916842e4300L, 1.333307331840530219050170916015276125870e4305L, -1.443648758235403286296065629219598769529e4310L, 1.566147425967471851736562867318748510088e4315L, -1.702326086290842780634120184324081017286e4320L, 1.853920350455786350409148418966087344063e4325L, -2.022911043115598592197907512410632615740e4330L, 2.211561842992792253055716743938240466613e4335L, -2.422463130294011318178080247305407476096e4340L, 2.658583129381772791030436640519847627789e4345L, -2.923327636881988941081365085520742216540e4350L, 3.220609866329557159104267531058019683271e4355L, -3.554932228621330128152149026066400241546e4360L, 3.931482212643167323798366327390058684499e4365L, -4.356244944221399578650235478583297389113e4370L, 4.836135498303121165971331625888490168138e4375L, -5.379154636371461359750682662639062606297e4380L, 5.994572359716861309678596804350346692501e4385L, -6.693144535124290060793936095397161934045e4390L, 7.487368894313509797084395689517008597061e4395L, -8.391787970609807810531578161564037339793e4400L, 9.423348062978921203475110312003096820035e4405L, -1.060182516651648405903017734022504884319e4411L, 1.195033105063952979885086754342706651656e4416L, -1.349591538868673992167798923586925758429e4421L, 1.527028315253291113905307092657539132480e4426L, -1.731065051510920640409442255224015234974e4431L, 1.966076741510092840076264635935585216200e4436L, -2.237214093245750681191361238831105906202e4441L, 2.550550094903891445719729187215253324232e4446L, -2.913255853313667303707651906277658164129e4451L, 3.333811847072394764285817140850092324169e4456L, -3.822262084288044913490118858492563410392e4461L, 4.390520310533864198186202368026630430120e4466L, -5.052739449335052080092114976206610871466e4471L, 5.825757966350870043117899492954521458799e4476L, -6.729639942938203582008846884575881320532e4481L, 7.788329466816396015493306357116312471970e4486L, -9.030444674469025073047417528762134025409e4491L, 1.049024263381993629167658236142000524752e4497L, -1.220879351508964912255081664072251573277e4502L, 1.423541151220109512749655991050110438471e4507L, -1.662940118618541616964708044356967429362e4512L, 1.946219185900482116137855064775635250366e4517L, -2.281995008842006909631764011781911322493e4522L, 2.680678198213108543648324254258111216040e4527L, -3.154866427472784086389609599207759103500e4532L, 3.719827710160801797530420206201570269720e4537L, -4.394095404360277919140027580071549980218e4542L, 5.200201854779615608741690339830306148442e4547L, -6.165584312943608652377791415603277251516e4552L, 7.323705248531382981433751104158852636445e4557L, -8.715439846124090647163930834760361817820e4562L, 1.039079696609215651011736087603304766850e4568L, -1.241105689556982425619608247473478857800e4573L, 1.485143079696380339521658550262280772546e4578L, -1.780437412164973637340821168154300094802e4583L, 2.138372099157518882088209435171770222745e4588L, -2.572985071149069551034276570909360759588e4593L, 3.101615379617643734762997559011097203354e4598L, -3.745713657616368229906151946770042703357e4603L, 4.531859496161940719835150033082561700677e4608L, -5.493040495326927998321538336584233566465e4613L, 6.670262730603009306595018122252730741798e4618L, -8.114581584793494903775255213273982440688e4623L, 9.889666561810883044159054730371102725871e4628L, -1.207504541653929734716275932570097623330e4634L, 1.477021377885843688233899471354959308782e4639L, -1.809984912147908767583043524070645821179e4644L, + // + // 2202-2320: http://www.wolframalpha.com/input/?i=TABLE[N[Bernoulli[i]%2C40]%2C+{i%2C2202%2C2320%2C2}] + 2.222043594325228980916360265527780300093e4649L, -2.732869701246338361699515268224049951411e4654L, 3.367233945421922463553518272642397177145e4659L, -4.156377225041273602431272489314020150392e4664L, 5.139764368092890466235162431795350591151e4669L, -6.367329693760865476879589228002216011370e4674L, 7.902356742934106007362514378717026407839e4679L, -9.825176966314431712897976595483070301406e4684L, 1.223792760178593282435724837135946867088e4690L, -1.527068151452750404853140815207477555192e4695L, 1.908935682572268829496101580401263597905e4700L, -2.390593888616966248780378941331847473699e4705L, 2.999171106576893833644521002894489856321e4710L, -3.769440655453736670024798444784356437578e4715L, 4.746047769851891438576002047529258107351e4720L, -5.986405469241447720766576164546767533359e4725L, 7.564466155536872051712519119999711534616e4730L, -9.575641408047918720040356745796976488951e4735L, 1.214322951835035451699619713803395497423e4741L, -1.542682591979864353012093794301924196234e4746L, 1.963334539793192183270983986567556358603e4751L, -2.503148969013901182572118121398034622584e4756L, 3.197076711250102964526567664729089847162e4761L, -4.090653552025822488578293526174572934858e4766L, 5.243302769651520536759521264615159906699e4771L, -6.732697170903775309261288127044088674182e4776L, 8.660529543801770516930589210020128142543e4781L, -1.116015823611149634592870112730519454113e4787L, 1.440675306432920129218036927923030695520e4792L, -1.863078034853256227415397798026969938881e4797L, 2.413595413458810442409656314019115041699e4802L, -3.132317029597258599678590012779717945144e4807L, 4.072246763371584312534474102756137619716e4812L, -5.303577511521827157146305369181950467569e4817L, 6.919417518688636032335131253584331645491e4822L, -9.043473312934241153732087612484569398979e4827L, 1.184037400265044213826044590639924237359e4833L, -1.552956685415800894409743993367334099777e4838L, 2.040404893052952221581694807126473204625e4843L, -2.685565763841580219033402331219206776210e4848L, 3.540927057361929050327811875290025248120e4853L, -4.676912607538885419407656762767991163574e4858L, 6.188165903566760647569323704623433330229e4863L, -8.202087471895029964699042637255411806373e4868L, 1.089045274355389654614196651761310970580e4874L, -1.448524684976553869119447042300206226148e4879L, 1.930028100376784839502387280956424581974e4884L, -2.576074799096023589462128312524664980682e4889L, 3.444369635011990347297134928452972402038e4894L, -4.613354441299253694113609154769978684993e4899L, 6.189834306866879018555349507257537840922e4904L, -8.319470760665157534580593571258276368233e4909L, 1.120124240070996761986102680587384813245e4915L, -1.510740451399746828351090108638980398124e4920L, 2.041108231091323198877509959371257503819e4925L, -2.762447751447012472733302936575873838539e4930L, +#endif + }}; + + return bernoulli_data[n]; +} + +template <class T> +inline T unchecked_bernoulli_imp(std::size_t n, const mpl::int_<4>& ) +{ + // + // Special case added for multiprecision types that have no conversion from long long, + // there are very few such types, but mpfr_class is one. + // + static const boost::array<boost::int32_t, 1 + max_bernoulli_b2n<T>::value> numerators = + {{ + boost::int32_t( +1LL), + boost::int32_t( +1LL), + boost::int32_t( -1LL), + boost::int32_t( +1LL), + boost::int32_t( -1LL), + boost::int32_t( +5LL), + boost::int32_t( -691LL), + boost::int32_t( +7LL), + boost::int32_t( -3617LL), + boost::int32_t( +43867LL), + boost::int32_t( -174611LL), + boost::int32_t( +854513LL), + }}; + + static const boost::array<boost::int32_t, 1 + max_bernoulli_b2n<T>::value> denominators = + {{ + boost::int32_t( 1LL), + boost::int32_t( 6LL), + boost::int32_t( 30LL), + boost::int32_t( 42LL), + boost::int32_t( 30LL), + boost::int32_t( 66LL), + boost::int32_t( 2730LL), + boost::int32_t( 6LL), + boost::int32_t( 510LL), + boost::int32_t( 798LL), + boost::int32_t( 330LL), + boost::int32_t( 138LL), + }}; + return T(numerators[n]) / T(denominators[n]); +} + +} // namespace detail + +template<class T> +inline T unchecked_bernoulli_b2n(const std::size_t n) +{ + typedef mpl::int_<detail::bernoulli_imp_variant<T>::value> tag_type; + + return detail::unchecked_bernoulli_imp<T>(n, tag_type()); +} + +}} // namespaces + +#endif // BOOST_MATH_UNCHECKED_BERNOULLI_HPP diff --git a/boost/math/special_functions/detail/unchecked_factorial.hpp b/boost/math/special_functions/detail/unchecked_factorial.hpp index eb8927a268..3c23d6e15a 100644 --- a/boost/math/special_functions/detail/unchecked_factorial.hpp +++ b/boost/math/special_functions/detail/unchecked_factorial.hpp @@ -15,7 +15,9 @@ #pragma warning(push) // Temporary until lexical cast fixed. #pragma warning(disable: 4127 4701) #endif +#ifndef BOOST_MATH_NO_LEXICAL_CAST #include <boost/lexical_cast.hpp> +#endif #ifdef BOOST_MSVC #pragma warning(pop) #endif @@ -266,6 +268,196 @@ struct max_factorial<long double> BOOST_STATIC_CONSTANT(unsigned, value = 170); }; +#ifdef BOOST_MATH_USE_FLOAT128 + +template <> +inline BOOST_MATH_FLOAT128_TYPE unchecked_factorial<BOOST_MATH_FLOAT128_TYPE>(unsigned i) +{ + static const boost::array<BOOST_MATH_FLOAT128_TYPE, 171> factorials = { { + 1, + 1, + 2, + 6, + 24, + 120, + 720, + 5040, + 40320, + 362880.0Q, + 3628800.0Q, + 39916800.0Q, + 479001600.0Q, + 6227020800.0Q, + 87178291200.0Q, + 1307674368000.0Q, + 20922789888000.0Q, + 355687428096000.0Q, + 6402373705728000.0Q, + 121645100408832000.0Q, + 0.243290200817664e19Q, + 0.5109094217170944e20Q, + 0.112400072777760768e22Q, + 0.2585201673888497664e23Q, + 0.62044840173323943936e24Q, + 0.15511210043330985984e26Q, + 0.403291461126605635584e27Q, + 0.10888869450418352160768e29Q, + 0.304888344611713860501504e30Q, + 0.8841761993739701954543616e31Q, + 0.26525285981219105863630848e33Q, + 0.822283865417792281772556288e34Q, + 0.26313083693369353016721801216e36Q, + 0.868331761881188649551819440128e37Q, + 0.29523279903960414084761860964352e39Q, + 0.103331479663861449296666513375232e41Q, + 0.3719933267899012174679994481508352e42Q, + 0.137637530912263450463159795815809024e44Q, + 0.5230226174666011117600072241000742912e45Q, + 0.203978820811974433586402817399028973568e47Q, + 0.815915283247897734345611269596115894272e48Q, + 0.3345252661316380710817006205344075166515e50Q, + 0.1405006117752879898543142606244511569936e52Q, + 0.6041526306337383563735513206851399750726e53Q, + 0.265827157478844876804362581101461589032e55Q, + 0.1196222208654801945619631614956577150644e57Q, + 0.5502622159812088949850305428800254892962e58Q, + 0.2586232415111681806429643551536119799692e60Q, + 0.1241391559253607267086228904737337503852e62Q, + 0.6082818640342675608722521633212953768876e63Q, + 0.3041409320171337804361260816606476884438e65Q, + 0.1551118753287382280224243016469303211063e67Q, + 0.8065817517094387857166063685640376697529e68Q, + 0.427488328406002556429801375338939964969e70Q, + 0.2308436973392413804720927426830275810833e72Q, + 0.1269640335365827592596510084756651695958e74Q, + 0.7109985878048634518540456474637249497365e75Q, + 0.4052691950487721675568060190543232213498e77Q, + 0.2350561331282878571829474910515074683829e79Q, + 0.1386831185456898357379390197203894063459e81Q, + 0.8320987112741390144276341183223364380754e82Q, + 0.507580213877224798800856812176625227226e84Q, + 0.3146997326038793752565312235495076408801e86Q, + 0.1982608315404440064116146708361898137545e88Q, + 0.1268869321858841641034333893351614808029e90Q, + 0.8247650592082470666723170306785496252186e91Q, + 0.5443449390774430640037292402478427526443e93Q, + 0.3647111091818868528824985909660546442717e95Q, + 0.2480035542436830599600990418569171581047e97Q, + 0.1711224524281413113724683388812728390923e99Q, + 0.1197857166996989179607278372168909873646e101Q, + 0.8504785885678623175211676442399260102886e102Q, + 0.6123445837688608686152407038527467274078e104Q, + 0.4470115461512684340891257138125051110077e106Q, + 0.3307885441519386412259530282212537821457e108Q, + 0.2480914081139539809194647711659403366093e110Q, + 0.188549470166605025498793226086114655823e112Q, + 0.1451830920282858696340707840863082849837e114Q, + 0.1132428117820629783145752115873204622873e116Q, + 0.8946182130782975286851441715398316520698e117Q, + 0.7156945704626380229481153372318653216558e119Q, + 0.5797126020747367985879734231578109105412e121Q, + 0.4753643337012841748421382069894049466438e123Q, + 0.3945523969720658651189747118012061057144e125Q, + 0.3314240134565353266999387579130131288001e127Q, + 0.2817104114380550276949479442260611594801e129Q, + 0.2422709538367273238176552320344125971528e131Q, + 0.210775729837952771721360051869938959523e133Q, + 0.1854826422573984391147968456455462843802e135Q, + 0.1650795516090846108121691926245361930984e137Q, + 0.1485715964481761497309522733620825737886e139Q, + 0.1352001527678402962551665687594951421476e141Q, + 0.1243841405464130725547532432587355307758e143Q, + 0.1156772507081641574759205162306240436215e145Q, + 0.1087366156656743080273652852567866010042e147Q, + 0.103299784882390592625997020993947270954e149Q, + 0.9916779348709496892095714015418938011582e150Q, + 0.9619275968248211985332842594956369871234e152Q, + 0.942689044888324774562618574305724247381e154Q, + 0.9332621544394415268169923885626670049072e156Q, + 0.9332621544394415268169923885626670049072e158Q, + 0.9425947759838359420851623124482936749562e160Q, + 0.9614466715035126609268655586972595484554e162Q, + 0.990290071648618040754671525458177334909e164Q, + 0.1029901674514562762384858386476504428305e167Q, + 0.1081396758240290900504101305800329649721e169Q, + 0.1146280563734708354534347384148349428704e171Q, + 0.1226520203196137939351751701038733888713e173Q, + 0.132464181945182897449989183712183259981e175Q, + 0.1443859583202493582204882102462797533793e177Q, + 0.1588245541522742940425370312709077287172e179Q, + 0.1762952551090244663872161047107075788761e181Q, + 0.1974506857221074023536820372759924883413e183Q, + 0.2231192748659813646596607021218715118256e185Q, + 0.2543559733472187557120132004189335234812e187Q, + 0.2925093693493015690688151804817735520034e189Q, + 0.339310868445189820119825609358857320324e191Q, + 0.396993716080872089540195962949863064779e193Q, + 0.4684525849754290656574312362808384164393e195Q, + 0.5574585761207605881323431711741977155627e197Q, + 0.6689502913449127057588118054090372586753e199Q, + 0.8094298525273443739681622845449350829971e201Q, + 0.9875044200833601362411579871448208012564e203Q, + 0.1214630436702532967576624324188129585545e206Q, + 0.1506141741511140879795014161993280686076e208Q, + 0.1882677176888926099743767702491600857595e210Q, + 0.237217324288004688567714730513941708057e212Q, + 0.3012660018457659544809977077527059692324e214Q, + 0.3856204823625804217356770659234636406175e216Q, + 0.4974504222477287440390234150412680963966e218Q, + 0.6466855489220473672507304395536485253155e220Q, + 0.8471580690878820510984568758152795681634e222Q, + 0.1118248651196004307449963076076169029976e225Q, + 0.1487270706090685728908450891181304809868e227Q, + 0.1992942746161518876737324194182948445223e229Q, + 0.269047270731805048359538766214698040105e231Q, + 0.3659042881952548657689727220519893345429e233Q, + 0.5012888748274991661034926292112253883237e235Q, + 0.6917786472619488492228198283114910358867e237Q, + 0.9615723196941089004197195613529725398826e239Q, + 0.1346201247571752460587607385894161555836e242Q, + 0.1898143759076170969428526414110767793728e244Q, + 0.2695364137888162776588507508037290267094e246Q, + 0.3854370717180072770521565736493325081944e248Q, + 0.5550293832739304789551054660550388118e250Q, + 0.80479260574719919448490292577980627711e252Q, + 0.1174997204390910823947958271638517164581e255Q, + 0.1727245890454638911203498659308620231933e257Q, + 0.2556323917872865588581178015776757943262e259Q, + 0.380892263763056972698595524350736933546e261Q, + 0.571338395644585459047893286526105400319e263Q, + 0.8627209774233240431623188626544191544816e265Q, + 0.1311335885683452545606724671234717114812e268Q, + 0.2006343905095682394778288746989117185662e270Q, + 0.308976961384735088795856467036324046592e272Q, + 0.4789142901463393876335775239063022722176e274Q, + 0.7471062926282894447083809372938315446595e276Q, + 0.1172956879426414428192158071551315525115e279Q, + 0.1853271869493734796543609753051078529682e281Q, + 0.2946702272495038326504339507351214862195e283Q, + 0.4714723635992061322406943211761943779512e285Q, + 0.7590705053947218729075178570936729485014e287Q, + 0.1229694218739449434110178928491750176572e290Q, + 0.2004401576545302577599591653441552787813e292Q, + 0.3287218585534296227263330311644146572013e294Q, + 0.5423910666131588774984495014212841843822e296Q, + 0.9003691705778437366474261723593317460744e298Q, + 0.1503616514864999040201201707840084015944e301Q, + 0.2526075744973198387538018869171341146786e303Q, + 0.4269068009004705274939251888899566538069e305Q, + 0.7257415615307998967396728211129263114717e307Q, + } }; + + return factorials[i]; +} + +template <> +struct max_factorial<BOOST_MATH_FLOAT128_TYPE> +{ + BOOST_STATIC_CONSTANT(unsigned, value = 170); +}; + +#endif + template <> inline double unchecked_factorial<double>(unsigned i BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(double)) { @@ -279,6 +471,8 @@ struct max_factorial<double> value = ::boost::math::max_factorial<long double>::value); }; +#ifndef BOOST_MATH_NO_LEXICAL_CAST + template <class T> inline T unchecked_factorial(unsigned i BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(T)) { @@ -403,6 +597,22 @@ struct max_factorial BOOST_STATIC_CONSTANT(unsigned, value = 100); }; +#else // BOOST_MATH_NO_LEXICAL_CAST + +template <class T> +inline T unchecked_factorial(unsigned i BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE_SPEC(T)) +{ + return 1; +} + +template <class T> +struct max_factorial +{ + BOOST_STATIC_CONSTANT(unsigned, value = 0); +}; + +#endif + #ifndef BOOST_NO_INCLASS_MEMBER_INITIALIZATION template <class T> const unsigned max_factorial<T>::value; diff --git a/boost/math/special_functions/digamma.hpp b/boost/math/special_functions/digamma.hpp index 1268b64dc9..785cd75c5e 100644 --- a/boost/math/special_functions/digamma.hpp +++ b/boost/math/special_functions/digamma.hpp @@ -10,6 +10,7 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/tools/rational.hpp> #include <boost/math/tools/promotion.hpp> #include <boost/math/policies/error_handling.hpp> @@ -180,7 +181,7 @@ T digamma_imp_1_2(T x, const mpl::int_<0>*) BOOST_MATH_BIG_CONSTANT(T, 113, -0.20327832297631728077731148515093164955e-6) }; static const T Q[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 2.6210924610812025425088411043163287646), BOOST_MATH_BIG_CONSTANT(T, 113, 2.6850757078559596612621337395886392594), BOOST_MATH_BIG_CONSTANT(T, 113, 1.4320913706209965531250495490639289418), @@ -236,7 +237,7 @@ T digamma_imp_1_2(T x, const mpl::int_<64>*) BOOST_MATH_BIG_CONSTANT(T, 64, -0.00289268368333918761452) }; static const T Q[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 2.1195759927055347547), BOOST_MATH_BIG_CONSTANT(T, 64, 1.54350554664961128724), BOOST_MATH_BIG_CONSTANT(T, 64, 0.486986018231042975162), @@ -286,7 +287,7 @@ T digamma_imp_1_2(T x, const mpl::int_<53>*) BOOST_MATH_BIG_CONSTANT(T, 53, -0.0020713321167745952) }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 2.0767117023730469), BOOST_MATH_BIG_CONSTANT(T, 53, 1.4606242909763515), BOOST_MATH_BIG_CONSTANT(T, 53, 0.43593529692665969), @@ -356,7 +357,7 @@ T digamma_imp(T x, const Tag* t, const Policy& pol) // // Check for negative arguments and use reflection: // - if(x < 0) + if(x <= -1) { // Reflect: x = 1 - x; @@ -376,6 +377,8 @@ T digamma_imp(T x, const Tag* t, const Policy& pol) } result = constants::pi<T>() / tan(constants::pi<T>() * remainder); } + if(x == 0) + return policies::raise_pole_error<T>("boost::math::digamma<%1%>(%1%)", 0, x, pol); // // If we're above the lower-limit for the // asymptotic expansion then use it: @@ -397,9 +400,9 @@ T digamma_imp(T x, const Tag* t, const Policy& pol) // // If x < 1 use recurrance to shift to > 1: // - if(x < 1) + while(x < 1) { - result = -1/x; + result -= 1/x; x += 1; } result += digamma_imp_1_2(x, t); diff --git a/boost/math/special_functions/ellint_1.hpp b/boost/math/special_functions/ellint_1.hpp index 469f4bd01a..da16bc6f26 100644 --- a/boost/math/special_functions/ellint_1.hpp +++ b/boost/math/special_functions/ellint_1.hpp @@ -18,10 +18,12 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/ellint_rf.hpp> #include <boost/math/constants/constants.hpp> #include <boost/math/policies/error_handling.hpp> #include <boost/math/tools/workaround.hpp> +#include <boost/math/special_functions/round.hpp> // Elliptic integrals (complete and incomplete) of the first kind // Carlson, Numerische Mathematik, vol 33, 1 (1979) @@ -88,16 +90,16 @@ T ellint_f_imp(T phi, T k, const Policy& pol) // so rewritten to use fmod instead: // BOOST_MATH_INSTRUMENT_CODE("pi/2 = " << constants::pi<T>() / 2); - T rphi = boost::math::tools::fmod_workaround(phi, T(constants::pi<T>() / 2)); + T rphi = boost::math::tools::fmod_workaround(phi, T(constants::half_pi<T>())); BOOST_MATH_INSTRUMENT_VARIABLE(rphi); - T m = floor((2 * phi) / constants::pi<T>()); + T m = boost::math::round((phi - rphi) / constants::half_pi<T>()); BOOST_MATH_INSTRUMENT_VARIABLE(m); int s = 1; if(boost::math::tools::fmod_workaround(m, T(2)) > 0.5) { m += 1; s = -1; - rphi = constants::pi<T>() / 2 - rphi; + rphi = constants::half_pi<T>() - rphi; BOOST_MATH_INSTRUMENT_VARIABLE(rphi); } T sinp = sin(rphi); diff --git a/boost/math/special_functions/ellint_2.hpp b/boost/math/special_functions/ellint_2.hpp index 85eca6cde7..72caf3eb11 100644 --- a/boost/math/special_functions/ellint_2.hpp +++ b/boost/math/special_functions/ellint_2.hpp @@ -18,11 +18,13 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/ellint_rf.hpp> #include <boost/math/special_functions/ellint_rd.hpp> #include <boost/math/constants/constants.hpp> #include <boost/math/policies/error_handling.hpp> #include <boost/math/tools/workaround.hpp> +#include <boost/math/special_functions/round.hpp> // Elliptic integrals (complete and incomplete) of the second kind // Carlson, Numerische Mathematik, vol 33, 1 (1979) @@ -74,14 +76,14 @@ T ellint_e_imp(T phi, T k, const Policy& pol) // but that fails if T has more digits than a long long, // so rewritten to use fmod instead: // - T rphi = boost::math::tools::fmod_workaround(phi, T(constants::pi<T>() / 2)); - T m = floor((2 * phi) / constants::pi<T>()); + T rphi = boost::math::tools::fmod_workaround(phi, T(constants::half_pi<T>())); + T m = boost::math::round((phi - rphi) / constants::half_pi<T>()); int s = 1; if(boost::math::tools::fmod_workaround(m, T(2)) > 0.5) { m += 1; s = -1; - rphi = constants::pi<T>() / 2 - rphi; + rphi = constants::half_pi<T>() - rphi; } T sinp = sin(rphi); T cosp = cos(rphi); diff --git a/boost/math/special_functions/ellint_3.hpp b/boost/math/special_functions/ellint_3.hpp index f63bb2d4b0..ac7e68c17f 100644 --- a/boost/math/special_functions/ellint_3.hpp +++ b/boost/math/special_functions/ellint_3.hpp @@ -18,6 +18,7 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/ellint_rf.hpp> #include <boost/math/special_functions/ellint_rj.hpp> #include <boost/math/special_functions/ellint_1.hpp> @@ -26,6 +27,7 @@ #include <boost/math/constants/constants.hpp> #include <boost/math/policies/error_handling.hpp> #include <boost/math/tools/workaround.hpp> +#include <boost/math/special_functions/round.hpp> // Elliptic integrals (complete and incomplete) of the third kind // Carlson, Numerische Mathematik, vol 33, 1 (1979) @@ -182,14 +184,14 @@ T ellint_pi_imp(T v, T phi, T k, T vc, const Policy& pol) } else { - T rphi = boost::math::tools::fmod_workaround(T(fabs(phi)), T(constants::pi<T>() / 2)); - T m = floor((2 * fabs(phi)) / constants::pi<T>()); + T rphi = boost::math::tools::fmod_workaround(T(fabs(phi)), T(constants::half_pi<T>())); + T m = boost::math::round((fabs(phi) - rphi) / constants::half_pi<T>()); int sign = 1; if(boost::math::tools::fmod_workaround(m, T(2)) > 0.5) { m += 1; sign = -1; - rphi = constants::pi<T>() / 2 - rphi; + rphi = constants::half_pi<T>() - rphi; } T sinp = sin(rphi); T cosp = cos(rphi); diff --git a/boost/math/special_functions/ellint_rj.hpp b/boost/math/special_functions/ellint_rj.hpp index 1ecca753a4..8a242f06a4 100644 --- a/boost/math/special_functions/ellint_rj.hpp +++ b/boost/math/special_functions/ellint_rj.hpp @@ -91,7 +91,7 @@ T ellint_rj_imp(T x, T y, T z, T p, const Policy& pol) BOOST_ASSERT(pmy >= 0); - T p = pmy + y; + p = pmy + y; value = boost::math::ellint_rj(x, y, z, p, pol); value *= pmy; value -= 3 * boost::math::ellint_rf(x, y, z, pol); diff --git a/boost/math/special_functions/erf.hpp b/boost/math/special_functions/erf.hpp index e67332a61a..f7f75b0bc7 100644 --- a/boost/math/special_functions/erf.hpp +++ b/boost/math/special_functions/erf.hpp @@ -226,7 +226,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<53>& t) BOOST_MATH_BIG_CONSTANT(T, 53, -0.000322780120964605683831), }; static const T Q[] = { - 1L, + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 0.455004033050794024546), BOOST_MATH_BIG_CONSTANT(T, 53, 0.0875222600142252549554), BOOST_MATH_BIG_CONSTANT(T, 53, 0.00858571925074406212772), @@ -258,7 +258,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<53>& t) BOOST_MATH_BIG_CONSTANT(T, 53, 0.00180424538297014223957), }; static const T Q[] = { - 1L, + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 1.84759070983002217845), BOOST_MATH_BIG_CONSTANT(T, 53, 1.42628004845511324508), BOOST_MATH_BIG_CONSTANT(T, 53, 0.578052804889902404909), @@ -266,8 +266,14 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<53>& t) BOOST_MATH_BIG_CONSTANT(T, 53, 0.0113385233577001411017), BOOST_MATH_BIG_CONSTANT(T, 53, 0.337511472483094676155e-5), }; + BOOST_MATH_INSTRUMENT_VARIABLE(Y); + BOOST_MATH_INSTRUMENT_VARIABLE(P[0]); + BOOST_MATH_INSTRUMENT_VARIABLE(Q[0]); + BOOST_MATH_INSTRUMENT_VARIABLE(z); result = Y + tools::evaluate_polynomial(P, T(z - 0.5)) / tools::evaluate_polynomial(Q, T(z - 0.5)); + BOOST_MATH_INSTRUMENT_VARIABLE(result); result *= exp(-z * z) / z; + BOOST_MATH_INSTRUMENT_VARIABLE(result); } else if(z < 2.5f) { @@ -285,7 +291,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<53>& t) BOOST_MATH_BIG_CONSTANT(T, 53, 0.000235839115596880717416), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 1.53991494948552447182), BOOST_MATH_BIG_CONSTANT(T, 53, 0.982403709157920235114), BOOST_MATH_BIG_CONSTANT(T, 53, 0.325732924782444448493), @@ -311,7 +317,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<53>& t) BOOST_MATH_BIG_CONSTANT(T, 53, 0.113212406648847561139e-4), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 1.04217814166938418171), BOOST_MATH_BIG_CONSTANT(T, 53, 0.442597659481563127003), BOOST_MATH_BIG_CONSTANT(T, 53, 0.0958492726301061423444), @@ -338,7 +344,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<53>& t) BOOST_MATH_BIG_CONSTANT(T, 53, -2.8175401114513378771), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 2.79257750980575282228), BOOST_MATH_BIG_CONSTANT(T, 53, 11.0567237927800161565), BOOST_MATH_BIG_CONSTANT(T, 53, 15.930646027911794143), @@ -422,7 +428,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<64>& t) BOOST_MATH_BIG_CONSTANT(T, 64, -0.200305626366151877759e-4), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.455817300515875172439), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0916537354356241792007), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0102722652675910031202), @@ -456,7 +462,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<64>& t) BOOST_MATH_BIG_CONSTANT(T, 64, 0.266689068336295642561e-7), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 2.03237474985469469291), BOOST_MATH_BIG_CONSTANT(T, 64, 1.78355454954969405222), BOOST_MATH_BIG_CONSTANT(T, 64, 0.867940326293760578231), @@ -484,7 +490,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<64>& t) BOOST_MATH_BIG_CONSTANT(T, 64, 0.515917266698050027934e-4), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 1.71657861671930336344), BOOST_MATH_BIG_CONSTANT(T, 64, 1.26409634824280366218), BOOST_MATH_BIG_CONSTANT(T, 64, 0.512371437838969015941), @@ -512,7 +518,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<64>& t) BOOST_MATH_BIG_CONSTANT(T, 64, 0.189896043050331257262e-5), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 1.19352160185285642574), BOOST_MATH_BIG_CONSTANT(T, 64, 0.603256964363454392857), BOOST_MATH_BIG_CONSTANT(T, 64, 0.165411142458540585835), @@ -542,7 +548,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<64>& t) BOOST_MATH_BIG_CONSTANT(T, 64, -16.8865774499799676937), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 4.72948911186645394541), BOOST_MATH_BIG_CONSTANT(T, 64, 23.6750543147695749212), BOOST_MATH_BIG_CONSTANT(T, 64, 60.0021517335693186785), @@ -630,7 +636,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, -0.344448249920445916714548295433198544e-7), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.466542092785657604666906909196052522), BOOST_MATH_BIG_CONSTANT(T, 113, 0.100005087012526447295176964142107611), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0128341535890117646540050072234142603), @@ -668,7 +674,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, 0.436544865032836914773944382339900079e-5), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 2.47651182872457465043733800302427977), BOOST_MATH_BIG_CONSTANT(T, 113, 2.78706486002517996428836400245547955), BOOST_MATH_BIG_CONSTANT(T, 113, 1.87295924621659627926365005293130693), @@ -703,7 +709,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, 0.133166058052466262415271732172490045e-5), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 2.32970330146503867261275580968135126), BOOST_MATH_BIG_CONSTANT(T, 113, 2.46325715420422771961250513514928746), BOOST_MATH_BIG_CONSTANT(T, 113, 1.55307882560757679068505047390857842), @@ -737,7 +743,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, 0.312857043762117596999398067153076051e-6), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 2.13506082409097783827103424943508554), BOOST_MATH_BIG_CONSTANT(T, 113, 2.06399257267556230937723190496806215), BOOST_MATH_BIG_CONSTANT(T, 113, 1.18678481279932541314830499880691109), @@ -772,7 +778,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, 0.676586625472423508158937481943649258e-7), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 1.93669171363907292305550231764920001), BOOST_MATH_BIG_CONSTANT(T, 113, 1.69468476144051356810672506101377494), BOOST_MATH_BIG_CONSTANT(T, 113, 0.880023580986436640372794392579985511), @@ -805,7 +811,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, 0.971120407556888763695313774578711839e-7), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 1.59911256167540354915906501335919317), BOOST_MATH_BIG_CONSTANT(T, 113, 1.136006830764025173864831382946934), BOOST_MATH_BIG_CONSTANT(T, 113, 0.468565867990030871678574840738423023), @@ -839,7 +845,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, 0.156161469668275442569286723236274457e-9), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 1.52955245103668419479878456656709381), BOOST_MATH_BIG_CONSTANT(T, 113, 1.06263944820093830054635017117417064), BOOST_MATH_BIG_CONSTANT(T, 113, 0.441684612681607364321013134378316463), @@ -874,7 +880,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, 0.673002744115866600294723141176820155e-10), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 1.12843690320861239631195353379313367), BOOST_MATH_BIG_CONSTANT(T, 113, 0.569900657061622955362493442186537259), BOOST_MATH_BIG_CONSTANT(T, 113, 0.169094404206844928112348730277514273), @@ -908,7 +914,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, 0.119735694018906705225870691331543806e-8), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 1.69889613396167354566098060039549882), BOOST_MATH_BIG_CONSTANT(T, 113, 1.28824647372749624464956031163282674), BOOST_MATH_BIG_CONSTANT(T, 113, 0.572297795434934493541628008224078717), @@ -944,7 +950,7 @@ T erf_imp(T z, bool invert, const Policy& pol, const mpl::int_<113>& t) BOOST_MATH_BIG_CONSTANT(T, 113, -60.0530577077238079968843307523245547), }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 3.49040448075464744191022350947892036), BOOST_MATH_BIG_CONSTANT(T, 113, 34.3563592467165971295915749548313227), BOOST_MATH_BIG_CONSTANT(T, 113, 84.4993232033879023178285731843850461), diff --git a/boost/math/special_functions/expint.hpp b/boost/math/special_functions/expint.hpp index 1c86d282fa..c26420db9e 100644 --- a/boost/math/special_functions/expint.hpp +++ b/boost/math/special_functions/expint.hpp @@ -15,6 +15,7 @@ #include <boost/math/tools/fraction.hpp> #include <boost/math/tools/series.hpp> #include <boost/math/policies/error_handling.hpp> +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/digamma.hpp> #include <boost/math/special_functions/log1p.hpp> #include <boost/math/special_functions/pow.hpp> @@ -55,7 +56,7 @@ T expint_1_rational(const T& z, const mpl::int_<53>&) BOOST_MATH_BIG_CONSTANT(T, 53, -0.000111507792921197858394) }; static const T Q[6] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 0.37091387659397013215), BOOST_MATH_BIG_CONSTANT(T, 53, 0.056770677104207528384), BOOST_MATH_BIG_CONSTANT(T, 53, 0.00427347600017103698101), @@ -84,7 +85,7 @@ T expint_1_rational(const T& z, const mpl::int_<53>&) BOOST_MATH_BIG_CONSTANT(T, 53, -1185.45720315201027667) }; static const T Q[12] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 45.3058660811801465927), BOOST_MATH_BIG_CONSTANT(T, 53, 809.193214954550328455), BOOST_MATH_BIG_CONSTANT(T, 53, 7417.37624454689546708), @@ -130,7 +131,7 @@ T expint_1_rational(const T& z, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, 0.30853660894346057053e-4) }; static const T Q[7] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.317978365797784100273), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0393622602554758722511), BOOST_MATH_BIG_CONSTANT(T, 64, 0.00204062029115966323229), @@ -163,7 +164,7 @@ T expint_1_rational(const T& z, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, -2038.82870680427258038) }; static const T Q[14] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 64.1517806091379399478), BOOST_MATH_BIG_CONSTANT(T, 64, 1690.76044393722763785), BOOST_MATH_BIG_CONSTANT(T, 64, 24035.9534033068949426), @@ -215,7 +216,7 @@ T expint_1_rational(const T& z, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -0.340500302777838063940402160594523429e-9) }; static const T Q[10] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.426568827778942588160423015589537302), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0841384046470893490592450881447510148), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0100557215850668029618957359471132995), @@ -256,7 +257,7 @@ T expint_1_rational(const T& z, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -1.51492042209561411434644938098833499) }; static const T Q[16] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 46.734521442032505570517810766704587), BOOST_MATH_BIG_CONSTANT(T, 113, 908.694714348462269000247450058595655), BOOST_MATH_BIG_CONSTANT(T, 113, 9701.76053033673927362784882748513195), @@ -305,7 +306,7 @@ T expint_1_rational(const T& z, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -68028222642.1941480871395695677675137) }; static const T Q[20] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 168.542326331163836642960118190147311), BOOST_MATH_BIG_CONSTANT(T, 113, 12535.7237814586576783518249115343619), BOOST_MATH_BIG_CONSTANT(T, 113, 544891.263372016404143120911148640627), @@ -541,7 +542,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<53>& tag) BOOST_MATH_BIG_CONSTANT(T, 53, 0.2777056254402008721e-6) }; static const T Q[8] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, -1.17090412365413911947), BOOST_MATH_BIG_CONSTANT(T, 53, 0.62215109846016746276), BOOST_MATH_BIG_CONSTANT(T, 53, -0.195114782069495403315), @@ -563,7 +564,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<53>& tag) result *= t; if(fabs(t) < 0.1) { - result += boost::math::log1p(t / r); + result += boost::math::log1p(t / r, pol); } else { @@ -587,7 +588,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<53>& tag) BOOST_MATH_BIG_CONSTANT(T, 53, -0.396487648924804510056e-5) }; static const T Q[8] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 0.744625566823272107711), BOOST_MATH_BIG_CONSTANT(T, 53, 0.329061095011767059236), BOOST_MATH_BIG_CONSTANT(T, 53, 0.100128624977313872323), @@ -621,7 +622,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<53>& tag) BOOST_MATH_BIG_CONSTANT(T, 53, -0.138652200349182596186e-4) }; static const T Q[9] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 1.97017214039061194971), BOOST_MATH_BIG_CONSTANT(T, 53, 1.86232465043073157508), BOOST_MATH_BIG_CONSTANT(T, 53, 1.09601437090337519977), @@ -657,7 +658,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<53>& tag) BOOST_MATH_BIG_CONSTANT(T, 53, -0.113161784705911400295e-9) }; static const T Q[9] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 2.84354408840148561131), BOOST_MATH_BIG_CONSTANT(T, 53, 3.6599610090072393012), BOOST_MATH_BIG_CONSTANT(T, 53, 2.75088464344293083595), @@ -686,7 +687,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<53>& tag) BOOST_MATH_BIG_CONSTANT(T, 53, -38703.1431362056714134) }; static const T Q[7] = { - BOOST_MATH_BIG_CONSTANT(T, 53, 1), + BOOST_MATH_BIG_CONSTANT(T, 53, 1.0), BOOST_MATH_BIG_CONSTANT(T, 53, 61.9733592849439884145), BOOST_MATH_BIG_CONSTANT(T, 53, -2354.56211323420194283), BOOST_MATH_BIG_CONSTANT(T, 53, 22329.1459489893079041), @@ -757,7 +758,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<64>& tag) BOOST_MATH_BIG_CONSTANT(T, 64, 0.177833045143692498221e-7) }; static const T Q[9] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, -1.20352377969742325748), BOOST_MATH_BIG_CONSTANT(T, 64, 0.66707904942606479811), BOOST_MATH_BIG_CONSTANT(T, 64, -0.223014531629140771914), @@ -780,7 +781,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<64>& tag) result *= t; if(fabs(t) < 0.1) { - result += boost::math::log1p(t / r); + result += boost::math::log1p(t / r, pol); } else { @@ -806,7 +807,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<64>& tag) BOOST_MATH_BIG_CONSTANT(T, 64, -0.377246883283337141444e-6) }; static const T Q[10] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 1.08073635708902053767), BOOST_MATH_BIG_CONSTANT(T, 64, 0.553681133533942532909), BOOST_MATH_BIG_CONSTANT(T, 64, 0.176763647137553797451), @@ -844,7 +845,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<64>& tag) BOOST_MATH_BIG_CONSTANT(T, 64, -0.252788029251437017959e-5) }; static const T Q[10] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 2.00323265503572414261), BOOST_MATH_BIG_CONSTANT(T, 64, 1.94688958187256383178), BOOST_MATH_BIG_CONSTANT(T, 64, 1.19733638134417472296), @@ -883,7 +884,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<64>& tag) BOOST_MATH_BIG_CONSTANT(T, 64, -0.533769629702262072175e-11) }; static const T Q[9] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 3.13286733695729715455), BOOST_MATH_BIG_CONSTANT(T, 64, 4.49281223045653491929), BOOST_MATH_BIG_CONSTANT(T, 64, 3.84900294427622911374), @@ -921,7 +922,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<64>& tag) BOOST_MATH_BIG_CONSTANT(T, 64, 137839271.592778020028) }; static const T Q[9] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 27.2103343964943718802), BOOST_MATH_BIG_CONSTANT(T, 64, -8785.48528692879413676), BOOST_MATH_BIG_CONSTANT(T, 64, 397530.290000322626766), @@ -962,8 +963,8 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<64>& tag) return result; } -template <class T> -void expint_i_imp_113a(T& result, const T& z) +template <class T, class Policy> +void expint_i_imp_113a(T& result, const T& z, const Policy& pol) { BOOST_MATH_STD_USING // Maximum Deviation Found: 1.230e-36 @@ -989,7 +990,7 @@ void expint_i_imp_113a(T& result, const T& z) BOOST_MATH_BIG_CONSTANT(T, 113, 0.306243138978114692252817805327426657e-13) }; static const T Q[15] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, -1.40178870313943798705491944989231793), BOOST_MATH_BIG_CONSTANT(T, 113, 0.943810968269701047641218856758605284), BOOST_MATH_BIG_CONSTANT(T, 113, -0.405026631534345064600850391026113165), @@ -1022,7 +1023,7 @@ void expint_i_imp_113a(T& result, const T& z) result *= t; if(fabs(t) < 0.1) { - result += boost::math::log1p(t / r); + result += boost::math::log1p(t / r, pol); } else { @@ -1057,7 +1058,7 @@ void expint_i_113b(T& result, const T& z) BOOST_MATH_BIG_CONSTANT(T, 113, -0.384276705503357655108096065452950822e-12) }; static const T Q[15] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 1.58784732785354597996617046880946257), BOOST_MATH_BIG_CONSTANT(T, 113, 1.18550755302279446339364262338114098), BOOST_MATH_BIG_CONSTANT(T, 113, 0.55598993549661368604527040349702836), @@ -1110,7 +1111,7 @@ void expint_i_113c(T& result, const T& z) BOOST_MATH_BIG_CONSTANT(T, 113, 0.869226483473172853557775877908693647e-15) }; static const T Q[15] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 2.23227220874479061894038229141871087), BOOST_MATH_BIG_CONSTANT(T, 113, 2.40221000361027971895657505660959863), BOOST_MATH_BIG_CONSTANT(T, 113, 1.65476320985936174728238416007084214), @@ -1159,7 +1160,7 @@ void expint_i_113d(T& result, const T& z) BOOST_MATH_BIG_CONSTANT(T, 113, -0.133141358866324100955927979606981328e-10) }; static const T Q[14] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 1.72490783907582654629537013560044682), BOOST_MATH_BIG_CONSTANT(T, 113, 1.44524329516800613088375685659759765), BOOST_MATH_BIG_CONSTANT(T, 113, 0.778241785539308257585068744978050181), @@ -1211,7 +1212,7 @@ void expint_i_113e(T& result, const T& z) BOOST_MATH_BIG_CONSTANT(T, 113, -0.105428907085424234504608142258423505e-8) }; static const T Q[16] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 3.17261315255467581204685605414005525), BOOST_MATH_BIG_CONSTANT(T, 113, 4.85267952971640525245338392887217426), BOOST_MATH_BIG_CONSTANT(T, 113, 4.74341914912439861451492872946725151), @@ -1262,7 +1263,7 @@ void expint_i_113f(T& result, const T& z) BOOST_MATH_BIG_CONSTANT(T, 113, -0.107839681938752337160494412638656696e-8) }; static const T Q[12] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 2.09913805456661084097134805151524958), BOOST_MATH_BIG_CONSTANT(T, 113, 2.07041755535439919593503171320431849), BOOST_MATH_BIG_CONSTANT(T, 113, 1.26406517226052371320416108604874734), @@ -1308,7 +1309,7 @@ void expint_i_113g(T& result, const T& z) BOOST_MATH_BIG_CONSTANT(T, 113, -0.720558173805289167524715527536874694e-7) }; static const T Q[11] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 2.95918362458402597039366979529287095), BOOST_MATH_BIG_CONSTANT(T, 113, 3.96472247520659077944638411856748924), BOOST_MATH_BIG_CONSTANT(T, 113, 3.15563251550528513747923714884142131), @@ -1351,7 +1352,7 @@ void expint_i_113h(T& result, const T& z) BOOST_MATH_BIG_CONSTANT(T, 113, -6758379.93672362080947905580906028645) }; static const T Q[10] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, -99.4868026047611434569541483506091713), BOOST_MATH_BIG_CONSTANT(T, 113, 3879.67753690517114249705089803055473), BOOST_MATH_BIG_CONSTANT(T, 113, -76495.82413252517165830203774900806), @@ -1383,7 +1384,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<113>& tag) if(z <= 6) { - expint_i_imp_113a(result, z); + expint_i_imp_113a(result, z, pol); } else if (z <= 10) { @@ -1432,7 +1433,7 @@ T expint_i_imp(T z, const Policy& pol, const mpl::int_<113>& tag) BOOST_MATH_BIG_CONSTANT(T, 113, 175864.614717440010942804684741336853) }; static const T Q[9] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, -65.6998869881600212224652719706425129), BOOST_MATH_BIG_CONSTANT(T, 113, 1642.73850032324014781607859416890077), BOOST_MATH_BIG_CONSTANT(T, 113, -19937.2610222467322481947237312818575), diff --git a/boost/math/special_functions/expm1.hpp b/boost/math/special_functions/expm1.hpp index 9ff2541fb1..7423dc5c81 100644 --- a/boost/math/special_functions/expm1.hpp +++ b/boost/math/special_functions/expm1.hpp @@ -151,8 +151,8 @@ T expm1_imp(T x, const mpl::int_<53>&, const P& pol) return x; static const float Y = 0.10281276702880859e1f; - static const T n[] = { -0.28127670288085937e-1, 0.51278186299064534e0, -0.6310029069350198e-1, 0.11638457975729296e-1, -0.52143390687521003e-3, 0.21491399776965688e-4 }; - static const T d[] = { 1, -0.45442309511354755e0, 0.90850389570911714e-1, -0.10088963629815502e-1, 0.63003407478692265e-3, -0.17976570003654402e-4 }; + static const T n[] = { static_cast<T>(-0.28127670288085937e-1), static_cast<T>(0.51278186299064534e0), static_cast<T>(-0.6310029069350198e-1), static_cast<T>(0.11638457975729296e-1), static_cast<T>(-0.52143390687521003e-3), static_cast<T>(0.21491399776965688e-4) }; + static const T d[] = { 1, static_cast<T>(-0.45442309511354755e0), static_cast<T>(0.90850389570911714e-1), static_cast<T>(-0.10088963629815502e-1), static_cast<T>(0.63003407478692265e-3), static_cast<T>(-0.17976570003654402e-4) }; T result = x * Y + x * tools::evaluate_polynomial(n, x) / tools::evaluate_polynomial(d, x); return result; @@ -188,7 +188,7 @@ T expm1_imp(T x, const mpl::int_<64>&, const P& pol) BOOST_MATH_BIG_CONSTANT(T, 64, -0.714539134024984593011e-6) }; static const T d[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, -0.461477618025562520389e0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.961237488025708540713e-1), BOOST_MATH_BIG_CONSTANT(T, 64, -0.116483957658204450739e-1), @@ -234,7 +234,7 @@ T expm1_imp(T x, const mpl::int_<113>&, const P& pol) BOOST_MATH_BIG_CONSTANT(T, 113, 0.45261820069007790520447958280473183582e-10) }; static const T d[] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, -0.45441264709074310514348137469214538853e0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.96827131936192217313133611655555298106e-1), BOOST_MATH_BIG_CONSTANT(T, 113, -0.12745248725908178612540554584374876219e-1), @@ -305,7 +305,7 @@ inline float expm1(float x, const policies::policy<>&){ return ::expm1f(x); } inline long double expm1(long double x, const policies::policy<>&){ return ::expm1l(x); } # endif # else -inline float expm1(float x, const policies::policy<>&){ return ::expm1(x); } +inline float expm1(float x, const policies::policy<>&){ return static_cast<float>(::expm1(x)); } # endif inline double expm1(double x, const policies::policy<>&){ return ::expm1(x); } #endif diff --git a/boost/math/special_functions/factorials.hpp b/boost/math/special_functions/factorials.hpp index f57147ebfa..de24642ac4 100644 --- a/boost/math/special_functions/factorials.hpp +++ b/boost/math/special_functions/factorials.hpp @@ -10,15 +10,14 @@ #pragma once #endif -#include <boost/math/special_functions/gamma.hpp> #include <boost/math/special_functions/math_fwd.hpp> +#include <boost/math/special_functions/gamma.hpp> #include <boost/math/special_functions/detail/unchecked_factorial.hpp> #include <boost/array.hpp> #ifdef BOOST_MSVC #pragma warning(push) // Temporary until lexical cast fixed. #pragma warning(disable: 4127 4701) #endif -#include <boost/lexical_cast.hpp> #ifdef BOOST_MSVC #pragma warning(pop) #endif @@ -142,6 +141,18 @@ T rising_factorial_imp(T x, int n, const Policy& pol) } if(n == 0) return 1; + if(x == 0) + { + if(n < 0) + return -boost::math::tgamma_delta_ratio(x + 1, static_cast<T>(-n), pol); + else + return 0; + } + if((x < 1) && (x + n < 0)) + { + T val = boost::math::tgamma_delta_ratio(1 - x, static_cast<T>(-n), pol); + return (n & 1) ? -val : val; + } // // We don't optimise this for small n, because // tgamma_delta_ratio is alreay optimised for that @@ -155,7 +166,7 @@ inline T falling_factorial_imp(T x, unsigned n, const Policy& pol) { BOOST_STATIC_ASSERT(!boost::is_integral<T>::value); BOOST_MATH_STD_USING // ADL of std names - if(x == 0) + if((x == 0) && (n >= 0)) return 0; if(x < 0) { @@ -167,7 +178,24 @@ inline T falling_factorial_imp(T x, unsigned n, const Policy& pol) } if(n == 0) return 1; - if(x < n-1) + if(x < 0.5f) + { + // + // 1 + x below will throw away digits, so split up calculation: + // + if(n > max_factorial<T>::value - 2) + { + // If the two end of the range are far apart we have a ratio of two very large + // numbers, split the calculation up into two blocks: + T t1 = x * boost::math::falling_factorial(x - 1, max_factorial<T>::value - 2); + T t2 = boost::math::falling_factorial(x - max_factorial<T>::value + 1, n - max_factorial<T>::value + 1); + if(tools::max_value<T>() / fabs(t1) < fabs(t2)) + return boost::math::sign(t1) * boost::math::sign(t2) * policies::raise_overflow_error<T>("boost::math::falling_factorial<%1%>", 0, pol); + return t1 * t2; + } + return x * boost::math::falling_factorial(x - 1, n - 1); + } + if(x <= n - 1) { // // x+1-n will be negative and tgamma_delta_ratio won't diff --git a/boost/math/special_functions/fpclassify.hpp b/boost/math/special_functions/fpclassify.hpp index 2abec5fa84..40f6e14ba5 100644 --- a/boost/math/special_functions/fpclassify.hpp +++ b/boost/math/special_functions/fpclassify.hpp @@ -37,13 +37,13 @@ the template is never instantiated. a floating point type (float, double or long double) can be determined at compile time, then the following algorithm is used: - If all exponent bits, the flag bit (if there is one), + If all exponent bits, the flag bit (if there is one), and all significand bits are 0, then the number is zero. - If all exponent bits and the flag bit (if there is one) are 0, + If all exponent bits and the flag bit (if there is one) are 0, and at least one significand bit is 1, then the number is subnormal. - If all exponent bits are 1 and all significand bits are 0, + If all exponent bits are 1 and all significand bits are 0, then the number is infinity. If all exponent bits are 1 and at least one significand bit is 1, @@ -56,7 +56,7 @@ at compile time, then the following algorithm is used: Most formats have the structure sign bit + exponent bits + significand bits. - + A few have the structure sign bit + exponent bits + flag bit + significand bits. The flag bit is 0 for zero and subnormal numbers, @@ -85,7 +85,7 @@ is used. namespace std{ using ::abs; using ::fabs; } #endif -namespace boost{ +namespace boost{ // // This must not be located in any namespace under boost::math @@ -94,18 +94,28 @@ namespace boost{ // namespace math_detail{ +#ifdef BOOST_MSVC +#pragma warning(push) +#pragma warning(disable:4800) +#endif + template <class T> inline bool is_nan_helper(T t, const boost::true_type&) { #ifdef isnan return isnan(t); #elif defined(BOOST_MATH_DISABLE_STD_FPCLASSIFY) || !defined(BOOST_HAS_FPCLASSIFY) + (void)t; return false; #else // BOOST_HAS_FPCLASSIFY return (BOOST_FPCLASSIFY_PREFIX fpclassify(t) == (int)FP_NAN); #endif } +#ifdef BOOST_MSVC +#pragma warning(pop) +#endif + template <class T> inline bool is_nan_helper(T, const boost::false_type&) { @@ -169,7 +179,7 @@ inline int fpclassify_imp BOOST_NO_MACRO_EXPAND(T t, const generic_tag<false>&) if(std::numeric_limits<T>::is_specialized) return fpclassify_imp(t, generic_tag<true>()); #endif - // + // // An unknown type with no numeric_limits support, // so what are we supposed to do we do here? // @@ -178,7 +188,7 @@ inline int fpclassify_imp BOOST_NO_MACRO_EXPAND(T t, const generic_tag<false>&) return t == 0 ? FP_ZERO : FP_NORMAL; } -template<class T> +template<class T> int fpclassify_imp BOOST_NO_MACRO_EXPAND(T x, ieee_copy_all_bits_tag) { typedef BOOST_DEDUCED_TYPENAME fp_traits<T>::type traits; @@ -207,7 +217,7 @@ int fpclassify_imp BOOST_NO_MACRO_EXPAND(T x, ieee_copy_all_bits_tag) return FP_NAN; } -template<class T> +template<class T> int fpclassify_imp BOOST_NO_MACRO_EXPAND(T x, ieee_copy_leading_bits_tag) { typedef BOOST_DEDUCED_TYPENAME fp_traits<T>::type traits; @@ -215,7 +225,7 @@ int fpclassify_imp BOOST_NO_MACRO_EXPAND(T x, ieee_copy_leading_bits_tag) BOOST_MATH_INSTRUMENT_VARIABLE(x); BOOST_DEDUCED_TYPENAME traits::bits a; - traits::get_bits(x,a); + traits::get_bits(x,a); a &= traits::exponent | traits::flag | traits::significand; if(a <= traits::significand) { @@ -234,9 +244,8 @@ int fpclassify_imp BOOST_NO_MACRO_EXPAND(T x, ieee_copy_leading_bits_tag) return FP_NAN; } -#if defined(BOOST_MATH_USE_STD_FPCLASSIFY) && defined(BOOST_MATH_NO_NATIVE_LONG_DOUBLE_FP_CLASSIFY) -template <> -inline int fpclassify_imp<long double> BOOST_NO_MACRO_EXPAND(long double t, const native_tag&) +#if defined(BOOST_MATH_USE_STD_FPCLASSIFY) && (defined(BOOST_MATH_NO_NATIVE_LONG_DOUBLE_FP_CLASSIFY) || defined(BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS)) +inline int fpclassify_imp BOOST_NO_MACRO_EXPAND(long double t, const native_tag&) { return boost::math::detail::fpclassify_imp(t, generic_tag<true>()); } @@ -249,33 +258,51 @@ inline int fpclassify BOOST_NO_MACRO_EXPAND(T t) { typedef typename detail::fp_traits<T>::type traits; typedef typename traits::method method; + typedef typename tools::promote_args_permissive<T>::type value_type; #ifdef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS if(std::numeric_limits<T>::is_specialized && detail::is_generic_tag_false(static_cast<method*>(0))) - return detail::fpclassify_imp(t, detail::generic_tag<true>()); - return detail::fpclassify_imp(t, method()); + return detail::fpclassify_imp(static_cast<value_type>(t), detail::generic_tag<true>()); + return detail::fpclassify_imp(static_cast<value_type>(t), method()); #else - return detail::fpclassify_imp(t, method()); + return detail::fpclassify_imp(static_cast<value_type>(t), method()); #endif } +#ifdef BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS +template <> +inline int fpclassify<long double> BOOST_NO_MACRO_EXPAND(long double t) +{ + typedef detail::fp_traits<long double>::type traits; + typedef traits::method method; + typedef long double value_type; +#ifdef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS + if(std::numeric_limits<long double>::is_specialized && detail::is_generic_tag_false(static_cast<method*>(0))) + return detail::fpclassify_imp(static_cast<value_type>(t), detail::generic_tag<true>()); + return detail::fpclassify_imp(static_cast<value_type>(t), method()); +#else + return detail::fpclassify_imp(static_cast<value_type>(t), method()); +#endif +} +#endif + namespace detail { #ifdef BOOST_MATH_USE_STD_FPCLASSIFY - template<class T> + template<class T> inline bool isfinite_impl(T x, native_tag const&) { return (std::isfinite)(x); } #endif - template<class T> + template<class T> inline bool isfinite_impl(T x, generic_tag<true> const&) { return x >= -(std::numeric_limits<T>::max)() && x <= (std::numeric_limits<T>::max)(); } - template<class T> + template<class T> inline bool isfinite_impl(T x, generic_tag<false> const&) { #ifdef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS @@ -286,7 +313,7 @@ namespace detail { return true; } - template<class T> + template<class T> inline bool isfinite_impl(T x, ieee_tag const&) { typedef BOOST_DEDUCED_TYPENAME detail::fp_traits<T>::type traits; @@ -297,8 +324,7 @@ namespace detail { } #if defined(BOOST_MATH_USE_STD_FPCLASSIFY) && defined(BOOST_MATH_NO_NATIVE_LONG_DOUBLE_FP_CLASSIFY) -template <> -inline bool isfinite_impl<long double> BOOST_NO_MACRO_EXPAND(long double t, const native_tag&) +inline bool isfinite_impl BOOST_NO_MACRO_EXPAND(long double t, const native_tag&) { return boost::math::detail::isfinite_impl(t, generic_tag<true>()); } @@ -306,28 +332,41 @@ inline bool isfinite_impl<long double> BOOST_NO_MACRO_EXPAND(long double t, cons } -template<class T> +template<class T> inline bool (isfinite)(T x) { //!< \brief return true if floating-point type t is finite. typedef typename detail::fp_traits<T>::type traits; typedef typename traits::method method; - typedef typename boost::is_floating_point<T>::type fp_tag; - return detail::isfinite_impl(x, method()); + // typedef typename boost::is_floating_point<T>::type fp_tag; + typedef typename tools::promote_args_permissive<T>::type value_type; + return detail::isfinite_impl(static_cast<value_type>(x), method()); } +#ifdef BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS +template<> +inline bool (isfinite)(long double x) +{ //!< \brief return true if floating-point type t is finite. + typedef detail::fp_traits<long double>::type traits; + typedef traits::method method; + //typedef boost::is_floating_point<long double>::type fp_tag; + typedef long double value_type; + return detail::isfinite_impl(static_cast<value_type>(x), method()); +} +#endif + //------------------------------------------------------------------------------ namespace detail { #ifdef BOOST_MATH_USE_STD_FPCLASSIFY - template<class T> + template<class T> inline bool isnormal_impl(T x, native_tag const&) { return (std::isnormal)(x); } #endif - template<class T> + template<class T> inline bool isnormal_impl(T x, generic_tag<true> const&) { if(x < 0) x = -x; @@ -335,7 +374,7 @@ namespace detail { && x <= (std::numeric_limits<T>::max)(); } - template<class T> + template<class T> inline bool isnormal_impl(T x, generic_tag<false> const&) { #ifdef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS @@ -345,7 +384,7 @@ namespace detail { return !(x == 0); } - template<class T> + template<class T> inline bool isnormal_impl(T x, ieee_tag const&) { typedef BOOST_DEDUCED_TYPENAME detail::fp_traits<T>::type traits; @@ -356,8 +395,7 @@ namespace detail { } #if defined(BOOST_MATH_USE_STD_FPCLASSIFY) && defined(BOOST_MATH_NO_NATIVE_LONG_DOUBLE_FP_CLASSIFY) -template <> -inline bool isnormal_impl<long double> BOOST_NO_MACRO_EXPAND(long double t, const native_tag&) +inline bool isnormal_impl BOOST_NO_MACRO_EXPAND(long double t, const native_tag&) { return boost::math::detail::isnormal_impl(t, generic_tag<true>()); } @@ -365,37 +403,50 @@ inline bool isnormal_impl<long double> BOOST_NO_MACRO_EXPAND(long double t, cons } -template<class T> +template<class T> inline bool (isnormal)(T x) { typedef typename detail::fp_traits<T>::type traits; typedef typename traits::method method; - typedef typename boost::is_floating_point<T>::type fp_tag; - return detail::isnormal_impl(x, method()); + //typedef typename boost::is_floating_point<T>::type fp_tag; + typedef typename tools::promote_args_permissive<T>::type value_type; + return detail::isnormal_impl(static_cast<value_type>(x), method()); } +#ifdef BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS +template<> +inline bool (isnormal)(long double x) +{ + typedef detail::fp_traits<long double>::type traits; + typedef traits::method method; + //typedef boost::is_floating_point<long double>::type fp_tag; + typedef long double value_type; + return detail::isnormal_impl(static_cast<value_type>(x), method()); +} +#endif + //------------------------------------------------------------------------------ namespace detail { #ifdef BOOST_MATH_USE_STD_FPCLASSIFY - template<class T> + template<class T> inline bool isinf_impl(T x, native_tag const&) { return (std::isinf)(x); } #endif - template<class T> + template<class T> inline bool isinf_impl(T x, generic_tag<true> const&) { (void)x; // in case the compiler thinks that x is unused because std::numeric_limits<T>::has_infinity is false - return std::numeric_limits<T>::has_infinity + return std::numeric_limits<T>::has_infinity && ( x == std::numeric_limits<T>::infinity() || x == -std::numeric_limits<T>::infinity()); } - template<class T> + template<class T> inline bool isinf_impl(T x, generic_tag<false> const&) { #ifdef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS @@ -406,7 +457,7 @@ namespace detail { return false; } - template<class T> + template<class T> inline bool isinf_impl(T x, ieee_copy_all_bits_tag const&) { typedef BOOST_DEDUCED_TYPENAME fp_traits<T>::type traits; @@ -417,7 +468,7 @@ namespace detail { return a == traits::exponent; } - template<class T> + template<class T> inline bool isinf_impl(T x, ieee_copy_leading_bits_tag const&) { typedef BOOST_DEDUCED_TYPENAME fp_traits<T>::type traits; @@ -433,8 +484,7 @@ namespace detail { } #if defined(BOOST_MATH_USE_STD_FPCLASSIFY) && defined(BOOST_MATH_NO_NATIVE_LONG_DOUBLE_FP_CLASSIFY) -template <> -inline bool isinf_impl<long double> BOOST_NO_MACRO_EXPAND(long double t, const native_tag&) +inline bool isinf_impl BOOST_NO_MACRO_EXPAND(long double t, const native_tag&) { return boost::math::detail::isinf_impl(t, generic_tag<true>()); } @@ -442,28 +492,41 @@ inline bool isinf_impl<long double> BOOST_NO_MACRO_EXPAND(long double t, const n } // namespace detail -template<class T> +template<class T> inline bool (isinf)(T x) { typedef typename detail::fp_traits<T>::type traits; typedef typename traits::method method; - typedef typename boost::is_floating_point<T>::type fp_tag; - return detail::isinf_impl(x, method()); + // typedef typename boost::is_floating_point<T>::type fp_tag; + typedef typename tools::promote_args_permissive<T>::type value_type; + return detail::isinf_impl(static_cast<value_type>(x), method()); } +#ifdef BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS +template<> +inline bool (isinf)(long double x) +{ + typedef detail::fp_traits<long double>::type traits; + typedef traits::method method; + //typedef boost::is_floating_point<long double>::type fp_tag; + typedef long double value_type; + return detail::isinf_impl(static_cast<value_type>(x), method()); +} +#endif + //------------------------------------------------------------------------------ namespace detail { #ifdef BOOST_MATH_USE_STD_FPCLASSIFY - template<class T> + template<class T> inline bool isnan_impl(T x, native_tag const&) { return (std::isnan)(x); } #endif - template<class T> + template<class T> inline bool isnan_impl(T x, generic_tag<true> const&) { return std::numeric_limits<T>::has_infinity @@ -471,7 +534,7 @@ namespace detail { : x != x; } - template<class T> + template<class T> inline bool isnan_impl(T x, generic_tag<false> const&) { #ifdef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS @@ -482,7 +545,7 @@ namespace detail { return false; } - template<class T> + template<class T> inline bool isnan_impl(T x, ieee_copy_all_bits_tag const&) { typedef BOOST_DEDUCED_TYPENAME fp_traits<T>::type traits; @@ -493,7 +556,7 @@ namespace detail { return a > traits::exponent; } - template<class T> + template<class T> inline bool isnan_impl(T x, ieee_copy_leading_bits_tag const&) { typedef BOOST_DEDUCED_TYPENAME fp_traits<T>::type traits; @@ -512,11 +575,12 @@ namespace detail { } // namespace detail -template<class T> bool (isnan)(T x) +template<class T> +inline bool (isnan)(T x) { //!< \brief return true if floating-point type t is NaN (Not A Number). typedef typename detail::fp_traits<T>::type traits; typedef typename traits::method method; - typedef typename boost::is_floating_point<T>::type fp_tag; + // typedef typename boost::is_floating_point<T>::type fp_tag; return detail::isnan_impl(x, method()); } @@ -524,6 +588,15 @@ template<class T> bool (isnan)(T x) template <> inline bool isnan BOOST_NO_MACRO_EXPAND<float>(float t){ return ::boost::math_detail::is_nan_helper(t, boost::true_type()); } template <> inline bool isnan BOOST_NO_MACRO_EXPAND<double>(double t){ return ::boost::math_detail::is_nan_helper(t, boost::true_type()); } template <> inline bool isnan BOOST_NO_MACRO_EXPAND<long double>(long double t){ return ::boost::math_detail::is_nan_helper(t, boost::true_type()); } +#elif defined(BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS) +template<> +inline bool (isnan)(long double x) +{ //!< \brief return true if floating-point type t is NaN (Not A Number). + typedef detail::fp_traits<long double>::type traits; + typedef traits::method method; + //typedef boost::is_floating_point<long double>::type fp_tag; + return detail::isnan_impl(x, method()); +} #endif } // namespace math diff --git a/boost/math/special_functions/gamma.hpp b/boost/math/special_functions/gamma.hpp index 86d15b7f2a..b6b4c574a9 100644 --- a/boost/math/special_functions/gamma.hpp +++ b/boost/math/special_functions/gamma.hpp @@ -1,6 +1,8 @@ -// Copyright John Maddock 2006-7. -// Copyright Paul A. Bristow 2007. +// Copyright John Maddock 2006-7, 2013-14. +// Copyright Paul A. Bristow 2007, 2013-14. +// Copyright Nikhar Agrawal 2013-14 +// Copyright Christopher Kormanyos 2013-14 // Use, modification and distribution are subject to the // Boost Software License, Version 1.0. (See accompanying file @@ -14,17 +16,6 @@ #endif #include <boost/config.hpp> -#ifdef BOOST_MSVC -# pragma warning(push) -# pragma warning(disable: 4127 4701) -// // For lexical_cast, until fixed in 1.35? -// // conditional expression is constant & -// // Potentially uninitialized local variable 'name' used -#endif -#include <boost/lexical_cast.hpp> -#ifdef BOOST_MSVC -# pragma warning(pop) -#endif #include <boost/math/tools/series.hpp> #include <boost/math/tools/fraction.hpp> #include <boost/math/tools/precision.hpp> @@ -41,6 +32,7 @@ #include <boost/math/special_functions/detail/igamma_large.hpp> #include <boost/math/special_functions/detail/unchecked_factorial.hpp> #include <boost/math/special_functions/detail/lgamma_small.hpp> +#include <boost/math/special_functions/bernoulli.hpp> #include <boost/type_traits/is_convertible.hpp> #include <boost/assert.hpp> #include <boost/mpl/greater.hpp> @@ -50,12 +42,6 @@ #include <boost/config/no_tr1/cmath.hpp> #include <algorithm> -#ifdef BOOST_MATH_INSTRUMENT -#include <iostream> -#include <iomanip> -#include <typeinfo> -#endif - #ifdef BOOST_MSVC # pragma warning(push) # pragma warning(disable: 4702) // unreachable code (return after domain_error throw). @@ -153,7 +139,7 @@ T gamma_imp(T z, const Policy& pol, const Lanczos& l) result = gamma_imp(T(-z), pol, l) * sinpx(z); BOOST_MATH_INSTRUMENT_VARIABLE(result); if((fabs(result) < 1) && (tools::max_value<T>() * fabs(result) < boost::math::constants::pi<T>())) - return policies::raise_overflow_error<T>(function, "Result of tgamma is too large to represent.", pol); + return -boost::math::sign(result) * policies::raise_overflow_error<T>(function, "Result of tgamma is too large to represent.", pol); result = -boost::math::constants::pi<T>() / result; if(result == 0) return policies::raise_underflow_error<T>(function, "Result of tgamma is too small to represent.", pol); @@ -176,30 +162,36 @@ T gamma_imp(T z, const Policy& pol, const Lanczos& l) result *= unchecked_factorial<T>(itrunc(z, pol) - 1); BOOST_MATH_INSTRUMENT_VARIABLE(result); } + else if (z < tools::root_epsilon<T>()) + { + if (z < 1 / tools::max_value<T>()) + result = policies::raise_overflow_error<T>(function, 0, pol); + result *= 1 / z - constants::euler<T>(); + } else { result *= Lanczos::lanczos_sum(z); + T zgh = (z + static_cast<T>(Lanczos::g()) - boost::math::constants::half<T>()); + T lzgh = log(zgh); BOOST_MATH_INSTRUMENT_VARIABLE(result); BOOST_MATH_INSTRUMENT_VARIABLE(tools::log_max_value<T>()); - if(z * log(z) > tools::log_max_value<T>()) + if(z * lzgh > tools::log_max_value<T>()) { // we're going to overflow unless this is done with care: - T zgh = (z + static_cast<T>(Lanczos::g()) - boost::math::constants::half<T>()); BOOST_MATH_INSTRUMENT_VARIABLE(zgh); - if(log(zgh) * z / 2 > tools::log_max_value<T>()) - return policies::raise_overflow_error<T>(function, "Result of tgamma is too large to represent.", pol); + if(lzgh * z / 2 > tools::log_max_value<T>()) + return boost::math::sign(result) * policies::raise_overflow_error<T>(function, "Result of tgamma is too large to represent.", pol); T hp = pow(zgh, (z / 2) - T(0.25)); BOOST_MATH_INSTRUMENT_VARIABLE(hp); result *= hp / exp(zgh); BOOST_MATH_INSTRUMENT_VARIABLE(result); if(tools::max_value<T>() / hp < result) - return policies::raise_overflow_error<T>(function, "Result of tgamma is too large to represent.", pol); + return boost::math::sign(result) * policies::raise_overflow_error<T>(function, "Result of tgamma is too large to represent.", pol); result *= hp; BOOST_MATH_INSTRUMENT_VARIABLE(result); } else { - T zgh = (z + static_cast<T>(Lanczos::g()) - boost::math::constants::half<T>()); BOOST_MATH_INSTRUMENT_VARIABLE(zgh); BOOST_MATH_INSTRUMENT_VARIABLE(pow(zgh, z - boost::math::constants::half<T>())); BOOST_MATH_INSTRUMENT_VARIABLE(exp(zgh)); @@ -230,7 +222,7 @@ T lgamma_imp(T z, const Policy& pol, const Lanczos& l, int* sign = 0) T result = 0; int sresult = 1; - if(z <= 0) + if(z <= -tools::root_epsilon<T>()) { // reflection formula: if(floor(z) == z) @@ -248,6 +240,17 @@ T lgamma_imp(T z, const Policy& pol, const Lanczos& l, int* sign = 0) } result = log(boost::math::constants::pi<T>()) - lgamma_imp(z, pol, l) - log(t); } + else if (z < tools::root_epsilon<T>()) + { + if (0 == z) + return policies::raise_pole_error<T>(function, "Evaluation of lgamma at %1%.", z, pol); + if (fabs(z) < 1 / tools::max_value<T>()) + result = -log(fabs(z)); + else + result = log(fabs(1 / z - constants::euler<T>())); + if (z < 0) + sresult = -1; + } else if(z < 15) { typedef typename policies::precision<T, Policy>::type precision_type; @@ -266,7 +269,7 @@ T lgamma_imp(T z, const Policy& pol, const Lanczos& l, int* sign = 0) >::type tag_type; result = lgamma_small_imp<T>(z, T(z - 1), T(z - 2), tag_type(), pol, l); } - else if((z >= 3) && (z < 100)) + else if((z >= 3) && (z < 100) && (std::numeric_limits<T>::max_exponent >= 1024)) { // taking the log of tgamma reduces the error, no danger of overflow here: result = log(gamma_imp(z, pol, l)); @@ -353,96 +356,271 @@ inline T lower_gamma_series(T a, T z, const Policy& pol, T init_value = 0) } // -// Fully generic tgamma and lgamma use the incomplete partial -// sums added together: +// Fully generic tgamma and lgamma use Stirling's approximation +// with Bernoulli numbers. // +template<class T> +std::size_t highest_bernoulli_index() +{ + const float digits10_of_type = (std::numeric_limits<T>::is_specialized + ? static_cast<float>(std::numeric_limits<T>::digits10) + : static_cast<float>(boost::math::tools::digits<T>() * 0.301F)); + + // Find the high index n for Bn to produce the desired precision in Stirling's calculation. + return static_cast<std::size_t>(18.0F + (0.6F * digits10_of_type)); +} + +template<class T> +T minimum_argument_for_bernoulli_recursion() +{ + const float digits10_of_type = (std::numeric_limits<T>::is_specialized + ? static_cast<float>(std::numeric_limits<T>::digits10) + : static_cast<float>(boost::math::tools::digits<T>() * 0.301F)); + + return T(digits10_of_type * 1.7F); +} + +// Forward declaration of the lgamma_imp template specialization. template <class T, class Policy> -T gamma_imp(T z, const Policy& pol, const lanczos::undefined_lanczos& l) +T lgamma_imp(T z, const Policy& pol, const lanczos::undefined_lanczos&, int* sign = 0); + +template <class T, class Policy> +T gamma_imp(T z, const Policy& pol, const lanczos::undefined_lanczos&) { - static const char* function = "boost::math::tgamma<%1%>(%1%)"; BOOST_MATH_STD_USING - if((z <= 0) && (floor(z) == z)) - return policies::raise_pole_error<T>(function, "Evaluation of tgamma at a negative integer %1%.", z, pol); - if(z <= -20) + + static const char* function = "boost::math::tgamma<%1%>(%1%)"; + + // Check if the argument of tgamma is identically zero. + const bool is_at_zero = (z == 0); + + if(is_at_zero) + return policies::raise_domain_error<T>(function, "Evaluation of tgamma at zero %1%.", z, pol); + + const bool b_neg = (z < 0); + + const bool floor_of_z_is_equal_to_z = (floor(z) == z); + + // Special case handling of small factorials: + if((!b_neg) && floor_of_z_is_equal_to_z && (z < boost::math::max_factorial<T>::value)) { - T result = gamma_imp(T(-z), pol, l) * sinpx(z); - if((fabs(result) < 1) && (tools::max_value<T>() * fabs(result) < boost::math::constants::pi<T>())) - return policies::raise_overflow_error<T>(function, "Result of tgamma is too large to represent.", pol); - result = -boost::math::constants::pi<T>() / result; - if(result == 0) - return policies::raise_underflow_error<T>(function, "Result of tgamma is too small to represent.", pol); - if((boost::math::fpclassify)(result) == (int)FP_SUBNORMAL) - return policies::raise_denorm_error<T>(function, "Result of tgamma is denormalized.", result, pol); - return result; + return boost::math::unchecked_factorial<T>(itrunc(z) - 1); } - // - // The upper gamma fraction is *very* slow for z < 6, actually it's very - // slow to converge everywhere but recursing until z > 6 gets rid of the - // worst of it's behaviour. - // - T prefix = 1; - while(z < 6) + + // Make a local, unsigned copy of the input argument. + T zz((!b_neg) ? z : -z); + + // Special case for ultra-small z: + if(zz < tools::cbrt_epsilon<T>()) { - prefix /= z; - z += 1; + const T a0(1); + const T a1(boost::math::constants::euler<T>()); + const T six_euler_squared((boost::math::constants::euler<T>() * boost::math::constants::euler<T>()) * 6); + const T a2((six_euler_squared - boost::math::constants::pi_sqr<T>()) / 12); + + const T inverse_tgamma_series = z * ((a2 * z + a1) * z + a0); + + return 1 / inverse_tgamma_series; } - BOOST_MATH_INSTRUMENT_CODE(prefix); - if((floor(z) == z) && (z < max_factorial<T>::value)) + + // Scale the argument up for the calculation of lgamma, + // and use downward recursion later for the final result. + const T min_arg_for_recursion = minimum_argument_for_bernoulli_recursion<T>(); + + int n_recur; + + if(zz < min_arg_for_recursion) { - prefix *= unchecked_factorial<T>(itrunc(z, pol) - 1); + n_recur = boost::math::itrunc(min_arg_for_recursion - zz) + 1; + + zz += n_recur; } else { - prefix = prefix * pow(z / boost::math::constants::e<T>(), z); - BOOST_MATH_INSTRUMENT_CODE(prefix); - T sum = detail::lower_gamma_series(z, z, pol) / z; - BOOST_MATH_INSTRUMENT_CODE(sum); - sum += detail::upper_gamma_fraction(z, z, ::boost::math::policies::get_epsilon<T, Policy>()); - BOOST_MATH_INSTRUMENT_CODE(sum); - if(fabs(tools::max_value<T>() / prefix) < fabs(sum)) + n_recur = 0; + } + + const T log_gamma_value = lgamma_imp(zz, pol, lanczos::undefined_lanczos()); + + if(log_gamma_value > tools::log_max_value<T>()) + return policies::raise_overflow_error<T>(function, 0, pol); + + T gamma_value = exp(log_gamma_value); + + // Rescale the result using downward recursion if necessary. + if(n_recur) + { + // The order of divides is important, if we keep subtracting 1 from zz + // we DO NOT get back to z (cancellation error). Further if z < epsilon + // we would end up dividing by zero. Also in order to prevent spurious + // overflow with the first division, we must save dividing by |z| till last, + // so the optimal order of divides is z+1, z+2, z+3...z+n_recur-1,z. + zz = fabs(z) + 1; + for(int k = 1; k < n_recur; ++k) + { + gamma_value /= zz; + zz += 1; + } + gamma_value /= fabs(z); + } + + // Return the result, accounting for possible negative arguments. + if(b_neg) + { + // Provide special error analysis for: + // * arguments in the neighborhood of a negative integer + // * arguments exactly equal to a negative integer. + + // Check if the argument of tgamma is exactly equal to a negative integer. + if(floor_of_z_is_equal_to_z) + return policies::raise_pole_error<T>(function, "Evaluation of tgamma at a negative integer %1%.", z, pol); + + gamma_value *= sinpx(z); + + BOOST_MATH_INSTRUMENT_VARIABLE(gamma_value); + + const bool result_is_too_large_to_represent = ( (abs(gamma_value) < 1) + && ((tools::max_value<T>() * abs(gamma_value)) < boost::math::constants::pi<T>())); + + if(result_is_too_large_to_represent) return policies::raise_overflow_error<T>(function, "Result of tgamma is too large to represent.", pol); - BOOST_MATH_INSTRUMENT_CODE((sum * prefix)); - return sum * prefix; + + gamma_value = -boost::math::constants::pi<T>() / gamma_value; + BOOST_MATH_INSTRUMENT_VARIABLE(gamma_value); + + if(gamma_value == 0) + return policies::raise_underflow_error<T>(function, "Result of tgamma is too small to represent.", pol); + + if((boost::math::fpclassify)(gamma_value) == static_cast<int>(FP_SUBNORMAL)) + return policies::raise_denorm_error<T>(function, "Result of tgamma is denormalized.", gamma_value, pol); } - return prefix; + + return gamma_value; } template <class T, class Policy> -T lgamma_imp(T z, const Policy& pol, const lanczos::undefined_lanczos& l, int*sign) +T lgamma_imp(T z, const Policy& pol, const lanczos::undefined_lanczos&, int* sign) { BOOST_MATH_STD_USING static const char* function = "boost::math::lgamma<%1%>(%1%)"; - T result = 0; - int sresult = 1; - if(z <= 0) + + // Check if the argument of lgamma is identically zero. + const bool is_at_zero = (z == 0); + + if(is_at_zero) + return policies::raise_domain_error<T>(function, "Evaluation of lgamma at zero %1%.", z, pol); + + const bool b_neg = (z < 0); + + const bool floor_of_z_is_equal_to_z = (floor(z) == z); + + // Special case handling of small factorials: + if((!b_neg) && floor_of_z_is_equal_to_z && (z < boost::math::max_factorial<T>::value)) { - if(floor(z) == z) - return policies::raise_pole_error<T>(function, "Evaluation of tgamma at a negative integer %1%.", z, pol); - T t = detail::sinpx(z); - z = -z; + return log(boost::math::unchecked_factorial<T>(itrunc(z) - 1)); + } + + // Make a local, unsigned copy of the input argument. + T zz((!b_neg) ? z : -z); + + const T min_arg_for_recursion = minimum_argument_for_bernoulli_recursion<T>(); + + T log_gamma_value; + + if (zz < min_arg_for_recursion) + { + // Here we simply take the logarithm of tgamma(). This is somewhat + // inefficient, but simple. The rationale is that the argument here + // is relatively small and overflow is not expected to be likely. + if (z > -tools::root_epsilon<T>()) + { + // Reflection formula may fail if z is very close to zero, let the series + // expansion for tgamma close to zero do the work: + log_gamma_value = log(abs(gamma_imp(z, pol, lanczos::undefined_lanczos()))); + if (sign) + { + *sign = z < 0 ? -1 : 1; + } + return log_gamma_value; + } + else + { + // No issue with spurious overflow in reflection formula, + // just fall through to regular code: + log_gamma_value = log(abs(gamma_imp(zz, pol, lanczos::undefined_lanczos()))); + } + } + else + { + // Perform the Bernoulli series expansion of Stirling's approximation. + + const std::size_t number_of_bernoullis_b2n = highest_bernoulli_index<T>(); + + T one_over_x_pow_two_n_minus_one = 1 / zz; + const T one_over_x2 = one_over_x_pow_two_n_minus_one * one_over_x_pow_two_n_minus_one; + T sum = (boost::math::bernoulli_b2n<T>(1) / 2) * one_over_x_pow_two_n_minus_one; + const T target_epsilon_to_break_loop = (sum * boost::math::tools::epsilon<T>()) * T(1.0E-10F); + + for(std::size_t n = 2U; n < number_of_bernoullis_b2n; ++n) + { + one_over_x_pow_two_n_minus_one *= one_over_x2; + + const std::size_t n2 = static_cast<std::size_t>(n * 2U); + + const T term = (boost::math::bernoulli_b2n<T>(static_cast<int>(n)) * one_over_x_pow_two_n_minus_one) / (n2 * (n2 - 1U)); + + if((n >= 8U) && (abs(term) < target_epsilon_to_break_loop)) + { + // We have reached the desired precision in Stirling's expansion. + // Adding additional terms to the sum of this divergent asymptotic + // expansion will not improve the result. + + // Break from the loop. + break; + } + + sum += term; + } + + // Complete Stirling's approximation. + const T half_ln_two_pi = log(boost::math::constants::two_pi<T>()) / 2; + + log_gamma_value = ((((zz - boost::math::constants::half<T>()) * log(zz)) - zz) + half_ln_two_pi) + sum; + } + + int sign_of_result = 1; + + if(b_neg) + { + // Provide special error analysis if the argument is exactly + // equal to a negative integer. + + // Check if the argument of lgamma is exactly equal to a negative integer. + if(floor_of_z_is_equal_to_z) + return policies::raise_pole_error<T>(function, "Evaluation of lgamma at a negative integer %1%.", z, pol); + + T t = sinpx(z); + if(t < 0) { t = -t; } else { - sresult = -sresult; + sign_of_result = -sign_of_result; } - result = log(boost::math::constants::pi<T>()) - lgamma_imp(z, pol, l, 0) - log(t); - } - else if((z != 1) && (z != 2)) - { - T limit = (std::max)(T(z+1), T(10)); - T prefix = z * log(limit) - limit; - T sum = detail::lower_gamma_series(z, limit, pol) / z; - sum += detail::upper_gamma_fraction(z, limit, ::boost::math::policies::get_epsilon<T, Policy>()); - result = log(sum) + prefix; + + log_gamma_value = - log_gamma_value + + log(boost::math::constants::pi<T>()) + - log(t); } - if(sign) - *sign = sresult; - return result; + + if(sign != static_cast<int*>(0U)) { *sign = sign_of_result; } + + return log_gamma_value; } + // // This helper calculates tgamma(dz+1)-1 without cancellation errors, // used by the upper incomplete gamma with z < 1: @@ -604,7 +782,7 @@ T full_igamma_prefix(T a, T z, const Policy& pol) // rather than before it... // if((boost::math::fpclassify)(prefix) == (int)FP_INFINITE) - policies::raise_overflow_error<T>("boost::math::detail::full_igamma_prefix<%1%>(%1%, %1%)", "Result of incomplete gamma function is too large to represent.", pol); + return policies::raise_overflow_error<T>("boost::math::detail::full_igamma_prefix<%1%>(%1%, %1%)", "Result of incomplete gamma function is too large to represent.", pol); return prefix; } @@ -842,9 +1020,9 @@ T gamma_incomplete_imp(T a, T x, bool normalised, bool invert, { static const char* function = "boost::math::gamma_p<%1%>(%1%, %1%)"; if(a <= 0) - policies::raise_domain_error<T>(function, "Argument a to the incomplete gamma function must be greater than zero (got a=%1%).", a, pol); + return policies::raise_domain_error<T>(function, "Argument a to the incomplete gamma function must be greater than zero (got a=%1%).", a, pol); if(x < 0) - policies::raise_domain_error<T>(function, "Argument x to the incomplete gamma function must be >= 0 (got x=%1%).", x, pol); + return policies::raise_domain_error<T>(function, "Argument x to the incomplete gamma function must be >= 0 (got x=%1%).", x, pol); BOOST_MATH_STD_USING @@ -852,10 +1030,51 @@ T gamma_incomplete_imp(T a, T x, bool normalised, bool invert, T result = 0; // Just to avoid warning C4701: potentially uninitialized local variable 'result' used + if(a >= max_factorial<T>::value && !normalised) + { + // + // When we're computing the non-normalized incomplete gamma + // and a is large the result is rather hard to compute unless + // we use logs. There are really two options - if x is a long + // way from a in value then we can reliably use methods 2 and 4 + // below in logarithmic form and go straight to the result. + // Otherwise we let the regularized gamma take the strain + // (the result is unlikely to unerflow in the central region anyway) + // and combine with lgamma in the hopes that we get a finite result. + // + if(invert && (a * 4 < x)) + { + // This is method 4 below, done in logs: + result = a * log(x) - x; + if(p_derivative) + *p_derivative = exp(result); + result += log(upper_gamma_fraction(a, x, policies::get_epsilon<T, Policy>())); + } + else if(!invert && (a > 4 * x)) + { + // This is method 2 below, done in logs: + result = a * log(x) - x; + if(p_derivative) + *p_derivative = exp(result); + T init_value = 0; + result += log(detail::lower_gamma_series(a, x, pol, init_value) / a); + } + else + { + result = gamma_incomplete_imp(a, x, true, invert, pol, p_derivative); + if(result == 0) + return policies::raise_evaluation_error<T>(function, "Obtained %1% for the incomplete gamma function, but in truth we don't really know what the answer is...", result, pol); + result = log(result) + boost::math::lgamma(a, pol); + } + if(result > tools::log_max_value<T>()) + return policies::raise_overflow_error<T>(function, 0, pol); + return exp(result); + } + BOOST_ASSERT((p_derivative == 0) || (normalised == true)); bool is_int, is_half_int; - bool is_small_a = (a < 30) && (a <= x + 1); + bool is_small_a = (a < 30) && (a <= x + 1) && (x < tools::log_max_value<T>()); if(is_small_a) { T fa = floor(a); @@ -881,6 +1100,10 @@ T gamma_incomplete_imp(T a, T x, bool normalised, bool invert, invert = !invert; eval_method = 1; } + else if((x < tools::root_epsilon<T>()) && (a > 1)) + { + eval_method = 6; + } else if(x < 0.5) { // @@ -994,13 +1217,39 @@ T gamma_incomplete_imp(T a, T x, bool normalised, bool invert, *p_derivative = result; if(result != 0) { + // + // If we're going to be inverting the result then we can + // reduce the number of series evaluations by quite + // a few iterations if we set an initial value for the + // series sum based on what we'll end up subtracting it from + // at the end. + // Have to be careful though that this optimization doesn't + // lead to spurious numberic overflow. Note that the + // scary/expensive overflow checks below are more often + // than not bypassed in practice for "sensible" input + // values: + // T init_value = 0; + bool optimised_invert = false; if(invert) { - init_value = -a * (normalised ? 1 : boost::math::tgamma(a, pol)) / result; + init_value = (normalised ? 1 : boost::math::tgamma(a, pol)); + if(normalised || (result >= 1) || (tools::max_value<T>() * result > init_value)) + { + init_value /= result; + if(normalised || (a < 1) || (tools::max_value<T>() / a > init_value)) + { + init_value *= -a; + optimised_invert = true; + } + else + init_value = 0; + } + else + init_value = 0; } result *= detail::lower_gamma_series(a, x, pol, init_value) / a; - if(invert) + if(optimised_invert) { invert = false; result = -result; @@ -1063,6 +1312,13 @@ T gamma_incomplete_imp(T a, T x, bool normalised, bool invert, *p_derivative = regularised_gamma_prefix(a, x, pol, lanczos_type()); break; } + case 6: + { + // x is so small that P is necessarily very small too, + // use http://functions.wolfram.com/GammaBetaErf/GammaRegularized/06/01/05/01/01/ + result = !normalised ? pow(x, a) / (a) : pow(x, a) / boost::math::tgamma(a + 1, pol); + result *= 1 - a * x / (a + 1); + } } if(normalised && (result > 1)) @@ -1093,9 +1349,32 @@ T gamma_incomplete_imp(T a, T x, bool normalised, bool invert, // Ratios of two gamma functions: // template <class T, class Policy, class Lanczos> -T tgamma_delta_ratio_imp_lanczos(T z, T delta, const Policy& pol, const Lanczos&) +T tgamma_delta_ratio_imp_lanczos(T z, T delta, const Policy& pol, const Lanczos& l) { BOOST_MATH_STD_USING + if(z < tools::epsilon<T>()) + { + // + // We get spurious numeric overflow unless we're very careful, this + // can occur either inside Lanczos::lanczos_sum(z) or in the + // final combination of terms, to avoid this, split the product up + // into 2 (or 3) parts: + // + // G(z) / G(L) = 1 / (z * G(L)) ; z < eps, L = z + delta = delta + // z * G(L) = z * G(lim) * (G(L)/G(lim)) ; lim = largest factorial + // + if(boost::math::max_factorial<T>::value < delta) + { + T ratio = tgamma_delta_ratio_imp_lanczos(delta, T(boost::math::max_factorial<T>::value - delta), pol, l); + ratio *= z; + ratio *= boost::math::unchecked_factorial<T>(boost::math::max_factorial<T>::value - 1); + return 1 / ratio; + } + else + { + return 1 / (z * boost::math::tgamma(z + delta, pol)); + } + } T zgh = z + Lanczos::g() - constants::half<T>(); T result; if(fabs(delta) < 10) @@ -1106,8 +1385,9 @@ T tgamma_delta_ratio_imp_lanczos(T z, T delta, const Policy& pol, const Lanczos& { result = pow(zgh / (zgh + delta), z - constants::half<T>()); } - result *= pow(constants::e<T>() / (zgh + delta), delta); + // Split the calculation up to avoid spurious overflow: result *= Lanczos::lanczos_sum(z) / Lanczos::lanczos_sum(T(z + delta)); + result *= pow(constants::e<T>() / (zgh + delta), delta); return result; } // @@ -1155,10 +1435,11 @@ T tgamma_delta_ratio_imp(T z, T delta, const Policy& pol) { BOOST_MATH_STD_USING - if(z <= 0) - policies::raise_domain_error<T>("boost::math::tgamma_delta_ratio<%1%>(%1%, %1%)", "Gamma function ratios only implemented for positive arguments (got a=%1%).", z, pol); - if(z+delta <= 0) - policies::raise_domain_error<T>("boost::math::tgamma_delta_ratio<%1%>(%1%, %1%)", "Gamma function ratios only implemented for positive arguments (got b=%1%).", z+delta, pol); + if((z <= 0) || (z + delta <= 0)) + { + // This isn't very sofisticated, or accurate, but it does work: + return boost::math::tgamma(z, pol) / boost::math::tgamma(z + delta, pol); + } if(floor(delta) == delta) { @@ -1208,15 +1489,84 @@ T tgamma_delta_ratio_imp(T z, T delta, const Policy& pol) } template <class T, class Policy> +T tgamma_ratio_imp(T x, T y, const Policy& pol) +{ + BOOST_MATH_STD_USING + + if((x <= 0) || (boost::math::isinf)(x)) + return policies::raise_domain_error<T>("boost::math::tgamma_ratio<%1%>(%1%, %1%)", "Gamma function ratios only implemented for positive arguments (got a=%1%).", x, pol); + if((y <= 0) || (boost::math::isinf)(y)) + return policies::raise_domain_error<T>("boost::math::tgamma_ratio<%1%>(%1%, %1%)", "Gamma function ratios only implemented for positive arguments (got b=%1%).", y, pol); + + if(x <= tools::min_value<T>()) + { + // Special case for denorms...Ugh. + T shift = ldexp(T(1), tools::digits<T>()); + return shift * tgamma_ratio_imp(T(x * shift), y, pol); + } + + if((x < max_factorial<T>::value) && (y < max_factorial<T>::value)) + { + // Rather than subtracting values, lets just call the gamma functions directly: + return boost::math::tgamma(x, pol) / boost::math::tgamma(y, pol); + } + T prefix = 1; + if(x < 1) + { + if(y < 2 * max_factorial<T>::value) + { + // We need to sidestep on x as well, otherwise we'll underflow + // before we get to factor in the prefix term: + prefix /= x; + x += 1; + while(y >= max_factorial<T>::value) + { + y -= 1; + prefix /= y; + } + return prefix * boost::math::tgamma(x, pol) / boost::math::tgamma(y, pol); + } + // + // result is almost certainly going to underflow to zero, try logs just in case: + // + return exp(boost::math::lgamma(x, pol) - boost::math::lgamma(y, pol)); + } + if(y < 1) + { + if(x < 2 * max_factorial<T>::value) + { + // We need to sidestep on y as well, otherwise we'll overflow + // before we get to factor in the prefix term: + prefix *= y; + y += 1; + while(x >= max_factorial<T>::value) + { + x -= 1; + prefix *= x; + } + return prefix * boost::math::tgamma(x, pol) / boost::math::tgamma(y, pol); + } + // + // Result will almost certainly overflow, try logs just in case: + // + return exp(boost::math::lgamma(x, pol) - boost::math::lgamma(y, pol)); + } + // + // Regular case, x and y both large and similar in magnitude: + // + return boost::math::tgamma_delta_ratio(x, y - x, pol); +} + +template <class T, class Policy> T gamma_p_derivative_imp(T a, T x, const Policy& pol) { // // Usual error checks first: // if(a <= 0) - policies::raise_domain_error<T>("boost::math::gamma_p_derivative<%1%>(%1%, %1%)", "Argument a to the incomplete gamma function must be greater than zero (got a=%1%).", a, pol); + return policies::raise_domain_error<T>("boost::math::gamma_p_derivative<%1%>(%1%, %1%)", "Argument a to the incomplete gamma function must be greater than zero (got a=%1%).", a, pol); if(x < 0) - policies::raise_domain_error<T>("boost::math::gamma_p_derivative<%1%>(%1%, %1%)", "Argument x to the incomplete gamma function must be >= 0 (got x=%1%).", x, pol); + return policies::raise_domain_error<T>("boost::math::gamma_p_derivative<%1%>(%1%, %1%)", "Argument x to the incomplete gamma function must be >= 0 (got x=%1%).", x, pol); // // Now special cases: // @@ -1360,7 +1710,7 @@ inline typename tools::promote_args<T1, T2>::type BOOST_FPU_EXCEPTION_GUARD typedef typename tools::promote_args<T1, T2>::type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; + // typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; typedef typename policies::normalise< Policy, policies::promote_float<false>, @@ -1489,7 +1839,7 @@ inline typename tools::promote_args<T1, T2>::type BOOST_FPU_EXCEPTION_GUARD typedef typename tools::promote_args<T1, T2>::type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; + // typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; typedef typename policies::normalise< Policy, policies::promote_float<false>, @@ -1520,7 +1870,7 @@ inline typename tools::promote_args<T1, T2>::type BOOST_FPU_EXCEPTION_GUARD typedef typename tools::promote_args<T1, T2>::type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; + // typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; typedef typename policies::normalise< Policy, policies::promote_float<false>, @@ -1551,7 +1901,7 @@ inline typename tools::promote_args<T1, T2>::type BOOST_FPU_EXCEPTION_GUARD typedef typename tools::promote_args<T1, T2>::type result_type; typedef typename policies::evaluation<result_type, Policy>::type value_type; - typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; + // typedef typename lanczos::lanczos<value_type, Policy>::type evaluation_type; typedef typename policies::normalise< Policy, policies::promote_float<false>, @@ -1609,7 +1959,7 @@ inline typename tools::promote_args<T1, T2>::type policies::discrete_quantile<>, policies::assert_undefined<> >::type forwarding_policy; - return policies::checked_narrowing_cast<result_type, forwarding_policy>(detail::tgamma_delta_ratio_imp(static_cast<value_type>(a), static_cast<value_type>(static_cast<value_type>(b) - static_cast<value_type>(a)), forwarding_policy()), "boost::math::tgamma_delta_ratio<%1%>(%1%, %1%)"); + return policies::checked_narrowing_cast<result_type, forwarding_policy>(detail::tgamma_ratio_imp(static_cast<value_type>(a), static_cast<value_type>(b), forwarding_policy()), "boost::math::tgamma_delta_ratio<%1%>(%1%, %1%)"); } template <class T1, class T2> inline typename tools::promote_args<T1, T2>::type diff --git a/boost/math/special_functions/hankel.hpp b/boost/math/special_functions/hankel.hpp index bc3fc2d742..4266ef808c 100644 --- a/boost/math/special_functions/hankel.hpp +++ b/boost/math/special_functions/hankel.hpp @@ -7,6 +7,7 @@ #ifndef BOOST_MATH_HANKEL_HPP #define BOOST_MATH_HANKEL_HPP +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/bessel.hpp> namespace boost{ namespace math{ @@ -28,7 +29,7 @@ std::complex<T> hankel_imp(T v, T x, const bessel_no_int_tag&, const Policy& pol std::complex<T> j_result, y_result; if(isint_v) { - int s = (iround(j) & 1) ? -1 : 1; + int s = (iround(v) & 1) ? -1 : 1; j_result = j * s; y_result = T(s) * (y - (2 / constants::pi<T>()) * (log(-x) - log(cx)) * j); } @@ -83,7 +84,7 @@ template <class T, class Policy> inline std::complex<T> hankel_imp(int v, T x, const bessel_int_tag&, const Policy& pol, int sign) { BOOST_MATH_STD_USING - if((std::abs(v < 200)) && (x > 0)) + if((std::abs(v) < 200) && (x > 0)) return std::complex<T>(bessel_jn(v, x, pol), sign * bessel_yn(v, x, pol)); return hankel_imp(static_cast<T>(v), x, bessel_no_int_tag(), pol, sign); } @@ -130,7 +131,7 @@ inline std::complex<typename detail::bessel_traits<T1, T2, policies::policy<> >: } template <class T1, class T2, class Policy> -inline std::complex<typename detail::bessel_traits<T1, T2, Policy>::result_type> sph_hankel_1(T1 v, T2 x, const Policy& pol) +inline std::complex<typename detail::bessel_traits<T1, T2, Policy>::result_type> sph_hankel_1(T1 v, T2 x, const Policy&) { BOOST_FPU_EXCEPTION_GUARD typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; @@ -152,7 +153,7 @@ inline std::complex<typename detail::bessel_traits<T1, T2, policies::policy<> >: } template <class T1, class T2, class Policy> -inline std::complex<typename detail::bessel_traits<T1, T2, Policy>::result_type> sph_hankel_2(T1 v, T2 x, const Policy& pol) +inline std::complex<typename detail::bessel_traits<T1, T2, Policy>::result_type> sph_hankel_2(T1 v, T2 x, const Policy&) { BOOST_FPU_EXCEPTION_GUARD typedef typename detail::bessel_traits<T1, T2, Policy>::result_type result_type; @@ -175,4 +176,5 @@ inline std::complex<typename detail::bessel_traits<T1, T2, policies::policy<> >: }} // namespaces -#endif // BOOST_MATH_HANKEL_HPP
\ No newline at end of file +#endif // BOOST_MATH_HANKEL_HPP + diff --git a/boost/math/special_functions/jacobi_elliptic.hpp b/boost/math/special_functions/jacobi_elliptic.hpp new file mode 100644 index 0000000000..3ffc011566 --- /dev/null +++ b/boost/math/special_functions/jacobi_elliptic.hpp @@ -0,0 +1,321 @@ +// Copyright John Maddock 2012. +// Use, modification and distribution are subject to the +// Boost Software License, Version 1.0. +// (See accompanying file LICENSE_1_0.txt +// or copy at http://www.boost.org/LICENSE_1_0.txt) + +#ifndef BOOST_MATH_JACOBI_ELLIPTIC_HPP +#define BOOST_MATH_JACOBI_ELLIPTIC_HPP + +#include <boost/math/tools/precision.hpp> +#include <boost/math/tools/promotion.hpp> +#include <boost/math/policies/error_handling.hpp> +#include <boost/math/special_functions/math_fwd.hpp> + +namespace boost{ namespace math{ + +namespace detail{ + +template <class T, class Policy> +T jacobi_recurse(const T& x, const T& k, T anm1, T bnm1, unsigned N, T* pTn, const Policy& pol) +{ + BOOST_MATH_STD_USING + ++N; + T Tn; + T cn = (anm1 - bnm1) / 2; + T an = (anm1 + bnm1) / 2; + if(cn < policies::get_epsilon<T, Policy>()) + { + Tn = ldexp(T(1), (int)N) * x * an; + } + else + Tn = jacobi_recurse<T>(x, k, an, sqrt(anm1 * bnm1), N, 0, pol); + if(pTn) + *pTn = Tn; + return (Tn + asin((cn / an) * sin(Tn))) / 2; +} + +template <class T, class Policy> +T jacobi_imp(const T& x, const T& k, T* cn, T* dn, const Policy& pol, const char* function) +{ + BOOST_MATH_STD_USING + if(k < 0) + { + *cn = policies::raise_domain_error<T>(function, "Modulus k must be positive but got %1%.", k, pol); + *dn = *cn; + return *cn; + } + if(k > 1) + { + T xp = x * k; + T kp = 1 / k; + T snp, cnp, dnp; + snp = jacobi_imp(xp, kp, &cnp, &dnp, pol, function); + *cn = dnp; + *dn = cnp; + return snp * kp; + } + // + // Special cases first: + // + if(x == 0) + { + *cn = *dn = 1; + return 0; + } + if(k == 0) + { + *cn = cos(x); + *dn = 1; + return sin(x); + } + if(k == 1) + { + *cn = *dn = 1 / cosh(x); + return tanh(x); + } + // + // Asymptotic forms from A&S 16.13: + // + if(k < tools::forth_root_epsilon<T>()) + { + T su = sin(x); + T cu = cos(x); + T m = k * k; + *dn = 1 - m * su * su / 2; + *cn = cu + m * (x - su * cu) * su / 4; + return su - m * (x - su * cu) * cu / 4; + } + /* Can't get this to work to adequate precision - disabled for now... + // + // Asymptotic forms from A&S 16.15: + // + if(k > 1 - tools::root_epsilon<T>()) + { + T tu = tanh(x); + T su = sinh(x); + T cu = cosh(x); + T sec = 1 / cu; + T kp = 1 - k; + T m1 = 2 * kp - kp * kp; + *dn = sec + m1 * (su * cu + x) * tu * sec / 4; + *cn = sec - m1 * (su * cu - x) * tu * sec / 4; + T sn = tu; + T sn2 = m1 * (x * sec * sec - tu) / 4; + T sn3 = (72 * x * cu + 4 * (8 * x * x - 5) * su - 19 * sinh(3 * x) + sinh(5 * x)) * sec * sec * sec * m1 * m1 / 512; + return sn + sn2 - sn3; + }*/ + T T1; + T kc = 1 - k; + T k_prime = k < 0.5 ? T(sqrt(1 - k * k)) : T(sqrt(2 * kc - kc * kc)); + T T0 = jacobi_recurse(x, k, T(1), k_prime, 0, &T1, pol); + *cn = cos(T0); + *dn = cos(T0) / cos(T1 - T0); + return sin(T0); +} + +} // namespace detail + +template <class T, class U, class V, class Policy> +inline typename tools::promote_args<T, U, V>::type jacobi_elliptic(T k, U theta, V* pcn, V* pdn, const Policy&) +{ + BOOST_FPU_EXCEPTION_GUARD + typedef typename tools::promote_args<T>::type result_type; + typedef typename policies::evaluation<result_type, Policy>::type value_type; + typedef typename policies::normalise< + Policy, + policies::promote_float<false>, + policies::promote_double<false>, + policies::discrete_quantile<>, + policies::assert_undefined<> >::type forwarding_policy; + + static const char* function = "boost::math::jacobi_elliptic<%1%>(%1%)"; + + value_type sn, cn, dn; + sn = detail::jacobi_imp<value_type>(static_cast<value_type>(theta), static_cast<value_type>(k), &cn, &dn, forwarding_policy(), function); + if(pcn) + *pcn = policies::checked_narrowing_cast<result_type, Policy>(cn, function); + if(pdn) + *pdn = policies::checked_narrowing_cast<result_type, Policy>(dn, function); + return policies::checked_narrowing_cast<result_type, Policy>(sn, function);; +} + +template <class T, class U, class V> +inline typename tools::promote_args<T, U, V>::type jacobi_elliptic(T k, U theta, V* pcn, V* pdn) +{ + return jacobi_elliptic(k, theta, pcn, pdn, policies::policy<>()); +} + +template <class U, class T, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_sn(U k, T theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + return jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), static_cast<result_type*>(0), static_cast<result_type*>(0), pol); +} + +template <class U, class T> +inline typename tools::promote_args<T, U>::type jacobi_sn(U k, T theta) +{ + return jacobi_sn(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_cn(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + result_type cn; + jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), &cn, static_cast<result_type*>(0), pol); + return cn; +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_cn(T k, U theta) +{ + return jacobi_cn(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_dn(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + result_type dn; + jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), static_cast<result_type*>(0), &dn, pol); + return dn; +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_dn(T k, U theta) +{ + return jacobi_dn(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_cd(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + result_type cn, dn; + jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), &cn, &dn, pol); + return cn / dn; +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_cd(T k, U theta) +{ + return jacobi_cd(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_dc(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + result_type cn, dn; + jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), &cn, &dn, pol); + return dn / cn; +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_dc(T k, U theta) +{ + return jacobi_dc(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_ns(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + return 1 / jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), static_cast<result_type*>(0), static_cast<result_type*>(0), pol); +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_ns(T k, U theta) +{ + return jacobi_ns(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_sd(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + result_type sn, dn; + sn = jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), static_cast<result_type*>(0), &dn, pol); + return sn / dn; +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_sd(T k, U theta) +{ + return jacobi_sd(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_ds(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + result_type sn, dn; + sn = jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), static_cast<result_type*>(0), &dn, pol); + return dn / sn; +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_ds(T k, U theta) +{ + return jacobi_ds(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_nc(T k, U theta, const Policy& pol) +{ + return 1 / jacobi_cn(k, theta, pol); +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_nc(T k, U theta) +{ + return jacobi_nc(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_nd(T k, U theta, const Policy& pol) +{ + return 1 / jacobi_dn(k, theta, pol); +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_nd(T k, U theta) +{ + return jacobi_nd(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_sc(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + result_type sn, cn; + sn = jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), &cn, static_cast<result_type*>(0), pol); + return sn / cn; +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_sc(T k, U theta) +{ + return jacobi_sc(k, theta, policies::policy<>()); +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type jacobi_cs(T k, U theta, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + result_type sn, cn; + sn = jacobi_elliptic(static_cast<result_type>(k), static_cast<result_type>(theta), &cn, static_cast<result_type*>(0), pol); + return cn / sn; +} + +template <class T, class U> +inline typename tools::promote_args<T, U>::type jacobi_cs(T k, U theta) +{ + return jacobi_cs(k, theta, policies::policy<>()); +} + +}} // namespaces + +#endif // BOOST_MATH_JACOBI_ELLIPTIC_HPP diff --git a/boost/math/special_functions/lanczos.hpp b/boost/math/special_functions/lanczos.hpp index ed891549f1..0db21d3d16 100644 --- a/boost/math/special_functions/lanczos.hpp +++ b/boost/math/special_functions/lanczos.hpp @@ -1068,7 +1068,7 @@ struct lanczos24m113 : public mpl::int_<113> static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 2.50662827463100050241576528481104515966515623051532908941425544355490413900497467936202516)) }; static const T denom[24] = { - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0.112400072777760768e22)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0.414847677933545472e22)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 6756146673770930688000.0)), @@ -1087,11 +1087,11 @@ struct lanczos24m113 : public mpl::int_<113> static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 3256091103430.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 136717357942.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 4546047198.0)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 116896626)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 2240315)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 30107)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 253)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 1)) + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 116896626.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 2240315.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 30107.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 253.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 1.0)) }; return boost::math::tools::evaluate_rational(num, denom, z); } @@ -1127,7 +1127,7 @@ struct lanczos24m113 : public mpl::int_<113> static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0.374799931707148855771381263542708435935402853962736029347951399323367765509988401336565436e-8)) }; static const T denom[24] = { - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0.112400072777760768e22)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 0.414847677933545472e22)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 6756146673770930688000.0)), @@ -1146,11 +1146,11 @@ struct lanczos24m113 : public mpl::int_<113> static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 3256091103430.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 136717357942.0)), static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 4546047198.0)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 116896626)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 2240315)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 30107)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 253)), - static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 1)) + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 116896626.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 2240315.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 30107.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 253.0)), + static_cast<T>(BOOST_MATH_BIG_CONSTANT(T, 113, 1.0)) }; return boost::math::tools::evaluate_rational(num, denom, z); } diff --git a/boost/math/special_functions/log1p.hpp b/boost/math/special_functions/log1p.hpp index 989bdc21b6..62f5b8027c 100644 --- a/boost/math/special_functions/log1p.hpp +++ b/boost/math/special_functions/log1p.hpp @@ -195,7 +195,7 @@ T log1p_imp(T const& x, const Policy& pol, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, 0.00441709903782239229447) }; static const T Q[] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 4.26423872346263928361), BOOST_MATH_BIG_CONSTANT(T, 64, 7.48189472704477708962), BOOST_MATH_BIG_CONSTANT(T, 64, 6.94757016732904280913), diff --git a/boost/math/special_functions/math_fwd.hpp b/boost/math/special_functions/math_fwd.hpp index 982cdf7ca3..e952dcdb51 100644 --- a/boost/math/special_functions/math_fwd.hpp +++ b/boost/math/special_functions/math_fwd.hpp @@ -14,7 +14,7 @@ // IT = Integer type. // RT = Real type (built-in floating-point types, float, double, long double) & User Defined Types -// AT = Integer or Real type +// AT = Integer or Real type #ifndef BOOST_MATH_SPECIAL_MATH_FWD_HPP #define BOOST_MATH_SPECIAL_MATH_FWD_HPP @@ -28,7 +28,6 @@ #include <boost/math/policies/policy.hpp> #include <boost/mpl/comparison.hpp> #include <boost/config/no_tr1/complex.hpp> -#include <complex> #define BOOST_NO_MACRO_EXPAND /**/ @@ -39,111 +38,111 @@ namespace boost // Beta functions. template <class RT1, class RT2> - typename tools::promote_args<RT1, RT2>::type + typename tools::promote_args<RT1, RT2>::type beta(RT1 a, RT2 b); // Beta function (2 arguments). template <class RT1, class RT2, class A> - typename tools::promote_args<RT1, RT2, A>::type + typename tools::promote_args<RT1, RT2, A>::type beta(RT1 a, RT2 b, A x); // Beta function (3 arguments). template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type beta(RT1 a, RT2 b, RT3 x, const Policy& pol); // Beta function (3 arguments). template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type betac(RT1 a, RT2 b, RT3 x); template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type betac(RT1 a, RT2 b, RT3 x, const Policy& pol); template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta(RT1 a, RT2 b, RT3 x); // Incomplete beta function. template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta(RT1 a, RT2 b, RT3 x, const Policy& pol); // Incomplete beta function. template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibetac(RT1 a, RT2 b, RT3 x); // Incomplete beta complement function. template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibetac(RT1 a, RT2 b, RT3 x, const Policy& pol); // Incomplete beta complement function. template <class T1, class T2, class T3, class T4> - typename tools::promote_args<T1, T2, T3, T4>::type + typename tools::promote_args<T1, T2, T3, T4>::type ibeta_inv(T1 a, T2 b, T3 p, T4* py); template <class T1, class T2, class T3, class T4, class Policy> - typename tools::promote_args<T1, T2, T3, T4>::type + typename tools::promote_args<T1, T2, T3, T4>::type ibeta_inv(T1 a, T2 b, T3 p, T4* py, const Policy& pol); template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta_inv(RT1 a, RT2 b, RT3 p); // Incomplete beta inverse function. template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta_inv(RT1 a, RT2 b, RT3 p, const Policy&); // Incomplete beta inverse function. template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta_inva(RT1 a, RT2 b, RT3 p); // Incomplete beta inverse function. template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta_inva(RT1 a, RT2 b, RT3 p, const Policy&); // Incomplete beta inverse function. template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta_invb(RT1 a, RT2 b, RT3 p); // Incomplete beta inverse function. template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta_invb(RT1 a, RT2 b, RT3 p, const Policy&); // Incomplete beta inverse function. template <class T1, class T2, class T3, class T4> - typename tools::promote_args<T1, T2, T3, T4>::type + typename tools::promote_args<T1, T2, T3, T4>::type ibetac_inv(T1 a, T2 b, T3 q, T4* py); template <class T1, class T2, class T3, class T4, class Policy> - typename tools::promote_args<T1, T2, T3, T4>::type + typename tools::promote_args<T1, T2, T3, T4>::type ibetac_inv(T1 a, T2 b, T3 q, T4* py, const Policy& pol); template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibetac_inv(RT1 a, RT2 b, RT3 q); // Incomplete beta complement inverse function. template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibetac_inv(RT1 a, RT2 b, RT3 q, const Policy&); // Incomplete beta complement inverse function. template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibetac_inva(RT1 a, RT2 b, RT3 q); // Incomplete beta complement inverse function. template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibetac_inva(RT1 a, RT2 b, RT3 q, const Policy&); // Incomplete beta complement inverse function. template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibetac_invb(RT1 a, RT2 b, RT3 q); // Incomplete beta complement inverse function. template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibetac_invb(RT1 a, RT2 b, RT3 q, const Policy&); // Incomplete beta complement inverse function. template <class RT1, class RT2, class RT3> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta_derivative(RT1 a, RT2 b, RT3 x); // derivative of incomplete beta template <class RT1, class RT2, class RT3, class Policy> - typename tools::promote_args<RT1, RT2, RT3>::type + typename tools::promote_args<RT1, RT2, RT3>::type ibeta_derivative(RT1 a, RT2 b, RT3 x, const Policy& pol); // derivative of incomplete beta // erf & erfc error functions. @@ -169,51 +168,51 @@ namespace boost // Polynomials: template <class T1, class T2, class T3> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type legendre_next(unsigned l, T1 x, T2 Pl, T3 Plm1); template <class T> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type legendre_p(int l, T x); template <class T, class Policy> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type legendre_p(int l, T x, const Policy& pol); template <class T> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type legendre_q(unsigned l, T x); template <class T, class Policy> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type legendre_q(unsigned l, T x, const Policy& pol); template <class T1, class T2, class T3> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type legendre_next(unsigned l, unsigned m, T1 x, T2 Pl, T3 Plm1); template <class T> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type legendre_p(int l, int m, T x); template <class T, class Policy> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type legendre_p(int l, int m, T x, const Policy& pol); template <class T1, class T2, class T3> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type laguerre_next(unsigned n, T1 x, T2 Ln, T3 Lnm1); template <class T1, class T2, class T3> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type laguerre_next(unsigned n, unsigned l, T1 x, T2 Pl, T3 Plm1); template <class T> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type laguerre(unsigned n, T x); template <class T, class Policy> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type laguerre(unsigned n, unsigned m, T x, const Policy& pol); template <class T1, class T2> @@ -227,76 +226,76 @@ namespace boost }; template <class T1, class T2> - typename laguerre_result<T1, T2>::type + typename laguerre_result<T1, T2>::type laguerre(unsigned n, T1 m, T2 x); template <class T> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type hermite(unsigned n, T x); template <class T, class Policy> - typename tools::promote_args<T>::type + typename tools::promote_args<T>::type hermite(unsigned n, T x, const Policy& pol); template <class T1, class T2, class T3> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type hermite_next(unsigned n, T1 x, T2 Hn, T3 Hnm1); template <class T1, class T2> - std::complex<typename tools::promote_args<T1, T2>::type> + std::complex<typename tools::promote_args<T1, T2>::type> spherical_harmonic(unsigned n, int m, T1 theta, T2 phi); template <class T1, class T2, class Policy> - std::complex<typename tools::promote_args<T1, T2>::type> + std::complex<typename tools::promote_args<T1, T2>::type> spherical_harmonic(unsigned n, int m, T1 theta, T2 phi, const Policy& pol); template <class T1, class T2> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type spherical_harmonic_r(unsigned n, int m, T1 theta, T2 phi); template <class T1, class T2, class Policy> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type spherical_harmonic_r(unsigned n, int m, T1 theta, T2 phi, const Policy& pol); template <class T1, class T2> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type spherical_harmonic_i(unsigned n, int m, T1 theta, T2 phi); template <class T1, class T2, class Policy> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type spherical_harmonic_i(unsigned n, int m, T1 theta, T2 phi, const Policy& pol); // Elliptic integrals: template <class T1, class T2, class T3> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type ellint_rf(T1 x, T2 y, T3 z); template <class T1, class T2, class T3, class Policy> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type ellint_rf(T1 x, T2 y, T3 z, const Policy& pol); template <class T1, class T2, class T3> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type ellint_rd(T1 x, T2 y, T3 z); template <class T1, class T2, class T3, class Policy> - typename tools::promote_args<T1, T2, T3>::type + typename tools::promote_args<T1, T2, T3>::type ellint_rd(T1 x, T2 y, T3 z, const Policy& pol); template <class T1, class T2> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type ellint_rc(T1 x, T2 y); template <class T1, class T2, class Policy> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type ellint_rc(T1 x, T2 y, const Policy& pol); template <class T1, class T2, class T3, class T4> - typename tools::promote_args<T1, T2, T3, T4>::type + typename tools::promote_args<T1, T2, T3, T4>::type ellint_rj(T1 x, T2 y, T3 z, T4 p); template <class T1, class T2, class T3, class T4, class Policy> - typename tools::promote_args<T1, T2, T3, T4>::type + typename tools::promote_args<T1, T2, T3, T4>::type ellint_rj(T1 x, T2 y, T3 z, T4 p, const Policy& pol); template <typename T> @@ -350,7 +349,7 @@ namespace boost template <class RT, class Policy> RT factorial(unsigned int, const Policy& pol); template <class RT> - RT unchecked_factorial(unsigned int BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE(RT)); + RT unchecked_factorial(unsigned int BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE(RT)); template <class RT> RT double_factorial(unsigned i); template <class RT, class Policy> @@ -466,11 +465,11 @@ namespace boost // Hypotenuse function sqrt(x ^ 2 + y ^ 2). template <class T1, class T2> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type hypot(T1 x, T2 y); template <class T1, class T2, class Policy> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type hypot(T1 x, T2 y, const Policy&); // cbrt - cube root. @@ -503,11 +502,11 @@ namespace boost // Power - 1 template <class T1, class T2> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type powm1(const T1 a, const T2 z); template <class T1, class T2, class Policy> - typename tools::promote_args<T1, T2>::type + typename tools::promote_args<T1, T2>::type powm1(const T1 a, const T2 z, const Policy&); // sqrt(1+x) - 1 @@ -581,47 +580,109 @@ namespace boost // Bessel functions: template <class T1, class T2, class Policy> typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_j(T1 v, T2 x, const Policy& pol); + template <class T1, class T2, class Policy> + typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_j_prime(T1 v, T2 x, const Policy& pol); template <class T1, class T2> typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_j(T1 v, T2 x); + template <class T1, class T2> + typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_j_prime(T1 v, T2 x); template <class T, class Policy> typename detail::bessel_traits<T, T, Policy>::result_type sph_bessel(unsigned v, T x, const Policy& pol); + template <class T, class Policy> + typename detail::bessel_traits<T, T, Policy>::result_type sph_bessel_prime(unsigned v, T x, const Policy& pol); template <class T> typename detail::bessel_traits<T, T, policies::policy<> >::result_type sph_bessel(unsigned v, T x); + template <class T> + typename detail::bessel_traits<T, T, policies::policy<> >::result_type sph_bessel_prime(unsigned v, T x); template <class T1, class T2, class Policy> typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_i(T1 v, T2 x, const Policy& pol); + template <class T1, class T2, class Policy> + typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_i_prime(T1 v, T2 x, const Policy& pol); template <class T1, class T2> typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_i(T1 v, T2 x); + template <class T1, class T2> + typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_i_prime(T1 v, T2 x); template <class T1, class T2, class Policy> typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_k(T1 v, T2 x, const Policy& pol); + template <class T1, class T2, class Policy> + typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_bessel_k_prime(T1 v, T2 x, const Policy& pol); template <class T1, class T2> typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_k(T1 v, T2 x); + template <class T1, class T2> + typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_bessel_k_prime(T1 v, T2 x); template <class T1, class T2, class Policy> typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_neumann(T1 v, T2 x, const Policy& pol); + template <class T1, class T2, class Policy> + typename detail::bessel_traits<T1, T2, Policy>::result_type cyl_neumann_prime(T1 v, T2 x, const Policy& pol); template <class T1, class T2> typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_neumann(T1 v, T2 x); + template <class T1, class T2> + typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type cyl_neumann_prime(T1 v, T2 x); template <class T, class Policy> typename detail::bessel_traits<T, T, Policy>::result_type sph_neumann(unsigned v, T x, const Policy& pol); + template <class T, class Policy> + typename detail::bessel_traits<T, T, Policy>::result_type sph_neumann_prime(unsigned v, T x, const Policy& pol); template <class T> typename detail::bessel_traits<T, T, policies::policy<> >::result_type sph_neumann(unsigned v, T x); + template <class T> + typename detail::bessel_traits<T, T, policies::policy<> >::result_type sph_neumann_prime(unsigned v, T x); - template <class T1, class T2, class Policy> - std::complex<typename detail::bessel_traits<T1, T2, Policy>::result_type> cyl_hankel_1(T1 v, T2 x, const Policy& pol); + template <class T, class Policy> + typename detail::bessel_traits<T, T, Policy>::result_type cyl_bessel_j_zero(T v, int m, const Policy& pol); + + template <class T> + typename detail::bessel_traits<T, T, policies::policy<> >::result_type cyl_bessel_j_zero(T v, int m); + + template <class T, class OutputIterator> + OutputIterator cyl_bessel_j_zero(T v, + int start_index, + unsigned number_of_zeros, + OutputIterator out_it); + + template <class T, class OutputIterator, class Policy> + OutputIterator cyl_bessel_j_zero(T v, + int start_index, + unsigned number_of_zeros, + OutputIterator out_it, + const Policy&); + + template <class T, class Policy> + typename detail::bessel_traits<T, T, Policy>::result_type cyl_neumann_zero(T v, int m, const Policy& pol); + + template <class T> + typename detail::bessel_traits<T, T, policies::policy<> >::result_type cyl_neumann_zero(T v, int m); + + template <class T, class OutputIterator> + OutputIterator cyl_neumann_zero(T v, + int start_index, + unsigned number_of_zeros, + OutputIterator out_it); + + template <class T, class OutputIterator, class Policy> + OutputIterator cyl_neumann_zero(T v, + int start_index, + unsigned number_of_zeros, + OutputIterator out_it, + const Policy&); template <class T1, class T2> std::complex<typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type> cyl_hankel_1(T1 v, T2 x); template <class T1, class T2, class Policy> + std::complex<typename detail::bessel_traits<T1, T2, Policy>::result_type> cyl_hankel_1(T1 v, T2 x, const Policy& pol); + + template <class T1, class T2, class Policy> std::complex<typename detail::bessel_traits<T1, T2, Policy>::result_type> cyl_hankel_2(T1 v, T2 x, const Policy& pol); template <class T1, class T2> @@ -640,6 +701,64 @@ namespace boost std::complex<typename detail::bessel_traits<T1, T2, policies::policy<> >::result_type> sph_hankel_2(T1 v, T2 x); template <class T, class Policy> + typename tools::promote_args<T>::type airy_ai(T x, const Policy&); + + template <class T> + typename tools::promote_args<T>::type airy_ai(T x); + + template <class T, class Policy> + typename tools::promote_args<T>::type airy_bi(T x, const Policy&); + + template <class T> + typename tools::promote_args<T>::type airy_bi(T x); + + template <class T, class Policy> + typename tools::promote_args<T>::type airy_ai_prime(T x, const Policy&); + + template <class T> + typename tools::promote_args<T>::type airy_ai_prime(T x); + + template <class T, class Policy> + typename tools::promote_args<T>::type airy_bi_prime(T x, const Policy&); + + template <class T> + typename tools::promote_args<T>::type airy_bi_prime(T x); + + template <class T> + T airy_ai_zero(int m); + template <class T, class Policy> + T airy_ai_zero(int m, const Policy&); + + template <class OutputIterator> + OutputIterator airy_ai_zero( + int start_index, + unsigned number_of_zeros, + OutputIterator out_it); + template <class OutputIterator, class Policy> + OutputIterator airy_ai_zero( + int start_index, + unsigned number_of_zeros, + OutputIterator out_it, + const Policy&); + + template <class T> + T airy_bi_zero(int m); + template <class T, class Policy> + T airy_bi_zero(int m, const Policy&); + + template <class OutputIterator> + OutputIterator airy_bi_zero( + int start_index, + unsigned number_of_zeros, + OutputIterator out_it); + template <class OutputIterator, class Policy> + OutputIterator airy_bi_zero( + int start_index, + unsigned number_of_zeros, + OutputIterator out_it, + const Policy&); + + template <class T, class Policy> typename tools::promote_args<T>::type sin_pi(T x, const Policy&); template <class T> @@ -666,17 +785,17 @@ namespace boost template <class T> bool isnormal BOOST_NO_MACRO_EXPAND(T t); - template<class T> + template<class T> int signbit BOOST_NO_MACRO_EXPAND(T x); template <class T> int sign BOOST_NO_MACRO_EXPAND(const T& z); - template <class T> - T copysign BOOST_NO_MACRO_EXPAND(const T& x, const T& y); + template <class T, class U> + typename tools::promote_args_permissive<T, U>::type copysign BOOST_NO_MACRO_EXPAND(const T& x, const U& y); template <class T> - T changesign BOOST_NO_MACRO_EXPAND(const T& z); + typename tools::promote_args_permissive<T>::type changesign BOOST_NO_MACRO_EXPAND(const T& z); // Exponential integrals: namespace detail{ @@ -713,6 +832,86 @@ namespace boost template <class T1, class T2> typename tools::promote_args<T1, T2>::type owens_t(T1 h, T2 a); + // Jacobi Functions: + template <class T, class U, class V, class Policy> + typename tools::promote_args<T, U, V>::type jacobi_elliptic(T k, U theta, V* pcn, V* pdn, const Policy&); + + template <class T, class U, class V> + typename tools::promote_args<T, U, V>::type jacobi_elliptic(T k, U theta, V* pcn = 0, V* pdn = 0); + + template <class U, class T, class Policy> + typename tools::promote_args<T, U>::type jacobi_sn(U k, T theta, const Policy& pol); + + template <class U, class T> + typename tools::promote_args<T, U>::type jacobi_sn(U k, T theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_cn(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_cn(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_dn(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_dn(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_cd(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_cd(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_dc(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_dc(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_ns(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_ns(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_sd(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_sd(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_ds(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_ds(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_nc(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_nc(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_nd(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_nd(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_sc(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_sc(T k, U theta); + + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type jacobi_cs(T k, U theta, const Policy& pol); + + template <class T, class U> + typename tools::promote_args<T, U>::type jacobi_cs(T k, U theta); + + template <class T> typename tools::promote_args<T>::type zeta(T s); @@ -724,22 +923,55 @@ namespace boost typename tools::promote_args<T>::type pow(T base); // next: + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type nextafter(const T&, const U&, const Policy&); + template <class T, class U> + typename tools::promote_args<T, U>::type nextafter(const T&, const U&); template <class T, class Policy> - T nextafter(const T&, const T&, const Policy&); + typename tools::promote_args<T>::type float_next(const T&, const Policy&); template <class T> - T nextafter(const T&, const T&); + typename tools::promote_args<T>::type float_next(const T&); template <class T, class Policy> - T float_next(const T&, const Policy&); + typename tools::promote_args<T>::type float_prior(const T&, const Policy&); template <class T> - T float_next(const T&); + typename tools::promote_args<T>::type float_prior(const T&); + template <class T, class U, class Policy> + typename tools::promote_args<T, U>::type float_distance(const T&, const U&, const Policy&); + template <class T, class U> + typename tools::promote_args<T, U>::type float_distance(const T&, const U&); template <class T, class Policy> - T float_prior(const T&, const Policy&); + typename tools::promote_args<T>::type float_advance(T val, int distance, const Policy& pol); template <class T> - T float_prior(const T&); + typename tools::promote_args<T>::type float_advance(const T& val, int distance); + + template<class T> + T unchecked_bernoulli_b2n(const std::size_t n); template <class T, class Policy> - T float_distance(const T&, const T&, const Policy&); + T bernoulli_b2n(const int i, const Policy &pol); template <class T> - T float_distance(const T&, const T&); + T bernoulli_b2n(const int i); + template <class T, class OutputIterator, class Policy> + OutputIterator bernoulli_b2n(const int start_index, + const unsigned number_of_bernoullis_b2n, + OutputIterator out_it, + const Policy& pol); + template <class T, class OutputIterator> + OutputIterator bernoulli_b2n(const int start_index, + const unsigned number_of_bernoullis_b2n, + OutputIterator out_it); + template <class T, class Policy> + T tangent_t2n(const int i, const Policy &pol); + template <class T> + T tangent_t2n(const int i); + template <class T, class OutputIterator, class Policy> + OutputIterator tangent_t2n(const int start_index, + const unsigned number_of_bernoullis_b2n, + OutputIterator out_it, + const Policy& pol); + template <class T, class OutputIterator> + OutputIterator tangent_t2n(const int start_index, + const unsigned number_of_bernoullis_b2n, + OutputIterator out_it); } // namespace math } // namespace boost @@ -1015,27 +1247,73 @@ namespace boost inline typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type cyl_bessel_j(T1 v, T2 x)\ { return boost::math::cyl_bessel_j(v, x, Policy()); }\ \ + template <class T1, class T2>\ + inline typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type cyl_bessel_j_prime(T1 v, T2 x)\ + { return boost::math::cyl_bessel_j_prime(v, x, Policy()); }\ +\ template <class T>\ inline typename boost::math::detail::bessel_traits<T, T, Policy >::result_type sph_bessel(unsigned v, T x)\ { return boost::math::sph_bessel(v, x, Policy()); }\ \ + template <class T>\ + inline typename boost::math::detail::bessel_traits<T, T, Policy >::result_type sph_bessel_prime(unsigned v, T x)\ + { return boost::math::sph_bessel_prime(v, x, Policy()); }\ +\ template <class T1, class T2>\ inline typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type \ cyl_bessel_i(T1 v, T2 x) { return boost::math::cyl_bessel_i(v, x, Policy()); }\ \ template <class T1, class T2>\ inline typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type \ + cyl_bessel_i_prime(T1 v, T2 x) { return boost::math::cyl_bessel_i_prime(v, x, Policy()); }\ +\ + template <class T1, class T2>\ + inline typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type \ cyl_bessel_k(T1 v, T2 x) { return boost::math::cyl_bessel_k(v, x, Policy()); }\ \ template <class T1, class T2>\ inline typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type \ + cyl_bessel_k_prime(T1 v, T2 x) { return boost::math::cyl_bessel_k_prime(v, x, Policy()); }\ +\ + template <class T1, class T2>\ + inline typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type \ cyl_neumann(T1 v, T2 x){ return boost::math::cyl_neumann(v, x, Policy()); }\ \ + template <class T1, class T2>\ + inline typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type \ + cyl_neumann_prime(T1 v, T2 x){ return boost::math::cyl_neumann_prime(v, x, Policy()); }\ +\ template <class T>\ inline typename boost::math::detail::bessel_traits<T, T, Policy >::result_type \ sph_neumann(unsigned v, T x){ return boost::math::sph_neumann(v, x, Policy()); }\ \ template <class T>\ + inline typename boost::math::detail::bessel_traits<T, T, Policy >::result_type \ + sph_neumann_prime(unsigned v, T x){ return boost::math::sph_neumann_prime(v, x, Policy()); }\ +\ + template <class T>\ + inline typename boost::math::detail::bessel_traits<T, T, Policy >::result_type cyl_bessel_j_zero(T v, int m)\ + { return boost::math::cyl_bessel_j_zero(v, m, Policy()); }\ +\ +template <class OutputIterator, class T>\ + inline void cyl_bessel_j_zero(T v,\ + int start_index,\ + unsigned number_of_zeros,\ + OutputIterator out_it)\ + { boost::math::cyl_bessel_j_zero(v, start_index, number_of_zeros, out_it, Policy()); }\ +\ + template <class T>\ + inline typename boost::math::detail::bessel_traits<T, T, Policy >::result_type cyl_neumann_zero(T v, int m)\ + { return boost::math::cyl_neumann_zero(v, m, Policy()); }\ +\ +template <class OutputIterator, class T>\ + inline void cyl_neumann_zero(T v,\ + int start_index,\ + unsigned number_of_zeros,\ + OutputIterator out_it)\ + { boost::math::cyl_neumann_zero(v, start_index, number_of_zeros, out_it, Policy()); }\ +\ + template <class T>\ inline typename boost::math::tools::promote_args<T>::type sin_pi(T x){ return boost::math::sin_pi(x); }\ \ template <class T>\ @@ -1114,6 +1392,105 @@ namespace boost template <class T1, class T2>\ inline std::complex<typename boost::math::detail::bessel_traits<T1, T2, Policy >::result_type> sph_hankel_2(T1 v, T2 x)\ { return boost::math::sph_hankel_2(v, x, Policy()); }\ + \ + template <class T>\ + inline typename boost::math::tools::promote_args<T>::type jacobi_elliptic(T k, T theta, T* pcn, T* pdn)\ + { return boost::math::jacobi_elliptic(k, theta, pcn, pdn, Policy()); }\ + \ + template <class U, class T>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_sn(U k, T theta)\ + { return boost::math::jacobi_sn(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_cn(T k, U theta)\ + { return boost::math::jacobi_cn(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_dn(T k, U theta)\ + { return boost::math::jacobi_dn(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_cd(T k, U theta)\ + { return boost::math::jacobi_cd(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_dc(T k, U theta)\ + { return boost::math::jacobi_dc(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_ns(T k, U theta)\ + { return boost::math::jacobi_ns(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_sd(T k, U theta)\ + { return boost::math::jacobi_sd(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_ds(T k, U theta)\ + { return boost::math::jacobi_ds(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_nc(T k, U theta)\ + { return boost::math::jacobi_nc(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_nd(T k, U theta)\ + { return boost::math::jacobi_nd(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_sc(T k, U theta)\ + { return boost::math::jacobi_sc(k, theta, Policy()); }\ + \ + template <class T, class U>\ + inline typename boost::math::tools::promote_args<T, U>::type jacobi_cs(T k, U theta)\ + { return boost::math::jacobi_cs(k, theta, Policy()); }\ + \ + template <class T>\ + inline typename boost::math::tools::promote_args<T>::type airy_ai(T x)\ + { return boost::math::airy_ai(x, Policy()); }\ + \ + template <class T>\ + inline typename boost::math::tools::promote_args<T>::type airy_bi(T x)\ + { return boost::math::airy_bi(x, Policy()); }\ + \ + template <class T>\ + inline typename boost::math::tools::promote_args<T>::type airy_ai_prime(T x)\ + { return boost::math::airy_ai_prime(x, Policy()); }\ + \ + template <class T>\ + inline typename boost::math::tools::promote_args<T>::type airy_bi_prime(T x)\ + { return boost::math::airy_bi_prime(x, Policy()); }\ + \ + template <class T>\ + inline T airy_ai_zero(int m)\ + { return boost::math::airy_ai_zero<T>(m, Policy()); }\ + template <class T, class OutputIterator>\ + OutputIterator airy_ai_zero(int start_index, unsigned number_of_zeros, OutputIterator out_it)\ + { return boost::math::airy_ai_zero<T>(start_index, number_of_zeros, out_it, Policy()); }\ + \ + template <class T>\ + inline T airy_bi_zero(int m)\ + { return boost::math::airy_bi_zero<T>(m, Policy()); }\ + template <class T, class OutputIterator>\ + OutputIterator airy_bi_zero(int start_index, unsigned number_of_zeros, OutputIterator out_it)\ + { return boost::math::airy_bi_zero<T>(start_index, number_of_zeros, out_it, Policy()); }\ + \ + template <class T>\ + T bernoulli_b2n(const int i)\ + { return boost::math::bernoulli_b2n<T>(i, Policy()); }\ + template <class T, class OutputIterator>\ + OutputIterator bernoulli_b2n(int start_index, unsigned number_of_bernoullis_b2n, OutputIterator out_it)\ + { return boost::math::bernoulli_b2n<T>(start_index, number_of_bernoullis_b2n, out_it, Policy()); }\ + \ + template <class T>\ + T tangent_t2n(const int i)\ + { return boost::math::tangent_t2n<T>(i, Policy()); }\ + template <class T, class OutputIterator>\ + OutputIterator tangent_t2n(int start_index, unsigned number_of_bernoullis_b2n, OutputIterator out_it)\ + { return boost::math::tangent_t2n<T>(start_index, number_of_bernoullis_b2n, out_it, Policy()); }\ + \ + + diff --git a/boost/math/special_functions/modf.hpp b/boost/math/special_functions/modf.hpp index 48b15fe44f..3ce74e7aa3 100644 --- a/boost/math/special_functions/modf.hpp +++ b/boost/math/special_functions/modf.hpp @@ -10,6 +10,7 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/tools/config.hpp> #include <boost/math/special_functions/trunc.hpp> diff --git a/boost/math/special_functions/next.hpp b/boost/math/special_functions/next.hpp index 6c91cd1e38..9602bc7697 100644 --- a/boost/math/special_functions/next.hpp +++ b/boost/math/special_functions/next.hpp @@ -10,13 +10,19 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/policies/error_handling.hpp> #include <boost/math/special_functions/fpclassify.hpp> #include <boost/math/special_functions/sign.hpp> #include <boost/math/special_functions/trunc.hpp> -#ifdef BOOST_MSVC #include <float.h> + +#if !defined(_CRAYC) && !defined(__CUDACC__) && (!defined(__GNUC__) || (__GNUC__ > 3) || ((__GNUC__ == 3) && (__GNUC_MINOR__ > 3))) +#if (defined(_M_IX86_FP) && (_M_IX86_FP >= 2)) || defined(__SSE2__) +#include "xmmintrin.h" +#define BOOST_MATH_CHECK_SSE2 +#endif #endif namespace boost{ namespace math{ @@ -26,7 +32,17 @@ namespace detail{ template <class T> inline T get_smallest_value(mpl::true_ const&) { - return std::numeric_limits<T>::denorm_min(); + // + // numeric_limits lies about denorms being present - particularly + // when this can be turned on or off at runtime, as is the case + // when using the SSE2 registers in DAZ or FTZ mode. + // + static const T m = std::numeric_limits<T>::denorm_min(); +#ifdef BOOST_MATH_CHECK_SSE2 + return (_mm_getcsr() & (_MM_FLUSH_ZERO_ON | 0x40)) ? tools::min_value<T>() : m;; +#else + return ((tools::min_value<T>() / 2) == 0) ? tools::min_value<T>() : m; +#endif } template <class T> @@ -45,16 +61,59 @@ inline T get_smallest_value() #endif } +// +// Returns the smallest value that won't generate denorms when +// we calculate the value of the least-significant-bit: +// +template <class T> +T get_min_shift_value(); + +template <class T> +struct min_shift_initializer +{ + struct init + { + init() + { + do_init(); + } + static void do_init() + { + get_min_shift_value<T>(); + } + void force_instantiate()const{} + }; + static const init initializer; + static void force_instantiate() + { + initializer.force_instantiate(); + } +}; + +template <class T> +const typename min_shift_initializer<T>::init min_shift_initializer<T>::initializer; + + +template <class T> +inline T get_min_shift_value() +{ + BOOST_MATH_STD_USING + static const T val = ldexp(tools::min_value<T>(), tools::digits<T>() + 1); + min_shift_initializer<T>::force_instantiate(); + + return val; } template <class T, class Policy> -T float_next(const T& val, const Policy& pol) +T float_next_imp(const T& val, const Policy& pol) { BOOST_MATH_STD_USING int expon; static const char* function = "float_next<%1%>(%1%)"; - if(!(boost::math::isfinite)(val)) + int fpclass = (boost::math::fpclassify)(val); + + if((fpclass == (int)FP_NAN) || (fpclass == (int)FP_INFINITE)) { if(val < 0) return -tools::max_value<T>(); @@ -69,6 +128,16 @@ T float_next(const T& val, const Policy& pol) if(val == 0) return detail::get_smallest_value<T>(); + if((fpclass != (int)FP_SUBNORMAL) && (fpclass != (int)FP_ZERO) && (fabs(val) < detail::get_min_shift_value<T>()) && (val != -tools::min_value<T>())) + { + // + // Special case: if the value of the least significant bit is a denorm, and the result + // would not be a denorm, then shift the input, increment, and shift back. + // This avoids issues with the Intel SSE2 registers when the FTZ or DAZ flags are set. + // + return ldexp(float_next(T(ldexp(val, 2 * tools::digits<T>())), pol), -2 * tools::digits<T>()); + } + if(-0.5f == frexp(val, &expon)) --expon; // reduce exponent when val is a power of two, and negative. T diff = ldexp(T(1), expon - tools::digits<T>()); @@ -77,7 +146,21 @@ T float_next(const T& val, const Policy& pol) return val + diff; } -#ifdef BOOST_MSVC +} + +template <class T, class Policy> +inline typename tools::promote_args<T>::type float_next(const T& val, const Policy& pol) +{ + typedef typename tools::promote_args<T>::type result_type; + return detail::float_next_imp(static_cast<result_type>(val), pol); +} + +#if 0 //def BOOST_MSVC +// +// We used to use ::_nextafter here, but doing so fails when using +// the SSE2 registers if the FTZ or DAZ flags are set, so use our own +// - albeit slower - code instead as at least that gives the correct answer. +// template <class Policy> inline double float_next(const double& val, const Policy& pol) { @@ -96,19 +179,23 @@ inline double float_next(const double& val, const Policy& pol) #endif template <class T> -inline T float_next(const T& val) +inline typename tools::promote_args<T>::type float_next(const T& val) { return float_next(val, policies::policy<>()); } +namespace detail{ + template <class T, class Policy> -T float_prior(const T& val, const Policy& pol) +T float_prior_imp(const T& val, const Policy& pol) { BOOST_MATH_STD_USING int expon; static const char* function = "float_prior<%1%>(%1%)"; - if(!(boost::math::isfinite)(val)) + int fpclass = (boost::math::fpclassify)(val); + + if((fpclass == (int)FP_NAN) || (fpclass == (int)FP_INFINITE)) { if(val > 0) return tools::max_value<T>(); @@ -123,6 +210,16 @@ T float_prior(const T& val, const Policy& pol) if(val == 0) return -detail::get_smallest_value<T>(); + if((fpclass != (int)FP_SUBNORMAL) && (fpclass != (int)FP_ZERO) && (fabs(val) < detail::get_min_shift_value<T>()) && (val != tools::min_value<T>())) + { + // + // Special case: if the value of the least significant bit is a denorm, and the result + // would not be a denorm, then shift the input, increment, and shift back. + // This avoids issues with the Intel SSE2 registers when the FTZ or DAZ flags are set. + // + return ldexp(float_prior(T(ldexp(val, 2 * tools::digits<T>())), pol), -2 * tools::digits<T>()); + } + T remain = frexp(val, &expon); if(remain == 0.5) --expon; // when val is a power of two we must reduce the exponent @@ -132,7 +229,21 @@ T float_prior(const T& val, const Policy& pol) return val - diff; } -#ifdef BOOST_MSVC +} + +template <class T, class Policy> +inline typename tools::promote_args<T>::type float_prior(const T& val, const Policy& pol) +{ + typedef typename tools::promote_args<T>::type result_type; + return detail::float_prior_imp(static_cast<result_type>(val), pol); +} + +#if 0 //def BOOST_MSVC +// +// We used to use ::_nextafter here, but doing so fails when using +// the SSE2 registers if the FTZ or DAZ flags are set, so use our own +// - albeit slower - code instead as at least that gives the correct answer. +// template <class Policy> inline double float_prior(const double& val, const Policy& pol) { @@ -151,25 +262,28 @@ inline double float_prior(const double& val, const Policy& pol) #endif template <class T> -inline T float_prior(const T& val) +inline typename tools::promote_args<T>::type float_prior(const T& val) { return float_prior(val, policies::policy<>()); } -template <class T, class Policy> -inline T nextafter(const T& val, const T& direction, const Policy& pol) +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type nextafter(const T& val, const U& direction, const Policy& pol) { - return val < direction ? boost::math::float_next(val, pol) : val == direction ? val : boost::math::float_prior(val, pol); + typedef typename tools::promote_args<T, U>::type result_type; + return val < direction ? boost::math::float_next<result_type>(val, pol) : val == direction ? val : boost::math::float_prior<result_type>(val, pol); } -template <class T> -inline T nextafter(const T& val, const T& direction) +template <class T, class U> +inline typename tools::promote_args<T, U>::type nextafter(const T& val, const U& direction) { return nextafter(val, direction, policies::policy<>()); } +namespace detail{ + template <class T, class Policy> -T float_distance(const T& a, const T& b, const Policy& pol) +T float_distance_imp(const T& a, const T& b, const Policy& pol) { BOOST_MATH_STD_USING // @@ -188,22 +302,22 @@ T float_distance(const T& a, const T& b, const Policy& pol) // Special cases: // if(a > b) - return -float_distance(b, a); + return -float_distance(b, a, pol); if(a == b) return 0; if(a == 0) - return 1 + fabs(float_distance(static_cast<T>(boost::math::sign(b) * detail::get_smallest_value<T>()), b, pol)); + return 1 + fabs(float_distance(static_cast<T>((b < 0) ? T(-detail::get_smallest_value<T>()) : detail::get_smallest_value<T>()), b, pol)); if(b == 0) - return 1 + fabs(float_distance(static_cast<T>(boost::math::sign(a) * detail::get_smallest_value<T>()), a, pol)); + return 1 + fabs(float_distance(static_cast<T>((a < 0) ? T(-detail::get_smallest_value<T>()) : detail::get_smallest_value<T>()), a, pol)); if(boost::math::sign(a) != boost::math::sign(b)) - return 2 + fabs(float_distance(static_cast<T>(boost::math::sign(b) * detail::get_smallest_value<T>()), b, pol)) - + fabs(float_distance(static_cast<T>(boost::math::sign(a) * detail::get_smallest_value<T>()), a, pol)); + return 2 + fabs(float_distance(static_cast<T>((b < 0) ? T(-detail::get_smallest_value<T>()) : detail::get_smallest_value<T>()), b, pol)) + + fabs(float_distance(static_cast<T>((a < 0) ? T(-detail::get_smallest_value<T>()) : detail::get_smallest_value<T>()), a, pol)); // // By the time we get here, both a and b must have the same sign, we want // b > a and both postive for the following logic: // if(a < 0) - return float_distance(static_cast<T>(-b), static_cast<T>(-a)); + return float_distance(static_cast<T>(-b), static_cast<T>(-a), pol); BOOST_ASSERT(a >= 0); BOOST_ASSERT(b >= a); @@ -214,7 +328,7 @@ T float_distance(const T& a, const T& b, const Policy& pol) // because we actually have fewer than tools::digits<T>() // significant bits in the representation: // - frexp(((boost::math::fpclassify)(a) == FP_SUBNORMAL) ? tools::min_value<T>() : a, &expon); + frexp(((boost::math::fpclassify)(a) == (int)FP_SUBNORMAL) ? tools::min_value<T>() : a, &expon); T upper = ldexp(T(1), expon); T result = 0; expon = tools::digits<T>() - expon; @@ -227,13 +341,33 @@ T float_distance(const T& a, const T& b, const Policy& pol) result = float_distance(upper, b); } // - // Use compensated double-double addition to avoid rounding + // Use compensated double-double addition to avoid rounding // errors in the subtraction: // - T mb = -(std::min)(upper, b); - T x = a + mb; - T z = x - a; - T y = (a - (x - z)) + (mb - z); + T mb, x, y, z; + if(((boost::math::fpclassify)(a) == (int)FP_SUBNORMAL) || (b - a < tools::min_value<T>())) + { + // + // Special case - either one end of the range is a denormal, or else the difference is. + // The regular code will fail if we're using the SSE2 registers on Intel and either + // the FTZ or DAZ flags are set. + // + T a2 = ldexp(a, tools::digits<T>()); + T b2 = ldexp(b, tools::digits<T>()); + mb = -(std::min)(T(ldexp(upper, tools::digits<T>())), b2); + x = a2 + mb; + z = x - a2; + y = (a2 - (x - z)) + (mb - z); + + expon -= tools::digits<T>(); + } + else + { + mb = -(std::min)(upper, b); + x = a + mb; + z = x - a; + y = (a - (x - z)) + (mb - z); + } if(x < 0) { x = -x; @@ -247,20 +381,35 @@ T float_distance(const T& a, const T& b, const Policy& pol) return result; } -template <class T> -T float_distance(const T& a, const T& b) +} + +template <class T, class U, class Policy> +inline typename tools::promote_args<T, U>::type float_distance(const T& a, const U& b, const Policy& pol) +{ + typedef typename tools::promote_args<T, U>::type result_type; + return detail::float_distance_imp(static_cast<result_type>(a), static_cast<result_type>(b), pol); +} + +template <class T, class U> +typename tools::promote_args<T, U>::type float_distance(const T& a, const U& b) { return boost::math::float_distance(a, b, policies::policy<>()); } +namespace detail{ + template <class T, class Policy> -T float_advance(T val, int distance, const Policy& pol) +T float_advance_imp(T val, int distance, const Policy& pol) { + BOOST_MATH_STD_USING // // Error handling: // static const char* function = "float_advance<%1%>(%1%, int)"; - if(!(boost::math::isfinite)(val)) + + int fpclass = (boost::math::fpclassify)(val); + + if((fpclass == (int)FP_NAN) || (fpclass == (int)FP_INFINITE)) return policies::raise_domain_error<T>( function, "Argument val must be finite, but got %1%", val, pol); @@ -273,7 +422,25 @@ T float_advance(T val, int distance, const Policy& pol) return float_next(val, pol); if(distance == -1) return float_prior(val, pol); - BOOST_MATH_STD_USING + + if(fabs(val) < detail::get_min_shift_value<T>()) + { + // + // Special case: if the value of the least significant bit is a denorm, + // implement in terms of float_next/float_prior. + // This avoids issues with the Intel SSE2 registers when the FTZ or DAZ flags are set. + // + if(distance > 0) + { + do{ val = float_next(val, pol); } while(--distance); + } + else + { + do{ val = float_prior(val, pol); } while(++distance); + } + return val; + } + int expon; frexp(val, &expon); T limit = ldexp((distance < 0 ? T(0.5f) : T(1)), expon); @@ -286,7 +453,7 @@ T float_advance(T val, int distance, const Policy& pol) { distance -= itrunc(limit_distance); val = limit; - if(distance < 0) + if(distance < 0) { limit /= 2; expon--; @@ -297,6 +464,10 @@ T float_advance(T val, int distance, const Policy& pol) expon++; } limit_distance = float_distance(val, limit); + if(distance && (limit_distance == 0)) + { + return policies::raise_evaluation_error<T>(function, "Internal logic failed while trying to increment floating point value %1%: most likely your FPU is in non-IEEE conforming mode.", val, pol); + } } if((0.5f == frexp(val, &expon)) && (distance < 0)) --expon; @@ -308,8 +479,17 @@ T float_advance(T val, int distance, const Policy& pol) return val += diff; } +} + +template <class T, class Policy> +inline typename tools::promote_args<T>::type float_advance(T val, int distance, const Policy& pol) +{ + typedef typename tools::promote_args<T>::type result_type; + return detail::float_advance_imp(static_cast<result_type>(val), distance, pol); +} + template <class T> -inline T float_advance(const T& val, int distance) +inline typename tools::promote_args<T>::type float_advance(const T& val, int distance) { return boost::math::float_advance(val, distance, policies::policy<>()); } diff --git a/boost/math/special_functions/owens_t.hpp b/boost/math/special_functions/owens_t.hpp index 98d6380c39..6de93a4887 100644 --- a/boost/math/special_functions/owens_t.hpp +++ b/boost/math/special_functions/owens_t.hpp @@ -1,4 +1,4 @@ -// (C) Benjamin Sobotta 2012 +// Copyright Benjamin Sobotta 2012 // Use, modification and distribution are subject to the // Boost Software License, Version 1.0. (See accompanying file @@ -16,6 +16,7 @@ # pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/config/no_tr1/cmath.hpp> #include <boost/math/special_functions/erf.hpp> #include <boost/math/special_functions/expm1.hpp> @@ -26,6 +27,11 @@ #include <stdexcept> +#ifdef BOOST_MSVC +#pragma warning(push) +#pragma warning(disable:4127) +#endif + namespace boost { namespace math @@ -144,8 +150,8 @@ namespace boost } // compute the value of Owen's T function with method T1 from the reference paper - template<typename RealType> - inline RealType owens_t_T1(const RealType h, const RealType a, const unsigned short m) + template<typename RealType, typename Policy> + inline RealType owens_t_T1(const RealType h, const RealType a, const unsigned short m, const Policy& pol) { BOOST_MATH_STD_USING using namespace boost::math::constants; @@ -157,7 +163,7 @@ namespace boost unsigned short j=1; RealType jj = 1; RealType aj = a * one_div_two_pi<RealType>(); - RealType dj = expm1( hs ); + RealType dj = boost::math::expm1( hs, pol); RealType gj = hs*dhs; RealType val = atan( a ) * one_div_two_pi<RealType>(); @@ -219,7 +225,7 @@ namespace boost BOOST_MATH_STD_USING using namespace boost::math::constants; - const unsigned short m = 20; + const unsigned short m = 20; static const RealType c2[] = { @@ -275,37 +281,37 @@ namespace boost static const RealType c2[] = { - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.99999999999999999999999729978162447266851932041876728736094298092917625009873), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.99999999999999999999467056379678391810626533251885323416799874878563998732905968), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.99999999999999999824849349313270659391127814689133077036298754586814091034842536), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.9999999999999997703859616213643405880166422891953033591551179153879839440241685), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.99999999999998394883415238173334565554173013941245103172035286759201504179038147), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.9999999999993063616095509371081203145247992197457263066869044528823599399470977), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.9999999999797336340409464429599229870590160411238245275855903767652432017766116267), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.999999999574958412069046680119051639753412378037565521359444170241346845522403274), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.9999999933226234193375324943920160947158239076786103108097456617750134812033362048), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.9999999188923242461073033481053037468263536806742737922476636768006622772762168467), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.9999992195143483674402853783549420883055129680082932629160081128947764415749728967), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.999993935137206712830997921913316971472227199741857386575097250553105958772041501), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.99996135597690552745362392866517133091672395614263398912807169603795088421057688716), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.99979556366513946026406788969630293820987757758641211293079784585126692672425362469), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.999092789629617100153486251423850590051366661947344315423226082520411961968929483), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.996593837411918202119308620432614600338157335862888580671450938858935084316004769854), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.98910017138386127038463510314625339359073956513420458166238478926511821146316469589567), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.970078558040693314521331982203762771512160168582494513347846407314584943870399016019), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.92911438683263187495758525500033707204091967947532160289872782771388170647150321633673), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.8542058695956156057286980736842905011429254735181323743367879525470479126968822863), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.73796526033030091233118357742803709382964420335559408722681794195743240930748630755), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.58523469882837394570128599003785154144164680587615878645171632791404210655891158), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.415997776145676306165661663581868460503874205343014196580122174949645271353372263), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.2588210875241943574388730510317252236407805082485246378222935376279663808416534365), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.1375535825163892648504646951500265585055789019410617565727090346559210218472356689), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.0607952766325955730493900985022020434830339794955745989150270485056436844239206648), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.0216337683299871528059836483840390514275488679530797294557060229266785853764115), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.00593405693455186729876995814181203900550014220428843483927218267309209471516256), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.0011743414818332946510474576182739210553333860106811865963485870668929503649964142), - BOOST_MATH_BIG_CONSTANT(RealType, 260, -1.489155613350368934073453260689881330166342484405529981510694514036264969925132e-4), - BOOST_MATH_BIG_CONSTANT(RealType, 260, 9.072354320794357587710929507988814669454281514268844884841547607134260303118208e-6) + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.99999999999999999999999729978162447266851932041876728736094298092917625009873), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.99999999999999999999467056379678391810626533251885323416799874878563998732905968), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.99999999999999999824849349313270659391127814689133077036298754586814091034842536), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.9999999999999997703859616213643405880166422891953033591551179153879839440241685), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.99999999999998394883415238173334565554173013941245103172035286759201504179038147), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.9999999999993063616095509371081203145247992197457263066869044528823599399470977), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.9999999999797336340409464429599229870590160411238245275855903767652432017766116267), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.999999999574958412069046680119051639753412378037565521359444170241346845522403274), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.9999999933226234193375324943920160947158239076786103108097456617750134812033362048), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.9999999188923242461073033481053037468263536806742737922476636768006622772762168467), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.9999992195143483674402853783549420883055129680082932629160081128947764415749728967), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.999993935137206712830997921913316971472227199741857386575097250553105958772041501), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.99996135597690552745362392866517133091672395614263398912807169603795088421057688716), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.99979556366513946026406788969630293820987757758641211293079784585126692672425362469), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.999092789629617100153486251423850590051366661947344315423226082520411961968929483), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.996593837411918202119308620432614600338157335862888580671450938858935084316004769854), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.98910017138386127038463510314625339359073956513420458166238478926511821146316469589567), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.970078558040693314521331982203762771512160168582494513347846407314584943870399016019), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.92911438683263187495758525500033707204091967947532160289872782771388170647150321633673), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.8542058695956156057286980736842905011429254735181323743367879525470479126968822863), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.73796526033030091233118357742803709382964420335559408722681794195743240930748630755), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.58523469882837394570128599003785154144164680587615878645171632791404210655891158), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.415997776145676306165661663581868460503874205343014196580122174949645271353372263), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.2588210875241943574388730510317252236407805082485246378222935376279663808416534365), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.1375535825163892648504646951500265585055789019410617565727090346559210218472356689), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.0607952766325955730493900985022020434830339794955745989150270485056436844239206648), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.0216337683299871528059836483840390514275488679530797294557060229266785853764115), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -0.00593405693455186729876995814181203900550014220428843483927218267309209471516256), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 0.0011743414818332946510474576182739210553333860106811865963485870668929503649964142), + BOOST_MATH_BIG_CONSTANT(RealType, 260, -1.489155613350368934073453260689881330166342484405529981510694514036264969925132e-4), + BOOST_MATH_BIG_CONSTANT(RealType, 260, 9.072354320794357587710929507988814669454281514268844884841547607134260303118208e-6) }; const RealType as = a*a; @@ -595,7 +601,7 @@ namespace boost term = one_minus_dj_sum * a_pow / (2 * j + 1); c = b - c; sum += c * term; - abs_err += ldexp(std::max(T(fabs(sum)), T(fabs(c*term))), -tools::digits<T>()); + abs_err += ldexp((std::max)(T(fabs(sum)), T(fabs(c*term))), -tools::digits<T>()); b = (j + n) * (j - n) * b / ((j + T(0.5)) * (j + 1)); ++j; // @@ -795,7 +801,7 @@ namespace boost switch( meth[icode] ) { case 1: // T1 - val = owens_t_T1(h,a,m); + val = owens_t_T1(h,a,m,pol); break; case 2: // T2 typedef typename policies::precision<RealType, Policy>::type precision_type; @@ -1057,5 +1063,9 @@ namespace boost } // namespace math } // namespace boost +#ifdef BOOST_MSVC +#pragma warning(pop) +#endif + #endif // EOF diff --git a/boost/math/special_functions/pow.hpp b/boost/math/special_functions/pow.hpp index 5423e9c8e4..494f721d05 100644 --- a/boost/math/special_functions/pow.hpp +++ b/boost/math/special_functions/pow.hpp @@ -13,6 +13,7 @@ #define BOOST_MATH_POW_HPP +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/policies/policy.hpp> #include <boost/math/policies/error_handling.hpp> #include <boost/math/tools/promotion.hpp> @@ -22,6 +23,10 @@ namespace boost { namespace math { +#ifdef BOOST_MSVC +#pragma warning(push) +#pragma warning(disable:4702) // Unreachable code, only triggered in release mode and /W4 +#endif namespace detail { @@ -132,6 +137,9 @@ template <int N, typename T> inline typename tools::promote_args<T>::type pow(T base) { return pow<N>(base, policies::policy<>()); } +#ifdef BOOST_MSVC +#pragma warning(pop) +#endif } // namespace math } // namespace boost diff --git a/boost/math/special_functions/powm1.hpp b/boost/math/special_functions/powm1.hpp index cb33ae03d0..f3af3d6e59 100644 --- a/boost/math/special_functions/powm1.hpp +++ b/boost/math/special_functions/powm1.hpp @@ -10,9 +10,9 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/log1p.hpp> #include <boost/math/special_functions/expm1.hpp> -#include <boost/math/special_functions/math_fwd.hpp> #include <boost/assert.hpp> namespace boost{ namespace math{ namespace detail{ diff --git a/boost/math/special_functions/prime.hpp b/boost/math/special_functions/prime.hpp index ee25f991a3..94c28f9842 100644 --- a/boost/math/special_functions/prime.hpp +++ b/boost/math/special_functions/prime.hpp @@ -11,6 +11,7 @@ #include <boost/array.hpp> #include <boost/cstdint.hpp> #include <boost/math/policies/error_handling.hpp> +#include <boost/math/special_functions/math_fwd.hpp> namespace boost{ namespace math{ diff --git a/boost/math/special_functions/round.hpp b/boost/math/special_functions/round.hpp index 2b4497e198..e21f7185d1 100644 --- a/boost/math/special_functions/round.hpp +++ b/boost/math/special_functions/round.hpp @@ -12,20 +12,60 @@ #include <boost/math/tools/config.hpp> #include <boost/math/policies/error_handling.hpp> +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/fpclassify.hpp> namespace boost{ namespace math{ +namespace detail{ + template <class T, class Policy> -inline T round(const T& v, const Policy& pol) +inline typename tools::promote_args<T>::type round(const T& v, const Policy& pol, const mpl::false_) { BOOST_MATH_STD_USING + typedef typename tools::promote_args<T>::type result_type; if(!(boost::math::isfinite)(v)) - return policies::raise_rounding_error("boost::math::round<%1%>(%1%)", 0, v, v, pol); - return v < 0 ? static_cast<T>(ceil(v - 0.5f)) : static_cast<T>(floor(v + 0.5f)); + return policies::raise_rounding_error("boost::math::round<%1%>(%1%)", 0, static_cast<result_type>(v), static_cast<result_type>(v), pol); + // + // The logic here is rather convoluted, but avoids a number of traps, + // see discussion here https://github.com/boostorg/math/pull/8 + // + if (-0.5 < v && v < 0.5) + { + // special case to avoid rounding error on the direct + // predecessor of +0.5 resp. the direct successor of -0.5 in + // IEEE floating point types + return 0; + } + else if (v > 0) + { + // subtract v from ceil(v) first in order to avoid rounding + // errors on largest representable integer numbers + result_type c(ceil(v)); + return 0.5 < c - v ? c - 1 : c; + } + else + { + // see former branch + result_type f(floor(v)); + return 0.5 < v - f ? f + 1 : f; + } +} +template <class T, class Policy> +inline typename tools::promote_args<T>::type round(const T& v, const Policy&, const mpl::true_) +{ + return v; +} + +} // namespace detail + +template <class T, class Policy> +inline typename tools::promote_args<T>::type round(const T& v, const Policy& pol) +{ + return detail::round(v, pol, mpl::bool_<detail::is_integer_for_rounding<T>::value>()); } template <class T> -inline T round(const T& v) +inline typename tools::promote_args<T>::type round(const T& v) { return round(v, policies::policy<>()); } diff --git a/boost/math/special_functions/sign.hpp b/boost/math/special_functions/sign.hpp index 6de88b29a2..f5c562d44c 100644 --- a/boost/math/special_functions/sign.hpp +++ b/boost/math/special_functions/sign.hpp @@ -31,7 +31,10 @@ namespace detail { } #endif - template<class T> + // Generic versions first, note that these do not handle + // signed zero or NaN. + + template<class T> inline int signbit_impl(T x, generic_tag<true> const&) { return x < 0; @@ -43,7 +46,25 @@ namespace detail { return x < 0; } - template<class T> +#if defined(__GNUC__) && (LDBL_MANT_DIG == 106) + // + // Special handling for GCC's "double double" type, + // in this case the sign is the same as the sign we + // get by casting to double, no overflow/underflow + // can occur since the exponents are the same magnitude + // for the two types: + // + inline int signbit_impl(long double x, generic_tag<true> const&) + { + return boost::math::signbit(static_cast<double>(x)); + } + inline int signbit_impl(long double x, generic_tag<false> const&) + { + return boost::math::signbit(static_cast<double>(x)); + } +#endif + + template<class T> inline int signbit_impl(T x, ieee_copy_all_bits_tag const&) { typedef BOOST_DEDUCED_TYPENAME fp_traits<T>::type traits; @@ -65,6 +86,9 @@ namespace detail { } // Changesign + + // Generic versions first, note that these do not handle + // signed zero or NaN. template<class T> inline T (changesign_impl)(T x, generic_tag<true> const&) @@ -77,7 +101,27 @@ namespace detail { { return -x; } - +#if defined(__GNUC__) && (LDBL_MANT_DIG == 106) + // + // Special handling for GCC's "double double" type, + // in this case we need to change the sign of both + // components of the "double double": + // + inline long double (changesign_impl)(long double x, generic_tag<true> const&) + { + double* pd = reinterpret_cast<double*>(&x); + pd[0] = boost::math::changesign(pd[0]); + pd[1] = boost::math::changesign(pd[1]); + return x; + } + inline long double (changesign_impl)(long double x, generic_tag<false> const&) + { + double* pd = reinterpret_cast<double*>(&x); + pd[0] = boost::math::changesign(pd[0]); + pd[1] = boost::math::changesign(pd[1]); + return x; + } +#endif template<class T> inline T changesign_impl(T x, ieee_copy_all_bits_tag const&) @@ -110,8 +154,9 @@ template<class T> int (signbit)(T x) { typedef typename detail::fp_traits<T>::type traits; typedef typename traits::method method; - typedef typename boost::is_floating_point<T>::type fp_tag; - return detail::signbit_impl(x, method()); + // typedef typename boost::is_floating_point<T>::type fp_tag; + typedef typename tools::promote_args_permissive<T>::type result_type; + return detail::signbit_impl(static_cast<result_type>(x), method()); } template <class T> @@ -120,20 +165,24 @@ inline int sign BOOST_NO_MACRO_EXPAND(const T& z) return (z == 0) ? 0 : (boost::math::signbit)(z) ? -1 : 1; } -template<class T> T (changesign)(const T& x) +template <class T> typename tools::promote_args_permissive<T>::type (changesign)(const T& x) { //!< \brief return unchanged binary pattern of x, except for change of sign bit. typedef typename detail::fp_traits<T>::sign_change_type traits; typedef typename traits::method method; - typedef typename boost::is_floating_point<T>::type fp_tag; + // typedef typename boost::is_floating_point<T>::type fp_tag; + typedef typename tools::promote_args_permissive<T>::type result_type; - return detail::changesign_impl(x, method()); + return detail::changesign_impl(static_cast<result_type>(x), method()); } -template <class T> -inline T copysign BOOST_NO_MACRO_EXPAND(const T& x, const T& y) +template <class T, class U> +inline typename tools::promote_args_permissive<T, U>::type + copysign BOOST_NO_MACRO_EXPAND(const T& x, const U& y) { BOOST_MATH_STD_USING - return (boost::math::signbit)(x) != (boost::math::signbit)(y) ? (boost::math::changesign)(x) : x; + typedef typename tools::promote_args_permissive<T, U>::type result_type; + return (boost::math::signbit)(static_cast<result_type>(x)) != (boost::math::signbit)(static_cast<result_type>(y)) + ? (boost::math::changesign)(static_cast<result_type>(x)) : static_cast<result_type>(x); } } // namespace math diff --git a/boost/math/special_functions/sin_pi.hpp b/boost/math/special_functions/sin_pi.hpp index 38c02bc99e..16aed51d2b 100644 --- a/boost/math/special_functions/sin_pi.hpp +++ b/boost/math/special_functions/sin_pi.hpp @@ -12,6 +12,7 @@ #include <boost/config/no_tr1/cmath.hpp> #include <boost/math/tools/config.hpp> +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/trunc.hpp> #include <boost/math/tools/promotion.hpp> #include <boost/math/constants/constants.hpp> diff --git a/boost/math/special_functions/sinc.hpp b/boost/math/special_functions/sinc.hpp index ffb19d8b99..84fbf0e324 100644 --- a/boost/math/special_functions/sinc.hpp +++ b/boost/math/special_functions/sinc.hpp @@ -36,36 +36,16 @@ namespace boost { namespace detail { -#if defined(__GNUC__) && (__GNUC__ < 3) - // gcc 2.x ignores function scope using declarations, - // put them in the scope of the enclosing namespace instead: - - using ::std::abs; - using ::std::sqrt; - using ::std::sin; - - using ::std::numeric_limits; -#endif /* defined(__GNUC__) && (__GNUC__ < 3) */ - // This is the "Sinus Cardinal" of index Pi. template<typename T> inline T sinc_pi_imp(const T x) { -#if defined(BOOST_NO_STDC_NAMESPACE) && !defined(__SUNPRO_CC) - using ::abs; - using ::sin; - using ::sqrt; -#else /* BOOST_NO_STDC_NAMESPACE */ - using ::std::abs; - using ::std::sin; - using ::std::sqrt; -#endif /* BOOST_NO_STDC_NAMESPACE */ - - // Note: this code is *not* thread safe! - static T const taylor_0_bound = tools::epsilon<T>(); - static T const taylor_2_bound = sqrt(taylor_0_bound); - static T const taylor_n_bound = sqrt(taylor_2_bound); + BOOST_MATH_STD_USING + + T const taylor_0_bound = tools::epsilon<T>(); + T const taylor_2_bound = tools::root_epsilon<T>(); + T const taylor_n_bound = tools::forth_root_epsilon<T>(); if (abs(x) >= taylor_n_bound) { @@ -110,28 +90,16 @@ namespace boost return detail::sinc_pi_imp(static_cast<result_type>(x)); } -#ifdef BOOST_NO_TEMPLATE_TEMPLATES -#else /* BOOST_NO_TEMPLATE_TEMPLATES */ +#ifndef BOOST_NO_TEMPLATE_TEMPLATES template<typename T, template<typename> class U> inline U<T> sinc_pi(const U<T> x) { -#if defined(BOOST_FUNCTION_SCOPE_USING_DECLARATION_BREAKS_ADL) || defined(__GNUC__) - using namespace std; -#elif defined(BOOST_NO_STDC_NAMESPACE) && !defined(__SUNPRO_CC) - using ::abs; - using ::sin; - using ::sqrt; -#else /* BOOST_NO_STDC_NAMESPACE */ - using ::std::abs; - using ::std::sin; - using ::std::sqrt; -#endif /* BOOST_NO_STDC_NAMESPACE */ - + BOOST_MATH_STD_USING using ::std::numeric_limits; - static T const taylor_0_bound = tools::epsilon<T>(); - static T const taylor_2_bound = sqrt(taylor_0_bound); - static T const taylor_n_bound = sqrt(taylor_2_bound); + T const taylor_0_bound = tools::epsilon<T>(); + T const taylor_2_bound = tools::root_epsilon<T>(); + T const taylor_n_bound = tools::forth_root_epsilon<T>(); if (abs(x) >= taylor_n_bound) { diff --git a/boost/math/special_functions/sinhc.hpp b/boost/math/special_functions/sinhc.hpp index d19a4b71c6..1216b7bfb7 100644 --- a/boost/math/special_functions/sinhc.hpp +++ b/boost/math/special_functions/sinhc.hpp @@ -34,17 +34,6 @@ namespace boost { namespace detail { -#if defined(__GNUC__) && (__GNUC__ < 3) - // gcc 2.x ignores function scope using declarations, - // put them in the scope of the enclosing namespace instead: - - using ::std::abs; - using ::std::sqrt; - using ::std::sinh; - - using ::std::numeric_limits; -#endif /* defined(__GNUC__) && (__GNUC__ < 3) */ - // This is the "Hyperbolic Sinus Cardinal" of index Pi. template<typename T> diff --git a/boost/math/special_functions/spherical_harmonic.hpp b/boost/math/special_functions/spherical_harmonic.hpp index 33b2574480..00a6ade0d2 100644 --- a/boost/math/special_functions/spherical_harmonic.hpp +++ b/boost/math/special_functions/spherical_harmonic.hpp @@ -11,6 +11,7 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/legendre.hpp> #include <boost/math/tools/workaround.hpp> #include <complex> @@ -119,7 +120,7 @@ std::complex<T> spherical_harmonic(unsigned n, int m, U theta, U phi, const Poli if(m&1) { // Check phase if theta is outside [0, PI]: - U mod = boost::math::tools::fmod_workaround(theta, 2 * constants::pi<U>()); + U mod = boost::math::tools::fmod_workaround(theta, U(2 * constants::pi<U>())); if(mod < 0) mod += 2 * constants::pi<U>(); if(mod > constants::pi<U>()) diff --git a/boost/math/special_functions/sqrt1pm1.hpp b/boost/math/special_functions/sqrt1pm1.hpp index ad0203e722..293a9d97b3 100644 --- a/boost/math/special_functions/sqrt1pm1.hpp +++ b/boost/math/special_functions/sqrt1pm1.hpp @@ -10,9 +10,9 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/special_functions/log1p.hpp> #include <boost/math/special_functions/expm1.hpp> -#include <boost/math/special_functions/math_fwd.hpp> // // This algorithm computes sqrt(1+x)-1 for small x: diff --git a/boost/math/special_functions/trunc.hpp b/boost/math/special_functions/trunc.hpp index 7346afe6d1..3f80c96fee 100644 --- a/boost/math/special_functions/trunc.hpp +++ b/boost/math/special_functions/trunc.hpp @@ -10,22 +10,38 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/tools/config.hpp> #include <boost/math/policies/error_handling.hpp> #include <boost/math/special_functions/fpclassify.hpp> -namespace boost{ namespace math{ +namespace boost{ namespace math{ namespace detail{ template <class T, class Policy> -inline T trunc(const T& v, const Policy& pol) +inline typename tools::promote_args<T>::type trunc(const T& v, const Policy& pol, const mpl::false_&) { BOOST_MATH_STD_USING + typedef typename tools::promote_args<T>::type result_type; if(!(boost::math::isfinite)(v)) - return policies::raise_rounding_error("boost::math::trunc<%1%>(%1%)", 0, v, v, pol); - return (v >= 0) ? static_cast<T>(floor(v)) : static_cast<T>(ceil(v)); + return policies::raise_rounding_error("boost::math::trunc<%1%>(%1%)", 0, static_cast<result_type>(v), static_cast<result_type>(v), pol); + return (v >= 0) ? static_cast<result_type>(floor(v)) : static_cast<result_type>(ceil(v)); +} + +template <class T, class Policy> +inline typename tools::promote_args<T>::type trunc(const T& v, const Policy&, const mpl::true_&) +{ + return v; +} + +} + +template <class T, class Policy> +inline typename tools::promote_args<T>::type trunc(const T& v, const Policy& pol) +{ + return detail::trunc(v, pol, mpl::bool_<detail::is_integer_for_rounding<T>::value>()); } template <class T> -inline T trunc(const T& v) +inline typename tools::promote_args<T>::type trunc(const T& v) { return trunc(v, policies::policy<>()); } @@ -42,9 +58,10 @@ template <class T, class Policy> inline int itrunc(const T& v, const Policy& pol) { BOOST_MATH_STD_USING - T r = boost::math::trunc(v, pol); + typedef typename tools::promote_args<T>::type result_type; + result_type r = boost::math::trunc(v, pol); if((r > (std::numeric_limits<int>::max)()) || (r < (std::numeric_limits<int>::min)())) - return static_cast<int>(policies::raise_rounding_error("boost::math::itrunc<%1%>(%1%)", 0, v, 0, pol)); + return static_cast<int>(policies::raise_rounding_error("boost::math::itrunc<%1%>(%1%)", 0, static_cast<result_type>(v), 0, pol)); return static_cast<int>(r); } template <class T> @@ -57,9 +74,10 @@ template <class T, class Policy> inline long ltrunc(const T& v, const Policy& pol) { BOOST_MATH_STD_USING - T r = boost::math::trunc(v, pol); + typedef typename tools::promote_args<T>::type result_type; + result_type r = boost::math::trunc(v, pol); if((r > (std::numeric_limits<long>::max)()) || (r < (std::numeric_limits<long>::min)())) - return static_cast<long>(policies::raise_rounding_error("boost::math::ltrunc<%1%>(%1%)", 0, v, 0L, pol)); + return static_cast<long>(policies::raise_rounding_error("boost::math::ltrunc<%1%>(%1%)", 0, static_cast<result_type>(v), 0L, pol)); return static_cast<long>(r); } template <class T> @@ -74,7 +92,8 @@ template <class T, class Policy> inline boost::long_long_type lltrunc(const T& v, const Policy& pol) { BOOST_MATH_STD_USING - T r = boost::math::trunc(v, pol); + typedef typename tools::promote_args<T>::type result_type; + result_type r = boost::math::trunc(v, pol); if((r > (std::numeric_limits<boost::long_long_type>::max)()) || (r < (std::numeric_limits<boost::long_long_type>::min)())) return static_cast<boost::long_long_type>(policies::raise_rounding_error("boost::math::lltrunc<%1%>(%1%)", 0, v, static_cast<boost::long_long_type>(0), pol)); return static_cast<boost::long_long_type>(r); diff --git a/boost/math/special_functions/zeta.hpp b/boost/math/special_functions/zeta.hpp index 011182718e..b176f20176 100644 --- a/boost/math/special_functions/zeta.hpp +++ b/boost/math/special_functions/zeta.hpp @@ -10,6 +10,7 @@ #pragma once #endif +#include <boost/math/special_functions/math_fwd.hpp> #include <boost/math/tools/precision.hpp> #include <boost/math/tools/series.hpp> #include <boost/math/tools/big_constant.hpp> @@ -378,7 +379,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, -0.279496685273033761927e-4), }; static const T Q[7] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, -0.30425480068225790522), BOOST_MATH_BIG_CONSTANT(T, 64, 0.050052748580371598736), BOOST_MATH_BIG_CONSTANT(T, 64, -0.00519355671064700627862), @@ -406,7 +407,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, 0.700867470265983665042e-5), }; static const T Q[7] = { - BOOST_MATH_BIG_CONSTANT(T, 64, 1), + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.259385759149531030085), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0373974962106091316854), BOOST_MATH_BIG_CONSTANT(T, 64, 0.00332735159183332820617), @@ -432,7 +433,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, 0.540319769113543934483e-7), }; static const T Q[8] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.286577739726542730421), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0447355811517733225843), BOOST_MATH_BIG_CONSTANT(T, 64, 0.00430125107610252363302), @@ -458,7 +459,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, -0.252884970740994069582e-5), }; static const T Q[9] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 1.01300131390690459085), BOOST_MATH_BIG_CONSTANT(T, 64, 0.387898115758643503827), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0695071490045701135188), @@ -487,7 +488,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, -0.815696314790853893484e-8), }; static const T Q[9] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.525765665400123515036), BOOST_MATH_BIG_CONSTANT(T, 64, 0.10852641753657122787), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0115669945375362045249), @@ -516,7 +517,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<64>&) BOOST_MATH_BIG_CONSTANT(T, 64, -0.145392555873022044329e-9), }; static const T Q[10] = { - 1, + BOOST_MATH_BIG_CONSTANT(T, 64, 1.0), BOOST_MATH_BIG_CONSTANT(T, 64, 0.205135978585281988052), BOOST_MATH_BIG_CONSTANT(T, 64, 0.0192359357875879453602), BOOST_MATH_BIG_CONSTANT(T, 64, 0.00111496452029715514119), @@ -554,7 +555,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) // Max error found at long double precision: 7.281332e-31 static const T P[10] = { - BOOST_MATH_BIG_CONSTANT(T, 113, -1), + BOOST_MATH_BIG_CONSTANT(T, 113, -1.0), BOOST_MATH_BIG_CONSTANT(T, 113, -0.0353008629988648122808504280990313668), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0107795651204927743049369868548706909), BOOST_MATH_BIG_CONSTANT(T, 113, 0.000523961870530500751114866884685172975), @@ -566,7 +567,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, 0.113103113698388531428914333768142527e-10), }; static const T Q[11] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, -0.387483472099602327112637481818565459), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0802265315091063135271497708694776875), BOOST_MATH_BIG_CONSTANT(T, 113, -0.0110727276164171919280036408995078164), @@ -600,7 +601,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -0.835774625259919268768735944711219256e-11), }; static const T Q[11] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.316661751179735502065583176348292881), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0540401806533507064453851182728635272), BOOST_MATH_BIG_CONSTANT(T, 113, 0.00598621274107420237785899476374043797), @@ -636,7 +637,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, 0.340169592866058506675897646629036044e-12), }; static const T Q[12] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.363755247765087100018556983050520554), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0696581979014242539385695131258321598), BOOST_MATH_BIG_CONSTANT(T, 113, 0.00882208914484611029571547753782014817), @@ -675,7 +676,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -0.15090220092460596872172844424267351e-10), }; static const T Q[14] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 1.69490865837142338462982225731926485), BOOST_MATH_BIG_CONSTANT(T, 113, 1.22697696630994080733321401255942464), BOOST_MATH_BIG_CONSTANT(T, 113, 0.495409420862526540074366618006341533), @@ -715,7 +716,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -0.420204769185233365849253969097184005e-12), }; static const T Q[14] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.97663511666410096104783358493318814), BOOST_MATH_BIG_CONSTANT(T, 113, 0.40878780231201806504987368939673249), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0963890666609396058945084107597727252), @@ -753,7 +754,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -0.289187187441625868404494665572279364e-15), }; static const T Q[14] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.427310044448071818775721584949868806), BOOST_MATH_BIG_CONSTANT(T, 113, 0.074602514873055756201435421385243062), BOOST_MATH_BIG_CONSTANT(T, 113, 0.00688651562174480772901425121653945942), @@ -792,7 +793,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -0.402663128248642002351627980255756363e-16), }; static const T Q[14] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.311288325355705609096155335186466508), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0438318468940415543546769437752132748), BOOST_MATH_BIG_CONSTANT(T, 113, 0.00374396349183199548610264222242269536), @@ -831,7 +832,7 @@ T zeta_imp_prec(T s, T sc, const Policy&, const mpl::int_<113>&) BOOST_MATH_BIG_CONSTANT(T, 113, -0.376708747782400769427057630528578187e-19), }; static const T Q[16] = { - BOOST_MATH_BIG_CONSTANT(T, 113, 1), + BOOST_MATH_BIG_CONSTANT(T, 113, 1.0), BOOST_MATH_BIG_CONSTANT(T, 113, 0.205076752981410805177554569784219717), BOOST_MATH_BIG_CONSTANT(T, 113, 0.0202526722696670378999575738524540269), BOOST_MATH_BIG_CONSTANT(T, 113, 0.001278305290005994980069466658219057), @@ -866,15 +867,16 @@ template <class T, class Policy, class Tag> T zeta_imp(T s, T sc, const Policy& pol, const Tag& tag) { BOOST_MATH_STD_USING - if(s == 1) + static const char* function = "boost::math::zeta<%1%>"; + if(sc == 0) return policies::raise_pole_error<T>( - "boost::math::zeta<%1%>", + function, "Evaluation of zeta function at pole %1%", s, pol); T result; - if(s == 0) + if(fabs(s) < tools::root_epsilon<T>()) { - result = -0.5; + result = -0.5f - constants::log_root_two_pi<T, Policy>() * s; } else if(s < 0) { @@ -883,10 +885,25 @@ T zeta_imp(T s, T sc, const Policy& pol, const Tag& tag) result = 0; else { - result = boost::math::sin_pi(0.5f * sc, pol) - * 2 * pow(2 * constants::pi<T>(), -s) - * boost::math::tgamma(s, pol) - * zeta_imp(s, sc, pol, tag); + if(s > max_factorial<T>::value) + { + T mult = boost::math::sin_pi(0.5f * sc, pol) * 2 * zeta_imp(s, sc, pol, tag); + result = boost::math::lgamma(s, pol); + result -= s * log(2 * constants::pi<T>()); + if(result > tools::log_max_value<T>()) + return sign(mult) * policies::raise_overflow_error<T>(function, 0, pol); + result = exp(result); + if(tools::max_value<T>() / fabs(mult) < result) + return boost::math::sign(mult) * policies::raise_overflow_error<T>(function, 0, pol); + result *= mult; + } + else + { + result = boost::math::sin_pi(0.5f * sc, pol) + * 2 * pow(2 * constants::pi<T>(), -s) + * boost::math::tgamma(s, pol) + * zeta_imp(s, sc, pol, tag); + } } } else diff --git a/boost/math/tools/big_constant.hpp b/boost/math/tools/big_constant.hpp index 119063164a..423cc1b631 100644 --- a/boost/math/tools/big_constant.hpp +++ b/boost/math/tools/big_constant.hpp @@ -8,30 +8,35 @@ #define BOOST_MATH_TOOLS_BIG_CONSTANT_HPP #include <boost/math/tools/config.hpp> +#ifndef BOOST_MATH_NO_LEXICAL_CAST #include <boost/lexical_cast.hpp> +#endif #include <boost/type_traits/is_convertible.hpp> +#include <boost/math/cstdfloat/cstdfloat_types.hpp> namespace boost{ namespace math{ namespace tools{ template <class T> -inline BOOST_CONSTEXPR_OR_CONST T make_big_value(long double v, const char*, mpl::true_ const&, mpl::false_ const&) +inline BOOST_CONSTEXPR_OR_CONST T make_big_value(boost::floatmax_t v, const char*, mpl::true_ const&, mpl::false_ const&) { return static_cast<T>(v); } template <class T> -inline BOOST_CONSTEXPR_OR_CONST T make_big_value(long double v, const char*, mpl::true_ const&, mpl::true_ const&) +inline BOOST_CONSTEXPR_OR_CONST T make_big_value(boost::floatmax_t v, const char*, mpl::true_ const&, mpl::true_ const&) { return static_cast<T>(v); } +#ifndef BOOST_MATH_NO_LEXICAL_CAST template <class T> -inline T make_big_value(long double, const char* s, mpl::false_ const&, mpl::false_ const&) +inline T make_big_value(boost::floatmax_t, const char* s, mpl::false_ const&, mpl::false_ const&) { return boost::lexical_cast<T>(s); } +#endif template <class T> -inline BOOST_CONSTEXPR const char* make_big_value(long double, const char* s, mpl::false_ const&, mpl::true_ const&) +inline BOOST_CONSTEXPR const char* make_big_value(boost::floatmax_t, const char* s, mpl::false_ const&, mpl::true_ const&) { return s; } @@ -41,19 +46,21 @@ inline BOOST_CONSTEXPR const char* make_big_value(long double, const char* s, mp // #define BOOST_MATH_BIG_CONSTANT(T, D, x)\ boost::math::tools::make_big_value<T>(\ - BOOST_JOIN(x, L), \ + BOOST_FLOATMAX_C(x), \ BOOST_STRINGIZE(x), \ - mpl::bool_< (is_convertible<long double, T>::value) && \ - ((D <= std::numeric_limits<long double>::digits) \ + mpl::bool_< (is_convertible<boost::floatmax_t, T>::value) && \ + ((D <= std::numeric_limits<boost::floatmax_t>::digits) \ || is_floating_point<T>::value \ || (std::numeric_limits<T>::is_specialized && \ - (std::numeric_limits<T>::digits10 <= std::numeric_limits<long double>::digits10))) >(), \ + (std::numeric_limits<T>::digits10 <= std::numeric_limits<boost::floatmax_t>::digits10))) >(), \ boost::is_convertible<const char*, T>()) // // For constants too huge for any conceivable long double (and which generate compiler errors if we try and declare them as such): // #define BOOST_MATH_HUGE_CONSTANT(T, D, x)\ - boost::math::tools::make_big_value<T>(0.0L, BOOST_STRINGIZE(x), mpl::bool_<false>(), boost::is_convertible<const char*, T>()) + boost::math::tools::make_big_value<T>(0.0L, BOOST_STRINGIZE(x), \ + mpl::bool_<is_floating_point<T>::value || (std::numeric_limits<T>::is_specialized && std::numeric_limits<T>::max_exponent <= std::numeric_limits<long double>::max_exponent && std::numeric_limits<T>::digits <= std::numeric_limits<long double>::digits)>(), \ + boost::is_convertible<const char*, T>()) }}} // namespaces diff --git a/boost/math/tools/config.hpp b/boost/math/tools/config.hpp index b1fcd13856..4ec5768aaf 100644 --- a/boost/math/tools/config.hpp +++ b/boost/math/tools/config.hpp @@ -13,6 +13,7 @@ #include <boost/config.hpp> #include <boost/cstdint.hpp> // for boost::uintmax_t #include <boost/detail/workaround.hpp> +#include <boost/type_traits/is_integral.hpp> #include <algorithm> // for min and max #include <boost/config/no_tr1/cmath.hpp> #include <climits> @@ -20,9 +21,11 @@ #if (defined(macintosh) || defined(__APPLE__) || defined(__APPLE_CC__)) # include <math.h> #endif +#ifndef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS +# include <limits> +#endif #include <boost/math/tools/user.hpp> -#include <boost/math/special_functions/detail/round_fwd.hpp> #if (defined(__CYGWIN__) || defined(__FreeBSD__) || defined(__NetBSD__) \ || (defined(__hppa) && !defined(__OpenBSD__)) || (defined(__NO_LONG_DOUBLE_MATH) && (DBL_MANT_DIG != LDBL_MANT_DIG))) \ @@ -99,13 +102,18 @@ # define BOOST_MATH_USE_C99 #endif +#if defined(_LIBCPP_VERSION) && !defined(_MSC_VER) +# define BOOST_MATH_USE_C99 +#endif + #if defined(__CYGWIN__) || defined(__HP_aCC) || defined(BOOST_INTEL) \ || defined(BOOST_NO_NATIVE_LONG_DOUBLE_FP_CLASSIFY) \ - || (defined(__GNUC__) && !defined(BOOST_MATH_USE_C99)) + || (defined(__GNUC__) && !defined(BOOST_MATH_USE_C99))\ + || defined(BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS) # define BOOST_MATH_NO_NATIVE_LONG_DOUBLE_FP_CLASSIFY #endif -#if defined(BOOST_NO_EXPLICIT_FUNCTION_TEMPLATE_ARGUMENTS) || BOOST_WORKAROUND(__SUNPRO_CC, <= 0x590) +#if BOOST_WORKAROUND(__SUNPRO_CC, <= 0x590) # include "boost/type.hpp" # include "boost/non_type.hpp" @@ -139,12 +147,12 @@ # define BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_NON_TYPE_SPEC(t, v) -#endif // defined BOOST_NO_EXPLICIT_FUNCTION_TEMPLATE_ARGUMENTS +#endif // __SUNPRO_CC #if (defined(__SUNPRO_CC) || defined(__hppa) || defined(__GNUC__)) && !defined(BOOST_MATH_SMALL_CONSTANT) // Sun's compiler emits a hard error if a constant underflows, // as does aCC on PA-RISC, while gcc issues a large number of warnings: -# define BOOST_MATH_SMALL_CONSTANT(x) 0 +# define BOOST_MATH_SMALL_CONSTANT(x) 0.0 #else # define BOOST_MATH_SMALL_CONSTANT(x) x #endif @@ -203,6 +211,37 @@ #ifndef BOOST_MATH_INT_VALUE_SUFFIX # define BOOST_MATH_INT_VALUE_SUFFIX(RV, SUF) RV##SUF #endif +// +// Test whether to support __float128: +// +#if defined(_GLIBCXX_USE_FLOAT128) && defined(BOOST_GCC) && !defined(__STRICT_ANSI__) \ + && !defined(BOOST_MATH_DISABLE_FLOAT128) || defined(BOOST_MATH_USE_FLOAT128) +// +// Only enable this when the compiler really is GCC as clang and probably +// intel too don't support __float128 yet :-( +// +#ifndef BOOST_MATH_USE_FLOAT128 +# define BOOST_MATH_USE_FLOAT128 +#endif + +# if defined(BOOST_INTEL) && defined(BOOST_INTEL_CXX_VERSION) && (BOOST_INTEL_CXX_VERSION >= 1310) && defined(__GNUC__) +# if (__GNUC__ > 4) || ((__GNUC__ == 4) && (__GNUC_MINOR__ >= 6)) +# define BOOST_MATH_FLOAT128_TYPE __float128 +# endif +# elif defined(__GNUC__) +# define BOOST_MATH_FLOAT128_TYPE __float128 +# endif + +# ifndef BOOST_MATH_FLOAT128_TYPE +# define BOOST_MATH_FLOAT128_TYPE _Quad +# endif +#endif +// +// Check for WinCE with no iostream support: +// +#if defined(_WIN32_WCE) && !defined(__SGI_STL_PORT) +# define BOOST_MATH_NO_LEXICAL_CAST +#endif // // Helper macro for controlling the FP behaviour: @@ -213,7 +252,7 @@ // // Helper macro for using statements: // -#define BOOST_MATH_STD_USING \ +#define BOOST_MATH_STD_USING_CORE \ using std::abs;\ using std::acos;\ using std::cos;\ @@ -236,15 +275,9 @@ using std::ceil;\ using std::floor;\ using std::log10;\ - using std::sqrt;\ - using boost::math::round;\ - using boost::math::iround;\ - using boost::math::lround;\ - using boost::math::trunc;\ - using boost::math::itrunc;\ - using boost::math::ltrunc;\ - using boost::math::modf; + using std::sqrt; +#define BOOST_MATH_STD_USING BOOST_MATH_STD_USING_CORE namespace boost{ namespace math{ namespace tools @@ -269,9 +302,35 @@ void suppress_unused_variable_warning(const T&) { } +namespace detail{ + +template <class T> +struct is_integer_for_rounding +{ + static const bool value = boost::is_integral<T>::value +#ifndef BOOST_NO_LIMITS_COMPILE_TIME_CONSTANTS + || (std::numeric_limits<T>::is_specialized && std::numeric_limits<T>::is_integer) +#endif + ; +}; + +} + }} // namespace boost namespace math -#if ((defined(__linux__) && !defined(__UCLIBC__)) || defined(__QNX__) || defined(__IBMCPP__)) && !defined(BOOST_NO_FENV_H) +#ifdef __GLIBC_PREREQ +# if __GLIBC_PREREQ(2,14) +# define BOOST_MATH_HAVE_FIXED_GLIBC +# endif +#endif + +#if ((defined(__linux__) && !defined(__UCLIBC__) && !defined(BOOST_MATH_HAVE_FIXED_GLIBC)) || defined(__QNX__) || defined(__IBMCPP__)) && !defined(BOOST_NO_FENV_H) +// +// This code was introduced in response to this glibc bug: http://sourceware.org/bugzilla/show_bug.cgi?id=2445 +// Basically powl and expl can return garbage when the result is small and certain exception flags are set +// on entrance to these functions. This appears to have been fixed in Glibc 2.14 (May 2011). +// Much more information in this message thread: https://groups.google.com/forum/#!topic/boost-list/ZT99wtIFlb4 +// #include <boost/detail/fenv.hpp> @@ -314,12 +373,20 @@ namespace boost{ namespace math{ #endif #ifdef BOOST_MATH_INSTRUMENT -#define BOOST_MATH_INSTRUMENT_CODE(x) \ - std::cout << std::setprecision(35) << __FILE__ << ":" << __LINE__ << " " << x << std::endl; -#define BOOST_MATH_INSTRUMENT_VARIABLE(name) BOOST_MATH_INSTRUMENT_CODE(BOOST_STRINGIZE(name) << " = " << name) + +# include <iostream> +# include <iomanip> +# include <typeinfo> + +# define BOOST_MATH_INSTRUMENT_CODE(x) \ + std::cout << std::setprecision(35) << __FILE__ << ":" << __LINE__ << " " << x << std::endl; +# define BOOST_MATH_INSTRUMENT_VARIABLE(name) BOOST_MATH_INSTRUMENT_CODE(BOOST_STRINGIZE(name) << " = " << name) + #else -#define BOOST_MATH_INSTRUMENT_CODE(x) -#define BOOST_MATH_INSTRUMENT_VARIABLE(name) + +# define BOOST_MATH_INSTRUMENT_CODE(x) +# define BOOST_MATH_INSTRUMENT_VARIABLE(name) + #endif #endif // BOOST_MATH_TOOLS_CONFIG_HPP diff --git a/boost/math/tools/detail/polynomial_horner1_10.hpp b/boost/math/tools/detail/polynomial_horner1_10.hpp index ffc3a68040..b13d6a3887 100644 --- a/boost/math/tools/detail/polynomial_horner1_10.hpp +++ b/boost/math/tools/detail/polynomial_horner1_10.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_11.hpp b/boost/math/tools/detail/polynomial_horner1_11.hpp index 8e2232c534..f0cf67e959 100644 --- a/boost/math/tools/detail/polynomial_horner1_11.hpp +++ b/boost/math/tools/detail/polynomial_horner1_11.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_12.hpp b/boost/math/tools/detail/polynomial_horner1_12.hpp index 07d2947c9f..03b974ceca 100644 --- a/boost/math/tools/detail/polynomial_horner1_12.hpp +++ b/boost/math/tools/detail/polynomial_horner1_12.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_13.hpp b/boost/math/tools/detail/polynomial_horner1_13.hpp index d826b5150b..b947f542c3 100644 --- a/boost/math/tools/detail/polynomial_horner1_13.hpp +++ b/boost/math/tools/detail/polynomial_horner1_13.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_14.hpp b/boost/math/tools/detail/polynomial_horner1_14.hpp index 02b23ada59..8374e38904 100644 --- a/boost/math/tools/detail/polynomial_horner1_14.hpp +++ b/boost/math/tools/detail/polynomial_horner1_14.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_15.hpp b/boost/math/tools/detail/polynomial_horner1_15.hpp index 72cbbd2986..ebfa463601 100644 --- a/boost/math/tools/detail/polynomial_horner1_15.hpp +++ b/boost/math/tools/detail/polynomial_horner1_15.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_16.hpp b/boost/math/tools/detail/polynomial_horner1_16.hpp index 39202e0019..60eb4dc675 100644 --- a/boost/math/tools/detail/polynomial_horner1_16.hpp +++ b/boost/math/tools/detail/polynomial_horner1_16.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_17.hpp b/boost/math/tools/detail/polynomial_horner1_17.hpp index a777ab76b3..6233f1b07b 100644 --- a/boost/math/tools/detail/polynomial_horner1_17.hpp +++ b/boost/math/tools/detail/polynomial_horner1_17.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_18.hpp b/boost/math/tools/detail/polynomial_horner1_18.hpp index 57e171c6bf..2a06def44b 100644 --- a/boost/math/tools/detail/polynomial_horner1_18.hpp +++ b/boost/math/tools/detail/polynomial_horner1_18.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_19.hpp b/boost/math/tools/detail/polynomial_horner1_19.hpp index f2e893d650..8f0da8b219 100644 --- a/boost/math/tools/detail/polynomial_horner1_19.hpp +++ b/boost/math/tools/detail/polynomial_horner1_19.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_2.hpp b/boost/math/tools/detail/polynomial_horner1_2.hpp index cf2af8ec26..a0b10d5ee5 100644 --- a/boost/math/tools/detail/polynomial_horner1_2.hpp +++ b/boost/math/tools/detail/polynomial_horner1_2.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_20.hpp b/boost/math/tools/detail/polynomial_horner1_20.hpp index 6cd2fa2ca8..d1a886dd76 100644 --- a/boost/math/tools/detail/polynomial_horner1_20.hpp +++ b/boost/math/tools/detail/polynomial_horner1_20.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_3.hpp b/boost/math/tools/detail/polynomial_horner1_3.hpp index 34283d1cf0..715a69aee0 100644 --- a/boost/math/tools/detail/polynomial_horner1_3.hpp +++ b/boost/math/tools/detail/polynomial_horner1_3.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_4.hpp b/boost/math/tools/detail/polynomial_horner1_4.hpp index 7a06708e06..d74b7a6386 100644 --- a/boost/math/tools/detail/polynomial_horner1_4.hpp +++ b/boost/math/tools/detail/polynomial_horner1_4.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_5.hpp b/boost/math/tools/detail/polynomial_horner1_5.hpp index 135e155ec7..bb66e6c41d 100644 --- a/boost/math/tools/detail/polynomial_horner1_5.hpp +++ b/boost/math/tools/detail/polynomial_horner1_5.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_6.hpp b/boost/math/tools/detail/polynomial_horner1_6.hpp index af993517cb..a29c2710e8 100644 --- a/boost/math/tools/detail/polynomial_horner1_6.hpp +++ b/boost/math/tools/detail/polynomial_horner1_6.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_7.hpp b/boost/math/tools/detail/polynomial_horner1_7.hpp index 9205f2efa0..093ab89b02 100644 --- a/boost/math/tools/detail/polynomial_horner1_7.hpp +++ b/boost/math/tools/detail/polynomial_horner1_7.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_8.hpp b/boost/math/tools/detail/polynomial_horner1_8.hpp index 70afa90088..a3d329a37b 100644 --- a/boost/math/tools/detail/polynomial_horner1_8.hpp +++ b/boost/math/tools/detail/polynomial_horner1_8.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner1_9.hpp b/boost/math/tools/detail/polynomial_horner1_9.hpp index b823f24b5f..e90f578d04 100644 --- a/boost/math/tools/detail/polynomial_horner1_9.hpp +++ b/boost/math/tools/detail/polynomial_horner1_9.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_10.hpp b/boost/math/tools/detail/polynomial_horner2_10.hpp index 0474d7e3e1..7c4101f465 100644 --- a/boost/math/tools/detail/polynomial_horner2_10.hpp +++ b/boost/math/tools/detail/polynomial_horner2_10.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_11.hpp b/boost/math/tools/detail/polynomial_horner2_11.hpp index 6fd1ea99e0..bebd1e6483 100644 --- a/boost/math/tools/detail/polynomial_horner2_11.hpp +++ b/boost/math/tools/detail/polynomial_horner2_11.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_12.hpp b/boost/math/tools/detail/polynomial_horner2_12.hpp index c6615c7ac0..c4da24ac88 100644 --- a/boost/math/tools/detail/polynomial_horner2_12.hpp +++ b/boost/math/tools/detail/polynomial_horner2_12.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_13.hpp b/boost/math/tools/detail/polynomial_horner2_13.hpp index 02f4136b72..5d7dddc5b5 100644 --- a/boost/math/tools/detail/polynomial_horner2_13.hpp +++ b/boost/math/tools/detail/polynomial_horner2_13.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_14.hpp b/boost/math/tools/detail/polynomial_horner2_14.hpp index 34d27cc9fa..21a5a37903 100644 --- a/boost/math/tools/detail/polynomial_horner2_14.hpp +++ b/boost/math/tools/detail/polynomial_horner2_14.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_15.hpp b/boost/math/tools/detail/polynomial_horner2_15.hpp index a1615243fd..7b41214466 100644 --- a/boost/math/tools/detail/polynomial_horner2_15.hpp +++ b/boost/math/tools/detail/polynomial_horner2_15.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_16.hpp b/boost/math/tools/detail/polynomial_horner2_16.hpp index 43a2679bf9..aa3763ad65 100644 --- a/boost/math/tools/detail/polynomial_horner2_16.hpp +++ b/boost/math/tools/detail/polynomial_horner2_16.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_17.hpp b/boost/math/tools/detail/polynomial_horner2_17.hpp index 83dd92129a..6ed5566d49 100644 --- a/boost/math/tools/detail/polynomial_horner2_17.hpp +++ b/boost/math/tools/detail/polynomial_horner2_17.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_18.hpp b/boost/math/tools/detail/polynomial_horner2_18.hpp index 8a13a049e4..02c72b8227 100644 --- a/boost/math/tools/detail/polynomial_horner2_18.hpp +++ b/boost/math/tools/detail/polynomial_horner2_18.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_19.hpp b/boost/math/tools/detail/polynomial_horner2_19.hpp index 38e5226343..6e36ace904 100644 --- a/boost/math/tools/detail/polynomial_horner2_19.hpp +++ b/boost/math/tools/detail/polynomial_horner2_19.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_2.hpp b/boost/math/tools/detail/polynomial_horner2_2.hpp index 5421d828c3..e2a4e7faef 100644 --- a/boost/math/tools/detail/polynomial_horner2_2.hpp +++ b/boost/math/tools/detail/polynomial_horner2_2.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_20.hpp b/boost/math/tools/detail/polynomial_horner2_20.hpp index dd422705c1..e394b6b325 100644 --- a/boost/math/tools/detail/polynomial_horner2_20.hpp +++ b/boost/math/tools/detail/polynomial_horner2_20.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_3.hpp b/boost/math/tools/detail/polynomial_horner2_3.hpp index cd568ab79d..187b86c1ce 100644 --- a/boost/math/tools/detail/polynomial_horner2_3.hpp +++ b/boost/math/tools/detail/polynomial_horner2_3.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_4.hpp b/boost/math/tools/detail/polynomial_horner2_4.hpp index a99a695c76..84badc365a 100644 --- a/boost/math/tools/detail/polynomial_horner2_4.hpp +++ b/boost/math/tools/detail/polynomial_horner2_4.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_5.hpp b/boost/math/tools/detail/polynomial_horner2_5.hpp index 950568f9d0..287b4be08e 100644 --- a/boost/math/tools/detail/polynomial_horner2_5.hpp +++ b/boost/math/tools/detail/polynomial_horner2_5.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_6.hpp b/boost/math/tools/detail/polynomial_horner2_6.hpp index b1035f5031..3662d44f93 100644 --- a/boost/math/tools/detail/polynomial_horner2_6.hpp +++ b/boost/math/tools/detail/polynomial_horner2_6.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_7.hpp b/boost/math/tools/detail/polynomial_horner2_7.hpp index 0b167564df..78ed0df54d 100644 --- a/boost/math/tools/detail/polynomial_horner2_7.hpp +++ b/boost/math/tools/detail/polynomial_horner2_7.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_8.hpp b/boost/math/tools/detail/polynomial_horner2_8.hpp index ba92c21e20..ac8e941180 100644 --- a/boost/math/tools/detail/polynomial_horner2_8.hpp +++ b/boost/math/tools/detail/polynomial_horner2_8.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner2_9.hpp b/boost/math/tools/detail/polynomial_horner2_9.hpp index cc4afb38d3..e1a3d17eca 100644 --- a/boost/math/tools/detail/polynomial_horner2_9.hpp +++ b/boost/math/tools/detail/polynomial_horner2_9.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_10.hpp b/boost/math/tools/detail/polynomial_horner3_10.hpp index 14b1b66f38..69736d7118 100644 --- a/boost/math/tools/detail/polynomial_horner3_10.hpp +++ b/boost/math/tools/detail/polynomial_horner3_10.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_11.hpp b/boost/math/tools/detail/polynomial_horner3_11.hpp index 690906938f..273ed535cc 100644 --- a/boost/math/tools/detail/polynomial_horner3_11.hpp +++ b/boost/math/tools/detail/polynomial_horner3_11.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_12.hpp b/boost/math/tools/detail/polynomial_horner3_12.hpp index d17d3c586d..340567400b 100644 --- a/boost/math/tools/detail/polynomial_horner3_12.hpp +++ b/boost/math/tools/detail/polynomial_horner3_12.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_13.hpp b/boost/math/tools/detail/polynomial_horner3_13.hpp index aff043bd17..849c93e54a 100644 --- a/boost/math/tools/detail/polynomial_horner3_13.hpp +++ b/boost/math/tools/detail/polynomial_horner3_13.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_14.hpp b/boost/math/tools/detail/polynomial_horner3_14.hpp index 5ff2a51de9..f5ac1df9d1 100644 --- a/boost/math/tools/detail/polynomial_horner3_14.hpp +++ b/boost/math/tools/detail/polynomial_horner3_14.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_15.hpp b/boost/math/tools/detail/polynomial_horner3_15.hpp index 896545617b..b57af7e3dc 100644 --- a/boost/math/tools/detail/polynomial_horner3_15.hpp +++ b/boost/math/tools/detail/polynomial_horner3_15.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_16.hpp b/boost/math/tools/detail/polynomial_horner3_16.hpp index 5bfddc59a6..1fc8560a21 100644 --- a/boost/math/tools/detail/polynomial_horner3_16.hpp +++ b/boost/math/tools/detail/polynomial_horner3_16.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_17.hpp b/boost/math/tools/detail/polynomial_horner3_17.hpp index d6679b392e..4a0d0aa472 100644 --- a/boost/math/tools/detail/polynomial_horner3_17.hpp +++ b/boost/math/tools/detail/polynomial_horner3_17.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_18.hpp b/boost/math/tools/detail/polynomial_horner3_18.hpp index df016a1739..899117d2f9 100644 --- a/boost/math/tools/detail/polynomial_horner3_18.hpp +++ b/boost/math/tools/detail/polynomial_horner3_18.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_19.hpp b/boost/math/tools/detail/polynomial_horner3_19.hpp index 10adbe556b..7c4f728419 100644 --- a/boost/math/tools/detail/polynomial_horner3_19.hpp +++ b/boost/math/tools/detail/polynomial_horner3_19.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_2.hpp b/boost/math/tools/detail/polynomial_horner3_2.hpp index b32501f0ad..372630cfd9 100644 --- a/boost/math/tools/detail/polynomial_horner3_2.hpp +++ b/boost/math/tools/detail/polynomial_horner3_2.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_20.hpp b/boost/math/tools/detail/polynomial_horner3_20.hpp index 68bd0beadf..b20e0d5fe1 100644 --- a/boost/math/tools/detail/polynomial_horner3_20.hpp +++ b/boost/math/tools/detail/polynomial_horner3_20.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_3.hpp b/boost/math/tools/detail/polynomial_horner3_3.hpp index 8296740a54..cc6b1a9351 100644 --- a/boost/math/tools/detail/polynomial_horner3_3.hpp +++ b/boost/math/tools/detail/polynomial_horner3_3.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_4.hpp b/boost/math/tools/detail/polynomial_horner3_4.hpp index e6ba3179b1..74192f0c90 100644 --- a/boost/math/tools/detail/polynomial_horner3_4.hpp +++ b/boost/math/tools/detail/polynomial_horner3_4.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_5.hpp b/boost/math/tools/detail/polynomial_horner3_5.hpp index d4e94b90d5..73d1900998 100644 --- a/boost/math/tools/detail/polynomial_horner3_5.hpp +++ b/boost/math/tools/detail/polynomial_horner3_5.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_6.hpp b/boost/math/tools/detail/polynomial_horner3_6.hpp index 143defc63d..da02574866 100644 --- a/boost/math/tools/detail/polynomial_horner3_6.hpp +++ b/boost/math/tools/detail/polynomial_horner3_6.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_7.hpp b/boost/math/tools/detail/polynomial_horner3_7.hpp index 016895076c..d45a622278 100644 --- a/boost/math/tools/detail/polynomial_horner3_7.hpp +++ b/boost/math/tools/detail/polynomial_horner3_7.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_8.hpp b/boost/math/tools/detail/polynomial_horner3_8.hpp index 9a373446e1..d0198bf345 100644 --- a/boost/math/tools/detail/polynomial_horner3_8.hpp +++ b/boost/math/tools/detail/polynomial_horner3_8.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/polynomial_horner3_9.hpp b/boost/math/tools/detail/polynomial_horner3_9.hpp index d0f9dd310c..b3e0b19970 100644 --- a/boost/math/tools/detail/polynomial_horner3_9.hpp +++ b/boost/math/tools/detail/polynomial_horner3_9.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class V> -inline V evaluate_polynomial_c_imp(const T* a, const V&, const mpl::int_<0>*) +inline V evaluate_polynomial_c_imp(const T*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_10.hpp b/boost/math/tools/detail/rational_horner2_10.hpp index db752742dc..e26d2d934f 100644 --- a/boost/math/tools/detail/rational_horner2_10.hpp +++ b/boost/math/tools/detail/rational_horner2_10.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_11.hpp b/boost/math/tools/detail/rational_horner2_11.hpp index 2b728e8b4f..c05e697197 100644 --- a/boost/math/tools/detail/rational_horner2_11.hpp +++ b/boost/math/tools/detail/rational_horner2_11.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_12.hpp b/boost/math/tools/detail/rational_horner2_12.hpp index daa14e4d2b..4ee3734001 100644 --- a/boost/math/tools/detail/rational_horner2_12.hpp +++ b/boost/math/tools/detail/rational_horner2_12.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_13.hpp b/boost/math/tools/detail/rational_horner2_13.hpp index e5dfc62288..37977a111d 100644 --- a/boost/math/tools/detail/rational_horner2_13.hpp +++ b/boost/math/tools/detail/rational_horner2_13.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_14.hpp b/boost/math/tools/detail/rational_horner2_14.hpp index 37ddfa5e65..78edfbbe1b 100644 --- a/boost/math/tools/detail/rational_horner2_14.hpp +++ b/boost/math/tools/detail/rational_horner2_14.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_15.hpp b/boost/math/tools/detail/rational_horner2_15.hpp index 9168b2efcd..3cf4ef56a0 100644 --- a/boost/math/tools/detail/rational_horner2_15.hpp +++ b/boost/math/tools/detail/rational_horner2_15.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_16.hpp b/boost/math/tools/detail/rational_horner2_16.hpp index 7dafa460a5..3936a1ba4b 100644 --- a/boost/math/tools/detail/rational_horner2_16.hpp +++ b/boost/math/tools/detail/rational_horner2_16.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_17.hpp b/boost/math/tools/detail/rational_horner2_17.hpp index 06330599d3..4d253b9593 100644 --- a/boost/math/tools/detail/rational_horner2_17.hpp +++ b/boost/math/tools/detail/rational_horner2_17.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_18.hpp b/boost/math/tools/detail/rational_horner2_18.hpp index 78584e037f..6c213ecfb0 100644 --- a/boost/math/tools/detail/rational_horner2_18.hpp +++ b/boost/math/tools/detail/rational_horner2_18.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_19.hpp b/boost/math/tools/detail/rational_horner2_19.hpp index 592e9edbcf..88e0b9ff01 100644 --- a/boost/math/tools/detail/rational_horner2_19.hpp +++ b/boost/math/tools/detail/rational_horner2_19.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_2.hpp b/boost/math/tools/detail/rational_horner2_2.hpp index c5400a0d1c..35b5abb354 100644 --- a/boost/math/tools/detail/rational_horner2_2.hpp +++ b/boost/math/tools/detail/rational_horner2_2.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_20.hpp b/boost/math/tools/detail/rational_horner2_20.hpp index 7f8f5d6a0a..dc73fdd58e 100644 --- a/boost/math/tools/detail/rational_horner2_20.hpp +++ b/boost/math/tools/detail/rational_horner2_20.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_3.hpp b/boost/math/tools/detail/rational_horner2_3.hpp index 645c3c3642..8838ac13e6 100644 --- a/boost/math/tools/detail/rational_horner2_3.hpp +++ b/boost/math/tools/detail/rational_horner2_3.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_4.hpp b/boost/math/tools/detail/rational_horner2_4.hpp index 781b4c1094..5fe5ada83b 100644 --- a/boost/math/tools/detail/rational_horner2_4.hpp +++ b/boost/math/tools/detail/rational_horner2_4.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_5.hpp b/boost/math/tools/detail/rational_horner2_5.hpp index a11d0d643f..48b8498bc7 100644 --- a/boost/math/tools/detail/rational_horner2_5.hpp +++ b/boost/math/tools/detail/rational_horner2_5.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_6.hpp b/boost/math/tools/detail/rational_horner2_6.hpp index 596bc115c6..83631eaf51 100644 --- a/boost/math/tools/detail/rational_horner2_6.hpp +++ b/boost/math/tools/detail/rational_horner2_6.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_7.hpp b/boost/math/tools/detail/rational_horner2_7.hpp index 28998d2c9c..3ed86eafcd 100644 --- a/boost/math/tools/detail/rational_horner2_7.hpp +++ b/boost/math/tools/detail/rational_horner2_7.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_8.hpp b/boost/math/tools/detail/rational_horner2_8.hpp index 1405c432f4..f8b36ece4a 100644 --- a/boost/math/tools/detail/rational_horner2_8.hpp +++ b/boost/math/tools/detail/rational_horner2_8.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner2_9.hpp b/boost/math/tools/detail/rational_horner2_9.hpp index 5a537ef4e8..88cc4e5fcf 100644 --- a/boost/math/tools/detail/rational_horner2_9.hpp +++ b/boost/math/tools/detail/rational_horner2_9.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_10.hpp b/boost/math/tools/detail/rational_horner3_10.hpp index 205077c2d7..019ffdacc3 100644 --- a/boost/math/tools/detail/rational_horner3_10.hpp +++ b/boost/math/tools/detail/rational_horner3_10.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_11.hpp b/boost/math/tools/detail/rational_horner3_11.hpp index 05ed555c23..13ce3134ae 100644 --- a/boost/math/tools/detail/rational_horner3_11.hpp +++ b/boost/math/tools/detail/rational_horner3_11.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_12.hpp b/boost/math/tools/detail/rational_horner3_12.hpp index 88d6d9402a..634140bd0d 100644 --- a/boost/math/tools/detail/rational_horner3_12.hpp +++ b/boost/math/tools/detail/rational_horner3_12.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_13.hpp b/boost/math/tools/detail/rational_horner3_13.hpp index 8f1661a883..0b4974a501 100644 --- a/boost/math/tools/detail/rational_horner3_13.hpp +++ b/boost/math/tools/detail/rational_horner3_13.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_14.hpp b/boost/math/tools/detail/rational_horner3_14.hpp index 2996173390..63f4e95963 100644 --- a/boost/math/tools/detail/rational_horner3_14.hpp +++ b/boost/math/tools/detail/rational_horner3_14.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_15.hpp b/boost/math/tools/detail/rational_horner3_15.hpp index 67b71b42c4..c13500f130 100644 --- a/boost/math/tools/detail/rational_horner3_15.hpp +++ b/boost/math/tools/detail/rational_horner3_15.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_16.hpp b/boost/math/tools/detail/rational_horner3_16.hpp index 75cb17a60b..b1c89774f8 100644 --- a/boost/math/tools/detail/rational_horner3_16.hpp +++ b/boost/math/tools/detail/rational_horner3_16.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_17.hpp b/boost/math/tools/detail/rational_horner3_17.hpp index 275236412d..9c3498ec24 100644 --- a/boost/math/tools/detail/rational_horner3_17.hpp +++ b/boost/math/tools/detail/rational_horner3_17.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_18.hpp b/boost/math/tools/detail/rational_horner3_18.hpp index 19e0a5337b..5401e9f3a2 100644 --- a/boost/math/tools/detail/rational_horner3_18.hpp +++ b/boost/math/tools/detail/rational_horner3_18.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_19.hpp b/boost/math/tools/detail/rational_horner3_19.hpp index ff7156c804..c111b68f1e 100644 --- a/boost/math/tools/detail/rational_horner3_19.hpp +++ b/boost/math/tools/detail/rational_horner3_19.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_2.hpp b/boost/math/tools/detail/rational_horner3_2.hpp index c5400a0d1c..35b5abb354 100644 --- a/boost/math/tools/detail/rational_horner3_2.hpp +++ b/boost/math/tools/detail/rational_horner3_2.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_20.hpp b/boost/math/tools/detail/rational_horner3_20.hpp index a5948d2ff8..7bee9b110a 100644 --- a/boost/math/tools/detail/rational_horner3_20.hpp +++ b/boost/math/tools/detail/rational_horner3_20.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_3.hpp b/boost/math/tools/detail/rational_horner3_3.hpp index 645c3c3642..8838ac13e6 100644 --- a/boost/math/tools/detail/rational_horner3_3.hpp +++ b/boost/math/tools/detail/rational_horner3_3.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_4.hpp b/boost/math/tools/detail/rational_horner3_4.hpp index 781b4c1094..5fe5ada83b 100644 --- a/boost/math/tools/detail/rational_horner3_4.hpp +++ b/boost/math/tools/detail/rational_horner3_4.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_5.hpp b/boost/math/tools/detail/rational_horner3_5.hpp index 333b7fd2e8..23a606855b 100644 --- a/boost/math/tools/detail/rational_horner3_5.hpp +++ b/boost/math/tools/detail/rational_horner3_5.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_6.hpp b/boost/math/tools/detail/rational_horner3_6.hpp index 33e075b6af..186167d614 100644 --- a/boost/math/tools/detail/rational_horner3_6.hpp +++ b/boost/math/tools/detail/rational_horner3_6.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_7.hpp b/boost/math/tools/detail/rational_horner3_7.hpp index 6f886d16df..e08dce62d7 100644 --- a/boost/math/tools/detail/rational_horner3_7.hpp +++ b/boost/math/tools/detail/rational_horner3_7.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_8.hpp b/boost/math/tools/detail/rational_horner3_8.hpp index 062f9d3cba..3ceb717439 100644 --- a/boost/math/tools/detail/rational_horner3_8.hpp +++ b/boost/math/tools/detail/rational_horner3_8.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/detail/rational_horner3_9.hpp b/boost/math/tools/detail/rational_horner3_9.hpp index 5c47864eb0..94dab4c0db 100644 --- a/boost/math/tools/detail/rational_horner3_9.hpp +++ b/boost/math/tools/detail/rational_horner3_9.hpp @@ -12,7 +12,7 @@ namespace boost{ namespace math{ namespace tools{ namespace detail{ template <class T, class U, class V> -inline V evaluate_rational_c_imp(const T* a, const U* b, const V&, const mpl::int_<0>*) +inline V evaluate_rational_c_imp(const T*, const U*, const V&, const mpl::int_<0>*) { return static_cast<V>(0); } diff --git a/boost/math/tools/fraction.hpp b/boost/math/tools/fraction.hpp index a9938094a7..b245ddd2a3 100644 --- a/boost/math/tools/fraction.hpp +++ b/boost/math/tools/fraction.hpp @@ -33,7 +33,7 @@ namespace detail typedef typename Gen::result_type result_type; typedef typename Gen::result_type value_type; - static result_type a(const value_type& v) + static result_type a(const value_type&) { return 1; } diff --git a/boost/math/tools/precision.hpp b/boost/math/tools/precision.hpp index 8cdcd4eb87..49e653d6a3 100644 --- a/boost/math/tools/precision.hpp +++ b/boost/math/tools/precision.hpp @@ -18,8 +18,6 @@ #include <boost/mpl/if.hpp> #include <boost/math/policies/policy.hpp> -#include <iostream> -#include <iomanip> // These two are for LDBL_MAN_DIG: #include <limits.h> #include <math.h> @@ -159,11 +157,19 @@ inline T epsilon(const mpl::true_& BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE(T)) return std::numeric_limits<T>::epsilon(); } -#if (defined(macintosh) || defined(__APPLE__) || defined(__APPLE_CC__)) && ((LDBL_MANT_DIG == 106) || (__LDBL_MANT_DIG__ == 106)) +#if defined(__GNUC__) && ((LDBL_MANT_DIG == 106) || (__LDBL_MANT_DIG__ == 106)) template <> inline long double epsilon<long double>(const mpl::true_& BOOST_MATH_APPEND_EXPLICIT_TEMPLATE_TYPE(long double)) { - // numeric_limits on Darwin tells lies here. + // numeric_limits on Darwin (and elsewhere) tells lies here: + // the issue is that long double on a few platforms is + // really a "double double" which has a non-contiguous + // mantissa: 53 bits followed by an unspecified number of + // zero bits, followed by 53 more bits. Thus the apparent + // precision of the type varies depending where it's been. + // Set epsilon to the value that a 106 bit fixed mantissa + // type would have, as that will give us sensible behaviour everywhere. + // // This static assert fails for some unknown reason, so // disabled for now... // BOOST_STATIC_ASSERT(std::numeric_limits<long double>::digits == 106); @@ -282,6 +288,38 @@ inline T root_epsilon_imp(const T*, const Tag&) } template <class T> +inline T cbrt_epsilon_imp(const mpl::int_<24>&) +{ + return static_cast<T>(0.0049215666011518482998719164346805794944150447839903L); +} + +template <class T> +inline T cbrt_epsilon_imp(const T*, const mpl::int_<53>&) +{ + return static_cast<T>(6.05545445239333906078989272793696693569753008995e-6L); +} + +template <class T> +inline T cbrt_epsilon_imp(const T*, const mpl::int_<64>&) +{ + return static_cast<T>(4.76837158203125e-7L); +} + +template <class T> +inline T cbrt_epsilon_imp(const T*, const mpl::int_<113>&) +{ + return static_cast<T>(5.7749313854154005630396773604745549542403508090496e-12L); +} + +template <class T, class Tag> +inline T cbrt_epsilon_imp(const T*, const Tag&) +{ + BOOST_MATH_STD_USING; + static const T cbrt_eps = pow(tools::epsilon<T>(), T(1) / 3); + return cbrt_eps; +} + +template <class T> inline T forth_root_epsilon_imp(const T*, const mpl::int_<24>&) { return static_cast<T>(0.018581361171917516667460937040007436176452688944747L); @@ -323,6 +361,13 @@ inline T root_epsilon() } template <class T> +inline T cbrt_epsilon() +{ + typedef mpl::int_< (::std::numeric_limits<T>::radix == 2) ? std::numeric_limits<T>::digits : 0> tag_type; + return detail::cbrt_epsilon_imp(static_cast<T const*>(0), tag_type()); +} + +template <class T> inline T forth_root_epsilon() { typedef mpl::int_< (::std::numeric_limits<T>::radix == 2) ? std::numeric_limits<T>::digits : 0> tag_type; diff --git a/boost/math/tools/promotion.hpp b/boost/math/tools/promotion.hpp index 728aaf1209..b3ad204077 100644 --- a/boost/math/tools/promotion.hpp +++ b/boost/math/tools/promotion.hpp @@ -138,10 +138,35 @@ namespace boost // // Guard against use of long double if it's not supported: // - BOOST_STATIC_ASSERT((0 == ::boost::is_same<type, long double>::value)); + BOOST_STATIC_ASSERT_MSG((0 == ::boost::is_same<type, long double>::value), "Sorry, but this platform does not have sufficient long double support for the special functions to be reliably implemented."); #endif }; + // + // This struct is the same as above, but has no static assert on long double usage, + // it should be used only on functions that can be implemented for long double + // even when std lib support is missing or broken for that type. + // + template <class T1, class T2=float, class T3=float, class T4=float, class T5=float, class T6=float> + struct promote_args_permissive + { + typedef typename promote_args_2< + typename remove_cv<T1>::type, + typename promote_args_2< + typename remove_cv<T2>::type, + typename promote_args_2< + typename remove_cv<T3>::type, + typename promote_args_2< + typename remove_cv<T4>::type, + typename promote_args_2< + typename remove_cv<T5>::type, typename remove_cv<T6>::type + >::type + >::type + >::type + >::type + >::type type; + }; + } // namespace tools } // namespace math } // namespace boost diff --git a/boost/math/tools/remez.hpp b/boost/math/tools/remez.hpp deleted file mode 100644 index afcbe25afa..0000000000 --- a/boost/math/tools/remez.hpp +++ /dev/null @@ -1,667 +0,0 @@ -// (C) Copyright John Maddock 2006. -// Use, modification and distribution are subject to the -// Boost Software License, Version 1.0. (See accompanying file -// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) - -#ifndef BOOST_MATH_TOOLS_REMEZ_HPP -#define BOOST_MATH_TOOLS_REMEZ_HPP - -#ifdef _MSC_VER -#pragma once -#endif - -#include <boost/math/tools/solve.hpp> -#include <boost/math/tools/minima.hpp> -#include <boost/math/tools/roots.hpp> -#include <boost/math/tools/polynomial.hpp> -#include <boost/function/function1.hpp> -#include <boost/scoped_array.hpp> -#include <boost/math/constants/constants.hpp> -#include <boost/math/policies/policy.hpp> - -namespace boost{ namespace math{ namespace tools{ - -namespace detail{ - -// -// The error function: the difference between F(x) and -// the current approximation. This is the function -// for which we must find the extema. -// -template <class T> -struct remez_error_function -{ - typedef boost::function1<T, T const &> function_type; -public: - remez_error_function( - function_type f_, - const polynomial<T>& n, - const polynomial<T>& d, - bool rel_err) - : f(f_), numerator(n), denominator(d), rel_error(rel_err) {} - - T operator()(const T& z)const - { - T y = f(z); - T abs = y - (numerator.evaluate(z) / denominator.evaluate(z)); - T err; - if(rel_error) - { - if(y != 0) - err = abs / fabs(y); - else if(0 == abs) - { - // we must be at a root, or it's not recoverable: - BOOST_ASSERT(0 == abs); - err = 0; - } - else - { - // We have a divide by zero! - // Lets assume that f(x) is zero as a result of - // internal cancellation error that occurs as a result - // of shifting a root at point z to the origin so that - // the approximation can be "pinned" to pass through - // the origin: in that case it really - // won't matter what our approximation calculates here - // as long as it's a small number, return the absolute error: - err = abs; - } - } - else - err = abs; - return err; - } -private: - function_type f; - polynomial<T> numerator; - polynomial<T> denominator; - bool rel_error; -}; -// -// This function adapts the error function so that it's minima -// are the extema of the error function. We can find the minima -// with standard techniques. -// -template <class T> -struct remez_max_error_function -{ - remez_max_error_function(const remez_error_function<T>& f) - : func(f) {} - - T operator()(const T& x) - { - BOOST_MATH_STD_USING - return -fabs(func(x)); - } -private: - remez_error_function<T> func; -}; - -} // detail - -template <class T> -class remez_minimax -{ -public: - typedef boost::function1<T, T const &> function_type; - typedef boost::numeric::ublas::vector<T> vector_type; - typedef boost::numeric::ublas::matrix<T> matrix_type; - - remez_minimax(function_type f, unsigned oN, unsigned oD, T a, T b, bool pin = true, bool rel_err = false, int sk = 0, int bits = 0); - remez_minimax(function_type f, unsigned oN, unsigned oD, T a, T b, bool pin, bool rel_err, int sk, int bits, const vector_type& points); - - void reset(unsigned oN, unsigned oD, T a, T b, bool pin = true, bool rel_err = false, int sk = 0, int bits = 0); - void reset(unsigned oN, unsigned oD, T a, T b, bool pin, bool rel_err, int sk, int bits, const vector_type& points); - - void set_brake(int b) - { - BOOST_ASSERT(b < 100); - BOOST_ASSERT(b >= 0); - m_brake = b; - } - - T iterate(); - - polynomial<T> denominator()const; - polynomial<T> numerator()const; - - vector_type const& chebyshev_points()const - { - return control_points; - } - - vector_type const& zero_points()const - { - return zeros; - } - - T error_term()const - { - return solution[solution.size() - 1]; - } - T max_error()const - { - return m_max_error; - } - T max_change()const - { - return m_max_change; - } - void rotate() - { - --orderN; - ++orderD; - } - void rescale(T a, T b) - { - T scale = (b - a) / (max - min); - for(unsigned i = 0; i < control_points.size(); ++i) - { - control_points[i] = (control_points[i] - min) * scale + a; - } - min = a; - max = b; - } -private: - - void init_chebyshev(); - - function_type func; // The function to approximate. - vector_type control_points; // Current control points to be used for the next iteration. - vector_type solution; // Solution from the last iteration contains all unknowns including the error term. - vector_type zeros; // Location of points of zero error from last iteration, plus the two end points. - vector_type maxima; // Location of maxima of the error function, actually contains the control points used for the last iteration. - T m_max_error; // Maximum error found in last approximation. - T m_max_change; // Maximum change in location of control points after last iteration. - unsigned orderN; // Order of the numerator polynomial. - unsigned orderD; // Order of the denominator polynomial. - T min, max; // End points of the range to optimise over. - bool rel_error; // If true optimise for relative not absolute error. - bool pinned; // If true the approximation is "pinned" to go through the origin. - unsigned unknowns; // Total number of unknowns. - int m_precision; // Number of bits precision to which the zeros and maxima are found. - T m_max_change_history[2]; // Past history of changes to control points. - int m_brake; // amount to break by in percentage points. - int m_skew; // amount to skew starting points by in percentage points: -100-100 -}; - -#ifndef BRAKE -#define BRAKE 0 -#endif -#ifndef SKEW -#define SKEW 0 -#endif - -template <class T> -void remez_minimax<T>::init_chebyshev() -{ - BOOST_MATH_STD_USING - // - // Fill in the zeros: - // - unsigned terms = pinned ? orderD + orderN : orderD + orderN + 1; - - for(unsigned i = 0; i < terms; ++i) - { - T cheb = cos((2 * terms - 1 - 2 * i) * constants::pi<T>() / (2 * terms)); - cheb += 1; - cheb /= 2; - if(m_skew != 0) - { - T p = static_cast<T>(200 + m_skew) / 200; - cheb = pow(cheb, p); - } - cheb *= (max - min); - cheb += min; - zeros[i+1] = cheb; - } - zeros[0] = min; - zeros[unknowns] = max; - // perform a regular interpolation fit: - matrix_type A(terms, terms); - vector_type b(terms); - // fill in the y values: - for(unsigned i = 0; i < b.size(); ++i) - { - b[i] = func(zeros[i+1]); - } - // fill in powers of x evaluated at each of the control points: - unsigned offsetN = pinned ? 0 : 1; - unsigned offsetD = offsetN + orderN; - unsigned maxorder = (std::max)(orderN, orderD); - for(unsigned i = 0; i < b.size(); ++i) - { - T x0 = zeros[i+1]; - T x = x0; - if(!pinned) - A(i, 0) = 1; - for(unsigned j = 0; j < maxorder; ++j) - { - if(j < orderN) - A(i, j + offsetN) = x; - if(j < orderD) - { - A(i, j + offsetD) = -x * b[i]; - } - x *= x0; - } - } - // - // Now go ahead and solve the expression to get our solution: - // - vector_type l_solution = boost::math::tools::solve(A, b); - // need to add a "fake" error term: - l_solution.resize(unknowns); - l_solution[unknowns-1] = 0; - solution = l_solution; - // - // Now find all the extrema of the error function: - // - detail::remez_error_function<T> Err(func, this->numerator(), this->denominator(), rel_error); - detail::remez_max_error_function<T> Ex(Err); - m_max_error = 0; - int max_err_location = 0; - for(unsigned i = 0; i < unknowns; ++i) - { - std::pair<T, T> r = brent_find_minima(Ex, zeros[i], zeros[i+1], m_precision); - maxima[i] = r.first; - T rel_err = fabs(r.second); - if(rel_err > m_max_error) - { - m_max_error = fabs(r.second); - max_err_location = i; - } - } - control_points = maxima; -} - -template <class T> -void remez_minimax<T>::reset( - unsigned oN, - unsigned oD, - T a, - T b, - bool pin, - bool rel_err, - int sk, - int bits) -{ - control_points = vector_type(oN + oD + (pin ? 1 : 2)); - solution = control_points; - zeros = vector_type(oN + oD + (pin ? 2 : 3)); - maxima = control_points; - orderN = oN; - orderD = oD; - rel_error = rel_err; - pinned = pin; - m_skew = sk; - min = a; - max = b; - m_max_error = 0; - unknowns = orderN + orderD + (pinned ? 1 : 2); - // guess our initial control points: - control_points[0] = min; - control_points[unknowns - 1] = max; - T interval = (max - min) / (unknowns - 1); - T spot = min + interval; - for(unsigned i = 1; i < control_points.size(); ++i) - { - control_points[i] = spot; - spot += interval; - } - solution[unknowns - 1] = 0; - m_max_error = 0; - if(bits == 0) - { - // don't bother about more than float precision: - m_precision = (std::min)(24, (boost::math::policies::digits<T, boost::math::policies::policy<> >() / 2) - 2); - } - else - { - // can't be more accurate than half the bits of T: - m_precision = (std::min)(bits, (boost::math::policies::digits<T, boost::math::policies::policy<> >() / 2) - 2); - } - m_max_change_history[0] = m_max_change_history[1] = 1; - init_chebyshev(); - // do one iteration whatever: - //iterate(); -} - -template <class T> -inline remez_minimax<T>::remez_minimax( - typename remez_minimax<T>::function_type f, - unsigned oN, - unsigned oD, - T a, - T b, - bool pin, - bool rel_err, - int sk, - int bits) - : func(f) -{ - m_brake = 0; - reset(oN, oD, a, b, pin, rel_err, sk, bits); -} - -template <class T> -void remez_minimax<T>::reset( - unsigned oN, - unsigned oD, - T a, - T b, - bool pin, - bool rel_err, - int sk, - int bits, - const vector_type& points) -{ - control_points = vector_type(oN + oD + (pin ? 1 : 2)); - solution = control_points; - zeros = vector_type(oN + oD + (pin ? 2 : 3)); - maxima = control_points; - orderN = oN; - orderD = oD; - rel_error = rel_err; - pinned = pin; - m_skew = sk; - min = a; - max = b; - m_max_error = 0; - unknowns = orderN + orderD + (pinned ? 1 : 2); - control_points = points; - solution[unknowns - 1] = 0; - m_max_error = 0; - if(bits == 0) - { - // don't bother about more than float precision: - m_precision = (std::min)(24, (boost::math::policies::digits<T, boost::math::policies::policy<> >() / 2) - 2); - } - else - { - // can't be more accurate than half the bits of T: - m_precision = (std::min)(bits, (boost::math::policies::digits<T, boost::math::policies::policy<> >() / 2) - 2); - } - m_max_change_history[0] = m_max_change_history[1] = 1; - // do one iteration whatever: - //iterate(); -} - -template <class T> -inline remez_minimax<T>::remez_minimax( - typename remez_minimax<T>::function_type f, - unsigned oN, - unsigned oD, - T a, - T b, - bool pin, - bool rel_err, - int sk, - int bits, - const vector_type& points) - : func(f) -{ - m_brake = 0; - reset(oN, oD, a, b, pin, rel_err, sk, bits, points); -} - -template <class T> -T remez_minimax<T>::iterate() -{ - BOOST_MATH_STD_USING - matrix_type A(unknowns, unknowns); - vector_type b(unknowns); - - // fill in evaluation of f(x) at each of the control points: - for(unsigned i = 0; i < b.size(); ++i) - { - // take care that none of our control points are at the origin: - if(pinned && (control_points[i] == 0)) - { - if(i) - control_points[i] = control_points[i-1] / 3; - else - control_points[i] = control_points[i+1] / 3; - } - b[i] = func(control_points[i]); - } - - T err_err; - unsigned convergence_count = 0; - do{ - // fill in powers of x evaluated at each of the control points: - int sign = 1; - unsigned offsetN = pinned ? 0 : 1; - unsigned offsetD = offsetN + orderN; - unsigned maxorder = (std::max)(orderN, orderD); - T Elast = solution[unknowns - 1]; - - for(unsigned i = 0; i < b.size(); ++i) - { - T x0 = control_points[i]; - T x = x0; - if(!pinned) - A(i, 0) = 1; - for(unsigned j = 0; j < maxorder; ++j) - { - if(j < orderN) - A(i, j + offsetN) = x; - if(j < orderD) - { - T mult = rel_error ? (b[i] - sign * fabs(b[i]) * Elast): (b[i] - sign * Elast); - A(i, j + offsetD) = -x * mult; - } - x *= x0; - } - // The last variable to be solved for is the error term, - // sign changes with each control point: - T E = rel_error ? sign * fabs(b[i]) : sign; - A(i, unknowns - 1) = E; - sign = -sign; - } - - #ifdef BOOST_MATH_INSTRUMENT - for(unsigned i = 0; i < b.size(); ++i) - std::cout << b[i] << " "; - std::cout << "\n\n"; - for(unsigned i = 0; i < b.size(); ++i) - { - for(unsigned j = 0; j < b.size(); ++ j) - std::cout << A(i, j) << " "; - std::cout << "\n"; - } - std::cout << std::endl; - #endif - // - // Now go ahead and solve the expression to get our solution: - // - solution = boost::math::tools::solve(A, b); - - err_err = (Elast != 0) ? fabs((fabs(solution[unknowns-1]) - fabs(Elast)) / fabs(Elast)) : 1; - }while(orderD && (convergence_count++ < 80) && (err_err > 0.001)); - - // - // Perform a sanity check to verify that the solution to the equations - // is not so much in error as to be useless. The matrix inversion can - // be very close to singular, so this can be a real problem. - // - vector_type sanity = prod(A, solution); - for(unsigned i = 0; i < b.size(); ++i) - { - T err = fabs((b[i] - sanity[i]) / fabs(b[i])); - if(err > sqrt(epsilon<T>())) - { - std::cerr << "Sanity check failed: more than half the digits in the found solution are in error." << std::endl; - } - } - - // - // Next comes another sanity check, we want to verify that all the control - // points do actually alternate in sign, in practice we may have - // additional roots in the error function that cause this to fail. - // Failure here is always fatal: even though this code attempts to correct - // the problem it usually only postpones the inevitable. - // - polynomial<T> num, denom; - num = this->numerator(); - denom = this->denominator(); - T e1 = b[0] - num.evaluate(control_points[0]) / denom.evaluate(control_points[0]); -#ifdef BOOST_MATH_INSTRUMENT - std::cout << e1; -#endif - for(unsigned i = 1; i < b.size(); ++i) - { - T e2 = b[i] - num.evaluate(control_points[i]) / denom.evaluate(control_points[i]); -#ifdef BOOST_MATH_INSTRUMENT - std::cout << " " << e2; -#endif - if(e2 * e1 > 0) - { - std::cerr << std::flush << "Basic sanity check failed: Error term does not alternate in sign, non-recoverable error may follow..." << std::endl; - T perturbation = 0.05; - do{ - T point = control_points[i] * (1 - perturbation) + control_points[i-1] * perturbation; - e2 = func(point) - num.evaluate(point) / denom.evaluate(point); - if(e2 * e1 < 0) - { - control_points[i] = point; - break; - } - perturbation += 0.05; - }while(perturbation < 0.8); - - if((e2 * e1 > 0) && (i + 1 < b.size())) - { - perturbation = 0.05; - do{ - T point = control_points[i] * (1 - perturbation) + control_points[i+1] * perturbation; - e2 = func(point) - num.evaluate(point) / denom.evaluate(point); - if(e2 * e1 < 0) - { - control_points[i] = point; - break; - } - perturbation += 0.05; - }while(perturbation < 0.8); - } - - } - e1 = e2; - } - -#ifdef BOOST_MATH_INSTRUMENT - for(unsigned i = 0; i < solution.size(); ++i) - std::cout << solution[i] << " "; - std::cout << std::endl << this->numerator() << std::endl; - std::cout << this->denominator() << std::endl; - std::cout << std::endl; -#endif - - // - // The next step is to find all the intervals in which our maxima - // lie: - // - detail::remez_error_function<T> Err(func, this->numerator(), this->denominator(), rel_error); - zeros[0] = min; - zeros[unknowns] = max; - for(unsigned i = 1; i < control_points.size(); ++i) - { - eps_tolerance<T> tol(m_precision); - boost::uintmax_t max_iter = 1000; - std::pair<T, T> p = toms748_solve( - Err, - control_points[i-1], - control_points[i], - tol, - max_iter); - zeros[i] = (p.first + p.second) / 2; - //zeros[i] = bisect(Err, control_points[i-1], control_points[i], m_precision); - } - // - // Now find all the extrema of the error function: - // - detail::remez_max_error_function<T> Ex(Err); - m_max_error = 0; - int max_err_location = 0; - for(unsigned i = 0; i < unknowns; ++i) - { - std::pair<T, T> r = brent_find_minima(Ex, zeros[i], zeros[i+1], m_precision); - maxima[i] = r.first; - T rel_err = fabs(r.second); - if(rel_err > m_max_error) - { - m_max_error = fabs(r.second); - max_err_location = i; - } - } - // - // Almost done now! we just need to set our control points - // to the extrema, and calculate how much each point has changed - // (this will be our termination condition): - // - swap(control_points, maxima); - m_max_change = 0; - int max_change_location = 0; - for(unsigned i = 0; i < unknowns; ++i) - { - control_points[i] = (control_points[i] * (100 - m_brake) + maxima[i] * m_brake) / 100; - T change = fabs((control_points[i] - maxima[i]) / control_points[i]); -#if 0 - if(change > m_max_change_history[1]) - { - // divergence!!! try capping the change: - std::cerr << "Possible divergent step, change will be capped!!" << std::endl; - change = m_max_change_history[1]; - if(control_points[i] < maxima[i]) - control_points[i] = maxima[i] - change * maxima[i]; - else - control_points[i] = maxima[i] + change * maxima[i]; - } -#endif - if(change > m_max_change) - { - m_max_change = change; - max_change_location = i; - } - } - // - // store max change information: - // - m_max_change_history[0] = m_max_change_history[1]; - m_max_change_history[1] = fabs(m_max_change); - - return m_max_change; -} - -template <class T> -polynomial<T> remez_minimax<T>::numerator()const -{ - boost::scoped_array<T> a(new T[orderN + 1]); - if(pinned) - a[0] = 0; - unsigned terms = pinned ? orderN : orderN + 1; - for(unsigned i = 0; i < terms; ++i) - a[pinned ? i+1 : i] = solution[i]; - return boost::math::tools::polynomial<T>(&a[0], orderN); -} - -template <class T> -polynomial<T> remez_minimax<T>::denominator()const -{ - unsigned terms = orderD + 1; - unsigned offsetD = pinned ? orderN : (orderN + 1); - boost::scoped_array<T> a(new T[terms]); - a[0] = 1; - for(unsigned i = 0; i < orderD; ++i) - a[i+1] = solution[i + offsetD]; - return boost::math::tools::polynomial<T>(&a[0], orderD); -} - - -}}} // namespaces - -#endif // BOOST_MATH_TOOLS_REMEZ_HPP - - - diff --git a/boost/math/tools/roots.hpp b/boost/math/tools/roots.hpp index 356197dcf2..2442f5c2d1 100644 --- a/boost/math/tools/roots.hpp +++ b/boost/math/tools/roots.hpp @@ -109,13 +109,13 @@ std::pair<T, T> bisect(F f, T min, T max, Tol tol, boost::uintmax_t& max_iter, c static const char* function = "boost::math::tools::bisect<%1%>"; if(min >= max) { - policies::raise_evaluation_error(function, - "Arguments in wrong order in boost::math::tools::bisect (first arg=%1%)", min, pol); + return boost::math::detail::pair_from_single(policies::raise_evaluation_error(function, + "Arguments in wrong order in boost::math::tools::bisect (first arg=%1%)", min, pol)); } if(fmin * fmax >= 0) { - policies::raise_evaluation_error(function, - "No change of sign in boost::math::tools::bisect, either there is no root to find, or there are multiple roots in the interval (f(min) = %1%).", fmin, pol); + return boost::math::detail::pair_from_single(policies::raise_evaluation_error(function, + "No change of sign in boost::math::tools::bisect, either there is no root to find, or there are multiple roots in the interval (f(min) = %1%).", fmin, pol)); } // @@ -302,7 +302,7 @@ T halley_iterate(F f, T guess, T min, T max, int digits, boost::uintmax_t& max_i if(0 == f0) break; - if((f1 == 0) && (f2 == 0)) + if(f1 == 0) { // Oops zero derivative!!! #ifdef BOOST_MATH_INSTRUMENT @@ -329,8 +329,18 @@ T halley_iterate(F f, T guess, T min, T max, int digits, boost::uintmax_t& max_i delta = denom / num; if(delta * f1 / f0 < 0) { - // probably cancellation error, try a Newton step instead: + // Oh dear, we have a problem as Newton and Halley steps + // disagree about which way we should move. Probably + // there is cancelation error in the calculation of the + // Halley step, or else the derivatives are so small + // that their values are basically trash. We will move + // in the direction indicated by a Newton step, but + // by no more than twice the current guess value, otherwise + // we can jump way out of bounds if we're not careful. + // See https://svn.boost.org/trac/boost/ticket/8314. delta = f0 / f1; + if(fabs(delta) > 2 * fabs(guess)) + delta = (delta < 0 ? -1 : 1) * 2 * fabs(guess); } } else diff --git a/boost/math/tools/solve.hpp b/boost/math/tools/solve.hpp deleted file mode 100644 index 64b01e5210..0000000000 --- a/boost/math/tools/solve.hpp +++ /dev/null @@ -1,79 +0,0 @@ -// (C) Copyright John Maddock 2006. -// Use, modification and distribution are subject to the -// Boost Software License, Version 1.0. (See accompanying file -// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) - -#ifndef BOOST_MATH_TOOLS_SOLVE_HPP -#define BOOST_MATH_TOOLS_SOLVE_HPP - -#ifdef _MSC_VER -#pragma once -#endif - -#include <boost/config.hpp> -#include <boost/assert.hpp> - -#ifdef BOOST_MSVC -#pragma warning(push) -#pragma warning(disable:4996 4267 4244) -#endif - -#include <boost/numeric/ublas/lu.hpp> -#include <boost/numeric/ublas/matrix.hpp> -#include <boost/numeric/ublas/vector.hpp> - -#ifdef BOOST_MSVC -#pragma warning(pop) -#endif - -namespace boost{ namespace math{ namespace tools{ - -// -// Find x such that Ax = b -// -// Caution: this uses undocumented, and untested ublas code, -// however short of writing our own LU-decompostion code -// it's the only game in town. -// -template <class T> -boost::numeric::ublas::vector<T> solve( - const boost::numeric::ublas::matrix<T>& A_, - const boost::numeric::ublas::vector<T>& b_) -{ - //BOOST_ASSERT(A_.size() == b_.size()); - - boost::numeric::ublas::matrix<T> A(A_); - boost::numeric::ublas::vector<T> b(b_); - boost::numeric::ublas::permutation_matrix<> piv(b.size()); - lu_factorize(A, piv); - lu_substitute(A, piv, b); - // - // iterate to reduce error: - // - boost::numeric::ublas::vector<T> delta(b.size()); - for(unsigned i = 0; i < 1; ++i) - { - noalias(delta) = prod(A_, b); - delta -= b_; - lu_substitute(A, piv, delta); - b -= delta; - - T max_error = 0; - - for(unsigned i = 0; i < delta.size(); ++i) - { - T err = fabs(delta[i] / b[i]); - if(err > max_error) - max_error = err; - } - //std::cout << "Max change in LU error correction: " << max_error << std::endl; - } - - return b; -} - -}}} // namespaces - -#endif // BOOST_MATH_TOOLS_SOLVE_HPP - - diff --git a/boost/math/tools/test.hpp b/boost/math/tools/test.hpp deleted file mode 100644 index af51d9e3e1..0000000000 --- a/boost/math/tools/test.hpp +++ /dev/null @@ -1,332 +0,0 @@ -// (C) Copyright John Maddock 2006. -// Use, modification and distribution are subject to the -// Boost Software License, Version 1.0. (See accompanying file -// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) - -#ifndef BOOST_MATH_TOOLS_TEST_HPP -#define BOOST_MATH_TOOLS_TEST_HPP - -#ifdef _MSC_VER -#pragma once -#endif - -#include <boost/math/tools/config.hpp> -#include <boost/math/tools/stats.hpp> -#include <boost/math/special_functions/fpclassify.hpp> -#include <boost/test/test_tools.hpp> -#include <stdexcept> - -namespace boost{ namespace math{ namespace tools{ - -template <class T> -struct test_result -{ -private: - boost::math::tools::stats<T> stat; // Statistics for the test. - unsigned worst_case; // Index of the worst case test. -public: - test_result() { worst_case = 0; } - void set_worst(int i){ worst_case = i; } - void add(const T& point){ stat.add(point); } - // accessors: - unsigned worst()const{ return worst_case; } - T min BOOST_PREVENT_MACRO_SUBSTITUTION()const{ return (stat.min)(); } - T max BOOST_PREVENT_MACRO_SUBSTITUTION()const{ return (stat.max)(); } - T total()const{ return stat.total(); } - T mean()const{ return stat.mean(); } - boost::uintmax_t count()const{ return stat.count(); } - T variance()const{ return stat.variance(); } - T variance1()const{ return stat.variance1(); } - T rms()const{ return stat.rms(); } - - test_result& operator+=(const test_result& t) - { - if((t.stat.max)() > (stat.max)()) - worst_case = t.worst_case; - stat += t.stat; - return *this; - } -}; - -template <class T> -struct calculate_result_type -{ - typedef typename T::value_type row_type; - typedef typename row_type::value_type value_type; -}; - -template <class T> -T relative_error(T a, T b) -{ - BOOST_MATH_STD_USING -#ifdef BOOST_MATH_NO_LONG_DOUBLE_MATH_FUNCTIONS - // - // If math.h has no long double support we can't rely - // on the math functions generating exponents outside - // the range of a double: - // - T min_val = (std::max)( - tools::min_value<T>(), - static_cast<T>((std::numeric_limits<double>::min)())); - T max_val = (std::min)( - tools::max_value<T>(), - static_cast<T>((std::numeric_limits<double>::max)())); -#else - T min_val = tools::min_value<T>(); - T max_val = tools::max_value<T>(); -#endif - - if((a != 0) && (b != 0)) - { - // TODO: use isfinite: - if(fabs(b) >= max_val) - { - if(fabs(a) >= max_val) - return 0; // one infinity is as good as another! - } - // If the result is denormalised, treat all denorms as equivalent: - if((a < min_val) && (a > 0)) - a = min_val; - else if((a > -min_val) && (a < 0)) - a = -min_val; - if((b < min_val) && (b > 0)) - b = min_val; - else if((b > -min_val) && (b < 0)) - b = -min_val; - return (std::max)(fabs((a-b)/a), fabs((a-b)/b)); - } - - // Handle special case where one or both are zero: - if(min_val == 0) - return fabs(a-b); - if(fabs(a) < min_val) - a = min_val; - if(fabs(b) < min_val) - b = min_val; - return (std::max)(fabs((a-b)/a), fabs((a-b)/b)); -} - -#if defined(macintosh) || defined(__APPLE__) || defined(__APPLE_CC__) -template <> -inline double relative_error<double>(double a, double b) -{ - BOOST_MATH_STD_USING - // - // On Mac OS X we evaluate "double" functions at "long double" precision, - // but "long double" actually has a very slightly narrower range than "double"! - // Therefore use the range of "long double" as our limits since results outside - // that range may have been truncated to 0 or INF: - // - double min_val = (std::max)((double)tools::min_value<long double>(), tools::min_value<double>()); - double max_val = (std::min)((double)tools::max_value<long double>(), tools::max_value<double>()); - - if((a != 0) && (b != 0)) - { - // TODO: use isfinite: - if(b > max_val) - { - if(a > max_val) - return 0; // one infinity is as good as another! - } - // If the result is denormalised, treat all denorms as equivalent: - if((a < min_val) && (a > 0)) - a = min_val; - else if((a > -min_val) && (a < 0)) - a = -min_val; - if((b < min_val) && (b > 0)) - b = min_val; - else if((b > -min_val) && (b < 0)) - b = -min_val; - return (std::max)(fabs((a-b)/a), fabs((a-b)/b)); - } - - // Handle special case where one or both are zero: - if(min_val == 0) - return fabs(a-b); - if(fabs(a) < min_val) - a = min_val; - if(fabs(b) < min_val) - b = min_val; - return (std::max)(fabs((a-b)/a), fabs((a-b)/b)); -} -#endif - -template <class T> -void set_output_precision(T) -{ -#ifdef BOOST_MSVC -#pragma warning(push) -#pragma warning(disable:4127) -#endif - if(std::numeric_limits<T>::digits10) - { - std::cout << std::setprecision(std::numeric_limits<T>::digits10 + 2); - } -#ifdef BOOST_MSVC -#pragma warning(pop) -#endif -} - -template <class Seq> -void print_row(const Seq& row) -{ - set_output_precision(row[0]); - for(unsigned i = 0; i < row.size(); ++i) - { - if(i) - std::cout << ", "; - std::cout << row[i]; - } - std::cout << std::endl; -} - -// -// Function test accepts an matrix of input values (probably a 2D boost::array) -// and calls two functors for each row in the array - one calculates a value -// to test, and one extracts the expected value from the array (or possibly -// calculates it at high precision). The two functors are usually simple lambda -// expressions. -// -template <class A, class F1, class F2> -test_result<typename calculate_result_type<A>::value_type> test(const A& a, F1 test_func, F2 expect_func) -{ - typedef typename A::value_type row_type; - typedef typename row_type::value_type value_type; - - test_result<value_type> result; - - for(unsigned i = 0; i < a.size(); ++i) - { - const row_type& row = a[i]; - value_type point; - try - { - point = test_func(row); - } - catch(const std::underflow_error&) - { - point = 0; - } - catch(const std::overflow_error&) - { - point = std::numeric_limits<value_type>::has_infinity ? - std::numeric_limits<value_type>::infinity() - : tools::max_value<value_type>(); - } - catch(const std::exception& e) - { - std::cerr << e.what() << std::endl; - print_row(row); - BOOST_ERROR("Unexpected exception."); - // so we don't get further errors: - point = expect_func(row); - } - value_type expected = expect_func(row); - value_type err = relative_error(point, expected); -#ifdef BOOST_INSTRUMENT - if(err != 0) - { - std::cout << row[0] << " " << err; - if(std::numeric_limits<value_type>::is_specialized) - { - std::cout << " (" << err / std::numeric_limits<value_type>::epsilon() << "eps)"; - } - std::cout << std::endl; - } -#endif - if(!(boost::math::isfinite)(point) && (boost::math::isfinite)(expected)) - { - std::cout << "CAUTION: Found non-finite result, when a finite value was expected at entry " << i << "\n"; - std::cout << "Found: " << point << " Expected " << expected << " Error: " << err << std::endl; - print_row(row); - BOOST_ERROR("Unexpected non-finite result"); - } - if(err > 0.5) - { - std::cout << "CAUTION: Gross error found at entry " << i << ".\n"; - std::cout << "Found: " << point << " Expected " << expected << " Error: " << err << std::endl; - print_row(row); - BOOST_ERROR("Gross error"); - } - result.add(err); - if((result.max)() == err) - result.set_worst(i); - } - return result; -} - -template <class Real, class A, class F1, class F2> -test_result<Real> test_hetero(const A& a, F1 test_func, F2 expect_func) -{ - typedef typename A::value_type row_type; - typedef Real value_type; - - test_result<value_type> result; - - for(unsigned i = 0; i < a.size(); ++i) - { - const row_type& row = a[i]; - value_type point; - try - { - point = test_func(row); - } - catch(const std::underflow_error&) - { - point = 0; - } - catch(const std::overflow_error&) - { - point = std::numeric_limits<value_type>::has_infinity ? - std::numeric_limits<value_type>::infinity() - : tools::max_value<value_type>(); - } - catch(const std::exception& e) - { - std::cerr << e.what() << std::endl; - print_row(row); - BOOST_ERROR("Unexpected exception."); - // so we don't get further errors: - point = expect_func(row); - } - value_type expected = expect_func(row); - value_type err = relative_error(point, expected); -#ifdef BOOST_INSTRUMENT - if(err != 0) - { - std::cout << row[0] << " " << err; - if(std::numeric_limits<value_type>::is_specialized) - { - std::cout << " (" << err / std::numeric_limits<value_type>::epsilon() << "eps)"; - } - std::cout << std::endl; - } -#endif - if(!(boost::math::isfinite)(point) && (boost::math::isfinite)(expected)) - { - std::cout << "CAUTION: Found non-finite result, when a finite value was expected at entry " << i << "\n"; - std::cout << "Found: " << point << " Expected " << expected << " Error: " << err << std::endl; - print_row(row); - BOOST_ERROR("Unexpected non-finite result"); - } - if(err > 0.5) - { - std::cout << "CAUTION: Gross error found at entry " << i << ".\n"; - std::cout << "Found: " << point << " Expected " << expected << " Error: " << err << std::endl; - print_row(row); - BOOST_ERROR("Gross error"); - } - result.add(err); - if((result.max)() == err) - result.set_worst(i); - } - return result; -} - -} // namespace tools -} // namespace math -} // namespace boost - -#endif - - diff --git a/boost/math/tools/test_data.hpp b/boost/math/tools/test_data.hpp deleted file mode 100644 index 56bae051b4..0000000000 --- a/boost/math/tools/test_data.hpp +++ /dev/null @@ -1,767 +0,0 @@ -// (C) Copyright John Maddock 2006. -// Use, modification and distribution are subject to the -// Boost Software License, Version 1.0. (See accompanying file -// LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt) - -#ifndef BOOST_MATH_TOOLS_TEST_DATA_HPP -#define BOOST_MATH_TOOLS_TEST_DATA_HPP - -#ifdef _MSC_VER -#pragma once -#endif - -#include <boost/math/tools/config.hpp> -#include <boost/assert.hpp> -#ifdef BOOST_MSVC -# pragma warning(push) -# pragma warning(disable: 4127 4701 4512) -# pragma warning(disable: 4130) // '==' : logical operation on address of string constant. -#endif -#include <boost/algorithm/string/trim.hpp> -#include <boost/lexical_cast.hpp> -#ifdef BOOST_MSVC -#pragma warning(pop) -#endif -#include <boost/type_traits/is_floating_point.hpp> -#include <boost/type_traits/is_convertible.hpp> -#include <boost/type_traits/integral_constant.hpp> -#include <boost/tr1/random.hpp> -#include <boost/math/tools/tuple.hpp> -#include <boost/math/tools/real_cast.hpp> - -#include <set> -#include <vector> -#include <iostream> - -#ifdef BOOST_MSVC -# pragma warning(push) -# pragma warning(disable: 4130) // '==' : logical operation on address of string constant. -// Used as a warning with BOOST_ASSERT -#endif - -namespace boost{ namespace math{ namespace tools{ - -enum parameter_type -{ - random_in_range = 0, - periodic_in_range = 1, - power_series = 2, - dummy_param = 0x80 -}; - -parameter_type operator | (parameter_type a, parameter_type b) -{ - return static_cast<parameter_type>((int)a|(int)b); -} -parameter_type& operator |= (parameter_type& a, parameter_type b) -{ - a = static_cast<parameter_type>(a|b); - return a; -} - -// -// If type == random_in_range then -// z1 and r2 are the endpoints of the half open range and n1 is the number of points. -// -// If type == periodic_in_range then -// z1 and r2 are the endpoints of the half open range and n1 is the number of points. -// -// If type == power_series then -// n1 and n2 are the endpoints of the exponents (closed range) and z1 is the basis. -// -// If type & dummy_param then this data is ignored and not stored in the output, it -// is passed to the generator function however which can do with it as it sees fit. -// -template <class T> -struct parameter_info -{ - parameter_type type; - T z1, z2; - int n1, n2; -}; - -template <class T> -inline parameter_info<T> make_random_param(T start_range, T end_range, int n_points) -{ - parameter_info<T> result = { random_in_range, start_range, end_range, n_points, 0 }; - return result; -} - -template <class T> -inline parameter_info<T> make_periodic_param(T start_range, T end_range, int n_points) -{ - parameter_info<T> result = { periodic_in_range, start_range, end_range, n_points, 0 }; - return result; -} - -template <class T> -inline parameter_info<T> make_power_param(T basis, int start_exponent, int end_exponent) -{ - parameter_info<T> result = { power_series, basis, 0, start_exponent, end_exponent }; - return result; -} - -namespace detail{ - -template <class Seq, class Item, int N> -inline void unpack_and_append_tuple(Seq& s, - const Item& data, - const boost::integral_constant<int, N>&, - const boost::false_type&) -{ - // termimation condition nothing to do here -} - -template <class Seq, class Item, int N> -inline void unpack_and_append_tuple(Seq& s, - const Item& data, - const boost::integral_constant<int, N>&, - const boost::true_type&) -{ - // extract the N'th element, append, and recurse: - typedef typename Seq::value_type value_type; - value_type val = boost::math::get<N>(data); - s.push_back(val); - - typedef boost::integral_constant<int, N+1> next_value; - typedef boost::integral_constant<bool, (boost::math::tuple_size<Item>::value > N+1)> terminate; - - unpack_and_append_tuple(s, data, next_value(), terminate()); -} - -template <class Seq, class Item> -inline void unpack_and_append(Seq& s, const Item& data, const boost::true_type&) -{ - s.push_back(data); -} - -template <class Seq, class Item> -inline void unpack_and_append(Seq& s, const Item& data, const boost::false_type&) -{ - // Item had better be a tuple-like type or we've had it!!!! - typedef boost::integral_constant<int, 0> next_value; - typedef boost::integral_constant<bool, (boost::math::tuple_size<Item>::value > 0)> terminate; - - unpack_and_append_tuple(s, data, next_value(), terminate()); -} - -template <class Seq, class Item> -inline void unpack_and_append(Seq& s, const Item& data) -{ - typedef typename Seq::value_type value_type; - unpack_and_append(s, data, ::boost::is_convertible<Item, value_type>()); -} - -} // detail - -template <class T> -class test_data -{ -public: - typedef std::vector<T> row_type; - typedef row_type value_type; -private: - typedef std::set<row_type> container_type; -public: - typedef typename container_type::reference reference; - typedef typename container_type::const_reference const_reference; - typedef typename container_type::iterator iterator; - typedef typename container_type::const_iterator const_iterator; - typedef typename container_type::difference_type difference_type; - typedef typename container_type::size_type size_type; - - // creation: - test_data(){} - template <class F> - test_data(F func, const parameter_info<T>& arg1) - { - insert(func, arg1); - } - - // insertion: - template <class F> - test_data& insert(F func, const parameter_info<T>& arg1) - { - // generate data for single argument functor F - - typedef typename std::set<T>::const_iterator it_type; - - std::set<T> points; - create_test_points(points, arg1); - it_type a = points.begin(); - it_type b = points.end(); - row_type row; - while(a != b) - { - if((arg1.type & dummy_param) == 0) - row.push_back(*a); - try{ - // domain_error exceptions from func are swallowed - // and this data point is ignored: - boost::math::tools::detail::unpack_and_append(row, func(*a)); - m_data.insert(row); - } - catch(const std::domain_error&){} - row.clear(); - ++a; - } - return *this; - } - - template <class F> - test_data& insert(F func, const parameter_info<T>& arg1, const parameter_info<T>& arg2) - { - // generate data for 2-argument functor F - - typedef typename std::set<T>::const_iterator it_type; - - std::set<T> points1, points2; - create_test_points(points1, arg1); - create_test_points(points2, arg2); - it_type a = points1.begin(); - it_type b = points1.end(); - row_type row; - while(a != b) - { - it_type c = points2.begin(); - it_type d = points2.end(); - while(c != d) - { - if((arg1.type & dummy_param) == 0) - row.push_back(*a); - if((arg2.type & dummy_param) == 0) - row.push_back(*c); - try{ - // domain_error exceptions from func are swallowed - // and this data point is ignored: - detail::unpack_and_append(row, func(*a, *c)); - m_data.insert(row); - } - catch(const std::domain_error&){} - row.clear(); - ++c; - } - ++a; - } - return *this; - } - - template <class F> - test_data& insert(F func, const parameter_info<T>& arg1, const parameter_info<T>& arg2, const parameter_info<T>& arg3) - { - // generate data for 3-argument functor F - - typedef typename std::set<T>::const_iterator it_type; - - std::set<T> points1, points2, points3; - create_test_points(points1, arg1); - create_test_points(points2, arg2); - create_test_points(points3, arg3); - it_type a = points1.begin(); - it_type b = points1.end(); - row_type row; - while(a != b) - { - it_type c = points2.begin(); - it_type d = points2.end(); - while(c != d) - { - it_type e = points3.begin(); - it_type f = points3.end(); - while(e != f) - { - if((arg1.type & dummy_param) == 0) - row.push_back(*a); - if((arg2.type & dummy_param) == 0) - row.push_back(*c); - if((arg3.type & dummy_param) == 0) - row.push_back(*e); - try{ - // domain_error exceptions from func are swallowed - // and this data point is ignored: - detail::unpack_and_append(row, func(*a, *c, *e)); - m_data.insert(row); - } - catch(const std::domain_error&){} - row.clear(); - ++e; - } - ++c; - } - ++a; - } - return *this; - } - - void clear(){ m_data.clear(); } - - // access: - iterator begin() { return m_data.begin(); } - iterator end() { return m_data.end(); } - const_iterator begin()const { return m_data.begin(); } - const_iterator end()const { return m_data.end(); } - bool operator==(const test_data& d)const{ return m_data == d.m_data; } - bool operator!=(const test_data& d)const{ return m_data != d.m_data; } - void swap(test_data& other){ m_data.swap(other.m_data); } - size_type size()const{ return m_data.size(); } - size_type max_size()const{ return m_data.max_size(); } - bool empty()const{ return m_data.empty(); } - - bool operator < (const test_data& dat)const{ return m_data < dat.m_data; } - bool operator <= (const test_data& dat)const{ return m_data <= dat.m_data; } - bool operator > (const test_data& dat)const{ return m_data > dat.m_data; } - bool operator >= (const test_data& dat)const{ return m_data >= dat.m_data; } - -private: - void create_test_points(std::set<T>& points, const parameter_info<T>& arg1); - std::set<row_type> m_data; - - static float extern_val; - static float truncate_to_float(float const * pf); - static float truncate_to_float(float c){ return truncate_to_float(&c); } -}; - -// -// This code exists to bemuse the compiler's optimizer and force a -// truncation to float-precision only: -// -template <class T> -inline float test_data<T>::truncate_to_float(float const * pf) -{ - BOOST_MATH_STD_USING - int expon; - float f = floor(ldexp(frexp(*pf, &expon), 22)); - f = ldexp(f, expon - 22); - return f; - - //extern_val = *pf; - //return *pf; -} - -template <class T> -float test_data<T>::extern_val = 0; - -template <class T> -void test_data<T>::create_test_points(std::set<T>& points, const parameter_info<T>& arg1) -{ - BOOST_MATH_STD_USING - // - // Generate a set of test points as requested, try and generate points - // at only float precision: otherwise when testing float versions of functions - // there will be a rounding error in our input values which throws off the results - // (Garbage in garbage out etc). - // - switch(arg1.type & 0x7F) - { - case random_in_range: - { - BOOST_ASSERT(arg1.z1 < arg1.z2); - BOOST_ASSERT(arg1.n1 > 0); - typedef float random_type; - - std::tr1::mt19937 rnd; - std::tr1::uniform_real<random_type> ur_a(real_cast<random_type>(arg1.z1), real_cast<random_type>(arg1.z2)); - std::tr1::variate_generator<std::tr1::mt19937, std::tr1::uniform_real<random_type> > gen(rnd, ur_a); - - for(int i = 0; i < arg1.n1; ++i) - { - random_type r = gen(); - points.insert(truncate_to_float(r)); - } - } - break; - case periodic_in_range: - { - BOOST_ASSERT(arg1.z1 < arg1.z2); - BOOST_ASSERT(arg1.n1 > 0); - float interval = real_cast<float>((arg1.z2 - arg1.z1) / arg1.n1); - T val = arg1.z1; - while(val < arg1.z2) - { - points.insert(truncate_to_float(real_cast<float>(val))); - val += interval; - } - } - break; - case power_series: - { - BOOST_ASSERT(arg1.n1 < arg1.n2); - - typedef float random_type; - typedef typename boost::mpl::if_< - ::boost::is_floating_point<T>, - T, long double>::type power_type; - - std::tr1::mt19937 rnd; - std::tr1::uniform_real<random_type> ur_a(1.0, 2.0); - std::tr1::variate_generator<std::tr1::mt19937, std::tr1::uniform_real<random_type> > gen(rnd, ur_a); - - for(int power = arg1.n1; power <= arg1.n2; ++power) - { - random_type r = gen(); - power_type p = ldexp(static_cast<power_type>(r), power); - points.insert(truncate_to_float(real_cast<float>(arg1.z1 + p))); - } - } - break; - default: - BOOST_ASSERT(0 == "Invalid parameter_info object"); - // Assert will fail if get here. - // Triggers warning 4130) // '==' : logical operation on address of string constant. - } -} - -// -// Prompt a user for information on a parameter range: -// -template <class T> -bool get_user_parameter_info(parameter_info<T>& info, const char* param_name) -{ -#ifdef BOOST_MSVC -# pragma warning(push) -# pragma warning(disable: 4127) -#endif - std::string line; - do{ - std::cout << "What kind of distribution do you require for parameter " << param_name << "?\n" - "Choices are:\n" - " r Random values in a half open range\n" - " p Evenly spaced periodic values in a half open range\n" - " e Exponential power series at a particular point: a + 2^b for some range of b\n" - "[Default=r]"; - - std::getline(std::cin, line); - boost::algorithm::trim(line); - - if(line == "r") - { - info.type = random_in_range; - break; - } - else if(line == "p") - { - info.type = periodic_in_range; - break; - } - else if(line == "e") - { - info.type = power_series; - break; - } - else if(line == "") - { - info.type = random_in_range; - break; - } - // - // Ooops, not a valid input.... - // - std::cout << "Sorry don't recognise \"" << line << "\" as a valid input\n" - "do you want to try again [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "n") - return false; - else if(line == "y") - continue; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - }while(true); - - switch(info.type & ~dummy_param) - { - case random_in_range: - case periodic_in_range: - // get start and end points of range: - do{ - std::cout << "Data will be in the half open range a <= x < b,\n" - "enter value for the start point fo the range [default=0]:"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "") - { - info.z1 = 0; - break; - } - try{ - info.z1 = boost::lexical_cast<T>(line); - break; - } - catch(const boost::bad_lexical_cast&) - { - std::cout << "Sorry, that was not valid input, try again [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "y") - continue; - if(line == "n") - return false; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - } - }while(true); - do{ - std::cout << "Enter value for the end point fo the range [default=1]:"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "") - { - info.z2 = 1; - } - else - { - try - { - info.z2 = boost::lexical_cast<T>(line); - } - catch(const boost::bad_lexical_cast&) - { - std::cout << "Sorry, that was not valid input, try again [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "y") - continue; - if(line == "n") - return false; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - } - } - if(info.z1 >= info.z2) - { - std::cout << "The end point of the range was <= the start point\n" - "try a different value for the endpoint [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "y") - continue; - if(line == "n") - return false; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - } - break; - }while(true); - do{ - // get the number of points: - std::cout << "How many data points do you want?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - try{ - info.n1 = boost::lexical_cast<int>(line); - info.n2 = 0; - if(info.n1 <= 0) - { - std::cout << "The number of points should be > 0\n" - "try again [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "y") - continue; - if(line == "n") - return false; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - } - break; - } - catch(const boost::bad_lexical_cast&) - { - std::cout << "Sorry, that was not valid input, try again [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "y") - continue; - if(line == "n") - return false; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - } - }while(true); - break; - case power_series: - // get start and end points of range: - info.z2 = 0; - do{ - std::cout << "Data will be in the form a + r*2^b\n" - "for random value r,\n" - "enter value for the point a [default=0]:"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "") - { - info.z1 = 0; - break; - } - try{ - info.z1 = boost::lexical_cast<T>(line); - break; - } - catch(const boost::bad_lexical_cast&) - { - std::cout << "Sorry, that was not valid input, try again [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "y") - continue; - if(line == "n") - return false; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - } - }while(true); - - do{ - std::cout << "Data will be in the form a + r*2^b\n" - "for random value r,\n" - "enter value for the starting exponent b:"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - try{ - info.n1 = boost::lexical_cast<int>(line); - break; - } - catch(const boost::bad_lexical_cast&) - { - std::cout << "Sorry, that was not valid input, try again [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "y") - continue; - if(line == "n") - return false; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - } - }while(true); - - do{ - std::cout << "Data will be in the form a + r*2^b\n" - "for random value r,\n" - "enter value for the ending exponent b:"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - try{ - info.n2 = boost::lexical_cast<int>(line); - break; - } - catch(const boost::bad_lexical_cast&) - { - std::cout << "Sorry, that was not valid input, try again [y/n]?"; - std::getline(std::cin, line); - boost::algorithm::trim(line); - if(line == "y") - continue; - if(line == "n") - return false; - std::cout << "Sorry don't recognise that either, giving up...\n\n"; - return false; - } - }while(true); - - break; - default: - BOOST_ASSERT(0); // should never get here!! - } - - return true; -#ifdef BOOST_MSVC -# pragma warning(pop) -#endif -} - -template <class charT, class traits, class T> -inline std::basic_ostream<charT, traits>& write_csv(std::basic_ostream<charT, traits>& os, - const test_data<T>& data) -{ - const charT defarg[] = { ',', ' ', '\0' }; - return write_csv(os, data, defarg); -} - -template <class charT, class traits, class T> -std::basic_ostream<charT, traits>& write_csv(std::basic_ostream<charT, traits>& os, - const test_data<T>& data, - const charT* separator) -{ - typedef typename test_data<T>::const_iterator it_type; - typedef typename test_data<T>::value_type value_type; - typedef typename value_type::const_iterator value_type_iterator; - it_type a, b; - a = data.begin(); - b = data.end(); - while(a != b) - { - value_type_iterator x, y; - bool sep = false; - x = a->begin(); - y = a->end(); - while(x != y) - { - if(sep) - os << separator; - os << *x; - sep = true; - ++x; - } - os << std::endl; - ++a; - } - return os; -} - -template <class T> -std::ostream& write_code(std::ostream& os, - const test_data<T>& data, - const char* name) -{ - typedef typename test_data<T>::const_iterator it_type; - typedef typename test_data<T>::value_type value_type; - typedef typename value_type::const_iterator value_type_iterator; - - BOOST_ASSERT(os.good()); - - it_type a, b; - a = data.begin(); - b = data.end(); - if(a == b) - return os; - - os << "#ifndef SC_\n# define SC_(x) static_cast<T>(BOOST_JOIN(x, L))\n#endif\n" - " static const boost::array<boost::array<T, " - << a->size() << ">, " << data.size() << "> " << name << " = {{\n"; - - while(a != b) - { - if(a != data.begin()) - os << ", \n"; - - value_type_iterator x, y; - x = a->begin(); - y = a->end(); - os << " { "; - while(x != y) - { - if(x != a->begin()) - os << ", "; - os << "SC_(" << *x << ")"; - ++x; - } - os << " }"; - ++a; - } - os << "\n }};\n//#undef SC_\n\n"; - return os; -} - -} // namespace tools -} // namespace math -} // namespace boost - -#ifdef BOOST_MSVC -#pragma warning(pop) -#endif - - -#endif // BOOST_MATH_TOOLS_TEST_DATA_HPP - - diff --git a/boost/math/tools/toms748_solve.hpp b/boost/math/tools/toms748_solve.hpp index f0c42324e8..48737a821a 100644 --- a/boost/math/tools/toms748_solve.hpp +++ b/boost/math/tools/toms748_solve.hpp @@ -17,6 +17,14 @@ #include <boost/cstdint.hpp> #include <limits> +#ifdef BOOST_MATH_LOG_ROOT_ITERATIONS +# define BOOST_MATH_LOGGER_INCLUDE <boost/math/tools/iteration_logger.hpp> +# include BOOST_MATH_LOGGER_INCLUDE +# undef BOOST_MATH_LOGGER_INCLUDE +#else +# define BOOST_MATH_LOG_COUNT(count) +#endif + namespace boost{ namespace math{ namespace tools{ template <class T> @@ -197,7 +205,7 @@ T quadratic_interpolate(const T& a, const T& b, T const& d, T A = safe_div(T(fd - fb), T(d - b), tools::max_value<T>()); A = safe_div(T(A - B), T(d - a), T(0)); - if(a == 0) + if(A == 0) { // failure to determine coefficients, try a secant step: return secant_interpolate(a, b, fa, fb); @@ -298,9 +306,9 @@ std::pair<T, T> toms748_solve(F f, const T& ax, const T& bx, const T& fax, const a = ax; b = bx; if(a >= b) - policies::raise_domain_error( + return boost::math::detail::pair_from_single(policies::raise_domain_error( function, - "Parameters a and b out of order: a=%1%", a, pol); + "Parameters a and b out of order: a=%1%", a, pol)); fa = fax; fb = fbx; @@ -315,9 +323,9 @@ std::pair<T, T> toms748_solve(F f, const T& ax, const T& bx, const T& fax, const } if(boost::math::sign(fa) * boost::math::sign(fb) > 0) - policies::raise_domain_error( + return boost::math::detail::pair_from_single(policies::raise_domain_error( function, - "Parameters a and b do not bracket the root: a=%1%", a, pol); + "Parameters a and b do not bracket the root: a=%1%", a, pol)); // dummy value for fd, e and fe: fe = e = fd = 1e5F; @@ -452,6 +460,7 @@ std::pair<T, T> toms748_solve(F f, const T& ax, const T& bx, const T& fax, const { a = b; } + BOOST_MATH_LOG_COUNT(max_iter) return std::make_pair(a, b); } @@ -493,6 +502,8 @@ std::pair<T, T> bracket_and_solve_root(F f, const T& guess, T factor, bool risin // boost::uintmax_t count = max_iter - 1; + int step = 32; + if((fa < 0) == (guess < 0 ? !rising : rising)) { // @@ -502,13 +513,19 @@ std::pair<T, T> bracket_and_solve_root(F f, const T& guess, T factor, bool risin while((boost::math::sign)(fb) == (boost::math::sign)(fa)) { if(count == 0) - policies::raise_evaluation_error(function, "Unable to bracket root, last nearest value was %1%", b, pol); + return boost::math::detail::pair_from_single(policies::raise_evaluation_error(function, "Unable to bracket root, last nearest value was %1%", b, pol)); // - // Heuristic: every 20 iterations we double the growth factor in case the - // initial guess was *really* bad ! + // Heuristic: normally it's best not to increase the step sizes as we'll just end up + // with a really wide range to search for the root. However, if the initial guess was *really* + // bad then we need to speed up the search otherwise we'll take forever if we're orders of + // magnitude out. This happens most often if the guess is a small value (say 1) and the result + // we're looking for is close to std::numeric_limits<T>::min(). // - if((max_iter - count) % 20 == 0) + if((max_iter - count) % step == 0) + { factor *= 2; + if(step > 1) step /= 2; + } // // Now go ahead and move our guess by "factor": // @@ -536,13 +553,19 @@ std::pair<T, T> bracket_and_solve_root(F f, const T& guess, T factor, bool risin return a > 0 ? std::make_pair(T(0), T(a)) : std::make_pair(T(a), T(0)); } if(count == 0) - policies::raise_evaluation_error(function, "Unable to bracket root, last nearest value was %1%", a, pol); + return boost::math::detail::pair_from_single(policies::raise_evaluation_error(function, "Unable to bracket root, last nearest value was %1%", a, pol)); // - // Heuristic: every 20 iterations we double the growth factor in case the - // initial guess was *really* bad ! + // Heuristic: normally it's best not to increase the step sizes as we'll just end up + // with a really wide range to search for the root. However, if the initial guess was *really* + // bad then we need to speed up the search otherwise we'll take forever if we're orders of + // magnitude out. This happens most often if the guess is a small value (say 1) and the result + // we're looking for is close to std::numeric_limits<T>::min(). // - if((max_iter - count) % 20 == 0) + if((max_iter - count) % step == 0) + { factor *= 2; + if(step > 1) step /= 2; + } // // Now go ahead and move are guess by "factor": // @@ -567,6 +590,7 @@ std::pair<T, T> bracket_and_solve_root(F f, const T& guess, T factor, bool risin pol); max_iter += count; BOOST_MATH_INSTRUMENT_CODE("max_iter = " << max_iter << " count = " << count); + BOOST_MATH_LOG_COUNT(max_iter) return r; } diff --git a/boost/math/tools/tuple.hpp b/boost/math/tools/tuple.hpp index 2f297360a2..0ae778cbef 100644 --- a/boost/math/tools/tuple.hpp +++ b/boost/math/tools/tuple.hpp @@ -7,8 +7,6 @@ # define BOOST_MATH_TUPLE_HPP_INCLUDED # include <boost/config.hpp> -#include <boost/tr1/detail/config.hpp> // for BOOST_HAS_TR1_TUPLE - #ifndef BOOST_NO_CXX11_HDR_TUPLE #include <tuple> @@ -29,27 +27,7 @@ using ::std::tuple_element; }} -#elif defined(BOOST_HAS_TR1_TUPLE) - -#include <boost/tr1/tuple.hpp> - -namespace boost{ namespace math{ - -using ::std::tr1::tuple; - -// [6.1.3.2] Tuple creation functions -using ::std::tr1::ignore; -using ::std::tr1::make_tuple; -using ::std::tr1::tie; -using ::std::tr1::get; - -// [6.1.3.3] Tuple helper classes -using ::std::tr1::tuple_size; -using ::std::tr1::tuple_element; - -}} - -#elif (defined(__BORLANDC__) && (__BORLANDC__ <= 0x600)) || (defined(_MSC_VER) && (_MSC_VER < 1310)) || defined(__IBMCPP__) +#elif (defined(__BORLANDC__) && (__BORLANDC__ <= 0x600)) || defined(__IBMCPP__) #include <boost/tuple/tuple.hpp> #include <boost/tuple/tuple_comparison.hpp> diff --git a/boost/math/tools/user.hpp b/boost/math/tools/user.hpp index c1bdaf7d87..08a7e53d9e 100644 --- a/boost/math/tools/user.hpp +++ b/boost/math/tools/user.hpp @@ -91,6 +91,14 @@ // Maximum root finding steps permitted: // // define BOOST_MATH_MAX_ROOT_ITERATION_POLICY 200 +// +// Enable use of __float128 in numeric constants: +// +// #define BOOST_MATH_USE_FLOAT128 +// +// Disable use of __float128 in numeric_constants even if the compiler looks to support it: +// +// #define BOOST_MATH_DISABLE_FLOAT128 #endif // BOOST_MATH_TOOLS_USER_HPP diff --git a/boost/math/tr1_c_macros.ipp b/boost/math/tr1_c_macros.ipp index c173639af5..ec8e7da3ef 100644 --- a/boost/math/tr1_c_macros.ipp +++ b/boost/math/tr1_c_macros.ipp @@ -807,4 +807,4 @@ #endif #define sph_neumannl boost_sph_neumannl -#endif // BOOST_MATH_C_MACROS_IPP
\ No newline at end of file +#endif // BOOST_MATH_C_MACROS_IPP |