diff options
| author | r.tyminski <r.tyminski@partner.samsung.com> | 2017-05-29 11:42:10 +0200 |
|---|---|---|
| committer | r.tyminski <r.tyminski@partner.samsung.com> | 2017-05-29 11:49:50 +0200 |
| commit | f9a43781767007462965b21f3f518c4cfc0744c7 (patch) | |
| tree | 201509439b1d9798256227794dae6774345adf43 /core/lib/libtomcrypt | |
| parent | 1fed20f5471aa0dad5e4b4f79d1f2843ac88734f (diff) | |
| download | tef-optee_os-f9a43781767007462965b21f3f518c4cfc0744c7.tar.gz tef-optee_os-f9a43781767007462965b21f3f518c4cfc0744c7.tar.bz2 tef-optee_os-f9a43781767007462965b21f3f518c4cfc0744c7.zip | |
Initial commit with upstream sources
Change-Id: Ie9460111f21fc955102fd8732a0173b2d0499a4a
Diffstat (limited to 'core/lib/libtomcrypt')
332 files changed, 49740 insertions, 0 deletions
diff --git a/core/lib/libtomcrypt/include/tomcrypt.h b/core/lib/libtomcrypt/include/tomcrypt.h new file mode 100644 index 0000000..6864eb7 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt.h @@ -0,0 +1,117 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef TOMCRYPT_H_ +#define TOMCRYPT_H_ +#include <assert.h> +#include <stdio.h> +#include <string.h> +#include <stdlib.h> +#include <time.h> +#include <ctype.h> +#include <limits.h> +#include <stddef.h> // for ptrdiff_t + +/* use configuration data */ +#include <tomcrypt_custom.h> + +#ifdef __cplusplus +extern "C" { +#endif + +/* version */ +#define CRYPT 0x0117 +#define SCRYPT "1.17" + +/* max size of either a cipher/hash block or symmetric key [largest of the two] */ +#define MAXBLOCKSIZE 128 + +/* descriptor table size */ +#define TAB_SIZE 32 + +/* error codes [will be expanded in future releases] */ +enum { + CRYPT_OK=0, /* Result OK */ + CRYPT_ERROR, /* Generic Error */ + CRYPT_NOP, /* Not a failure but no operation was performed */ + + CRYPT_INVALID_KEYSIZE, /* Invalid key size given */ + CRYPT_INVALID_ROUNDS, /* Invalid number of rounds */ + CRYPT_FAIL_TESTVECTOR, /* Algorithm failed test vectors */ + + CRYPT_BUFFER_OVERFLOW, /* Not enough space for output */ + CRYPT_INVALID_PACKET, /* Invalid input packet given */ + + CRYPT_INVALID_PRNGSIZE, /* Invalid number of bits for a PRNG */ + CRYPT_ERROR_READPRNG, /* Could not read enough from PRNG */ + + CRYPT_INVALID_CIPHER, /* Invalid cipher specified */ + CRYPT_INVALID_HASH, /* Invalid hash specified */ + CRYPT_INVALID_PRNG, /* Invalid PRNG specified */ + + CRYPT_MEM, /* Out of memory */ + + CRYPT_PK_TYPE_MISMATCH, /* Not equivalent types of PK keys */ + CRYPT_PK_NOT_PRIVATE, /* Requires a private PK key */ + + CRYPT_INVALID_ARG, /* Generic invalid argument */ + CRYPT_FILE_NOTFOUND, /* File Not Found */ + + CRYPT_PK_INVALID_TYPE, /* Invalid type of PK key */ + CRYPT_PK_INVALID_SYSTEM,/* Invalid PK system specified */ + CRYPT_PK_DUP, /* Duplicate key already in key ring */ + CRYPT_PK_NOT_FOUND, /* Key not found in keyring */ + CRYPT_PK_INVALID_SIZE, /* Invalid size input for PK parameters */ + + CRYPT_INVALID_PRIME_SIZE,/* Invalid size of prime requested */ + CRYPT_PK_INVALID_PADDING, /* Invalid padding on input */ + + CRYPT_HASH_OVERFLOW /* Hash applied to too many bits */ +}; + +#include <tomcrypt_cfg.h> +#include <tomcrypt_macros.h> +#include <tomcrypt_cipher.h> +#include <tomcrypt_hash.h> +#include <tomcrypt_mac.h> +#include <tomcrypt_prng.h> +#include <tomcrypt_pk.h> +#include <tomcrypt_math.h> +#include <tomcrypt_misc.h> +#include <tomcrypt_argchk.h> +#include <tomcrypt_pkcs.h> + +#ifdef __cplusplus + } +#endif + +#endif /* TOMCRYPT_H_ */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt.h,v $ */ +/* $Revision: 1.21 $ */ +/* $Date: 2006/12/16 19:34:05 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_argchk.h b/core/lib/libtomcrypt/include/tomcrypt_argchk.h new file mode 100644 index 0000000..5476f3e --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_argchk.h @@ -0,0 +1,71 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* Defines the LTC_ARGCHK macro used within the library */ +/* ARGTYPE is defined in mycrypt_cfg.h */ +#if ARGTYPE == 0 + +#include <signal.h> + +/* this is the default LibTomCrypt macro */ +#if defined(__clang__) || defined(__GNUC_MINOR__) +#define NORETURN __attribute__ ((noreturn)) +#else +#define NORETURN +#endif + +void crypt_argchk(char *v, char *s, int d) NORETURN; +#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) +#define LTC_ARGCHKVD(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) + +#elif ARGTYPE == 1 + +/* fatal type of error */ +#define LTC_ARGCHK(x) assert((x)) +#define LTC_ARGCHKVD(x) LTC_ARGCHK(x) + +#elif ARGTYPE == 2 + +#define LTC_ARGCHK(x) if (!(x)) { fprintf(stderr, "\nwarning: ARGCHK failed at %s:%d\n", __FILE__, __LINE__); } +#define LTC_ARGCHKVD(x) LTC_ARGCHK(x) + +#elif ARGTYPE == 3 + +#define LTC_ARGCHK(x) +#define LTC_ARGCHKVD(x) LTC_ARGCHK(x) + +#elif ARGTYPE == 4 + +#define LTC_ARGCHK(x) if (!(x)) return CRYPT_INVALID_ARG; +#define LTC_ARGCHKVD(x) if (!(x)) return; + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_argchk.h,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/08/27 20:50:21 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_arm_neon.h b/core/lib/libtomcrypt/include/tomcrypt_arm_neon.h new file mode 100644 index 0000000..61a3041 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_arm_neon.h @@ -0,0 +1,41 @@ +/* + * Copyright (c) 2015, Linaro Limited + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ +#ifndef TOMCRYPT_ARM_NEON_H +#define TOMCRYPT_ARM_NEON_H + +#include <tomcrypt_macros.h> + +struct tomcrypt_arm_neon_state { + ulong32 state; +}; + +/* Temporarily enables neon instructions */ +void tomcrypt_arm_neon_enable(struct tomcrypt_arm_neon_state *state); +/* Disables neon instructions after a call to tomcrypt_arm_neon_enable() */ +void tomcrypt_arm_neon_disable(struct tomcrypt_arm_neon_state *state); + +#endif /*TOMCRYPT_ARM_NEON_H*/ diff --git a/core/lib/libtomcrypt/include/tomcrypt_cfg.h b/core/lib/libtomcrypt/include/tomcrypt_cfg.h new file mode 100644 index 0000000..2338971 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_cfg.h @@ -0,0 +1,197 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* This is the build config file. + * + * With this you can setup what to inlcude/exclude automatically during any build. Just comment + * out the line that #define's the word for the thing you want to remove. phew! + */ + +#ifndef TOMCRYPT_CFG_H +#define TOMCRYPT_CFG_H + +#if defined(_WIN32) || defined(_MSC_VER) +#define LTC_CALL __cdecl +#else +#ifndef LTC_CALL + #define LTC_CALL +#endif +#endif + +#ifndef LTC_EXPORT +#define LTC_EXPORT +#endif + +/* certain platforms use macros for these, making the prototypes broken */ +#ifndef LTC_NO_PROTOTYPES + +/* you can change how memory allocation works ... */ +LTC_EXPORT void * LTC_CALL XMALLOC(size_t n); +LTC_EXPORT void * LTC_CALL XREALLOC(void *p, size_t n); +LTC_EXPORT void * LTC_CALL XCALLOC(size_t n, size_t s); +LTC_EXPORT void LTC_CALL XFREE(void *p); + +LTC_EXPORT void LTC_CALL XQSORT(void *base, size_t nmemb, size_t size, int(*compar)(const void *, const void *)); + + +/* change the clock function too */ +LTC_EXPORT clock_t LTC_CALL XCLOCK(void); + +/* various other functions */ +LTC_EXPORT void * LTC_CALL XMEMCPY(void *dest, const void *src, size_t n); +LTC_EXPORT int LTC_CALL XMEMCMP(const void *s1, const void *s2, size_t n); +LTC_EXPORT void * LTC_CALL XMEMSET(void *s, int c, size_t n); + +LTC_EXPORT int LTC_CALL XSTRCMP(const char *s1, const char *s2); + +#endif + +/* + * with ARGTYPE==4, LTC_ARGCHK() returns an error when an argument is not correct + */ +#define ARGTYPE 4 + +/* type of argument checking, 0=default, 1=fatal and 2=error+continue, 3=nothing */ +#ifndef ARGTYPE + #define ARGTYPE 0 +#endif + +/* Controls endianess and size of registers. Leave uncommented to get platform neutral [slower] code + * + * Note: in order to use the optimized macros your platform must support unaligned 32 and 64 bit read/writes. + * The x86 platforms allow this but some others [ARM for instance] do not. On those platforms you **MUST** + * use the portable [slower] macros. + */ + +/* detect x86-32 machines somewhat */ +#if !defined(__STRICT_ANSI__) && !defined(__x86_64__) && !defined(_WIN64) && ((defined(_MSC_VER) && defined(WIN32)) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__)))) + #define ENDIAN_LITTLE + #define ENDIAN_32BITWORD + #define LTC_FAST +#endif + +/* detects MIPS R5900 processors (PS2) */ +#if (defined(__R5900) || defined(R5900) || defined(__R5900__)) && (defined(_mips) || defined(__mips__) || defined(mips)) + #define ENDIAN_LITTLE + #define ENDIAN_64BITWORD +#endif + +/* detect amd64 */ +#if !defined(__STRICT_ANSI__) && defined(__x86_64__) + #define ENDIAN_LITTLE + #define ENDIAN_64BITWORD + #define LTC_FAST +#endif + +/* detect PPC32 */ +#if !defined(__STRICT_ANSI__) && defined(LTC_PPC32) + #define ENDIAN_BIG + #define ENDIAN_32BITWORD + #define LTC_FAST +#endif + +/* detect sparc and sparc64 */ +#if defined(__sparc__) + #define ENDIAN_BIG + #if defined(__arch64__) + #define ENDIAN_64BITWORD + #else + #define ENDIAN_32BITWORD + #endif +#endif + + +#ifdef LTC_NO_FAST + #ifdef LTC_FAST + #undef LTC_FAST + #endif +#endif + +#ifdef LTC_FAST +#if __GNUC__ < 4 /* if the compiler does not support gnu extensions, i.e. its neither clang nor gcc nor icc */ +#error the LTC_FAST hack is only available on compilers that support __attribute__((may_alias)) - disable it for your compiler, and dont worry, it won`t buy you much anyway +#else +#ifdef ENDIAN_64BITWORD +typedef ulong64 __attribute__((__may_alias__)) LTC_FAST_TYPE; +#else +typedef ulong32 __attribute__((__may_alias__)) LTC_FAST_TYPE; +#endif +#endif +#endif /* LTC_FAST */ + + +/* No asm is a quick way to disable anything "not portable" */ +#ifdef LTC_NO_ASM + #undef ENDIAN_LITTLE + #undef ENDIAN_BIG + #undef ENDIAN_32BITWORD + #undef ENDIAN_64BITWORD + #undef LTC_FAST + #undef LTC_FAST_TYPE + #define LTC_NO_ROLC + #define LTC_NO_BSWAP +#endif + +/* #define ENDIAN_LITTLE */ +/* #define ENDIAN_BIG */ + +/* #define ENDIAN_32BITWORD */ +/* #define ENDIAN_64BITWORD */ + +#if (defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) && !(defined(ENDIAN_32BITWORD) || defined(ENDIAN_64BITWORD)) + #error You must specify a word size as well as endianess in tomcrypt_cfg.h +#endif + +#if !(defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) + #define ENDIAN_NEUTRAL +#endif + +#if (defined(ENDIAN_32BITWORD) && defined(ENDIAN_64BITWORD)) + #error Can not be 32 and 64 bit words... +#endif + +/* gcc 4.3 and up has a bswap builtin; detect it by gcc version. + * clang also supports the bswap builtin, and although clang pretends + * to be gcc (macro-wise, anyway), clang pretends to be a version + * prior to gcc 4.3, so we can't detect bswap that way. Instead, + * clang has a __has_builtin mechanism that can be used to check + * for builtins: + * http://clang.llvm.org/docs/LanguageExtensions.html#feature_check */ +#ifndef __has_builtin + #define __has_builtin(x) 0 +#endif +#if !defined(LTC_NO_BSWAP) && defined(__GNUC__) && \ + ((__GNUC__ * 100 + __GNUC_MINOR__ >= 403) || \ + (__has_builtin(__builtin_bswap32) && __has_builtin(__builtin_bswap64))) + #define LTC_HAVE_BSWAP_BUILTIN +#endif + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_cfg.h,v $ */ +/* $Revision: 1.19 $ */ +/* $Date: 2006/12/04 02:19:48 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_cipher.h b/core/lib/libtomcrypt/include/tomcrypt_cipher.h new file mode 100644 index 0000000..9a2647e --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_cipher.h @@ -0,0 +1,618 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* ---- SYMMETRIC KEY STUFF ----- + * + * We put each of the ciphers scheduled keys in their own structs then we put all of + * the key formats in one union. This makes the function prototypes easier to use. + */ + +#ifdef LTC_RIJNDAEL +struct rijndael_key { + ulong32 eK[60], dK[60]; + int Nr; +}; +#endif + + +#ifdef LTC_DES +struct des_key { + ulong32 ek[32], dk[32]; +}; + +struct des3_key { + ulong32 ek[3][32], dk[3][32]; +}; +#endif + + +typedef union Symmetric_key { +#ifdef LTC_DES + struct des_key des; + struct des3_key des3; +#endif +#ifdef LTC_RIJNDAEL + struct rijndael_key rijndael; +#endif + void *data; +} symmetric_key; + +#ifdef LTC_ECB_MODE +/** A block cipher ECB structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen; + /** The scheduled key */ + symmetric_key key; +} symmetric_ECB; +#endif + +#ifdef LTC_CFB_MODE +/** A block cipher CFB structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen, + /** The padding offset */ + padlen; + /** The current IV */ + unsigned char IV[MAXBLOCKSIZE], + /** The pad used to encrypt/decrypt */ + pad[MAXBLOCKSIZE]; + /** The scheduled key */ + symmetric_key key; +} symmetric_CFB; +#endif + +#ifdef LTC_OFB_MODE +/** A block cipher OFB structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen, + /** The padding offset */ + padlen; + /** The current IV */ + unsigned char IV[MAXBLOCKSIZE]; + /** The scheduled key */ + symmetric_key key; +} symmetric_OFB; +#endif + +#ifdef LTC_CBC_MODE +/** A block cipher CBC structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen; + /** The current IV */ + unsigned char IV[MAXBLOCKSIZE]; + /** The scheduled key */ + symmetric_key key; +} symmetric_CBC; +#endif + + +#ifdef LTC_CTR_MODE +/** A block cipher CTR structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen, + /** The padding offset */ + padlen, + /** The mode (endianess) of the CTR, 0==little, 1==big */ + mode, + /** counter width */ + ctrlen; + + /** The counter */ + unsigned char ctr[MAXBLOCKSIZE], + /** The pad used to encrypt/decrypt */ + pad[MAXBLOCKSIZE]; + /** The scheduled key */ + symmetric_key key; +} symmetric_CTR; +#endif + + +#ifdef LTC_LRW_MODE +/** A LRW structure */ +typedef struct { + /** The index of the cipher chosen (must be a 128-bit block cipher) */ + int cipher; + + /** The current IV */ + unsigned char IV[16], + + /** the tweak key */ + tweak[16], + + /** The current pad, it's the product of the first 15 bytes against the tweak key */ + pad[16]; + + /** The scheduled symmetric key */ + symmetric_key key; + +#ifdef LTC_LRW_TABLES + /** The pre-computed multiplication table */ + unsigned char PC[16][256][16]; +#endif +} symmetric_LRW; +#endif + +#ifdef LTC_F8_MODE +/** A block cipher F8 structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen, + /** The padding offset */ + padlen; + /** The current IV */ + unsigned char IV[MAXBLOCKSIZE], + MIV[MAXBLOCKSIZE]; + /** Current block count */ + ulong32 blockcnt; + /** The scheduled key */ + symmetric_key key; +} symmetric_F8; +#endif + + +/** cipher descriptor table, last entry has "name == NULL" to mark the end of table */ +extern const struct ltc_cipher_descriptor { + /** name of cipher */ + const char *name; + /** internal ID */ + unsigned char ID; + /** min keysize (octets) */ + int min_key_length, + /** max keysize (octets) */ + max_key_length, + /** block size (octets) */ + block_length, + /** default number of rounds */ + default_rounds; + /** Setup the cipher + @param key The input symmetric key + @param keylen The length of the input key (octets) + @param num_rounds The requested number of rounds (0==default) + @param skey [out] The destination of the scheduled key + @return CRYPT_OK if successful + */ + int (*setup)(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); + /** Encrypt a block + @param pt The plaintext + @param ct [out] The ciphertext + @param skey The scheduled key + @return CRYPT_OK if successful + */ + int (*ecb_encrypt)(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); + /** Decrypt a block + @param ct The ciphertext + @param pt [out] The plaintext + @param skey The scheduled key + @return CRYPT_OK if successful + */ + int (*ecb_decrypt)(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); + /** Test the block cipher + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled + */ + int (*test)(void); + + /** Terminate the context + @param skey The scheduled key + */ + void (*done)(symmetric_key *skey); + + /** Determine a key size + @param keysize [in/out] The size of the key desired and the suggested size + @return CRYPT_OK if successful + */ + int (*keysize)(int *keysize); + +/** Accelerators **/ + /** Accelerated ECB encryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_ecb_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, symmetric_key *skey); + + /** Accelerated ECB decryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_ecb_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, symmetric_key *skey); + + /** Accelerated CBC encryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_cbc_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, symmetric_key *skey); + + /** Accelerated CBC decryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_cbc_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, symmetric_key *skey); + + /** Accelerated CTR encryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param mode little or big endian counter (mode=0 or mode=1) + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_ctr_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, int mode, symmetric_key *skey); + + /** Accelerated LRW + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param tweak The LRW tweak + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_lrw_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey); + + /** Accelerated LRW + @param ct Ciphertext + @param pt Plaintext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param tweak The LRW tweak + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_lrw_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey); + + /** Accelerated CCM packet (one-shot) + @param key The secret key to use + @param keylen The length of the secret key (octets) + @param uskey A previously scheduled key [optional can be NULL] + @param nonce The session nonce [use once] + @param noncelen The length of the nonce + @param header The header for the session + @param headerlen The length of the header (octets) + @param pt [out] The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext + @param tag [out] The destination tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @param direction Encrypt or Decrypt direction (0 or 1) + @return CRYPT_OK if successful + */ + int (*accel_ccm_memory)( + const unsigned char *key, unsigned long keylen, + symmetric_key *uskey, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction); + + /** Accelerated GCM packet (one shot) + @param key The secret key + @param keylen The length of the secret key + @param IV The initial vector + @param IVlen The length of the initial vector + @param adata The additional authentication data (header) + @param adatalen The length of the adata + @param pt The plaintext + @param ptlen The length of the plaintext (ciphertext length is the same) + @param ct The ciphertext + @param tag [out] The MAC tag + @param taglen [in/out] The MAC tag length + @param direction Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT) + @return CRYPT_OK on success + */ + int (*accel_gcm_memory)( + const unsigned char *key, unsigned long keylen, + const unsigned char *IV, unsigned long IVlen, + const unsigned char *adata, unsigned long adatalen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction); + + /** Accelerated one shot LTC_OMAC + @param key The secret key + @param keylen The key length (octets) + @param in The message + @param inlen Length of message (octets) + @param out [out] Destination for tag + @param outlen [in/out] Initial and final size of out + @return CRYPT_OK on success + */ + int (*omac_memory)( + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + + /** Accelerated one shot XCBC + @param key The secret key + @param keylen The key length (octets) + @param in The message + @param inlen Length of message (octets) + @param out [out] Destination for tag + @param outlen [in/out] Initial and final size of out + @return CRYPT_OK on success + */ + int (*xcbc_memory)( + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + + /** Accelerated one shot F9 + @param key The secret key + @param keylen The key length (octets) + @param in The message + @param inlen Length of message (octets) + @param out [out] Destination for tag + @param outlen [in/out] Initial and final size of out + @return CRYPT_OK on success + @remark Requires manual padding + */ + int (*f9_memory)( + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + + /** Accelerated XTS encryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param tweak The 128-bit encryption tweak (input/output). + The tweak should not be encrypted on input, but + next tweak will be copied encrypted on output. + @param skey1 The first scheduled key context + @param skey2 The second scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_xts_encrypt)(const unsigned char *pt, unsigned char *ct, + unsigned long blocks, unsigned char *tweak, symmetric_key *skey1, + symmetric_key *skey2); + + /** Accelerated XTS decryption + @param ct Ciphertext + @param pt Plaintext + @param blocks The number of complete blocks to process + @param tweak The 128-bit encryption tweak (input/output). + The tweak should not be encrypted on input, but + next tweak will be copied encrypted on output. + @param skey1 The first scheduled key context + @param skey2 The second scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_xts_decrypt)(const unsigned char *ct, unsigned char *pt, + unsigned long blocks, unsigned char *tweak, symmetric_key *skey1, + symmetric_key *skey2); +} *cipher_descriptor[]; + + +/* make aes an alias */ +#define aes_setup rijndael_setup +#define aes_ecb_encrypt rijndael_ecb_encrypt +#define aes_ecb_decrypt rijndael_ecb_decrypt +#define aes_test rijndael_test +#define aes_done rijndael_done +#define aes_keysize rijndael_keysize + +#define aes_enc_setup rijndael_enc_setup +#define aes_enc_ecb_encrypt rijndael_enc_ecb_encrypt +#define aes_enc_keysize rijndael_enc_keysize + +int rijndael_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int rijndael_test(void); +void rijndael_done(symmetric_key *skey); +int rijndael_keysize(int *keysize); +int rijndael_enc_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int rijndael_enc_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +void rijndael_enc_done(symmetric_key *skey); +int rijndael_enc_keysize(int *keysize); +extern const struct ltc_cipher_descriptor rijndael_desc, aes_desc; +extern const struct ltc_cipher_descriptor rijndael_enc_desc, aes_enc_desc; + + + + +int des_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int des_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int des_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int des_test(void); +void des_done(symmetric_key *skey); +int des_keysize(int *keysize); +int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int des3_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int des3_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int des3_test(void); +void des3_done(symmetric_key *skey); +int des3_keysize(int *keysize); +extern const struct ltc_cipher_descriptor des_desc, des3_desc; + + +#ifdef LTC_ECB_MODE +int ecb_start(int cipher, const unsigned char *key, + int keylen, int num_rounds, symmetric_ECB *ecb); +int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_ECB *ecb); +int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_ECB *ecb); +int ecb_done(symmetric_ECB *ecb); +#endif + +#ifdef LTC_CFB_MODE +int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_CFB *cfb); +int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CFB *cfb); +int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CFB *cfb); +int cfb_getiv(unsigned char *IV, unsigned long *len, symmetric_CFB *cfb); +int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb); +int cfb_done(symmetric_CFB *cfb); +#endif + +#ifdef LTC_OFB_MODE +int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_OFB *ofb); +int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_OFB *ofb); +int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_OFB *ofb); +int ofb_getiv(unsigned char *IV, unsigned long *len, symmetric_OFB *ofb); +int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb); +int ofb_done(symmetric_OFB *ofb); +#endif + +#ifdef LTC_CBC_MODE +int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_CBC *cbc); +int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CBC *cbc); +int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CBC *cbc); +int cbc_getiv(unsigned char *IV, unsigned long *len, symmetric_CBC *cbc); +int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc); +int cbc_done(symmetric_CBC *cbc); +#endif + +#ifdef LTC_CTR_MODE + +#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 +#define CTR_COUNTER_BIG_ENDIAN 0x1000 +#define LTC_CTR_RFC3686 0x2000 + +int ctr_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, + int num_rounds, int ctr_mode, + symmetric_CTR *ctr); +int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CTR *ctr); +int ctr_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CTR *ctr); +int ctr_getiv(unsigned char *IV, unsigned long *len, symmetric_CTR *ctr); +int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr); +int ctr_done(symmetric_CTR *ctr); +int ctr_test(void); +#endif + +#ifdef LTC_LRW_MODE + +#define LRW_ENCRYPT 0 +#define LRW_DECRYPT 1 + +int lrw_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, + const unsigned char *tweak, + int num_rounds, + symmetric_LRW *lrw); +int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_LRW *lrw); +int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_LRW *lrw); +int lrw_getiv(unsigned char *IV, unsigned long *len, symmetric_LRW *lrw); +int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw); +int lrw_done(symmetric_LRW *lrw); +int lrw_test(void); + +/* don't call */ +int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, int mode, symmetric_LRW *lrw); +#endif + +#ifdef LTC_F8_MODE +int f8_start( int cipher, const unsigned char *IV, + const unsigned char *key, int keylen, + const unsigned char *salt_key, int skeylen, + int num_rounds, symmetric_F8 *f8); +int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_F8 *f8); +int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_F8 *f8); +int f8_getiv(unsigned char *IV, unsigned long *len, symmetric_F8 *f8); +int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8); +int f8_done(symmetric_F8 *f8); +int f8_test_mode(void); +#endif + +#ifdef LTC_XTS_MODE +typedef struct { + symmetric_key key1, key2; + int cipher; +} symmetric_xts; + +int xts_start( int cipher, + const unsigned char *key1, + const unsigned char *key2, + unsigned long keylen, + int num_rounds, + symmetric_xts *xts); + +int xts_encrypt( + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tweak, + symmetric_xts *xts); +int xts_decrypt( + const unsigned char *ct, unsigned long ptlen, + unsigned char *pt, + unsigned char *tweak, + symmetric_xts *xts); + +void xts_done(symmetric_xts *xts); +int xts_test(void); +void xts_mult_x(unsigned char *I); +#endif + +int find_cipher(const char *name); +int find_cipher_any(const char *name, int blocklen, int keylen); +int find_cipher_id(unsigned char ID); +int register_cipher(const struct ltc_cipher_descriptor *cipher); +int unregister_cipher(const struct ltc_cipher_descriptor *cipher); +int cipher_is_valid(int idx); + +LTC_MUTEX_PROTO(ltc_cipher_mutex) + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_cipher.h,v $ */ +/* $Revision: 1.54 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_custom.h b/core/lib/libtomcrypt/include/tomcrypt_custom.h new file mode 100644 index 0000000..aadce56 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_custom.h @@ -0,0 +1,545 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * Copyright (c) 2014, STMicroelectronics International N.V. + * + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef TOMCRYPT_CUSTOM_H_ +#define TOMCRYPT_CUSTOM_H_ + +#define LTC_NO_PROTOTYPES +#define LTC_SOURCE +#define LTC_NO_TABLES +// #define LTC_VERBOSE +#define LTC_NO_TEST + +/* macros for various libc functions you can change for embedded targets */ +#ifndef XMALLOC + #ifdef malloc + #define LTC_NO_PROTOTYPES + #endif +#define XMALLOC malloc +#endif +#ifndef XREALLOC + #ifdef realloc + #define LTC_NO_PROTOTYPES + #endif +#define XREALLOC realloc +#endif +#ifndef XCALLOC + #ifdef calloc + #define LTC_NO_PROTOTYPES + #endif +#define XCALLOC calloc +#endif +#ifndef XFREE + #ifdef free + #define LTC_NO_PROTOTYPES + #endif +#define XFREE free +#endif + +#ifndef XMEMSET + #ifdef memset + #define LTC_NO_PROTOTYPES + #endif +#define XMEMSET memset +#endif +#ifndef XMEMCPY + #ifdef memcpy + #define LTC_NO_PROTOTYPES + #endif +#define XMEMCPY memcpy +#endif +#ifndef XMEMCMP + #ifdef memcmp + #define LTC_NO_PROTOTYPES + #endif +#define XMEMCMP memcmp +#endif +#ifndef XMEM_NEQ +#include <string_ext.h> +#define XMEM_NEQ buf_compare_ct +#endif +#ifndef XSTRCMP + #ifdef strcmp + #define LTC_NO_PROTOTYPES + #endif +#define XSTRCMP strcmp +#endif + +#ifndef XCLOCK +#define XCLOCK clock +#endif +#ifndef XCLOCKS_PER_SEC +#define XCLOCKS_PER_SEC CLOCKS_PER_SEC +#endif + +#ifndef XQSORT + #ifdef qsort + #define LTC_NO_PROTOTYPES + #endif +#define XQSORT qsort +#endif + +/* Easy button? */ +#ifdef LTC_EASY + #define LTC_NO_CIPHERS + #define LTC_RIJNDAEL + #define LTC_BLOWFISH + #define LTC_DES + #define LTC_CAST5 + + #define LTC_NO_MODES + #define LTC_ECB_MODE + #define LTC_CBC_MODE + #define LTC_CTR_MODE + + #define LTC_NO_HASHES + #define LTC_SHA1 + #define LTC_SHA512 + #define LTC_SHA384 + #define LTC_SHA256 + #define LTC_SHA224 + + + #define LTC_NO_MACS + #define LTC_HMAC + #define LTC_OMAC + #define LTC_CCM_MODE + + #define LTC_NO_PRNGS + #define LTC_SPRNG + #define LTC_DEVRANDOM + #define LTC_TRY_URANDOM_FIRST + + #define LTC_NO_PK + #define LTC_MRSA + #define LTC_MECC +#endif + +/* Set LTC_ options based on OP-TEE configuration */ + +#define LTC_NO_CIPHERS + +#ifdef CFG_CRYPTO_AES + #define LTC_RIJNDAEL +#endif +#ifdef CFG_CRYPTO_DES + #define LTC_DES +#endif + +#define LTC_NO_MODES + +#ifdef CFG_CRYPTO_ECB + #define LTC_ECB_MODE +#endif +#if defined(CFG_CRYPTO_CBC) || defined(CFG_CRYPTO_CBC_MAC) + #define LTC_CBC_MODE +#endif +#ifdef CFG_CRYPTO_CTR + #define LTC_CTR_MODE +#endif +#ifdef CFG_CRYPTO_XTS + #define LTC_XTS_MODE +#endif + +#define LTC_NO_HASHES + +#ifdef CFG_CRYPTO_MD5 +#define LTC_MD5 +#endif +#ifdef CFG_CRYPTO_SHA1 +#define LTC_SHA1 +#endif +#ifdef CFG_CRYPTO_SHA1_ARM32_CE +#define LTC_SHA1_ARM32_CE +#endif +#ifdef CFG_CRYPTO_SHA1_ARM64_CE +#define LTC_SHA1_ARM64_CE +#endif +#ifdef CFG_CRYPTO_SHA224 +#define LTC_SHA224 +#endif +#ifdef CFG_CRYPTO_SHA256 +#define LTC_SHA256 +#endif +#ifdef CFG_CRYPTO_SHA256_ARM32_CE +#define LTC_SHA256_ARM32_CE +#endif +#ifdef CFG_CRYPTO_SHA256_ARM64_CE +#define LTC_SHA256_ARM64_CE +#endif +#ifdef CFG_CRYPTO_SHA384 +#define LTC_SHA384 +#endif +#ifdef CFG_CRYPTO_SHA512 +#define LTC_SHA512 +#endif + +#define LTC_NO_MACS + +#ifdef CFG_CRYPTO_HMAC + #define LTC_HMAC +#endif +#ifdef CFG_CRYPTO_CMAC + #define LTC_OMAC +#endif +#ifdef CFG_CRYPTO_CCM + #define LTC_CCM_MODE +#endif +#ifdef CFG_CRYPTO_GCM + #define LTC_GCM_MODE +#endif + +#define LTC_NO_PK + +#ifdef CFG_CRYPTO_RSA + #define LTC_MRSA +#endif +#ifdef CFG_CRYPTO_DSA + #define LTC_MDSA +#endif +#ifdef CFG_CRYPTO_DH + #define LTC_MDH +#endif +#ifdef CFG_CRYPTO_ECC + #define LTC_MECC + + /* use Shamir's trick for point mul (speeds up signature verification) */ + #define LTC_ECC_SHAMIR + + #if defined(TFM_LTC_DESC) && defined(LTC_MECC) + #define LTC_MECC_ACCEL + #endif + + /* do we want fixed point ECC */ + /* #define LTC_MECC_FP */ + + /* Timing Resistant */ + #define LTC_ECC_TIMING_RESISTANT + + #define LTC_ECC192 + #define LTC_ECC224 + #define LTC_ECC256 + #define LTC_ECC384 + #define LTC_ECC521 + + /* ECC 521 bits is the max supported key size */ + #define LTC_MAX_ECC 521 +#endif + +#define LTC_NO_PKCS + +#if defined(CFG_CRYPTO_RSA) || defined(CFG_CRYPTO_DSA) || \ + defined(CFG_CRYPTO_ECC) + #define LTC_DER +#endif + +/* Use small code where possible */ +/* #define LTC_SMALL_CODE */ + +/* Enable self-test test vector checking */ +#ifndef LTC_NO_TEST + #define LTC_TEST +#endif + +/* clean the stack of functions which put private information on stack */ +/* #define LTC_CLEAN_STACK */ + +/* disable all file related functions */ +#define LTC_NO_FILE + +/* disable all forms of ASM */ +#define LTC_NO_ASM + +/* disable FAST mode */ +/* #define LTC_NO_FAST */ + +/* disable BSWAP on x86 */ +/* #define LTC_NO_BSWAP */ + +/* ---> Symmetric Block Ciphers <--- */ + +#ifndef LTC_NO_CIPHERS + +#define LTC_RIJNDAEL + +/* LTC_DES includes EDE triple-LTC_DES */ +#define LTC_DES + +#endif + +/* ---> Block Cipher Modes of Operation <--- */ +#ifndef LTC_NO_MODES + +#define LTC_CFB_MODE +#define LTC_OFB_MODE +#define LTC_ECB_MODE +#define LTC_CBC_MODE +#define LTC_CTR_MODE + +/* F8 chaining mode */ +#define LTC_F8_MODE + +/* LRW mode */ +#define LTC_LRW_MODE +#ifndef LTC_NO_TABLES + /* like GCM mode this will enable 16 8x128 tables [64KB] that make + * seeking very fast. + */ + #define LTC_LRW_TABLES +#endif + +/* XTS mode */ +#define LTC_XTS_MODE + +#endif /* LTC_NO_MODES */ + +/* ---> One-Way Hash Functions <--- */ +#ifndef LTC_NO_HASHES + +#define LTC_SHA512 +#define LTC_SHA384 +#define LTC_SHA256 +#define LTC_SHA224 +#define LTC_SHA1 +#define LTC_MD5 + + + +#endif /* LTC_NO_HASHES */ + +/* ---> MAC functions <--- */ +#ifndef LTC_NO_MACS + +#define LTC_HMAC +#define LTC_OMAC +#define LTC_PMAC +#define LTC_XCBC + + +/* ---> Encrypt + Authenticate Modes <--- */ + +#define LTC_EAX_MODE +#if defined(LTC_EAX_MODE) && !(defined(LTC_CTR_MODE) && defined(LTC_OMAC)) + #error LTC_EAX_MODE requires CTR and LTC_OMAC mode +#endif + +#define LTC_OCB_MODE +#define LTC_CCM_MODE +#define LTC_GCM_MODE + +/* Use 64KiB tables */ +#ifndef LTC_NO_TABLES + #define LTC_GCM_TABLES +#endif + +/* USE SSE2? requires GCC works on x86_32 and x86_64*/ +#ifdef LTC_GCM_TABLES +/* #define LTC_GCM_TABLES_SSE2 */ +#endif + +#endif /* LTC_NO_MACS */ + +/* Various tidbits of modern neatoness */ +#define LTC_BASE64 + +/* --> Pseudo Random Number Generators <--- */ +#ifndef LTC_NO_PRNGS + +/* a PRNG that simply reads from an available system source */ +#define LTC_SPRNG + +/* The LTC_RC4 stream cipher */ +#define LTC_RC4 + +/* Fortuna PRNG */ +#define LTC_FORTUNA +/* reseed every N calls to the read function */ +#define LTC_FORTUNA_WD 10 +/* number of pools (4..32) can save a bit of ram by lowering the count */ +#define LTC_FORTUNA_POOLS 32 + +/* the *nix style /dev/random device */ +#define LTC_DEVRANDOM +/* try /dev/urandom before trying /dev/random */ +#define LTC_TRY_URANDOM_FIRST + +#endif /* LTC_NO_PRNGS */ + +/* ---> Public Key Crypto <--- */ +#ifndef LTC_NO_PK + +/* Include RSA support */ +#define LTC_MRSA + +/* Include Diffie-Hellman support */ +/* + * From libtomcrypt.org: + * DH vanished because nobody used it and it was a pain to support + * DH support rewritten by ST + */ +#define LTC_MDH + +/* Include Katja (a Rabin variant like RSA) */ +/* #define LTC_MKAT */ + +/* Digital Signature Algorithm */ +#define LTC_MDSA + +/* ECC */ +#define LTC_MECC + +/* use Shamir's trick for point mul (speeds up signature verification) */ +#define LTC_ECC_SHAMIR + +#if defined(TFM_LTC_DESC) && defined(LTC_MECC) + #define LTC_MECC_ACCEL +#endif + +/* do we want fixed point ECC */ +/* #define LTC_MECC_FP */ + +/* Timing Resistant? */ +/* #define LTC_ECC_TIMING_RESISTANT */ + +#endif /* LTC_NO_PK */ + +/* in cases where you want ASN.1/DER functionality, but no + * RSA, you can define this externally if 1024 is not enough + */ +#if defined(LTC_MRSA) +#define LTC_DER_MAX_PUBKEY_SIZE MAX_RSA_SIZE +#elif !defined(LTC_DER_MAX_PUBKEY_SIZE) +/* this includes DSA */ +#define LTC_DER_MAX_PUBKEY_SIZE 1024 +#endif + +/* LTC_PKCS #1 (RSA) and #5 (Password Handling) stuff */ +#ifndef LTC_NO_PKCS + +#define LTC_PKCS_1 +#define LTC_PKCS_5 + +/* Include ASN.1 DER (required by DSA/RSA) */ +#define LTC_DER + +#endif /* LTC_NO_PKCS */ + +/* cleanup */ + +#if defined(LTC_MECC) || defined(LTC_MRSA) || defined(LTC_MDSA) || \ + defined(MKATJA) || defined(LTC_MDH) + /* Include the MPI functionality? (required by the PK algorithms) */ + #define LTC_MPI +#endif + +#ifdef LTC_MRSA + #define LTC_PKCS_1 +#endif + +#if defined(LTC_DER) && !defined(LTC_MPI) + #error ASN.1 DER requires MPI functionality +#endif + +#if (defined(LTC_MDSA) || defined(LTC_MRSA) || defined(LTC_MECC) || defined(MKATJA)) && !defined(LTC_DER) + #error PK requires ASN.1 DER functionality, make sure LTC_DER is enabled +#endif + + +/* THREAD management */ +#if defined(CFG_LTC_OPTEE_THREAD) + +#include <kernel/mutex.h> + +#define LTC_MUTEX_GLOBAL(x) struct mutex x = MUTEX_INITIALIZER; +#define LTC_MUTEX_PROTO(x) extern struct mutex x; +#define LTC_MUTEX_TYPE(x) struct mutex x; +#define LTC_MUTEX_INIT(x) mutex_init(x); +#define LTC_MUTEX_LOCK(x) mutex_lock(x); +#define LTC_MUTEX_UNLOCK(x) mutex_unlock(x); + +#elif defined(LTC_PTHREAD) + +#include <pthread.h> + +#define LTC_MUTEX_GLOBAL(x) pthread_mutex_t x = PTHREAD_MUTEX_INITIALIZER; +#define LTC_MUTEX_PROTO(x) extern pthread_mutex_t x; +#define LTC_MUTEX_TYPE(x) pthread_mutex_t x; +#define LTC_MUTEX_INIT(x) pthread_mutex_init(x, NULL); +#define LTC_MUTEX_LOCK(x) pthread_mutex_lock(x); +#define LTC_MUTEX_UNLOCK(x) pthread_mutex_unlock(x); + +#else + +/* default no functions */ +#define LTC_MUTEX_GLOBAL(x) +#define LTC_MUTEX_PROTO(x) +#define LTC_MUTEX_TYPE(x) +#define LTC_MUTEX_INIT(x) +#define LTC_MUTEX_LOCK(x) +#define LTC_MUTEX_UNLOCK(x) + +#endif + +/* + * Here are a list of fixes required in libtomcrypt + */ + +#define LTC_LINARO_FIX_RSAWITHOUTCRT + +/* + * From libtomcrypt.org: + * DH vanished because nobody used it and it was a pain to support + * DH support was adapted from the master branch of libtomcrypt that can be + * found at + * http://dev.openaos.org/browser/trunk/buildroot/gen7/buildroot/package/libtomcrypt/libtomcrypt-dh.patch + * The original version was not taken as it makes use of static const array + * containing base and prime, and did not include subprime and x-bits + * constraints + */ +#define LTC_LINARO_FIX_DH + +/* + * XTS encryption / decryption does not update the tweak when successive + * operations are performed. + * Defining LTC_LINARO_FIX_XTS fixes this. + */ +#define LTC_LINARO_FIX_XTS + +/* Debuggers */ + +/* define this if you use Valgrind, note: it CHANGES the way SOBER-128 and LTC_RC4 work (see the code) */ +/* #define LTC_VALGRIND */ + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_custom.h,v $ */ +/* $Revision: 1.73 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_hash.h b/core/lib/libtomcrypt/include/tomcrypt_hash.h new file mode 100644 index 0000000..18ff4a2 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_hash.h @@ -0,0 +1,427 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* ---- HASH FUNCTIONS ---- */ +#ifdef LTC_SHA512 +struct sha512_state { + ulong64 length, state[8]; + unsigned long curlen; + unsigned char buf[128]; +}; +#endif + +#if defined(LTC_SHA256) || defined(LTC_SHA256_ARM32_CE) +struct sha256_state { + ulong64 length; + ulong32 state[8], curlen; + unsigned char buf[64]; +}; +#endif + +#if defined(LTC_SHA1) || defined(LTC_SHA1_ARM32_CE) || defined(LTC_SHA1_ARM64_CE) +struct sha1_state { + ulong64 length; + ulong32 state[5], curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef LTC_MD5 +struct md5_state { + ulong64 length; + ulong32 state[4], curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef LTC_MD4 +struct md4_state { + ulong64 length; + ulong32 state[4], curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef LTC_TIGER +struct tiger_state { + ulong64 state[3], length; + unsigned long curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef LTC_MD2 +struct md2_state { + unsigned char chksum[16], X[48], buf[16]; + unsigned long curlen; +}; +#endif + +#ifdef LTC_RIPEMD128 +struct rmd128_state { + ulong64 length; + unsigned char buf[64]; + ulong32 curlen, state[4]; +}; +#endif + +#ifdef LTC_RIPEMD160 +struct rmd160_state { + ulong64 length; + unsigned char buf[64]; + ulong32 curlen, state[5]; +}; +#endif + +#ifdef LTC_RIPEMD256 +struct rmd256_state { + ulong64 length; + unsigned char buf[64]; + ulong32 curlen, state[8]; +}; +#endif + +#ifdef LTC_RIPEMD320 +struct rmd320_state { + ulong64 length; + unsigned char buf[64]; + ulong32 curlen, state[10]; +}; +#endif + +#ifdef LTC_WHIRLPOOL +struct whirlpool_state { + ulong64 length, state[8]; + unsigned char buf[64]; + ulong32 curlen; +}; +#endif + +#ifdef LTC_CHC_HASH +struct chc_state { + ulong64 length; + unsigned char state[MAXBLOCKSIZE], buf[MAXBLOCKSIZE]; + ulong32 curlen; +}; +#endif + +typedef union Hash_state { + char dummy[1]; +#ifdef LTC_CHC_HASH + struct chc_state chc; +#endif +#ifdef LTC_WHIRLPOOL + struct whirlpool_state whirlpool; +#endif +#ifdef LTC_SHA512 + struct sha512_state sha512; +#endif +#if defined(LTC_SHA256) || defined(LTC_SHA256_ARM32_CE) + struct sha256_state sha256; +#endif +#if defined(LTC_SHA1) || defined(LTC_SHA1_ARM32_CE) + struct sha1_state sha1; +#endif +#ifdef LTC_MD5 + struct md5_state md5; +#endif +#ifdef LTC_MD4 + struct md4_state md4; +#endif +#ifdef LTC_MD2 + struct md2_state md2; +#endif +#ifdef LTC_TIGER + struct tiger_state tiger; +#endif +#ifdef LTC_RIPEMD128 + struct rmd128_state rmd128; +#endif +#ifdef LTC_RIPEMD160 + struct rmd160_state rmd160; +#endif +#ifdef LTC_RIPEMD256 + struct rmd256_state rmd256; +#endif +#ifdef LTC_RIPEMD320 + struct rmd320_state rmd320; +#endif + void *data; +} hash_state; + +/** hash descriptor */ +extern const struct ltc_hash_descriptor { + /** name of hash */ + const char *name; + /** internal ID */ + unsigned char ID; + /** Size of digest in octets */ + unsigned long hashsize; + /** Input block size in octets */ + unsigned long blocksize; + /** ASN.1 OID */ + unsigned long OID[16]; + /** Length of DER encoding */ + unsigned long OIDlen; + + /** Init a hash state + @param hash The hash to initialize + @return CRYPT_OK if successful + */ + int (*init)(hash_state *hash); + /** Process a block of data + @param hash The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful + */ + int (*process)(hash_state *hash, const unsigned char *in, unsigned long inlen); + /** Produce the digest and store it + @param hash The hash state + @param out [out] The destination of the digest + @return CRYPT_OK if successful + */ + int (*done)(hash_state *hash, unsigned char *out); + /** Self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled + */ + int (*test)(void); + + /* accelerated hmac callback: if you need to-do multiple packets just use the generic hmac_memory and provide a hash callback */ + int (*hmac_block)(const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +} *hash_descriptor[]; + +#ifdef LTC_CHC_HASH +int chc_register(int cipher); +int chc_init(hash_state * md); +int chc_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int chc_done(hash_state * md, unsigned char *hash); +int chc_test(void); +extern const struct ltc_hash_descriptor chc_desc; +#endif + +#ifdef LTC_WHIRLPOOL +int whirlpool_init(hash_state * md); +int whirlpool_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int whirlpool_done(hash_state * md, unsigned char *hash); +int whirlpool_test(void); +extern const struct ltc_hash_descriptor whirlpool_desc; +#endif + +#ifdef LTC_SHA512 +int sha512_init(hash_state * md); +int sha512_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int sha512_done(hash_state * md, unsigned char *hash); +int sha512_test(void); +extern const struct ltc_hash_descriptor sha512_desc; +#endif + +#ifdef LTC_SHA384 +#ifndef LTC_SHA512 + #error LTC_SHA512 is required for LTC_SHA384 +#endif +int sha384_init(hash_state * md); +#define sha384_process sha512_process +int sha384_done(hash_state * md, unsigned char *hash); +int sha384_test(void); +extern const struct ltc_hash_descriptor sha384_desc; +#endif + +#if defined(LTC_SHA256) || defined(LTC_SHA256_ARM32_CE) +int sha256_init(hash_state * md); +int sha256_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int sha256_done(hash_state * md, unsigned char *hash); +int sha256_test(void); +extern const struct ltc_hash_descriptor sha256_desc; + +#ifdef LTC_SHA224 +#ifndef LTC_SHA256 + #error LTC_SHA256 is required for LTC_SHA224 +#endif +int sha224_init(hash_state * md); +#define sha224_process sha256_process +int sha224_done(hash_state * md, unsigned char *hash); +int sha224_test(void); +extern const struct ltc_hash_descriptor sha224_desc; +#endif +#endif + +#if defined(LTC_SHA1) || defined(LTC_SHA1_ARM32_CE) +int sha1_init(hash_state * md); +int sha1_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int sha1_done(hash_state * md, unsigned char *hash); +int sha1_test(void); +extern const struct ltc_hash_descriptor sha1_desc; +#endif + +#ifdef LTC_MD5 +int md5_init(hash_state * md); +int md5_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int md5_done(hash_state * md, unsigned char *hash); +int md5_test(void); +extern const struct ltc_hash_descriptor md5_desc; +#endif + +#ifdef LTC_MD4 +int md4_init(hash_state * md); +int md4_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int md4_done(hash_state * md, unsigned char *hash); +int md4_test(void); +extern const struct ltc_hash_descriptor md4_desc; +#endif + +#ifdef LTC_MD2 +int md2_init(hash_state * md); +int md2_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int md2_done(hash_state * md, unsigned char *hash); +int md2_test(void); +extern const struct ltc_hash_descriptor md2_desc; +#endif + +#ifdef LTC_TIGER +int tiger_init(hash_state * md); +int tiger_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int tiger_done(hash_state * md, unsigned char *hash); +int tiger_test(void); +extern const struct ltc_hash_descriptor tiger_desc; +#endif + +#ifdef LTC_RIPEMD128 +int rmd128_init(hash_state * md); +int rmd128_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int rmd128_done(hash_state * md, unsigned char *hash); +int rmd128_test(void); +extern const struct ltc_hash_descriptor rmd128_desc; +#endif + +#ifdef LTC_RIPEMD160 +int rmd160_init(hash_state * md); +int rmd160_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int rmd160_done(hash_state * md, unsigned char *hash); +int rmd160_test(void); +extern const struct ltc_hash_descriptor rmd160_desc; +#endif + +#ifdef LTC_RIPEMD256 +int rmd256_init(hash_state * md); +int rmd256_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int rmd256_done(hash_state * md, unsigned char *hash); +int rmd256_test(void); +extern const struct ltc_hash_descriptor rmd256_desc; +#endif + +#ifdef LTC_RIPEMD320 +int rmd320_init(hash_state * md); +int rmd320_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int rmd320_done(hash_state * md, unsigned char *hash); +int rmd320_test(void); +extern const struct ltc_hash_descriptor rmd320_desc; +#endif + + +int find_hash(const char *name); +int find_hash_id(unsigned char ID); +int find_hash_oid(const unsigned long *ID, unsigned long IDlen); +int find_hash_any(const char *name, int digestlen); +int register_hash(const struct ltc_hash_descriptor *hash); +int unregister_hash(const struct ltc_hash_descriptor *hash); +int hash_is_valid(int idx); + +LTC_MUTEX_PROTO(ltc_hash_mutex) + +int hash_memory(int hash, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen); +int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen); + +/* a macro for making hash "process" functions */ +#define HASH_PROCESS_(func_name, compress_name, compress_n_name, state_var, block_size) \ +int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ +{ \ + unsigned long n, blocks; \ + int err; \ + int (*compress)(hash_state *, unsigned char *) = compress_name; \ + int (*compress_n)(hash_state *, unsigned char *, int) = compress_n_name; \ + LTC_ARGCHK(md != NULL); \ + LTC_ARGCHK(in != NULL); \ + if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ + return CRYPT_INVALID_ARG; \ + } \ + while (inlen > 0) { \ + if (md-> state_var .curlen == 0 && inlen >= block_size) { \ + if (compress_n) { \ + blocks = inlen / block_size; \ + err = compress_n (md, (unsigned char *)in, blocks); \ + } else { \ + blocks = 1; \ + err = compress (md, (unsigned char *)in); \ + } \ + if (err != CRYPT_OK) \ + return err; \ + md-> state_var .length += blocks * block_size * 8; \ + in += blocks * block_size; \ + inlen -= blocks * block_size; \ + } else { \ + n = MIN(inlen, (block_size - md-> state_var .curlen)); \ + memcpy(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ + md-> state_var .curlen += n; \ + in += n; \ + inlen -= n; \ + if (md-> state_var .curlen == block_size) { \ + if (compress_n) { \ + err = compress_n (md, md-> state_var .buf, 1); \ + } else { \ + err = compress (md, md-> state_var .buf); \ + } \ + if (err != CRYPT_OK) { \ + return err; \ + } \ + md-> state_var .length += 8*block_size; \ + md-> state_var .curlen = 0; \ + } \ + } \ + } \ + return CRYPT_OK; \ +} + +/* define a hash "process" function based on a 1-block compress function */ +#define HASH_PROCESS(func_name, compress_name, state_var, block_size) \ + HASH_PROCESS_(func_name, compress_name, NULL, state_var, block_size) + +/* define a hash "process" function based on a n-block compress function */ +#define HASH_PROCESS_NBLOCKS(func_name, compress_n_name, state_var, block_size) \ + HASH_PROCESS_(func_name, NULL, compress_n_name, state_var, block_size) + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_hash.h,v $ */ +/* $Revision: 1.22 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_mac.h b/core/lib/libtomcrypt/include/tomcrypt_mac.h new file mode 100644 index 0000000..f5843fe --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_mac.h @@ -0,0 +1,449 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifdef LTC_HMAC +typedef struct Hmac_state { + hash_state md; + int hash; + hash_state hashstate; + unsigned char key[MAXBLOCKSIZE]; +} hmac_state; + +int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned long keylen); +int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen); +int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen); +int hmac_test(void); +int hmac_memory(int hash, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int hmac_memory_multi(int hash, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int hmac_file(int hash, const char *fname, const unsigned char *key, + unsigned long keylen, + unsigned char *dst, unsigned long *dstlen); +#endif + +#ifdef LTC_OMAC + +typedef struct { + int cipher_idx, + buflen, + blklen; + unsigned char block[MAXBLOCKSIZE], + prev[MAXBLOCKSIZE], + Lu[2][MAXBLOCKSIZE]; + symmetric_key key; +} omac_state; + +int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned long keylen); +int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen); +int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen); +int omac_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int omac_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int omac_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen); +int omac_test(void); +#endif /* LTC_OMAC */ + +#ifdef LTC_PMAC + +typedef struct { + unsigned char Ls[32][MAXBLOCKSIZE], /* L shifted by i bits to the left */ + Li[MAXBLOCKSIZE], /* value of Li [current value, we calc from previous recall] */ + Lr[MAXBLOCKSIZE], /* L * x^-1 */ + block[MAXBLOCKSIZE], /* currently accumulated block */ + checksum[MAXBLOCKSIZE]; /* current checksum */ + + symmetric_key key; /* scheduled key for cipher */ + unsigned long block_index; /* index # for current block */ + int cipher_idx, /* cipher idx */ + block_len, /* length of block */ + buflen; /* number of bytes in the buffer */ +} pmac_state; + +int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned long keylen); +int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen); +int pmac_done(pmac_state *pmac, unsigned char *out, unsigned long *outlen); + +int pmac_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *msg, unsigned long msglen, + unsigned char *out, unsigned long *outlen); + +int pmac_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); + +int pmac_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen); + +int pmac_test(void); + +/* internal functions */ +int pmac_ntz(unsigned long x); +void pmac_shift_xor(pmac_state *pmac); + +#endif /* PMAC */ + +#ifdef LTC_EAX_MODE + +#if !(defined(LTC_OMAC) && defined(LTC_CTR_MODE)) + #error LTC_EAX_MODE requires LTC_OMAC and CTR +#endif + +typedef struct { + unsigned char N[MAXBLOCKSIZE]; + symmetric_CTR ctr; + omac_state headeromac, ctomac; +} eax_state; + +int eax_init(eax_state *eax, int cipher, const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen); + +int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, unsigned long length); +int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, unsigned long length); +int eax_addheader(eax_state *eax, const unsigned char *header, unsigned long length); +int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen); + +int eax_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen); + +int eax_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + unsigned char *tag, unsigned long taglen, + int *stat); + + int eax_test(void); +#endif /* EAX MODE */ + +#ifdef LTC_OCB_MODE +typedef struct { + unsigned char L[MAXBLOCKSIZE], /* L value */ + Ls[32][MAXBLOCKSIZE], /* L shifted by i bits to the left */ + Li[MAXBLOCKSIZE], /* value of Li [current value, we calc from previous recall] */ + Lr[MAXBLOCKSIZE], /* L * x^-1 */ + R[MAXBLOCKSIZE], /* R value */ + checksum[MAXBLOCKSIZE]; /* current checksum */ + + symmetric_key key; /* scheduled key for cipher */ + unsigned long block_index; /* index # for current block */ + int cipher, /* cipher idx */ + block_len; /* length of block */ +} ocb_state; + +int ocb_init(ocb_state *ocb, int cipher, + const unsigned char *key, unsigned long keylen, const unsigned char *nonce); + +int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct); +int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt); + +int ocb_done_encrypt(ocb_state *ocb, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen); + +int ocb_done_decrypt(ocb_state *ocb, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, int *stat); + +int ocb_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen); + +int ocb_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, + int *stat); + +int ocb_test(void); + +/* internal functions */ +void ocb_shift_xor(ocb_state *ocb, unsigned char *Z); +int ocb_ntz(unsigned long x); +int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, unsigned char *tag, unsigned long *taglen, int mode); + +#endif /* LTC_OCB_MODE */ + +#ifdef LTC_CCM_MODE + +#define CCM_ENCRYPT 0 +#define CCM_DECRYPT 1 + +typedef struct { + symmetric_key K; + int cipher, /* which cipher */ + taglen, /* length of the tag */ + x; /* index in PAD */ + + unsigned long L, /* L value */ + ptlen, /* length that will be enc / dec */ + current_ptlen, /* current processed length */ + aadlen, /* length of the aad */ + current_aadlen, /* length of the currently provided add */ + noncelen; /* length of the nonce */ + + unsigned char PAD[16], + ctr[16], + CTRPAD[16], + CTRlen; +} ccm_state; + +int ccm_init(ccm_state *ccm, int cipher, + const unsigned char *key, int keylen, int ptlen, int taglen, int aad_len); + +int ccm_reset(ccm_state *ccm); + +int ccm_add_nonce(ccm_state *ccm, + const unsigned char *nonce, unsigned long noncelen); + +int ccm_add_aad(ccm_state *ccm, + const unsigned char *adata, unsigned long adatalen); + +int ccm_process(ccm_state *ccm, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + int direction); + +int ccm_done(ccm_state *ccm, + unsigned char *tag, unsigned long *taglen); + +int ccm_memory(int cipher, + const unsigned char *key, unsigned long keylen, + symmetric_key *uskey, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction); + +int ccm_test(void); + +#endif /* LTC_CCM_MODE */ + +#if defined(LRW_MODE) || defined(LTC_GCM_MODE) +void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c); +#endif + + +/* table shared between GCM and LRW */ +#if defined(LTC_GCM_TABLES) || defined(LTC_LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) +extern const unsigned char gcm_shift_table[]; +#endif + +#ifdef LTC_GCM_MODE + +#define GCM_ENCRYPT 0 +#define GCM_DECRYPT 1 + +#define LTC_GCM_MODE_IV 0 +#define LTC_GCM_MODE_AAD 1 +#define LTC_GCM_MODE_TEXT 2 + +typedef struct { + symmetric_key K; + unsigned char H[16], /* multiplier */ + X[16], /* accumulator */ + Y[16], /* counter */ + Y_0[16], /* initial counter */ + buf[16]; /* buffer for stuff */ + + int cipher, /* which cipher */ + ivmode, /* Which mode is the IV in? */ + mode, /* mode the GCM code is in */ + buflen; /* length of data in buf */ + + ulong64 totlen, /* 64-bit counter used for IV and AAD */ + pttotlen; /* 64-bit counter for the PT */ + +#ifdef LTC_GCM_TABLES + unsigned char PC[16][256][16] /* 16 tables of 8x128 */ +#ifdef LTC_GCM_TABLES_SSE2 +__attribute__ ((aligned (16))) +#endif +; +#endif +} gcm_state; + +void gcm_mult_h(gcm_state *gcm, unsigned char *I); + +int gcm_init(gcm_state *gcm, int cipher, + const unsigned char *key, int keylen); + +int gcm_reset(gcm_state *gcm); + +int gcm_add_iv(gcm_state *gcm, + const unsigned char *IV, unsigned long IVlen); + +int gcm_add_aad(gcm_state *gcm, + const unsigned char *adata, unsigned long adatalen); + +int gcm_process(gcm_state *gcm, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + int direction); + +int gcm_done(gcm_state *gcm, + unsigned char *tag, unsigned long *taglen); + +int gcm_memory( int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *IV, unsigned long IVlen, + const unsigned char *adata, unsigned long adatalen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction); +int gcm_test(void); + +#endif /* LTC_GCM_MODE */ + +#ifdef LTC_PELICAN + +typedef struct pelican_state +{ + symmetric_key K; + unsigned char state[16]; + int buflen; +} pelican_state; + +int pelican_init(pelican_state *pelmac, const unsigned char *key, unsigned long keylen); +int pelican_process(pelican_state *pelmac, const unsigned char *in, unsigned long inlen); +int pelican_done(pelican_state *pelmac, unsigned char *out); +int pelican_test(void); + +int pelican_memory(const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out); + +#endif + +#ifdef LTC_XCBC + +/* add this to "keylen" to xcbc_init to use a pure three-key XCBC MAC */ +#define LTC_XCBC_PURE 0x8000UL + +typedef struct { + unsigned char K[3][MAXBLOCKSIZE], + IV[MAXBLOCKSIZE]; + + symmetric_key key; + + int cipher, + buflen, + blocksize; +} xcbc_state; + +int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned long keylen); +int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen); +int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen); +int xcbc_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int xcbc_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int xcbc_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen); +int xcbc_test(void); + +#endif + +#ifdef LTC_F9_MODE + +typedef struct { + unsigned char akey[MAXBLOCKSIZE], + ACC[MAXBLOCKSIZE], + IV[MAXBLOCKSIZE]; + + symmetric_key key; + + int cipher, + buflen, + keylen, + blocksize; +} f9_state; + +int f9_init(f9_state *f9, int cipher, const unsigned char *key, unsigned long keylen); +int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen); +int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen); +int f9_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int f9_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int f9_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen); +int f9_test(void); + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_mac.h,v $ */ +/* $Revision: 1.23 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_macros.h b/core/lib/libtomcrypt/include/tomcrypt_macros.h new file mode 100644 index 0000000..af6f7ca --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_macros.h @@ -0,0 +1,491 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef TOMCRYPT_MACROS_H_ +#define TOMCRYPT_MACROS_H_ + +/* fix for MSVC ...evil! */ +#ifdef _MSC_VER + #define CONST64(n) n ## ui64 + typedef unsigned __int64 ulong64; +#else + #define CONST64(n) n ## ULL + typedef unsigned long long ulong64; +#endif + +/* this is the "32-bit at least" data type + * Re-define it to suit your platform but it must be at least 32-bits + */ +#if defined(__x86_64__) || (defined(__sparc__) && defined(__arch64__)) || \ + defined(__LP64__) + typedef unsigned ulong32; +#else + typedef unsigned long ulong32; +#endif + +#ifdef ENDIAN_64BITWORD +typedef ulong64 ltc_mp_digit; +#else +typedef ulong32 ltc_mp_digit; +#endif + +/* ---- HELPER MACROS ---- */ +#ifdef ENDIAN_NEUTRAL + +#define STORE32L(x, y) \ + do { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) + +#define LOAD32L(x, y) \ + do { x = ((ulong32)((y)[3] & 255)<<24) | \ + ((ulong32)((y)[2] & 255)<<16) | \ + ((ulong32)((y)[1] & 255)<<8) | \ + ((ulong32)((y)[0] & 255)); } while(0) + +#define STORE64L(x, y) \ + do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ + (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ + (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) + +#define LOAD64L(x, y) \ + do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \ + (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32)| \ + (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16)| \ + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0) + +#define STORE32H(x, y) \ + do { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ + (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } while(0) + +#define LOAD32H(x, y) \ + do { x = ((ulong32)((y)[0] & 255)<<24) | \ + ((ulong32)((y)[1] & 255)<<16) | \ + ((ulong32)((y)[2] & 255)<<8) | \ + ((ulong32)((y)[3] & 255)); } while(0) + +#define STORE64H(x, y) \ +do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ + (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ + (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } while(0) + +#define LOAD64H(x, y) \ +do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \ + (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32) | \ + (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16) | \ + (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } while(0) + +#endif /* ENDIAN_NEUTRAL */ + +#ifdef ENDIAN_LITTLE + +#ifdef LTC_HAVE_BSWAP_BUILTIN + +#define STORE32H(x, y) \ +do { ulong32 __t = __builtin_bswap32 ((x)); \ + XMEMCPY ((y), &__t, 4); } while(0) + +#define LOAD32H(x, y) \ +do { XMEMCPY (&(x), (y), 4); \ + (x) = __builtin_bswap32 ((x)); } while(0) + +#elif !defined(LTC_NO_BSWAP) && (defined(INTEL_CC) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__) || defined(__x86_64__)))) + +#define STORE32H(x, y) \ +asm __volatile__ ( \ + "bswapl %0 \n\t" \ + "movl %0,(%1)\n\t" \ + "bswapl %0 \n\t" \ + ::"r"(x), "r"(y)); + +#define LOAD32H(x, y) \ +asm __volatile__ ( \ + "movl (%1),%0\n\t" \ + "bswapl %0\n\t" \ + :"=r"(x): "r"(y)); + +#else + +#define STORE32H(x, y) \ + do { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ + (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } while(0) + +#define LOAD32H(x, y) \ + do { x = ((ulong32)((y)[0] & 255)<<24) | \ + ((ulong32)((y)[1] & 255)<<16) | \ + ((ulong32)((y)[2] & 255)<<8) | \ + ((ulong32)((y)[3] & 255)); } while(0) + +#endif + +#ifdef LTC_HAVE_BSWAP_BUILTIN + +#define STORE64H(x, y) \ +do { ulong64 __t = __builtin_bswap64 ((x)); \ + XMEMCPY ((y), &__t, 8); } while(0) + +#define LOAD64H(x, y) \ +do { XMEMCPY (&(x), (y), 8); \ + (x) = __builtin_bswap64 ((x)); } while(0) + +/* x86_64 processor */ +#elif !defined(LTC_NO_BSWAP) && (defined(__GNUC__) && defined(__x86_64__)) + +#define STORE64H(x, y) \ +asm __volatile__ ( \ + "bswapq %0 \n\t" \ + "movq %0,(%1)\n\t" \ + "bswapq %0 \n\t" \ + ::"r"(x), "r"(y): "memory"); + +#define LOAD64H(x, y) \ +asm __volatile__ ( \ + "movq (%1),%0\n\t" \ + "bswapq %0\n\t" \ + :"=r"(x): "r"(y): "memory"); + +#else + +#define STORE64H(x, y) \ +do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ + (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ + (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } while(0) + +#define LOAD64H(x, y) \ +do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \ + (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32) | \ + (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16) | \ + (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } while(0) + +#endif + +#ifdef ENDIAN_32BITWORD + +#define STORE32L(x, y) \ + do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) + +#define LOAD32L(x, y) \ + do { XMEMCPY(&(x), y, 4); } while(0) + +#define STORE64L(x, y) \ + do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ + (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ + (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) + +#define LOAD64L(x, y) \ + do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \ + (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32)| \ + (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16)| \ + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0) + +#else /* 64-bit words then */ + +#define STORE32L(x, y) \ + do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) + +#define LOAD32L(x, y) \ + do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) + +#define STORE64L(x, y) \ + do { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } while(0) + +#define LOAD64L(x, y) \ + do { XMEMCPY(&(x), y, 8); } while(0) + +#endif /* ENDIAN_64BITWORD */ + +#endif /* ENDIAN_LITTLE */ + +#ifdef ENDIAN_BIG +#define STORE32L(x, y) \ + do { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) + +#define LOAD32L(x, y) \ + do { x = ((ulong32)((y)[3] & 255)<<24) | \ + ((ulong32)((y)[2] & 255)<<16) | \ + ((ulong32)((y)[1] & 255)<<8) | \ + ((ulong32)((y)[0] & 255)); } while(0) + +#define STORE64L(x, y) \ +do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ + (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ + (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) + +#define LOAD64L(x, y) \ +do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48) | \ + (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32) | \ + (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16) | \ + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0) + +#ifdef ENDIAN_32BITWORD + +#define STORE32H(x, y) \ + do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) + +#define LOAD32H(x, y) \ + do { XMEMCPY(&(x), y, 4); } while(0) + +#define STORE64H(x, y) \ + do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ + (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ + (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } while(0) + +#define LOAD64H(x, y) \ + do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48)| \ + (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32)| \ + (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16)| \ + (((ulong64)((y)[6] & 255))<<8)| (((ulong64)((y)[7] & 255))); } while(0) + +#else /* 64-bit words then */ + +#define STORE32H(x, y) \ + do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) + +#define LOAD32H(x, y) \ + do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) + +#define STORE64H(x, y) \ + do { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } while(0) + +#define LOAD64H(x, y) \ + do { XMEMCPY(&(x), y, 8); } while(0) + +#endif /* ENDIAN_64BITWORD */ +#endif /* ENDIAN_BIG */ + +#define BSWAP(x) ( ((x>>24)&0x000000FFUL) | ((x<<24)&0xFF000000UL) | \ + ((x>>8)&0x0000FF00UL) | ((x<<8)&0x00FF0000UL) ) + + +/* 32-bit Rotates */ +#if defined(_MSC_VER) +#define LTC_ROx_ASM + +/* instrinsic rotate */ +#include <stdlib.h> +#pragma intrinsic(_lrotr,_lrotl) +#define ROR(x,n) _lrotr(x,n) +#define ROL(x,n) _lrotl(x,n) +#define RORc(x,n) _lrotr(x,n) +#define ROLc(x,n) _lrotl(x,n) + +#elif !defined(__STRICT_ANSI__) && defined(__GNUC__) && (defined(__i386__) || defined(__x86_64__)) && !defined(INTEL_CC) && !defined(LTC_NO_ASM) +#define LTC_ROx_ASM + +static inline ulong32 ROL(ulong32 word, int i) +{ + asm ("roll %%cl,%0" + :"=r" (word) + :"0" (word),"c" (i)); + return word; +} + +static inline ulong32 ROR(ulong32 word, int i) +{ + asm ("rorl %%cl,%0" + :"=r" (word) + :"0" (word),"c" (i)); + return word; +} + +#ifndef LTC_NO_ROLC + +#define ROLc(word,i) ({ \ + ulong32 __ROLc_tmp = word; \ + __asm__ ("roll %2, %0" : \ + "=r" (__ROLc_tmp) : \ + "0" (__ROLc_tmp), \ + "I" (i)); \ + __ROLc_tmp; \ + }) +#define RORc(word,i) ({ \ + ulong32 __RORc_tmp = word; \ + __asm__ ("rorl %2, %0" : \ + "=r" (__RORc_tmp) : \ + "0" (__RORc_tmp), \ + "I" (i)); \ + __RORc_tmp; \ + }) + +#else + +#define ROLc ROL +#define RORc ROR + +#endif + +#elif !defined(__STRICT_ANSI__) && defined(LTC_PPC32) +#define LTC_ROx_ASM + +static inline ulong32 ROL(ulong32 word, int i) +{ + asm ("rotlw %0,%0,%2" + :"=r" (word) + :"0" (word),"r" (i)); + return word; +} + +static inline ulong32 ROR(ulong32 word, int i) +{ + asm ("rotlw %0,%0,%2" + :"=r" (word) + :"0" (word),"r" (32-i)); + return word; +} + +#ifndef LTC_NO_ROLC + +static inline ulong32 ROLc(ulong32 word, const int i) +{ + asm ("rotlwi %0,%0,%2" + :"=r" (word) + :"0" (word),"I" (i)); + return word; +} + +static inline ulong32 RORc(ulong32 word, const int i) +{ + asm ("rotrwi %0,%0,%2" + :"=r" (word) + :"0" (word),"I" (i)); + return word; +} + +#else + +#define ROLc ROL +#define RORc ROR + +#endif + + +#else + +/* rotates the hard way */ +#define ROL(x, y) ( (((ulong32)(x)<<(ulong32)((y)&31)) | (((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)(32-((y)&31)))) & 0xFFFFFFFFUL) +#define ROR(x, y) ( ((((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((y)&31)) | ((ulong32)(x)<<(ulong32)(32-((y)&31)))) & 0xFFFFFFFFUL) +#define ROLc(x, y) ( (((ulong32)(x)<<(ulong32)((y)&31)) | (((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)(32-((y)&31)))) & 0xFFFFFFFFUL) +#define RORc(x, y) ( ((((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((y)&31)) | ((ulong32)(x)<<(ulong32)(32-((y)&31)))) & 0xFFFFFFFFUL) + +#endif + + +/* 64-bit Rotates */ +#if !defined(__STRICT_ANSI__) && defined(__GNUC__) && defined(__x86_64__) && !defined(_WIN64) && !defined(LTC_NO_ASM) + +static inline ulong64 ROL64(ulong64 word, int i) +{ + asm("rolq %%cl,%0" + :"=r" (word) + :"0" (word),"c" (i)); + return word; +} + +static inline ulong64 ROR64(ulong64 word, int i) +{ + asm("rorq %%cl,%0" + :"=r" (word) + :"0" (word),"c" (i)); + return word; +} + +#ifndef LTC_NO_ROLC + +#define ROL64c(word,i) ({ \ + ulong64 __ROL64c_tmp = word; \ + __asm__ ("rolq %2, %0" : \ + "=r" (__ROL64c_tmp) : \ + "0" (__ROL64c_tmp), \ + "J" (i)); \ + __ROL64c_tmp; \ + }) +#define ROR64c(word,i) ({ \ + ulong64 __ROR64c_tmp = word; \ + __asm__ ("rorq %2, %0" : \ + "=r" (__ROR64c_tmp) : \ + "0" (__ROR64c_tmp), \ + "J" (i)); \ + __ROR64c_tmp; \ + }) + +#else /* LTC_NO_ROLC */ + +#define ROL64c ROL64 +#define ROR64c ROR64 + +#endif + +#else /* Not x86_64 */ + +#define ROL64(x, y) \ + ( (((x)<<((ulong64)(y)&63)) | \ + (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)64-((y)&63)))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +#define ROR64(x, y) \ + ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)(y)&CONST64(63))) | \ + ((x)<<((ulong64)(64-((y)&CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +#define ROL64c(x, y) \ + ( (((x)<<((ulong64)(y)&63)) | \ + (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)64-((y)&63)))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +#define ROR64c(x, y) \ + ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)(y)&CONST64(63))) | \ + ((x)<<((ulong64)(64-((y)&CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +#endif + +#ifndef MAX + #define MAX(x, y) ( ((x)>(y))?(x):(y) ) +#endif + +#ifndef MIN + #define MIN(x, y) ( ((x)<(y))?(x):(y) ) +#endif + +#ifndef LTC_UNUSED_PARAM + #define LTC_UNUSED_PARAM(x) (void)(x) +#endif + +/* extract a byte portably */ +#ifdef _MSC_VER + #define byte(x, n) ((unsigned char)((x) >> (8 * (n)))) +#else + #define byte(x, n) (((x) >> (8 * (n))) & 255) +#endif + + +#endif /* TOMCRYPT_MACROS_H_ */ +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_macros.h,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2006/11/29 23:43:57 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_math.h b/core/lib/libtomcrypt/include/tomcrypt_math.h new file mode 100644 index 0000000..b3e6308 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_math.h @@ -0,0 +1,547 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/** math functions **/ + +#define LTC_MP_LT -1 +#define LTC_MP_EQ 0 +#define LTC_MP_GT 1 + +#define LTC_MP_NO 0 +#define LTC_MP_YES 1 + +#ifndef LTC_MECC + typedef void ecc_point; +#endif + +#ifndef LTC_MRSA + typedef void rsa_key; +#endif + +/** math descriptor */ +typedef struct { + /** Name of the math provider */ + const char *name; + + /** Bits per digit, amount of bits must fit in an unsigned long */ + int bits_per_digit; + +/* ---- init/deinit functions ---- */ + + /** initialize a bignum + @param a The number to initialize + @return CRYPT_OK on success + */ + int (*init)(void **a); + + /** initialize a bignum + @param size_bits The size of the number we compute on + @param a The number to initialize + @return CRYPT_OK on success + */ + int (*init_size)(int size_bits, void **a); + + /** init copy + @param dst The number to initialize and write to + @param src The number to copy from + @return CRYPT_OK on success + */ + int (*init_copy)(void **dst, void *src); + + /** deinit + @param a The number to free + @return CRYPT_OK on success + */ + void (*deinit)(void *a); + +/* ---- data movement ---- */ + + /** negate + @param src The number to negate + @param dst The destination + @return CRYPT_OK on success + */ + int (*neg)(void *src, void *dst); + + /** copy + @param src The number to copy from + @param dst The number to write to + @return CRYPT_OK on success + */ + int (*copy)(void *src, void *dst); + +/* ---- trivial low level functions ---- */ + + /** set small constant + @param a Number to write to + @param n Source upto bits_per_digit (actually meant for very small constants) + @return CRYPT_OK on succcess + */ + int (*set_int)(void *a, unsigned long n); + + /** get small constant + @param a Number to read, only fetches upto bits_per_digit from the number + @return The lower bits_per_digit of the integer (unsigned) + */ + unsigned long (*get_int)(void *a); + + /** get digit n + @param a The number to read from + @param n The number of the digit to fetch + @return The bits_per_digit sized n'th digit of a + */ + ltc_mp_digit (*get_digit)(void *a, int n); + + /** Get the number of digits that represent the number + @param a The number to count + @return The number of digits used to represent the number + */ + int (*get_digit_count)(void *a); + + /** compare two integers + @param a The left side integer + @param b The right side integer + @return LTC_MP_LT if a < b, LTC_MP_GT if a > b and LTC_MP_EQ otherwise. (signed comparison) + */ + int (*compare)(void *a, void *b); + + /** compare against int + @param a The left side integer + @param b The right side integer (upto bits_per_digit) + @return LTC_MP_LT if a < b, LTC_MP_GT if a > b and LTC_MP_EQ otherwise. (signed comparison) + */ + int (*compare_d)(void *a, unsigned long n); + + /** Count the number of bits used to represent the integer + @param a The integer to count + @return The number of bits required to represent the integer + */ + int (*count_bits)(void * a); + + /** Count the number of LSB bits which are zero + @param a The integer to count + @return The number of contiguous zero LSB bits + */ + int (*count_lsb_bits)(void *a); + + /** Compute a power of two + @param a The integer to store the power in + @param n The power of two you want to store (a = 2^n) + @return CRYPT_OK on success + */ + int (*twoexpt)(void *a , int n); + +/* ---- radix conversions ---- */ + + /** read ascii string + @param a The integer to store into + @param str The string to read + @param radix The radix the integer has been represented in (2-64) + @return CRYPT_OK on success + */ + int (*read_radix)(void *a, const char *str, int radix); + + /** write number to string + @param a The integer to store + @param str The destination for the string + @param radix The radix the integer is to be represented in (2-64) + @return CRYPT_OK on success + */ + int (*write_radix)(void *a, char *str, int radix); + + /** get size as unsigned char string + @param a The integer to get the size (when stored in array of octets) + @return The length of the integer + */ + unsigned long (*unsigned_size)(void *a); + + /** store an integer as an array of octets + @param src The integer to store + @param dst The buffer to store the integer in + @return CRYPT_OK on success + */ + int (*unsigned_write)(void *src, unsigned char *dst); + + /** read an array of octets and store as integer + @param dst The integer to load + @param src The array of octets + @param len The number of octets + @return CRYPT_OK on success + */ + int (*unsigned_read)(void *dst, unsigned char *src, unsigned long len); + +/* ---- basic math ---- */ + + /** add two integers + @param a The first source integer + @param b The second source integer + @param c The destination of "a + b" + @return CRYPT_OK on success + */ + int (*add)(void *a, void *b, void *c); + + + /** add two integers + @param a The first source integer + @param b The second source integer (single digit of upto bits_per_digit in length) + @param c The destination of "a + b" + @return CRYPT_OK on success + */ + int (*addi)(void *a, unsigned long b, void *c); + + /** subtract two integers + @param a The first source integer + @param b The second source integer + @param c The destination of "a - b" + @return CRYPT_OK on success + */ + int (*sub)(void *a, void *b, void *c); + + /** subtract two integers + @param a The first source integer + @param b The second source integer (single digit of upto bits_per_digit in length) + @param c The destination of "a - b" + @return CRYPT_OK on success + */ + int (*subi)(void *a, unsigned long b, void *c); + + /** multiply two integers + @param a The first source integer + @param b The second source integer (single digit of upto bits_per_digit in length) + @param c The destination of "a * b" + @return CRYPT_OK on success + */ + int (*mul)(void *a, void *b, void *c); + + /** multiply two integers + @param a The first source integer + @param b The second source integer (single digit of upto bits_per_digit in length) + @param c The destination of "a * b" + @return CRYPT_OK on success + */ + int (*muli)(void *a, unsigned long b, void *c); + + /** Square an integer + @param a The integer to square + @param b The destination + @return CRYPT_OK on success + */ + int (*sqr)(void *a, void *b); + + /** Divide an integer + @param a The dividend + @param b The divisor + @param c The quotient (can be NULL to signify don't care) + @param d The remainder (can be NULL to signify don't care) + @return CRYPT_OK on success + */ + int (*mpdiv)(void *a, void *b, void *c, void *d); + + /** divide by two + @param a The integer to divide (shift right) + @param b The destination + @return CRYPT_OK on success + */ + int (*div_2)(void *a, void *b); + + /** Get remainder (small value) + @param a The integer to reduce + @param b The modulus (upto bits_per_digit in length) + @param c The destination for the residue + @return CRYPT_OK on success + */ + int (*modi)(void *a, unsigned long b, unsigned long *c); + + /** gcd + @param a The first integer + @param b The second integer + @param c The destination for (a, b) + @return CRYPT_OK on success + */ + int (*gcd)(void *a, void *b, void *c); + + /** lcm + @param a The first integer + @param b The second integer + @param c The destination for [a, b] + @return CRYPT_OK on success + */ + int (*lcm)(void *a, void *b, void *c); + + /** Modular reduction + @param a The source + @param b The modulus + @param c The destination (c = a mod b) + @return CRYPT_OK on success + */ + int (*mod)(void *a, void *b, void *c); + + + /** Modular multiplication + @param a The first source + @param b The second source + @param c The modulus + @param d The destination (a*b mod c) + @return CRYPT_OK on success + */ + int (*mulmod)(void *a, void *b, void *c, void *d); + + /** Modular squaring + @param a The first source + @param b The modulus + @param c The destination (a*a mod b) + @return CRYPT_OK on success + */ + int (*sqrmod)(void *a, void *b, void *c); + + /** Modular inversion + @param a The value to invert + @param b The modulus + @param c The destination (1/a mod b) + @return CRYPT_OK on success + */ + int (*invmod)(void *, void *, void *); + +/* ---- reduction ---- */ + + /** setup montgomery + @param a The modulus + @param b The destination for the reduction digit + @return CRYPT_OK on success + */ + int (*montgomery_setup)(void *a, void **b); + + /** get normalization value + @param a The destination for the normalization value + @param b The modulus + @return CRYPT_OK on success + */ + int (*montgomery_normalization)(void *a, void *b); + + /** reduce a number + @param a The number [and dest] to reduce + @param b The modulus + @param c The value "b" from montgomery_setup() + @return CRYPT_OK on success + */ + int (*montgomery_reduce)(void *a, void *b, void *c); + + /** clean up (frees memory) + @param a The value "b" from montgomery_setup() + @return CRYPT_OK on success + */ + void (*montgomery_deinit)(void *a); + +/* ---- exponentiation ---- */ + + /** Modular exponentiation + @param a The base integer + @param b The power (can be negative) integer + @param c The modulus integer + @param d The destination + @return CRYPT_OK on success + */ + int (*exptmod)(void *a, void *b, void *c, void *d); + + /** Primality testing + @param a The integer to test + @param b The number of tests that shall be executed + @param c The destination of the result (FP_YES if prime) + @return CRYPT_OK on success + */ + int (*isprime)(void *a, int b, int *c); + +/* ---- (optional) ecc point math ---- */ + + /** ECC GF(p) point multiplication (from the NIST curves) + @param k The integer to multiply the point by + @param G The point to multiply + @param R The destination for kG + @param modulus The modulus for the field + @param map Boolean indicated whether to map back to affine or not (can be ignored if you work in affine only) + @return CRYPT_OK on success + */ + int (*ecc_ptmul)(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); + + /** ECC GF(p) point addition + @param P The first point + @param Q The second point + @param R The destination of P + Q + @param modulus The modulus + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success + */ + int (*ecc_ptadd)(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp); + + /** ECC GF(p) point double + @param P The first point + @param R The destination of 2P + @param modulus The modulus + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success + */ + int (*ecc_ptdbl)(ecc_point *P, ecc_point *R, void *modulus, void *mp); + + /** ECC mapping from projective to affine, currently uses (x,y,z) => (x/z^2, y/z^3, 1) + @param P The point to map + @param modulus The modulus + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success + @remark The mapping can be different but keep in mind a ecc_point only has three + integers (x,y,z) so if you use a different mapping you have to make it fit. + */ + int (*ecc_map)(ecc_point *P, void *modulus, void *mp); + + /** Computes kA*A + kB*B = C using Shamir's Trick + @param A First point to multiply + @param kA What to multiple A by + @param B Second point to multiply + @param kB What to multiple B by + @param C [out] Destination point (can overlap with A or B + @param modulus Modulus for curve + @return CRYPT_OK on success + */ + int (*ecc_mul2add)(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, + void *modulus); + +/* ---- (optional) rsa optimized math (for internal CRT) ---- */ + + /** RSA Key Generation + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param size The size of the modulus (key size) desired (octets) + @param e The "e" value (public key). e==65537 is a good choice + @param key [out] Destination of a newly created private key pair + @return CRYPT_OK if successful, upon error all allocated ram is freed + */ + int (*rsa_keygen)(prng_state *prng, int wprng, int size, long e, rsa_key *key); + + + /** RSA exponentiation + @param in The octet array representing the base + @param inlen The length of the input + @param out The destination (to be stored in an octet array format) + @param outlen The length of the output buffer and the resulting size (zero padded to the size of the modulus) + @param which PK_PUBLIC for public RSA and PK_PRIVATE for private RSA + @param key The RSA key to use + @return CRYPT_OK on success + */ + int (*rsa_me)(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + rsa_key *key); +} ltc_math_descriptor; + +extern ltc_math_descriptor ltc_mp; + +int ltc_init_multi(void **a, ...); +int ltc_init_multi_size(int size_bits, void **a, ...); +void ltc_deinit_multi(void *a, ...); + +#ifdef LTM_DESC +extern const ltc_math_descriptor ltm_desc; +#endif + +#ifdef TFM_DESC +extern const ltc_math_descriptor tfm_desc; +#endif + +#ifdef GMP_DESC +extern const ltc_math_descriptor gmp_desc; +#endif + +#if !defined(DESC_DEF_ONLY) && defined(LTC_SOURCE) + +#define MP_DIGIT_BIT ltc_mp.bits_per_digit + +/* some handy macros */ +#define mp_init(a) ltc_mp.init(a) +#define mp_init_multi ltc_init_multi +#define mp_init_size(a, b) ltc_mp.init_size(a, b) +#define mp_init_multi_size ltc_init_multi_size +#define mp_clear(a) ltc_mp.deinit(a) +#define mp_clear_multi ltc_deinit_multi +#define mp_init_copy(a, b) ltc_mp.init_copy(a, b) + +#define mp_neg(a, b) ltc_mp.neg(a, b) +#define mp_copy(a, b) ltc_mp.copy(a, b) + +#define mp_set(a, b) ltc_mp.set_int(a, b) +#define mp_set_int(a, b) ltc_mp.set_int(a, b) +#define mp_get_int(a) ltc_mp.get_int(a) +#define mp_get_digit(a, n) ltc_mp.get_digit(a, n) +#define mp_get_digit_count(a) ltc_mp.get_digit_count(a) +#define mp_cmp(a, b) ltc_mp.compare(a, b) +#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) +#define mp_count_bits(a) ltc_mp.count_bits(a) +#define mp_cnt_lsb(a) ltc_mp.count_lsb_bits(a) +#define mp_2expt(a, b) ltc_mp.twoexpt(a, b) + +#define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) +#define mp_toradix(a, b, c) ltc_mp.write_radix(a, b, c) +#define mp_unsigned_bin_size(a) ltc_mp.unsigned_size(a) +#define mp_to_unsigned_bin(a, b) ltc_mp.unsigned_write(a, b) +#define mp_read_unsigned_bin(a, b, c) ltc_mp.unsigned_read(a, b, c) + +#define mp_add(a, b, c) ltc_mp.add(a, b, c) +#define mp_add_d(a, b, c) ltc_mp.addi(a, b, c) +#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) +#define mp_sub_d(a, b, c) ltc_mp.subi(a, b, c) +#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) +#define mp_mul_d(a, b, c) ltc_mp.muli(a, b, c) +#define mp_sqr(a, b) ltc_mp.sqr(a, b) +#define mp_div(a, b, c, d) ltc_mp.mpdiv(a, b, c, d) +#define mp_div_2(a, b) ltc_mp.div_2(a, b) +#define mp_mod(a, b, c) ltc_mp.mod(a, b, c) +#define mp_mod_d(a, b, c) ltc_mp.modi(a, b, c) +#define mp_gcd(a, b, c) ltc_mp.gcd(a, b, c) +#define mp_lcm(a, b, c) ltc_mp.lcm(a, b, c) + +#define mp_mulmod(a, b, c, d) ltc_mp.mulmod(a, b, c, d) +#define mp_sqrmod(a, b, c) ltc_mp.sqrmod(a, b, c) +#define mp_invmod(a, b, c) ltc_mp.invmod(a, b, c) + +#define mp_montgomery_setup(a, b) ltc_mp.montgomery_setup(a, b) +#define mp_montgomery_normalization(a, b) ltc_mp.montgomery_normalization(a, b) +#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) +#define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) + +#define mp_exptmod(a,b,c,d) ltc_mp.exptmod(a,b,c,d) +#define mp_prime_is_prime(a, b, c) ltc_mp.isprime(a,b,c) + +#define mp_iszero(a) (mp_cmp_d(a, 0) == LTC_MP_EQ ? LTC_MP_YES : LTC_MP_NO) +#define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) +#define mp_exch(a, b) do { void *ABC__tmp = a; a = b; b = ABC__tmp; } while(0); + +#define mp_tohex(a, b) mp_toradix(a, b, 16) + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_math.h,v $ */ +/* $Revision: 1.44 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_misc.h b/core/lib/libtomcrypt/include/tomcrypt_misc.h new file mode 100644 index 0000000..f346d19 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_misc.h @@ -0,0 +1,58 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* ---- LTC_BASE64 Routines ---- */ +#ifdef LTC_BASE64 +int base64_encode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); + +int base64_decode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); +#endif + +#ifdef LTC_BASE64_URL +int base64url_encode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); + +int base64url_decode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); +#endif +/* ---- MEM routines ---- */ +int mem_neq(const void *a, const void *b, size_t len); +void zeromem(volatile void *dst, size_t len); +void burn_stack(unsigned long len); + +const char *error_to_string(int err); + +extern const char *crypt_build_settings; + +/* ---- HMM ---- */ +int crypt_fsa(void *mp, ...); + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_misc.h,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_mpa.h b/core/lib/libtomcrypt/include/tomcrypt_mpa.h new file mode 100644 index 0000000..dba1206 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_mpa.h @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef TOMCRYPT_MPA_H_ +#define TOMCRYPT_MPA_H_ + +#include <mpalib.h> +#include "tomcrypt.h" + +extern mpa_scratch_mem external_mem_pool; + +void init_mpa_tomcrypt(mpa_scratch_mem pool); + +#endif /* TOMCRYPT_MPA_H_ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_pk.h b/core/lib/libtomcrypt/include/tomcrypt_pk.h new file mode 100644 index 0000000..9b23cc0 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_pk.h @@ -0,0 +1,657 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* ---- NUMBER THEORY ---- */ + +enum { + PK_PUBLIC=0, + PK_PRIVATE=1 +}; + +#define PK_STD 0x1000 + +int rand_prime(void *N, long len, prng_state *prng, int wprng); +int rand_bn_bits(void *N, int bits, prng_state *prng, int wprng); +int rand_bn_range(void *N, void *limit, prng_state *prng, int wprng); + +enum { + PKA_RSA, + PKA_DSA +}; + +typedef struct Oid { + unsigned long OID[16]; + /** Length of DER encoding */ + unsigned long OIDlen; +} oid_st; + +int pk_get_oid(int pk, oid_st *st); + +/* ---- RSA ---- */ +#ifdef LTC_MRSA + +/* Min and Max RSA key sizes (in bits) */ +#define MIN_RSA_SIZE 256 +#define MAX_RSA_SIZE 4096 + +/** RSA LTC_PKCS style key */ +typedef struct Rsa_key { + /** Type of key, PK_PRIVATE or PK_PUBLIC */ + int type; + /** The public exponent */ + void *e; + /** The private exponent */ + void *d; + /** The modulus */ + void *N; + /** The p factor of N */ + void *p; + /** The q factor of N */ + void *q; + /** The 1/q mod p CRT param */ + void *qP; + /** The d mod (p - 1) CRT param */ + void *dP; + /** The d mod (q - 1) CRT param */ + void *dQ; +} rsa_key; + +int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key); + +int rsa_exptmod(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + rsa_key *key); + +void rsa_free(rsa_key *key); + +/* These use LTC_PKCS #1 v2.0 padding */ +#define rsa_encrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, _key) \ + rsa_encrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, LTC_PKCS_1_OAEP, _key) + +#define rsa_decrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, _stat, _key) \ + rsa_decrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, LTC_PKCS_1_OAEP, _stat, _key) + +#define rsa_sign_hash(_in, _inlen, _out, _outlen, _prng, _prng_idx, _hash_idx, _saltlen, _key) \ + rsa_sign_hash_ex(_in, _inlen, _out, _outlen, LTC_PKCS_1_PSS, _prng, _prng_idx, _hash_idx, _saltlen, _key) + +#define rsa_verify_hash(_sig, _siglen, _hash, _hashlen, _hash_idx, _saltlen, _stat, _key) \ + rsa_verify_hash_ex(_sig, _siglen, _hash, _hashlen, LTC_PKCS_1_PSS, _hash_idx, _saltlen, _stat, _key) + +/* These can be switched between LTC_PKCS #1 v2.x and LTC_PKCS #1 v1.5 paddings */ +int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + prng_state *prng, int prng_idx, int hash_idx, int padding, rsa_key *key); + +int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + int hash_idx, int padding, + int *stat, rsa_key *key); + +int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + int padding, + prng_state *prng, int prng_idx, + int hash_idx, unsigned long saltlen, + rsa_key *key); + +int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int padding, + int hash_idx, unsigned long saltlen, + int *stat, rsa_key *key); + +/* LTC_PKCS #1 import/export */ +int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key); +int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key); + +#endif + +/* ---- Katja ---- */ +#ifdef LTC_MKAT + +/* Min and Max KAT key sizes (in bits) */ +#define MIN_KAT_SIZE 1024 +#define MAX_KAT_SIZE 4096 + +/** Katja LTC_PKCS style key */ +typedef struct KAT_key { + /** Type of key, PK_PRIVATE or PK_PUBLIC */ + int type; + /** The private exponent */ + void *d; + /** The modulus */ + void *N; + /** The p factor of N */ + void *p; + /** The q factor of N */ + void *q; + /** The 1/q mod p CRT param */ + void *qP; + /** The d mod (p - 1) CRT param */ + void *dP; + /** The d mod (q - 1) CRT param */ + void *dQ; + /** The pq param */ + void *pq; +} katja_key; + +int katja_make_key(prng_state *prng, int wprng, int size, katja_key *key); + +int katja_exptmod(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + katja_key *key); + +void katja_free(katja_key *key); + +/* These use LTC_PKCS #1 v2.0 padding */ +int katja_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + prng_state *prng, int prng_idx, int hash_idx, katja_key *key); + +int katja_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + int hash_idx, int *stat, + katja_key *key); + +/* LTC_PKCS #1 import/export */ +int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key *key); +int katja_import(const unsigned char *in, unsigned long inlen, katja_key *key); + +#endif + +/* + * From libtomcrypt.org: + * DH vanished because nobody used it and it was a pain to support + * DH support has been taken from + * http://dev.openaos.org/browser/trunk/buildroot/gen7/buildroot/package/libtomcrypt/libtomcrypt-dh.patch + */ +#ifdef LTC_LINARO_FIX_DH +/* ---- DH Routines ---- */ +#ifdef LTC_MDH + +typedef struct Dh_key { + int type; /* Type of key, PK_PRIVATE or PK_PUBLIC */ + void *x; /* private key */ + void *y; /* public key - is g^x [p] */ + void *g; /* base */ + void *p; /* prime */ +} dh_key; + +int dh_make_key(prng_state *prng, int wprng, void *q, int xbits, dh_key *key); +void dh_free(dh_key *key); +int dh_shared_secret(dh_key *private_key, void *public_key, void *secret); +#endif +#endif + +/* ---- ECC Routines ---- */ +#ifdef LTC_MECC + +/* size of our temp buffers for exported keys */ +#define ECC_BUF_SIZE 256 + +/* max private key size */ +#define ECC_MAXSIZE 66 + +/** Structure defines a NIST GF(p) curve */ +typedef struct { + /** The size of the curve in octets */ + int size; + + /** name of curve */ + const char *name; + + /** The prime that defines the field the curve is in (encoded in hex) */ + const char *prime; + + /** The fields B param (hex) */ + const char *B; + + /** The order of the curve (hex) */ + const char *order; + + /** The x co-ordinate of the base point on the curve (hex) */ + const char *Gx; + + /** The y co-ordinate of the base point on the curve (hex) */ + const char *Gy; +} ltc_ecc_set_type; + +/** A point on a ECC curve, stored in Jacbobian format such that (x,y,z) => (x/z^2, y/z^3, 1) when interpretted as affine */ +typedef struct { + /** The x co-ordinate */ + void *x; + + /** The y co-ordinate */ + void *y; + + /** The z co-ordinate */ + void *z; +} ecc_point; + +/** An ECC key */ +typedef struct { + /** Type of key, PK_PRIVATE or PK_PUBLIC */ + int type; + + /** Index into the ltc_ecc_sets[] for the parameters of this curve; if -1, then this key is using user supplied curve in dp */ + int idx; + + /** pointer to domain parameters; either points to NIST curves (identified by idx >= 0) or user supplied curve */ + const ltc_ecc_set_type *dp; + + /** The public key */ + ecc_point pubkey; + + /** The private key */ + void *k; +} ecc_key; + +/** the ECC params provided */ +extern const ltc_ecc_set_type ltc_ecc_sets[]; + +int ecc_test(void); +void ecc_sizes(int *low, int *high); +int ecc_get_size(ecc_key *key); + +int ecc_make_key(prng_state *prng, int wprng, int keysize, ecc_key *key); +int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set_type *dp); +void ecc_free(ecc_key *key); + +int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key); +int ecc_import(const unsigned char *in, unsigned long inlen, ecc_key *key); +int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, const ltc_ecc_set_type *dp); + +int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen); +int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key *key); +int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp); + +int ecc_shared_secret(ecc_key *private_key, ecc_key *public_key, + unsigned char *out, unsigned long *outlen); + +int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, + ecc_key *key); + +int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + ecc_key *key); + +int ecc_sign_hash_raw(const unsigned char *in, unsigned long inlen, + void *r, void *s, + prng_state *prng, int wprng, ecc_key *key); + +int ecc_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, ecc_key *key); + +int ecc_verify_hash_raw( void *r, void *s, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key); + +int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key); + +/* low level functions */ +ecc_point *ltc_ecc_new_point(void); +void ltc_ecc_del_point(ecc_point *p); +int ltc_ecc_is_valid_idx(int n); + +/* point ops (mp == montgomery digit) */ +#if !defined(LTC_MECC_ACCEL) || defined(LTM_DESC) || defined(GMP_DESC) +/* R = 2P */ +int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *mp); + +/* R = P + Q */ +int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp); +#endif + +#if defined(LTC_MECC_FP) +/* optimized point multiplication using fixed point cache (HAC algorithm 14.117) */ +int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); + +/* functions for saving/loading/freeing/adding to fixed point cache */ +int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen); +int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen); +void ltc_ecc_fp_free(void); +int ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock); + +/* lock/unlock all points currently in fixed point cache */ +void ltc_ecc_fp_tablelock(int lock); +#endif + +/* R = kG */ +int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); + +#ifdef LTC_ECC_SHAMIR +/* kA*A + kB*B = C */ +int ltc_ecc_mul2add(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, + void *modulus); + +#ifdef LTC_MECC_FP +/* Shamir's trick with optimized point multiplication using fixed point cache */ +int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, void *modulus); +#endif + +#endif + + +/* map P to affine from projective */ +int ltc_ecc_map(ecc_point *P, void *modulus, void *mp); + +#endif + +#ifdef LTC_MDSA + +/* Max diff between group and modulus size in bytes */ +#define LTC_MDSA_DELTA 512 + +/* Max DSA group size in bytes (default allows 4k-bit groups) */ +#define LTC_MDSA_MAX_GROUP 512 + +/** DSA key structure */ +typedef struct { + /** The key type, PK_PRIVATE or PK_PUBLIC */ + int type; + + /** The order of the sub-group used in octets */ + int qord; + + /** The generator */ + void *g; + + /** The prime used to generate the sub-group */ + void *q; + + /** The large prime that generats the field the contains the sub-group */ + void *p; + + /** The private key */ + void *x; + + /** The public key */ + void *y; +} dsa_key; + +int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key); +void dsa_free(dsa_key *key); + +int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen, + void *r, void *s, + prng_state *prng, int wprng, dsa_key *key); + +int dsa_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, dsa_key *key); + +int dsa_verify_hash_raw( void *r, void *s, + const unsigned char *hash, unsigned long hashlen, + int *stat, dsa_key *key); + +int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, dsa_key *key); + +int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, + dsa_key *key); + +int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + dsa_key *key); + +int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key); +int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key); +int dsa_verify_key(dsa_key *key, int *stat); + +int dsa_shared_secret(void *private_key, void *base, + dsa_key *public_key, + unsigned char *out, unsigned long *outlen); +#endif + +#ifdef LTC_DER +/* DER handling */ + +typedef enum ltc_asn1_type_ { + /* 0 */ + LTC_ASN1_EOL, + LTC_ASN1_BOOLEAN, + LTC_ASN1_INTEGER, + LTC_ASN1_SHORT_INTEGER, + LTC_ASN1_BIT_STRING, + /* 5 */ + LTC_ASN1_OCTET_STRING, + LTC_ASN1_NULL, + LTC_ASN1_OBJECT_IDENTIFIER, + LTC_ASN1_IA5_STRING, + LTC_ASN1_PRINTABLE_STRING, + /* 10 */ + LTC_ASN1_UTF8_STRING, + LTC_ASN1_UTCTIME, + LTC_ASN1_CHOICE, + LTC_ASN1_SEQUENCE, + LTC_ASN1_SET, + /* 15 */ + LTC_ASN1_SETOF, + LTC_ASN1_RAW_BIT_STRING, + LTC_ASN1_TELETEX_STRING, + LTC_ASN1_CONSTRUCTED, + LTC_ASN1_CONTEXT_SPECIFIC, +} ltc_asn1_type; + +/** A LTC ASN.1 list type */ +typedef struct ltc_asn1_list_ { + /** The LTC ASN.1 enumerated type identifier */ + ltc_asn1_type type; + /** The data to encode or place for decoding */ + void *data; + /** The size of the input or resulting output */ + unsigned long size; + /** The used flag, this is used by the CHOICE ASN.1 type to indicate which choice was made */ + int used; + /** prev/next entry in the list */ + struct ltc_asn1_list_ *prev, *next, *child, *parent; +} ltc_asn1_list; + +#define LTC_SET_ASN1(list, index, Type, Data, Size) \ + do { \ + int LTC_MACRO_temp = (index); \ + ltc_asn1_list *LTC_MACRO_list = (list); \ + LTC_MACRO_list[LTC_MACRO_temp].type = (Type); \ + LTC_MACRO_list[LTC_MACRO_temp].data = (void*)(Data); \ + LTC_MACRO_list[LTC_MACRO_temp].size = (Size); \ + LTC_MACRO_list[LTC_MACRO_temp].used = 0; \ + } while (0) + +/* SEQUENCE */ +int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int type_of); + +#define der_encode_sequence(list, inlen, out, outlen) der_encode_sequence_ex(list, inlen, out, outlen, LTC_ASN1_SEQUENCE) + +int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, + ltc_asn1_list *list, unsigned long outlen, int ordered); + +#define der_decode_sequence(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, 1) + +int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, + unsigned long *outlen); + +/* SUBJECT PUBLIC KEY INFO */ +int der_encode_subject_public_key_info(unsigned char *out, unsigned long *outlen, + unsigned int algorithm, void* public_key, unsigned long public_key_len, + unsigned long parameters_type, void* parameters, unsigned long parameters_len); + +int der_decode_subject_public_key_info(const unsigned char *in, unsigned long inlen, + unsigned int algorithm, void* public_key, unsigned long* public_key_len, + unsigned long parameters_type, ltc_asn1_list* parameters, unsigned long parameters_len); + +/* SET */ +#define der_decode_set(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, 0) +#define der_length_set der_length_sequence +int der_encode_set(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +/* VA list handy helpers with triplets of <type, size, data> */ +int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...); +int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...); + +/* FLEXI DECODER handle unknown list decoder */ +int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out); +#define der_free_sequence_flexi der_sequence_free +void der_sequence_free(ltc_asn1_list *in); + +/* BOOLEAN */ +int der_length_boolean(unsigned long *outlen); +int der_encode_boolean(int in, + unsigned char *out, unsigned long *outlen); +int der_decode_boolean(const unsigned char *in, unsigned long inlen, + int *out); +/* INTEGER */ +int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen); +int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num); +int der_length_integer(void *num, unsigned long *len); + +/* INTEGER -- handy for 0..2^32-1 values */ +int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsigned long *num); +int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen); +int der_length_short_integer(unsigned long num, unsigned long *outlen); + +/* BIT STRING */ +int der_encode_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_encode_raw_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_raw_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_bit_string(unsigned long nbits, unsigned long *outlen); + +/* OCTET STRING */ +int der_encode_octet_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_octet_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_octet_string(unsigned long noctets, unsigned long *outlen); + +/* OBJECT IDENTIFIER */ +int der_encode_object_identifier(unsigned long *words, unsigned long nwords, + unsigned char *out, unsigned long *outlen); +int der_decode_object_identifier(const unsigned char *in, unsigned long inlen, + unsigned long *words, unsigned long *outlen); +int der_length_object_identifier(unsigned long *words, unsigned long nwords, unsigned long *outlen); +unsigned long der_object_identifier_bits(unsigned long x); + +/* IA5 STRING */ +int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_ia5_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen); + +int der_ia5_char_encode(int c); +int der_ia5_value_decode(int v); + +/* TELETEX STRING */ +int der_decode_teletex_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_teletex_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen); + +int der_teletex_char_encode(int c); +int der_teletex_value_decode(int v); + +/* PRINTABLE STRING */ +int der_encode_printable_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_printable_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_printable_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen); + +int der_printable_char_encode(int c); +int der_printable_value_decode(int v); + +/* UTF-8 */ +#if (defined(SIZE_MAX) || __STDC_VERSION__ >= 199901L || defined(WCHAR_MAX) || defined(_WCHAR_T) || defined(_WCHAR_T_DEFINED) || defined (__WCHAR_TYPE__)) && !defined(LTC_NO_WCHAR) +#include <wchar.h> +#else +typedef ulong32 wchar_t; +#endif + +int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, + wchar_t *out, unsigned long *outlen); +unsigned long der_utf8_charsize(const wchar_t c); +int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned long *outlen); + + +/* CHOICE */ +int der_decode_choice(const unsigned char *in, unsigned long *inlen, + ltc_asn1_list *list, unsigned long outlen); + +/* UTCTime */ +typedef struct { + unsigned YY, /* year */ + MM, /* month */ + DD, /* day */ + hh, /* hour */ + mm, /* minute */ + ss, /* second */ + off_dir, /* timezone offset direction 0 == +, 1 == - */ + off_hh, /* timezone offset hours */ + off_mm; /* timezone offset minutes */ +} ltc_utctime; + +int der_encode_utctime(ltc_utctime *utctime, + unsigned char *out, unsigned long *outlen); + +int der_decode_utctime(const unsigned char *in, unsigned long *inlen, + ltc_utctime *out); + +int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen); + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_pk.h,v $ */ +/* $Revision: 1.81 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_pkcs.h b/core/lib/libtomcrypt/include/tomcrypt_pkcs.h new file mode 100644 index 0000000..30cda91 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_pkcs.h @@ -0,0 +1,116 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LTC_PKCS Header Info */ + +/* ===> LTC_PKCS #1 -- RSA Cryptography <=== */ +#ifdef LTC_PKCS_1 + +enum ltc_pkcs_1_v1_5_blocks +{ + LTC_PKCS_1_EMSA = 1, /* Block type 1 (PKCS #1 v1.5 signature padding) */ + LTC_PKCS_1_EME = 2 /* Block type 2 (PKCS #1 v1.5 encryption padding) */ +}; + +enum ltc_pkcs_1_paddings +{ + LTC_PKCS_1_V1_5 = 1, /* PKCS #1 v1.5 padding (\sa ltc_pkcs_1_v1_5_blocks) */ + LTC_PKCS_1_OAEP = 2, /* PKCS #1 v2.0 encryption padding */ + LTC_PKCS_1_PSS = 3 /* PKCS #1 v2.1 signature padding */ +}; + +int pkcs_1_mgf1( int hash_idx, + const unsigned char *seed, unsigned long seedlen, + unsigned char *mask, unsigned long masklen); + +int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out); +int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen); + +/* *** v1.5 padding */ +int pkcs_1_v1_5_encode(const unsigned char *msg, + unsigned long msglen, + int block_type, + unsigned long modulus_bitlen, + prng_state *prng, + int prng_idx, + unsigned char *out, + unsigned long *outlen); + +int pkcs_1_v1_5_decode(const unsigned char *msg, + unsigned long msglen, + int block_type, + unsigned long modulus_bitlen, + unsigned char *out, + unsigned long *outlen, + int *is_valid); + +/* *** v2.1 padding */ +int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, + const unsigned char *lparam, unsigned long lparamlen, + unsigned long modulus_bitlen, prng_state *prng, + int prng_idx, int hash_idx, + unsigned char *out, unsigned long *outlen); + +int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, + const unsigned char *lparam, unsigned long lparamlen, + unsigned long modulus_bitlen, int hash_idx, + unsigned char *out, unsigned long *outlen, + int *res); + +int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, + unsigned long saltlen, prng_state *prng, + int prng_idx, int hash_idx, + unsigned long modulus_bitlen, + unsigned char *out, unsigned long *outlen); + +int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, + const unsigned char *sig, unsigned long siglen, + unsigned long saltlen, int hash_idx, + unsigned long modulus_bitlen, int *res); + +#endif /* LTC_PKCS_1 */ + +/* ===> LTC_PKCS #5 -- Password Based Cryptography <=== */ +#ifdef LTC_PKCS_5 + +/* Algorithm #1 (old) */ +int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen); + +/* Algorithm #2 (new) */ +int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, unsigned long salt_len, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen); + +#endif /* LTC_PKCS_5 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_pkcs.h,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/include/tomcrypt_prng.h b/core/lib/libtomcrypt/include/tomcrypt_prng.h new file mode 100644 index 0000000..bc8b828 --- /dev/null +++ b/core/lib/libtomcrypt/include/tomcrypt_prng.h @@ -0,0 +1,226 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* ---- PRNG Stuff ---- */ +#ifdef LTC_YARROW +struct yarrow_prng { + int cipher, hash; + unsigned char pool[MAXBLOCKSIZE]; + symmetric_CTR ctr; + LTC_MUTEX_TYPE(prng_lock) +}; +#endif + +#ifdef LTC_RC4 +struct rc4_prng { + int x, y; + unsigned char buf[256]; +}; +#endif + +#ifdef LTC_FORTUNA +struct fortuna_prng { + hash_state pool[LTC_FORTUNA_POOLS]; /* the pools */ + + symmetric_key skey; + + unsigned char K[32], /* the current key */ + IV[16]; /* IV for CTR mode */ + + unsigned long pool_idx, /* current pool we will add to */ + pool0_len, /* length of 0'th pool */ + wd; + + ulong64 reset_cnt; /* number of times we have reset */ + LTC_MUTEX_TYPE(prng_lock) +}; +#endif + +#ifdef LTC_SOBER128 +struct sober128_prng { + ulong32 R[17], /* Working storage for the shift register */ + initR[17], /* saved register contents */ + konst, /* key dependent constant */ + sbuf; /* partial word encryption buffer */ + + int nbuf, /* number of part-word stream bits buffered */ + flag, /* first add_entropy call or not? */ + set; /* did we call add_entropy to set key? */ + +}; +#endif + +typedef union Prng_state { + char dummy[1]; +#ifdef LTC_YARROW + struct yarrow_prng yarrow; +#endif +#ifdef LTC_RC4 + struct rc4_prng rc4; +#endif +#ifdef LTC_FORTUNA + struct fortuna_prng fortuna; +#endif +#ifdef LTC_SOBER128 + struct sober128_prng sober128; +#endif +} prng_state; + +/** PRNG descriptor */ +extern const struct ltc_prng_descriptor { + /** Name of the PRNG */ + const char *name; + /** size in bytes of exported state */ + int export_size; + /** Start a PRNG state + @param prng [out] The state to initialize + @return CRYPT_OK if successful + */ + int (*start)(prng_state *prng); + /** Add entropy to the PRNG + @param in The entropy + @param inlen Length of the entropy (octets)\ + @param prng The PRNG state + @return CRYPT_OK if successful + */ + int (*add_entropy)(const unsigned char *in, unsigned long inlen, prng_state *prng); + /** Ready a PRNG state to read from + @param prng The PRNG state to ready + @return CRYPT_OK if successful + */ + int (*ready)(prng_state *prng); + /** Read from the PRNG + @param out [out] Where to store the data + @param outlen Length of data desired (octets) + @param prng The PRNG state to read from + @return Number of octets read + */ + unsigned long (*read)(unsigned char *out, unsigned long outlen, prng_state *prng); + /** Terminate a PRNG state + @param prng The PRNG state to terminate + @return CRYPT_OK if successful + */ + int (*done)(prng_state *prng); + /** Export a PRNG state + @param out [out] The destination for the state + @param outlen [in/out] The max size and resulting size of the PRNG state + @param prng The PRNG to export + @return CRYPT_OK if successful + */ + int (*pexport)(unsigned char *out, unsigned long *outlen, prng_state *prng); + /** Import a PRNG state + @param in The data to import + @param inlen The length of the data to import (octets) + @param prng The PRNG to initialize/import + @return CRYPT_OK if successful + */ + int (*pimport)(const unsigned char *in, unsigned long inlen, prng_state *prng); + /** Self-test the PRNG + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled + */ + int (*test)(void); +} *prng_descriptor[]; + +#ifdef LTC_YARROW +int yarrow_start(prng_state *prng); +int yarrow_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int yarrow_ready(prng_state *prng); +unsigned long yarrow_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int yarrow_done(prng_state *prng); +int yarrow_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int yarrow_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int yarrow_test(void); +extern const struct ltc_prng_descriptor yarrow_desc; +#endif + +#ifdef LTC_FORTUNA +int fortuna_start(prng_state *prng); +int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int fortuna_ready(prng_state *prng); +unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int fortuna_done(prng_state *prng); +int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int fortuna_test(void); +extern const struct ltc_prng_descriptor fortuna_desc; +#endif + +#ifdef LTC_RC4 +int rc4_start(prng_state *prng); +int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int rc4_ready(prng_state *prng); +unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int rc4_done(prng_state *prng); +int rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int rc4_test(void); +extern const struct ltc_prng_descriptor rc4_desc; +#endif + +#ifdef LTC_SPRNG +int sprng_start(prng_state *prng); +int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int sprng_ready(prng_state *prng); +unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int sprng_done(prng_state *prng); +int sprng_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int sprng_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int sprng_test(void); +extern const struct ltc_prng_descriptor sprng_desc; +#endif + +#ifdef LTC_SOBER128 +int sober128_start(prng_state *prng); +int sober128_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int sober128_ready(prng_state *prng); +unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int sober128_done(prng_state *prng); +int sober128_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int sober128_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int sober128_test(void); +extern const struct ltc_prng_descriptor sober128_desc; +#endif + +int find_prng(const char *name); +int register_prng(const struct ltc_prng_descriptor *prng); +int unregister_prng(const struct ltc_prng_descriptor *prng); +int prng_is_valid(int idx); +LTC_MUTEX_PROTO(ltc_prng_mutex) + +/* Slow RNG you **might** be able to use to seed a PRNG with. Be careful as this + * might not work on all platforms as planned + */ +unsigned long rng_get_bytes(unsigned char *out, + unsigned long outlen, + void (*callback)(void)); + +int rng_make_prng(int bits, int wprng, prng_state *prng, void (*callback)(void)); + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_prng.h,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/ciphers/aes.c b/core/lib/libtomcrypt/src/ciphers/aes.c new file mode 100644 index 0000000..e5d91de --- /dev/null +++ b/core/lib/libtomcrypt/src/ciphers/aes.c @@ -0,0 +1,785 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* AES implementation by Tom St Denis + * + * Derived from the Public Domain source code by + +--- + * rijndael-alg-fst.c + * + * @version 3.0 (December 2000) + * + * Optimised ANSI C code for the Rijndael cipher (now AES) + * + * @author Vincent Rijmen <vincent.rijmen@esat.kuleuven.ac.be> + * @author Antoon Bosselaers <antoon.bosselaers@esat.kuleuven.ac.be> + * @author Paulo Barreto <paulo.barreto@terra.com.br> +--- + */ +/** + @file aes.c + Implementation of AES +*/ + +#include "tomcrypt.h" + +#ifdef LTC_RIJNDAEL + +#ifndef ENCRYPT_ONLY + +#define SETUP rijndael_setup +#define ECB_ENC rijndael_ecb_encrypt +#define ECB_DEC rijndael_ecb_decrypt +#define ECB_DONE rijndael_done +#define ECB_TEST rijndael_test +#define ECB_KS rijndael_keysize + +const struct ltc_cipher_descriptor rijndael_desc = +{ + "rijndael", + 6, + 16, 32, 16, 10, + SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +const struct ltc_cipher_descriptor aes_desc = +{ + "aes", + 6, + 16, 32, 16, 10, + SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +#else + +#define SETUP rijndael_enc_setup +#define ECB_ENC rijndael_enc_ecb_encrypt +#define ECB_KS rijndael_enc_keysize +#define ECB_DONE rijndael_enc_done + +const struct ltc_cipher_descriptor rijndael_enc_desc = +{ + "rijndael", + 6, + 16, 32, 16, 10, + SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +const struct ltc_cipher_descriptor aes_enc_desc = +{ + "aes", + 6, + 16, 32, 16, 10, + SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +#endif + +#include "aes_tab.c" + +static ulong32 setup_mix(ulong32 temp) +{ + return (Te4_3[byte(temp, 2)]) ^ + (Te4_2[byte(temp, 1)]) ^ + (Te4_1[byte(temp, 0)]) ^ + (Te4_0[byte(temp, 3)]); +} + +#ifndef ENCRYPT_ONLY +#ifdef LTC_SMALL_CODE +static ulong32 setup_mix2(ulong32 temp) +{ + return Td0(255 & Te4[byte(temp, 3)]) ^ + Td1(255 & Te4[byte(temp, 2)]) ^ + Td2(255 & Te4[byte(temp, 1)]) ^ + Td3(255 & Te4[byte(temp, 0)]); +} +#endif +#endif + + /** + Initialize the AES (Rijndael) block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int i; + ulong32 temp, *rk; +#ifndef ENCRYPT_ONLY + ulong32 *rrk; +#endif + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (keylen != 16 && keylen != 24 && keylen != 32) { + return CRYPT_INVALID_KEYSIZE; + } + + if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) { + return CRYPT_INVALID_ROUNDS; + } + + skey->rijndael.Nr = 10 + ((keylen/8)-2)*2; + + /* setup the forward key */ + i = 0; + rk = skey->rijndael.eK; + LOAD32H(rk[0], key ); + LOAD32H(rk[1], key + 4); + LOAD32H(rk[2], key + 8); + LOAD32H(rk[3], key + 12); + if (keylen == 16) { + for (;;) { + temp = rk[3]; + rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i]; + rk[5] = rk[1] ^ rk[4]; + rk[6] = rk[2] ^ rk[5]; + rk[7] = rk[3] ^ rk[6]; + if (++i == 10) { + break; + } + rk += 4; + } + } else if (keylen == 24) { + LOAD32H(rk[4], key + 16); + LOAD32H(rk[5], key + 20); + for (;;) { + #ifdef _MSC_VER + temp = skey->rijndael.eK[rk - skey->rijndael.eK + 5]; + #else + temp = rk[5]; + #endif + rk[ 6] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; + rk[ 7] = rk[ 1] ^ rk[ 6]; + rk[ 8] = rk[ 2] ^ rk[ 7]; + rk[ 9] = rk[ 3] ^ rk[ 8]; + if (++i == 8) { + break; + } + rk[10] = rk[ 4] ^ rk[ 9]; + rk[11] = rk[ 5] ^ rk[10]; + rk += 6; + } + } else if (keylen == 32) { + LOAD32H(rk[4], key + 16); + LOAD32H(rk[5], key + 20); + LOAD32H(rk[6], key + 24); + LOAD32H(rk[7], key + 28); + for (;;) { + #ifdef _MSC_VER + temp = skey->rijndael.eK[rk - skey->rijndael.eK + 7]; + #else + temp = rk[7]; + #endif + rk[ 8] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; + rk[ 9] = rk[ 1] ^ rk[ 8]; + rk[10] = rk[ 2] ^ rk[ 9]; + rk[11] = rk[ 3] ^ rk[10]; + if (++i == 7) { + break; + } + temp = rk[11]; + rk[12] = rk[ 4] ^ setup_mix(RORc(temp, 8)); + rk[13] = rk[ 5] ^ rk[12]; + rk[14] = rk[ 6] ^ rk[13]; + rk[15] = rk[ 7] ^ rk[14]; + rk += 8; + } + } else { + /* this can't happen */ + return CRYPT_ERROR; + } + +#ifndef ENCRYPT_ONLY + /* setup the inverse key now */ + rk = skey->rijndael.dK; + rrk = skey->rijndael.eK + (28 + keylen) - 4; + + /* apply the inverse MixColumn transform to all round keys but the first and the last: */ + /* copy first */ + *rk++ = *rrk++; + *rk++ = *rrk++; + *rk++ = *rrk++; + *rk = *rrk; + rk -= 3; rrk -= 3; + + for (i = 1; i < skey->rijndael.Nr; i++) { + rrk -= 4; + rk += 4; + #ifdef LTC_SMALL_CODE + temp = rrk[0]; + rk[0] = setup_mix2(temp); + temp = rrk[1]; + rk[1] = setup_mix2(temp); + temp = rrk[2]; + rk[2] = setup_mix2(temp); + temp = rrk[3]; + rk[3] = setup_mix2(temp); + #else + temp = rrk[0]; + rk[0] = + Tks0[byte(temp, 3)] ^ + Tks1[byte(temp, 2)] ^ + Tks2[byte(temp, 1)] ^ + Tks3[byte(temp, 0)]; + temp = rrk[1]; + rk[1] = + Tks0[byte(temp, 3)] ^ + Tks1[byte(temp, 2)] ^ + Tks2[byte(temp, 1)] ^ + Tks3[byte(temp, 0)]; + temp = rrk[2]; + rk[2] = + Tks0[byte(temp, 3)] ^ + Tks1[byte(temp, 2)] ^ + Tks2[byte(temp, 1)] ^ + Tks3[byte(temp, 0)]; + temp = rrk[3]; + rk[3] = + Tks0[byte(temp, 3)] ^ + Tks1[byte(temp, 2)] ^ + Tks2[byte(temp, 1)] ^ + Tks3[byte(temp, 0)]; + #endif + + } + + /* copy last */ + rrk -= 4; + rk += 4; + *rk++ = *rrk++; + *rk++ = *rrk++; + *rk++ = *rrk++; + *rk = *rrk; +#endif /* ENCRYPT_ONLY */ + + return CRYPT_OK; +} + +/** + Encrypts a block of text with AES + @param pt The input plaintext (16 bytes) + @param ct The output ciphertext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int ECB_ENC(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; + int Nr, r; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + Nr = skey->rijndael.Nr; + rk = skey->rijndael.eK; + + /* + * map byte array block to cipher state + * and add initial round key: + */ + LOAD32H(s0, pt ); s0 ^= rk[0]; + LOAD32H(s1, pt + 4); s1 ^= rk[1]; + LOAD32H(s2, pt + 8); s2 ^= rk[2]; + LOAD32H(s3, pt + 12); s3 ^= rk[3]; + +#ifdef LTC_SMALL_CODE + + for (r = 0; ; r++) { + rk += 4; + t0 = + Te0(byte(s0, 3)) ^ + Te1(byte(s1, 2)) ^ + Te2(byte(s2, 1)) ^ + Te3(byte(s3, 0)) ^ + rk[0]; + t1 = + Te0(byte(s1, 3)) ^ + Te1(byte(s2, 2)) ^ + Te2(byte(s3, 1)) ^ + Te3(byte(s0, 0)) ^ + rk[1]; + t2 = + Te0(byte(s2, 3)) ^ + Te1(byte(s3, 2)) ^ + Te2(byte(s0, 1)) ^ + Te3(byte(s1, 0)) ^ + rk[2]; + t3 = + Te0(byte(s3, 3)) ^ + Te1(byte(s0, 2)) ^ + Te2(byte(s1, 1)) ^ + Te3(byte(s2, 0)) ^ + rk[3]; + if (r == Nr-2) { + break; + } + s0 = t0; s1 = t1; s2 = t2; s3 = t3; + } + rk += 4; + +#else + + /* + * Nr - 1 full rounds: + */ + r = Nr >> 1; + for (;;) { + t0 = + Te0(byte(s0, 3)) ^ + Te1(byte(s1, 2)) ^ + Te2(byte(s2, 1)) ^ + Te3(byte(s3, 0)) ^ + rk[4]; + t1 = + Te0(byte(s1, 3)) ^ + Te1(byte(s2, 2)) ^ + Te2(byte(s3, 1)) ^ + Te3(byte(s0, 0)) ^ + rk[5]; + t2 = + Te0(byte(s2, 3)) ^ + Te1(byte(s3, 2)) ^ + Te2(byte(s0, 1)) ^ + Te3(byte(s1, 0)) ^ + rk[6]; + t3 = + Te0(byte(s3, 3)) ^ + Te1(byte(s0, 2)) ^ + Te2(byte(s1, 1)) ^ + Te3(byte(s2, 0)) ^ + rk[7]; + + rk += 8; + if (--r == 0) { + break; + } + + s0 = + Te0(byte(t0, 3)) ^ + Te1(byte(t1, 2)) ^ + Te2(byte(t2, 1)) ^ + Te3(byte(t3, 0)) ^ + rk[0]; + s1 = + Te0(byte(t1, 3)) ^ + Te1(byte(t2, 2)) ^ + Te2(byte(t3, 1)) ^ + Te3(byte(t0, 0)) ^ + rk[1]; + s2 = + Te0(byte(t2, 3)) ^ + Te1(byte(t3, 2)) ^ + Te2(byte(t0, 1)) ^ + Te3(byte(t1, 0)) ^ + rk[2]; + s3 = + Te0(byte(t3, 3)) ^ + Te1(byte(t0, 2)) ^ + Te2(byte(t1, 1)) ^ + Te3(byte(t2, 0)) ^ + rk[3]; + } + +#endif + + /* + * apply last round and + * map cipher state to byte array block: + */ + s0 = + (Te4_3[byte(t0, 3)]) ^ + (Te4_2[byte(t1, 2)]) ^ + (Te4_1[byte(t2, 1)]) ^ + (Te4_0[byte(t3, 0)]) ^ + rk[0]; + STORE32H(s0, ct); + s1 = + (Te4_3[byte(t1, 3)]) ^ + (Te4_2[byte(t2, 2)]) ^ + (Te4_1[byte(t3, 1)]) ^ + (Te4_0[byte(t0, 0)]) ^ + rk[1]; + STORE32H(s1, ct+4); + s2 = + (Te4_3[byte(t2, 3)]) ^ + (Te4_2[byte(t3, 2)]) ^ + (Te4_1[byte(t0, 1)]) ^ + (Te4_0[byte(t1, 0)]) ^ + rk[2]; + STORE32H(s2, ct+8); + s3 = + (Te4_3[byte(t3, 3)]) ^ + (Te4_2[byte(t0, 2)]) ^ + (Te4_1[byte(t1, 1)]) ^ + (Te4_0[byte(t2, 0)]) ^ + rk[3]; + STORE32H(s3, ct+12); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int ECB_ENC(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err = _rijndael_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(unsigned long)*8 + sizeof(unsigned long*) + sizeof(int)*2); + return err; +} +#endif + +#ifndef ENCRYPT_ONLY + +/** + Decrypts a block of text with AES + @param ct The input ciphertext (16 bytes) + @param pt The output plaintext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int ECB_DEC(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; + int Nr, r; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + Nr = skey->rijndael.Nr; + rk = skey->rijndael.dK; + + /* + * map byte array block to cipher state + * and add initial round key: + */ + LOAD32H(s0, ct ); s0 ^= rk[0]; + LOAD32H(s1, ct + 4); s1 ^= rk[1]; + LOAD32H(s2, ct + 8); s2 ^= rk[2]; + LOAD32H(s3, ct + 12); s3 ^= rk[3]; + +#ifdef LTC_SMALL_CODE + for (r = 0; ; r++) { + rk += 4; + t0 = + Td0(byte(s0, 3)) ^ + Td1(byte(s3, 2)) ^ + Td2(byte(s2, 1)) ^ + Td3(byte(s1, 0)) ^ + rk[0]; + t1 = + Td0(byte(s1, 3)) ^ + Td1(byte(s0, 2)) ^ + Td2(byte(s3, 1)) ^ + Td3(byte(s2, 0)) ^ + rk[1]; + t2 = + Td0(byte(s2, 3)) ^ + Td1(byte(s1, 2)) ^ + Td2(byte(s0, 1)) ^ + Td3(byte(s3, 0)) ^ + rk[2]; + t3 = + Td0(byte(s3, 3)) ^ + Td1(byte(s2, 2)) ^ + Td2(byte(s1, 1)) ^ + Td3(byte(s0, 0)) ^ + rk[3]; + if (r == Nr-2) { + break; + } + s0 = t0; s1 = t1; s2 = t2; s3 = t3; + } + rk += 4; + +#else + + /* + * Nr - 1 full rounds: + */ + r = Nr >> 1; + for (;;) { + + t0 = + Td0(byte(s0, 3)) ^ + Td1(byte(s3, 2)) ^ + Td2(byte(s2, 1)) ^ + Td3(byte(s1, 0)) ^ + rk[4]; + t1 = + Td0(byte(s1, 3)) ^ + Td1(byte(s0, 2)) ^ + Td2(byte(s3, 1)) ^ + Td3(byte(s2, 0)) ^ + rk[5]; + t2 = + Td0(byte(s2, 3)) ^ + Td1(byte(s1, 2)) ^ + Td2(byte(s0, 1)) ^ + Td3(byte(s3, 0)) ^ + rk[6]; + t3 = + Td0(byte(s3, 3)) ^ + Td1(byte(s2, 2)) ^ + Td2(byte(s1, 1)) ^ + Td3(byte(s0, 0)) ^ + rk[7]; + + rk += 8; + if (--r == 0) { + break; + } + + + s0 = + Td0(byte(t0, 3)) ^ + Td1(byte(t3, 2)) ^ + Td2(byte(t2, 1)) ^ + Td3(byte(t1, 0)) ^ + rk[0]; + s1 = + Td0(byte(t1, 3)) ^ + Td1(byte(t0, 2)) ^ + Td2(byte(t3, 1)) ^ + Td3(byte(t2, 0)) ^ + rk[1]; + s2 = + Td0(byte(t2, 3)) ^ + Td1(byte(t1, 2)) ^ + Td2(byte(t0, 1)) ^ + Td3(byte(t3, 0)) ^ + rk[2]; + s3 = + Td0(byte(t3, 3)) ^ + Td1(byte(t2, 2)) ^ + Td2(byte(t1, 1)) ^ + Td3(byte(t0, 0)) ^ + rk[3]; + } +#endif + + /* + * apply last round and + * map cipher state to byte array block: + */ + s0 = + (Td4[byte(t0, 3)] & 0xff000000) ^ + (Td4[byte(t3, 2)] & 0x00ff0000) ^ + (Td4[byte(t2, 1)] & 0x0000ff00) ^ + (Td4[byte(t1, 0)] & 0x000000ff) ^ + rk[0]; + STORE32H(s0, pt); + s1 = + (Td4[byte(t1, 3)] & 0xff000000) ^ + (Td4[byte(t0, 2)] & 0x00ff0000) ^ + (Td4[byte(t3, 1)] & 0x0000ff00) ^ + (Td4[byte(t2, 0)] & 0x000000ff) ^ + rk[1]; + STORE32H(s1, pt+4); + s2 = + (Td4[byte(t2, 3)] & 0xff000000) ^ + (Td4[byte(t1, 2)] & 0x00ff0000) ^ + (Td4[byte(t0, 1)] & 0x0000ff00) ^ + (Td4[byte(t3, 0)] & 0x000000ff) ^ + rk[2]; + STORE32H(s2, pt+8); + s3 = + (Td4[byte(t3, 3)] & 0xff000000) ^ + (Td4[byte(t2, 2)] & 0x00ff0000) ^ + (Td4[byte(t1, 1)] & 0x0000ff00) ^ + (Td4[byte(t0, 0)] & 0x000000ff) ^ + rk[3]; + STORE32H(s3, pt+12); + + return CRYPT_OK; +} + + +#ifdef LTC_CLEAN_STACK +int ECB_DEC(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err = _rijndael_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(unsigned long)*8 + sizeof(unsigned long*) + sizeof(int)*2); + return err; +} +#endif + +/** + Performs a self-test of the AES block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int ECB_TEST(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + int err; + static const struct { + int keylen; + unsigned char key[32], pt[16], ct[16]; + } tests[] = { + { 16, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, + 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, + { 0x69, 0xc4, 0xe0, 0xd8, 0x6a, 0x7b, 0x04, 0x30, + 0xd8, 0xcd, 0xb7, 0x80, 0x70, 0xb4, 0xc5, 0x5a } + }, { + 24, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17 }, + { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, + 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, + { 0xdd, 0xa9, 0x7c, 0xa4, 0x86, 0x4c, 0xdf, 0xe0, + 0x6e, 0xaf, 0x70, 0xa0, 0xec, 0x0d, 0x71, 0x91 } + }, { + 32, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, + { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, + 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, + { 0x8e, 0xa2, 0xb7, 0xca, 0x51, 0x67, 0x45, 0xbf, + 0xea, 0xfc, 0x49, 0x90, 0x4b, 0x49, 0x60, 0x89 } + } + }; + + symmetric_key key; + unsigned char tmp[2][16]; + int i, y; + + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + zeromem(&key, sizeof(key)); + if ((err = rijndael_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { + return err; + } + + rijndael_ecb_encrypt(tests[i].pt, tmp[0], &key); + rijndael_ecb_decrypt(tmp[0], tmp[1], &key); + if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { +#if 0 + printf("\n\nTest %d failed\n", i); + if (XMEMCMP(tmp[0], tests[i].ct, 16)) { + printf("CT: "); + for (i = 0; i < 16; i++) { + printf("%02x ", tmp[0][i]); + } + printf("\n"); + } else { + printf("PT: "); + for (i = 0; i < 16; i++) { + printf("%02x ", tmp[1][i]); + } + printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) rijndael_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) rijndael_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; + #endif +} + +#endif /* ENCRYPT_ONLY */ + + +/** Terminate the context + @param skey The scheduled key +*/ +void ECB_DONE(symmetric_key *skey) +{ + LTC_UNUSED_PARAM(skey); +} + + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int ECB_KS(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + + if (*keysize < 16) + return CRYPT_INVALID_KEYSIZE; + if (*keysize < 24) { + *keysize = 16; + return CRYPT_OK; + } else if (*keysize < 32) { + *keysize = 24; + return CRYPT_OK; + } else { + *keysize = 32; + return CRYPT_OK; + } +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/aes/aes.c,v $ */ +/* $Revision: 1.16 $ */ +/* $Date: 2007/05/12 14:13:00 $ */ diff --git a/core/lib/libtomcrypt/src/ciphers/aes_armv8a_ce.c b/core/lib/libtomcrypt/src/ciphers/aes_armv8a_ce.c new file mode 100644 index 0000000..dc2a6f0 --- /dev/null +++ b/core/lib/libtomcrypt/src/ciphers/aes_armv8a_ce.c @@ -0,0 +1,393 @@ +/* + * Copyright (c) 2015, Linaro Limited + * All rights reserved. + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* + * AES cipher for ARMv8 with Crypto Extensions + * + * Copyright (C) 2013 Linaro Ltd <ard.biesheuvel@linaro.org> + */ + +#include "tomcrypt.h" +#include "tomcrypt_arm_neon.h" + +typedef unsigned int u32; +typedef unsigned char u8; + +/* Prototypes for assembly functions */ +uint32_t ce_aes_sub(uint32_t in); +void ce_aes_invert(void *dst, void *src); +void ce_aes_ecb_encrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + int blocks, int first); +void ce_aes_ecb_decrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + int blocks, int first); +void ce_aes_cbc_encrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + int blocks, u8 iv[], int first); +void ce_aes_cbc_decrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + int blocks, u8 iv[], int first); +void ce_aes_ctr_encrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + int blocks, u8 ctr[], int first); +void ce_aes_xts_encrypt(u8 out[], u8 const in[], u8 const rk1[], int rounds, + int blocks, u8 const rk2[], u8 iv[]); +void ce_aes_xts_decrypt(u8 out[], u8 const in[], u8 const rk1[], int rounds, + int blocks, u8 const rk2[], u8 iv[]); + + +struct aes_block { + u8 b[16]; +}; + +static inline u32 ror32(u32 val, u32 shift) +{ + return (val >> shift) | (val << (32 - shift)); +} + +int rijndael_setup(const unsigned char *key, int keylen, int num_rounds, + symmetric_key *skey) +{ + /* The AES key schedule round constants */ + static u8 const rcon[] = { + 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, + }; + u32 kwords = keylen / sizeof(u32); + struct aes_block *key_enc, *key_dec; + struct tomcrypt_arm_neon_state state; + unsigned int i, j; + void *p; + + LTC_ARGCHK(key); + LTC_ARGCHK(skey); + + if (keylen != 16 && keylen != 24 && keylen != 32) + return CRYPT_INVALID_KEYSIZE; + + if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) + return CRYPT_INVALID_ROUNDS; + + num_rounds = 10 + ((keylen/8)-2)*2; + skey->rijndael.Nr = num_rounds; + + memcpy(skey->rijndael.eK, key, keylen); + + tomcrypt_arm_neon_enable(&state); + + for (i = 0; i < sizeof(rcon); i++) { + u32 *rki; + u32 *rko; + + p = skey->rijndael.eK; + rki = (u32 *)p + (i * kwords); + rko = rki + kwords; + + rko[0] = ror32(ce_aes_sub(rki[kwords - 1]), 8) + ^ rcon[i] ^ rki[0]; + rko[1] = rko[0] ^ rki[1]; + rko[2] = rko[1] ^ rki[2]; + rko[3] = rko[2] ^ rki[3]; + + if (keylen == 24) { + if (i >= 7) + break; + rko[4] = rko[3] ^ rki[4]; + rko[5] = rko[4] ^ rki[5]; + } else if (keylen == 32) { + if (i >= 6) + break; + rko[4] = ce_aes_sub(rko[3]) ^ rki[4]; + rko[5] = rko[4] ^ rki[5]; + rko[6] = rko[5] ^ rki[6]; + rko[7] = rko[6] ^ rki[7]; + } + } + + /* + * Generate the decryption keys for the Equivalent Inverse Cipher. + * This involves reversing the order of the round keys, and applying + * the Inverse Mix Columns transformation on all but the first and + * the last one. + */ + p = skey->rijndael.eK; + key_enc = (struct aes_block *)p; + p = skey->rijndael.dK; + key_dec = (struct aes_block *)p; + j = num_rounds; + + key_dec[0] = key_enc[j]; + for (i = 1, j--; j > 0; i++, j--) + ce_aes_invert(key_dec + i, key_enc + j); + key_dec[i] = key_enc[0]; + + tomcrypt_arm_neon_disable(&state); + + return CRYPT_OK; +} + +void rijndael_done(symmetric_key *skey) +{ +} + +int rijndael_keysize(int *keysize) +{ + LTC_ARGCHK(keysize); + + if (*keysize < 16) + return CRYPT_INVALID_KEYSIZE; + else if (*keysize < 24) + *keysize = 16; + else if (*keysize < 32) + *keysize = 24; + else + *keysize = 32; + + return CRYPT_OK; +} + +static int aes_ecb_encrypt_nblocks(const unsigned char *pt, unsigned char *ct, + unsigned long blocks, symmetric_key *skey) +{ + struct tomcrypt_arm_neon_state state; + u8 *rk; + int Nr; + + LTC_ARGCHK(pt); + LTC_ARGCHK(ct); + LTC_ARGCHK(skey); + + Nr = skey->rijndael.Nr; + rk = (u8 *)skey->rijndael.eK; + + tomcrypt_arm_neon_enable(&state); + ce_aes_ecb_encrypt(ct, pt, rk, Nr, blocks, 1); + tomcrypt_arm_neon_disable(&state); + + return CRYPT_OK; +} + +static int aes_ecb_decrypt_nblocks(const unsigned char *ct, unsigned char *pt, + unsigned long blocks, symmetric_key *skey) +{ + struct tomcrypt_arm_neon_state state; + u8 *rk; + int Nr; + + LTC_ARGCHK(pt); + LTC_ARGCHK(ct); + LTC_ARGCHK(skey); + + Nr = skey->rijndael.Nr; + rk = (u8 *)skey->rijndael.dK; + + tomcrypt_arm_neon_enable(&state); + ce_aes_ecb_decrypt(pt, ct, rk, Nr, blocks, 1); + tomcrypt_arm_neon_disable(&state); + + return CRYPT_OK; +} + +int rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, + symmetric_key *skey) +{ + return aes_ecb_encrypt_nblocks(pt, ct, 1, skey); +} + +int rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, + symmetric_key *skey) +{ + return aes_ecb_decrypt_nblocks(ct, pt, 1, skey); +} + +static int aes_cbc_encrypt_nblocks(const unsigned char *pt, unsigned char *ct, + unsigned long blocks, unsigned char *IV, + symmetric_key *skey) +{ + struct tomcrypt_arm_neon_state state; + u8 *rk; + int Nr; + + LTC_ARGCHK(pt); + LTC_ARGCHK(ct); + LTC_ARGCHK(IV); + LTC_ARGCHK(skey); + + Nr = skey->rijndael.Nr; + rk = (u8 *)skey->rijndael.eK; + + tomcrypt_arm_neon_enable(&state); + ce_aes_cbc_encrypt(ct, pt, rk, Nr, blocks, IV, 1); + tomcrypt_arm_neon_disable(&state); + + return CRYPT_OK; +} + +static int aes_cbc_decrypt_nblocks(const unsigned char *ct, unsigned char *pt, + unsigned long blocks, unsigned char *IV, + symmetric_key *skey) +{ + struct tomcrypt_arm_neon_state state; + u8 *rk; + int Nr; + + LTC_ARGCHK(pt); + LTC_ARGCHK(ct); + LTC_ARGCHK(IV); + LTC_ARGCHK(skey); + + Nr = skey->rijndael.Nr; + rk = (u8 *)skey->rijndael.dK; + + tomcrypt_arm_neon_enable(&state); + ce_aes_cbc_decrypt(pt, ct, rk, Nr, blocks, IV, 1); + tomcrypt_arm_neon_disable(&state); + + return CRYPT_OK; +} + +/* Increment 128-bit counter */ +static void increment_ctr(unsigned char *val) +{ + int i; + + for (i = 15; i >= 0; i--) { + val[i] = (val[i] + 1) & 0xff; + if (val[i]) + break; + } +} + +static int aes_ctr_encrypt_nblocks(const unsigned char *pt, unsigned char *ct, + unsigned long blocks, unsigned char *IV, + int mode, symmetric_key *skey) +{ + struct tomcrypt_arm_neon_state state; + u8 *rk; + int Nr; + + LTC_ARGCHK(pt); + LTC_ARGCHK(ct); + LTC_ARGCHK(IV); + LTC_ARGCHK(skey); + + if (mode == CTR_COUNTER_LITTLE_ENDIAN) { + /* Accelerated algorithm supports big endian only */ + return CRYPT_ERROR; + } + + Nr = skey->rijndael.Nr; + rk = (u8 *)skey->rijndael.eK; + + increment_ctr(IV); + tomcrypt_arm_neon_enable(&state); + ce_aes_ctr_encrypt(ct, pt, rk, Nr, blocks, IV, 1); + tomcrypt_arm_neon_disable(&state); + + return CRYPT_OK; +} + +static int aes_xts_encrypt_nblocks(const unsigned char *pt, unsigned char *ct, + unsigned long blocks, unsigned char *tweak, + symmetric_key *skey1, symmetric_key *skey2) +{ + struct tomcrypt_arm_neon_state state; + u8 *rk1, *rk2; + int Nr; + + LTC_ARGCHK(pt); + LTC_ARGCHK(ct); + LTC_ARGCHK(tweak); + LTC_ARGCHK(skey1); + LTC_ARGCHK(skey2); + LTC_ARGCHK(skey1->rijndael.Nr == skey2->rijndael.Nr); + + Nr = skey1->rijndael.Nr; + rk1 = (u8 *)skey1->rijndael.eK; + rk2 = (u8 *)skey2->rijndael.eK; + + tomcrypt_arm_neon_enable(&state); + ce_aes_xts_encrypt(ct, pt, rk1, Nr, blocks, rk2, tweak); + tomcrypt_arm_neon_disable(&state); + + return CRYPT_OK; +} + +static int aes_xts_decrypt_nblocks(const unsigned char *ct, unsigned char *pt, + unsigned long blocks, unsigned char *tweak, + symmetric_key *skey1, symmetric_key *skey2) +{ + struct tomcrypt_arm_neon_state state; + u8 *rk1, *rk2; + int Nr; + + LTC_ARGCHK(pt); + LTC_ARGCHK(ct); + LTC_ARGCHK(tweak); + LTC_ARGCHK(skey1); + LTC_ARGCHK(skey2); + LTC_ARGCHK(skey1->rijndael.Nr == skey2->rijndael.Nr); + + Nr = skey1->rijndael.Nr; + rk1 = (u8 *)skey1->rijndael.dK; + rk2 = (u8 *)skey2->rijndael.eK; + + tomcrypt_arm_neon_enable(&state); + ce_aes_xts_decrypt(pt, ct, rk1, Nr, blocks, rk2, tweak); + tomcrypt_arm_neon_disable(&state); + + return CRYPT_OK; +} + +const struct ltc_cipher_descriptor aes_desc = { + .name = "aes", + .ID = 6, + .min_key_length = 16, + .max_key_length = 32, + .block_length = 16, + .default_rounds = 10, + .setup = rijndael_setup, + .ecb_encrypt = rijndael_ecb_encrypt, + .ecb_decrypt = rijndael_ecb_decrypt, + .done = rijndael_done, + .keysize = rijndael_keysize, + .accel_ecb_encrypt = aes_ecb_encrypt_nblocks, + .accel_ecb_decrypt = aes_ecb_decrypt_nblocks, + .accel_cbc_encrypt = aes_cbc_encrypt_nblocks, + .accel_cbc_decrypt = aes_cbc_decrypt_nblocks, + .accel_ctr_encrypt = aes_ctr_encrypt_nblocks, + .accel_xts_encrypt = aes_xts_encrypt_nblocks, + .accel_xts_decrypt = aes_xts_decrypt_nblocks, +}; diff --git a/core/lib/libtomcrypt/src/ciphers/aes_modes_armv8a_ce_a32.S b/core/lib/libtomcrypt/src/ciphers/aes_modes_armv8a_ce_a32.S new file mode 100644 index 0000000..f4c12ea --- /dev/null +++ b/core/lib/libtomcrypt/src/ciphers/aes_modes_armv8a_ce_a32.S @@ -0,0 +1,548 @@ +/* + * Copyright (c) 2016, Linaro Limited + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * aes-ce-core.S - AES in CBC/CTR/XTS mode using ARMv8 Crypto Extensions + * + * Copyright (C) 2015 Linaro Ltd <ard.biesheuvel@linaro.org> + */ + + .text + .fpu crypto-neon-fp-armv8 + .align 3 + + .macro enc_round, state, key + aese.8 \state, \key + aesmc.8 \state, \state + .endm + + .macro dec_round, state, key + aesd.8 \state, \key + aesimc.8 \state, \state + .endm + + .macro enc_dround, key1, key2 + enc_round q0, \key1 + enc_round q0, \key2 + .endm + + .macro dec_dround, key1, key2 + dec_round q0, \key1 + dec_round q0, \key2 + .endm + + .macro enc_fround, key1, key2, key3 + enc_round q0, \key1 + aese.8 q0, \key2 + veor q0, q0, \key3 + .endm + + .macro dec_fround, key1, key2, key3 + dec_round q0, \key1 + aesd.8 q0, \key2 + veor q0, q0, \key3 + .endm + + .macro enc_dround_3x, key1, key2 + enc_round q0, \key1 + enc_round q1, \key1 + enc_round q2, \key1 + enc_round q0, \key2 + enc_round q1, \key2 + enc_round q2, \key2 + .endm + + .macro dec_dround_3x, key1, key2 + dec_round q0, \key1 + dec_round q1, \key1 + dec_round q2, \key1 + dec_round q0, \key2 + dec_round q1, \key2 + dec_round q2, \key2 + .endm + + .macro enc_fround_3x, key1, key2, key3 + enc_round q0, \key1 + enc_round q1, \key1 + enc_round q2, \key1 + aese.8 q0, \key2 + aese.8 q1, \key2 + aese.8 q2, \key2 + veor q0, q0, \key3 + veor q1, q1, \key3 + veor q2, q2, \key3 + .endm + + .macro dec_fround_3x, key1, key2, key3 + dec_round q0, \key1 + dec_round q1, \key1 + dec_round q2, \key1 + aesd.8 q0, \key2 + aesd.8 q1, \key2 + aesd.8 q2, \key2 + veor q0, q0, \key3 + veor q1, q1, \key3 + veor q2, q2, \key3 + .endm + + .macro do_block, dround, fround + cmp r3, #12 @ which key size? + vld1.8 {q10-q11}, [ip]! + \dround q8, q9 + vld1.8 {q12-q13}, [ip]! + \dround q10, q11 + vld1.8 {q10-q11}, [ip]! + \dround q12, q13 + vld1.8 {q12-q13}, [ip]! + \dround q10, q11 + blo 0f @ AES-128: 10 rounds + vld1.8 {q10-q11}, [ip]! + \dround q12, q13 + beq 1f @ AES-192: 12 rounds + vld1.8 {q12-q13}, [ip] + \dround q10, q11 +0: \fround q12, q13, q14 + bx lr + +1: \fround q10, q11, q14 + bx lr + .endm + + /* + * Internal, non-AAPCS compliant functions that implement the core AES + * transforms. These should preserve all registers except q0 - q2 and ip + * Arguments: + * q0 : first in/output block + * q1 : second in/output block (_3x version only) + * q2 : third in/output block (_3x version only) + * q8 : first round key + * q9 : secound round key + * q14 : final round key + * r2 : address of round key array + * r3 : number of rounds + */ + .align 6 +aes_encrypt: + add ip, r2, #32 @ 3rd round key +.Laes_encrypt_tweak: + do_block enc_dround, enc_fround + + .align 6 +aes_decrypt: + add ip, r2, #32 @ 3rd round key + do_block dec_dround, dec_fround + + .align 6 +aes_encrypt_3x: + add ip, r2, #32 @ 3rd round key + do_block enc_dround_3x, enc_fround_3x + + .align 6 +aes_decrypt_3x: + add ip, r2, #32 @ 3rd round key + do_block dec_dround_3x, dec_fround_3x + + .macro prepare_key, rk, rounds + add ip, \rk, \rounds, lsl #4 + vld1.8 {q8-q9}, [\rk] @ load first 2 round keys + vld1.8 {q14}, [ip] @ load last round key + .endm + + /* + * aes_ecb_encrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + * int blocks) + * aes_ecb_decrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + * int blocks) + */ + .global ce_aes_ecb_encrypt + .type ce_aes_ecb_encrypt, %function +ce_aes_ecb_encrypt: + push {r4, lr} + ldr r4, [sp, #8] + prepare_key r2, r3 +.Lecbencloop3x: + subs r4, r4, #3 + bmi .Lecbenc1x + vld1.8 {q0-q1}, [r1]! + vld1.8 {q2}, [r1]! + bl aes_encrypt_3x + vst1.8 {q0-q1}, [r0]! + vst1.8 {q2}, [r0]! + b .Lecbencloop3x +.Lecbenc1x: + adds r4, r4, #3 + beq .Lecbencout +.Lecbencloop: + vld1.8 {q0}, [r1]! + bl aes_encrypt + vst1.8 {q0}, [r0]! + subs r4, r4, #1 + bne .Lecbencloop +.Lecbencout: + pop {r4, pc} + + .global ce_aes_ecb_decrypt + .type ce_aes_ecb_decrypt, %function +ce_aes_ecb_decrypt: + push {r4, lr} + ldr r4, [sp, #8] + prepare_key r2, r3 +.Lecbdecloop3x: + subs r4, r4, #3 + bmi .Lecbdec1x + vld1.8 {q0-q1}, [r1]! + vld1.8 {q2}, [r1]! + bl aes_decrypt_3x + vst1.8 {q0-q1}, [r0]! + vst1.8 {q2}, [r0]! + b .Lecbdecloop3x +.Lecbdec1x: + adds r4, r4, #3 + beq .Lecbdecout +.Lecbdecloop: + vld1.8 {q0}, [r1]! + bl aes_decrypt + vst1.8 {q0}, [r0]! + subs r4, r4, #1 + bne .Lecbdecloop +.Lecbdecout: + pop {r4, pc} + + /* + * aes_cbc_encrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + * int blocks, u8 iv[]) + * aes_cbc_decrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + * int blocks, u8 iv[]) + */ + .global ce_aes_cbc_encrypt + .type ce_aes_cbc_encrypt, %function +ce_aes_cbc_encrypt: + push {r4-r6, lr} + ldrd r4, r5, [sp, #16] + vld1.8 {q0}, [r5] + prepare_key r2, r3 +.Lcbcencloop: + vld1.8 {q1}, [r1]! @ get next pt block + veor q0, q0, q1 @ ..and xor with iv + bl aes_encrypt + vst1.8 {q0}, [r0]! + subs r4, r4, #1 + bne .Lcbcencloop + vst1.8 {q0}, [r5] + pop {r4-r6, pc} + + .global ce_aes_cbc_decrypt + .type ce_aes_cbc_decrypt, %function +ce_aes_cbc_decrypt: + push {r4-r6, lr} + ldrd r4, r5, [sp, #16] + vld1.8 {q6}, [r5] @ keep iv in q6 + prepare_key r2, r3 +.Lcbcdecloop3x: + subs r4, r4, #3 + bmi .Lcbcdec1x + vld1.8 {q0-q1}, [r1]! + vld1.8 {q2}, [r1]! + vmov q3, q0 + vmov q4, q1 + vmov q5, q2 + bl aes_decrypt_3x + veor q0, q0, q6 + veor q1, q1, q3 + veor q2, q2, q4 + vmov q6, q5 + vst1.8 {q0-q1}, [r0]! + vst1.8 {q2}, [r0]! + b .Lcbcdecloop3x +.Lcbcdec1x: + adds r4, r4, #3 + beq .Lcbcdecout + vmov q15, q14 @ preserve last round key +.Lcbcdecloop: + vld1.8 {q0}, [r1]! @ get next ct block + veor q14, q15, q6 @ combine prev ct with last key + vmov q6, q0 + bl aes_decrypt + vst1.8 {q0}, [r0]! + subs r4, r4, #1 + bne .Lcbcdecloop +.Lcbcdecout: + vst1.8 {q6}, [r5] @ keep iv in q6 + pop {r4-r6, pc} + + /* + * aes_ctr_encrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + * int blocks, u8 ctr[]) + */ + /* + * Note: ctr is not incremented before first block is encrypted. It is + * not incremented either after the last block is done. The value used + * for the last block is copied on return. + */ + .global ce_aes_ctr_encrypt + .type ce_aes_ctr_encrypt, %function +ce_aes_ctr_encrypt: + push {r4-r6, lr} + ldrd r4, r5, [sp, #16] + vld1.8 {q6}, [r5] @ load ctr + prepare_key r2, r3 + vmov r6, s27 @ keep swabbed ctr in r6 + rev r6, r6 + sub r7, r4, #1 @ times ctr will be incremented + cmn r6, r7 @ 32 bit overflow? + bcs .Lctrloop +.Lctrloop3x: + subs r4, r4, #3 + bmi .Lctr1x + vmov q0, q6 + vmov q1, q6 + rev ip, r6 + add r6, r6, #1 + vmov q2, q6 + vmov s7, ip + rev ip, r6 + add r6, r6, #1 + vmov s11, ip + vld1.8 {q3-q4}, [r1]! + vld1.8 {q5}, [r1]! + bl aes_encrypt_3x + veor q0, q0, q3 + veor q1, q1, q4 + veor q2, q2, q5 + rev ip, r6 + vst1.8 {q0-q1}, [r0]! + vst1.8 {q2}, [r0]! + vmov s27, ip + b .Lctrloop3x +.Lctr1x: + adds r4, r4, #3 + beq .Lctrout +.Lctrloop: + vmov q0, q6 + bl aes_encrypt + subs r4, r4, #1 + bmi .Lctrhalfblock @ blocks < 0 means 1/2 block + vld1.8 {q3}, [r1]! + veor q3, q0, q3 + vst1.8 {q3}, [r0]! + beq .Lctrout + + adds r6, r6, #1 @ increment BE ctr + rev ip, r6 + vmov s27, ip + bcs .Lctrcarry + teq r4, #0 + bne .Lctrloop +.Lctrout: + vst1.8 {q6}, [r5] + pop {r4-r6, pc} + +.Lctrhalfblock: + vld1.8 {d1}, [r1] + veor d0, d0, d1 + vst1.8 {d0}, [r0] + pop {r4-r6, pc} + +.Lctrcarry: + .irp sreg, s26, s25, s24 + vmov ip, \sreg @ load next word of ctr + rev ip, ip @ ... to handle the carry + adds ip, ip, #1 + rev ip, ip + vmov \sreg, ip + bcc 0f + .endr +0: teq r4, #0 + beq .Lctrout + b .Lctrloop + + /* + * aes_xts_encrypt(u8 out[], u8 const in[], u8 const rk1[], int rounds, + * int blocks, u8 iv[], u8 const rk2[]) + * aes_xts_decrypt(u8 out[], u8 const in[], u8 const rk1[], int rounds, + * int blocks, u8 iv[], u8 const rk2[]) + */ + + .macro next_tweak, out, in, const, tmp + vshr.s64 \tmp, \in, #63 + vand \tmp, \tmp, \const + vadd.u64 \out, \in, \in + vext.8 \tmp, \tmp, \tmp, #8 + veor \out, \out, \tmp + .endm + + .align 3 +.Lxts_mul_x: + .quad 1, 0x87 + + .global ce_aes_xts_init + .type ce_aes_xts_init, %function +ce_aes_xts_init: + vldr d14, .Lxts_mul_x + vldr d15, .Lxts_mul_x + 8 + + ldr r4, [sp, #16] @ load args + ldr r5, [sp, #24] + vld1.8 {q0}, [r5] @ load iv + + @ Encrypt the IV in q0 with the second AES key. This should only + @ be done at the start of a block. + ldr r6, [sp, #20] @ load AES key 2 + prepare_key r6, r3 + add ip, r6, #32 @ 3rd round key of key 2 + b .Laes_encrypt_tweak @ tail call + + .global ce_aes_xts_encrypt + .type ce_aes_xts_encrypt, %function +ce_aes_xts_encrypt: + push {r4-r6, lr} + + bl ce_aes_xts_init @ run shared prologue + prepare_key r2, r3 + vmov q3, q0 + + teq r6, #0 @ start of a block? + bne .Lxtsenc3x + +.Lxtsencloop3x: + next_tweak q3, q3, q7, q6 +.Lxtsenc3x: + subs r4, r4, #3 + bmi .Lxtsenc1x + vld1.8 {q0-q1}, [r1]! @ get 3 pt blocks + vld1.8 {q2}, [r1]! + next_tweak q4, q3, q7, q6 + veor q0, q0, q3 + next_tweak q5, q4, q7, q6 + veor q1, q1, q4 + veor q2, q2, q5 + bl aes_encrypt_3x + veor q0, q0, q3 + veor q1, q1, q4 + veor q2, q2, q5 + vst1.8 {q0-q1}, [r0]! @ write 3 ct blocks + vst1.8 {q2}, [r0]! + vmov q3, q5 + teq r4, #0 + beq .Lxtsencout + b .Lxtsencloop3x +.Lxtsenc1x: + adds r4, r4, #3 + beq .Lxtsencout +.Lxtsencloop: + vld1.8 {q0}, [r1]! + veor q0, q0, q3 + bl aes_encrypt + veor q0, q0, q3 + vst1.8 {q0}, [r0]! + subs r4, r4, #1 + beq .Lxtsencout + next_tweak q3, q3, q7, q6 + b .Lxtsencloop +.Lxtsencout: + next_tweak q3, q3, q7, q6 + vst1.8 {q3}, [r5] + pop {r4-r6, pc} + + .global ce_aes_xts_decrypt + .type ce_aes_xts_decrypt, %function +ce_aes_xts_decrypt: + push {r4-r6, lr} + + bl ce_aes_xts_init @ run shared prologue + prepare_key r2, r3 + vmov q3, q0 + + teq r6, #0 @ start of a block? + bne .Lxtsdec3x + +.Lxtsdecloop3x: + next_tweak q3, q3, q7, q6 +.Lxtsdec3x: + subs r4, r4, #3 + bmi .Lxtsdec1x + vld1.8 {q0-q1}, [r1]! @ get 3 ct blocks + vld1.8 {q2}, [r1]! + next_tweak q4, q3, q7, q6 + veor q0, q0, q3 + next_tweak q5, q4, q7, q6 + veor q1, q1, q4 + veor q2, q2, q5 + bl aes_decrypt_3x + veor q0, q0, q3 + veor q1, q1, q4 + veor q2, q2, q5 + vst1.8 {q0-q1}, [r0]! @ write 3 pt blocks + vst1.8 {q2}, [r0]! + vmov q3, q5 + teq r4, #0 + beq .Lxtsdecout + b .Lxtsdecloop3x +.Lxtsdec1x: + adds r4, r4, #3 + beq .Lxtsdecout +.Lxtsdecloop: + vld1.8 {q0}, [r1]! + veor q0, q0, q3 + add ip, r2, #32 @ 3rd round key + bl aes_decrypt + veor q0, q0, q3 + vst1.8 {q0}, [r0]! + subs r4, r4, #1 + beq .Lxtsdecout + next_tweak q3, q3, q7, q6 + b .Lxtsdecloop +.Lxtsdecout: + next_tweak q3, q3, q7, q6 + vst1.8 {q3}, [r5] + pop {r4-r6, pc} + + /* + * u32 ce_aes_sub(u32 input) - use the aese instruction to perform the + * AES sbox substitution on each byte in + * 'input' + */ + .global ce_aes_sub + .type ce_aes_sub, %function +ce_aes_sub: + vdup.32 q1, r0 + veor q0, q0, q0 + aese.8 q0, q1 + vmov r0, s0 + bx lr + + /* + * void ce_aes_invert(u8 *dst, u8 *src) - perform the Inverse MixColumns + * operation on round key *src + */ + .global ce_aes_invert + .type ce_aes_invert, %function +ce_aes_invert: + vld1.8 {q0}, [r1] + aesimc.8 q0, q0 + vst1.8 {q0}, [r0] + bx lr diff --git a/core/lib/libtomcrypt/src/ciphers/aes_modes_armv8a_ce_a64.S b/core/lib/libtomcrypt/src/ciphers/aes_modes_armv8a_ce_a64.S new file mode 100644 index 0000000..bbc533e --- /dev/null +++ b/core/lib/libtomcrypt/src/ciphers/aes_modes_armv8a_ce_a64.S @@ -0,0 +1,705 @@ +/* + * Copyright (c) 2015, Linaro Limited + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * - AES cipher for ARMv8 with Crypto Extensions + * - Chaining mode wrappers for AES + * + * Copyright (C) 2013 Linaro Ltd <ard.biesheuvel@linaro.org> + */ + + +#define ENTRY(func) \ + .global func ; \ + .type func , %function ; \ + func : + +#define ENDPROC(func) \ + .size func , .-func + + .arch armv8-a+crypto + + /* preload all round keys */ + .macro load_round_keys, rounds, rk + cmp \rounds, #12 + blo 2222f /* 128 bits */ + beq 1111f /* 192 bits */ + ld1 {v17.16b-v18.16b}, [\rk], #32 +1111: ld1 {v19.16b-v20.16b}, [\rk], #32 +2222: ld1 {v21.16b-v24.16b}, [\rk], #64 + ld1 {v25.16b-v28.16b}, [\rk], #64 + ld1 {v29.16b-v31.16b}, [\rk] + .endm + + /* prepare for encryption with key in rk[] */ + .macro enc_prepare, rounds, rk, ignore + load_round_keys \rounds, \rk + .endm + + /* prepare for encryption (again) but with new key in rk[] */ + .macro enc_switch_key, rounds, rk, ignore + load_round_keys \rounds, \rk + .endm + + /* prepare for decryption with key in rk[] */ + .macro dec_prepare, rounds, rk, ignore + load_round_keys \rounds, \rk + .endm + + .macro do_enc_Nx, de, mc, k, i0, i1, i2, i3 + aes\de \i0\().16b, \k\().16b + aes\mc \i0\().16b, \i0\().16b + .ifnb \i1 + aes\de \i1\().16b, \k\().16b + aes\mc \i1\().16b, \i1\().16b + .ifnb \i3 + aes\de \i2\().16b, \k\().16b + aes\mc \i2\().16b, \i2\().16b + aes\de \i3\().16b, \k\().16b + aes\mc \i3\().16b, \i3\().16b + .endif + .endif + .endm + + /* up to 4 interleaved encryption rounds with the same round key */ + .macro round_Nx, enc, k, i0, i1, i2, i3 + .ifc \enc, e + do_enc_Nx e, mc, \k, \i0, \i1, \i2, \i3 + .else + do_enc_Nx d, imc, \k, \i0, \i1, \i2, \i3 + .endif + .endm + + /* up to 4 interleaved final rounds */ + .macro fin_round_Nx, de, k, k2, i0, i1, i2, i3 + aes\de \i0\().16b, \k\().16b + .ifnb \i1 + aes\de \i1\().16b, \k\().16b + .ifnb \i3 + aes\de \i2\().16b, \k\().16b + aes\de \i3\().16b, \k\().16b + .endif + .endif + eor \i0\().16b, \i0\().16b, \k2\().16b + .ifnb \i1 + eor \i1\().16b, \i1\().16b, \k2\().16b + .ifnb \i3 + eor \i2\().16b, \i2\().16b, \k2\().16b + eor \i3\().16b, \i3\().16b, \k2\().16b + .endif + .endif + .endm + + /* up to 4 interleaved blocks */ + .macro do_block_Nx, enc, rounds, i0, i1, i2, i3 + cmp \rounds, #12 + blo 2222f /* 128 bits */ + beq 1111f /* 192 bits */ + round_Nx \enc, v17, \i0, \i1, \i2, \i3 + round_Nx \enc, v18, \i0, \i1, \i2, \i3 +1111: round_Nx \enc, v19, \i0, \i1, \i2, \i3 + round_Nx \enc, v20, \i0, \i1, \i2, \i3 +2222: .irp key, v21, v22, v23, v24, v25, v26, v27, v28, v29 + round_Nx \enc, \key, \i0, \i1, \i2, \i3 + .endr + fin_round_Nx \enc, v30, v31, \i0, \i1, \i2, \i3 + .endm + + .macro encrypt_block, in, rounds, t0, t1, t2 + do_block_Nx e, \rounds, \in + .endm + + .macro encrypt_block2x, i0, i1, rounds, t0, t1, t2 + do_block_Nx e, \rounds, \i0, \i1 + .endm + + .macro encrypt_block4x, i0, i1, i2, i3, rounds, t0, t1, t2 + do_block_Nx e, \rounds, \i0, \i1, \i2, \i3 + .endm + + .macro decrypt_block, in, rounds, t0, t1, t2 + do_block_Nx d, \rounds, \in + .endm + + .macro decrypt_block2x, i0, i1, rounds, t0, t1, t2 + do_block_Nx d, \rounds, \i0, \i1 + .endm + + .macro decrypt_block4x, i0, i1, i2, i3, rounds, t0, t1, t2 + do_block_Nx d, \rounds, \i0, \i1, \i2, \i3 + .endm + + + .text + .align 4 + +/* + * There are several ways to instantiate this code: + * - no interleave, all inline + * - 2-way interleave, 2x calls out of line (-DINTERLEAVE=2) + * - 2-way interleave, all inline (-DINTERLEAVE=2 -DINTERLEAVE_INLINE) + * - 4-way interleave, 4x calls out of line (-DINTERLEAVE=4) + * - 4-way interleave, all inline (-DINTERLEAVE=4 -DINTERLEAVE_INLINE) + * + * Macros imported by this code: + * - enc_prepare - setup NEON registers for encryption + * - dec_prepare - setup NEON registers for decryption + * - enc_switch_key - change to new key after having prepared for encryption + * - encrypt_block - encrypt a single block + * - decrypt block - decrypt a single block + * - encrypt_block2x - encrypt 2 blocks in parallel (if INTERLEAVE == 2) + * - decrypt_block2x - decrypt 2 blocks in parallel (if INTERLEAVE == 2) + * - encrypt_block4x - encrypt 4 blocks in parallel (if INTERLEAVE == 4) + * - decrypt_block4x - decrypt 4 blocks in parallel (if INTERLEAVE == 4) + */ + +#if defined(INTERLEAVE) && !defined(INTERLEAVE_INLINE) +#define FRAME_PUSH stp x29, x30, [sp,#-16]! ; mov x29, sp +#define FRAME_POP ldp x29, x30, [sp],#16 + +#if INTERLEAVE == 2 + +aes_encrypt_block2x: + encrypt_block2x v0, v1, w3, x2, x6, w7 + ret +ENDPROC(aes_encrypt_block2x) + +aes_decrypt_block2x: + decrypt_block2x v0, v1, w3, x2, x6, w7 + ret +ENDPROC(aes_decrypt_block2x) + +#elif INTERLEAVE == 4 + +aes_encrypt_block4x: + encrypt_block4x v0, v1, v2, v3, w3, x2, x6, w7 + ret +ENDPROC(aes_encrypt_block4x) + +aes_decrypt_block4x: + decrypt_block4x v0, v1, v2, v3, w3, x2, x6, w7 + ret +ENDPROC(aes_decrypt_block4x) + +#else +#error INTERLEAVE should equal 2 or 4 +#endif + + .macro do_encrypt_block2x + bl aes_encrypt_block2x + .endm + + .macro do_decrypt_block2x + bl aes_decrypt_block2x + .endm + + .macro do_encrypt_block4x + bl aes_encrypt_block4x + .endm + + .macro do_decrypt_block4x + bl aes_decrypt_block4x + .endm + +#else +#define FRAME_PUSH +#define FRAME_POP + + .macro do_encrypt_block2x + encrypt_block2x v0, v1, w3, x2, x6, w7 + .endm + + .macro do_decrypt_block2x + decrypt_block2x v0, v1, w3, x2, x6, w7 + .endm + + .macro do_encrypt_block4x + encrypt_block4x v0, v1, v2, v3, w3, x2, x6, w7 + .endm + + .macro do_decrypt_block4x + decrypt_block4x v0, v1, v2, v3, w3, x2, x6, w7 + .endm + +#endif + + + /* + * uint32_t ce_aes_sub(uint32_t in) - use the aese instruction to + * perform the AES sbox substitution on each byte in 'input' + */ +ENTRY(ce_aes_sub) + dup v1.4s, w0 + movi v0.16b, #0 + aese v0.16b, v1.16b + umov w0, v0.4s[0] + ret +ENDPROC(ce_aes_sub) + + /* + * void ce_aes_invert(void *dst, void *src) + */ +ENTRY(ce_aes_invert) + ld1 {v0.16b}, [x1] + aesimc v1.16b, v0.16b + st1 {v1.16b}, [x0] + ret +ENDPROC(ce_aes_invert) + + /* + * ce_aes_ecb_encrypt(u8 out[], u8 const in[], u8 const rk[], + * int rounds, int blocks, int first) + * ce_aes_ecb_decrypt(u8 out[], u8 const in[], u8 const rk[], + * int rounds, int blocks, int first) + */ + +ENTRY(ce_aes_ecb_encrypt) + FRAME_PUSH + cbz w5, .LecbencloopNx + + enc_prepare w3, x2, x5 + +.LecbencloopNx: +#if INTERLEAVE >= 2 + subs w4, w4, #INTERLEAVE + bmi .Lecbenc1x +#if INTERLEAVE == 2 + ld1 {v0.16b-v1.16b}, [x1], #32 /* get 2 pt blocks */ + do_encrypt_block2x + st1 {v0.16b-v1.16b}, [x0], #32 +#else + ld1 {v0.16b-v3.16b}, [x1], #64 /* get 4 pt blocks */ + do_encrypt_block4x + st1 {v0.16b-v3.16b}, [x0], #64 +#endif + b .LecbencloopNx +.Lecbenc1x: + adds w4, w4, #INTERLEAVE + beq .Lecbencout +#endif +.Lecbencloop: + ld1 {v0.16b}, [x1], #16 /* get next pt block */ + encrypt_block v0, w3, x2, x5, w6 + st1 {v0.16b}, [x0], #16 + subs w4, w4, #1 + bne .Lecbencloop +.Lecbencout: + FRAME_POP + ret +ENDPROC(ce_aes_ecb_encrypt) + + +ENTRY(ce_aes_ecb_decrypt) + FRAME_PUSH + cbz w5, .LecbdecloopNx + + dec_prepare w3, x2, x5 + +.LecbdecloopNx: +#if INTERLEAVE >= 2 + subs w4, w4, #INTERLEAVE + bmi .Lecbdec1x +#if INTERLEAVE == 2 + ld1 {v0.16b-v1.16b}, [x1], #32 /* get 2 ct blocks */ + do_decrypt_block2x + st1 {v0.16b-v1.16b}, [x0], #32 +#else + ld1 {v0.16b-v3.16b}, [x1], #64 /* get 4 ct blocks */ + do_decrypt_block4x + st1 {v0.16b-v3.16b}, [x0], #64 +#endif + b .LecbdecloopNx +.Lecbdec1x: + adds w4, w4, #INTERLEAVE + beq .Lecbdecout +#endif +.Lecbdecloop: + ld1 {v0.16b}, [x1], #16 /* get next ct block */ + decrypt_block v0, w3, x2, x5, w6 + st1 {v0.16b}, [x0], #16 + subs w4, w4, #1 + bne .Lecbdecloop +.Lecbdecout: + FRAME_POP + ret +ENDPROC(ce_aes_ecb_decrypt) + + + /* + * aes_cbc_encrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + * int blocks, u8 iv[], int first) + * aes_cbc_decrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + * int blocks, u8 iv[], int first) + */ + +ENTRY(ce_aes_cbc_encrypt) + cbz w6, .Lcbcencloop + + ld1 {v0.16b}, [x5] /* get iv */ + enc_prepare w3, x2, x5 + +.Lcbcencloop: + ld1 {v1.16b}, [x1], #16 /* get next pt block */ + eor v0.16b, v0.16b, v1.16b /* ..and xor with iv */ + encrypt_block v0, w3, x2, x5, w6 + st1 {v0.16b}, [x0], #16 + subs w4, w4, #1 + bne .Lcbcencloop + st1 {v0.16b}, [x5] /* save iv for later */ + ret +ENDPROC(ce_aes_cbc_encrypt) + + +ENTRY(ce_aes_cbc_decrypt) + FRAME_PUSH + cbz w6, .LcbcdecloopNx + + ld1 {v7.16b}, [x5] /* get iv */ + dec_prepare w3, x2, x5 + +.LcbcdecloopNx: +#if INTERLEAVE >= 2 + subs w4, w4, #INTERLEAVE + bmi .Lcbcdec1x +#if INTERLEAVE == 2 + ld1 {v0.16b-v1.16b}, [x1], #32 /* get 2 ct blocks */ + mov v2.16b, v0.16b + mov v3.16b, v1.16b + do_decrypt_block2x + eor v0.16b, v0.16b, v7.16b + eor v1.16b, v1.16b, v2.16b + mov v7.16b, v3.16b + st1 {v0.16b-v1.16b}, [x0], #32 +#else + ld1 {v0.16b-v3.16b}, [x1], #64 /* get 4 ct blocks */ + mov v4.16b, v0.16b + mov v5.16b, v1.16b + mov v6.16b, v2.16b + do_decrypt_block4x + sub x1, x1, #16 + eor v0.16b, v0.16b, v7.16b + eor v1.16b, v1.16b, v4.16b + ld1 {v7.16b}, [x1], #16 /* reload 1 ct block */ + eor v2.16b, v2.16b, v5.16b + eor v3.16b, v3.16b, v6.16b + st1 {v0.16b-v3.16b}, [x0], #64 +#endif + b .LcbcdecloopNx +.Lcbcdec1x: + adds w4, w4, #INTERLEAVE + beq .Lcbcdecout +#endif +.Lcbcdecloop: + ld1 {v1.16b}, [x1], #16 /* get next ct block */ + mov v0.16b, v1.16b /* ...and copy to v0 */ + decrypt_block v0, w3, x2, x5, w6 + eor v0.16b, v0.16b, v7.16b /* xor with iv => pt */ + mov v7.16b, v1.16b /* ct is next iv */ + st1 {v0.16b}, [x0], #16 + subs w4, w4, #1 + bne .Lcbcdecloop +.Lcbcdecout: + st1 {v1.16b}, [x5] /* save iv for later */ + FRAME_POP + ret +ENDPROC(ce_aes_cbc_decrypt) + + + /* + * aes_ctr_encrypt(u8 out[], u8 const in[], u8 const rk[], int rounds, + * int blocks, u8 ctr[], int first) + */ + +ENTRY(ce_aes_ctr_encrypt) + FRAME_PUSH + mov x9, x5 /* save ctr pointer */ + cbnz w6, .Lctrfirst /* 1st time around? */ + umov x5, v4.d[1] /* keep swabbed ctr in reg */ + rev x5, x5 +#if INTERLEAVE >= 2 + cmn w5, w4 /* 32 bit overflow? */ + bcs .Lctrinc + add x5, x5, #1 /* increment BE ctr */ + b .LctrincNx +#else + b .Lctrinc +#endif +.Lctrfirst: + enc_prepare w3, x2, x6 + ld1 {v4.16b}, [x5] + umov x5, v4.d[1] /* keep swabbed ctr in reg */ + rev x5, x5 +#if INTERLEAVE >= 2 + cmn w5, w4 /* 32 bit overflow? */ + bcs .Lctrloop +.LctrloopNx: + subs w4, w4, #INTERLEAVE + bmi .Lctr1x +#if INTERLEAVE == 2 + mov v0.8b, v4.8b + mov v1.8b, v4.8b + rev x7, x5 + add x5, x5, #1 + ins v0.d[1], x7 + rev x7, x5 + add x5, x5, #1 + ins v1.d[1], x7 + ld1 {v2.16b-v3.16b}, [x1], #32 /* get 2 input blocks */ + do_encrypt_block2x + eor v0.16b, v0.16b, v2.16b + eor v1.16b, v1.16b, v3.16b + st1 {v0.16b-v1.16b}, [x0], #32 +#else + ldr q8, =0x30000000200000001 /* addends 1,2,3[,0] */ + dup v7.4s, w5 + mov v0.16b, v4.16b + add v7.4s, v7.4s, v8.4s + mov v1.16b, v4.16b + rev32 v8.16b, v7.16b + mov v2.16b, v4.16b + mov v3.16b, v4.16b + mov v1.s[3], v8.s[0] + mov v2.s[3], v8.s[1] + mov v3.s[3], v8.s[2] + ld1 {v5.16b-v7.16b}, [x1], #48 /* get 3 input blocks */ + do_encrypt_block4x + eor v0.16b, v5.16b, v0.16b + ld1 {v5.16b}, [x1], #16 /* get 1 input block */ + eor v1.16b, v6.16b, v1.16b + eor v2.16b, v7.16b, v2.16b + eor v3.16b, v5.16b, v3.16b + st1 {v0.16b-v3.16b}, [x0], #64 + add x5, x5, #INTERLEAVE +#endif + cbz w4, .LctroutNx +.LctrincNx: + rev x7, x5 + ins v4.d[1], x7 + b .LctrloopNx +.LctroutNx: + sub x5, x5, #1 + rev x7, x5 + ins v4.d[1], x7 + b .Lctrout +.Lctr1x: + adds w4, w4, #INTERLEAVE + beq .Lctrout +#endif +.Lctrloop: + mov v0.16b, v4.16b + encrypt_block v0, w3, x2, x6, w7 + subs w4, w4, #1 + bmi .Lctrhalfblock /* blocks < 0 means 1/2 block */ + ld1 {v3.16b}, [x1], #16 + eor v3.16b, v0.16b, v3.16b + st1 {v3.16b}, [x0], #16 + beq .Lctrout +.Lctrinc: + adds x5, x5, #1 /* increment BE ctr */ + rev x7, x5 + ins v4.d[1], x7 + bcc .Lctrloop /* no overflow? */ + umov x7, v4.d[0] /* load upper word of ctr */ + rev x7, x7 /* ... to handle the carry */ + add x7, x7, #1 + rev x7, x7 + ins v4.d[0], x7 + b .Lctrloop +.Lctrhalfblock: + ld1 {v3.8b}, [x1] + eor v3.8b, v0.8b, v3.8b + st1 {v3.8b}, [x0] +.Lctrout: + st1 {v4.16b}, [x9] /* save ctr for next call */ + FRAME_POP + ret +ENDPROC(ce_aes_ctr_encrypt) + .ltorg + + + /* + * aes_xts_decrypt(u8 out[], u8 const in[], u8 const rk1[], int rounds, + * int blocks, u8 const rk2[], u8 iv[]) + * aes_xts_decrypt(u8 out[], u8 const in[], u8 const rk1[], int rounds, + * int blocks, u8 const rk2[], u8 iv[]) + */ + + .macro next_tweak, out, in, const, tmp + sshr \tmp\().2d, \in\().2d, #63 + and \tmp\().16b, \tmp\().16b, \const\().16b + add \out\().2d, \in\().2d, \in\().2d + ext \tmp\().16b, \tmp\().16b, \tmp\().16b, #8 + eor \out\().16b, \out\().16b, \tmp\().16b + .endm + +.Lxts_mul_x: + .word 1, 0, 0x87, 0 + +ENTRY(ce_aes_xts_encrypt) + FRAME_PUSH + + ld1 {v4.16b}, [x6] + enc_prepare w3, x5, x6 + encrypt_block v4, w3, x5, x6, w7 /* first tweak */ + enc_switch_key w3, x2, x6 + ldr q7, .Lxts_mul_x + b .LxtsencNx + +.LxtsencloopNx: + ldr q7, .Lxts_mul_x + next_tweak v4, v4, v7, v8 +.LxtsencNx: +#if INTERLEAVE >= 2 + subs w4, w4, #INTERLEAVE + bmi .Lxtsenc1x +#if INTERLEAVE == 2 + ld1 {v0.16b-v1.16b}, [x1], #32 /* get 2 pt blocks */ + next_tweak v5, v4, v7, v8 + eor v0.16b, v0.16b, v4.16b + eor v1.16b, v1.16b, v5.16b + do_encrypt_block2x + eor v0.16b, v0.16b, v4.16b + eor v1.16b, v1.16b, v5.16b + st1 {v0.16b-v1.16b}, [x0], #32 + cbz w4, .LxtsencoutNx + next_tweak v4, v5, v7, v8 + b .LxtsencNx +.LxtsencoutNx: + mov v4.16b, v5.16b + b .Lxtsencout +#else + ld1 {v0.16b-v3.16b}, [x1], #64 /* get 4 pt blocks */ + next_tweak v5, v4, v7, v8 + eor v0.16b, v0.16b, v4.16b + next_tweak v6, v5, v7, v8 + eor v1.16b, v1.16b, v5.16b + eor v2.16b, v2.16b, v6.16b + next_tweak v7, v6, v7, v8 + eor v3.16b, v3.16b, v7.16b + do_encrypt_block4x + eor v3.16b, v3.16b, v7.16b + eor v0.16b, v0.16b, v4.16b + eor v1.16b, v1.16b, v5.16b + eor v2.16b, v2.16b, v6.16b + st1 {v0.16b-v3.16b}, [x0], #64 + mov v4.16b, v7.16b + cbz w4, .Lxtsencout + b .LxtsencloopNx +#endif +.Lxtsenc1x: + adds w4, w4, #INTERLEAVE + beq .Lxtsencout +#endif +.Lxtsencloop: + ld1 {v1.16b}, [x1], #16 + eor v0.16b, v1.16b, v4.16b + encrypt_block v0, w3, x2, x6, w7 + eor v0.16b, v0.16b, v4.16b + st1 {v0.16b}, [x0], #16 + subs w4, w4, #1 + beq .Lxtsencout + next_tweak v4, v4, v7, v8 + b .Lxtsencloop +.Lxtsencout: + next_tweak v4, v4, v7, v8 + st1 {v4.16b}, [x6], #16 + FRAME_POP + ret +ENDPROC(ce_aes_xts_encrypt) + + +ENTRY(ce_aes_xts_decrypt) + FRAME_PUSH + + ld1 {v4.16b}, [x6] + enc_prepare w3, x5, x6 + encrypt_block v4, w3, x5, x6, w7 /* first tweak */ + dec_prepare w3, x2, x6 + ldr q7, .Lxts_mul_x + b .LxtsdecNx + +.LxtsdecloopNx: + ldr q7, .Lxts_mul_x + next_tweak v4, v4, v7, v8 +.LxtsdecNx: +#if INTERLEAVE >= 2 + subs w4, w4, #INTERLEAVE + bmi .Lxtsdec1x +#if INTERLEAVE == 2 + ld1 {v0.16b-v1.16b}, [x1], #32 /* get 2 ct blocks */ + next_tweak v5, v4, v7, v8 + eor v0.16b, v0.16b, v4.16b + eor v1.16b, v1.16b, v5.16b + do_decrypt_block2x + eor v0.16b, v0.16b, v4.16b + eor v1.16b, v1.16b, v5.16b + st1 {v0.16b-v1.16b}, [x0], #32 + cbz w4, .LxtsdecoutNx + next_tweak v4, v5, v7, v8 + b .LxtsdecNx +.LxtsdecoutNx: + mov v4.16b, v5.16b + b .Lxtsdecout +#else + ld1 {v0.16b-v3.16b}, [x1], #64 /* get 4 ct blocks */ + next_tweak v5, v4, v7, v8 + eor v0.16b, v0.16b, v4.16b + next_tweak v6, v5, v7, v8 + eor v1.16b, v1.16b, v5.16b + eor v2.16b, v2.16b, v6.16b + next_tweak v7, v6, v7, v8 + eor v3.16b, v3.16b, v7.16b + do_decrypt_block4x + eor v3.16b, v3.16b, v7.16b + eor v0.16b, v0.16b, v4.16b + eor v1.16b, v1.16b, v5.16b + eor v2.16b, v2.16b, v6.16b + st1 {v0.16b-v3.16b}, [x0], #64 + mov v4.16b, v7.16b + cbz w4, .Lxtsdecout + b .LxtsdecloopNx +#endif +.Lxtsdec1x: + adds w4, w4, #INTERLEAVE + beq .Lxtsdecout +#endif +.Lxtsdecloop: + ld1 {v1.16b}, [x1], #16 + eor v0.16b, v1.16b, v4.16b + decrypt_block v0, w3, x2, x6, w7 + eor v0.16b, v0.16b, v4.16b + st1 {v0.16b}, [x0], #16 + subs w4, w4, #1 + beq .Lxtsdecout + next_tweak v4, v4, v7, v8 + b .Lxtsdecloop +.Lxtsdecout: + FRAME_POP + next_tweak v4, v4, v7, v8 + st1 {v4.16b}, [x6], #16 + ret +ENDPROC(ce_aes_xts_decrypt) diff --git a/core/lib/libtomcrypt/src/ciphers/aes_tab.c b/core/lib/libtomcrypt/src/ciphers/aes_tab.c new file mode 100644 index 0000000..51a90a6 --- /dev/null +++ b/core/lib/libtomcrypt/src/ciphers/aes_tab.c @@ -0,0 +1,1057 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +/* The precomputed tables for AES */ +/* +Te0[x] = S [x].[02, 01, 01, 03]; +Te1[x] = S [x].[03, 02, 01, 01]; +Te2[x] = S [x].[01, 03, 02, 01]; +Te3[x] = S [x].[01, 01, 03, 02]; +Te4[x] = S [x].[01, 01, 01, 01]; + +Td0[x] = Si[x].[0e, 09, 0d, 0b]; +Td1[x] = Si[x].[0b, 0e, 09, 0d]; +Td2[x] = Si[x].[0d, 0b, 0e, 09]; +Td3[x] = Si[x].[09, 0d, 0b, 0e]; +Td4[x] = Si[x].[01, 01, 01, 01]; +*/ + +/** + @file aes_tab.c + AES tables +*/ +#include "tomcrypt_macros.h" + +static const ulong32 TE0[256] = { + 0xc66363a5UL, 0xf87c7c84UL, 0xee777799UL, 0xf67b7b8dUL, + 0xfff2f20dUL, 0xd66b6bbdUL, 0xde6f6fb1UL, 0x91c5c554UL, + 0x60303050UL, 0x02010103UL, 0xce6767a9UL, 0x562b2b7dUL, + 0xe7fefe19UL, 0xb5d7d762UL, 0x4dababe6UL, 0xec76769aUL, + 0x8fcaca45UL, 0x1f82829dUL, 0x89c9c940UL, 0xfa7d7d87UL, + 0xeffafa15UL, 0xb25959ebUL, 0x8e4747c9UL, 0xfbf0f00bUL, + 0x41adadecUL, 0xb3d4d467UL, 0x5fa2a2fdUL, 0x45afafeaUL, + 0x239c9cbfUL, 0x53a4a4f7UL, 0xe4727296UL, 0x9bc0c05bUL, + 0x75b7b7c2UL, 0xe1fdfd1cUL, 0x3d9393aeUL, 0x4c26266aUL, + 0x6c36365aUL, 0x7e3f3f41UL, 0xf5f7f702UL, 0x83cccc4fUL, + 0x6834345cUL, 0x51a5a5f4UL, 0xd1e5e534UL, 0xf9f1f108UL, + 0xe2717193UL, 0xabd8d873UL, 0x62313153UL, 0x2a15153fUL, + 0x0804040cUL, 0x95c7c752UL, 0x46232365UL, 0x9dc3c35eUL, + 0x30181828UL, 0x379696a1UL, 0x0a05050fUL, 0x2f9a9ab5UL, + 0x0e070709UL, 0x24121236UL, 0x1b80809bUL, 0xdfe2e23dUL, + 0xcdebeb26UL, 0x4e272769UL, 0x7fb2b2cdUL, 0xea75759fUL, + 0x1209091bUL, 0x1d83839eUL, 0x582c2c74UL, 0x341a1a2eUL, + 0x361b1b2dUL, 0xdc6e6eb2UL, 0xb45a5aeeUL, 0x5ba0a0fbUL, + 0xa45252f6UL, 0x763b3b4dUL, 0xb7d6d661UL, 0x7db3b3ceUL, + 0x5229297bUL, 0xdde3e33eUL, 0x5e2f2f71UL, 0x13848497UL, + 0xa65353f5UL, 0xb9d1d168UL, 0x00000000UL, 0xc1eded2cUL, + 0x40202060UL, 0xe3fcfc1fUL, 0x79b1b1c8UL, 0xb65b5bedUL, + 0xd46a6abeUL, 0x8dcbcb46UL, 0x67bebed9UL, 0x7239394bUL, + 0x944a4adeUL, 0x984c4cd4UL, 0xb05858e8UL, 0x85cfcf4aUL, + 0xbbd0d06bUL, 0xc5efef2aUL, 0x4faaaae5UL, 0xedfbfb16UL, + 0x864343c5UL, 0x9a4d4dd7UL, 0x66333355UL, 0x11858594UL, + 0x8a4545cfUL, 0xe9f9f910UL, 0x04020206UL, 0xfe7f7f81UL, + 0xa05050f0UL, 0x783c3c44UL, 0x259f9fbaUL, 0x4ba8a8e3UL, + 0xa25151f3UL, 0x5da3a3feUL, 0x804040c0UL, 0x058f8f8aUL, + 0x3f9292adUL, 0x219d9dbcUL, 0x70383848UL, 0xf1f5f504UL, + 0x63bcbcdfUL, 0x77b6b6c1UL, 0xafdada75UL, 0x42212163UL, + 0x20101030UL, 0xe5ffff1aUL, 0xfdf3f30eUL, 0xbfd2d26dUL, + 0x81cdcd4cUL, 0x180c0c14UL, 0x26131335UL, 0xc3ecec2fUL, + 0xbe5f5fe1UL, 0x359797a2UL, 0x884444ccUL, 0x2e171739UL, + 0x93c4c457UL, 0x55a7a7f2UL, 0xfc7e7e82UL, 0x7a3d3d47UL, + 0xc86464acUL, 0xba5d5de7UL, 0x3219192bUL, 0xe6737395UL, + 0xc06060a0UL, 0x19818198UL, 0x9e4f4fd1UL, 0xa3dcdc7fUL, + 0x44222266UL, 0x542a2a7eUL, 0x3b9090abUL, 0x0b888883UL, + 0x8c4646caUL, 0xc7eeee29UL, 0x6bb8b8d3UL, 0x2814143cUL, + 0xa7dede79UL, 0xbc5e5ee2UL, 0x160b0b1dUL, 0xaddbdb76UL, + 0xdbe0e03bUL, 0x64323256UL, 0x743a3a4eUL, 0x140a0a1eUL, + 0x924949dbUL, 0x0c06060aUL, 0x4824246cUL, 0xb85c5ce4UL, + 0x9fc2c25dUL, 0xbdd3d36eUL, 0x43acacefUL, 0xc46262a6UL, + 0x399191a8UL, 0x319595a4UL, 0xd3e4e437UL, 0xf279798bUL, + 0xd5e7e732UL, 0x8bc8c843UL, 0x6e373759UL, 0xda6d6db7UL, + 0x018d8d8cUL, 0xb1d5d564UL, 0x9c4e4ed2UL, 0x49a9a9e0UL, + 0xd86c6cb4UL, 0xac5656faUL, 0xf3f4f407UL, 0xcfeaea25UL, + 0xca6565afUL, 0xf47a7a8eUL, 0x47aeaee9UL, 0x10080818UL, + 0x6fbabad5UL, 0xf0787888UL, 0x4a25256fUL, 0x5c2e2e72UL, + 0x381c1c24UL, 0x57a6a6f1UL, 0x73b4b4c7UL, 0x97c6c651UL, + 0xcbe8e823UL, 0xa1dddd7cUL, 0xe874749cUL, 0x3e1f1f21UL, + 0x964b4bddUL, 0x61bdbddcUL, 0x0d8b8b86UL, 0x0f8a8a85UL, + 0xe0707090UL, 0x7c3e3e42UL, 0x71b5b5c4UL, 0xcc6666aaUL, + 0x904848d8UL, 0x06030305UL, 0xf7f6f601UL, 0x1c0e0e12UL, + 0xc26161a3UL, 0x6a35355fUL, 0xae5757f9UL, 0x69b9b9d0UL, + 0x17868691UL, 0x99c1c158UL, 0x3a1d1d27UL, 0x279e9eb9UL, + 0xd9e1e138UL, 0xebf8f813UL, 0x2b9898b3UL, 0x22111133UL, + 0xd26969bbUL, 0xa9d9d970UL, 0x078e8e89UL, 0x339494a7UL, + 0x2d9b9bb6UL, 0x3c1e1e22UL, 0x15878792UL, 0xc9e9e920UL, + 0x87cece49UL, 0xaa5555ffUL, 0x50282878UL, 0xa5dfdf7aUL, + 0x038c8c8fUL, 0x59a1a1f8UL, 0x09898980UL, 0x1a0d0d17UL, + 0x65bfbfdaUL, 0xd7e6e631UL, 0x844242c6UL, 0xd06868b8UL, + 0x824141c3UL, 0x299999b0UL, 0x5a2d2d77UL, 0x1e0f0f11UL, + 0x7bb0b0cbUL, 0xa85454fcUL, 0x6dbbbbd6UL, 0x2c16163aUL, +}; + +#ifndef PELI_TAB +static const ulong32 Te4[256] = { + 0x63636363UL, 0x7c7c7c7cUL, 0x77777777UL, 0x7b7b7b7bUL, + 0xf2f2f2f2UL, 0x6b6b6b6bUL, 0x6f6f6f6fUL, 0xc5c5c5c5UL, + 0x30303030UL, 0x01010101UL, 0x67676767UL, 0x2b2b2b2bUL, + 0xfefefefeUL, 0xd7d7d7d7UL, 0xababababUL, 0x76767676UL, + 0xcacacacaUL, 0x82828282UL, 0xc9c9c9c9UL, 0x7d7d7d7dUL, + 0xfafafafaUL, 0x59595959UL, 0x47474747UL, 0xf0f0f0f0UL, + 0xadadadadUL, 0xd4d4d4d4UL, 0xa2a2a2a2UL, 0xafafafafUL, + 0x9c9c9c9cUL, 0xa4a4a4a4UL, 0x72727272UL, 0xc0c0c0c0UL, + 0xb7b7b7b7UL, 0xfdfdfdfdUL, 0x93939393UL, 0x26262626UL, + 0x36363636UL, 0x3f3f3f3fUL, 0xf7f7f7f7UL, 0xccccccccUL, + 0x34343434UL, 0xa5a5a5a5UL, 0xe5e5e5e5UL, 0xf1f1f1f1UL, + 0x71717171UL, 0xd8d8d8d8UL, 0x31313131UL, 0x15151515UL, + 0x04040404UL, 0xc7c7c7c7UL, 0x23232323UL, 0xc3c3c3c3UL, + 0x18181818UL, 0x96969696UL, 0x05050505UL, 0x9a9a9a9aUL, + 0x07070707UL, 0x12121212UL, 0x80808080UL, 0xe2e2e2e2UL, + 0xebebebebUL, 0x27272727UL, 0xb2b2b2b2UL, 0x75757575UL, + 0x09090909UL, 0x83838383UL, 0x2c2c2c2cUL, 0x1a1a1a1aUL, + 0x1b1b1b1bUL, 0x6e6e6e6eUL, 0x5a5a5a5aUL, 0xa0a0a0a0UL, + 0x52525252UL, 0x3b3b3b3bUL, 0xd6d6d6d6UL, 0xb3b3b3b3UL, + 0x29292929UL, 0xe3e3e3e3UL, 0x2f2f2f2fUL, 0x84848484UL, + 0x53535353UL, 0xd1d1d1d1UL, 0x00000000UL, 0xededededUL, + 0x20202020UL, 0xfcfcfcfcUL, 0xb1b1b1b1UL, 0x5b5b5b5bUL, + 0x6a6a6a6aUL, 0xcbcbcbcbUL, 0xbebebebeUL, 0x39393939UL, + 0x4a4a4a4aUL, 0x4c4c4c4cUL, 0x58585858UL, 0xcfcfcfcfUL, + 0xd0d0d0d0UL, 0xefefefefUL, 0xaaaaaaaaUL, 0xfbfbfbfbUL, + 0x43434343UL, 0x4d4d4d4dUL, 0x33333333UL, 0x85858585UL, + 0x45454545UL, 0xf9f9f9f9UL, 0x02020202UL, 0x7f7f7f7fUL, + 0x50505050UL, 0x3c3c3c3cUL, 0x9f9f9f9fUL, 0xa8a8a8a8UL, + 0x51515151UL, 0xa3a3a3a3UL, 0x40404040UL, 0x8f8f8f8fUL, + 0x92929292UL, 0x9d9d9d9dUL, 0x38383838UL, 0xf5f5f5f5UL, + 0xbcbcbcbcUL, 0xb6b6b6b6UL, 0xdadadadaUL, 0x21212121UL, + 0x10101010UL, 0xffffffffUL, 0xf3f3f3f3UL, 0xd2d2d2d2UL, + 0xcdcdcdcdUL, 0x0c0c0c0cUL, 0x13131313UL, 0xececececUL, + 0x5f5f5f5fUL, 0x97979797UL, 0x44444444UL, 0x17171717UL, + 0xc4c4c4c4UL, 0xa7a7a7a7UL, 0x7e7e7e7eUL, 0x3d3d3d3dUL, + 0x64646464UL, 0x5d5d5d5dUL, 0x19191919UL, 0x73737373UL, + 0x60606060UL, 0x81818181UL, 0x4f4f4f4fUL, 0xdcdcdcdcUL, + 0x22222222UL, 0x2a2a2a2aUL, 0x90909090UL, 0x88888888UL, + 0x46464646UL, 0xeeeeeeeeUL, 0xb8b8b8b8UL, 0x14141414UL, + 0xdedededeUL, 0x5e5e5e5eUL, 0x0b0b0b0bUL, 0xdbdbdbdbUL, + 0xe0e0e0e0UL, 0x32323232UL, 0x3a3a3a3aUL, 0x0a0a0a0aUL, + 0x49494949UL, 0x06060606UL, 0x24242424UL, 0x5c5c5c5cUL, + 0xc2c2c2c2UL, 0xd3d3d3d3UL, 0xacacacacUL, 0x62626262UL, + 0x91919191UL, 0x95959595UL, 0xe4e4e4e4UL, 0x79797979UL, + 0xe7e7e7e7UL, 0xc8c8c8c8UL, 0x37373737UL, 0x6d6d6d6dUL, + 0x8d8d8d8dUL, 0xd5d5d5d5UL, 0x4e4e4e4eUL, 0xa9a9a9a9UL, + 0x6c6c6c6cUL, 0x56565656UL, 0xf4f4f4f4UL, 0xeaeaeaeaUL, + 0x65656565UL, 0x7a7a7a7aUL, 0xaeaeaeaeUL, 0x08080808UL, + 0xbabababaUL, 0x78787878UL, 0x25252525UL, 0x2e2e2e2eUL, + 0x1c1c1c1cUL, 0xa6a6a6a6UL, 0xb4b4b4b4UL, 0xc6c6c6c6UL, + 0xe8e8e8e8UL, 0xddddddddUL, 0x74747474UL, 0x1f1f1f1fUL, + 0x4b4b4b4bUL, 0xbdbdbdbdUL, 0x8b8b8b8bUL, 0x8a8a8a8aUL, + 0x70707070UL, 0x3e3e3e3eUL, 0xb5b5b5b5UL, 0x66666666UL, + 0x48484848UL, 0x03030303UL, 0xf6f6f6f6UL, 0x0e0e0e0eUL, + 0x61616161UL, 0x35353535UL, 0x57575757UL, 0xb9b9b9b9UL, + 0x86868686UL, 0xc1c1c1c1UL, 0x1d1d1d1dUL, 0x9e9e9e9eUL, + 0xe1e1e1e1UL, 0xf8f8f8f8UL, 0x98989898UL, 0x11111111UL, + 0x69696969UL, 0xd9d9d9d9UL, 0x8e8e8e8eUL, 0x94949494UL, + 0x9b9b9b9bUL, 0x1e1e1e1eUL, 0x87878787UL, 0xe9e9e9e9UL, + 0xcecececeUL, 0x55555555UL, 0x28282828UL, 0xdfdfdfdfUL, + 0x8c8c8c8cUL, 0xa1a1a1a1UL, 0x89898989UL, 0x0d0d0d0dUL, + 0xbfbfbfbfUL, 0xe6e6e6e6UL, 0x42424242UL, 0x68686868UL, + 0x41414141UL, 0x99999999UL, 0x2d2d2d2dUL, 0x0f0f0f0fUL, + 0xb0b0b0b0UL, 0x54545454UL, 0xbbbbbbbbUL, 0x16161616UL, +}; +#endif + +#ifndef ENCRYPT_ONLY + +static const ulong32 TD0[256] = { + 0x51f4a750UL, 0x7e416553UL, 0x1a17a4c3UL, 0x3a275e96UL, + 0x3bab6bcbUL, 0x1f9d45f1UL, 0xacfa58abUL, 0x4be30393UL, + 0x2030fa55UL, 0xad766df6UL, 0x88cc7691UL, 0xf5024c25UL, + 0x4fe5d7fcUL, 0xc52acbd7UL, 0x26354480UL, 0xb562a38fUL, + 0xdeb15a49UL, 0x25ba1b67UL, 0x45ea0e98UL, 0x5dfec0e1UL, + 0xc32f7502UL, 0x814cf012UL, 0x8d4697a3UL, 0x6bd3f9c6UL, + 0x038f5fe7UL, 0x15929c95UL, 0xbf6d7aebUL, 0x955259daUL, + 0xd4be832dUL, 0x587421d3UL, 0x49e06929UL, 0x8ec9c844UL, + 0x75c2896aUL, 0xf48e7978UL, 0x99583e6bUL, 0x27b971ddUL, + 0xbee14fb6UL, 0xf088ad17UL, 0xc920ac66UL, 0x7dce3ab4UL, + 0x63df4a18UL, 0xe51a3182UL, 0x97513360UL, 0x62537f45UL, + 0xb16477e0UL, 0xbb6bae84UL, 0xfe81a01cUL, 0xf9082b94UL, + 0x70486858UL, 0x8f45fd19UL, 0x94de6c87UL, 0x527bf8b7UL, + 0xab73d323UL, 0x724b02e2UL, 0xe31f8f57UL, 0x6655ab2aUL, + 0xb2eb2807UL, 0x2fb5c203UL, 0x86c57b9aUL, 0xd33708a5UL, + 0x302887f2UL, 0x23bfa5b2UL, 0x02036abaUL, 0xed16825cUL, + 0x8acf1c2bUL, 0xa779b492UL, 0xf307f2f0UL, 0x4e69e2a1UL, + 0x65daf4cdUL, 0x0605bed5UL, 0xd134621fUL, 0xc4a6fe8aUL, + 0x342e539dUL, 0xa2f355a0UL, 0x058ae132UL, 0xa4f6eb75UL, + 0x0b83ec39UL, 0x4060efaaUL, 0x5e719f06UL, 0xbd6e1051UL, + 0x3e218af9UL, 0x96dd063dUL, 0xdd3e05aeUL, 0x4de6bd46UL, + 0x91548db5UL, 0x71c45d05UL, 0x0406d46fUL, 0x605015ffUL, + 0x1998fb24UL, 0xd6bde997UL, 0x894043ccUL, 0x67d99e77UL, + 0xb0e842bdUL, 0x07898b88UL, 0xe7195b38UL, 0x79c8eedbUL, + 0xa17c0a47UL, 0x7c420fe9UL, 0xf8841ec9UL, 0x00000000UL, + 0x09808683UL, 0x322bed48UL, 0x1e1170acUL, 0x6c5a724eUL, + 0xfd0efffbUL, 0x0f853856UL, 0x3daed51eUL, 0x362d3927UL, + 0x0a0fd964UL, 0x685ca621UL, 0x9b5b54d1UL, 0x24362e3aUL, + 0x0c0a67b1UL, 0x9357e70fUL, 0xb4ee96d2UL, 0x1b9b919eUL, + 0x80c0c54fUL, 0x61dc20a2UL, 0x5a774b69UL, 0x1c121a16UL, + 0xe293ba0aUL, 0xc0a02ae5UL, 0x3c22e043UL, 0x121b171dUL, + 0x0e090d0bUL, 0xf28bc7adUL, 0x2db6a8b9UL, 0x141ea9c8UL, + 0x57f11985UL, 0xaf75074cUL, 0xee99ddbbUL, 0xa37f60fdUL, + 0xf701269fUL, 0x5c72f5bcUL, 0x44663bc5UL, 0x5bfb7e34UL, + 0x8b432976UL, 0xcb23c6dcUL, 0xb6edfc68UL, 0xb8e4f163UL, + 0xd731dccaUL, 0x42638510UL, 0x13972240UL, 0x84c61120UL, + 0x854a247dUL, 0xd2bb3df8UL, 0xaef93211UL, 0xc729a16dUL, + 0x1d9e2f4bUL, 0xdcb230f3UL, 0x0d8652ecUL, 0x77c1e3d0UL, + 0x2bb3166cUL, 0xa970b999UL, 0x119448faUL, 0x47e96422UL, + 0xa8fc8cc4UL, 0xa0f03f1aUL, 0x567d2cd8UL, 0x223390efUL, + 0x87494ec7UL, 0xd938d1c1UL, 0x8ccaa2feUL, 0x98d40b36UL, + 0xa6f581cfUL, 0xa57ade28UL, 0xdab78e26UL, 0x3fadbfa4UL, + 0x2c3a9de4UL, 0x5078920dUL, 0x6a5fcc9bUL, 0x547e4662UL, + 0xf68d13c2UL, 0x90d8b8e8UL, 0x2e39f75eUL, 0x82c3aff5UL, + 0x9f5d80beUL, 0x69d0937cUL, 0x6fd52da9UL, 0xcf2512b3UL, + 0xc8ac993bUL, 0x10187da7UL, 0xe89c636eUL, 0xdb3bbb7bUL, + 0xcd267809UL, 0x6e5918f4UL, 0xec9ab701UL, 0x834f9aa8UL, + 0xe6956e65UL, 0xaaffe67eUL, 0x21bccf08UL, 0xef15e8e6UL, + 0xbae79bd9UL, 0x4a6f36ceUL, 0xea9f09d4UL, 0x29b07cd6UL, + 0x31a4b2afUL, 0x2a3f2331UL, 0xc6a59430UL, 0x35a266c0UL, + 0x744ebc37UL, 0xfc82caa6UL, 0xe090d0b0UL, 0x33a7d815UL, + 0xf104984aUL, 0x41ecdaf7UL, 0x7fcd500eUL, 0x1791f62fUL, + 0x764dd68dUL, 0x43efb04dUL, 0xccaa4d54UL, 0xe49604dfUL, + 0x9ed1b5e3UL, 0x4c6a881bUL, 0xc12c1fb8UL, 0x4665517fUL, + 0x9d5eea04UL, 0x018c355dUL, 0xfa877473UL, 0xfb0b412eUL, + 0xb3671d5aUL, 0x92dbd252UL, 0xe9105633UL, 0x6dd64713UL, + 0x9ad7618cUL, 0x37a10c7aUL, 0x59f8148eUL, 0xeb133c89UL, + 0xcea927eeUL, 0xb761c935UL, 0xe11ce5edUL, 0x7a47b13cUL, + 0x9cd2df59UL, 0x55f2733fUL, 0x1814ce79UL, 0x73c737bfUL, + 0x53f7cdeaUL, 0x5ffdaa5bUL, 0xdf3d6f14UL, 0x7844db86UL, + 0xcaaff381UL, 0xb968c43eUL, 0x3824342cUL, 0xc2a3405fUL, + 0x161dc372UL, 0xbce2250cUL, 0x283c498bUL, 0xff0d9541UL, + 0x39a80171UL, 0x080cb3deUL, 0xd8b4e49cUL, 0x6456c190UL, + 0x7bcb8461UL, 0xd532b670UL, 0x486c5c74UL, 0xd0b85742UL, +}; + +static const ulong32 Td4[256] = { + 0x52525252UL, 0x09090909UL, 0x6a6a6a6aUL, 0xd5d5d5d5UL, + 0x30303030UL, 0x36363636UL, 0xa5a5a5a5UL, 0x38383838UL, + 0xbfbfbfbfUL, 0x40404040UL, 0xa3a3a3a3UL, 0x9e9e9e9eUL, + 0x81818181UL, 0xf3f3f3f3UL, 0xd7d7d7d7UL, 0xfbfbfbfbUL, + 0x7c7c7c7cUL, 0xe3e3e3e3UL, 0x39393939UL, 0x82828282UL, + 0x9b9b9b9bUL, 0x2f2f2f2fUL, 0xffffffffUL, 0x87878787UL, + 0x34343434UL, 0x8e8e8e8eUL, 0x43434343UL, 0x44444444UL, + 0xc4c4c4c4UL, 0xdedededeUL, 0xe9e9e9e9UL, 0xcbcbcbcbUL, + 0x54545454UL, 0x7b7b7b7bUL, 0x94949494UL, 0x32323232UL, + 0xa6a6a6a6UL, 0xc2c2c2c2UL, 0x23232323UL, 0x3d3d3d3dUL, + 0xeeeeeeeeUL, 0x4c4c4c4cUL, 0x95959595UL, 0x0b0b0b0bUL, + 0x42424242UL, 0xfafafafaUL, 0xc3c3c3c3UL, 0x4e4e4e4eUL, + 0x08080808UL, 0x2e2e2e2eUL, 0xa1a1a1a1UL, 0x66666666UL, + 0x28282828UL, 0xd9d9d9d9UL, 0x24242424UL, 0xb2b2b2b2UL, + 0x76767676UL, 0x5b5b5b5bUL, 0xa2a2a2a2UL, 0x49494949UL, + 0x6d6d6d6dUL, 0x8b8b8b8bUL, 0xd1d1d1d1UL, 0x25252525UL, + 0x72727272UL, 0xf8f8f8f8UL, 0xf6f6f6f6UL, 0x64646464UL, + 0x86868686UL, 0x68686868UL, 0x98989898UL, 0x16161616UL, + 0xd4d4d4d4UL, 0xa4a4a4a4UL, 0x5c5c5c5cUL, 0xccccccccUL, + 0x5d5d5d5dUL, 0x65656565UL, 0xb6b6b6b6UL, 0x92929292UL, + 0x6c6c6c6cUL, 0x70707070UL, 0x48484848UL, 0x50505050UL, + 0xfdfdfdfdUL, 0xededededUL, 0xb9b9b9b9UL, 0xdadadadaUL, + 0x5e5e5e5eUL, 0x15151515UL, 0x46464646UL, 0x57575757UL, + 0xa7a7a7a7UL, 0x8d8d8d8dUL, 0x9d9d9d9dUL, 0x84848484UL, + 0x90909090UL, 0xd8d8d8d8UL, 0xababababUL, 0x00000000UL, + 0x8c8c8c8cUL, 0xbcbcbcbcUL, 0xd3d3d3d3UL, 0x0a0a0a0aUL, + 0xf7f7f7f7UL, 0xe4e4e4e4UL, 0x58585858UL, 0x05050505UL, + 0xb8b8b8b8UL, 0xb3b3b3b3UL, 0x45454545UL, 0x06060606UL, + 0xd0d0d0d0UL, 0x2c2c2c2cUL, 0x1e1e1e1eUL, 0x8f8f8f8fUL, + 0xcacacacaUL, 0x3f3f3f3fUL, 0x0f0f0f0fUL, 0x02020202UL, + 0xc1c1c1c1UL, 0xafafafafUL, 0xbdbdbdbdUL, 0x03030303UL, + 0x01010101UL, 0x13131313UL, 0x8a8a8a8aUL, 0x6b6b6b6bUL, + 0x3a3a3a3aUL, 0x91919191UL, 0x11111111UL, 0x41414141UL, + 0x4f4f4f4fUL, 0x67676767UL, 0xdcdcdcdcUL, 0xeaeaeaeaUL, + 0x97979797UL, 0xf2f2f2f2UL, 0xcfcfcfcfUL, 0xcecececeUL, + 0xf0f0f0f0UL, 0xb4b4b4b4UL, 0xe6e6e6e6UL, 0x73737373UL, + 0x96969696UL, 0xacacacacUL, 0x74747474UL, 0x22222222UL, + 0xe7e7e7e7UL, 0xadadadadUL, 0x35353535UL, 0x85858585UL, + 0xe2e2e2e2UL, 0xf9f9f9f9UL, 0x37373737UL, 0xe8e8e8e8UL, + 0x1c1c1c1cUL, 0x75757575UL, 0xdfdfdfdfUL, 0x6e6e6e6eUL, + 0x47474747UL, 0xf1f1f1f1UL, 0x1a1a1a1aUL, 0x71717171UL, + 0x1d1d1d1dUL, 0x29292929UL, 0xc5c5c5c5UL, 0x89898989UL, + 0x6f6f6f6fUL, 0xb7b7b7b7UL, 0x62626262UL, 0x0e0e0e0eUL, + 0xaaaaaaaaUL, 0x18181818UL, 0xbebebebeUL, 0x1b1b1b1bUL, + 0xfcfcfcfcUL, 0x56565656UL, 0x3e3e3e3eUL, 0x4b4b4b4bUL, + 0xc6c6c6c6UL, 0xd2d2d2d2UL, 0x79797979UL, 0x20202020UL, + 0x9a9a9a9aUL, 0xdbdbdbdbUL, 0xc0c0c0c0UL, 0xfefefefeUL, + 0x78787878UL, 0xcdcdcdcdUL, 0x5a5a5a5aUL, 0xf4f4f4f4UL, + 0x1f1f1f1fUL, 0xddddddddUL, 0xa8a8a8a8UL, 0x33333333UL, + 0x88888888UL, 0x07070707UL, 0xc7c7c7c7UL, 0x31313131UL, + 0xb1b1b1b1UL, 0x12121212UL, 0x10101010UL, 0x59595959UL, + 0x27272727UL, 0x80808080UL, 0xececececUL, 0x5f5f5f5fUL, + 0x60606060UL, 0x51515151UL, 0x7f7f7f7fUL, 0xa9a9a9a9UL, + 0x19191919UL, 0xb5b5b5b5UL, 0x4a4a4a4aUL, 0x0d0d0d0dUL, + 0x2d2d2d2dUL, 0xe5e5e5e5UL, 0x7a7a7a7aUL, 0x9f9f9f9fUL, + 0x93939393UL, 0xc9c9c9c9UL, 0x9c9c9c9cUL, 0xefefefefUL, + 0xa0a0a0a0UL, 0xe0e0e0e0UL, 0x3b3b3b3bUL, 0x4d4d4d4dUL, + 0xaeaeaeaeUL, 0x2a2a2a2aUL, 0xf5f5f5f5UL, 0xb0b0b0b0UL, + 0xc8c8c8c8UL, 0xebebebebUL, 0xbbbbbbbbUL, 0x3c3c3c3cUL, + 0x83838383UL, 0x53535353UL, 0x99999999UL, 0x61616161UL, + 0x17171717UL, 0x2b2b2b2bUL, 0x04040404UL, 0x7e7e7e7eUL, + 0xbabababaUL, 0x77777777UL, 0xd6d6d6d6UL, 0x26262626UL, + 0xe1e1e1e1UL, 0x69696969UL, 0x14141414UL, 0x63636363UL, + 0x55555555UL, 0x21212121UL, 0x0c0c0c0cUL, 0x7d7d7d7dUL, +}; + +#endif /* ENCRYPT_ONLY */ + +#ifdef LTC_SMALL_CODE + +#define Te0(x) TE0[x] +#define Te1(x) RORc(TE0[x], 8) +#define Te2(x) RORc(TE0[x], 16) +#define Te3(x) RORc(TE0[x], 24) + +#define Td0(x) TD0[x] +#define Td1(x) RORc(TD0[x], 8) +#define Td2(x) RORc(TD0[x], 16) +#define Td3(x) RORc(TD0[x], 24) + +#define Te4_0 0x000000FF & Te4 +#define Te4_1 0x0000FF00 & Te4 +#define Te4_2 0x00FF0000 & Te4 +#define Te4_3 0xFF000000 & Te4 + +#else + +#define Te0(x) TE0[x] +#define Te1(x) TE1[x] +#define Te2(x) TE2[x] +#define Te3(x) TE3[x] + +#define Td0(x) TD0[x] +#define Td1(x) TD1[x] +#define Td2(x) TD2[x] +#define Td3(x) TD3[x] + +static const ulong32 TE1[256] = { + 0xa5c66363UL, 0x84f87c7cUL, 0x99ee7777UL, 0x8df67b7bUL, + 0x0dfff2f2UL, 0xbdd66b6bUL, 0xb1de6f6fUL, 0x5491c5c5UL, + 0x50603030UL, 0x03020101UL, 0xa9ce6767UL, 0x7d562b2bUL, + 0x19e7fefeUL, 0x62b5d7d7UL, 0xe64dababUL, 0x9aec7676UL, + 0x458fcacaUL, 0x9d1f8282UL, 0x4089c9c9UL, 0x87fa7d7dUL, + 0x15effafaUL, 0xebb25959UL, 0xc98e4747UL, 0x0bfbf0f0UL, + 0xec41adadUL, 0x67b3d4d4UL, 0xfd5fa2a2UL, 0xea45afafUL, + 0xbf239c9cUL, 0xf753a4a4UL, 0x96e47272UL, 0x5b9bc0c0UL, + 0xc275b7b7UL, 0x1ce1fdfdUL, 0xae3d9393UL, 0x6a4c2626UL, + 0x5a6c3636UL, 0x417e3f3fUL, 0x02f5f7f7UL, 0x4f83ccccUL, + 0x5c683434UL, 0xf451a5a5UL, 0x34d1e5e5UL, 0x08f9f1f1UL, + 0x93e27171UL, 0x73abd8d8UL, 0x53623131UL, 0x3f2a1515UL, + 0x0c080404UL, 0x5295c7c7UL, 0x65462323UL, 0x5e9dc3c3UL, + 0x28301818UL, 0xa1379696UL, 0x0f0a0505UL, 0xb52f9a9aUL, + 0x090e0707UL, 0x36241212UL, 0x9b1b8080UL, 0x3ddfe2e2UL, + 0x26cdebebUL, 0x694e2727UL, 0xcd7fb2b2UL, 0x9fea7575UL, + 0x1b120909UL, 0x9e1d8383UL, 0x74582c2cUL, 0x2e341a1aUL, + 0x2d361b1bUL, 0xb2dc6e6eUL, 0xeeb45a5aUL, 0xfb5ba0a0UL, + 0xf6a45252UL, 0x4d763b3bUL, 0x61b7d6d6UL, 0xce7db3b3UL, + 0x7b522929UL, 0x3edde3e3UL, 0x715e2f2fUL, 0x97138484UL, + 0xf5a65353UL, 0x68b9d1d1UL, 0x00000000UL, 0x2cc1ededUL, + 0x60402020UL, 0x1fe3fcfcUL, 0xc879b1b1UL, 0xedb65b5bUL, + 0xbed46a6aUL, 0x468dcbcbUL, 0xd967bebeUL, 0x4b723939UL, + 0xde944a4aUL, 0xd4984c4cUL, 0xe8b05858UL, 0x4a85cfcfUL, + 0x6bbbd0d0UL, 0x2ac5efefUL, 0xe54faaaaUL, 0x16edfbfbUL, + 0xc5864343UL, 0xd79a4d4dUL, 0x55663333UL, 0x94118585UL, + 0xcf8a4545UL, 0x10e9f9f9UL, 0x06040202UL, 0x81fe7f7fUL, + 0xf0a05050UL, 0x44783c3cUL, 0xba259f9fUL, 0xe34ba8a8UL, + 0xf3a25151UL, 0xfe5da3a3UL, 0xc0804040UL, 0x8a058f8fUL, + 0xad3f9292UL, 0xbc219d9dUL, 0x48703838UL, 0x04f1f5f5UL, + 0xdf63bcbcUL, 0xc177b6b6UL, 0x75afdadaUL, 0x63422121UL, + 0x30201010UL, 0x1ae5ffffUL, 0x0efdf3f3UL, 0x6dbfd2d2UL, + 0x4c81cdcdUL, 0x14180c0cUL, 0x35261313UL, 0x2fc3ececUL, + 0xe1be5f5fUL, 0xa2359797UL, 0xcc884444UL, 0x392e1717UL, + 0x5793c4c4UL, 0xf255a7a7UL, 0x82fc7e7eUL, 0x477a3d3dUL, + 0xacc86464UL, 0xe7ba5d5dUL, 0x2b321919UL, 0x95e67373UL, + 0xa0c06060UL, 0x98198181UL, 0xd19e4f4fUL, 0x7fa3dcdcUL, + 0x66442222UL, 0x7e542a2aUL, 0xab3b9090UL, 0x830b8888UL, + 0xca8c4646UL, 0x29c7eeeeUL, 0xd36bb8b8UL, 0x3c281414UL, + 0x79a7dedeUL, 0xe2bc5e5eUL, 0x1d160b0bUL, 0x76addbdbUL, + 0x3bdbe0e0UL, 0x56643232UL, 0x4e743a3aUL, 0x1e140a0aUL, + 0xdb924949UL, 0x0a0c0606UL, 0x6c482424UL, 0xe4b85c5cUL, + 0x5d9fc2c2UL, 0x6ebdd3d3UL, 0xef43acacUL, 0xa6c46262UL, + 0xa8399191UL, 0xa4319595UL, 0x37d3e4e4UL, 0x8bf27979UL, + 0x32d5e7e7UL, 0x438bc8c8UL, 0x596e3737UL, 0xb7da6d6dUL, + 0x8c018d8dUL, 0x64b1d5d5UL, 0xd29c4e4eUL, 0xe049a9a9UL, + 0xb4d86c6cUL, 0xfaac5656UL, 0x07f3f4f4UL, 0x25cfeaeaUL, + 0xafca6565UL, 0x8ef47a7aUL, 0xe947aeaeUL, 0x18100808UL, + 0xd56fbabaUL, 0x88f07878UL, 0x6f4a2525UL, 0x725c2e2eUL, + 0x24381c1cUL, 0xf157a6a6UL, 0xc773b4b4UL, 0x5197c6c6UL, + 0x23cbe8e8UL, 0x7ca1ddddUL, 0x9ce87474UL, 0x213e1f1fUL, + 0xdd964b4bUL, 0xdc61bdbdUL, 0x860d8b8bUL, 0x850f8a8aUL, + 0x90e07070UL, 0x427c3e3eUL, 0xc471b5b5UL, 0xaacc6666UL, + 0xd8904848UL, 0x05060303UL, 0x01f7f6f6UL, 0x121c0e0eUL, + 0xa3c26161UL, 0x5f6a3535UL, 0xf9ae5757UL, 0xd069b9b9UL, + 0x91178686UL, 0x5899c1c1UL, 0x273a1d1dUL, 0xb9279e9eUL, + 0x38d9e1e1UL, 0x13ebf8f8UL, 0xb32b9898UL, 0x33221111UL, + 0xbbd26969UL, 0x70a9d9d9UL, 0x89078e8eUL, 0xa7339494UL, + 0xb62d9b9bUL, 0x223c1e1eUL, 0x92158787UL, 0x20c9e9e9UL, + 0x4987ceceUL, 0xffaa5555UL, 0x78502828UL, 0x7aa5dfdfUL, + 0x8f038c8cUL, 0xf859a1a1UL, 0x80098989UL, 0x171a0d0dUL, + 0xda65bfbfUL, 0x31d7e6e6UL, 0xc6844242UL, 0xb8d06868UL, + 0xc3824141UL, 0xb0299999UL, 0x775a2d2dUL, 0x111e0f0fUL, + 0xcb7bb0b0UL, 0xfca85454UL, 0xd66dbbbbUL, 0x3a2c1616UL, +}; +static const ulong32 TE2[256] = { + 0x63a5c663UL, 0x7c84f87cUL, 0x7799ee77UL, 0x7b8df67bUL, + 0xf20dfff2UL, 0x6bbdd66bUL, 0x6fb1de6fUL, 0xc55491c5UL, + 0x30506030UL, 0x01030201UL, 0x67a9ce67UL, 0x2b7d562bUL, + 0xfe19e7feUL, 0xd762b5d7UL, 0xabe64dabUL, 0x769aec76UL, + 0xca458fcaUL, 0x829d1f82UL, 0xc94089c9UL, 0x7d87fa7dUL, + 0xfa15effaUL, 0x59ebb259UL, 0x47c98e47UL, 0xf00bfbf0UL, + 0xadec41adUL, 0xd467b3d4UL, 0xa2fd5fa2UL, 0xafea45afUL, + 0x9cbf239cUL, 0xa4f753a4UL, 0x7296e472UL, 0xc05b9bc0UL, + 0xb7c275b7UL, 0xfd1ce1fdUL, 0x93ae3d93UL, 0x266a4c26UL, + 0x365a6c36UL, 0x3f417e3fUL, 0xf702f5f7UL, 0xcc4f83ccUL, + 0x345c6834UL, 0xa5f451a5UL, 0xe534d1e5UL, 0xf108f9f1UL, + 0x7193e271UL, 0xd873abd8UL, 0x31536231UL, 0x153f2a15UL, + 0x040c0804UL, 0xc75295c7UL, 0x23654623UL, 0xc35e9dc3UL, + 0x18283018UL, 0x96a13796UL, 0x050f0a05UL, 0x9ab52f9aUL, + 0x07090e07UL, 0x12362412UL, 0x809b1b80UL, 0xe23ddfe2UL, + 0xeb26cdebUL, 0x27694e27UL, 0xb2cd7fb2UL, 0x759fea75UL, + 0x091b1209UL, 0x839e1d83UL, 0x2c74582cUL, 0x1a2e341aUL, + 0x1b2d361bUL, 0x6eb2dc6eUL, 0x5aeeb45aUL, 0xa0fb5ba0UL, + 0x52f6a452UL, 0x3b4d763bUL, 0xd661b7d6UL, 0xb3ce7db3UL, + 0x297b5229UL, 0xe33edde3UL, 0x2f715e2fUL, 0x84971384UL, + 0x53f5a653UL, 0xd168b9d1UL, 0x00000000UL, 0xed2cc1edUL, + 0x20604020UL, 0xfc1fe3fcUL, 0xb1c879b1UL, 0x5bedb65bUL, + 0x6abed46aUL, 0xcb468dcbUL, 0xbed967beUL, 0x394b7239UL, + 0x4ade944aUL, 0x4cd4984cUL, 0x58e8b058UL, 0xcf4a85cfUL, + 0xd06bbbd0UL, 0xef2ac5efUL, 0xaae54faaUL, 0xfb16edfbUL, + 0x43c58643UL, 0x4dd79a4dUL, 0x33556633UL, 0x85941185UL, + 0x45cf8a45UL, 0xf910e9f9UL, 0x02060402UL, 0x7f81fe7fUL, + 0x50f0a050UL, 0x3c44783cUL, 0x9fba259fUL, 0xa8e34ba8UL, + 0x51f3a251UL, 0xa3fe5da3UL, 0x40c08040UL, 0x8f8a058fUL, + 0x92ad3f92UL, 0x9dbc219dUL, 0x38487038UL, 0xf504f1f5UL, + 0xbcdf63bcUL, 0xb6c177b6UL, 0xda75afdaUL, 0x21634221UL, + 0x10302010UL, 0xff1ae5ffUL, 0xf30efdf3UL, 0xd26dbfd2UL, + 0xcd4c81cdUL, 0x0c14180cUL, 0x13352613UL, 0xec2fc3ecUL, + 0x5fe1be5fUL, 0x97a23597UL, 0x44cc8844UL, 0x17392e17UL, + 0xc45793c4UL, 0xa7f255a7UL, 0x7e82fc7eUL, 0x3d477a3dUL, + 0x64acc864UL, 0x5de7ba5dUL, 0x192b3219UL, 0x7395e673UL, + 0x60a0c060UL, 0x81981981UL, 0x4fd19e4fUL, 0xdc7fa3dcUL, + 0x22664422UL, 0x2a7e542aUL, 0x90ab3b90UL, 0x88830b88UL, + 0x46ca8c46UL, 0xee29c7eeUL, 0xb8d36bb8UL, 0x143c2814UL, + 0xde79a7deUL, 0x5ee2bc5eUL, 0x0b1d160bUL, 0xdb76addbUL, + 0xe03bdbe0UL, 0x32566432UL, 0x3a4e743aUL, 0x0a1e140aUL, + 0x49db9249UL, 0x060a0c06UL, 0x246c4824UL, 0x5ce4b85cUL, + 0xc25d9fc2UL, 0xd36ebdd3UL, 0xacef43acUL, 0x62a6c462UL, + 0x91a83991UL, 0x95a43195UL, 0xe437d3e4UL, 0x798bf279UL, + 0xe732d5e7UL, 0xc8438bc8UL, 0x37596e37UL, 0x6db7da6dUL, + 0x8d8c018dUL, 0xd564b1d5UL, 0x4ed29c4eUL, 0xa9e049a9UL, + 0x6cb4d86cUL, 0x56faac56UL, 0xf407f3f4UL, 0xea25cfeaUL, + 0x65afca65UL, 0x7a8ef47aUL, 0xaee947aeUL, 0x08181008UL, + 0xbad56fbaUL, 0x7888f078UL, 0x256f4a25UL, 0x2e725c2eUL, + 0x1c24381cUL, 0xa6f157a6UL, 0xb4c773b4UL, 0xc65197c6UL, + 0xe823cbe8UL, 0xdd7ca1ddUL, 0x749ce874UL, 0x1f213e1fUL, + 0x4bdd964bUL, 0xbddc61bdUL, 0x8b860d8bUL, 0x8a850f8aUL, + 0x7090e070UL, 0x3e427c3eUL, 0xb5c471b5UL, 0x66aacc66UL, + 0x48d89048UL, 0x03050603UL, 0xf601f7f6UL, 0x0e121c0eUL, + 0x61a3c261UL, 0x355f6a35UL, 0x57f9ae57UL, 0xb9d069b9UL, + 0x86911786UL, 0xc15899c1UL, 0x1d273a1dUL, 0x9eb9279eUL, + 0xe138d9e1UL, 0xf813ebf8UL, 0x98b32b98UL, 0x11332211UL, + 0x69bbd269UL, 0xd970a9d9UL, 0x8e89078eUL, 0x94a73394UL, + 0x9bb62d9bUL, 0x1e223c1eUL, 0x87921587UL, 0xe920c9e9UL, + 0xce4987ceUL, 0x55ffaa55UL, 0x28785028UL, 0xdf7aa5dfUL, + 0x8c8f038cUL, 0xa1f859a1UL, 0x89800989UL, 0x0d171a0dUL, + 0xbfda65bfUL, 0xe631d7e6UL, 0x42c68442UL, 0x68b8d068UL, + 0x41c38241UL, 0x99b02999UL, 0x2d775a2dUL, 0x0f111e0fUL, + 0xb0cb7bb0UL, 0x54fca854UL, 0xbbd66dbbUL, 0x163a2c16UL, +}; +static const ulong32 TE3[256] = { + + 0x6363a5c6UL, 0x7c7c84f8UL, 0x777799eeUL, 0x7b7b8df6UL, + 0xf2f20dffUL, 0x6b6bbdd6UL, 0x6f6fb1deUL, 0xc5c55491UL, + 0x30305060UL, 0x01010302UL, 0x6767a9ceUL, 0x2b2b7d56UL, + 0xfefe19e7UL, 0xd7d762b5UL, 0xababe64dUL, 0x76769aecUL, + 0xcaca458fUL, 0x82829d1fUL, 0xc9c94089UL, 0x7d7d87faUL, + 0xfafa15efUL, 0x5959ebb2UL, 0x4747c98eUL, 0xf0f00bfbUL, + 0xadadec41UL, 0xd4d467b3UL, 0xa2a2fd5fUL, 0xafafea45UL, + 0x9c9cbf23UL, 0xa4a4f753UL, 0x727296e4UL, 0xc0c05b9bUL, + 0xb7b7c275UL, 0xfdfd1ce1UL, 0x9393ae3dUL, 0x26266a4cUL, + 0x36365a6cUL, 0x3f3f417eUL, 0xf7f702f5UL, 0xcccc4f83UL, + 0x34345c68UL, 0xa5a5f451UL, 0xe5e534d1UL, 0xf1f108f9UL, + 0x717193e2UL, 0xd8d873abUL, 0x31315362UL, 0x15153f2aUL, + 0x04040c08UL, 0xc7c75295UL, 0x23236546UL, 0xc3c35e9dUL, + 0x18182830UL, 0x9696a137UL, 0x05050f0aUL, 0x9a9ab52fUL, + 0x0707090eUL, 0x12123624UL, 0x80809b1bUL, 0xe2e23ddfUL, + 0xebeb26cdUL, 0x2727694eUL, 0xb2b2cd7fUL, 0x75759feaUL, + 0x09091b12UL, 0x83839e1dUL, 0x2c2c7458UL, 0x1a1a2e34UL, + 0x1b1b2d36UL, 0x6e6eb2dcUL, 0x5a5aeeb4UL, 0xa0a0fb5bUL, + 0x5252f6a4UL, 0x3b3b4d76UL, 0xd6d661b7UL, 0xb3b3ce7dUL, + 0x29297b52UL, 0xe3e33eddUL, 0x2f2f715eUL, 0x84849713UL, + 0x5353f5a6UL, 0xd1d168b9UL, 0x00000000UL, 0xeded2cc1UL, + 0x20206040UL, 0xfcfc1fe3UL, 0xb1b1c879UL, 0x5b5bedb6UL, + 0x6a6abed4UL, 0xcbcb468dUL, 0xbebed967UL, 0x39394b72UL, + 0x4a4ade94UL, 0x4c4cd498UL, 0x5858e8b0UL, 0xcfcf4a85UL, + 0xd0d06bbbUL, 0xefef2ac5UL, 0xaaaae54fUL, 0xfbfb16edUL, + 0x4343c586UL, 0x4d4dd79aUL, 0x33335566UL, 0x85859411UL, + 0x4545cf8aUL, 0xf9f910e9UL, 0x02020604UL, 0x7f7f81feUL, + 0x5050f0a0UL, 0x3c3c4478UL, 0x9f9fba25UL, 0xa8a8e34bUL, + 0x5151f3a2UL, 0xa3a3fe5dUL, 0x4040c080UL, 0x8f8f8a05UL, + 0x9292ad3fUL, 0x9d9dbc21UL, 0x38384870UL, 0xf5f504f1UL, + 0xbcbcdf63UL, 0xb6b6c177UL, 0xdada75afUL, 0x21216342UL, + 0x10103020UL, 0xffff1ae5UL, 0xf3f30efdUL, 0xd2d26dbfUL, + 0xcdcd4c81UL, 0x0c0c1418UL, 0x13133526UL, 0xecec2fc3UL, + 0x5f5fe1beUL, 0x9797a235UL, 0x4444cc88UL, 0x1717392eUL, + 0xc4c45793UL, 0xa7a7f255UL, 0x7e7e82fcUL, 0x3d3d477aUL, + 0x6464acc8UL, 0x5d5de7baUL, 0x19192b32UL, 0x737395e6UL, + 0x6060a0c0UL, 0x81819819UL, 0x4f4fd19eUL, 0xdcdc7fa3UL, + 0x22226644UL, 0x2a2a7e54UL, 0x9090ab3bUL, 0x8888830bUL, + 0x4646ca8cUL, 0xeeee29c7UL, 0xb8b8d36bUL, 0x14143c28UL, + 0xdede79a7UL, 0x5e5ee2bcUL, 0x0b0b1d16UL, 0xdbdb76adUL, + 0xe0e03bdbUL, 0x32325664UL, 0x3a3a4e74UL, 0x0a0a1e14UL, + 0x4949db92UL, 0x06060a0cUL, 0x24246c48UL, 0x5c5ce4b8UL, + 0xc2c25d9fUL, 0xd3d36ebdUL, 0xacacef43UL, 0x6262a6c4UL, + 0x9191a839UL, 0x9595a431UL, 0xe4e437d3UL, 0x79798bf2UL, + 0xe7e732d5UL, 0xc8c8438bUL, 0x3737596eUL, 0x6d6db7daUL, + 0x8d8d8c01UL, 0xd5d564b1UL, 0x4e4ed29cUL, 0xa9a9e049UL, + 0x6c6cb4d8UL, 0x5656faacUL, 0xf4f407f3UL, 0xeaea25cfUL, + 0x6565afcaUL, 0x7a7a8ef4UL, 0xaeaee947UL, 0x08081810UL, + 0xbabad56fUL, 0x787888f0UL, 0x25256f4aUL, 0x2e2e725cUL, + 0x1c1c2438UL, 0xa6a6f157UL, 0xb4b4c773UL, 0xc6c65197UL, + 0xe8e823cbUL, 0xdddd7ca1UL, 0x74749ce8UL, 0x1f1f213eUL, + 0x4b4bdd96UL, 0xbdbddc61UL, 0x8b8b860dUL, 0x8a8a850fUL, + 0x707090e0UL, 0x3e3e427cUL, 0xb5b5c471UL, 0x6666aaccUL, + 0x4848d890UL, 0x03030506UL, 0xf6f601f7UL, 0x0e0e121cUL, + 0x6161a3c2UL, 0x35355f6aUL, 0x5757f9aeUL, 0xb9b9d069UL, + 0x86869117UL, 0xc1c15899UL, 0x1d1d273aUL, 0x9e9eb927UL, + 0xe1e138d9UL, 0xf8f813ebUL, 0x9898b32bUL, 0x11113322UL, + 0x6969bbd2UL, 0xd9d970a9UL, 0x8e8e8907UL, 0x9494a733UL, + 0x9b9bb62dUL, 0x1e1e223cUL, 0x87879215UL, 0xe9e920c9UL, + 0xcece4987UL, 0x5555ffaaUL, 0x28287850UL, 0xdfdf7aa5UL, + 0x8c8c8f03UL, 0xa1a1f859UL, 0x89898009UL, 0x0d0d171aUL, + 0xbfbfda65UL, 0xe6e631d7UL, 0x4242c684UL, 0x6868b8d0UL, + 0x4141c382UL, 0x9999b029UL, 0x2d2d775aUL, 0x0f0f111eUL, + 0xb0b0cb7bUL, 0x5454fca8UL, 0xbbbbd66dUL, 0x16163a2cUL, +}; + +#ifndef PELI_TAB +static const ulong32 Te4_0[] = { +0x00000063UL, 0x0000007cUL, 0x00000077UL, 0x0000007bUL, 0x000000f2UL, 0x0000006bUL, 0x0000006fUL, 0x000000c5UL, +0x00000030UL, 0x00000001UL, 0x00000067UL, 0x0000002bUL, 0x000000feUL, 0x000000d7UL, 0x000000abUL, 0x00000076UL, +0x000000caUL, 0x00000082UL, 0x000000c9UL, 0x0000007dUL, 0x000000faUL, 0x00000059UL, 0x00000047UL, 0x000000f0UL, +0x000000adUL, 0x000000d4UL, 0x000000a2UL, 0x000000afUL, 0x0000009cUL, 0x000000a4UL, 0x00000072UL, 0x000000c0UL, +0x000000b7UL, 0x000000fdUL, 0x00000093UL, 0x00000026UL, 0x00000036UL, 0x0000003fUL, 0x000000f7UL, 0x000000ccUL, +0x00000034UL, 0x000000a5UL, 0x000000e5UL, 0x000000f1UL, 0x00000071UL, 0x000000d8UL, 0x00000031UL, 0x00000015UL, +0x00000004UL, 0x000000c7UL, 0x00000023UL, 0x000000c3UL, 0x00000018UL, 0x00000096UL, 0x00000005UL, 0x0000009aUL, +0x00000007UL, 0x00000012UL, 0x00000080UL, 0x000000e2UL, 0x000000ebUL, 0x00000027UL, 0x000000b2UL, 0x00000075UL, +0x00000009UL, 0x00000083UL, 0x0000002cUL, 0x0000001aUL, 0x0000001bUL, 0x0000006eUL, 0x0000005aUL, 0x000000a0UL, +0x00000052UL, 0x0000003bUL, 0x000000d6UL, 0x000000b3UL, 0x00000029UL, 0x000000e3UL, 0x0000002fUL, 0x00000084UL, +0x00000053UL, 0x000000d1UL, 0x00000000UL, 0x000000edUL, 0x00000020UL, 0x000000fcUL, 0x000000b1UL, 0x0000005bUL, +0x0000006aUL, 0x000000cbUL, 0x000000beUL, 0x00000039UL, 0x0000004aUL, 0x0000004cUL, 0x00000058UL, 0x000000cfUL, +0x000000d0UL, 0x000000efUL, 0x000000aaUL, 0x000000fbUL, 0x00000043UL, 0x0000004dUL, 0x00000033UL, 0x00000085UL, +0x00000045UL, 0x000000f9UL, 0x00000002UL, 0x0000007fUL, 0x00000050UL, 0x0000003cUL, 0x0000009fUL, 0x000000a8UL, +0x00000051UL, 0x000000a3UL, 0x00000040UL, 0x0000008fUL, 0x00000092UL, 0x0000009dUL, 0x00000038UL, 0x000000f5UL, +0x000000bcUL, 0x000000b6UL, 0x000000daUL, 0x00000021UL, 0x00000010UL, 0x000000ffUL, 0x000000f3UL, 0x000000d2UL, +0x000000cdUL, 0x0000000cUL, 0x00000013UL, 0x000000ecUL, 0x0000005fUL, 0x00000097UL, 0x00000044UL, 0x00000017UL, +0x000000c4UL, 0x000000a7UL, 0x0000007eUL, 0x0000003dUL, 0x00000064UL, 0x0000005dUL, 0x00000019UL, 0x00000073UL, +0x00000060UL, 0x00000081UL, 0x0000004fUL, 0x000000dcUL, 0x00000022UL, 0x0000002aUL, 0x00000090UL, 0x00000088UL, +0x00000046UL, 0x000000eeUL, 0x000000b8UL, 0x00000014UL, 0x000000deUL, 0x0000005eUL, 0x0000000bUL, 0x000000dbUL, +0x000000e0UL, 0x00000032UL, 0x0000003aUL, 0x0000000aUL, 0x00000049UL, 0x00000006UL, 0x00000024UL, 0x0000005cUL, +0x000000c2UL, 0x000000d3UL, 0x000000acUL, 0x00000062UL, 0x00000091UL, 0x00000095UL, 0x000000e4UL, 0x00000079UL, +0x000000e7UL, 0x000000c8UL, 0x00000037UL, 0x0000006dUL, 0x0000008dUL, 0x000000d5UL, 0x0000004eUL, 0x000000a9UL, +0x0000006cUL, 0x00000056UL, 0x000000f4UL, 0x000000eaUL, 0x00000065UL, 0x0000007aUL, 0x000000aeUL, 0x00000008UL, +0x000000baUL, 0x00000078UL, 0x00000025UL, 0x0000002eUL, 0x0000001cUL, 0x000000a6UL, 0x000000b4UL, 0x000000c6UL, +0x000000e8UL, 0x000000ddUL, 0x00000074UL, 0x0000001fUL, 0x0000004bUL, 0x000000bdUL, 0x0000008bUL, 0x0000008aUL, +0x00000070UL, 0x0000003eUL, 0x000000b5UL, 0x00000066UL, 0x00000048UL, 0x00000003UL, 0x000000f6UL, 0x0000000eUL, +0x00000061UL, 0x00000035UL, 0x00000057UL, 0x000000b9UL, 0x00000086UL, 0x000000c1UL, 0x0000001dUL, 0x0000009eUL, +0x000000e1UL, 0x000000f8UL, 0x00000098UL, 0x00000011UL, 0x00000069UL, 0x000000d9UL, 0x0000008eUL, 0x00000094UL, +0x0000009bUL, 0x0000001eUL, 0x00000087UL, 0x000000e9UL, 0x000000ceUL, 0x00000055UL, 0x00000028UL, 0x000000dfUL, +0x0000008cUL, 0x000000a1UL, 0x00000089UL, 0x0000000dUL, 0x000000bfUL, 0x000000e6UL, 0x00000042UL, 0x00000068UL, +0x00000041UL, 0x00000099UL, 0x0000002dUL, 0x0000000fUL, 0x000000b0UL, 0x00000054UL, 0x000000bbUL, 0x00000016UL +}; + +static const ulong32 Te4_1[] = { +0x00006300UL, 0x00007c00UL, 0x00007700UL, 0x00007b00UL, 0x0000f200UL, 0x00006b00UL, 0x00006f00UL, 0x0000c500UL, +0x00003000UL, 0x00000100UL, 0x00006700UL, 0x00002b00UL, 0x0000fe00UL, 0x0000d700UL, 0x0000ab00UL, 0x00007600UL, +0x0000ca00UL, 0x00008200UL, 0x0000c900UL, 0x00007d00UL, 0x0000fa00UL, 0x00005900UL, 0x00004700UL, 0x0000f000UL, +0x0000ad00UL, 0x0000d400UL, 0x0000a200UL, 0x0000af00UL, 0x00009c00UL, 0x0000a400UL, 0x00007200UL, 0x0000c000UL, +0x0000b700UL, 0x0000fd00UL, 0x00009300UL, 0x00002600UL, 0x00003600UL, 0x00003f00UL, 0x0000f700UL, 0x0000cc00UL, +0x00003400UL, 0x0000a500UL, 0x0000e500UL, 0x0000f100UL, 0x00007100UL, 0x0000d800UL, 0x00003100UL, 0x00001500UL, +0x00000400UL, 0x0000c700UL, 0x00002300UL, 0x0000c300UL, 0x00001800UL, 0x00009600UL, 0x00000500UL, 0x00009a00UL, +0x00000700UL, 0x00001200UL, 0x00008000UL, 0x0000e200UL, 0x0000eb00UL, 0x00002700UL, 0x0000b200UL, 0x00007500UL, +0x00000900UL, 0x00008300UL, 0x00002c00UL, 0x00001a00UL, 0x00001b00UL, 0x00006e00UL, 0x00005a00UL, 0x0000a000UL, +0x00005200UL, 0x00003b00UL, 0x0000d600UL, 0x0000b300UL, 0x00002900UL, 0x0000e300UL, 0x00002f00UL, 0x00008400UL, +0x00005300UL, 0x0000d100UL, 0x00000000UL, 0x0000ed00UL, 0x00002000UL, 0x0000fc00UL, 0x0000b100UL, 0x00005b00UL, +0x00006a00UL, 0x0000cb00UL, 0x0000be00UL, 0x00003900UL, 0x00004a00UL, 0x00004c00UL, 0x00005800UL, 0x0000cf00UL, +0x0000d000UL, 0x0000ef00UL, 0x0000aa00UL, 0x0000fb00UL, 0x00004300UL, 0x00004d00UL, 0x00003300UL, 0x00008500UL, +0x00004500UL, 0x0000f900UL, 0x00000200UL, 0x00007f00UL, 0x00005000UL, 0x00003c00UL, 0x00009f00UL, 0x0000a800UL, +0x00005100UL, 0x0000a300UL, 0x00004000UL, 0x00008f00UL, 0x00009200UL, 0x00009d00UL, 0x00003800UL, 0x0000f500UL, +0x0000bc00UL, 0x0000b600UL, 0x0000da00UL, 0x00002100UL, 0x00001000UL, 0x0000ff00UL, 0x0000f300UL, 0x0000d200UL, +0x0000cd00UL, 0x00000c00UL, 0x00001300UL, 0x0000ec00UL, 0x00005f00UL, 0x00009700UL, 0x00004400UL, 0x00001700UL, +0x0000c400UL, 0x0000a700UL, 0x00007e00UL, 0x00003d00UL, 0x00006400UL, 0x00005d00UL, 0x00001900UL, 0x00007300UL, +0x00006000UL, 0x00008100UL, 0x00004f00UL, 0x0000dc00UL, 0x00002200UL, 0x00002a00UL, 0x00009000UL, 0x00008800UL, +0x00004600UL, 0x0000ee00UL, 0x0000b800UL, 0x00001400UL, 0x0000de00UL, 0x00005e00UL, 0x00000b00UL, 0x0000db00UL, +0x0000e000UL, 0x00003200UL, 0x00003a00UL, 0x00000a00UL, 0x00004900UL, 0x00000600UL, 0x00002400UL, 0x00005c00UL, +0x0000c200UL, 0x0000d300UL, 0x0000ac00UL, 0x00006200UL, 0x00009100UL, 0x00009500UL, 0x0000e400UL, 0x00007900UL, +0x0000e700UL, 0x0000c800UL, 0x00003700UL, 0x00006d00UL, 0x00008d00UL, 0x0000d500UL, 0x00004e00UL, 0x0000a900UL, +0x00006c00UL, 0x00005600UL, 0x0000f400UL, 0x0000ea00UL, 0x00006500UL, 0x00007a00UL, 0x0000ae00UL, 0x00000800UL, +0x0000ba00UL, 0x00007800UL, 0x00002500UL, 0x00002e00UL, 0x00001c00UL, 0x0000a600UL, 0x0000b400UL, 0x0000c600UL, +0x0000e800UL, 0x0000dd00UL, 0x00007400UL, 0x00001f00UL, 0x00004b00UL, 0x0000bd00UL, 0x00008b00UL, 0x00008a00UL, +0x00007000UL, 0x00003e00UL, 0x0000b500UL, 0x00006600UL, 0x00004800UL, 0x00000300UL, 0x0000f600UL, 0x00000e00UL, +0x00006100UL, 0x00003500UL, 0x00005700UL, 0x0000b900UL, 0x00008600UL, 0x0000c100UL, 0x00001d00UL, 0x00009e00UL, +0x0000e100UL, 0x0000f800UL, 0x00009800UL, 0x00001100UL, 0x00006900UL, 0x0000d900UL, 0x00008e00UL, 0x00009400UL, +0x00009b00UL, 0x00001e00UL, 0x00008700UL, 0x0000e900UL, 0x0000ce00UL, 0x00005500UL, 0x00002800UL, 0x0000df00UL, +0x00008c00UL, 0x0000a100UL, 0x00008900UL, 0x00000d00UL, 0x0000bf00UL, 0x0000e600UL, 0x00004200UL, 0x00006800UL, +0x00004100UL, 0x00009900UL, 0x00002d00UL, 0x00000f00UL, 0x0000b000UL, 0x00005400UL, 0x0000bb00UL, 0x00001600UL +}; + +static const ulong32 Te4_2[] = { +0x00630000UL, 0x007c0000UL, 0x00770000UL, 0x007b0000UL, 0x00f20000UL, 0x006b0000UL, 0x006f0000UL, 0x00c50000UL, +0x00300000UL, 0x00010000UL, 0x00670000UL, 0x002b0000UL, 0x00fe0000UL, 0x00d70000UL, 0x00ab0000UL, 0x00760000UL, +0x00ca0000UL, 0x00820000UL, 0x00c90000UL, 0x007d0000UL, 0x00fa0000UL, 0x00590000UL, 0x00470000UL, 0x00f00000UL, +0x00ad0000UL, 0x00d40000UL, 0x00a20000UL, 0x00af0000UL, 0x009c0000UL, 0x00a40000UL, 0x00720000UL, 0x00c00000UL, +0x00b70000UL, 0x00fd0000UL, 0x00930000UL, 0x00260000UL, 0x00360000UL, 0x003f0000UL, 0x00f70000UL, 0x00cc0000UL, +0x00340000UL, 0x00a50000UL, 0x00e50000UL, 0x00f10000UL, 0x00710000UL, 0x00d80000UL, 0x00310000UL, 0x00150000UL, +0x00040000UL, 0x00c70000UL, 0x00230000UL, 0x00c30000UL, 0x00180000UL, 0x00960000UL, 0x00050000UL, 0x009a0000UL, +0x00070000UL, 0x00120000UL, 0x00800000UL, 0x00e20000UL, 0x00eb0000UL, 0x00270000UL, 0x00b20000UL, 0x00750000UL, +0x00090000UL, 0x00830000UL, 0x002c0000UL, 0x001a0000UL, 0x001b0000UL, 0x006e0000UL, 0x005a0000UL, 0x00a00000UL, +0x00520000UL, 0x003b0000UL, 0x00d60000UL, 0x00b30000UL, 0x00290000UL, 0x00e30000UL, 0x002f0000UL, 0x00840000UL, +0x00530000UL, 0x00d10000UL, 0x00000000UL, 0x00ed0000UL, 0x00200000UL, 0x00fc0000UL, 0x00b10000UL, 0x005b0000UL, +0x006a0000UL, 0x00cb0000UL, 0x00be0000UL, 0x00390000UL, 0x004a0000UL, 0x004c0000UL, 0x00580000UL, 0x00cf0000UL, +0x00d00000UL, 0x00ef0000UL, 0x00aa0000UL, 0x00fb0000UL, 0x00430000UL, 0x004d0000UL, 0x00330000UL, 0x00850000UL, +0x00450000UL, 0x00f90000UL, 0x00020000UL, 0x007f0000UL, 0x00500000UL, 0x003c0000UL, 0x009f0000UL, 0x00a80000UL, +0x00510000UL, 0x00a30000UL, 0x00400000UL, 0x008f0000UL, 0x00920000UL, 0x009d0000UL, 0x00380000UL, 0x00f50000UL, +0x00bc0000UL, 0x00b60000UL, 0x00da0000UL, 0x00210000UL, 0x00100000UL, 0x00ff0000UL, 0x00f30000UL, 0x00d20000UL, +0x00cd0000UL, 0x000c0000UL, 0x00130000UL, 0x00ec0000UL, 0x005f0000UL, 0x00970000UL, 0x00440000UL, 0x00170000UL, +0x00c40000UL, 0x00a70000UL, 0x007e0000UL, 0x003d0000UL, 0x00640000UL, 0x005d0000UL, 0x00190000UL, 0x00730000UL, +0x00600000UL, 0x00810000UL, 0x004f0000UL, 0x00dc0000UL, 0x00220000UL, 0x002a0000UL, 0x00900000UL, 0x00880000UL, +0x00460000UL, 0x00ee0000UL, 0x00b80000UL, 0x00140000UL, 0x00de0000UL, 0x005e0000UL, 0x000b0000UL, 0x00db0000UL, +0x00e00000UL, 0x00320000UL, 0x003a0000UL, 0x000a0000UL, 0x00490000UL, 0x00060000UL, 0x00240000UL, 0x005c0000UL, +0x00c20000UL, 0x00d30000UL, 0x00ac0000UL, 0x00620000UL, 0x00910000UL, 0x00950000UL, 0x00e40000UL, 0x00790000UL, +0x00e70000UL, 0x00c80000UL, 0x00370000UL, 0x006d0000UL, 0x008d0000UL, 0x00d50000UL, 0x004e0000UL, 0x00a90000UL, +0x006c0000UL, 0x00560000UL, 0x00f40000UL, 0x00ea0000UL, 0x00650000UL, 0x007a0000UL, 0x00ae0000UL, 0x00080000UL, +0x00ba0000UL, 0x00780000UL, 0x00250000UL, 0x002e0000UL, 0x001c0000UL, 0x00a60000UL, 0x00b40000UL, 0x00c60000UL, +0x00e80000UL, 0x00dd0000UL, 0x00740000UL, 0x001f0000UL, 0x004b0000UL, 0x00bd0000UL, 0x008b0000UL, 0x008a0000UL, +0x00700000UL, 0x003e0000UL, 0x00b50000UL, 0x00660000UL, 0x00480000UL, 0x00030000UL, 0x00f60000UL, 0x000e0000UL, +0x00610000UL, 0x00350000UL, 0x00570000UL, 0x00b90000UL, 0x00860000UL, 0x00c10000UL, 0x001d0000UL, 0x009e0000UL, +0x00e10000UL, 0x00f80000UL, 0x00980000UL, 0x00110000UL, 0x00690000UL, 0x00d90000UL, 0x008e0000UL, 0x00940000UL, +0x009b0000UL, 0x001e0000UL, 0x00870000UL, 0x00e90000UL, 0x00ce0000UL, 0x00550000UL, 0x00280000UL, 0x00df0000UL, +0x008c0000UL, 0x00a10000UL, 0x00890000UL, 0x000d0000UL, 0x00bf0000UL, 0x00e60000UL, 0x00420000UL, 0x00680000UL, +0x00410000UL, 0x00990000UL, 0x002d0000UL, 0x000f0000UL, 0x00b00000UL, 0x00540000UL, 0x00bb0000UL, 0x00160000UL +}; + +static const ulong32 Te4_3[] = { +0x63000000UL, 0x7c000000UL, 0x77000000UL, 0x7b000000UL, 0xf2000000UL, 0x6b000000UL, 0x6f000000UL, 0xc5000000UL, +0x30000000UL, 0x01000000UL, 0x67000000UL, 0x2b000000UL, 0xfe000000UL, 0xd7000000UL, 0xab000000UL, 0x76000000UL, +0xca000000UL, 0x82000000UL, 0xc9000000UL, 0x7d000000UL, 0xfa000000UL, 0x59000000UL, 0x47000000UL, 0xf0000000UL, +0xad000000UL, 0xd4000000UL, 0xa2000000UL, 0xaf000000UL, 0x9c000000UL, 0xa4000000UL, 0x72000000UL, 0xc0000000UL, +0xb7000000UL, 0xfd000000UL, 0x93000000UL, 0x26000000UL, 0x36000000UL, 0x3f000000UL, 0xf7000000UL, 0xcc000000UL, +0x34000000UL, 0xa5000000UL, 0xe5000000UL, 0xf1000000UL, 0x71000000UL, 0xd8000000UL, 0x31000000UL, 0x15000000UL, +0x04000000UL, 0xc7000000UL, 0x23000000UL, 0xc3000000UL, 0x18000000UL, 0x96000000UL, 0x05000000UL, 0x9a000000UL, +0x07000000UL, 0x12000000UL, 0x80000000UL, 0xe2000000UL, 0xeb000000UL, 0x27000000UL, 0xb2000000UL, 0x75000000UL, +0x09000000UL, 0x83000000UL, 0x2c000000UL, 0x1a000000UL, 0x1b000000UL, 0x6e000000UL, 0x5a000000UL, 0xa0000000UL, +0x52000000UL, 0x3b000000UL, 0xd6000000UL, 0xb3000000UL, 0x29000000UL, 0xe3000000UL, 0x2f000000UL, 0x84000000UL, +0x53000000UL, 0xd1000000UL, 0x00000000UL, 0xed000000UL, 0x20000000UL, 0xfc000000UL, 0xb1000000UL, 0x5b000000UL, +0x6a000000UL, 0xcb000000UL, 0xbe000000UL, 0x39000000UL, 0x4a000000UL, 0x4c000000UL, 0x58000000UL, 0xcf000000UL, +0xd0000000UL, 0xef000000UL, 0xaa000000UL, 0xfb000000UL, 0x43000000UL, 0x4d000000UL, 0x33000000UL, 0x85000000UL, +0x45000000UL, 0xf9000000UL, 0x02000000UL, 0x7f000000UL, 0x50000000UL, 0x3c000000UL, 0x9f000000UL, 0xa8000000UL, +0x51000000UL, 0xa3000000UL, 0x40000000UL, 0x8f000000UL, 0x92000000UL, 0x9d000000UL, 0x38000000UL, 0xf5000000UL, +0xbc000000UL, 0xb6000000UL, 0xda000000UL, 0x21000000UL, 0x10000000UL, 0xff000000UL, 0xf3000000UL, 0xd2000000UL, +0xcd000000UL, 0x0c000000UL, 0x13000000UL, 0xec000000UL, 0x5f000000UL, 0x97000000UL, 0x44000000UL, 0x17000000UL, +0xc4000000UL, 0xa7000000UL, 0x7e000000UL, 0x3d000000UL, 0x64000000UL, 0x5d000000UL, 0x19000000UL, 0x73000000UL, +0x60000000UL, 0x81000000UL, 0x4f000000UL, 0xdc000000UL, 0x22000000UL, 0x2a000000UL, 0x90000000UL, 0x88000000UL, +0x46000000UL, 0xee000000UL, 0xb8000000UL, 0x14000000UL, 0xde000000UL, 0x5e000000UL, 0x0b000000UL, 0xdb000000UL, +0xe0000000UL, 0x32000000UL, 0x3a000000UL, 0x0a000000UL, 0x49000000UL, 0x06000000UL, 0x24000000UL, 0x5c000000UL, +0xc2000000UL, 0xd3000000UL, 0xac000000UL, 0x62000000UL, 0x91000000UL, 0x95000000UL, 0xe4000000UL, 0x79000000UL, +0xe7000000UL, 0xc8000000UL, 0x37000000UL, 0x6d000000UL, 0x8d000000UL, 0xd5000000UL, 0x4e000000UL, 0xa9000000UL, +0x6c000000UL, 0x56000000UL, 0xf4000000UL, 0xea000000UL, 0x65000000UL, 0x7a000000UL, 0xae000000UL, 0x08000000UL, +0xba000000UL, 0x78000000UL, 0x25000000UL, 0x2e000000UL, 0x1c000000UL, 0xa6000000UL, 0xb4000000UL, 0xc6000000UL, +0xe8000000UL, 0xdd000000UL, 0x74000000UL, 0x1f000000UL, 0x4b000000UL, 0xbd000000UL, 0x8b000000UL, 0x8a000000UL, +0x70000000UL, 0x3e000000UL, 0xb5000000UL, 0x66000000UL, 0x48000000UL, 0x03000000UL, 0xf6000000UL, 0x0e000000UL, +0x61000000UL, 0x35000000UL, 0x57000000UL, 0xb9000000UL, 0x86000000UL, 0xc1000000UL, 0x1d000000UL, 0x9e000000UL, +0xe1000000UL, 0xf8000000UL, 0x98000000UL, 0x11000000UL, 0x69000000UL, 0xd9000000UL, 0x8e000000UL, 0x94000000UL, +0x9b000000UL, 0x1e000000UL, 0x87000000UL, 0xe9000000UL, 0xce000000UL, 0x55000000UL, 0x28000000UL, 0xdf000000UL, +0x8c000000UL, 0xa1000000UL, 0x89000000UL, 0x0d000000UL, 0xbf000000UL, 0xe6000000UL, 0x42000000UL, 0x68000000UL, +0x41000000UL, 0x99000000UL, 0x2d000000UL, 0x0f000000UL, 0xb0000000UL, 0x54000000UL, 0xbb000000UL, 0x16000000UL +}; +#endif /* pelimac */ + +#ifndef ENCRYPT_ONLY + +static const ulong32 TD1[256] = { + 0x5051f4a7UL, 0x537e4165UL, 0xc31a17a4UL, 0x963a275eUL, + 0xcb3bab6bUL, 0xf11f9d45UL, 0xabacfa58UL, 0x934be303UL, + 0x552030faUL, 0xf6ad766dUL, 0x9188cc76UL, 0x25f5024cUL, + 0xfc4fe5d7UL, 0xd7c52acbUL, 0x80263544UL, 0x8fb562a3UL, + 0x49deb15aUL, 0x6725ba1bUL, 0x9845ea0eUL, 0xe15dfec0UL, + 0x02c32f75UL, 0x12814cf0UL, 0xa38d4697UL, 0xc66bd3f9UL, + 0xe7038f5fUL, 0x9515929cUL, 0xebbf6d7aUL, 0xda955259UL, + 0x2dd4be83UL, 0xd3587421UL, 0x2949e069UL, 0x448ec9c8UL, + 0x6a75c289UL, 0x78f48e79UL, 0x6b99583eUL, 0xdd27b971UL, + 0xb6bee14fUL, 0x17f088adUL, 0x66c920acUL, 0xb47dce3aUL, + 0x1863df4aUL, 0x82e51a31UL, 0x60975133UL, 0x4562537fUL, + 0xe0b16477UL, 0x84bb6baeUL, 0x1cfe81a0UL, 0x94f9082bUL, + 0x58704868UL, 0x198f45fdUL, 0x8794de6cUL, 0xb7527bf8UL, + 0x23ab73d3UL, 0xe2724b02UL, 0x57e31f8fUL, 0x2a6655abUL, + 0x07b2eb28UL, 0x032fb5c2UL, 0x9a86c57bUL, 0xa5d33708UL, + 0xf2302887UL, 0xb223bfa5UL, 0xba02036aUL, 0x5ced1682UL, + 0x2b8acf1cUL, 0x92a779b4UL, 0xf0f307f2UL, 0xa14e69e2UL, + 0xcd65daf4UL, 0xd50605beUL, 0x1fd13462UL, 0x8ac4a6feUL, + 0x9d342e53UL, 0xa0a2f355UL, 0x32058ae1UL, 0x75a4f6ebUL, + 0x390b83ecUL, 0xaa4060efUL, 0x065e719fUL, 0x51bd6e10UL, + 0xf93e218aUL, 0x3d96dd06UL, 0xaedd3e05UL, 0x464de6bdUL, + 0xb591548dUL, 0x0571c45dUL, 0x6f0406d4UL, 0xff605015UL, + 0x241998fbUL, 0x97d6bde9UL, 0xcc894043UL, 0x7767d99eUL, + 0xbdb0e842UL, 0x8807898bUL, 0x38e7195bUL, 0xdb79c8eeUL, + 0x47a17c0aUL, 0xe97c420fUL, 0xc9f8841eUL, 0x00000000UL, + 0x83098086UL, 0x48322bedUL, 0xac1e1170UL, 0x4e6c5a72UL, + 0xfbfd0effUL, 0x560f8538UL, 0x1e3daed5UL, 0x27362d39UL, + 0x640a0fd9UL, 0x21685ca6UL, 0xd19b5b54UL, 0x3a24362eUL, + 0xb10c0a67UL, 0x0f9357e7UL, 0xd2b4ee96UL, 0x9e1b9b91UL, + 0x4f80c0c5UL, 0xa261dc20UL, 0x695a774bUL, 0x161c121aUL, + 0x0ae293baUL, 0xe5c0a02aUL, 0x433c22e0UL, 0x1d121b17UL, + 0x0b0e090dUL, 0xadf28bc7UL, 0xb92db6a8UL, 0xc8141ea9UL, + 0x8557f119UL, 0x4caf7507UL, 0xbbee99ddUL, 0xfda37f60UL, + 0x9ff70126UL, 0xbc5c72f5UL, 0xc544663bUL, 0x345bfb7eUL, + 0x768b4329UL, 0xdccb23c6UL, 0x68b6edfcUL, 0x63b8e4f1UL, + 0xcad731dcUL, 0x10426385UL, 0x40139722UL, 0x2084c611UL, + 0x7d854a24UL, 0xf8d2bb3dUL, 0x11aef932UL, 0x6dc729a1UL, + 0x4b1d9e2fUL, 0xf3dcb230UL, 0xec0d8652UL, 0xd077c1e3UL, + 0x6c2bb316UL, 0x99a970b9UL, 0xfa119448UL, 0x2247e964UL, + 0xc4a8fc8cUL, 0x1aa0f03fUL, 0xd8567d2cUL, 0xef223390UL, + 0xc787494eUL, 0xc1d938d1UL, 0xfe8ccaa2UL, 0x3698d40bUL, + 0xcfa6f581UL, 0x28a57adeUL, 0x26dab78eUL, 0xa43fadbfUL, + 0xe42c3a9dUL, 0x0d507892UL, 0x9b6a5fccUL, 0x62547e46UL, + 0xc2f68d13UL, 0xe890d8b8UL, 0x5e2e39f7UL, 0xf582c3afUL, + 0xbe9f5d80UL, 0x7c69d093UL, 0xa96fd52dUL, 0xb3cf2512UL, + 0x3bc8ac99UL, 0xa710187dUL, 0x6ee89c63UL, 0x7bdb3bbbUL, + 0x09cd2678UL, 0xf46e5918UL, 0x01ec9ab7UL, 0xa8834f9aUL, + 0x65e6956eUL, 0x7eaaffe6UL, 0x0821bccfUL, 0xe6ef15e8UL, + 0xd9bae79bUL, 0xce4a6f36UL, 0xd4ea9f09UL, 0xd629b07cUL, + 0xaf31a4b2UL, 0x312a3f23UL, 0x30c6a594UL, 0xc035a266UL, + 0x37744ebcUL, 0xa6fc82caUL, 0xb0e090d0UL, 0x1533a7d8UL, + 0x4af10498UL, 0xf741ecdaUL, 0x0e7fcd50UL, 0x2f1791f6UL, + 0x8d764dd6UL, 0x4d43efb0UL, 0x54ccaa4dUL, 0xdfe49604UL, + 0xe39ed1b5UL, 0x1b4c6a88UL, 0xb8c12c1fUL, 0x7f466551UL, + 0x049d5eeaUL, 0x5d018c35UL, 0x73fa8774UL, 0x2efb0b41UL, + 0x5ab3671dUL, 0x5292dbd2UL, 0x33e91056UL, 0x136dd647UL, + 0x8c9ad761UL, 0x7a37a10cUL, 0x8e59f814UL, 0x89eb133cUL, + 0xeecea927UL, 0x35b761c9UL, 0xede11ce5UL, 0x3c7a47b1UL, + 0x599cd2dfUL, 0x3f55f273UL, 0x791814ceUL, 0xbf73c737UL, + 0xea53f7cdUL, 0x5b5ffdaaUL, 0x14df3d6fUL, 0x867844dbUL, + 0x81caaff3UL, 0x3eb968c4UL, 0x2c382434UL, 0x5fc2a340UL, + 0x72161dc3UL, 0x0cbce225UL, 0x8b283c49UL, 0x41ff0d95UL, + 0x7139a801UL, 0xde080cb3UL, 0x9cd8b4e4UL, 0x906456c1UL, + 0x617bcb84UL, 0x70d532b6UL, 0x74486c5cUL, 0x42d0b857UL, +}; +static const ulong32 TD2[256] = { + 0xa75051f4UL, 0x65537e41UL, 0xa4c31a17UL, 0x5e963a27UL, + 0x6bcb3babUL, 0x45f11f9dUL, 0x58abacfaUL, 0x03934be3UL, + 0xfa552030UL, 0x6df6ad76UL, 0x769188ccUL, 0x4c25f502UL, + 0xd7fc4fe5UL, 0xcbd7c52aUL, 0x44802635UL, 0xa38fb562UL, + 0x5a49deb1UL, 0x1b6725baUL, 0x0e9845eaUL, 0xc0e15dfeUL, + 0x7502c32fUL, 0xf012814cUL, 0x97a38d46UL, 0xf9c66bd3UL, + 0x5fe7038fUL, 0x9c951592UL, 0x7aebbf6dUL, 0x59da9552UL, + 0x832dd4beUL, 0x21d35874UL, 0x692949e0UL, 0xc8448ec9UL, + 0x896a75c2UL, 0x7978f48eUL, 0x3e6b9958UL, 0x71dd27b9UL, + 0x4fb6bee1UL, 0xad17f088UL, 0xac66c920UL, 0x3ab47dceUL, + 0x4a1863dfUL, 0x3182e51aUL, 0x33609751UL, 0x7f456253UL, + 0x77e0b164UL, 0xae84bb6bUL, 0xa01cfe81UL, 0x2b94f908UL, + 0x68587048UL, 0xfd198f45UL, 0x6c8794deUL, 0xf8b7527bUL, + 0xd323ab73UL, 0x02e2724bUL, 0x8f57e31fUL, 0xab2a6655UL, + 0x2807b2ebUL, 0xc2032fb5UL, 0x7b9a86c5UL, 0x08a5d337UL, + 0x87f23028UL, 0xa5b223bfUL, 0x6aba0203UL, 0x825ced16UL, + 0x1c2b8acfUL, 0xb492a779UL, 0xf2f0f307UL, 0xe2a14e69UL, + 0xf4cd65daUL, 0xbed50605UL, 0x621fd134UL, 0xfe8ac4a6UL, + 0x539d342eUL, 0x55a0a2f3UL, 0xe132058aUL, 0xeb75a4f6UL, + 0xec390b83UL, 0xefaa4060UL, 0x9f065e71UL, 0x1051bd6eUL, + 0x8af93e21UL, 0x063d96ddUL, 0x05aedd3eUL, 0xbd464de6UL, + 0x8db59154UL, 0x5d0571c4UL, 0xd46f0406UL, 0x15ff6050UL, + 0xfb241998UL, 0xe997d6bdUL, 0x43cc8940UL, 0x9e7767d9UL, + 0x42bdb0e8UL, 0x8b880789UL, 0x5b38e719UL, 0xeedb79c8UL, + 0x0a47a17cUL, 0x0fe97c42UL, 0x1ec9f884UL, 0x00000000UL, + 0x86830980UL, 0xed48322bUL, 0x70ac1e11UL, 0x724e6c5aUL, + 0xfffbfd0eUL, 0x38560f85UL, 0xd51e3daeUL, 0x3927362dUL, + 0xd9640a0fUL, 0xa621685cUL, 0x54d19b5bUL, 0x2e3a2436UL, + 0x67b10c0aUL, 0xe70f9357UL, 0x96d2b4eeUL, 0x919e1b9bUL, + 0xc54f80c0UL, 0x20a261dcUL, 0x4b695a77UL, 0x1a161c12UL, + 0xba0ae293UL, 0x2ae5c0a0UL, 0xe0433c22UL, 0x171d121bUL, + 0x0d0b0e09UL, 0xc7adf28bUL, 0xa8b92db6UL, 0xa9c8141eUL, + 0x198557f1UL, 0x074caf75UL, 0xddbbee99UL, 0x60fda37fUL, + 0x269ff701UL, 0xf5bc5c72UL, 0x3bc54466UL, 0x7e345bfbUL, + 0x29768b43UL, 0xc6dccb23UL, 0xfc68b6edUL, 0xf163b8e4UL, + 0xdccad731UL, 0x85104263UL, 0x22401397UL, 0x112084c6UL, + 0x247d854aUL, 0x3df8d2bbUL, 0x3211aef9UL, 0xa16dc729UL, + 0x2f4b1d9eUL, 0x30f3dcb2UL, 0x52ec0d86UL, 0xe3d077c1UL, + 0x166c2bb3UL, 0xb999a970UL, 0x48fa1194UL, 0x642247e9UL, + 0x8cc4a8fcUL, 0x3f1aa0f0UL, 0x2cd8567dUL, 0x90ef2233UL, + 0x4ec78749UL, 0xd1c1d938UL, 0xa2fe8ccaUL, 0x0b3698d4UL, + 0x81cfa6f5UL, 0xde28a57aUL, 0x8e26dab7UL, 0xbfa43fadUL, + 0x9de42c3aUL, 0x920d5078UL, 0xcc9b6a5fUL, 0x4662547eUL, + 0x13c2f68dUL, 0xb8e890d8UL, 0xf75e2e39UL, 0xaff582c3UL, + 0x80be9f5dUL, 0x937c69d0UL, 0x2da96fd5UL, 0x12b3cf25UL, + 0x993bc8acUL, 0x7da71018UL, 0x636ee89cUL, 0xbb7bdb3bUL, + 0x7809cd26UL, 0x18f46e59UL, 0xb701ec9aUL, 0x9aa8834fUL, + 0x6e65e695UL, 0xe67eaaffUL, 0xcf0821bcUL, 0xe8e6ef15UL, + 0x9bd9bae7UL, 0x36ce4a6fUL, 0x09d4ea9fUL, 0x7cd629b0UL, + 0xb2af31a4UL, 0x23312a3fUL, 0x9430c6a5UL, 0x66c035a2UL, + 0xbc37744eUL, 0xcaa6fc82UL, 0xd0b0e090UL, 0xd81533a7UL, + 0x984af104UL, 0xdaf741ecUL, 0x500e7fcdUL, 0xf62f1791UL, + 0xd68d764dUL, 0xb04d43efUL, 0x4d54ccaaUL, 0x04dfe496UL, + 0xb5e39ed1UL, 0x881b4c6aUL, 0x1fb8c12cUL, 0x517f4665UL, + 0xea049d5eUL, 0x355d018cUL, 0x7473fa87UL, 0x412efb0bUL, + 0x1d5ab367UL, 0xd25292dbUL, 0x5633e910UL, 0x47136dd6UL, + 0x618c9ad7UL, 0x0c7a37a1UL, 0x148e59f8UL, 0x3c89eb13UL, + 0x27eecea9UL, 0xc935b761UL, 0xe5ede11cUL, 0xb13c7a47UL, + 0xdf599cd2UL, 0x733f55f2UL, 0xce791814UL, 0x37bf73c7UL, + 0xcdea53f7UL, 0xaa5b5ffdUL, 0x6f14df3dUL, 0xdb867844UL, + 0xf381caafUL, 0xc43eb968UL, 0x342c3824UL, 0x405fc2a3UL, + 0xc372161dUL, 0x250cbce2UL, 0x498b283cUL, 0x9541ff0dUL, + 0x017139a8UL, 0xb3de080cUL, 0xe49cd8b4UL, 0xc1906456UL, + 0x84617bcbUL, 0xb670d532UL, 0x5c74486cUL, 0x5742d0b8UL, +}; +static const ulong32 TD3[256] = { + 0xf4a75051UL, 0x4165537eUL, 0x17a4c31aUL, 0x275e963aUL, + 0xab6bcb3bUL, 0x9d45f11fUL, 0xfa58abacUL, 0xe303934bUL, + 0x30fa5520UL, 0x766df6adUL, 0xcc769188UL, 0x024c25f5UL, + 0xe5d7fc4fUL, 0x2acbd7c5UL, 0x35448026UL, 0x62a38fb5UL, + 0xb15a49deUL, 0xba1b6725UL, 0xea0e9845UL, 0xfec0e15dUL, + 0x2f7502c3UL, 0x4cf01281UL, 0x4697a38dUL, 0xd3f9c66bUL, + 0x8f5fe703UL, 0x929c9515UL, 0x6d7aebbfUL, 0x5259da95UL, + 0xbe832dd4UL, 0x7421d358UL, 0xe0692949UL, 0xc9c8448eUL, + 0xc2896a75UL, 0x8e7978f4UL, 0x583e6b99UL, 0xb971dd27UL, + 0xe14fb6beUL, 0x88ad17f0UL, 0x20ac66c9UL, 0xce3ab47dUL, + 0xdf4a1863UL, 0x1a3182e5UL, 0x51336097UL, 0x537f4562UL, + 0x6477e0b1UL, 0x6bae84bbUL, 0x81a01cfeUL, 0x082b94f9UL, + 0x48685870UL, 0x45fd198fUL, 0xde6c8794UL, 0x7bf8b752UL, + 0x73d323abUL, 0x4b02e272UL, 0x1f8f57e3UL, 0x55ab2a66UL, + 0xeb2807b2UL, 0xb5c2032fUL, 0xc57b9a86UL, 0x3708a5d3UL, + 0x2887f230UL, 0xbfa5b223UL, 0x036aba02UL, 0x16825cedUL, + 0xcf1c2b8aUL, 0x79b492a7UL, 0x07f2f0f3UL, 0x69e2a14eUL, + 0xdaf4cd65UL, 0x05bed506UL, 0x34621fd1UL, 0xa6fe8ac4UL, + 0x2e539d34UL, 0xf355a0a2UL, 0x8ae13205UL, 0xf6eb75a4UL, + 0x83ec390bUL, 0x60efaa40UL, 0x719f065eUL, 0x6e1051bdUL, + 0x218af93eUL, 0xdd063d96UL, 0x3e05aeddUL, 0xe6bd464dUL, + 0x548db591UL, 0xc45d0571UL, 0x06d46f04UL, 0x5015ff60UL, + 0x98fb2419UL, 0xbde997d6UL, 0x4043cc89UL, 0xd99e7767UL, + 0xe842bdb0UL, 0x898b8807UL, 0x195b38e7UL, 0xc8eedb79UL, + 0x7c0a47a1UL, 0x420fe97cUL, 0x841ec9f8UL, 0x00000000UL, + 0x80868309UL, 0x2bed4832UL, 0x1170ac1eUL, 0x5a724e6cUL, + 0x0efffbfdUL, 0x8538560fUL, 0xaed51e3dUL, 0x2d392736UL, + 0x0fd9640aUL, 0x5ca62168UL, 0x5b54d19bUL, 0x362e3a24UL, + 0x0a67b10cUL, 0x57e70f93UL, 0xee96d2b4UL, 0x9b919e1bUL, + 0xc0c54f80UL, 0xdc20a261UL, 0x774b695aUL, 0x121a161cUL, + 0x93ba0ae2UL, 0xa02ae5c0UL, 0x22e0433cUL, 0x1b171d12UL, + 0x090d0b0eUL, 0x8bc7adf2UL, 0xb6a8b92dUL, 0x1ea9c814UL, + 0xf1198557UL, 0x75074cafUL, 0x99ddbbeeUL, 0x7f60fda3UL, + 0x01269ff7UL, 0x72f5bc5cUL, 0x663bc544UL, 0xfb7e345bUL, + 0x4329768bUL, 0x23c6dccbUL, 0xedfc68b6UL, 0xe4f163b8UL, + 0x31dccad7UL, 0x63851042UL, 0x97224013UL, 0xc6112084UL, + 0x4a247d85UL, 0xbb3df8d2UL, 0xf93211aeUL, 0x29a16dc7UL, + 0x9e2f4b1dUL, 0xb230f3dcUL, 0x8652ec0dUL, 0xc1e3d077UL, + 0xb3166c2bUL, 0x70b999a9UL, 0x9448fa11UL, 0xe9642247UL, + 0xfc8cc4a8UL, 0xf03f1aa0UL, 0x7d2cd856UL, 0x3390ef22UL, + 0x494ec787UL, 0x38d1c1d9UL, 0xcaa2fe8cUL, 0xd40b3698UL, + 0xf581cfa6UL, 0x7ade28a5UL, 0xb78e26daUL, 0xadbfa43fUL, + 0x3a9de42cUL, 0x78920d50UL, 0x5fcc9b6aUL, 0x7e466254UL, + 0x8d13c2f6UL, 0xd8b8e890UL, 0x39f75e2eUL, 0xc3aff582UL, + 0x5d80be9fUL, 0xd0937c69UL, 0xd52da96fUL, 0x2512b3cfUL, + 0xac993bc8UL, 0x187da710UL, 0x9c636ee8UL, 0x3bbb7bdbUL, + 0x267809cdUL, 0x5918f46eUL, 0x9ab701ecUL, 0x4f9aa883UL, + 0x956e65e6UL, 0xffe67eaaUL, 0xbccf0821UL, 0x15e8e6efUL, + 0xe79bd9baUL, 0x6f36ce4aUL, 0x9f09d4eaUL, 0xb07cd629UL, + 0xa4b2af31UL, 0x3f23312aUL, 0xa59430c6UL, 0xa266c035UL, + 0x4ebc3774UL, 0x82caa6fcUL, 0x90d0b0e0UL, 0xa7d81533UL, + 0x04984af1UL, 0xecdaf741UL, 0xcd500e7fUL, 0x91f62f17UL, + 0x4dd68d76UL, 0xefb04d43UL, 0xaa4d54ccUL, 0x9604dfe4UL, + 0xd1b5e39eUL, 0x6a881b4cUL, 0x2c1fb8c1UL, 0x65517f46UL, + 0x5eea049dUL, 0x8c355d01UL, 0x877473faUL, 0x0b412efbUL, + 0x671d5ab3UL, 0xdbd25292UL, 0x105633e9UL, 0xd647136dUL, + 0xd7618c9aUL, 0xa10c7a37UL, 0xf8148e59UL, 0x133c89ebUL, + 0xa927eeceUL, 0x61c935b7UL, 0x1ce5ede1UL, 0x47b13c7aUL, + 0xd2df599cUL, 0xf2733f55UL, 0x14ce7918UL, 0xc737bf73UL, + 0xf7cdea53UL, 0xfdaa5b5fUL, 0x3d6f14dfUL, 0x44db8678UL, + 0xaff381caUL, 0x68c43eb9UL, 0x24342c38UL, 0xa3405fc2UL, + 0x1dc37216UL, 0xe2250cbcUL, 0x3c498b28UL, 0x0d9541ffUL, + 0xa8017139UL, 0x0cb3de08UL, 0xb4e49cd8UL, 0x56c19064UL, + 0xcb84617bUL, 0x32b670d5UL, 0x6c5c7448UL, 0xb85742d0UL, +}; + +static const ulong32 Tks0[] = { +0x00000000UL, 0x0e090d0bUL, 0x1c121a16UL, 0x121b171dUL, 0x3824342cUL, 0x362d3927UL, 0x24362e3aUL, 0x2a3f2331UL, +0x70486858UL, 0x7e416553UL, 0x6c5a724eUL, 0x62537f45UL, 0x486c5c74UL, 0x4665517fUL, 0x547e4662UL, 0x5a774b69UL, +0xe090d0b0UL, 0xee99ddbbUL, 0xfc82caa6UL, 0xf28bc7adUL, 0xd8b4e49cUL, 0xd6bde997UL, 0xc4a6fe8aUL, 0xcaaff381UL, +0x90d8b8e8UL, 0x9ed1b5e3UL, 0x8ccaa2feUL, 0x82c3aff5UL, 0xa8fc8cc4UL, 0xa6f581cfUL, 0xb4ee96d2UL, 0xbae79bd9UL, +0xdb3bbb7bUL, 0xd532b670UL, 0xc729a16dUL, 0xc920ac66UL, 0xe31f8f57UL, 0xed16825cUL, 0xff0d9541UL, 0xf104984aUL, +0xab73d323UL, 0xa57ade28UL, 0xb761c935UL, 0xb968c43eUL, 0x9357e70fUL, 0x9d5eea04UL, 0x8f45fd19UL, 0x814cf012UL, +0x3bab6bcbUL, 0x35a266c0UL, 0x27b971ddUL, 0x29b07cd6UL, 0x038f5fe7UL, 0x0d8652ecUL, 0x1f9d45f1UL, 0x119448faUL, +0x4be30393UL, 0x45ea0e98UL, 0x57f11985UL, 0x59f8148eUL, 0x73c737bfUL, 0x7dce3ab4UL, 0x6fd52da9UL, 0x61dc20a2UL, +0xad766df6UL, 0xa37f60fdUL, 0xb16477e0UL, 0xbf6d7aebUL, 0x955259daUL, 0x9b5b54d1UL, 0x894043ccUL, 0x87494ec7UL, +0xdd3e05aeUL, 0xd33708a5UL, 0xc12c1fb8UL, 0xcf2512b3UL, 0xe51a3182UL, 0xeb133c89UL, 0xf9082b94UL, 0xf701269fUL, +0x4de6bd46UL, 0x43efb04dUL, 0x51f4a750UL, 0x5ffdaa5bUL, 0x75c2896aUL, 0x7bcb8461UL, 0x69d0937cUL, 0x67d99e77UL, +0x3daed51eUL, 0x33a7d815UL, 0x21bccf08UL, 0x2fb5c203UL, 0x058ae132UL, 0x0b83ec39UL, 0x1998fb24UL, 0x1791f62fUL, +0x764dd68dUL, 0x7844db86UL, 0x6a5fcc9bUL, 0x6456c190UL, 0x4e69e2a1UL, 0x4060efaaUL, 0x527bf8b7UL, 0x5c72f5bcUL, +0x0605bed5UL, 0x080cb3deUL, 0x1a17a4c3UL, 0x141ea9c8UL, 0x3e218af9UL, 0x302887f2UL, 0x223390efUL, 0x2c3a9de4UL, +0x96dd063dUL, 0x98d40b36UL, 0x8acf1c2bUL, 0x84c61120UL, 0xaef93211UL, 0xa0f03f1aUL, 0xb2eb2807UL, 0xbce2250cUL, +0xe6956e65UL, 0xe89c636eUL, 0xfa877473UL, 0xf48e7978UL, 0xdeb15a49UL, 0xd0b85742UL, 0xc2a3405fUL, 0xccaa4d54UL, +0x41ecdaf7UL, 0x4fe5d7fcUL, 0x5dfec0e1UL, 0x53f7cdeaUL, 0x79c8eedbUL, 0x77c1e3d0UL, 0x65daf4cdUL, 0x6bd3f9c6UL, +0x31a4b2afUL, 0x3fadbfa4UL, 0x2db6a8b9UL, 0x23bfa5b2UL, 0x09808683UL, 0x07898b88UL, 0x15929c95UL, 0x1b9b919eUL, +0xa17c0a47UL, 0xaf75074cUL, 0xbd6e1051UL, 0xb3671d5aUL, 0x99583e6bUL, 0x97513360UL, 0x854a247dUL, 0x8b432976UL, +0xd134621fUL, 0xdf3d6f14UL, 0xcd267809UL, 0xc32f7502UL, 0xe9105633UL, 0xe7195b38UL, 0xf5024c25UL, 0xfb0b412eUL, +0x9ad7618cUL, 0x94de6c87UL, 0x86c57b9aUL, 0x88cc7691UL, 0xa2f355a0UL, 0xacfa58abUL, 0xbee14fb6UL, 0xb0e842bdUL, +0xea9f09d4UL, 0xe49604dfUL, 0xf68d13c2UL, 0xf8841ec9UL, 0xd2bb3df8UL, 0xdcb230f3UL, 0xcea927eeUL, 0xc0a02ae5UL, +0x7a47b13cUL, 0x744ebc37UL, 0x6655ab2aUL, 0x685ca621UL, 0x42638510UL, 0x4c6a881bUL, 0x5e719f06UL, 0x5078920dUL, +0x0a0fd964UL, 0x0406d46fUL, 0x161dc372UL, 0x1814ce79UL, 0x322bed48UL, 0x3c22e043UL, 0x2e39f75eUL, 0x2030fa55UL, +0xec9ab701UL, 0xe293ba0aUL, 0xf088ad17UL, 0xfe81a01cUL, 0xd4be832dUL, 0xdab78e26UL, 0xc8ac993bUL, 0xc6a59430UL, +0x9cd2df59UL, 0x92dbd252UL, 0x80c0c54fUL, 0x8ec9c844UL, 0xa4f6eb75UL, 0xaaffe67eUL, 0xb8e4f163UL, 0xb6edfc68UL, +0x0c0a67b1UL, 0x02036abaUL, 0x10187da7UL, 0x1e1170acUL, 0x342e539dUL, 0x3a275e96UL, 0x283c498bUL, 0x26354480UL, +0x7c420fe9UL, 0x724b02e2UL, 0x605015ffUL, 0x6e5918f4UL, 0x44663bc5UL, 0x4a6f36ceUL, 0x587421d3UL, 0x567d2cd8UL, +0x37a10c7aUL, 0x39a80171UL, 0x2bb3166cUL, 0x25ba1b67UL, 0x0f853856UL, 0x018c355dUL, 0x13972240UL, 0x1d9e2f4bUL, +0x47e96422UL, 0x49e06929UL, 0x5bfb7e34UL, 0x55f2733fUL, 0x7fcd500eUL, 0x71c45d05UL, 0x63df4a18UL, 0x6dd64713UL, +0xd731dccaUL, 0xd938d1c1UL, 0xcb23c6dcUL, 0xc52acbd7UL, 0xef15e8e6UL, 0xe11ce5edUL, 0xf307f2f0UL, 0xfd0efffbUL, +0xa779b492UL, 0xa970b999UL, 0xbb6bae84UL, 0xb562a38fUL, 0x9f5d80beUL, 0x91548db5UL, 0x834f9aa8UL, 0x8d4697a3UL +}; + +static const ulong32 Tks1[] = { +0x00000000UL, 0x0b0e090dUL, 0x161c121aUL, 0x1d121b17UL, 0x2c382434UL, 0x27362d39UL, 0x3a24362eUL, 0x312a3f23UL, +0x58704868UL, 0x537e4165UL, 0x4e6c5a72UL, 0x4562537fUL, 0x74486c5cUL, 0x7f466551UL, 0x62547e46UL, 0x695a774bUL, +0xb0e090d0UL, 0xbbee99ddUL, 0xa6fc82caUL, 0xadf28bc7UL, 0x9cd8b4e4UL, 0x97d6bde9UL, 0x8ac4a6feUL, 0x81caaff3UL, +0xe890d8b8UL, 0xe39ed1b5UL, 0xfe8ccaa2UL, 0xf582c3afUL, 0xc4a8fc8cUL, 0xcfa6f581UL, 0xd2b4ee96UL, 0xd9bae79bUL, +0x7bdb3bbbUL, 0x70d532b6UL, 0x6dc729a1UL, 0x66c920acUL, 0x57e31f8fUL, 0x5ced1682UL, 0x41ff0d95UL, 0x4af10498UL, +0x23ab73d3UL, 0x28a57adeUL, 0x35b761c9UL, 0x3eb968c4UL, 0x0f9357e7UL, 0x049d5eeaUL, 0x198f45fdUL, 0x12814cf0UL, +0xcb3bab6bUL, 0xc035a266UL, 0xdd27b971UL, 0xd629b07cUL, 0xe7038f5fUL, 0xec0d8652UL, 0xf11f9d45UL, 0xfa119448UL, +0x934be303UL, 0x9845ea0eUL, 0x8557f119UL, 0x8e59f814UL, 0xbf73c737UL, 0xb47dce3aUL, 0xa96fd52dUL, 0xa261dc20UL, +0xf6ad766dUL, 0xfda37f60UL, 0xe0b16477UL, 0xebbf6d7aUL, 0xda955259UL, 0xd19b5b54UL, 0xcc894043UL, 0xc787494eUL, +0xaedd3e05UL, 0xa5d33708UL, 0xb8c12c1fUL, 0xb3cf2512UL, 0x82e51a31UL, 0x89eb133cUL, 0x94f9082bUL, 0x9ff70126UL, +0x464de6bdUL, 0x4d43efb0UL, 0x5051f4a7UL, 0x5b5ffdaaUL, 0x6a75c289UL, 0x617bcb84UL, 0x7c69d093UL, 0x7767d99eUL, +0x1e3daed5UL, 0x1533a7d8UL, 0x0821bccfUL, 0x032fb5c2UL, 0x32058ae1UL, 0x390b83ecUL, 0x241998fbUL, 0x2f1791f6UL, +0x8d764dd6UL, 0x867844dbUL, 0x9b6a5fccUL, 0x906456c1UL, 0xa14e69e2UL, 0xaa4060efUL, 0xb7527bf8UL, 0xbc5c72f5UL, +0xd50605beUL, 0xde080cb3UL, 0xc31a17a4UL, 0xc8141ea9UL, 0xf93e218aUL, 0xf2302887UL, 0xef223390UL, 0xe42c3a9dUL, +0x3d96dd06UL, 0x3698d40bUL, 0x2b8acf1cUL, 0x2084c611UL, 0x11aef932UL, 0x1aa0f03fUL, 0x07b2eb28UL, 0x0cbce225UL, +0x65e6956eUL, 0x6ee89c63UL, 0x73fa8774UL, 0x78f48e79UL, 0x49deb15aUL, 0x42d0b857UL, 0x5fc2a340UL, 0x54ccaa4dUL, +0xf741ecdaUL, 0xfc4fe5d7UL, 0xe15dfec0UL, 0xea53f7cdUL, 0xdb79c8eeUL, 0xd077c1e3UL, 0xcd65daf4UL, 0xc66bd3f9UL, +0xaf31a4b2UL, 0xa43fadbfUL, 0xb92db6a8UL, 0xb223bfa5UL, 0x83098086UL, 0x8807898bUL, 0x9515929cUL, 0x9e1b9b91UL, +0x47a17c0aUL, 0x4caf7507UL, 0x51bd6e10UL, 0x5ab3671dUL, 0x6b99583eUL, 0x60975133UL, 0x7d854a24UL, 0x768b4329UL, +0x1fd13462UL, 0x14df3d6fUL, 0x09cd2678UL, 0x02c32f75UL, 0x33e91056UL, 0x38e7195bUL, 0x25f5024cUL, 0x2efb0b41UL, +0x8c9ad761UL, 0x8794de6cUL, 0x9a86c57bUL, 0x9188cc76UL, 0xa0a2f355UL, 0xabacfa58UL, 0xb6bee14fUL, 0xbdb0e842UL, +0xd4ea9f09UL, 0xdfe49604UL, 0xc2f68d13UL, 0xc9f8841eUL, 0xf8d2bb3dUL, 0xf3dcb230UL, 0xeecea927UL, 0xe5c0a02aUL, +0x3c7a47b1UL, 0x37744ebcUL, 0x2a6655abUL, 0x21685ca6UL, 0x10426385UL, 0x1b4c6a88UL, 0x065e719fUL, 0x0d507892UL, +0x640a0fd9UL, 0x6f0406d4UL, 0x72161dc3UL, 0x791814ceUL, 0x48322bedUL, 0x433c22e0UL, 0x5e2e39f7UL, 0x552030faUL, +0x01ec9ab7UL, 0x0ae293baUL, 0x17f088adUL, 0x1cfe81a0UL, 0x2dd4be83UL, 0x26dab78eUL, 0x3bc8ac99UL, 0x30c6a594UL, +0x599cd2dfUL, 0x5292dbd2UL, 0x4f80c0c5UL, 0x448ec9c8UL, 0x75a4f6ebUL, 0x7eaaffe6UL, 0x63b8e4f1UL, 0x68b6edfcUL, +0xb10c0a67UL, 0xba02036aUL, 0xa710187dUL, 0xac1e1170UL, 0x9d342e53UL, 0x963a275eUL, 0x8b283c49UL, 0x80263544UL, +0xe97c420fUL, 0xe2724b02UL, 0xff605015UL, 0xf46e5918UL, 0xc544663bUL, 0xce4a6f36UL, 0xd3587421UL, 0xd8567d2cUL, +0x7a37a10cUL, 0x7139a801UL, 0x6c2bb316UL, 0x6725ba1bUL, 0x560f8538UL, 0x5d018c35UL, 0x40139722UL, 0x4b1d9e2fUL, +0x2247e964UL, 0x2949e069UL, 0x345bfb7eUL, 0x3f55f273UL, 0x0e7fcd50UL, 0x0571c45dUL, 0x1863df4aUL, 0x136dd647UL, +0xcad731dcUL, 0xc1d938d1UL, 0xdccb23c6UL, 0xd7c52acbUL, 0xe6ef15e8UL, 0xede11ce5UL, 0xf0f307f2UL, 0xfbfd0effUL, +0x92a779b4UL, 0x99a970b9UL, 0x84bb6baeUL, 0x8fb562a3UL, 0xbe9f5d80UL, 0xb591548dUL, 0xa8834f9aUL, 0xa38d4697UL +}; + +static const ulong32 Tks2[] = { +0x00000000UL, 0x0d0b0e09UL, 0x1a161c12UL, 0x171d121bUL, 0x342c3824UL, 0x3927362dUL, 0x2e3a2436UL, 0x23312a3fUL, +0x68587048UL, 0x65537e41UL, 0x724e6c5aUL, 0x7f456253UL, 0x5c74486cUL, 0x517f4665UL, 0x4662547eUL, 0x4b695a77UL, +0xd0b0e090UL, 0xddbbee99UL, 0xcaa6fc82UL, 0xc7adf28bUL, 0xe49cd8b4UL, 0xe997d6bdUL, 0xfe8ac4a6UL, 0xf381caafUL, +0xb8e890d8UL, 0xb5e39ed1UL, 0xa2fe8ccaUL, 0xaff582c3UL, 0x8cc4a8fcUL, 0x81cfa6f5UL, 0x96d2b4eeUL, 0x9bd9bae7UL, +0xbb7bdb3bUL, 0xb670d532UL, 0xa16dc729UL, 0xac66c920UL, 0x8f57e31fUL, 0x825ced16UL, 0x9541ff0dUL, 0x984af104UL, +0xd323ab73UL, 0xde28a57aUL, 0xc935b761UL, 0xc43eb968UL, 0xe70f9357UL, 0xea049d5eUL, 0xfd198f45UL, 0xf012814cUL, +0x6bcb3babUL, 0x66c035a2UL, 0x71dd27b9UL, 0x7cd629b0UL, 0x5fe7038fUL, 0x52ec0d86UL, 0x45f11f9dUL, 0x48fa1194UL, +0x03934be3UL, 0x0e9845eaUL, 0x198557f1UL, 0x148e59f8UL, 0x37bf73c7UL, 0x3ab47dceUL, 0x2da96fd5UL, 0x20a261dcUL, +0x6df6ad76UL, 0x60fda37fUL, 0x77e0b164UL, 0x7aebbf6dUL, 0x59da9552UL, 0x54d19b5bUL, 0x43cc8940UL, 0x4ec78749UL, +0x05aedd3eUL, 0x08a5d337UL, 0x1fb8c12cUL, 0x12b3cf25UL, 0x3182e51aUL, 0x3c89eb13UL, 0x2b94f908UL, 0x269ff701UL, +0xbd464de6UL, 0xb04d43efUL, 0xa75051f4UL, 0xaa5b5ffdUL, 0x896a75c2UL, 0x84617bcbUL, 0x937c69d0UL, 0x9e7767d9UL, +0xd51e3daeUL, 0xd81533a7UL, 0xcf0821bcUL, 0xc2032fb5UL, 0xe132058aUL, 0xec390b83UL, 0xfb241998UL, 0xf62f1791UL, +0xd68d764dUL, 0xdb867844UL, 0xcc9b6a5fUL, 0xc1906456UL, 0xe2a14e69UL, 0xefaa4060UL, 0xf8b7527bUL, 0xf5bc5c72UL, +0xbed50605UL, 0xb3de080cUL, 0xa4c31a17UL, 0xa9c8141eUL, 0x8af93e21UL, 0x87f23028UL, 0x90ef2233UL, 0x9de42c3aUL, +0x063d96ddUL, 0x0b3698d4UL, 0x1c2b8acfUL, 0x112084c6UL, 0x3211aef9UL, 0x3f1aa0f0UL, 0x2807b2ebUL, 0x250cbce2UL, +0x6e65e695UL, 0x636ee89cUL, 0x7473fa87UL, 0x7978f48eUL, 0x5a49deb1UL, 0x5742d0b8UL, 0x405fc2a3UL, 0x4d54ccaaUL, +0xdaf741ecUL, 0xd7fc4fe5UL, 0xc0e15dfeUL, 0xcdea53f7UL, 0xeedb79c8UL, 0xe3d077c1UL, 0xf4cd65daUL, 0xf9c66bd3UL, +0xb2af31a4UL, 0xbfa43fadUL, 0xa8b92db6UL, 0xa5b223bfUL, 0x86830980UL, 0x8b880789UL, 0x9c951592UL, 0x919e1b9bUL, +0x0a47a17cUL, 0x074caf75UL, 0x1051bd6eUL, 0x1d5ab367UL, 0x3e6b9958UL, 0x33609751UL, 0x247d854aUL, 0x29768b43UL, +0x621fd134UL, 0x6f14df3dUL, 0x7809cd26UL, 0x7502c32fUL, 0x5633e910UL, 0x5b38e719UL, 0x4c25f502UL, 0x412efb0bUL, +0x618c9ad7UL, 0x6c8794deUL, 0x7b9a86c5UL, 0x769188ccUL, 0x55a0a2f3UL, 0x58abacfaUL, 0x4fb6bee1UL, 0x42bdb0e8UL, +0x09d4ea9fUL, 0x04dfe496UL, 0x13c2f68dUL, 0x1ec9f884UL, 0x3df8d2bbUL, 0x30f3dcb2UL, 0x27eecea9UL, 0x2ae5c0a0UL, +0xb13c7a47UL, 0xbc37744eUL, 0xab2a6655UL, 0xa621685cUL, 0x85104263UL, 0x881b4c6aUL, 0x9f065e71UL, 0x920d5078UL, +0xd9640a0fUL, 0xd46f0406UL, 0xc372161dUL, 0xce791814UL, 0xed48322bUL, 0xe0433c22UL, 0xf75e2e39UL, 0xfa552030UL, +0xb701ec9aUL, 0xba0ae293UL, 0xad17f088UL, 0xa01cfe81UL, 0x832dd4beUL, 0x8e26dab7UL, 0x993bc8acUL, 0x9430c6a5UL, +0xdf599cd2UL, 0xd25292dbUL, 0xc54f80c0UL, 0xc8448ec9UL, 0xeb75a4f6UL, 0xe67eaaffUL, 0xf163b8e4UL, 0xfc68b6edUL, +0x67b10c0aUL, 0x6aba0203UL, 0x7da71018UL, 0x70ac1e11UL, 0x539d342eUL, 0x5e963a27UL, 0x498b283cUL, 0x44802635UL, +0x0fe97c42UL, 0x02e2724bUL, 0x15ff6050UL, 0x18f46e59UL, 0x3bc54466UL, 0x36ce4a6fUL, 0x21d35874UL, 0x2cd8567dUL, +0x0c7a37a1UL, 0x017139a8UL, 0x166c2bb3UL, 0x1b6725baUL, 0x38560f85UL, 0x355d018cUL, 0x22401397UL, 0x2f4b1d9eUL, +0x642247e9UL, 0x692949e0UL, 0x7e345bfbUL, 0x733f55f2UL, 0x500e7fcdUL, 0x5d0571c4UL, 0x4a1863dfUL, 0x47136dd6UL, +0xdccad731UL, 0xd1c1d938UL, 0xc6dccb23UL, 0xcbd7c52aUL, 0xe8e6ef15UL, 0xe5ede11cUL, 0xf2f0f307UL, 0xfffbfd0eUL, +0xb492a779UL, 0xb999a970UL, 0xae84bb6bUL, 0xa38fb562UL, 0x80be9f5dUL, 0x8db59154UL, 0x9aa8834fUL, 0x97a38d46UL +}; + +static const ulong32 Tks3[] = { +0x00000000UL, 0x090d0b0eUL, 0x121a161cUL, 0x1b171d12UL, 0x24342c38UL, 0x2d392736UL, 0x362e3a24UL, 0x3f23312aUL, +0x48685870UL, 0x4165537eUL, 0x5a724e6cUL, 0x537f4562UL, 0x6c5c7448UL, 0x65517f46UL, 0x7e466254UL, 0x774b695aUL, +0x90d0b0e0UL, 0x99ddbbeeUL, 0x82caa6fcUL, 0x8bc7adf2UL, 0xb4e49cd8UL, 0xbde997d6UL, 0xa6fe8ac4UL, 0xaff381caUL, +0xd8b8e890UL, 0xd1b5e39eUL, 0xcaa2fe8cUL, 0xc3aff582UL, 0xfc8cc4a8UL, 0xf581cfa6UL, 0xee96d2b4UL, 0xe79bd9baUL, +0x3bbb7bdbUL, 0x32b670d5UL, 0x29a16dc7UL, 0x20ac66c9UL, 0x1f8f57e3UL, 0x16825cedUL, 0x0d9541ffUL, 0x04984af1UL, +0x73d323abUL, 0x7ade28a5UL, 0x61c935b7UL, 0x68c43eb9UL, 0x57e70f93UL, 0x5eea049dUL, 0x45fd198fUL, 0x4cf01281UL, +0xab6bcb3bUL, 0xa266c035UL, 0xb971dd27UL, 0xb07cd629UL, 0x8f5fe703UL, 0x8652ec0dUL, 0x9d45f11fUL, 0x9448fa11UL, +0xe303934bUL, 0xea0e9845UL, 0xf1198557UL, 0xf8148e59UL, 0xc737bf73UL, 0xce3ab47dUL, 0xd52da96fUL, 0xdc20a261UL, +0x766df6adUL, 0x7f60fda3UL, 0x6477e0b1UL, 0x6d7aebbfUL, 0x5259da95UL, 0x5b54d19bUL, 0x4043cc89UL, 0x494ec787UL, +0x3e05aeddUL, 0x3708a5d3UL, 0x2c1fb8c1UL, 0x2512b3cfUL, 0x1a3182e5UL, 0x133c89ebUL, 0x082b94f9UL, 0x01269ff7UL, +0xe6bd464dUL, 0xefb04d43UL, 0xf4a75051UL, 0xfdaa5b5fUL, 0xc2896a75UL, 0xcb84617bUL, 0xd0937c69UL, 0xd99e7767UL, +0xaed51e3dUL, 0xa7d81533UL, 0xbccf0821UL, 0xb5c2032fUL, 0x8ae13205UL, 0x83ec390bUL, 0x98fb2419UL, 0x91f62f17UL, +0x4dd68d76UL, 0x44db8678UL, 0x5fcc9b6aUL, 0x56c19064UL, 0x69e2a14eUL, 0x60efaa40UL, 0x7bf8b752UL, 0x72f5bc5cUL, +0x05bed506UL, 0x0cb3de08UL, 0x17a4c31aUL, 0x1ea9c814UL, 0x218af93eUL, 0x2887f230UL, 0x3390ef22UL, 0x3a9de42cUL, +0xdd063d96UL, 0xd40b3698UL, 0xcf1c2b8aUL, 0xc6112084UL, 0xf93211aeUL, 0xf03f1aa0UL, 0xeb2807b2UL, 0xe2250cbcUL, +0x956e65e6UL, 0x9c636ee8UL, 0x877473faUL, 0x8e7978f4UL, 0xb15a49deUL, 0xb85742d0UL, 0xa3405fc2UL, 0xaa4d54ccUL, +0xecdaf741UL, 0xe5d7fc4fUL, 0xfec0e15dUL, 0xf7cdea53UL, 0xc8eedb79UL, 0xc1e3d077UL, 0xdaf4cd65UL, 0xd3f9c66bUL, +0xa4b2af31UL, 0xadbfa43fUL, 0xb6a8b92dUL, 0xbfa5b223UL, 0x80868309UL, 0x898b8807UL, 0x929c9515UL, 0x9b919e1bUL, +0x7c0a47a1UL, 0x75074cafUL, 0x6e1051bdUL, 0x671d5ab3UL, 0x583e6b99UL, 0x51336097UL, 0x4a247d85UL, 0x4329768bUL, +0x34621fd1UL, 0x3d6f14dfUL, 0x267809cdUL, 0x2f7502c3UL, 0x105633e9UL, 0x195b38e7UL, 0x024c25f5UL, 0x0b412efbUL, +0xd7618c9aUL, 0xde6c8794UL, 0xc57b9a86UL, 0xcc769188UL, 0xf355a0a2UL, 0xfa58abacUL, 0xe14fb6beUL, 0xe842bdb0UL, +0x9f09d4eaUL, 0x9604dfe4UL, 0x8d13c2f6UL, 0x841ec9f8UL, 0xbb3df8d2UL, 0xb230f3dcUL, 0xa927eeceUL, 0xa02ae5c0UL, +0x47b13c7aUL, 0x4ebc3774UL, 0x55ab2a66UL, 0x5ca62168UL, 0x63851042UL, 0x6a881b4cUL, 0x719f065eUL, 0x78920d50UL, +0x0fd9640aUL, 0x06d46f04UL, 0x1dc37216UL, 0x14ce7918UL, 0x2bed4832UL, 0x22e0433cUL, 0x39f75e2eUL, 0x30fa5520UL, +0x9ab701ecUL, 0x93ba0ae2UL, 0x88ad17f0UL, 0x81a01cfeUL, 0xbe832dd4UL, 0xb78e26daUL, 0xac993bc8UL, 0xa59430c6UL, +0xd2df599cUL, 0xdbd25292UL, 0xc0c54f80UL, 0xc9c8448eUL, 0xf6eb75a4UL, 0xffe67eaaUL, 0xe4f163b8UL, 0xedfc68b6UL, +0x0a67b10cUL, 0x036aba02UL, 0x187da710UL, 0x1170ac1eUL, 0x2e539d34UL, 0x275e963aUL, 0x3c498b28UL, 0x35448026UL, +0x420fe97cUL, 0x4b02e272UL, 0x5015ff60UL, 0x5918f46eUL, 0x663bc544UL, 0x6f36ce4aUL, 0x7421d358UL, 0x7d2cd856UL, +0xa10c7a37UL, 0xa8017139UL, 0xb3166c2bUL, 0xba1b6725UL, 0x8538560fUL, 0x8c355d01UL, 0x97224013UL, 0x9e2f4b1dUL, +0xe9642247UL, 0xe0692949UL, 0xfb7e345bUL, 0xf2733f55UL, 0xcd500e7fUL, 0xc45d0571UL, 0xdf4a1863UL, 0xd647136dUL, +0x31dccad7UL, 0x38d1c1d9UL, 0x23c6dccbUL, 0x2acbd7c5UL, 0x15e8e6efUL, 0x1ce5ede1UL, 0x07f2f0f3UL, 0x0efffbfdUL, +0x79b492a7UL, 0x70b999a9UL, 0x6bae84bbUL, 0x62a38fb5UL, 0x5d80be9fUL, 0x548db591UL, 0x4f9aa883UL, 0x4697a38dUL +}; + +#endif /* ENCRYPT_ONLY */ + +#endif /* SMALL CODE */ + +static const ulong32 rcon[] = { + 0x01000000UL, 0x02000000UL, 0x04000000UL, 0x08000000UL, + 0x10000000UL, 0x20000000UL, 0x40000000UL, 0x80000000UL, + 0x1B000000UL, 0x36000000UL, /* for 128-bit blocks, Rijndael never uses more than 10 rcon values */ +}; + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/aes/aes_tab.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/ciphers/des.c b/core/lib/libtomcrypt/src/ciphers/des.c new file mode 100644 index 0000000..a83b7df --- /dev/null +++ b/core/lib/libtomcrypt/src/ciphers/des.c @@ -0,0 +1,2112 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file des.c + LTC_DES code submitted by Dobes Vandermeer +*/ + +#ifdef LTC_DES + +#define EN0 0 +#define DE1 1 + +const struct ltc_cipher_descriptor des_desc = +{ + "des", + 13, + 8, 8, 8, 16, + &des_setup, + &des_ecb_encrypt, + &des_ecb_decrypt, + &des_test, + &des_done, + &des_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +const struct ltc_cipher_descriptor des3_desc = +{ + "3des", + 14, + 24, 24, 8, 16, + &des3_setup, + &des3_ecb_encrypt, + &des3_ecb_decrypt, + &des3_test, + &des3_done, + &des3_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 bytebit[8] = +{ + 0200, 0100, 040, 020, 010, 04, 02, 01 +}; + +static const ulong32 bigbyte[24] = +{ + 0x800000UL, 0x400000UL, 0x200000UL, 0x100000UL, + 0x80000UL, 0x40000UL, 0x20000UL, 0x10000UL, + 0x8000UL, 0x4000UL, 0x2000UL, 0x1000UL, + 0x800UL, 0x400UL, 0x200UL, 0x100UL, + 0x80UL, 0x40UL, 0x20UL, 0x10UL, + 0x8UL, 0x4UL, 0x2UL, 0x1L +}; + +/* Use the key schedule specific in the standard (ANSI X3.92-1981) */ + +static const unsigned char pc1[56] = { + 56, 48, 40, 32, 24, 16, 8, 0, 57, 49, 41, 33, 25, 17, + 9, 1, 58, 50, 42, 34, 26, 18, 10, 2, 59, 51, 43, 35, + 62, 54, 46, 38, 30, 22, 14, 6, 61, 53, 45, 37, 29, 21, + 13, 5, 60, 52, 44, 36, 28, 20, 12, 4, 27, 19, 11, 3 +}; + +static const unsigned char totrot[16] = { + 1, 2, 4, 6, + 8, 10, 12, 14, + 15, 17, 19, 21, + 23, 25, 27, 28 +}; + +static const unsigned char pc2[48] = { + 13, 16, 10, 23, 0, 4, 2, 27, 14, 5, 20, 9, + 22, 18, 11, 3, 25, 7, 15, 6, 26, 19, 12, 1, + 40, 51, 30, 36, 46, 54, 29, 39, 50, 44, 32, 47, + 43, 48, 38, 55, 33, 52, 45, 41, 49, 35, 28, 31 +}; + + +static const ulong32 SP1[64] = +{ + 0x01010400UL, 0x00000000UL, 0x00010000UL, 0x01010404UL, + 0x01010004UL, 0x00010404UL, 0x00000004UL, 0x00010000UL, + 0x00000400UL, 0x01010400UL, 0x01010404UL, 0x00000400UL, + 0x01000404UL, 0x01010004UL, 0x01000000UL, 0x00000004UL, + 0x00000404UL, 0x01000400UL, 0x01000400UL, 0x00010400UL, + 0x00010400UL, 0x01010000UL, 0x01010000UL, 0x01000404UL, + 0x00010004UL, 0x01000004UL, 0x01000004UL, 0x00010004UL, + 0x00000000UL, 0x00000404UL, 0x00010404UL, 0x01000000UL, + 0x00010000UL, 0x01010404UL, 0x00000004UL, 0x01010000UL, + 0x01010400UL, 0x01000000UL, 0x01000000UL, 0x00000400UL, + 0x01010004UL, 0x00010000UL, 0x00010400UL, 0x01000004UL, + 0x00000400UL, 0x00000004UL, 0x01000404UL, 0x00010404UL, + 0x01010404UL, 0x00010004UL, 0x01010000UL, 0x01000404UL, + 0x01000004UL, 0x00000404UL, 0x00010404UL, 0x01010400UL, + 0x00000404UL, 0x01000400UL, 0x01000400UL, 0x00000000UL, + 0x00010004UL, 0x00010400UL, 0x00000000UL, 0x01010004UL +}; + +static const ulong32 SP2[64] = +{ + 0x80108020UL, 0x80008000UL, 0x00008000UL, 0x00108020UL, + 0x00100000UL, 0x00000020UL, 0x80100020UL, 0x80008020UL, + 0x80000020UL, 0x80108020UL, 0x80108000UL, 0x80000000UL, + 0x80008000UL, 0x00100000UL, 0x00000020UL, 0x80100020UL, + 0x00108000UL, 0x00100020UL, 0x80008020UL, 0x00000000UL, + 0x80000000UL, 0x00008000UL, 0x00108020UL, 0x80100000UL, + 0x00100020UL, 0x80000020UL, 0x00000000UL, 0x00108000UL, + 0x00008020UL, 0x80108000UL, 0x80100000UL, 0x00008020UL, + 0x00000000UL, 0x00108020UL, 0x80100020UL, 0x00100000UL, + 0x80008020UL, 0x80100000UL, 0x80108000UL, 0x00008000UL, + 0x80100000UL, 0x80008000UL, 0x00000020UL, 0x80108020UL, + 0x00108020UL, 0x00000020UL, 0x00008000UL, 0x80000000UL, + 0x00008020UL, 0x80108000UL, 0x00100000UL, 0x80000020UL, + 0x00100020UL, 0x80008020UL, 0x80000020UL, 0x00100020UL, + 0x00108000UL, 0x00000000UL, 0x80008000UL, 0x00008020UL, + 0x80000000UL, 0x80100020UL, 0x80108020UL, 0x00108000UL +}; + +static const ulong32 SP3[64] = +{ + 0x00000208UL, 0x08020200UL, 0x00000000UL, 0x08020008UL, + 0x08000200UL, 0x00000000UL, 0x00020208UL, 0x08000200UL, + 0x00020008UL, 0x08000008UL, 0x08000008UL, 0x00020000UL, + 0x08020208UL, 0x00020008UL, 0x08020000UL, 0x00000208UL, + 0x08000000UL, 0x00000008UL, 0x08020200UL, 0x00000200UL, + 0x00020200UL, 0x08020000UL, 0x08020008UL, 0x00020208UL, + 0x08000208UL, 0x00020200UL, 0x00020000UL, 0x08000208UL, + 0x00000008UL, 0x08020208UL, 0x00000200UL, 0x08000000UL, + 0x08020200UL, 0x08000000UL, 0x00020008UL, 0x00000208UL, + 0x00020000UL, 0x08020200UL, 0x08000200UL, 0x00000000UL, + 0x00000200UL, 0x00020008UL, 0x08020208UL, 0x08000200UL, + 0x08000008UL, 0x00000200UL, 0x00000000UL, 0x08020008UL, + 0x08000208UL, 0x00020000UL, 0x08000000UL, 0x08020208UL, + 0x00000008UL, 0x00020208UL, 0x00020200UL, 0x08000008UL, + 0x08020000UL, 0x08000208UL, 0x00000208UL, 0x08020000UL, + 0x00020208UL, 0x00000008UL, 0x08020008UL, 0x00020200UL +}; + +static const ulong32 SP4[64] = +{ + 0x00802001UL, 0x00002081UL, 0x00002081UL, 0x00000080UL, + 0x00802080UL, 0x00800081UL, 0x00800001UL, 0x00002001UL, + 0x00000000UL, 0x00802000UL, 0x00802000UL, 0x00802081UL, + 0x00000081UL, 0x00000000UL, 0x00800080UL, 0x00800001UL, + 0x00000001UL, 0x00002000UL, 0x00800000UL, 0x00802001UL, + 0x00000080UL, 0x00800000UL, 0x00002001UL, 0x00002080UL, + 0x00800081UL, 0x00000001UL, 0x00002080UL, 0x00800080UL, + 0x00002000UL, 0x00802080UL, 0x00802081UL, 0x00000081UL, + 0x00800080UL, 0x00800001UL, 0x00802000UL, 0x00802081UL, + 0x00000081UL, 0x00000000UL, 0x00000000UL, 0x00802000UL, + 0x00002080UL, 0x00800080UL, 0x00800081UL, 0x00000001UL, + 0x00802001UL, 0x00002081UL, 0x00002081UL, 0x00000080UL, + 0x00802081UL, 0x00000081UL, 0x00000001UL, 0x00002000UL, + 0x00800001UL, 0x00002001UL, 0x00802080UL, 0x00800081UL, + 0x00002001UL, 0x00002080UL, 0x00800000UL, 0x00802001UL, + 0x00000080UL, 0x00800000UL, 0x00002000UL, 0x00802080UL +}; + +static const ulong32 SP5[64] = +{ + 0x00000100UL, 0x02080100UL, 0x02080000UL, 0x42000100UL, + 0x00080000UL, 0x00000100UL, 0x40000000UL, 0x02080000UL, + 0x40080100UL, 0x00080000UL, 0x02000100UL, 0x40080100UL, + 0x42000100UL, 0x42080000UL, 0x00080100UL, 0x40000000UL, + 0x02000000UL, 0x40080000UL, 0x40080000UL, 0x00000000UL, + 0x40000100UL, 0x42080100UL, 0x42080100UL, 0x02000100UL, + 0x42080000UL, 0x40000100UL, 0x00000000UL, 0x42000000UL, + 0x02080100UL, 0x02000000UL, 0x42000000UL, 0x00080100UL, + 0x00080000UL, 0x42000100UL, 0x00000100UL, 0x02000000UL, + 0x40000000UL, 0x02080000UL, 0x42000100UL, 0x40080100UL, + 0x02000100UL, 0x40000000UL, 0x42080000UL, 0x02080100UL, + 0x40080100UL, 0x00000100UL, 0x02000000UL, 0x42080000UL, + 0x42080100UL, 0x00080100UL, 0x42000000UL, 0x42080100UL, + 0x02080000UL, 0x00000000UL, 0x40080000UL, 0x42000000UL, + 0x00080100UL, 0x02000100UL, 0x40000100UL, 0x00080000UL, + 0x00000000UL, 0x40080000UL, 0x02080100UL, 0x40000100UL +}; + +static const ulong32 SP6[64] = +{ + 0x20000010UL, 0x20400000UL, 0x00004000UL, 0x20404010UL, + 0x20400000UL, 0x00000010UL, 0x20404010UL, 0x00400000UL, + 0x20004000UL, 0x00404010UL, 0x00400000UL, 0x20000010UL, + 0x00400010UL, 0x20004000UL, 0x20000000UL, 0x00004010UL, + 0x00000000UL, 0x00400010UL, 0x20004010UL, 0x00004000UL, + 0x00404000UL, 0x20004010UL, 0x00000010UL, 0x20400010UL, + 0x20400010UL, 0x00000000UL, 0x00404010UL, 0x20404000UL, + 0x00004010UL, 0x00404000UL, 0x20404000UL, 0x20000000UL, + 0x20004000UL, 0x00000010UL, 0x20400010UL, 0x00404000UL, + 0x20404010UL, 0x00400000UL, 0x00004010UL, 0x20000010UL, + 0x00400000UL, 0x20004000UL, 0x20000000UL, 0x00004010UL, + 0x20000010UL, 0x20404010UL, 0x00404000UL, 0x20400000UL, + 0x00404010UL, 0x20404000UL, 0x00000000UL, 0x20400010UL, + 0x00000010UL, 0x00004000UL, 0x20400000UL, 0x00404010UL, + 0x00004000UL, 0x00400010UL, 0x20004010UL, 0x00000000UL, + 0x20404000UL, 0x20000000UL, 0x00400010UL, 0x20004010UL +}; + +static const ulong32 SP7[64] = +{ + 0x00200000UL, 0x04200002UL, 0x04000802UL, 0x00000000UL, + 0x00000800UL, 0x04000802UL, 0x00200802UL, 0x04200800UL, + 0x04200802UL, 0x00200000UL, 0x00000000UL, 0x04000002UL, + 0x00000002UL, 0x04000000UL, 0x04200002UL, 0x00000802UL, + 0x04000800UL, 0x00200802UL, 0x00200002UL, 0x04000800UL, + 0x04000002UL, 0x04200000UL, 0x04200800UL, 0x00200002UL, + 0x04200000UL, 0x00000800UL, 0x00000802UL, 0x04200802UL, + 0x00200800UL, 0x00000002UL, 0x04000000UL, 0x00200800UL, + 0x04000000UL, 0x00200800UL, 0x00200000UL, 0x04000802UL, + 0x04000802UL, 0x04200002UL, 0x04200002UL, 0x00000002UL, + 0x00200002UL, 0x04000000UL, 0x04000800UL, 0x00200000UL, + 0x04200800UL, 0x00000802UL, 0x00200802UL, 0x04200800UL, + 0x00000802UL, 0x04000002UL, 0x04200802UL, 0x04200000UL, + 0x00200800UL, 0x00000000UL, 0x00000002UL, 0x04200802UL, + 0x00000000UL, 0x00200802UL, 0x04200000UL, 0x00000800UL, + 0x04000002UL, 0x04000800UL, 0x00000800UL, 0x00200002UL +}; + +static const ulong32 SP8[64] = +{ + 0x10001040UL, 0x00001000UL, 0x00040000UL, 0x10041040UL, + 0x10000000UL, 0x10001040UL, 0x00000040UL, 0x10000000UL, + 0x00040040UL, 0x10040000UL, 0x10041040UL, 0x00041000UL, + 0x10041000UL, 0x00041040UL, 0x00001000UL, 0x00000040UL, + 0x10040000UL, 0x10000040UL, 0x10001000UL, 0x00001040UL, + 0x00041000UL, 0x00040040UL, 0x10040040UL, 0x10041000UL, + 0x00001040UL, 0x00000000UL, 0x00000000UL, 0x10040040UL, + 0x10000040UL, 0x10001000UL, 0x00041040UL, 0x00040000UL, + 0x00041040UL, 0x00040000UL, 0x10041000UL, 0x00001000UL, + 0x00000040UL, 0x10040040UL, 0x00001000UL, 0x00041040UL, + 0x10001000UL, 0x00000040UL, 0x10000040UL, 0x10040000UL, + 0x10040040UL, 0x10000000UL, 0x00040000UL, 0x10001040UL, + 0x00000000UL, 0x10041040UL, 0x00040040UL, 0x10000040UL, + 0x10040000UL, 0x10001000UL, 0x10001040UL, 0x00000000UL, + 0x10041040UL, 0x00041000UL, 0x00041000UL, 0x00001040UL, + 0x00001040UL, 0x00040040UL, 0x10000000UL, 0x10041000UL +}; + +#ifndef LTC_SMALL_CODE + +static const ulong64 des_ip[8][256] = { + +{ CONST64(0x0000000000000000), CONST64(0x0000001000000000), CONST64(0x0000000000000010), CONST64(0x0000001000000010), + CONST64(0x0000100000000000), CONST64(0x0000101000000000), CONST64(0x0000100000000010), CONST64(0x0000101000000010), + CONST64(0x0000000000001000), CONST64(0x0000001000001000), CONST64(0x0000000000001010), CONST64(0x0000001000001010), + CONST64(0x0000100000001000), CONST64(0x0000101000001000), CONST64(0x0000100000001010), CONST64(0x0000101000001010), + CONST64(0x0010000000000000), CONST64(0x0010001000000000), CONST64(0x0010000000000010), CONST64(0x0010001000000010), + CONST64(0x0010100000000000), CONST64(0x0010101000000000), CONST64(0x0010100000000010), CONST64(0x0010101000000010), + CONST64(0x0010000000001000), CONST64(0x0010001000001000), CONST64(0x0010000000001010), CONST64(0x0010001000001010), + CONST64(0x0010100000001000), CONST64(0x0010101000001000), CONST64(0x0010100000001010), CONST64(0x0010101000001010), + CONST64(0x0000000000100000), CONST64(0x0000001000100000), CONST64(0x0000000000100010), CONST64(0x0000001000100010), + CONST64(0x0000100000100000), CONST64(0x0000101000100000), CONST64(0x0000100000100010), CONST64(0x0000101000100010), + CONST64(0x0000000000101000), CONST64(0x0000001000101000), CONST64(0x0000000000101010), CONST64(0x0000001000101010), + CONST64(0x0000100000101000), CONST64(0x0000101000101000), CONST64(0x0000100000101010), CONST64(0x0000101000101010), + CONST64(0x0010000000100000), CONST64(0x0010001000100000), CONST64(0x0010000000100010), CONST64(0x0010001000100010), + CONST64(0x0010100000100000), CONST64(0x0010101000100000), CONST64(0x0010100000100010), CONST64(0x0010101000100010), + CONST64(0x0010000000101000), CONST64(0x0010001000101000), CONST64(0x0010000000101010), CONST64(0x0010001000101010), + CONST64(0x0010100000101000), CONST64(0x0010101000101000), CONST64(0x0010100000101010), CONST64(0x0010101000101010), + CONST64(0x1000000000000000), CONST64(0x1000001000000000), CONST64(0x1000000000000010), CONST64(0x1000001000000010), + CONST64(0x1000100000000000), CONST64(0x1000101000000000), CONST64(0x1000100000000010), CONST64(0x1000101000000010), + CONST64(0x1000000000001000), CONST64(0x1000001000001000), CONST64(0x1000000000001010), CONST64(0x1000001000001010), + CONST64(0x1000100000001000), CONST64(0x1000101000001000), CONST64(0x1000100000001010), CONST64(0x1000101000001010), + CONST64(0x1010000000000000), CONST64(0x1010001000000000), CONST64(0x1010000000000010), CONST64(0x1010001000000010), + CONST64(0x1010100000000000), CONST64(0x1010101000000000), CONST64(0x1010100000000010), CONST64(0x1010101000000010), + CONST64(0x1010000000001000), CONST64(0x1010001000001000), CONST64(0x1010000000001010), CONST64(0x1010001000001010), + CONST64(0x1010100000001000), CONST64(0x1010101000001000), CONST64(0x1010100000001010), CONST64(0x1010101000001010), + CONST64(0x1000000000100000), CONST64(0x1000001000100000), CONST64(0x1000000000100010), CONST64(0x1000001000100010), + CONST64(0x1000100000100000), CONST64(0x1000101000100000), CONST64(0x1000100000100010), CONST64(0x1000101000100010), + CONST64(0x1000000000101000), CONST64(0x1000001000101000), CONST64(0x1000000000101010), CONST64(0x1000001000101010), + CONST64(0x1000100000101000), CONST64(0x1000101000101000), CONST64(0x1000100000101010), CONST64(0x1000101000101010), + CONST64(0x1010000000100000), CONST64(0x1010001000100000), CONST64(0x1010000000100010), CONST64(0x1010001000100010), + CONST64(0x1010100000100000), CONST64(0x1010101000100000), CONST64(0x1010100000100010), CONST64(0x1010101000100010), + CONST64(0x1010000000101000), CONST64(0x1010001000101000), CONST64(0x1010000000101010), CONST64(0x1010001000101010), + CONST64(0x1010100000101000), CONST64(0x1010101000101000), CONST64(0x1010100000101010), CONST64(0x1010101000101010), + CONST64(0x0000000010000000), CONST64(0x0000001010000000), CONST64(0x0000000010000010), CONST64(0x0000001010000010), + CONST64(0x0000100010000000), CONST64(0x0000101010000000), CONST64(0x0000100010000010), CONST64(0x0000101010000010), + CONST64(0x0000000010001000), CONST64(0x0000001010001000), CONST64(0x0000000010001010), CONST64(0x0000001010001010), + CONST64(0x0000100010001000), CONST64(0x0000101010001000), CONST64(0x0000100010001010), CONST64(0x0000101010001010), + CONST64(0x0010000010000000), CONST64(0x0010001010000000), CONST64(0x0010000010000010), CONST64(0x0010001010000010), + CONST64(0x0010100010000000), CONST64(0x0010101010000000), CONST64(0x0010100010000010), CONST64(0x0010101010000010), + CONST64(0x0010000010001000), CONST64(0x0010001010001000), CONST64(0x0010000010001010), CONST64(0x0010001010001010), + CONST64(0x0010100010001000), CONST64(0x0010101010001000), CONST64(0x0010100010001010), CONST64(0x0010101010001010), + CONST64(0x0000000010100000), CONST64(0x0000001010100000), CONST64(0x0000000010100010), CONST64(0x0000001010100010), + CONST64(0x0000100010100000), CONST64(0x0000101010100000), CONST64(0x0000100010100010), CONST64(0x0000101010100010), + CONST64(0x0000000010101000), CONST64(0x0000001010101000), CONST64(0x0000000010101010), CONST64(0x0000001010101010), + CONST64(0x0000100010101000), CONST64(0x0000101010101000), CONST64(0x0000100010101010), CONST64(0x0000101010101010), + CONST64(0x0010000010100000), CONST64(0x0010001010100000), CONST64(0x0010000010100010), CONST64(0x0010001010100010), + CONST64(0x0010100010100000), CONST64(0x0010101010100000), CONST64(0x0010100010100010), CONST64(0x0010101010100010), + CONST64(0x0010000010101000), CONST64(0x0010001010101000), CONST64(0x0010000010101010), CONST64(0x0010001010101010), + CONST64(0x0010100010101000), CONST64(0x0010101010101000), CONST64(0x0010100010101010), CONST64(0x0010101010101010), + CONST64(0x1000000010000000), CONST64(0x1000001010000000), CONST64(0x1000000010000010), CONST64(0x1000001010000010), + CONST64(0x1000100010000000), CONST64(0x1000101010000000), CONST64(0x1000100010000010), CONST64(0x1000101010000010), + CONST64(0x1000000010001000), CONST64(0x1000001010001000), CONST64(0x1000000010001010), CONST64(0x1000001010001010), + CONST64(0x1000100010001000), CONST64(0x1000101010001000), CONST64(0x1000100010001010), CONST64(0x1000101010001010), + CONST64(0x1010000010000000), CONST64(0x1010001010000000), CONST64(0x1010000010000010), CONST64(0x1010001010000010), + CONST64(0x1010100010000000), CONST64(0x1010101010000000), CONST64(0x1010100010000010), CONST64(0x1010101010000010), + CONST64(0x1010000010001000), CONST64(0x1010001010001000), CONST64(0x1010000010001010), CONST64(0x1010001010001010), + CONST64(0x1010100010001000), CONST64(0x1010101010001000), CONST64(0x1010100010001010), CONST64(0x1010101010001010), + CONST64(0x1000000010100000), CONST64(0x1000001010100000), CONST64(0x1000000010100010), CONST64(0x1000001010100010), + CONST64(0x1000100010100000), CONST64(0x1000101010100000), CONST64(0x1000100010100010), CONST64(0x1000101010100010), + CONST64(0x1000000010101000), CONST64(0x1000001010101000), CONST64(0x1000000010101010), CONST64(0x1000001010101010), + CONST64(0x1000100010101000), CONST64(0x1000101010101000), CONST64(0x1000100010101010), CONST64(0x1000101010101010), + CONST64(0x1010000010100000), CONST64(0x1010001010100000), CONST64(0x1010000010100010), CONST64(0x1010001010100010), + CONST64(0x1010100010100000), CONST64(0x1010101010100000), CONST64(0x1010100010100010), CONST64(0x1010101010100010), + CONST64(0x1010000010101000), CONST64(0x1010001010101000), CONST64(0x1010000010101010), CONST64(0x1010001010101010), + CONST64(0x1010100010101000), CONST64(0x1010101010101000), CONST64(0x1010100010101010), CONST64(0x1010101010101010) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000800000000), CONST64(0x0000000000000008), CONST64(0x0000000800000008), + CONST64(0x0000080000000000), CONST64(0x0000080800000000), CONST64(0x0000080000000008), CONST64(0x0000080800000008), + CONST64(0x0000000000000800), CONST64(0x0000000800000800), CONST64(0x0000000000000808), CONST64(0x0000000800000808), + CONST64(0x0000080000000800), CONST64(0x0000080800000800), CONST64(0x0000080000000808), CONST64(0x0000080800000808), + CONST64(0x0008000000000000), CONST64(0x0008000800000000), CONST64(0x0008000000000008), CONST64(0x0008000800000008), + CONST64(0x0008080000000000), CONST64(0x0008080800000000), CONST64(0x0008080000000008), CONST64(0x0008080800000008), + CONST64(0x0008000000000800), CONST64(0x0008000800000800), CONST64(0x0008000000000808), CONST64(0x0008000800000808), + CONST64(0x0008080000000800), CONST64(0x0008080800000800), CONST64(0x0008080000000808), CONST64(0x0008080800000808), + CONST64(0x0000000000080000), CONST64(0x0000000800080000), CONST64(0x0000000000080008), CONST64(0x0000000800080008), + CONST64(0x0000080000080000), CONST64(0x0000080800080000), CONST64(0x0000080000080008), CONST64(0x0000080800080008), + CONST64(0x0000000000080800), CONST64(0x0000000800080800), CONST64(0x0000000000080808), CONST64(0x0000000800080808), + CONST64(0x0000080000080800), CONST64(0x0000080800080800), CONST64(0x0000080000080808), CONST64(0x0000080800080808), + CONST64(0x0008000000080000), CONST64(0x0008000800080000), CONST64(0x0008000000080008), CONST64(0x0008000800080008), + CONST64(0x0008080000080000), CONST64(0x0008080800080000), CONST64(0x0008080000080008), CONST64(0x0008080800080008), + CONST64(0x0008000000080800), CONST64(0x0008000800080800), CONST64(0x0008000000080808), CONST64(0x0008000800080808), + CONST64(0x0008080000080800), CONST64(0x0008080800080800), CONST64(0x0008080000080808), CONST64(0x0008080800080808), + CONST64(0x0800000000000000), CONST64(0x0800000800000000), CONST64(0x0800000000000008), CONST64(0x0800000800000008), + CONST64(0x0800080000000000), CONST64(0x0800080800000000), CONST64(0x0800080000000008), CONST64(0x0800080800000008), + CONST64(0x0800000000000800), CONST64(0x0800000800000800), CONST64(0x0800000000000808), CONST64(0x0800000800000808), + CONST64(0x0800080000000800), CONST64(0x0800080800000800), CONST64(0x0800080000000808), CONST64(0x0800080800000808), + CONST64(0x0808000000000000), CONST64(0x0808000800000000), CONST64(0x0808000000000008), CONST64(0x0808000800000008), + CONST64(0x0808080000000000), CONST64(0x0808080800000000), CONST64(0x0808080000000008), CONST64(0x0808080800000008), + CONST64(0x0808000000000800), CONST64(0x0808000800000800), CONST64(0x0808000000000808), CONST64(0x0808000800000808), + CONST64(0x0808080000000800), CONST64(0x0808080800000800), CONST64(0x0808080000000808), CONST64(0x0808080800000808), + CONST64(0x0800000000080000), CONST64(0x0800000800080000), CONST64(0x0800000000080008), CONST64(0x0800000800080008), + CONST64(0x0800080000080000), CONST64(0x0800080800080000), CONST64(0x0800080000080008), CONST64(0x0800080800080008), + CONST64(0x0800000000080800), CONST64(0x0800000800080800), CONST64(0x0800000000080808), CONST64(0x0800000800080808), + CONST64(0x0800080000080800), CONST64(0x0800080800080800), CONST64(0x0800080000080808), CONST64(0x0800080800080808), + CONST64(0x0808000000080000), CONST64(0x0808000800080000), CONST64(0x0808000000080008), CONST64(0x0808000800080008), + CONST64(0x0808080000080000), CONST64(0x0808080800080000), CONST64(0x0808080000080008), CONST64(0x0808080800080008), + CONST64(0x0808000000080800), CONST64(0x0808000800080800), CONST64(0x0808000000080808), CONST64(0x0808000800080808), + CONST64(0x0808080000080800), CONST64(0x0808080800080800), CONST64(0x0808080000080808), CONST64(0x0808080800080808), + CONST64(0x0000000008000000), CONST64(0x0000000808000000), CONST64(0x0000000008000008), CONST64(0x0000000808000008), + CONST64(0x0000080008000000), CONST64(0x0000080808000000), CONST64(0x0000080008000008), CONST64(0x0000080808000008), + CONST64(0x0000000008000800), CONST64(0x0000000808000800), CONST64(0x0000000008000808), CONST64(0x0000000808000808), + CONST64(0x0000080008000800), CONST64(0x0000080808000800), CONST64(0x0000080008000808), CONST64(0x0000080808000808), + CONST64(0x0008000008000000), CONST64(0x0008000808000000), CONST64(0x0008000008000008), CONST64(0x0008000808000008), + CONST64(0x0008080008000000), CONST64(0x0008080808000000), CONST64(0x0008080008000008), CONST64(0x0008080808000008), + CONST64(0x0008000008000800), CONST64(0x0008000808000800), CONST64(0x0008000008000808), CONST64(0x0008000808000808), + CONST64(0x0008080008000800), CONST64(0x0008080808000800), CONST64(0x0008080008000808), CONST64(0x0008080808000808), + CONST64(0x0000000008080000), CONST64(0x0000000808080000), CONST64(0x0000000008080008), CONST64(0x0000000808080008), + CONST64(0x0000080008080000), CONST64(0x0000080808080000), CONST64(0x0000080008080008), CONST64(0x0000080808080008), + CONST64(0x0000000008080800), CONST64(0x0000000808080800), CONST64(0x0000000008080808), CONST64(0x0000000808080808), + CONST64(0x0000080008080800), CONST64(0x0000080808080800), CONST64(0x0000080008080808), CONST64(0x0000080808080808), + CONST64(0x0008000008080000), CONST64(0x0008000808080000), CONST64(0x0008000008080008), CONST64(0x0008000808080008), + CONST64(0x0008080008080000), CONST64(0x0008080808080000), CONST64(0x0008080008080008), CONST64(0x0008080808080008), + CONST64(0x0008000008080800), CONST64(0x0008000808080800), CONST64(0x0008000008080808), CONST64(0x0008000808080808), + CONST64(0x0008080008080800), CONST64(0x0008080808080800), CONST64(0x0008080008080808), CONST64(0x0008080808080808), + CONST64(0x0800000008000000), CONST64(0x0800000808000000), CONST64(0x0800000008000008), CONST64(0x0800000808000008), + CONST64(0x0800080008000000), CONST64(0x0800080808000000), CONST64(0x0800080008000008), CONST64(0x0800080808000008), + CONST64(0x0800000008000800), CONST64(0x0800000808000800), CONST64(0x0800000008000808), CONST64(0x0800000808000808), + CONST64(0x0800080008000800), CONST64(0x0800080808000800), CONST64(0x0800080008000808), CONST64(0x0800080808000808), + CONST64(0x0808000008000000), CONST64(0x0808000808000000), CONST64(0x0808000008000008), CONST64(0x0808000808000008), + CONST64(0x0808080008000000), CONST64(0x0808080808000000), CONST64(0x0808080008000008), CONST64(0x0808080808000008), + CONST64(0x0808000008000800), CONST64(0x0808000808000800), CONST64(0x0808000008000808), CONST64(0x0808000808000808), + CONST64(0x0808080008000800), CONST64(0x0808080808000800), CONST64(0x0808080008000808), CONST64(0x0808080808000808), + CONST64(0x0800000008080000), CONST64(0x0800000808080000), CONST64(0x0800000008080008), CONST64(0x0800000808080008), + CONST64(0x0800080008080000), CONST64(0x0800080808080000), CONST64(0x0800080008080008), CONST64(0x0800080808080008), + CONST64(0x0800000008080800), CONST64(0x0800000808080800), CONST64(0x0800000008080808), CONST64(0x0800000808080808), + CONST64(0x0800080008080800), CONST64(0x0800080808080800), CONST64(0x0800080008080808), CONST64(0x0800080808080808), + CONST64(0x0808000008080000), CONST64(0x0808000808080000), CONST64(0x0808000008080008), CONST64(0x0808000808080008), + CONST64(0x0808080008080000), CONST64(0x0808080808080000), CONST64(0x0808080008080008), CONST64(0x0808080808080008), + CONST64(0x0808000008080800), CONST64(0x0808000808080800), CONST64(0x0808000008080808), CONST64(0x0808000808080808), + CONST64(0x0808080008080800), CONST64(0x0808080808080800), CONST64(0x0808080008080808), CONST64(0x0808080808080808) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000400000000), CONST64(0x0000000000000004), CONST64(0x0000000400000004), + CONST64(0x0000040000000000), CONST64(0x0000040400000000), CONST64(0x0000040000000004), CONST64(0x0000040400000004), + CONST64(0x0000000000000400), CONST64(0x0000000400000400), CONST64(0x0000000000000404), CONST64(0x0000000400000404), + CONST64(0x0000040000000400), CONST64(0x0000040400000400), CONST64(0x0000040000000404), CONST64(0x0000040400000404), + CONST64(0x0004000000000000), CONST64(0x0004000400000000), CONST64(0x0004000000000004), CONST64(0x0004000400000004), + CONST64(0x0004040000000000), CONST64(0x0004040400000000), CONST64(0x0004040000000004), CONST64(0x0004040400000004), + CONST64(0x0004000000000400), CONST64(0x0004000400000400), CONST64(0x0004000000000404), CONST64(0x0004000400000404), + CONST64(0x0004040000000400), CONST64(0x0004040400000400), CONST64(0x0004040000000404), CONST64(0x0004040400000404), + CONST64(0x0000000000040000), CONST64(0x0000000400040000), CONST64(0x0000000000040004), CONST64(0x0000000400040004), + CONST64(0x0000040000040000), CONST64(0x0000040400040000), CONST64(0x0000040000040004), CONST64(0x0000040400040004), + CONST64(0x0000000000040400), CONST64(0x0000000400040400), CONST64(0x0000000000040404), CONST64(0x0000000400040404), + CONST64(0x0000040000040400), CONST64(0x0000040400040400), CONST64(0x0000040000040404), CONST64(0x0000040400040404), + CONST64(0x0004000000040000), CONST64(0x0004000400040000), CONST64(0x0004000000040004), CONST64(0x0004000400040004), + CONST64(0x0004040000040000), CONST64(0x0004040400040000), CONST64(0x0004040000040004), CONST64(0x0004040400040004), + CONST64(0x0004000000040400), CONST64(0x0004000400040400), CONST64(0x0004000000040404), CONST64(0x0004000400040404), + CONST64(0x0004040000040400), CONST64(0x0004040400040400), CONST64(0x0004040000040404), CONST64(0x0004040400040404), + CONST64(0x0400000000000000), CONST64(0x0400000400000000), CONST64(0x0400000000000004), CONST64(0x0400000400000004), + CONST64(0x0400040000000000), CONST64(0x0400040400000000), CONST64(0x0400040000000004), CONST64(0x0400040400000004), + CONST64(0x0400000000000400), CONST64(0x0400000400000400), CONST64(0x0400000000000404), CONST64(0x0400000400000404), + CONST64(0x0400040000000400), CONST64(0x0400040400000400), CONST64(0x0400040000000404), CONST64(0x0400040400000404), + CONST64(0x0404000000000000), CONST64(0x0404000400000000), CONST64(0x0404000000000004), CONST64(0x0404000400000004), + CONST64(0x0404040000000000), CONST64(0x0404040400000000), CONST64(0x0404040000000004), CONST64(0x0404040400000004), + CONST64(0x0404000000000400), CONST64(0x0404000400000400), CONST64(0x0404000000000404), CONST64(0x0404000400000404), + CONST64(0x0404040000000400), CONST64(0x0404040400000400), CONST64(0x0404040000000404), CONST64(0x0404040400000404), + CONST64(0x0400000000040000), CONST64(0x0400000400040000), CONST64(0x0400000000040004), CONST64(0x0400000400040004), + CONST64(0x0400040000040000), CONST64(0x0400040400040000), CONST64(0x0400040000040004), CONST64(0x0400040400040004), + CONST64(0x0400000000040400), CONST64(0x0400000400040400), CONST64(0x0400000000040404), CONST64(0x0400000400040404), + CONST64(0x0400040000040400), CONST64(0x0400040400040400), CONST64(0x0400040000040404), CONST64(0x0400040400040404), + CONST64(0x0404000000040000), CONST64(0x0404000400040000), CONST64(0x0404000000040004), CONST64(0x0404000400040004), + CONST64(0x0404040000040000), CONST64(0x0404040400040000), CONST64(0x0404040000040004), CONST64(0x0404040400040004), + CONST64(0x0404000000040400), CONST64(0x0404000400040400), CONST64(0x0404000000040404), CONST64(0x0404000400040404), + CONST64(0x0404040000040400), CONST64(0x0404040400040400), CONST64(0x0404040000040404), CONST64(0x0404040400040404), + CONST64(0x0000000004000000), CONST64(0x0000000404000000), CONST64(0x0000000004000004), CONST64(0x0000000404000004), + CONST64(0x0000040004000000), CONST64(0x0000040404000000), CONST64(0x0000040004000004), CONST64(0x0000040404000004), + CONST64(0x0000000004000400), CONST64(0x0000000404000400), CONST64(0x0000000004000404), CONST64(0x0000000404000404), + CONST64(0x0000040004000400), CONST64(0x0000040404000400), CONST64(0x0000040004000404), CONST64(0x0000040404000404), + CONST64(0x0004000004000000), CONST64(0x0004000404000000), CONST64(0x0004000004000004), CONST64(0x0004000404000004), + CONST64(0x0004040004000000), CONST64(0x0004040404000000), CONST64(0x0004040004000004), CONST64(0x0004040404000004), + CONST64(0x0004000004000400), CONST64(0x0004000404000400), CONST64(0x0004000004000404), CONST64(0x0004000404000404), + CONST64(0x0004040004000400), CONST64(0x0004040404000400), CONST64(0x0004040004000404), CONST64(0x0004040404000404), + CONST64(0x0000000004040000), CONST64(0x0000000404040000), CONST64(0x0000000004040004), CONST64(0x0000000404040004), + CONST64(0x0000040004040000), CONST64(0x0000040404040000), CONST64(0x0000040004040004), CONST64(0x0000040404040004), + CONST64(0x0000000004040400), CONST64(0x0000000404040400), CONST64(0x0000000004040404), CONST64(0x0000000404040404), + CONST64(0x0000040004040400), CONST64(0x0000040404040400), CONST64(0x0000040004040404), CONST64(0x0000040404040404), + CONST64(0x0004000004040000), CONST64(0x0004000404040000), CONST64(0x0004000004040004), CONST64(0x0004000404040004), + CONST64(0x0004040004040000), CONST64(0x0004040404040000), CONST64(0x0004040004040004), CONST64(0x0004040404040004), + CONST64(0x0004000004040400), CONST64(0x0004000404040400), CONST64(0x0004000004040404), CONST64(0x0004000404040404), + CONST64(0x0004040004040400), CONST64(0x0004040404040400), CONST64(0x0004040004040404), CONST64(0x0004040404040404), + CONST64(0x0400000004000000), CONST64(0x0400000404000000), CONST64(0x0400000004000004), CONST64(0x0400000404000004), + CONST64(0x0400040004000000), CONST64(0x0400040404000000), CONST64(0x0400040004000004), CONST64(0x0400040404000004), + CONST64(0x0400000004000400), CONST64(0x0400000404000400), CONST64(0x0400000004000404), CONST64(0x0400000404000404), + CONST64(0x0400040004000400), CONST64(0x0400040404000400), CONST64(0x0400040004000404), CONST64(0x0400040404000404), + CONST64(0x0404000004000000), CONST64(0x0404000404000000), CONST64(0x0404000004000004), CONST64(0x0404000404000004), + CONST64(0x0404040004000000), CONST64(0x0404040404000000), CONST64(0x0404040004000004), CONST64(0x0404040404000004), + CONST64(0x0404000004000400), CONST64(0x0404000404000400), CONST64(0x0404000004000404), CONST64(0x0404000404000404), + CONST64(0x0404040004000400), CONST64(0x0404040404000400), CONST64(0x0404040004000404), CONST64(0x0404040404000404), + CONST64(0x0400000004040000), CONST64(0x0400000404040000), CONST64(0x0400000004040004), CONST64(0x0400000404040004), + CONST64(0x0400040004040000), CONST64(0x0400040404040000), CONST64(0x0400040004040004), CONST64(0x0400040404040004), + CONST64(0x0400000004040400), CONST64(0x0400000404040400), CONST64(0x0400000004040404), CONST64(0x0400000404040404), + CONST64(0x0400040004040400), CONST64(0x0400040404040400), CONST64(0x0400040004040404), CONST64(0x0400040404040404), + CONST64(0x0404000004040000), CONST64(0x0404000404040000), CONST64(0x0404000004040004), CONST64(0x0404000404040004), + CONST64(0x0404040004040000), CONST64(0x0404040404040000), CONST64(0x0404040004040004), CONST64(0x0404040404040004), + CONST64(0x0404000004040400), CONST64(0x0404000404040400), CONST64(0x0404000004040404), CONST64(0x0404000404040404), + CONST64(0x0404040004040400), CONST64(0x0404040404040400), CONST64(0x0404040004040404), CONST64(0x0404040404040404) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000200000000), CONST64(0x0000000000000002), CONST64(0x0000000200000002), + CONST64(0x0000020000000000), CONST64(0x0000020200000000), CONST64(0x0000020000000002), CONST64(0x0000020200000002), + CONST64(0x0000000000000200), CONST64(0x0000000200000200), CONST64(0x0000000000000202), CONST64(0x0000000200000202), + CONST64(0x0000020000000200), CONST64(0x0000020200000200), CONST64(0x0000020000000202), CONST64(0x0000020200000202), + CONST64(0x0002000000000000), CONST64(0x0002000200000000), CONST64(0x0002000000000002), CONST64(0x0002000200000002), + CONST64(0x0002020000000000), CONST64(0x0002020200000000), CONST64(0x0002020000000002), CONST64(0x0002020200000002), + CONST64(0x0002000000000200), CONST64(0x0002000200000200), CONST64(0x0002000000000202), CONST64(0x0002000200000202), + CONST64(0x0002020000000200), CONST64(0x0002020200000200), CONST64(0x0002020000000202), CONST64(0x0002020200000202), + CONST64(0x0000000000020000), CONST64(0x0000000200020000), CONST64(0x0000000000020002), CONST64(0x0000000200020002), + CONST64(0x0000020000020000), CONST64(0x0000020200020000), CONST64(0x0000020000020002), CONST64(0x0000020200020002), + CONST64(0x0000000000020200), CONST64(0x0000000200020200), CONST64(0x0000000000020202), CONST64(0x0000000200020202), + CONST64(0x0000020000020200), CONST64(0x0000020200020200), CONST64(0x0000020000020202), CONST64(0x0000020200020202), + CONST64(0x0002000000020000), CONST64(0x0002000200020000), CONST64(0x0002000000020002), CONST64(0x0002000200020002), + CONST64(0x0002020000020000), CONST64(0x0002020200020000), CONST64(0x0002020000020002), CONST64(0x0002020200020002), + CONST64(0x0002000000020200), CONST64(0x0002000200020200), CONST64(0x0002000000020202), CONST64(0x0002000200020202), + CONST64(0x0002020000020200), CONST64(0x0002020200020200), CONST64(0x0002020000020202), CONST64(0x0002020200020202), + CONST64(0x0200000000000000), CONST64(0x0200000200000000), CONST64(0x0200000000000002), CONST64(0x0200000200000002), + CONST64(0x0200020000000000), CONST64(0x0200020200000000), CONST64(0x0200020000000002), CONST64(0x0200020200000002), + CONST64(0x0200000000000200), CONST64(0x0200000200000200), CONST64(0x0200000000000202), CONST64(0x0200000200000202), + CONST64(0x0200020000000200), CONST64(0x0200020200000200), CONST64(0x0200020000000202), CONST64(0x0200020200000202), + CONST64(0x0202000000000000), CONST64(0x0202000200000000), CONST64(0x0202000000000002), CONST64(0x0202000200000002), + CONST64(0x0202020000000000), CONST64(0x0202020200000000), CONST64(0x0202020000000002), CONST64(0x0202020200000002), + CONST64(0x0202000000000200), CONST64(0x0202000200000200), CONST64(0x0202000000000202), CONST64(0x0202000200000202), + CONST64(0x0202020000000200), CONST64(0x0202020200000200), CONST64(0x0202020000000202), CONST64(0x0202020200000202), + CONST64(0x0200000000020000), CONST64(0x0200000200020000), CONST64(0x0200000000020002), CONST64(0x0200000200020002), + CONST64(0x0200020000020000), CONST64(0x0200020200020000), CONST64(0x0200020000020002), CONST64(0x0200020200020002), + CONST64(0x0200000000020200), CONST64(0x0200000200020200), CONST64(0x0200000000020202), CONST64(0x0200000200020202), + CONST64(0x0200020000020200), CONST64(0x0200020200020200), CONST64(0x0200020000020202), CONST64(0x0200020200020202), + CONST64(0x0202000000020000), CONST64(0x0202000200020000), CONST64(0x0202000000020002), CONST64(0x0202000200020002), + CONST64(0x0202020000020000), CONST64(0x0202020200020000), CONST64(0x0202020000020002), CONST64(0x0202020200020002), + CONST64(0x0202000000020200), CONST64(0x0202000200020200), CONST64(0x0202000000020202), CONST64(0x0202000200020202), + CONST64(0x0202020000020200), CONST64(0x0202020200020200), CONST64(0x0202020000020202), CONST64(0x0202020200020202), + CONST64(0x0000000002000000), CONST64(0x0000000202000000), CONST64(0x0000000002000002), CONST64(0x0000000202000002), + CONST64(0x0000020002000000), CONST64(0x0000020202000000), CONST64(0x0000020002000002), CONST64(0x0000020202000002), + CONST64(0x0000000002000200), CONST64(0x0000000202000200), CONST64(0x0000000002000202), CONST64(0x0000000202000202), + CONST64(0x0000020002000200), CONST64(0x0000020202000200), CONST64(0x0000020002000202), CONST64(0x0000020202000202), + CONST64(0x0002000002000000), CONST64(0x0002000202000000), CONST64(0x0002000002000002), CONST64(0x0002000202000002), + CONST64(0x0002020002000000), CONST64(0x0002020202000000), CONST64(0x0002020002000002), CONST64(0x0002020202000002), + CONST64(0x0002000002000200), CONST64(0x0002000202000200), CONST64(0x0002000002000202), CONST64(0x0002000202000202), + CONST64(0x0002020002000200), CONST64(0x0002020202000200), CONST64(0x0002020002000202), CONST64(0x0002020202000202), + CONST64(0x0000000002020000), CONST64(0x0000000202020000), CONST64(0x0000000002020002), CONST64(0x0000000202020002), + CONST64(0x0000020002020000), CONST64(0x0000020202020000), CONST64(0x0000020002020002), CONST64(0x0000020202020002), + CONST64(0x0000000002020200), CONST64(0x0000000202020200), CONST64(0x0000000002020202), CONST64(0x0000000202020202), + CONST64(0x0000020002020200), CONST64(0x0000020202020200), CONST64(0x0000020002020202), CONST64(0x0000020202020202), + CONST64(0x0002000002020000), CONST64(0x0002000202020000), CONST64(0x0002000002020002), CONST64(0x0002000202020002), + CONST64(0x0002020002020000), CONST64(0x0002020202020000), CONST64(0x0002020002020002), CONST64(0x0002020202020002), + CONST64(0x0002000002020200), CONST64(0x0002000202020200), CONST64(0x0002000002020202), CONST64(0x0002000202020202), + CONST64(0x0002020002020200), CONST64(0x0002020202020200), CONST64(0x0002020002020202), CONST64(0x0002020202020202), + CONST64(0x0200000002000000), CONST64(0x0200000202000000), CONST64(0x0200000002000002), CONST64(0x0200000202000002), + CONST64(0x0200020002000000), CONST64(0x0200020202000000), CONST64(0x0200020002000002), CONST64(0x0200020202000002), + CONST64(0x0200000002000200), CONST64(0x0200000202000200), CONST64(0x0200000002000202), CONST64(0x0200000202000202), + CONST64(0x0200020002000200), CONST64(0x0200020202000200), CONST64(0x0200020002000202), CONST64(0x0200020202000202), + CONST64(0x0202000002000000), CONST64(0x0202000202000000), CONST64(0x0202000002000002), CONST64(0x0202000202000002), + CONST64(0x0202020002000000), CONST64(0x0202020202000000), CONST64(0x0202020002000002), CONST64(0x0202020202000002), + CONST64(0x0202000002000200), CONST64(0x0202000202000200), CONST64(0x0202000002000202), CONST64(0x0202000202000202), + CONST64(0x0202020002000200), CONST64(0x0202020202000200), CONST64(0x0202020002000202), CONST64(0x0202020202000202), + CONST64(0x0200000002020000), CONST64(0x0200000202020000), CONST64(0x0200000002020002), CONST64(0x0200000202020002), + CONST64(0x0200020002020000), CONST64(0x0200020202020000), CONST64(0x0200020002020002), CONST64(0x0200020202020002), + CONST64(0x0200000002020200), CONST64(0x0200000202020200), CONST64(0x0200000002020202), CONST64(0x0200000202020202), + CONST64(0x0200020002020200), CONST64(0x0200020202020200), CONST64(0x0200020002020202), CONST64(0x0200020202020202), + CONST64(0x0202000002020000), CONST64(0x0202000202020000), CONST64(0x0202000002020002), CONST64(0x0202000202020002), + CONST64(0x0202020002020000), CONST64(0x0202020202020000), CONST64(0x0202020002020002), CONST64(0x0202020202020002), + CONST64(0x0202000002020200), CONST64(0x0202000202020200), CONST64(0x0202000002020202), CONST64(0x0202000202020202), + CONST64(0x0202020002020200), CONST64(0x0202020202020200), CONST64(0x0202020002020202), CONST64(0x0202020202020202) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000010000000000), CONST64(0x0000000000000100), CONST64(0x0000010000000100), + CONST64(0x0001000000000000), CONST64(0x0001010000000000), CONST64(0x0001000000000100), CONST64(0x0001010000000100), + CONST64(0x0000000000010000), CONST64(0x0000010000010000), CONST64(0x0000000000010100), CONST64(0x0000010000010100), + CONST64(0x0001000000010000), CONST64(0x0001010000010000), CONST64(0x0001000000010100), CONST64(0x0001010000010100), + CONST64(0x0100000000000000), CONST64(0x0100010000000000), CONST64(0x0100000000000100), CONST64(0x0100010000000100), + CONST64(0x0101000000000000), CONST64(0x0101010000000000), CONST64(0x0101000000000100), CONST64(0x0101010000000100), + CONST64(0x0100000000010000), CONST64(0x0100010000010000), CONST64(0x0100000000010100), CONST64(0x0100010000010100), + CONST64(0x0101000000010000), CONST64(0x0101010000010000), CONST64(0x0101000000010100), CONST64(0x0101010000010100), + CONST64(0x0000000001000000), CONST64(0x0000010001000000), CONST64(0x0000000001000100), CONST64(0x0000010001000100), + CONST64(0x0001000001000000), CONST64(0x0001010001000000), CONST64(0x0001000001000100), CONST64(0x0001010001000100), + CONST64(0x0000000001010000), CONST64(0x0000010001010000), CONST64(0x0000000001010100), CONST64(0x0000010001010100), + CONST64(0x0001000001010000), CONST64(0x0001010001010000), CONST64(0x0001000001010100), CONST64(0x0001010001010100), + CONST64(0x0100000001000000), CONST64(0x0100010001000000), CONST64(0x0100000001000100), CONST64(0x0100010001000100), + CONST64(0x0101000001000000), CONST64(0x0101010001000000), CONST64(0x0101000001000100), CONST64(0x0101010001000100), + CONST64(0x0100000001010000), CONST64(0x0100010001010000), CONST64(0x0100000001010100), CONST64(0x0100010001010100), + CONST64(0x0101000001010000), CONST64(0x0101010001010000), CONST64(0x0101000001010100), CONST64(0x0101010001010100), + CONST64(0x0000000100000000), CONST64(0x0000010100000000), CONST64(0x0000000100000100), CONST64(0x0000010100000100), + CONST64(0x0001000100000000), CONST64(0x0001010100000000), CONST64(0x0001000100000100), CONST64(0x0001010100000100), + CONST64(0x0000000100010000), CONST64(0x0000010100010000), CONST64(0x0000000100010100), CONST64(0x0000010100010100), + CONST64(0x0001000100010000), CONST64(0x0001010100010000), CONST64(0x0001000100010100), CONST64(0x0001010100010100), + CONST64(0x0100000100000000), CONST64(0x0100010100000000), CONST64(0x0100000100000100), CONST64(0x0100010100000100), + CONST64(0x0101000100000000), CONST64(0x0101010100000000), CONST64(0x0101000100000100), CONST64(0x0101010100000100), + CONST64(0x0100000100010000), CONST64(0x0100010100010000), CONST64(0x0100000100010100), CONST64(0x0100010100010100), + CONST64(0x0101000100010000), CONST64(0x0101010100010000), CONST64(0x0101000100010100), CONST64(0x0101010100010100), + CONST64(0x0000000101000000), CONST64(0x0000010101000000), CONST64(0x0000000101000100), CONST64(0x0000010101000100), + CONST64(0x0001000101000000), CONST64(0x0001010101000000), CONST64(0x0001000101000100), CONST64(0x0001010101000100), + CONST64(0x0000000101010000), CONST64(0x0000010101010000), CONST64(0x0000000101010100), CONST64(0x0000010101010100), + CONST64(0x0001000101010000), CONST64(0x0001010101010000), CONST64(0x0001000101010100), CONST64(0x0001010101010100), + CONST64(0x0100000101000000), CONST64(0x0100010101000000), CONST64(0x0100000101000100), CONST64(0x0100010101000100), + CONST64(0x0101000101000000), CONST64(0x0101010101000000), CONST64(0x0101000101000100), CONST64(0x0101010101000100), + CONST64(0x0100000101010000), CONST64(0x0100010101010000), CONST64(0x0100000101010100), CONST64(0x0100010101010100), + CONST64(0x0101000101010000), CONST64(0x0101010101010000), CONST64(0x0101000101010100), CONST64(0x0101010101010100), + CONST64(0x0000000000000001), CONST64(0x0000010000000001), CONST64(0x0000000000000101), CONST64(0x0000010000000101), + CONST64(0x0001000000000001), CONST64(0x0001010000000001), CONST64(0x0001000000000101), CONST64(0x0001010000000101), + CONST64(0x0000000000010001), CONST64(0x0000010000010001), CONST64(0x0000000000010101), CONST64(0x0000010000010101), + CONST64(0x0001000000010001), CONST64(0x0001010000010001), CONST64(0x0001000000010101), CONST64(0x0001010000010101), + CONST64(0x0100000000000001), CONST64(0x0100010000000001), CONST64(0x0100000000000101), CONST64(0x0100010000000101), + CONST64(0x0101000000000001), CONST64(0x0101010000000001), CONST64(0x0101000000000101), CONST64(0x0101010000000101), + CONST64(0x0100000000010001), CONST64(0x0100010000010001), CONST64(0x0100000000010101), CONST64(0x0100010000010101), + CONST64(0x0101000000010001), CONST64(0x0101010000010001), CONST64(0x0101000000010101), CONST64(0x0101010000010101), + CONST64(0x0000000001000001), CONST64(0x0000010001000001), CONST64(0x0000000001000101), CONST64(0x0000010001000101), + CONST64(0x0001000001000001), CONST64(0x0001010001000001), CONST64(0x0001000001000101), CONST64(0x0001010001000101), + CONST64(0x0000000001010001), CONST64(0x0000010001010001), CONST64(0x0000000001010101), CONST64(0x0000010001010101), + CONST64(0x0001000001010001), CONST64(0x0001010001010001), CONST64(0x0001000001010101), CONST64(0x0001010001010101), + CONST64(0x0100000001000001), CONST64(0x0100010001000001), CONST64(0x0100000001000101), CONST64(0x0100010001000101), + CONST64(0x0101000001000001), CONST64(0x0101010001000001), CONST64(0x0101000001000101), CONST64(0x0101010001000101), + CONST64(0x0100000001010001), CONST64(0x0100010001010001), CONST64(0x0100000001010101), CONST64(0x0100010001010101), + CONST64(0x0101000001010001), CONST64(0x0101010001010001), CONST64(0x0101000001010101), CONST64(0x0101010001010101), + CONST64(0x0000000100000001), CONST64(0x0000010100000001), CONST64(0x0000000100000101), CONST64(0x0000010100000101), + CONST64(0x0001000100000001), CONST64(0x0001010100000001), CONST64(0x0001000100000101), CONST64(0x0001010100000101), + CONST64(0x0000000100010001), CONST64(0x0000010100010001), CONST64(0x0000000100010101), CONST64(0x0000010100010101), + CONST64(0x0001000100010001), CONST64(0x0001010100010001), CONST64(0x0001000100010101), CONST64(0x0001010100010101), + CONST64(0x0100000100000001), CONST64(0x0100010100000001), CONST64(0x0100000100000101), CONST64(0x0100010100000101), + CONST64(0x0101000100000001), CONST64(0x0101010100000001), CONST64(0x0101000100000101), CONST64(0x0101010100000101), + CONST64(0x0100000100010001), CONST64(0x0100010100010001), CONST64(0x0100000100010101), CONST64(0x0100010100010101), + CONST64(0x0101000100010001), CONST64(0x0101010100010001), CONST64(0x0101000100010101), CONST64(0x0101010100010101), + CONST64(0x0000000101000001), CONST64(0x0000010101000001), CONST64(0x0000000101000101), CONST64(0x0000010101000101), + CONST64(0x0001000101000001), CONST64(0x0001010101000001), CONST64(0x0001000101000101), CONST64(0x0001010101000101), + CONST64(0x0000000101010001), CONST64(0x0000010101010001), CONST64(0x0000000101010101), CONST64(0x0000010101010101), + CONST64(0x0001000101010001), CONST64(0x0001010101010001), CONST64(0x0001000101010101), CONST64(0x0001010101010101), + CONST64(0x0100000101000001), CONST64(0x0100010101000001), CONST64(0x0100000101000101), CONST64(0x0100010101000101), + CONST64(0x0101000101000001), CONST64(0x0101010101000001), CONST64(0x0101000101000101), CONST64(0x0101010101000101), + CONST64(0x0100000101010001), CONST64(0x0100010101010001), CONST64(0x0100000101010101), CONST64(0x0100010101010101), + CONST64(0x0101000101010001), CONST64(0x0101010101010001), CONST64(0x0101000101010101), CONST64(0x0101010101010101) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000008000000000), CONST64(0x0000000000000080), CONST64(0x0000008000000080), + CONST64(0x0000800000000000), CONST64(0x0000808000000000), CONST64(0x0000800000000080), CONST64(0x0000808000000080), + CONST64(0x0000000000008000), CONST64(0x0000008000008000), CONST64(0x0000000000008080), CONST64(0x0000008000008080), + CONST64(0x0000800000008000), CONST64(0x0000808000008000), CONST64(0x0000800000008080), CONST64(0x0000808000008080), + CONST64(0x0080000000000000), CONST64(0x0080008000000000), CONST64(0x0080000000000080), CONST64(0x0080008000000080), + CONST64(0x0080800000000000), CONST64(0x0080808000000000), CONST64(0x0080800000000080), CONST64(0x0080808000000080), + CONST64(0x0080000000008000), CONST64(0x0080008000008000), CONST64(0x0080000000008080), CONST64(0x0080008000008080), + CONST64(0x0080800000008000), CONST64(0x0080808000008000), CONST64(0x0080800000008080), CONST64(0x0080808000008080), + CONST64(0x0000000000800000), CONST64(0x0000008000800000), CONST64(0x0000000000800080), CONST64(0x0000008000800080), + CONST64(0x0000800000800000), CONST64(0x0000808000800000), CONST64(0x0000800000800080), CONST64(0x0000808000800080), + CONST64(0x0000000000808000), CONST64(0x0000008000808000), CONST64(0x0000000000808080), CONST64(0x0000008000808080), + CONST64(0x0000800000808000), CONST64(0x0000808000808000), CONST64(0x0000800000808080), CONST64(0x0000808000808080), + CONST64(0x0080000000800000), CONST64(0x0080008000800000), CONST64(0x0080000000800080), CONST64(0x0080008000800080), + CONST64(0x0080800000800000), CONST64(0x0080808000800000), CONST64(0x0080800000800080), CONST64(0x0080808000800080), + CONST64(0x0080000000808000), CONST64(0x0080008000808000), CONST64(0x0080000000808080), CONST64(0x0080008000808080), + CONST64(0x0080800000808000), CONST64(0x0080808000808000), CONST64(0x0080800000808080), CONST64(0x0080808000808080), + CONST64(0x8000000000000000), CONST64(0x8000008000000000), CONST64(0x8000000000000080), CONST64(0x8000008000000080), + CONST64(0x8000800000000000), CONST64(0x8000808000000000), CONST64(0x8000800000000080), CONST64(0x8000808000000080), + CONST64(0x8000000000008000), CONST64(0x8000008000008000), CONST64(0x8000000000008080), CONST64(0x8000008000008080), + CONST64(0x8000800000008000), CONST64(0x8000808000008000), CONST64(0x8000800000008080), CONST64(0x8000808000008080), + CONST64(0x8080000000000000), CONST64(0x8080008000000000), CONST64(0x8080000000000080), CONST64(0x8080008000000080), + CONST64(0x8080800000000000), CONST64(0x8080808000000000), CONST64(0x8080800000000080), CONST64(0x8080808000000080), + CONST64(0x8080000000008000), CONST64(0x8080008000008000), CONST64(0x8080000000008080), CONST64(0x8080008000008080), + CONST64(0x8080800000008000), CONST64(0x8080808000008000), CONST64(0x8080800000008080), CONST64(0x8080808000008080), + CONST64(0x8000000000800000), CONST64(0x8000008000800000), CONST64(0x8000000000800080), CONST64(0x8000008000800080), + CONST64(0x8000800000800000), CONST64(0x8000808000800000), CONST64(0x8000800000800080), CONST64(0x8000808000800080), + CONST64(0x8000000000808000), CONST64(0x8000008000808000), CONST64(0x8000000000808080), CONST64(0x8000008000808080), + CONST64(0x8000800000808000), CONST64(0x8000808000808000), CONST64(0x8000800000808080), CONST64(0x8000808000808080), + CONST64(0x8080000000800000), CONST64(0x8080008000800000), CONST64(0x8080000000800080), CONST64(0x8080008000800080), + CONST64(0x8080800000800000), CONST64(0x8080808000800000), CONST64(0x8080800000800080), CONST64(0x8080808000800080), + CONST64(0x8080000000808000), CONST64(0x8080008000808000), CONST64(0x8080000000808080), CONST64(0x8080008000808080), + CONST64(0x8080800000808000), CONST64(0x8080808000808000), CONST64(0x8080800000808080), CONST64(0x8080808000808080), + CONST64(0x0000000080000000), CONST64(0x0000008080000000), CONST64(0x0000000080000080), CONST64(0x0000008080000080), + CONST64(0x0000800080000000), CONST64(0x0000808080000000), CONST64(0x0000800080000080), CONST64(0x0000808080000080), + CONST64(0x0000000080008000), CONST64(0x0000008080008000), CONST64(0x0000000080008080), CONST64(0x0000008080008080), + CONST64(0x0000800080008000), CONST64(0x0000808080008000), CONST64(0x0000800080008080), CONST64(0x0000808080008080), + CONST64(0x0080000080000000), CONST64(0x0080008080000000), CONST64(0x0080000080000080), CONST64(0x0080008080000080), + CONST64(0x0080800080000000), CONST64(0x0080808080000000), CONST64(0x0080800080000080), CONST64(0x0080808080000080), + CONST64(0x0080000080008000), CONST64(0x0080008080008000), CONST64(0x0080000080008080), CONST64(0x0080008080008080), + CONST64(0x0080800080008000), CONST64(0x0080808080008000), CONST64(0x0080800080008080), CONST64(0x0080808080008080), + CONST64(0x0000000080800000), CONST64(0x0000008080800000), CONST64(0x0000000080800080), CONST64(0x0000008080800080), + CONST64(0x0000800080800000), CONST64(0x0000808080800000), CONST64(0x0000800080800080), CONST64(0x0000808080800080), + CONST64(0x0000000080808000), CONST64(0x0000008080808000), CONST64(0x0000000080808080), CONST64(0x0000008080808080), + CONST64(0x0000800080808000), CONST64(0x0000808080808000), CONST64(0x0000800080808080), CONST64(0x0000808080808080), + CONST64(0x0080000080800000), CONST64(0x0080008080800000), CONST64(0x0080000080800080), CONST64(0x0080008080800080), + CONST64(0x0080800080800000), CONST64(0x0080808080800000), CONST64(0x0080800080800080), CONST64(0x0080808080800080), + CONST64(0x0080000080808000), CONST64(0x0080008080808000), CONST64(0x0080000080808080), CONST64(0x0080008080808080), + CONST64(0x0080800080808000), CONST64(0x0080808080808000), CONST64(0x0080800080808080), CONST64(0x0080808080808080), + CONST64(0x8000000080000000), CONST64(0x8000008080000000), CONST64(0x8000000080000080), CONST64(0x8000008080000080), + CONST64(0x8000800080000000), CONST64(0x8000808080000000), CONST64(0x8000800080000080), CONST64(0x8000808080000080), + CONST64(0x8000000080008000), CONST64(0x8000008080008000), CONST64(0x8000000080008080), CONST64(0x8000008080008080), + CONST64(0x8000800080008000), CONST64(0x8000808080008000), CONST64(0x8000800080008080), CONST64(0x8000808080008080), + CONST64(0x8080000080000000), CONST64(0x8080008080000000), CONST64(0x8080000080000080), CONST64(0x8080008080000080), + CONST64(0x8080800080000000), CONST64(0x8080808080000000), CONST64(0x8080800080000080), CONST64(0x8080808080000080), + CONST64(0x8080000080008000), CONST64(0x8080008080008000), CONST64(0x8080000080008080), CONST64(0x8080008080008080), + CONST64(0x8080800080008000), CONST64(0x8080808080008000), CONST64(0x8080800080008080), CONST64(0x8080808080008080), + CONST64(0x8000000080800000), CONST64(0x8000008080800000), CONST64(0x8000000080800080), CONST64(0x8000008080800080), + CONST64(0x8000800080800000), CONST64(0x8000808080800000), CONST64(0x8000800080800080), CONST64(0x8000808080800080), + CONST64(0x8000000080808000), CONST64(0x8000008080808000), CONST64(0x8000000080808080), CONST64(0x8000008080808080), + CONST64(0x8000800080808000), CONST64(0x8000808080808000), CONST64(0x8000800080808080), CONST64(0x8000808080808080), + CONST64(0x8080000080800000), CONST64(0x8080008080800000), CONST64(0x8080000080800080), CONST64(0x8080008080800080), + CONST64(0x8080800080800000), CONST64(0x8080808080800000), CONST64(0x8080800080800080), CONST64(0x8080808080800080), + CONST64(0x8080000080808000), CONST64(0x8080008080808000), CONST64(0x8080000080808080), CONST64(0x8080008080808080), + CONST64(0x8080800080808000), CONST64(0x8080808080808000), CONST64(0x8080800080808080), CONST64(0x8080808080808080) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000004000000000), CONST64(0x0000000000000040), CONST64(0x0000004000000040), + CONST64(0x0000400000000000), CONST64(0x0000404000000000), CONST64(0x0000400000000040), CONST64(0x0000404000000040), + CONST64(0x0000000000004000), CONST64(0x0000004000004000), CONST64(0x0000000000004040), CONST64(0x0000004000004040), + CONST64(0x0000400000004000), CONST64(0x0000404000004000), CONST64(0x0000400000004040), CONST64(0x0000404000004040), + CONST64(0x0040000000000000), CONST64(0x0040004000000000), CONST64(0x0040000000000040), CONST64(0x0040004000000040), + CONST64(0x0040400000000000), CONST64(0x0040404000000000), CONST64(0x0040400000000040), CONST64(0x0040404000000040), + CONST64(0x0040000000004000), CONST64(0x0040004000004000), CONST64(0x0040000000004040), CONST64(0x0040004000004040), + CONST64(0x0040400000004000), CONST64(0x0040404000004000), CONST64(0x0040400000004040), CONST64(0x0040404000004040), + CONST64(0x0000000000400000), CONST64(0x0000004000400000), CONST64(0x0000000000400040), CONST64(0x0000004000400040), + CONST64(0x0000400000400000), CONST64(0x0000404000400000), CONST64(0x0000400000400040), CONST64(0x0000404000400040), + CONST64(0x0000000000404000), CONST64(0x0000004000404000), CONST64(0x0000000000404040), CONST64(0x0000004000404040), + CONST64(0x0000400000404000), CONST64(0x0000404000404000), CONST64(0x0000400000404040), CONST64(0x0000404000404040), + CONST64(0x0040000000400000), CONST64(0x0040004000400000), CONST64(0x0040000000400040), CONST64(0x0040004000400040), + CONST64(0x0040400000400000), CONST64(0x0040404000400000), CONST64(0x0040400000400040), CONST64(0x0040404000400040), + CONST64(0x0040000000404000), CONST64(0x0040004000404000), CONST64(0x0040000000404040), CONST64(0x0040004000404040), + CONST64(0x0040400000404000), CONST64(0x0040404000404000), CONST64(0x0040400000404040), CONST64(0x0040404000404040), + CONST64(0x4000000000000000), CONST64(0x4000004000000000), CONST64(0x4000000000000040), CONST64(0x4000004000000040), + CONST64(0x4000400000000000), CONST64(0x4000404000000000), CONST64(0x4000400000000040), CONST64(0x4000404000000040), + CONST64(0x4000000000004000), CONST64(0x4000004000004000), CONST64(0x4000000000004040), CONST64(0x4000004000004040), + CONST64(0x4000400000004000), CONST64(0x4000404000004000), CONST64(0x4000400000004040), CONST64(0x4000404000004040), + CONST64(0x4040000000000000), CONST64(0x4040004000000000), CONST64(0x4040000000000040), CONST64(0x4040004000000040), + CONST64(0x4040400000000000), CONST64(0x4040404000000000), CONST64(0x4040400000000040), CONST64(0x4040404000000040), + CONST64(0x4040000000004000), CONST64(0x4040004000004000), CONST64(0x4040000000004040), CONST64(0x4040004000004040), + CONST64(0x4040400000004000), CONST64(0x4040404000004000), CONST64(0x4040400000004040), CONST64(0x4040404000004040), + CONST64(0x4000000000400000), CONST64(0x4000004000400000), CONST64(0x4000000000400040), CONST64(0x4000004000400040), + CONST64(0x4000400000400000), CONST64(0x4000404000400000), CONST64(0x4000400000400040), CONST64(0x4000404000400040), + CONST64(0x4000000000404000), CONST64(0x4000004000404000), CONST64(0x4000000000404040), CONST64(0x4000004000404040), + CONST64(0x4000400000404000), CONST64(0x4000404000404000), CONST64(0x4000400000404040), CONST64(0x4000404000404040), + CONST64(0x4040000000400000), CONST64(0x4040004000400000), CONST64(0x4040000000400040), CONST64(0x4040004000400040), + CONST64(0x4040400000400000), CONST64(0x4040404000400000), CONST64(0x4040400000400040), CONST64(0x4040404000400040), + CONST64(0x4040000000404000), CONST64(0x4040004000404000), CONST64(0x4040000000404040), CONST64(0x4040004000404040), + CONST64(0x4040400000404000), CONST64(0x4040404000404000), CONST64(0x4040400000404040), CONST64(0x4040404000404040), + CONST64(0x0000000040000000), CONST64(0x0000004040000000), CONST64(0x0000000040000040), CONST64(0x0000004040000040), + CONST64(0x0000400040000000), CONST64(0x0000404040000000), CONST64(0x0000400040000040), CONST64(0x0000404040000040), + CONST64(0x0000000040004000), CONST64(0x0000004040004000), CONST64(0x0000000040004040), CONST64(0x0000004040004040), + CONST64(0x0000400040004000), CONST64(0x0000404040004000), CONST64(0x0000400040004040), CONST64(0x0000404040004040), + CONST64(0x0040000040000000), CONST64(0x0040004040000000), CONST64(0x0040000040000040), CONST64(0x0040004040000040), + CONST64(0x0040400040000000), CONST64(0x0040404040000000), CONST64(0x0040400040000040), CONST64(0x0040404040000040), + CONST64(0x0040000040004000), CONST64(0x0040004040004000), CONST64(0x0040000040004040), CONST64(0x0040004040004040), + CONST64(0x0040400040004000), CONST64(0x0040404040004000), CONST64(0x0040400040004040), CONST64(0x0040404040004040), + CONST64(0x0000000040400000), CONST64(0x0000004040400000), CONST64(0x0000000040400040), CONST64(0x0000004040400040), + CONST64(0x0000400040400000), CONST64(0x0000404040400000), CONST64(0x0000400040400040), CONST64(0x0000404040400040), + CONST64(0x0000000040404000), CONST64(0x0000004040404000), CONST64(0x0000000040404040), CONST64(0x0000004040404040), + CONST64(0x0000400040404000), CONST64(0x0000404040404000), CONST64(0x0000400040404040), CONST64(0x0000404040404040), + CONST64(0x0040000040400000), CONST64(0x0040004040400000), CONST64(0x0040000040400040), CONST64(0x0040004040400040), + CONST64(0x0040400040400000), CONST64(0x0040404040400000), CONST64(0x0040400040400040), CONST64(0x0040404040400040), + CONST64(0x0040000040404000), CONST64(0x0040004040404000), CONST64(0x0040000040404040), CONST64(0x0040004040404040), + CONST64(0x0040400040404000), CONST64(0x0040404040404000), CONST64(0x0040400040404040), CONST64(0x0040404040404040), + CONST64(0x4000000040000000), CONST64(0x4000004040000000), CONST64(0x4000000040000040), CONST64(0x4000004040000040), + CONST64(0x4000400040000000), CONST64(0x4000404040000000), CONST64(0x4000400040000040), CONST64(0x4000404040000040), + CONST64(0x4000000040004000), CONST64(0x4000004040004000), CONST64(0x4000000040004040), CONST64(0x4000004040004040), + CONST64(0x4000400040004000), CONST64(0x4000404040004000), CONST64(0x4000400040004040), CONST64(0x4000404040004040), + CONST64(0x4040000040000000), CONST64(0x4040004040000000), CONST64(0x4040000040000040), CONST64(0x4040004040000040), + CONST64(0x4040400040000000), CONST64(0x4040404040000000), CONST64(0x4040400040000040), CONST64(0x4040404040000040), + CONST64(0x4040000040004000), CONST64(0x4040004040004000), CONST64(0x4040000040004040), CONST64(0x4040004040004040), + CONST64(0x4040400040004000), CONST64(0x4040404040004000), CONST64(0x4040400040004040), CONST64(0x4040404040004040), + CONST64(0x4000000040400000), CONST64(0x4000004040400000), CONST64(0x4000000040400040), CONST64(0x4000004040400040), + CONST64(0x4000400040400000), CONST64(0x4000404040400000), CONST64(0x4000400040400040), CONST64(0x4000404040400040), + CONST64(0x4000000040404000), CONST64(0x4000004040404000), CONST64(0x4000000040404040), CONST64(0x4000004040404040), + CONST64(0x4000400040404000), CONST64(0x4000404040404000), CONST64(0x4000400040404040), CONST64(0x4000404040404040), + CONST64(0x4040000040400000), CONST64(0x4040004040400000), CONST64(0x4040000040400040), CONST64(0x4040004040400040), + CONST64(0x4040400040400000), CONST64(0x4040404040400000), CONST64(0x4040400040400040), CONST64(0x4040404040400040), + CONST64(0x4040000040404000), CONST64(0x4040004040404000), CONST64(0x4040000040404040), CONST64(0x4040004040404040), + CONST64(0x4040400040404000), CONST64(0x4040404040404000), CONST64(0x4040400040404040), CONST64(0x4040404040404040) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000002000000000), CONST64(0x0000000000000020), CONST64(0x0000002000000020), + CONST64(0x0000200000000000), CONST64(0x0000202000000000), CONST64(0x0000200000000020), CONST64(0x0000202000000020), + CONST64(0x0000000000002000), CONST64(0x0000002000002000), CONST64(0x0000000000002020), CONST64(0x0000002000002020), + CONST64(0x0000200000002000), CONST64(0x0000202000002000), CONST64(0x0000200000002020), CONST64(0x0000202000002020), + CONST64(0x0020000000000000), CONST64(0x0020002000000000), CONST64(0x0020000000000020), CONST64(0x0020002000000020), + CONST64(0x0020200000000000), CONST64(0x0020202000000000), CONST64(0x0020200000000020), CONST64(0x0020202000000020), + CONST64(0x0020000000002000), CONST64(0x0020002000002000), CONST64(0x0020000000002020), CONST64(0x0020002000002020), + CONST64(0x0020200000002000), CONST64(0x0020202000002000), CONST64(0x0020200000002020), CONST64(0x0020202000002020), + CONST64(0x0000000000200000), CONST64(0x0000002000200000), CONST64(0x0000000000200020), CONST64(0x0000002000200020), + CONST64(0x0000200000200000), CONST64(0x0000202000200000), CONST64(0x0000200000200020), CONST64(0x0000202000200020), + CONST64(0x0000000000202000), CONST64(0x0000002000202000), CONST64(0x0000000000202020), CONST64(0x0000002000202020), + CONST64(0x0000200000202000), CONST64(0x0000202000202000), CONST64(0x0000200000202020), CONST64(0x0000202000202020), + CONST64(0x0020000000200000), CONST64(0x0020002000200000), CONST64(0x0020000000200020), CONST64(0x0020002000200020), + CONST64(0x0020200000200000), CONST64(0x0020202000200000), CONST64(0x0020200000200020), CONST64(0x0020202000200020), + CONST64(0x0020000000202000), CONST64(0x0020002000202000), CONST64(0x0020000000202020), CONST64(0x0020002000202020), + CONST64(0x0020200000202000), CONST64(0x0020202000202000), CONST64(0x0020200000202020), CONST64(0x0020202000202020), + CONST64(0x2000000000000000), CONST64(0x2000002000000000), CONST64(0x2000000000000020), CONST64(0x2000002000000020), + CONST64(0x2000200000000000), CONST64(0x2000202000000000), CONST64(0x2000200000000020), CONST64(0x2000202000000020), + CONST64(0x2000000000002000), CONST64(0x2000002000002000), CONST64(0x2000000000002020), CONST64(0x2000002000002020), + CONST64(0x2000200000002000), CONST64(0x2000202000002000), CONST64(0x2000200000002020), CONST64(0x2000202000002020), + CONST64(0x2020000000000000), CONST64(0x2020002000000000), CONST64(0x2020000000000020), CONST64(0x2020002000000020), + CONST64(0x2020200000000000), CONST64(0x2020202000000000), CONST64(0x2020200000000020), CONST64(0x2020202000000020), + CONST64(0x2020000000002000), CONST64(0x2020002000002000), CONST64(0x2020000000002020), CONST64(0x2020002000002020), + CONST64(0x2020200000002000), CONST64(0x2020202000002000), CONST64(0x2020200000002020), CONST64(0x2020202000002020), + CONST64(0x2000000000200000), CONST64(0x2000002000200000), CONST64(0x2000000000200020), CONST64(0x2000002000200020), + CONST64(0x2000200000200000), CONST64(0x2000202000200000), CONST64(0x2000200000200020), CONST64(0x2000202000200020), + CONST64(0x2000000000202000), CONST64(0x2000002000202000), CONST64(0x2000000000202020), CONST64(0x2000002000202020), + CONST64(0x2000200000202000), CONST64(0x2000202000202000), CONST64(0x2000200000202020), CONST64(0x2000202000202020), + CONST64(0x2020000000200000), CONST64(0x2020002000200000), CONST64(0x2020000000200020), CONST64(0x2020002000200020), + CONST64(0x2020200000200000), CONST64(0x2020202000200000), CONST64(0x2020200000200020), CONST64(0x2020202000200020), + CONST64(0x2020000000202000), CONST64(0x2020002000202000), CONST64(0x2020000000202020), CONST64(0x2020002000202020), + CONST64(0x2020200000202000), CONST64(0x2020202000202000), CONST64(0x2020200000202020), CONST64(0x2020202000202020), + CONST64(0x0000000020000000), CONST64(0x0000002020000000), CONST64(0x0000000020000020), CONST64(0x0000002020000020), + CONST64(0x0000200020000000), CONST64(0x0000202020000000), CONST64(0x0000200020000020), CONST64(0x0000202020000020), + CONST64(0x0000000020002000), CONST64(0x0000002020002000), CONST64(0x0000000020002020), CONST64(0x0000002020002020), + CONST64(0x0000200020002000), CONST64(0x0000202020002000), CONST64(0x0000200020002020), CONST64(0x0000202020002020), + CONST64(0x0020000020000000), CONST64(0x0020002020000000), CONST64(0x0020000020000020), CONST64(0x0020002020000020), + CONST64(0x0020200020000000), CONST64(0x0020202020000000), CONST64(0x0020200020000020), CONST64(0x0020202020000020), + CONST64(0x0020000020002000), CONST64(0x0020002020002000), CONST64(0x0020000020002020), CONST64(0x0020002020002020), + CONST64(0x0020200020002000), CONST64(0x0020202020002000), CONST64(0x0020200020002020), CONST64(0x0020202020002020), + CONST64(0x0000000020200000), CONST64(0x0000002020200000), CONST64(0x0000000020200020), CONST64(0x0000002020200020), + CONST64(0x0000200020200000), CONST64(0x0000202020200000), CONST64(0x0000200020200020), CONST64(0x0000202020200020), + CONST64(0x0000000020202000), CONST64(0x0000002020202000), CONST64(0x0000000020202020), CONST64(0x0000002020202020), + CONST64(0x0000200020202000), CONST64(0x0000202020202000), CONST64(0x0000200020202020), CONST64(0x0000202020202020), + CONST64(0x0020000020200000), CONST64(0x0020002020200000), CONST64(0x0020000020200020), CONST64(0x0020002020200020), + CONST64(0x0020200020200000), CONST64(0x0020202020200000), CONST64(0x0020200020200020), CONST64(0x0020202020200020), + CONST64(0x0020000020202000), CONST64(0x0020002020202000), CONST64(0x0020000020202020), CONST64(0x0020002020202020), + CONST64(0x0020200020202000), CONST64(0x0020202020202000), CONST64(0x0020200020202020), CONST64(0x0020202020202020), + CONST64(0x2000000020000000), CONST64(0x2000002020000000), CONST64(0x2000000020000020), CONST64(0x2000002020000020), + CONST64(0x2000200020000000), CONST64(0x2000202020000000), CONST64(0x2000200020000020), CONST64(0x2000202020000020), + CONST64(0x2000000020002000), CONST64(0x2000002020002000), CONST64(0x2000000020002020), CONST64(0x2000002020002020), + CONST64(0x2000200020002000), CONST64(0x2000202020002000), CONST64(0x2000200020002020), CONST64(0x2000202020002020), + CONST64(0x2020000020000000), CONST64(0x2020002020000000), CONST64(0x2020000020000020), CONST64(0x2020002020000020), + CONST64(0x2020200020000000), CONST64(0x2020202020000000), CONST64(0x2020200020000020), CONST64(0x2020202020000020), + CONST64(0x2020000020002000), CONST64(0x2020002020002000), CONST64(0x2020000020002020), CONST64(0x2020002020002020), + CONST64(0x2020200020002000), CONST64(0x2020202020002000), CONST64(0x2020200020002020), CONST64(0x2020202020002020), + CONST64(0x2000000020200000), CONST64(0x2000002020200000), CONST64(0x2000000020200020), CONST64(0x2000002020200020), + CONST64(0x2000200020200000), CONST64(0x2000202020200000), CONST64(0x2000200020200020), CONST64(0x2000202020200020), + CONST64(0x2000000020202000), CONST64(0x2000002020202000), CONST64(0x2000000020202020), CONST64(0x2000002020202020), + CONST64(0x2000200020202000), CONST64(0x2000202020202000), CONST64(0x2000200020202020), CONST64(0x2000202020202020), + CONST64(0x2020000020200000), CONST64(0x2020002020200000), CONST64(0x2020000020200020), CONST64(0x2020002020200020), + CONST64(0x2020200020200000), CONST64(0x2020202020200000), CONST64(0x2020200020200020), CONST64(0x2020202020200020), + CONST64(0x2020000020202000), CONST64(0x2020002020202000), CONST64(0x2020000020202020), CONST64(0x2020002020202020), + CONST64(0x2020200020202000), CONST64(0x2020202020202000), CONST64(0x2020200020202020), CONST64(0x2020202020202020) + }}; + +static const ulong64 des_fp[8][256] = { + +{ CONST64(0x0000000000000000), CONST64(0x0000008000000000), CONST64(0x0000000002000000), CONST64(0x0000008002000000), + CONST64(0x0000000000020000), CONST64(0x0000008000020000), CONST64(0x0000000002020000), CONST64(0x0000008002020000), + CONST64(0x0000000000000200), CONST64(0x0000008000000200), CONST64(0x0000000002000200), CONST64(0x0000008002000200), + CONST64(0x0000000000020200), CONST64(0x0000008000020200), CONST64(0x0000000002020200), CONST64(0x0000008002020200), + CONST64(0x0000000000000002), CONST64(0x0000008000000002), CONST64(0x0000000002000002), CONST64(0x0000008002000002), + CONST64(0x0000000000020002), CONST64(0x0000008000020002), CONST64(0x0000000002020002), CONST64(0x0000008002020002), + CONST64(0x0000000000000202), CONST64(0x0000008000000202), CONST64(0x0000000002000202), CONST64(0x0000008002000202), + CONST64(0x0000000000020202), CONST64(0x0000008000020202), CONST64(0x0000000002020202), CONST64(0x0000008002020202), + CONST64(0x0200000000000000), CONST64(0x0200008000000000), CONST64(0x0200000002000000), CONST64(0x0200008002000000), + CONST64(0x0200000000020000), CONST64(0x0200008000020000), CONST64(0x0200000002020000), CONST64(0x0200008002020000), + CONST64(0x0200000000000200), CONST64(0x0200008000000200), CONST64(0x0200000002000200), CONST64(0x0200008002000200), + CONST64(0x0200000000020200), CONST64(0x0200008000020200), CONST64(0x0200000002020200), CONST64(0x0200008002020200), + CONST64(0x0200000000000002), CONST64(0x0200008000000002), CONST64(0x0200000002000002), CONST64(0x0200008002000002), + CONST64(0x0200000000020002), CONST64(0x0200008000020002), CONST64(0x0200000002020002), CONST64(0x0200008002020002), + CONST64(0x0200000000000202), CONST64(0x0200008000000202), CONST64(0x0200000002000202), CONST64(0x0200008002000202), + CONST64(0x0200000000020202), CONST64(0x0200008000020202), CONST64(0x0200000002020202), CONST64(0x0200008002020202), + CONST64(0x0002000000000000), CONST64(0x0002008000000000), CONST64(0x0002000002000000), CONST64(0x0002008002000000), + CONST64(0x0002000000020000), CONST64(0x0002008000020000), CONST64(0x0002000002020000), CONST64(0x0002008002020000), + CONST64(0x0002000000000200), CONST64(0x0002008000000200), CONST64(0x0002000002000200), CONST64(0x0002008002000200), + CONST64(0x0002000000020200), CONST64(0x0002008000020200), CONST64(0x0002000002020200), CONST64(0x0002008002020200), + CONST64(0x0002000000000002), CONST64(0x0002008000000002), CONST64(0x0002000002000002), CONST64(0x0002008002000002), + CONST64(0x0002000000020002), CONST64(0x0002008000020002), CONST64(0x0002000002020002), CONST64(0x0002008002020002), + CONST64(0x0002000000000202), CONST64(0x0002008000000202), CONST64(0x0002000002000202), CONST64(0x0002008002000202), + CONST64(0x0002000000020202), CONST64(0x0002008000020202), CONST64(0x0002000002020202), CONST64(0x0002008002020202), + CONST64(0x0202000000000000), CONST64(0x0202008000000000), CONST64(0x0202000002000000), CONST64(0x0202008002000000), + CONST64(0x0202000000020000), CONST64(0x0202008000020000), CONST64(0x0202000002020000), CONST64(0x0202008002020000), + CONST64(0x0202000000000200), CONST64(0x0202008000000200), CONST64(0x0202000002000200), CONST64(0x0202008002000200), + CONST64(0x0202000000020200), CONST64(0x0202008000020200), CONST64(0x0202000002020200), CONST64(0x0202008002020200), + CONST64(0x0202000000000002), CONST64(0x0202008000000002), CONST64(0x0202000002000002), CONST64(0x0202008002000002), + CONST64(0x0202000000020002), CONST64(0x0202008000020002), CONST64(0x0202000002020002), CONST64(0x0202008002020002), + CONST64(0x0202000000000202), CONST64(0x0202008000000202), CONST64(0x0202000002000202), CONST64(0x0202008002000202), + CONST64(0x0202000000020202), CONST64(0x0202008000020202), CONST64(0x0202000002020202), CONST64(0x0202008002020202), + CONST64(0x0000020000000000), CONST64(0x0000028000000000), CONST64(0x0000020002000000), CONST64(0x0000028002000000), + CONST64(0x0000020000020000), CONST64(0x0000028000020000), CONST64(0x0000020002020000), CONST64(0x0000028002020000), + CONST64(0x0000020000000200), CONST64(0x0000028000000200), CONST64(0x0000020002000200), CONST64(0x0000028002000200), + CONST64(0x0000020000020200), CONST64(0x0000028000020200), CONST64(0x0000020002020200), CONST64(0x0000028002020200), + CONST64(0x0000020000000002), CONST64(0x0000028000000002), CONST64(0x0000020002000002), CONST64(0x0000028002000002), + CONST64(0x0000020000020002), CONST64(0x0000028000020002), CONST64(0x0000020002020002), CONST64(0x0000028002020002), + CONST64(0x0000020000000202), CONST64(0x0000028000000202), CONST64(0x0000020002000202), CONST64(0x0000028002000202), + CONST64(0x0000020000020202), CONST64(0x0000028000020202), CONST64(0x0000020002020202), CONST64(0x0000028002020202), + CONST64(0x0200020000000000), CONST64(0x0200028000000000), CONST64(0x0200020002000000), CONST64(0x0200028002000000), + CONST64(0x0200020000020000), CONST64(0x0200028000020000), CONST64(0x0200020002020000), CONST64(0x0200028002020000), + CONST64(0x0200020000000200), CONST64(0x0200028000000200), CONST64(0x0200020002000200), CONST64(0x0200028002000200), + CONST64(0x0200020000020200), CONST64(0x0200028000020200), CONST64(0x0200020002020200), CONST64(0x0200028002020200), + CONST64(0x0200020000000002), CONST64(0x0200028000000002), CONST64(0x0200020002000002), CONST64(0x0200028002000002), + CONST64(0x0200020000020002), CONST64(0x0200028000020002), CONST64(0x0200020002020002), CONST64(0x0200028002020002), + CONST64(0x0200020000000202), CONST64(0x0200028000000202), CONST64(0x0200020002000202), CONST64(0x0200028002000202), + CONST64(0x0200020000020202), CONST64(0x0200028000020202), CONST64(0x0200020002020202), CONST64(0x0200028002020202), + CONST64(0x0002020000000000), CONST64(0x0002028000000000), CONST64(0x0002020002000000), CONST64(0x0002028002000000), + CONST64(0x0002020000020000), CONST64(0x0002028000020000), CONST64(0x0002020002020000), CONST64(0x0002028002020000), + CONST64(0x0002020000000200), CONST64(0x0002028000000200), CONST64(0x0002020002000200), CONST64(0x0002028002000200), + CONST64(0x0002020000020200), CONST64(0x0002028000020200), CONST64(0x0002020002020200), CONST64(0x0002028002020200), + CONST64(0x0002020000000002), CONST64(0x0002028000000002), CONST64(0x0002020002000002), CONST64(0x0002028002000002), + CONST64(0x0002020000020002), CONST64(0x0002028000020002), CONST64(0x0002020002020002), CONST64(0x0002028002020002), + CONST64(0x0002020000000202), CONST64(0x0002028000000202), CONST64(0x0002020002000202), CONST64(0x0002028002000202), + CONST64(0x0002020000020202), CONST64(0x0002028000020202), CONST64(0x0002020002020202), CONST64(0x0002028002020202), + CONST64(0x0202020000000000), CONST64(0x0202028000000000), CONST64(0x0202020002000000), CONST64(0x0202028002000000), + CONST64(0x0202020000020000), CONST64(0x0202028000020000), CONST64(0x0202020002020000), CONST64(0x0202028002020000), + CONST64(0x0202020000000200), CONST64(0x0202028000000200), CONST64(0x0202020002000200), CONST64(0x0202028002000200), + CONST64(0x0202020000020200), CONST64(0x0202028000020200), CONST64(0x0202020002020200), CONST64(0x0202028002020200), + CONST64(0x0202020000000002), CONST64(0x0202028000000002), CONST64(0x0202020002000002), CONST64(0x0202028002000002), + CONST64(0x0202020000020002), CONST64(0x0202028000020002), CONST64(0x0202020002020002), CONST64(0x0202028002020002), + CONST64(0x0202020000000202), CONST64(0x0202028000000202), CONST64(0x0202020002000202), CONST64(0x0202028002000202), + CONST64(0x0202020000020202), CONST64(0x0202028000020202), CONST64(0x0202020002020202), CONST64(0x0202028002020202) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000200000000), CONST64(0x0000000008000000), CONST64(0x0000000208000000), + CONST64(0x0000000000080000), CONST64(0x0000000200080000), CONST64(0x0000000008080000), CONST64(0x0000000208080000), + CONST64(0x0000000000000800), CONST64(0x0000000200000800), CONST64(0x0000000008000800), CONST64(0x0000000208000800), + CONST64(0x0000000000080800), CONST64(0x0000000200080800), CONST64(0x0000000008080800), CONST64(0x0000000208080800), + CONST64(0x0000000000000008), CONST64(0x0000000200000008), CONST64(0x0000000008000008), CONST64(0x0000000208000008), + CONST64(0x0000000000080008), CONST64(0x0000000200080008), CONST64(0x0000000008080008), CONST64(0x0000000208080008), + CONST64(0x0000000000000808), CONST64(0x0000000200000808), CONST64(0x0000000008000808), CONST64(0x0000000208000808), + CONST64(0x0000000000080808), CONST64(0x0000000200080808), CONST64(0x0000000008080808), CONST64(0x0000000208080808), + CONST64(0x0800000000000000), CONST64(0x0800000200000000), CONST64(0x0800000008000000), CONST64(0x0800000208000000), + CONST64(0x0800000000080000), CONST64(0x0800000200080000), CONST64(0x0800000008080000), CONST64(0x0800000208080000), + CONST64(0x0800000000000800), CONST64(0x0800000200000800), CONST64(0x0800000008000800), CONST64(0x0800000208000800), + CONST64(0x0800000000080800), CONST64(0x0800000200080800), CONST64(0x0800000008080800), CONST64(0x0800000208080800), + CONST64(0x0800000000000008), CONST64(0x0800000200000008), CONST64(0x0800000008000008), CONST64(0x0800000208000008), + CONST64(0x0800000000080008), CONST64(0x0800000200080008), CONST64(0x0800000008080008), CONST64(0x0800000208080008), + CONST64(0x0800000000000808), CONST64(0x0800000200000808), CONST64(0x0800000008000808), CONST64(0x0800000208000808), + CONST64(0x0800000000080808), CONST64(0x0800000200080808), CONST64(0x0800000008080808), CONST64(0x0800000208080808), + CONST64(0x0008000000000000), CONST64(0x0008000200000000), CONST64(0x0008000008000000), CONST64(0x0008000208000000), + CONST64(0x0008000000080000), CONST64(0x0008000200080000), CONST64(0x0008000008080000), CONST64(0x0008000208080000), + CONST64(0x0008000000000800), CONST64(0x0008000200000800), CONST64(0x0008000008000800), CONST64(0x0008000208000800), + CONST64(0x0008000000080800), CONST64(0x0008000200080800), CONST64(0x0008000008080800), CONST64(0x0008000208080800), + CONST64(0x0008000000000008), CONST64(0x0008000200000008), CONST64(0x0008000008000008), CONST64(0x0008000208000008), + CONST64(0x0008000000080008), CONST64(0x0008000200080008), CONST64(0x0008000008080008), CONST64(0x0008000208080008), + CONST64(0x0008000000000808), CONST64(0x0008000200000808), CONST64(0x0008000008000808), CONST64(0x0008000208000808), + CONST64(0x0008000000080808), CONST64(0x0008000200080808), CONST64(0x0008000008080808), CONST64(0x0008000208080808), + CONST64(0x0808000000000000), CONST64(0x0808000200000000), CONST64(0x0808000008000000), CONST64(0x0808000208000000), + CONST64(0x0808000000080000), CONST64(0x0808000200080000), CONST64(0x0808000008080000), CONST64(0x0808000208080000), + CONST64(0x0808000000000800), CONST64(0x0808000200000800), CONST64(0x0808000008000800), CONST64(0x0808000208000800), + CONST64(0x0808000000080800), CONST64(0x0808000200080800), CONST64(0x0808000008080800), CONST64(0x0808000208080800), + CONST64(0x0808000000000008), CONST64(0x0808000200000008), CONST64(0x0808000008000008), CONST64(0x0808000208000008), + CONST64(0x0808000000080008), CONST64(0x0808000200080008), CONST64(0x0808000008080008), CONST64(0x0808000208080008), + CONST64(0x0808000000000808), CONST64(0x0808000200000808), CONST64(0x0808000008000808), CONST64(0x0808000208000808), + CONST64(0x0808000000080808), CONST64(0x0808000200080808), CONST64(0x0808000008080808), CONST64(0x0808000208080808), + CONST64(0x0000080000000000), CONST64(0x0000080200000000), CONST64(0x0000080008000000), CONST64(0x0000080208000000), + CONST64(0x0000080000080000), CONST64(0x0000080200080000), CONST64(0x0000080008080000), CONST64(0x0000080208080000), + CONST64(0x0000080000000800), CONST64(0x0000080200000800), CONST64(0x0000080008000800), CONST64(0x0000080208000800), + CONST64(0x0000080000080800), CONST64(0x0000080200080800), CONST64(0x0000080008080800), CONST64(0x0000080208080800), + CONST64(0x0000080000000008), CONST64(0x0000080200000008), CONST64(0x0000080008000008), CONST64(0x0000080208000008), + CONST64(0x0000080000080008), CONST64(0x0000080200080008), CONST64(0x0000080008080008), CONST64(0x0000080208080008), + CONST64(0x0000080000000808), CONST64(0x0000080200000808), CONST64(0x0000080008000808), CONST64(0x0000080208000808), + CONST64(0x0000080000080808), CONST64(0x0000080200080808), CONST64(0x0000080008080808), CONST64(0x0000080208080808), + CONST64(0x0800080000000000), CONST64(0x0800080200000000), CONST64(0x0800080008000000), CONST64(0x0800080208000000), + CONST64(0x0800080000080000), CONST64(0x0800080200080000), CONST64(0x0800080008080000), CONST64(0x0800080208080000), + CONST64(0x0800080000000800), CONST64(0x0800080200000800), CONST64(0x0800080008000800), CONST64(0x0800080208000800), + CONST64(0x0800080000080800), CONST64(0x0800080200080800), CONST64(0x0800080008080800), CONST64(0x0800080208080800), + CONST64(0x0800080000000008), CONST64(0x0800080200000008), CONST64(0x0800080008000008), CONST64(0x0800080208000008), + CONST64(0x0800080000080008), CONST64(0x0800080200080008), CONST64(0x0800080008080008), CONST64(0x0800080208080008), + CONST64(0x0800080000000808), CONST64(0x0800080200000808), CONST64(0x0800080008000808), CONST64(0x0800080208000808), + CONST64(0x0800080000080808), CONST64(0x0800080200080808), CONST64(0x0800080008080808), CONST64(0x0800080208080808), + CONST64(0x0008080000000000), CONST64(0x0008080200000000), CONST64(0x0008080008000000), CONST64(0x0008080208000000), + CONST64(0x0008080000080000), CONST64(0x0008080200080000), CONST64(0x0008080008080000), CONST64(0x0008080208080000), + CONST64(0x0008080000000800), CONST64(0x0008080200000800), CONST64(0x0008080008000800), CONST64(0x0008080208000800), + CONST64(0x0008080000080800), CONST64(0x0008080200080800), CONST64(0x0008080008080800), CONST64(0x0008080208080800), + CONST64(0x0008080000000008), CONST64(0x0008080200000008), CONST64(0x0008080008000008), CONST64(0x0008080208000008), + CONST64(0x0008080000080008), CONST64(0x0008080200080008), CONST64(0x0008080008080008), CONST64(0x0008080208080008), + CONST64(0x0008080000000808), CONST64(0x0008080200000808), CONST64(0x0008080008000808), CONST64(0x0008080208000808), + CONST64(0x0008080000080808), CONST64(0x0008080200080808), CONST64(0x0008080008080808), CONST64(0x0008080208080808), + CONST64(0x0808080000000000), CONST64(0x0808080200000000), CONST64(0x0808080008000000), CONST64(0x0808080208000000), + CONST64(0x0808080000080000), CONST64(0x0808080200080000), CONST64(0x0808080008080000), CONST64(0x0808080208080000), + CONST64(0x0808080000000800), CONST64(0x0808080200000800), CONST64(0x0808080008000800), CONST64(0x0808080208000800), + CONST64(0x0808080000080800), CONST64(0x0808080200080800), CONST64(0x0808080008080800), CONST64(0x0808080208080800), + CONST64(0x0808080000000008), CONST64(0x0808080200000008), CONST64(0x0808080008000008), CONST64(0x0808080208000008), + CONST64(0x0808080000080008), CONST64(0x0808080200080008), CONST64(0x0808080008080008), CONST64(0x0808080208080008), + CONST64(0x0808080000000808), CONST64(0x0808080200000808), CONST64(0x0808080008000808), CONST64(0x0808080208000808), + CONST64(0x0808080000080808), CONST64(0x0808080200080808), CONST64(0x0808080008080808), CONST64(0x0808080208080808) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000800000000), CONST64(0x0000000020000000), CONST64(0x0000000820000000), + CONST64(0x0000000000200000), CONST64(0x0000000800200000), CONST64(0x0000000020200000), CONST64(0x0000000820200000), + CONST64(0x0000000000002000), CONST64(0x0000000800002000), CONST64(0x0000000020002000), CONST64(0x0000000820002000), + CONST64(0x0000000000202000), CONST64(0x0000000800202000), CONST64(0x0000000020202000), CONST64(0x0000000820202000), + CONST64(0x0000000000000020), CONST64(0x0000000800000020), CONST64(0x0000000020000020), CONST64(0x0000000820000020), + CONST64(0x0000000000200020), CONST64(0x0000000800200020), CONST64(0x0000000020200020), CONST64(0x0000000820200020), + CONST64(0x0000000000002020), CONST64(0x0000000800002020), CONST64(0x0000000020002020), CONST64(0x0000000820002020), + CONST64(0x0000000000202020), CONST64(0x0000000800202020), CONST64(0x0000000020202020), CONST64(0x0000000820202020), + CONST64(0x2000000000000000), CONST64(0x2000000800000000), CONST64(0x2000000020000000), CONST64(0x2000000820000000), + CONST64(0x2000000000200000), CONST64(0x2000000800200000), CONST64(0x2000000020200000), CONST64(0x2000000820200000), + CONST64(0x2000000000002000), CONST64(0x2000000800002000), CONST64(0x2000000020002000), CONST64(0x2000000820002000), + CONST64(0x2000000000202000), CONST64(0x2000000800202000), CONST64(0x2000000020202000), CONST64(0x2000000820202000), + CONST64(0x2000000000000020), CONST64(0x2000000800000020), CONST64(0x2000000020000020), CONST64(0x2000000820000020), + CONST64(0x2000000000200020), CONST64(0x2000000800200020), CONST64(0x2000000020200020), CONST64(0x2000000820200020), + CONST64(0x2000000000002020), CONST64(0x2000000800002020), CONST64(0x2000000020002020), CONST64(0x2000000820002020), + CONST64(0x2000000000202020), CONST64(0x2000000800202020), CONST64(0x2000000020202020), CONST64(0x2000000820202020), + CONST64(0x0020000000000000), CONST64(0x0020000800000000), CONST64(0x0020000020000000), CONST64(0x0020000820000000), + CONST64(0x0020000000200000), CONST64(0x0020000800200000), CONST64(0x0020000020200000), CONST64(0x0020000820200000), + CONST64(0x0020000000002000), CONST64(0x0020000800002000), CONST64(0x0020000020002000), CONST64(0x0020000820002000), + CONST64(0x0020000000202000), CONST64(0x0020000800202000), CONST64(0x0020000020202000), CONST64(0x0020000820202000), + CONST64(0x0020000000000020), CONST64(0x0020000800000020), CONST64(0x0020000020000020), CONST64(0x0020000820000020), + CONST64(0x0020000000200020), CONST64(0x0020000800200020), CONST64(0x0020000020200020), CONST64(0x0020000820200020), + CONST64(0x0020000000002020), CONST64(0x0020000800002020), CONST64(0x0020000020002020), CONST64(0x0020000820002020), + CONST64(0x0020000000202020), CONST64(0x0020000800202020), CONST64(0x0020000020202020), CONST64(0x0020000820202020), + CONST64(0x2020000000000000), CONST64(0x2020000800000000), CONST64(0x2020000020000000), CONST64(0x2020000820000000), + CONST64(0x2020000000200000), CONST64(0x2020000800200000), CONST64(0x2020000020200000), CONST64(0x2020000820200000), + CONST64(0x2020000000002000), CONST64(0x2020000800002000), CONST64(0x2020000020002000), CONST64(0x2020000820002000), + CONST64(0x2020000000202000), CONST64(0x2020000800202000), CONST64(0x2020000020202000), CONST64(0x2020000820202000), + CONST64(0x2020000000000020), CONST64(0x2020000800000020), CONST64(0x2020000020000020), CONST64(0x2020000820000020), + CONST64(0x2020000000200020), CONST64(0x2020000800200020), CONST64(0x2020000020200020), CONST64(0x2020000820200020), + CONST64(0x2020000000002020), CONST64(0x2020000800002020), CONST64(0x2020000020002020), CONST64(0x2020000820002020), + CONST64(0x2020000000202020), CONST64(0x2020000800202020), CONST64(0x2020000020202020), CONST64(0x2020000820202020), + CONST64(0x0000200000000000), CONST64(0x0000200800000000), CONST64(0x0000200020000000), CONST64(0x0000200820000000), + CONST64(0x0000200000200000), CONST64(0x0000200800200000), CONST64(0x0000200020200000), CONST64(0x0000200820200000), + CONST64(0x0000200000002000), CONST64(0x0000200800002000), CONST64(0x0000200020002000), CONST64(0x0000200820002000), + CONST64(0x0000200000202000), CONST64(0x0000200800202000), CONST64(0x0000200020202000), CONST64(0x0000200820202000), + CONST64(0x0000200000000020), CONST64(0x0000200800000020), CONST64(0x0000200020000020), CONST64(0x0000200820000020), + CONST64(0x0000200000200020), CONST64(0x0000200800200020), CONST64(0x0000200020200020), CONST64(0x0000200820200020), + CONST64(0x0000200000002020), CONST64(0x0000200800002020), CONST64(0x0000200020002020), CONST64(0x0000200820002020), + CONST64(0x0000200000202020), CONST64(0x0000200800202020), CONST64(0x0000200020202020), CONST64(0x0000200820202020), + CONST64(0x2000200000000000), CONST64(0x2000200800000000), CONST64(0x2000200020000000), CONST64(0x2000200820000000), + CONST64(0x2000200000200000), CONST64(0x2000200800200000), CONST64(0x2000200020200000), CONST64(0x2000200820200000), + CONST64(0x2000200000002000), CONST64(0x2000200800002000), CONST64(0x2000200020002000), CONST64(0x2000200820002000), + CONST64(0x2000200000202000), CONST64(0x2000200800202000), CONST64(0x2000200020202000), CONST64(0x2000200820202000), + CONST64(0x2000200000000020), CONST64(0x2000200800000020), CONST64(0x2000200020000020), CONST64(0x2000200820000020), + CONST64(0x2000200000200020), CONST64(0x2000200800200020), CONST64(0x2000200020200020), CONST64(0x2000200820200020), + CONST64(0x2000200000002020), CONST64(0x2000200800002020), CONST64(0x2000200020002020), CONST64(0x2000200820002020), + CONST64(0x2000200000202020), CONST64(0x2000200800202020), CONST64(0x2000200020202020), CONST64(0x2000200820202020), + CONST64(0x0020200000000000), CONST64(0x0020200800000000), CONST64(0x0020200020000000), CONST64(0x0020200820000000), + CONST64(0x0020200000200000), CONST64(0x0020200800200000), CONST64(0x0020200020200000), CONST64(0x0020200820200000), + CONST64(0x0020200000002000), CONST64(0x0020200800002000), CONST64(0x0020200020002000), CONST64(0x0020200820002000), + CONST64(0x0020200000202000), CONST64(0x0020200800202000), CONST64(0x0020200020202000), CONST64(0x0020200820202000), + CONST64(0x0020200000000020), CONST64(0x0020200800000020), CONST64(0x0020200020000020), CONST64(0x0020200820000020), + CONST64(0x0020200000200020), CONST64(0x0020200800200020), CONST64(0x0020200020200020), CONST64(0x0020200820200020), + CONST64(0x0020200000002020), CONST64(0x0020200800002020), CONST64(0x0020200020002020), CONST64(0x0020200820002020), + CONST64(0x0020200000202020), CONST64(0x0020200800202020), CONST64(0x0020200020202020), CONST64(0x0020200820202020), + CONST64(0x2020200000000000), CONST64(0x2020200800000000), CONST64(0x2020200020000000), CONST64(0x2020200820000000), + CONST64(0x2020200000200000), CONST64(0x2020200800200000), CONST64(0x2020200020200000), CONST64(0x2020200820200000), + CONST64(0x2020200000002000), CONST64(0x2020200800002000), CONST64(0x2020200020002000), CONST64(0x2020200820002000), + CONST64(0x2020200000202000), CONST64(0x2020200800202000), CONST64(0x2020200020202000), CONST64(0x2020200820202000), + CONST64(0x2020200000000020), CONST64(0x2020200800000020), CONST64(0x2020200020000020), CONST64(0x2020200820000020), + CONST64(0x2020200000200020), CONST64(0x2020200800200020), CONST64(0x2020200020200020), CONST64(0x2020200820200020), + CONST64(0x2020200000002020), CONST64(0x2020200800002020), CONST64(0x2020200020002020), CONST64(0x2020200820002020), + CONST64(0x2020200000202020), CONST64(0x2020200800202020), CONST64(0x2020200020202020), CONST64(0x2020200820202020) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000002000000000), CONST64(0x0000000080000000), CONST64(0x0000002080000000), + CONST64(0x0000000000800000), CONST64(0x0000002000800000), CONST64(0x0000000080800000), CONST64(0x0000002080800000), + CONST64(0x0000000000008000), CONST64(0x0000002000008000), CONST64(0x0000000080008000), CONST64(0x0000002080008000), + CONST64(0x0000000000808000), CONST64(0x0000002000808000), CONST64(0x0000000080808000), CONST64(0x0000002080808000), + CONST64(0x0000000000000080), CONST64(0x0000002000000080), CONST64(0x0000000080000080), CONST64(0x0000002080000080), + CONST64(0x0000000000800080), CONST64(0x0000002000800080), CONST64(0x0000000080800080), CONST64(0x0000002080800080), + CONST64(0x0000000000008080), CONST64(0x0000002000008080), CONST64(0x0000000080008080), CONST64(0x0000002080008080), + CONST64(0x0000000000808080), CONST64(0x0000002000808080), CONST64(0x0000000080808080), CONST64(0x0000002080808080), + CONST64(0x8000000000000000), CONST64(0x8000002000000000), CONST64(0x8000000080000000), CONST64(0x8000002080000000), + CONST64(0x8000000000800000), CONST64(0x8000002000800000), CONST64(0x8000000080800000), CONST64(0x8000002080800000), + CONST64(0x8000000000008000), CONST64(0x8000002000008000), CONST64(0x8000000080008000), CONST64(0x8000002080008000), + CONST64(0x8000000000808000), CONST64(0x8000002000808000), CONST64(0x8000000080808000), CONST64(0x8000002080808000), + CONST64(0x8000000000000080), CONST64(0x8000002000000080), CONST64(0x8000000080000080), CONST64(0x8000002080000080), + CONST64(0x8000000000800080), CONST64(0x8000002000800080), CONST64(0x8000000080800080), CONST64(0x8000002080800080), + CONST64(0x8000000000008080), CONST64(0x8000002000008080), CONST64(0x8000000080008080), CONST64(0x8000002080008080), + CONST64(0x8000000000808080), CONST64(0x8000002000808080), CONST64(0x8000000080808080), CONST64(0x8000002080808080), + CONST64(0x0080000000000000), CONST64(0x0080002000000000), CONST64(0x0080000080000000), CONST64(0x0080002080000000), + CONST64(0x0080000000800000), CONST64(0x0080002000800000), CONST64(0x0080000080800000), CONST64(0x0080002080800000), + CONST64(0x0080000000008000), CONST64(0x0080002000008000), CONST64(0x0080000080008000), CONST64(0x0080002080008000), + CONST64(0x0080000000808000), CONST64(0x0080002000808000), CONST64(0x0080000080808000), CONST64(0x0080002080808000), + CONST64(0x0080000000000080), CONST64(0x0080002000000080), CONST64(0x0080000080000080), CONST64(0x0080002080000080), + CONST64(0x0080000000800080), CONST64(0x0080002000800080), CONST64(0x0080000080800080), CONST64(0x0080002080800080), + CONST64(0x0080000000008080), CONST64(0x0080002000008080), CONST64(0x0080000080008080), CONST64(0x0080002080008080), + CONST64(0x0080000000808080), CONST64(0x0080002000808080), CONST64(0x0080000080808080), CONST64(0x0080002080808080), + CONST64(0x8080000000000000), CONST64(0x8080002000000000), CONST64(0x8080000080000000), CONST64(0x8080002080000000), + CONST64(0x8080000000800000), CONST64(0x8080002000800000), CONST64(0x8080000080800000), CONST64(0x8080002080800000), + CONST64(0x8080000000008000), CONST64(0x8080002000008000), CONST64(0x8080000080008000), CONST64(0x8080002080008000), + CONST64(0x8080000000808000), CONST64(0x8080002000808000), CONST64(0x8080000080808000), CONST64(0x8080002080808000), + CONST64(0x8080000000000080), CONST64(0x8080002000000080), CONST64(0x8080000080000080), CONST64(0x8080002080000080), + CONST64(0x8080000000800080), CONST64(0x8080002000800080), CONST64(0x8080000080800080), CONST64(0x8080002080800080), + CONST64(0x8080000000008080), CONST64(0x8080002000008080), CONST64(0x8080000080008080), CONST64(0x8080002080008080), + CONST64(0x8080000000808080), CONST64(0x8080002000808080), CONST64(0x8080000080808080), CONST64(0x8080002080808080), + CONST64(0x0000800000000000), CONST64(0x0000802000000000), CONST64(0x0000800080000000), CONST64(0x0000802080000000), + CONST64(0x0000800000800000), CONST64(0x0000802000800000), CONST64(0x0000800080800000), CONST64(0x0000802080800000), + CONST64(0x0000800000008000), CONST64(0x0000802000008000), CONST64(0x0000800080008000), CONST64(0x0000802080008000), + CONST64(0x0000800000808000), CONST64(0x0000802000808000), CONST64(0x0000800080808000), CONST64(0x0000802080808000), + CONST64(0x0000800000000080), CONST64(0x0000802000000080), CONST64(0x0000800080000080), CONST64(0x0000802080000080), + CONST64(0x0000800000800080), CONST64(0x0000802000800080), CONST64(0x0000800080800080), CONST64(0x0000802080800080), + CONST64(0x0000800000008080), CONST64(0x0000802000008080), CONST64(0x0000800080008080), CONST64(0x0000802080008080), + CONST64(0x0000800000808080), CONST64(0x0000802000808080), CONST64(0x0000800080808080), CONST64(0x0000802080808080), + CONST64(0x8000800000000000), CONST64(0x8000802000000000), CONST64(0x8000800080000000), CONST64(0x8000802080000000), + CONST64(0x8000800000800000), CONST64(0x8000802000800000), CONST64(0x8000800080800000), CONST64(0x8000802080800000), + CONST64(0x8000800000008000), CONST64(0x8000802000008000), CONST64(0x8000800080008000), CONST64(0x8000802080008000), + CONST64(0x8000800000808000), CONST64(0x8000802000808000), CONST64(0x8000800080808000), CONST64(0x8000802080808000), + CONST64(0x8000800000000080), CONST64(0x8000802000000080), CONST64(0x8000800080000080), CONST64(0x8000802080000080), + CONST64(0x8000800000800080), CONST64(0x8000802000800080), CONST64(0x8000800080800080), CONST64(0x8000802080800080), + CONST64(0x8000800000008080), CONST64(0x8000802000008080), CONST64(0x8000800080008080), CONST64(0x8000802080008080), + CONST64(0x8000800000808080), CONST64(0x8000802000808080), CONST64(0x8000800080808080), CONST64(0x8000802080808080), + CONST64(0x0080800000000000), CONST64(0x0080802000000000), CONST64(0x0080800080000000), CONST64(0x0080802080000000), + CONST64(0x0080800000800000), CONST64(0x0080802000800000), CONST64(0x0080800080800000), CONST64(0x0080802080800000), + CONST64(0x0080800000008000), CONST64(0x0080802000008000), CONST64(0x0080800080008000), CONST64(0x0080802080008000), + CONST64(0x0080800000808000), CONST64(0x0080802000808000), CONST64(0x0080800080808000), CONST64(0x0080802080808000), + CONST64(0x0080800000000080), CONST64(0x0080802000000080), CONST64(0x0080800080000080), CONST64(0x0080802080000080), + CONST64(0x0080800000800080), CONST64(0x0080802000800080), CONST64(0x0080800080800080), CONST64(0x0080802080800080), + CONST64(0x0080800000008080), CONST64(0x0080802000008080), CONST64(0x0080800080008080), CONST64(0x0080802080008080), + CONST64(0x0080800000808080), CONST64(0x0080802000808080), CONST64(0x0080800080808080), CONST64(0x0080802080808080), + CONST64(0x8080800000000000), CONST64(0x8080802000000000), CONST64(0x8080800080000000), CONST64(0x8080802080000000), + CONST64(0x8080800000800000), CONST64(0x8080802000800000), CONST64(0x8080800080800000), CONST64(0x8080802080800000), + CONST64(0x8080800000008000), CONST64(0x8080802000008000), CONST64(0x8080800080008000), CONST64(0x8080802080008000), + CONST64(0x8080800000808000), CONST64(0x8080802000808000), CONST64(0x8080800080808000), CONST64(0x8080802080808000), + CONST64(0x8080800000000080), CONST64(0x8080802000000080), CONST64(0x8080800080000080), CONST64(0x8080802080000080), + CONST64(0x8080800000800080), CONST64(0x8080802000800080), CONST64(0x8080800080800080), CONST64(0x8080802080800080), + CONST64(0x8080800000008080), CONST64(0x8080802000008080), CONST64(0x8080800080008080), CONST64(0x8080802080008080), + CONST64(0x8080800000808080), CONST64(0x8080802000808080), CONST64(0x8080800080808080), CONST64(0x8080802080808080) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000004000000000), CONST64(0x0000000001000000), CONST64(0x0000004001000000), + CONST64(0x0000000000010000), CONST64(0x0000004000010000), CONST64(0x0000000001010000), CONST64(0x0000004001010000), + CONST64(0x0000000000000100), CONST64(0x0000004000000100), CONST64(0x0000000001000100), CONST64(0x0000004001000100), + CONST64(0x0000000000010100), CONST64(0x0000004000010100), CONST64(0x0000000001010100), CONST64(0x0000004001010100), + CONST64(0x0000000000000001), CONST64(0x0000004000000001), CONST64(0x0000000001000001), CONST64(0x0000004001000001), + CONST64(0x0000000000010001), CONST64(0x0000004000010001), CONST64(0x0000000001010001), CONST64(0x0000004001010001), + CONST64(0x0000000000000101), CONST64(0x0000004000000101), CONST64(0x0000000001000101), CONST64(0x0000004001000101), + CONST64(0x0000000000010101), CONST64(0x0000004000010101), CONST64(0x0000000001010101), CONST64(0x0000004001010101), + CONST64(0x0100000000000000), CONST64(0x0100004000000000), CONST64(0x0100000001000000), CONST64(0x0100004001000000), + CONST64(0x0100000000010000), CONST64(0x0100004000010000), CONST64(0x0100000001010000), CONST64(0x0100004001010000), + CONST64(0x0100000000000100), CONST64(0x0100004000000100), CONST64(0x0100000001000100), CONST64(0x0100004001000100), + CONST64(0x0100000000010100), CONST64(0x0100004000010100), CONST64(0x0100000001010100), CONST64(0x0100004001010100), + CONST64(0x0100000000000001), CONST64(0x0100004000000001), CONST64(0x0100000001000001), CONST64(0x0100004001000001), + CONST64(0x0100000000010001), CONST64(0x0100004000010001), CONST64(0x0100000001010001), CONST64(0x0100004001010001), + CONST64(0x0100000000000101), CONST64(0x0100004000000101), CONST64(0x0100000001000101), CONST64(0x0100004001000101), + CONST64(0x0100000000010101), CONST64(0x0100004000010101), CONST64(0x0100000001010101), CONST64(0x0100004001010101), + CONST64(0x0001000000000000), CONST64(0x0001004000000000), CONST64(0x0001000001000000), CONST64(0x0001004001000000), + CONST64(0x0001000000010000), CONST64(0x0001004000010000), CONST64(0x0001000001010000), CONST64(0x0001004001010000), + CONST64(0x0001000000000100), CONST64(0x0001004000000100), CONST64(0x0001000001000100), CONST64(0x0001004001000100), + CONST64(0x0001000000010100), CONST64(0x0001004000010100), CONST64(0x0001000001010100), CONST64(0x0001004001010100), + CONST64(0x0001000000000001), CONST64(0x0001004000000001), CONST64(0x0001000001000001), CONST64(0x0001004001000001), + CONST64(0x0001000000010001), CONST64(0x0001004000010001), CONST64(0x0001000001010001), CONST64(0x0001004001010001), + CONST64(0x0001000000000101), CONST64(0x0001004000000101), CONST64(0x0001000001000101), CONST64(0x0001004001000101), + CONST64(0x0001000000010101), CONST64(0x0001004000010101), CONST64(0x0001000001010101), CONST64(0x0001004001010101), + CONST64(0x0101000000000000), CONST64(0x0101004000000000), CONST64(0x0101000001000000), CONST64(0x0101004001000000), + CONST64(0x0101000000010000), CONST64(0x0101004000010000), CONST64(0x0101000001010000), CONST64(0x0101004001010000), + CONST64(0x0101000000000100), CONST64(0x0101004000000100), CONST64(0x0101000001000100), CONST64(0x0101004001000100), + CONST64(0x0101000000010100), CONST64(0x0101004000010100), CONST64(0x0101000001010100), CONST64(0x0101004001010100), + CONST64(0x0101000000000001), CONST64(0x0101004000000001), CONST64(0x0101000001000001), CONST64(0x0101004001000001), + CONST64(0x0101000000010001), CONST64(0x0101004000010001), CONST64(0x0101000001010001), CONST64(0x0101004001010001), + CONST64(0x0101000000000101), CONST64(0x0101004000000101), CONST64(0x0101000001000101), CONST64(0x0101004001000101), + CONST64(0x0101000000010101), CONST64(0x0101004000010101), CONST64(0x0101000001010101), CONST64(0x0101004001010101), + CONST64(0x0000010000000000), CONST64(0x0000014000000000), CONST64(0x0000010001000000), CONST64(0x0000014001000000), + CONST64(0x0000010000010000), CONST64(0x0000014000010000), CONST64(0x0000010001010000), CONST64(0x0000014001010000), + CONST64(0x0000010000000100), CONST64(0x0000014000000100), CONST64(0x0000010001000100), CONST64(0x0000014001000100), + CONST64(0x0000010000010100), CONST64(0x0000014000010100), CONST64(0x0000010001010100), CONST64(0x0000014001010100), + CONST64(0x0000010000000001), CONST64(0x0000014000000001), CONST64(0x0000010001000001), CONST64(0x0000014001000001), + CONST64(0x0000010000010001), CONST64(0x0000014000010001), CONST64(0x0000010001010001), CONST64(0x0000014001010001), + CONST64(0x0000010000000101), CONST64(0x0000014000000101), CONST64(0x0000010001000101), CONST64(0x0000014001000101), + CONST64(0x0000010000010101), CONST64(0x0000014000010101), CONST64(0x0000010001010101), CONST64(0x0000014001010101), + CONST64(0x0100010000000000), CONST64(0x0100014000000000), CONST64(0x0100010001000000), CONST64(0x0100014001000000), + CONST64(0x0100010000010000), CONST64(0x0100014000010000), CONST64(0x0100010001010000), CONST64(0x0100014001010000), + CONST64(0x0100010000000100), CONST64(0x0100014000000100), CONST64(0x0100010001000100), CONST64(0x0100014001000100), + CONST64(0x0100010000010100), CONST64(0x0100014000010100), CONST64(0x0100010001010100), CONST64(0x0100014001010100), + CONST64(0x0100010000000001), CONST64(0x0100014000000001), CONST64(0x0100010001000001), CONST64(0x0100014001000001), + CONST64(0x0100010000010001), CONST64(0x0100014000010001), CONST64(0x0100010001010001), CONST64(0x0100014001010001), + CONST64(0x0100010000000101), CONST64(0x0100014000000101), CONST64(0x0100010001000101), CONST64(0x0100014001000101), + CONST64(0x0100010000010101), CONST64(0x0100014000010101), CONST64(0x0100010001010101), CONST64(0x0100014001010101), + CONST64(0x0001010000000000), CONST64(0x0001014000000000), CONST64(0x0001010001000000), CONST64(0x0001014001000000), + CONST64(0x0001010000010000), CONST64(0x0001014000010000), CONST64(0x0001010001010000), CONST64(0x0001014001010000), + CONST64(0x0001010000000100), CONST64(0x0001014000000100), CONST64(0x0001010001000100), CONST64(0x0001014001000100), + CONST64(0x0001010000010100), CONST64(0x0001014000010100), CONST64(0x0001010001010100), CONST64(0x0001014001010100), + CONST64(0x0001010000000001), CONST64(0x0001014000000001), CONST64(0x0001010001000001), CONST64(0x0001014001000001), + CONST64(0x0001010000010001), CONST64(0x0001014000010001), CONST64(0x0001010001010001), CONST64(0x0001014001010001), + CONST64(0x0001010000000101), CONST64(0x0001014000000101), CONST64(0x0001010001000101), CONST64(0x0001014001000101), + CONST64(0x0001010000010101), CONST64(0x0001014000010101), CONST64(0x0001010001010101), CONST64(0x0001014001010101), + CONST64(0x0101010000000000), CONST64(0x0101014000000000), CONST64(0x0101010001000000), CONST64(0x0101014001000000), + CONST64(0x0101010000010000), CONST64(0x0101014000010000), CONST64(0x0101010001010000), CONST64(0x0101014001010000), + CONST64(0x0101010000000100), CONST64(0x0101014000000100), CONST64(0x0101010001000100), CONST64(0x0101014001000100), + CONST64(0x0101010000010100), CONST64(0x0101014000010100), CONST64(0x0101010001010100), CONST64(0x0101014001010100), + CONST64(0x0101010000000001), CONST64(0x0101014000000001), CONST64(0x0101010001000001), CONST64(0x0101014001000001), + CONST64(0x0101010000010001), CONST64(0x0101014000010001), CONST64(0x0101010001010001), CONST64(0x0101014001010001), + CONST64(0x0101010000000101), CONST64(0x0101014000000101), CONST64(0x0101010001000101), CONST64(0x0101014001000101), + CONST64(0x0101010000010101), CONST64(0x0101014000010101), CONST64(0x0101010001010101), CONST64(0x0101014001010101) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000100000000), CONST64(0x0000000004000000), CONST64(0x0000000104000000), + CONST64(0x0000000000040000), CONST64(0x0000000100040000), CONST64(0x0000000004040000), CONST64(0x0000000104040000), + CONST64(0x0000000000000400), CONST64(0x0000000100000400), CONST64(0x0000000004000400), CONST64(0x0000000104000400), + CONST64(0x0000000000040400), CONST64(0x0000000100040400), CONST64(0x0000000004040400), CONST64(0x0000000104040400), + CONST64(0x0000000000000004), CONST64(0x0000000100000004), CONST64(0x0000000004000004), CONST64(0x0000000104000004), + CONST64(0x0000000000040004), CONST64(0x0000000100040004), CONST64(0x0000000004040004), CONST64(0x0000000104040004), + CONST64(0x0000000000000404), CONST64(0x0000000100000404), CONST64(0x0000000004000404), CONST64(0x0000000104000404), + CONST64(0x0000000000040404), CONST64(0x0000000100040404), CONST64(0x0000000004040404), CONST64(0x0000000104040404), + CONST64(0x0400000000000000), CONST64(0x0400000100000000), CONST64(0x0400000004000000), CONST64(0x0400000104000000), + CONST64(0x0400000000040000), CONST64(0x0400000100040000), CONST64(0x0400000004040000), CONST64(0x0400000104040000), + CONST64(0x0400000000000400), CONST64(0x0400000100000400), CONST64(0x0400000004000400), CONST64(0x0400000104000400), + CONST64(0x0400000000040400), CONST64(0x0400000100040400), CONST64(0x0400000004040400), CONST64(0x0400000104040400), + CONST64(0x0400000000000004), CONST64(0x0400000100000004), CONST64(0x0400000004000004), CONST64(0x0400000104000004), + CONST64(0x0400000000040004), CONST64(0x0400000100040004), CONST64(0x0400000004040004), CONST64(0x0400000104040004), + CONST64(0x0400000000000404), CONST64(0x0400000100000404), CONST64(0x0400000004000404), CONST64(0x0400000104000404), + CONST64(0x0400000000040404), CONST64(0x0400000100040404), CONST64(0x0400000004040404), CONST64(0x0400000104040404), + CONST64(0x0004000000000000), CONST64(0x0004000100000000), CONST64(0x0004000004000000), CONST64(0x0004000104000000), + CONST64(0x0004000000040000), CONST64(0x0004000100040000), CONST64(0x0004000004040000), CONST64(0x0004000104040000), + CONST64(0x0004000000000400), CONST64(0x0004000100000400), CONST64(0x0004000004000400), CONST64(0x0004000104000400), + CONST64(0x0004000000040400), CONST64(0x0004000100040400), CONST64(0x0004000004040400), CONST64(0x0004000104040400), + CONST64(0x0004000000000004), CONST64(0x0004000100000004), CONST64(0x0004000004000004), CONST64(0x0004000104000004), + CONST64(0x0004000000040004), CONST64(0x0004000100040004), CONST64(0x0004000004040004), CONST64(0x0004000104040004), + CONST64(0x0004000000000404), CONST64(0x0004000100000404), CONST64(0x0004000004000404), CONST64(0x0004000104000404), + CONST64(0x0004000000040404), CONST64(0x0004000100040404), CONST64(0x0004000004040404), CONST64(0x0004000104040404), + CONST64(0x0404000000000000), CONST64(0x0404000100000000), CONST64(0x0404000004000000), CONST64(0x0404000104000000), + CONST64(0x0404000000040000), CONST64(0x0404000100040000), CONST64(0x0404000004040000), CONST64(0x0404000104040000), + CONST64(0x0404000000000400), CONST64(0x0404000100000400), CONST64(0x0404000004000400), CONST64(0x0404000104000400), + CONST64(0x0404000000040400), CONST64(0x0404000100040400), CONST64(0x0404000004040400), CONST64(0x0404000104040400), + CONST64(0x0404000000000004), CONST64(0x0404000100000004), CONST64(0x0404000004000004), CONST64(0x0404000104000004), + CONST64(0x0404000000040004), CONST64(0x0404000100040004), CONST64(0x0404000004040004), CONST64(0x0404000104040004), + CONST64(0x0404000000000404), CONST64(0x0404000100000404), CONST64(0x0404000004000404), CONST64(0x0404000104000404), + CONST64(0x0404000000040404), CONST64(0x0404000100040404), CONST64(0x0404000004040404), CONST64(0x0404000104040404), + CONST64(0x0000040000000000), CONST64(0x0000040100000000), CONST64(0x0000040004000000), CONST64(0x0000040104000000), + CONST64(0x0000040000040000), CONST64(0x0000040100040000), CONST64(0x0000040004040000), CONST64(0x0000040104040000), + CONST64(0x0000040000000400), CONST64(0x0000040100000400), CONST64(0x0000040004000400), CONST64(0x0000040104000400), + CONST64(0x0000040000040400), CONST64(0x0000040100040400), CONST64(0x0000040004040400), CONST64(0x0000040104040400), + CONST64(0x0000040000000004), CONST64(0x0000040100000004), CONST64(0x0000040004000004), CONST64(0x0000040104000004), + CONST64(0x0000040000040004), CONST64(0x0000040100040004), CONST64(0x0000040004040004), CONST64(0x0000040104040004), + CONST64(0x0000040000000404), CONST64(0x0000040100000404), CONST64(0x0000040004000404), CONST64(0x0000040104000404), + CONST64(0x0000040000040404), CONST64(0x0000040100040404), CONST64(0x0000040004040404), CONST64(0x0000040104040404), + CONST64(0x0400040000000000), CONST64(0x0400040100000000), CONST64(0x0400040004000000), CONST64(0x0400040104000000), + CONST64(0x0400040000040000), CONST64(0x0400040100040000), CONST64(0x0400040004040000), CONST64(0x0400040104040000), + CONST64(0x0400040000000400), CONST64(0x0400040100000400), CONST64(0x0400040004000400), CONST64(0x0400040104000400), + CONST64(0x0400040000040400), CONST64(0x0400040100040400), CONST64(0x0400040004040400), CONST64(0x0400040104040400), + CONST64(0x0400040000000004), CONST64(0x0400040100000004), CONST64(0x0400040004000004), CONST64(0x0400040104000004), + CONST64(0x0400040000040004), CONST64(0x0400040100040004), CONST64(0x0400040004040004), CONST64(0x0400040104040004), + CONST64(0x0400040000000404), CONST64(0x0400040100000404), CONST64(0x0400040004000404), CONST64(0x0400040104000404), + CONST64(0x0400040000040404), CONST64(0x0400040100040404), CONST64(0x0400040004040404), CONST64(0x0400040104040404), + CONST64(0x0004040000000000), CONST64(0x0004040100000000), CONST64(0x0004040004000000), CONST64(0x0004040104000000), + CONST64(0x0004040000040000), CONST64(0x0004040100040000), CONST64(0x0004040004040000), CONST64(0x0004040104040000), + CONST64(0x0004040000000400), CONST64(0x0004040100000400), CONST64(0x0004040004000400), CONST64(0x0004040104000400), + CONST64(0x0004040000040400), CONST64(0x0004040100040400), CONST64(0x0004040004040400), CONST64(0x0004040104040400), + CONST64(0x0004040000000004), CONST64(0x0004040100000004), CONST64(0x0004040004000004), CONST64(0x0004040104000004), + CONST64(0x0004040000040004), CONST64(0x0004040100040004), CONST64(0x0004040004040004), CONST64(0x0004040104040004), + CONST64(0x0004040000000404), CONST64(0x0004040100000404), CONST64(0x0004040004000404), CONST64(0x0004040104000404), + CONST64(0x0004040000040404), CONST64(0x0004040100040404), CONST64(0x0004040004040404), CONST64(0x0004040104040404), + CONST64(0x0404040000000000), CONST64(0x0404040100000000), CONST64(0x0404040004000000), CONST64(0x0404040104000000), + CONST64(0x0404040000040000), CONST64(0x0404040100040000), CONST64(0x0404040004040000), CONST64(0x0404040104040000), + CONST64(0x0404040000000400), CONST64(0x0404040100000400), CONST64(0x0404040004000400), CONST64(0x0404040104000400), + CONST64(0x0404040000040400), CONST64(0x0404040100040400), CONST64(0x0404040004040400), CONST64(0x0404040104040400), + CONST64(0x0404040000000004), CONST64(0x0404040100000004), CONST64(0x0404040004000004), CONST64(0x0404040104000004), + CONST64(0x0404040000040004), CONST64(0x0404040100040004), CONST64(0x0404040004040004), CONST64(0x0404040104040004), + CONST64(0x0404040000000404), CONST64(0x0404040100000404), CONST64(0x0404040004000404), CONST64(0x0404040104000404), + CONST64(0x0404040000040404), CONST64(0x0404040100040404), CONST64(0x0404040004040404), CONST64(0x0404040104040404) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000400000000), CONST64(0x0000000010000000), CONST64(0x0000000410000000), + CONST64(0x0000000000100000), CONST64(0x0000000400100000), CONST64(0x0000000010100000), CONST64(0x0000000410100000), + CONST64(0x0000000000001000), CONST64(0x0000000400001000), CONST64(0x0000000010001000), CONST64(0x0000000410001000), + CONST64(0x0000000000101000), CONST64(0x0000000400101000), CONST64(0x0000000010101000), CONST64(0x0000000410101000), + CONST64(0x0000000000000010), CONST64(0x0000000400000010), CONST64(0x0000000010000010), CONST64(0x0000000410000010), + CONST64(0x0000000000100010), CONST64(0x0000000400100010), CONST64(0x0000000010100010), CONST64(0x0000000410100010), + CONST64(0x0000000000001010), CONST64(0x0000000400001010), CONST64(0x0000000010001010), CONST64(0x0000000410001010), + CONST64(0x0000000000101010), CONST64(0x0000000400101010), CONST64(0x0000000010101010), CONST64(0x0000000410101010), + CONST64(0x1000000000000000), CONST64(0x1000000400000000), CONST64(0x1000000010000000), CONST64(0x1000000410000000), + CONST64(0x1000000000100000), CONST64(0x1000000400100000), CONST64(0x1000000010100000), CONST64(0x1000000410100000), + CONST64(0x1000000000001000), CONST64(0x1000000400001000), CONST64(0x1000000010001000), CONST64(0x1000000410001000), + CONST64(0x1000000000101000), CONST64(0x1000000400101000), CONST64(0x1000000010101000), CONST64(0x1000000410101000), + CONST64(0x1000000000000010), CONST64(0x1000000400000010), CONST64(0x1000000010000010), CONST64(0x1000000410000010), + CONST64(0x1000000000100010), CONST64(0x1000000400100010), CONST64(0x1000000010100010), CONST64(0x1000000410100010), + CONST64(0x1000000000001010), CONST64(0x1000000400001010), CONST64(0x1000000010001010), CONST64(0x1000000410001010), + CONST64(0x1000000000101010), CONST64(0x1000000400101010), CONST64(0x1000000010101010), CONST64(0x1000000410101010), + CONST64(0x0010000000000000), CONST64(0x0010000400000000), CONST64(0x0010000010000000), CONST64(0x0010000410000000), + CONST64(0x0010000000100000), CONST64(0x0010000400100000), CONST64(0x0010000010100000), CONST64(0x0010000410100000), + CONST64(0x0010000000001000), CONST64(0x0010000400001000), CONST64(0x0010000010001000), CONST64(0x0010000410001000), + CONST64(0x0010000000101000), CONST64(0x0010000400101000), CONST64(0x0010000010101000), CONST64(0x0010000410101000), + CONST64(0x0010000000000010), CONST64(0x0010000400000010), CONST64(0x0010000010000010), CONST64(0x0010000410000010), + CONST64(0x0010000000100010), CONST64(0x0010000400100010), CONST64(0x0010000010100010), CONST64(0x0010000410100010), + CONST64(0x0010000000001010), CONST64(0x0010000400001010), CONST64(0x0010000010001010), CONST64(0x0010000410001010), + CONST64(0x0010000000101010), CONST64(0x0010000400101010), CONST64(0x0010000010101010), CONST64(0x0010000410101010), + CONST64(0x1010000000000000), CONST64(0x1010000400000000), CONST64(0x1010000010000000), CONST64(0x1010000410000000), + CONST64(0x1010000000100000), CONST64(0x1010000400100000), CONST64(0x1010000010100000), CONST64(0x1010000410100000), + CONST64(0x1010000000001000), CONST64(0x1010000400001000), CONST64(0x1010000010001000), CONST64(0x1010000410001000), + CONST64(0x1010000000101000), CONST64(0x1010000400101000), CONST64(0x1010000010101000), CONST64(0x1010000410101000), + CONST64(0x1010000000000010), CONST64(0x1010000400000010), CONST64(0x1010000010000010), CONST64(0x1010000410000010), + CONST64(0x1010000000100010), CONST64(0x1010000400100010), CONST64(0x1010000010100010), CONST64(0x1010000410100010), + CONST64(0x1010000000001010), CONST64(0x1010000400001010), CONST64(0x1010000010001010), CONST64(0x1010000410001010), + CONST64(0x1010000000101010), CONST64(0x1010000400101010), CONST64(0x1010000010101010), CONST64(0x1010000410101010), + CONST64(0x0000100000000000), CONST64(0x0000100400000000), CONST64(0x0000100010000000), CONST64(0x0000100410000000), + CONST64(0x0000100000100000), CONST64(0x0000100400100000), CONST64(0x0000100010100000), CONST64(0x0000100410100000), + CONST64(0x0000100000001000), CONST64(0x0000100400001000), CONST64(0x0000100010001000), CONST64(0x0000100410001000), + CONST64(0x0000100000101000), CONST64(0x0000100400101000), CONST64(0x0000100010101000), CONST64(0x0000100410101000), + CONST64(0x0000100000000010), CONST64(0x0000100400000010), CONST64(0x0000100010000010), CONST64(0x0000100410000010), + CONST64(0x0000100000100010), CONST64(0x0000100400100010), CONST64(0x0000100010100010), CONST64(0x0000100410100010), + CONST64(0x0000100000001010), CONST64(0x0000100400001010), CONST64(0x0000100010001010), CONST64(0x0000100410001010), + CONST64(0x0000100000101010), CONST64(0x0000100400101010), CONST64(0x0000100010101010), CONST64(0x0000100410101010), + CONST64(0x1000100000000000), CONST64(0x1000100400000000), CONST64(0x1000100010000000), CONST64(0x1000100410000000), + CONST64(0x1000100000100000), CONST64(0x1000100400100000), CONST64(0x1000100010100000), CONST64(0x1000100410100000), + CONST64(0x1000100000001000), CONST64(0x1000100400001000), CONST64(0x1000100010001000), CONST64(0x1000100410001000), + CONST64(0x1000100000101000), CONST64(0x1000100400101000), CONST64(0x1000100010101000), CONST64(0x1000100410101000), + CONST64(0x1000100000000010), CONST64(0x1000100400000010), CONST64(0x1000100010000010), CONST64(0x1000100410000010), + CONST64(0x1000100000100010), CONST64(0x1000100400100010), CONST64(0x1000100010100010), CONST64(0x1000100410100010), + CONST64(0x1000100000001010), CONST64(0x1000100400001010), CONST64(0x1000100010001010), CONST64(0x1000100410001010), + CONST64(0x1000100000101010), CONST64(0x1000100400101010), CONST64(0x1000100010101010), CONST64(0x1000100410101010), + CONST64(0x0010100000000000), CONST64(0x0010100400000000), CONST64(0x0010100010000000), CONST64(0x0010100410000000), + CONST64(0x0010100000100000), CONST64(0x0010100400100000), CONST64(0x0010100010100000), CONST64(0x0010100410100000), + CONST64(0x0010100000001000), CONST64(0x0010100400001000), CONST64(0x0010100010001000), CONST64(0x0010100410001000), + CONST64(0x0010100000101000), CONST64(0x0010100400101000), CONST64(0x0010100010101000), CONST64(0x0010100410101000), + CONST64(0x0010100000000010), CONST64(0x0010100400000010), CONST64(0x0010100010000010), CONST64(0x0010100410000010), + CONST64(0x0010100000100010), CONST64(0x0010100400100010), CONST64(0x0010100010100010), CONST64(0x0010100410100010), + CONST64(0x0010100000001010), CONST64(0x0010100400001010), CONST64(0x0010100010001010), CONST64(0x0010100410001010), + CONST64(0x0010100000101010), CONST64(0x0010100400101010), CONST64(0x0010100010101010), CONST64(0x0010100410101010), + CONST64(0x1010100000000000), CONST64(0x1010100400000000), CONST64(0x1010100010000000), CONST64(0x1010100410000000), + CONST64(0x1010100000100000), CONST64(0x1010100400100000), CONST64(0x1010100010100000), CONST64(0x1010100410100000), + CONST64(0x1010100000001000), CONST64(0x1010100400001000), CONST64(0x1010100010001000), CONST64(0x1010100410001000), + CONST64(0x1010100000101000), CONST64(0x1010100400101000), CONST64(0x1010100010101000), CONST64(0x1010100410101000), + CONST64(0x1010100000000010), CONST64(0x1010100400000010), CONST64(0x1010100010000010), CONST64(0x1010100410000010), + CONST64(0x1010100000100010), CONST64(0x1010100400100010), CONST64(0x1010100010100010), CONST64(0x1010100410100010), + CONST64(0x1010100000001010), CONST64(0x1010100400001010), CONST64(0x1010100010001010), CONST64(0x1010100410001010), + CONST64(0x1010100000101010), CONST64(0x1010100400101010), CONST64(0x1010100010101010), CONST64(0x1010100410101010) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000001000000000), CONST64(0x0000000040000000), CONST64(0x0000001040000000), + CONST64(0x0000000000400000), CONST64(0x0000001000400000), CONST64(0x0000000040400000), CONST64(0x0000001040400000), + CONST64(0x0000000000004000), CONST64(0x0000001000004000), CONST64(0x0000000040004000), CONST64(0x0000001040004000), + CONST64(0x0000000000404000), CONST64(0x0000001000404000), CONST64(0x0000000040404000), CONST64(0x0000001040404000), + CONST64(0x0000000000000040), CONST64(0x0000001000000040), CONST64(0x0000000040000040), CONST64(0x0000001040000040), + CONST64(0x0000000000400040), CONST64(0x0000001000400040), CONST64(0x0000000040400040), CONST64(0x0000001040400040), + CONST64(0x0000000000004040), CONST64(0x0000001000004040), CONST64(0x0000000040004040), CONST64(0x0000001040004040), + CONST64(0x0000000000404040), CONST64(0x0000001000404040), CONST64(0x0000000040404040), CONST64(0x0000001040404040), + CONST64(0x4000000000000000), CONST64(0x4000001000000000), CONST64(0x4000000040000000), CONST64(0x4000001040000000), + CONST64(0x4000000000400000), CONST64(0x4000001000400000), CONST64(0x4000000040400000), CONST64(0x4000001040400000), + CONST64(0x4000000000004000), CONST64(0x4000001000004000), CONST64(0x4000000040004000), CONST64(0x4000001040004000), + CONST64(0x4000000000404000), CONST64(0x4000001000404000), CONST64(0x4000000040404000), CONST64(0x4000001040404000), + CONST64(0x4000000000000040), CONST64(0x4000001000000040), CONST64(0x4000000040000040), CONST64(0x4000001040000040), + CONST64(0x4000000000400040), CONST64(0x4000001000400040), CONST64(0x4000000040400040), CONST64(0x4000001040400040), + CONST64(0x4000000000004040), CONST64(0x4000001000004040), CONST64(0x4000000040004040), CONST64(0x4000001040004040), + CONST64(0x4000000000404040), CONST64(0x4000001000404040), CONST64(0x4000000040404040), CONST64(0x4000001040404040), + CONST64(0x0040000000000000), CONST64(0x0040001000000000), CONST64(0x0040000040000000), CONST64(0x0040001040000000), + CONST64(0x0040000000400000), CONST64(0x0040001000400000), CONST64(0x0040000040400000), CONST64(0x0040001040400000), + CONST64(0x0040000000004000), CONST64(0x0040001000004000), CONST64(0x0040000040004000), CONST64(0x0040001040004000), + CONST64(0x0040000000404000), CONST64(0x0040001000404000), CONST64(0x0040000040404000), CONST64(0x0040001040404000), + CONST64(0x0040000000000040), CONST64(0x0040001000000040), CONST64(0x0040000040000040), CONST64(0x0040001040000040), + CONST64(0x0040000000400040), CONST64(0x0040001000400040), CONST64(0x0040000040400040), CONST64(0x0040001040400040), + CONST64(0x0040000000004040), CONST64(0x0040001000004040), CONST64(0x0040000040004040), CONST64(0x0040001040004040), + CONST64(0x0040000000404040), CONST64(0x0040001000404040), CONST64(0x0040000040404040), CONST64(0x0040001040404040), + CONST64(0x4040000000000000), CONST64(0x4040001000000000), CONST64(0x4040000040000000), CONST64(0x4040001040000000), + CONST64(0x4040000000400000), CONST64(0x4040001000400000), CONST64(0x4040000040400000), CONST64(0x4040001040400000), + CONST64(0x4040000000004000), CONST64(0x4040001000004000), CONST64(0x4040000040004000), CONST64(0x4040001040004000), + CONST64(0x4040000000404000), CONST64(0x4040001000404000), CONST64(0x4040000040404000), CONST64(0x4040001040404000), + CONST64(0x4040000000000040), CONST64(0x4040001000000040), CONST64(0x4040000040000040), CONST64(0x4040001040000040), + CONST64(0x4040000000400040), CONST64(0x4040001000400040), CONST64(0x4040000040400040), CONST64(0x4040001040400040), + CONST64(0x4040000000004040), CONST64(0x4040001000004040), CONST64(0x4040000040004040), CONST64(0x4040001040004040), + CONST64(0x4040000000404040), CONST64(0x4040001000404040), CONST64(0x4040000040404040), CONST64(0x4040001040404040), + CONST64(0x0000400000000000), CONST64(0x0000401000000000), CONST64(0x0000400040000000), CONST64(0x0000401040000000), + CONST64(0x0000400000400000), CONST64(0x0000401000400000), CONST64(0x0000400040400000), CONST64(0x0000401040400000), + CONST64(0x0000400000004000), CONST64(0x0000401000004000), CONST64(0x0000400040004000), CONST64(0x0000401040004000), + CONST64(0x0000400000404000), CONST64(0x0000401000404000), CONST64(0x0000400040404000), CONST64(0x0000401040404000), + CONST64(0x0000400000000040), CONST64(0x0000401000000040), CONST64(0x0000400040000040), CONST64(0x0000401040000040), + CONST64(0x0000400000400040), CONST64(0x0000401000400040), CONST64(0x0000400040400040), CONST64(0x0000401040400040), + CONST64(0x0000400000004040), CONST64(0x0000401000004040), CONST64(0x0000400040004040), CONST64(0x0000401040004040), + CONST64(0x0000400000404040), CONST64(0x0000401000404040), CONST64(0x0000400040404040), CONST64(0x0000401040404040), + CONST64(0x4000400000000000), CONST64(0x4000401000000000), CONST64(0x4000400040000000), CONST64(0x4000401040000000), + CONST64(0x4000400000400000), CONST64(0x4000401000400000), CONST64(0x4000400040400000), CONST64(0x4000401040400000), + CONST64(0x4000400000004000), CONST64(0x4000401000004000), CONST64(0x4000400040004000), CONST64(0x4000401040004000), + CONST64(0x4000400000404000), CONST64(0x4000401000404000), CONST64(0x4000400040404000), CONST64(0x4000401040404000), + CONST64(0x4000400000000040), CONST64(0x4000401000000040), CONST64(0x4000400040000040), CONST64(0x4000401040000040), + CONST64(0x4000400000400040), CONST64(0x4000401000400040), CONST64(0x4000400040400040), CONST64(0x4000401040400040), + CONST64(0x4000400000004040), CONST64(0x4000401000004040), CONST64(0x4000400040004040), CONST64(0x4000401040004040), + CONST64(0x4000400000404040), CONST64(0x4000401000404040), CONST64(0x4000400040404040), CONST64(0x4000401040404040), + CONST64(0x0040400000000000), CONST64(0x0040401000000000), CONST64(0x0040400040000000), CONST64(0x0040401040000000), + CONST64(0x0040400000400000), CONST64(0x0040401000400000), CONST64(0x0040400040400000), CONST64(0x0040401040400000), + CONST64(0x0040400000004000), CONST64(0x0040401000004000), CONST64(0x0040400040004000), CONST64(0x0040401040004000), + CONST64(0x0040400000404000), CONST64(0x0040401000404000), CONST64(0x0040400040404000), CONST64(0x0040401040404000), + CONST64(0x0040400000000040), CONST64(0x0040401000000040), CONST64(0x0040400040000040), CONST64(0x0040401040000040), + CONST64(0x0040400000400040), CONST64(0x0040401000400040), CONST64(0x0040400040400040), CONST64(0x0040401040400040), + CONST64(0x0040400000004040), CONST64(0x0040401000004040), CONST64(0x0040400040004040), CONST64(0x0040401040004040), + CONST64(0x0040400000404040), CONST64(0x0040401000404040), CONST64(0x0040400040404040), CONST64(0x0040401040404040), + CONST64(0x4040400000000000), CONST64(0x4040401000000000), CONST64(0x4040400040000000), CONST64(0x4040401040000000), + CONST64(0x4040400000400000), CONST64(0x4040401000400000), CONST64(0x4040400040400000), CONST64(0x4040401040400000), + CONST64(0x4040400000004000), CONST64(0x4040401000004000), CONST64(0x4040400040004000), CONST64(0x4040401040004000), + CONST64(0x4040400000404000), CONST64(0x4040401000404000), CONST64(0x4040400040404000), CONST64(0x4040401040404000), + CONST64(0x4040400000000040), CONST64(0x4040401000000040), CONST64(0x4040400040000040), CONST64(0x4040401040000040), + CONST64(0x4040400000400040), CONST64(0x4040401000400040), CONST64(0x4040400040400040), CONST64(0x4040401040400040), + CONST64(0x4040400000004040), CONST64(0x4040401000004040), CONST64(0x4040400040004040), CONST64(0x4040401040004040), + CONST64(0x4040400000404040), CONST64(0x4040401000404040), CONST64(0x4040400040404040), CONST64(0x4040401040404040) + }}; + +#endif + + +static void cookey(const ulong32 *raw1, ulong32 *keyout); + +#ifdef LTC_CLEAN_STACK +static void _deskey(const unsigned char *key, short edf, ulong32 *keyout) +#else +static void deskey(const unsigned char *key, short edf, ulong32 *keyout) +#endif +{ + ulong32 i, j, l, m, n, kn[32]; + unsigned char pc1m[56], pcr[56]; + + for (j=0; j < 56; j++) { + l = (ulong32)pc1[j]; + m = l & 7; + pc1m[j] = (unsigned char)((key[l >> 3U] & bytebit[m]) == bytebit[m] ? 1 : 0); + } + + for (i=0; i < 16; i++) { + if (edf == DE1) { + m = (15 - i) << 1; + } else { + m = i << 1; + } + n = m + 1; + kn[m] = kn[n] = 0L; + for (j=0; j < 28; j++) { + l = j + (ulong32)totrot[i]; + if (l < 28) { + pcr[j] = pc1m[l]; + } else { + pcr[j] = pc1m[l - 28]; + } + } + for (/*j = 28*/; j < 56; j++) { + l = j + (ulong32)totrot[i]; + if (l < 56) { + pcr[j] = pc1m[l]; + } else { + pcr[j] = pc1m[l - 28]; + } + } + for (j=0; j < 24; j++) { + if ((int)pcr[(int)pc2[j]] != 0) { + kn[m] |= bigbyte[j]; + } + if ((int)pcr[(int)pc2[j+24]] != 0) { + kn[n] |= bigbyte[j]; + } + } + } + + cookey(kn, keyout); +} + +#ifdef LTC_CLEAN_STACK +static void deskey(const unsigned char *key, short edf, ulong32 *keyout) +{ + _deskey(key, edf, keyout); + burn_stack(sizeof(int)*5 + sizeof(ulong32)*32 + sizeof(unsigned char)*112); +} +#endif + +#ifdef LTC_CLEAN_STACK +static void _cookey(const ulong32 *raw1, ulong32 *keyout) +#else +static void cookey(const ulong32 *raw1, ulong32 *keyout) +#endif +{ + ulong32 *cook; + const ulong32 *raw0; + ulong32 dough[32]; + int i; + + cook = dough; + for(i=0; i < 16; i++, raw1++) + { + raw0 = raw1++; + *cook = (*raw0 & 0x00fc0000L) << 6; + *cook |= (*raw0 & 0x00000fc0L) << 10; + *cook |= (*raw1 & 0x00fc0000L) >> 10; + *cook++ |= (*raw1 & 0x00000fc0L) >> 6; + *cook = (*raw0 & 0x0003f000L) << 12; + *cook |= (*raw0 & 0x0000003fL) << 16; + *cook |= (*raw1 & 0x0003f000L) >> 4; + *cook++ |= (*raw1 & 0x0000003fL); + } + + XMEMCPY(keyout, dough, sizeof dough); +} + +#ifdef LTC_CLEAN_STACK +static void cookey(const ulong32 *raw1, ulong32 *keyout) +{ + _cookey(raw1, keyout); + burn_stack(sizeof(ulong32 *) * 2 + sizeof(ulong32)*32 + sizeof(int)); +} +#endif + +#ifndef LTC_CLEAN_STACK +static void desfunc(ulong32 *block, const ulong32 *keys) +#else +static void _desfunc(ulong32 *block, const ulong32 *keys) +#endif +{ + ulong32 work, right, leftt; + int cur_round; + + leftt = block[0]; + right = block[1]; + +#ifdef LTC_SMALL_CODE + work = ((leftt >> 4) ^ right) & 0x0f0f0f0fL; + right ^= work; + leftt ^= (work << 4); + + work = ((leftt >> 16) ^ right) & 0x0000ffffL; + right ^= work; + leftt ^= (work << 16); + + work = ((right >> 2) ^ leftt) & 0x33333333L; + leftt ^= work; + right ^= (work << 2); + + work = ((right >> 8) ^ leftt) & 0x00ff00ffL; + leftt ^= work; + right ^= (work << 8); + + right = ROLc(right, 1); + work = (leftt ^ right) & 0xaaaaaaaaL; + + leftt ^= work; + right ^= work; + leftt = ROLc(leftt, 1); +#else + { + ulong64 tmp; + tmp = des_ip[0][byte(leftt, 0)] ^ + des_ip[1][byte(leftt, 1)] ^ + des_ip[2][byte(leftt, 2)] ^ + des_ip[3][byte(leftt, 3)] ^ + des_ip[4][byte(right, 0)] ^ + des_ip[5][byte(right, 1)] ^ + des_ip[6][byte(right, 2)] ^ + des_ip[7][byte(right, 3)]; + leftt = (ulong32)(tmp >> 32); + right = (ulong32)(tmp & 0xFFFFFFFFUL); + } +#endif + + for (cur_round = 0; cur_round < 8; cur_round++) { + work = RORc(right, 4) ^ *keys++; + leftt ^= SP7[work & 0x3fL] + ^ SP5[(work >> 8) & 0x3fL] + ^ SP3[(work >> 16) & 0x3fL] + ^ SP1[(work >> 24) & 0x3fL]; + work = right ^ *keys++; + leftt ^= SP8[ work & 0x3fL] + ^ SP6[(work >> 8) & 0x3fL] + ^ SP4[(work >> 16) & 0x3fL] + ^ SP2[(work >> 24) & 0x3fL]; + + work = RORc(leftt, 4) ^ *keys++; + right ^= SP7[ work & 0x3fL] + ^ SP5[(work >> 8) & 0x3fL] + ^ SP3[(work >> 16) & 0x3fL] + ^ SP1[(work >> 24) & 0x3fL]; + work = leftt ^ *keys++; + right ^= SP8[ work & 0x3fL] + ^ SP6[(work >> 8) & 0x3fL] + ^ SP4[(work >> 16) & 0x3fL] + ^ SP2[(work >> 24) & 0x3fL]; + } + +#ifdef LTC_SMALL_CODE + right = RORc(right, 1); + work = (leftt ^ right) & 0xaaaaaaaaL; + leftt ^= work; + right ^= work; + leftt = RORc(leftt, 1); + work = ((leftt >> 8) ^ right) & 0x00ff00ffL; + right ^= work; + leftt ^= (work << 8); + /* -- */ + work = ((leftt >> 2) ^ right) & 0x33333333L; + right ^= work; + leftt ^= (work << 2); + work = ((right >> 16) ^ leftt) & 0x0000ffffL; + leftt ^= work; + right ^= (work << 16); + work = ((right >> 4) ^ leftt) & 0x0f0f0f0fL; + leftt ^= work; + right ^= (work << 4); +#else + { + ulong64 tmp; + tmp = des_fp[0][byte(leftt, 0)] ^ + des_fp[1][byte(leftt, 1)] ^ + des_fp[2][byte(leftt, 2)] ^ + des_fp[3][byte(leftt, 3)] ^ + des_fp[4][byte(right, 0)] ^ + des_fp[5][byte(right, 1)] ^ + des_fp[6][byte(right, 2)] ^ + des_fp[7][byte(right, 3)]; + leftt = (ulong32)(tmp >> 32); + right = (ulong32)(tmp & 0xFFFFFFFFUL); + } +#endif + + block[0] = right; + block[1] = leftt; +} + +#ifdef LTC_CLEAN_STACK +static void desfunc(ulong32 *block, const ulong32 *keys) +{ + _desfunc(block, keys); + burn_stack(sizeof(ulong32) * 4 + sizeof(int)); +} +#endif + + /** + Initialize the LTC_DES block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int des_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (num_rounds != 0 && num_rounds != 16) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 8) { + return CRYPT_INVALID_KEYSIZE; + } + + deskey(key, EN0, skey->des.ek); + deskey(key, DE1, skey->des.dk); + + return CRYPT_OK; +} + + /** + Initialize the 3LTC_DES-EDE block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if(num_rounds != 0 && num_rounds != 16) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 24 && keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } + + deskey(key, EN0, skey->des3.ek[0]); + deskey(key+8, DE1, skey->des3.ek[1]); + if (keylen == 24) { + deskey(key+16, EN0, skey->des3.ek[2]); + } else { + /* two-key 3DES: K3=K1 */ + deskey(key, EN0, skey->des3.ek[2]); + } + + deskey(key, DE1, skey->des3.dk[2]); + deskey(key+8, EN0, skey->des3.dk[1]); + if (keylen == 24) { + deskey(key+16, DE1, skey->des3.dk[0]); + } else { + /* two-key 3DES: K3=K1 */ + deskey(key, DE1, skey->des3.dk[0]); + } + + return CRYPT_OK; +} + +/** + Encrypts a block of text with LTC_DES + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int des_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + ulong32 work[2]; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + LOAD32H(work[0], pt+0); + LOAD32H(work[1], pt+4); + desfunc(work, skey->des.ek); + STORE32H(work[0],ct+0); + STORE32H(work[1],ct+4); + return CRYPT_OK; +} + +/** + Decrypts a block of text with LTC_DES + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int des_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + ulong32 work[2]; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + LOAD32H(work[0], ct+0); + LOAD32H(work[1], ct+4); + desfunc(work, skey->des.dk); + STORE32H(work[0],pt+0); + STORE32H(work[1],pt+4); + return CRYPT_OK; +} + +/** + Encrypts a block of text with 3LTC_DES-EDE + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int des3_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + ulong32 work[2]; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + LOAD32H(work[0], pt+0); + LOAD32H(work[1], pt+4); + desfunc(work, skey->des3.ek[0]); + desfunc(work, skey->des3.ek[1]); + desfunc(work, skey->des3.ek[2]); + STORE32H(work[0],ct+0); + STORE32H(work[1],ct+4); + return CRYPT_OK; +} + +/** + Decrypts a block of text with 3LTC_DES-EDE + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int des3_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + ulong32 work[2]; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + LOAD32H(work[0], ct+0); + LOAD32H(work[1], ct+4); + desfunc(work, skey->des3.dk[0]); + desfunc(work, skey->des3.dk[1]); + desfunc(work, skey->des3.dk[2]); + STORE32H(work[0],pt+0); + STORE32H(work[1],pt+4); + return CRYPT_OK; +} + +/** + Performs a self-test of the LTC_DES block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int des_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + int err; + static const struct des_test_case { + int num, mode; /* mode 1 = encrypt */ + unsigned char key[8], txt[8], out[8]; + } cases[] = { + { 1, 1, { 0x10, 0x31, 0x6E, 0x02, 0x8C, 0x8F, 0x3B, 0x4A }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x82, 0xDC, 0xBA, 0xFB, 0xDE, 0xAB, 0x66, 0x02 } }, + { 2, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x95, 0xF8, 0xA5, 0xE5, 0xDD, 0x31, 0xD9, 0x00 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 3, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0xDD, 0x7F, 0x12, 0x1C, 0xA5, 0x01, 0x56, 0x19 }, + { 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 4, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x2E, 0x86, 0x53, 0x10, 0x4F, 0x38, 0x34, 0xEA }, + { 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 5, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x4B, 0xD3, 0x88, 0xFF, 0x6C, 0xD8, 0x1D, 0x4F }, + { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 6, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x20, 0xB9, 0xE7, 0x67, 0xB2, 0xFB, 0x14, 0x56 }, + { 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 7, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x55, 0x57, 0x93, 0x80, 0xD7, 0x71, 0x38, 0xEF }, + { 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 8, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x6C, 0xC5, 0xDE, 0xFA, 0xAF, 0x04, 0x51, 0x2F }, + { 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 9, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x0D, 0x9F, 0x27, 0x9B, 0xA5, 0xD8, 0x72, 0x60 }, + { 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + {10, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0xD9, 0x03, 0x1B, 0x02, 0x71, 0xBD, 0x5A, 0x0A }, + { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + + { 1, 0, { 0x10, 0x31, 0x6E, 0x02, 0x8C, 0x8F, 0x3B, 0x4A }, + { 0x82, 0xDC, 0xBA, 0xFB, 0xDE, 0xAB, 0x66, 0x02 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 2, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x95, 0xF8, 0xA5, 0xE5, 0xDD, 0x31, 0xD9, 0x00 } }, + { 3, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDD, 0x7F, 0x12, 0x1C, 0xA5, 0x01, 0x56, 0x19 } }, + { 4, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x2E, 0x86, 0x53, 0x10, 0x4F, 0x38, 0x34, 0xEA } }, + { 5, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x4B, 0xD3, 0x88, 0xFF, 0x6C, 0xD8, 0x1D, 0x4F } }, + { 6, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x20, 0xB9, 0xE7, 0x67, 0xB2, 0xFB, 0x14, 0x56 } }, + { 7, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x55, 0x57, 0x93, 0x80, 0xD7, 0x71, 0x38, 0xEF } }, + { 8, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x6C, 0xC5, 0xDE, 0xFA, 0xAF, 0x04, 0x51, 0x2F } }, + { 9, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x0D, 0x9F, 0x27, 0x9B, 0xA5, 0xD8, 0x72, 0x60 } }, + {10, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xD9, 0x03, 0x1B, 0x02, 0x71, 0xBD, 0x5A, 0x0A } }, + +#ifdef LTC_TEST_EXT + { 0+11, 0, { 0x80, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x95, 0xA8, 0xD7, 0x28, 0x13, 0xDA, 0xA9, 0x4D } }, + { 1+11, 0, { 0x40, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x0E, 0xEC, 0x14, 0x87, 0xDD, 0x8C, 0x26, 0xD5 } }, + { 2+11, 0, { 0x20, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x7A, 0xD1, 0x6F, 0xFB, 0x79, 0xC4, 0x59, 0x26 } }, + { 3+11, 0, { 0x10, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xD3, 0x74, 0x62, 0x94, 0xCA, 0x6A, 0x6C, 0xF3 } }, + { 4+11, 0, { 0x08, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x80, 0x9F, 0x5F, 0x87, 0x3C, 0x1F, 0xD7, 0x61 } }, + { 5+11, 0, { 0x04, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xC0, 0x2F, 0xAF, 0xFE, 0xC9, 0x89, 0xD1, 0xFC } }, + { 6+11, 0, { 0x02, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x46, 0x15, 0xAA, 0x1D, 0x33, 0xE7, 0x2F, 0x10 } }, + { 7+11, 0, { 0x01, 0x80, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x20, 0x55, 0x12, 0x33, 0x50, 0xC0, 0x08, 0x58 } }, + { 8+11, 0, { 0x01, 0x40, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDF, 0x3B, 0x99, 0xD6, 0x57, 0x73, 0x97, 0xC8 } }, + { 9+11, 0, { 0x01, 0x20, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x31, 0xFE, 0x17, 0x36, 0x9B, 0x52, 0x88, 0xC9 } }, + {10+11, 0, { 0x01, 0x10, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDF, 0xDD, 0x3C, 0xC6, 0x4D, 0xAE, 0x16, 0x42 } }, + {11+11, 0, { 0x01, 0x08, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x17, 0x8C, 0x83, 0xCE, 0x2B, 0x39, 0x9D, 0x94 } }, + {12+11, 0, { 0x01, 0x04, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x50, 0xF6, 0x36, 0x32, 0x4A, 0x9B, 0x7F, 0x80 } }, + {13+11, 0, { 0x01, 0x02, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA8, 0x46, 0x8E, 0xE3, 0xBC, 0x18, 0xF0, 0x6D } }, + {14+11, 0, { 0x01, 0x01, 0x80, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA2, 0xDC, 0x9E, 0x92, 0xFD, 0x3C, 0xDE, 0x92 } }, + {15+11, 0, { 0x01, 0x01, 0x40, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xCA, 0xC0, 0x9F, 0x79, 0x7D, 0x03, 0x12, 0x87 } }, + {16+11, 0, { 0x01, 0x01, 0x20, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x90, 0xBA, 0x68, 0x0B, 0x22, 0xAE, 0xB5, 0x25 } }, + {17+11, 0, { 0x01, 0x01, 0x10, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xCE, 0x7A, 0x24, 0xF3, 0x50, 0xE2, 0x80, 0xB6 } }, + {18+11, 0, { 0x01, 0x01, 0x08, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x88, 0x2B, 0xFF, 0x0A, 0xA0, 0x1A, 0x0B, 0x87 } }, + {19+11, 0, { 0x01, 0x01, 0x04, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x25, 0x61, 0x02, 0x88, 0x92, 0x45, 0x11, 0xC2 } }, + {20+11, 0, { 0x01, 0x01, 0x02, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xC7, 0x15, 0x16, 0xC2, 0x9C, 0x75, 0xD1, 0x70 } }, + {21+11, 0, { 0x01, 0x01, 0x01, 0x80, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x51, 0x99, 0xC2, 0x9A, 0x52, 0xC9, 0xF0, 0x59 } }, + {22+11, 0, { 0x01, 0x01, 0x01, 0x40, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xC2, 0x2F, 0x0A, 0x29, 0x4A, 0x71, 0xF2, 0x9F } }, + {23+11, 0, { 0x01, 0x01, 0x01, 0x20, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xEE, 0x37, 0x14, 0x83, 0x71, 0x4C, 0x02, 0xEA } }, + {24+11, 0, { 0x01, 0x01, 0x01, 0x10, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA8, 0x1F, 0xBD, 0x44, 0x8F, 0x9E, 0x52, 0x2F } }, + {25+11, 0, { 0x01, 0x01, 0x01, 0x08, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x4F, 0x64, 0x4C, 0x92, 0xE1, 0x92, 0xDF, 0xED } }, + {26+11, 0, { 0x01, 0x01, 0x01, 0x04, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x1A, 0xFA, 0x9A, 0x66, 0xA6, 0xDF, 0x92, 0xAE } }, + {27+11, 0, { 0x01, 0x01, 0x01, 0x02, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB3, 0xC1, 0xCC, 0x71, 0x5C, 0xB8, 0x79, 0xD8 } }, + {28+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x80, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x19, 0xD0, 0x32, 0xE6, 0x4A, 0xB0, 0xBD, 0x8B } }, + {29+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x40, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x3C, 0xFA, 0xA7, 0xA7, 0xDC, 0x87, 0x20, 0xDC } }, + {30+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x20, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB7, 0x26, 0x5F, 0x7F, 0x44, 0x7A, 0xC6, 0xF3 } }, + {31+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x10, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x9D, 0xB7, 0x3B, 0x3C, 0x0D, 0x16, 0x3F, 0x54 } }, + {32+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x08, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x81, 0x81, 0xB6, 0x5B, 0xAB, 0xF4, 0xA9, 0x75 } }, + {33+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x04, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x93, 0xC9, 0xB6, 0x40, 0x42, 0xEA, 0xA2, 0x40 } }, + {34+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x02, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x55, 0x70, 0x53, 0x08, 0x29, 0x70, 0x55, 0x92 } }, + {35+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x80, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x86, 0x38, 0x80, 0x9E, 0x87, 0x87, 0x87, 0xA0 } }, + {36+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x40, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x41, 0xB9, 0xA7, 0x9A, 0xF7, 0x9A, 0xC2, 0x08 } }, + {37+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x20, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x7A, 0x9B, 0xE4, 0x2F, 0x20, 0x09, 0xA8, 0x92 } }, + {38+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x10, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x29, 0x03, 0x8D, 0x56, 0xBA, 0x6D, 0x27, 0x45 } }, + {39+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x08, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x54, 0x95, 0xC6, 0xAB, 0xF1, 0xE5, 0xDF, 0x51 } }, + {40+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x04, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xAE, 0x13, 0xDB, 0xD5, 0x61, 0x48, 0x89, 0x33 } }, + {41+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x02, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x02, 0x4D, 0x1F, 0xFA, 0x89, 0x04, 0xE3, 0x89 } }, + {42+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x80, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xD1, 0x39, 0x97, 0x12, 0xF9, 0x9B, 0xF0, 0x2E } }, + {43+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x40, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x14, 0xC1, 0xD7, 0xC1, 0xCF, 0xFE, 0xC7, 0x9E } }, + {44+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x20, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x1D, 0xE5, 0x27, 0x9D, 0xAE, 0x3B, 0xED, 0x6F } }, + {45+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x10, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xE9, 0x41, 0xA3, 0x3F, 0x85, 0x50, 0x13, 0x03 } }, + {46+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x08, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDA, 0x99, 0xDB, 0xBC, 0x9A, 0x03, 0xF3, 0x79 } }, + {47+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x04, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB7, 0xFC, 0x92, 0xF9, 0x1D, 0x8E, 0x92, 0xE9 } }, + {48+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x02, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xAE, 0x8E, 0x5C, 0xAA, 0x3C, 0xA0, 0x4E, 0x85 } }, + {49+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x80 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x9C, 0xC6, 0x2D, 0xF4, 0x3B, 0x6E, 0xED, 0x74 } }, + {50+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x40 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xD8, 0x63, 0xDB, 0xB5, 0xC5, 0x9A, 0x91, 0xA0 } }, + {51+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x20 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA1, 0xAB, 0x21, 0x90, 0x54, 0x5B, 0x91, 0xD7 } }, + {52+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x10 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x08, 0x75, 0x04, 0x1E, 0x64, 0xC5, 0x70, 0xF7 } }, + {53+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x08 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x5A, 0x59, 0x45, 0x28, 0xBE, 0xBE, 0xF1, 0xCC } }, + {54+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x04 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xFC, 0xDB, 0x32, 0x91, 0xDE, 0x21, 0xF0, 0xC0 } }, + {55+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x02 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x86, 0x9E, 0xFD, 0x7F, 0x9F, 0x26, 0x5A, 0x09 } }, +#endif /* LTC_TEST_EXT */ + + /*** more test cases you could add if you are not convinced (the above test cases aren't really too good): + + key plaintext ciphertext + 0000000000000000 0000000000000000 8CA64DE9C1B123A7 + FFFFFFFFFFFFFFFF FFFFFFFFFFFFFFFF 7359B2163E4EDC58 + 3000000000000000 1000000000000001 958E6E627A05557B + 1111111111111111 1111111111111111 F40379AB9E0EC533 + 0123456789ABCDEF 1111111111111111 17668DFC7292532D + 1111111111111111 0123456789ABCDEF 8A5AE1F81AB8F2DD + 0000000000000000 0000000000000000 8CA64DE9C1B123A7 + FEDCBA9876543210 0123456789ABCDEF ED39D950FA74BCC4 + 7CA110454A1A6E57 01A1D6D039776742 690F5B0D9A26939B + 0131D9619DC1376E 5CD54CA83DEF57DA 7A389D10354BD271 + 07A1133E4A0B2686 0248D43806F67172 868EBB51CAB4599A + 3849674C2602319E 51454B582DDF440A 7178876E01F19B2A + 04B915BA43FEB5B6 42FD443059577FA2 AF37FB421F8C4095 + 0113B970FD34F2CE 059B5E0851CF143A 86A560F10EC6D85B + 0170F175468FB5E6 0756D8E0774761D2 0CD3DA020021DC09 + 43297FAD38E373FE 762514B829BF486A EA676B2CB7DB2B7A + 07A7137045DA2A16 3BDD119049372802 DFD64A815CAF1A0F + 04689104C2FD3B2F 26955F6835AF609A 5C513C9C4886C088 + 37D06BB516CB7546 164D5E404F275232 0A2AEEAE3FF4AB77 + 1F08260D1AC2465E 6B056E18759F5CCA EF1BF03E5DFA575A + 584023641ABA6176 004BD6EF09176062 88BF0DB6D70DEE56 + 025816164629B007 480D39006EE762F2 A1F9915541020B56 + 49793EBC79B3258F 437540C8698F3CFA 6FBF1CAFCFFD0556 + 4FB05E1515AB73A7 072D43A077075292 2F22E49BAB7CA1AC + 49E95D6D4CA229BF 02FE55778117F12A 5A6B612CC26CCE4A + 018310DC409B26D6 1D9D5C5018F728C2 5F4C038ED12B2E41 + 1C587F1C13924FEF 305532286D6F295A 63FAC0D034D9F793 + 0101010101010101 0123456789ABCDEF 617B3A0CE8F07100 + 1F1F1F1F0E0E0E0E 0123456789ABCDEF DB958605F8C8C606 + E0FEE0FEF1FEF1FE 0123456789ABCDEF EDBFD1C66C29CCC7 + 0000000000000000 FFFFFFFFFFFFFFFF 355550B2150E2451 + FFFFFFFFFFFFFFFF 0000000000000000 CAAAAF4DEAF1DBAE + 0123456789ABCDEF 0000000000000000 D5D44FF720683D0D + FEDCBA9876543210 FFFFFFFFFFFFFFFF 2A2BB008DF97C2F2 + + http://www.ecs.soton.ac.uk/~prw99r/ez438/vectors.txt + ***/ + }; + int i, y; + unsigned char tmp[8]; + symmetric_key des; + + for(i=0; i < (int)(sizeof(cases)/sizeof(cases[0])); i++) + { + if ((err = des_setup(cases[i].key, 8, 0, &des)) != CRYPT_OK) { + return err; + } + if (cases[i].mode != 0) { + des_ecb_encrypt(cases[i].txt, tmp, &des); + } else { + des_ecb_decrypt(cases[i].txt, tmp, &des); + } + + if (XMEMCMP(cases[i].out, tmp, sizeof(tmp)) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) tmp[y] = 0; + for (y = 0; y < 1000; y++) des_ecb_encrypt(tmp, tmp, &des); + for (y = 0; y < 1000; y++) des_ecb_decrypt(tmp, tmp, &des); + for (y = 0; y < 8; y++) if (tmp[y] != 0) return CRYPT_FAIL_TESTVECTOR; +} + + return CRYPT_OK; + #endif +} + +int des3_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + unsigned char key[24], pt[8], ct[8], tmp[8]; + symmetric_key skey; + int x, err; + + if ((err = des_test()) != CRYPT_OK) { + return err; + } + + for (x = 0; x < 8; x++) { + pt[x] = x; + } + + for (x = 0; x < 24; x++) { + key[x] = x; + } + + if ((err = des3_setup(key, 24, 0, &skey)) != CRYPT_OK) { + return err; + } + + des3_ecb_encrypt(pt, ct, &skey); + des3_ecb_decrypt(ct, tmp, &skey); + + if (XMEMCMP(pt, tmp, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void des_done(symmetric_key *skey) +{ + LTC_UNUSED_PARAM(skey); +} + +/** Terminate the context + @param skey The scheduled key +*/ +void des3_done(symmetric_key *skey) +{ + LTC_UNUSED_PARAM(skey); +} + + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int des_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if(*keysize < 8) { + return CRYPT_INVALID_KEYSIZE; + } + *keysize = 8; + return CRYPT_OK; +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int des3_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if(*keysize < 24) { + return CRYPT_INVALID_KEYSIZE; + } + *keysize = 24; + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/des.c,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2007/05/12 14:20:27 $ */ diff --git a/core/lib/libtomcrypt/src/ciphers/sub.mk b/core/lib/libtomcrypt/src/ciphers/sub.mk new file mode 100644 index 0000000..6f1f1aa --- /dev/null +++ b/core/lib/libtomcrypt/src/ciphers/sub.mk @@ -0,0 +1,17 @@ +cflags-y += -Wno-unused-parameter + +ifeq ($(CFG_CRYPTO_AES_ARM64_CE),y) +srcs-y += aes_armv8a_ce.c +cflags-aes_armv8a_ce.c-y += -march=armv8-a+crypto +srcs-y += aes_modes_armv8a_ce_a64.S +aflags-aes_modes_armv8a_ce_a64.S-y += -DINTERLEAVE=4 +else +ifeq ($(CFG_CRYPTO_AES_ARM32_CE),y) +srcs-y += aes_armv8a_ce.c +srcs-y += aes_modes_armv8a_ce_a32.S +else +srcs-$(CFG_CRYPTO_AES) += aes.c +endif +endif + +srcs-$(CFG_CRYPTO_DES) += des.c diff --git a/core/lib/libtomcrypt/src/encauth/ccm/ccm_add_aad.c b/core/lib/libtomcrypt/src/encauth/ccm/ccm_add_aad.c new file mode 100644 index 0000000..03130ea --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ccm/ccm_add_aad.c @@ -0,0 +1,89 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Add AAD to the CCM state + @param ccm The CCM state + @param adata The additional authentication data to add to the CCM state + @param adatalen The length of the AAD data. + @return CRYPT_OK on success + */ +int ccm_add_aad(ccm_state *ccm, + const unsigned char *adata, unsigned long adatalen) +{ + unsigned long y; + int err; + + LTC_ARGCHK(ccm != NULL); + LTC_ARGCHK(adata != NULL); + + if (ccm->aadlen < ccm->current_aadlen + adatalen) { + return CRYPT_INVALID_ARG; + } + ccm->current_aadlen += adatalen; + + /* now add the data */ + for (y = 0; y < adatalen; y++) { + if (ccm->x == 16) { + /* full block so let's encrypt it */ + if ((err = cipher_descriptor[ccm->cipher]->ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return CRYPT_ERROR; + } + ccm->x = 0; + } + ccm->PAD[ccm->x++] ^= adata[y]; + } + + /* remainder? */ + if (ccm->aadlen == ccm->current_aadlen) { + if (ccm->x != 0) { + if ((err = cipher_descriptor[ccm->cipher]->ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return CRYPT_ERROR; + } + } + ccm->x = 0; + } + + return CRYPT_OK; +} + +#endif diff --git a/core/lib/libtomcrypt/src/encauth/ccm/ccm_add_nonce.c b/core/lib/libtomcrypt/src/encauth/ccm/ccm_add_nonce.c new file mode 100644 index 0000000..9097670 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ccm/ccm_add_nonce.c @@ -0,0 +1,139 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Add nonce data to the CCM state + @param ccm The CCM state + @param nonce The nonce data to add + @param noncelen The length of the nonce + @return CRYPT_OK on success + */ +int ccm_add_nonce(ccm_state *ccm, + const unsigned char *nonce, unsigned long noncelen) +{ + unsigned long x, y, len; + int err; + + LTC_ARGCHK(ccm != NULL); + LTC_ARGCHK(nonce != NULL); + + /* increase L to match the nonce len */ + ccm->noncelen = (noncelen > 13) ? 13 : noncelen; + if ((15 - ccm->noncelen) > ccm->L) { + ccm->L = 15 - ccm->noncelen; + } + + /* decrease noncelen to match L */ + if ((ccm->noncelen + ccm->L) > 15) { + ccm->noncelen = 15 - ccm->L; + } + + /* form B_0 == flags | Nonce N | l(m) */ + x = 0; + ccm->PAD[x++] = (unsigned char)(((ccm->aadlen > 0) ? (1<<6) : 0) | + (((ccm->taglen - 2)>>1)<<3) | + (ccm->L-1)); + + /* nonce */ + for (y = 0; y < (16 - (ccm->L + 1)); y++) { + ccm->PAD[x++] = nonce[y]; + } + + /* store len */ + len = ccm->ptlen; + + /* shift len so the upper bytes of len are the contents of the length */ + for (y = ccm->L; y < 4; y++) { + len <<= 8; + } + + /* store l(m) (only store 32-bits) */ + for (y = 0; ccm->L > 4 && (ccm->L-y)>4; y++) { + ccm->PAD[x++] = 0; + } + for (; y < ccm->L; y++) { + ccm->PAD[x++] = (unsigned char)((len >> 24) & 255); + len <<= 8; + } + + /* encrypt PAD */ + if ((err = cipher_descriptor[ccm->cipher]->ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return err; + } + + /* handle header */ + ccm->x = 0; + if (ccm->aadlen > 0) { + /* store length */ + if (ccm->aadlen < ((1UL<<16) - (1UL<<8))) { + ccm->PAD[ccm->x++] ^= (ccm->aadlen>>8) & 255; + ccm->PAD[ccm->x++] ^= ccm->aadlen & 255; + } else { + ccm->PAD[ccm->x++] ^= 0xFF; + ccm->PAD[ccm->x++] ^= 0xFE; + ccm->PAD[ccm->x++] ^= (ccm->aadlen>>24) & 255; + ccm->PAD[ccm->x++] ^= (ccm->aadlen>>16) & 255; + ccm->PAD[ccm->x++] ^= (ccm->aadlen>>8) & 255; + ccm->PAD[ccm->x++] ^= ccm->aadlen & 255; + } + } + + /* setup the ctr counter */ + x = 0; + + /* flags */ + ccm->ctr[x++] = (unsigned char)ccm->L-1; + + /* nonce */ + for (y = 0; y < (16 - (ccm->L+1)); ++y) { + ccm->ctr[x++] = nonce[y]; + } + /* offset */ + while (x < 16) { + ccm->ctr[x++] = 0; + } + + ccm->CTRlen = 16; + return CRYPT_OK; +} + +#endif diff --git a/core/lib/libtomcrypt/src/encauth/ccm/ccm_done.c b/core/lib/libtomcrypt/src/encauth/ccm/ccm_done.c new file mode 100644 index 0000000..7a4e211 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ccm/ccm_done.c @@ -0,0 +1,91 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Terminate a CCM stream + @param ccm The CCM state + @param tag [out] The destination for the MAC tag + @param taglen [in/out] The length of the MAC tag + @return CRYPT_OK on success + */ +int ccm_done(ccm_state *ccm, + unsigned char *tag, unsigned long *taglen) +{ + unsigned long x, y; + int err; + + LTC_ARGCHK(ccm != NULL); + + /* Check all data have been processed */ + if (ccm->ptlen != ccm->current_ptlen) { + return CRYPT_ERROR; + } + + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + if (ccm->x != 0) { + if ((err = cipher_descriptor[ccm->cipher]->ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return err; + } + } + + /* setup CTR for the TAG (zero the count) */ + for (y = 15; y > 15 - ccm->L; y--) { + ccm->ctr[y] = 0x00; + } + if ((err = cipher_descriptor[ccm->cipher]->ecb_encrypt(ccm->ctr, ccm->CTRPAD, &ccm->K)) != CRYPT_OK) { + return err; + } + + cipher_descriptor[ccm->cipher]->done(&ccm->K); + + /* store the TAG */ + for (x = 0; x < 16 && x < *taglen; x++) { + tag[x] = ccm->PAD[x] ^ ccm->CTRPAD[x]; + } + *taglen = x; + + return CRYPT_OK; +} + +#endif diff --git a/core/lib/libtomcrypt/src/encauth/ccm/ccm_init.c b/core/lib/libtomcrypt/src/encauth/ccm/ccm_init.c new file mode 100644 index 0000000..04a38c2 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ccm/ccm_init.c @@ -0,0 +1,107 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Initialize a CCM state + @param ccm The CCM state to initialize + @param cipher The index of the cipher to use + @param key The secret key + @param keylen The length of the secret key + @param ptlen The length of the plain/cipher text that will be processed + @param taglen The max length of the MAC tag + @param aadlen The length of the AAD + + @return CRYPT_OK on success + */ +int ccm_init(ccm_state *ccm, int cipher, + const unsigned char *key, int keylen, int ptlen, int taglen, int aadlen) +{ + int err; + + LTC_ARGCHK(ccm != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(taglen != 0); + + XMEMSET(ccm, 0, sizeof(ccm_state)); + + /* check cipher input */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + if (cipher_descriptor[cipher]->block_length != 16) { + return CRYPT_INVALID_CIPHER; + } + + /* make sure the taglen is even and <= 16 */ + ccm->taglen = taglen; + ccm->taglen &= ~1; + if (ccm->taglen > 16) { + ccm->taglen = 16; + } + + /* can't use < 4 */ + if (ccm->taglen < 4) { + return CRYPT_INVALID_ARG; + } + + /* schedule key */ + if ((err = cipher_descriptor[cipher]->setup(key, keylen, 0, &ccm->K)) != CRYPT_OK) { + return err; + } + ccm->cipher = cipher; + + /* let's get the L value */ + ccm->ptlen = ptlen; + ccm->L = 0; + while (ptlen) { + ++ccm->L; + ptlen >>= 8; + } + if (ccm->L <= 1) { + ccm->L = 2; + } + + ccm->aadlen = aadlen; + return CRYPT_OK; +} + +#endif diff --git a/core/lib/libtomcrypt/src/encauth/ccm/ccm_memory.c b/core/lib/libtomcrypt/src/encauth/ccm/ccm_memory.c new file mode 100644 index 0000000..d68988a --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ccm/ccm_memory.c @@ -0,0 +1,432 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ccm_memory.c + CCM support, process a block of memory, Tom St Denis +*/ + +#ifdef LTC_CCM_MODE + +/** + CCM encrypt/decrypt and produce an authentication tag + + *1 'pt', 'ct' and 'tag' can both be 'in' or 'out', depending on 'direction' + + @param cipher The index of the cipher desired + @param key The secret key to use + @param keylen The length of the secret key (octets) + @param uskey A previously scheduled key [optional can be NULL] + @param nonce The session nonce [use once] + @param noncelen The length of the nonce + @param header The header for the session + @param headerlen The length of the header (octets) + @param pt [*1] The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [*1] The ciphertext + @param tag [*1] The destination tag + @param taglen The max size and resulting size of the authentication tag + @param direction Encrypt or Decrypt direction (0 or 1) + @return CRYPT_OK if successful +*/ +int ccm_memory(int cipher, + const unsigned char *key, unsigned long keylen, + symmetric_key *uskey, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction) +{ + unsigned char PAD[16], ctr[16], CTRPAD[16], ptTag[16], b, *pt_real; + unsigned char *pt_work = NULL; + symmetric_key *skey; + int err; + unsigned long len, L, x, y, z, CTRlen; +#ifdef LTC_FAST + LTC_FAST_TYPE fastMask = -1; /* initialize fastMask at all zeroes */ +#endif + unsigned char mask = 0xff; /* initialize mask at all zeroes */ + + if (uskey == NULL) { + LTC_ARGCHK(key != NULL); + } + LTC_ARGCHK(nonce != NULL); + if (headerlen > 0) { + LTC_ARGCHK(header != NULL); + } + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + pt_real = pt; + +#ifdef LTC_FAST + if (16 % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* check cipher input */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + if (cipher_descriptor[cipher].block_length != 16) { + return CRYPT_INVALID_CIPHER; + } + + /* make sure the taglen is even and <= 16 */ + *taglen &= ~1; + if (*taglen > 16) { + *taglen = 16; + } + + /* can't use < 4 */ + if (*taglen < 4) { + return CRYPT_INVALID_ARG; + } + + /* is there an accelerator? */ + if (cipher_descriptor[cipher].accel_ccm_memory != NULL) { + return cipher_descriptor[cipher].accel_ccm_memory( + key, keylen, + uskey, + nonce, noncelen, + header, headerlen, + pt, ptlen, + ct, + tag, taglen, + direction); + } + + /* let's get the L value */ + len = ptlen; + L = 0; + while (len) { + ++L; + len >>= 8; + } + if (L <= 1) { + L = 2; + } + + /* increase L to match the nonce len */ + noncelen = (noncelen > 13) ? 13 : noncelen; + if ((15 - noncelen) > L) { + L = 15 - noncelen; + } + + /* allocate mem for the symmetric key */ + if (uskey == NULL) { + skey = XMALLOC(sizeof(*skey)); + if (skey == NULL) { + return CRYPT_MEM; + } + + /* initialize the cipher */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, skey)) != CRYPT_OK) { + XFREE(skey); + return err; + } + } else { + skey = uskey; + } + + /* initialize buffer for pt */ + if (direction == CCM_DECRYPT) { + pt_work = XMALLOC(ptlen); + if (pt_work == NULL) { + goto error; + } + pt = pt_work; + } + + /* form B_0 == flags | Nonce N | l(m) */ + x = 0; + PAD[x++] = (unsigned char)(((headerlen > 0) ? (1<<6) : 0) | + (((*taglen - 2)>>1)<<3) | + (L-1)); + + /* nonce */ + for (y = 0; y < (16 - (L + 1)); y++) { + PAD[x++] = nonce[y]; + } + + /* store len */ + len = ptlen; + + /* shift len so the upper bytes of len are the contents of the length */ + for (y = L; y < 4; y++) { + len <<= 8; + } + + /* store l(m) (only store 32-bits) */ + for (y = 0; L > 4 && (L-y)>4; y++) { + PAD[x++] = 0; + } + for (; y < L; y++) { + PAD[x++] = (unsigned char)((len >> 24) & 255); + len <<= 8; + } + + /* encrypt PAD */ + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + + /* handle header */ + if (headerlen > 0) { + x = 0; + + /* store length */ + if (headerlen < ((1UL<<16) - (1UL<<8))) { + PAD[x++] ^= (headerlen>>8) & 255; + PAD[x++] ^= headerlen & 255; + } else { + PAD[x++] ^= 0xFF; + PAD[x++] ^= 0xFE; + PAD[x++] ^= (headerlen>>24) & 255; + PAD[x++] ^= (headerlen>>16) & 255; + PAD[x++] ^= (headerlen>>8) & 255; + PAD[x++] ^= headerlen & 255; + } + + /* now add the data */ + for (y = 0; y < headerlen; y++) { + if (x == 16) { + /* full block so let's encrypt it */ + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + x = 0; + } + PAD[x++] ^= header[y]; + } + + /* remainder */ + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + } + + /* setup the ctr counter */ + x = 0; + + /* flags */ + ctr[x++] = (unsigned char)L-1; + + /* nonce */ + for (y = 0; y < (16 - (L+1)); ++y) { + ctr[x++] = nonce[y]; + } + /* offset */ + while (x < 16) { + ctr[x++] = 0; + } + + x = 0; + CTRlen = 16; + + /* now handle the PT */ + if (ptlen > 0) { + y = 0; +#ifdef LTC_FAST + if (ptlen & ~15) { + if (direction == CCM_ENCRYPT) { + for (; y < (ptlen & ~15); y += 16) { + /* increment the ctr? */ + for (z = 15; z > 15-L; z--) { + ctr[z] = (ctr[z] + 1) & 255; + if (ctr[z]) break; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ctr, CTRPAD, skey)) != CRYPT_OK) { + goto error; + } + + /* xor the PT against the pad first */ + for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&PAD[z])) ^= *((LTC_FAST_TYPE*)(&pt[y+z])); + *((LTC_FAST_TYPE*)(&ct[y+z])) = *((LTC_FAST_TYPE*)(&pt[y+z])) ^ *((LTC_FAST_TYPE*)(&CTRPAD[z])); + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + } + } else { /* direction == CCM_DECRYPT */ + for (; y < (ptlen & ~15); y += 16) { + /* increment the ctr? */ + for (z = 15; z > 15-L; z--) { + ctr[z] = (ctr[z] + 1) & 255; + if (ctr[z]) break; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ctr, CTRPAD, skey)) != CRYPT_OK) { + goto error; + } + + /* xor the PT against the pad last */ + for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&pt[y+z])) = *((LTC_FAST_TYPE*)(&ct[y+z])) ^ *((LTC_FAST_TYPE*)(&CTRPAD[z])); + *((LTC_FAST_TYPE*)(&PAD[z])) ^= *((LTC_FAST_TYPE*)(&pt[y+z])); + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + } + } + } +#endif + + for (; y < ptlen; y++) { + /* increment the ctr? */ + if (CTRlen == 16) { + for (z = 15; z > 15-L; z--) { + ctr[z] = (ctr[z] + 1) & 255; + if (ctr[z]) break; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ctr, CTRPAD, skey)) != CRYPT_OK) { + goto error; + } + CTRlen = 0; + } + + /* if we encrypt we add the bytes to the MAC first */ + if (direction == CCM_ENCRYPT) { + b = pt[y]; + ct[y] = b ^ CTRPAD[CTRlen++]; + } else { + b = ct[y] ^ CTRPAD[CTRlen++]; + pt[y] = b; + } + + if (x == 16) { + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + x = 0; + } + PAD[x++] ^= b; + } + + if (x != 0) { + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + } + } + + /* setup CTR for the TAG (zero the count) */ + for (y = 15; y > 15 - L; y--) { + ctr[y] = 0x00; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ctr, CTRPAD, skey)) != CRYPT_OK) { + goto error; + } + + if (skey != uskey) { + cipher_descriptor[cipher].done(skey); + } + + if (direction == CCM_ENCRYPT) { + /* store the TAG */ + for (x = 0; x < 16 && x < *taglen; x++) { + tag[x] = PAD[x] ^ CTRPAD[x]; + } + *taglen = x; + } else { /* direction == CCM_DECRYPT */ + /* decrypt the tag */ + for (x = 0; x < 16 && x < *taglen; x++) { + ptTag[x] = tag[x] ^ CTRPAD[x]; + } + *taglen = x; + + /* check validity of the decrypted tag against the computed PAD (in constant time) */ + /* HACK: the boolean value of XMEM_NEQ becomes either 0 (CRYPT_OK) or 1 (CRYPT_ERR). + * there should be a better way of setting the correct error code in constant + * time. + */ + err = XMEM_NEQ(ptTag, PAD, *taglen); + + /* Zero the plaintext if the tag was invalid (in constant time) */ + if (ptlen > 0) { + y = 0; + mask *= 1 - err; /* mask = ( err ? 0 : 0xff ) */ +#ifdef LTC_FAST + fastMask *= 1 - err; + if (ptlen & ~15) { + for (; y < (ptlen & ~15); y += 16) { + for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&pt_real[y+z])) = *((LTC_FAST_TYPE*)(&pt[y+z])) & fastMask; + } + } + } +#endif + for (; y < ptlen; y++) { + pt_real[y] = pt[y] & mask; + } + } + } + +#ifdef LTC_CLEAN_STACK + fastMask = 0; + mask = 0; + zeromem(skey, sizeof(*skey)); + zeromem(PAD, sizeof(PAD)); + zeromem(CTRPAD, sizeof(CTRPAD)); + if (pt_work != NULL) { + zeromem(pt_work, ptlen); + } +#endif +error: + if (pt_work) { + XFREE(pt_work); + } + if (skey != uskey) { + XFREE(skey); + } + + return err; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/encauth/ccm/ccm_process.c b/core/lib/libtomcrypt/src/encauth/ccm/ccm_process.c new file mode 100644 index 0000000..772f5a4 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ccm/ccm_process.c @@ -0,0 +1,114 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Process plaintext/ciphertext through CCM + @param ccm The CCM state + @param pt The plaintext + @param ptlen The plaintext length (ciphertext length is the same) + @param ct The ciphertext + @param direction Encrypt or Decrypt mode (CCM_ENCRYPT or CCM_DECRYPT) + @return CRYPT_OK on success + */ +int ccm_process(ccm_state *ccm, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + int direction) +{ + unsigned char y, z, b; + int err; + + LTC_ARGCHK(ccm != NULL); + + /* Check aad has been correctly added */ + if (ccm->aadlen != ccm->current_aadlen) { + return CRYPT_ERROR; + } + + /* Check we do not process too much data */ + if (ccm->ptlen < ccm->current_ptlen + ptlen) { + return CRYPT_ERROR; + } + ccm->current_ptlen += ptlen; + + /* now handle the PT */ + if (ptlen > 0) { + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + y = 0; + + for (; y < ptlen; y++) { + /* increment the ctr? */ + if (ccm->CTRlen == 16) { + for (z = 15; z > 15-ccm->L; z--) { + ccm->ctr[z] = (ccm->ctr[z] + 1) & 255; + if (ccm->ctr[z]) break; + } + if ((err = cipher_descriptor[ccm->cipher]->ecb_encrypt(ccm->ctr, ccm->CTRPAD, &ccm->K)) != CRYPT_OK) { + return err; + } + ccm->CTRlen = 0; + } + + /* if we encrypt we add the bytes to the MAC first */ + if (direction == CCM_ENCRYPT) { + b = pt[y]; + ct[y] = b ^ ccm->CTRPAD[ccm->CTRlen++]; + } else { + b = ct[y] ^ ccm->CTRPAD[ccm->CTRlen++]; + pt[y] = b; + } + + if (ccm->x == 16) { + if ((err = cipher_descriptor[ccm->cipher]->ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return err; + } + ccm->x = 0; + } + ccm->PAD[ccm->x++] ^= b; + } + } + + return CRYPT_OK; +} + +#endif diff --git a/core/lib/libtomcrypt/src/encauth/ccm/ccm_reset.c b/core/lib/libtomcrypt/src/encauth/ccm/ccm_reset.c new file mode 100644 index 0000000..308cd3d --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ccm/ccm_reset.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Reset a CCM state to as if you just called ccm_init(). This saves the initialization time. + @param ccm The CCM state to reset + @return CRYPT_OK on success +*/ +int ccm_reset(ccm_state *ccm) +{ + LTC_ARGCHK(ccm != NULL); + zeromem(ccm->PAD, sizeof(ccm->PAD)); + zeromem(ccm->ctr, sizeof(ccm->ctr)); + zeromem(ccm->CTRPAD, sizeof(ccm->CTRPAD)); + ccm->CTRlen = 0; + ccm->current_ptlen = 0; + ccm->current_aadlen = 0; + + return CRYPT_OK; +} + +#endif diff --git a/core/lib/libtomcrypt/src/encauth/ccm/sub.mk b/core/lib/libtomcrypt/src/encauth/ccm/sub.mk new file mode 100644 index 0000000..d767248 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ccm/sub.mk @@ -0,0 +1,8 @@ +srcs-y += ccm_init.c +srcs-y += ccm_add_nonce.c +srcs-y += ccm_add_aad.c +srcs-y += ccm_process.c +srcs-y += ccm_done.c +srcs-y += ccm_reset.c +# srcs-y += ccm_memory.c +# srcs-y += ccm_test.c diff --git a/core/lib/libtomcrypt/src/encauth/eax/eax_addheader.c b/core/lib/libtomcrypt/src/encauth/eax/eax_addheader.c new file mode 100644 index 0000000..0e68844 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/eax/eax_addheader.c @@ -0,0 +1,65 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +/** + @file eax_addheader.c + EAX implementation, add meta-data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_EAX_MODE + +/** + add header (metadata) to the stream + @param eax The current EAX state + @param header The header (meta-data) data you wish to add to the state + @param length The length of the header data + @return CRYPT_OK if successful +*/ +int eax_addheader(eax_state *eax, const unsigned char *header, + unsigned long length) +{ + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(header != NULL); + return omac_process(&eax->headeromac, header, length); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_addheader.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/eax/eax_decrypt.c b/core/lib/libtomcrypt/src/encauth/eax/eax_decrypt.c new file mode 100644 index 0000000..ffe0d25 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/eax/eax_decrypt.c @@ -0,0 +1,77 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file eax_decrypt.c + EAX implementation, decrypt block, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_EAX_MODE + +/** + Decrypt data with the EAX protocol + @param eax The EAX state + @param ct The ciphertext + @param pt [out] The plaintext + @param length The length (octets) of the ciphertext + @return CRYPT_OK if successful +*/ +int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, + unsigned long length) +{ + int err; + + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + /* omac ciphertext */ + if ((err = omac_process(&eax->ctomac, ct, length)) != CRYPT_OK) { + return err; + } + + /* decrypt */ + return ctr_decrypt(ct, pt, length, &eax->ctr); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_decrypt.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c b/core/lib/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c new file mode 100644 index 0000000..30a81c8 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c @@ -0,0 +1,135 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file eax_decrypt_verify_memory.c + EAX implementation, decrypt block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_EAX_MODE + +/** + Decrypt a block of memory and verify the provided MAC tag with EAX + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the key (octets) + @param nonce The nonce data (use once) for the session + @param noncelen The length of the nonce data. + @param header The session header data + @param headerlen The length of the header (octets) + @param ct The ciphertext + @param ctlen The length of the ciphertext (octets) + @param pt [out] The plaintext + @param tag The authentication tag provided by the encoder + @param taglen [in/out] The length of the tag (octets) + @param stat [out] The result of the decryption (1==valid tag, 0==invalid) + @return CRYPT_OK if successful regardless of the resulting tag comparison +*/ +int eax_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + unsigned char *tag, unsigned long taglen, + int *stat) +{ + int err; + eax_state *eax; + unsigned char *buf; + unsigned long buflen; + + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + + /* default to zero */ + *stat = 0; + + /* allocate ram */ + buf = XMALLOC(taglen); + eax = XMALLOC(sizeof(*eax)); + if (eax == NULL || buf == NULL) { + if (eax != NULL) { + XFREE(eax); + } + if (buf != NULL) { + XFREE(buf); + } + return CRYPT_MEM; + } + + if ((err = eax_init(eax, cipher, key, keylen, nonce, noncelen, header, headerlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = eax_decrypt(eax, ct, pt, ctlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + buflen = taglen; + if ((err = eax_done(eax, buf, &buflen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* compare tags */ + if (buflen >= taglen && XMEMCMP(buf, tag, taglen) == 0) { + *stat = 1; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf, taglen); + zeromem(eax, sizeof(*eax)); +#endif + + XFREE(eax); + XFREE(buf); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/eax/eax_done.c b/core/lib/libtomcrypt/src/encauth/eax/eax_done.c new file mode 100644 index 0000000..63297b0 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/eax/eax_done.c @@ -0,0 +1,121 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file eax_done.c + EAX implementation, terminate session, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_EAX_MODE + +/** + Terminate an EAX session and get the tag. + @param eax The EAX state + @param tag [out] The destination of the authentication tag + @param taglen [in/out] The max length and resulting length of the authentication tag + @return CRYPT_OK if successful +*/ +int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen) +{ + int err; + unsigned char *headermac, *ctmac; + unsigned long x, len; + + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + /* allocate ram */ + headermac = XMALLOC(MAXBLOCKSIZE); + ctmac = XMALLOC(MAXBLOCKSIZE); + + if (headermac == NULL || ctmac == NULL) { + if (headermac != NULL) { + XFREE(headermac); + } + if (ctmac != NULL) { + XFREE(ctmac); + } + return CRYPT_MEM; + } + + /* finish ctomac */ + len = MAXBLOCKSIZE; + if ((err = omac_done(&eax->ctomac, ctmac, &len)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* finish headeromac */ + + /* note we specifically don't reset len so the two lens are minimal */ + + if ((err = omac_done(&eax->headeromac, headermac, &len)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* terminate the CTR chain */ + if ((err = ctr_done(&eax->ctr)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* compute N xor H xor C */ + for (x = 0; x < len && x < *taglen; x++) { + tag[x] = eax->N[x] ^ headermac[x] ^ ctmac[x]; + } + *taglen = x; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(ctmac, MAXBLOCKSIZE); + zeromem(headermac, MAXBLOCKSIZE); + zeromem(eax, sizeof(*eax)); +#endif + + XFREE(ctmac); + XFREE(headermac); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/eax/eax_encrypt.c b/core/lib/libtomcrypt/src/encauth/eax/eax_encrypt.c new file mode 100644 index 0000000..07572dc --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/eax/eax_encrypt.c @@ -0,0 +1,78 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file eax_encrypt.c + EAX implementation, encrypt block by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_EAX_MODE + +/** + Encrypt with EAX a block of data. + @param eax The EAX state + @param pt The plaintext to encrypt + @param ct [out] The ciphertext as encrypted + @param length The length of the plaintext (octets) + @return CRYPT_OK if successful +*/ +int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, + unsigned long length) +{ + int err; + + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + /* encrypt */ + if ((err = ctr_encrypt(pt, ct, length, &eax->ctr)) != CRYPT_OK) { + return err; + } + + /* omac ciphertext */ + return omac_process(&eax->ctomac, ct, length); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_encrypt.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c b/core/lib/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c new file mode 100644 index 0000000..5b40386 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c @@ -0,0 +1,109 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file eax_encrypt_authenticate_memory.c + EAX implementation, encrypt a block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_EAX_MODE + +/** + EAX encrypt and produce an authentication tag + @param cipher The index of the cipher desired + @param key The secret key to use + @param keylen The length of the secret key (octets) + @param nonce The session nonce [use once] + @param noncelen The length of the nonce + @param header The header for the session + @param headerlen The length of the header (octets) + @param pt The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext + @param tag [out] The destination tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int eax_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen) +{ + int err; + eax_state *eax; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + eax = XMALLOC(sizeof(*eax)); + + if ((err = eax_init(eax, cipher, key, keylen, nonce, noncelen, header, headerlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = eax_encrypt(eax, pt, ct, ptlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = eax_done(eax, tag, taglen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(eax, sizeof(*eax)); +#endif + + XFREE(eax); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/eax/eax_init.c b/core/lib/libtomcrypt/src/encauth/eax/eax_init.c new file mode 100644 index 0000000..1ae30d9 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/eax/eax_init.c @@ -0,0 +1,171 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file eax_init.c + EAX implementation, initialized EAX state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_EAX_MODE + +/** + Initialized an EAX state + @param eax [out] The EAX state to initialize + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The use-once nonce for the session + @param noncelen The length of the nonce (octets) + @param header The header for the EAX state + @param headerlen The header length (octets) + @return CRYPT_OK if successful +*/ +int eax_init(eax_state *eax, int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen) +{ + unsigned char *buf; + int err, blklen; + omac_state *omac; + unsigned long len; + + + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + if (headerlen > 0) { + LTC_ARGCHK(header != NULL); + } + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + blklen = cipher_descriptor[cipher].block_length; + + /* allocate ram */ + buf = XMALLOC(MAXBLOCKSIZE); + omac = XMALLOC(sizeof(*omac)); + + if (buf == NULL || omac == NULL) { + if (buf != NULL) { + XFREE(buf); + } + if (omac != NULL) { + XFREE(omac); + } + return CRYPT_MEM; + } + + /* N = LTC_OMAC_0K(nonce) */ + zeromem(buf, MAXBLOCKSIZE); + if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* omac the [0]_n */ + if ((err = omac_process(omac, buf, blklen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* omac the nonce */ + if ((err = omac_process(omac, nonce, noncelen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* store result */ + len = sizeof(eax->N); + if ((err = omac_done(omac, eax->N, &len)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* H = LTC_OMAC_1K(header) */ + zeromem(buf, MAXBLOCKSIZE); + buf[blklen - 1] = 1; + + if ((err = omac_init(&eax->headeromac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* omac the [1]_n */ + if ((err = omac_process(&eax->headeromac, buf, blklen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* omac the header */ + if (headerlen != 0) { + if ((err = omac_process(&eax->headeromac, header, headerlen)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* note we don't finish the headeromac, this allows us to add more header later */ + + /* setup the CTR mode */ + if ((err = ctr_start(cipher, eax->N, key, keylen, 0, CTR_COUNTER_BIG_ENDIAN, &eax->ctr)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* setup the LTC_OMAC for the ciphertext */ + if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* omac [2]_n */ + zeromem(buf, MAXBLOCKSIZE); + buf[blklen-1] = 2; + if ((err = omac_process(&eax->ctomac, buf, blklen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf, MAXBLOCKSIZE); + zeromem(omac, sizeof(*omac)); +#endif + + XFREE(omac); + XFREE(buf); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_init.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_add_aad.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_add_aad.c new file mode 100644 index 0000000..b8e6285 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_add_aad.c @@ -0,0 +1,151 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_add_aad.c + GCM implementation, Add AAD data to the stream, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_GCM_MODE + +/** + Add AAD to the GCM state + @param gcm The GCM state + @param adata The additional authentication data to add to the GCM state + @param adatalen The length of the AAD data. + @return CRYPT_OK on success + */ +int gcm_add_aad(gcm_state *gcm, + const unsigned char *adata, unsigned long adatalen) +{ + unsigned long x; + int err; +#ifdef LTC_FAST + unsigned long y; +#endif + + LTC_ARGCHK(gcm != NULL); + if (adatalen > 0) { + LTC_ARGCHK(adata != NULL); + } + + if (gcm->buflen > 16 || gcm->buflen < 0) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { + return err; + } + + /* in IV mode? */ + if (gcm->mode == LTC_GCM_MODE_IV) { + /* let's process the IV */ + if (gcm->ivmode || gcm->buflen != 12) { + for (x = 0; x < (unsigned long)gcm->buflen; x++) { + gcm->X[x] ^= gcm->buf[x]; + } + if (gcm->buflen) { + gcm->totlen += gcm->buflen * CONST64(8); + gcm_mult_h(gcm, gcm->X); + } + + /* mix in the length */ + zeromem(gcm->buf, 8); + STORE64H(gcm->totlen, gcm->buf+8); + for (x = 0; x < 16; x++) { + gcm->X[x] ^= gcm->buf[x]; + } + gcm_mult_h(gcm, gcm->X); + + /* copy counter out */ + XMEMCPY(gcm->Y, gcm->X, 16); + zeromem(gcm->X, 16); + } else { + XMEMCPY(gcm->Y, gcm->buf, 12); + gcm->Y[12] = 0; + gcm->Y[13] = 0; + gcm->Y[14] = 0; + gcm->Y[15] = 1; + } + XMEMCPY(gcm->Y_0, gcm->Y, 16); + zeromem(gcm->buf, 16); + gcm->buflen = 0; + gcm->totlen = 0; + gcm->mode = LTC_GCM_MODE_AAD; + } + + if (gcm->mode != LTC_GCM_MODE_AAD || gcm->buflen >= 16) { + return CRYPT_INVALID_ARG; + } + + x = 0; +#ifdef LTC_FAST + if (gcm->buflen == 0) { + for (x = 0; x < (adatalen & ~15); x += 16) { + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&adata[x + y])); + } + gcm_mult_h(gcm, gcm->X); + gcm->totlen += 128; + } + adata += x; + } +#endif + + + /* start adding AAD data to the state */ + for (; x < adatalen; x++) { + gcm->X[gcm->buflen++] ^= *adata++; + + if (gcm->buflen == 16) { + /* GF mult it */ + gcm_mult_h(gcm, gcm->X); + gcm->buflen = 0; + gcm->totlen += 128; + } + } + + return CRYPT_OK; +} +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_add_aad.c,v $ */ +/* $Revision: 1.18 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_add_iv.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_add_iv.c new file mode 100644 index 0000000..1f0b897 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_add_iv.c @@ -0,0 +1,121 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_add_iv.c + GCM implementation, add IV data to the state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_GCM_MODE + +/** + Add IV data to the GCM state + @param gcm The GCM state + @param IV The initial value data to add + @param IVlen The length of the IV + @return CRYPT_OK on success + */ +int gcm_add_iv(gcm_state *gcm, + const unsigned char *IV, unsigned long IVlen) +{ + unsigned long x, y; + int err; + + LTC_ARGCHK(gcm != NULL); + if (IVlen > 0) { + LTC_ARGCHK(IV != NULL); + } + + /* must be in IV mode */ + if (gcm->mode != LTC_GCM_MODE_IV) { + return CRYPT_INVALID_ARG; + } + + if (gcm->buflen >= 16 || gcm->buflen < 0) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { + return err; + } + + + /* trip the ivmode flag */ + if (IVlen + gcm->buflen > 12) { + gcm->ivmode |= 1; + } + + x = 0; +#ifdef LTC_FAST + if (gcm->buflen == 0) { + for (x = 0; x < (IVlen & ~15); x += 16) { + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&IV[x + y])); + } + gcm_mult_h(gcm, gcm->X); + gcm->totlen += 128; + } + IV += x; + } +#endif + + /* start adding IV data to the state */ + for (; x < IVlen; x++) { + gcm->buf[gcm->buflen++] = *IV++; + + if (gcm->buflen == 16) { + /* GF mult it */ + for (y = 0; y < 16; y++) { + gcm->X[y] ^= gcm->buf[y]; + } + gcm_mult_h(gcm, gcm->X); + gcm->buflen = 0; + gcm->totlen += 128; + } + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_add_iv.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_done.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_done.c new file mode 100644 index 0000000..28d0909 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_done.c @@ -0,0 +1,110 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_done.c + GCM implementation, Terminate the stream, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_GCM_MODE + +/** + Terminate a GCM stream + @param gcm The GCM state + @param tag [out] The destination for the MAC tag + @param taglen [in/out] The length of the MAC tag + @return CRYPT_OK on success + */ +int gcm_done(gcm_state *gcm, + unsigned char *tag, unsigned long *taglen) +{ + unsigned long x; + int err; + + LTC_ARGCHK(gcm != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + if (gcm->buflen > 16 || gcm->buflen < 0) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { + return err; + } + + + if (gcm->mode != LTC_GCM_MODE_TEXT) { + return CRYPT_INVALID_ARG; + } + + /* handle remaining ciphertext */ + if (gcm->buflen) { + gcm->pttotlen += gcm->buflen * CONST64(8); + gcm_mult_h(gcm, gcm->X); + } + + /* length */ + STORE64H(gcm->totlen, gcm->buf); + STORE64H(gcm->pttotlen, gcm->buf+8); + for (x = 0; x < 16; x++) { + gcm->X[x] ^= gcm->buf[x]; + } + gcm_mult_h(gcm, gcm->X); + + /* encrypt original counter */ + if ((err = cipher_descriptor[gcm->cipher]->ecb_encrypt(gcm->Y_0, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + for (x = 0; x < 16 && x < *taglen; x++) { + tag[x] = gcm->buf[x] ^ gcm->X[x]; + } + *taglen = x; + + cipher_descriptor[gcm->cipher]->done(&gcm->K); + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_done.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c new file mode 100644 index 0000000..00f0860 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c @@ -0,0 +1,248 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_gf_mult.c + GCM implementation, do the GF mult, by Tom St Denis +*/ +#include "tomcrypt.h" + +#if defined(LTC_GCM_TABLES) || defined(LTC_LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) + +/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the + * lower 16 bits are not zero'ed I removed the upper 14 bytes */ +const unsigned char gcm_shift_table[256*2] = { +0x00, 0x00, 0x01, 0xc2, 0x03, 0x84, 0x02, 0x46, 0x07, 0x08, 0x06, 0xca, 0x04, 0x8c, 0x05, 0x4e, +0x0e, 0x10, 0x0f, 0xd2, 0x0d, 0x94, 0x0c, 0x56, 0x09, 0x18, 0x08, 0xda, 0x0a, 0x9c, 0x0b, 0x5e, +0x1c, 0x20, 0x1d, 0xe2, 0x1f, 0xa4, 0x1e, 0x66, 0x1b, 0x28, 0x1a, 0xea, 0x18, 0xac, 0x19, 0x6e, +0x12, 0x30, 0x13, 0xf2, 0x11, 0xb4, 0x10, 0x76, 0x15, 0x38, 0x14, 0xfa, 0x16, 0xbc, 0x17, 0x7e, +0x38, 0x40, 0x39, 0x82, 0x3b, 0xc4, 0x3a, 0x06, 0x3f, 0x48, 0x3e, 0x8a, 0x3c, 0xcc, 0x3d, 0x0e, +0x36, 0x50, 0x37, 0x92, 0x35, 0xd4, 0x34, 0x16, 0x31, 0x58, 0x30, 0x9a, 0x32, 0xdc, 0x33, 0x1e, +0x24, 0x60, 0x25, 0xa2, 0x27, 0xe4, 0x26, 0x26, 0x23, 0x68, 0x22, 0xaa, 0x20, 0xec, 0x21, 0x2e, +0x2a, 0x70, 0x2b, 0xb2, 0x29, 0xf4, 0x28, 0x36, 0x2d, 0x78, 0x2c, 0xba, 0x2e, 0xfc, 0x2f, 0x3e, +0x70, 0x80, 0x71, 0x42, 0x73, 0x04, 0x72, 0xc6, 0x77, 0x88, 0x76, 0x4a, 0x74, 0x0c, 0x75, 0xce, +0x7e, 0x90, 0x7f, 0x52, 0x7d, 0x14, 0x7c, 0xd6, 0x79, 0x98, 0x78, 0x5a, 0x7a, 0x1c, 0x7b, 0xde, +0x6c, 0xa0, 0x6d, 0x62, 0x6f, 0x24, 0x6e, 0xe6, 0x6b, 0xa8, 0x6a, 0x6a, 0x68, 0x2c, 0x69, 0xee, +0x62, 0xb0, 0x63, 0x72, 0x61, 0x34, 0x60, 0xf6, 0x65, 0xb8, 0x64, 0x7a, 0x66, 0x3c, 0x67, 0xfe, +0x48, 0xc0, 0x49, 0x02, 0x4b, 0x44, 0x4a, 0x86, 0x4f, 0xc8, 0x4e, 0x0a, 0x4c, 0x4c, 0x4d, 0x8e, +0x46, 0xd0, 0x47, 0x12, 0x45, 0x54, 0x44, 0x96, 0x41, 0xd8, 0x40, 0x1a, 0x42, 0x5c, 0x43, 0x9e, +0x54, 0xe0, 0x55, 0x22, 0x57, 0x64, 0x56, 0xa6, 0x53, 0xe8, 0x52, 0x2a, 0x50, 0x6c, 0x51, 0xae, +0x5a, 0xf0, 0x5b, 0x32, 0x59, 0x74, 0x58, 0xb6, 0x5d, 0xf8, 0x5c, 0x3a, 0x5e, 0x7c, 0x5f, 0xbe, +0xe1, 0x00, 0xe0, 0xc2, 0xe2, 0x84, 0xe3, 0x46, 0xe6, 0x08, 0xe7, 0xca, 0xe5, 0x8c, 0xe4, 0x4e, +0xef, 0x10, 0xee, 0xd2, 0xec, 0x94, 0xed, 0x56, 0xe8, 0x18, 0xe9, 0xda, 0xeb, 0x9c, 0xea, 0x5e, +0xfd, 0x20, 0xfc, 0xe2, 0xfe, 0xa4, 0xff, 0x66, 0xfa, 0x28, 0xfb, 0xea, 0xf9, 0xac, 0xf8, 0x6e, +0xf3, 0x30, 0xf2, 0xf2, 0xf0, 0xb4, 0xf1, 0x76, 0xf4, 0x38, 0xf5, 0xfa, 0xf7, 0xbc, 0xf6, 0x7e, +0xd9, 0x40, 0xd8, 0x82, 0xda, 0xc4, 0xdb, 0x06, 0xde, 0x48, 0xdf, 0x8a, 0xdd, 0xcc, 0xdc, 0x0e, +0xd7, 0x50, 0xd6, 0x92, 0xd4, 0xd4, 0xd5, 0x16, 0xd0, 0x58, 0xd1, 0x9a, 0xd3, 0xdc, 0xd2, 0x1e, +0xc5, 0x60, 0xc4, 0xa2, 0xc6, 0xe4, 0xc7, 0x26, 0xc2, 0x68, 0xc3, 0xaa, 0xc1, 0xec, 0xc0, 0x2e, +0xcb, 0x70, 0xca, 0xb2, 0xc8, 0xf4, 0xc9, 0x36, 0xcc, 0x78, 0xcd, 0xba, 0xcf, 0xfc, 0xce, 0x3e, +0x91, 0x80, 0x90, 0x42, 0x92, 0x04, 0x93, 0xc6, 0x96, 0x88, 0x97, 0x4a, 0x95, 0x0c, 0x94, 0xce, +0x9f, 0x90, 0x9e, 0x52, 0x9c, 0x14, 0x9d, 0xd6, 0x98, 0x98, 0x99, 0x5a, 0x9b, 0x1c, 0x9a, 0xde, +0x8d, 0xa0, 0x8c, 0x62, 0x8e, 0x24, 0x8f, 0xe6, 0x8a, 0xa8, 0x8b, 0x6a, 0x89, 0x2c, 0x88, 0xee, +0x83, 0xb0, 0x82, 0x72, 0x80, 0x34, 0x81, 0xf6, 0x84, 0xb8, 0x85, 0x7a, 0x87, 0x3c, 0x86, 0xfe, +0xa9, 0xc0, 0xa8, 0x02, 0xaa, 0x44, 0xab, 0x86, 0xae, 0xc8, 0xaf, 0x0a, 0xad, 0x4c, 0xac, 0x8e, +0xa7, 0xd0, 0xa6, 0x12, 0xa4, 0x54, 0xa5, 0x96, 0xa0, 0xd8, 0xa1, 0x1a, 0xa3, 0x5c, 0xa2, 0x9e, +0xb5, 0xe0, 0xb4, 0x22, 0xb6, 0x64, 0xb7, 0xa6, 0xb2, 0xe8, 0xb3, 0x2a, 0xb1, 0x6c, 0xb0, 0xae, +0xbb, 0xf0, 0xba, 0x32, 0xb8, 0x74, 0xb9, 0xb6, 0xbc, 0xf8, 0xbd, 0x3a, 0xbf, 0x7c, 0xbe, 0xbe }; + +#endif + + +#if defined(LTC_GCM_MODE) || defined(LRW_MODE) + +#ifndef LTC_FAST +/* right shift */ +static void gcm_rightshift(unsigned char *a) +{ + int x; + for (x = 15; x > 0; x--) { + a[x] = (a[x]>>1) | ((a[x-1]<<7)&0x80); + } + a[0] >>= 1; +} + +/* c = b*a */ +static const unsigned char mask[] = { 0x80, 0x40, 0x20, 0x10, 0x08, 0x04, 0x02, 0x01 }; +static const unsigned char poly[] = { 0x00, 0xE1 }; + + +/** + GCM GF multiplier (internal use only) bitserial + @param a First value + @param b Second value + @param c Destination for a * b + */ +void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) +{ + unsigned char Z[16], V[16]; + unsigned char x, y, z; + + zeromem(Z, 16); + XMEMCPY(V, a, 16); + for (x = 0; x < 128; x++) { + if (b[x>>3] & mask[x&7]) { + for (y = 0; y < 16; y++) { + Z[y] ^= V[y]; + } + } + z = V[15] & 0x01; + gcm_rightshift(V); + V[0] ^= poly[z]; + } + XMEMCPY(c, Z, 16); +} + +#else + +/* map normal numbers to "ieee" way ... e.g. bit reversed */ +#define M(x) ( ((x&8)>>3) | ((x&4)>>1) | ((x&2)<<1) | ((x&1)<<3) ) + +#define BPD (sizeof(LTC_FAST_TYPE) * 8) +#define WPV (1 + (16 / sizeof(LTC_FAST_TYPE))) + +/** + GCM GF multiplier (internal use only) word oriented + @param a First value + @param b Second value + @param c Destination for a * b + */ +void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) +{ + int i, j, k, u; + LTC_FAST_TYPE B[16][WPV], tmp[32 / sizeof(LTC_FAST_TYPE)], pB[16 / sizeof(LTC_FAST_TYPE)], zz, z; + unsigned char pTmp[32]; + + /* create simple tables */ + zeromem(B[0], sizeof(B[0])); + zeromem(B[M(1)], sizeof(B[M(1)])); + +#ifdef ENDIAN_32BITWORD + for (i = 0; i < 4; i++) { + LOAD32H(B[M(1)][i], a + (i<<2)); + LOAD32L(pB[i], b + (i<<2)); + } +#else + for (i = 0; i < 2; i++) { + LOAD64H(B[M(1)][i], a + (i<<3)); + LOAD64L(pB[i], b + (i<<3)); + } +#endif + + /* now create 2, 4 and 8 */ + B[M(2)][0] = B[M(1)][0] >> 1; + B[M(4)][0] = B[M(1)][0] >> 2; + B[M(8)][0] = B[M(1)][0] >> 3; + for (i = 1; i < (int)WPV; i++) { + B[M(2)][i] = (B[M(1)][i-1] << (BPD-1)) | (B[M(1)][i] >> 1); + B[M(4)][i] = (B[M(1)][i-1] << (BPD-2)) | (B[M(1)][i] >> 2); + B[M(8)][i] = (B[M(1)][i-1] << (BPD-3)) | (B[M(1)][i] >> 3); + } + + /* now all values with two bits which are 3, 5, 6, 9, 10, 12 */ + for (i = 0; i < (int)WPV; i++) { + B[M(3)][i] = B[M(1)][i] ^ B[M(2)][i]; + B[M(5)][i] = B[M(1)][i] ^ B[M(4)][i]; + B[M(6)][i] = B[M(2)][i] ^ B[M(4)][i]; + B[M(9)][i] = B[M(1)][i] ^ B[M(8)][i]; + B[M(10)][i] = B[M(2)][i] ^ B[M(8)][i]; + B[M(12)][i] = B[M(8)][i] ^ B[M(4)][i]; + + /* now all 3 bit values and the only 4 bit value: 7, 11, 13, 14, 15 */ + B[M(7)][i] = B[M(3)][i] ^ B[M(4)][i]; + B[M(11)][i] = B[M(3)][i] ^ B[M(8)][i]; + B[M(13)][i] = B[M(1)][i] ^ B[M(12)][i]; + B[M(14)][i] = B[M(6)][i] ^ B[M(8)][i]; + B[M(15)][i] = B[M(7)][i] ^ B[M(8)][i]; + } + + zeromem(tmp, sizeof(tmp)); + + /* compute product four bits of each word at a time */ + /* for each nibble */ + for (i = (BPD/4)-1; i >= 0; i--) { + /* for each word */ + for (j = 0; j < (int)(WPV-1); j++) { + /* grab the 4 bits recall the nibbles are backwards so it's a shift by (i^1)*4 */ + u = (pB[j] >> ((i^1)<<2)) & 15; + + /* add offset by the word count the table looked up value to the result */ + for (k = 0; k < (int)WPV; k++) { + tmp[k+j] ^= B[u][k]; + } + } + /* shift result up by 4 bits */ + if (i != 0) { + for (z = j = 0; j < (int)(32 / sizeof(LTC_FAST_TYPE)); j++) { + zz = tmp[j] << (BPD-4); + tmp[j] = (tmp[j] >> 4) | z; + z = zz; + } + } + } + + /* store product */ +#ifdef ENDIAN_32BITWORD + for (i = 0; i < 8; i++) { + STORE32H(tmp[i], pTmp + (i<<2)); + } +#else + for (i = 0; i < 4; i++) { + STORE64H(tmp[i], pTmp + (i<<3)); + } +#endif + + /* reduce by taking most significant byte and adding the appropriate two byte sequence 16 bytes down */ + for (i = 31; i >= 16; i--) { + pTmp[i-16] ^= gcm_shift_table[((unsigned)pTmp[i]<<1)]; + pTmp[i-15] ^= gcm_shift_table[((unsigned)pTmp[i]<<1)+1]; + } + + for (i = 0; i < 16; i++) { + c[i] = pTmp[i]; + } + +} + +#endif + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c,v $ */ +/* $Revision: 1.25 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ + diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_init.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_init.c new file mode 100644 index 0000000..056e112 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_init.c @@ -0,0 +1,134 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_init.c + GCM implementation, initialize state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_GCM_MODE + +/** + Initialize a GCM state + @param gcm The GCM state to initialize + @param cipher The index of the cipher to use + @param key The secret key + @param keylen The length of the secret key + @return CRYPT_OK on success + */ +int gcm_init(gcm_state *gcm, int cipher, + const unsigned char *key, int keylen) +{ + int err; + unsigned char B[16]; +#ifdef LTC_GCM_TABLES + int x, y, z, t; +#endif + + LTC_ARGCHK(gcm != NULL); + LTC_ARGCHK(key != NULL); + +#ifdef LTC_FAST + if (16 % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* is cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + if (cipher_descriptor[cipher]->block_length != 16) { + return CRYPT_INVALID_CIPHER; + } + + /* schedule key */ + if ((err = cipher_descriptor[cipher]->setup(key, keylen, 0, &gcm->K)) != CRYPT_OK) { + return err; + } + + /* H = E(0) */ + zeromem(B, 16); + if ((err = cipher_descriptor[cipher]->ecb_encrypt(B, gcm->H, &gcm->K)) != CRYPT_OK) { + return err; + } + + /* setup state */ + zeromem(gcm->buf, sizeof(gcm->buf)); + zeromem(gcm->X, sizeof(gcm->X)); + gcm->cipher = cipher; + gcm->mode = LTC_GCM_MODE_IV; + gcm->ivmode = 0; + gcm->buflen = 0; + gcm->totlen = 0; + gcm->pttotlen = 0; + +#ifdef LTC_GCM_TABLES + /* setup tables */ + + /* generate the first table as it has no shifting (from which we make the other tables) */ + zeromem(B, 16); + for (y = 0; y < 256; y++) { + B[0] = y; + gcm_gf_mult(gcm->H, B, &gcm->PC[0][y][0]); + } + + /* now generate the rest of the tables based the previous table */ + for (x = 1; x < 16; x++) { + for (y = 0; y < 256; y++) { + /* now shift it right by 8 bits */ + t = gcm->PC[x-1][y][15]; + for (z = 15; z > 0; z--) { + gcm->PC[x][y][z] = gcm->PC[x-1][y][z-1]; + } + gcm->PC[x][y][0] = gcm_shift_table[t<<1]; + gcm->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; + } + } + +#endif + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_init.c,v $ */ +/* $Revision: 1.20 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_memory.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_memory.c new file mode 100644 index 0000000..e7764c3 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_memory.c @@ -0,0 +1,136 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_memory.c + GCM implementation, process a packet, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_GCM_MODE + +/** + Process an entire GCM packet in one call. + @param cipher Index of cipher to use + @param key The secret key + @param keylen The length of the secret key + @param IV The initial vector + @param IVlen The length of the initial vector + @param adata The additional authentication data (header) + @param adatalen The length of the adata + @param pt The plaintext + @param ptlen The length of the plaintext (ciphertext length is the same) + @param ct The ciphertext + @param tag [out] The MAC tag + @param taglen [in/out] The MAC tag length + @param direction Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT) + @return CRYPT_OK on success + */ +int gcm_memory( int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *IV, unsigned long IVlen, + const unsigned char *adata, unsigned long adatalen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction) +{ + void *orig; + gcm_state *gcm; + int err; + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + if (cipher_descriptor[cipher]->accel_gcm_memory != NULL) { + return + cipher_descriptor[cipher]->accel_gcm_memory + (key, keylen, + IV, IVlen, + adata, adatalen, + pt, ptlen, + ct, + tag, taglen, + direction); + } + + + +#ifndef LTC_GCM_TABLES_SSE2 + orig = gcm = XMALLOC(sizeof(*gcm)); +#else + orig = gcm = XMALLOC(sizeof(*gcm) + 16); +#endif + if (gcm == NULL) { + return CRYPT_MEM; + } + + /* Force GCM to be on a multiple of 16 so we can use 128-bit aligned operations + * note that we only modify gcm and keep orig intact. This code is not portable + * but again it's only for SSE2 anyways, so who cares? + */ +#ifdef LTC_GCM_TABLES_SSE2 + if ((unsigned long)gcm & 15) { + gcm = (gcm_state *)((unsigned long)gcm + (16 - ((unsigned long)gcm & 15))); + } +#endif + + if ((err = gcm_init(gcm, cipher, key, keylen)) != CRYPT_OK) { + goto LTC_ERR; + } + if ((err = gcm_add_iv(gcm, IV, IVlen)) != CRYPT_OK) { + goto LTC_ERR; + } + if ((err = gcm_add_aad(gcm, adata, adatalen)) != CRYPT_OK) { + goto LTC_ERR; + } + if ((err = gcm_process(gcm, pt, ptlen, ct, direction)) != CRYPT_OK) { + goto LTC_ERR; + } + err = gcm_done(gcm, tag, taglen); +LTC_ERR: + XFREE(orig); + return err; +} +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_memory.c,v $ */ +/* $Revision: 1.25 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_mult_h.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_mult_h.c new file mode 100644 index 0000000..269112f --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_mult_h.c @@ -0,0 +1,86 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_mult_h.c + GCM implementation, do the GF mult, by Tom St Denis +*/ +#include "tomcrypt.h" + +#if defined(LTC_GCM_MODE) +/** + GCM multiply by H + @param gcm The GCM state which holds the H value + @param I The value to multiply H by + */ +void gcm_mult_h(gcm_state *gcm, unsigned char *I) +{ + unsigned char T[16]; +#ifdef LTC_GCM_TABLES + int x; +#ifdef LTC_GCM_TABLES_SSE2 + asm("movdqa (%0),%%xmm0"::"r"(&gcm->PC[0][I[0]][0])); + for (x = 1; x < 16; x++) { + asm("pxor (%0),%%xmm0"::"r"(&gcm->PC[x][I[x]][0])); + } + asm("movdqa %%xmm0,(%0)"::"r"(&T)); +#else + int y; + XMEMCPY(T, &gcm->PC[0][I[0]][0], 16); + for (x = 1; x < 16; x++) { +#ifdef LTC_FAST + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(T + y)) ^= *((LTC_FAST_TYPE *)(&gcm->PC[x][I[x]][y])); + } +#else + for (y = 0; y < 16; y++) { + T[y] ^= gcm->PC[x][I[x]][y]; + } +#endif /* LTC_FAST */ + } +#endif /* LTC_GCM_TABLES_SSE2 */ +#else + gcm_gf_mult(gcm->H, I, T); +#endif + XMEMCPY(I, T, 16); +} +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_mult_h.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_process.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_process.c new file mode 100644 index 0000000..5745e50 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_process.c @@ -0,0 +1,179 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_process.c + GCM implementation, process message data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_GCM_MODE + +/** + Process plaintext/ciphertext through GCM + @param gcm The GCM state + @param pt The plaintext + @param ptlen The plaintext length (ciphertext length is the same) + @param ct The ciphertext + @param direction Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT) + @return CRYPT_OK on success + */ +int gcm_process(gcm_state *gcm, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + int direction) +{ + unsigned long x; + int y, err; + unsigned char b; + + LTC_ARGCHK(gcm != NULL); + if (ptlen > 0) { + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + } + + if (gcm->buflen > 16 || gcm->buflen < 0) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { + return err; + } + + /* in AAD mode? */ + if (gcm->mode == LTC_GCM_MODE_AAD) { + /* let's process the AAD */ + if (gcm->buflen) { + gcm->totlen += gcm->buflen * CONST64(8); + gcm_mult_h(gcm, gcm->X); + } + + /* increment counter */ + for (y = 15; y >= 12; y--) { + if (++gcm->Y[y] & 255) { break; } + } + /* encrypt the counter */ + if ((err = cipher_descriptor[gcm->cipher]->ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + + gcm->buflen = 0; + gcm->mode = LTC_GCM_MODE_TEXT; + } + + if (gcm->mode != LTC_GCM_MODE_TEXT) { + return CRYPT_INVALID_ARG; + } + + x = 0; +#ifdef LTC_FAST + if (gcm->buflen == 0) { + if (direction == GCM_ENCRYPT) { + for (x = 0; x < (ptlen & ~15); x += 16) { + /* ctr encrypt */ + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&ct[x + y])) = *((LTC_FAST_TYPE*)(&pt[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y])); + *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y])); + } + /* GMAC it */ + gcm->pttotlen += 128; + gcm_mult_h(gcm, gcm->X); + /* increment counter */ + for (y = 15; y >= 12; y--) { + if (++gcm->Y[y] & 255) { break; } + } + if ((err = cipher_descriptor[gcm->cipher]->ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + } + } else { + for (x = 0; x < (ptlen & ~15); x += 16) { + /* ctr encrypt */ + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y])); + *((LTC_FAST_TYPE*)(&pt[x + y])) = *((LTC_FAST_TYPE*)(&ct[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y])); + } + /* GMAC it */ + gcm->pttotlen += 128; + gcm_mult_h(gcm, gcm->X); + /* increment counter */ + for (y = 15; y >= 12; y--) { + if (++gcm->Y[y] & 255) { break; } + } + if ((err = cipher_descriptor[gcm->cipher]->ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + } + } + } +#endif + + /* process text */ + for (; x < ptlen; x++) { + if (gcm->buflen == 16) { + gcm->pttotlen += 128; + gcm_mult_h(gcm, gcm->X); + + /* increment counter */ + for (y = 15; y >= 12; y--) { + if (++gcm->Y[y] & 255) { break; } + } + if ((err = cipher_descriptor[gcm->cipher]->ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + gcm->buflen = 0; + } + + if (direction == GCM_ENCRYPT) { + b = ct[x] = pt[x] ^ gcm->buf[gcm->buflen]; + } else { + b = ct[x]; + pt[x] = ct[x] ^ gcm->buf[gcm->buflen]; + } + gcm->X[gcm->buflen++] ^= b; + } + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_process.c,v $ */ +/* $Revision: 1.16 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/gcm_reset.c b/core/lib/libtomcrypt/src/encauth/gcm/gcm_reset.c new file mode 100644 index 0000000..3b293b3 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/gcm_reset.c @@ -0,0 +1,71 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file gcm_reset.c + GCM implementation, reset a used state so it can accept IV data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_GCM_MODE + +/** + Reset a GCM state to as if you just called gcm_init(). This saves the initialization time. + @param gcm The GCM state to reset + @return CRYPT_OK on success +*/ +int gcm_reset(gcm_state *gcm) +{ + LTC_ARGCHK(gcm != NULL); + + zeromem(gcm->buf, sizeof(gcm->buf)); + zeromem(gcm->X, sizeof(gcm->X)); + gcm->mode = LTC_GCM_MODE_IV; + gcm->ivmode = 0; + gcm->buflen = 0; + gcm->totlen = 0; + gcm->pttotlen = 0; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_reset.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/gcm/sub.mk b/core/lib/libtomcrypt/src/encauth/gcm/sub.mk new file mode 100644 index 0000000..62946f5 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/gcm/sub.mk @@ -0,0 +1,10 @@ +srcs-y += gcm_add_aad.c +srcs-y += gcm_add_iv.c +srcs-y += gcm_done.c +srcs-y += gcm_gf_mult.c +srcs-y += gcm_init.c +srcs-y += gcm_memory.c +srcs-y += gcm_mult_h.c +srcs-y += gcm_process.c +srcs-y += gcm_reset.c +# srcs-y += gcm_test.c diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_decrypt.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_decrypt.c new file mode 100644 index 0000000..e1d2d3a --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_decrypt.c @@ -0,0 +1,106 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_decrypt.c + OCB implementation, decrypt data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/** + Decrypt a block with OCB. + @param ocb The OCB state + @param ct The ciphertext (length of the block size of the block cipher) + @param pt [out] The plaintext (length of ct) + @return CRYPT_OK if successful +*/ +int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt) +{ + unsigned char Z[MAXBLOCKSIZE], tmp[MAXBLOCKSIZE]; + int err, x; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + /* check if valid cipher */ + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + return err; + } + LTC_ARGCHK(cipher_descriptor[ocb->cipher].ecb_decrypt != NULL); + + /* check length */ + if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + /* Get Z[i] value */ + ocb_shift_xor(ocb, Z); + + /* xor ct in, encrypt, xor Z out */ + for (x = 0; x < ocb->block_len; x++) { + tmp[x] = ct[x] ^ Z[x]; + } + if ((err = cipher_descriptor[ocb->cipher].ecb_decrypt(tmp, pt, &ocb->key)) != CRYPT_OK) { + return err; + } + for (x = 0; x < ocb->block_len; x++) { + pt[x] ^= Z[x]; + } + + /* compute checksum */ + for (x = 0; x < ocb->block_len; x++) { + ocb->checksum[x] ^= pt[x]; + } + + +#ifdef LTC_CLEAN_STACK + zeromem(Z, sizeof(Z)); + zeromem(tmp, sizeof(tmp)); +#endif + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_decrypt.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c new file mode 100644 index 0000000..c3d0efb --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c @@ -0,0 +1,113 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_decrypt_verify_memory.c + OCB implementation, helper to decrypt block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/** + Decrypt and compare the tag with OCB. + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce (length of the block size of the block cipher) + @param ct The ciphertext + @param ctlen The length of the ciphertext (octets) + @param pt [out] The plaintext + @param tag The tag to compare against + @param taglen The length of the tag (octets) + @param stat [out] The result of the tag comparison (1==valid, 0==invalid) + @return CRYPT_OK if successful regardless of the tag comparison +*/ +int ocb_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, + int *stat) +{ + int err; + ocb_state *ocb; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(stat != NULL); + + /* allocate memory */ + ocb = XMALLOC(sizeof(ocb_state)); + if (ocb == NULL) { + return CRYPT_MEM; + } + + if ((err = ocb_init(ocb, cipher, key, keylen, nonce)) != CRYPT_OK) { + goto LBL_ERR; + } + + while (ctlen > (unsigned long)ocb->block_len) { + if ((err = ocb_decrypt(ocb, ct, pt)) != CRYPT_OK) { + goto LBL_ERR; + } + ctlen -= ocb->block_len; + pt += ocb->block_len; + ct += ocb->block_len; + } + + err = ocb_done_decrypt(ocb, ct, ctlen, pt, tag, taglen, stat); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(ocb, sizeof(ocb_state)); +#endif + + XFREE(ocb); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c new file mode 100644 index 0000000..336ef86 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c @@ -0,0 +1,107 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_done_decrypt.c + OCB implementation, terminate decryption, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/** + Terminate a decrypting OCB state + @param ocb The OCB state + @param ct The ciphertext (if any) + @param ctlen The length of the ciphertext (octets) + @param pt [out] The plaintext + @param tag The authentication tag (to compare against) + @param taglen The length of the authentication tag provided + @param stat [out] The result of the tag comparison + @return CRYPT_OK if the process was successful regardless if the tag is valid +*/ +int ocb_done_decrypt(ocb_state *ocb, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, int *stat) +{ + int err; + unsigned char *tagbuf; + unsigned long tagbuflen; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(stat != NULL); + + /* default to failed */ + *stat = 0; + + /* allocate memory */ + tagbuf = XMALLOC(MAXBLOCKSIZE); + if (tagbuf == NULL) { + return CRYPT_MEM; + } + + tagbuflen = MAXBLOCKSIZE; + if ((err = s_ocb_done(ocb, ct, ctlen, pt, tagbuf, &tagbuflen, 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + if (taglen <= tagbuflen && XMEMCMP(tagbuf, tag, taglen) == 0) { + *stat = 1; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(tagbuf, MAXBLOCKSIZE); +#endif + + XFREE(tagbuf); + + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c new file mode 100644 index 0000000..ccc9129 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_done_encrypt.c + OCB implementation, terminate encryption, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/** + Terminate an encryption OCB state + @param ocb The OCB state + @param pt Remaining plaintext (if any) + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext (if any) + @param tag [out] The tag for the OCB stream + @param taglen [in/out] The max size and resulting size of the tag + @return CRYPT_OK if successful +*/ +int ocb_done_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, unsigned char *tag, unsigned long *taglen) +{ + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + return s_ocb_done(ocb, pt, ptlen, ct, tag, taglen, 0); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_encrypt.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_encrypt.c new file mode 100644 index 0000000..bce2af7 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_encrypt.c @@ -0,0 +1,99 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_encrypt.c + OCB implementation, encrypt data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/** + Encrypt a block of data with OCB. + @param ocb The OCB state + @param pt The plaintext (length of the block size of the block cipher) + @param ct [out] The ciphertext (same size as the pt) + @return CRYPT_OK if successful +*/ +int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct) +{ + unsigned char Z[MAXBLOCKSIZE], tmp[MAXBLOCKSIZE]; + int err, x; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + return err; + } + if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + /* compute checksum */ + for (x = 0; x < ocb->block_len; x++) { + ocb->checksum[x] ^= pt[x]; + } + + /* Get Z[i] value */ + ocb_shift_xor(ocb, Z); + + /* xor pt in, encrypt, xor Z out */ + for (x = 0; x < ocb->block_len; x++) { + tmp[x] = pt[x] ^ Z[x]; + } + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(tmp, ct, &ocb->key)) != CRYPT_OK) { + return err; + } + for (x = 0; x < ocb->block_len; x++) { + ct[x] ^= Z[x]; + } + +#ifdef LTC_CLEAN_STACK + zeromem(Z, sizeof(Z)); + zeromem(tmp, sizeof(tmp)); +#endif + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_encrypt.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c new file mode 100644 index 0000000..da44945 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c @@ -0,0 +1,111 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_encrypt_authenticate_memory.c + OCB implementation, encrypt block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/** + Encrypt and generate an authentication code for a buffer of memory + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce (length of the block ciphers block size) + @param pt The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext + @param tag [out] The authentication tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int ocb_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen) +{ + int err; + ocb_state *ocb; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + /* allocate ram */ + ocb = XMALLOC(sizeof(ocb_state)); + if (ocb == NULL) { + return CRYPT_MEM; + } + + if ((err = ocb_init(ocb, cipher, key, keylen, nonce)) != CRYPT_OK) { + goto LBL_ERR; + } + + while (ptlen > (unsigned long)ocb->block_len) { + if ((err = ocb_encrypt(ocb, pt, ct)) != CRYPT_OK) { + goto LBL_ERR; + } + ptlen -= ocb->block_len; + pt += ocb->block_len; + ct += ocb->block_len; + } + + err = ocb_done_encrypt(ocb, pt, ptlen, ct, tag, taglen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(ocb, sizeof(ocb_state)); +#endif + + XFREE(ocb); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_init.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_init.c new file mode 100644 index 0000000..b656e6a --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_init.c @@ -0,0 +1,168 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_init.c + OCB implementation, initialize state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +static const struct { + int len; + unsigned char poly_div[MAXBLOCKSIZE], + poly_mul[MAXBLOCKSIZE]; +} polys[] = { +{ + 8, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0D }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B } +}, { + 16, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x87 } +} +}; + +/** + Initialize an OCB context. + @param ocb [out] The destination of the OCB state + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce (length of the block size of the cipher) + @return CRYPT_OK if successful +*/ +int ocb_init(ocb_state *ocb, int cipher, + const unsigned char *key, unsigned long keylen, const unsigned char *nonce) +{ + int poly, x, y, m, err; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + + /* valid cipher? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* determine which polys to use */ + ocb->block_len = cipher_descriptor[cipher].block_length; + x = (int)(sizeof(polys)/sizeof(polys[0])); + for (poly = 0; poly < x; poly++) { + if (polys[poly].len == ocb->block_len) { + break; + } + } + if (poly == x) { + return CRYPT_INVALID_ARG; /* block_len not found in polys */ + } + if (polys[poly].len != ocb->block_len) { + return CRYPT_INVALID_ARG; + } + + /* schedule the key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ocb->key)) != CRYPT_OK) { + return err; + } + + /* find L = E[0] */ + zeromem(ocb->L, ocb->block_len); + if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->L, ocb->L, &ocb->key)) != CRYPT_OK) { + return err; + } + + /* find R = E[N xor L] */ + for (x = 0; x < ocb->block_len; x++) { + ocb->R[x] = ocb->L[x] ^ nonce[x]; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->R, ocb->R, &ocb->key)) != CRYPT_OK) { + return err; + } + + /* find Ls[i] = L << i for i == 0..31 */ + XMEMCPY(ocb->Ls[0], ocb->L, ocb->block_len); + for (x = 1; x < 32; x++) { + m = ocb->Ls[x-1][0] >> 7; + for (y = 0; y < ocb->block_len-1; y++) { + ocb->Ls[x][y] = ((ocb->Ls[x-1][y] << 1) | (ocb->Ls[x-1][y+1] >> 7)) & 255; + } + ocb->Ls[x][ocb->block_len-1] = (ocb->Ls[x-1][ocb->block_len-1] << 1) & 255; + + if (m == 1) { + for (y = 0; y < ocb->block_len; y++) { + ocb->Ls[x][y] ^= polys[poly].poly_mul[y]; + } + } + } + + /* find Lr = L / x */ + m = ocb->L[ocb->block_len-1] & 1; + + /* shift right */ + for (x = ocb->block_len - 1; x > 0; x--) { + ocb->Lr[x] = ((ocb->L[x] >> 1) | (ocb->L[x-1] << 7)) & 255; + } + ocb->Lr[0] = ocb->L[0] >> 1; + + if (m == 1) { + for (x = 0; x < ocb->block_len; x++) { + ocb->Lr[x] ^= polys[poly].poly_div[x]; + } + } + + /* set Li, checksum */ + zeromem(ocb->Li, ocb->block_len); + zeromem(ocb->checksum, ocb->block_len); + + /* set other params */ + ocb->block_index = 1; + ocb->cipher = cipher; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_init.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_ntz.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_ntz.c new file mode 100644 index 0000000..8012d01 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_ntz.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_ntz.c + OCB implementation, internal function, by Tom St Denis +*/ + +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/** + Returns the number of leading zero bits [from lsb up] + @param x The 32-bit value to observe + @return The number of bits [from the lsb up] that are zero +*/ +int ocb_ntz(unsigned long x) +{ + int c; + x &= 0xFFFFFFFFUL; + c = 0; + while ((x & 1) == 0) { + ++c; + x >>= 1; + } + return c; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_ntz.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c b/core/lib/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c new file mode 100644 index 0000000..e5c5436 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c @@ -0,0 +1,66 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file ocb_shift_xor.c + OCB implementation, internal function, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/** + Compute the shift/xor for OCB (internal function) + @param ocb The OCB state + @param Z The destination of the shift +*/ +void ocb_shift_xor(ocb_state *ocb, unsigned char *Z) +{ + int x, y; + y = ocb_ntz(ocb->block_index++); + for (x = 0; x < ocb->block_len; x++) { + ocb->Li[x] ^= ocb->Ls[y][x]; + Z[x] = ocb->Li[x] ^ ocb->R[x]; + } +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/ocb/s_ocb_done.c b/core/lib/libtomcrypt/src/encauth/ocb/s_ocb_done.c new file mode 100644 index 0000000..50d4af6 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/ocb/s_ocb_done.c @@ -0,0 +1,175 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/** + @file s_ocb_done.c + OCB implementation, internal helper, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB_MODE + +/* Since the last block is encrypted in CTR mode the same code can + * be used to finish a decrypt or encrypt stream. The only difference + * is we XOR the final ciphertext into the checksum so we have to xor it + * before we CTR [decrypt] or after [encrypt] + * + * the names pt/ptlen/ct really just mean in/inlen/out but this is the way I wrote it... + */ + +/** + Shared code to finish an OCB stream + @param ocb The OCB state + @param pt The remaining plaintext [or input] + @param ptlen The length of the input (octets) + @param ct [out] The output buffer + @param tag [out] The destination for the authentication tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @param mode The mode we are terminating, 0==encrypt, 1==decrypt + @return CRYPT_OK if successful +*/ +int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, unsigned char *tag, unsigned long *taglen, int mode) + +{ + unsigned char *Z, *Y, *X; + int err, x; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + return err; + } + if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length || + (int)ptlen > ocb->block_len || (int)ptlen < 0) { + return CRYPT_INVALID_ARG; + } + + /* allocate ram */ + Z = XMALLOC(MAXBLOCKSIZE); + Y = XMALLOC(MAXBLOCKSIZE); + X = XMALLOC(MAXBLOCKSIZE); + if (X == NULL || Y == NULL || Z == NULL) { + if (X != NULL) { + XFREE(X); + } + if (Y != NULL) { + XFREE(Y); + } + if (Z != NULL) { + XFREE(Z); + } + return CRYPT_MEM; + } + + /* compute X[m] = len(pt[m]) XOR Lr XOR Z[m] */ + ocb_shift_xor(ocb, X); + XMEMCPY(Z, X, ocb->block_len); + + X[ocb->block_len-1] ^= (ptlen*8)&255; + X[ocb->block_len-2] ^= ((ptlen*8)>>8)&255; + for (x = 0; x < ocb->block_len; x++) { + X[x] ^= ocb->Lr[x]; + } + + /* Y[m] = E(X[m])) */ + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(X, Y, &ocb->key)) != CRYPT_OK) { + goto error; + } + + if (mode == 1) { + /* decrypt mode, so let's xor it first */ + /* xor C[m] into checksum */ + for (x = 0; x < (int)ptlen; x++) { + ocb->checksum[x] ^= ct[x]; + } + } + + /* C[m] = P[m] xor Y[m] */ + for (x = 0; x < (int)ptlen; x++) { + ct[x] = pt[x] ^ Y[x]; + } + + if (mode == 0) { + /* encrypt mode */ + /* xor C[m] into checksum */ + for (x = 0; x < (int)ptlen; x++) { + ocb->checksum[x] ^= ct[x]; + } + } + + /* xor Y[m] and Z[m] into checksum */ + for (x = 0; x < ocb->block_len; x++) { + ocb->checksum[x] ^= Y[x] ^ Z[x]; + } + + /* encrypt checksum, er... tag!! */ + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->checksum, X, &ocb->key)) != CRYPT_OK) { + goto error; + } + cipher_descriptor[ocb->cipher].done(&ocb->key); + + /* now store it */ + for (x = 0; x < ocb->block_len && x < (int)*taglen; x++) { + tag[x] = X[x]; + } + *taglen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(X, MAXBLOCKSIZE); + zeromem(Y, MAXBLOCKSIZE); + zeromem(Z, MAXBLOCKSIZE); + zeromem(ocb, sizeof(*ocb)); +#endif +error: + XFREE(X); + XFREE(Y); + XFREE(Z); + + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/s_ocb_done.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/encauth/sub.mk b/core/lib/libtomcrypt/src/encauth/sub.mk new file mode 100644 index 0000000..1434122 --- /dev/null +++ b/core/lib/libtomcrypt/src/encauth/sub.mk @@ -0,0 +1,2 @@ +subdirs-$(CFG_CRYPTO_CCM) += ccm +subdirs-$(CFG_CRYPTO_GCM) += gcm diff --git a/core/lib/libtomcrypt/src/hashes/helper/hash_file.c b/core/lib/libtomcrypt/src/hashes/helper/hash_file.c new file mode 100644 index 0000000..9d058c6 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/helper/hash_file.c @@ -0,0 +1,82 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifndef LTC_NO_FILE +/** + @file hash_file.c + Hash a file, Tom St Denis +*/ + +/** + @param hash The index of the hash desired + @param fname The name of the file you wish to hash + @param out [out] The destination of the digest + @param outlen [in/out] The max size and resulting size of the message digest + @result CRYPT_OK if successful +*/ +int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen) +{ + FILE *in; + int err; + LTC_ARGCHK(fname != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + in = fopen(fname, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + err = hash_filehandle(hash, in, out, outlen); + if (fclose(in) != 0) { + return CRYPT_ERROR; + } + + return err; +} +#endif /* #ifndef LTC_NO_FILE */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_file.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/helper/hash_filehandle.c b/core/lib/libtomcrypt/src/hashes/helper/hash_filehandle.c new file mode 100644 index 0000000..b283846 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/helper/hash_filehandle.c @@ -0,0 +1,96 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifndef LTC_NO_FILE +/** + @file hash_filehandle.c + Hash open files, Tom St Denis +*/ + +/** + Hash data from an open file handle. + @param hash The index of the hash you want to use + @param in The FILE* handle of the file you want to hash + @param out [out] The destination of the digest + @param outlen [in/out] The max size and resulting size of the digest + @result CRYPT_OK if successful +*/ +int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen) +{ + hash_state md; + unsigned char buf[512]; + size_t x; + int err; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(in != NULL); + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (*outlen < hash_descriptor[hash].hashsize) { + *outlen = hash_descriptor[hash].hashsize; + return CRYPT_BUFFER_OVERFLOW; + } + if ((err = hash_descriptor[hash].init(&md)) != CRYPT_OK) { + return err; + } + + *outlen = hash_descriptor[hash].hashsize; + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = hash_descriptor[hash].process(&md, buf, x)) != CRYPT_OK) { + return err; + } + } while (x == sizeof(buf)); + err = hash_descriptor[hash].done(&md, out); + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return err; +} +#endif /* #ifndef LTC_NO_FILE */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_filehandle.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/helper/hash_memory.c b/core/lib/libtomcrypt/src/hashes/helper/hash_memory.c new file mode 100644 index 0000000..2e8dce0 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/helper/hash_memory.c @@ -0,0 +1,96 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file hash_memory.c + Hash memory helper, Tom St Denis +*/ + +/** + Hash a block of memory and store the digest. + @param hash The index of the hash you wish to use + @param in The data you wish to hash + @param inlen The length of the data to hash (octets) + @param out [out] Where to store the digest + @param outlen [in/out] Max size and resulting size of the digest + @return CRYPT_OK if successful +*/ +int hash_memory(int hash, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) +{ + hash_state *md; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (*outlen < hash_descriptor[hash]->hashsize) { + *outlen = hash_descriptor[hash]->hashsize; + return CRYPT_BUFFER_OVERFLOW; + } + + md = XMALLOC(sizeof(hash_state)); + if (md == NULL) { + return CRYPT_MEM; + } + + if ((err = hash_descriptor[hash]->init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash]->process(md, in, inlen)) != CRYPT_OK) { + goto LBL_ERR; + } + err = hash_descriptor[hash]->done(md, out); + *outlen = hash_descriptor[hash]->hashsize; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + XFREE(md); + + return err; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_memory.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/helper/hash_memory_multi.c b/core/lib/libtomcrypt/src/hashes/helper/hash_memory_multi.c new file mode 100644 index 0000000..4488b8f --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/helper/hash_memory_multi.c @@ -0,0 +1,114 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> +/** + @file hash_memory_multi.c + Hash (multiple buffers) memory helper, Tom St Denis +*/ + +/** + Hash multiple (non-adjacent) blocks of memory at once. + @param hash The index of the hash you wish to use + @param out [out] Where to store the digest + @param outlen [in/out] Max size and resulting size of the digest + @param in The data you wish to hash + @param inlen The length of the data to hash (octets) + @param ... tuples of (data,len) pairs to hash, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + hash_state *md; + int err; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (*outlen < hash_descriptor[hash]->hashsize) { + *outlen = hash_descriptor[hash]->hashsize; + return CRYPT_BUFFER_OVERFLOW; + } + + md = XMALLOC(sizeof(hash_state)); + if (md == NULL) { + return CRYPT_MEM; + } + + if ((err = hash_descriptor[hash]->init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = hash_descriptor[hash]->process(md, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + err = hash_descriptor[hash]->done(md, out); + *outlen = hash_descriptor[hash]->hashsize; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + XFREE(md); + va_end(args); + return err; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_memory_multi.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/helper/sub.mk b/core/lib/libtomcrypt/src/hashes/helper/sub.mk new file mode 100644 index 0000000..8e0a971 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/helper/sub.mk @@ -0,0 +1,6 @@ +cflags-y += -Wno-unused-parameter + +# srcs-y += hash_file.c +# srcs-y += hash_filehandle.c +srcs-y += hash_memory.c +srcs-y += hash_memory_multi.c diff --git a/core/lib/libtomcrypt/src/hashes/md5.c b/core/lib/libtomcrypt/src/hashes/md5.c new file mode 100644 index 0000000..de6de16 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/md5.c @@ -0,0 +1,395 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + + +/** + @file md5.c + LTC_MD5 hash function by Tom St Denis +*/ + +#ifdef LTC_MD5 + +const struct ltc_hash_descriptor md5_desc = +{ + "md5", + 3, + 16, + 64, + + /* OID */ + { 1, 2, 840, 113549, 2, 5, }, + 6, + + &md5_init, + &md5_process, + &md5_done, + &md5_test, + NULL +}; + +#define F(x,y,z) (z ^ (x & (y ^ z))) +#define G(x,y,z) (y ^ (z & (y ^ x))) +#define H(x,y,z) (x^y^z) +#define I(x,y,z) (y^(x|(~z))) + +#ifdef LTC_SMALL_CODE + +#define FF(a,b,c,d,M,s,t) \ + a = (a + F(b,c,d) + M + t); a = ROL(a, s) + b; + +#define GG(a,b,c,d,M,s,t) \ + a = (a + G(b,c,d) + M + t); a = ROL(a, s) + b; + +#define HH(a,b,c,d,M,s,t) \ + a = (a + H(b,c,d) + M + t); a = ROL(a, s) + b; + +#define II(a,b,c,d,M,s,t) \ + a = (a + I(b,c,d) + M + t); a = ROL(a, s) + b; + +static const unsigned char Worder[64] = { + 0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15, + 1,6,11,0,5,10,15,4,9,14,3,8,13,2,7,12, + 5,8,11,14,1,4,7,10,13,0,3,6,9,12,15,2, + 0,7,14,5,12,3,10,1,8,15,6,13,4,11,2,9 +}; + +static const unsigned char Rorder[64] = { + 7,12,17,22,7,12,17,22,7,12,17,22,7,12,17,22, + 5,9,14,20,5,9,14,20,5,9,14,20,5,9,14,20, + 4,11,16,23,4,11,16,23,4,11,16,23,4,11,16,23, + 6,10,15,21,6,10,15,21,6,10,15,21,6,10,15,21 +}; + +static const ulong32 Korder[64] = { +0xd76aa478UL, 0xe8c7b756UL, 0x242070dbUL, 0xc1bdceeeUL, 0xf57c0fafUL, 0x4787c62aUL, 0xa8304613UL, 0xfd469501UL, +0x698098d8UL, 0x8b44f7afUL, 0xffff5bb1UL, 0x895cd7beUL, 0x6b901122UL, 0xfd987193UL, 0xa679438eUL, 0x49b40821UL, +0xf61e2562UL, 0xc040b340UL, 0x265e5a51UL, 0xe9b6c7aaUL, 0xd62f105dUL, 0x02441453UL, 0xd8a1e681UL, 0xe7d3fbc8UL, +0x21e1cde6UL, 0xc33707d6UL, 0xf4d50d87UL, 0x455a14edUL, 0xa9e3e905UL, 0xfcefa3f8UL, 0x676f02d9UL, 0x8d2a4c8aUL, +0xfffa3942UL, 0x8771f681UL, 0x6d9d6122UL, 0xfde5380cUL, 0xa4beea44UL, 0x4bdecfa9UL, 0xf6bb4b60UL, 0xbebfbc70UL, +0x289b7ec6UL, 0xeaa127faUL, 0xd4ef3085UL, 0x04881d05UL, 0xd9d4d039UL, 0xe6db99e5UL, 0x1fa27cf8UL, 0xc4ac5665UL, +0xf4292244UL, 0x432aff97UL, 0xab9423a7UL, 0xfc93a039UL, 0x655b59c3UL, 0x8f0ccc92UL, 0xffeff47dUL, 0x85845dd1UL, +0x6fa87e4fUL, 0xfe2ce6e0UL, 0xa3014314UL, 0x4e0811a1UL, 0xf7537e82UL, 0xbd3af235UL, 0x2ad7d2bbUL, 0xeb86d391UL +}; + +#else + +#define FF(a,b,c,d,M,s,t) \ + a = (a + F(b,c,d) + M + t); a = ROLc(a, s) + b; + +#define GG(a,b,c,d,M,s,t) \ + a = (a + G(b,c,d) + M + t); a = ROLc(a, s) + b; + +#define HH(a,b,c,d,M,s,t) \ + a = (a + H(b,c,d) + M + t); a = ROLc(a, s) + b; + +#define II(a,b,c,d,M,s,t) \ + a = (a + I(b,c,d) + M + t); a = ROLc(a, s) + b; + + +#endif + +#ifdef LTC_CLEAN_STACK +static int _md5_compress(hash_state *md, unsigned char *buf) +#else +static int md5_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 i, W[16], a, b, c, d; +#ifdef LTC_SMALL_CODE + ulong32 t; +#endif + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32L(W[i], buf + (4*i)); + } + + /* copy state */ + a = md->md5.state[0]; + b = md->md5.state[1]; + c = md->md5.state[2]; + d = md->md5.state[3]; + +#ifdef LTC_SMALL_CODE + for (i = 0; i < 16; ++i) { + FF(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); + t = d; d = c; c = b; b = a; a = t; + } + + for (; i < 32; ++i) { + GG(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); + t = d; d = c; c = b; b = a; a = t; + } + + for (; i < 48; ++i) { + HH(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); + t = d; d = c; c = b; b = a; a = t; + } + + for (; i < 64; ++i) { + II(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); + t = d; d = c; c = b; b = a; a = t; + } + +#else + FF(a,b,c,d,W[0],7,0xd76aa478UL) + FF(d,a,b,c,W[1],12,0xe8c7b756UL) + FF(c,d,a,b,W[2],17,0x242070dbUL) + FF(b,c,d,a,W[3],22,0xc1bdceeeUL) + FF(a,b,c,d,W[4],7,0xf57c0fafUL) + FF(d,a,b,c,W[5],12,0x4787c62aUL) + FF(c,d,a,b,W[6],17,0xa8304613UL) + FF(b,c,d,a,W[7],22,0xfd469501UL) + FF(a,b,c,d,W[8],7,0x698098d8UL) + FF(d,a,b,c,W[9],12,0x8b44f7afUL) + FF(c,d,a,b,W[10],17,0xffff5bb1UL) + FF(b,c,d,a,W[11],22,0x895cd7beUL) + FF(a,b,c,d,W[12],7,0x6b901122UL) + FF(d,a,b,c,W[13],12,0xfd987193UL) + FF(c,d,a,b,W[14],17,0xa679438eUL) + FF(b,c,d,a,W[15],22,0x49b40821UL) + GG(a,b,c,d,W[1],5,0xf61e2562UL) + GG(d,a,b,c,W[6],9,0xc040b340UL) + GG(c,d,a,b,W[11],14,0x265e5a51UL) + GG(b,c,d,a,W[0],20,0xe9b6c7aaUL) + GG(a,b,c,d,W[5],5,0xd62f105dUL) + GG(d,a,b,c,W[10],9,0x02441453UL) + GG(c,d,a,b,W[15],14,0xd8a1e681UL) + GG(b,c,d,a,W[4],20,0xe7d3fbc8UL) + GG(a,b,c,d,W[9],5,0x21e1cde6UL) + GG(d,a,b,c,W[14],9,0xc33707d6UL) + GG(c,d,a,b,W[3],14,0xf4d50d87UL) + GG(b,c,d,a,W[8],20,0x455a14edUL) + GG(a,b,c,d,W[13],5,0xa9e3e905UL) + GG(d,a,b,c,W[2],9,0xfcefa3f8UL) + GG(c,d,a,b,W[7],14,0x676f02d9UL) + GG(b,c,d,a,W[12],20,0x8d2a4c8aUL) + HH(a,b,c,d,W[5],4,0xfffa3942UL) + HH(d,a,b,c,W[8],11,0x8771f681UL) + HH(c,d,a,b,W[11],16,0x6d9d6122UL) + HH(b,c,d,a,W[14],23,0xfde5380cUL) + HH(a,b,c,d,W[1],4,0xa4beea44UL) + HH(d,a,b,c,W[4],11,0x4bdecfa9UL) + HH(c,d,a,b,W[7],16,0xf6bb4b60UL) + HH(b,c,d,a,W[10],23,0xbebfbc70UL) + HH(a,b,c,d,W[13],4,0x289b7ec6UL) + HH(d,a,b,c,W[0],11,0xeaa127faUL) + HH(c,d,a,b,W[3],16,0xd4ef3085UL) + HH(b,c,d,a,W[6],23,0x04881d05UL) + HH(a,b,c,d,W[9],4,0xd9d4d039UL) + HH(d,a,b,c,W[12],11,0xe6db99e5UL) + HH(c,d,a,b,W[15],16,0x1fa27cf8UL) + HH(b,c,d,a,W[2],23,0xc4ac5665UL) + II(a,b,c,d,W[0],6,0xf4292244UL) + II(d,a,b,c,W[7],10,0x432aff97UL) + II(c,d,a,b,W[14],15,0xab9423a7UL) + II(b,c,d,a,W[5],21,0xfc93a039UL) + II(a,b,c,d,W[12],6,0x655b59c3UL) + II(d,a,b,c,W[3],10,0x8f0ccc92UL) + II(c,d,a,b,W[10],15,0xffeff47dUL) + II(b,c,d,a,W[1],21,0x85845dd1UL) + II(a,b,c,d,W[8],6,0x6fa87e4fUL) + II(d,a,b,c,W[15],10,0xfe2ce6e0UL) + II(c,d,a,b,W[6],15,0xa3014314UL) + II(b,c,d,a,W[13],21,0x4e0811a1UL) + II(a,b,c,d,W[4],6,0xf7537e82UL) + II(d,a,b,c,W[11],10,0xbd3af235UL) + II(c,d,a,b,W[2],15,0x2ad7d2bbUL) + II(b,c,d,a,W[9],21,0xeb86d391UL) +#endif + + md->md5.state[0] = md->md5.state[0] + a; + md->md5.state[1] = md->md5.state[1] + b; + md->md5.state[2] = md->md5.state[2] + c; + md->md5.state[3] = md->md5.state[3] + d; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int md5_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _md5_compress(md, buf); + burn_stack(sizeof(ulong32) * 21); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int md5_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->md5.state[0] = 0x67452301UL; + md->md5.state[1] = 0xefcdab89UL; + md->md5.state[2] = 0x98badcfeUL; + md->md5.state[3] = 0x10325476UL; + md->md5.curlen = 0; + md->md5.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(md5_process, md5_compress, md5, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (16 bytes) + @return CRYPT_OK if successful +*/ +int md5_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->md5.curlen >= sizeof(md->md5.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->md5.length += md->md5.curlen * 8; + + /* append the '1' bit */ + md->md5.buf[md->md5.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->md5.curlen > 56) { + while (md->md5.curlen < 64) { + md->md5.buf[md->md5.curlen++] = (unsigned char)0; + } + md5_compress(md, md->md5.buf); + md->md5.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->md5.curlen < 56) { + md->md5.buf[md->md5.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->md5.length, md->md5.buf+56); + md5_compress(md, md->md5.buf); + + /* copy output */ + for (i = 0; i < 4; i++) { + STORE32L(md->md5.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int md5_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[16]; + } tests[] = { + { "", + { 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04, + 0xe9, 0x80, 0x09, 0x98, 0xec, 0xf8, 0x42, 0x7e } }, + { "a", + {0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8, + 0x31, 0xc3, 0x99, 0xe2, 0x69, 0x77, 0x26, 0x61 } }, + { "abc", + { 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0, + 0xd6, 0x96, 0x3f, 0x7d, 0x28, 0xe1, 0x7f, 0x72 } }, + { "message digest", + { 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d, + 0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } }, + { "abcdefghijklmnopqrstuvwxyz", + { 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00, + 0x7d, 0xfb, 0x49, 0x6c, 0xca, 0x67, 0xe1, 0x3b } }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", + { 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5, + 0xa5, 0x61, 0x1c, 0x2c, 0x9f, 0x41, 0x9d, 0x9f } }, + { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", + { 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55, + 0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } }, + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[16]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + md5_init(&md); + md5_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + md5_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 16) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/md5.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:25:28 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/sha1.c b/core/lib/libtomcrypt/src/hashes/sha1.c new file mode 100644 index 0000000..d82d4d0 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha1.c @@ -0,0 +1,315 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file sha1.c + LTC_SHA1 code by Tom St Denis +*/ + + +#ifdef LTC_SHA1 + +const struct ltc_hash_descriptor sha1_desc = +{ + "sha1", + 2, + 20, + 64, + + /* OID */ + { 1, 3, 14, 3, 2, 26, }, + 6, + + &sha1_init, + &sha1_process, + &sha1_done, + &sha1_test, + NULL +}; + +#define F0(x,y,z) (z ^ (x & (y ^ z))) +#define F1(x,y,z) (x ^ y ^ z) +#define F2(x,y,z) ((x & y) | (z & (x | y))) +#define F3(x,y,z) (x ^ y ^ z) + +#ifdef LTC_CLEAN_STACK +static int _sha1_compress(hash_state *md, unsigned char *buf) +#else +static int sha1_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 a,b,c,d,e,W[80],i; +#ifdef LTC_SMALL_CODE + ulong32 t; +#endif + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32H(W[i], buf + (4*i)); + } + + /* copy state */ + a = md->sha1.state[0]; + b = md->sha1.state[1]; + c = md->sha1.state[2]; + d = md->sha1.state[3]; + e = md->sha1.state[4]; + + /* expand it */ + for (i = 16; i < 80; i++) { + W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); + } + + /* compress */ + /* round one */ + #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); + #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); + #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); + #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); + +#ifdef LTC_SMALL_CODE + + for (i = 0; i < 20; ) { + FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; + } + + for (; i < 40; ) { + FF1(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; + } + + for (; i < 60; ) { + FF2(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; + } + + for (; i < 80; ) { + FF3(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; + } + +#else + + for (i = 0; i < 20; ) { + FF0(a,b,c,d,e,i++); + FF0(e,a,b,c,d,i++); + FF0(d,e,a,b,c,i++); + FF0(c,d,e,a,b,i++); + FF0(b,c,d,e,a,i++); + } + + /* round two */ + for (; i < 40; ) { + FF1(a,b,c,d,e,i++); + FF1(e,a,b,c,d,i++); + FF1(d,e,a,b,c,i++); + FF1(c,d,e,a,b,i++); + FF1(b,c,d,e,a,i++); + } + + /* round three */ + for (; i < 60; ) { + FF2(a,b,c,d,e,i++); + FF2(e,a,b,c,d,i++); + FF2(d,e,a,b,c,i++); + FF2(c,d,e,a,b,i++); + FF2(b,c,d,e,a,i++); + } + + /* round four */ + for (; i < 80; ) { + FF3(a,b,c,d,e,i++); + FF3(e,a,b,c,d,i++); + FF3(d,e,a,b,c,i++); + FF3(c,d,e,a,b,i++); + FF3(b,c,d,e,a,i++); + } +#endif + + #undef FF0 + #undef FF1 + #undef FF2 + #undef FF3 + + /* store */ + md->sha1.state[0] = md->sha1.state[0] + a; + md->sha1.state[1] = md->sha1.state[1] + b; + md->sha1.state[2] = md->sha1.state[2] + c; + md->sha1.state[3] = md->sha1.state[3] + d; + md->sha1.state[4] = md->sha1.state[4] + e; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int sha1_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _sha1_compress(md, buf); + burn_stack(sizeof(ulong32) * 87); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha1_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->sha1.state[0] = 0x67452301UL; + md->sha1.state[1] = 0xefcdab89UL; + md->sha1.state[2] = 0x98badcfeUL; + md->sha1.state[3] = 0x10325476UL; + md->sha1.state[4] = 0xc3d2e1f0UL; + md->sha1.curlen = 0; + md->sha1.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(sha1_process, sha1_compress, sha1, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (20 bytes) + @return CRYPT_OK if successful +*/ +int sha1_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha1.curlen >= sizeof(md->sha1.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->sha1.length += md->sha1.curlen * 8; + + /* append the '1' bit */ + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha1.curlen > 56) { + while (md->sha1.curlen < 64) { + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; + } + sha1_compress(md, md->sha1.buf); + md->sha1.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->sha1.curlen < 56) { + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha1.length, md->sha1.buf+56); + sha1_compress(md, md->sha1.buf); + + /* copy output */ + for (i = 0; i < 5; i++) { + STORE32H(md->sha1.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha1_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[20]; + } tests[] = { + { "abc", + { 0xa9, 0x99, 0x3e, 0x36, 0x47, 0x06, 0x81, 0x6a, + 0xba, 0x3e, 0x25, 0x71, 0x78, 0x50, 0xc2, 0x6c, + 0x9c, 0xd0, 0xd8, 0x9d } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x84, 0x98, 0x3E, 0x44, 0x1C, 0x3B, 0xD2, 0x6E, + 0xBA, 0xAE, 0x4A, 0xA1, 0xF9, 0x51, 0x29, 0xE5, + 0xE5, 0x46, 0x70, 0xF1 } + } + }; + + int i; + unsigned char tmp[20]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha1_init(&md); + sha1_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha1_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 20) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha1.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:25:28 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce.c b/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce.c new file mode 100644 index 0000000..e19aa4a --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce.c @@ -0,0 +1,207 @@ +/* + * Copyright (c) 2015, Linaro Limited + * All rights reserved. + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include "tomcrypt_arm_neon.h" + +#if defined(LTC_SHA1_ARM32_CE) || defined(LTC_SHA1_ARM64_CE) + +const struct ltc_hash_descriptor sha1_desc = +{ + "sha1", + 2, + 20, + 64, + + /* OID */ + { 1, 3, 14, 3, 2, 26, }, + 6, + + &sha1_init, + &sha1_process, + &sha1_done, + &sha1_test, + NULL +}; + + +/* Implemented in assembly */ +void sha1_ce_transform(ulong32 *state, unsigned char *src, int blocks); + +static int sha1_compress_nblocks(hash_state *md, unsigned char *buf, int blocks) +{ + struct tomcrypt_arm_neon_state state; + + /* sha1_ce_transform() assumes this */ + COMPILE_TIME_ASSERT(sizeof(md->sha1.state[0]) == 4); + + tomcrypt_arm_neon_enable(&state); + sha1_ce_transform(md->sha1.state, buf, blocks); + tomcrypt_arm_neon_disable(&state); + return CRYPT_OK; +} + +static int sha1_compress(hash_state *md, unsigned char *buf) +{ + return sha1_compress_nblocks(md, buf, 1); +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS_NBLOCKS(sha1_process, sha1_compress_nblocks, sha1, 64) + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha1_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->sha1.state[0] = 0x67452301UL; + md->sha1.state[1] = 0xefcdab89UL; + md->sha1.state[2] = 0x98badcfeUL; + md->sha1.state[3] = 0x10325476UL; + md->sha1.state[4] = 0xc3d2e1f0UL; + md->sha1.curlen = 0; + md->sha1.length = 0; + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (20 bytes) + @return CRYPT_OK if successful +*/ +int sha1_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha1.curlen >= sizeof(md->sha1.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->sha1.length += md->sha1.curlen * 8; + + /* append the '1' bit */ + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha1.curlen > 56) { + while (md->sha1.curlen < 64) { + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; + } + sha1_compress(md, md->sha1.buf); + md->sha1.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->sha1.curlen < 56) { + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha1.length, md->sha1.buf+56); + sha1_compress(md, md->sha1.buf); + + /* copy output */ + for (i = 0; i < 5; i++) { + STORE32H(md->sha1.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha1_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[20]; + } tests[] = { + { "abc", + { 0xa9, 0x99, 0x3e, 0x36, 0x47, 0x06, 0x81, 0x6a, + 0xba, 0x3e, 0x25, 0x71, 0x78, 0x50, 0xc2, 0x6c, + 0x9c, 0xd0, 0xd8, 0x9d } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x84, 0x98, 0x3E, 0x44, 0x1C, 0x3B, 0xD2, 0x6E, + 0xBA, 0xAE, 0x4A, 0xA1, 0xF9, 0x51, 0x29, 0xE5, + 0xE5, 0x46, 0x70, 0xF1 } + } + }; + + int i; + unsigned char tmp[20]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha1_init(&md); + sha1_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha1_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 20) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif diff --git a/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce_a32.S b/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce_a32.S new file mode 100644 index 0000000..9ed81b3 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce_a32.S @@ -0,0 +1,135 @@ +/* + * Copyright (c) 2014-2015, Linaro Limited + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* SHA-1 secure hash using ARMv8 Crypto Extensions */ + + .text + .fpu crypto-neon-fp-armv8 + + k0 .req q0 + k1 .req q1 + k2 .req q2 + k3 .req q3 + + ta0 .req q4 + ta1 .req q5 + tb0 .req q5 + tb1 .req q4 + + dga .req q6 + dgb .req q7 + dgbs .req s28 + + dg0 .req q12 + + dg1a0 .req q13 + dg1a1 .req q14 + dg1b0 .req q14 + dg1b1 .req q13 + + .macro add_only, op, ev, rc, s0, dg1 + .ifnb \s0 + vadd.u32 tb\ev, q\s0, \rc + .endif + sha1h.32 dg1b\ev, dg0 + .ifb \dg1 + sha1\op\().32 dg0, dg1a\ev, ta\ev + .else + sha1\op\().32 dg0, \dg1, ta\ev + .endif + .endm + + .macro add_update, op, ev, rc, s0, s1, s2, s3, dg1 + sha1su0.32 q\s0, q\s1, q\s2 + add_only \op, \ev, \rc, \s1, \dg1 + sha1su1.32 q\s0, q\s3 + .endm + + .align 4 +.Lsha1_rcon: + .word 0x5a827999, 0x5a827999, 0x5a827999, 0x5a827999 + .word 0x6ed9eba1, 0x6ed9eba1, 0x6ed9eba1, 0x6ed9eba1 + .word 0x8f1bbcdc, 0x8f1bbcdc, 0x8f1bbcdc, 0x8f1bbcdc + .word 0xca62c1d6, 0xca62c1d6, 0xca62c1d6, 0xca62c1d6 + + .global sha1_ce_transform + .type sha1_ce_transform, %function +sha1_ce_transform: + /* load round constants */ + adr r3, .Lsha1_rcon + vld1.32 {k0-k1}, [r3]! + vld1.32 {k2-k3}, [r3] + + /* load state */ + vld1.32 {dga}, [r0] + vldr dgbs, [r0, #16] + +0: /* load input */ + vld1.8 {q8-q9}, [r1]! + vrev32.8 q8, q8 + vrev32.8 q9, q9 + vld1.8 {q10-q11}, [r1]! + vrev32.8 q10, q10 + vrev32.8 q11, q11 + subs r2, r2, #1 + + vadd.u32 ta0, q8, k0 + vmov dg0, dga + + add_update c, 0, k0, 8, 9, 10, 11, dgb + add_update c, 1, k0, 9, 10, 11, 8 + add_update c, 0, k0, 10, 11, 8, 9 + add_update c, 1, k0, 11, 8, 9, 10 + add_update c, 0, k1, 8, 9, 10, 11 + + add_update p, 1, k1, 9, 10, 11, 8 + add_update p, 0, k1, 10, 11, 8, 9 + add_update p, 1, k1, 11, 8, 9, 10 + add_update p, 0, k1, 8, 9, 10, 11 + add_update p, 1, k2, 9, 10, 11, 8 + + add_update m, 0, k2, 10, 11, 8, 9 + add_update m, 1, k2, 11, 8, 9, 10 + add_update m, 0, k2, 8, 9, 10, 11 + add_update m, 1, k2, 9, 10, 11, 8 + add_update m, 0, k3, 10, 11, 8, 9 + + add_update p, 1, k3, 11, 8, 9, 10 + add_only p, 0, k3, 9 + add_only p, 1, k3, 10 + add_only p, 0, k3, 11 + add_only p, 1 + + /* update state */ + vadd.u32 dga, dga, dg0 + vadd.u32 dgb, dgb, dg1a0 + bne 0b + + /* store new state */ + vst1.32 {dga}, [r0] + vstr dgbs, [r0, #16] + bx lr diff --git a/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce_a64.S b/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce_a64.S new file mode 100644 index 0000000..76091ad --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha1_armv8a_ce_a64.S @@ -0,0 +1,158 @@ +/* + * Copyright (c) 2014-2015, Linaro Limited + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + + /* + * SHA-1 secure hash using ARMv8 Crypto Extensions + * + * Copyright (C) 2014 Linaro Ltd <ard.biesheuvel@linaro.org> + */ + + +#define ENTRY(func) \ + .global func ; \ + .type func , %function ; \ + func : + +#define ENDPROC(func) \ + .size func , .-func + + .text + .arch armv8-a+crypto + + k0 .req v0 + k1 .req v1 + k2 .req v2 + k3 .req v3 + + t0 .req v4 + t1 .req v5 + + dga .req q6 + dgav .req v6 + dgb .req s7 + dgbv .req v7 + + dg0q .req q12 + dg0s .req s12 + dg0v .req v12 + dg1s .req s13 + dg1v .req v13 + dg2s .req s14 + + .macro add_only, op, ev, rc, s0, dg1 + .ifc \ev, ev + add t1.4s, v\s0\().4s, \rc\().4s + sha1h dg2s, dg0s + .ifnb \dg1 + sha1\op dg0q, \dg1, t0.4s + .else + sha1\op dg0q, dg1s, t0.4s + .endif + .else + .ifnb \s0 + add t0.4s, v\s0\().4s, \rc\().4s + .endif + sha1h dg1s, dg0s + sha1\op dg0q, dg2s, t1.4s + .endif + .endm + + .macro add_update, op, ev, rc, s0, s1, s2, s3, dg1 + sha1su0 v\s0\().4s, v\s1\().4s, v\s2\().4s + add_only \op, \ev, \rc, \s1, \dg1 + sha1su1 v\s0\().4s, v\s3\().4s + .endm + + /* + * The SHA1 round constants + */ + .align 4 +.Lsha1_rcon: + .word 0x5a827999, 0x6ed9eba1, 0x8f1bbcdc, 0xca62c1d6 + + /* + * void sha1_ce_transform(u32 state[5], u8 const *src, int blocks) + */ +ENTRY(sha1_ce_transform) + /* load round constants */ + adr x6, .Lsha1_rcon + ld1r {k0.4s}, [x6], #4 + ld1r {k1.4s}, [x6], #4 + ld1r {k2.4s}, [x6], #4 + ld1r {k3.4s}, [x6] + + /* load state */ + ld1 {dgav.4s}, [x0] + ldr dgb, [x0, #16] + + /* load input */ +0: ld1 {v8.16b-v11.16b}, [x1], #64 + sub w2, w2, #1 + + rev32 v8.16b, v8.16b + rev32 v9.16b, v9.16b + rev32 v10.16b, v10.16b + rev32 v11.16b, v11.16b + +1: add t0.4s, v8.4s, k0.4s + mov dg0v.16b, dgav.16b + + add_update c, ev, k0, 8, 9, 10, 11, dgb + add_update c, od, k0, 9, 10, 11, 8 + add_update c, ev, k0, 10, 11, 8, 9 + add_update c, od, k0, 11, 8, 9, 10 + add_update c, ev, k1, 8, 9, 10, 11 + + add_update p, od, k1, 9, 10, 11, 8 + add_update p, ev, k1, 10, 11, 8, 9 + add_update p, od, k1, 11, 8, 9, 10 + add_update p, ev, k1, 8, 9, 10, 11 + add_update p, od, k2, 9, 10, 11, 8 + + add_update m, ev, k2, 10, 11, 8, 9 + add_update m, od, k2, 11, 8, 9, 10 + add_update m, ev, k2, 8, 9, 10, 11 + add_update m, od, k2, 9, 10, 11, 8 + add_update m, ev, k3, 10, 11, 8, 9 + + add_update p, od, k3, 11, 8, 9, 10 + add_only p, ev, k3, 9 + add_only p, od, k3, 10 + add_only p, ev, k3, 11 + add_only p, od + + /* update state */ + add dgbv.2s, dgbv.2s, dg1v.2s + add dgav.4s, dgav.4s, dg0v.4s + + cbnz w2, 0b + + /* store new state */ +3: st1 {dgav.4s}, [x0] + str dgb, [x0, #16] + ret +ENDPROC(sha1_ce_transform) diff --git a/core/lib/libtomcrypt/src/hashes/sha2/sha224.c b/core/lib/libtomcrypt/src/hashes/sha2/sha224.c new file mode 100644 index 0000000..6055655 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha2/sha224.c @@ -0,0 +1,157 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +/** + @param sha224.c + LTC_SHA-224 new NIST standard based off of LTC_SHA-256 truncated to 224 bits (Tom St Denis) +*/ + +#include "tomcrypt.h" + +#if defined(LTC_SHA224) && defined(LTC_SHA256) + +const struct ltc_hash_descriptor sha224_desc = +{ + "sha224", + 10, + 28, + 64, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 4, }, + 9, + + &sha224_init, + &sha256_process, + &sha224_done, + &sha224_test, + NULL +}; + +/* init the sha256 er... sha224 state ;-) */ +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha224_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0xc1059ed8UL; + md->sha256.state[1] = 0x367cd507UL; + md->sha256.state[2] = 0x3070dd17UL; + md->sha256.state[3] = 0xf70e5939UL; + md->sha256.state[4] = 0xffc00b31UL; + md->sha256.state[5] = 0x68581511UL; + md->sha256.state[6] = 0x64f98fa7UL; + md->sha256.state[7] = 0xbefa4fa4UL; + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (28 bytes) + @return CRYPT_OK if successful +*/ +int sha224_done(hash_state * md, unsigned char *out) +{ + unsigned char buf[32]; + int err; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + err = sha256_done(md, buf); + XMEMCPY(out, buf, 28); +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return err; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha224_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[28]; + } tests[] = { + { "abc", + { 0x23, 0x09, 0x7d, 0x22, 0x34, 0x05, 0xd8, + 0x22, 0x86, 0x42, 0xa4, 0x77, 0xbd, 0xa2, + 0x55, 0xb3, 0x2a, 0xad, 0xbc, 0xe4, 0xbd, + 0xa0, 0xb3, 0xf7, 0xe3, 0x6c, 0x9d, 0xa7 } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x75, 0x38, 0x8b, 0x16, 0x51, 0x27, 0x76, + 0xcc, 0x5d, 0xba, 0x5d, 0xa1, 0xfd, 0x89, + 0x01, 0x50, 0xb0, 0xc6, 0x45, 0x5c, 0xb4, + 0xf5, 0x8b, 0x19, 0x52, 0x52, 0x25, 0x25 } + }, + }; + + int i; + unsigned char tmp[28]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha224_init(&md); + sha224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha224_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 28) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif /* defined(LTC_SHA224) && defined(LTC_SHA256) */ + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha224.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:25:28 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/sha2/sha256.c b/core/lib/libtomcrypt/src/hashes/sha2/sha256.c new file mode 100644 index 0000000..e1e827d --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha2/sha256.c @@ -0,0 +1,363 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file sha256.c + LTC_SHA256 by Tom St Denis +*/ + +#ifdef LTC_SHA256 + +const struct ltc_hash_descriptor sha256_desc = +{ + "sha256", + 0, + 32, + 64, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 1, }, + 9, + + &sha256_init, + &sha256_process, + &sha256_done, + &sha256_test, + NULL +}; + +#ifdef LTC_SMALL_CODE +/* the K array */ +static const ulong32 K[64] = { + 0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL, + 0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL, + 0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL, + 0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL, + 0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL, + 0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL, + 0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL, + 0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL, + 0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL, + 0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL, + 0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL, + 0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL, + 0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL +}; +#endif + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) RORc((x),(n)) +#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) +#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) +#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) +#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) +#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) + +/* compress 512-bits */ +#ifdef LTC_CLEAN_STACK +static int _sha256_compress(hash_state * md, unsigned char *buf) +#else +static int sha256_compress(hash_state * md, unsigned char *buf) +#endif +{ + ulong32 S[8], W[64], t0, t1; +#ifdef LTC_SMALL_CODE + ulong32 t; +#endif + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha256.state[i]; + } + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32H(W[i], buf + (4*i)); + } + + /* fill W[16..63] */ + for (i = 16; i < 64; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ +#ifdef LTC_SMALL_CODE +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + for (i = 0; i < 64; ++i) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); + t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; + S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; + } +#else +#define RND(a,b,c,d,e,f,g,h,i,ki) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); + +#undef RND + +#endif + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha256.state[i] = md->sha256.state[i] + S[i]; + } + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int sha256_compress(hash_state * md, unsigned char *buf) +{ + int err; + err = _sha256_compress(md, buf); + burn_stack(sizeof(ulong32) * 74); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha256_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0x6A09E667UL; + md->sha256.state[1] = 0xBB67AE85UL; + md->sha256.state[2] = 0x3C6EF372UL; + md->sha256.state[3] = 0xA54FF53AUL; + md->sha256.state[4] = 0x510E527FUL; + md->sha256.state[5] = 0x9B05688CUL; + md->sha256.state[6] = 0x1F83D9ABUL; + md->sha256.state[7] = 0x5BE0CD19UL; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(sha256_process, sha256_compress, sha256, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (32 bytes) + @return CRYPT_OK if successful +*/ +int sha256_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha256.curlen >= sizeof(md->sha256.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->sha256.length += md->sha256.curlen * 8; + + /* append the '1' bit */ + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha256.curlen > 56) { + while (md->sha256.curlen < 64) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + sha256_compress(md, md->sha256.buf); + md->sha256.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->sha256.curlen < 56) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha256.length, md->sha256.buf+56); + sha256_compress(md, md->sha256.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE32H(md->sha256.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha256_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[32]; + } tests[] = { + { "abc", + { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea, + 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23, + 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c, + 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } + }, + }; + + int i; + unsigned char tmp[32]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha256_init(&md); + sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha256_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 32) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha256.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2007/05/12 14:25:28 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce.c b/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce.c new file mode 100644 index 0000000..0ba73e7 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce.c @@ -0,0 +1,216 @@ +/* + * Copyright (c) 2015, Linaro Limited + * All rights reserved. + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include "tomcrypt_arm_neon.h" + +/** + @file sha256_arm32_ce.c + LTC_SHA256_ARM32_CE +*/ + +#if defined(LTC_SHA256_ARM32_CE) || defined(LTC_SHA256_ARM64_CE) + +const struct ltc_hash_descriptor sha256_desc = +{ + "sha256", + 0, + 32, + 64, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 1, }, + 9, + + &sha256_init, + &sha256_process, + &sha256_done, + &sha256_test, + NULL +}; + + +/* Implemented in assembly */ +int sha256_ce_transform(ulong32 *state, unsigned char *buf, int blocks); + +static int sha256_compress_nblocks(hash_state *md, unsigned char *buf, int blocks) +{ + struct tomcrypt_arm_neon_state state; + + tomcrypt_arm_neon_enable(&state); + sha256_ce_transform(md->sha256.state, buf, blocks); + tomcrypt_arm_neon_disable(&state); + return CRYPT_OK; +} + +static int sha256_compress(hash_state *md, unsigned char *buf) +{ + return sha256_compress_nblocks(md, buf, 1); +} + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha256_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0x6A09E667UL; + md->sha256.state[1] = 0xBB67AE85UL; + md->sha256.state[2] = 0x3C6EF372UL; + md->sha256.state[3] = 0xA54FF53AUL; + md->sha256.state[4] = 0x510E527FUL; + md->sha256.state[5] = 0x9B05688CUL; + md->sha256.state[6] = 0x1F83D9ABUL; + md->sha256.state[7] = 0x5BE0CD19UL; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS_NBLOCKS(sha256_process, sha256_compress_nblocks, sha256, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (32 bytes) + @return CRYPT_OK if successful +*/ +int sha256_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha256.curlen >= sizeof(md->sha256.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->sha256.length += md->sha256.curlen * 8; + + /* append the '1' bit */ + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha256.curlen > 56) { + while (md->sha256.curlen < 64) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + sha256_compress(md, md->sha256.buf); + md->sha256.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->sha256.curlen < 56) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha256.length, md->sha256.buf+56); + sha256_compress(md, md->sha256.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE32H(md->sha256.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha256_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[32]; + } tests[] = { + { "abc", + { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea, + 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23, + 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c, + 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } + }, + }; + + int i; + unsigned char tmp[32]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha256_init(&md); + sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha256_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 32) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif diff --git a/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce_a32.S b/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce_a32.S new file mode 100644 index 0000000..26568fd --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce_a32.S @@ -0,0 +1,133 @@ +/* + * Copyright (c) 2014-2015, Linaro Limited + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* SHA-256 secure hash using ARMv8 Crypto Extensions */ + + .text + .fpu crypto-neon-fp-armv8 + + k0 .req q7 + k1 .req q8 + + ta0 .req q9 + ta1 .req q10 + tb0 .req q10 + tb1 .req q9 + + dga .req q11 + dgb .req q12 + + dg0 .req q13 + dg1 .req q14 + dg2 .req q15 + + .macro add_only, ev, s0 + vmov dg2, dg0 + .ifnb \s0 + vld1.32 {k\ev}, [r3]! + .endif + sha256h.32 dg0, dg1, tb\ev + sha256h2.32 dg1, dg2, tb\ev + .ifnb \s0 + vadd.u32 ta\ev, q\s0, k\ev + .endif + .endm + + .macro add_update, ev, s0, s1, s2, s3 + sha256su0.32 q\s0, q\s1 + add_only \ev, \s1 + sha256su1.32 q\s0, q\s2, q\s3 + .endm + + .align 6 +.Lsha256_rcon: + .word 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5 + .word 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5 + .word 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3 + .word 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174 + .word 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc + .word 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da + .word 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7 + .word 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967 + .word 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13 + .word 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85 + .word 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3 + .word 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070 + .word 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5 + .word 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3 + .word 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208 + .word 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2 + + .global sha256_ce_transform + .type sha256_ce_transform, %function +sha256_ce_transform: + /* load state */ + vld1.8 {dga-dgb}, [r0] + + /* load input */ +0: vld1.8 {q0-q1}, [r1]! + vrev32.8 q0, q0 + vrev32.8 q1, q1 + vld1.8 {q2-q3}, [r1]! + vrev32.8 q2, q2 + vrev32.8 q3, q3 + subs r2, r2, #1 + + /* load round constants */ + adr r3, .Lsha256_rcon + vld1.32 {k0}, [r3]! + + vadd.u32 ta0, q0, k0 + vmov dg0, dga + vmov dg1, dgb + + add_update 1, 0, 1, 2, 3 + add_update 0, 1, 2, 3, 0 + add_update 1, 2, 3, 0, 1 + add_update 0, 3, 0, 1, 2 + add_update 1, 0, 1, 2, 3 + add_update 0, 1, 2, 3, 0 + add_update 1, 2, 3, 0, 1 + add_update 0, 3, 0, 1, 2 + add_update 1, 0, 1, 2, 3 + add_update 0, 1, 2, 3, 0 + add_update 1, 2, 3, 0, 1 + add_update 0, 3, 0, 1, 2 + + add_only 1, 1 + add_only 0, 2 + add_only 1, 3 + add_only 0 + + /* update state */ + vadd.u32 dga, dga, dg0 + vadd.u32 dgb, dgb, dg1 + bne 0b + + /* store new state */ + vst1.8 {dga-dgb}, [r0] + bx lr diff --git a/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce_a64.S b/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce_a64.S new file mode 100644 index 0000000..506525e --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha2/sha256_armv8a_ce_a64.S @@ -0,0 +1,166 @@ +/* + * Copyright (c) 2015, Linaro Limited + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * Core SHA-224/SHA-256 transform using v8 Crypto Extensions + * + * Copyright (C) 2014 Linaro Ltd <ard.biesheuvel@linaro.org> + */ + + +#define ENTRY(func) \ + .global func ; \ + .type func , %function ; \ + func : + +#define ENDPROC(func) \ + .size func , .-func + + .text + .arch armv8-a+crypto + + dga .req q20 + dgav .req v20 + dgb .req q21 + dgbv .req v21 + + t0 .req v22 + t1 .req v23 + + dg0q .req q24 + dg0v .req v24 + dg1q .req q25 + dg1v .req v25 + dg2q .req q26 + dg2v .req v26 + + .macro add_only, ev, rc, s0 + mov dg2v.16b, dg0v.16b + .ifeq \ev + add t1.4s, v\s0\().4s, \rc\().4s + sha256h dg0q, dg1q, t0.4s + sha256h2 dg1q, dg2q, t0.4s + .else + .ifnb \s0 + add t0.4s, v\s0\().4s, \rc\().4s + .endif + sha256h dg0q, dg1q, t1.4s + sha256h2 dg1q, dg2q, t1.4s + .endif + .endm + + .macro add_update, ev, rc, s0, s1, s2, s3 + sha256su0 v\s0\().4s, v\s1\().4s + add_only \ev, \rc, \s1 + sha256su1 v\s0\().4s, v\s2\().4s, v\s3\().4s + .endm + + /* + * The SHA-256 round constants + */ + .align 4 +.Lsha2_rcon: + .word 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5 + .word 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5 + .word 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3 + .word 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174 + .word 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc + .word 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da + .word 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7 + .word 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967 + .word 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13 + .word 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85 + .word 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3 + .word 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070 + .word 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5 + .word 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3 + .word 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208 + .word 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2 + + /* + * void sha2_ce_transform(struct sha256_ce_state *sst, u8 const *src, + * int blocks) + */ +ENTRY(sha256_ce_transform) + /* load round constants */ + adr x8, .Lsha2_rcon + ld1 { v0.4s- v3.4s}, [x8], #64 + ld1 { v4.4s- v7.4s}, [x8], #64 + ld1 { v8.4s-v11.4s}, [x8], #64 + ld1 {v12.4s-v15.4s}, [x8] + + /* load state */ + mov x9, x0 + ld1 {dgav.4s}, [x9], #16 + ld1 {dgbv.4s}, [x9] + + /* load input */ +0: ld1 {v16.16b-v19.16b}, [x1], #64 + sub w2, w2, #1 + + rev32 v16.16b, v16.16b + rev32 v17.16b, v17.16b + rev32 v18.16b, v18.16b + rev32 v19.16b, v19.16b + +1: add t0.4s, v16.4s, v0.4s + mov dg0v.16b, dgav.16b + mov dg1v.16b, dgbv.16b + + add_update 0, v1, 16, 17, 18, 19 + add_update 1, v2, 17, 18, 19, 16 + add_update 0, v3, 18, 19, 16, 17 + add_update 1, v4, 19, 16, 17, 18 + + add_update 0, v5, 16, 17, 18, 19 + add_update 1, v6, 17, 18, 19, 16 + add_update 0, v7, 18, 19, 16, 17 + add_update 1, v8, 19, 16, 17, 18 + + add_update 0, v9, 16, 17, 18, 19 + add_update 1, v10, 17, 18, 19, 16 + add_update 0, v11, 18, 19, 16, 17 + add_update 1, v12, 19, 16, 17, 18 + + add_only 0, v13, 17 + add_only 1, v14, 18 + add_only 0, v15, 19 + add_only 1 + + /* update state */ + add dgav.4s, dgav.4s, dg0v.4s + add dgbv.4s, dgbv.4s, dg1v.4s + + /* handled all input blocks? */ + cbnz w2, 0b + + /* store new state */ +3: mov x9, x0 + st1 {dgav.16b}, [x9], #16 + st1 {dgbv.16b}, [x9] + ret +ENDPROC(sha256_ce_transform) diff --git a/core/lib/libtomcrypt/src/hashes/sha2/sha384.c b/core/lib/libtomcrypt/src/hashes/sha2/sha384.c new file mode 100644 index 0000000..c491f70 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha2/sha384.c @@ -0,0 +1,165 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +/** + @param sha384.c + LTC_SHA384 hash included in sha512.c, Tom St Denis +*/ + +#include "tomcrypt.h" + +#if defined(LTC_SHA384) && defined(LTC_SHA512) + +const struct ltc_hash_descriptor sha384_desc = +{ + "sha384", + 4, + 48, + 128, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 2, }, + 9, + + &sha384_init, + &sha512_process, + &sha384_done, + &sha384_test, + NULL +}; + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha384_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8); + md->sha512.state[1] = CONST64(0x629a292a367cd507); + md->sha512.state[2] = CONST64(0x9159015a3070dd17); + md->sha512.state[3] = CONST64(0x152fecd8f70e5939); + md->sha512.state[4] = CONST64(0x67332667ffc00b31); + md->sha512.state[5] = CONST64(0x8eb44a8768581511); + md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7); + md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4); + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (48 bytes) + @return CRYPT_OK if successful +*/ +int sha384_done(hash_state * md, unsigned char *out) +{ + unsigned char buf[64]; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + sha512_done(md, buf); + XMEMCPY(out, buf, 48); +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha384_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[48]; + } tests[] = { + { "abc", + { 0xcb, 0x00, 0x75, 0x3f, 0x45, 0xa3, 0x5e, 0x8b, + 0xb5, 0xa0, 0x3d, 0x69, 0x9a, 0xc6, 0x50, 0x07, + 0x27, 0x2c, 0x32, 0xab, 0x0e, 0xde, 0xd1, 0x63, + 0x1a, 0x8b, 0x60, 0x5a, 0x43, 0xff, 0x5b, 0xed, + 0x80, 0x86, 0x07, 0x2b, 0xa1, 0xe7, 0xcc, 0x23, + 0x58, 0xba, 0xec, 0xa1, 0x34, 0xc8, 0x25, 0xa7 } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x09, 0x33, 0x0c, 0x33, 0xf7, 0x11, 0x47, 0xe8, + 0x3d, 0x19, 0x2f, 0xc7, 0x82, 0xcd, 0x1b, 0x47, + 0x53, 0x11, 0x1b, 0x17, 0x3b, 0x3b, 0x05, 0xd2, + 0x2f, 0xa0, 0x80, 0x86, 0xe3, 0xb0, 0xf7, 0x12, + 0xfc, 0xc7, 0xc7, 0x1a, 0x55, 0x7e, 0x2d, 0xb9, + 0x66, 0xc3, 0xe9, 0xfa, 0x91, 0x74, 0x60, 0x39 } + }, + }; + + int i; + unsigned char tmp[48]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha384_init(&md); + sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha384_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 48) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */ + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha384.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:25:28 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/sha2/sha512.c b/core/lib/libtomcrypt/src/hashes/sha2/sha512.c new file mode 100644 index 0000000..1fd2323 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha2/sha512.c @@ -0,0 +1,342 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @param sha512.c + LTC_SHA512 by Tom St Denis +*/ + +#ifdef LTC_SHA512 + +const struct ltc_hash_descriptor sha512_desc = +{ + "sha512", + 5, + 64, + 128, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 3, }, + 9, + + &sha512_init, + &sha512_process, + &sha512_done, + &sha512_test, + NULL +}; + +/* the K array */ +static const ulong64 K[80] = { +CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), +CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc), +CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), +CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118), +CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), +CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2), +CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), +CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694), +CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), +CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65), +CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), +CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5), +CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), +CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4), +CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), +CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70), +CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), +CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df), +CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), +CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b), +CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001), +CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30), +CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), +CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8), +CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), +CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8), +CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), +CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3), +CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), +CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec), +CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), +CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b), +CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), +CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178), +CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), +CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b), +CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), +CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c), +CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), +CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817) +}; + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) ROR64c(x, n) +#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) +#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) +#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) +#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) +#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) + +/* compress 1024-bits */ +#ifdef LTC_CLEAN_STACK +static int _sha512_compress(hash_state * md, unsigned char *buf) +#else +static int sha512_compress(hash_state * md, unsigned char *buf) +#endif +{ + ulong64 S[8], W[80], t0, t1; + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha512.state[i]; + } + + /* copy the state into 1024-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD64H(W[i], buf + (8*i)); + } + + /* fill W[16..79] */ + for (i = 16; i < 80; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ +#ifdef LTC_SMALL_CODE + for (i = 0; i < 80; i++) { + t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; + t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); + S[7] = S[6]; + S[6] = S[5]; + S[5] = S[4]; + S[4] = S[3] + t0; + S[3] = S[2]; + S[2] = S[1]; + S[1] = S[0]; + S[0] = t0 + t1; + } +#else +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + for (i = 0; i < 80; i += 8) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); + } +#endif + + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha512.state[i] = md->sha512.state[i] + S[i]; + } + + return CRYPT_OK; +} + +/* compress 1024-bits */ +#ifdef LTC_CLEAN_STACK +static int sha512_compress(hash_state * md, unsigned char *buf) +{ + int err; + err = _sha512_compress(md, buf); + burn_stack(sizeof(ulong64) * 90 + sizeof(int)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha512_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); + md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); + md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); + md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); + md->sha512.state[4] = CONST64(0x510e527fade682d1); + md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); + md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); + md->sha512.state[7] = CONST64(0x5be0cd19137e2179); + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(sha512_process, sha512_compress, sha512, 128) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (64 bytes) + @return CRYPT_OK if successful +*/ +int sha512_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->sha512.length += md->sha512.curlen * CONST64(8); + + /* append the '1' bit */ + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 112 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha512.curlen > 112) { + while (md->sha512.curlen < 128) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + sha512_compress(md, md->sha512.buf); + md->sha512.curlen = 0; + } + + /* pad upto 120 bytes of zeroes + * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash + * > 2^64 bits of data... :-) + */ + while (md->sha512.curlen < 120) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha512.length, md->sha512.buf+120); + sha512_compress(md, md->sha512.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE64H(md->sha512.state[i], out+(8*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha512_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[64]; + } tests[] = { + { "abc", + { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba, + 0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31, + 0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2, + 0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a, + 0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8, + 0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd, + 0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e, + 0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda, + 0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f, + 0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1, + 0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18, + 0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4, + 0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a, + 0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54, + 0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 } + }, + }; + + int i; + unsigned char tmp[64]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha512_init(&md); + sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha512_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 64) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha512.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:25:28 $ */ diff --git a/core/lib/libtomcrypt/src/hashes/sha2/sub.mk b/core/lib/libtomcrypt/src/hashes/sha2/sub.mk new file mode 100644 index 0000000..e6ff9bf --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sha2/sub.mk @@ -0,0 +1,17 @@ +srcs-$(CFG_CRYPTO_SHA224) += sha224.c + +# SHA-224 needs SHA-256 +SHA256 := $(call cfg-one-enabled, CFG_CRYPTO_SHA224 CFG_CRYPTO_SHA256) +ifeq ($(SHA256),y) +SHA256_CE := $(call cfg-one-enabled, CFG_CRYPTO_SHA256_ARM32_CE CFG_CRYPTO_SHA256_ARM64_CE) +ifeq ($(SHA256_CE),y) +srcs-y += sha256_armv8a_ce.c +srcs-$(CFG_CRYPTO_SHA256_ARM32_CE) += sha256_armv8a_ce_a32.S +srcs-$(CFG_CRYPTO_SHA256_ARM64_CE) += sha256_armv8a_ce_a64.S +else +srcs-y += sha256.c +endif +endif + +srcs-$(CFG_CRYPTO_SHA384) += sha384.c +srcs-$(CFG_CRYPTO_SHA512) += sha512.c diff --git a/core/lib/libtomcrypt/src/hashes/sub.mk b/core/lib/libtomcrypt/src/hashes/sub.mk new file mode 100644 index 0000000..7e897f7 --- /dev/null +++ b/core/lib/libtomcrypt/src/hashes/sub.mk @@ -0,0 +1,15 @@ +srcs-$(CFG_CRYPTO_MD5) += md5.c + +ifeq ($(CFG_CRYPTO_SHA1),y) +SHA1_CE := $(call cfg-one-enabled, CFG_CRYPTO_SHA1_ARM32_CE CFG_CRYPTO_SHA1_ARM64_CE) +ifeq ($(SHA1_CE),y) +srcs-y += sha1_armv8a_ce.c +srcs-$(CFG_CRYPTO_SHA1_ARM32_CE) += sha1_armv8a_ce_a32.S +srcs-$(CFG_CRYPTO_SHA1_ARM64_CE) += sha1_armv8a_ce_a64.S +else +srcs-y += sha1.c +endif +endif + +subdirs-y += helper +subdirs-y += sha2 diff --git a/core/lib/libtomcrypt/src/mac/hmac/hmac_done.c b/core/lib/libtomcrypt/src/mac/hmac/hmac_done.c new file mode 100644 index 0000000..5b9e738 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/hmac/hmac_done.c @@ -0,0 +1,135 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file hmac_done.c + LTC_HMAC support, terminate stream, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash]->blocksize + +/** + Terminate an LTC_HMAC session + @param hmac The LTC_HMAC state + @param out [out] The destination of the LTC_HMAC authentication tag + @param outlen [in/out] The max size and resulting size of the LTC_HMAC authentication tag + @return CRYPT_OK if successful +*/ +int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen) +{ + unsigned char *buf, *isha; + unsigned long hashsize, i; + int hash, err; + + LTC_ARGCHK(hmac != NULL); + LTC_ARGCHK(out != NULL); + + /* test hash */ + hash = hmac->hash; + if((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + /* get the hash message digest size */ + hashsize = hash_descriptor[hash]->hashsize; + + /* allocate buffers */ + buf = XMALLOC(LTC_HMAC_BLOCKSIZE); + isha = XMALLOC(hashsize); + if (buf == NULL || isha == NULL) { + if (buf != NULL) { + XFREE(buf); + } + if (isha != NULL) { + XFREE(isha); + } + return CRYPT_MEM; + } + + /* Get the hash of the first LTC_HMAC vector plus the data */ + if ((err = hash_descriptor[hash]->done(&hmac->md, isha)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* Create the second LTC_HMAC vector vector for step (3) */ + for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { + buf[i] = hmac->key[i] ^ 0x5C; + } + + /* Now calculate the "outer" hash for step (5), (6), and (7) */ + if ((err = hash_descriptor[hash]->init(&hmac->md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash]->process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash]->process(&hmac->md, isha, hashsize)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash]->done(&hmac->md, buf)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* copy to output */ + for (i = 0; i < hashsize && i < *outlen; i++) { + out[i] = buf[i]; + } + *outlen = i; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(isha, hashsize); + zeromem(buf, hashsize); + zeromem(hmac, sizeof(*hmac)); +#endif + + XFREE(isha); + XFREE(buf); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/hmac/hmac_file.c b/core/lib/libtomcrypt/src/mac/hmac/hmac_file.c new file mode 100644 index 0000000..03cc140 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/hmac/hmac_file.c @@ -0,0 +1,120 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file hmac_file.c + LTC_HMAC support, process a file, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +/** + LTC_HMAC a file + @param hash The index of the hash you wish to use + @param fname The name of the file you wish to LTC_HMAC + @param key The secret key + @param keylen The length of the secret key + @param out [out] The LTC_HMAC authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int hmac_file(int hash, const char *fname, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + hmac_state hmac; + FILE *in; + unsigned char buf[512]; + size_t x; + int err; + + LTC_ARGCHK(fname != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if ((err = hmac_init(&hmac, hash, key, keylen)) != CRYPT_OK) { + return err; + } + + in = fopen(fname, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + /* process the file contents */ + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = hmac_process(&hmac, buf, (unsigned long)x)) != CRYPT_OK) { + /* we don't trap this error since we're already returning an error! */ + fclose(in); + return err; + } + } while (x == sizeof(buf)); + + if (fclose(in) != 0) { + return CRYPT_ERROR; + } + + /* get final hmac */ + if ((err = hmac_done(&hmac, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + /* clear memory */ + zeromem(buf, sizeof(buf)); +#endif + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_file.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/hmac/hmac_init.c b/core/lib/libtomcrypt/src/mac/hmac/hmac_init.c new file mode 100644 index 0000000..abc5bf3 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/hmac/hmac_init.c @@ -0,0 +1,134 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file hmac_init.c + LTC_HMAC support, initialize state, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash]->blocksize + +/** + Initialize an LTC_HMAC context. + @param hmac The LTC_HMAC state + @param hash The index of the hash you want to use + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned long keylen) +{ + unsigned char *buf; + unsigned long hashsize; + unsigned long i, z; + int err; + + LTC_ARGCHK(hmac != NULL); + LTC_ARGCHK(key != NULL); + + /* valid hash? */ + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + hmac->hash = hash; + hashsize = hash_descriptor[hash]->hashsize; + + /* valid key length? */ + if (keylen == 0) { + return CRYPT_INVALID_KEYSIZE; + } + + /* allocate ram for buf */ + buf = XMALLOC(LTC_HMAC_BLOCKSIZE); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* check hash blocks fits */ + if (sizeof(hmac->key) < LTC_HMAC_BLOCKSIZE) { + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* (1) make sure we have a large enough key */ + if(keylen > LTC_HMAC_BLOCKSIZE) { + z = LTC_HMAC_BLOCKSIZE; + if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + keylen = hashsize; + } else { + XMEMCPY(hmac->key, key, (size_t)keylen); + } + + if(keylen < LTC_HMAC_BLOCKSIZE) { + zeromem((hmac->key) + keylen, (size_t)(LTC_HMAC_BLOCKSIZE - keylen)); + } + + /* Create the initial vector for step (3) */ + for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { + buf[i] = hmac->key[i] ^ 0x36; + } + + /* Pre-pend that to the hash data */ + if ((err = hash_descriptor[hash]->init(&hmac->md)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = hash_descriptor[hash]->process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { + goto LBL_ERR; + } + goto done; +LBL_ERR: +done: +#ifdef LTC_CLEAN_STACK + zeromem(buf, LTC_HMAC_BLOCKSIZE); +#endif + + XFREE(buf); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_init.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/hmac/hmac_memory.c b/core/lib/libtomcrypt/src/mac/hmac/hmac_memory.c new file mode 100644 index 0000000..1d2e1ef --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/hmac/hmac_memory.c @@ -0,0 +1,115 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file hmac_memory.c + LTC_HMAC support, process a block of memory, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +/** + LTC_HMAC a block of memory to produce the authentication tag + @param hash The index of the hash to use + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data to LTC_HMAC + @param inlen The length of the data to LTC_HMAC (octets) + @param out [out] Destination of the authentication tag + @param outlen [in/out] Max size and resulting size of authentication tag + @return CRYPT_OK if successful +*/ +int hmac_memory(int hash, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + hmac_state *hmac; + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* make sure hash descriptor is valid */ + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + /* is there a descriptor? */ + if (hash_descriptor[hash]->hmac_block != NULL) { + return hash_descriptor[hash]->hmac_block(key, keylen, in, inlen, out, outlen); + } + + /* nope, so call the hmac functions */ + /* allocate ram for hmac state */ + hmac = XMALLOC(sizeof(hmac_state)); + if (hmac == NULL) { + return CRYPT_MEM; + } + + if ((err = hmac_init(hmac, hash, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = hmac_process(hmac, in, inlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = hmac_done(hmac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(hmac, sizeof(hmac_state)); +#endif + + XFREE(hmac); + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_memory.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/hmac/hmac_memory_multi.c b/core/lib/libtomcrypt/src/mac/hmac/hmac_memory_multi.c new file mode 100644 index 0000000..95d7d1e --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/hmac/hmac_memory_multi.c @@ -0,0 +1,119 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file hmac_memory_multi.c + LTC_HMAC support, process multiple blocks of memory, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +/** + LTC_HMAC multiple blocks of memory to produce the authentication tag + @param hash The index of the hash to use + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] Destination of the authentication tag + @param outlen [in/out] Max size and resulting size of authentication tag + @param in The data to LTC_HMAC + @param inlen The length of the data to LTC_HMAC (octets) + @param ... tuples of (data,len) pairs to LTC_HMAC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int hmac_memory_multi(int hash, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) + +{ + hmac_state *hmac; + int err; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for hmac state */ + hmac = XMALLOC(sizeof(hmac_state)); + if (hmac == NULL) { + return CRYPT_MEM; + } + + if ((err = hmac_init(hmac, hash, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = hmac_process(hmac, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = hmac_done(hmac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(hmac, sizeof(hmac_state)); +#endif + XFREE(hmac); + va_end(args); + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_memory_multi.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/hmac/hmac_process.c b/core/lib/libtomcrypt/src/mac/hmac/hmac_process.c new file mode 100644 index 0000000..6b6f62d --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/hmac/hmac_process.c @@ -0,0 +1,70 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file hmac_process.c + LTC_HMAC support, process data, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +/** + Process data through LTC_HMAC + @param hmac The hmac state + @param in The data to send through LTC_HMAC + @param inlen The length of the data to LTC_HMAC (octets) + @return CRYPT_OK if successful +*/ +int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen) +{ + int err; + LTC_ARGCHK(hmac != NULL); + LTC_ARGCHK(in != NULL); + if ((err = hash_is_valid(hmac->hash)) != CRYPT_OK) { + return err; + } + return hash_descriptor[hmac->hash]->process(&hmac->md, in, inlen); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_process.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/hmac/sub.mk b/core/lib/libtomcrypt/src/mac/hmac/sub.mk new file mode 100644 index 0000000..e1c3627 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/hmac/sub.mk @@ -0,0 +1,9 @@ +cflags-y += -Wno-unused-parameter + +srcs-y += hmac_done.c +# srcs-y += hmac_file.c +srcs-y += hmac_init.c +srcs-y += hmac_memory.c +srcs-y += hmac_memory_multi.c +srcs-y += hmac_process.c +# srcs-y += hmac_test.c diff --git a/core/lib/libtomcrypt/src/mac/omac/omac_done.c b/core/lib/libtomcrypt/src/mac/omac/omac_done.c new file mode 100644 index 0000000..3bb62a2 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/omac/omac_done.c @@ -0,0 +1,113 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file omac_done.c + LTC_OMAC1 support, terminate a stream, Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + Terminate an LTC_OMAC stream + @param omac The LTC_OMAC state + @param out [out] Destination for the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen) +{ + int err, mode; + unsigned x; + + LTC_ARGCHK(omac != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + if ((err = cipher_is_valid(omac->cipher_idx)) != CRYPT_OK) { + return err; + } + + if ((omac->buflen > (int)sizeof(omac->block)) || (omac->buflen < 0) || + (omac->blklen > (int)sizeof(omac->block)) || (omac->buflen > omac->blklen)) { + return CRYPT_INVALID_ARG; + } + + /* figure out mode */ + if (omac->buflen != omac->blklen) { + /* add the 0x80 byte */ + omac->block[omac->buflen++] = 0x80; + + /* pad with 0x00 */ + while (omac->buflen < omac->blklen) { + omac->block[omac->buflen++] = 0x00; + } + mode = 1; + } else { + mode = 0; + } + + /* now xor prev + Lu[mode] */ + for (x = 0; x < (unsigned)omac->blklen; x++) { + omac->block[x] ^= omac->prev[x] ^ omac->Lu[mode][x]; + } + + /* encrypt it */ + if ((err = cipher_descriptor[omac->cipher_idx]->ecb_encrypt(omac->block, omac->block, &omac->key)) != CRYPT_OK) { + return err; + } + cipher_descriptor[omac->cipher_idx]->done(&omac->key); + + /* output it */ + for (x = 0; x < (unsigned)omac->blklen && x < *outlen; x++) { + out[x] = omac->block[x]; + } + *outlen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(omac, sizeof(*omac)); +#endif + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_done.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/omac/omac_file.c b/core/lib/libtomcrypt/src/mac/omac/omac_file.c new file mode 100644 index 0000000..569e52a --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/omac/omac_file.c @@ -0,0 +1,110 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file omac_file.c + LTC_OMAC1 support, process a file, Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + LTC_OMAC a file + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param filename The name of the file you wish to LTC_OMAC + @param out [out] Where the authentication tag is to be stored + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int omac_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + int err, x; + omac_state omac; + FILE *in; + unsigned char buf[512]; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(filename != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + in = fopen(filename, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + if ((err = omac_init(&omac, cipher, key, keylen)) != CRYPT_OK) { + fclose(in); + return err; + } + + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = omac_process(&omac, buf, x)) != CRYPT_OK) { + fclose(in); + return err; + } + } while (x == sizeof(buf)); + fclose(in); + + if ((err = omac_done(&omac, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_file.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/omac/omac_init.c b/core/lib/libtomcrypt/src/mac/omac/omac_init.c new file mode 100644 index 0000000..a5c7be0 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/omac/omac_init.c @@ -0,0 +1,128 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file omac_init.c + LTC_OMAC1 support, initialize state, by Tom St Denis +*/ + + +#ifdef LTC_OMAC + +/** + Initialize an LTC_OMAC state + @param omac The LTC_OMAC state to initialize + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned long keylen) +{ + int err, x, y, mask, msb, len; + + LTC_ARGCHK(omac != NULL); + LTC_ARGCHK(key != NULL); + + /* schedule the key */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_FAST + if (cipher_descriptor[cipher]->block_length % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* now setup the system */ + switch (cipher_descriptor[cipher]->block_length) { + case 8: mask = 0x1B; + len = 8; + break; + case 16: mask = 0x87; + len = 16; + break; + default: return CRYPT_INVALID_ARG; + } + + if ((err = cipher_descriptor[cipher]->setup(key, keylen, 0, &omac->key)) != CRYPT_OK) { + return err; + } + + /* ok now we need Lu and Lu^2 [calc one from the other] */ + + /* first calc L which is Ek(0) */ + zeromem(omac->Lu[0], cipher_descriptor[cipher]->block_length); + if ((err = cipher_descriptor[cipher]->ecb_encrypt(omac->Lu[0], omac->Lu[0], &omac->key)) != CRYPT_OK) { + return err; + } + + /* now do the mults, whoopy! */ + for (x = 0; x < 2; x++) { + /* if msb(L * u^(x+1)) = 0 then just shift, otherwise shift and xor constant mask */ + msb = omac->Lu[x][0] >> 7; + + /* shift left */ + for (y = 0; y < (len - 1); y++) { + omac->Lu[x][y] = ((omac->Lu[x][y] << 1) | (omac->Lu[x][y+1] >> 7)) & 255; + } + omac->Lu[x][len - 1] = ((omac->Lu[x][len - 1] << 1) ^ (msb ? mask : 0)) & 255; + + /* copy up as require */ + if (x == 0) { + XMEMCPY(omac->Lu[1], omac->Lu[0], sizeof(omac->Lu[0])); + } + } + + /* setup state */ + omac->cipher_idx = cipher; + omac->buflen = 0; + omac->blklen = len; + zeromem(omac->prev, sizeof(omac->prev)); + zeromem(omac->block, sizeof(omac->block)); + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_init.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/omac/omac_memory.c b/core/lib/libtomcrypt/src/mac/omac/omac_memory.c new file mode 100644 index 0000000..594d4fb --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/omac/omac_memory.c @@ -0,0 +1,112 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file omac_memory.c + LTC_OMAC1 support, process a block of memory, Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + LTC_OMAC a block of memory + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data to send through LTC_OMAC + @param inlen The length of the data to send through LTC_OMAC (octets) + @param out [out] The destination of the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag (octets) + @return CRYPT_OK if successful +*/ +int omac_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + int err; + omac_state *omac; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* is the cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* Use accelerator if found */ + if (cipher_descriptor[cipher]->omac_memory != NULL) { + return cipher_descriptor[cipher]->omac_memory(key, keylen, in, inlen, out, outlen); + } + + /* allocate ram for omac state */ + omac = XMALLOC(sizeof(omac_state)); + if (omac == NULL) { + return CRYPT_MEM; + } + + /* omac process the message */ + if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = omac_process(omac, in, inlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = omac_done(omac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(omac, sizeof(omac_state)); +#endif + + XFREE(omac); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_memory.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/omac/omac_memory_multi.c b/core/lib/libtomcrypt/src/mac/omac/omac_memory_multi.c new file mode 100644 index 0000000..3739b8d --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/omac/omac_memory_multi.c @@ -0,0 +1,117 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file omac_memory_multi.c + LTC_OMAC1 support, process multiple blocks of memory, Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + LTC_OMAC multiple blocks of memory + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] The destination of the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag (octets) + @param in The data to send through LTC_OMAC + @param inlen The length of the data to send through LTC_OMAC (octets) + @param ... tuples of (data,len) pairs to LTC_OMAC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int omac_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + int err; + omac_state *omac; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for omac state */ + omac = XMALLOC(sizeof(omac_state)); + if (omac == NULL) { + return CRYPT_MEM; + } + + /* omac process the message */ + if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = omac_process(omac, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = omac_done(omac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(omac, sizeof(omac_state)); +#endif + XFREE(omac); + va_end(args); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_memory_multi.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/omac/omac_process.c b/core/lib/libtomcrypt/src/mac/omac/omac_process.c new file mode 100644 index 0000000..2e1e2cc --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/omac/omac_process.c @@ -0,0 +1,116 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file omac_process.c + LTC_OMAC1 support, process data, Tom St Denis +*/ + + +#ifdef LTC_OMAC + +/** + Process data through LTC_OMAC + @param omac The LTC_OMAC state + @param in The input data to send through LTC_OMAC + @param inlen The length of the input (octets) + @return CRYPT_OK if successful +*/ +int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen) +{ + unsigned long n, x; + int err; + + LTC_ARGCHK(omac != NULL); + LTC_ARGCHK(in != NULL); + if ((err = cipher_is_valid(omac->cipher_idx)) != CRYPT_OK) { + return err; + } + + if ((omac->buflen > (int)sizeof(omac->block)) || (omac->buflen < 0) || + (omac->blklen > (int)sizeof(omac->block)) || (omac->buflen > omac->blklen)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + unsigned long blklen = cipher_descriptor[omac->cipher_idx]->block_length; + if (omac->buflen == 0 && inlen > blklen) { + unsigned long y; + for (x = 0; x < (inlen - blklen); x += blklen) { + for (y = 0; y < blklen; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&omac->prev[y])) ^= *((LTC_FAST_TYPE*)(&in[y])); + } + in += blklen; + if ((err = cipher_descriptor[omac->cipher_idx]->ecb_encrypt(omac->prev, omac->prev, &omac->key)) != CRYPT_OK) { + return err; + } + } + inlen -= x; + } +#endif + + while (inlen != 0) { + /* ok if the block is full we xor in prev, encrypt and replace prev */ + if (omac->buflen == omac->blklen) { + for (x = 0; x < (unsigned long)omac->blklen; x++) { + omac->block[x] ^= omac->prev[x]; + } + if ((err = cipher_descriptor[omac->cipher_idx]->ecb_encrypt(omac->block, omac->prev, &omac->key)) != CRYPT_OK) { + return err; + } + omac->buflen = 0; + } + + /* add bytes */ + n = MIN(inlen, (unsigned long)(omac->blklen - omac->buflen)); + XMEMCPY(omac->block + omac->buflen, in, n); + omac->buflen += n; + inlen -= n; + in += n; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_process.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2007/05/12 14:37:41 $ */ diff --git a/core/lib/libtomcrypt/src/mac/omac/sub.mk b/core/lib/libtomcrypt/src/mac/omac/sub.mk new file mode 100644 index 0000000..076bd0f --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/omac/sub.mk @@ -0,0 +1,9 @@ +cflags-y += -Wno-unused-parameter + +srcs-y += omac_done.c +# srcs-y += omac_file.c +srcs-y += omac_init.c +srcs-y += omac_memory.c +srcs-y += omac_memory_multi.c +srcs-y += omac_process.c +# srcs-y += omac_test.c diff --git a/core/lib/libtomcrypt/src/mac/pmac/pmac_done.c b/core/lib/libtomcrypt/src/mac/pmac/pmac_done.c new file mode 100644 index 0000000..49ce0e2 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/pmac/pmac_done.c @@ -0,0 +1,101 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pmac_done.c + PMAC implementation, terminate a session, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +int pmac_done(pmac_state *state, unsigned char *out, unsigned long *outlen) +{ + int err, x; + + LTC_ARGCHK(state != NULL); + LTC_ARGCHK(out != NULL); + if ((err = cipher_is_valid(state->cipher_idx)) != CRYPT_OK) { + return err; + } + + if ((state->buflen > (int)sizeof(state->block)) || (state->buflen < 0) || + (state->block_len > (int)sizeof(state->block)) || (state->buflen > state->block_len)) { + return CRYPT_INVALID_ARG; + } + + + /* handle padding. If multiple xor in L/x */ + + if (state->buflen == state->block_len) { + /* xor Lr against the checksum */ + for (x = 0; x < state->block_len; x++) { + state->checksum[x] ^= state->block[x] ^ state->Lr[x]; + } + } else { + /* otherwise xor message bytes then the 0x80 byte */ + for (x = 0; x < state->buflen; x++) { + state->checksum[x] ^= state->block[x]; + } + state->checksum[x] ^= 0x80; + } + + /* encrypt it */ + if ((err = cipher_descriptor[state->cipher_idx].ecb_encrypt(state->checksum, state->checksum, &state->key)) != CRYPT_OK) { + return err; + } + cipher_descriptor[state->cipher_idx].done(&state->key); + + /* store it */ + for (x = 0; x < state->block_len && x < (int)*outlen; x++) { + out[x] = state->checksum[x]; + } + *outlen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(state, sizeof(*state)); +#endif + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_done.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/pmac/pmac_file.c b/core/lib/libtomcrypt/src/mac/pmac/pmac_file.c new file mode 100644 index 0000000..d018692 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/pmac/pmac_file.c @@ -0,0 +1,111 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pmac_file.c + PMAC implementation, process a file, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + PMAC a file + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param filename The name of the file to send through PMAC + @param out [out] Destination for the authentication tag + @param outlen [in/out] Max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int pmac_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + int err, x; + pmac_state pmac; + FILE *in; + unsigned char buf[512]; + + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(filename != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + in = fopen(filename, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + if ((err = pmac_init(&pmac, cipher, key, keylen)) != CRYPT_OK) { + fclose(in); + return err; + } + + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = pmac_process(&pmac, buf, x)) != CRYPT_OK) { + fclose(in); + return err; + } + } while (x == sizeof(buf)); + fclose(in); + + if ((err = pmac_done(&pmac, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_file.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/pmac/pmac_init.c b/core/lib/libtomcrypt/src/mac/pmac/pmac_init.c new file mode 100644 index 0000000..34a23d1 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/pmac/pmac_init.c @@ -0,0 +1,177 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pmac_init.c + PMAC implementation, initialize state, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +static const struct { + int len; + unsigned char poly_div[MAXBLOCKSIZE], + poly_mul[MAXBLOCKSIZE]; +} polys[] = { +{ + 8, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0D }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B } +}, { + 16, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x87 } +} +}; + +/** + Initialize a PMAC state + @param pmac The PMAC state to initialize + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned long keylen) +{ + int poly, x, y, m, err; + unsigned char *L; + + LTC_ARGCHK(pmac != NULL); + LTC_ARGCHK(key != NULL); + + /* valid cipher? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* determine which polys to use */ + pmac->block_len = cipher_descriptor[cipher].block_length; + for (poly = 0; poly < (int)(sizeof(polys)/sizeof(polys[0])); poly++) { + if (polys[poly].len == pmac->block_len) { + break; + } + } + if (poly >= (int)(sizeof(polys)/sizeof(polys[0]))) { + return CRYPT_INVALID_ARG; + } + if (polys[poly].len != pmac->block_len) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (pmac->block_len % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + + /* schedule the key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &pmac->key)) != CRYPT_OK) { + return err; + } + + /* allocate L */ + L = XMALLOC(pmac->block_len); + if (L == NULL) { + return CRYPT_MEM; + } + + /* find L = E[0] */ + zeromem(L, pmac->block_len); + if ((err = cipher_descriptor[cipher].ecb_encrypt(L, L, &pmac->key)) != CRYPT_OK) { + goto error; + } + + /* find Ls[i] = L << i for i == 0..31 */ + XMEMCPY(pmac->Ls[0], L, pmac->block_len); + for (x = 1; x < 32; x++) { + m = pmac->Ls[x-1][0] >> 7; + for (y = 0; y < pmac->block_len-1; y++) { + pmac->Ls[x][y] = ((pmac->Ls[x-1][y] << 1) | (pmac->Ls[x-1][y+1] >> 7)) & 255; + } + pmac->Ls[x][pmac->block_len-1] = (pmac->Ls[x-1][pmac->block_len-1] << 1) & 255; + + if (m == 1) { + for (y = 0; y < pmac->block_len; y++) { + pmac->Ls[x][y] ^= polys[poly].poly_mul[y]; + } + } + } + + /* find Lr = L / x */ + m = L[pmac->block_len-1] & 1; + + /* shift right */ + for (x = pmac->block_len - 1; x > 0; x--) { + pmac->Lr[x] = ((L[x] >> 1) | (L[x-1] << 7)) & 255; + } + pmac->Lr[0] = L[0] >> 1; + + if (m == 1) { + for (x = 0; x < pmac->block_len; x++) { + pmac->Lr[x] ^= polys[poly].poly_div[x]; + } + } + + /* zero buffer, counters, etc... */ + pmac->block_index = 1; + pmac->cipher_idx = cipher; + pmac->buflen = 0; + zeromem(pmac->block, sizeof(pmac->block)); + zeromem(pmac->Li, sizeof(pmac->Li)); + zeromem(pmac->checksum, sizeof(pmac->checksum)); + err = CRYPT_OK; +error: +#ifdef LTC_CLEAN_STACK + zeromem(L, pmac->block_len); +#endif + + XFREE(L); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_init.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/pmac/pmac_memory.c b/core/lib/libtomcrypt/src/mac/pmac/pmac_memory.c new file mode 100644 index 0000000..03073d8 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/pmac/pmac_memory.c @@ -0,0 +1,101 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pmac_memory.c + PMAC implementation, process a block of memory, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + PMAC a block of memory + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data you wish to send through PMAC + @param inlen The length of data you wish to send through PMAC (octets) + @param out [out] Destination for the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int pmac_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + int err; + pmac_state *pmac; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for pmac state */ + pmac = XMALLOC(sizeof(pmac_state)); + if (pmac == NULL) { + return CRYPT_MEM; + } + + if ((err = pmac_init(pmac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = pmac_process(pmac, in, inlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = pmac_done(pmac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(pmac, sizeof(pmac_state)); +#endif + + XFREE(pmac); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_memory.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/pmac/pmac_memory_multi.c b/core/lib/libtomcrypt/src/mac/pmac/pmac_memory_multi.c new file mode 100644 index 0000000..28085cc --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/pmac/pmac_memory_multi.c @@ -0,0 +1,116 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file pmac_memory_multi.c + PMAC implementation, process multiple blocks of memory, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + PMAC multiple blocks of memory + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] Destination for the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag + @param in The data you wish to send through PMAC + @param inlen The length of data you wish to send through PMAC (octets) + @param ... tuples of (data,len) pairs to PMAC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int pmac_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + int err; + pmac_state *pmac; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for pmac state */ + pmac = XMALLOC(sizeof(pmac_state)); + if (pmac == NULL) { + return CRYPT_MEM; + } + + if ((err = pmac_init(pmac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = pmac_process(pmac, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = pmac_done(pmac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(pmac, sizeof(pmac_state)); +#endif + XFREE(pmac); + va_end(args); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_memory_multi.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/pmac/pmac_ntz.c b/core/lib/libtomcrypt/src/mac/pmac/pmac_ntz.c new file mode 100644 index 0000000..cc9464e --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/pmac/pmac_ntz.c @@ -0,0 +1,66 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pmac_ntz.c + PMAC implementation, internal function, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + Internal PMAC function +*/ +int pmac_ntz(unsigned long x) +{ + int c; + x &= 0xFFFFFFFFUL; + c = 0; + while ((x & 1) == 0) { + ++c; + x >>= 1; + } + return c; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_ntz.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/pmac/pmac_process.c b/core/lib/libtomcrypt/src/mac/pmac/pmac_process.c new file mode 100644 index 0000000..beed309 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/pmac/pmac_process.c @@ -0,0 +1,127 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pmac_process.c + PMAC implementation, process data, by Tom St Denis +*/ + + +#ifdef LTC_PMAC + +/** + Process data in a PMAC stream + @param pmac The PMAC state + @param in The data to send through PMAC + @param inlen The length of the data to send through PMAC + @return CRYPT_OK if successful +*/ +int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen) +{ + int err, n; + unsigned long x; + unsigned char Z[MAXBLOCKSIZE]; + + LTC_ARGCHK(pmac != NULL); + LTC_ARGCHK(in != NULL); + if ((err = cipher_is_valid(pmac->cipher_idx)) != CRYPT_OK) { + return err; + } + + if ((pmac->buflen > (int)sizeof(pmac->block)) || (pmac->buflen < 0) || + (pmac->block_len > (int)sizeof(pmac->block)) || (pmac->buflen > pmac->block_len)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (pmac->buflen == 0 && inlen > 16) { + unsigned long y; + for (x = 0; x < (inlen - 16); x += 16) { + pmac_shift_xor(pmac); + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&Z[y])) = *((LTC_FAST_TYPE*)(&in[y])) ^ *((LTC_FAST_TYPE*)(&pmac->Li[y])); + } + if ((err = cipher_descriptor[pmac->cipher_idx].ecb_encrypt(Z, Z, &pmac->key)) != CRYPT_OK) { + return err; + } + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&pmac->checksum[y])) ^= *((LTC_FAST_TYPE*)(&Z[y])); + } + in += 16; + } + inlen -= x; + } +#endif + + while (inlen != 0) { + /* ok if the block is full we xor in prev, encrypt and replace prev */ + if (pmac->buflen == pmac->block_len) { + pmac_shift_xor(pmac); + for (x = 0; x < (unsigned long)pmac->block_len; x++) { + Z[x] = pmac->Li[x] ^ pmac->block[x]; + } + if ((err = cipher_descriptor[pmac->cipher_idx].ecb_encrypt(Z, Z, &pmac->key)) != CRYPT_OK) { + return err; + } + for (x = 0; x < (unsigned long)pmac->block_len; x++) { + pmac->checksum[x] ^= Z[x]; + } + pmac->buflen = 0; + } + + /* add bytes */ + n = MIN(inlen, (unsigned long)(pmac->block_len - pmac->buflen)); + XMEMCPY(pmac->block + pmac->buflen, in, n); + pmac->buflen += n; + inlen -= n; + in += n; + } + +#ifdef LTC_CLEAN_STACK + zeromem(Z, sizeof(Z)); +#endif + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_process.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/pmac/pmac_shift_xor.c b/core/lib/libtomcrypt/src/mac/pmac/pmac_shift_xor.c new file mode 100644 index 0000000..53a8fcb --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/pmac/pmac_shift_xor.c @@ -0,0 +1,71 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pmac_shift_xor.c + PMAC implementation, internal function, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + Internal function. Performs the state update (adding correct multiple) + @param pmac The PMAC state. +*/ +void pmac_shift_xor(pmac_state *pmac) +{ + int x, y; + y = pmac_ntz(pmac->block_index++); +#ifdef LTC_FAST + for (x = 0; x < pmac->block_len; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)pmac->Li + x)) ^= + *((LTC_FAST_TYPE*)((unsigned char *)pmac->Ls[y] + x)); + } +#else + for (x = 0; x < pmac->block_len; x++) { + pmac->Li[x] ^= pmac->Ls[y][x]; + } +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_shift_xor.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/sub.mk b/core/lib/libtomcrypt/src/mac/sub.mk new file mode 100644 index 0000000..c4c60ff --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/sub.mk @@ -0,0 +1,2 @@ +subdirs-$(CFG_CRYPTO_HMAC) += hmac +subdirs-$(CFG_CRYPTO_CMAC) += omac diff --git a/core/lib/libtomcrypt/src/mac/xcbc/xcbc_done.c b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_done.c new file mode 100644 index 0000000..34aa199 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_done.c @@ -0,0 +1,104 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file xcbc_done.c + XCBC Support, terminate the state +*/ + +#ifdef LTC_XCBC + +/** Terminate the XCBC-MAC state + @param xcbc XCBC state to terminate + @param out [out] Destination for the MAC tag + @param outlen [in/out] Destination size and final tag size + Return CRYPT_OK on success +*/ +int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen) +{ + int err, x; + LTC_ARGCHK(xcbc != NULL); + LTC_ARGCHK(out != NULL); + + /* check structure */ + if ((err = cipher_is_valid(xcbc->cipher)) != CRYPT_OK) { + return err; + } + + if ((xcbc->blocksize > cipher_descriptor[xcbc->cipher].block_length) || (xcbc->blocksize < 0) || + (xcbc->buflen > xcbc->blocksize) || (xcbc->buflen < 0)) { + return CRYPT_INVALID_ARG; + } + + /* which key do we use? */ + if (xcbc->buflen == xcbc->blocksize) { + /* k2 */ + for (x = 0; x < xcbc->blocksize; x++) { + xcbc->IV[x] ^= xcbc->K[1][x]; + } + } else { + xcbc->IV[xcbc->buflen] ^= 0x80; + /* k3 */ + for (x = 0; x < xcbc->blocksize; x++) { + xcbc->IV[x] ^= xcbc->K[2][x]; + } + } + + /* encrypt */ + cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); + cipher_descriptor[xcbc->cipher].done(&xcbc->key); + + /* extract tag */ + for (x = 0; x < xcbc->blocksize && (unsigned long)x < *outlen; x++) { + out[x] = xcbc->IV[x]; + } + *outlen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(xcbc, sizeof(*xcbc)); +#endif + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_done.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ + diff --git a/core/lib/libtomcrypt/src/mac/xcbc/xcbc_file.c b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_file.c new file mode 100644 index 0000000..fc790ef --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_file.c @@ -0,0 +1,110 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file xcbc_file.c + XCBC support, process a file, Tom St Denis +*/ + +#ifdef LTC_XCBC + +/** + XCBC a file + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param filename The name of the file you wish to XCBC + @param out [out] Where the authentication tag is to be stored + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int xcbc_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + int err, x; + xcbc_state xcbc; + FILE *in; + unsigned char buf[512]; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(filename != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + in = fopen(filename, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + if ((err = xcbc_init(&xcbc, cipher, key, keylen)) != CRYPT_OK) { + fclose(in); + return err; + } + + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = xcbc_process(&xcbc, buf, x)) != CRYPT_OK) { + fclose(in); + return err; + } + } while (x == sizeof(buf)); + fclose(in); + + if ((err = xcbc_done(&xcbc, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_file.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/xcbc/xcbc_init.c b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_init.c new file mode 100644 index 0000000..14c6313 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_init.c @@ -0,0 +1,135 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file xcbc_init.c + XCBC Support, start an XCBC state +*/ + +#ifdef LTC_XCBC + +/** Initialize XCBC-MAC state + @param xcbc [out] XCBC state to initialize + @param cipher Index of cipher to use + @param key [in] Secret key + @param keylen Length of secret key in octets + Return CRYPT_OK on success +*/ +int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned long keylen) +{ + int x, y, err; + symmetric_key *skey; + unsigned long k1; + + LTC_ARGCHK(xcbc != NULL); + LTC_ARGCHK(key != NULL); + + /* schedule the key */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_FAST + if (cipher_descriptor[cipher].block_length % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + skey = NULL; + + /* are we in pure XCBC mode with three keys? */ + if (keylen & LTC_XCBC_PURE) { + keylen &= ~LTC_XCBC_PURE; + + if (keylen < 2UL*cipher_descriptor[cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + k1 = keylen - 2*cipher_descriptor[cipher].block_length; + XMEMCPY(xcbc->K[0], key, k1); + XMEMCPY(xcbc->K[1], key+k1, cipher_descriptor[cipher].block_length); + XMEMCPY(xcbc->K[2], key+k1 + cipher_descriptor[cipher].block_length, cipher_descriptor[cipher].block_length); + } else { + /* use the key expansion */ + k1 = cipher_descriptor[cipher].block_length; + + /* schedule the user key */ + skey = XCALLOC(1, sizeof(*skey)); + if (skey == NULL) { + return CRYPT_MEM; + } + + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, skey)) != CRYPT_OK) { + goto done; + } + + /* make the three keys */ + for (y = 0; y < 3; y++) { + for (x = 0; x < cipher_descriptor[cipher].block_length; x++) { + xcbc->K[y][x] = y + 1; + } + cipher_descriptor[cipher].ecb_encrypt(xcbc->K[y], xcbc->K[y], skey); + } + } + + /* setup K1 */ + err = cipher_descriptor[cipher].setup(xcbc->K[0], k1, 0, &xcbc->key); + + /* setup struct */ + zeromem(xcbc->IV, cipher_descriptor[cipher].block_length); + xcbc->blocksize = cipher_descriptor[cipher].block_length; + xcbc->cipher = cipher; + xcbc->buflen = 0; +done: + cipher_descriptor[cipher].done(skey); + if (skey != NULL) { +#ifdef LTC_CLEAN_STACK + zeromem(skey, sizeof(*skey)); +#endif + XFREE(skey); + } + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_init.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/02/20 13:07:58 $ */ + diff --git a/core/lib/libtomcrypt/src/mac/xcbc/xcbc_memory.c b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_memory.c new file mode 100644 index 0000000..81783d2 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_memory.c @@ -0,0 +1,98 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file xcbc_process.c + XCBC Support, XCBC-MAC a block of memory +*/ + +#ifdef LTC_XCBC + +/** XCBC-MAC a block of memory + @param cipher Index of cipher to use + @param key [in] Secret key + @param keylen Length of key in octets + @param in [in] Message to MAC + @param inlen Length of input in octets + @param out [out] Destination for the MAC tag + @param outlen [in/out] Output size and final tag size + Return CRYPT_OK on success. +*/ +int xcbc_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + xcbc_state *xcbc; + int err; + + /* is the cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* Use accelerator if found */ + if (cipher_descriptor[cipher].xcbc_memory != NULL) { + return cipher_descriptor[cipher].xcbc_memory(key, keylen, in, inlen, out, outlen); + } + + xcbc = XCALLOC(1, sizeof(*xcbc)); + if (xcbc == NULL) { + return CRYPT_MEM; + } + + if ((err = xcbc_init(xcbc, cipher, key, keylen)) != CRYPT_OK) { + goto done; + } + + if ((err = xcbc_process(xcbc, in, inlen)) != CRYPT_OK) { + goto done; + } + + err = xcbc_done(xcbc, out, outlen); +done: + XFREE(xcbc); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_memory.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c new file mode 100644 index 0000000..8c5ded4 --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c @@ -0,0 +1,117 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file xcbc_memory_multi.c + XCBC support, process multiple blocks of memory, Tom St Denis +*/ + +#ifdef LTC_XCBC + +/** + XCBC multiple blocks of memory + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] The destination of the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag (octets) + @param in The data to send through XCBC + @param inlen The length of the data to send through XCBC (octets) + @param ... tuples of (data,len) pairs to XCBC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int xcbc_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + int err; + xcbc_state *xcbc; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for xcbc state */ + xcbc = XMALLOC(sizeof(xcbc_state)); + if (xcbc == NULL) { + return CRYPT_MEM; + } + + /* xcbc process the message */ + if ((err = xcbc_init(xcbc, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = xcbc_process(xcbc, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = xcbc_done(xcbc, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(xcbc, sizeof(xcbc_state)); +#endif + XFREE(xcbc); + va_end(args); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/mac/xcbc/xcbc_process.c b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_process.c new file mode 100644 index 0000000..63f6d5f --- /dev/null +++ b/core/lib/libtomcrypt/src/mac/xcbc/xcbc_process.c @@ -0,0 +1,102 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file xcbc_process.c + XCBC Support, process blocks with XCBC +*/ + +#ifdef LTC_XCBC + +/** Process data through XCBC-MAC + @param xcbc The XCBC-MAC state + @param in Input data to process + @param inlen Length of input in octets + Return CRYPT_OK on success +*/ +int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen) +{ + int err; +#ifdef LTC_FAST + int x; +#endif + + LTC_ARGCHK(xcbc != NULL); + LTC_ARGCHK(in != NULL); + + /* check structure */ + if ((err = cipher_is_valid(xcbc->cipher)) != CRYPT_OK) { + return err; + } + + if ((xcbc->blocksize > cipher_descriptor[xcbc->cipher].block_length) || (xcbc->blocksize < 0) || + (xcbc->buflen > xcbc->blocksize) || (xcbc->buflen < 0)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (xcbc->buflen == 0) { + while (inlen > (unsigned long)xcbc->blocksize) { + for (x = 0; x < xcbc->blocksize; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)&(xcbc->IV[x])) ^= *((LTC_FAST_TYPE*)&(in[x])); + } + cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); + in += xcbc->blocksize; + inlen -= xcbc->blocksize; + } + } +#endif + + while (inlen) { + if (xcbc->buflen == xcbc->blocksize) { + cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); + xcbc->buflen = 0; + } + xcbc->IV[xcbc->buflen++] ^= *in++; + --inlen; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_process.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ + diff --git a/core/lib/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c b/core/lib/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c new file mode 100644 index 0000000..6dbcc83 --- /dev/null +++ b/core/lib/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c @@ -0,0 +1,1614 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_fp_mulmod.c + ECC Crypto, Tom St Denis +*/ + +#if defined(LTC_MECC) && defined(LTC_MECC_FP) +#include <limits.h> + +/* number of entries in the cache */ +#ifndef FP_ENTRIES +#define FP_ENTRIES 16 +#endif + +/* number of bits in LUT */ +#ifndef FP_LUT +#define FP_LUT 8U +#endif + +#if (FP_LUT > 12) || (FP_LUT < 2) + #error FP_LUT must be between 2 and 12 inclusively +#endif + +/** Our FP cache */ +static struct { + ecc_point *g, /* cached COPY of base point */ + *LUT[1U<<FP_LUT]; /* fixed point lookup */ + void *mu; /* copy of the montgomery constant */ + int lru_count; /* amount of times this entry has been used */ + int lock; /* flag to indicate cache eviction permitted (0) or not (1) */ +} fp_cache[FP_ENTRIES]; + +LTC_MUTEX_GLOBAL(ltc_ecc_fp_lock) + +/* simple table to help direct the generation of the LUT */ +static const struct { + int ham, terma, termb; +} lut_orders[] = { + { 0, 0, 0 }, { 1, 0, 0 }, { 1, 0, 0 }, { 2, 1, 2 }, { 1, 0, 0 }, { 2, 1, 4 }, { 2, 2, 4 }, { 3, 3, 4 }, + { 1, 0, 0 }, { 2, 1, 8 }, { 2, 2, 8 }, { 3, 3, 8 }, { 2, 4, 8 }, { 3, 5, 8 }, { 3, 6, 8 }, { 4, 7, 8 }, + { 1, 0, 0 }, { 2, 1, 16 }, { 2, 2, 16 }, { 3, 3, 16 }, { 2, 4, 16 }, { 3, 5, 16 }, { 3, 6, 16 }, { 4, 7, 16 }, + { 2, 8, 16 }, { 3, 9, 16 }, { 3, 10, 16 }, { 4, 11, 16 }, { 3, 12, 16 }, { 4, 13, 16 }, { 4, 14, 16 }, { 5, 15, 16 }, + { 1, 0, 0 }, { 2, 1, 32 }, { 2, 2, 32 }, { 3, 3, 32 }, { 2, 4, 32 }, { 3, 5, 32 }, { 3, 6, 32 }, { 4, 7, 32 }, + { 2, 8, 32 }, { 3, 9, 32 }, { 3, 10, 32 }, { 4, 11, 32 }, { 3, 12, 32 }, { 4, 13, 32 }, { 4, 14, 32 }, { 5, 15, 32 }, + { 2, 16, 32 }, { 3, 17, 32 }, { 3, 18, 32 }, { 4, 19, 32 }, { 3, 20, 32 }, { 4, 21, 32 }, { 4, 22, 32 }, { 5, 23, 32 }, + { 3, 24, 32 }, { 4, 25, 32 }, { 4, 26, 32 }, { 5, 27, 32 }, { 4, 28, 32 }, { 5, 29, 32 }, { 5, 30, 32 }, { 6, 31, 32 }, +#if FP_LUT > 6 + { 1, 0, 0 }, { 2, 1, 64 }, { 2, 2, 64 }, { 3, 3, 64 }, { 2, 4, 64 }, { 3, 5, 64 }, { 3, 6, 64 }, { 4, 7, 64 }, + { 2, 8, 64 }, { 3, 9, 64 }, { 3, 10, 64 }, { 4, 11, 64 }, { 3, 12, 64 }, { 4, 13, 64 }, { 4, 14, 64 }, { 5, 15, 64 }, + { 2, 16, 64 }, { 3, 17, 64 }, { 3, 18, 64 }, { 4, 19, 64 }, { 3, 20, 64 }, { 4, 21, 64 }, { 4, 22, 64 }, { 5, 23, 64 }, + { 3, 24, 64 }, { 4, 25, 64 }, { 4, 26, 64 }, { 5, 27, 64 }, { 4, 28, 64 }, { 5, 29, 64 }, { 5, 30, 64 }, { 6, 31, 64 }, + { 2, 32, 64 }, { 3, 33, 64 }, { 3, 34, 64 }, { 4, 35, 64 }, { 3, 36, 64 }, { 4, 37, 64 }, { 4, 38, 64 }, { 5, 39, 64 }, + { 3, 40, 64 }, { 4, 41, 64 }, { 4, 42, 64 }, { 5, 43, 64 }, { 4, 44, 64 }, { 5, 45, 64 }, { 5, 46, 64 }, { 6, 47, 64 }, + { 3, 48, 64 }, { 4, 49, 64 }, { 4, 50, 64 }, { 5, 51, 64 }, { 4, 52, 64 }, { 5, 53, 64 }, { 5, 54, 64 }, { 6, 55, 64 }, + { 4, 56, 64 }, { 5, 57, 64 }, { 5, 58, 64 }, { 6, 59, 64 }, { 5, 60, 64 }, { 6, 61, 64 }, { 6, 62, 64 }, { 7, 63, 64 }, +#if FP_LUT > 7 + { 1, 0, 0 }, { 2, 1, 128 }, { 2, 2, 128 }, { 3, 3, 128 }, { 2, 4, 128 }, { 3, 5, 128 }, { 3, 6, 128 }, { 4, 7, 128 }, + { 2, 8, 128 }, { 3, 9, 128 }, { 3, 10, 128 }, { 4, 11, 128 }, { 3, 12, 128 }, { 4, 13, 128 }, { 4, 14, 128 }, { 5, 15, 128 }, + { 2, 16, 128 }, { 3, 17, 128 }, { 3, 18, 128 }, { 4, 19, 128 }, { 3, 20, 128 }, { 4, 21, 128 }, { 4, 22, 128 }, { 5, 23, 128 }, + { 3, 24, 128 }, { 4, 25, 128 }, { 4, 26, 128 }, { 5, 27, 128 }, { 4, 28, 128 }, { 5, 29, 128 }, { 5, 30, 128 }, { 6, 31, 128 }, + { 2, 32, 128 }, { 3, 33, 128 }, { 3, 34, 128 }, { 4, 35, 128 }, { 3, 36, 128 }, { 4, 37, 128 }, { 4, 38, 128 }, { 5, 39, 128 }, + { 3, 40, 128 }, { 4, 41, 128 }, { 4, 42, 128 }, { 5, 43, 128 }, { 4, 44, 128 }, { 5, 45, 128 }, { 5, 46, 128 }, { 6, 47, 128 }, + { 3, 48, 128 }, { 4, 49, 128 }, { 4, 50, 128 }, { 5, 51, 128 }, { 4, 52, 128 }, { 5, 53, 128 }, { 5, 54, 128 }, { 6, 55, 128 }, + { 4, 56, 128 }, { 5, 57, 128 }, { 5, 58, 128 }, { 6, 59, 128 }, { 5, 60, 128 }, { 6, 61, 128 }, { 6, 62, 128 }, { 7, 63, 128 }, + { 2, 64, 128 }, { 3, 65, 128 }, { 3, 66, 128 }, { 4, 67, 128 }, { 3, 68, 128 }, { 4, 69, 128 }, { 4, 70, 128 }, { 5, 71, 128 }, + { 3, 72, 128 }, { 4, 73, 128 }, { 4, 74, 128 }, { 5, 75, 128 }, { 4, 76, 128 }, { 5, 77, 128 }, { 5, 78, 128 }, { 6, 79, 128 }, + { 3, 80, 128 }, { 4, 81, 128 }, { 4, 82, 128 }, { 5, 83, 128 }, { 4, 84, 128 }, { 5, 85, 128 }, { 5, 86, 128 }, { 6, 87, 128 }, + { 4, 88, 128 }, { 5, 89, 128 }, { 5, 90, 128 }, { 6, 91, 128 }, { 5, 92, 128 }, { 6, 93, 128 }, { 6, 94, 128 }, { 7, 95, 128 }, + { 3, 96, 128 }, { 4, 97, 128 }, { 4, 98, 128 }, { 5, 99, 128 }, { 4, 100, 128 }, { 5, 101, 128 }, { 5, 102, 128 }, { 6, 103, 128 }, + { 4, 104, 128 }, { 5, 105, 128 }, { 5, 106, 128 }, { 6, 107, 128 }, { 5, 108, 128 }, { 6, 109, 128 }, { 6, 110, 128 }, { 7, 111, 128 }, + { 4, 112, 128 }, { 5, 113, 128 }, { 5, 114, 128 }, { 6, 115, 128 }, { 5, 116, 128 }, { 6, 117, 128 }, { 6, 118, 128 }, { 7, 119, 128 }, + { 5, 120, 128 }, { 6, 121, 128 }, { 6, 122, 128 }, { 7, 123, 128 }, { 6, 124, 128 }, { 7, 125, 128 }, { 7, 126, 128 }, { 8, 127, 128 }, +#if FP_LUT > 8 + { 1, 0, 0 }, { 2, 1, 256 }, { 2, 2, 256 }, { 3, 3, 256 }, { 2, 4, 256 }, { 3, 5, 256 }, { 3, 6, 256 }, { 4, 7, 256 }, + { 2, 8, 256 }, { 3, 9, 256 }, { 3, 10, 256 }, { 4, 11, 256 }, { 3, 12, 256 }, { 4, 13, 256 }, { 4, 14, 256 }, { 5, 15, 256 }, + { 2, 16, 256 }, { 3, 17, 256 }, { 3, 18, 256 }, { 4, 19, 256 }, { 3, 20, 256 }, { 4, 21, 256 }, { 4, 22, 256 }, { 5, 23, 256 }, + { 3, 24, 256 }, { 4, 25, 256 }, { 4, 26, 256 }, { 5, 27, 256 }, { 4, 28, 256 }, { 5, 29, 256 }, { 5, 30, 256 }, { 6, 31, 256 }, + { 2, 32, 256 }, { 3, 33, 256 }, { 3, 34, 256 }, { 4, 35, 256 }, { 3, 36, 256 }, { 4, 37, 256 }, { 4, 38, 256 }, { 5, 39, 256 }, + { 3, 40, 256 }, { 4, 41, 256 }, { 4, 42, 256 }, { 5, 43, 256 }, { 4, 44, 256 }, { 5, 45, 256 }, { 5, 46, 256 }, { 6, 47, 256 }, + { 3, 48, 256 }, { 4, 49, 256 }, { 4, 50, 256 }, { 5, 51, 256 }, { 4, 52, 256 }, { 5, 53, 256 }, { 5, 54, 256 }, { 6, 55, 256 }, + { 4, 56, 256 }, { 5, 57, 256 }, { 5, 58, 256 }, { 6, 59, 256 }, { 5, 60, 256 }, { 6, 61, 256 }, { 6, 62, 256 }, { 7, 63, 256 }, + { 2, 64, 256 }, { 3, 65, 256 }, { 3, 66, 256 }, { 4, 67, 256 }, { 3, 68, 256 }, { 4, 69, 256 }, { 4, 70, 256 }, { 5, 71, 256 }, + { 3, 72, 256 }, { 4, 73, 256 }, { 4, 74, 256 }, { 5, 75, 256 }, { 4, 76, 256 }, { 5, 77, 256 }, { 5, 78, 256 }, { 6, 79, 256 }, + { 3, 80, 256 }, { 4, 81, 256 }, { 4, 82, 256 }, { 5, 83, 256 }, { 4, 84, 256 }, { 5, 85, 256 }, { 5, 86, 256 }, { 6, 87, 256 }, + { 4, 88, 256 }, { 5, 89, 256 }, { 5, 90, 256 }, { 6, 91, 256 }, { 5, 92, 256 }, { 6, 93, 256 }, { 6, 94, 256 }, { 7, 95, 256 }, + { 3, 96, 256 }, { 4, 97, 256 }, { 4, 98, 256 }, { 5, 99, 256 }, { 4, 100, 256 }, { 5, 101, 256 }, { 5, 102, 256 }, { 6, 103, 256 }, + { 4, 104, 256 }, { 5, 105, 256 }, { 5, 106, 256 }, { 6, 107, 256 }, { 5, 108, 256 }, { 6, 109, 256 }, { 6, 110, 256 }, { 7, 111, 256 }, + { 4, 112, 256 }, { 5, 113, 256 }, { 5, 114, 256 }, { 6, 115, 256 }, { 5, 116, 256 }, { 6, 117, 256 }, { 6, 118, 256 }, { 7, 119, 256 }, + { 5, 120, 256 }, { 6, 121, 256 }, { 6, 122, 256 }, { 7, 123, 256 }, { 6, 124, 256 }, { 7, 125, 256 }, { 7, 126, 256 }, { 8, 127, 256 }, + { 2, 128, 256 }, { 3, 129, 256 }, { 3, 130, 256 }, { 4, 131, 256 }, { 3, 132, 256 }, { 4, 133, 256 }, { 4, 134, 256 }, { 5, 135, 256 }, + { 3, 136, 256 }, { 4, 137, 256 }, { 4, 138, 256 }, { 5, 139, 256 }, { 4, 140, 256 }, { 5, 141, 256 }, { 5, 142, 256 }, { 6, 143, 256 }, + { 3, 144, 256 }, { 4, 145, 256 }, { 4, 146, 256 }, { 5, 147, 256 }, { 4, 148, 256 }, { 5, 149, 256 }, { 5, 150, 256 }, { 6, 151, 256 }, + { 4, 152, 256 }, { 5, 153, 256 }, { 5, 154, 256 }, { 6, 155, 256 }, { 5, 156, 256 }, { 6, 157, 256 }, { 6, 158, 256 }, { 7, 159, 256 }, + { 3, 160, 256 }, { 4, 161, 256 }, { 4, 162, 256 }, { 5, 163, 256 }, { 4, 164, 256 }, { 5, 165, 256 }, { 5, 166, 256 }, { 6, 167, 256 }, + { 4, 168, 256 }, { 5, 169, 256 }, { 5, 170, 256 }, { 6, 171, 256 }, { 5, 172, 256 }, { 6, 173, 256 }, { 6, 174, 256 }, { 7, 175, 256 }, + { 4, 176, 256 }, { 5, 177, 256 }, { 5, 178, 256 }, { 6, 179, 256 }, { 5, 180, 256 }, { 6, 181, 256 }, { 6, 182, 256 }, { 7, 183, 256 }, + { 5, 184, 256 }, { 6, 185, 256 }, { 6, 186, 256 }, { 7, 187, 256 }, { 6, 188, 256 }, { 7, 189, 256 }, { 7, 190, 256 }, { 8, 191, 256 }, + { 3, 192, 256 }, { 4, 193, 256 }, { 4, 194, 256 }, { 5, 195, 256 }, { 4, 196, 256 }, { 5, 197, 256 }, { 5, 198, 256 }, { 6, 199, 256 }, + { 4, 200, 256 }, { 5, 201, 256 }, { 5, 202, 256 }, { 6, 203, 256 }, { 5, 204, 256 }, { 6, 205, 256 }, { 6, 206, 256 }, { 7, 207, 256 }, + { 4, 208, 256 }, { 5, 209, 256 }, { 5, 210, 256 }, { 6, 211, 256 }, { 5, 212, 256 }, { 6, 213, 256 }, { 6, 214, 256 }, { 7, 215, 256 }, + { 5, 216, 256 }, { 6, 217, 256 }, { 6, 218, 256 }, { 7, 219, 256 }, { 6, 220, 256 }, { 7, 221, 256 }, { 7, 222, 256 }, { 8, 223, 256 }, + { 4, 224, 256 }, { 5, 225, 256 }, { 5, 226, 256 }, { 6, 227, 256 }, { 5, 228, 256 }, { 6, 229, 256 }, { 6, 230, 256 }, { 7, 231, 256 }, + { 5, 232, 256 }, { 6, 233, 256 }, { 6, 234, 256 }, { 7, 235, 256 }, { 6, 236, 256 }, { 7, 237, 256 }, { 7, 238, 256 }, { 8, 239, 256 }, + { 5, 240, 256 }, { 6, 241, 256 }, { 6, 242, 256 }, { 7, 243, 256 }, { 6, 244, 256 }, { 7, 245, 256 }, { 7, 246, 256 }, { 8, 247, 256 }, + { 6, 248, 256 }, { 7, 249, 256 }, { 7, 250, 256 }, { 8, 251, 256 }, { 7, 252, 256 }, { 8, 253, 256 }, { 8, 254, 256 }, { 9, 255, 256 }, +#if FP_LUT > 9 + { 1, 0, 0 }, { 2, 1, 512 }, { 2, 2, 512 }, { 3, 3, 512 }, { 2, 4, 512 }, { 3, 5, 512 }, { 3, 6, 512 }, { 4, 7, 512 }, + { 2, 8, 512 }, { 3, 9, 512 }, { 3, 10, 512 }, { 4, 11, 512 }, { 3, 12, 512 }, { 4, 13, 512 }, { 4, 14, 512 }, { 5, 15, 512 }, + { 2, 16, 512 }, { 3, 17, 512 }, { 3, 18, 512 }, { 4, 19, 512 }, { 3, 20, 512 }, { 4, 21, 512 }, { 4, 22, 512 }, { 5, 23, 512 }, + { 3, 24, 512 }, { 4, 25, 512 }, { 4, 26, 512 }, { 5, 27, 512 }, { 4, 28, 512 }, { 5, 29, 512 }, { 5, 30, 512 }, { 6, 31, 512 }, + { 2, 32, 512 }, { 3, 33, 512 }, { 3, 34, 512 }, { 4, 35, 512 }, { 3, 36, 512 }, { 4, 37, 512 }, { 4, 38, 512 }, { 5, 39, 512 }, + { 3, 40, 512 }, { 4, 41, 512 }, { 4, 42, 512 }, { 5, 43, 512 }, { 4, 44, 512 }, { 5, 45, 512 }, { 5, 46, 512 }, { 6, 47, 512 }, + { 3, 48, 512 }, { 4, 49, 512 }, { 4, 50, 512 }, { 5, 51, 512 }, { 4, 52, 512 }, { 5, 53, 512 }, { 5, 54, 512 }, { 6, 55, 512 }, + { 4, 56, 512 }, { 5, 57, 512 }, { 5, 58, 512 }, { 6, 59, 512 }, { 5, 60, 512 }, { 6, 61, 512 }, { 6, 62, 512 }, { 7, 63, 512 }, + { 2, 64, 512 }, { 3, 65, 512 }, { 3, 66, 512 }, { 4, 67, 512 }, { 3, 68, 512 }, { 4, 69, 512 }, { 4, 70, 512 }, { 5, 71, 512 }, + { 3, 72, 512 }, { 4, 73, 512 }, { 4, 74, 512 }, { 5, 75, 512 }, { 4, 76, 512 }, { 5, 77, 512 }, { 5, 78, 512 }, { 6, 79, 512 }, + { 3, 80, 512 }, { 4, 81, 512 }, { 4, 82, 512 }, { 5, 83, 512 }, { 4, 84, 512 }, { 5, 85, 512 }, { 5, 86, 512 }, { 6, 87, 512 }, + { 4, 88, 512 }, { 5, 89, 512 }, { 5, 90, 512 }, { 6, 91, 512 }, { 5, 92, 512 }, { 6, 93, 512 }, { 6, 94, 512 }, { 7, 95, 512 }, + { 3, 96, 512 }, { 4, 97, 512 }, { 4, 98, 512 }, { 5, 99, 512 }, { 4, 100, 512 }, { 5, 101, 512 }, { 5, 102, 512 }, { 6, 103, 512 }, + { 4, 104, 512 }, { 5, 105, 512 }, { 5, 106, 512 }, { 6, 107, 512 }, { 5, 108, 512 }, { 6, 109, 512 }, { 6, 110, 512 }, { 7, 111, 512 }, + { 4, 112, 512 }, { 5, 113, 512 }, { 5, 114, 512 }, { 6, 115, 512 }, { 5, 116, 512 }, { 6, 117, 512 }, { 6, 118, 512 }, { 7, 119, 512 }, + { 5, 120, 512 }, { 6, 121, 512 }, { 6, 122, 512 }, { 7, 123, 512 }, { 6, 124, 512 }, { 7, 125, 512 }, { 7, 126, 512 }, { 8, 127, 512 }, + { 2, 128, 512 }, { 3, 129, 512 }, { 3, 130, 512 }, { 4, 131, 512 }, { 3, 132, 512 }, { 4, 133, 512 }, { 4, 134, 512 }, { 5, 135, 512 }, + { 3, 136, 512 }, { 4, 137, 512 }, { 4, 138, 512 }, { 5, 139, 512 }, { 4, 140, 512 }, { 5, 141, 512 }, { 5, 142, 512 }, { 6, 143, 512 }, + { 3, 144, 512 }, { 4, 145, 512 }, { 4, 146, 512 }, { 5, 147, 512 }, { 4, 148, 512 }, { 5, 149, 512 }, { 5, 150, 512 }, { 6, 151, 512 }, + { 4, 152, 512 }, { 5, 153, 512 }, { 5, 154, 512 }, { 6, 155, 512 }, { 5, 156, 512 }, { 6, 157, 512 }, { 6, 158, 512 }, { 7, 159, 512 }, + { 3, 160, 512 }, { 4, 161, 512 }, { 4, 162, 512 }, { 5, 163, 512 }, { 4, 164, 512 }, { 5, 165, 512 }, { 5, 166, 512 }, { 6, 167, 512 }, + { 4, 168, 512 }, { 5, 169, 512 }, { 5, 170, 512 }, { 6, 171, 512 }, { 5, 172, 512 }, { 6, 173, 512 }, { 6, 174, 512 }, { 7, 175, 512 }, + { 4, 176, 512 }, { 5, 177, 512 }, { 5, 178, 512 }, { 6, 179, 512 }, { 5, 180, 512 }, { 6, 181, 512 }, { 6, 182, 512 }, { 7, 183, 512 }, + { 5, 184, 512 }, { 6, 185, 512 }, { 6, 186, 512 }, { 7, 187, 512 }, { 6, 188, 512 }, { 7, 189, 512 }, { 7, 190, 512 }, { 8, 191, 512 }, + { 3, 192, 512 }, { 4, 193, 512 }, { 4, 194, 512 }, { 5, 195, 512 }, { 4, 196, 512 }, { 5, 197, 512 }, { 5, 198, 512 }, { 6, 199, 512 }, + { 4, 200, 512 }, { 5, 201, 512 }, { 5, 202, 512 }, { 6, 203, 512 }, { 5, 204, 512 }, { 6, 205, 512 }, { 6, 206, 512 }, { 7, 207, 512 }, + { 4, 208, 512 }, { 5, 209, 512 }, { 5, 210, 512 }, { 6, 211, 512 }, { 5, 212, 512 }, { 6, 213, 512 }, { 6, 214, 512 }, { 7, 215, 512 }, + { 5, 216, 512 }, { 6, 217, 512 }, { 6, 218, 512 }, { 7, 219, 512 }, { 6, 220, 512 }, { 7, 221, 512 }, { 7, 222, 512 }, { 8, 223, 512 }, + { 4, 224, 512 }, { 5, 225, 512 }, { 5, 226, 512 }, { 6, 227, 512 }, { 5, 228, 512 }, { 6, 229, 512 }, { 6, 230, 512 }, { 7, 231, 512 }, + { 5, 232, 512 }, { 6, 233, 512 }, { 6, 234, 512 }, { 7, 235, 512 }, { 6, 236, 512 }, { 7, 237, 512 }, { 7, 238, 512 }, { 8, 239, 512 }, + { 5, 240, 512 }, { 6, 241, 512 }, { 6, 242, 512 }, { 7, 243, 512 }, { 6, 244, 512 }, { 7, 245, 512 }, { 7, 246, 512 }, { 8, 247, 512 }, + { 6, 248, 512 }, { 7, 249, 512 }, { 7, 250, 512 }, { 8, 251, 512 }, { 7, 252, 512 }, { 8, 253, 512 }, { 8, 254, 512 }, { 9, 255, 512 }, + { 2, 256, 512 }, { 3, 257, 512 }, { 3, 258, 512 }, { 4, 259, 512 }, { 3, 260, 512 }, { 4, 261, 512 }, { 4, 262, 512 }, { 5, 263, 512 }, + { 3, 264, 512 }, { 4, 265, 512 }, { 4, 266, 512 }, { 5, 267, 512 }, { 4, 268, 512 }, { 5, 269, 512 }, { 5, 270, 512 }, { 6, 271, 512 }, + { 3, 272, 512 }, { 4, 273, 512 }, { 4, 274, 512 }, { 5, 275, 512 }, { 4, 276, 512 }, { 5, 277, 512 }, { 5, 278, 512 }, { 6, 279, 512 }, + { 4, 280, 512 }, { 5, 281, 512 }, { 5, 282, 512 }, { 6, 283, 512 }, { 5, 284, 512 }, { 6, 285, 512 }, { 6, 286, 512 }, { 7, 287, 512 }, + { 3, 288, 512 }, { 4, 289, 512 }, { 4, 290, 512 }, { 5, 291, 512 }, { 4, 292, 512 }, { 5, 293, 512 }, { 5, 294, 512 }, { 6, 295, 512 }, + { 4, 296, 512 }, { 5, 297, 512 }, { 5, 298, 512 }, { 6, 299, 512 }, { 5, 300, 512 }, { 6, 301, 512 }, { 6, 302, 512 }, { 7, 303, 512 }, + { 4, 304, 512 }, { 5, 305, 512 }, { 5, 306, 512 }, { 6, 307, 512 }, { 5, 308, 512 }, { 6, 309, 512 }, { 6, 310, 512 }, { 7, 311, 512 }, + { 5, 312, 512 }, { 6, 313, 512 }, { 6, 314, 512 }, { 7, 315, 512 }, { 6, 316, 512 }, { 7, 317, 512 }, { 7, 318, 512 }, { 8, 319, 512 }, + { 3, 320, 512 }, { 4, 321, 512 }, { 4, 322, 512 }, { 5, 323, 512 }, { 4, 324, 512 }, { 5, 325, 512 }, { 5, 326, 512 }, { 6, 327, 512 }, + { 4, 328, 512 }, { 5, 329, 512 }, { 5, 330, 512 }, { 6, 331, 512 }, { 5, 332, 512 }, { 6, 333, 512 }, { 6, 334, 512 }, { 7, 335, 512 }, + { 4, 336, 512 }, { 5, 337, 512 }, { 5, 338, 512 }, { 6, 339, 512 }, { 5, 340, 512 }, { 6, 341, 512 }, { 6, 342, 512 }, { 7, 343, 512 }, + { 5, 344, 512 }, { 6, 345, 512 }, { 6, 346, 512 }, { 7, 347, 512 }, { 6, 348, 512 }, { 7, 349, 512 }, { 7, 350, 512 }, { 8, 351, 512 }, + { 4, 352, 512 }, { 5, 353, 512 }, { 5, 354, 512 }, { 6, 355, 512 }, { 5, 356, 512 }, { 6, 357, 512 }, { 6, 358, 512 }, { 7, 359, 512 }, + { 5, 360, 512 }, { 6, 361, 512 }, { 6, 362, 512 }, { 7, 363, 512 }, { 6, 364, 512 }, { 7, 365, 512 }, { 7, 366, 512 }, { 8, 367, 512 }, + { 5, 368, 512 }, { 6, 369, 512 }, { 6, 370, 512 }, { 7, 371, 512 }, { 6, 372, 512 }, { 7, 373, 512 }, { 7, 374, 512 }, { 8, 375, 512 }, + { 6, 376, 512 }, { 7, 377, 512 }, { 7, 378, 512 }, { 8, 379, 512 }, { 7, 380, 512 }, { 8, 381, 512 }, { 8, 382, 512 }, { 9, 383, 512 }, + { 3, 384, 512 }, { 4, 385, 512 }, { 4, 386, 512 }, { 5, 387, 512 }, { 4, 388, 512 }, { 5, 389, 512 }, { 5, 390, 512 }, { 6, 391, 512 }, + { 4, 392, 512 }, { 5, 393, 512 }, { 5, 394, 512 }, { 6, 395, 512 }, { 5, 396, 512 }, { 6, 397, 512 }, { 6, 398, 512 }, { 7, 399, 512 }, + { 4, 400, 512 }, { 5, 401, 512 }, { 5, 402, 512 }, { 6, 403, 512 }, { 5, 404, 512 }, { 6, 405, 512 }, { 6, 406, 512 }, { 7, 407, 512 }, + { 5, 408, 512 }, { 6, 409, 512 }, { 6, 410, 512 }, { 7, 411, 512 }, { 6, 412, 512 }, { 7, 413, 512 }, { 7, 414, 512 }, { 8, 415, 512 }, + { 4, 416, 512 }, { 5, 417, 512 }, { 5, 418, 512 }, { 6, 419, 512 }, { 5, 420, 512 }, { 6, 421, 512 }, { 6, 422, 512 }, { 7, 423, 512 }, + { 5, 424, 512 }, { 6, 425, 512 }, { 6, 426, 512 }, { 7, 427, 512 }, { 6, 428, 512 }, { 7, 429, 512 }, { 7, 430, 512 }, { 8, 431, 512 }, + { 5, 432, 512 }, { 6, 433, 512 }, { 6, 434, 512 }, { 7, 435, 512 }, { 6, 436, 512 }, { 7, 437, 512 }, { 7, 438, 512 }, { 8, 439, 512 }, + { 6, 440, 512 }, { 7, 441, 512 }, { 7, 442, 512 }, { 8, 443, 512 }, { 7, 444, 512 }, { 8, 445, 512 }, { 8, 446, 512 }, { 9, 447, 512 }, + { 4, 448, 512 }, { 5, 449, 512 }, { 5, 450, 512 }, { 6, 451, 512 }, { 5, 452, 512 }, { 6, 453, 512 }, { 6, 454, 512 }, { 7, 455, 512 }, + { 5, 456, 512 }, { 6, 457, 512 }, { 6, 458, 512 }, { 7, 459, 512 }, { 6, 460, 512 }, { 7, 461, 512 }, { 7, 462, 512 }, { 8, 463, 512 }, + { 5, 464, 512 }, { 6, 465, 512 }, { 6, 466, 512 }, { 7, 467, 512 }, { 6, 468, 512 }, { 7, 469, 512 }, { 7, 470, 512 }, { 8, 471, 512 }, + { 6, 472, 512 }, { 7, 473, 512 }, { 7, 474, 512 }, { 8, 475, 512 }, { 7, 476, 512 }, { 8, 477, 512 }, { 8, 478, 512 }, { 9, 479, 512 }, + { 5, 480, 512 }, { 6, 481, 512 }, { 6, 482, 512 }, { 7, 483, 512 }, { 6, 484, 512 }, { 7, 485, 512 }, { 7, 486, 512 }, { 8, 487, 512 }, + { 6, 488, 512 }, { 7, 489, 512 }, { 7, 490, 512 }, { 8, 491, 512 }, { 7, 492, 512 }, { 8, 493, 512 }, { 8, 494, 512 }, { 9, 495, 512 }, + { 6, 496, 512 }, { 7, 497, 512 }, { 7, 498, 512 }, { 8, 499, 512 }, { 7, 500, 512 }, { 8, 501, 512 }, { 8, 502, 512 }, { 9, 503, 512 }, + { 7, 504, 512 }, { 8, 505, 512 }, { 8, 506, 512 }, { 9, 507, 512 }, { 8, 508, 512 }, { 9, 509, 512 }, { 9, 510, 512 }, { 10, 511, 512 }, +#if FP_LUT > 10 + { 1, 0, 0 }, { 2, 1, 1024 }, { 2, 2, 1024 }, { 3, 3, 1024 }, { 2, 4, 1024 }, { 3, 5, 1024 }, { 3, 6, 1024 }, { 4, 7, 1024 }, + { 2, 8, 1024 }, { 3, 9, 1024 }, { 3, 10, 1024 }, { 4, 11, 1024 }, { 3, 12, 1024 }, { 4, 13, 1024 }, { 4, 14, 1024 }, { 5, 15, 1024 }, + { 2, 16, 1024 }, { 3, 17, 1024 }, { 3, 18, 1024 }, { 4, 19, 1024 }, { 3, 20, 1024 }, { 4, 21, 1024 }, { 4, 22, 1024 }, { 5, 23, 1024 }, + { 3, 24, 1024 }, { 4, 25, 1024 }, { 4, 26, 1024 }, { 5, 27, 1024 }, { 4, 28, 1024 }, { 5, 29, 1024 }, { 5, 30, 1024 }, { 6, 31, 1024 }, + { 2, 32, 1024 }, { 3, 33, 1024 }, { 3, 34, 1024 }, { 4, 35, 1024 }, { 3, 36, 1024 }, { 4, 37, 1024 }, { 4, 38, 1024 }, { 5, 39, 1024 }, + { 3, 40, 1024 }, { 4, 41, 1024 }, { 4, 42, 1024 }, { 5, 43, 1024 }, { 4, 44, 1024 }, { 5, 45, 1024 }, { 5, 46, 1024 }, { 6, 47, 1024 }, + { 3, 48, 1024 }, { 4, 49, 1024 }, { 4, 50, 1024 }, { 5, 51, 1024 }, { 4, 52, 1024 }, { 5, 53, 1024 }, { 5, 54, 1024 }, { 6, 55, 1024 }, + { 4, 56, 1024 }, { 5, 57, 1024 }, { 5, 58, 1024 }, { 6, 59, 1024 }, { 5, 60, 1024 }, { 6, 61, 1024 }, { 6, 62, 1024 }, { 7, 63, 1024 }, + { 2, 64, 1024 }, { 3, 65, 1024 }, { 3, 66, 1024 }, { 4, 67, 1024 }, { 3, 68, 1024 }, { 4, 69, 1024 }, { 4, 70, 1024 }, { 5, 71, 1024 }, + { 3, 72, 1024 }, { 4, 73, 1024 }, { 4, 74, 1024 }, { 5, 75, 1024 }, { 4, 76, 1024 }, { 5, 77, 1024 }, { 5, 78, 1024 }, { 6, 79, 1024 }, + { 3, 80, 1024 }, { 4, 81, 1024 }, { 4, 82, 1024 }, { 5, 83, 1024 }, { 4, 84, 1024 }, { 5, 85, 1024 }, { 5, 86, 1024 }, { 6, 87, 1024 }, + { 4, 88, 1024 }, { 5, 89, 1024 }, { 5, 90, 1024 }, { 6, 91, 1024 }, { 5, 92, 1024 }, { 6, 93, 1024 }, { 6, 94, 1024 }, { 7, 95, 1024 }, + { 3, 96, 1024 }, { 4, 97, 1024 }, { 4, 98, 1024 }, { 5, 99, 1024 }, { 4, 100, 1024 }, { 5, 101, 1024 }, { 5, 102, 1024 }, { 6, 103, 1024 }, + { 4, 104, 1024 }, { 5, 105, 1024 }, { 5, 106, 1024 }, { 6, 107, 1024 }, { 5, 108, 1024 }, { 6, 109, 1024 }, { 6, 110, 1024 }, { 7, 111, 1024 }, + { 4, 112, 1024 }, { 5, 113, 1024 }, { 5, 114, 1024 }, { 6, 115, 1024 }, { 5, 116, 1024 }, { 6, 117, 1024 }, { 6, 118, 1024 }, { 7, 119, 1024 }, + { 5, 120, 1024 }, { 6, 121, 1024 }, { 6, 122, 1024 }, { 7, 123, 1024 }, { 6, 124, 1024 }, { 7, 125, 1024 }, { 7, 126, 1024 }, { 8, 127, 1024 }, + { 2, 128, 1024 }, { 3, 129, 1024 }, { 3, 130, 1024 }, { 4, 131, 1024 }, { 3, 132, 1024 }, { 4, 133, 1024 }, { 4, 134, 1024 }, { 5, 135, 1024 }, + { 3, 136, 1024 }, { 4, 137, 1024 }, { 4, 138, 1024 }, { 5, 139, 1024 }, { 4, 140, 1024 }, { 5, 141, 1024 }, { 5, 142, 1024 }, { 6, 143, 1024 }, + { 3, 144, 1024 }, { 4, 145, 1024 }, { 4, 146, 1024 }, { 5, 147, 1024 }, { 4, 148, 1024 }, { 5, 149, 1024 }, { 5, 150, 1024 }, { 6, 151, 1024 }, + { 4, 152, 1024 }, { 5, 153, 1024 }, { 5, 154, 1024 }, { 6, 155, 1024 }, { 5, 156, 1024 }, { 6, 157, 1024 }, { 6, 158, 1024 }, { 7, 159, 1024 }, + { 3, 160, 1024 }, { 4, 161, 1024 }, { 4, 162, 1024 }, { 5, 163, 1024 }, { 4, 164, 1024 }, { 5, 165, 1024 }, { 5, 166, 1024 }, { 6, 167, 1024 }, + { 4, 168, 1024 }, { 5, 169, 1024 }, { 5, 170, 1024 }, { 6, 171, 1024 }, { 5, 172, 1024 }, { 6, 173, 1024 }, { 6, 174, 1024 }, { 7, 175, 1024 }, + { 4, 176, 1024 }, { 5, 177, 1024 }, { 5, 178, 1024 }, { 6, 179, 1024 }, { 5, 180, 1024 }, { 6, 181, 1024 }, { 6, 182, 1024 }, { 7, 183, 1024 }, + { 5, 184, 1024 }, { 6, 185, 1024 }, { 6, 186, 1024 }, { 7, 187, 1024 }, { 6, 188, 1024 }, { 7, 189, 1024 }, { 7, 190, 1024 }, { 8, 191, 1024 }, + { 3, 192, 1024 }, { 4, 193, 1024 }, { 4, 194, 1024 }, { 5, 195, 1024 }, { 4, 196, 1024 }, { 5, 197, 1024 }, { 5, 198, 1024 }, { 6, 199, 1024 }, + { 4, 200, 1024 }, { 5, 201, 1024 }, { 5, 202, 1024 }, { 6, 203, 1024 }, { 5, 204, 1024 }, { 6, 205, 1024 }, { 6, 206, 1024 }, { 7, 207, 1024 }, + { 4, 208, 1024 }, { 5, 209, 1024 }, { 5, 210, 1024 }, { 6, 211, 1024 }, { 5, 212, 1024 }, { 6, 213, 1024 }, { 6, 214, 1024 }, { 7, 215, 1024 }, + { 5, 216, 1024 }, { 6, 217, 1024 }, { 6, 218, 1024 }, { 7, 219, 1024 }, { 6, 220, 1024 }, { 7, 221, 1024 }, { 7, 222, 1024 }, { 8, 223, 1024 }, + { 4, 224, 1024 }, { 5, 225, 1024 }, { 5, 226, 1024 }, { 6, 227, 1024 }, { 5, 228, 1024 }, { 6, 229, 1024 }, { 6, 230, 1024 }, { 7, 231, 1024 }, + { 5, 232, 1024 }, { 6, 233, 1024 }, { 6, 234, 1024 }, { 7, 235, 1024 }, { 6, 236, 1024 }, { 7, 237, 1024 }, { 7, 238, 1024 }, { 8, 239, 1024 }, + { 5, 240, 1024 }, { 6, 241, 1024 }, { 6, 242, 1024 }, { 7, 243, 1024 }, { 6, 244, 1024 }, { 7, 245, 1024 }, { 7, 246, 1024 }, { 8, 247, 1024 }, + { 6, 248, 1024 }, { 7, 249, 1024 }, { 7, 250, 1024 }, { 8, 251, 1024 }, { 7, 252, 1024 }, { 8, 253, 1024 }, { 8, 254, 1024 }, { 9, 255, 1024 }, + { 2, 256, 1024 }, { 3, 257, 1024 }, { 3, 258, 1024 }, { 4, 259, 1024 }, { 3, 260, 1024 }, { 4, 261, 1024 }, { 4, 262, 1024 }, { 5, 263, 1024 }, + { 3, 264, 1024 }, { 4, 265, 1024 }, { 4, 266, 1024 }, { 5, 267, 1024 }, { 4, 268, 1024 }, { 5, 269, 1024 }, { 5, 270, 1024 }, { 6, 271, 1024 }, + { 3, 272, 1024 }, { 4, 273, 1024 }, { 4, 274, 1024 }, { 5, 275, 1024 }, { 4, 276, 1024 }, { 5, 277, 1024 }, { 5, 278, 1024 }, { 6, 279, 1024 }, + { 4, 280, 1024 }, { 5, 281, 1024 }, { 5, 282, 1024 }, { 6, 283, 1024 }, { 5, 284, 1024 }, { 6, 285, 1024 }, { 6, 286, 1024 }, { 7, 287, 1024 }, + { 3, 288, 1024 }, { 4, 289, 1024 }, { 4, 290, 1024 }, { 5, 291, 1024 }, { 4, 292, 1024 }, { 5, 293, 1024 }, { 5, 294, 1024 }, { 6, 295, 1024 }, + { 4, 296, 1024 }, { 5, 297, 1024 }, { 5, 298, 1024 }, { 6, 299, 1024 }, { 5, 300, 1024 }, { 6, 301, 1024 }, { 6, 302, 1024 }, { 7, 303, 1024 }, + { 4, 304, 1024 }, { 5, 305, 1024 }, { 5, 306, 1024 }, { 6, 307, 1024 }, { 5, 308, 1024 }, { 6, 309, 1024 }, { 6, 310, 1024 }, { 7, 311, 1024 }, + { 5, 312, 1024 }, { 6, 313, 1024 }, { 6, 314, 1024 }, { 7, 315, 1024 }, { 6, 316, 1024 }, { 7, 317, 1024 }, { 7, 318, 1024 }, { 8, 319, 1024 }, + { 3, 320, 1024 }, { 4, 321, 1024 }, { 4, 322, 1024 }, { 5, 323, 1024 }, { 4, 324, 1024 }, { 5, 325, 1024 }, { 5, 326, 1024 }, { 6, 327, 1024 }, + { 4, 328, 1024 }, { 5, 329, 1024 }, { 5, 330, 1024 }, { 6, 331, 1024 }, { 5, 332, 1024 }, { 6, 333, 1024 }, { 6, 334, 1024 }, { 7, 335, 1024 }, + { 4, 336, 1024 }, { 5, 337, 1024 }, { 5, 338, 1024 }, { 6, 339, 1024 }, { 5, 340, 1024 }, { 6, 341, 1024 }, { 6, 342, 1024 }, { 7, 343, 1024 }, + { 5, 344, 1024 }, { 6, 345, 1024 }, { 6, 346, 1024 }, { 7, 347, 1024 }, { 6, 348, 1024 }, { 7, 349, 1024 }, { 7, 350, 1024 }, { 8, 351, 1024 }, + { 4, 352, 1024 }, { 5, 353, 1024 }, { 5, 354, 1024 }, { 6, 355, 1024 }, { 5, 356, 1024 }, { 6, 357, 1024 }, { 6, 358, 1024 }, { 7, 359, 1024 }, + { 5, 360, 1024 }, { 6, 361, 1024 }, { 6, 362, 1024 }, { 7, 363, 1024 }, { 6, 364, 1024 }, { 7, 365, 1024 }, { 7, 366, 1024 }, { 8, 367, 1024 }, + { 5, 368, 1024 }, { 6, 369, 1024 }, { 6, 370, 1024 }, { 7, 371, 1024 }, { 6, 372, 1024 }, { 7, 373, 1024 }, { 7, 374, 1024 }, { 8, 375, 1024 }, + { 6, 376, 1024 }, { 7, 377, 1024 }, { 7, 378, 1024 }, { 8, 379, 1024 }, { 7, 380, 1024 }, { 8, 381, 1024 }, { 8, 382, 1024 }, { 9, 383, 1024 }, + { 3, 384, 1024 }, { 4, 385, 1024 }, { 4, 386, 1024 }, { 5, 387, 1024 }, { 4, 388, 1024 }, { 5, 389, 1024 }, { 5, 390, 1024 }, { 6, 391, 1024 }, + { 4, 392, 1024 }, { 5, 393, 1024 }, { 5, 394, 1024 }, { 6, 395, 1024 }, { 5, 396, 1024 }, { 6, 397, 1024 }, { 6, 398, 1024 }, { 7, 399, 1024 }, + { 4, 400, 1024 }, { 5, 401, 1024 }, { 5, 402, 1024 }, { 6, 403, 1024 }, { 5, 404, 1024 }, { 6, 405, 1024 }, { 6, 406, 1024 }, { 7, 407, 1024 }, + { 5, 408, 1024 }, { 6, 409, 1024 }, { 6, 410, 1024 }, { 7, 411, 1024 }, { 6, 412, 1024 }, { 7, 413, 1024 }, { 7, 414, 1024 }, { 8, 415, 1024 }, + { 4, 416, 1024 }, { 5, 417, 1024 }, { 5, 418, 1024 }, { 6, 419, 1024 }, { 5, 420, 1024 }, { 6, 421, 1024 }, { 6, 422, 1024 }, { 7, 423, 1024 }, + { 5, 424, 1024 }, { 6, 425, 1024 }, { 6, 426, 1024 }, { 7, 427, 1024 }, { 6, 428, 1024 }, { 7, 429, 1024 }, { 7, 430, 1024 }, { 8, 431, 1024 }, + { 5, 432, 1024 }, { 6, 433, 1024 }, { 6, 434, 1024 }, { 7, 435, 1024 }, { 6, 436, 1024 }, { 7, 437, 1024 }, { 7, 438, 1024 }, { 8, 439, 1024 }, + { 6, 440, 1024 }, { 7, 441, 1024 }, { 7, 442, 1024 }, { 8, 443, 1024 }, { 7, 444, 1024 }, { 8, 445, 1024 }, { 8, 446, 1024 }, { 9, 447, 1024 }, + { 4, 448, 1024 }, { 5, 449, 1024 }, { 5, 450, 1024 }, { 6, 451, 1024 }, { 5, 452, 1024 }, { 6, 453, 1024 }, { 6, 454, 1024 }, { 7, 455, 1024 }, + { 5, 456, 1024 }, { 6, 457, 1024 }, { 6, 458, 1024 }, { 7, 459, 1024 }, { 6, 460, 1024 }, { 7, 461, 1024 }, { 7, 462, 1024 }, { 8, 463, 1024 }, + { 5, 464, 1024 }, { 6, 465, 1024 }, { 6, 466, 1024 }, { 7, 467, 1024 }, { 6, 468, 1024 }, { 7, 469, 1024 }, { 7, 470, 1024 }, { 8, 471, 1024 }, + { 6, 472, 1024 }, { 7, 473, 1024 }, { 7, 474, 1024 }, { 8, 475, 1024 }, { 7, 476, 1024 }, { 8, 477, 1024 }, { 8, 478, 1024 }, { 9, 479, 1024 }, + { 5, 480, 1024 }, { 6, 481, 1024 }, { 6, 482, 1024 }, { 7, 483, 1024 }, { 6, 484, 1024 }, { 7, 485, 1024 }, { 7, 486, 1024 }, { 8, 487, 1024 }, + { 6, 488, 1024 }, { 7, 489, 1024 }, { 7, 490, 1024 }, { 8, 491, 1024 }, { 7, 492, 1024 }, { 8, 493, 1024 }, { 8, 494, 1024 }, { 9, 495, 1024 }, + { 6, 496, 1024 }, { 7, 497, 1024 }, { 7, 498, 1024 }, { 8, 499, 1024 }, { 7, 500, 1024 }, { 8, 501, 1024 }, { 8, 502, 1024 }, { 9, 503, 1024 }, + { 7, 504, 1024 }, { 8, 505, 1024 }, { 8, 506, 1024 }, { 9, 507, 1024 }, { 8, 508, 1024 }, { 9, 509, 1024 }, { 9, 510, 1024 }, { 10, 511, 1024 }, + { 2, 512, 1024 }, { 3, 513, 1024 }, { 3, 514, 1024 }, { 4, 515, 1024 }, { 3, 516, 1024 }, { 4, 517, 1024 }, { 4, 518, 1024 }, { 5, 519, 1024 }, + { 3, 520, 1024 }, { 4, 521, 1024 }, { 4, 522, 1024 }, { 5, 523, 1024 }, { 4, 524, 1024 }, { 5, 525, 1024 }, { 5, 526, 1024 }, { 6, 527, 1024 }, + { 3, 528, 1024 }, { 4, 529, 1024 }, { 4, 530, 1024 }, { 5, 531, 1024 }, { 4, 532, 1024 }, { 5, 533, 1024 }, { 5, 534, 1024 }, { 6, 535, 1024 }, + { 4, 536, 1024 }, { 5, 537, 1024 }, { 5, 538, 1024 }, { 6, 539, 1024 }, { 5, 540, 1024 }, { 6, 541, 1024 }, { 6, 542, 1024 }, { 7, 543, 1024 }, + { 3, 544, 1024 }, { 4, 545, 1024 }, { 4, 546, 1024 }, { 5, 547, 1024 }, { 4, 548, 1024 }, { 5, 549, 1024 }, { 5, 550, 1024 }, { 6, 551, 1024 }, + { 4, 552, 1024 }, { 5, 553, 1024 }, { 5, 554, 1024 }, { 6, 555, 1024 }, { 5, 556, 1024 }, { 6, 557, 1024 }, { 6, 558, 1024 }, { 7, 559, 1024 }, + { 4, 560, 1024 }, { 5, 561, 1024 }, { 5, 562, 1024 }, { 6, 563, 1024 }, { 5, 564, 1024 }, { 6, 565, 1024 }, { 6, 566, 1024 }, { 7, 567, 1024 }, + { 5, 568, 1024 }, { 6, 569, 1024 }, { 6, 570, 1024 }, { 7, 571, 1024 }, { 6, 572, 1024 }, { 7, 573, 1024 }, { 7, 574, 1024 }, { 8, 575, 1024 }, + { 3, 576, 1024 }, { 4, 577, 1024 }, { 4, 578, 1024 }, { 5, 579, 1024 }, { 4, 580, 1024 }, { 5, 581, 1024 }, { 5, 582, 1024 }, { 6, 583, 1024 }, + { 4, 584, 1024 }, { 5, 585, 1024 }, { 5, 586, 1024 }, { 6, 587, 1024 }, { 5, 588, 1024 }, { 6, 589, 1024 }, { 6, 590, 1024 }, { 7, 591, 1024 }, + { 4, 592, 1024 }, { 5, 593, 1024 }, { 5, 594, 1024 }, { 6, 595, 1024 }, { 5, 596, 1024 }, { 6, 597, 1024 }, { 6, 598, 1024 }, { 7, 599, 1024 }, + { 5, 600, 1024 }, { 6, 601, 1024 }, { 6, 602, 1024 }, { 7, 603, 1024 }, { 6, 604, 1024 }, { 7, 605, 1024 }, { 7, 606, 1024 }, { 8, 607, 1024 }, + { 4, 608, 1024 }, { 5, 609, 1024 }, { 5, 610, 1024 }, { 6, 611, 1024 }, { 5, 612, 1024 }, { 6, 613, 1024 }, { 6, 614, 1024 }, { 7, 615, 1024 }, + { 5, 616, 1024 }, { 6, 617, 1024 }, { 6, 618, 1024 }, { 7, 619, 1024 }, { 6, 620, 1024 }, { 7, 621, 1024 }, { 7, 622, 1024 }, { 8, 623, 1024 }, + { 5, 624, 1024 }, { 6, 625, 1024 }, { 6, 626, 1024 }, { 7, 627, 1024 }, { 6, 628, 1024 }, { 7, 629, 1024 }, { 7, 630, 1024 }, { 8, 631, 1024 }, + { 6, 632, 1024 }, { 7, 633, 1024 }, { 7, 634, 1024 }, { 8, 635, 1024 }, { 7, 636, 1024 }, { 8, 637, 1024 }, { 8, 638, 1024 }, { 9, 639, 1024 }, + { 3, 640, 1024 }, { 4, 641, 1024 }, { 4, 642, 1024 }, { 5, 643, 1024 }, { 4, 644, 1024 }, { 5, 645, 1024 }, { 5, 646, 1024 }, { 6, 647, 1024 }, + { 4, 648, 1024 }, { 5, 649, 1024 }, { 5, 650, 1024 }, { 6, 651, 1024 }, { 5, 652, 1024 }, { 6, 653, 1024 }, { 6, 654, 1024 }, { 7, 655, 1024 }, + { 4, 656, 1024 }, { 5, 657, 1024 }, { 5, 658, 1024 }, { 6, 659, 1024 }, { 5, 660, 1024 }, { 6, 661, 1024 }, { 6, 662, 1024 }, { 7, 663, 1024 }, + { 5, 664, 1024 }, { 6, 665, 1024 }, { 6, 666, 1024 }, { 7, 667, 1024 }, { 6, 668, 1024 }, { 7, 669, 1024 }, { 7, 670, 1024 }, { 8, 671, 1024 }, + { 4, 672, 1024 }, { 5, 673, 1024 }, { 5, 674, 1024 }, { 6, 675, 1024 }, { 5, 676, 1024 }, { 6, 677, 1024 }, { 6, 678, 1024 }, { 7, 679, 1024 }, + { 5, 680, 1024 }, { 6, 681, 1024 }, { 6, 682, 1024 }, { 7, 683, 1024 }, { 6, 684, 1024 }, { 7, 685, 1024 }, { 7, 686, 1024 }, { 8, 687, 1024 }, + { 5, 688, 1024 }, { 6, 689, 1024 }, { 6, 690, 1024 }, { 7, 691, 1024 }, { 6, 692, 1024 }, { 7, 693, 1024 }, { 7, 694, 1024 }, { 8, 695, 1024 }, + { 6, 696, 1024 }, { 7, 697, 1024 }, { 7, 698, 1024 }, { 8, 699, 1024 }, { 7, 700, 1024 }, { 8, 701, 1024 }, { 8, 702, 1024 }, { 9, 703, 1024 }, + { 4, 704, 1024 }, { 5, 705, 1024 }, { 5, 706, 1024 }, { 6, 707, 1024 }, { 5, 708, 1024 }, { 6, 709, 1024 }, { 6, 710, 1024 }, { 7, 711, 1024 }, + { 5, 712, 1024 }, { 6, 713, 1024 }, { 6, 714, 1024 }, { 7, 715, 1024 }, { 6, 716, 1024 }, { 7, 717, 1024 }, { 7, 718, 1024 }, { 8, 719, 1024 }, + { 5, 720, 1024 }, { 6, 721, 1024 }, { 6, 722, 1024 }, { 7, 723, 1024 }, { 6, 724, 1024 }, { 7, 725, 1024 }, { 7, 726, 1024 }, { 8, 727, 1024 }, + { 6, 728, 1024 }, { 7, 729, 1024 }, { 7, 730, 1024 }, { 8, 731, 1024 }, { 7, 732, 1024 }, { 8, 733, 1024 }, { 8, 734, 1024 }, { 9, 735, 1024 }, + { 5, 736, 1024 }, { 6, 737, 1024 }, { 6, 738, 1024 }, { 7, 739, 1024 }, { 6, 740, 1024 }, { 7, 741, 1024 }, { 7, 742, 1024 }, { 8, 743, 1024 }, + { 6, 744, 1024 }, { 7, 745, 1024 }, { 7, 746, 1024 }, { 8, 747, 1024 }, { 7, 748, 1024 }, { 8, 749, 1024 }, { 8, 750, 1024 }, { 9, 751, 1024 }, + { 6, 752, 1024 }, { 7, 753, 1024 }, { 7, 754, 1024 }, { 8, 755, 1024 }, { 7, 756, 1024 }, { 8, 757, 1024 }, { 8, 758, 1024 }, { 9, 759, 1024 }, + { 7, 760, 1024 }, { 8, 761, 1024 }, { 8, 762, 1024 }, { 9, 763, 1024 }, { 8, 764, 1024 }, { 9, 765, 1024 }, { 9, 766, 1024 }, { 10, 767, 1024 }, + { 3, 768, 1024 }, { 4, 769, 1024 }, { 4, 770, 1024 }, { 5, 771, 1024 }, { 4, 772, 1024 }, { 5, 773, 1024 }, { 5, 774, 1024 }, { 6, 775, 1024 }, + { 4, 776, 1024 }, { 5, 777, 1024 }, { 5, 778, 1024 }, { 6, 779, 1024 }, { 5, 780, 1024 }, { 6, 781, 1024 }, { 6, 782, 1024 }, { 7, 783, 1024 }, + { 4, 784, 1024 }, { 5, 785, 1024 }, { 5, 786, 1024 }, { 6, 787, 1024 }, { 5, 788, 1024 }, { 6, 789, 1024 }, { 6, 790, 1024 }, { 7, 791, 1024 }, + { 5, 792, 1024 }, { 6, 793, 1024 }, { 6, 794, 1024 }, { 7, 795, 1024 }, { 6, 796, 1024 }, { 7, 797, 1024 }, { 7, 798, 1024 }, { 8, 799, 1024 }, + { 4, 800, 1024 }, { 5, 801, 1024 }, { 5, 802, 1024 }, { 6, 803, 1024 }, { 5, 804, 1024 }, { 6, 805, 1024 }, { 6, 806, 1024 }, { 7, 807, 1024 }, + { 5, 808, 1024 }, { 6, 809, 1024 }, { 6, 810, 1024 }, { 7, 811, 1024 }, { 6, 812, 1024 }, { 7, 813, 1024 }, { 7, 814, 1024 }, { 8, 815, 1024 }, + { 5, 816, 1024 }, { 6, 817, 1024 }, { 6, 818, 1024 }, { 7, 819, 1024 }, { 6, 820, 1024 }, { 7, 821, 1024 }, { 7, 822, 1024 }, { 8, 823, 1024 }, + { 6, 824, 1024 }, { 7, 825, 1024 }, { 7, 826, 1024 }, { 8, 827, 1024 }, { 7, 828, 1024 }, { 8, 829, 1024 }, { 8, 830, 1024 }, { 9, 831, 1024 }, + { 4, 832, 1024 }, { 5, 833, 1024 }, { 5, 834, 1024 }, { 6, 835, 1024 }, { 5, 836, 1024 }, { 6, 837, 1024 }, { 6, 838, 1024 }, { 7, 839, 1024 }, + { 5, 840, 1024 }, { 6, 841, 1024 }, { 6, 842, 1024 }, { 7, 843, 1024 }, { 6, 844, 1024 }, { 7, 845, 1024 }, { 7, 846, 1024 }, { 8, 847, 1024 }, + { 5, 848, 1024 }, { 6, 849, 1024 }, { 6, 850, 1024 }, { 7, 851, 1024 }, { 6, 852, 1024 }, { 7, 853, 1024 }, { 7, 854, 1024 }, { 8, 855, 1024 }, + { 6, 856, 1024 }, { 7, 857, 1024 }, { 7, 858, 1024 }, { 8, 859, 1024 }, { 7, 860, 1024 }, { 8, 861, 1024 }, { 8, 862, 1024 }, { 9, 863, 1024 }, + { 5, 864, 1024 }, { 6, 865, 1024 }, { 6, 866, 1024 }, { 7, 867, 1024 }, { 6, 868, 1024 }, { 7, 869, 1024 }, { 7, 870, 1024 }, { 8, 871, 1024 }, + { 6, 872, 1024 }, { 7, 873, 1024 }, { 7, 874, 1024 }, { 8, 875, 1024 }, { 7, 876, 1024 }, { 8, 877, 1024 }, { 8, 878, 1024 }, { 9, 879, 1024 }, + { 6, 880, 1024 }, { 7, 881, 1024 }, { 7, 882, 1024 }, { 8, 883, 1024 }, { 7, 884, 1024 }, { 8, 885, 1024 }, { 8, 886, 1024 }, { 9, 887, 1024 }, + { 7, 888, 1024 }, { 8, 889, 1024 }, { 8, 890, 1024 }, { 9, 891, 1024 }, { 8, 892, 1024 }, { 9, 893, 1024 }, { 9, 894, 1024 }, { 10, 895, 1024 }, + { 4, 896, 1024 }, { 5, 897, 1024 }, { 5, 898, 1024 }, { 6, 899, 1024 }, { 5, 900, 1024 }, { 6, 901, 1024 }, { 6, 902, 1024 }, { 7, 903, 1024 }, + { 5, 904, 1024 }, { 6, 905, 1024 }, { 6, 906, 1024 }, { 7, 907, 1024 }, { 6, 908, 1024 }, { 7, 909, 1024 }, { 7, 910, 1024 }, { 8, 911, 1024 }, + { 5, 912, 1024 }, { 6, 913, 1024 }, { 6, 914, 1024 }, { 7, 915, 1024 }, { 6, 916, 1024 }, { 7, 917, 1024 }, { 7, 918, 1024 }, { 8, 919, 1024 }, + { 6, 920, 1024 }, { 7, 921, 1024 }, { 7, 922, 1024 }, { 8, 923, 1024 }, { 7, 924, 1024 }, { 8, 925, 1024 }, { 8, 926, 1024 }, { 9, 927, 1024 }, + { 5, 928, 1024 }, { 6, 929, 1024 }, { 6, 930, 1024 }, { 7, 931, 1024 }, { 6, 932, 1024 }, { 7, 933, 1024 }, { 7, 934, 1024 }, { 8, 935, 1024 }, + { 6, 936, 1024 }, { 7, 937, 1024 }, { 7, 938, 1024 }, { 8, 939, 1024 }, { 7, 940, 1024 }, { 8, 941, 1024 }, { 8, 942, 1024 }, { 9, 943, 1024 }, + { 6, 944, 1024 }, { 7, 945, 1024 }, { 7, 946, 1024 }, { 8, 947, 1024 }, { 7, 948, 1024 }, { 8, 949, 1024 }, { 8, 950, 1024 }, { 9, 951, 1024 }, + { 7, 952, 1024 }, { 8, 953, 1024 }, { 8, 954, 1024 }, { 9, 955, 1024 }, { 8, 956, 1024 }, { 9, 957, 1024 }, { 9, 958, 1024 }, { 10, 959, 1024 }, + { 5, 960, 1024 }, { 6, 961, 1024 }, { 6, 962, 1024 }, { 7, 963, 1024 }, { 6, 964, 1024 }, { 7, 965, 1024 }, { 7, 966, 1024 }, { 8, 967, 1024 }, + { 6, 968, 1024 }, { 7, 969, 1024 }, { 7, 970, 1024 }, { 8, 971, 1024 }, { 7, 972, 1024 }, { 8, 973, 1024 }, { 8, 974, 1024 }, { 9, 975, 1024 }, + { 6, 976, 1024 }, { 7, 977, 1024 }, { 7, 978, 1024 }, { 8, 979, 1024 }, { 7, 980, 1024 }, { 8, 981, 1024 }, { 8, 982, 1024 }, { 9, 983, 1024 }, + { 7, 984, 1024 }, { 8, 985, 1024 }, { 8, 986, 1024 }, { 9, 987, 1024 }, { 8, 988, 1024 }, { 9, 989, 1024 }, { 9, 990, 1024 }, { 10, 991, 1024 }, + { 6, 992, 1024 }, { 7, 993, 1024 }, { 7, 994, 1024 }, { 8, 995, 1024 }, { 7, 996, 1024 }, { 8, 997, 1024 }, { 8, 998, 1024 }, { 9, 999, 1024 }, + { 7, 1000, 1024 }, { 8, 1001, 1024 }, { 8, 1002, 1024 }, { 9, 1003, 1024 }, { 8, 1004, 1024 }, { 9, 1005, 1024 }, { 9, 1006, 1024 }, { 10, 1007, 1024 }, + { 7, 1008, 1024 }, { 8, 1009, 1024 }, { 8, 1010, 1024 }, { 9, 1011, 1024 }, { 8, 1012, 1024 }, { 9, 1013, 1024 }, { 9, 1014, 1024 }, { 10, 1015, 1024 }, + { 8, 1016, 1024 }, { 9, 1017, 1024 }, { 9, 1018, 1024 }, { 10, 1019, 1024 }, { 9, 1020, 1024 }, { 10, 1021, 1024 }, { 10, 1022, 1024 }, { 11, 1023, 1024 }, +#if FP_LUT > 11 + { 1, 0, 0 }, { 2, 1, 2048 }, { 2, 2, 2048 }, { 3, 3, 2048 }, { 2, 4, 2048 }, { 3, 5, 2048 }, { 3, 6, 2048 }, { 4, 7, 2048 }, + { 2, 8, 2048 }, { 3, 9, 2048 }, { 3, 10, 2048 }, { 4, 11, 2048 }, { 3, 12, 2048 }, { 4, 13, 2048 }, { 4, 14, 2048 }, { 5, 15, 2048 }, + { 2, 16, 2048 }, { 3, 17, 2048 }, { 3, 18, 2048 }, { 4, 19, 2048 }, { 3, 20, 2048 }, { 4, 21, 2048 }, { 4, 22, 2048 }, { 5, 23, 2048 }, + { 3, 24, 2048 }, { 4, 25, 2048 }, { 4, 26, 2048 }, { 5, 27, 2048 }, { 4, 28, 2048 }, { 5, 29, 2048 }, { 5, 30, 2048 }, { 6, 31, 2048 }, + { 2, 32, 2048 }, { 3, 33, 2048 }, { 3, 34, 2048 }, { 4, 35, 2048 }, { 3, 36, 2048 }, { 4, 37, 2048 }, { 4, 38, 2048 }, { 5, 39, 2048 }, + { 3, 40, 2048 }, { 4, 41, 2048 }, { 4, 42, 2048 }, { 5, 43, 2048 }, { 4, 44, 2048 }, { 5, 45, 2048 }, { 5, 46, 2048 }, { 6, 47, 2048 }, + { 3, 48, 2048 }, { 4, 49, 2048 }, { 4, 50, 2048 }, { 5, 51, 2048 }, { 4, 52, 2048 }, { 5, 53, 2048 }, { 5, 54, 2048 }, { 6, 55, 2048 }, + { 4, 56, 2048 }, { 5, 57, 2048 }, { 5, 58, 2048 }, { 6, 59, 2048 }, { 5, 60, 2048 }, { 6, 61, 2048 }, { 6, 62, 2048 }, { 7, 63, 2048 }, + { 2, 64, 2048 }, { 3, 65, 2048 }, { 3, 66, 2048 }, { 4, 67, 2048 }, { 3, 68, 2048 }, { 4, 69, 2048 }, { 4, 70, 2048 }, { 5, 71, 2048 }, + { 3, 72, 2048 }, { 4, 73, 2048 }, { 4, 74, 2048 }, { 5, 75, 2048 }, { 4, 76, 2048 }, { 5, 77, 2048 }, { 5, 78, 2048 }, { 6, 79, 2048 }, + { 3, 80, 2048 }, { 4, 81, 2048 }, { 4, 82, 2048 }, { 5, 83, 2048 }, { 4, 84, 2048 }, { 5, 85, 2048 }, { 5, 86, 2048 }, { 6, 87, 2048 }, + { 4, 88, 2048 }, { 5, 89, 2048 }, { 5, 90, 2048 }, { 6, 91, 2048 }, { 5, 92, 2048 }, { 6, 93, 2048 }, { 6, 94, 2048 }, { 7, 95, 2048 }, + { 3, 96, 2048 }, { 4, 97, 2048 }, { 4, 98, 2048 }, { 5, 99, 2048 }, { 4, 100, 2048 }, { 5, 101, 2048 }, { 5, 102, 2048 }, { 6, 103, 2048 }, + { 4, 104, 2048 }, { 5, 105, 2048 }, { 5, 106, 2048 }, { 6, 107, 2048 }, { 5, 108, 2048 }, { 6, 109, 2048 }, { 6, 110, 2048 }, { 7, 111, 2048 }, + { 4, 112, 2048 }, { 5, 113, 2048 }, { 5, 114, 2048 }, { 6, 115, 2048 }, { 5, 116, 2048 }, { 6, 117, 2048 }, { 6, 118, 2048 }, { 7, 119, 2048 }, + { 5, 120, 2048 }, { 6, 121, 2048 }, { 6, 122, 2048 }, { 7, 123, 2048 }, { 6, 124, 2048 }, { 7, 125, 2048 }, { 7, 126, 2048 }, { 8, 127, 2048 }, + { 2, 128, 2048 }, { 3, 129, 2048 }, { 3, 130, 2048 }, { 4, 131, 2048 }, { 3, 132, 2048 }, { 4, 133, 2048 }, { 4, 134, 2048 }, { 5, 135, 2048 }, + { 3, 136, 2048 }, { 4, 137, 2048 }, { 4, 138, 2048 }, { 5, 139, 2048 }, { 4, 140, 2048 }, { 5, 141, 2048 }, { 5, 142, 2048 }, { 6, 143, 2048 }, + { 3, 144, 2048 }, { 4, 145, 2048 }, { 4, 146, 2048 }, { 5, 147, 2048 }, { 4, 148, 2048 }, { 5, 149, 2048 }, { 5, 150, 2048 }, { 6, 151, 2048 }, + { 4, 152, 2048 }, { 5, 153, 2048 }, { 5, 154, 2048 }, { 6, 155, 2048 }, { 5, 156, 2048 }, { 6, 157, 2048 }, { 6, 158, 2048 }, { 7, 159, 2048 }, + { 3, 160, 2048 }, { 4, 161, 2048 }, { 4, 162, 2048 }, { 5, 163, 2048 }, { 4, 164, 2048 }, { 5, 165, 2048 }, { 5, 166, 2048 }, { 6, 167, 2048 }, + { 4, 168, 2048 }, { 5, 169, 2048 }, { 5, 170, 2048 }, { 6, 171, 2048 }, { 5, 172, 2048 }, { 6, 173, 2048 }, { 6, 174, 2048 }, { 7, 175, 2048 }, + { 4, 176, 2048 }, { 5, 177, 2048 }, { 5, 178, 2048 }, { 6, 179, 2048 }, { 5, 180, 2048 }, { 6, 181, 2048 }, { 6, 182, 2048 }, { 7, 183, 2048 }, + { 5, 184, 2048 }, { 6, 185, 2048 }, { 6, 186, 2048 }, { 7, 187, 2048 }, { 6, 188, 2048 }, { 7, 189, 2048 }, { 7, 190, 2048 }, { 8, 191, 2048 }, + { 3, 192, 2048 }, { 4, 193, 2048 }, { 4, 194, 2048 }, { 5, 195, 2048 }, { 4, 196, 2048 }, { 5, 197, 2048 }, { 5, 198, 2048 }, { 6, 199, 2048 }, + { 4, 200, 2048 }, { 5, 201, 2048 }, { 5, 202, 2048 }, { 6, 203, 2048 }, { 5, 204, 2048 }, { 6, 205, 2048 }, { 6, 206, 2048 }, { 7, 207, 2048 }, + { 4, 208, 2048 }, { 5, 209, 2048 }, { 5, 210, 2048 }, { 6, 211, 2048 }, { 5, 212, 2048 }, { 6, 213, 2048 }, { 6, 214, 2048 }, { 7, 215, 2048 }, + { 5, 216, 2048 }, { 6, 217, 2048 }, { 6, 218, 2048 }, { 7, 219, 2048 }, { 6, 220, 2048 }, { 7, 221, 2048 }, { 7, 222, 2048 }, { 8, 223, 2048 }, + { 4, 224, 2048 }, { 5, 225, 2048 }, { 5, 226, 2048 }, { 6, 227, 2048 }, { 5, 228, 2048 }, { 6, 229, 2048 }, { 6, 230, 2048 }, { 7, 231, 2048 }, + { 5, 232, 2048 }, { 6, 233, 2048 }, { 6, 234, 2048 }, { 7, 235, 2048 }, { 6, 236, 2048 }, { 7, 237, 2048 }, { 7, 238, 2048 }, { 8, 239, 2048 }, + { 5, 240, 2048 }, { 6, 241, 2048 }, { 6, 242, 2048 }, { 7, 243, 2048 }, { 6, 244, 2048 }, { 7, 245, 2048 }, { 7, 246, 2048 }, { 8, 247, 2048 }, + { 6, 248, 2048 }, { 7, 249, 2048 }, { 7, 250, 2048 }, { 8, 251, 2048 }, { 7, 252, 2048 }, { 8, 253, 2048 }, { 8, 254, 2048 }, { 9, 255, 2048 }, + { 2, 256, 2048 }, { 3, 257, 2048 }, { 3, 258, 2048 }, { 4, 259, 2048 }, { 3, 260, 2048 }, { 4, 261, 2048 }, { 4, 262, 2048 }, { 5, 263, 2048 }, + { 3, 264, 2048 }, { 4, 265, 2048 }, { 4, 266, 2048 }, { 5, 267, 2048 }, { 4, 268, 2048 }, { 5, 269, 2048 }, { 5, 270, 2048 }, { 6, 271, 2048 }, + { 3, 272, 2048 }, { 4, 273, 2048 }, { 4, 274, 2048 }, { 5, 275, 2048 }, { 4, 276, 2048 }, { 5, 277, 2048 }, { 5, 278, 2048 }, { 6, 279, 2048 }, + { 4, 280, 2048 }, { 5, 281, 2048 }, { 5, 282, 2048 }, { 6, 283, 2048 }, { 5, 284, 2048 }, { 6, 285, 2048 }, { 6, 286, 2048 }, { 7, 287, 2048 }, + { 3, 288, 2048 }, { 4, 289, 2048 }, { 4, 290, 2048 }, { 5, 291, 2048 }, { 4, 292, 2048 }, { 5, 293, 2048 }, { 5, 294, 2048 }, { 6, 295, 2048 }, + { 4, 296, 2048 }, { 5, 297, 2048 }, { 5, 298, 2048 }, { 6, 299, 2048 }, { 5, 300, 2048 }, { 6, 301, 2048 }, { 6, 302, 2048 }, { 7, 303, 2048 }, + { 4, 304, 2048 }, { 5, 305, 2048 }, { 5, 306, 2048 }, { 6, 307, 2048 }, { 5, 308, 2048 }, { 6, 309, 2048 }, { 6, 310, 2048 }, { 7, 311, 2048 }, + { 5, 312, 2048 }, { 6, 313, 2048 }, { 6, 314, 2048 }, { 7, 315, 2048 }, { 6, 316, 2048 }, { 7, 317, 2048 }, { 7, 318, 2048 }, { 8, 319, 2048 }, + { 3, 320, 2048 }, { 4, 321, 2048 }, { 4, 322, 2048 }, { 5, 323, 2048 }, { 4, 324, 2048 }, { 5, 325, 2048 }, { 5, 326, 2048 }, { 6, 327, 2048 }, + { 4, 328, 2048 }, { 5, 329, 2048 }, { 5, 330, 2048 }, { 6, 331, 2048 }, { 5, 332, 2048 }, { 6, 333, 2048 }, { 6, 334, 2048 }, { 7, 335, 2048 }, + { 4, 336, 2048 }, { 5, 337, 2048 }, { 5, 338, 2048 }, { 6, 339, 2048 }, { 5, 340, 2048 }, { 6, 341, 2048 }, { 6, 342, 2048 }, { 7, 343, 2048 }, + { 5, 344, 2048 }, { 6, 345, 2048 }, { 6, 346, 2048 }, { 7, 347, 2048 }, { 6, 348, 2048 }, { 7, 349, 2048 }, { 7, 350, 2048 }, { 8, 351, 2048 }, + { 4, 352, 2048 }, { 5, 353, 2048 }, { 5, 354, 2048 }, { 6, 355, 2048 }, { 5, 356, 2048 }, { 6, 357, 2048 }, { 6, 358, 2048 }, { 7, 359, 2048 }, + { 5, 360, 2048 }, { 6, 361, 2048 }, { 6, 362, 2048 }, { 7, 363, 2048 }, { 6, 364, 2048 }, { 7, 365, 2048 }, { 7, 366, 2048 }, { 8, 367, 2048 }, + { 5, 368, 2048 }, { 6, 369, 2048 }, { 6, 370, 2048 }, { 7, 371, 2048 }, { 6, 372, 2048 }, { 7, 373, 2048 }, { 7, 374, 2048 }, { 8, 375, 2048 }, + { 6, 376, 2048 }, { 7, 377, 2048 }, { 7, 378, 2048 }, { 8, 379, 2048 }, { 7, 380, 2048 }, { 8, 381, 2048 }, { 8, 382, 2048 }, { 9, 383, 2048 }, + { 3, 384, 2048 }, { 4, 385, 2048 }, { 4, 386, 2048 }, { 5, 387, 2048 }, { 4, 388, 2048 }, { 5, 389, 2048 }, { 5, 390, 2048 }, { 6, 391, 2048 }, + { 4, 392, 2048 }, { 5, 393, 2048 }, { 5, 394, 2048 }, { 6, 395, 2048 }, { 5, 396, 2048 }, { 6, 397, 2048 }, { 6, 398, 2048 }, { 7, 399, 2048 }, + { 4, 400, 2048 }, { 5, 401, 2048 }, { 5, 402, 2048 }, { 6, 403, 2048 }, { 5, 404, 2048 }, { 6, 405, 2048 }, { 6, 406, 2048 }, { 7, 407, 2048 }, + { 5, 408, 2048 }, { 6, 409, 2048 }, { 6, 410, 2048 }, { 7, 411, 2048 }, { 6, 412, 2048 }, { 7, 413, 2048 }, { 7, 414, 2048 }, { 8, 415, 2048 }, + { 4, 416, 2048 }, { 5, 417, 2048 }, { 5, 418, 2048 }, { 6, 419, 2048 }, { 5, 420, 2048 }, { 6, 421, 2048 }, { 6, 422, 2048 }, { 7, 423, 2048 }, + { 5, 424, 2048 }, { 6, 425, 2048 }, { 6, 426, 2048 }, { 7, 427, 2048 }, { 6, 428, 2048 }, { 7, 429, 2048 }, { 7, 430, 2048 }, { 8, 431, 2048 }, + { 5, 432, 2048 }, { 6, 433, 2048 }, { 6, 434, 2048 }, { 7, 435, 2048 }, { 6, 436, 2048 }, { 7, 437, 2048 }, { 7, 438, 2048 }, { 8, 439, 2048 }, + { 6, 440, 2048 }, { 7, 441, 2048 }, { 7, 442, 2048 }, { 8, 443, 2048 }, { 7, 444, 2048 }, { 8, 445, 2048 }, { 8, 446, 2048 }, { 9, 447, 2048 }, + { 4, 448, 2048 }, { 5, 449, 2048 }, { 5, 450, 2048 }, { 6, 451, 2048 }, { 5, 452, 2048 }, { 6, 453, 2048 }, { 6, 454, 2048 }, { 7, 455, 2048 }, + { 5, 456, 2048 }, { 6, 457, 2048 }, { 6, 458, 2048 }, { 7, 459, 2048 }, { 6, 460, 2048 }, { 7, 461, 2048 }, { 7, 462, 2048 }, { 8, 463, 2048 }, + { 5, 464, 2048 }, { 6, 465, 2048 }, { 6, 466, 2048 }, { 7, 467, 2048 }, { 6, 468, 2048 }, { 7, 469, 2048 }, { 7, 470, 2048 }, { 8, 471, 2048 }, + { 6, 472, 2048 }, { 7, 473, 2048 }, { 7, 474, 2048 }, { 8, 475, 2048 }, { 7, 476, 2048 }, { 8, 477, 2048 }, { 8, 478, 2048 }, { 9, 479, 2048 }, + { 5, 480, 2048 }, { 6, 481, 2048 }, { 6, 482, 2048 }, { 7, 483, 2048 }, { 6, 484, 2048 }, { 7, 485, 2048 }, { 7, 486, 2048 }, { 8, 487, 2048 }, + { 6, 488, 2048 }, { 7, 489, 2048 }, { 7, 490, 2048 }, { 8, 491, 2048 }, { 7, 492, 2048 }, { 8, 493, 2048 }, { 8, 494, 2048 }, { 9, 495, 2048 }, + { 6, 496, 2048 }, { 7, 497, 2048 }, { 7, 498, 2048 }, { 8, 499, 2048 }, { 7, 500, 2048 }, { 8, 501, 2048 }, { 8, 502, 2048 }, { 9, 503, 2048 }, + { 7, 504, 2048 }, { 8, 505, 2048 }, { 8, 506, 2048 }, { 9, 507, 2048 }, { 8, 508, 2048 }, { 9, 509, 2048 }, { 9, 510, 2048 }, { 10, 511, 2048 }, + { 2, 512, 2048 }, { 3, 513, 2048 }, { 3, 514, 2048 }, { 4, 515, 2048 }, { 3, 516, 2048 }, { 4, 517, 2048 }, { 4, 518, 2048 }, { 5, 519, 2048 }, + { 3, 520, 2048 }, { 4, 521, 2048 }, { 4, 522, 2048 }, { 5, 523, 2048 }, { 4, 524, 2048 }, { 5, 525, 2048 }, { 5, 526, 2048 }, { 6, 527, 2048 }, + { 3, 528, 2048 }, { 4, 529, 2048 }, { 4, 530, 2048 }, { 5, 531, 2048 }, { 4, 532, 2048 }, { 5, 533, 2048 }, { 5, 534, 2048 }, { 6, 535, 2048 }, + { 4, 536, 2048 }, { 5, 537, 2048 }, { 5, 538, 2048 }, { 6, 539, 2048 }, { 5, 540, 2048 }, { 6, 541, 2048 }, { 6, 542, 2048 }, { 7, 543, 2048 }, + { 3, 544, 2048 }, { 4, 545, 2048 }, { 4, 546, 2048 }, { 5, 547, 2048 }, { 4, 548, 2048 }, { 5, 549, 2048 }, { 5, 550, 2048 }, { 6, 551, 2048 }, + { 4, 552, 2048 }, { 5, 553, 2048 }, { 5, 554, 2048 }, { 6, 555, 2048 }, { 5, 556, 2048 }, { 6, 557, 2048 }, { 6, 558, 2048 }, { 7, 559, 2048 }, + { 4, 560, 2048 }, { 5, 561, 2048 }, { 5, 562, 2048 }, { 6, 563, 2048 }, { 5, 564, 2048 }, { 6, 565, 2048 }, { 6, 566, 2048 }, { 7, 567, 2048 }, + { 5, 568, 2048 }, { 6, 569, 2048 }, { 6, 570, 2048 }, { 7, 571, 2048 }, { 6, 572, 2048 }, { 7, 573, 2048 }, { 7, 574, 2048 }, { 8, 575, 2048 }, + { 3, 576, 2048 }, { 4, 577, 2048 }, { 4, 578, 2048 }, { 5, 579, 2048 }, { 4, 580, 2048 }, { 5, 581, 2048 }, { 5, 582, 2048 }, { 6, 583, 2048 }, + { 4, 584, 2048 }, { 5, 585, 2048 }, { 5, 586, 2048 }, { 6, 587, 2048 }, { 5, 588, 2048 }, { 6, 589, 2048 }, { 6, 590, 2048 }, { 7, 591, 2048 }, + { 4, 592, 2048 }, { 5, 593, 2048 }, { 5, 594, 2048 }, { 6, 595, 2048 }, { 5, 596, 2048 }, { 6, 597, 2048 }, { 6, 598, 2048 }, { 7, 599, 2048 }, + { 5, 600, 2048 }, { 6, 601, 2048 }, { 6, 602, 2048 }, { 7, 603, 2048 }, { 6, 604, 2048 }, { 7, 605, 2048 }, { 7, 606, 2048 }, { 8, 607, 2048 }, + { 4, 608, 2048 }, { 5, 609, 2048 }, { 5, 610, 2048 }, { 6, 611, 2048 }, { 5, 612, 2048 }, { 6, 613, 2048 }, { 6, 614, 2048 }, { 7, 615, 2048 }, + { 5, 616, 2048 }, { 6, 617, 2048 }, { 6, 618, 2048 }, { 7, 619, 2048 }, { 6, 620, 2048 }, { 7, 621, 2048 }, { 7, 622, 2048 }, { 8, 623, 2048 }, + { 5, 624, 2048 }, { 6, 625, 2048 }, { 6, 626, 2048 }, { 7, 627, 2048 }, { 6, 628, 2048 }, { 7, 629, 2048 }, { 7, 630, 2048 }, { 8, 631, 2048 }, + { 6, 632, 2048 }, { 7, 633, 2048 }, { 7, 634, 2048 }, { 8, 635, 2048 }, { 7, 636, 2048 }, { 8, 637, 2048 }, { 8, 638, 2048 }, { 9, 639, 2048 }, + { 3, 640, 2048 }, { 4, 641, 2048 }, { 4, 642, 2048 }, { 5, 643, 2048 }, { 4, 644, 2048 }, { 5, 645, 2048 }, { 5, 646, 2048 }, { 6, 647, 2048 }, + { 4, 648, 2048 }, { 5, 649, 2048 }, { 5, 650, 2048 }, { 6, 651, 2048 }, { 5, 652, 2048 }, { 6, 653, 2048 }, { 6, 654, 2048 }, { 7, 655, 2048 }, + { 4, 656, 2048 }, { 5, 657, 2048 }, { 5, 658, 2048 }, { 6, 659, 2048 }, { 5, 660, 2048 }, { 6, 661, 2048 }, { 6, 662, 2048 }, { 7, 663, 2048 }, + { 5, 664, 2048 }, { 6, 665, 2048 }, { 6, 666, 2048 }, { 7, 667, 2048 }, { 6, 668, 2048 }, { 7, 669, 2048 }, { 7, 670, 2048 }, { 8, 671, 2048 }, + { 4, 672, 2048 }, { 5, 673, 2048 }, { 5, 674, 2048 }, { 6, 675, 2048 }, { 5, 676, 2048 }, { 6, 677, 2048 }, { 6, 678, 2048 }, { 7, 679, 2048 }, + { 5, 680, 2048 }, { 6, 681, 2048 }, { 6, 682, 2048 }, { 7, 683, 2048 }, { 6, 684, 2048 }, { 7, 685, 2048 }, { 7, 686, 2048 }, { 8, 687, 2048 }, + { 5, 688, 2048 }, { 6, 689, 2048 }, { 6, 690, 2048 }, { 7, 691, 2048 }, { 6, 692, 2048 }, { 7, 693, 2048 }, { 7, 694, 2048 }, { 8, 695, 2048 }, + { 6, 696, 2048 }, { 7, 697, 2048 }, { 7, 698, 2048 }, { 8, 699, 2048 }, { 7, 700, 2048 }, { 8, 701, 2048 }, { 8, 702, 2048 }, { 9, 703, 2048 }, + { 4, 704, 2048 }, { 5, 705, 2048 }, { 5, 706, 2048 }, { 6, 707, 2048 }, { 5, 708, 2048 }, { 6, 709, 2048 }, { 6, 710, 2048 }, { 7, 711, 2048 }, + { 5, 712, 2048 }, { 6, 713, 2048 }, { 6, 714, 2048 }, { 7, 715, 2048 }, { 6, 716, 2048 }, { 7, 717, 2048 }, { 7, 718, 2048 }, { 8, 719, 2048 }, + { 5, 720, 2048 }, { 6, 721, 2048 }, { 6, 722, 2048 }, { 7, 723, 2048 }, { 6, 724, 2048 }, { 7, 725, 2048 }, { 7, 726, 2048 }, { 8, 727, 2048 }, + { 6, 728, 2048 }, { 7, 729, 2048 }, { 7, 730, 2048 }, { 8, 731, 2048 }, { 7, 732, 2048 }, { 8, 733, 2048 }, { 8, 734, 2048 }, { 9, 735, 2048 }, + { 5, 736, 2048 }, { 6, 737, 2048 }, { 6, 738, 2048 }, { 7, 739, 2048 }, { 6, 740, 2048 }, { 7, 741, 2048 }, { 7, 742, 2048 }, { 8, 743, 2048 }, + { 6, 744, 2048 }, { 7, 745, 2048 }, { 7, 746, 2048 }, { 8, 747, 2048 }, { 7, 748, 2048 }, { 8, 749, 2048 }, { 8, 750, 2048 }, { 9, 751, 2048 }, + { 6, 752, 2048 }, { 7, 753, 2048 }, { 7, 754, 2048 }, { 8, 755, 2048 }, { 7, 756, 2048 }, { 8, 757, 2048 }, { 8, 758, 2048 }, { 9, 759, 2048 }, + { 7, 760, 2048 }, { 8, 761, 2048 }, { 8, 762, 2048 }, { 9, 763, 2048 }, { 8, 764, 2048 }, { 9, 765, 2048 }, { 9, 766, 2048 }, { 10, 767, 2048 }, + { 3, 768, 2048 }, { 4, 769, 2048 }, { 4, 770, 2048 }, { 5, 771, 2048 }, { 4, 772, 2048 }, { 5, 773, 2048 }, { 5, 774, 2048 }, { 6, 775, 2048 }, + { 4, 776, 2048 }, { 5, 777, 2048 }, { 5, 778, 2048 }, { 6, 779, 2048 }, { 5, 780, 2048 }, { 6, 781, 2048 }, { 6, 782, 2048 }, { 7, 783, 2048 }, + { 4, 784, 2048 }, { 5, 785, 2048 }, { 5, 786, 2048 }, { 6, 787, 2048 }, { 5, 788, 2048 }, { 6, 789, 2048 }, { 6, 790, 2048 }, { 7, 791, 2048 }, + { 5, 792, 2048 }, { 6, 793, 2048 }, { 6, 794, 2048 }, { 7, 795, 2048 }, { 6, 796, 2048 }, { 7, 797, 2048 }, { 7, 798, 2048 }, { 8, 799, 2048 }, + { 4, 800, 2048 }, { 5, 801, 2048 }, { 5, 802, 2048 }, { 6, 803, 2048 }, { 5, 804, 2048 }, { 6, 805, 2048 }, { 6, 806, 2048 }, { 7, 807, 2048 }, + { 5, 808, 2048 }, { 6, 809, 2048 }, { 6, 810, 2048 }, { 7, 811, 2048 }, { 6, 812, 2048 }, { 7, 813, 2048 }, { 7, 814, 2048 }, { 8, 815, 2048 }, + { 5, 816, 2048 }, { 6, 817, 2048 }, { 6, 818, 2048 }, { 7, 819, 2048 }, { 6, 820, 2048 }, { 7, 821, 2048 }, { 7, 822, 2048 }, { 8, 823, 2048 }, + { 6, 824, 2048 }, { 7, 825, 2048 }, { 7, 826, 2048 }, { 8, 827, 2048 }, { 7, 828, 2048 }, { 8, 829, 2048 }, { 8, 830, 2048 }, { 9, 831, 2048 }, + { 4, 832, 2048 }, { 5, 833, 2048 }, { 5, 834, 2048 }, { 6, 835, 2048 }, { 5, 836, 2048 }, { 6, 837, 2048 }, { 6, 838, 2048 }, { 7, 839, 2048 }, + { 5, 840, 2048 }, { 6, 841, 2048 }, { 6, 842, 2048 }, { 7, 843, 2048 }, { 6, 844, 2048 }, { 7, 845, 2048 }, { 7, 846, 2048 }, { 8, 847, 2048 }, + { 5, 848, 2048 }, { 6, 849, 2048 }, { 6, 850, 2048 }, { 7, 851, 2048 }, { 6, 852, 2048 }, { 7, 853, 2048 }, { 7, 854, 2048 }, { 8, 855, 2048 }, + { 6, 856, 2048 }, { 7, 857, 2048 }, { 7, 858, 2048 }, { 8, 859, 2048 }, { 7, 860, 2048 }, { 8, 861, 2048 }, { 8, 862, 2048 }, { 9, 863, 2048 }, + { 5, 864, 2048 }, { 6, 865, 2048 }, { 6, 866, 2048 }, { 7, 867, 2048 }, { 6, 868, 2048 }, { 7, 869, 2048 }, { 7, 870, 2048 }, { 8, 871, 2048 }, + { 6, 872, 2048 }, { 7, 873, 2048 }, { 7, 874, 2048 }, { 8, 875, 2048 }, { 7, 876, 2048 }, { 8, 877, 2048 }, { 8, 878, 2048 }, { 9, 879, 2048 }, + { 6, 880, 2048 }, { 7, 881, 2048 }, { 7, 882, 2048 }, { 8, 883, 2048 }, { 7, 884, 2048 }, { 8, 885, 2048 }, { 8, 886, 2048 }, { 9, 887, 2048 }, + { 7, 888, 2048 }, { 8, 889, 2048 }, { 8, 890, 2048 }, { 9, 891, 2048 }, { 8, 892, 2048 }, { 9, 893, 2048 }, { 9, 894, 2048 }, { 10, 895, 2048 }, + { 4, 896, 2048 }, { 5, 897, 2048 }, { 5, 898, 2048 }, { 6, 899, 2048 }, { 5, 900, 2048 }, { 6, 901, 2048 }, { 6, 902, 2048 }, { 7, 903, 2048 }, + { 5, 904, 2048 }, { 6, 905, 2048 }, { 6, 906, 2048 }, { 7, 907, 2048 }, { 6, 908, 2048 }, { 7, 909, 2048 }, { 7, 910, 2048 }, { 8, 911, 2048 }, + { 5, 912, 2048 }, { 6, 913, 2048 }, { 6, 914, 2048 }, { 7, 915, 2048 }, { 6, 916, 2048 }, { 7, 917, 2048 }, { 7, 918, 2048 }, { 8, 919, 2048 }, + { 6, 920, 2048 }, { 7, 921, 2048 }, { 7, 922, 2048 }, { 8, 923, 2048 }, { 7, 924, 2048 }, { 8, 925, 2048 }, { 8, 926, 2048 }, { 9, 927, 2048 }, + { 5, 928, 2048 }, { 6, 929, 2048 }, { 6, 930, 2048 }, { 7, 931, 2048 }, { 6, 932, 2048 }, { 7, 933, 2048 }, { 7, 934, 2048 }, { 8, 935, 2048 }, + { 6, 936, 2048 }, { 7, 937, 2048 }, { 7, 938, 2048 }, { 8, 939, 2048 }, { 7, 940, 2048 }, { 8, 941, 2048 }, { 8, 942, 2048 }, { 9, 943, 2048 }, + { 6, 944, 2048 }, { 7, 945, 2048 }, { 7, 946, 2048 }, { 8, 947, 2048 }, { 7, 948, 2048 }, { 8, 949, 2048 }, { 8, 950, 2048 }, { 9, 951, 2048 }, + { 7, 952, 2048 }, { 8, 953, 2048 }, { 8, 954, 2048 }, { 9, 955, 2048 }, { 8, 956, 2048 }, { 9, 957, 2048 }, { 9, 958, 2048 }, { 10, 959, 2048 }, + { 5, 960, 2048 }, { 6, 961, 2048 }, { 6, 962, 2048 }, { 7, 963, 2048 }, { 6, 964, 2048 }, { 7, 965, 2048 }, { 7, 966, 2048 }, { 8, 967, 2048 }, + { 6, 968, 2048 }, { 7, 969, 2048 }, { 7, 970, 2048 }, { 8, 971, 2048 }, { 7, 972, 2048 }, { 8, 973, 2048 }, { 8, 974, 2048 }, { 9, 975, 2048 }, + { 6, 976, 2048 }, { 7, 977, 2048 }, { 7, 978, 2048 }, { 8, 979, 2048 }, { 7, 980, 2048 }, { 8, 981, 2048 }, { 8, 982, 2048 }, { 9, 983, 2048 }, + { 7, 984, 2048 }, { 8, 985, 2048 }, { 8, 986, 2048 }, { 9, 987, 2048 }, { 8, 988, 2048 }, { 9, 989, 2048 }, { 9, 990, 2048 }, { 10, 991, 2048 }, + { 6, 992, 2048 }, { 7, 993, 2048 }, { 7, 994, 2048 }, { 8, 995, 2048 }, { 7, 996, 2048 }, { 8, 997, 2048 }, { 8, 998, 2048 }, { 9, 999, 2048 }, + { 7, 1000, 2048 }, { 8, 1001, 2048 }, { 8, 1002, 2048 }, { 9, 1003, 2048 }, { 8, 1004, 2048 }, { 9, 1005, 2048 }, { 9, 1006, 2048 }, { 10, 1007, 2048 }, + { 7, 1008, 2048 }, { 8, 1009, 2048 }, { 8, 1010, 2048 }, { 9, 1011, 2048 }, { 8, 1012, 2048 }, { 9, 1013, 2048 }, { 9, 1014, 2048 }, { 10, 1015, 2048 }, + { 8, 1016, 2048 }, { 9, 1017, 2048 }, { 9, 1018, 2048 }, { 10, 1019, 2048 }, { 9, 1020, 2048 }, { 10, 1021, 2048 }, { 10, 1022, 2048 }, { 11, 1023, 2048 }, + { 2, 1024, 2048 }, { 3, 1025, 2048 }, { 3, 1026, 2048 }, { 4, 1027, 2048 }, { 3, 1028, 2048 }, { 4, 1029, 2048 }, { 4, 1030, 2048 }, { 5, 1031, 2048 }, + { 3, 1032, 2048 }, { 4, 1033, 2048 }, { 4, 1034, 2048 }, { 5, 1035, 2048 }, { 4, 1036, 2048 }, { 5, 1037, 2048 }, { 5, 1038, 2048 }, { 6, 1039, 2048 }, + { 3, 1040, 2048 }, { 4, 1041, 2048 }, { 4, 1042, 2048 }, { 5, 1043, 2048 }, { 4, 1044, 2048 }, { 5, 1045, 2048 }, { 5, 1046, 2048 }, { 6, 1047, 2048 }, + { 4, 1048, 2048 }, { 5, 1049, 2048 }, { 5, 1050, 2048 }, { 6, 1051, 2048 }, { 5, 1052, 2048 }, { 6, 1053, 2048 }, { 6, 1054, 2048 }, { 7, 1055, 2048 }, + { 3, 1056, 2048 }, { 4, 1057, 2048 }, { 4, 1058, 2048 }, { 5, 1059, 2048 }, { 4, 1060, 2048 }, { 5, 1061, 2048 }, { 5, 1062, 2048 }, { 6, 1063, 2048 }, + { 4, 1064, 2048 }, { 5, 1065, 2048 }, { 5, 1066, 2048 }, { 6, 1067, 2048 }, { 5, 1068, 2048 }, { 6, 1069, 2048 }, { 6, 1070, 2048 }, { 7, 1071, 2048 }, + { 4, 1072, 2048 }, { 5, 1073, 2048 }, { 5, 1074, 2048 }, { 6, 1075, 2048 }, { 5, 1076, 2048 }, { 6, 1077, 2048 }, { 6, 1078, 2048 }, { 7, 1079, 2048 }, + { 5, 1080, 2048 }, { 6, 1081, 2048 }, { 6, 1082, 2048 }, { 7, 1083, 2048 }, { 6, 1084, 2048 }, { 7, 1085, 2048 }, { 7, 1086, 2048 }, { 8, 1087, 2048 }, + { 3, 1088, 2048 }, { 4, 1089, 2048 }, { 4, 1090, 2048 }, { 5, 1091, 2048 }, { 4, 1092, 2048 }, { 5, 1093, 2048 }, { 5, 1094, 2048 }, { 6, 1095, 2048 }, + { 4, 1096, 2048 }, { 5, 1097, 2048 }, { 5, 1098, 2048 }, { 6, 1099, 2048 }, { 5, 1100, 2048 }, { 6, 1101, 2048 }, { 6, 1102, 2048 }, { 7, 1103, 2048 }, + { 4, 1104, 2048 }, { 5, 1105, 2048 }, { 5, 1106, 2048 }, { 6, 1107, 2048 }, { 5, 1108, 2048 }, { 6, 1109, 2048 }, { 6, 1110, 2048 }, { 7, 1111, 2048 }, + { 5, 1112, 2048 }, { 6, 1113, 2048 }, { 6, 1114, 2048 }, { 7, 1115, 2048 }, { 6, 1116, 2048 }, { 7, 1117, 2048 }, { 7, 1118, 2048 }, { 8, 1119, 2048 }, + { 4, 1120, 2048 }, { 5, 1121, 2048 }, { 5, 1122, 2048 }, { 6, 1123, 2048 }, { 5, 1124, 2048 }, { 6, 1125, 2048 }, { 6, 1126, 2048 }, { 7, 1127, 2048 }, + { 5, 1128, 2048 }, { 6, 1129, 2048 }, { 6, 1130, 2048 }, { 7, 1131, 2048 }, { 6, 1132, 2048 }, { 7, 1133, 2048 }, { 7, 1134, 2048 }, { 8, 1135, 2048 }, + { 5, 1136, 2048 }, { 6, 1137, 2048 }, { 6, 1138, 2048 }, { 7, 1139, 2048 }, { 6, 1140, 2048 }, { 7, 1141, 2048 }, { 7, 1142, 2048 }, { 8, 1143, 2048 }, + { 6, 1144, 2048 }, { 7, 1145, 2048 }, { 7, 1146, 2048 }, { 8, 1147, 2048 }, { 7, 1148, 2048 }, { 8, 1149, 2048 }, { 8, 1150, 2048 }, { 9, 1151, 2048 }, + { 3, 1152, 2048 }, { 4, 1153, 2048 }, { 4, 1154, 2048 }, { 5, 1155, 2048 }, { 4, 1156, 2048 }, { 5, 1157, 2048 }, { 5, 1158, 2048 }, { 6, 1159, 2048 }, + { 4, 1160, 2048 }, { 5, 1161, 2048 }, { 5, 1162, 2048 }, { 6, 1163, 2048 }, { 5, 1164, 2048 }, { 6, 1165, 2048 }, { 6, 1166, 2048 }, { 7, 1167, 2048 }, + { 4, 1168, 2048 }, { 5, 1169, 2048 }, { 5, 1170, 2048 }, { 6, 1171, 2048 }, { 5, 1172, 2048 }, { 6, 1173, 2048 }, { 6, 1174, 2048 }, { 7, 1175, 2048 }, + { 5, 1176, 2048 }, { 6, 1177, 2048 }, { 6, 1178, 2048 }, { 7, 1179, 2048 }, { 6, 1180, 2048 }, { 7, 1181, 2048 }, { 7, 1182, 2048 }, { 8, 1183, 2048 }, + { 4, 1184, 2048 }, { 5, 1185, 2048 }, { 5, 1186, 2048 }, { 6, 1187, 2048 }, { 5, 1188, 2048 }, { 6, 1189, 2048 }, { 6, 1190, 2048 }, { 7, 1191, 2048 }, + { 5, 1192, 2048 }, { 6, 1193, 2048 }, { 6, 1194, 2048 }, { 7, 1195, 2048 }, { 6, 1196, 2048 }, { 7, 1197, 2048 }, { 7, 1198, 2048 }, { 8, 1199, 2048 }, + { 5, 1200, 2048 }, { 6, 1201, 2048 }, { 6, 1202, 2048 }, { 7, 1203, 2048 }, { 6, 1204, 2048 }, { 7, 1205, 2048 }, { 7, 1206, 2048 }, { 8, 1207, 2048 }, + { 6, 1208, 2048 }, { 7, 1209, 2048 }, { 7, 1210, 2048 }, { 8, 1211, 2048 }, { 7, 1212, 2048 }, { 8, 1213, 2048 }, { 8, 1214, 2048 }, { 9, 1215, 2048 }, + { 4, 1216, 2048 }, { 5, 1217, 2048 }, { 5, 1218, 2048 }, { 6, 1219, 2048 }, { 5, 1220, 2048 }, { 6, 1221, 2048 }, { 6, 1222, 2048 }, { 7, 1223, 2048 }, + { 5, 1224, 2048 }, { 6, 1225, 2048 }, { 6, 1226, 2048 }, { 7, 1227, 2048 }, { 6, 1228, 2048 }, { 7, 1229, 2048 }, { 7, 1230, 2048 }, { 8, 1231, 2048 }, + { 5, 1232, 2048 }, { 6, 1233, 2048 }, { 6, 1234, 2048 }, { 7, 1235, 2048 }, { 6, 1236, 2048 }, { 7, 1237, 2048 }, { 7, 1238, 2048 }, { 8, 1239, 2048 }, + { 6, 1240, 2048 }, { 7, 1241, 2048 }, { 7, 1242, 2048 }, { 8, 1243, 2048 }, { 7, 1244, 2048 }, { 8, 1245, 2048 }, { 8, 1246, 2048 }, { 9, 1247, 2048 }, + { 5, 1248, 2048 }, { 6, 1249, 2048 }, { 6, 1250, 2048 }, { 7, 1251, 2048 }, { 6, 1252, 2048 }, { 7, 1253, 2048 }, { 7, 1254, 2048 }, { 8, 1255, 2048 }, + { 6, 1256, 2048 }, { 7, 1257, 2048 }, { 7, 1258, 2048 }, { 8, 1259, 2048 }, { 7, 1260, 2048 }, { 8, 1261, 2048 }, { 8, 1262, 2048 }, { 9, 1263, 2048 }, + { 6, 1264, 2048 }, { 7, 1265, 2048 }, { 7, 1266, 2048 }, { 8, 1267, 2048 }, { 7, 1268, 2048 }, { 8, 1269, 2048 }, { 8, 1270, 2048 }, { 9, 1271, 2048 }, + { 7, 1272, 2048 }, { 8, 1273, 2048 }, { 8, 1274, 2048 }, { 9, 1275, 2048 }, { 8, 1276, 2048 }, { 9, 1277, 2048 }, { 9, 1278, 2048 }, { 10, 1279, 2048 }, + { 3, 1280, 2048 }, { 4, 1281, 2048 }, { 4, 1282, 2048 }, { 5, 1283, 2048 }, { 4, 1284, 2048 }, { 5, 1285, 2048 }, { 5, 1286, 2048 }, { 6, 1287, 2048 }, + { 4, 1288, 2048 }, { 5, 1289, 2048 }, { 5, 1290, 2048 }, { 6, 1291, 2048 }, { 5, 1292, 2048 }, { 6, 1293, 2048 }, { 6, 1294, 2048 }, { 7, 1295, 2048 }, + { 4, 1296, 2048 }, { 5, 1297, 2048 }, { 5, 1298, 2048 }, { 6, 1299, 2048 }, { 5, 1300, 2048 }, { 6, 1301, 2048 }, { 6, 1302, 2048 }, { 7, 1303, 2048 }, + { 5, 1304, 2048 }, { 6, 1305, 2048 }, { 6, 1306, 2048 }, { 7, 1307, 2048 }, { 6, 1308, 2048 }, { 7, 1309, 2048 }, { 7, 1310, 2048 }, { 8, 1311, 2048 }, + { 4, 1312, 2048 }, { 5, 1313, 2048 }, { 5, 1314, 2048 }, { 6, 1315, 2048 }, { 5, 1316, 2048 }, { 6, 1317, 2048 }, { 6, 1318, 2048 }, { 7, 1319, 2048 }, + { 5, 1320, 2048 }, { 6, 1321, 2048 }, { 6, 1322, 2048 }, { 7, 1323, 2048 }, { 6, 1324, 2048 }, { 7, 1325, 2048 }, { 7, 1326, 2048 }, { 8, 1327, 2048 }, + { 5, 1328, 2048 }, { 6, 1329, 2048 }, { 6, 1330, 2048 }, { 7, 1331, 2048 }, { 6, 1332, 2048 }, { 7, 1333, 2048 }, { 7, 1334, 2048 }, { 8, 1335, 2048 }, + { 6, 1336, 2048 }, { 7, 1337, 2048 }, { 7, 1338, 2048 }, { 8, 1339, 2048 }, { 7, 1340, 2048 }, { 8, 1341, 2048 }, { 8, 1342, 2048 }, { 9, 1343, 2048 }, + { 4, 1344, 2048 }, { 5, 1345, 2048 }, { 5, 1346, 2048 }, { 6, 1347, 2048 }, { 5, 1348, 2048 }, { 6, 1349, 2048 }, { 6, 1350, 2048 }, { 7, 1351, 2048 }, + { 5, 1352, 2048 }, { 6, 1353, 2048 }, { 6, 1354, 2048 }, { 7, 1355, 2048 }, { 6, 1356, 2048 }, { 7, 1357, 2048 }, { 7, 1358, 2048 }, { 8, 1359, 2048 }, + { 5, 1360, 2048 }, { 6, 1361, 2048 }, { 6, 1362, 2048 }, { 7, 1363, 2048 }, { 6, 1364, 2048 }, { 7, 1365, 2048 }, { 7, 1366, 2048 }, { 8, 1367, 2048 }, + { 6, 1368, 2048 }, { 7, 1369, 2048 }, { 7, 1370, 2048 }, { 8, 1371, 2048 }, { 7, 1372, 2048 }, { 8, 1373, 2048 }, { 8, 1374, 2048 }, { 9, 1375, 2048 }, + { 5, 1376, 2048 }, { 6, 1377, 2048 }, { 6, 1378, 2048 }, { 7, 1379, 2048 }, { 6, 1380, 2048 }, { 7, 1381, 2048 }, { 7, 1382, 2048 }, { 8, 1383, 2048 }, + { 6, 1384, 2048 }, { 7, 1385, 2048 }, { 7, 1386, 2048 }, { 8, 1387, 2048 }, { 7, 1388, 2048 }, { 8, 1389, 2048 }, { 8, 1390, 2048 }, { 9, 1391, 2048 }, + { 6, 1392, 2048 }, { 7, 1393, 2048 }, { 7, 1394, 2048 }, { 8, 1395, 2048 }, { 7, 1396, 2048 }, { 8, 1397, 2048 }, { 8, 1398, 2048 }, { 9, 1399, 2048 }, + { 7, 1400, 2048 }, { 8, 1401, 2048 }, { 8, 1402, 2048 }, { 9, 1403, 2048 }, { 8, 1404, 2048 }, { 9, 1405, 2048 }, { 9, 1406, 2048 }, { 10, 1407, 2048 }, + { 4, 1408, 2048 }, { 5, 1409, 2048 }, { 5, 1410, 2048 }, { 6, 1411, 2048 }, { 5, 1412, 2048 }, { 6, 1413, 2048 }, { 6, 1414, 2048 }, { 7, 1415, 2048 }, + { 5, 1416, 2048 }, { 6, 1417, 2048 }, { 6, 1418, 2048 }, { 7, 1419, 2048 }, { 6, 1420, 2048 }, { 7, 1421, 2048 }, { 7, 1422, 2048 }, { 8, 1423, 2048 }, + { 5, 1424, 2048 }, { 6, 1425, 2048 }, { 6, 1426, 2048 }, { 7, 1427, 2048 }, { 6, 1428, 2048 }, { 7, 1429, 2048 }, { 7, 1430, 2048 }, { 8, 1431, 2048 }, + { 6, 1432, 2048 }, { 7, 1433, 2048 }, { 7, 1434, 2048 }, { 8, 1435, 2048 }, { 7, 1436, 2048 }, { 8, 1437, 2048 }, { 8, 1438, 2048 }, { 9, 1439, 2048 }, + { 5, 1440, 2048 }, { 6, 1441, 2048 }, { 6, 1442, 2048 }, { 7, 1443, 2048 }, { 6, 1444, 2048 }, { 7, 1445, 2048 }, { 7, 1446, 2048 }, { 8, 1447, 2048 }, + { 6, 1448, 2048 }, { 7, 1449, 2048 }, { 7, 1450, 2048 }, { 8, 1451, 2048 }, { 7, 1452, 2048 }, { 8, 1453, 2048 }, { 8, 1454, 2048 }, { 9, 1455, 2048 }, + { 6, 1456, 2048 }, { 7, 1457, 2048 }, { 7, 1458, 2048 }, { 8, 1459, 2048 }, { 7, 1460, 2048 }, { 8, 1461, 2048 }, { 8, 1462, 2048 }, { 9, 1463, 2048 }, + { 7, 1464, 2048 }, { 8, 1465, 2048 }, { 8, 1466, 2048 }, { 9, 1467, 2048 }, { 8, 1468, 2048 }, { 9, 1469, 2048 }, { 9, 1470, 2048 }, { 10, 1471, 2048 }, + { 5, 1472, 2048 }, { 6, 1473, 2048 }, { 6, 1474, 2048 }, { 7, 1475, 2048 }, { 6, 1476, 2048 }, { 7, 1477, 2048 }, { 7, 1478, 2048 }, { 8, 1479, 2048 }, + { 6, 1480, 2048 }, { 7, 1481, 2048 }, { 7, 1482, 2048 }, { 8, 1483, 2048 }, { 7, 1484, 2048 }, { 8, 1485, 2048 }, { 8, 1486, 2048 }, { 9, 1487, 2048 }, + { 6, 1488, 2048 }, { 7, 1489, 2048 }, { 7, 1490, 2048 }, { 8, 1491, 2048 }, { 7, 1492, 2048 }, { 8, 1493, 2048 }, { 8, 1494, 2048 }, { 9, 1495, 2048 }, + { 7, 1496, 2048 }, { 8, 1497, 2048 }, { 8, 1498, 2048 }, { 9, 1499, 2048 }, { 8, 1500, 2048 }, { 9, 1501, 2048 }, { 9, 1502, 2048 }, { 10, 1503, 2048 }, + { 6, 1504, 2048 }, { 7, 1505, 2048 }, { 7, 1506, 2048 }, { 8, 1507, 2048 }, { 7, 1508, 2048 }, { 8, 1509, 2048 }, { 8, 1510, 2048 }, { 9, 1511, 2048 }, + { 7, 1512, 2048 }, { 8, 1513, 2048 }, { 8, 1514, 2048 }, { 9, 1515, 2048 }, { 8, 1516, 2048 }, { 9, 1517, 2048 }, { 9, 1518, 2048 }, { 10, 1519, 2048 }, + { 7, 1520, 2048 }, { 8, 1521, 2048 }, { 8, 1522, 2048 }, { 9, 1523, 2048 }, { 8, 1524, 2048 }, { 9, 1525, 2048 }, { 9, 1526, 2048 }, { 10, 1527, 2048 }, + { 8, 1528, 2048 }, { 9, 1529, 2048 }, { 9, 1530, 2048 }, { 10, 1531, 2048 }, { 9, 1532, 2048 }, { 10, 1533, 2048 }, { 10, 1534, 2048 }, { 11, 1535, 2048 }, + { 3, 1536, 2048 }, { 4, 1537, 2048 }, { 4, 1538, 2048 }, { 5, 1539, 2048 }, { 4, 1540, 2048 }, { 5, 1541, 2048 }, { 5, 1542, 2048 }, { 6, 1543, 2048 }, + { 4, 1544, 2048 }, { 5, 1545, 2048 }, { 5, 1546, 2048 }, { 6, 1547, 2048 }, { 5, 1548, 2048 }, { 6, 1549, 2048 }, { 6, 1550, 2048 }, { 7, 1551, 2048 }, + { 4, 1552, 2048 }, { 5, 1553, 2048 }, { 5, 1554, 2048 }, { 6, 1555, 2048 }, { 5, 1556, 2048 }, { 6, 1557, 2048 }, { 6, 1558, 2048 }, { 7, 1559, 2048 }, + { 5, 1560, 2048 }, { 6, 1561, 2048 }, { 6, 1562, 2048 }, { 7, 1563, 2048 }, { 6, 1564, 2048 }, { 7, 1565, 2048 }, { 7, 1566, 2048 }, { 8, 1567, 2048 }, + { 4, 1568, 2048 }, { 5, 1569, 2048 }, { 5, 1570, 2048 }, { 6, 1571, 2048 }, { 5, 1572, 2048 }, { 6, 1573, 2048 }, { 6, 1574, 2048 }, { 7, 1575, 2048 }, + { 5, 1576, 2048 }, { 6, 1577, 2048 }, { 6, 1578, 2048 }, { 7, 1579, 2048 }, { 6, 1580, 2048 }, { 7, 1581, 2048 }, { 7, 1582, 2048 }, { 8, 1583, 2048 }, + { 5, 1584, 2048 }, { 6, 1585, 2048 }, { 6, 1586, 2048 }, { 7, 1587, 2048 }, { 6, 1588, 2048 }, { 7, 1589, 2048 }, { 7, 1590, 2048 }, { 8, 1591, 2048 }, + { 6, 1592, 2048 }, { 7, 1593, 2048 }, { 7, 1594, 2048 }, { 8, 1595, 2048 }, { 7, 1596, 2048 }, { 8, 1597, 2048 }, { 8, 1598, 2048 }, { 9, 1599, 2048 }, + { 4, 1600, 2048 }, { 5, 1601, 2048 }, { 5, 1602, 2048 }, { 6, 1603, 2048 }, { 5, 1604, 2048 }, { 6, 1605, 2048 }, { 6, 1606, 2048 }, { 7, 1607, 2048 }, + { 5, 1608, 2048 }, { 6, 1609, 2048 }, { 6, 1610, 2048 }, { 7, 1611, 2048 }, { 6, 1612, 2048 }, { 7, 1613, 2048 }, { 7, 1614, 2048 }, { 8, 1615, 2048 }, + { 5, 1616, 2048 }, { 6, 1617, 2048 }, { 6, 1618, 2048 }, { 7, 1619, 2048 }, { 6, 1620, 2048 }, { 7, 1621, 2048 }, { 7, 1622, 2048 }, { 8, 1623, 2048 }, + { 6, 1624, 2048 }, { 7, 1625, 2048 }, { 7, 1626, 2048 }, { 8, 1627, 2048 }, { 7, 1628, 2048 }, { 8, 1629, 2048 }, { 8, 1630, 2048 }, { 9, 1631, 2048 }, + { 5, 1632, 2048 }, { 6, 1633, 2048 }, { 6, 1634, 2048 }, { 7, 1635, 2048 }, { 6, 1636, 2048 }, { 7, 1637, 2048 }, { 7, 1638, 2048 }, { 8, 1639, 2048 }, + { 6, 1640, 2048 }, { 7, 1641, 2048 }, { 7, 1642, 2048 }, { 8, 1643, 2048 }, { 7, 1644, 2048 }, { 8, 1645, 2048 }, { 8, 1646, 2048 }, { 9, 1647, 2048 }, + { 6, 1648, 2048 }, { 7, 1649, 2048 }, { 7, 1650, 2048 }, { 8, 1651, 2048 }, { 7, 1652, 2048 }, { 8, 1653, 2048 }, { 8, 1654, 2048 }, { 9, 1655, 2048 }, + { 7, 1656, 2048 }, { 8, 1657, 2048 }, { 8, 1658, 2048 }, { 9, 1659, 2048 }, { 8, 1660, 2048 }, { 9, 1661, 2048 }, { 9, 1662, 2048 }, { 10, 1663, 2048 }, + { 4, 1664, 2048 }, { 5, 1665, 2048 }, { 5, 1666, 2048 }, { 6, 1667, 2048 }, { 5, 1668, 2048 }, { 6, 1669, 2048 }, { 6, 1670, 2048 }, { 7, 1671, 2048 }, + { 5, 1672, 2048 }, { 6, 1673, 2048 }, { 6, 1674, 2048 }, { 7, 1675, 2048 }, { 6, 1676, 2048 }, { 7, 1677, 2048 }, { 7, 1678, 2048 }, { 8, 1679, 2048 }, + { 5, 1680, 2048 }, { 6, 1681, 2048 }, { 6, 1682, 2048 }, { 7, 1683, 2048 }, { 6, 1684, 2048 }, { 7, 1685, 2048 }, { 7, 1686, 2048 }, { 8, 1687, 2048 }, + { 6, 1688, 2048 }, { 7, 1689, 2048 }, { 7, 1690, 2048 }, { 8, 1691, 2048 }, { 7, 1692, 2048 }, { 8, 1693, 2048 }, { 8, 1694, 2048 }, { 9, 1695, 2048 }, + { 5, 1696, 2048 }, { 6, 1697, 2048 }, { 6, 1698, 2048 }, { 7, 1699, 2048 }, { 6, 1700, 2048 }, { 7, 1701, 2048 }, { 7, 1702, 2048 }, { 8, 1703, 2048 }, + { 6, 1704, 2048 }, { 7, 1705, 2048 }, { 7, 1706, 2048 }, { 8, 1707, 2048 }, { 7, 1708, 2048 }, { 8, 1709, 2048 }, { 8, 1710, 2048 }, { 9, 1711, 2048 }, + { 6, 1712, 2048 }, { 7, 1713, 2048 }, { 7, 1714, 2048 }, { 8, 1715, 2048 }, { 7, 1716, 2048 }, { 8, 1717, 2048 }, { 8, 1718, 2048 }, { 9, 1719, 2048 }, + { 7, 1720, 2048 }, { 8, 1721, 2048 }, { 8, 1722, 2048 }, { 9, 1723, 2048 }, { 8, 1724, 2048 }, { 9, 1725, 2048 }, { 9, 1726, 2048 }, { 10, 1727, 2048 }, + { 5, 1728, 2048 }, { 6, 1729, 2048 }, { 6, 1730, 2048 }, { 7, 1731, 2048 }, { 6, 1732, 2048 }, { 7, 1733, 2048 }, { 7, 1734, 2048 }, { 8, 1735, 2048 }, + { 6, 1736, 2048 }, { 7, 1737, 2048 }, { 7, 1738, 2048 }, { 8, 1739, 2048 }, { 7, 1740, 2048 }, { 8, 1741, 2048 }, { 8, 1742, 2048 }, { 9, 1743, 2048 }, + { 6, 1744, 2048 }, { 7, 1745, 2048 }, { 7, 1746, 2048 }, { 8, 1747, 2048 }, { 7, 1748, 2048 }, { 8, 1749, 2048 }, { 8, 1750, 2048 }, { 9, 1751, 2048 }, + { 7, 1752, 2048 }, { 8, 1753, 2048 }, { 8, 1754, 2048 }, { 9, 1755, 2048 }, { 8, 1756, 2048 }, { 9, 1757, 2048 }, { 9, 1758, 2048 }, { 10, 1759, 2048 }, + { 6, 1760, 2048 }, { 7, 1761, 2048 }, { 7, 1762, 2048 }, { 8, 1763, 2048 }, { 7, 1764, 2048 }, { 8, 1765, 2048 }, { 8, 1766, 2048 }, { 9, 1767, 2048 }, + { 7, 1768, 2048 }, { 8, 1769, 2048 }, { 8, 1770, 2048 }, { 9, 1771, 2048 }, { 8, 1772, 2048 }, { 9, 1773, 2048 }, { 9, 1774, 2048 }, { 10, 1775, 2048 }, + { 7, 1776, 2048 }, { 8, 1777, 2048 }, { 8, 1778, 2048 }, { 9, 1779, 2048 }, { 8, 1780, 2048 }, { 9, 1781, 2048 }, { 9, 1782, 2048 }, { 10, 1783, 2048 }, + { 8, 1784, 2048 }, { 9, 1785, 2048 }, { 9, 1786, 2048 }, { 10, 1787, 2048 }, { 9, 1788, 2048 }, { 10, 1789, 2048 }, { 10, 1790, 2048 }, { 11, 1791, 2048 }, + { 4, 1792, 2048 }, { 5, 1793, 2048 }, { 5, 1794, 2048 }, { 6, 1795, 2048 }, { 5, 1796, 2048 }, { 6, 1797, 2048 }, { 6, 1798, 2048 }, { 7, 1799, 2048 }, + { 5, 1800, 2048 }, { 6, 1801, 2048 }, { 6, 1802, 2048 }, { 7, 1803, 2048 }, { 6, 1804, 2048 }, { 7, 1805, 2048 }, { 7, 1806, 2048 }, { 8, 1807, 2048 }, + { 5, 1808, 2048 }, { 6, 1809, 2048 }, { 6, 1810, 2048 }, { 7, 1811, 2048 }, { 6, 1812, 2048 }, { 7, 1813, 2048 }, { 7, 1814, 2048 }, { 8, 1815, 2048 }, + { 6, 1816, 2048 }, { 7, 1817, 2048 }, { 7, 1818, 2048 }, { 8, 1819, 2048 }, { 7, 1820, 2048 }, { 8, 1821, 2048 }, { 8, 1822, 2048 }, { 9, 1823, 2048 }, + { 5, 1824, 2048 }, { 6, 1825, 2048 }, { 6, 1826, 2048 }, { 7, 1827, 2048 }, { 6, 1828, 2048 }, { 7, 1829, 2048 }, { 7, 1830, 2048 }, { 8, 1831, 2048 }, + { 6, 1832, 2048 }, { 7, 1833, 2048 }, { 7, 1834, 2048 }, { 8, 1835, 2048 }, { 7, 1836, 2048 }, { 8, 1837, 2048 }, { 8, 1838, 2048 }, { 9, 1839, 2048 }, + { 6, 1840, 2048 }, { 7, 1841, 2048 }, { 7, 1842, 2048 }, { 8, 1843, 2048 }, { 7, 1844, 2048 }, { 8, 1845, 2048 }, { 8, 1846, 2048 }, { 9, 1847, 2048 }, + { 7, 1848, 2048 }, { 8, 1849, 2048 }, { 8, 1850, 2048 }, { 9, 1851, 2048 }, { 8, 1852, 2048 }, { 9, 1853, 2048 }, { 9, 1854, 2048 }, { 10, 1855, 2048 }, + { 5, 1856, 2048 }, { 6, 1857, 2048 }, { 6, 1858, 2048 }, { 7, 1859, 2048 }, { 6, 1860, 2048 }, { 7, 1861, 2048 }, { 7, 1862, 2048 }, { 8, 1863, 2048 }, + { 6, 1864, 2048 }, { 7, 1865, 2048 }, { 7, 1866, 2048 }, { 8, 1867, 2048 }, { 7, 1868, 2048 }, { 8, 1869, 2048 }, { 8, 1870, 2048 }, { 9, 1871, 2048 }, + { 6, 1872, 2048 }, { 7, 1873, 2048 }, { 7, 1874, 2048 }, { 8, 1875, 2048 }, { 7, 1876, 2048 }, { 8, 1877, 2048 }, { 8, 1878, 2048 }, { 9, 1879, 2048 }, + { 7, 1880, 2048 }, { 8, 1881, 2048 }, { 8, 1882, 2048 }, { 9, 1883, 2048 }, { 8, 1884, 2048 }, { 9, 1885, 2048 }, { 9, 1886, 2048 }, { 10, 1887, 2048 }, + { 6, 1888, 2048 }, { 7, 1889, 2048 }, { 7, 1890, 2048 }, { 8, 1891, 2048 }, { 7, 1892, 2048 }, { 8, 1893, 2048 }, { 8, 1894, 2048 }, { 9, 1895, 2048 }, + { 7, 1896, 2048 }, { 8, 1897, 2048 }, { 8, 1898, 2048 }, { 9, 1899, 2048 }, { 8, 1900, 2048 }, { 9, 1901, 2048 }, { 9, 1902, 2048 }, { 10, 1903, 2048 }, + { 7, 1904, 2048 }, { 8, 1905, 2048 }, { 8, 1906, 2048 }, { 9, 1907, 2048 }, { 8, 1908, 2048 }, { 9, 1909, 2048 }, { 9, 1910, 2048 }, { 10, 1911, 2048 }, + { 8, 1912, 2048 }, { 9, 1913, 2048 }, { 9, 1914, 2048 }, { 10, 1915, 2048 }, { 9, 1916, 2048 }, { 10, 1917, 2048 }, { 10, 1918, 2048 }, { 11, 1919, 2048 }, + { 5, 1920, 2048 }, { 6, 1921, 2048 }, { 6, 1922, 2048 }, { 7, 1923, 2048 }, { 6, 1924, 2048 }, { 7, 1925, 2048 }, { 7, 1926, 2048 }, { 8, 1927, 2048 }, + { 6, 1928, 2048 }, { 7, 1929, 2048 }, { 7, 1930, 2048 }, { 8, 1931, 2048 }, { 7, 1932, 2048 }, { 8, 1933, 2048 }, { 8, 1934, 2048 }, { 9, 1935, 2048 }, + { 6, 1936, 2048 }, { 7, 1937, 2048 }, { 7, 1938, 2048 }, { 8, 1939, 2048 }, { 7, 1940, 2048 }, { 8, 1941, 2048 }, { 8, 1942, 2048 }, { 9, 1943, 2048 }, + { 7, 1944, 2048 }, { 8, 1945, 2048 }, { 8, 1946, 2048 }, { 9, 1947, 2048 }, { 8, 1948, 2048 }, { 9, 1949, 2048 }, { 9, 1950, 2048 }, { 10, 1951, 2048 }, + { 6, 1952, 2048 }, { 7, 1953, 2048 }, { 7, 1954, 2048 }, { 8, 1955, 2048 }, { 7, 1956, 2048 }, { 8, 1957, 2048 }, { 8, 1958, 2048 }, { 9, 1959, 2048 }, + { 7, 1960, 2048 }, { 8, 1961, 2048 }, { 8, 1962, 2048 }, { 9, 1963, 2048 }, { 8, 1964, 2048 }, { 9, 1965, 2048 }, { 9, 1966, 2048 }, { 10, 1967, 2048 }, + { 7, 1968, 2048 }, { 8, 1969, 2048 }, { 8, 1970, 2048 }, { 9, 1971, 2048 }, { 8, 1972, 2048 }, { 9, 1973, 2048 }, { 9, 1974, 2048 }, { 10, 1975, 2048 }, + { 8, 1976, 2048 }, { 9, 1977, 2048 }, { 9, 1978, 2048 }, { 10, 1979, 2048 }, { 9, 1980, 2048 }, { 10, 1981, 2048 }, { 10, 1982, 2048 }, { 11, 1983, 2048 }, + { 6, 1984, 2048 }, { 7, 1985, 2048 }, { 7, 1986, 2048 }, { 8, 1987, 2048 }, { 7, 1988, 2048 }, { 8, 1989, 2048 }, { 8, 1990, 2048 }, { 9, 1991, 2048 }, + { 7, 1992, 2048 }, { 8, 1993, 2048 }, { 8, 1994, 2048 }, { 9, 1995, 2048 }, { 8, 1996, 2048 }, { 9, 1997, 2048 }, { 9, 1998, 2048 }, { 10, 1999, 2048 }, + { 7, 2000, 2048 }, { 8, 2001, 2048 }, { 8, 2002, 2048 }, { 9, 2003, 2048 }, { 8, 2004, 2048 }, { 9, 2005, 2048 }, { 9, 2006, 2048 }, { 10, 2007, 2048 }, + { 8, 2008, 2048 }, { 9, 2009, 2048 }, { 9, 2010, 2048 }, { 10, 2011, 2048 }, { 9, 2012, 2048 }, { 10, 2013, 2048 }, { 10, 2014, 2048 }, { 11, 2015, 2048 }, + { 7, 2016, 2048 }, { 8, 2017, 2048 }, { 8, 2018, 2048 }, { 9, 2019, 2048 }, { 8, 2020, 2048 }, { 9, 2021, 2048 }, { 9, 2022, 2048 }, { 10, 2023, 2048 }, + { 8, 2024, 2048 }, { 9, 2025, 2048 }, { 9, 2026, 2048 }, { 10, 2027, 2048 }, { 9, 2028, 2048 }, { 10, 2029, 2048 }, { 10, 2030, 2048 }, { 11, 2031, 2048 }, + { 8, 2032, 2048 }, { 9, 2033, 2048 }, { 9, 2034, 2048 }, { 10, 2035, 2048 }, { 9, 2036, 2048 }, { 10, 2037, 2048 }, { 10, 2038, 2048 }, { 11, 2039, 2048 }, + { 9, 2040, 2048 }, { 10, 2041, 2048 }, { 10, 2042, 2048 }, { 11, 2043, 2048 }, { 10, 2044, 2048 }, { 11, 2045, 2048 }, { 11, 2046, 2048 }, { 12, 2047, 2048 }, +#endif +#endif +#endif +#endif +#endif +#endif +}; + +/* find a hole and free as required, return -1 if no hole found */ +static int find_hole(void) +{ + unsigned x; + int y, z; + for (z = -1, y = INT_MAX, x = 0; x < FP_ENTRIES; x++) { + if (fp_cache[x].lru_count < y && fp_cache[x].lock == 0) { + z = x; + y = fp_cache[x].lru_count; + } + } + + /* decrease all */ + for (x = 0; x < FP_ENTRIES; x++) { + if (fp_cache[x].lru_count > 3) { + --(fp_cache[x].lru_count); + } + } + + /* free entry z */ + if (z >= 0 && fp_cache[z].g) { + if (fp_cache[z].mu != NULL) { + mp_clear(fp_cache[z].mu); + fp_cache[z].mu = NULL; + } + ltc_ecc_del_point(fp_cache[z].g); + fp_cache[z].g = NULL; + for (x = 0; x < (1U<<FP_LUT); x++) { + ltc_ecc_del_point(fp_cache[z].LUT[x]); + fp_cache[z].LUT[x] = NULL; + } + fp_cache[z].lru_count = 0; + } + return z; +} + +/* determine if a base is already in the cache and if so, where */ +static int find_base(ecc_point *g) +{ + int x; + for (x = 0; x < FP_ENTRIES; x++) { + if (fp_cache[x].g != NULL && + mp_cmp(fp_cache[x].g->x, g->x) == LTC_MP_EQ && + mp_cmp(fp_cache[x].g->y, g->y) == LTC_MP_EQ && + mp_cmp(fp_cache[x].g->z, g->z) == LTC_MP_EQ) { + break; + } + } + if (x == FP_ENTRIES) { + x = -1; + } + return x; +} + +/* add a new base to the cache */ +static int add_entry(int idx, ecc_point *g) +{ + unsigned x, y; + + /* allocate base and LUT */ + fp_cache[idx].g = ltc_ecc_new_point(); + if (fp_cache[idx].g == NULL) { + return CRYPT_MEM; + } + + /* copy x and y */ + if ((mp_copy(g->x, fp_cache[idx].g->x) != CRYPT_OK) || + (mp_copy(g->y, fp_cache[idx].g->y) != CRYPT_OK) || + (mp_copy(g->z, fp_cache[idx].g->z) != CRYPT_OK)) { + ltc_ecc_del_point(fp_cache[idx].g); + fp_cache[idx].g = NULL; + return CRYPT_MEM; + } + + for (x = 0; x < (1U<<FP_LUT); x++) { + fp_cache[idx].LUT[x] = ltc_ecc_new_point(); + if (fp_cache[idx].LUT[x] == NULL) { + for (y = 0; y < x; y++) { + ltc_ecc_del_point(fp_cache[idx].LUT[y]); + fp_cache[idx].LUT[y] = NULL; + } + ltc_ecc_del_point(fp_cache[idx].g); + fp_cache[idx].g = NULL; + fp_cache[idx].lru_count = 0; + return CRYPT_MEM; + } + } + + fp_cache[idx].lru_count = 0; + return CRYPT_OK; +} + +/* build the LUT by spacing the bits of the input by #modulus/FP_LUT bits apart + * + * The algorithm builds patterns in increasing bit order by first making all + * single bit input patterns, then all two bit input patterns and so on + */ +static int build_lut(int idx, void *modulus, void *mp, void *mu) +{ + unsigned x, y, err, bitlen, lut_gap; + void *tmp; + + tmp = NULL; + + /* sanity check to make sure lut_order table is of correct size, should compile out to a NOP if true */ + if ((sizeof(lut_orders) / sizeof(lut_orders[0])) < (1U<<FP_LUT)) { + err = CRYPT_INVALID_ARG; + goto DONE; + } + + /* get bitlen and round up to next multiple of FP_LUT */ + bitlen = mp_unsigned_bin_size(modulus) << 3; + x = bitlen % FP_LUT; + if (x) { + bitlen += FP_LUT - x; + } + lut_gap = bitlen / FP_LUT; + + /* init the mu */ + if ((err = mp_init_copy(&fp_cache[idx].mu, mu)) != CRYPT_OK) { + goto ERR; + } + + /* copy base */ + if ((mp_mulmod(fp_cache[idx].g->x, mu, modulus, fp_cache[idx].LUT[1]->x) != CRYPT_OK) || + (mp_mulmod(fp_cache[idx].g->y, mu, modulus, fp_cache[idx].LUT[1]->y) != CRYPT_OK) || + (mp_mulmod(fp_cache[idx].g->z, mu, modulus, fp_cache[idx].LUT[1]->z) != CRYPT_OK)) { goto ERR; } + + /* make all single bit entries */ + for (x = 1; x < FP_LUT; x++) { + if ((mp_copy(fp_cache[idx].LUT[1<<(x-1)]->x, fp_cache[idx].LUT[1<<x]->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->y, fp_cache[idx].LUT[1<<x]->y) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->z, fp_cache[idx].LUT[1<<x]->z) != CRYPT_OK)) { goto ERR; } + + /* now double it bitlen/FP_LUT times */ + for (y = 0; y < lut_gap; y++) { + if ((err = ltc_mp.ecc_ptdbl(fp_cache[idx].LUT[1<<x], fp_cache[idx].LUT[1<<x], modulus, mp)) != CRYPT_OK) { + goto ERR; + } + } + } + + /* now make all entries in increase order of hamming weight */ + for (x = 2; x <= FP_LUT; x++) { + for (y = 0; y < (1UL<<FP_LUT); y++) { + if (lut_orders[y].ham != (int)x) continue; + + /* perform the add */ + if ((err = ltc_mp.ecc_ptadd(fp_cache[idx].LUT[lut_orders[y].terma], fp_cache[idx].LUT[lut_orders[y].termb], + fp_cache[idx].LUT[y], modulus, mp)) != CRYPT_OK) { + goto ERR; + } + } + } + + /* now map all entries back to affine space to make point addition faster */ + if ((err = mp_init(&tmp)) != CRYPT_OK) { goto ERR; } + for (x = 1; x < (1UL<<FP_LUT); x++) { + /* convert z to normal from montgomery */ + if ((err = mp_montgomery_reduce(fp_cache[idx].LUT[x]->z, modulus, mp)) != CRYPT_OK) { goto ERR; } + + /* invert it */ + if ((err = mp_invmod(fp_cache[idx].LUT[x]->z, modulus, fp_cache[idx].LUT[x]->z)) != CRYPT_OK) { goto ERR; } + + /* now square it */ + if ((err = mp_sqrmod(fp_cache[idx].LUT[x]->z, modulus, tmp)) != CRYPT_OK) { goto ERR; } + + /* fix x */ + if ((err = mp_mulmod(fp_cache[idx].LUT[x]->x, tmp, modulus, fp_cache[idx].LUT[x]->x)) != CRYPT_OK) { goto ERR; } + + /* get 1/z^3 */ + if ((err = mp_mulmod(tmp, fp_cache[idx].LUT[x]->z, modulus, tmp)) != CRYPT_OK) { goto ERR; } + + /* fix y */ + if ((err = mp_mulmod(fp_cache[idx].LUT[x]->y, tmp, modulus, fp_cache[idx].LUT[x]->y)) != CRYPT_OK) { goto ERR; } + + /* free z */ + mp_clear(fp_cache[idx].LUT[x]->z); + fp_cache[idx].LUT[x]->z = NULL; + } + mp_clear(tmp); + + return CRYPT_OK; +ERR: + err = CRYPT_MEM; +DONE: + for (y = 0; y < (1U<<FP_LUT); y++) { + ltc_ecc_del_point(fp_cache[idx].LUT[y]); + fp_cache[idx].LUT[y] = NULL; + } + ltc_ecc_del_point(fp_cache[idx].g); + fp_cache[idx].g = NULL; + fp_cache[idx].lru_count = 0; + if (fp_cache[idx].mu != NULL) { + mp_clear(fp_cache[idx].mu); + fp_cache[idx].mu = NULL; + } + if (tmp != NULL) { + mp_clear(tmp); + } + return err; +} + +/* perform a fixed point ECC mulmod */ +static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, int map) +{ + unsigned char kb[128]; + int x; + unsigned y, z, err, bitlen, bitpos, lut_gap, first; + void *tk, *order; + + /* if it's smaller than modulus we fine */ + if (mp_unsigned_bin_size(k) > mp_unsigned_bin_size(modulus)) { + /* find order */ + y = mp_unsigned_bin_size(modulus); + for (x = 0; ltc_ecc_sets[x].size; x++) { + if (y <= (unsigned)ltc_ecc_sets[x].size) break; + } + + /* back off if we are on the 521 bit curve */ + if (y == 66) --x; + + if ((err = mp_init(&order)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { + mp_clear(&order); + return err; + } + + /* k must be less than modulus */ + if (mp_cmp(k, order) != LTC_MP_LT) { + if ((err = mp_init(&tk)) != CRYPT_OK) { + mp_clear(order); + return err; + } + if ((err = mp_mod(k, order, tk)) != CRYPT_OK) { + mp_clear(tk); + mp_clear(order); + return err; + } + } else { + tk = k; + } + mp_clear(order); + } else { + tk = k; + } + + /* get bitlen and round up to next multiple of FP_LUT */ + bitlen = mp_unsigned_bin_size(modulus) << 3; + x = bitlen % FP_LUT; + if (x) { + bitlen += FP_LUT - x; + } + lut_gap = bitlen / FP_LUT; + + /* get the k value */ + if (mp_unsigned_bin_size(tk) > (sizeof(kb) - 2)) { + if (tk != k) { + mp_clear(tk); + } + return CRYPT_BUFFER_OVERFLOW; + } + + /* store k */ + zeromem(kb, sizeof(kb)); + if ((err = mp_to_unsigned_bin(tk, kb)) != CRYPT_OK) { + if (tk != k) { + mp_clear(tk); + } + return err; + } + + /* let's reverse kb so it's little endian */ + x = 0; + y = mp_unsigned_bin_size(tk) - 1; + if (tk != k) { + mp_clear(tk); + } + while ((unsigned)x < y) { + z = kb[x]; kb[x] = kb[y]; kb[y] = z; + ++x; --y; + } + + /* at this point we can start, yipee */ + first = 1; + for (x = lut_gap-1; x >= 0; x--) { + /* extract FP_LUT bits from kb spread out by lut_gap bits and offset by x bits from the start */ + bitpos = x; + for (y = z = 0; y < FP_LUT; y++) { + z |= ((kb[bitpos>>3] >> (bitpos&7)) & 1) << y; + bitpos += lut_gap; /* it's y*lut_gap + x, but here we can avoid the mult in each loop */ + } + + /* double if not first */ + if (!first) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + + /* add if not first, otherwise copy */ + if (!first && z) { + if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx].LUT[z], R, modulus, mp)) != CRYPT_OK) { + return err; + } + } else if (z) { + if ((mp_copy(fp_cache[idx].LUT[z]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[z]->y, R->y) != CRYPT_OK) || + (mp_copy(fp_cache[idx].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } + first = 0; + } + } + z = 0; + zeromem(kb, sizeof(kb)); + /* map R back from projective space */ + if (map) { + err = ltc_ecc_map(R, modulus, mp); + } else { + err = CRYPT_OK; + } + return err; +} + +#ifdef LTC_ECC_SHAMIR +/* perform a fixed point ECC mulmod */ +static int accel_fp_mul2add(int idx1, int idx2, + void *kA, void *kB, + ecc_point *R, void *modulus, void *mp) +{ + unsigned char kb[2][128]; + int x; + unsigned y, z, err, bitlen, bitpos, lut_gap, first, zA, zB; + void *tka, *tkb, *order; + + /* if it's smaller than modulus we fine */ + if (mp_unsigned_bin_size(kA) > mp_unsigned_bin_size(modulus)) { + /* find order */ + y = mp_unsigned_bin_size(modulus); + for (x = 0; ltc_ecc_sets[x].size; x++) { + if (y <= (unsigned)ltc_ecc_sets[x].size) break; + } + + /* back off if we are on the 521 bit curve */ + if (y == 66) --x; + + if ((err = mp_init(&order)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { + mp_clear(&order); + return err; + } + + /* kA must be less than modulus */ + if (mp_cmp(kA, order) != LTC_MP_LT) { + if ((err = mp_init(&tka)) != CRYPT_OK) { + mp_clear(order); + return err; + } + if ((err = mp_mod(kA, order, tka)) != CRYPT_OK) { + mp_clear(tka); + mp_clear(order); + return err; + } + } else { + tka = kA; + } + mp_clear(order); + } else { + tka = kA; + } + + /* if it's smaller than modulus we fine */ + if (mp_unsigned_bin_size(kB) > mp_unsigned_bin_size(modulus)) { + /* find order */ + y = mp_unsigned_bin_size(modulus); + for (x = 0; ltc_ecc_sets[x].size; x++) { + if (y <= (unsigned)ltc_ecc_sets[x].size) break; + } + + /* back off if we are on the 521 bit curve */ + if (y == 66) --x; + + if ((err = mp_init(&order)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { + mp_clear(&order); + return err; + } + + /* kB must be less than modulus */ + if (mp_cmp(kB, order) != LTC_MP_LT) { + if ((err = mp_init(&tkb)) != CRYPT_OK) { + mp_clear(order); + return err; + } + if ((err = mp_mod(kB, order, tkb)) != CRYPT_OK) { + mp_clear(tkb); + mp_clear(order); + return err; + } + } else { + tkb = kB; + } + mp_clear(order); + } else { + tkb = kB; + } + + /* get bitlen and round up to next multiple of FP_LUT */ + bitlen = mp_unsigned_bin_size(modulus) << 3; + x = bitlen % FP_LUT; + if (x) { + bitlen += FP_LUT - x; + } + lut_gap = bitlen / FP_LUT; + + /* get the k value */ + if ((mp_unsigned_bin_size(tka) > (sizeof(kb[0]) - 2)) || (mp_unsigned_bin_size(tkb) > (sizeof(kb[0]) - 2)) ) { + if (tka != kA) { + mp_clear(tka); + } + if (tkb != kB) { + mp_clear(tkb); + } + return CRYPT_BUFFER_OVERFLOW; + } + + /* store k */ + zeromem(kb, sizeof(kb)); + if ((err = mp_to_unsigned_bin(tka, kb[0])) != CRYPT_OK) { + if (tka != kA) { + mp_clear(tka); + } + if (tkb != kB) { + mp_clear(tkb); + } + return err; + } + + /* let's reverse kb so it's little endian */ + x = 0; + y = mp_unsigned_bin_size(tka) - 1; + if (tka != kA) { + mp_clear(tka); + } + while ((unsigned)x < y) { + z = kb[0][x]; kb[0][x] = kb[0][y]; kb[0][y] = z; + ++x; --y; + } + + /* store b */ + if ((err = mp_to_unsigned_bin(tkb, kb[1])) != CRYPT_OK) { + if (tkb != kB) { + mp_clear(tkb); + } + return err; + } + + x = 0; + y = mp_unsigned_bin_size(tkb) - 1; + if (tkb != kB) { + mp_clear(tkb); + } + while ((unsigned)x < y) { + z = kb[1][x]; kb[1][x] = kb[1][y]; kb[1][y] = z; + ++x; --y; + } + + /* at this point we can start, yipee */ + first = 1; + for (x = lut_gap-1; x >= 0; x--) { + /* extract FP_LUT bits from kb spread out by lut_gap bits and offset by x bits from the start */ + bitpos = x; + for (y = zA = zB = 0; y < FP_LUT; y++) { + zA |= ((kb[0][bitpos>>3] >> (bitpos&7)) & 1) << y; + zB |= ((kb[1][bitpos>>3] >> (bitpos&7)) & 1) << y; + bitpos += lut_gap; /* it's y*lut_gap + x, but here we can avoid the mult in each loop */ + } + + /* double if not first */ + if (!first) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + + /* add if not first, otherwise copy */ + if (!first) { + if (zA) { + if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx1].LUT[zA], R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + if (zB) { + if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx2].LUT[zB], R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + } else { + if (zA) { + if ((mp_copy(fp_cache[idx1].LUT[zA]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx1].LUT[zA]->y, R->y) != CRYPT_OK) || + (mp_copy(fp_cache[idx1].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } + first = 0; + } + if (zB && first == 0) { + if (zB) { + if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx2].LUT[zB], R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + } else if (zB && first == 1) { + if ((mp_copy(fp_cache[idx2].LUT[zB]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx2].LUT[zB]->y, R->y) != CRYPT_OK) || + (mp_copy(fp_cache[idx2].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } + first = 0; + } + } + } + zeromem(kb, sizeof(kb)); + return ltc_ecc_map(R, modulus, mp); +} + +/** ECC Fixed Point mulmod global + Computes kA*A + kB*B = C using Shamir's Trick + @param A First point to multiply + @param kA What to multiple A by + @param B Second point to multiply + @param kB What to multiple B by + @param C [out] Destination point (can overlap with A or B) + @param modulus Modulus for curve + @return CRYPT_OK on success +*/ +int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, void *modulus) +{ + int idx1, idx2, err; + void *mp, *mu; + + mp = NULL; + mu = NULL; + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + /* find point */ + idx1 = find_base(A); + + /* no entry? */ + if (idx1 == -1) { + /* find hole and add it */ + if ((idx1 = find_hole()) >= 0) { + if ((err = add_entry(idx1, A)) != CRYPT_OK) { + goto LBL_ERR; + } + } + } + if (idx1 != -1) { + /* increment LRU */ + ++(fp_cache[idx1].lru_count); + } + + /* find point */ + idx2 = find_base(B); + + /* no entry? */ + if (idx2 == -1) { + /* find hole and add it */ + if ((idx2 = find_hole()) >= 0) { + if ((err = add_entry(idx2, B)) != CRYPT_OK) { + goto LBL_ERR; + } + } + } + if (idx2 != -1) { + /* increment LRU */ + ++(fp_cache[idx2].lru_count); + } + + /* if it's 2 build the LUT, if it's higher just use the LUT */ + if (idx1 >= 0 && fp_cache[idx1].lru_count == 2) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + + /* compute mu */ + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* build the LUT */ + if ((err = build_lut(idx1, modulus, mp, mu)) != CRYPT_OK) { + goto LBL_ERR;; + } + } + + /* if it's 2 build the LUT, if it's higher just use the LUT */ + if (idx2 >= 0 && fp_cache[idx2].lru_count == 2) { + if (mp == NULL) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + + /* compute mu */ + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* build the LUT */ + if ((err = build_lut(idx2, modulus, mp, mu)) != CRYPT_OK) { + goto LBL_ERR;; + } + } + + + if (idx1 >=0 && idx2 >= 0 && fp_cache[idx1].lru_count >= 2 && fp_cache[idx2].lru_count >= 2) { + if (mp == NULL) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + } + err = accel_fp_mul2add(idx1, idx2, kA, kB, C, modulus, mp); + } else { + err = ltc_ecc_mul2add(A, kA, B, kB, C, modulus); + } +LBL_ERR: + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + if (mp != NULL) { + mp_montgomery_free(mp); + } + if (mu != NULL) { + mp_clear(mu); + } + return err; +} +#endif + +/** ECC Fixed Point mulmod global + @param k The multiplicand + @param G Base point to multiply + @param R [out] Destination of product + @param modulus The modulus for the curve + @param map [boolean] If non-zero maps the point back to affine co-ordinates, otherwise it's left in jacobian-montgomery form + @return CRYPT_OK if successful +*/ +int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) +{ + int idx, err; + void *mp, *mu; + + mp = NULL; + mu = NULL; + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + /* find point */ + idx = find_base(G); + + /* no entry? */ + if (idx == -1) { + /* find hole and add it */ + idx = find_hole(); + + if (idx >= 0) { + if ((err = add_entry(idx, G)) != CRYPT_OK) { + goto LBL_ERR; + } + } + } + if (idx != -1) { + /* increment LRU */ + ++(fp_cache[idx].lru_count); + } + + + /* if it's 2 build the LUT, if it's higher just use the LUT */ + if (idx >= 0 && fp_cache[idx].lru_count == 2) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + + /* compute mu */ + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* build the LUT */ + if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { + goto LBL_ERR;; + } + } + + if (idx >= 0 && fp_cache[idx].lru_count >= 2) { + if (mp == NULL) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + } + err = accel_fp_mul(idx, k, R, modulus, mp, map); + } else { + err = ltc_ecc_mulmod(k, G, R, modulus, map); + } +LBL_ERR: + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + if (mp != NULL) { + mp_montgomery_free(mp); + } + if (mu != NULL) { + mp_clear(mu); + } + return err; +} + +/* helper function for freeing the cache ... must be called with the cache mutex locked */ +static void ltc_ecc_fp_free_cache(void) +{ + unsigned x, y; + for (x = 0; x < FP_ENTRIES; x++) { + if (fp_cache[x].g != NULL) { + for (y = 0; y < (1U<<FP_LUT); y++) { + ltc_ecc_del_point(fp_cache[x].LUT[y]); + fp_cache[x].LUT[y] = NULL; + } + ltc_ecc_del_point(fp_cache[x].g); + fp_cache[x].g = NULL; + if (fp_cache[x].mu != NULL) { + mp_clear(fp_cache[x].mu); + fp_cache[x].mu = NULL; + } + fp_cache[x].lru_count = 0; + fp_cache[x].lock = 0; + } + } +} + +/** Free the Fixed Point cache */ +void ltc_ecc_fp_free(void) +{ + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + ltc_ecc_fp_free_cache(); + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); +} + +/** Add a point to the cache and initialize the LUT + @param g The point to add + @param modulus Modulus for curve + @param lock Flag to indicate if this entry should be locked into the cache or not + @return CRYPT_OK on success +*/ +int +ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock) +{ + int idx; + int err; + void *mp = NULL; + void *mu = NULL; + + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + if ((idx = find_base(g)) >= 0) { + /* it is already in the cache ... just check that the LUT is initialized */ + if(fp_cache[idx].lru_count >= 2) { + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + return CRYPT_OK; + } + } + + if(idx == -1 && (idx = find_hole()) == -1) { + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + if ((err = add_entry(idx, g)) != CRYPT_OK) { + goto LBL_ERR; + } + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* compute mu */ + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* build the LUT */ + if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { + goto LBL_ERR; + } + fp_cache[idx].lru_count = 2; + fp_cache[idx].lock = lock; +LBL_ERR: + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + if (mp != NULL) { + mp_montgomery_free(mp); + } + if (mu != NULL) { + mp_clear(mu); + } + return err; +} + +/** Prevent/permit the FP cache from being updated + @param flag If flag is 0, remove cache lock (unlock), otherwise lock it +*/ +void ltc_ecc_fp_tablelock(int lock) +{ + int i; + + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + for (i = 0; i < FP_ENTRIES; i++) { + fp_cache[i].lock = lock; + } + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); +} + +/** Export the current cache as a binary packet + @param out [out] pointer to malloc'ed space containing the packet + @param outlen [out] size of exported packet + @return CRYPT_OK if successful +*/ +int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen) +{ + ltc_asn1_list *cache_entry; + unsigned int i, j, k; + unsigned long fp_entries, fp_lut, num_entries; + int err; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + fp_entries = FP_ENTRIES; + fp_lut = FP_LUT; + num_entries = 0; + + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + /* + * build the list; + Cache DEFINITIONS ::= + BEGIN + CacheDump ::= SEQUENCE { + numEntries SHORTINTEGER, + maxEntries SHORTINTEGER, + numLUT SHORTINTEGER, + cache SEQUENCE OF INTEGER + } + END + * + */ + /* + * The cache itself is a point (3 INTEGERS), + * the LUT as pairs of INTEGERS (2 * 1<<FP_LUT), + * and the mu INTEGER + */ + cache_entry = XCALLOC(FP_ENTRIES*(2*(1U<<FP_LUT)+4)+3, sizeof(ltc_asn1_list)); + if (cache_entry == NULL) + return CRYPT_MEM; + j = 1; /* handle the zero'th element later */ + + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_SHORT_INTEGER, &fp_entries, 1); + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_SHORT_INTEGER, &fp_lut, 1); + + for (i = 0; i < FP_ENTRIES; i++) { + /* + * do not save empty entries, or entries that have not yet had the lut built + */ + if (fp_cache[i].g == NULL || fp_cache[i].lru_count < 2) { + continue; + } + num_entries++; + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].g->x, 1); + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].g->y, 1); + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].g->z, 1); + for (k = 0; k < (1U<<FP_LUT); k++) { + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].LUT[k]->x, 1); + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].LUT[k]->y, 1); + } + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].mu, 1); + } + LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_EOL, 0, 0); + + LTC_SET_ASN1(cache_entry, 0, LTC_ASN1_SHORT_INTEGER, &num_entries, 1); + + if ((err = der_length_sequence(cache_entry, j, outlen)) != CRYPT_OK) { + goto save_err; + } + if ((*out = XMALLOC(*outlen)) == NULL) { + err = CRYPT_MEM; + goto save_err; + } + err = der_encode_sequence(cache_entry, j, *out, outlen); +save_err: + XFREE(cache_entry); + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + return err; +} + +/** Import a binary packet into the current cache + @param in [in] pointer to packet + @param inlen [in] size of packet (bytes) + @return CRYPT_OK if successful +*/ +int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen) +{ + int err; + ltc_asn1_list *asn1_list; + unsigned long num_entries, fp_entries, fp_lut; + unsigned long i, j; + unsigned int x; + + LTC_ARGCHK(in != NULL); + if (inlen == 0) { + return CRYPT_INVALID_ARG; + } + + /* zero indecies */ + i = 0; + j = 0; + asn1_list = NULL; + + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + /* + * start with an empty cache + */ + ltc_ecc_fp_free_cache(); + + /* + * decode the input packet: It consists of a sequence with a few + * integers (including the FP_ENTRIES and FP_LUT sizes), followed by a + * SEQUENCE which is the cache itself. + * + * use standard decoding for the first part, then flexible for the second + */ + if((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_SHORT_INTEGER, 1, &num_entries, + LTC_ASN1_SHORT_INTEGER, 1, &fp_entries, + LTC_ASN1_SHORT_INTEGER, 1, &fp_lut, + LTC_ASN1_EOL, 0, 0)) != CRYPT_OK) { + goto ERR_OUT; + } + if (fp_entries != FP_ENTRIES || fp_lut != FP_LUT || num_entries > fp_entries) { + err = CRYPT_INVALID_PACKET; + goto ERR_OUT; + } + if ((asn1_list = XCALLOC(3+num_entries*(4+2*(1<<FP_LUT))+1, sizeof(ltc_asn1_list))) == NULL) { + err = CRYPT_MEM; + goto ERR_OUT; + } + j = 0; + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_SHORT_INTEGER, &num_entries, 1); + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_SHORT_INTEGER, &fp_entries, 1); + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_SHORT_INTEGER, &fp_lut, 1); + for (i = 0; i < num_entries; i++) { + if((fp_cache[i].g = ltc_ecc_new_point()) == NULL) { + err = CRYPT_MEM; + goto ERR_OUT; + } + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->x, 1); + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->y, 1); + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->z, 1); + for (x = 0; x < (1U<<FP_LUT); x++) { + /* since we don't store z in the cache, don't use ltc_ecc_new_point() + * (which allocates space for z, only to have to free it later) */ + ecc_point *p = XCALLOC(1, sizeof(*p)); + + if (p == NULL) { + err = CRYPT_MEM; + goto ERR_OUT; + } + fp_cache[i].LUT[x] = p; + if ((err = mp_init_multi(&p->x, &p->y, NULL)) != CRYPT_OK) { + goto ERR_OUT; + } + p->z = NULL; + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, p->x, 1); + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, p->y, 1); + } + if((err = mp_init(&fp_cache[i].mu)) != CRYPT_OK) { + goto ERR_OUT; + } + LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].mu, 1); + fp_cache[i].lru_count = 3; + fp_cache[i].lock = 1; + } + + if ((err = der_decode_sequence(in, inlen, asn1_list, j)) != CRYPT_OK) { + goto ERR_OUT; + } + XFREE(asn1_list); + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + return CRYPT_OK; +ERR_OUT: + if(asn1_list) + XFREE(asn1_list); + ltc_ecc_fp_free_cache(); + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + return err; +} + +#endif + + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ + diff --git a/core/lib/libtomcrypt/src/math/fp/sub.mk b/core/lib/libtomcrypt/src/math/fp/sub.mk new file mode 100644 index 0000000..c3dacea --- /dev/null +++ b/core/lib/libtomcrypt/src/math/fp/sub.mk @@ -0,0 +1 @@ +srcs-$(CFG_CRYPTO_ECC) += ltc_ecc_fp_mulmod.c diff --git a/core/lib/libtomcrypt/src/math/multi.c b/core/lib/libtomcrypt/src/math/multi.c new file mode 100644 index 0000000..d2d8f96 --- /dev/null +++ b/core/lib/libtomcrypt/src/math/multi.c @@ -0,0 +1,116 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#ifdef LTC_MPI +#include <stdarg.h> + +int ltc_init_multi(void **a, ...) +{ + void **cur = a; + int np = 0; + va_list args; + + va_start(args, a); + while (cur != NULL) { + if (mp_init(cur) != CRYPT_OK) { + /* failed */ + va_list clean_list; + + va_start(clean_list, a); + cur = a; + while (np--) { + mp_clear(*cur); + cur = va_arg(clean_list, void**); + } + va_end(clean_list); + return CRYPT_MEM; + } + ++np; + cur = va_arg(args, void**); + } + va_end(args); + return CRYPT_OK; +} + +int ltc_init_multi_size(int size_bits, void **a, ...) +{ + void **cur = a; + int np = 0; + va_list args; + + va_start(args, a); + while (cur != NULL) { + if (mp_init_size(size_bits, cur) != CRYPT_OK) { + /* failed */ + va_list clean_list; + + va_start(clean_list, a); + cur = a; + while (np--) { + mp_clear(*cur); + cur = va_arg(clean_list, void**); + } + va_end(clean_list); + return CRYPT_MEM; + } + ++np; + cur = va_arg(args, void**); + } + va_end(args); + return CRYPT_OK; +} + +void ltc_deinit_multi(void *a, ...) +{ + void *cur = a; + va_list args; + + va_start(args, a); + while (cur != NULL) { + mp_clear(cur); + cur = va_arg(args, void *); + } + va_end(args); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/math/multi.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/math/rand_bn.c b/core/lib/libtomcrypt/src/math/rand_bn.c new file mode 100755 index 0000000..bd328e0 --- /dev/null +++ b/core/lib/libtomcrypt/src/math/rand_bn.c @@ -0,0 +1,71 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + */ +#include "tomcrypt.h" + +#ifdef LTC_MDSA +/** + Generate a random number N with given bitlength (note: MSB can be 0) +*/ + +int rand_bn_bits(void *N, int bits, prng_state *prng, int wprng) +{ + int res, bytes; + unsigned char *buf, mask; + + LTC_ARGCHK(N != NULL); + LTC_ARGCHK(bits > 1); + + /* check PRNG */ + if ((res = prng_is_valid(wprng)) != CRYPT_OK) return res; + + bytes = (bits+7) >> 3; + mask = 0xff << (8 - bits % 8); + + /* allocate buffer */ + if ((buf = XCALLOC(1, bytes)) == NULL) return CRYPT_MEM; + + /* generate random bytes */ + if (prng_descriptor[wprng]->read(buf, bytes, prng) != (unsigned long)bytes) { + res = CRYPT_ERROR_READPRNG; + goto cleanup; + } + /* mask bits */ + buf[0] &= ~mask; + /* load value */ + if ((res = mp_read_unsigned_bin(N, buf, bytes)) != CRYPT_OK) goto cleanup; + + res = CRYPT_OK; + +cleanup: +#ifdef LTC_CLEAN_STACK + zeromem(buf, bytes); +#endif + XFREE(buf); + return res; +} + +/** + Generate a random number N in a range: 0 <= N < limit +*/ +int rand_bn_range(void *N, void *limit, prng_state *prng, int wprng) +{ + int res; + + LTC_ARGCHK(N != NULL); + LTC_ARGCHK(limit != NULL); + + do { + res = rand_bn_bits(N, mp_count_bits(limit), prng, wprng); + if (res != CRYPT_OK) return res; + } while (mp_cmp(N, limit) != LTC_MP_LT); + + return CRYPT_OK; +} +#endif diff --git a/core/lib/libtomcrypt/src/math/rand_prime.c b/core/lib/libtomcrypt/src/math/rand_prime.c new file mode 100644 index 0000000..4b73142 --- /dev/null +++ b/core/lib/libtomcrypt/src/math/rand_prime.c @@ -0,0 +1,117 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +#if !defined LTC_NO_MATH && !defined LTC_NO_PRNGS + +/** + @file rand_prime.c + Generate a random prime, Tom St Denis +*/ + +#define USE_BBS 1 + +int rand_prime(void *N, long len, prng_state *prng, int wprng) +{ + int err, res, type; + unsigned char *buf; + + LTC_ARGCHK(N != NULL); + + /* get type */ + if (len < 0) { + type = USE_BBS; + len = -len; + } else { + type = 0; + } + + /* allow sizes between 2 and 512 bytes for a prime size */ + if (len < 2 || len > 512) { + return CRYPT_INVALID_PRIME_SIZE; + } + + /* valid PRNG? Better be! */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + /* allocate buffer to work with */ + buf = XCALLOC(1, len); + if (buf == NULL) { + return CRYPT_MEM; + } + + do { + /* generate value */ + if (prng_descriptor[wprng]->read(buf, len, prng) != (unsigned long)len) { + XFREE(buf); + return CRYPT_ERROR_READPRNG; + } + + /* munge bits */ + buf[0] |= 0x80 | 0x40; + buf[len-1] |= 0x01 | ((type & USE_BBS) ? 0x02 : 0x00); + + /* load value */ + if ((err = mp_read_unsigned_bin(N, buf, len)) != CRYPT_OK) { + XFREE(buf); + return err; + } + + /* test */ + if ((err = mp_prime_is_prime(N, 8, &res)) != CRYPT_OK) { + XFREE(buf); + return err; + } + } while (res == LTC_MP_NO); + +#ifdef LTC_CLEAN_STACK + zeromem(buf, len); +#endif + + XFREE(buf); + return CRYPT_OK; +} + +#endif /* LTC_NO_MATH */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/math/rand_prime.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:23 $ */ diff --git a/core/lib/libtomcrypt/src/math/sub.mk b/core/lib/libtomcrypt/src/math/sub.mk new file mode 100644 index 0000000..4a38a32 --- /dev/null +++ b/core/lib/libtomcrypt/src/math/sub.mk @@ -0,0 +1,4 @@ +subdirs-y += fp +srcs-y += multi.c +srcs-y += rand_prime.c +srcs-y += rand_bn.c diff --git a/core/lib/libtomcrypt/src/misc/base64/base64_decode.c b/core/lib/libtomcrypt/src/misc/base64/base64_decode.c new file mode 100644 index 0000000..6ed8530 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/base64/base64_decode.c @@ -0,0 +1,185 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file base64_decode.c + Compliant base64 code donated by Wayne Scott (wscott@bitmover.com) + base64 URL Safe variant (RFC 4648 section 5) by Karel Miko +*/ + + +#if defined(LTC_BASE64) || defined (LTC_BASE64_URL) + +#if defined(LTC_BASE64) +static const unsigned char map_base64[256] = { +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 62, 255, 255, 255, 63, + 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 255, 255, +255, 254, 255, 255, 255, 0, 1, 2, 3, 4, 5, 6, + 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, + 19, 20, 21, 22, 23, 24, 25, 255, 255, 255, 255, 255, +255, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, + 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, + 49, 50, 51, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255 }; +#endif /* LTC_BASE64 */ + +#if defined(LTC_BASE64_URL) +static const unsigned char map_base64url[256] = { +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 62, 255, 255, + 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 255, 255, +255, 254, 255, 255, 255, 0, 1, 2, 3, 4, 5, 6, + 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, + 19, 20, 21, 22, 23, 24, 25, 255, 255, 255, 255, 63, +255, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, + 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, + 49, 50, 51, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255 }; +#endif /* LTC_BASE64_URL */ + +static int _base64_decode_internal(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *map) +{ + unsigned long t, x, y, z; + unsigned char c; + int g; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + g = 3; + for (x = y = z = t = 0; x < inlen; x++) { + c = map[in[x]&0xFF]; + if (c == 255) continue; + /* the final = symbols are read and used to trim the remaining bytes */ + if (c == 254) { + c = 0; + /* prevent g < 0 which would potentially allow an overflow later */ + if (--g < 0) { + return CRYPT_INVALID_PACKET; + } + } else if (g != 3) { + /* we only allow = to be at the end */ + return CRYPT_INVALID_PACKET; + } + + t = (t<<6)|c; + + if (++y == 4) { + if (z + g > *outlen) { + return CRYPT_BUFFER_OVERFLOW; + } + out[z++] = (unsigned char)((t>>16)&255); + if (g > 1) out[z++] = (unsigned char)((t>>8)&255); + if (g > 2) out[z++] = (unsigned char)(t&255); + y = t = 0; + } + } + if (y != 0) { + return CRYPT_INVALID_PACKET; + } + *outlen = z; + return CRYPT_OK; +} + +#if defined(LTC_BASE64) +/** + base64 decode a block of memory + @param in The base64 data to decode + @param inlen The length of the base64 data + @param out [out] The destination of the binary decoded data + @param outlen [in/out] The max size and resulting size of the decoded data + @return CRYPT_OK if successful +*/ +int base64_decode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_decode_internal(in, inlen, out, outlen, map_base64); +} +#endif /* LTC_BASE64 */ + +#if defined(LTC_BASE64_URL) +/** + base64 (URL Safe, RFC 4648 section 5) decode a block of memory + @param in The base64 data to decode + @param inlen The length of the base64 data + @param out [out] The destination of the binary decoded data + @param outlen [in/out] The max size and resulting size of the decoded data + @return CRYPT_OK if successful +*/ +int base64url_decode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_decode_internal(in, inlen, out, outlen, map_base64url); +} +#endif /* LTC_BASE64_URL */ + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/base64/base64_decode.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/misc/base64/base64_encode.c b/core/lib/libtomcrypt/src/misc/base64/base64_encode.c new file mode 100644 index 0000000..822c174 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/base64/base64_encode.c @@ -0,0 +1,147 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file base64_encode.c + Compliant base64 encoder donated by Wayne Scott (wscott@bitmover.com) + base64 URL Safe variant (RFC 4648 section 5) by Karel Miko +*/ + + +#if defined(LTC_BASE64) || defined (LTC_BASE64_URL) + +#if defined(LTC_BASE64) +static const char *codes_base64 = +"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; +#endif /* LTC_BASE64 */ + +#if defined(LTC_BASE64_URL) +static const char *codes_base64url = +"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_"; +#endif /* LTC_BASE64_URL */ + +static int _base64_encode_internal(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const char *codes, int pad) +{ + unsigned long i, len2, leven; + unsigned char *p; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* valid output size ? */ + len2 = 4 * ((inlen + 2) / 3); + if (*outlen < len2 + 1) { + *outlen = len2 + 1; + return CRYPT_BUFFER_OVERFLOW; + } + p = out; + leven = 3*(inlen / 3); + for (i = 0; i < leven; i += 3) { + *p++ = codes[(in[0] >> 2) & 0x3F]; + *p++ = codes[(((in[0] & 3) << 4) + (in[1] >> 4)) & 0x3F]; + *p++ = codes[(((in[1] & 0xf) << 2) + (in[2] >> 6)) & 0x3F]; + *p++ = codes[in[2] & 0x3F]; + in += 3; + } + /* Pad it if necessary... */ + if (i < inlen) { + unsigned a = in[0]; + unsigned b = (i+1 < inlen) ? in[1] : 0; + + *p++ = codes[(a >> 2) & 0x3F]; + *p++ = codes[(((a & 3) << 4) + (b >> 4)) & 0x3F]; + if (pad) { + *p++ = (i+1 < inlen) ? codes[(((b & 0xf) << 2)) & 0x3F] : '='; + *p++ = '='; + } + else { + if (i+1 < inlen) *p++ = codes[(((b & 0xf) << 2)) & 0x3F]; + } + } + + /* append a NULL byte */ + *p = '\0'; + + /* return ok */ + *outlen = p - out; + return CRYPT_OK; +} + +#if defined(LTC_BASE64) +/** + base64 Encode a buffer (NUL terminated) + @param in The input buffer to encode + @param inlen The length of the input buffer + @param out [out] The destination of the base64 encoded data + @param outlen [in/out] The max size and resulting size + @return CRYPT_OK if successful +*/ +int base64_encode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_encode_internal(in, inlen, out, outlen, codes_base64, 1); +} +#endif /* LTC_BASE64 */ + + +#if defined(LTC_BASE64_URL) +/** + base64 (URL Safe, RFC 4648 section 5) Encode a buffer (NUL terminated) + @param in The input buffer to encode + @param inlen The length of the input buffer + @param out [out] The destination of the base64 encoded data + @param outlen [in/out] The max size and resulting size + @return CRYPT_OK if successful +*/ +int base64url_encode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_encode_internal(in, inlen, out, outlen, codes_base64url, 0); +} +#endif /* LTC_BASE64_URL */ + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/base64/base64_encode.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/misc/base64/sub.mk b/core/lib/libtomcrypt/src/misc/base64/sub.mk new file mode 100644 index 0000000..9191690 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/base64/sub.mk @@ -0,0 +1,2 @@ +srcs-y += base64_decode.c +srcs-y += base64_encode.c diff --git a/core/lib/libtomcrypt/src/misc/burn_stack.c b/core/lib/libtomcrypt/src/misc/burn_stack.c new file mode 100644 index 0000000..8b903d4 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/burn_stack.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file burn_stack.c + Burn stack, Tom St Denis +*/ + +/** + Burn some stack memory + @param len amount of stack to burn in bytes +*/ +void burn_stack(unsigned long len) +{ + unsigned char buf[32]; + zeromem(buf, sizeof(buf)); + if (len > (unsigned long)sizeof(buf)) + burn_stack(len - sizeof(buf)); +} + + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/burn_stack.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt.c b/core/lib/libtomcrypt/src/misc/crypt/crypt.c new file mode 100644 index 0000000..369c5ac --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt.c @@ -0,0 +1,472 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt.c + Build strings, Tom St Denis +*/ +#define NAME_VALUE(s) #s"="NAME(s) +#define NAME(s) #s + +const char *crypt_build_settings = + "LibTomCrypt " SCRYPT " (Tom St Denis, tomstdenis@gmail.com)\n" + "LibTomCrypt is public domain software.\n" +#if defined(INCLUDE_BUILD_DATE) + "Built on " __DATE__ " at " __TIME__ "\n" +#endif + "\n\nEndianness: " +#if defined(ENDIAN_NEUTRAL) + "neutral\n" +#else +#if defined(ENDIAN_LITTLE) + "little" +#elif defined(ENDIAN_BIG) + "big" +#endif + #if defined(ENDIAN_32BITWORD) + " (32-bit words)\n" + #else + " (64-bit words)\n" + #endif +#endif + "Clean stack: " +#if defined(LTC_CLEAN_STACK) + "enabled\n" +#else + "disabled\n" +#endif + "Ciphers built-in:\n" +#if defined(LTC_BLOWFISH) + " Blowfish\n" +#endif +#if defined(LTC_RC2) + " RC2\n" +#endif +#if defined(LTC_RC5) + " RC5\n" +#endif +#if defined(LTC_RC6) + " RC6\n" +#endif +#if defined(LTC_SAFERP) + " Safer+\n" +#endif +#if defined(LTC_SAFER) + " Safer\n" +#endif +#if defined(LTC_RIJNDAEL) + " Rijndael\n" +#endif +#if defined(LTC_XTEA) + " XTEA\n" +#endif +#if defined(LTC_TWOFISH) + " Twofish " + #if defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_TABLES) && defined(LTC_TWOFISH_ALL_TABLES) + "(small, tables, all_tables)\n" + #elif defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_TABLES) + "(small, tables)\n" + #elif defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_ALL_TABLES) + "(small, all_tables)\n" + #elif defined(LTC_TWOFISH_TABLES) && defined(LTC_TWOFISH_ALL_TABLES) + "(tables, all_tables)\n" + #elif defined(LTC_TWOFISH_SMALL) + "(small)\n" + #elif defined(LTC_TWOFISH_TABLES) + "(tables)\n" + #elif defined(LTC_TWOFISH_ALL_TABLES) + "(all_tables)\n" + #else + "\n" + #endif +#endif +#if defined(LTC_DES) + " DES\n" +#endif +#if defined(LTC_CAST5) + " CAST5\n" +#endif +#if defined(LTC_NOEKEON) + " Noekeon\n" +#endif +#if defined(LTC_SKIPJACK) + " Skipjack\n" +#endif +#if defined(LTC_KHAZAD) + " Khazad\n" +#endif +#if defined(LTC_ANUBIS) + " Anubis " +#endif +#if defined(LTC_ANUBIS_TWEAK) + " (tweaked)" +#endif + "\n" +#if defined(LTC_KSEED) + " KSEED\n" +#endif +#if defined(LTC_KASUMI) + " KASUMI\n" +#endif +#if defined(LTC_MULTI2) + " MULTI2\n" +#endif +#if defined(LTC_CAMELLIA) + " Camellia\n" +#endif + + "\nHashes built-in:\n" +#if defined(LTC_SHA512) + " SHA-512\n" +#endif +#if defined(LTC_SHA384) + " SHA-384\n" +#endif +#if defined(LTC_SHA512_256) + " SHA-512/256\n" +#endif +#if defined(LTC_SHA256) + " SHA-256\n" +#endif +#if defined(LTC_SHA512_224) + " SHA-512/224\n" +#endif +#if defined(LTC_SHA224) + " SHA-224\n" +#endif +#if defined(LTC_TIGER) + " TIGER\n" +#endif +#if defined(LTC_SHA1) + " SHA1\n" +#endif +#if defined(LTC_MD5) + " MD5\n" +#endif +#if defined(LTC_MD4) + " MD4\n" +#endif +#if defined(LTC_MD2) + " MD2\n" +#endif +#if defined(LTC_RIPEMD128) + " RIPEMD128\n" +#endif +#if defined(LTC_RIPEMD160) + " RIPEMD160\n" +#endif +#if defined(LTC_RIPEMD256) + " RIPEMD256\n" +#endif +#if defined(LTC_RIPEMD320) + " RIPEMD320\n" +#endif +#if defined(LTC_WHIRLPOOL) + " WHIRLPOOL\n" +#endif +#if defined(LTC_CHC_HASH) + " CHC_HASH\n" +#endif + + "\nBlock Chaining Modes:\n" +#if defined(LTC_CFB_MODE) + " CFB\n" +#endif +#if defined(LTC_OFB_MODE) + " OFB\n" +#endif +#if defined(LTC_ECB_MODE) + " ECB\n" +#endif +#if defined(LTC_CBC_MODE) + " CBC\n" +#endif +#if defined(LTC_CTR_MODE) + " CTR\n" +#endif +#if defined(LTC_LRW_MODE) + " LRW" +#if defined(LTC_LRW_TABLES) + " (tables) " +#endif + "\n" +#endif +#if defined(LTC_F8_MODE) + " F8\n" +#endif +#if defined(LTC_XTS_MODE) + " XTS\n" +#endif + + "\nMACs:\n" +#if defined(LTC_HMAC) + " HMAC\n" +#endif +#if defined(LTC_OMAC) + " OMAC\n" +#endif +#if defined(LTC_PMAC) + " PMAC\n" +#endif +#if defined(LTC_PELICAN) + " PELICAN\n" +#endif +#if defined(LTC_XCBC) + " XCBC\n" +#endif +#if defined(LTC_F9_MODE) + " F9\n" +#endif + + "\nENC + AUTH modes:\n" +#if defined(LTC_EAX_MODE) + " EAX\n" +#endif +#if defined(LTC_OCB_MODE) + " OCB\n" +#endif +#if defined(LTC_OCB3_MODE) + " OCB3\n" +#endif +#if defined(LTC_CCM_MODE) + " CCM\n" +#endif +#if defined(LTC_GCM_MODE) + " GCM" +#if defined(LTC_GCM_TABLES) + " (tables) " +#endif +#if defined(LTC_GCM_TABLES_SSE2) + " (SSE2) " +#endif + "\n" +#endif + + "\nPRNG:\n" +#if defined(LTC_YARROW) + " Yarrow ("NAME_VALUE(LTC_YARROW_AES)")\n" +#endif +#if defined(LTC_SPRNG) + " SPRNG\n" +#endif +#if defined(LTC_RC4) + " RC4\n" +#endif +#if defined(LTC_FORTUNA) + " Fortuna (" NAME_VALUE(LTC_FORTUNA_POOLS) ", " NAME_VALUE(LTC_FORTUNA_WD) ")\n" +#endif +#if defined(LTC_SOBER128) + " SOBER128\n" +#endif + + "\nPK Algs:\n" +#if defined(LTC_MRSA) + " RSA" +#if defined(LTC_RSA_BLINDING) && defined(LTC_RSA_CRT_HARDENING) + " (with blinding and CRT hardening)" +#elif defined(LTC_RSA_BLINDING) + " (with blinding)" +#elif defined(LTC_RSA_CRT_HARDENING) + " (with CRT hardening)" +#endif + "\n" +#endif +#if defined(LTC_MDH) + " DH\n" +#endif +#if defined(LTC_MECC) + " ECC" +#if defined(LTC_ECC_TIMING_RESISTANT) + " (with blinding)" +#endif + "\n" +#endif +#if defined(LTC_MDSA) + " DSA\n" +#endif +#if defined(LTC_MKAT) + " Katja\n" +#endif + + "\nCompiler:\n" +#if defined(_WIN64) + " WIN64 platform detected.\n" +#elif defined(_WIN32) + " WIN32 platform detected.\n" +#endif +#if defined(__CYGWIN__) + " CYGWIN Detected.\n" +#endif +#if defined(__DJGPP__) + " DJGPP Detected.\n" +#endif +#if defined(_MSC_VER) + " MSVC compiler detected.\n" +#endif +#if defined(__clang_version__) + " Clang compiler " __clang_version__ ".\n" +#elif defined(INTEL_CC) + " Intel C Compiler " __VERSION__ ".\n" +#elif defined(__GNUC__) /* clang and icc also define __GNUC__ */ + " GCC compiler " __VERSION__ ".\n" +#endif + +#if defined(__x86_64__) + " x86-64 detected.\n" +#endif +#if defined(LTC_PPC32) + " PPC32 detected.\n" +#endif + + "\nVarious others: " +#if defined(LTC_ADLER32) + " ADLER32 " +#endif +#if defined(LTC_BASE64) + " BASE64 " +#endif +#if defined(LTC_BASE64_URL) + " BASE64-URL-SAFE " +#endif +#if defined(LTC_CRC32) + " CRC32 " +#endif +#if defined(LTC_DER) + " DER " +#endif +#if defined(LTC_DER_MAX_PUBKEY_SIZE) + " " NAME_VALUE(LTC_DER_MAX_PUBKEY_SIZE) " " +#endif +#if defined(LTC_PKCS_1) + " PKCS#1 " +#endif +#if defined(LTC_PKCS_5) + " PKCS#5 " +#endif +#if defined(LTC_HKDF) + " HKDF " +#endif +#if defined(LTC_MPI) + " MPI " +#endif +#if defined(LTC_DEVRANDOM) + " LTC_DEVRANDOM " +#endif +#if defined(LTC_TRY_URANDOM_FIRST) + " LTC_TRY_URANDOM_FIRST " +#endif +#if defined(LTC_RNG_GET_BYTES) + " LTC_RNG_GET_BYTES " +#endif +#if defined(LTC_RNG_MAKE_PRNG) + " LTC_RNG_MAKE_PRNG " +#endif +#if defined(LTC_HASH_HELPERS) + " LTC_HASH_HELPERS " +#endif +#if defined(LTC_VALGRIND) + " LTC_VALGRIND " +#endif +#if defined(LTC_TEST) + " LTC_TEST " +#endif +#if defined(LTC_TEST_EXT) + " LTC_TEST_EXT " +#endif +#if defined(LTC_SMALL_CODE) + " LTC_SMALL_CODE " +#endif +#if defined(LTC_NO_FILE) + " LTC_NO_FILE " +#endif +#if defined(LTC_FAST) + " LTC_FAST " +#endif +#if defined(LTC_NO_FAST) + " LTC_NO_FAST " +#endif +#if defined(LTC_NO_BSWAP) + " LTC_NO_BSWAP " +#endif +#if defined(LTC_NO_ASM) + " LTC_NO_ASM " +#endif +#if defined(LTC_ROx_ASM) + " LTC_ROx_ASM " +#if defined(LTC_NO_ROLC) + " LTC_NO_ROLC " +#endif +#endif +#if defined(LTC_NO_TEST) + " LTC_NO_TEST " +#endif +#if defined(LTC_NO_TABLES) + " LTC_NO_TABLES " +#endif +#if defined(LTC_PTHREAD) + " LTC_PTHREAD " +#endif +#if defined(LTM_DESC) + " LTM_DESC " +#endif +#if defined(TFM_DESC) + " TFM_DESC " +#endif +#if defined(GMP_DESC) + " GMP_DESC " +#endif +#if defined(LTC_EASY) + " LTC_EASY " +#endif +#if defined(LTC_MECC_ACCEL) + " LTC_MECC_ACCEL " +#endif +#if defined(LTC_MECC_FP) + " LTC_MECC_FP " +#endif +#if defined(LTC_ECC_SHAMIR) + " LTC_ECC_SHAMIR " +#endif + "\n" + ; + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt.c,v $ */ +/* $Revision: 1.36 $ */ +/* $Date: 2007/05/12 14:46:12 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_argchk.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_argchk.c new file mode 100644 index 0000000..10591df --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_argchk.c @@ -0,0 +1,56 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_argchk.c + Perform argument checking, Tom St Denis +*/ + +#if (ARGTYPE == 0) +void crypt_argchk(char *v, char *s, int d) +{ + fprintf(stderr, "LTC_ARGCHK '%s' failure on line %d of file %s\n", + v, d, s); + abort(); +} +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_argchk.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c new file mode 100644 index 0000000..2a10863 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c @@ -0,0 +1,52 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_cipher_descriptor.c + Stores the cipher descriptor table, Tom St Denis +*/ + +const struct ltc_cipher_descriptor *cipher_descriptor[TAB_SIZE]; + +LTC_MUTEX_GLOBAL(ltc_cipher_mutex) + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c new file mode 100644 index 0000000..1e0ed18 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_cipher_is_valid.c + Determine if cipher is valid, Tom St Denis +*/ + +/* + Test if a cipher index is valid + @param idx The index of the cipher to search for + @return CRYPT_OK if valid +*/ +int cipher_is_valid(int idx) +{ + LTC_MUTEX_LOCK(<c_cipher_mutex); + if (idx < 0 || idx >= TAB_SIZE || cipher_descriptor[idx] == NULL) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return CRYPT_INVALID_CIPHER; + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return CRYPT_OK; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher.c new file mode 100644 index 0000000..ddafca8 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher.c @@ -0,0 +1,68 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_find_cipher.c + Find a cipher in the descriptor tables, Tom St Denis +*/ + +/** + Find a registered cipher by name + @param name The name of the cipher to look for + @return >= 0 if found, -1 if not present +*/ +int find_cipher(const char *name) +{ + int x; + LTC_ARGCHK(name != NULL); + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x] != NULL && !XSTRCMP(cipher_descriptor[x]->name, name)) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return -1; +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c new file mode 100644 index 0000000..ccc2f9f --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c @@ -0,0 +1,77 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_find_cipher_any.c + Find a cipher in the descriptor tables, Tom St Denis +*/ + +/** + Find a cipher flexibly. First by name then if not present by block and key size + @param name The name of the cipher desired + @param blocklen The minimum length of the block cipher desired (octets) + @param keylen The minimum length of the key size desired (octets) + @return >= 0 if found, -1 if not present +*/ +int find_cipher_any(const char *name, int blocklen, int keylen) +{ + int x; + + LTC_ARGCHK(name != NULL); + + x = find_cipher(name); + if (x != -1) return x; + + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x] == NULL) { + continue; + } + if (blocklen <= (int)cipher_descriptor[x]->block_length && keylen <= (int)cipher_descriptor[x]->max_key_length) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c new file mode 100644 index 0000000..f4a8cc5 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c @@ -0,0 +1,66 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_find_cipher_id.c + Find cipher by ID, Tom St Denis +*/ + +/** + Find a cipher by ID number + @param ID The ID (not same as index) of the cipher to find + @return >= 0 if found, -1 if not present +*/ +int find_cipher_id(unsigned char ID) +{ + int x; + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE && cipher_descriptor[x] != NULL; x++) { + if (cipher_descriptor[x]->ID == ID) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash.c new file mode 100644 index 0000000..cd51135 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash.c @@ -0,0 +1,67 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_find_hash.c + Find a hash, Tom St Denis +*/ + +/** + Find a registered hash by name + @param name The name of the hash to look for + @return >= 0 if found, -1 if not present +*/ +int find_hash(const char *name) +{ + int x; + LTC_ARGCHK(name != NULL); + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x] != NULL && XSTRCMP(hash_descriptor[x]->name, name) == 0) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c new file mode 100644 index 0000000..e6ac21e --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c @@ -0,0 +1,76 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_find_hash_any.c + Find a hash, Tom St Denis +*/ + +/** + Find a hash flexibly. First by name then if not present by digest size + @param name The name of the hash desired + @param digestlen The minimum length of the digest size (octets) + @return >= 0 if found, -1 if not present +*/int find_hash_any(const char *name, int digestlen) +{ + int x, y, z; + LTC_ARGCHK(name != NULL); + + x = find_hash(name); + if (x != -1) return x; + + LTC_MUTEX_LOCK(<c_hash_mutex); + y = MAXBLOCKSIZE+1; + z = -1; + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x] == NULL) { + continue; + } + if ((int)hash_descriptor[x]->hashsize >= digestlen && (int)hash_descriptor[x]->hashsize < y) { + z = x; + y = hash_descriptor[x]->hashsize; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return z; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c new file mode 100644 index 0000000..07c81fc --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c @@ -0,0 +1,66 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_find_hash_id.c + Find hash by ID, Tom St Denis +*/ + +/** + Find a hash by ID number + @param ID The ID (not same as index) of the hash to find + @return >= 0 if found, -1 if not present +*/ +int find_hash_id(unsigned char ID) +{ + int x; + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x] && hash_descriptor[x]->ID == ID) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c new file mode 100644 index 0000000..5a0fb64 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c @@ -0,0 +1,62 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_find_hash_oid.c + Find a hash, Tom St Denis +*/ + +int find_hash_oid(const unsigned long *ID, unsigned long IDlen) +{ + int x; + LTC_ARGCHK(ID != NULL); + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x] != NULL && hash_descriptor[x]->OIDlen == IDlen && !XMEMCMP(hash_descriptor[x]->OID, ID, sizeof(unsigned long) * IDlen)) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_find_prng.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_prng.c new file mode 100644 index 0000000..c4bd507 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_find_prng.c @@ -0,0 +1,68 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_find_prng.c + Find a PRNG, Tom St Denis +*/ + +/** + Find a registered PRNG by name + @param name The name of the PRNG to look for + @return >= 0 if found, -1 if not present +*/ +int find_prng(const char *name) +{ + int x; + LTC_ARGCHK(name != NULL); + LTC_MUTEX_LOCK(<c_prng_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if ((prng_descriptor[x] != NULL) && XSTRCMP(prng_descriptor[x]->name, name) == 0) { + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return -1; +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_prng.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_fsa.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_fsa.c new file mode 100644 index 0000000..d912fd0 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_fsa.c @@ -0,0 +1,85 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file crypt_fsa.c + LibTomCrypt FULL SPEED AHEAD!, Tom St Denis +*/ + +/* format is ltc_mp, cipher_desc, [cipher_desc], NULL, hash_desc, [hash_desc], NULL, prng_desc, [prng_desc], NULL */ +int crypt_fsa(void *mp, ...) +{ + va_list args; + void *p; + + va_start(args, mp); + if (mp != NULL) { + XMEMCPY(<c_mp, mp, sizeof(ltc_mp)); + } + + while ((p = va_arg(args, void*)) != NULL) { + if (register_cipher(p) == -1) { + va_end(args); + return CRYPT_INVALID_CIPHER; + } + } + + while ((p = va_arg(args, void*)) != NULL) { + if (register_hash(p) == -1) { + va_end(args); + return CRYPT_INVALID_HASH; + } + } + + while ((p = va_arg(args, void*)) != NULL) { + if (register_prng(p) == -1) { + va_end(args); + return CRYPT_INVALID_PRNG; + } + } + + va_end(args); + return CRYPT_OK; +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_fsa.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c new file mode 100644 index 0000000..875919e --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c @@ -0,0 +1,52 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_hash_descriptor.c + Stores the hash descriptor table, Tom St Denis +*/ + +const struct ltc_hash_descriptor *hash_descriptor[TAB_SIZE]; + +LTC_MUTEX_GLOBAL(ltc_hash_mutex) + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c new file mode 100644 index 0000000..ca654d6 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_hash_is_valid.c + Determine if hash is valid, Tom St Denis +*/ + +/* + Test if a hash index is valid + @param idx The index of the hash to search for + @return CRYPT_OK if valid +*/ +int hash_is_valid(int idx) +{ + LTC_MUTEX_LOCK(<c_hash_mutex); + if (idx < 0 || idx >= TAB_SIZE || hash_descriptor[idx] == NULL) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return CRYPT_INVALID_HASH; + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return CRYPT_OK; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c new file mode 100644 index 0000000..17eb1bc --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c @@ -0,0 +1,51 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_prng_descriptor.c + Stores the PRNG descriptors, Tom St Denis +*/ +const struct ltc_prng_descriptor *prng_descriptor[TAB_SIZE]; + +LTC_MUTEX_GLOBAL(ltc_prng_mutex) + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c new file mode 100644 index 0000000..65d1550 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_prng_is_valid.c + Determine if PRNG is valid, Tom St Denis +*/ + +/* + Test if a PRNG index is valid + @param idx The index of the PRNG to search for + @return CRYPT_OK if valid +*/ +int prng_is_valid(int idx) +{ + LTC_MUTEX_LOCK(<c_prng_mutex); + if (idx < 0 || idx >= TAB_SIZE || prng_descriptor[idx] == NULL) { + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return CRYPT_INVALID_PRNG; + } + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return CRYPT_OK; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_register_cipher.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_register_cipher.c new file mode 100644 index 0000000..27fcde1 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_register_cipher.c @@ -0,0 +1,81 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_register_cipher.c + Register a cipher, Tom St Denis +*/ + +/** + Register a cipher with the descriptor table + @param cipher The cipher you wish to register + @return value >= 0 if successfully added (or already present), -1 if unsuccessful +*/ +int register_cipher(const struct ltc_cipher_descriptor *cipher) +{ + int x; + + LTC_ARGCHK(cipher != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x] != NULL && cipher_descriptor[x]->ID == cipher->ID) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + + /* find a blank spot */ + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x] == NULL) { + cipher_descriptor[x] = cipher; + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + + /* no spot */ + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_cipher.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_register_hash.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_register_hash.c new file mode 100644 index 0000000..ad4bc64 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_register_hash.c @@ -0,0 +1,81 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_register_hash.c + Register a HASH, Tom St Denis +*/ + +/** + Register a hash with the descriptor table + @param hash The hash you wish to register + @return value >= 0 if successfully added (or already present), -1 if unsuccessful +*/ +int register_hash(const struct ltc_hash_descriptor *hash) +{ + int x; + + LTC_ARGCHK(hash != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x] == hash) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + + /* find a blank spot */ + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x] == NULL) { + hash_descriptor[x] = hash; + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + + /* no spot */ + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_hash.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_register_prng.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_register_prng.c new file mode 100644 index 0000000..16297ce --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_register_prng.c @@ -0,0 +1,81 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_register_prng.c + Register a PRNG, Tom St Denis +*/ + +/** + Register a PRNG with the descriptor table + @param prng The PRNG you wish to register + @return value >= 0 if successfully added (or already present), -1 if unsuccessful +*/ +int register_prng(const struct ltc_prng_descriptor *prng) +{ + int x; + + LTC_ARGCHK(prng != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_prng_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (prng_descriptor[x] == prng) { + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return x; + } + } + + /* find a blank spot */ + for (x = 0; x < TAB_SIZE; x++) { + if (prng_descriptor[x] == NULL) { + prng_descriptor[x] = prng; + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return x; + } + } + + /* no spot */ + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_prng.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c new file mode 100644 index 0000000..111aceb --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c @@ -0,0 +1,71 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_unregister_cipher.c + Unregister a cipher, Tom St Denis +*/ + +/** + Unregister a cipher from the descriptor table + @param cipher The cipher descriptor to remove + @return CRYPT_OK on success +*/ +int unregister_cipher(const struct ltc_cipher_descriptor *cipher) +{ + int x; + + LTC_ARGCHK(cipher != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x] == cipher) { + cipher_descriptor[x] = NULL; + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return CRYPT_OK; + } + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return CRYPT_ERROR; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c new file mode 100644 index 0000000..77741b1 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c @@ -0,0 +1,71 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_unregister_hash.c + Unregister a hash, Tom St Denis +*/ + +/** + Unregister a hash from the descriptor table + @param hash The hash descriptor to remove + @return CRYPT_OK on success +*/ +int unregister_hash(const struct ltc_hash_descriptor *hash) +{ + int x; + + LTC_ARGCHK(hash != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x] == hash) { + hash_descriptor[x] = NULL; + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return CRYPT_OK; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return CRYPT_ERROR; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c b/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c new file mode 100644 index 0000000..efa9da9 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c @@ -0,0 +1,71 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file crypt_unregister_prng.c + Unregister a PRNG, Tom St Denis +*/ + +/** + Unregister a PRNG from the descriptor table + @param prng The PRNG descriptor to remove + @return CRYPT_OK on success +*/ +int unregister_prng(const struct ltc_prng_descriptor *prng) +{ + int x; + + LTC_ARGCHK(prng != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_prng_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (prng_descriptor[x] == prng) { + prng_descriptor[x] = NULL; + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return CRYPT_OK; + } + } + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return CRYPT_ERROR; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/crypt/sub.mk b/core/lib/libtomcrypt/src/misc/crypt/sub.mk new file mode 100644 index 0000000..9880a9b --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/crypt/sub.mk @@ -0,0 +1,22 @@ +srcs-y += crypt.c +srcs-y += crypt_cipher_descriptor.c +srcs-y += crypt_cipher_is_valid.c +srcs-y += crypt_find_cipher_any.c +srcs-y += crypt_find_cipher.c +srcs-y += crypt_find_cipher_id.c +srcs-y += crypt_find_hash_any.c +srcs-y += crypt_find_hash.c +srcs-y += crypt_find_hash_id.c +srcs-y += crypt_find_hash_oid.c +srcs-y += crypt_find_prng.c +srcs-y += crypt_fsa.c +srcs-y += crypt_hash_descriptor.c +srcs-y += crypt_hash_is_valid.c +srcs-y += crypt_prng_descriptor.c +srcs-y += crypt_prng_is_valid.c +srcs-y += crypt_register_cipher.c +srcs-y += crypt_register_hash.c +srcs-y += crypt_register_prng.c +srcs-y += crypt_unregister_cipher.c +srcs-y += crypt_unregister_hash.c +srcs-y += crypt_unregister_prng.c diff --git a/core/lib/libtomcrypt/src/misc/error_to_string.c b/core/lib/libtomcrypt/src/misc/error_to_string.c new file mode 100644 index 0000000..19b7311 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/error_to_string.c @@ -0,0 +1,104 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +#include "tomcrypt.h" + +/** + @file error_to_string.c + Convert error codes to ASCII strings, Tom St Denis +*/ + +static const char *err_2_str[] = +{ + "CRYPT_OK", + "CRYPT_ERROR", + "Non-fatal 'no-operation' requested.", + + "Invalid keysize for block cipher.", + "Invalid number of rounds for block cipher.", + "Algorithm failed test vectors.", + + "Buffer overflow.", + "Invalid input packet.", + + "Invalid number of bits for a PRNG.", + "Error reading the PRNG.", + + "Invalid cipher specified.", + "Invalid hash specified.", + "Invalid PRNG specified.", + + "Out of memory.", + + "Invalid PK key or key type specified for function.", + "A private PK key is required.", + + "Invalid argument provided.", + "File Not Found", + + "Invalid PK type.", + "Invalid PK system.", + "Duplicate PK key found on keyring.", + "Key not found in keyring.", + "Invalid sized parameter.", + + "Invalid size for prime.", + + "Invalid padding.", + + "Hash applied to too many bits.", +}; + +/** + Convert an LTC error code to ASCII + @param err The error code + @return A pointer to the ASCII NUL terminated string for the error or "Invalid error code." if the err code was not valid. +*/ +const char *error_to_string(int err) +{ + if (err < 0 || err >= (int)(sizeof(err_2_str)/sizeof(err_2_str[0]))) { + return "Invalid error code."; + } else { + return err_2_str[err]; + } +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/error_to_string.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/misc/mem_neq.c b/core/lib/libtomcrypt/src/misc/mem_neq.c new file mode 100644 index 0000000..9953388 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/mem_neq.c @@ -0,0 +1,87 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file mem_neq.c + Compare two blocks of memory for inequality. + Steffen Jaeckel +*/ + +/** + Compare two blocks of memory for inequality. + + The usage is similar to that of standard memcmp(), but you can only test + if the memory is equal or not - you can not determine by how much the + first different byte differs. + + @param a The first memory region + @param b The second memory region + @param len The length of the area to compare (octets) + + @return 0 when a and b are equal for len bytes, else they are not equal. +*/ +int mem_neq(const void *a, const void *b, size_t len) +{ + unsigned char ret = 0; + const unsigned char* pa; + const unsigned char* pb; + + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + + pa = a; + pb = b; + + while (len-- > 0) { + ret |= *pa ^ *pb; + ++pa; + ++pb; + } + + ret |= ret >> 4; + ret |= ret >> 2; + ret |= ret >> 1; + ret &= 1; + + return ret; +} + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c b/core/lib/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c new file mode 100644 index 0000000..19d07ef --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c @@ -0,0 +1,133 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include <tomcrypt.h> + +/** + @file pkcs_5_1.c + LTC_PKCS #5, Algorithm #1, Tom St Denis +*/ +#ifdef LTC_PKCS_5 +/** + Execute LTC_PKCS #5 v1 + @param password The password (or key) + @param password_len The length of the password (octet) + @param salt The salt (or nonce) which is 8 octets long + @param iteration_count The LTC_PKCS #5 v1 iteration count + @param hash_idx The index of the hash desired + @param out [out] The destination for this algorithm + @param outlen [in/out] The max size and resulting size of the algorithm output + @return CRYPT_OK if successful +*/ +int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen) +{ + int err; + unsigned long x; + hash_state *md; + unsigned char *buf; + + LTC_ARGCHK(password != NULL); + LTC_ARGCHK(salt != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* test hash IDX */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + /* allocate memory */ + md = XMALLOC(sizeof(hash_state)); + buf = XMALLOC(MAXBLOCKSIZE); + if (md == NULL || buf == NULL) { + if (md != NULL) { + XFREE(md); + } + if (buf != NULL) { + XFREE(buf); + } + return CRYPT_MEM; + } + + /* hash initial password + salt */ + if ((err = hash_descriptor[hash_idx].init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(md, password, password_len)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(md, salt, 8)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].done(md, buf)) != CRYPT_OK) { + goto LBL_ERR; + } + + while (--iteration_count) { + /* code goes here. */ + x = MAXBLOCKSIZE; + if ((err = hash_memory(hash_idx, buf, hash_descriptor[hash_idx].hashsize, buf, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* copy upto outlen bytes */ + for (x = 0; x < hash_descriptor[hash_idx].hashsize && x < *outlen; x++) { + out[x] = buf[x]; + } + *outlen = x; + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf, MAXBLOCKSIZE); + zeromem(md, sizeof(hash_state)); +#endif + + XFREE(buf); + XFREE(md); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c b/core/lib/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c new file mode 100644 index 0000000..b969798 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c @@ -0,0 +1,156 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include <tomcrypt.h> + +/** + @file pkcs_5_2.c + LTC_PKCS #5, Algorithm #2, Tom St Denis +*/ +#ifdef LTC_PKCS_5 + +/** + Execute LTC_PKCS #5 v2 + @param password The input password (or key) + @param password_len The length of the password (octets) + @param salt The salt (or nonce) + @param salt_len The length of the salt (octets) + @param iteration_count # of iterations desired for LTC_PKCS #5 v2 [read specs for more] + @param hash_idx The index of the hash desired + @param out [out] The destination for this algorithm + @param outlen [in/out] The max size and resulting size of the algorithm output + @return CRYPT_OK if successful +*/ +int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, unsigned long salt_len, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen) +{ + int err, itts; + ulong32 blkno; + unsigned long stored, left, x, y; + unsigned char *buf[2]; + hmac_state *hmac; + + LTC_ARGCHK(password != NULL); + LTC_ARGCHK(salt != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* test hash IDX */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + buf[0] = XMALLOC(MAXBLOCKSIZE * 2); + hmac = XMALLOC(sizeof(hmac_state)); + if (hmac == NULL || buf[0] == NULL) { + if (hmac != NULL) { + XFREE(hmac); + } + if (buf[0] != NULL) { + XFREE(buf[0]); + } + return CRYPT_MEM; + } + /* buf[1] points to the second block of MAXBLOCKSIZE bytes */ + buf[1] = buf[0] + MAXBLOCKSIZE; + + left = *outlen; + blkno = 1; + stored = 0; + while (left != 0) { + /* process block number blkno */ + zeromem(buf[0], MAXBLOCKSIZE*2); + + /* store current block number and increment for next pass */ + STORE32H(blkno, buf[1]); + ++blkno; + + /* get PRF(P, S||int(blkno)) */ + if ((err = hmac_init(hmac, hash_idx, password, password_len)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hmac_process(hmac, salt, salt_len)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hmac_process(hmac, buf[1], 4)) != CRYPT_OK) { + goto LBL_ERR; + } + x = MAXBLOCKSIZE; + if ((err = hmac_done(hmac, buf[0], &x)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* now compute repeated and XOR it in buf[1] */ + XMEMCPY(buf[1], buf[0], x); + for (itts = 1; itts < iteration_count; ++itts) { + if ((err = hmac_memory(hash_idx, password, password_len, buf[0], x, buf[0], &x)) != CRYPT_OK) { + goto LBL_ERR; + } + for (y = 0; y < x; y++) { + buf[1][y] ^= buf[0][y]; + } + } + + /* now emit upto x bytes of buf[1] to output */ + for (y = 0; y < x && left != 0; ++y) { + out[stored++] = buf[1][y]; + --left; + } + } + *outlen = stored; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf[0], MAXBLOCKSIZE*2); + zeromem(hmac, sizeof(hmac_state)); +#endif + + XFREE(hmac); + XFREE(buf[0]); + + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/misc/pkcs5/sub.mk b/core/lib/libtomcrypt/src/misc/pkcs5/sub.mk new file mode 100644 index 0000000..7f8ccfe --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/pkcs5/sub.mk @@ -0,0 +1,2 @@ +srcs-y += pkcs_5_1.c +srcs-y += pkcs_5_2.c diff --git a/core/lib/libtomcrypt/src/misc/sub.mk b/core/lib/libtomcrypt/src/misc/sub.mk new file mode 100644 index 0000000..6b60213 --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/sub.mk @@ -0,0 +1,6 @@ +srcs-y += burn_stack.c +srcs-y += error_to_string.c +srcs-y += zeromem.c +subdirs-y += base64 +subdirs-y += crypt +subdirs-y += pkcs5 diff --git a/core/lib/libtomcrypt/src/misc/zeromem.c b/core/lib/libtomcrypt/src/misc/zeromem.c new file mode 100644 index 0000000..2afe0dd --- /dev/null +++ b/core/lib/libtomcrypt/src/misc/zeromem.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file zeromem.c + Zero a block of memory, Tom St Denis +*/ + +/** + Zero a block of memory + @param out The destination of the area to zero + @param outlen The length of the area to zero (octets) +*/ +void zeromem(volatile void *out, size_t outlen) +{ + volatile char *mem = out; + LTC_ARGCHKVD(out != NULL); + while (outlen-- > 0) { + *mem++ = 0; + } +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/zeromem.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cbc/cbc_decrypt.c b/core/lib/libtomcrypt/src/modes/cbc/cbc_decrypt.c new file mode 100644 index 0000000..8ab2542 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cbc/cbc_decrypt.c @@ -0,0 +1,124 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cbc_decrypt.c + CBC implementation, encrypt block, Tom St Denis +*/ + + +#ifdef LTC_CBC_MODE + +/** + CBC decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len The number of bytes to process (must be multiple of block length) + @param cbc CBC state + @return CRYPT_OK if successful +*/ +int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CBC *cbc) +{ + int x, err; + unsigned char tmp[16]; +#ifdef LTC_FAST + LTC_FAST_TYPE tmpy; +#else + unsigned char tmpy; +#endif + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(cbc != NULL); + + if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen valid? */ + if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV)) { + return CRYPT_INVALID_ARG; + } + + if (len % cbc->blocklen) { + return CRYPT_INVALID_ARG; + } +#ifdef LTC_FAST + if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + if (cipher_descriptor[cbc->cipher]->accel_cbc_decrypt != NULL) { + return cipher_descriptor[cbc->cipher]->accel_cbc_decrypt(ct, pt, len / cbc->blocklen, cbc->IV, &cbc->key); + } else { + while (len) { + /* decrypt */ + if ((err = cipher_descriptor[cbc->cipher]->ecb_decrypt(ct, tmp, &cbc->key)) != CRYPT_OK) { + return err; + } + + /* xor IV against plaintext */ + #if defined(LTC_FAST) + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + tmpy = *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^ *((LTC_FAST_TYPE*)((unsigned char *)tmp + x)); + *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); + *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) = tmpy; + } + #else + for (x = 0; x < cbc->blocklen; x++) { + tmpy = tmp[x] ^ cbc->IV[x]; + cbc->IV[x] = ct[x]; + pt[x] = tmpy; + } + #endif + + ct += cbc->blocklen; + pt += cbc->blocklen; + len -= cbc->blocklen; + } + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_decrypt.c,v $ */ +/* $Revision: 1.16 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cbc/cbc_done.c b/core/lib/libtomcrypt/src/modes/cbc/cbc_done.c new file mode 100644 index 0000000..a2664c1 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cbc/cbc_done.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cbc_done.c + CBC implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_CBC_MODE + +/** Terminate the chain + @param cbc The CBC chain to terminate + @return CRYPT_OK on success +*/ +int cbc_done(symmetric_CBC *cbc) +{ + int err; + LTC_ARGCHK(cbc != NULL); + + if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[cbc->cipher]->done(&cbc->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cbc/cbc_encrypt.c b/core/lib/libtomcrypt/src/modes/cbc/cbc_encrypt.c new file mode 100644 index 0000000..2b138b4 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cbc/cbc_encrypt.c @@ -0,0 +1,125 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cbc_encrypt.c + CBC implementation, encrypt block, Tom St Denis +*/ + + +#ifdef LTC_CBC_MODE + +/** + CBC encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len The number of bytes to process (must be multiple of block length) + @param cbc CBC state + @return CRYPT_OK if successful +*/ +int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CBC *cbc) +{ + int x, err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(cbc != NULL); + + if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen valid? */ + if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV)) { + return CRYPT_INVALID_ARG; + } + + if (len % cbc->blocklen) { + return CRYPT_INVALID_ARG; + } +#ifdef LTC_FAST + if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + if (cipher_descriptor[cbc->cipher]->accel_cbc_encrypt != NULL) { + return cipher_descriptor[cbc->cipher]->accel_cbc_encrypt(pt, ct, len / cbc->blocklen, cbc->IV, &cbc->key); + } else { + while (len) { + /* xor IV against plaintext */ + #if defined(LTC_FAST) + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^= *((LTC_FAST_TYPE*)((unsigned char *)pt + x)); + } + #else + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] ^= pt[x]; + } + #endif + + /* encrypt */ + if ((err = cipher_descriptor[cbc->cipher]->ecb_encrypt(cbc->IV, ct, &cbc->key)) != CRYPT_OK) { + return err; + } + + /* store IV [ciphertext] for a future block */ + #if defined(LTC_FAST) + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); + } + #else + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] = ct[x]; + } + #endif + + ct += cbc->blocklen; + pt += cbc->blocklen; + len -= cbc->blocklen; + } + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_encrypt.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cbc/cbc_getiv.c b/core/lib/libtomcrypt/src/modes/cbc/cbc_getiv.c new file mode 100644 index 0000000..799ac96 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cbc/cbc_getiv.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cbc_getiv.c + CBC implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_CBC_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param cbc The CBC state + @return CRYPT_OK if successful +*/ +int cbc_getiv(unsigned char *IV, unsigned long *len, symmetric_CBC *cbc) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(cbc != NULL); + if ((unsigned long)cbc->blocklen > *len) { + *len = cbc->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, cbc->IV, cbc->blocklen); + *len = cbc->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_getiv.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cbc/cbc_setiv.c b/core/lib/libtomcrypt/src/modes/cbc/cbc_setiv.c new file mode 100644 index 0000000..05e3ee9 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cbc/cbc_setiv.c @@ -0,0 +1,71 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cbc_setiv.c + CBC implementation, set IV, Tom St Denis +*/ + + +#ifdef LTC_CBC_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param cbc The CBC state + @return CRYPT_OK if successful +*/ +int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(cbc != NULL); + if (len != (unsigned long)cbc->blocklen) { + return CRYPT_INVALID_ARG; + } + XMEMCPY(cbc->IV, IV, len); + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_setiv.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cbc/cbc_start.c b/core/lib/libtomcrypt/src/modes/cbc/cbc_start.c new file mode 100644 index 0000000..f0c0218 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cbc/cbc_start.c @@ -0,0 +1,89 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cbc_start.c + CBC implementation, start chain, Tom St Denis +*/ + +#ifdef LTC_CBC_MODE + +/** + Initialize a CBC context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param cbc The CBC state to initialize + @return CRYPT_OK if successful +*/ +int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_CBC *cbc) +{ + int x, err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(cbc != NULL); + + /* bad param? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* setup cipher */ + if ((err = cipher_descriptor[cipher]->setup(key, keylen, num_rounds, &cbc->key)) != CRYPT_OK) { + return err; + } + + /* copy IV */ + cbc->blocklen = cipher_descriptor[cipher]->block_length; + cbc->cipher = cipher; + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] = IV[x]; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_start.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cbc/sub.mk b/core/lib/libtomcrypt/src/modes/cbc/sub.mk new file mode 100644 index 0000000..1ce3e77 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cbc/sub.mk @@ -0,0 +1,6 @@ +srcs-y += cbc_decrypt.c +srcs-y += cbc_done.c +srcs-y += cbc_encrypt.c +srcs-y += cbc_getiv.c +srcs-y += cbc_setiv.c +srcs-y += cbc_start.c diff --git a/core/lib/libtomcrypt/src/modes/cfb/cfb_decrypt.c b/core/lib/libtomcrypt/src/modes/cfb/cfb_decrypt.c new file mode 100644 index 0000000..7ca938f --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cfb/cfb_decrypt.c @@ -0,0 +1,94 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cfb_decrypt.c + CFB implementation, decrypt data, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** + CFB decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len Length of ciphertext (octets) + @param cfb CFB state + @return CRYPT_OK if successful +*/ +int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CFB *cfb) +{ + int err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (cfb->blocklen < 0 || cfb->blocklen > (int)sizeof(cfb->IV) || + cfb->padlen < 0 || cfb->padlen > (int)sizeof(cfb->pad)) { + return CRYPT_INVALID_ARG; + } + + while (len-- > 0) { + if (cfb->padlen == cfb->blocklen) { + if ((err = cipher_descriptor[cfb->cipher].ecb_encrypt(cfb->pad, cfb->IV, &cfb->key)) != CRYPT_OK) { + return err; + } + cfb->padlen = 0; + } + cfb->pad[cfb->padlen] = *ct; + *pt = *ct ^ cfb->IV[cfb->padlen]; + ++pt; + ++ct; + ++(cfb->padlen); + } + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_decrypt.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cfb/cfb_done.c b/core/lib/libtomcrypt/src/modes/cfb/cfb_done.c new file mode 100644 index 0000000..9f84727 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cfb/cfb_done.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cfb_done.c + CFB implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** Terminate the chain + @param cfb The CFB chain to terminate + @return CRYPT_OK on success +*/ +int cfb_done(symmetric_CFB *cfb) +{ + int err; + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[cfb->cipher].done(&cfb->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cfb/cfb_encrypt.c b/core/lib/libtomcrypt/src/modes/cfb/cfb_encrypt.c new file mode 100644 index 0000000..4acb8f1 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cfb/cfb_encrypt.c @@ -0,0 +1,92 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cfb_encrypt.c + CFB implementation, encrypt data, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** + CFB encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len Length of plaintext (octets) + @param cfb CFB state + @return CRYPT_OK if successful +*/ +int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CFB *cfb) +{ + int err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (cfb->blocklen < 0 || cfb->blocklen > (int)sizeof(cfb->IV) || + cfb->padlen < 0 || cfb->padlen > (int)sizeof(cfb->pad)) { + return CRYPT_INVALID_ARG; + } + + while (len-- > 0) { + if (cfb->padlen == cfb->blocklen) { + if ((err = cipher_descriptor[cfb->cipher].ecb_encrypt(cfb->pad, cfb->IV, &cfb->key)) != CRYPT_OK) { + return err; + } + cfb->padlen = 0; + } + cfb->pad[cfb->padlen] = (*ct = *pt ^ cfb->IV[cfb->padlen]); + ++pt; + ++ct; + ++(cfb->padlen); + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_encrypt.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cfb/cfb_getiv.c b/core/lib/libtomcrypt/src/modes/cfb/cfb_getiv.c new file mode 100644 index 0000000..0adb1f6 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cfb/cfb_getiv.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cfb_getiv.c + CFB implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param cfb The CFB state + @return CRYPT_OK if successful +*/ +int cfb_getiv(unsigned char *IV, unsigned long *len, symmetric_CFB *cfb) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(cfb != NULL); + if ((unsigned long)cfb->blocklen > *len) { + *len = cfb->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, cfb->IV, cfb->blocklen); + *len = cfb->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_getiv.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cfb/cfb_setiv.c b/core/lib/libtomcrypt/src/modes/cfb/cfb_setiv.c new file mode 100644 index 0000000..26cc81b --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cfb/cfb_setiv.c @@ -0,0 +1,79 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cfb_setiv.c + CFB implementation, set IV, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param cfb The CFB state + @return CRYPT_OK if successful +*/ +int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb) +{ + int err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { + return err; + } + + if (len != (unsigned long)cfb->blocklen) { + return CRYPT_INVALID_ARG; + } + + /* force next block */ + cfb->padlen = 0; + return cipher_descriptor[cfb->cipher].ecb_encrypt(IV, cfb->IV, &cfb->key); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_setiv.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cfb/cfb_start.c b/core/lib/libtomcrypt/src/modes/cfb/cfb_start.c new file mode 100644 index 0000000..3a691ec --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cfb/cfb_start.c @@ -0,0 +1,92 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file cfb_start.c + CFB implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_CFB_MODE + +/** + Initialize a CFB context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param cfb The CFB state to initialize + @return CRYPT_OK if successful +*/ +int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_CFB *cfb) +{ + int x, err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + + /* copy data */ + cfb->cipher = cipher; + cfb->blocklen = cipher_descriptor[cipher].block_length; + for (x = 0; x < cfb->blocklen; x++) + cfb->IV[x] = IV[x]; + + /* init the cipher */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &cfb->key)) != CRYPT_OK) { + return err; + } + + /* encrypt the IV */ + cfb->padlen = 0; + return cipher_descriptor[cfb->cipher].ecb_encrypt(cfb->IV, cfb->IV, &cfb->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_start.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/cfb/sub.mk b/core/lib/libtomcrypt/src/modes/cfb/sub.mk new file mode 100644 index 0000000..7a92b01 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/cfb/sub.mk @@ -0,0 +1,6 @@ +srcs-y += cfb_decrypt.c +srcs-y += cfb_done.c +srcs-y += cfb_encrypt.c +srcs-y += cfb_getiv.c +srcs-y += cfb_setiv.c +srcs-y += cfb_start.c diff --git a/core/lib/libtomcrypt/src/modes/ctr/ctr_decrypt.c b/core/lib/libtomcrypt/src/modes/ctr/ctr_decrypt.c new file mode 100644 index 0000000..834df8a --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ctr/ctr_decrypt.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ctr_decrypt.c + CTR implementation, decrypt data, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +/** + CTR decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len Length of ciphertext (octets) + @param ctr CTR state + @return CRYPT_OK if successful +*/ +int ctr_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CTR *ctr) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ctr != NULL); + + return ctr_encrypt(ct, pt, len, ctr); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_decrypt.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ctr/ctr_done.c b/core/lib/libtomcrypt/src/modes/ctr/ctr_done.c new file mode 100644 index 0000000..9b475f5 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ctr/ctr_done.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ctr_done.c + CTR implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +/** Terminate the chain + @param ctr The CTR chain to terminate + @return CRYPT_OK on success +*/ +int ctr_done(symmetric_CTR *ctr) +{ + int err; + LTC_ARGCHK(ctr != NULL); + + if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[ctr->cipher]->done(&ctr->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ctr/ctr_encrypt.c b/core/lib/libtomcrypt/src/modes/ctr/ctr_encrypt.c new file mode 100644 index 0000000..0c6b2d7 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ctr/ctr_encrypt.c @@ -0,0 +1,139 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ctr_encrypt.c + CTR implementation, encrypt data, Tom St Denis +*/ + + +#ifdef LTC_CTR_MODE + +/** + CTR encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len Length of plaintext (octets) + @param ctr CTR state + @return CRYPT_OK if successful +*/ +int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CTR *ctr) +{ + int x, err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ctr != NULL); + + if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (ctr->blocklen < 1 || ctr->blocklen > (int)sizeof(ctr->ctr) || + ctr->padlen < 0 || ctr->padlen > (int)sizeof(ctr->pad)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (ctr->blocklen % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* handle acceleration only if pad is empty, accelerator is present and length is >= a block size */ + if ((ctr->padlen == ctr->blocklen) && cipher_descriptor[ctr->cipher]->accel_ctr_encrypt != NULL && (len >= (unsigned long)ctr->blocklen)) { + if ((err = cipher_descriptor[ctr->cipher]->accel_ctr_encrypt(pt, ct, len/ctr->blocklen, ctr->ctr, ctr->mode, &ctr->key)) != CRYPT_OK) { + return err; + } + len %= ctr->blocklen; + } + + while (len) { + /* is the pad empty? */ + if (ctr->padlen == ctr->blocklen) { + /* increment counter */ + if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { + /* little-endian */ + for (x = 0; x < ctr->ctrlen; x++) { + ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; + if (ctr->ctr[x] != (unsigned char)0) { + break; + } + } + } else { + /* big-endian */ + for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { + ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; + if (ctr->ctr[x] != (unsigned char)0) { + break; + } + } + } + + /* encrypt it */ + if ((err = cipher_descriptor[ctr->cipher]->ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key)) != CRYPT_OK) { + return err; + } + ctr->padlen = 0; + } +#ifdef LTC_FAST + if (ctr->padlen == 0 && len >= (unsigned long)ctr->blocklen) { + for (x = 0; x < ctr->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)ct + x)) = *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) ^ + *((LTC_FAST_TYPE*)((unsigned char *)ctr->pad + x)); + } + pt += ctr->blocklen; + ct += ctr->blocklen; + len -= ctr->blocklen; + ctr->padlen = ctr->blocklen; + continue; + } +#endif + *ct++ = *pt++ ^ ctr->pad[ctr->padlen++]; + --len; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_encrypt.c,v $ */ +/* $Revision: 1.22 $ */ +/* $Date: 2007/02/22 20:26:05 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ctr/ctr_getiv.c b/core/lib/libtomcrypt/src/modes/ctr/ctr_getiv.c new file mode 100644 index 0000000..0ccb2fe --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ctr/ctr_getiv.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ctr_getiv.c + CTR implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param ctr The CTR state + @return CRYPT_OK if successful +*/ +int ctr_getiv(unsigned char *IV, unsigned long *len, symmetric_CTR *ctr) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(ctr != NULL); + if ((unsigned long)ctr->blocklen > *len) { + *len = ctr->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, ctr->ctr, ctr->blocklen); + *len = ctr->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_getiv.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ctr/ctr_setiv.c b/core/lib/libtomcrypt/src/modes/ctr/ctr_setiv.c new file mode 100644 index 0000000..cbc4c4e --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ctr/ctr_setiv.c @@ -0,0 +1,83 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ctr_setiv.c + CTR implementation, set IV, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param ctr The CTR state + @return CRYPT_OK if successful +*/ +int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr) +{ + int err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(ctr != NULL); + + /* bad param? */ + if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { + return err; + } + + if (len != (unsigned long)ctr->blocklen) { + return CRYPT_INVALID_ARG; + } + + /* set IV */ + XMEMCPY(ctr->ctr, IV, len); + + /* force next block */ + ctr->padlen = 0; + return cipher_descriptor[ctr->cipher]->ecb_encrypt(IV, ctr->pad, &ctr->key); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_setiv.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ctr/ctr_start.c b/core/lib/libtomcrypt/src/modes/ctr/ctr_start.c new file mode 100644 index 0000000..337c221 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ctr/ctr_start.c @@ -0,0 +1,128 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ctr_start.c + CTR implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_CTR_MODE + +/** + Initialize a CTR context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param ctr_mode The counter mode (CTR_COUNTER_LITTLE_ENDIAN or CTR_COUNTER_BIG_ENDIAN) + @param ctr The CTR state to initialize + @return CRYPT_OK if successful +*/ +int ctr_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, + int num_rounds, int ctr_mode, + symmetric_CTR *ctr) +{ + int x, err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ctr != NULL); + + /* bad param? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* ctrlen == counter width */ + ctr->ctrlen = (ctr_mode & 255) ? (ctr_mode & 255) : cipher_descriptor[cipher]->block_length; + if (ctr->ctrlen > cipher_descriptor[cipher]->block_length) { + return CRYPT_INVALID_ARG; + } + + if ((ctr_mode & 0x1000) == CTR_COUNTER_BIG_ENDIAN) { + ctr->ctrlen = cipher_descriptor[cipher]->block_length - ctr->ctrlen; + } + + /* setup cipher */ + if ((err = cipher_descriptor[cipher]->setup(key, keylen, num_rounds, &ctr->key)) != CRYPT_OK) { + return err; + } + + /* copy ctr */ + ctr->blocklen = cipher_descriptor[cipher]->block_length; + ctr->cipher = cipher; + ctr->padlen = 0; + ctr->mode = ctr_mode & 0x1000; + for (x = 0; x < ctr->blocklen; x++) { + ctr->ctr[x] = IV[x]; + } + + if (ctr_mode & LTC_CTR_RFC3686) { + /* increment the IV as per RFC 3686 */ + if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { + /* little-endian */ + for (x = 0; x < ctr->ctrlen; x++) { + ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; + if (ctr->ctr[x] != (unsigned char)0) { + break; + } + } + } else { + /* big-endian */ + for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { + ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; + if (ctr->ctr[x] != (unsigned char)0) { + break; + } + } + } + } + + return cipher_descriptor[ctr->cipher]->ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_start.c,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2007/02/23 14:18:37 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ctr/sub.mk b/core/lib/libtomcrypt/src/modes/ctr/sub.mk new file mode 100644 index 0000000..e6f9c92 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ctr/sub.mk @@ -0,0 +1,7 @@ +srcs-y += ctr_decrypt.c +srcs-y += ctr_done.c +srcs-y += ctr_encrypt.c +srcs-y += ctr_getiv.c +srcs-y += ctr_setiv.c +srcs-y += ctr_start.c +# srcs-y += ctr_test.c diff --git a/core/lib/libtomcrypt/src/modes/ecb/ecb_decrypt.c b/core/lib/libtomcrypt/src/modes/ecb/ecb_decrypt.c new file mode 100644 index 0000000..7d9d9a9 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ecb/ecb_decrypt.c @@ -0,0 +1,88 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ecb_decrypt.c + ECB implementation, decrypt a block, Tom St Denis +*/ + +#ifdef LTC_ECB_MODE + +/** + ECB decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len The number of octets to process (must be multiple of the cipher block size) + @param ecb ECB state + @return CRYPT_OK if successful +*/ +int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_ECB *ecb) +{ + int err; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ecb != NULL); + if ((err = cipher_is_valid(ecb->cipher)) != CRYPT_OK) { + return err; + } + if (len % cipher_descriptor[ecb->cipher]->block_length) { + return CRYPT_INVALID_ARG; + } + + /* check for accel */ + if (cipher_descriptor[ecb->cipher]->accel_ecb_decrypt != NULL) { + return cipher_descriptor[ecb->cipher]->accel_ecb_decrypt(ct, pt, len / cipher_descriptor[ecb->cipher]->block_length, &ecb->key); + } else { + while (len) { + if ((err = cipher_descriptor[ecb->cipher]->ecb_decrypt(ct, pt, &ecb->key)) != CRYPT_OK) { + return err; + } + pt += cipher_descriptor[ecb->cipher]->block_length; + ct += cipher_descriptor[ecb->cipher]->block_length; + len -= cipher_descriptor[ecb->cipher]->block_length; + } + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_decrypt.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ecb/ecb_done.c b/core/lib/libtomcrypt/src/modes/ecb/ecb_done.c new file mode 100644 index 0000000..1660366 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ecb/ecb_done.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ecb_done.c + ECB implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_ECB_MODE + +/** Terminate the chain + @param ecb The ECB chain to terminate + @return CRYPT_OK on success +*/ +int ecb_done(symmetric_ECB *ecb) +{ + int err; + LTC_ARGCHK(ecb != NULL); + + if ((err = cipher_is_valid(ecb->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[ecb->cipher]->done(&ecb->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_done.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ecb/ecb_encrypt.c b/core/lib/libtomcrypt/src/modes/ecb/ecb_encrypt.c new file mode 100644 index 0000000..78f6b92 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ecb/ecb_encrypt.c @@ -0,0 +1,88 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ecb_encrypt.c + ECB implementation, encrypt a block, Tom St Denis +*/ + +#ifdef LTC_ECB_MODE + +/** + ECB encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len The number of octets to process (must be multiple of the cipher block size) + @param ecb ECB state + @return CRYPT_OK if successful +*/ +int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_ECB *ecb) +{ + int err; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ecb != NULL); + if ((err = cipher_is_valid(ecb->cipher)) != CRYPT_OK) { + return err; + } + if (len % cipher_descriptor[ecb->cipher]->block_length) { + return CRYPT_INVALID_ARG; + } + + /* check for accel */ + if (cipher_descriptor[ecb->cipher]->accel_ecb_encrypt != NULL) { + return cipher_descriptor[ecb->cipher]->accel_ecb_encrypt(pt, ct, len / cipher_descriptor[ecb->cipher]->block_length, &ecb->key); + } else { + while (len) { + if ((err = cipher_descriptor[ecb->cipher]->ecb_encrypt(pt, ct, &ecb->key)) != CRYPT_OK) { + return err; + } + pt += cipher_descriptor[ecb->cipher]->block_length; + ct += cipher_descriptor[ecb->cipher]->block_length; + len -= cipher_descriptor[ecb->cipher]->block_length; + } + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_encrypt.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ecb/ecb_start.c b/core/lib/libtomcrypt/src/modes/ecb/ecb_start.c new file mode 100644 index 0000000..f57abb2 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ecb/ecb_start.c @@ -0,0 +1,75 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ecb_start.c + ECB implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_ECB_MODE + +/** + Initialize a ECB context + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param ecb The ECB state to initialize + @return CRYPT_OK if successful +*/ +int ecb_start(int cipher, const unsigned char *key, int keylen, int num_rounds, symmetric_ECB *ecb) +{ + int err; + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ecb != NULL); + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + ecb->cipher = cipher; + ecb->blocklen = cipher_descriptor[cipher]->block_length; + return cipher_descriptor[cipher]->setup(key, keylen, num_rounds, &ecb->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_start.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ecb/sub.mk b/core/lib/libtomcrypt/src/modes/ecb/sub.mk new file mode 100644 index 0000000..c47c061 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ecb/sub.mk @@ -0,0 +1,4 @@ +srcs-y += ecb_decrypt.c +srcs-y += ecb_done.c +srcs-y += ecb_encrypt.c +srcs-y += ecb_start.c diff --git a/core/lib/libtomcrypt/src/modes/f8/f8_decrypt.c b/core/lib/libtomcrypt/src/modes/f8/f8_decrypt.c new file mode 100644 index 0000000..2f4591f --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/f8/f8_decrypt.c @@ -0,0 +1,70 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file f8_decrypt.c + F8 implementation, decrypt data, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** + F8 decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len Length of ciphertext (octets) + @param f8 F8 state + @return CRYPT_OK if successful +*/ +int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_F8 *f8) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(f8 != NULL); + return f8_encrypt(ct, pt, len, f8); +} + + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_decrypt.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/f8/f8_done.c b/core/lib/libtomcrypt/src/modes/f8/f8_done.c new file mode 100644 index 0000000..91b5ddc --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/f8/f8_done.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file f8_done.c + F8 implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** Terminate the chain + @param f8 The F8 chain to terminate + @return CRYPT_OK on success +*/ +int f8_done(symmetric_F8 *f8) +{ + int err; + LTC_ARGCHK(f8 != NULL); + + if ((err = cipher_is_valid(f8->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[f8->cipher].done(&f8->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_done.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/f8/f8_encrypt.c b/core/lib/libtomcrypt/src/modes/f8/f8_encrypt.c new file mode 100644 index 0000000..7a0039c --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/f8/f8_encrypt.c @@ -0,0 +1,130 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file f8_encrypt.c + F8 implementation, encrypt data, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** + F8 encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len Length of plaintext (octets) + @param f8 F8 state + @return CRYPT_OK if successful +*/ +int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_F8 *f8) +{ + int err, x; + unsigned char buf[MAXBLOCKSIZE]; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(f8 != NULL); + if ((err = cipher_is_valid(f8->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (f8->blocklen < 0 || f8->blocklen > (int)sizeof(f8->IV) || + f8->padlen < 0 || f8->padlen > (int)sizeof(f8->IV)) { + return CRYPT_INVALID_ARG; + } + + zeromem(buf, sizeof(buf)); + + /* make sure the pad is empty */ + if (f8->padlen == f8->blocklen) { + /* xor of IV, MIV and blockcnt == what goes into cipher */ + STORE32H(f8->blockcnt, (buf+(f8->blocklen-4))); + ++(f8->blockcnt); + for (x = 0; x < f8->blocklen; x++) { + f8->IV[x] ^= f8->MIV[x] ^ buf[x]; + } + if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(f8->IV, f8->IV, &f8->key)) != CRYPT_OK) { + return err; + } + f8->padlen = 0; + } + +#ifdef LTC_FAST + if (f8->padlen == 0) { + while (len >= (unsigned long)f8->blocklen) { + STORE32H(f8->blockcnt, (buf+(f8->blocklen-4))); + ++(f8->blockcnt); + for (x = 0; x < f8->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&ct[x])) = *((LTC_FAST_TYPE*)(&pt[x])) ^ *((LTC_FAST_TYPE*)(&f8->IV[x])); + *((LTC_FAST_TYPE*)(&f8->IV[x])) ^= *((LTC_FAST_TYPE*)(&f8->MIV[x])) ^ *((LTC_FAST_TYPE*)(&buf[x])); + } + if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(f8->IV, f8->IV, &f8->key)) != CRYPT_OK) { + return err; + } + len -= x; + pt += x; + ct += x; + } + } +#endif + + while (len > 0) { + if (f8->padlen == f8->blocklen) { + /* xor of IV, MIV and blockcnt == what goes into cipher */ + STORE32H(f8->blockcnt, (buf+(f8->blocklen-4))); + ++(f8->blockcnt); + for (x = 0; x < f8->blocklen; x++) { + f8->IV[x] ^= f8->MIV[x] ^ buf[x]; + } + if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(f8->IV, f8->IV, &f8->key)) != CRYPT_OK) { + return err; + } + f8->padlen = 0; + } + *ct++ = *pt++ ^ f8->IV[f8->padlen++]; + --len; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_encrypt.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/f8/f8_getiv.c b/core/lib/libtomcrypt/src/modes/f8/f8_getiv.c new file mode 100644 index 0000000..425a420 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/f8/f8_getiv.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ofb_getiv.c + F8 implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param f8 The F8 state + @return CRYPT_OK if successful +*/ +int f8_getiv(unsigned char *IV, unsigned long *len, symmetric_F8 *f8) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(f8 != NULL); + if ((unsigned long)f8->blocklen > *len) { + *len = f8->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, f8->IV, f8->blocklen); + *len = f8->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_getiv.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/f8/f8_setiv.c b/core/lib/libtomcrypt/src/modes/f8/f8_setiv.c new file mode 100644 index 0000000..b0bce2a --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/f8/f8_setiv.c @@ -0,0 +1,79 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file f8_setiv.c + F8 implementation, set IV, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param f8 The F8 state + @return CRYPT_OK if successful +*/ +int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8) +{ + int err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(f8 != NULL); + + if ((err = cipher_is_valid(f8->cipher)) != CRYPT_OK) { + return err; + } + + if (len != (unsigned long)f8->blocklen) { + return CRYPT_INVALID_ARG; + } + + /* force next block */ + f8->padlen = 0; + return cipher_descriptor[f8->cipher].ecb_encrypt(IV, f8->IV, &f8->key); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_setiv.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/f8/f8_start.c b/core/lib/libtomcrypt/src/modes/f8/f8_start.c new file mode 100644 index 0000000..d7296e7 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/f8/f8_start.c @@ -0,0 +1,125 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file f8_start.c + F8 implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_F8_MODE + +/** + Initialize an F8 context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param salt_key The salting key for the IV + @param skeylen The length of the salting key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param f8 The F8 state to initialize + @return CRYPT_OK if successful +*/ +int f8_start( int cipher, const unsigned char *IV, + const unsigned char *key, int keylen, + const unsigned char *salt_key, int skeylen, + int num_rounds, symmetric_F8 *f8) +{ + int x, err; + unsigned char tkey[MAXBLOCKSIZE]; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(salt_key != NULL); + LTC_ARGCHK(f8 != NULL); + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_FAST + if (cipher_descriptor[cipher].block_length % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* copy details */ + f8->blockcnt = 0; + f8->cipher = cipher; + f8->blocklen = cipher_descriptor[cipher].block_length; + f8->padlen = f8->blocklen; + + /* now get key ^ salt_key [extend salt_ket with 0x55 as required to match length] */ + zeromem(tkey, sizeof(tkey)); + for (x = 0; x < keylen && x < (int)sizeof(tkey); x++) { + tkey[x] = key[x]; + } + for (x = 0; x < skeylen && x < (int)sizeof(tkey); x++) { + tkey[x] ^= salt_key[x]; + } + for (; x < keylen && x < (int)sizeof(tkey); x++) { + tkey[x] ^= 0x55; + } + + /* now encrypt with tkey[0..keylen-1] the IV and use that as the IV */ + if ((err = cipher_descriptor[cipher].setup(tkey, keylen, num_rounds, &f8->key)) != CRYPT_OK) { + return err; + } + + /* encrypt IV */ + if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(IV, f8->MIV, &f8->key)) != CRYPT_OK) { + cipher_descriptor[f8->cipher].done(&f8->key); + return err; + } + zeromem(tkey, sizeof(tkey)); + zeromem(f8->IV, sizeof(f8->IV)); + + /* terminate this cipher */ + cipher_descriptor[f8->cipher].done(&f8->key); + + /* init the cipher */ + return cipher_descriptor[cipher].setup(key, keylen, num_rounds, &f8->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_start.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/f8/sub.mk b/core/lib/libtomcrypt/src/modes/f8/sub.mk new file mode 100644 index 0000000..32e1381 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/f8/sub.mk @@ -0,0 +1,6 @@ +srcs-y += f8_decrypt.c +srcs-y += f8_done.c +srcs-y += f8_encrypt.c +srcs-y += f8_getiv.c +srcs-y += f8_setiv.c +srcs-y += f8_start.c diff --git a/core/lib/libtomcrypt/src/modes/lrw/lrw_decrypt.c b/core/lib/libtomcrypt/src/modes/lrw/lrw_decrypt.c new file mode 100644 index 0000000..be7447d --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/lrw/lrw_decrypt.c @@ -0,0 +1,78 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file lrw_decrypt.c + LRW_MODE implementation, Decrypt blocks, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + LRW decrypt blocks + @param ct The ciphertext + @param pt [out] The plaintext + @param len The length in octets, must be a multiple of 16 + @param lrw The LRW state +*/ +int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_LRW *lrw) +{ + int err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(lrw != NULL); + + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { + return err; + } + + if (cipher_descriptor[lrw->cipher].accel_lrw_decrypt != NULL) { + return cipher_descriptor[lrw->cipher].accel_lrw_decrypt(ct, pt, len, lrw->IV, lrw->tweak, &lrw->key); + } + + return lrw_process(ct, pt, len, LRW_DECRYPT, lrw); +} + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_decrypt.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/lrw/lrw_done.c b/core/lib/libtomcrypt/src/modes/lrw/lrw_done.c new file mode 100644 index 0000000..0a44bad --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/lrw/lrw_done.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file lrw_done.c + LRW_MODE implementation, Free resources, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Terminate a LRW state + @param lrw The state to terminate + @return CRYPT_OK if successful +*/ +int lrw_done(symmetric_LRW *lrw) +{ + int err; + + LTC_ARGCHK(lrw != NULL); + + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[lrw->cipher].done(&lrw->key); + + return CRYPT_OK; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/lrw/lrw_encrypt.c b/core/lib/libtomcrypt/src/modes/lrw/lrw_encrypt.c new file mode 100644 index 0000000..0032aab --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/lrw/lrw_encrypt.c @@ -0,0 +1,77 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file lrw_encrypt.c + LRW_MODE implementation, Encrypt blocks, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + LRW encrypt blocks + @param pt The plaintext + @param ct [out] The ciphertext + @param len The length in octets, must be a multiple of 16 + @param lrw The LRW state +*/ +int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_LRW *lrw) +{ + int err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(lrw != NULL); + + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { + return err; + } + + if (cipher_descriptor[lrw->cipher].accel_lrw_encrypt != NULL) { + return cipher_descriptor[lrw->cipher].accel_lrw_encrypt(pt, ct, len, lrw->IV, lrw->tweak, &lrw->key); + } + + return lrw_process(pt, ct, len, LRW_ENCRYPT, lrw); +} + + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_encrypt.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/lrw/lrw_getiv.c b/core/lib/libtomcrypt/src/modes/lrw/lrw_getiv.c new file mode 100644 index 0000000..0297b3c --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/lrw/lrw_getiv.c @@ -0,0 +1,72 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file lrw_getiv.c + LRW_MODE implementation, Retrieve the current IV, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Get the IV for LRW + @param IV [out] The IV, must be 16 octets + @param len Length ... must be at least 16 :-) + @param lrw The LRW state to read + @return CRYPT_OK if successful +*/ +int lrw_getiv(unsigned char *IV, unsigned long *len, symmetric_LRW *lrw) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(lrw != NULL); + if (*len < 16) { + *len = 16; + return CRYPT_BUFFER_OVERFLOW; + } + + XMEMCPY(IV, lrw->IV, 16); + *len = 16; + return CRYPT_OK; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_getiv.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/lrw/lrw_process.c b/core/lib/libtomcrypt/src/modes/lrw/lrw_process.c new file mode 100644 index 0000000..8830185 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/lrw/lrw_process.c @@ -0,0 +1,147 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file lrw_process.c + LRW_MODE implementation, Encrypt/decrypt blocks, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Process blocks with LRW, since decrypt/encrypt are largely the same they share this code. + @param pt The "input" data + @param ct [out] The "output" data + @param len The length of the input, must be a multiple of 128-bits (16 octets) + @param mode LRW_ENCRYPT or LRW_DECRYPT + @param lrw The LRW state + @return CRYPT_OK if successful +*/ +int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, int mode, symmetric_LRW *lrw) +{ + unsigned char prod[16]; + int x, err; +#ifdef LTC_LRW_TABLES + int y; +#endif + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(lrw != NULL); + + if (len & 15) { + return CRYPT_INVALID_ARG; + } + + while (len) { + /* copy pad */ + XMEMCPY(prod, lrw->pad, 16); + + /* increment IV */ + for (x = 15; x >= 0; x--) { + lrw->IV[x] = (lrw->IV[x] + 1) & 255; + if (lrw->IV[x]) { + break; + } + } + + /* update pad */ +#ifdef LTC_LRW_TABLES + /* for each byte changed we undo it's affect on the pad then add the new product */ + for (; x < 16; x++) { +#ifdef LTC_FAST + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(lrw->pad + y)) ^= *((LTC_FAST_TYPE *)(&lrw->PC[x][lrw->IV[x]][y])) ^ *((LTC_FAST_TYPE *)(&lrw->PC[x][(lrw->IV[x]-1)&255][y])); + } +#else + for (y = 0; y < 16; y++) { + lrw->pad[y] ^= lrw->PC[x][lrw->IV[x]][y] ^ lrw->PC[x][(lrw->IV[x]-1)&255][y]; + } +#endif + } +#else + gcm_gf_mult(lrw->tweak, lrw->IV, lrw->pad); +#endif + + /* xor prod */ +#ifdef LTC_FAST + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(ct + x)) = *((LTC_FAST_TYPE *)(pt + x)) ^ *((LTC_FAST_TYPE *)(prod + x)); + } +#else + for (x = 0; x < 16; x++) { + ct[x] = pt[x] ^ prod[x]; + } +#endif + + /* send through cipher */ + if (mode == LRW_ENCRYPT) { + if ((err = cipher_descriptor[lrw->cipher].ecb_encrypt(ct, ct, &lrw->key)) != CRYPT_OK) { + return err; + } + } else { + if ((err = cipher_descriptor[lrw->cipher].ecb_decrypt(ct, ct, &lrw->key)) != CRYPT_OK) { + return err; + } + } + + /* xor prod */ +#ifdef LTC_FAST + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(ct + x)) = *((LTC_FAST_TYPE *)(ct + x)) ^ *((LTC_FAST_TYPE *)(prod + x)); + } +#else + for (x = 0; x < 16; x++) { + ct[x] = ct[x] ^ prod[x]; + } +#endif + + /* move to next */ + pt += 16; + ct += 16; + len -= 16; + } + + return CRYPT_OK; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_process.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/lrw/lrw_setiv.c b/core/lib/libtomcrypt/src/modes/lrw/lrw_setiv.c new file mode 100644 index 0000000..3cc6a11 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/lrw/lrw_setiv.c @@ -0,0 +1,106 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file lrw_setiv.c + LRW_MODE implementation, Set the current IV, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Set the IV for LRW + @param IV The IV, must be 16 octets + @param len Length ... must be 16 :-) + @param lrw The LRW state to update + @return CRYPT_OK if successful +*/ +int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw) +{ + int err; +#ifdef LTC_LRW_TABLES + unsigned char T[16]; + int x, y; +#endif + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(lrw != NULL); + + if (len != 16) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { + return err; + } + + /* copy the IV */ + XMEMCPY(lrw->IV, IV, 16); + + /* check if we have to actually do work */ + if (cipher_descriptor[lrw->cipher].accel_lrw_encrypt != NULL && cipher_descriptor[lrw->cipher].accel_lrw_decrypt != NULL) { + /* we have accelerators, let's bail since they don't use lrw->pad anyways */ + return CRYPT_OK; + } + +#ifdef LTC_LRW_TABLES + XMEMCPY(T, &lrw->PC[0][IV[0]][0], 16); + for (x = 1; x < 16; x++) { +#ifdef LTC_FAST + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(T + y)) ^= *((LTC_FAST_TYPE *)(&lrw->PC[x][IV[x]][y])); + } +#else + for (y = 0; y < 16; y++) { + T[y] ^= lrw->PC[x][IV[x]][y]; + } +#endif + } + XMEMCPY(lrw->pad, T, 16); +#else + gcm_gf_mult(lrw->tweak, IV, lrw->pad); +#endif + + return CRYPT_OK; +} + + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_setiv.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/lrw/lrw_start.c b/core/lib/libtomcrypt/src/modes/lrw/lrw_start.c new file mode 100644 index 0000000..4924ebf --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/lrw/lrw_start.c @@ -0,0 +1,130 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file lrw_start.c + LRW_MODE implementation, start mode, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Initialize the LRW context + @param cipher The cipher desired, must be a 128-bit block cipher + @param IV The index value, must be 128-bits + @param key The cipher key + @param keylen The length of the cipher key in octets + @param tweak The tweak value (second key), must be 128-bits + @param num_rounds The number of rounds for the cipher (0 == default) + @param lrw [out] The LRW state + @return CRYPT_OK on success. +*/ +int lrw_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, + const unsigned char *tweak, + int num_rounds, + symmetric_LRW *lrw) +{ + int err; +#ifdef LTC_LRW_TABLES + unsigned char B[16]; + int x, y, z, t; +#endif + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(tweak != NULL); + LTC_ARGCHK(lrw != NULL); + +#ifdef LTC_FAST + if (16 % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* is cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + if (cipher_descriptor[cipher].block_length != 16) { + return CRYPT_INVALID_CIPHER; + } + + /* schedule key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &lrw->key)) != CRYPT_OK) { + return err; + } + lrw->cipher = cipher; + + /* copy the IV and tweak */ + XMEMCPY(lrw->tweak, tweak, 16); + +#ifdef LTC_LRW_TABLES + /* setup tables */ + /* generate the first table as it has no shifting (from which we make the other tables) */ + zeromem(B, 16); + for (y = 0; y < 256; y++) { + B[0] = y; + gcm_gf_mult(tweak, B, &lrw->PC[0][y][0]); + } + + /* now generate the rest of the tables based the previous table */ + for (x = 1; x < 16; x++) { + for (y = 0; y < 256; y++) { + /* now shift it right by 8 bits */ + t = lrw->PC[x-1][y][15]; + for (z = 15; z > 0; z--) { + lrw->PC[x][y][z] = lrw->PC[x-1][y][z-1]; + } + lrw->PC[x][y][0] = gcm_shift_table[t<<1]; + lrw->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; + } + } +#endif + + /* generate first pad */ + return lrw_setiv(IV, 16, lrw); +} + + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_start.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/lrw/sub.mk b/core/lib/libtomcrypt/src/modes/lrw/sub.mk new file mode 100644 index 0000000..cd256f7 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/lrw/sub.mk @@ -0,0 +1,8 @@ +srcs-y += lrw_decrypt.c +srcs-y += lrw_done.c +srcs-y += lrw_encrypt.c +srcs-y += lrw_getiv.c +srcs-y += lrw_process.c +srcs-y += lrw_setiv.c +srcs-y += lrw_start.c +# srcs-y += lrw_test.c diff --git a/core/lib/libtomcrypt/src/modes/ofb/ofb_decrypt.c b/core/lib/libtomcrypt/src/modes/ofb/ofb_decrypt.c new file mode 100644 index 0000000..d034bbe --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ofb/ofb_decrypt.c @@ -0,0 +1,70 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ofb_decrypt.c + OFB implementation, decrypt data, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** + OFB decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len Length of ciphertext (octets) + @param ofb OFB state + @return CRYPT_OK if successful +*/ +int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_OFB *ofb) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ofb != NULL); + return ofb_encrypt(ct, pt, len, ofb); +} + + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_decrypt.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ofb/ofb_done.c b/core/lib/libtomcrypt/src/modes/ofb/ofb_done.c new file mode 100644 index 0000000..72bfb09 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ofb/ofb_done.c @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ofb_done.c + OFB implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** Terminate the chain + @param ofb The OFB chain to terminate + @return CRYPT_OK on success +*/ +int ofb_done(symmetric_OFB *ofb) +{ + int err; + LTC_ARGCHK(ofb != NULL); + + if ((err = cipher_is_valid(ofb->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[ofb->cipher].done(&ofb->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ofb/ofb_encrypt.c b/core/lib/libtomcrypt/src/modes/ofb/ofb_encrypt.c new file mode 100644 index 0000000..943d9ce --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ofb/ofb_encrypt.c @@ -0,0 +1,87 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ofb_encrypt.c + OFB implementation, encrypt data, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** + OFB encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len Length of plaintext (octets) + @param ofb OFB state + @return CRYPT_OK if successful +*/ +int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_OFB *ofb) +{ + int err; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ofb != NULL); + if ((err = cipher_is_valid(ofb->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (ofb->blocklen < 0 || ofb->blocklen > (int)sizeof(ofb->IV) || + ofb->padlen < 0 || ofb->padlen > (int)sizeof(ofb->IV)) { + return CRYPT_INVALID_ARG; + } + + while (len-- > 0) { + if (ofb->padlen == ofb->blocklen) { + if ((err = cipher_descriptor[ofb->cipher].ecb_encrypt(ofb->IV, ofb->IV, &ofb->key)) != CRYPT_OK) { + return err; + } + ofb->padlen = 0; + } + *ct++ = *pt++ ^ ofb->IV[(ofb->padlen)++]; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_encrypt.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ofb/ofb_getiv.c b/core/lib/libtomcrypt/src/modes/ofb/ofb_getiv.c new file mode 100644 index 0000000..ee2d73d --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ofb/ofb_getiv.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ofb_getiv.c + OFB implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param ofb The OFB state + @return CRYPT_OK if successful +*/ +int ofb_getiv(unsigned char *IV, unsigned long *len, symmetric_OFB *ofb) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(ofb != NULL); + if ((unsigned long)ofb->blocklen > *len) { + *len = ofb->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, ofb->IV, ofb->blocklen); + *len = ofb->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_getiv.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ofb/ofb_setiv.c b/core/lib/libtomcrypt/src/modes/ofb/ofb_setiv.c new file mode 100644 index 0000000..efb66c8 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ofb/ofb_setiv.c @@ -0,0 +1,79 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ofb_setiv.c + OFB implementation, set IV, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param ofb The OFB state + @return CRYPT_OK if successful +*/ +int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb) +{ + int err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(ofb != NULL); + + if ((err = cipher_is_valid(ofb->cipher)) != CRYPT_OK) { + return err; + } + + if (len != (unsigned long)ofb->blocklen) { + return CRYPT_INVALID_ARG; + } + + /* force next block */ + ofb->padlen = 0; + return cipher_descriptor[ofb->cipher].ecb_encrypt(IV, ofb->IV, &ofb->key); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_setiv.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ofb/ofb_start.c b/core/lib/libtomcrypt/src/modes/ofb/ofb_start.c new file mode 100644 index 0000000..9633614 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ofb/ofb_start.c @@ -0,0 +1,87 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file ofb_start.c + OFB implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_OFB_MODE + +/** + Initialize a OFB context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param ofb The OFB state to initialize + @return CRYPT_OK if successful +*/ +int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_OFB *ofb) +{ + int x, err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ofb != NULL); + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* copy details */ + ofb->cipher = cipher; + ofb->blocklen = cipher_descriptor[cipher].block_length; + for (x = 0; x < ofb->blocklen; x++) { + ofb->IV[x] = IV[x]; + } + + /* init the cipher */ + ofb->padlen = ofb->blocklen; + return cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ofb->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_start.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/modes/ofb/sub.mk b/core/lib/libtomcrypt/src/modes/ofb/sub.mk new file mode 100644 index 0000000..f1fceeb --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/ofb/sub.mk @@ -0,0 +1,6 @@ +srcs-y += ofb_decrypt.c +srcs-y += ofb_done.c +srcs-y += ofb_encrypt.c +srcs-y += ofb_getiv.c +srcs-y += ofb_setiv.c +srcs-y += ofb_start.c diff --git a/core/lib/libtomcrypt/src/modes/sub.mk b/core/lib/libtomcrypt/src/modes/sub.mk new file mode 100644 index 0000000..9177622 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/sub.mk @@ -0,0 +1,4 @@ +subdirs-$(_CFG_CRYPTO_WITH_CBC) += cbc +subdirs-$(CFG_CRYPTO_CTR) += ctr +subdirs-$(CFG_CRYPTO_ECB) += ecb +subdirs-$(CFG_CRYPTO_XTS) += xts diff --git a/core/lib/libtomcrypt/src/modes/xts/sub.mk b/core/lib/libtomcrypt/src/modes/xts/sub.mk new file mode 100644 index 0000000..255a20d --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/xts/sub.mk @@ -0,0 +1,6 @@ +srcs-y += xts_decrypt.c +srcs-y += xts_done.c +srcs-y += xts_encrypt.c +srcs-y += xts_init.c +srcs-y += xts_mult_x.c +# srcs-y += xts_test.c diff --git a/core/lib/libtomcrypt/src/modes/xts/xts_decrypt.c b/core/lib/libtomcrypt/src/modes/xts/xts_decrypt.c new file mode 100644 index 0000000..7e729a9 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/xts/xts_decrypt.c @@ -0,0 +1,187 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects +*/ + +#ifdef LTC_XTS_MODE + +static int tweak_uncrypt(const unsigned char *C, unsigned char *P, unsigned char *T, symmetric_xts *xts) +{ + unsigned long x; + int err; + + /* tweak encrypt block i */ +#ifdef LTC_FAST + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)&P[x]) = *((LTC_FAST_TYPE*)&C[x]) ^ *((LTC_FAST_TYPE*)&T[x]); + } +#else + for (x = 0; x < 16; x++) { + P[x] = C[x] ^ T[x]; + } +#endif + + err = cipher_descriptor[xts->cipher]->ecb_decrypt(P, P, &xts->key1); + +#ifdef LTC_FAST + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)&P[x]) ^= *((LTC_FAST_TYPE*)&T[x]); + } +#else + for (x = 0; x < 16; x++) { + P[x] = P[x] ^ T[x]; + } +#endif + + /* LFSR the tweak */ + xts_mult_x(T); + + return err; +} + +/** XTS Decryption + @param ct [in] Ciphertext + @param ptlen Length of plaintext (and ciphertext) + @param pt [out] Plaintext + @param tweak [in] The 128--bit encryption tweak (e.g. sector number) + @param xts The XTS structure + Returns CRYPT_OK upon success +*/ +int xts_decrypt(const unsigned char *ct, unsigned long ptlen, unsigned char *pt, unsigned char *tweak, + symmetric_xts *xts) +{ + const struct ltc_cipher_descriptor *desc; + unsigned char PP[16], CC[16], T[16]; + unsigned long i, m, mo, lim; + int err; + + /* check inputs */ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tweak != NULL); + LTC_ARGCHK(xts != NULL); + + /* check if valid */ + if ((err = cipher_is_valid(xts->cipher)) != CRYPT_OK) { + return err; + } + + /* get number of blocks */ + m = ptlen >> 4; + mo = ptlen & 15; + + /* must have at least one full block */ + if (m == 0) { + return CRYPT_INVALID_ARG; + } + + if (mo == 0) { + lim = m; + } else { + lim = m - 1; + } + + desc = cipher_descriptor[xts->cipher]; + + if (desc->accel_xts_decrypt && lim > 0) { + + /* use accelerated decryption for whole blocks */ + if ((err = desc->accel_xts_decrypt(ct, pt, lim, tweak, &xts->key1, + &xts->key2) != CRYPT_OK)) { + return err; + } + ct += lim * 16; + pt += lim * 16; + + /* tweak is encrypted on output */ + XMEMCPY(T, tweak, sizeof(T)); + } else { + /* encrypt the tweak */ + if ((err = desc->ecb_encrypt(tweak, T, &xts->key2)) != CRYPT_OK) { + return err; + } + + for (i = 0; i < lim; i++) { + if ((err = tweak_uncrypt(ct, pt, T, xts)) != CRYPT_OK) { + return err; + } + ct += 16; + pt += 16; + } + } + + /* if ptlen not divide 16 then */ + if (mo > 0) { + XMEMCPY(CC, T, 16); + xts_mult_x(CC); + + /* PP = tweak decrypt block m-1 */ + if ((err = tweak_uncrypt(ct, PP, CC, xts)) != CRYPT_OK) { + return err; + } + + /* Pm = first ptlen % 16 bytes of PP */ + for (i = 0; i < mo; i++) { + CC[i] = ct[16+i]; + pt[16+i] = PP[i]; + } + for (; i < 16; i++) { + CC[i] = PP[i]; + } + + /* Pm-1 = Tweak uncrypt CC */ + if ((err = tweak_uncrypt(CC, pt, T, xts)) != CRYPT_OK) { + return err; + } + } + /* Decrypt the tweak back */ + if ((err = desc->ecb_decrypt(T, tweak, &xts->key2)) != CRYPT_OK) { + return err; + } + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/xts/xts_decrypt.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2007/05/12 14:05:56 $ */ diff --git a/core/lib/libtomcrypt/src/modes/xts/xts_done.c b/core/lib/libtomcrypt/src/modes/xts/xts_done.c new file mode 100644 index 0000000..6d24fbe --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/xts/xts_done.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects +*/ + +#ifdef LTC_XTS_MODE + +/** Terminate XTS state + @param XTS The state to terminate +*/ +void xts_done(symmetric_xts *xts) +{ + LTC_ARGCHKVD(xts != NULL); + cipher_descriptor[xts->cipher]->done(&xts->key1); + cipher_descriptor[xts->cipher]->done(&xts->key2); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/xts/xts_done.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2007/03/10 23:59:09 $ */ + diff --git a/core/lib/libtomcrypt/src/modes/xts/xts_encrypt.c b/core/lib/libtomcrypt/src/modes/xts/xts_encrypt.c new file mode 100644 index 0000000..3448383 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/xts/xts_encrypt.c @@ -0,0 +1,189 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects +*/ + +#ifdef LTC_XTS_MODE + +static int tweak_crypt(const unsigned char *P, unsigned char *C, unsigned char *T, symmetric_xts *xts) +{ + unsigned long x; + int err; + + /* tweak encrypt block i */ +#ifdef LTC_FAST + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)&C[x]) = *((LTC_FAST_TYPE*)&P[x]) ^ *((LTC_FAST_TYPE*)&T[x]); + } +#else + for (x = 0; x < 16; x++) { + C[x] = P[x] ^ T[x]; + } +#endif + + if ((err = cipher_descriptor[xts->cipher]->ecb_encrypt(C, C, &xts->key1)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_FAST + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)&C[x]) ^= *((LTC_FAST_TYPE*)&T[x]); + } +#else + for (x = 0; x < 16; x++) { + C[x] = C[x] ^ T[x]; + } +#endif + + /* LFSR the tweak */ + xts_mult_x(T); + + return CRYPT_OK; +} + +/** XTS Encryption + @param pt [in] Plaintext + @param ptlen Length of plaintext (and ciphertext) + @param ct [out] Ciphertext + @param tweak [in] The 128--bit encryption tweak (e.g. sector number) + @param xts The XTS structure + Returns CRYPT_OK upon success +*/ +int xts_encrypt(const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tweak, + symmetric_xts *xts) +{ + const struct ltc_cipher_descriptor *desc; + unsigned char PP[16], CC[16], T[16]; + unsigned long i, m, mo, lim; + int err; + + /* check inputs */ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tweak != NULL); + LTC_ARGCHK(xts != NULL); + + /* check if valid */ + if ((err = cipher_is_valid(xts->cipher)) != CRYPT_OK) { + return err; + } + + /* get number of blocks */ + m = ptlen >> 4; + mo = ptlen & 15; + + /* must have at least one full block */ + if (m == 0) { + return CRYPT_INVALID_ARG; + } + + if (mo == 0) { + lim = m; + } else { + lim = m - 1; + } + + desc = cipher_descriptor[xts->cipher]; + + if (desc->accel_xts_encrypt && lim > 0) { + + /* use accelerated encryption for whole blocks */ + if ((err = desc->accel_xts_encrypt(pt, ct, lim, tweak, &xts->key1, + &xts->key2) != CRYPT_OK)) { + return err; + } + ct += lim * 16; + pt += lim * 16; + + /* tweak is encrypted on output */ + XMEMCPY(T, tweak, sizeof(T)); + } else { + + /* encrypt the tweak */ + if ((err = desc->ecb_encrypt(tweak, T, &xts->key2)) != CRYPT_OK) { + return err; + } + + for (i = 0; i < lim; i++) { + if ((err = tweak_crypt(pt, ct, T, xts)) != CRYPT_OK) { + return err; + } + ct += 16; + pt += 16; + } + } + + /* if ptlen not divide 16 then */ + if (mo > 0) { + /* CC = tweak encrypt block m-1 */ + if ((err = tweak_crypt(pt, CC, T, xts)) != CRYPT_OK) { + return err; + } + + /* Cm = first ptlen % 16 bytes of CC */ + for (i = 0; i < mo; i++) { + PP[i] = pt[16+i]; + ct[16+i] = CC[i]; + } + + for (; i < 16; i++) { + PP[i] = CC[i]; + } + + /* Cm-1 = Tweak encrypt PP */ + if ((err = tweak_crypt(PP, ct, T, xts)) != CRYPT_OK) { + return err; + } + } + + /* Decrypt the tweak back */ + if ((err = cipher_descriptor[xts->cipher]->ecb_decrypt(T, tweak, &xts->key2)) != CRYPT_OK) { + return err; + } + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/xts/xts_encrypt.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2007/05/12 14:05:56 $ */ diff --git a/core/lib/libtomcrypt/src/modes/xts/xts_init.c b/core/lib/libtomcrypt/src/modes/xts/xts_init.c new file mode 100644 index 0000000..318d381 --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/xts/xts_init.c @@ -0,0 +1,95 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects +*/ + +#ifdef LTC_XTS_MODE + + +/** Start XTS mode + @param cipher The index of the cipher to use + @param key1 The encrypt key + @param key2 The tweak encrypt key + @param keylen The length of the keys (each) in octets + @param num_rounds The number of rounds for the cipher (0 == default) + @param xts [out] XTS structure + Returns CRYPT_OK upon success. +*/ +int xts_start( int cipher, + const unsigned char *key1, + const unsigned char *key2, + unsigned long keylen, + int num_rounds, + symmetric_xts *xts) +{ + int err; + + /* check inputs */ + LTC_ARGCHK(key1 != NULL); + LTC_ARGCHK(key2 != NULL); + LTC_ARGCHK(xts != NULL); + + /* check if valid */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + if (cipher_descriptor[cipher]->block_length != 16) { + return CRYPT_INVALID_ARG; + } + + /* schedule the two ciphers */ + if ((err = cipher_descriptor[cipher]->setup(key1, keylen, num_rounds, &xts->key1)) != CRYPT_OK) { + return err; + } + if ((err = cipher_descriptor[cipher]->setup(key2, keylen, num_rounds, &xts->key2)) != CRYPT_OK) { + return err; + } + xts->cipher = cipher; + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/xts/xts_init.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2007/03/10 23:59:09 $ */ diff --git a/core/lib/libtomcrypt/src/modes/xts/xts_mult_x.c b/core/lib/libtomcrypt/src/modes/xts/xts_mult_x.c new file mode 100644 index 0000000..1c3478b --- /dev/null +++ b/core/lib/libtomcrypt/src/modes/xts/xts_mult_x.c @@ -0,0 +1,68 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects +*/ + +#ifdef LTC_XTS_MODE + +/** multiply by x + @param I The value to multiply by x (LFSR shift) +*/ +void xts_mult_x(unsigned char *I) +{ + int x; + unsigned char t, tt; + + for (x = t = 0; x < 16; x++) { + tt = I[x] >> 7; + I[x] = ((I[x] << 1) | t) & 0xFF; + t = tt; + } + if (tt) { + I[0] ^= 0x87; + } +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/xts/xts_mult_x.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2007/03/10 23:59:09 $ */ diff --git a/core/lib/libtomcrypt/src/mpa_desc.c b/core/lib/libtomcrypt/src/mpa_desc.c new file mode 100644 index 0000000..ed7c3e2 --- /dev/null +++ b/core/lib/libtomcrypt/src/mpa_desc.c @@ -0,0 +1,663 @@ +/* + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include "tomcrypt_mpa.h" +#include <mpa.h> + +mpa_scratch_mem external_mem_pool; + +void init_mpa_tomcrypt(const mpa_scratch_mem pool) +{ + external_mem_pool = pool; +} + +static int init_mpanum(mpanum *a) +{ + LTC_ARGCHK(a != NULL); + if (!mpa_alloc_static_temp_var(a, external_mem_pool)) + return CRYPT_MEM; + mpa_set_S32(*a, 0); + return CRYPT_OK; +} + +static int init(void **a) +{ + mpanum n; + int ret; + + ret = init_mpanum(&n); + *a = n; + return ret; +} + +static int init_size(int size_bits, void **a) +{ + LTC_ARGCHK(a != NULL); + if (!mpa_alloc_static_temp_var_size(size_bits, (mpanum *)a, + external_mem_pool)) + return CRYPT_MEM; + mpa_set_S32(*a, 0); + return CRYPT_OK; +} + +static void deinit_mpanum(mpanum a) +{ + LTC_ARGCHKVD(a != NULL); + + mpa_free_static_temp_var(&a, external_mem_pool); +} + +static void deinit(void *a) +{ + deinit_mpanum(a); +} + +static int neg(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpa_neg((mpanum)b, (const mpanum)a); + return CRYPT_OK; +} + +static int copy(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpa_copy((mpanum)b, (const mpanum)a); + return CRYPT_OK; +} + +static int init_copy(void **a, void *b) +{ + if (init(a) != CRYPT_OK) { + return CRYPT_MEM; + } + return copy(b, *a); +} + +/* ---- trivial ---- */ +static int set_int(void *a, unsigned long b) +{ + LTC_ARGCHK(a != NULL); + if (b > (unsigned long) UINT32_MAX) { + return CRYPT_INVALID_ARG; + } + mpa_set_word((mpanum) a, (mpa_word_t)b); + return CRYPT_OK; +} + +static unsigned long get_int(void *a) +{ + LTC_ARGCHK(a != NULL); + return mpa_get_word((mpanum)a); +} + +static ltc_mp_digit get_digit(void *a, int n) +{ + LTC_ARGCHK(a != NULL); + return __mpanum_get_word(n, (mpanum) a); +} + +static int get_digit_count(void *a) +{ + LTC_ARGCHK(a != NULL); + return __mpanum_size((mpanum) a); +} + +static int compare(void *a, void *b) +{ + int ret; + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + ret = mpa_cmp((const mpanum)a, (const mpanum)b); + if (ret < 0) { + return LTC_MP_LT; + } else if (ret > 0) { + return LTC_MP_GT; + } else { + return LTC_MP_EQ; + } +} + +static int compare_d(void *a, unsigned long b) +{ + int ret; + LTC_ARGCHK(a != NULL); + // this particular case must be handled separately... + if (b > (unsigned long) MPA_INT_MAX) { + mpanum tmp = (mpanum) a; + ret = (tmp->size <= 0 ? LTC_MP_LT : + tmp->size > 1 ? LTC_MP_GT : + tmp->d[0] < b ? LTC_MP_LT : + tmp->d[0] == b ? LTC_MP_EQ : LTC_MP_GT); + } else { + ret = mpa_cmp_short(((const mpanum)a), b); + } + if (ret < 0) { + return LTC_MP_LT; + } else if (ret > 0) { + return LTC_MP_GT; + } else { + return LTC_MP_EQ; + } +} + +static int count_bits(void *a) +{ + LTC_ARGCHK(a != NULL); + // mpa_highest_bit_index returns the index of the highest '1' bit starting at 0 + // so adding 1 to the result gives the wanted result + return mpa_highest_bit_index((const mpanum)a) + 1; +} + +static int count_lsb_bits(void *a) +{ + LTC_ARGCHK(a != NULL); + if (((mpanum)a)->size == 0) { + return 0; + } + int zero_limb_nbr = 0; + int zero_bit_nbr = 0; + const mpanum aa = (mpanum) a; + while (aa->d[zero_limb_nbr] == 0) { + ++zero_limb_nbr; + } + zero_bit_nbr = zero_limb_nbr * MPA_WORD_SIZE; + while (!mpa_get_bit(aa, zero_bit_nbr)) { + ++zero_bit_nbr; + } + + return zero_bit_nbr; +} + + +static int twoexpt(void *a, int n) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(n >= 0); + int i; + mpa_asize_t q; /* quotient of n div WORD_SIZE */ + mpa_asize_t r; /* remainder of n div WORD_SIZE */ + + r = n & (MPA_WORD_SIZE - 1); /* 0 <= r < WORD_SIZE */ + q = n >> MPA_LOG_OF_WORD_SIZE; /* 0 <= q */ + + if (((mpanum)a)->alloc < (q + 1)) { + return CRYPT_MEM; + } + ((mpanum)a)->size = q + 1; + for (i = 0; i < ((mpanum)a)->size; ++i) { + ((mpanum)a)->d[i] = 0; + } + ((mpanum)a)->d[q] = 1UL << r; + return CRYPT_OK; +} + +/* ---- conversions ---- */ + +/* read ascii string */ +static int read_radix(void *a, const char *b, int radix) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + if (radix != 16) { + return CRYPT_ERROR; + } + mpa_set_str((mpanum)a, b); + return CRYPT_OK; +} + +/* write one */ +static int write_radix(void *a, char *b, int radix) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + if (mpa_get_str(b, MPA_STRING_MODE_HEX_UC, (const mpanum)a) == 0) { + return CRYPT_MEM; + } + return CRYPT_OK; +} + +/* get size as unsigned char string */ +static unsigned long unsigned_size(void *a) +{ + unsigned long t; + LTC_ARGCHK(a != NULL); + t = count_bits(a); + if (mpa_cmp_short((const mpanum)a, 0) == 0) return 0; + return (t>>3) + ((t&7)?1:0); +} + +/* store */ +static int unsigned_write(void *a, unsigned char *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + size_t len = unsigned_size(a); + mpa_get_oct_str(b, &len, (const mpanum) a); + return CRYPT_OK; +} + +/* read */ +static int unsigned_read(void *a, unsigned char *b, unsigned long len) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpa_set_oct_str((mpanum) a, b, len, 0); + return CRYPT_OK; +} + +/* add */ +static int add(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpa_add((mpanum) c, (const mpanum) a, (const mpanum) b, external_mem_pool); + return CRYPT_OK; +} + +static int addi(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + if (b > (unsigned long) UINT32_MAX) { + return CRYPT_INVALID_ARG; + } + mpa_add_word((mpanum) c, (const mpanum) a, b, external_mem_pool); + return CRYPT_OK; +} + +/* sub */ +static int sub(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpa_sub((mpanum) c, (const mpanum) a, (const mpanum) b, external_mem_pool); + return CRYPT_OK; +} + +static int subi(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + if (b > (unsigned long) UINT32_MAX) { + return CRYPT_INVALID_ARG; + } + mpa_sub_word((mpanum) c, (const mpanum) a, b, external_mem_pool); + return CRYPT_OK; +} + +/* mul */ +static int mul(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpa_mul((mpanum) c, (const mpanum) a, (const mpanum) b, external_mem_pool); + return CRYPT_OK; +} + +static int muli(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + if (b > (unsigned long) UINT32_MAX) { + return CRYPT_INVALID_ARG; + } + mpa_mul_word((mpanum) c, (const mpanum) a, b, external_mem_pool); + return CRYPT_OK; +} + +/* sqr */ +static int sqr(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpa_mul((mpanum) b, (const mpanum) a, (const mpanum) a, external_mem_pool); + return CRYPT_OK; +} + +/* div */ +static int divide(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpa_div(c, d, (const mpanum) a, (const mpanum) b, external_mem_pool); + return CRYPT_OK; +} + +static int div_2(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpa_shift_right(b, a, 1); + return CRYPT_OK; +} + +/* modi */ +static int modi(void *a, unsigned long b, unsigned long *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + if (b > (unsigned long) UINT32_MAX) { + return CRYPT_INVALID_ARG; + } + int err; + void *tmp; + if ((err = init(&tmp)) != CRYPT_OK) { + return CRYPT_MEM; + } + + if (set_int(tmp, b) != CRYPT_OK) {goto err;} + if (divide(a, tmp, NULL, tmp) != CRYPT_OK) {goto err;} + + *c = get_int(tmp); + + err: + deinit(tmp); + return CRYPT_OK; +} + +/* gcd */ +static int gcd(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpa_gcd((mpanum) c, (const mpanum) a, (const mpanum) b, external_mem_pool); + return CRYPT_OK; +} + +/* lcm */ +static int lcm(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + void *tmp; + if (init(&tmp) != CRYPT_OK) { + return CRYPT_MEM; + } + + if (mul(a, b, tmp) != CRYPT_OK) {goto err;} + if (gcd(a, b, c) != CRYPT_OK) {goto err;} + + /* We use the following equality: gcd(a, b) * lcm(a, b) = a * b */ + if (divide(tmp, c, c, NULL) != CRYPT_OK) {goto err;} + err: + deinit(tmp); + return CRYPT_OK; +} + +static int mod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpa_mod((mpanum) c, (const mpanum) a, (const mpanum) b, external_mem_pool); + if (mpa_cmp_short(c, 0) < 0) { + mpa_add(c, c, b, external_mem_pool); + } + return CRYPT_OK; +} + +static int mulmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + void *tmpa, *tmpb; + + mp_init_multi(&tmpa, &tmpb, NULL); + + mod(a, c, tmpa); + mod(b, c, tmpb); + mpa_mul_mod((mpanum) d, (const mpanum) tmpa, (const mpanum) tmpb, (const mpanum) c, external_mem_pool); + mp_clear_multi(tmpa, tmpb, NULL); + return CRYPT_OK; +} + +static int sqrmod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mulmod(a, a, b, c); +} + +/* invmod */ +static int invmod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(b != c); + mod(a, b, c); + if (mpa_inv_mod((mpanum) c, (const mpanum) c, (const mpanum) b, external_mem_pool) != 0) { + return CRYPT_ERROR; + } + + return CRYPT_OK; +} + +/* setup */ +static int montgomery_setup(void *a, void **b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpa_word_t len = mpa_fmm_context_size_in_U32(count_bits(a)); + *b = malloc(len * sizeof(mpa_word_t)); + if (*b == NULL) { + return CRYPT_MEM; + } + mpa_fmm_context_base * b_tmp = (mpa_fmm_context_base *) *b; + mpa_init_static_fmm_context(b_tmp, len); + mpa_compute_fmm_context((const mpanum) a, b_tmp->r_ptr, b_tmp->r2_ptr, &(b_tmp->n_inv), external_mem_pool); + return CRYPT_OK; +} + +/* get normalization value */ +static int montgomery_normalization(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpa_asize_t s; + s = __mpanum_size((mpanum) b); + twoexpt(a, s * MPA_WORD_SIZE); + mpa_mod((mpanum) a, (const mpanum) a, (const mpanum) b, external_mem_pool); + return CRYPT_OK; +} + +/* reduce */ +static int montgomery_reduce(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpanum tmp; + + if (init_mpanum(&tmp) != CRYPT_OK) { + return CRYPT_MEM; + } + // WARNING + // Workaround for a bug when a > b (a greater than the modulus) + if (compare(a, b) == LTC_MP_GT) { + mpa_mod((mpanum) a, (const mpanum) a, (const mpanum) b, external_mem_pool); + } + mpa_montgomery_mul(tmp, + (mpanum) a, + mpa_constant_one(), + (mpanum) b, + ((mpa_fmm_context) c)->n_inv, + external_mem_pool); + mpa_copy(a, tmp); + deinit(tmp); + return CRYPT_OK; +} + +/* clean up */ +static void montgomery_deinit(void *a) +{ + free(a); +} + +static int exptmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + void *c_mont; + if (montgomery_setup(c, &c_mont) != CRYPT_OK) { + return CRYPT_MEM; + } + + void *d_tmp; + int memguard; + + memguard = (a == d || b == d); + + if (memguard) { + if (init(&d_tmp) != CRYPT_OK) { + return CRYPT_MEM; + } + } else { + d_tmp = d; + } + + // WARNING !! + // Temporary fix, since ExpMod behaves badly when a > c + // (ie "a" is greater than the modulus) + mod(a, c, d_tmp); + + + mpa_exp_mod((mpanum) d, + (const mpanum) d_tmp, + (const mpanum) b, + (const mpanum) c, + ((mpa_fmm_context)c_mont)->r_ptr, + ((mpa_fmm_context)c_mont)->r2_ptr, + ((mpa_fmm_context)c_mont)->n_inv, + external_mem_pool); + montgomery_deinit(c_mont); + if (memguard) { + deinit(d_tmp); + } + return CRYPT_OK; +} + +static int isprime(void *a, int b, int *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + LTC_UNUSED_PARAM(b); + *c = mpa_is_prob_prime((mpanum) a, 100, external_mem_pool) != 0 ? LTC_MP_YES : LTC_MP_NO; + return CRYPT_OK; +} + +ltc_math_descriptor ltc_mp = { + .name = "MPA", + .bits_per_digit = MPA_WORD_SIZE, + + .init = &init, + .init_size = &init_size, + .init_copy = &init_copy, + .deinit = &deinit, + + .neg = &neg, + .copy = ©, + + .set_int = &set_int, + .get_int = &get_int, + .get_digit = &get_digit, + .get_digit_count = &get_digit_count, + .compare = &compare, + .compare_d = &compare_d, + .count_bits = &count_bits, + .count_lsb_bits = &count_lsb_bits, + .twoexpt = &twoexpt, + + .read_radix = &read_radix, + .write_radix = &write_radix, + .unsigned_size = &unsigned_size, + .unsigned_write = &unsigned_write, + .unsigned_read = &unsigned_read, + + .add = &add, + .addi = &addi, + .sub = &sub, + .subi = &subi, + .mul = &mul, + .muli = &muli, + .sqr = &sqr, + .mpdiv = ÷, + .div_2 = &div_2, + .modi = &modi, + .gcd = &gcd, + .lcm = &lcm, + + .mod = &mod, + .mulmod = &mulmod, + .sqrmod = &sqrmod, + .invmod = &invmod, + + .montgomery_setup = &montgomery_setup, + .montgomery_normalization = &montgomery_normalization, + .montgomery_reduce = &montgomery_reduce, + .montgomery_deinit = &montgomery_deinit, + + .exptmod = &exptmod, + .isprime = &isprime, + +#ifdef LTC_MECC +#ifdef LTC_MECC_FP + .ecc_ptmul = <c_ecc_fp_mulmod, +#else + .ecc_ptmul = <c_ecc_mulmod, +#endif /* LTC_MECC_FP */ + .ecc_ptadd = <c_ecc_projective_add_point, + .ecc_ptdbl = <c_ecc_projective_dbl_point, + .ecc_map = <c_ecc_map, +#ifdef LTC_ECC_SHAMIR +#ifdef LTC_MECC_FP + .ecc_mul2add = <c_ecc_fp_mul2add, +#else + .ecc_mul2add = <c_ecc_mul2add, +#endif /* LTC_MECC_FP */ +#endif /* LTC_ECC_SHAMIR */ +#endif /* LTC_MECC */ + +#ifdef LTC_MRSA + .rsa_keygen = &rsa_make_key, + .rsa_me = &rsa_exptmod, +#endif + +}; diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c new file mode 100644 index 0000000..9d16d90 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c @@ -0,0 +1,129 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_bit_string.c + ASN.1 DER, encode a BIT STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a BIT STRING + @param in The DER encoded BIT STRING + @param inlen The size of the DER BIT STRING + @param out [out] The array of bits stored (one per char) + @param outlen [in/out] The number of bits stored + @return CRYPT_OK if successful +*/ +int der_decode_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long dlen, blen, x, y; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* packet must be at least 4 bytes */ + if (inlen < 4) { + return CRYPT_INVALID_ARG; + } + + /* check for 0x03 */ + if ((in[0]&0x1F) != 0x03) { + return CRYPT_INVALID_PACKET; + } + + /* offset in the data */ + x = 1; + + /* get the length of the data */ + if (in[x] & 0x80) { + /* long format get number of length bytes */ + y = in[x++] & 0x7F; + + /* invalid if 0 or > 2 */ + if (y == 0 || y > 2) { + return CRYPT_INVALID_PACKET; + } + + /* read the data len */ + dlen = 0; + while (y--) { + dlen = (dlen << 8) | (unsigned long)in[x++]; + } + } else { + /* short format */ + dlen = in[x++] & 0x7F; + } + + /* is the data len too long or too short? */ + if ((dlen == 0) || (dlen + x > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* get padding count */ + blen = ((dlen - 1) << 3) - (in[x++] & 7); + + /* too many bits? */ + if (blen > *outlen) { + *outlen = blen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* decode/store the bits */ + for (y = 0; y < blen; y++) { + out[y] = (in[x] & (1 << (7 - (y & 7)))) ? 1 : 0; + if ((y & 7) == 7) { + ++x; + } + } + + /* we done */ + *outlen = blen; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_decode_raw_bit_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_decode_raw_bit_string.c new file mode 100644 index 0000000..a857933 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_decode_raw_bit_string.c @@ -0,0 +1,133 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_bit_string.c + ASN.1 DER, encode a BIT STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +#define SETBIT(v, n) (v=((unsigned char)(v) | (1U << (unsigned char)(n)))) + +/** + Store a BIT STRING + @param in The DER encoded BIT STRING + @param inlen The size of the DER BIT STRING + @param out [out] The array of bits stored (8 per char) + @param outlen [in/out] The number of bits stored + @return CRYPT_OK if successful +*/ +int der_decode_raw_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long dlen, blen, x, y; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* packet must be at least 4 bytes */ + if (inlen < 4) { + return CRYPT_INVALID_ARG; + } + + /* check for 0x03 */ + if ((in[0]&0x1F) != 0x03) { + return CRYPT_INVALID_PACKET; + } + + /* offset in the data */ + x = 1; + + /* get the length of the data */ + if (in[x] & 0x80) { + /* long format get number of length bytes */ + y = in[x++] & 0x7F; + + /* invalid if 0 or > 2 */ + if (y == 0 || y > 2) { + return CRYPT_INVALID_PACKET; + } + + /* read the data len */ + dlen = 0; + while (y--) { + dlen = (dlen << 8) | (unsigned long)in[x++]; + } + } else { + /* short format */ + dlen = in[x++] & 0x7F; + } + + /* is the data len too long or too short? */ + if ((dlen == 0) || (dlen + x > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* get padding count */ + blen = ((dlen - 1) << 3) - (in[x++] & 7); + + /* too many bits? */ + if (blen > *outlen) { + *outlen = blen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* decode/store the bits */ + for (y = 0; y < blen; y++) { + if (in[x] & (1 << (7 - (y & 7)))) { + SETBIT(out[y/8], 7-(y%8)); + } + if ((y & 7) == 7) { + ++x; + } + } + + /* we done */ + *outlen = blen; + return CRYPT_OK; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c new file mode 100644 index 0000000..1776fc0 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c @@ -0,0 +1,116 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_bit_string.c + ASN.1 DER, encode a BIT STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a BIT STRING + @param in The array of bits to store (one per char) + @param inlen The number of bits tostore + @param out [out] The destination for the DER encoded BIT STRING + @param outlen [in/out] The max size and resulting size of the DER BIT STRING + @return CRYPT_OK if successful +*/ +int der_encode_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long len, x, y; + unsigned char buf; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* avoid overflows */ + if ((err = der_length_bit_string(inlen, &len)) != CRYPT_OK) { + return err; + } + + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* store header (include bit padding count in length) */ + x = 0; + y = (inlen >> 3) + ((inlen&7) ? 1 : 0) + 1; + + out[x++] = 0x03; + if (y < 128) { + out[x++] = (unsigned char)y; + } else if (y < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)y; + } else if (y < 65536) { + out[x++] = 0x82; + out[x++] = (unsigned char)((y>>8)&255); + out[x++] = (unsigned char)(y&255); + } + + /* store number of zero padding bits */ + out[x++] = (unsigned char)((8 - inlen) & 7); + + /* store the bits in big endian format */ + for (y = buf = 0; y < inlen; y++) { + buf |= (in[y] ? 1 : 0) << (7 - (y & 7)); + if ((y & 7) == 7) { + out[x++] = buf; + buf = 0; + } + } + /* store last byte */ + if (inlen & 7) { + out[x++] = buf; + } + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_encode_raw_bit_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_encode_raw_bit_string.c new file mode 100644 index 0000000..8035e44 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_encode_raw_bit_string.c @@ -0,0 +1,119 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_bit_string.c + ASN.1 DER, encode a BIT STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +#define getbit(n, k) (((n) & ( 1 << (k) )) >> (k)) + +/** + Store a BIT STRING + @param in The array of bits to store (8 per char) + @param inlen The number of bits tostore + @param out [out] The destination for the DER encoded BIT STRING + @param outlen [in/out] The max size and resulting size of the DER BIT STRING + @return CRYPT_OK if successful +*/ +int der_encode_raw_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long len, x, y; + unsigned char buf; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* avoid overflows */ + if ((err = der_length_bit_string(inlen, &len)) != CRYPT_OK) { + return err; + } + + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* store header (include bit padding count in length) */ + x = 0; + y = (inlen >> 3) + ((inlen&7) ? 1 : 0) + 1; + + out[x++] = 0x03; + if (y < 128) { + out[x++] = (unsigned char)y; + } else if (y < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)y; + } else if (y < 65536) { + out[x++] = 0x82; + out[x++] = (unsigned char)((y>>8)&255); + out[x++] = (unsigned char)(y&255); + } + + /* store number of zero padding bits */ + out[x++] = (unsigned char)((8 - inlen) & 7); + + /* store the bits in big endian format */ + for (y = buf = 0; y < inlen; y++) { + buf |= (getbit(in[y/8],7-y%8)?1:0) << (7 - (y & 7)); + if ((y & 7) == 7) { + out[x++] = buf; + buf = 0; + } + } + /* store last byte */ + if (inlen & 7) { + out[x++] = buf; + } + + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c new file mode 100644 index 0000000..3966716 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c @@ -0,0 +1,81 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_bit_string.c + ASN.1 DER, get length of BIT STRING, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Gets length of DER encoding of BIT STRING + @param nbits The number of bits in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_bit_string(unsigned long nbits, unsigned long *outlen) +{ + unsigned long nbytes; + LTC_ARGCHK(outlen != NULL); + + /* get the number of the bytes */ + nbytes = (nbits >> 3) + ((nbits & 7) ? 1 : 0) + 1; + + if (nbytes < 128) { + /* 03 LL PP DD DD DD ... */ + *outlen = 2 + nbytes; + } else if (nbytes < 256) { + /* 03 81 LL PP DD DD DD ... */ + *outlen = 3 + nbytes; + } else if (nbytes < 65536) { + /* 03 82 LL LL PP DD DD DD ... */ + *outlen = 4 + nbytes; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/bit/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/bit/sub.mk new file mode 100644 index 0000000..4cf829e --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/bit/sub.mk @@ -0,0 +1,5 @@ +srcs-y += der_decode_bit_string.c +srcs-y += der_encode_bit_string.c +srcs-y += der_length_bit_string.c +srcs-y += der_decode_raw_bit_string.c +srcs-y += der_encode_raw_bit_string.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c b/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c new file mode 100644 index 0000000..96c31fe --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c @@ -0,0 +1,74 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_boolean.c + ASN.1 DER, decode a BOOLEAN, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Read a BOOLEAN + @param in The destination for the DER encoded BOOLEAN + @param inlen The size of the DER BOOLEAN + @param out [out] The boolean to decode + @return CRYPT_OK if successful +*/ +int der_decode_boolean(const unsigned char *in, unsigned long inlen, + int *out) +{ + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + + if (inlen < 3 || in[0] != 0x01 || in[1] != 0x01 || (in[2] != 0x00 && in[2] != 0xFF)) { + return CRYPT_INVALID_ARG; + } + + *out = (in[2]==0xFF) ? 1 : 0; + + return CRYPT_OK; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c b/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c new file mode 100644 index 0000000..90bf24b --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c @@ -0,0 +1,78 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_boolean.c + ASN.1 DER, encode a BOOLEAN, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a BOOLEAN + @param in The boolean to encode + @param out [out] The destination for the DER encoded BOOLEAN + @param outlen [in/out] The max size and resulting size of the DER BOOLEAN + @return CRYPT_OK if successful +*/ +int der_encode_boolean(int in, + unsigned char *out, unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(out != NULL); + + if (*outlen < 3) { + *outlen = 3; + return CRYPT_BUFFER_OVERFLOW; + } + + *outlen = 3; + out[0] = 0x01; + out[1] = 0x01; + out[2] = in ? 0xFF : 0x00; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c b/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c new file mode 100644 index 0000000..3f677c5 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c @@ -0,0 +1,62 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_boolean.c + ASN.1 DER, get length of a BOOLEAN, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Gets length of DER encoding of a BOOLEAN + @param outlen [out] The length of the DER encoding + @return CRYPT_OK if successful +*/ +int der_length_boolean(unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + *outlen = 3; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/boolean/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/boolean/sub.mk new file mode 100644 index 0000000..3761249 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/boolean/sub.mk @@ -0,0 +1,3 @@ +srcs-y += der_decode_boolean.c +srcs-y += der_encode_boolean.c +srcs-y += der_length_boolean.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c b/core/lib/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c new file mode 100644 index 0000000..b2b8bc0 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c @@ -0,0 +1,245 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_choice.c + ASN.1 DER, decode a CHOICE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Decode a CHOICE + @param in The DER encoded input + @param inlen [in/out] The size of the input and resulting size of read type + @param list The list of items to decode + @param outlen The number of items in the list + @return CRYPT_OK on success +*/ +int der_decode_choice(const unsigned char *in, unsigned long *inlen, + ltc_asn1_list *list, unsigned long outlen) +{ + unsigned long size, x, z; + void *data; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != NULL); + LTC_ARGCHK(list != NULL); + + /* get blk size */ + if (*inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* set all of the "used" flags to zero */ + for (x = 0; x < outlen; x++) { + list[x].used = 0; + } + + /* now scan until we have a winner */ + for (x = 0; x < outlen; x++) { + size = list[x].size; + data = list[x].data; + + switch (list[x].type) { + case LTC_ASN1_BOOLEAN: + if (der_decode_boolean(in, *inlen, data) == CRYPT_OK) { + if (der_length_boolean(&z) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_INTEGER: + if (der_decode_integer(in, *inlen, data) == CRYPT_OK) { + if (der_length_integer(data, &z) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_SHORT_INTEGER: + if (der_decode_short_integer(in, *inlen, data) == CRYPT_OK) { + if (der_length_short_integer(size, &z) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_BIT_STRING: + if (der_decode_bit_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_bit_string(size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_RAW_BIT_STRING: + if (der_decode_raw_bit_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_bit_string(size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_OCTET_STRING: + if (der_decode_octet_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_octet_string(size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_NULL: + if (*inlen == 2 && in[x] == 0x05 && in[x+1] == 0x00) { + *inlen = 2; + list[x].used = 1; + return CRYPT_OK; + } + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + if (der_decode_object_identifier(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_object_identifier(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_TELETEX_STRING: + if (der_decode_teletex_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_teletex_string(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_IA5_STRING: + if (der_decode_ia5_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_ia5_string(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_PRINTABLE_STRING: + if (der_decode_printable_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_printable_string(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_UTF8_STRING: + if (der_decode_utf8_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_utf8_string(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_UTCTIME: + z = *inlen; + if (der_decode_utctime(in, &z, data) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + break; + + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + if (der_decode_sequence(in, *inlen, data, size) == CRYPT_OK) { + if (der_length_sequence(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + return CRYPT_INVALID_ARG; + default: + return CRYPT_INVALID_ARG; + } + } + + return CRYPT_INVALID_PACKET; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/choice/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/choice/sub.mk new file mode 100644 index 0000000..d3b95ec --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/choice/sub.mk @@ -0,0 +1 @@ +srcs-y += der_decode_choice.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c new file mode 100644 index 0000000..d1dc468 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c @@ -0,0 +1,123 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_ia5_string.c + ASN.1 DER, encode a IA5 STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a IA5 STRING + @param in The DER encoded IA5 STRING + @param inlen The size of the DER IA5 STRING + @param out [out] The array of octets stored (one per char) + @param outlen [in/out] The number of octets stored + @return CRYPT_OK if successful +*/ +int der_decode_ia5_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int t; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x16 */ + if ((in[0] & 0x1F) != 0x16) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + /* is it too long? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read the data */ + for (y = 0; y < len; y++) { + t = der_ia5_value_decode(in[x++]); + if (t == -1) { + return CRYPT_INVALID_ARG; + } + out[y] = t; + } + + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c new file mode 100644 index 0000000..17a6354 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c @@ -0,0 +1,112 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_ia5_string.c + ASN.1 DER, encode a IA5 STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Store an IA5 STRING + @param in The array of IA5 to store (one per char) + @param inlen The number of IA5 to store + @param out [out] The destination for the DER encoded IA5 STRING + @param outlen [in/out] The max size and resulting size of the DER IA5 STRING + @return CRYPT_OK if successful +*/ +int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get the size */ + if ((err = der_length_ia5_string(in, inlen, &len)) != CRYPT_OK) { + return err; + } + + /* too big? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* encode the header+len */ + x = 0; + out[x++] = 0x16; + if (inlen < 128) { + out[x++] = (unsigned char)inlen; + } else if (inlen < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)inlen; + } else if (inlen < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else if (inlen < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((inlen>>16)&255); + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else { + return CRYPT_INVALID_ARG; + } + + /* store octets */ + for (y = 0; y < inlen; y++) { + out[x++] = der_ia5_char_encode(in[y]); + } + + /* retun length */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c new file mode 100644 index 0000000..7acea72 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c @@ -0,0 +1,221 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_ia5_string.c + ASN.1 DER, get length of IA5 STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +static const struct { + int code, value; +} ia5_table[] = { +{ '\0', 0 }, +{ '\a', 7 }, +{ '\b', 8 }, +{ '\t', 9 }, +{ '\n', 10 }, +{ '\f', 12 }, +{ '\r', 13 }, +{ ' ', 32 }, +{ '!', 33 }, +{ '"', 34 }, +{ '#', 35 }, +{ '$', 36 }, +{ '%', 37 }, +{ '&', 38 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '*', 42 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ ';', 59 }, +{ '<', 60 }, +{ '=', 61 }, +{ '>', 62 }, +{ '?', 63 }, +{ '@', 64 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ '[', 91 }, +{ '\\', 92 }, +{ ']', 93 }, +{ '^', 94 }, +{ '_', 95 }, +{ '`', 96 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +{ '{', 123 }, +{ '|', 124 }, +{ '}', 125 }, +{ '~', 126 } +}; + +int der_ia5_char_encode(int c) +{ + int x; + for (x = 0; x < (int)(sizeof(ia5_table)/sizeof(ia5_table[0])); x++) { + if (ia5_table[x].code == c) { + return ia5_table[x].value; + } + } + return -1; +} + +int der_ia5_value_decode(int v) +{ + int x; + for (x = 0; x < (int)(sizeof(ia5_table)/sizeof(ia5_table[0])); x++) { + if (ia5_table[x].value == v) { + return ia5_table[x].code; + } + } + return -1; +} + +/** + Gets length of DER encoding of IA5 STRING + @param octets The values you want to encode + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen) +{ + unsigned long x; + + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(octets != NULL); + + /* scan string for validity */ + for (x = 0; x < noctets; x++) { + if (der_ia5_char_encode(octets[x]) == -1) { + return CRYPT_INVALID_ARG; + } + } + + if (noctets < 128) { + /* 16 LL DD DD DD ... */ + *outlen = 2 + noctets; + } else if (noctets < 256) { + /* 16 81 LL DD DD DD ... */ + *outlen = 3 + noctets; + } else if (noctets < 65536UL) { + /* 16 82 LL LL DD DD DD ... */ + *outlen = 4 + noctets; + } else if (noctets < 16777216UL) { + /* 16 83 LL LL LL DD DD DD ... */ + *outlen = 5 + noctets; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/ia5/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/ia5/sub.mk new file mode 100644 index 0000000..dc32a5d --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/ia5/sub.mk @@ -0,0 +1,3 @@ +srcs-y += der_decode_ia5_string.c +srcs-y += der_encode_ia5_string.c +srcs-y += der_length_ia5_string.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c b/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c new file mode 100644 index 0000000..195ba0f --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c @@ -0,0 +1,137 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_integer.c + ASN.1 DER, decode an integer, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Read a mp_int integer + @param in The DER encoded data + @param inlen Size of DER encoded data + @param num The first mp_int to decode + @return CRYPT_OK if successful +*/ +int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) +{ + unsigned long x, y, z; + int err; + + LTC_ARGCHK(num != NULL); + LTC_ARGCHK(in != NULL); + + /* min DER INTEGER is 0x02 01 00 == 0 */ + if (inlen < (1 + 1 + 1)) { + return CRYPT_INVALID_PACKET; + } + + /* ok expect 0x02 when we AND with 0001 1111 [1F] */ + x = 0; + if ((in[x++] & 0x1F) != 0x02) { + return CRYPT_INVALID_PACKET; + } + + /* now decode the len stuff */ + z = in[x++]; + + if ((z & 0x80) == 0x00) { + /* short form */ + + /* will it overflow? */ + if (x + z > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* no so read it */ + if ((err = mp_read_unsigned_bin(num, (unsigned char *)in + x, z)) != CRYPT_OK) { + return err; + } + } else { + /* long form */ + z &= 0x7F; + + /* will number of length bytes overflow? (or > 4) */ + if (((x + z) > inlen) || (z > 4) || (z == 0)) { + return CRYPT_INVALID_PACKET; + } + + /* now read it in */ + y = 0; + while (z--) { + y = ((unsigned long)(in[x++])) | (y << 8); + } + + /* now will reading y bytes overrun? */ + if ((x + y) > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* no so read it */ + if ((err = mp_read_unsigned_bin(num, (unsigned char *)in + x, y)) != CRYPT_OK) { + return err; + } + } + + /* see if it's negative */ + if (in[x] & 0x80) { + void *tmp; + if (mp_init(&tmp) != CRYPT_OK) { + return CRYPT_MEM; + } + + if (mp_2expt(tmp, mp_count_bits(num)) != CRYPT_OK || mp_sub(num, tmp, num) != CRYPT_OK) { + mp_clear(tmp); + return CRYPT_MEM; + } + mp_clear(tmp); + } + + return CRYPT_OK; + +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c b/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c new file mode 100644 index 0000000..466522b --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c @@ -0,0 +1,157 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_integer.c + ASN.1 DER, encode an integer, Tom St Denis +*/ + + +#ifdef LTC_DER + +/* Exports a positive bignum as DER format (upto 2^32 bytes in size) */ +/** + Store a mp_int integer + @param num The first mp_int to encode + @param out [out] The destination for the DER encoded integers + @param outlen [in/out] The max size and resulting size of the DER encoded integers + @return CRYPT_OK if successful +*/ +int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) +{ + unsigned long tmplen, y; + int err, leading_zero; + + LTC_ARGCHK(num != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* find out how big this will be */ + if ((err = der_length_integer(num, &tmplen)) != CRYPT_OK) { + return err; + } + + if (*outlen < tmplen) { + *outlen = tmplen; + return CRYPT_BUFFER_OVERFLOW; + } + + if (mp_cmp_d(num, 0) != LTC_MP_LT) { + /* we only need a leading zero if the msb of the first byte is one */ + if ((mp_count_bits(num) & 7) == 0 || mp_iszero(num) == LTC_MP_YES) { + leading_zero = 1; + } else { + leading_zero = 0; + } + + /* get length of num in bytes (plus 1 since we force the msbyte to zero) */ + y = mp_unsigned_bin_size(num) + leading_zero; + } else { + leading_zero = 0; + y = mp_count_bits(num); + y = y + (8 - (y & 7)); + y = y >> 3; + if (((mp_cnt_lsb(num)+1)==mp_count_bits(num)) && ((mp_count_bits(num)&7)==0)) --y; + } + + /* now store initial data */ + *out++ = 0x02; + if (y < 128) { + /* short form */ + *out++ = (unsigned char)y; + } else if (y < 256) { + *out++ = 0x81; + *out++ = (unsigned char)y; + } else if (y < 65536UL) { + *out++ = 0x82; + *out++ = (unsigned char)((y>>8)&255); + *out++ = (unsigned char)y; + } else if (y < 16777216UL) { + *out++ = 0x83; + *out++ = (unsigned char)((y>>16)&255); + *out++ = (unsigned char)((y>>8)&255); + *out++ = (unsigned char)y; + } else { + return CRYPT_INVALID_ARG; + } + + /* now store msbyte of zero if num is non-zero */ + if (leading_zero) { + *out++ = 0x00; + } + + /* if it's not zero store it as big endian */ + if (mp_cmp_d(num, 0) == LTC_MP_GT) { + /* now store the mpint */ + if ((err = mp_to_unsigned_bin(num, out)) != CRYPT_OK) { + return err; + } + } else if (mp_iszero(num) != LTC_MP_YES) { + void *tmp; + + /* negative */ + if (mp_init(&tmp) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* 2^roundup and subtract */ + y = mp_count_bits(num); + y = y + (8 - (y & 7)); + if (((mp_cnt_lsb(num)+1)==mp_count_bits(num)) && ((mp_count_bits(num)&7)==0)) y -= 8; + if (mp_2expt(tmp, y) != CRYPT_OK || mp_add(tmp, num, tmp) != CRYPT_OK) { + mp_clear(tmp); + return CRYPT_MEM; + } + if ((err = mp_to_unsigned_bin(tmp, out)) != CRYPT_OK) { + mp_clear(tmp); + return err; + } + mp_clear(tmp); + } + + /* we good */ + *outlen = tmplen; + return CRYPT_OK; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c b/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c new file mode 100644 index 0000000..7205a9d --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c @@ -0,0 +1,108 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_integer.c + ASN.1 DER, get length of encoding, Tom St Denis +*/ + + +#ifdef LTC_DER +/** + Gets length of DER encoding of num + @param num The int to get the size of + @param outlen [out] The length of the DER encoding for the given integer + @return CRYPT_OK if successful +*/ +int der_length_integer(void *num, unsigned long *outlen) +{ + unsigned long z, len; + int leading_zero; + + LTC_ARGCHK(num != NULL); + LTC_ARGCHK(outlen != NULL); + + if (mp_cmp_d(num, 0) != LTC_MP_LT) { + /* positive */ + + /* we only need a leading zero if the msb of the first byte is one */ + if ((mp_count_bits(num) & 7) == 0 || mp_iszero(num) == LTC_MP_YES) { + leading_zero = 1; + } else { + leading_zero = 0; + } + + /* size for bignum */ + z = len = leading_zero + mp_unsigned_bin_size(num); + } else { + /* it's negative */ + /* find power of 2 that is a multiple of eight and greater than count bits */ + z = mp_count_bits(num); + z = z + (8 - (z & 7)); + if (((mp_cnt_lsb(num)+1)==mp_count_bits(num)) && ((mp_count_bits(num)&7)==0)) --z; + len = z = z >> 3; + } + + /* now we need a length */ + if (z < 128) { + /* short form */ + ++len; + } else { + /* long form (relies on z != 0), assumes length bytes < 128 */ + ++len; + + while (z) { + ++len; + z >>= 8; + } + } + + /* we need a 0x02 to indicate it's INTEGER */ + ++len; + + /* return length */ + *outlen = len; + return CRYPT_OK; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/integer/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/integer/sub.mk new file mode 100644 index 0000000..d319f91 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/integer/sub.mk @@ -0,0 +1,3 @@ +srcs-y += der_decode_integer.c +srcs-y += der_encode_integer.c +srcs-y += der_length_integer.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c b/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c new file mode 100644 index 0000000..13d5f1c --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c @@ -0,0 +1,126 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_object_identifier.c + ASN.1 DER, Decode Object Identifier, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Decode OID data and store the array of integers in words + @param in The OID DER encoded data + @param inlen The length of the OID data + @param words [out] The destination of the OID words + @param outlen [in/out] The number of OID words + @return CRYPT_OK if successful +*/ +int der_decode_object_identifier(const unsigned char *in, unsigned long inlen, + unsigned long *words, unsigned long *outlen) +{ + unsigned long x, y, t, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(words != NULL); + LTC_ARGCHK(outlen != NULL); + + /* header is at least 3 bytes */ + if (inlen < 3) { + return CRYPT_INVALID_PACKET; + } + + /* must be room for at least two words */ + if (*outlen < 2) { + return CRYPT_BUFFER_OVERFLOW; + } + + /* decode the packet header */ + x = 0; + if ((in[x++] & 0x1F) != 0x06) { + return CRYPT_INVALID_PACKET; + } + + /* get the length */ + if (in[x] < 128) { + len = in[x++]; + } else { + if (in[x] < 0x81 || in[x] > 0x82) { + return CRYPT_INVALID_PACKET; + } + y = in[x++] & 0x7F; + len = 0; + while (y--) { + len = (len << 8) | (unsigned long)in[x++]; + } + } + + if (len < 1 || (len + x) > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* decode words */ + y = 0; + t = 0; + while (len--) { + t = (t << 7) | (in[x] & 0x7F); + if (!(in[x++] & 0x80)) { + /* store t */ + if (y >= *outlen) { + return CRYPT_BUFFER_OVERFLOW; + } + if (y == 0) { + words[0] = t / 40; + words[1] = t % 40; + y = 2; + } else { + words[y++] = t; + } + t = 0; + } + } + + *outlen = y; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c b/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c new file mode 100644 index 0000000..890114d --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c @@ -0,0 +1,138 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_object_identifier.c + ASN.1 DER, Encode Object Identifier, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Encode an OID + @param words The words to encode (upto 32-bits each) + @param nwords The number of words in the OID + @param out [out] Destination of OID data + @param outlen [in/out] The max and resulting size of the OID + @return CRYPT_OK if successful +*/ +int der_encode_object_identifier(unsigned long *words, unsigned long nwords, + unsigned char *out, unsigned long *outlen) +{ + unsigned long i, x, y, z, t, mask, wordbuf; + int err; + + LTC_ARGCHK(words != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* check length */ + if ((err = der_length_object_identifier(words, nwords, &x)) != CRYPT_OK) { + return err; + } + if (x > *outlen) { + *outlen = x; + return CRYPT_BUFFER_OVERFLOW; + } + + /* compute length to store OID data */ + z = 0; + wordbuf = words[0] * 40 + words[1]; + for (y = 1; y < nwords; y++) { + t = der_object_identifier_bits(wordbuf); + z += t/7 + ((t%7) ? 1 : 0) + (wordbuf == 0 ? 1 : 0); + if (y < nwords - 1) { + wordbuf = words[y + 1]; + } + } + + /* store header + length */ + x = 0; + out[x++] = 0x06; + if (z < 128) { + out[x++] = (unsigned char)z; + } else if (z < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)z; + } else if (z < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((z>>8)&255); + out[x++] = (unsigned char)(z&255); + } else { + return CRYPT_INVALID_ARG; + } + + /* store first byte */ + wordbuf = words[0] * 40 + words[1]; + for (i = 1; i < nwords; i++) { + /* store 7 bit words in little endian */ + t = wordbuf & 0xFFFFFFFF; + if (t) { + y = x; + mask = 0; + while (t) { + out[x++] = (unsigned char)((t & 0x7F) | mask); + t >>= 7; + mask |= 0x80; /* upper bit is set on all but the last byte */ + } + /* now swap bytes y...x-1 */ + z = x - 1; + while (y < z) { + t = out[y]; out[y] = out[z]; out[z] = (unsigned char)t; + ++y; + --z; + } + } else { + /* zero word */ + out[x++] = 0x00; + } + + if (i < nwords - 1) { + wordbuf = words[i + 1]; + } + } + + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c b/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c new file mode 100644 index 0000000..d2fd0e0 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c @@ -0,0 +1,116 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_object_identifier.c + ASN.1 DER, get length of Object Identifier, Tom St Denis +*/ + +#ifdef LTC_DER + +unsigned long der_object_identifier_bits(unsigned long x) +{ + unsigned long c; + x &= 0xFFFFFFFF; + c = 0; + while (x) { + ++c; + x >>= 1; + } + return c; +} + + +/** + Gets length of DER encoding of Object Identifier + @param nwords The number of OID words + @param words The actual OID words to get the size of + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_object_identifier(unsigned long *words, unsigned long nwords, unsigned long *outlen) +{ + unsigned long y, z, t, wordbuf; + + LTC_ARGCHK(words != NULL); + LTC_ARGCHK(outlen != NULL); + + + /* must be >= 2 words */ + if (nwords < 2) { + return CRYPT_INVALID_ARG; + } + + /* word1 = 0,1,2,3 and word2 0..39 */ + if (words[0] > 3 || (words[0] < 2 && words[1] > 39)) { + return CRYPT_INVALID_ARG; + } + + /* leading word is the first two */ + z = 0; + wordbuf = words[0] * 40 + words[1]; + for (y = 1; y < nwords; y++) { + t = der_object_identifier_bits(wordbuf); + z += t/7 + ((t%7) ? 1 : 0) + (wordbuf == 0 ? 1 : 0); + if (y < nwords - 1) { + /* grab next word */ + wordbuf = words[y+1]; + } + } + + /* now depending on the length our length encoding changes */ + if (z < 128) { + z += 2; + } else if (z < 256) { + z += 3; + } else if (z < 65536UL) { + z += 4; + } else { + return CRYPT_INVALID_ARG; + } + + *outlen = z; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/sub.mk new file mode 100644 index 0000000..b56efb0 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/object_identifier/sub.mk @@ -0,0 +1,3 @@ +srcs-y += der_decode_object_identifier.c +srcs-y += der_encode_object_identifier.c +srcs-y += der_length_object_identifier.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c new file mode 100644 index 0000000..bae4760 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c @@ -0,0 +1,118 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_octet_string.c + ASN.1 DER, encode a OCTET STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a OCTET STRING + @param in The DER encoded OCTET STRING + @param inlen The size of the DER OCTET STRING + @param out [out] The array of octets stored (one per char) + @param outlen [in/out] The number of octets stored + @return CRYPT_OK if successful +*/ +int der_decode_octet_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x04 */ + if ((in[0] & 0x1F) != 0x04) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + /* is it too long? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read the data */ + for (y = 0; y < len; y++) { + out[y] = in[x++]; + } + + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c new file mode 100644 index 0000000..395774c --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c @@ -0,0 +1,113 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_octet_string.c + ASN.1 DER, encode a OCTET STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store an OCTET STRING + @param in The array of OCTETS to store (one per char) + @param inlen The number of OCTETS to store + @param out [out] The destination for the DER encoded OCTET STRING + @param outlen [in/out] The max size and resulting size of the DER OCTET STRING + @return CRYPT_OK if successful +*/ +int der_encode_octet_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get the size */ + if ((err = der_length_octet_string(inlen, &len)) != CRYPT_OK) { + return err; + } + + /* too big? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* encode the header+len */ + x = 0; + out[x++] = 0x04; + if (inlen < 128) { + out[x++] = (unsigned char)inlen; + } else if (inlen < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)inlen; + } else if (inlen < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else if (inlen < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((inlen>>16)&255); + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else { + return CRYPT_INVALID_ARG; + } + + /* store octets */ + for (y = 0; y < inlen; y++) { + out[x++] = in[y]; + } + + /* retun length */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c new file mode 100644 index 0000000..25ff5f8 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c @@ -0,0 +1,80 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_octet_string.c + ASN.1 DER, get length of OCTET STRING, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Gets length of DER encoding of OCTET STRING + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_octet_string(unsigned long noctets, unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + + if (noctets < 128) { + /* 04 LL DD DD DD ... */ + *outlen = 2 + noctets; + } else if (noctets < 256) { + /* 04 81 LL DD DD DD ... */ + *outlen = 3 + noctets; + } else if (noctets < 65536UL) { + /* 04 82 LL LL DD DD DD ... */ + *outlen = 4 + noctets; + } else if (noctets < 16777216UL) { + /* 04 83 LL LL LL DD DD DD ... */ + *outlen = 5 + noctets; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/octet/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/octet/sub.mk new file mode 100644 index 0000000..04607ee --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/octet/sub.mk @@ -0,0 +1,3 @@ +srcs-y += der_decode_octet_string.c +srcs-y += der_encode_octet_string.c +srcs-y += der_length_octet_string.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c new file mode 100644 index 0000000..4688c38 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c @@ -0,0 +1,123 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_printable_string.c + ASN.1 DER, encode a printable STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a printable STRING + @param in The DER encoded printable STRING + @param inlen The size of the DER printable STRING + @param out [out] The array of octets stored (one per char) + @param outlen [in/out] The number of octets stored + @return CRYPT_OK if successful +*/ +int der_decode_printable_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int t; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x13 */ + if ((in[0] & 0x1F) != 0x13) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + /* is it too long? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read the data */ + for (y = 0; y < len; y++) { + t = der_printable_value_decode(in[x++]); + if (t == -1) { + return CRYPT_INVALID_ARG; + } + out[y] = t; + } + + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c new file mode 100644 index 0000000..f94bd5e --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c @@ -0,0 +1,112 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_printable_string.c + ASN.1 DER, encode a printable STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Store an printable STRING + @param in The array of printable to store (one per char) + @param inlen The number of printable to store + @param out [out] The destination for the DER encoded printable STRING + @param outlen [in/out] The max size and resulting size of the DER printable STRING + @return CRYPT_OK if successful +*/ +int der_encode_printable_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get the size */ + if ((err = der_length_printable_string(in, inlen, &len)) != CRYPT_OK) { + return err; + } + + /* too big? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* encode the header+len */ + x = 0; + out[x++] = 0x13; + if (inlen < 128) { + out[x++] = (unsigned char)inlen; + } else if (inlen < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)inlen; + } else if (inlen < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else if (inlen < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((inlen>>16)&255); + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else { + return CRYPT_INVALID_ARG; + } + + /* store octets */ + for (y = 0; y < inlen; y++) { + out[x++] = der_printable_char_encode(in[y]); + } + + /* retun length */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c new file mode 100644 index 0000000..73cd8ee --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c @@ -0,0 +1,193 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_printable_string.c + ASN.1 DER, get length of Printable STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +static const struct { + int code, value; +} printable_table[] = { +{ ' ', 32 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ '=', 61 }, +{ '?', 63 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +}; + +int der_printable_char_encode(int c) +{ + int x; + for (x = 0; x < (int)(sizeof(printable_table)/sizeof(printable_table[0])); x++) { + if (printable_table[x].code == c) { + return printable_table[x].value; + } + } + return -1; +} + +int der_printable_value_decode(int v) +{ + int x; + for (x = 0; x < (int)(sizeof(printable_table)/sizeof(printable_table[0])); x++) { + if (printable_table[x].value == v) { + return printable_table[x].code; + } + } + return -1; +} + +/** + Gets length of DER encoding of Printable STRING + @param octets The values you want to encode + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_printable_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen) +{ + unsigned long x; + + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(octets != NULL); + + /* scan string for validity */ + for (x = 0; x < noctets; x++) { + if (der_printable_char_encode(octets[x]) == -1) { + return CRYPT_INVALID_ARG; + } + } + + if (noctets < 128) { + /* 16 LL DD DD DD ... */ + *outlen = 2 + noctets; + } else if (noctets < 256) { + /* 16 81 LL DD DD DD ... */ + *outlen = 3 + noctets; + } else if (noctets < 65536UL) { + /* 16 82 LL LL DD DD DD ... */ + *outlen = 4 + noctets; + } else if (noctets < 16777216UL) { + /* 16 83 LL LL LL DD DD DD ... */ + *outlen = 5 + noctets; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/sub.mk new file mode 100644 index 0000000..b509209 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/printable_string/sub.mk @@ -0,0 +1,3 @@ +srcs-y += der_decode_printable_string.c +srcs-y += der_encode_printable_string.c +srcs-y += der_length_printable_string.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c new file mode 100644 index 0000000..2973361 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c @@ -0,0 +1,347 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + + +/** + @file der_decode_sequence_ex.c + ASN.1 DER, decode a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Decode a SEQUENCE + @param in The DER encoded input + @param inlen The size of the input + @param list The list of items to decode + @param outlen The number of items in the list + @param ordered Search an unordeded or ordered list + @return CRYPT_OK on success +*/ +int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, + ltc_asn1_list *list, unsigned long outlen, int ordered) +{ + int err, i; + ltc_asn1_type type; + unsigned long size, x, y, z, blksize; + void *data; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(list != NULL); + + /* get blk size */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* sequence type? We allow 0x30 SEQUENCE and 0x31 SET since fundamentally they're the same structure */ + x = 0; + if (in[x] != 0x30 && in[x] != 0x31) { + return CRYPT_INVALID_PACKET; + } + ++x; + + /* check if the msb is set, which signals that the + * 7 lsb bits represent the number of bytes of the length + */ + if (in[x] < 128) { + blksize = in[x++]; + } else { + if (in[x] < 0x81 || in[x] > 0x83) { + return CRYPT_INVALID_PACKET; + } + y = in[x++] & 0x7F; + + /* would reading the len bytes overrun? */ + if (x + y > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read len */ + blksize = 0; + while (y--) { + blksize = (blksize << 8) | (unsigned long)in[x++]; + } + } + + /* would this blksize overflow? */ + if (x + blksize > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* mark all as unused */ + for (i = 0; i < (int)outlen; i++) { + list[i].used = 0; + } + + /* ok read data */ + inlen = blksize; + for (i = 0; i < (int)outlen; i++) { + z = 0; + type = list[i].type; + size = list[i].size; + data = list[i].data; + if (!ordered && list[i].used == 1) { continue; } + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + z = inlen; + if ((err = der_decode_boolean(in + x, z, ((int *)data))) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = der_length_boolean(&z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_INTEGER: + z = inlen; + if ((err = der_decode_integer(in + x, z, data)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + if ((err = der_length_integer(data, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_SHORT_INTEGER: + z = inlen; + if ((err = der_decode_short_integer(in + x, z, data)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + if ((err = der_length_short_integer(((unsigned long*)data)[0], &z)) != CRYPT_OK) { + goto LBL_ERR; + } + + break; + + case LTC_ASN1_BIT_STRING: + z = inlen; + if ((err = der_decode_bit_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_bit_string(size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_RAW_BIT_STRING: + z = inlen; + if ((err = der_decode_raw_bit_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_bit_string(size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_OCTET_STRING: + z = inlen; + if ((err = der_decode_octet_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_octet_string(size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_NULL: + if (inlen < 2 || in[x] != 0x05 || in[x+1] != 0x00) { + if (!ordered) { continue; } + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + z = 2; + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + z = inlen; + if ((err = der_decode_object_identifier(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_object_identifier(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_TELETEX_STRING: + z = inlen; + if ((err = der_decode_teletex_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_teletex_string(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_IA5_STRING: + z = inlen; + if ((err = der_decode_ia5_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_ia5_string(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + + case LTC_ASN1_PRINTABLE_STRING: + z = inlen; + if ((err = der_decode_printable_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_printable_string(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_UTF8_STRING: + z = inlen; + if ((err = der_decode_utf8_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_utf8_string(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_UTCTIME: + z = inlen; + if ((err = der_decode_utctime(in + x, &z, data)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + break; + + case LTC_ASN1_SET: + z = inlen; + if ((err = der_decode_set(in + x, z, data, size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + if ((err = der_length_sequence(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + /* detect if we have the right type */ + if ((type == LTC_ASN1_SETOF && (in[x] & 0x3F) != 0x31) || (type == LTC_ASN1_SEQUENCE && (in[x] & 0x3F) != 0x30)) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + z = inlen; + if ((err = der_decode_sequence(in + x, z, data, size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + if ((err = der_length_sequence(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + + case LTC_ASN1_CHOICE: + z = inlen; + if ((err = der_decode_choice(in + x, &z, data, size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + break; + + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + default: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + x += z; + inlen -= z; + list[i].used = 1; + if (!ordered) { + /* restart the decoder */ + i = -1; + } + } + + for (i = 0; i < (int)outlen; i++) { + if (list[i].used == 0) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + } + err = CRYPT_OK; + +LBL_ERR: + return err; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c new file mode 100644 index 0000000..e8969ed --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c @@ -0,0 +1,460 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_sequence_flexi.c + ASN.1 DER, decode an array of ASN.1 types with a flexi parser, Tom St Denis +*/ + +#ifdef LTC_DER + +static unsigned long fetch_length(const unsigned char *in, unsigned long inlen, unsigned long *data_offset) +{ + unsigned long x, z; + + *data_offset = 0; + + /* skip type and read len */ + if (inlen < 2) { + return 0xFFFFFFFF; + } + ++in; ++(*data_offset); + + /* read len */ + x = *in++; ++(*data_offset); + + /* <128 means literal */ + if (x < 128) { + return x+*data_offset; + } + x &= 0x7F; /* the lower 7 bits are the length of the length */ + inlen -= 2; + + /* len means len of len! */ + if (x == 0 || x > 4 || x > inlen) { + return 0xFFFFFFFF; + } + + *data_offset += x; + z = 0; + while (x--) { + z = (z<<8) | ((unsigned long)*in); + ++in; + } + return z+*data_offset; +} + +/** + ASN.1 DER Flexi(ble) decoder will decode arbitrary DER packets and create a linked list of the decoded elements. + @param in The input buffer + @param inlen [in/out] The length of the input buffer and on output the amount of decoded data + @param out [out] A pointer to the linked list + @return CRYPT_OK on success. +*/ +int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out) +{ + ltc_asn1_list *l; + unsigned long err, type, len, totlen, data_offset; + void *realloc_tmp; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != NULL); + LTC_ARGCHK(out != NULL); + + l = NULL; + totlen = 0; + + /* scan the input and and get lengths and what not */ + while (*inlen) { + /* read the type byte */ + type = *in; + + /* fetch length */ + len = fetch_length(in, *inlen, &data_offset); + if (len > *inlen) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* alloc new link */ + if (l == NULL) { + l = XCALLOC(1, sizeof(*l)); + if (l == NULL) { + err = CRYPT_MEM; + goto error; + } + } else { + l->next = XCALLOC(1, sizeof(*l)); + if (l->next == NULL) { + err = CRYPT_MEM; + goto error; + } + l->next->prev = l; + l = l->next; + } + + if ((type & 0x20) && (type != 0x30) && (type != 0x31)) { + /* constructed, use the 'used' field to store the original identifier */ + l->used = type; + /* treat constructed elements like SETs */ + type = 0x20; + } + else if ((type & 0xC0) == 0x80) { + /* context-specific, use the 'used' field to store the original identifier */ + l->used = type; + /* context-specific elements are treated as opaque data */ + type = 0x80; + } + + /* now switch on type */ + switch (type) { + case 0x01: /* BOOLEAN */ + l->type = LTC_ASN1_BOOLEAN; + l->size = 1; + l->data = XCALLOC(1, sizeof(int)); + + if ((err = der_decode_boolean(in, *inlen, l->data)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_boolean(&len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x02: /* INTEGER */ + /* init field */ + l->type = LTC_ASN1_INTEGER; + l->size = 1; + if ((err = mp_init(&l->data)) != CRYPT_OK) { + goto error; + } + + /* decode field */ + if ((err = der_decode_integer(in, *inlen, l->data)) != CRYPT_OK) { + goto error; + } + + /* calc length of object */ + if ((err = der_length_integer(l->data, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x03: /* BIT */ + /* init field */ + l->type = LTC_ASN1_BIT_STRING; + l->size = len * 8; /* *8 because we store decoded bits one per char and they are encoded 8 per char. */ + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_bit_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_bit_string(l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x04: /* OCTET */ + + /* init field */ + l->type = LTC_ASN1_OCTET_STRING; + l->size = len; + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_octet_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_octet_string(l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x05: /* NULL */ + + /* valid NULL is 0x05 0x00 */ + if (in[0] != 0x05 || in[1] != 0x00) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* simple to store ;-) */ + l->type = LTC_ASN1_NULL; + l->data = NULL; + l->size = 0; + len = 2; + + break; + + case 0x06: /* OID */ + + /* init field */ + l->type = LTC_ASN1_OBJECT_IDENTIFIER; + l->size = len; + + if ((l->data = XCALLOC(len, sizeof(unsigned long))) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_object_identifier(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_object_identifier(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + + /* resize it to save a bunch of mem */ + if ((realloc_tmp = XREALLOC(l->data, l->size * sizeof(unsigned long))) == NULL) { + /* out of heap but this is not an error */ + break; + } + l->data = realloc_tmp; + break; + + case 0x0C: /* UTF8 */ + + /* init field */ + l->type = LTC_ASN1_UTF8_STRING; + l->size = len; + + if ((l->data = XCALLOC(sizeof(wchar_t), l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_utf8_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_utf8_string(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x13: /* PRINTABLE */ + + /* init field */ + l->type = LTC_ASN1_PRINTABLE_STRING; + l->size = len; + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_printable_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_printable_string(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x14: /* TELETEXT */ + + /* init field */ + l->type = LTC_ASN1_TELETEX_STRING; + l->size = len; + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_teletex_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_teletex_string(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x16: /* IA5 */ + + /* init field */ + l->type = LTC_ASN1_IA5_STRING; + l->size = len; + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_ia5_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_ia5_string(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x17: /* UTC TIME */ + + /* init field */ + l->type = LTC_ASN1_UTCTIME; + l->size = 1; + + if ((l->data = XCALLOC(1, sizeof(ltc_utctime))) == NULL) { + err = CRYPT_MEM; + goto error; + } + + len = *inlen; + if ((err = der_decode_utctime(in, &len, l->data)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_utctime(l->data, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x20: /* Any CONSTRUCTED element that is neither SEQUENCE nor SET */ + case 0x30: /* SEQUENCE */ + case 0x31: /* SET */ + + /* init field */ + if (type == 0x20) { + l->type = LTC_ASN1_CONSTRUCTED; + } + else if (type == 0x30) { + l->type = LTC_ASN1_SEQUENCE; + } + else { + l->type = LTC_ASN1_SET; + } + + /* jump to the start of the data */ + in += data_offset; + *inlen -= data_offset; + len = len - data_offset; + + /* Sequence elements go as child */ + if ((err = der_decode_sequence_flexi(in, &len, &(l->child))) != CRYPT_OK) { + goto error; + } + + /* len update */ + totlen += data_offset; + + /* the flexi decoder can also do nothing, so make sure a child has been allocated */ + if (l->child) { + /* link them up y0 */ + l->child->parent = l; + } + + break; + + case 0x80: /* Context-specific */ + l->type = LTC_ASN1_CONTEXT_SPECIFIC; + + if ((l->data = XCALLOC(1, len - data_offset)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + XMEMCPY(l->data, in + data_offset, len - data_offset); + l->size = len - data_offset; + + break; + + default: + /* invalid byte ... this is a soft error */ + /* remove link */ + if (l->prev) { + l = l->prev; + XFREE(l->next); + l->next = NULL; + } + goto outside; + } + + /* advance pointers */ + totlen += len; + in += len; + *inlen -= len; + } + +outside: + + /* in case we processed anything */ + if (totlen) { + /* rewind l please */ + while (l->prev != NULL || l->parent != NULL) { + if (l->parent != NULL) { + l = l->parent; + } else { + l = l->prev; + } + } + } + + /* return */ + *out = l; + *inlen = totlen; + return CRYPT_OK; + +error: + /* free list */ + der_sequence_free(l); + + return err; +} + +#endif + + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c new file mode 100644 index 0000000..ea23558 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c @@ -0,0 +1,180 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + + +/** + @file der_decode_sequence_multi.c + ASN.1 DER, decode a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Decode a SEQUENCE type using a VA list + @param in Input buffer + @param inlen Length of input in octets + @remark <...> is of the form <type, size, data> (int, unsigned long, void*) + @return CRYPT_OK on success +*/ +int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...) +{ + int err; + ltc_asn1_type type; + unsigned long size, x; + void *data; + va_list args; + ltc_asn1_list *list; + + LTC_ARGCHK(in != NULL); + + /* get size of output that will be required */ + va_start(args, inlen); + x = 0; + for (;;) { + type = va_arg(args, ltc_asn1_type); + size = va_arg(args, unsigned long); + data = va_arg(args, void*); + LTC_UNUSED_PARAM(size); + LTC_UNUSED_PARAM(data); + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_OCTET_STRING: + case LTC_ASN1_NULL: + case LTC_ASN1_OBJECT_IDENTIFIER: + case LTC_ASN1_IA5_STRING: + case LTC_ASN1_PRINTABLE_STRING: + case LTC_ASN1_UTF8_STRING: + case LTC_ASN1_UTCTIME: + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + case LTC_ASN1_CHOICE: + case LTC_ASN1_RAW_BIT_STRING: + case LTC_ASN1_TELETEX_STRING: + ++x; + break; + + case LTC_ASN1_EOL: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + va_end(args); + return CRYPT_INVALID_ARG; + default: + va_end(args); + return CRYPT_INVALID_ARG; + } + } + va_end(args); + + /* allocate structure for x elements */ + if (x == 0) { + return CRYPT_NOP; + } + + list = XCALLOC(sizeof(*list), x); + if (list == NULL) { + return CRYPT_MEM; + } + + /* fill in the structure */ + va_start(args, inlen); + x = 0; + for (;;) { + type = va_arg(args, ltc_asn1_type); + size = va_arg(args, unsigned long); + data = va_arg(args, void*); + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_OCTET_STRING: + case LTC_ASN1_NULL: + case LTC_ASN1_OBJECT_IDENTIFIER: + case LTC_ASN1_IA5_STRING: + case LTC_ASN1_PRINTABLE_STRING: + case LTC_ASN1_UTF8_STRING: + case LTC_ASN1_UTCTIME: + case LTC_ASN1_SEQUENCE: + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_CHOICE: + case LTC_ASN1_RAW_BIT_STRING: + case LTC_ASN1_TELETEX_STRING: + LTC_SET_ASN1(list, x++, type, data, size); + break; + /* coverity[dead_error_line] */ + case LTC_ASN1_EOL: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + break; + default: + va_end(args); + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + va_end(args); + + err = der_decode_sequence(in, inlen, list, x); +LBL_ERR: + XFREE(list); + return err; +} + +#endif + + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_subject_public_key_info.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_subject_public_key_info.c new file mode 100644 index 0000000..22569bb --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_decode_subject_public_key_info.c @@ -0,0 +1,131 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + */ +#include "tomcrypt.h" +/** + @file der_encode_sequence_multi.c + ASN.1 DER, encode a Subject Public Key structure --nmav +*/ + +#ifdef LTC_DER + +/* AlgorithmIdentifier := SEQUENCE { + * algorithm OBJECT IDENTIFIER, + * parameters ANY DEFINED BY algorithm + * } + * + * SubjectPublicKeyInfo := SEQUENCE { + * algorithm AlgorithmIdentifier, + * subjectPublicKey BIT STRING + * } + */ +/** + Encode a SEQUENCE type using a VA list + @param out [out] Destination for data + @param outlen [in/out] Length of buffer and resulting length of output + @remark <...> is of the form <type, size, data> (int, unsigned long, void*) + @return CRYPT_OK on success +*/ +int der_decode_subject_public_key_info(const unsigned char *in, unsigned long inlen, + unsigned int algorithm, void* public_key, unsigned long* public_key_len, + unsigned long parameters_type, ltc_asn1_list* parameters, unsigned long parameters_len) +{ + int err; + unsigned long len; + oid_st oid; + unsigned char *tmpbuf; + unsigned long tmpoid[16]; + ltc_asn1_list alg_id[2]; + ltc_asn1_list subject_pubkey[2]; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != 0); + LTC_ARGCHK(public_key_len != NULL); + + err = pk_get_oid(algorithm, &oid); + if (err != CRYPT_OK) { + return err; + } + + /* see if the OpenSSL DER format RSA public key will work */ + tmpbuf = XCALLOC(1, LTC_DER_MAX_PUBKEY_SIZE*8); + if (tmpbuf == NULL) { + err = CRYPT_MEM; + goto LBL_ERR; + } + + /* this includes the internal hash ID and optional params (NULL in this case) */ + LTC_SET_ASN1(alg_id, 0, LTC_ASN1_OBJECT_IDENTIFIER, tmpoid, sizeof(tmpoid)/sizeof(tmpoid[0])); + LTC_SET_ASN1(alg_id, 1, parameters_type, parameters, parameters_len); + + /* the actual format of the SSL DER key is odd, it stores a RSAPublicKey + * in a **BIT** string ... so we have to extract it then proceed to convert bit to octet + */ + LTC_SET_ASN1(subject_pubkey, 0, LTC_ASN1_SEQUENCE, alg_id, 2); + LTC_SET_ASN1(subject_pubkey, 1, LTC_ASN1_RAW_BIT_STRING, tmpbuf, LTC_DER_MAX_PUBKEY_SIZE*8); + + err=der_decode_sequence(in, inlen, subject_pubkey, 2UL); + if (err != CRYPT_OK) { + goto LBL_ERR; + } + + if ((alg_id[0].size != oid.OIDlen) || + XMEMCMP(oid.OID, alg_id[0].data, oid.OIDlen * sizeof(oid.OID[0]))) { + /* OID mismatch */ + err = CRYPT_PK_INVALID_TYPE; + goto LBL_ERR; + } + + len = subject_pubkey[1].size/8; + if (*public_key_len > len) { + XMEMCPY(public_key, subject_pubkey[1].data, len); + *public_key_len = len; + } else { + *public_key_len = len; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + err = CRYPT_OK; + +LBL_ERR: + + XFREE(tmpbuf); + + return err; +} + +#endif diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c new file mode 100644 index 0000000..69ae0f1 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c @@ -0,0 +1,387 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + + +/** + @file der_encode_sequence_ex.c + ASN.1 DER, encode a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Encode a SEQUENCE + @param list The list of items to encode + @param inlen The number of items in the list + @param out [out] The destination + @param outlen [in/out] The size of the output + @param type_of LTC_ASN1_SEQUENCE or LTC_ASN1_SET/LTC_ASN1_SETOF + @return CRYPT_OK on success +*/ +int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int type_of) +{ + int err; + ltc_asn1_type type; + unsigned long size, x, y, z, i; + void *data; + + LTC_ARGCHK(list != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get size of output that will be required */ + y = 0; + for (i = 0; i < inlen; i++) { + type = list[i].type; + size = list[i].size; + data = list[i].data; + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + if ((err = der_length_boolean(&x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_INTEGER: + if ((err = der_length_integer(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_SHORT_INTEGER: + if ((err = der_length_short_integer(*((unsigned long*)data), &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_RAW_BIT_STRING: + if ((err = der_length_bit_string(size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_OCTET_STRING: + if ((err = der_length_octet_string(size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_NULL: + y += 2; + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + if ((err = der_length_object_identifier(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_IA5_STRING: + if ((err = der_length_ia5_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_PRINTABLE_STRING: + if ((err = der_length_printable_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_UTF8_STRING: + if ((err = der_length_utf8_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_UTCTIME: + if ((err = der_length_utctime(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + if ((err = der_length_sequence(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + case LTC_ASN1_TELETEX_STRING: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + default: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + + /* calc header size */ + z = y; + if (y < 128) { + y += 2; + } else if (y < 256) { + /* 0x30 0x81 LL */ + y += 3; + } else if (y < 65536UL) { + /* 0x30 0x82 LL LL */ + y += 4; + } else if (y < 16777216UL) { + /* 0x30 0x83 LL LL LL */ + y += 5; + } else { + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + + /* too big ? */ + if (*outlen < y) { + *outlen = y; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* store header */ + x = 0; + out[x++] = (type_of == LTC_ASN1_SEQUENCE) ? 0x30 : 0x31; + + if (z < 128) { + out[x++] = (unsigned char)z; + } else if (z < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)z; + } else if (z < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((z>>8UL)&255); + out[x++] = (unsigned char)(z&255); + } else if (z < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((z>>16UL)&255); + out[x++] = (unsigned char)((z>>8UL)&255); + out[x++] = (unsigned char)(z&255); + } + + /* store data */ + *outlen -= x; + for (i = 0; i < inlen; i++) { + type = list[i].type; + size = list[i].size; + data = list[i].data; + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + z = *outlen; + if ((err = der_encode_boolean(*((int *)data), out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_INTEGER: + z = *outlen; + if ((err = der_encode_integer(data, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_SHORT_INTEGER: + z = *outlen; + if ((err = der_encode_short_integer(*((unsigned long*)data), out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_BIT_STRING: + z = *outlen; + if ((err = der_encode_bit_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_RAW_BIT_STRING: + z = *outlen; + if ((err = der_encode_raw_bit_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_OCTET_STRING: + z = *outlen; + if ((err = der_encode_octet_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_NULL: + out[x++] = 0x05; + out[x++] = 0x00; + *outlen -= 2; + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + z = *outlen; + if ((err = der_encode_object_identifier(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_IA5_STRING: + z = *outlen; + if ((err = der_encode_ia5_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_PRINTABLE_STRING: + z = *outlen; + if ((err = der_encode_printable_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_UTF8_STRING: + z = *outlen; + if ((err = der_encode_utf8_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_UTCTIME: + z = *outlen; + if ((err = der_encode_utctime(data, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_SET: + z = *outlen; + if ((err = der_encode_set(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_SETOF: + z = *outlen; + if ((err = der_encode_setof(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_SEQUENCE: + z = *outlen; + if ((err = der_encode_sequence_ex(data, size, out + x, &z, type)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + case LTC_ASN1_TELETEX_STRING: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + default: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + *outlen = x; + err = CRYPT_OK; + +LBL_ERR: + return err; +} + +#endif diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c new file mode 100644 index 0000000..8bfc9ae --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c @@ -0,0 +1,183 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" +#include <stdarg.h> + + +/** + @file der_encode_sequence_multi.c + ASN.1 DER, encode a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Encode a SEQUENCE type using a VA list + @param out [out] Destination for data + @param outlen [in/out] Length of buffer and resulting length of output + @remark <...> is of the form <type, size, data> (int, unsigned long, void*) + @return CRYPT_OK on success +*/ +int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) +{ + int err; + ltc_asn1_type type; + unsigned long size, x; + void *data; + va_list args; + ltc_asn1_list *list; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get size of output that will be required */ + va_start(args, outlen); + x = 0; + for (;;) { + type = va_arg(args, ltc_asn1_type); + size = va_arg(args, unsigned long); + data = va_arg(args, void*); + LTC_UNUSED_PARAM(size); + LTC_UNUSED_PARAM(data); + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_OCTET_STRING: + case LTC_ASN1_NULL: + case LTC_ASN1_OBJECT_IDENTIFIER: + case LTC_ASN1_IA5_STRING: + case LTC_ASN1_PRINTABLE_STRING: + case LTC_ASN1_UTF8_STRING: + case LTC_ASN1_UTCTIME: + case LTC_ASN1_SEQUENCE: + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_RAW_BIT_STRING: + ++x; + break; + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + case LTC_ASN1_TELETEX_STRING: + va_end(args); + return CRYPT_INVALID_ARG; + default: + va_end(args); + return CRYPT_INVALID_ARG; + } + } + va_end(args); + + /* allocate structure for x elements */ + if (x == 0) { + return CRYPT_NOP; + } + + list = XCALLOC(sizeof(*list), x); + if (list == NULL) { + return CRYPT_MEM; + } + + /* fill in the structure */ + va_start(args, outlen); + x = 0; + for (;;) { + type = va_arg(args, ltc_asn1_type); + size = va_arg(args, unsigned long); + data = va_arg(args, void*); + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_OCTET_STRING: + case LTC_ASN1_NULL: + case LTC_ASN1_OBJECT_IDENTIFIER: + case LTC_ASN1_IA5_STRING: + case LTC_ASN1_PRINTABLE_STRING: + case LTC_ASN1_UTF8_STRING: + case LTC_ASN1_UTCTIME: + case LTC_ASN1_SEQUENCE: + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_RAW_BIT_STRING: + LTC_SET_ASN1(list, x++, type, data, size); + break; + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + case LTC_ASN1_TELETEX_STRING: + va_end(args); + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + default: + va_end(args); + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + va_end(args); + + err = der_encode_sequence(list, x, out, outlen); +LBL_ERR: + XFREE(list); + return err; +} + +#endif + + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_subject_public_key_info.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_subject_public_key_info.c new file mode 100644 index 0000000..a075e7c --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_encode_subject_public_key_info.c @@ -0,0 +1,91 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + */ +#include "tomcrypt.h" + +/** + @file der_encode_sequence_multi.c + ASN.1 DER, encode a Subject Public Key structure --nmav +*/ + +#ifdef LTC_DER + +/* AlgorithmIdentifier := SEQUENCE { + * algorithm OBJECT IDENTIFIER, + * parameters ANY DEFINED BY algorithm + * } + * + * SubjectPublicKeyInfo := SEQUENCE { + * algorithm AlgorithmIdentifier, + * subjectPublicKey BIT STRING + * } + */ +/** + Encode a SEQUENCE type using a VA list + @param out [out] Destination for data + @param outlen [in/out] Length of buffer and resulting length of output + @remark <...> is of the form <type, size, data> (int, unsigned long, void*) + @return CRYPT_OK on success +*/ +int der_encode_subject_public_key_info(unsigned char *out, unsigned long *outlen, + unsigned int algorithm, void* public_key, unsigned long public_key_len, + unsigned long parameters_type, void* parameters, unsigned long parameters_len) +{ + int err; + ltc_asn1_list alg_id[2]; + oid_st oid; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + err = pk_get_oid(algorithm, &oid); + if (err != CRYPT_OK) { + return err; + } + + LTC_SET_ASN1(alg_id, 0, LTC_ASN1_OBJECT_IDENTIFIER, oid.OID, oid.OIDlen); + LTC_SET_ASN1(alg_id, 1, parameters_type, parameters, parameters_len); + + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_SEQUENCE, (unsigned long)sizeof(alg_id)/sizeof(alg_id[0]), alg_id, + LTC_ASN1_RAW_BIT_STRING, (unsigned long)(public_key_len*8), public_key, + LTC_ASN1_EOL, 0UL, NULL); + +} + +#endif + + diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c new file mode 100644 index 0000000..6f9d688 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c @@ -0,0 +1,210 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_sequence.c + ASN.1 DER, length a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Get the length of a DER sequence + @param list The sequences of items in the SEQUENCE + @param inlen The number of items + @param outlen [out] The length required in octets to store it + @return CRYPT_OK on success +*/ +int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, + unsigned long *outlen) +{ + int err; + ltc_asn1_type type; + unsigned long size, x, y, i; + void *data; + + LTC_ARGCHK(list != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get size of output that will be required */ + y = 0; + for (i = 0; i < inlen; i++) { + type = list[i].type; + size = list[i].size; + data = list[i].data; + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + if ((err = der_length_boolean(&x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_INTEGER: + if ((err = der_length_integer(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_SHORT_INTEGER: + if ((err = der_length_short_integer(*((unsigned long *)data), &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_RAW_BIT_STRING: + if ((err = der_length_bit_string(size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_OCTET_STRING: + if ((err = der_length_octet_string(size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_NULL: + y += 2; + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + if ((err = der_length_object_identifier(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_IA5_STRING: + if ((err = der_length_ia5_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_TELETEX_STRING: + if ((err = der_length_teletex_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_PRINTABLE_STRING: + if ((err = der_length_printable_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_UTCTIME: + if ((err = der_length_utctime(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_UTF8_STRING: + if ((err = der_length_utf8_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + if ((err = der_length_sequence(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + default: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + + /* calc header size */ + if (y < 128) { + y += 2; + } else if (y < 256) { + /* 0x30 0x81 LL */ + y += 3; + } else if (y < 65536UL) { + /* 0x30 0x82 LL LL */ + y += 4; + } else if (y < 16777216UL) { + /* 0x30 0x83 LL LL LL */ + y += 5; + } else { + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + + /* store size */ + *outlen = y; + err = CRYPT_OK; + +LBL_ERR: + return err; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c new file mode 100644 index 0000000..d2ded80 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c @@ -0,0 +1,94 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_sequence_free.c + ASN.1 DER, free's a structure allocated by der_decode_sequence_flexi(), Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Free memory allocated by der_decode_sequence_flexi() + @param in The list to free +*/ +void der_sequence_free(ltc_asn1_list *in) +{ + ltc_asn1_list *l; + + if (!in) return; + + /* walk to the start of the chain */ + while (in->prev != NULL || in->parent != NULL) { + if (in->parent != NULL) { + in = in->parent; + } else { + in = in->prev; + } + } + + /* now walk the list and free stuff */ + while (in != NULL) { + /* is there a child? */ + if (in->child) { + /* disconnect */ + in->child->parent = NULL; + der_sequence_free(in->child); + } + + switch (in->type) { + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: break; + case LTC_ASN1_INTEGER : if (in->data != NULL) { mp_clear(in->data); } break; + default : if (in->data != NULL) { XFREE(in->data); } + } + + /* move to next and free current */ + l = in->next; + XFREE(in); + in = l; + } +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sequence/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/sub.mk new file mode 100644 index 0000000..a50b4ba --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sequence/sub.mk @@ -0,0 +1,9 @@ +srcs-y += der_decode_sequence_ex.c +srcs-y += der_decode_sequence_flexi.c +srcs-y += der_decode_sequence_multi.c +srcs-y += der_encode_sequence_ex.c +srcs-y += der_encode_sequence_multi.c +srcs-y += der_length_sequence.c +srcs-y += der_sequence_free.c +srcs-y += der_decode_subject_public_key_info.c +srcs-y += der_encode_subject_public_key_info.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c b/core/lib/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c new file mode 100644 index 0000000..881a226 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c @@ -0,0 +1,137 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_set.c + ASN.1 DER, Encode a SET, Tom St Denis +*/ + +#ifdef LTC_DER + +/* LTC define to ASN.1 TAG */ +static int ltc_to_asn1(ltc_asn1_type v) +{ + switch (v) { + case LTC_ASN1_BOOLEAN: return 0x01; + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: return 0x02; + case LTC_ASN1_RAW_BIT_STRING: + case LTC_ASN1_BIT_STRING: return 0x03; + case LTC_ASN1_OCTET_STRING: return 0x04; + case LTC_ASN1_NULL: return 0x05; + case LTC_ASN1_OBJECT_IDENTIFIER: return 0x06; + case LTC_ASN1_UTF8_STRING: return 0x0C; + case LTC_ASN1_PRINTABLE_STRING: return 0x13; + case LTC_ASN1_TELETEX_STRING: return 0x14; + case LTC_ASN1_IA5_STRING: return 0x16; + case LTC_ASN1_UTCTIME: return 0x17; + case LTC_ASN1_SEQUENCE: return 0x30; + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: return 0x31; + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: return -1; + default: return -1; + } + return -1; +} + + +static int qsort_helper(const void *a, const void *b) +{ + ltc_asn1_list *A = (ltc_asn1_list *)a, *B = (ltc_asn1_list *)b; + int r; + + r = ltc_to_asn1(A->type) - ltc_to_asn1(B->type); + + /* for QSORT the order is UNDEFINED if they are "equal" which means it is NOT DETERMINISTIC. So we force it to be :-) */ + if (r == 0) { + /* their order in the original list now determines the position */ + return A->used - B->used; + } else { + return r; + } +} + +/* + Encode a SET type + @param list The list of items to encode + @param inlen The number of items in the list + @param out [out] The destination + @param outlen [in/out] The size of the output + @return CRYPT_OK on success +*/ +int der_encode_set(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + ltc_asn1_list *copy; + unsigned long x; + int err; + + /* make copy of list */ + copy = XCALLOC(inlen, sizeof(*copy)); + if (copy == NULL) { + return CRYPT_MEM; + } + + /* fill in used member with index so we can fully sort it */ + for (x = 0; x < inlen; x++) { + copy[x] = list[x]; + copy[x].used = x; + } + + /* sort it by the "type" field */ + XQSORT(copy, inlen, sizeof(*copy), &qsort_helper); + + /* call der_encode_sequence_ex() */ + err = der_encode_sequence_ex(copy, inlen, out, outlen, LTC_ASN1_SET); + + /* free list */ + XFREE(copy); + + return err; +} + + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c b/core/lib/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c new file mode 100644 index 0000000..66fe72f --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c @@ -0,0 +1,190 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_setof.c + ASN.1 DER, Encode SET OF, Tom St Denis +*/ + +#ifdef LTC_DER + +struct edge { + unsigned char *start; + unsigned long size; +}; + +static int qsort_helper(const void *a, const void *b) +{ + struct edge *A = (struct edge *)a, *B = (struct edge *)b; + int r; + unsigned long x; + + /* compare min length */ + r = XMEMCMP(A->start, B->start, MIN(A->size, B->size)); + + if (r == 0 && A->size != B->size) { + if (A->size > B->size) { + for (x = B->size; x < A->size; x++) { + if (A->start[x]) { + return 1; + } + } + } else { + for (x = A->size; x < B->size; x++) { + if (B->start[x]) { + return -1; + } + } + } + } + + return r; +} + +/** + Encode a SETOF stucture + @param list The list of items to encode + @param inlen The number of items in the list + @param out [out] The destination + @param outlen [in/out] The size of the output + @return CRYPT_OK on success +*/ +int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, z; + ptrdiff_t hdrlen; + int err; + struct edge *edges; + unsigned char *ptr, *buf; + + /* check that they're all the same type */ + for (x = 1; x < inlen; x++) { + if (list[x].type != list[x-1].type) { + return CRYPT_INVALID_ARG; + } + } + + /* alloc buffer to store copy of output */ + buf = XCALLOC(1, *outlen); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* encode list */ + if ((err = der_encode_sequence_ex(list, inlen, buf, outlen, LTC_ASN1_SETOF)) != CRYPT_OK) { + XFREE(buf); + return err; + } + + /* allocate edges */ + edges = XCALLOC(inlen, sizeof(*edges)); + if (edges == NULL) { + XFREE(buf); + return CRYPT_MEM; + } + + /* skip header */ + ptr = buf + 1; + + /* now skip length data */ + x = *ptr++; + if (x >= 0x80) { + ptr += (x & 0x7F); + } + + /* get the size of the static header */ + hdrlen = ptr - buf; + + + /* scan for edges */ + x = 0; + while (ptr < (buf + *outlen)) { + /* store start */ + edges[x].start = ptr; + + /* skip type */ + z = 1; + + /* parse length */ + y = ptr[z++]; + if (y < 128) { + edges[x].size = y; + } else { + y &= 0x7F; + edges[x].size = 0; + while (y--) { + edges[x].size = (edges[x].size << 8) | ((unsigned long)ptr[z++]); + } + } + + /* skip content */ + edges[x].size += z; + ptr += edges[x].size; + ++x; + } + + /* sort based on contents (using edges) */ + XQSORT(edges, inlen, sizeof(*edges), &qsort_helper); + + /* copy static header */ + XMEMCPY(out, buf, hdrlen); + + /* copy+sort using edges+indecies to output from buffer */ + for (y = hdrlen, x = 0; x < inlen; x++) { + XMEMCPY(out+y, edges[x].start, edges[x].size); + y += edges[x].size; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, *outlen); +#endif + + /* free buffers */ + XFREE(edges); + XFREE(buf); + + return CRYPT_OK; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/set/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/set/sub.mk new file mode 100644 index 0000000..52525d6 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/set/sub.mk @@ -0,0 +1,2 @@ +srcs-y += der_encode_set.c +srcs-y += der_encode_setof.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c b/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c new file mode 100644 index 0000000..462f750 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c @@ -0,0 +1,95 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_short_integer.c + ASN.1 DER, decode an integer, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Read a short integer + @param in The DER encoded data + @param inlen Size of data + @param num [out] The integer to decode + @return CRYPT_OK if successful +*/ +int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsigned long *num) +{ + unsigned long len, x, y; + + LTC_ARGCHK(num != NULL); + LTC_ARGCHK(in != NULL); + + /* check length */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check header */ + x = 0; + if ((in[x++] & 0x1F) != 0x02) { + return CRYPT_INVALID_PACKET; + } + + /* get the packet len */ + len = in[x++]; + + if (x + len > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read number */ + y = 0; + while (len--) { + y = (y<<8) | (unsigned long)in[x++]; + } + *num = y; + + return CRYPT_OK; + +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c b/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c new file mode 100644 index 0000000..2f2cf33 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c @@ -0,0 +1,124 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_short_integer.c + ASN.1 DER, encode an integer, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a short integer in the range (0,2^32-1) + @param num The integer to encode + @param out [out] The destination for the DER encoded integers + @param outlen [in/out] The max size and resulting size of the DER encoded integers + @return CRYPT_OK if successful +*/ +int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen) +{ + unsigned long len, x, y, z; + int err; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* force to 32 bits */ + num &= 0xFFFFFFFFUL; + + /* find out how big this will be */ + if ((err = der_length_short_integer(num, &len)) != CRYPT_OK) { + return err; + } + + if (*outlen < len) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* get len of output */ + z = 0; + y = num; + while (y) { + ++z; + y >>= 8; + } + + /* handle zero */ + if (z == 0) { + z = 1; + } + + /* see if msb is set */ + z += (num&(1UL<<((z<<3) - 1))) ? 1 : 0; + + /* adjust the number so the msB is non-zero */ + for (x = 0; (z <= 4) && (x < (4 - z)); x++) { + num <<= 8; + } + + /* store header */ + x = 0; + out[x++] = 0x02; + out[x++] = (unsigned char)z; + + /* if 31st bit is set output a leading zero and decrement count */ + if (z == 5) { + out[x++] = 0; + --z; + } + + /* store values */ + for (y = 0; y < z; y++) { + out[x++] = (unsigned char)((num >> 24) & 0xFF); + num <<= 8; + } + + /* we good */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c b/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c new file mode 100644 index 0000000..1672697 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c @@ -0,0 +1,97 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_short_integer.c + ASN.1 DER, get length of encoding, Tom St Denis +*/ + + +#ifdef LTC_DER +/** + Gets length of DER encoding of num + @param num The integer to get the size of + @param outlen [out] The length of the DER encoding for the given integer + @return CRYPT_OK if successful +*/ +int der_length_short_integer(unsigned long num, unsigned long *outlen) +{ + unsigned long z, y, len; + + LTC_ARGCHK(outlen != NULL); + + /* force to 32 bits */ + num &= 0xFFFFFFFFUL; + + /* get the number of bytes */ + z = 0; + y = num; + while (y) { + ++z; + y >>= 8; + } + + /* handle zero */ + if (z == 0) { + z = 1; + } + + /* we need a 0x02 to indicate it's INTEGER */ + len = 1; + + /* length byte */ + ++len; + + /* bytes in value */ + len += z; + + /* see if msb is set */ + len += (num&(1UL<<((z<<3) - 1))) ? 1 : 0; + + /* return length */ + *outlen = len; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/sub.mk new file mode 100644 index 0000000..fae1f08 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/short_integer/sub.mk @@ -0,0 +1,3 @@ +srcs-y += der_decode_short_integer.c +srcs-y += der_encode_short_integer.c +srcs-y += der_length_short_integer.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/sub.mk new file mode 100644 index 0000000..b704c65 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/sub.mk @@ -0,0 +1,14 @@ +subdirs-y += bit +subdirs-y += boolean +subdirs-y += choice +subdirs-y += ia5 +subdirs-y += integer +subdirs-y += object_identifier +subdirs-y += octet +subdirs-y += printable_string +subdirs-y += sequence +subdirs-y += set +subdirs-y += short_integer +subdirs-y += utctime +subdirs-y += utf8 +subdirs-y += teletex_string diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/der_decode_teletex_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/der_decode_teletex_string.c new file mode 100644 index 0000000..a8eaecf --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/der_decode_teletex_string.c @@ -0,0 +1,122 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_teletex_string.c + ASN.1 DER, encode a teletex STRING +*/ + +#ifdef LTC_DER + +/** + Store a teletex STRING + @param in The DER encoded teletex STRING + @param inlen The size of the DER teletex STRING + @param out [out] The array of octets stored (one per char) + @param outlen [in/out] The number of octets stored + @return CRYPT_OK if successful +*/ +int der_decode_teletex_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int t; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x14 */ + if ((in[0] & 0x1F) != 0x14) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + /* is it too long? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read the data */ + for (y = 0; y < len; y++) { + t = der_teletex_value_decode(in[x++]); + if (t == -1) { + return CRYPT_INVALID_ARG; + } + out[y] = t; + } + + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/der_length_teletex_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/der_length_teletex_string.c new file mode 100644 index 0000000..7435e72 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/der_length_teletex_string.c @@ -0,0 +1,237 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_teletex_string.c + ASN.1 DER, get length of teletex STRING +*/ + +#ifdef LTC_DER + +static const struct { + int code, value; +} teletex_table[] = { +{ '\0', 0 }, +{ '\a', 7 }, +{ '\b', 8 }, +{ '\t', 9 }, +{ '\n', 10 }, +{ '\v', 11 }, +{ '\f', 12 }, +{ '\r', 13 }, +{ ' ', 32 }, +{ '!', 33 }, +{ '"', 34 }, +{ '%', 37 }, +{ '&', 38 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ ';', 59 }, +{ '<', 60 }, +{ '=', 61 }, +{ '>', 62 }, +{ '?', 63 }, +{ '@', 64 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ '[', 91 }, +{ ']', 93 }, +{ '_', 95 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +{ '|', 124 }, +{ ' ', 160 }, +{ 0xa1, 161 }, +{ 0xa2, 162 }, +{ 0xa3, 163 }, +{ '$', 164 }, +{ 0xa5, 165 }, +{ '#', 166 }, +{ 0xa7, 167 }, +{ 0xa4, 168 }, +{ 0xab, 171 }, +{ 0xb0, 176 }, +{ 0xb1, 177 }, +{ 0xb2, 178 }, +{ 0xb3, 179 }, +{ 0xd7, 180 }, +{ 0xb5, 181 }, +{ 0xb6, 182 }, +{ 0xb7, 183 }, +{ 0xf7, 184 }, +{ 0xbb, 187 }, +{ 0xbc, 188 }, +{ 0xbd, 189 }, +{ 0xbe, 190 }, +{ 0xbf, 191 }, +}; + +int der_teletex_char_encode(int c) +{ + int x; + for (x = 0; x < (int)(sizeof(teletex_table)/sizeof(teletex_table[0])); x++) { + if (teletex_table[x].code == c) { + return teletex_table[x].value; + } + } + return -1; +} + +int der_teletex_value_decode(int v) +{ + int x; + for (x = 0; x < (int)(sizeof(teletex_table)/sizeof(teletex_table[0])); x++) { + if (teletex_table[x].value == v) { + return teletex_table[x].code; + } + } + return -1; +} + +/** + Gets length of DER encoding of teletex STRING + @param octets The values you want to encode + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_teletex_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen) +{ + unsigned long x; + + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(octets != NULL); + + /* scan string for validity */ + for (x = 0; x < noctets; x++) { + if (der_teletex_char_encode(octets[x]) == -1) { + return CRYPT_INVALID_ARG; + } + } + + if (noctets < 128) { + /* 16 LL DD DD DD ... */ + *outlen = 2 + noctets; + } else if (noctets < 256) { + /* 16 81 LL DD DD DD ... */ + *outlen = 3 + noctets; + } else if (noctets < 65536UL) { + /* 16 82 LL LL DD DD DD ... */ + *outlen = 4 + noctets; + } else if (noctets < 16777216UL) { + /* 16 83 LL LL LL DD DD DD ... */ + *outlen = 5 + noctets; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/sub.mk new file mode 100644 index 0000000..8f47f07 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/teletex_string/sub.mk @@ -0,0 +1,2 @@ +srcs-y += der_decode_teletex_string.c +srcs-y += der_length_teletex_string.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c b/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c new file mode 100644 index 0000000..328051d --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c @@ -0,0 +1,156 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_utctime.c + ASN.1 DER, decode a UTCTIME, Tom St Denis +*/ + +#ifdef LTC_DER + +static int char_to_int(unsigned char x) +{ + switch (x) { + case '0': return 0; + case '1': return 1; + case '2': return 2; + case '3': return 3; + case '4': return 4; + case '5': return 5; + case '6': return 6; + case '7': return 7; + case '8': return 8; + case '9': return 9; + default: + return 100; + } + return 100; +} + +#define DECODE_V(y, max) \ + y = char_to_int(buf[x])*10 + char_to_int(buf[x+1]); \ + if (y >= max) return CRYPT_INVALID_PACKET; \ + x += 2; + +/** + Decodes a UTC time structure in DER format (reads all 6 valid encoding formats) + @param in Input buffer + @param inlen Length of input buffer in octets + @param out [out] Destination of UTC time structure + @return CRYPT_OK if successful +*/ +int der_decode_utctime(const unsigned char *in, unsigned long *inlen, + ltc_utctime *out) +{ + unsigned char buf[32]; + unsigned long x; + int y; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != NULL); + LTC_ARGCHK(out != NULL); + + /* check header */ + if (*inlen < 2UL || (in[1] >= sizeof(buf)) || ((in[1] + 2UL) > *inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* decode the string */ + for (x = 0; x < in[1]; x++) { + y = der_ia5_value_decode(in[x+2]); + if (y == -1) { + return CRYPT_INVALID_PACKET; + } + buf[x] = y; + } + *inlen = 2 + x; + + + /* possible encodings are +YYMMDDhhmmZ +YYMMDDhhmm+hh'mm' +YYMMDDhhmm-hh'mm' +YYMMDDhhmmssZ +YYMMDDhhmmss+hh'mm' +YYMMDDhhmmss-hh'mm' + + So let's do a trivial decode upto [including] mm + */ + + x = 0; + DECODE_V(out->YY, 100); + DECODE_V(out->MM, 13); + DECODE_V(out->DD, 32); + DECODE_V(out->hh, 24); + DECODE_V(out->mm, 60); + + /* clear timezone and seconds info */ + out->off_dir = out->off_hh = out->off_mm = out->ss = 0; + + /* now is it Z, +, - or 0-9 */ + if (buf[x] == 'Z') { + return CRYPT_OK; + } else if (buf[x] == '+' || buf[x] == '-') { + out->off_dir = (buf[x++] == '+') ? 0 : 1; + DECODE_V(out->off_hh, 24); + DECODE_V(out->off_mm, 60); + return CRYPT_OK; + } + + /* decode seconds */ + DECODE_V(out->ss, 60); + + /* now is it Z, +, - */ + if (buf[x] == 'Z') { + return CRYPT_OK; + } else if (buf[x] == '+' || buf[x] == '-') { + out->off_dir = (buf[x++] == '+') ? 0 : 1; + DECODE_V(out->off_hh, 24); + DECODE_V(out->off_mm, 60); + return CRYPT_OK; + } else { + return CRYPT_INVALID_PACKET; + } +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c b/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c new file mode 100644 index 0000000..e22b294 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c @@ -0,0 +1,110 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_utctime.c + ASN.1 DER, encode a UTCTIME, Tom St Denis +*/ + +#ifdef LTC_DER + +static const char *baseten = "0123456789"; + +#define STORE_V(y) \ + out[x++] = der_ia5_char_encode(baseten[(y/10) % 10]); \ + out[x++] = der_ia5_char_encode(baseten[y % 10]); + +/** + Encodes a UTC time structure in DER format + @param utctime The UTC time structure to encode + @param out The destination of the DER encoding of the UTC time structure + @param outlen [in/out] The length of the DER encoding + @return CRYPT_OK if successful +*/ +int der_encode_utctime(ltc_utctime *utctime, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, tmplen; + int err; + + LTC_ARGCHK(utctime != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = der_length_utctime(utctime, &tmplen)) != CRYPT_OK) { + return err; + } + if (tmplen > *outlen) { + *outlen = tmplen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* store header */ + out[0] = 0x17; + + /* store values */ + x = 2; + STORE_V(utctime->YY); + STORE_V(utctime->MM); + STORE_V(utctime->DD); + STORE_V(utctime->hh); + STORE_V(utctime->mm); + STORE_V(utctime->ss); + + if (utctime->off_mm || utctime->off_hh) { + out[x++] = der_ia5_char_encode(utctime->off_dir ? '-' : '+'); + STORE_V(utctime->off_hh); + STORE_V(utctime->off_mm); + } else { + out[x++] = der_ia5_char_encode('Z'); + } + + /* store length */ + out[1] = (unsigned char)(x - 2); + + /* all good let's return */ + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c b/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c new file mode 100644 index 0000000..055b726 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_utctime.c + ASN.1 DER, get length of UTCTIME, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Gets length of DER encoding of UTCTIME + @param utctime The UTC time structure to get the size of + @param outlen [out] The length of the DER encoding + @return CRYPT_OK if successful +*/ +int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(utctime != NULL); + + if (utctime->off_hh == 0 && utctime->off_mm == 0) { + /* we encode as YYMMDDhhmmssZ */ + *outlen = 2 + 13; + } else { + /* we encode as YYMMDDhhmmss{+|-}hh'mm' */ + *outlen = 2 + 17; + } + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/utctime/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/utctime/sub.mk new file mode 100644 index 0000000..afb3e1b --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/utctime/sub.mk @@ -0,0 +1,3 @@ +srcs-y += der_decode_utctime.c +srcs-y += der_encode_utctime.c +srcs-y += der_length_utctime.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c new file mode 100644 index 0000000..6226dd5 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c @@ -0,0 +1,138 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_decode_utf8_string.c + ASN.1 DER, encode a UTF8 STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a UTF8 STRING + @param in The DER encoded UTF8 STRING + @param inlen The size of the DER UTF8 STRING + @param out [out] The array of utf8s stored (one per char) + @param outlen [in/out] The number of utf8s stored + @return CRYPT_OK if successful +*/ +int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, + wchar_t *out, unsigned long *outlen) +{ + wchar_t tmp; + unsigned long x, y, z, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x0C */ + if ((in[0] & 0x1F) != 0x0C) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* proceed to decode */ + for (y = 0; x < inlen; ) { + /* get first byte */ + tmp = in[x++]; + + /* count number of bytes */ + for (z = 0; (tmp & 0x80) && (z <= 4); z++, tmp = (tmp << 1) & 0xFF); + + if (z > 4 || (x + (z - 1) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* decode, grab upper bits */ + tmp >>= z; + + /* grab remaining bytes */ + if (z > 1) { --z; } + while (z-- != 0) { + if ((in[x] & 0xC0) != 0x80) { + return CRYPT_INVALID_PACKET; + } + tmp = (tmp << 6) | ((wchar_t)in[x++] & 0x3F); + } + + if (y > *outlen) { + *outlen = y; + return CRYPT_BUFFER_OVERFLOW; + } + out[y++] = tmp; + } + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c new file mode 100644 index 0000000..684f31b --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c @@ -0,0 +1,134 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_encode_utf8_string.c + ASN.1 DER, encode a UTF8 STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store an UTF8 STRING + @param in The array of UTF8 to store (one per wchar_t) + @param inlen The number of UTF8 to store + @param out [out] The destination for the DER encoded UTF8 STRING + @param outlen [in/out] The max size and resulting size of the DER UTF8 STRING + @return CRYPT_OK if successful +*/ +int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get the size */ + for (x = len = 0; x < inlen; x++) { + if (in[x] < 0 || in[x] > 0x1FFFF) { + return CRYPT_INVALID_ARG; + } + len += der_utf8_charsize(in[x]); + } + + if (len < 128) { + y = 2 + len; + } else if (len < 256) { + y = 3 + len; + } else if (len < 65536UL) { + y = 4 + len; + } else if (len < 16777216UL) { + y = 5 + len; + } else { + return CRYPT_INVALID_ARG; + } + + /* too big? */ + if (y > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* encode the header+len */ + x = 0; + out[x++] = 0x0C; + if (len < 128) { + out[x++] = (unsigned char)len; + } else if (len < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)len; + } else if (len < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((len>>8)&255); + out[x++] = (unsigned char)(len&255); + } else if (len < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((len>>16)&255); + out[x++] = (unsigned char)((len>>8)&255); + out[x++] = (unsigned char)(len&255); + } else { + /* coverity[dead_error_line] */ + return CRYPT_INVALID_ARG; + } + + /* store UTF8 */ + for (y = 0; y < inlen; y++) { + switch (der_utf8_charsize(in[y])) { + case 1: out[x++] = (unsigned char)in[y]; break; + case 2: out[x++] = 0xC0 | ((in[y] >> 6) & 0x1F); out[x++] = 0x80 | (in[y] & 0x3F); break; + case 3: out[x++] = 0xE0 | ((in[y] >> 12) & 0x0F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break; + case 4: out[x++] = 0xF0 | ((in[y] >> 18) & 0x07); out[x++] = 0x80 | ((in[y] >> 12) & 0x3F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break; + default: break; + } + } + + /* retun length */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c b/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c new file mode 100644 index 0000000..17dd672 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c @@ -0,0 +1,110 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file der_length_utf8_string.c + ASN.1 DER, get length of UTF8 STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +/** Return the size in bytes of a UTF-8 character + @param c The UTF-8 character to measure + @return The size in bytes +*/ +unsigned long der_utf8_charsize(const wchar_t c) +{ + if (c <= 0x7F) { + return 1; + } else if (c <= 0x7FF) { + return 2; + } else if (c <= 0xFFFF) { + return 3; + } else { + return 4; + } +} + +/** + Gets length of DER encoding of UTF8 STRING + @param in The characters to measure the length of + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned long *outlen) +{ + unsigned long x, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(outlen != NULL); + + len = 0; + for (x = 0; x < noctets; x++) { + if (in[x] < 0 || in[x] > 0x10FFFF) { + return CRYPT_INVALID_ARG; + } + len += der_utf8_charsize(in[x]); + } + + if (len < 128) { + /* 0C LL DD DD DD ... */ + *outlen = 2 + len; + } else if (len < 256) { + /* 0C 81 LL DD DD DD ... */ + *outlen = 3 + len; + } else if (len < 65536UL) { + /* 0C 82 LL LL DD DD DD ... */ + *outlen = 4 + len; + } else if (len < 16777216UL) { + /* 0C 83 LL LL LL DD DD DD ... */ + *outlen = 5 + len; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/pk/asn1/der/utf8/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/der/utf8/sub.mk new file mode 100644 index 0000000..3538929 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/der/utf8/sub.mk @@ -0,0 +1,4 @@ +cflags-remove-y += -Wextra +srcs-y += der_decode_utf8_string.c +srcs-y += der_encode_utf8_string.c +srcs-y += der_length_utf8_string.c diff --git a/core/lib/libtomcrypt/src/pk/asn1/sub.mk b/core/lib/libtomcrypt/src/pk/asn1/sub.mk new file mode 100644 index 0000000..c93e1f1 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/asn1/sub.mk @@ -0,0 +1 @@ +subdirs-y += der diff --git a/core/lib/libtomcrypt/src/pk/dh/dh.c b/core/lib/libtomcrypt/src/pk/dh/dh.c new file mode 100644 index 0000000..d97f704 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dh/dh.c @@ -0,0 +1,217 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * Copyright (c) 2014, STMicroelectronics International N.V. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <tomcrypt.h> + +#ifdef LTC_LINARO_FIX_DH + +#include <stdint.h> +/* + * Make a DH key [private key pair] + * @param prng An active PRNG state + * @param wprng The index for the PRNG you desire to use + * @param keysize The key size (octets) desired of the private key + * @param q If not null, then the private key is in the range + * [2, q-2] where q is called the subprime + * @param xbits If not 0, then the private key has 'xbits' bits + * @note The private key must always be less than p-1 + * @param key [in/out] Where the newly created DH key will be stored + * g and p are provided as input in the key + * type, x and y are output of this function + * @return CRYPT_OK if successful, note: on error all allocated memory will be + * freed automatically. +*/ + +int dh_make_key(prng_state *prng, int wprng, void *q, int xbits, dh_key *key) +{ + const int limit = 500; /* number of tries */ + int err, i; + int key_size = 0; /* max key size, in bytes */ + int key_size_p = 0; /* key size of p */ + int key_size_q = 0; /* key size of p */ + void *arg_mod; + uint8_t *buf = 0; /* intermediate buffer to have a raw random */ + int found = 0; + + /* + * Check the arguments + */ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(key->g != NULL); + LTC_ARGCHK(key->p != NULL); + err = prng_is_valid(wprng); + if (err != CRYPT_OK) + return err; + + /* + * Set the key size and check constraints + */ + if (xbits) { + LTC_ARGCHK((xbits % 8) == 0); + key_size = xbits / 8; + } + key_size_p = mp_unsigned_bin_size(key->p); + if (q) + key_size_q = mp_unsigned_bin_size(q); + if (key_size) { + /* check the constraints */ + LTC_ARGCHK(key_size <= key_size_p); + LTC_ARGCHK((q == NULL) || (key_size <= key_size_q)); + } else { + if (q) + key_size = MIN(key_size_p, key_size_q); + else + key_size =key_size_p; + } + + /* Set the argument we will make the modulo against to */ + if ((q != NULL) && (key_size_q < key_size_p)) + arg_mod = q; + else + arg_mod = key->p; + + /* initialize the key */ + key->x = NULL; + key->y = NULL; + err = mp_init_multi(&key->x, &key->y, NULL); + if (err != CRYPT_OK) + goto error; + + /* Initialize the buffer used to store the random number */ + buf = XMALLOC(key_size); + if (buf == NULL) { + err = CRYPT_MEM; + goto error; + } + + for (i = 0; (i < limit) && (!found); i++) { + /* generate the private key in a raw-buffer */ + if (prng_descriptor[wprng]->read(buf, key_size, prng) != + (unsigned long)key_size) { + err = CRYPT_ERROR_READPRNG; + goto error; + } + + /* make sure it is on the right number of bits */ + if (xbits) + buf[0] |= 0x80; + + /* transform it as a Big Number */ + err = mp_read_unsigned_bin(key->x, buf, key_size); + if (err != CRYPT_OK) + goto error; + + /* + * Transform it as a Big Number compatible with p and q + */ + err = mp_read_unsigned_bin(key->y, buf, key_size); + if (err != CRYPT_OK) + goto error; + err = mp_mod(key->y, arg_mod, key->x); + if (err != CRYPT_OK) + goto error; + + /* + * Check the constraints + * - x < p is ok by construction + * - x < q-1: + * - x contains xbits + */ + if (xbits) { + if (mp_count_bits(key->x) != xbits) + continue; + } + + /* we found a suitable private key key->x */ + found = 1; + } + + if (!found) { + /* key is not found */ + err = CRYPT_PK_NOT_FOUND; + goto error; + } + + /* generate the public key key->y */ + err = mp_exptmod(key->g, key->x, key->p, key->y); + if (err != CRYPT_OK) + goto error; + + /* no error */ + err = CRYPT_OK; + +error: + if (err != CRYPT_OK) + mp_clear_multi(key->x, key->y, NULL); + if (buf) + XFREE(buf); + + return err; +} + +/* + * Free the allocated ram for a DH key + * @param key The key which you wish to free + */ +void dh_free(dh_key *key) +{ + /* + * g and p are not cleared on purpose as they are provided when + * generating the key + */ + if (key->x) { + mp_clear(key->x); + key->x = NULL; + } + if (key->y) { + mp_clear(key->y); + key->y = NULL; + } +} + +/* + * Create a DH shared secret. + * @param private_key The private DH key in the pair + * @param public_key The public DH key in the pair, as a big number + * @param secret The secret (as a big number) + * @return CRYPT_OK if successful + */ +int dh_shared_secret(dh_key *private_key, void *public_key, void *secret) +{ + LTC_ARGCHK(private_key != NULL); + LTC_ARGCHK(public_key != NULL); + LTC_ARGCHK(secret != NULL); + + /* types valid? */ + if (private_key->type != PK_PRIVATE) + return CRYPT_PK_NOT_PRIVATE; + + return mp_exptmod(public_key, private_key->x, private_key->p, secret); +} + +#endif diff --git a/core/lib/libtomcrypt/src/pk/dh/sub.mk b/core/lib/libtomcrypt/src/pk/dh/sub.mk new file mode 100644 index 0000000..7c36ef1 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dh/sub.mk @@ -0,0 +1,2 @@ +srcs-y += dh.c +cflags-dh.c-y += -Wno-unused-variable diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c new file mode 100644 index 0000000..fde55da --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c @@ -0,0 +1,165 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_decrypt_key.c + DSA Crypto, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Decrypt an DSA encrypted key + @param in The ciphertext + @param inlen The length of the ciphertext (octets) + @param out [out] The plaintext + @param outlen [in/out] The max size and resulting size of the plaintext + @param key The corresponding private DSA key + @return CRYPT_OK if successful +*/ +int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + dsa_key *key) +{ + unsigned char *skey, *expt; + void *g_pub; + unsigned long x, y, hashOID[32]; + int hash, err; + ltc_asn1_list decode[3]; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* right key type? */ + if (key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* decode to find out hash */ + LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID)/sizeof(hashOID[0])); + + if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { + return err; + } + + hash = find_hash_oid(hashOID, decode[0].size); + if (hash_is_valid(hash) != CRYPT_OK) { + return CRYPT_INVALID_PACKET; + } + + /* we now have the hash! */ + + if ((err = mp_init(&g_pub)) != CRYPT_OK) { + return err; + } + + /* allocate memory */ + expt = XMALLOC(mp_unsigned_bin_size(key->p) + 1); + skey = XMALLOC(MAXBLOCKSIZE); + if (expt == NULL || skey == NULL) { + if (expt != NULL) { + XFREE(expt); + } + if (skey != NULL) { + XFREE(skey); + } + mp_clear(g_pub); + return CRYPT_MEM; + } + + LTC_SET_ASN1(decode, 1, LTC_ASN1_INTEGER, g_pub, 1UL); + LTC_SET_ASN1(decode, 2, LTC_ASN1_OCTET_STRING, skey, MAXBLOCKSIZE); + + /* read the structure in now */ + if ((err = der_decode_sequence(in, inlen, decode, 3)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* make shared key */ + x = mp_unsigned_bin_size(key->p) + 1; + if ((err = dsa_shared_secret(key->x, g_pub, key, expt, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + + y = MIN(mp_unsigned_bin_size(key->p) + 1, MAXBLOCKSIZE); + if ((err = hash_memory(hash, expt, x, expt, &y)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* ensure the hash of the shared secret is at least as big as the encrypt itself */ + if (decode[2].size > y) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* avoid buffer overflow */ + if (*outlen < decode[2].size) { + *outlen = decode[2].size; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* Decrypt the key */ + for (x = 0; x < decode[2].size; x++) { + out[x] = expt[x] ^ skey[x]; + } + *outlen = x; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(expt, mp_unsigned_bin_size(key->p) + 1); + zeromem(skey, MAXBLOCKSIZE); +#endif + + XFREE(expt); + XFREE(skey); + + mp_clear(g_pub); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c new file mode 100644 index 0000000..d69a624 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c @@ -0,0 +1,158 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_encrypt_key.c + DSA Crypto, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Encrypt a symmetric key with DSA + @param in The symmetric key you want to encrypt + @param inlen The length of the key to encrypt (octets) + @param out [out] The destination for the ciphertext + @param outlen [in/out] The max size and resulting size of the ciphertext + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param hash The index of the hash you want to use + @param key The DSA key you want to encrypt to + @return CRYPT_OK if successful +*/ +int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, + dsa_key *key) +{ + unsigned char *expt, *skey; + void *g_pub, *g_priv; + unsigned long x, y; + int err, qbits; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* check that wprng/cipher/hash are not invalid */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (inlen > hash_descriptor[hash]->hashsize) { + return CRYPT_INVALID_HASH; + } + + /* make a random key and export the public copy */ + if ((err = mp_init_multi(&g_pub, &g_priv, NULL)) != CRYPT_OK) { + return err; + } + + expt = XMALLOC(mp_unsigned_bin_size(key->p) + 1); + skey = XMALLOC(MAXBLOCKSIZE); + if (expt == NULL || skey == NULL) { + if (expt != NULL) { + XFREE(expt); + } + if (skey != NULL) { + XFREE(skey); + } + mp_clear_multi(g_pub, g_priv, NULL); + return CRYPT_MEM; + } + + /* make a random g_priv, g_pub = g^x pair */ + qbits = mp_count_bits(key->q); + do { + if ((err = rand_bn_bits(g_priv, qbits, prng, wprng)) != CRYPT_OK) { + goto LBL_ERR; + } + /* private key x should be from range: 1 <= x <= q-1 (see FIPS 186-4 B.1.2) */ + } while (mp_cmp_d(g_priv, 0) != LTC_MP_GT || mp_cmp(g_priv, key->q) != LTC_MP_LT); + + /* compute y */ + if ((err = mp_exptmod(key->g, g_priv, key->p, g_pub)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* make random key */ + x = mp_unsigned_bin_size(key->p) + 1; + if ((err = dsa_shared_secret(g_priv, key->y, key, expt, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + + y = MAXBLOCKSIZE; + if ((err = hash_memory(hash, expt, x, skey, &y)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* Encrypt key */ + for (x = 0; x < inlen; x++) { + skey[x] ^= in[x]; + } + + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash]->OIDlen, hash_descriptor[hash]->OID, + LTC_ASN1_INTEGER, 1UL, g_pub, + LTC_ASN1_OCTET_STRING, inlen, skey, + LTC_ASN1_EOL, 0UL, NULL); + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + /* clean up */ + zeromem(expt, mp_unsigned_bin_size(key->p) + 1); + zeromem(skey, MAXBLOCKSIZE); +#endif + + XFREE(skey); + XFREE(expt); + + mp_clear_multi(g_pub, g_priv, NULL); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_export.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_export.c new file mode 100644 index 0000000..9424de4 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_export.c @@ -0,0 +1,145 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_export.c + DSA implementation, export key, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Export a DSA key to a binary packet + @param out [out] Where to store the packet + @param outlen [in/out] The max size and resulting size of the packet + @param type The type of key to export (PK_PRIVATE or PK_PUBLIC) + @param key The key to export + @return CRYPT_OK if successful +*/ +int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key) +{ + unsigned long zero=0; + int err, std; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + std = type & PK_STD; + type &= ~PK_STD; + + /* can we store the static header? */ + if (type == PK_PRIVATE && key->type != PK_PRIVATE) { + return CRYPT_PK_TYPE_MISMATCH; + } + + if (type != PK_PUBLIC && type != PK_PRIVATE) { + return CRYPT_INVALID_ARG; + } + + if (type == PK_PRIVATE) { + if (std) { + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL); + } + else { + unsigned char flags[1]; + flags[0] = 1; + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL); + } + } else { + if (std) { + unsigned long tmplen = (mp_count_bits(key->y) / 8) + 8; + unsigned char* tmp = XMALLOC(tmplen); + ltc_asn1_list int_list[3]; + + if (tmp == NULL) { + return CRYPT_MEM; + } + + err = der_encode_integer(key->y, tmp, &tmplen); + if (err != CRYPT_OK) { + goto error; + } + + LTC_SET_ASN1(int_list, 0, LTC_ASN1_INTEGER, key->p, 1UL); + LTC_SET_ASN1(int_list, 1, LTC_ASN1_INTEGER, key->q, 1UL); + LTC_SET_ASN1(int_list, 2, LTC_ASN1_INTEGER, key->g, 1UL); + + err = der_encode_subject_public_key_info(out, outlen, PKA_DSA, tmp, + tmplen, LTC_ASN1_SEQUENCE, int_list, + sizeof(int_list) / sizeof(int_list[0])); + +error: + XFREE(tmp); + return err; + } + else { + unsigned char flags[1]; + flags[0] = 0; + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_EOL, 0UL, NULL); + } + } +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_export.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_free.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_free.c new file mode 100644 index 0000000..ca5b887 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_free.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_free.c + DSA implementation, free a DSA key, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Free a DSA key + @param key The key to free from memory +*/ +void dsa_free(dsa_key *key) +{ + LTC_ARGCHKVD(key != NULL); + mp_clear_multi(key->g, key->q, key->p, key->x, key->y, NULL); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_free.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_import.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_import.c new file mode 100644 index 0000000..83c8ce5 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_import.c @@ -0,0 +1,164 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_import.c + DSA implementation, import a DSA key, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Import a DSA key + @param in The binary packet to import from + @param inlen The length of the binary packet + @param key [out] Where to store the imported key + @return CRYPT_OK if successful, upon error this function will free all allocated memory +*/ +int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key) +{ + int err; + unsigned long zero = 0; + unsigned char* tmpbuf = NULL; + unsigned char flags[1]; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + if (mp_init_multi(&key->p, &key->g, &key->q, &key->x, &key->y, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* try to match the old libtomcrypt format */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_EOL, 0UL, NULL)) == CRYPT_OK) { + /* private key */ + if (flags[0]) { + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PRIVATE; + goto LBL_OK; + } + /* public key */ + else { + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PUBLIC; + goto LBL_OK; + } + } + /* get key type */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL)) == CRYPT_OK) { + + key->type = PK_PRIVATE; + } else { /* public */ + ltc_asn1_list params[3]; + unsigned long tmpbuf_len = MAX_RSA_SIZE*8; + + LTC_SET_ASN1(params, 0, LTC_ASN1_INTEGER, key->p, 1UL); + LTC_SET_ASN1(params, 1, LTC_ASN1_INTEGER, key->q, 1UL); + LTC_SET_ASN1(params, 2, LTC_ASN1_INTEGER, key->g, 1UL); + + tmpbuf = XCALLOC(1, tmpbuf_len); + if (tmpbuf == NULL) { + err = CRYPT_MEM; + goto LBL_ERR; + } + + err = der_decode_subject_public_key_info(in, inlen, + PKA_DSA, tmpbuf, &tmpbuf_len, + LTC_ASN1_SEQUENCE, params, 3); + if (err != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err=der_decode_integer(tmpbuf, tmpbuf_len, key->y)) != CRYPT_OK) { + goto LBL_ERR; + } + + XFREE(tmpbuf); + key->type = PK_PUBLIC; + } + +LBL_OK: + key->qord = mp_unsigned_bin_size(key->q); + + if (key->qord >= LTC_MDSA_MAX_GROUP || key->qord <= 15 || + (unsigned long)key->qord >= mp_unsigned_bin_size(key->p) || (mp_unsigned_bin_size(key->p) - key->qord) >= LTC_MDSA_DELTA) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + return CRYPT_OK; +LBL_ERR: + XFREE(tmpbuf); + mp_clear_multi(key->p, key->g, key->q, key->x, key->y, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_import.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_make_key.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_make_key.c new file mode 100644 index 0000000..1b02db8 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_make_key.c @@ -0,0 +1,295 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_make_key.c + DSA implementation, generate a DSA key, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Create DSA parameters + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param group_size Size of the multiplicative group (octets) + @param modulus_size Size of the modulus (octets) + @param p [out] bignum where generated 'p' is stored (must be initialized by caller) + @param q [out] bignum where generated 'q' is stored (must be initialized by caller) + @param g [out] bignum where generated 'g' is stored (must be initialized by caller) + @return CRYPT_OK if successful, upon error this function will free all allocated memory +*/ +static int dsa_make_params(prng_state *prng, int wprng, int group_size, int modulus_size, void *p, void *q, void *g) +{ + unsigned long L, N, n, outbytes, seedbytes, counter, j, i; + int err, res, mr_tests_q, mr_tests_p, found_p, found_q, hash; + unsigned char *wbuf, *sbuf, digest[MAXBLOCKSIZE]; + void *t2L1, *t2N1, *t2q, *t2seedlen, *U, *W, *X, *c, *h, *e, *seedinc; + + /* check size */ + if (group_size >= LTC_MDSA_MAX_GROUP || group_size < 1 || group_size >= modulus_size) { + return CRYPT_INVALID_ARG; + } + + /* FIPS-186-4 A.1.1.2 Generation of the Probable Primes p and q Using an Approved Hash Function + * + * L = The desired length of the prime p (in bits e.g. L = 1024) + * N = The desired length of the prime q (in bits e.g. N = 160) + * seedlen = The desired bit length of the domain parameter seed; seedlen shallbe equal to or greater than N + * outlen = The bit length of Hash function + * + * 1. Check that the (L, N) + * 2. If (seedlen <N), then return INVALID. + * 3. n = ceil(L / outlen) - 1 + * 4. b = L- 1 - (n * outlen) + * 5. domain_parameter_seed = an arbitrary sequence of seedlen bits + * 6. U = Hash (domain_parameter_seed) mod 2^(N-1) + * 7. q = 2^(N-1) + U + 1 - (U mod 2) + * 8. Test whether or not q is prime as specified in Appendix C.3 + * 9. If qis not a prime, then go to step 5. + * 10. offset = 1 + * 11. For counter = 0 to (4L- 1) do { + * For j=0 to n do { + * Vj = Hash ((domain_parameter_seed+ offset + j) mod 2^seedlen + * } + * W = V0 + (V1 *2^outlen) + ... + (Vn-1 * 2^((n-1) * outlen)) + ((Vn mod 2^b) * 2^(n * outlen)) + * X = W + 2^(L-1) Comment: 0 <= W < 2^(L-1); hence 2^(L-1) <= X < 2^L + * c = X mod 2*q + * p = X - (c - 1) Comment: p ~ 1 (mod 2*q) + * If (p >= 2^(L-1)) { + * Test whether or not p is prime as specified in Appendix C.3. + * If p is determined to be prime, then return VALID and the values of p, qand (optionally) the values of domain_parameter_seed and counter + * } + * offset = offset + n + 1 Comment: Increment offset + * } + */ + + seedbytes = group_size; + L = modulus_size * 8; + N = group_size * 8; + + /* M-R tests (when followed by one Lucas test) according FIPS-186-4 - Appendix C.3 - table C.1 */ + mr_tests_p = (L <= 2048) ? 3 : 2; + if (N <= 160) { mr_tests_q = 19; } + else if (N <= 224) { mr_tests_q = 24; } + else { mr_tests_q = 27; } + + if (N <= 256) { + hash = register_hash(&sha256_desc); + } + else if (N <= 384) { + hash = register_hash(&sha384_desc); + } + else if (N <= 512) { + hash = register_hash(&sha512_desc); + } + else { + return CRYPT_INVALID_ARG; /* group_size too big */ + } + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } + outbytes = hash_descriptor[hash]->hashsize; + + n = ((L + outbytes*8 - 1) / (outbytes*8)) - 1; + + if ((wbuf = XMALLOC((n+1)*outbytes)) == NULL) { err = CRYPT_MEM; goto cleanup3; } + if ((sbuf = XMALLOC(seedbytes)) == NULL) { err = CRYPT_MEM; goto cleanup2; } + + err = mp_init_multi(&t2L1, &t2N1, &t2q, &t2seedlen, &U, &W, &X, &c, &h, &e, &seedinc, NULL); + if (err != CRYPT_OK) { goto cleanup1; } + + if ((err = mp_2expt(t2L1, L-1)) != CRYPT_OK) { goto cleanup; } + /* t2L1 = 2^(L-1) */ + if ((err = mp_2expt(t2N1, N-1)) != CRYPT_OK) { goto cleanup; } + /* t2N1 = 2^(N-1) */ + if ((err = mp_2expt(t2seedlen, seedbytes*8)) != CRYPT_OK) { goto cleanup; } + /* t2seedlen = 2^seedlen */ + + for(found_p=0; !found_p;) { + /* q */ + for(found_q=0; !found_q;) { + if (prng_descriptor[wprng]->read(sbuf, seedbytes, prng) != seedbytes) { err = CRYPT_ERROR_READPRNG; goto cleanup; } + i = outbytes; + if ((err = hash_memory(hash, sbuf, seedbytes, digest, &i)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_read_unsigned_bin(U, digest, outbytes)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_mod(U, t2N1, U)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_add(t2N1, U, q)) != CRYPT_OK) { goto cleanup; } + if (!mp_isodd(q)) mp_add_d(q, 1, q); + if ((err = mp_prime_is_prime(q, mr_tests_q, &res)) != CRYPT_OK) { goto cleanup; } /* XXX-TODO rounds are ignored; no Lucas test */ + if (res == LTC_MP_YES) found_q = 1; + } + + /* p */ + if ((err = mp_read_unsigned_bin(seedinc, sbuf, seedbytes)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_add(q, q, t2q)) != CRYPT_OK) { goto cleanup; } + for(counter=0; counter < 4*L && !found_p; counter++) { + for(j=0; j<=n; j++) { + if ((err = mp_add_d(seedinc, 1, seedinc)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_mod(seedinc, t2seedlen, seedinc)) != CRYPT_OK) { goto cleanup; } + /* seedinc = (seedinc+1) % 2^seed_bitlen */ + if ((i = mp_unsigned_bin_size(seedinc)) > seedbytes) { err = CRYPT_INVALID_ARG; goto cleanup; } + zeromem(sbuf, seedbytes); + if ((err = mp_to_unsigned_bin(seedinc, sbuf + seedbytes-i)) != CRYPT_OK) { goto cleanup; } + i = outbytes; + err = hash_memory(hash, sbuf, seedbytes, wbuf+(n-j)*outbytes, &i); + if (err != CRYPT_OK) { goto cleanup; } + } + if ((err = mp_read_unsigned_bin(W, wbuf, (n+1)*outbytes)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_mod(W, t2L1, W)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_add(W, t2L1, X)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_mod(X, t2q, c)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_sub_d(c, 1, p)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_sub(X, p, p)) != CRYPT_OK) { goto cleanup; } + if (mp_cmp(p, t2L1) != LTC_MP_LT) { + /* p >= 2^(L-1) */ + if ((err = mp_prime_is_prime(p, mr_tests_p, &res)) != CRYPT_OK) { goto cleanup; } /* XXX-TODO rounds are ignored; no Lucas test */ + if (res == LTC_MP_YES) { + found_p = 1; + } + } + } + } + + /* FIPS-186-4 A.2.1 Unverifiable Generation of the Generator g + * 1. e = (p - 1)/q + * 2. h = any integer satisfying: 1 < h < (p - 1) + * h could be obtained from a random number generator or from a counter that changes after each use + * 3. g = h^e mod p + * 4. if (g == 1), then go to step 2. + * + */ + + if ((err = mp_sub_d(p, 1, e)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_div(e, q, e, c)) != CRYPT_OK) { goto cleanup; } + /* e = (p - 1)/q */ + i = mp_count_bits(p); + do { + do { + if ((err = rand_bn_bits(h, i, prng, wprng)) != CRYPT_OK) { goto cleanup; } + } while (mp_cmp(h, p) != LTC_MP_LT || mp_cmp_d(h, 2) != LTC_MP_GT); + if ((err = mp_sub_d(h, 1, h)) != CRYPT_OK) { goto cleanup; } + /* h is randon and 1 < h < (p-1) */ + if ((err = mp_exptmod(h, e, p, g)) != CRYPT_OK) { goto cleanup; } + } while (mp_cmp_d(g, 1) == LTC_MP_EQ); + + err = CRYPT_OK; +cleanup: + mp_clear_multi(t2L1, t2N1, t2q, t2seedlen, U, W, X, c, h, e, seedinc, NULL); +cleanup1: + XFREE(sbuf); +cleanup2: + XFREE(wbuf); +cleanup3: + return err; +} + +/** + Create a DSA key (with given params) + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param group_size Size of the multiplicative group (octets) + @param modulus_size Size of the modulus (octets) + @param key [out] Where to store the created key + @param p_hex Hexadecimal string 'p' + @param q_hex Hexadecimal string 'q' + @param g_hex Hexadecimal string 'g' + @return CRYPT_OK if successful, upon error this function will free all allocated memory +*/ +static int dsa_make_key_ex(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key, char* p_hex, char* q_hex, char* g_hex) +{ + int err, qbits; + + LTC_ARGCHK(key != NULL); + + /* init mp_ints */ + if ((err = mp_init_multi(&key->g, &key->q, &key->p, &key->x, &key->y, NULL)) != CRYPT_OK) { + return err; + } + + if (p_hex == NULL || q_hex == NULL || g_hex == NULL) { + /* generate params */ + err = dsa_make_params(prng, wprng, group_size, modulus_size, key->p, key->q, key->g); + if (err != CRYPT_OK) { goto cleanup; } + } + else { + /* read params */ + if ((err = mp_read_radix(key->p, p_hex, 16)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_read_radix(key->q, q_hex, 16)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_read_radix(key->g, g_hex, 16)) != CRYPT_OK) { goto cleanup; } + /* XXX-TODO maybe do some validity check for p, q, g */ + } + + /* so now we have our DH structure, generator g, order q, modulus p + Now we need a random exponent [mod q] and it's power g^x mod p + */ + qbits = mp_count_bits(key->q); + do { + if ((err = rand_bn_bits(key->x, qbits, prng, wprng)) != CRYPT_OK) { goto cleanup; } + /* private key x should be from range: 1 <= x <= q-1 (see FIPS 186-4 B.1.2) */ + } while (mp_cmp_d(key->x, 0) != LTC_MP_GT || mp_cmp(key->x, key->q) != LTC_MP_LT); + if ((err = mp_exptmod(key->g, key->x, key->p, key->y)) != CRYPT_OK) { goto cleanup; } + key->type = PK_PRIVATE; + key->qord = group_size; + + return CRYPT_OK; + +cleanup: + mp_clear_multi(key->g, key->q, key->p, key->x, key->y, NULL); + return err; +} + +/** + Create a DSA key + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param group_size Size of the multiplicative group (octets) + @param modulus_size Size of the modulus (octets) + @param key [out] Where to store the created key + @return CRYPT_OK if successful, upon error this function will free all allocated memory +*/ +int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key) +{ + return dsa_make_key_ex(prng, wprng, group_size, modulus_size, key, NULL, NULL, NULL); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_make_key.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_shared_secret.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_shared_secret.c new file mode 100644 index 0000000..449af93 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_shared_secret.c @@ -0,0 +1,98 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_shared_secret.c + DSA Crypto, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Create a DSA shared secret between two keys + @param private_key The private DSA key (the exponent) + @param base The base of the exponentiation (allows this to be used for both encrypt and decrypt) + @param public_key The public key + @param out [out] Destination of the shared secret + @param outlen [in/out] The max size and resulting size of the shared secret + @return CRYPT_OK if successful +*/ +int dsa_shared_secret(void *private_key, void *base, + dsa_key *public_key, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x; + void *res; + int err; + + LTC_ARGCHK(private_key != NULL); + LTC_ARGCHK(public_key != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* make new point */ + if ((err = mp_init(&res)) != CRYPT_OK) { + return err; + } + + if ((err = mp_exptmod(base, private_key, public_key->p, res)) != CRYPT_OK) { + mp_clear(res); + return err; + } + + x = (unsigned long)mp_unsigned_bin_size(res); + if (*outlen < x) { + *outlen = x; + err = CRYPT_BUFFER_OVERFLOW; + goto done; + } + zeromem(out, x); + if ((err = mp_to_unsigned_bin(res, out + (x - mp_unsigned_bin_size(res)))) != CRYPT_OK) { goto done; } + + err = CRYPT_OK; + *outlen = x; +done: + mp_clear(res); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_shared_secret.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_sign_hash.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_sign_hash.c new file mode 100644 index 0000000..0c89967 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_sign_hash.c @@ -0,0 +1,178 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_sign_hash.c + DSA implementation, sign a hash, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Sign a hash with DSA + @param in The hash to sign + @param inlen The length of the hash to sign + @param r The "r" integer of the signature (caller must initialize with mp_init() first) + @param s The "s" integer of the signature (caller must initialize with mp_init() first) + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param key A private DSA key + @return CRYPT_OK if successful +*/ +int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen, + void *r, void *s, + prng_state *prng, int wprng, dsa_key *key) +{ + void *k, *kinv, *tmp; + unsigned char *buf; + int err, qbits; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(r != NULL); + LTC_ARGCHK(s != NULL); + LTC_ARGCHK(key != NULL); + + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + if (key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* check group order size */ + if (key->qord >= LTC_MDSA_MAX_GROUP) { + return CRYPT_INVALID_ARG; + } + + buf = XMALLOC(LTC_MDSA_MAX_GROUP); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* Init our temps */ + if ((err = mp_init_multi(&k, &kinv, &tmp, NULL)) != CRYPT_OK) { goto ERRBUF; } + + qbits = mp_count_bits(key->q); +retry: + + do { + /* gen random k */ + if ((err = rand_bn_bits(k, qbits, prng, wprng)) != CRYPT_OK) { goto error; } + + /* k should be from range: 1 <= k <= q-1 (see FIPS 186-4 B.2.2) */ + if (mp_cmp_d(k, 0) != LTC_MP_GT || mp_cmp(k, key->q) != LTC_MP_LT) { goto retry; } + + /* test gcd */ + if ((err = mp_gcd(k, key->q, tmp)) != CRYPT_OK) { goto error; } + } while (mp_cmp_d(tmp, 1) != LTC_MP_EQ); + + /* now find 1/k mod q */ + if ((err = mp_invmod(k, key->q, kinv)) != CRYPT_OK) { goto error; } + + /* now find r = g^k mod p mod q */ + if ((err = mp_exptmod(key->g, k, key->p, r)) != CRYPT_OK) { goto error; } + if ((err = mp_mod(r, key->q, r)) != CRYPT_OK) { goto error; } + + if (mp_iszero(r) == LTC_MP_YES) { goto retry; } + + /* now find s = (in + xr)/k mod q */ + if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, inlen)) != CRYPT_OK) { goto error; } + if ((err = mp_mul(key->x, r, s)) != CRYPT_OK) { goto error; } + if ((err = mp_add(s, tmp, s)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(s, kinv, key->q, s)) != CRYPT_OK) { goto error; } + + if (mp_iszero(s) == LTC_MP_YES) { goto retry; } + + err = CRYPT_OK; +error: + mp_clear_multi(k, kinv, tmp, NULL); +ERRBUF: +#ifdef LTC_CLEAN_STACK + zeromem(buf, LTC_MDSA_MAX_GROUP); +#endif + XFREE(buf); + return err; +} + +/** + Sign a hash with DSA + @param in The hash to sign + @param inlen The length of the hash to sign + @param out [out] Where to store the signature + @param outlen [in/out] The max size and resulting size of the signature + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param key A private DSA key + @return CRYPT_OK if successful +*/ +int dsa_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, dsa_key *key) +{ + void *r, *s; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + if (mp_init_multi(&r, &s, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + if ((err = dsa_sign_hash_raw(in, inlen, r, s, prng, wprng, key)) != CRYPT_OK) { + goto error; + } + + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_EOL, 0UL, NULL); + +error: + mp_clear_multi(r, s, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_sign_hash.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_verify_hash.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_verify_hash.c new file mode 100644 index 0000000..50ccaa7 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_verify_hash.c @@ -0,0 +1,154 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_verify_hash.c + DSA implementation, verify a signature, Tom St Denis +*/ + + +#ifdef LTC_MDSA +/** + Verify a DSA signature + @param r DSA "r" parameter + @param s DSA "s" parameter + @param hash The hash that was signed + @param hashlen The length of the hash that was signed + @param stat [out] The result of the signature verification, 1==valid, 0==invalid + @param key The corresponding public DH key + @return CRYPT_OK if successful (even if the signature is invalid) +*/ +int dsa_verify_hash_raw( void *r, void *s, + const unsigned char *hash, unsigned long hashlen, + int *stat, dsa_key *key) +{ + void *w, *v, *u1, *u2; + int err; + + LTC_ARGCHK(r != NULL); + LTC_ARGCHK(s != NULL); + LTC_ARGCHK(hash != NULL); + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + + /* default to invalid signature */ + *stat = 0; + + /* init our variables */ + if ((err = mp_init_multi(&w, &v, &u1, &u2, NULL)) != CRYPT_OK) { + return err; + } + + /* neither r or s can be null or >q*/ + if (mp_iszero(r) == LTC_MP_YES || mp_iszero(s) == LTC_MP_YES || mp_cmp(r, key->q) != LTC_MP_LT || mp_cmp(s, key->q) != LTC_MP_LT) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* w = 1/s mod q */ + if ((err = mp_invmod(s, key->q, w)) != CRYPT_OK) { goto error; } + + /* u1 = m * w mod q */ + if ((err = mp_read_unsigned_bin(u1, (unsigned char *)hash, hashlen)) != CRYPT_OK) { goto error; } + + if ((err = mp_mulmod(u1, w, key->q, u1)) != CRYPT_OK) { goto error; } + + /* u2 = r*w mod q */ + if ((err = mp_mulmod(r, w, key->q, u2)) != CRYPT_OK) { goto error; } + + /* v = g^u1 * y^u2 mod p mod q */ + if ((err = mp_exptmod(key->g, u1, key->p, u1)) != CRYPT_OK) { goto error; } + if ((err = mp_exptmod(key->y, u2, key->p, u2)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(u1, u2, key->p, v)) != CRYPT_OK) { goto error; } + if ((err = mp_mod(v, key->q, v)) != CRYPT_OK) { goto error; } + + /* if r = v then we're set */ + if (mp_cmp(r, v) == LTC_MP_EQ) { + *stat = 1; + } + + err = CRYPT_OK; +error: + mp_clear_multi(w, v, u1, u2, NULL); + return err; +} + +/** + Verify a DSA signature + @param sig The signature + @param siglen The length of the signature (octets) + @param hash The hash that was signed + @param hashlen The length of the hash that was signed + @param stat [out] The result of the signature verification, 1==valid, 0==invalid + @param key The corresponding public DH key + @return CRYPT_OK if successful (even if the signature is invalid) +*/ +int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, dsa_key *key) +{ + int err; + void *r, *s; + + if ((err = mp_init_multi(&r, &s, NULL)) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* decode the sequence */ + if ((err = der_decode_sequence_multi(sig, siglen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* do the op */ + err = dsa_verify_hash_raw(r, s, hash, hashlen, stat, key); + +LBL_ERR: + mp_clear_multi(r, s, NULL); + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_verify_hash.c,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/dsa_verify_key.c b/core/lib/libtomcrypt/src/pk/dsa/dsa_verify_key.c new file mode 100644 index 0000000..c413a4e --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/dsa_verify_key.c @@ -0,0 +1,127 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file dsa_verify_key.c + DSA implementation, verify a key, Tom St Denis +*/ + +#ifdef LTC_MDSA + +/** + Verify a DSA key for validity + @param key The key to verify + @param stat [out] Result of test, 1==valid, 0==invalid + @return CRYPT_OK if successful +*/ +int dsa_verify_key(dsa_key *key, int *stat) +{ + void *tmp, *tmp2; + int res, err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(stat != NULL); + + /* default to an invalid key */ + *stat = 0; + + /* first make sure key->q and key->p are prime */ + if ((err = mp_prime_is_prime(key->q, 8, &res)) != CRYPT_OK) { + return err; + } + if (res == 0) { + return CRYPT_OK; + } + + if ((err = mp_prime_is_prime(key->p, 8, &res)) != CRYPT_OK) { + return err; + } + if (res == 0) { + return CRYPT_OK; + } + + /* now make sure that g is not -1, 0 or 1 and <p */ + if (mp_cmp_d(key->g, 0) == LTC_MP_EQ || mp_cmp_d(key->g, 1) == LTC_MP_EQ) { + return CRYPT_OK; + } + if ((err = mp_init_multi(&tmp, &tmp2, NULL)) != CRYPT_OK) { return err; } + if ((err = mp_sub_d(key->p, 1, tmp)) != CRYPT_OK) { goto error; } + if (mp_cmp(tmp, key->g) == LTC_MP_EQ || mp_cmp(key->g, key->p) != LTC_MP_LT) { + err = CRYPT_OK; + goto error; + } + + /* 1 < y < p-1 */ + if (!(mp_cmp_d(key->y, 1) == LTC_MP_GT && mp_cmp(key->y, tmp) == LTC_MP_LT)) { + err = CRYPT_OK; + goto error; + } + + /* now we have to make sure that g^q = 1, and that p-1/q gives 0 remainder */ + if ((err = mp_div(tmp, key->q, tmp, tmp2)) != CRYPT_OK) { goto error; } + if (mp_iszero(tmp2) != LTC_MP_YES) { + err = CRYPT_OK; + goto error; + } + + if ((err = mp_exptmod(key->g, key->q, key->p, tmp)) != CRYPT_OK) { goto error; } + if (mp_cmp_d(tmp, 1) != LTC_MP_EQ) { + err = CRYPT_OK; + goto error; + } + + /* now we have to make sure that y^q = 1, this makes sure y \in g^x mod p */ + if ((err = mp_exptmod(key->y, key->q, key->p, tmp)) != CRYPT_OK) { goto error; } + if (mp_cmp_d(tmp, 1) != LTC_MP_EQ) { + err = CRYPT_OK; + goto error; + } + + /* at this point we are out of tests ;-( */ + err = CRYPT_OK; + *stat = 1; +error: + mp_clear_multi(tmp, tmp2, NULL); + return err; +} +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_verify_key.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/dsa/sub.mk b/core/lib/libtomcrypt/src/pk/dsa/sub.mk new file mode 100644 index 0000000..bd1d2df --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/dsa/sub.mk @@ -0,0 +1,10 @@ +srcs-y += dsa_decrypt_key.c +srcs-y += dsa_encrypt_key.c +srcs-y += dsa_export.c +srcs-y += dsa_free.c +srcs-y += dsa_import.c +srcs-y += dsa_make_key.c +srcs-y += dsa_shared_secret.c +srcs-y += dsa_sign_hash.c +srcs-y += dsa_verify_hash.c +srcs-y += dsa_verify_key.c diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc.c b/core/lib/libtomcrypt/src/pk/ecc/ecc.c new file mode 100644 index 0000000..5b321b7 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc.c @@ -0,0 +1,153 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/* This holds the key settings. ***MUST*** be organized by size from smallest to largest. */ +const ltc_ecc_set_type ltc_ecc_sets[] = { +#ifdef LTC_ECC112 +{ + 14, + "SECP112R1", + "DB7C2ABF62E35E668076BEAD208B", + "659EF8BA043916EEDE8911702B22", + "DB7C2ABF62E35E7628DFAC6561C5", + "09487239995A5EE76B55F9C2F098", + "A89CE5AF8724C0A23E0E0FF77500" +}, +#endif +#ifdef LTC_ECC128 +{ + 16, + "SECP128R1", + "FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF", + "E87579C11079F43DD824993C2CEE5ED3", + "FFFFFFFE0000000075A30D1B9038A115", + "161FF7528B899B2D0C28607CA52C5B86", + "CF5AC8395BAFEB13C02DA292DDED7A83", +}, +#endif +#ifdef LTC_ECC160 +{ + 20, + "SECP160R1", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF", + "1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45", + "0100000000000000000001F4C8F927AED3CA752257", + "4A96B5688EF573284664698968C38BB913CBFC82", + "23A628553168947D59DCC912042351377AC5FB32", +}, +#endif +#ifdef LTC_ECC192 +{ + 24, + "ECC-192", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF", + "64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1", + "FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831", + "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012", + "7192B95FFC8DA78631011ED6B24CDD573F977A11E794811", +}, +#endif +#ifdef LTC_ECC224 +{ + 28, + "ECC-224", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001", + "B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D", + "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21", + "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34", +}, +#endif +#ifdef LTC_ECC256 +{ + 32, + "ECC-256", + "FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF", + "5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B", + "FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551", + "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296", + "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5", +}, +#endif +#ifdef LTC_ECC384 +{ + 48, + "ECC-384", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFF0000000000000000FFFFFFFF", + "B3312FA7E23EE7E4988E056BE3F82D19181D9C6EFE8141120314088F5013875AC656398D8A2ED19D2A85C8EDD3EC2AEF", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC7634D81F4372DDF581A0DB248B0A77AECEC196ACCC52973", + "AA87CA22BE8B05378EB1C71EF320AD746E1D3B628BA79B9859F741E082542A385502F25DBF55296C3A545E3872760AB7", + "3617DE4A96262C6F5D9E98BF9292DC29F8F41DBD289A147CE9DA3113B5F0B8C00A60B1CE1D7E819D7A431D7C90EA0E5F", +}, +#endif +#ifdef LTC_ECC521 +{ + 66, + "ECC-521", + "1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF", + "51953EB9618E1C9A1F929A21A0B68540EEA2DA725B99B315F3B8B489918EF109E156193951EC7E937B1652C0BD3BB1BF073573DF883D2C34F1EF451FD46B503F00", + "1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFA51868783BF2F966B7FCC0148F709A5D03BB5C9B8899C47AEBB6FB71E91386409", + "C6858E06B70404E9CD9E3ECB662395B4429C648139053FB521F828AF606B4D3DBAA14B5E77EFE75928FE1DC127A2FFA8DE3348B3C1856A429BF97E7E31C2E5BD66", + "11839296A789A3BC0045C8A5FB42C7D1BD998F54449579B446817AFBD17273E662C97EE72995EF42640C550B9013FAD0761353C7086A272C24088BE94769FD16650", +}, +#endif +{ + 0, + NULL, NULL, NULL, NULL, NULL, NULL +} +}; + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc.c,v $ */ +/* $Revision: 1.40 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c new file mode 100644 index 0000000..b35b041 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c @@ -0,0 +1,106 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_ansi_x963_export.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** ECC X9.63 (Sec. 4.3.6) uncompressed export + @param key Key to export + @param out [out] destination of export + @param outlen [in/out] Length of destination and final output size + Return CRYPT_OK on success +*/ +int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen) +{ + unsigned char buf[ECC_BUF_SIZE]; + unsigned long numlen, xlen, ylen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(outlen != NULL); + + if (ltc_ecc_is_valid_idx(key->idx) == 0) { + return CRYPT_INVALID_ARG; + } + numlen = key->dp->size; + xlen = mp_unsigned_bin_size(key->pubkey.x); + ylen = mp_unsigned_bin_size(key->pubkey.y); + + if (xlen > numlen || ylen > numlen || sizeof(buf) < numlen) { + return CRYPT_BUFFER_OVERFLOW; + } + + if (*outlen < (1 + 2*numlen)) { + *outlen = 1 + 2*numlen; + return CRYPT_BUFFER_OVERFLOW; + } + + LTC_ARGCHK(out != NULL); + + /* store byte 0x04 */ + out[0] = 0x04; + + /* pad and store x */ + zeromem(buf, sizeof(buf)); + mp_to_unsigned_bin(key->pubkey.x, buf + (numlen - xlen)); + XMEMCPY(out+1, buf, numlen); + + /* pad and store y */ + zeromem(buf, sizeof(buf)); + mp_to_unsigned_bin(key->pubkey.y, buf + (numlen - ylen)); + XMEMCPY(out+1+numlen, buf, numlen); + + *outlen = 1 + 2*numlen; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c new file mode 100644 index 0000000..cafbd07 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c @@ -0,0 +1,131 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_ansi_x963_import.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** Import an ANSI X9.63 format public key + @param in The input data to read + @param inlen The length of the input data + @param key [out] destination to store imported key \ +*/ +int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key *key) +{ + return ecc_ansi_x963_import_ex(in, inlen, key, NULL); +} + +int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp) +{ + int x, err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + + /* must be odd */ + if ((inlen & 1) == 0) { + return CRYPT_INVALID_ARG; + } + + /* init key */ + if (mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* check for 4, 6 or 7 */ + if (in[0] != 4 && in[0] != 6 && in[0] != 7) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* read data */ + if ((err = mp_read_unsigned_bin(key->pubkey.x, (unsigned char *)in+1, (inlen-1)>>1)) != CRYPT_OK) { + goto error; + } + + if ((err = mp_read_unsigned_bin(key->pubkey.y, (unsigned char *)in+1+((inlen-1)>>1), (inlen-1)>>1)) != CRYPT_OK) { + goto error; + } + if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { goto error; } + + if (dp == NULL) { + /* determine the idx */ + for (x = 0; ltc_ecc_sets[x].size != 0; x++) { + if ((unsigned)ltc_ecc_sets[x].size >= ((inlen-1)>>1)) { + break; + } + } + if (ltc_ecc_sets[x].size == 0) { + err = CRYPT_INVALID_PACKET; + goto error; + } + /* set the idx */ + key->idx = x; + key->dp = <c_ecc_sets[x]; + } else { + if (((inlen-1)>>1) != (unsigned long) dp->size) { + err = CRYPT_INVALID_PACKET; + goto error; + } + key->idx = -1; + key->dp = dp; + } + key->type = PK_PUBLIC; + + /* we're done */ + return CRYPT_OK; +error: + mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c new file mode 100644 index 0000000..b928dce --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c @@ -0,0 +1,176 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_decrypt_key.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Decrypt an ECC encrypted key + @param in The ciphertext + @param inlen The length of the ciphertext (octets) + @param out [out] The plaintext + @param outlen [in/out] The max size and resulting size of the plaintext + @param key The corresponding private ECC key + @return CRYPT_OK if successful +*/ +int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + ecc_key *key) +{ + unsigned char *ecc_shared, *skey, *pub_expt; + unsigned long x, y, hashOID[32]; + int hash, err; + ecc_key pubkey; + ltc_asn1_list decode[3]; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* right key type? */ + if (key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* decode to find out hash */ + LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID)/sizeof(hashOID[0])); + + if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { + return err; + } + + hash = find_hash_oid(hashOID, decode[0].size); + if (hash_is_valid(hash) != CRYPT_OK) { + return CRYPT_INVALID_PACKET; + } + + /* we now have the hash! */ + + /* allocate memory */ + pub_expt = XMALLOC(ECC_BUF_SIZE); + ecc_shared = XMALLOC(ECC_BUF_SIZE); + skey = XMALLOC(MAXBLOCKSIZE); + if (pub_expt == NULL || ecc_shared == NULL || skey == NULL) { + if (pub_expt != NULL) { + XFREE(pub_expt); + } + if (ecc_shared != NULL) { + XFREE(ecc_shared); + } + if (skey != NULL) { + XFREE(skey); + } + return CRYPT_MEM; + } + LTC_SET_ASN1(decode, 1, LTC_ASN1_OCTET_STRING, pub_expt, ECC_BUF_SIZE); + LTC_SET_ASN1(decode, 2, LTC_ASN1_OCTET_STRING, skey, MAXBLOCKSIZE); + + /* read the structure in now */ + if ((err = der_decode_sequence(in, inlen, decode, 3)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* import ECC key from packet */ + if ((err = ecc_import(decode[1].data, decode[1].size, &pubkey)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* make shared key */ + x = ECC_BUF_SIZE; + if ((err = ecc_shared_secret(key, &pubkey, ecc_shared, &x)) != CRYPT_OK) { + ecc_free(&pubkey); + goto LBL_ERR; + } + ecc_free(&pubkey); + + y = MIN(ECC_BUF_SIZE, MAXBLOCKSIZE); + if ((err = hash_memory(hash, ecc_shared, x, ecc_shared, &y)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* ensure the hash of the shared secret is at least as big as the encrypt itself */ + if (decode[2].size > y) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* avoid buffer overflow */ + if (*outlen < decode[2].size) { + *outlen = decode[2].size; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* Decrypt the key */ + for (x = 0; x < decode[2].size; x++) { + out[x] = skey[x] ^ ecc_shared[x]; + } + *outlen = x; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(pub_expt, ECC_BUF_SIZE); + zeromem(ecc_shared, ECC_BUF_SIZE); + zeromem(skey, MAXBLOCKSIZE); +#endif + + XFREE(pub_expt); + XFREE(ecc_shared); + XFREE(skey); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c new file mode 100644 index 0000000..f37f374 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c @@ -0,0 +1,162 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_encrypt_key.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Encrypt a symmetric key with ECC + @param in The symmetric key you want to encrypt + @param inlen The length of the key to encrypt (octets) + @param out [out] The destination for the ciphertext + @param outlen [in/out] The max size and resulting size of the ciphertext + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param hash The index of the hash you want to use + @param key The ECC key you want to encrypt to + @return CRYPT_OK if successful +*/ +int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, + ecc_key *key) +{ + unsigned char *pub_expt, *ecc_shared, *skey; + ecc_key pubkey; + unsigned long x, y, pubkeysize; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* check that wprng/cipher/hash are not invalid */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (inlen > hash_descriptor[hash].hashsize) { + return CRYPT_INVALID_HASH; + } + + /* make a random key and export the public copy */ + if ((err = ecc_make_key_ex(prng, wprng, &pubkey, key->dp)) != CRYPT_OK) { + return err; + } + + pub_expt = XMALLOC(ECC_BUF_SIZE); + ecc_shared = XMALLOC(ECC_BUF_SIZE); + skey = XMALLOC(MAXBLOCKSIZE); + if (pub_expt == NULL || ecc_shared == NULL || skey == NULL) { + if (pub_expt != NULL) { + XFREE(pub_expt); + } + if (ecc_shared != NULL) { + XFREE(ecc_shared); + } + if (skey != NULL) { + XFREE(skey); + } + ecc_free(&pubkey); + return CRYPT_MEM; + } + + pubkeysize = ECC_BUF_SIZE; + if ((err = ecc_export(pub_expt, &pubkeysize, PK_PUBLIC, &pubkey)) != CRYPT_OK) { + ecc_free(&pubkey); + goto LBL_ERR; + } + + /* make random key */ + x = ECC_BUF_SIZE; + if ((err = ecc_shared_secret(&pubkey, key, ecc_shared, &x)) != CRYPT_OK) { + ecc_free(&pubkey); + goto LBL_ERR; + } + ecc_free(&pubkey); + y = MAXBLOCKSIZE; + if ((err = hash_memory(hash, ecc_shared, x, skey, &y)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* Encrypt key */ + for (x = 0; x < inlen; x++) { + skey[x] ^= in[x]; + } + + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash].OIDlen, hash_descriptor[hash].OID, + LTC_ASN1_OCTET_STRING, pubkeysize, pub_expt, + LTC_ASN1_OCTET_STRING, inlen, skey, + LTC_ASN1_EOL, 0UL, NULL); + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + /* clean up */ + zeromem(pub_expt, ECC_BUF_SIZE); + zeromem(ecc_shared, ECC_BUF_SIZE); + zeromem(skey, MAXBLOCKSIZE); +#endif + + XFREE(skey); + XFREE(ecc_shared); + XFREE(pub_expt); + + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_export.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_export.c new file mode 100644 index 0000000..70baedd --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_export.c @@ -0,0 +1,108 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_export.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Export an ECC key as a binary packet + @param out [out] Destination for the key + @param outlen [in/out] Max size and resulting size of the exported key + @param type The type of key you want to export (PK_PRIVATE or PK_PUBLIC) + @param key The key to export + @return CRYPT_OK if successful +*/ +int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key) +{ + int err; + unsigned char flags[1]; + unsigned long key_size; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* type valid? */ + if (key->type != PK_PRIVATE && type == PK_PRIVATE) { + return CRYPT_PK_TYPE_MISMATCH; + } + + if (ltc_ecc_is_valid_idx(key->idx) == 0) { + return CRYPT_INVALID_ARG; + } + + /* we store the NIST byte size */ + key_size = key->dp->size; + + if (type == PK_PRIVATE) { + flags[0] = 1; + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, + LTC_ASN1_INTEGER, 1UL, key->pubkey.x, + LTC_ASN1_INTEGER, 1UL, key->pubkey.y, + LTC_ASN1_INTEGER, 1UL, key->k, + LTC_ASN1_EOL, 0UL, NULL); + } else { + flags[0] = 0; + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, + LTC_ASN1_INTEGER, 1UL, key->pubkey.x, + LTC_ASN1_INTEGER, 1UL, key->pubkey.y, + LTC_ASN1_EOL, 0UL, NULL); + } + + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_export.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_free.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_free.c new file mode 100644 index 0000000..5de73ca --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_free.c @@ -0,0 +1,66 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_free.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Free an ECC key from memory + @param key The key you wish to free +*/ +void ecc_free(ecc_key *key) +{ + LTC_ARGCHKVD(key != NULL); + mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_free.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_get_size.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_get_size.c new file mode 100644 index 0000000..5e4e382 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_get_size.c @@ -0,0 +1,70 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_get_size.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Get the size of an ECC key + @param key The key to get the size of + @return The size (octets) of the key or INT_MAX on error +*/ +int ecc_get_size(ecc_key *key) +{ + LTC_ARGCHK(key != NULL); + if (ltc_ecc_is_valid_idx(key->idx)) + return key->dp->size; + else + return INT_MAX; /* large value known to cause it to fail when passed to ecc_make_key() */ +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_get_size.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_import.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_import.c new file mode 100644 index 0000000..41b3fe5 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_import.c @@ -0,0 +1,198 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_import.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +static int is_point(ecc_key *key) +{ + void *prime, *b, *t1, *t2; + int err; + + if ((err = mp_init_multi(&prime, &b, &t1, &t2, NULL)) != CRYPT_OK) { + return err; + } + + /* load prime and b */ + if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } + if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } + + /* compute y^2 */ + if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } + + /* compute x^3 */ + if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } + if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } + if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } + + /* compute y^2 - x^3 */ + if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } + + /* compute y^2 - x^3 + 3x */ + if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } + if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } + if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } + if ((err = mp_mod(t1, prime, t1)) != CRYPT_OK) { goto error; } + while (mp_cmp_d(t1, 0) == LTC_MP_LT) { + if ((err = mp_add(t1, prime, t1)) != CRYPT_OK) { goto error; } + } + while (mp_cmp(t1, prime) != LTC_MP_LT) { + if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } + } + + /* compare to b */ + if (mp_cmp(t1, b) != LTC_MP_EQ) { + err = CRYPT_INVALID_PACKET; + } else { + err = CRYPT_OK; + } + +error: + mp_clear_multi(prime, b, t1, t2, NULL); + return err; +} + +/** + Import an ECC key from a binary packet + @param in The packet to import + @param inlen The length of the packet + @param key [out] The destination of the import + @return CRYPT_OK if successful, upon error all allocated memory will be freed +*/ +int ecc_import(const unsigned char *in, unsigned long inlen, ecc_key *key) +{ + return ecc_import_ex(in, inlen, key, NULL); +} + +/** + Import an ECC key from a binary packet, using user supplied domain params rather than one of the NIST ones + @param in The packet to import + @param inlen The length of the packet + @param key [out] The destination of the import + @param dp pointer to user supplied params; must be the same as the params used when exporting + @return CRYPT_OK if successful, upon error all allocated memory will be freed +*/ +int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, const ltc_ecc_set_type *dp) +{ + unsigned long key_size; + unsigned char flags[1]; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + if (mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* find out what type of key it is */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, &flags, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto done; + } + + + if (flags[0] == 1) { + /* private key */ + key->type = PK_PRIVATE; + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, + LTC_ASN1_INTEGER, 1UL, key->pubkey.x, + LTC_ASN1_INTEGER, 1UL, key->pubkey.y, + LTC_ASN1_INTEGER, 1UL, key->k, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto done; + } + } else { + /* public key */ + key->type = PK_PUBLIC; + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, + LTC_ASN1_INTEGER, 1UL, key->pubkey.x, + LTC_ASN1_INTEGER, 1UL, key->pubkey.y, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto done; + } + } + + if (dp == NULL) { + /* find the idx */ + for (key->idx = 0; ltc_ecc_sets[key->idx].size && (unsigned long)ltc_ecc_sets[key->idx].size != key_size; ++key->idx); + if (ltc_ecc_sets[key->idx].size == 0) { + err = CRYPT_INVALID_PACKET; + goto done; + } + key->dp = <c_ecc_sets[key->idx]; + } else { + key->idx = -1; + key->dp = dp; + } + /* set z */ + if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { goto done; } + + /* is it a point on the curve? */ + if ((err = is_point(key)) != CRYPT_OK) { + goto done; + } + + /* we're good */ + return CRYPT_OK; +done: + mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); + return err; +} +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_import.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_make_key.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_make_key.c new file mode 100644 index 0000000..4e9f547 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_make_key.c @@ -0,0 +1,156 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_make_key.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Make a new ECC key + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param keysize The keysize for the new key (in octets from 20 to 65 bytes) + @param key [out] Destination of the newly created key + @return CRYPT_OK if successful, upon error all allocated memory will be freed +*/ +int ecc_make_key(prng_state *prng, int wprng, int keysize, ecc_key *key) +{ + int x, err; + + /* find key size */ + for (x = 0; (keysize > ltc_ecc_sets[x].size) && (ltc_ecc_sets[x].size != 0); x++); + keysize = ltc_ecc_sets[x].size; + + if (keysize > ECC_MAXSIZE || ltc_ecc_sets[x].size == 0) { + return CRYPT_INVALID_KEYSIZE; + } + err = ecc_make_key_ex(prng, wprng, key, <c_ecc_sets[x]); + key->idx = x; + return err; +} + +int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set_type *dp) +{ + int err; + ecc_point *base; + void *prime, *order; + unsigned char *buf; + int keysize; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + LTC_ARGCHK(dp != NULL); + + /* good prng? */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + key->idx = -1; + key->dp = dp; + keysize = dp->size; + + /* allocate ram */ + base = NULL; + buf = XMALLOC(ECC_MAXSIZE); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* make up random string */ + if (prng_descriptor[wprng]->read(buf, (unsigned long)keysize, prng) != (unsigned long)keysize) { + err = CRYPT_ERROR_READPRNG; + goto ERR_BUF; + } + + /* setup the key variables */ + if ((err = mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, &prime, &order, NULL)) != CRYPT_OK) { + goto ERR_BUF; + } + base = ltc_ecc_new_point(); + if (base == NULL) { + err = CRYPT_MEM; + goto errkey; + } + + /* read in the specs for this key */ + if ((err = mp_read_radix(prime, (char *)key->dp->prime, 16)) != CRYPT_OK) { goto errkey; } + if ((err = mp_read_radix(order, (char *)key->dp->order, 16)) != CRYPT_OK) { goto errkey; } + if ((err = mp_read_radix(base->x, (char *)key->dp->Gx, 16)) != CRYPT_OK) { goto errkey; } + if ((err = mp_read_radix(base->y, (char *)key->dp->Gy, 16)) != CRYPT_OK) { goto errkey; } + if ((err = mp_set(base->z, 1)) != CRYPT_OK) { goto errkey; } + if ((err = mp_read_unsigned_bin(key->k, (unsigned char *)buf, keysize)) != CRYPT_OK) { goto errkey; } + + /* the key should be smaller than the order of base point */ + if (mp_cmp(key->k, order) != LTC_MP_LT) { + if((err = mp_mod(key->k, order, key->k)) != CRYPT_OK) { goto errkey; } + } + /* make the public key */ + if ((err = ltc_mp.ecc_ptmul(key->k, base, &key->pubkey, prime, 1)) != CRYPT_OK) { goto errkey; } + key->type = PK_PRIVATE; + + /* free up ram */ + err = CRYPT_OK; + goto cleanup; +errkey: + mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); +cleanup: + ltc_ecc_del_point(base); + mp_clear_multi(prime, order, NULL); +ERR_BUF: +#ifdef LTC_CLEAN_STACK + zeromem(buf, ECC_MAXSIZE); +#endif + XFREE(buf); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_make_key.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_shared_secret.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_shared_secret.c new file mode 100644 index 0000000..5c0b563 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_shared_secret.c @@ -0,0 +1,121 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_shared_secret.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Create an ECC shared secret between two keys + @param private_key The private ECC key + @param public_key The public key + @param out [out] Destination of the shared secret (Conforms to EC-DH from ANSI X9.63) + @param outlen [in/out] The max size and resulting size of the shared secret + @return CRYPT_OK if successful +*/ +int ecc_shared_secret(ecc_key *private_key, ecc_key *public_key, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x; + ecc_point *result; + void *prime; + int err; + + LTC_ARGCHK(private_key != NULL); + LTC_ARGCHK(public_key != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* type valid? */ + if (private_key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + if (ltc_ecc_is_valid_idx(private_key->idx) == 0 || ltc_ecc_is_valid_idx(public_key->idx) == 0) { + return CRYPT_INVALID_ARG; + } + + if (XSTRCMP(private_key->dp->name, public_key->dp->name) != 0) { + return CRYPT_PK_TYPE_MISMATCH; + } + + /* make new point */ + result = ltc_ecc_new_point(); + if (result == NULL) { + return CRYPT_MEM; + } + + if ((err = mp_init(&prime)) != CRYPT_OK) { + ltc_ecc_del_point(result); + return err; + } + + if ((err = mp_read_radix(prime, (char *)private_key->dp->prime, 16)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptmul(private_key->k, &public_key->pubkey, result, prime, 1)) != CRYPT_OK) { goto done; } + + x = (unsigned long)mp_unsigned_bin_size(prime); + if (*outlen < x) { + *outlen = x; + err = CRYPT_BUFFER_OVERFLOW; + goto done; + } + zeromem(out, x); + if ((err = mp_to_unsigned_bin(result->x, out + (x - mp_unsigned_bin_size(result->x)))) != CRYPT_OK) { goto done; } + + err = CRYPT_OK; + *outlen = x; +done: + mp_clear(prime); + ltc_ecc_del_point(result); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_shared_secret.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_sign_hash.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_sign_hash.c new file mode 100644 index 0000000..0f5f3ae --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_sign_hash.c @@ -0,0 +1,179 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_sign_hash.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Sign a hash with ECC + @param in The hash to sign + @param inlen The length of the hash to sign + @param r The "r" integer of the signature (caller must initialize with mp_init() first) + @param s The "s" integer of the signature (caller must initialize with mp_init() first) + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param key A private ECC key + @return CRYPT_OK if successful +*/ +int ecc_sign_hash_raw(const unsigned char *in, unsigned long inlen, + void *r, void *s, + prng_state *prng, int wprng, ecc_key *key) +{ + ecc_key pubkey; + void *e, *p; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(r != NULL); + LTC_ARGCHK(s != NULL); + LTC_ARGCHK(key != NULL); + + /* is this a private key? */ + if (key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* is the IDX valid ? */ + if (ltc_ecc_is_valid_idx(key->idx) != 1) { + return CRYPT_PK_INVALID_TYPE; + } + + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + /* get the hash and load it as a bignum into 'e' */ + /* init the bignums */ + if ((err = mp_init_multi(&p, &e, NULL)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(p, (char *)key->dp->order, 16)) != CRYPT_OK) { goto errnokey; } + if ((err = mp_read_unsigned_bin(e, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto errnokey; } + + /* make up a key and export the public copy */ + for (;;) { + if ((err = ecc_make_key_ex(prng, wprng, &pubkey, key->dp)) != CRYPT_OK) { + goto errnokey; + } + + /* find r = x1 mod n */ + if ((err = mp_mod(pubkey.pubkey.x, p, r)) != CRYPT_OK) { goto error; } + + if (mp_iszero(r) == LTC_MP_YES) { + ecc_free(&pubkey); + } else { + /* find s = (e + xr)/k */ + if ((err = mp_invmod(pubkey.k, p, pubkey.k)) != CRYPT_OK) { goto error; } /* k = 1/k */ + if ((err = mp_mulmod(key->k, r, p, s)) != CRYPT_OK) { goto error; } /* s = xr */ + if ((err = mp_add(e, s, s)) != CRYPT_OK) { goto error; } /* s = e + xr */ + if ((err = mp_mod(s, p, s)) != CRYPT_OK) { goto error; } /* s = e + xr */ + if ((err = mp_mulmod(s, pubkey.k, p, s)) != CRYPT_OK) { goto error; } /* s = (e + xr)/k */ + ecc_free(&pubkey); + if (mp_iszero(s) == LTC_MP_NO) { + break; + } + } + } + + err = CRYPT_OK; + goto errnokey; + +error: + ecc_free(&pubkey); +errnokey: + mp_clear_multi(p, e, NULL); + return err; +} + +/** + Sign a message digest + @param in The message digest to sign + @param inlen The length of the digest + @param out [out] The destination for the signature + @param outlen [in/out] The max size and resulting size of the signature + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param key A private ECC key + @return CRYPT_OK if successful +*/ +int ecc_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, ecc_key *key) +{ + void *r, *s; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + if (mp_init_multi(&r, &s, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + if ((err = ecc_sign_hash_raw(in, inlen, r, s, prng, wprng, key)) != CRYPT_OK) { + goto error; + } + + /* store as SEQUENCE { r, s -- integer } */ + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_EOL, 0UL, NULL); + +error: + mp_clear_multi(r, s, NULL); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_sign_hash.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_sizes.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_sizes.c new file mode 100644 index 0000000..da8a45d --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_sizes.c @@ -0,0 +1,74 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_sizes.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +void ecc_sizes(int *low, int *high) +{ + int i; + LTC_ARGCHKVD(low != NULL); + LTC_ARGCHKVD(high != NULL); + + *low = INT_MAX; + *high = 0; + for (i = 0; ltc_ecc_sets[i].size != 0; i++) { + if (ltc_ecc_sets[i].size < *low) { + *low = ltc_ecc_sets[i].size; + } + if (ltc_ecc_sets[i].size > *high) { + *high = ltc_ecc_sets[i].size; + } + } +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_sizes.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ecc_verify_hash.c b/core/lib/libtomcrypt/src/pk/ecc/ecc_verify_hash.c new file mode 100644 index 0000000..2ee3609 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ecc_verify_hash.c @@ -0,0 +1,228 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_verify_hash.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/* verify + * + * w = s^-1 mod n + * u1 = xw + * u2 = rw + * X = u1*G + u2*Q + * v = X_x1 mod n + * accept if v == r + */ + +/** + Verify a ECC signature + @param r ECC "r" parameter + @param s ECC "s" parameter + @param hash The hash that was signed + @param hashlen The length of the hash that was signed + @param stat [out] The result of the signature verification, 1==valid, 0==invalid + @param key The corresponding public DH key + @return CRYPT_OK if successful (even if the signature is invalid) +*/ +int ecc_verify_hash_raw( void *r, void *s, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key) +{ + ecc_point *mG, *mQ; + void *v, *w, *u1, *u2, *e, *p, *m; + void *mp = NULL; + int err; + + LTC_ARGCHK(r != NULL); + LTC_ARGCHK(s != NULL); + LTC_ARGCHK(hash != NULL); + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + + /* default to invalid signature */ + *stat = 0; + mp = NULL; + + /* is the IDX valid ? */ + if (ltc_ecc_is_valid_idx(key->idx) != 1) { + return CRYPT_PK_INVALID_TYPE; + } + + /* allocate ints */ + if ((err = mp_init_multi(&v, &w, &u1, &u2, &p, &e, &m, NULL)) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* allocate points */ + mG = ltc_ecc_new_point(); + mQ = ltc_ecc_new_point(); + if (mQ == NULL || mG == NULL) { + err = CRYPT_MEM; + goto error; + } + + /* get the order */ + if ((err = mp_read_radix(p, (char *)key->dp->order, 16)) != CRYPT_OK) { goto error; } + + /* get the modulus */ + if ((err = mp_read_radix(m, (char *)key->dp->prime, 16)) != CRYPT_OK) { goto error; } + + /* check for zero */ + if (mp_iszero(r) || mp_iszero(s) || mp_cmp(r, p) != LTC_MP_LT || mp_cmp(s, p) != LTC_MP_LT) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* read hash */ + if ((err = mp_read_unsigned_bin(e, (unsigned char *)hash, (int)hashlen)) != CRYPT_OK) { goto error; } + + /* w = s^-1 mod n */ + if ((err = mp_invmod(s, p, w)) != CRYPT_OK) { goto error; } + + /* u1 = ew */ + if ((err = mp_mulmod(e, w, p, u1)) != CRYPT_OK) { goto error; } + + /* u2 = rw */ + if ((err = mp_mulmod(r, w, p, u2)) != CRYPT_OK) { goto error; } + + /* find mG and mQ */ + if ((err = mp_read_radix(mG->x, (char *)key->dp->Gx, 16)) != CRYPT_OK) { goto error; } + if ((err = mp_read_radix(mG->y, (char *)key->dp->Gy, 16)) != CRYPT_OK) { goto error; } + if ((err = mp_set(mG->z, 1)) != CRYPT_OK) { goto error; } + + if ((err = mp_copy(key->pubkey.x, mQ->x)) != CRYPT_OK) { goto error; } + if ((err = mp_copy(key->pubkey.y, mQ->y)) != CRYPT_OK) { goto error; } + if ((err = mp_copy(key->pubkey.z, mQ->z)) != CRYPT_OK) { goto error; } + + /* compute u1*mG + u2*mQ = mG */ + if (ltc_mp.ecc_mul2add == NULL) { + if ((err = ltc_mp.ecc_ptmul(u1, mG, mG, m, 0)) != CRYPT_OK) { goto error; } + if ((err = ltc_mp.ecc_ptmul(u2, mQ, mQ, m, 0)) != CRYPT_OK) { goto error; } + + /* find the montgomery mp */ + if ((err = mp_montgomery_setup(m, &mp)) != CRYPT_OK) { goto error; } + + /* add them */ + if ((err = ltc_mp.ecc_ptadd(mQ, mG, mG, m, mp)) != CRYPT_OK) { goto error; } + + /* reduce */ + if ((err = ltc_mp.ecc_map(mG, m, mp)) != CRYPT_OK) { goto error; } + } else { + /* use Shamir's trick to compute u1*mG + u2*mQ using half of the doubles */ + if ((err = ltc_mp.ecc_mul2add(mG, u1, mQ, u2, mG, m)) != CRYPT_OK) { goto error; } + } + + /* v = X_x1 mod n */ + if ((err = mp_mod(mG->x, p, v)) != CRYPT_OK) { goto error; } + + /* does v == r */ + if (mp_cmp(v, r) == LTC_MP_EQ) { + *stat = 1; + } + + /* clear up and return */ + err = CRYPT_OK; +error: + ltc_ecc_del_point(mG); + ltc_ecc_del_point(mQ); + mp_clear_multi(v, w, u1, u2, p, e, m, NULL); + if (mp != NULL) { + mp_montgomery_free(mp); + } + return err; +} + +/** + Verify an ECC signature + @param sig The signature to verify + @param siglen The length of the signature (octets) + @param hash The hash (message digest) that was signed + @param hashlen The length of the hash (octets) + @param stat Result of signature, 1==valid, 0==invalid + @param key The corresponding public ECC key + @return CRYPT_OK if successful (even if the signature is not valid) +*/ + +int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key) +{ + void *r, *s; + int err; + + LTC_ARGCHK(sig != NULL); + LTC_ARGCHK(hash != NULL); + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + + /* allocate ints */ + if ((err = mp_init_multi(&r, &s, NULL)) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* parse header */ + if ((err = der_decode_sequence_multi(sig, siglen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto error; + } + + /* do the op */ + err = ecc_verify_hash_raw(r, s, hash, hashlen, stat, key); + +error: + mp_clear_multi(r, s, NULL); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_verify_hash.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c new file mode 100644 index 0000000..2509273 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c @@ -0,0 +1,72 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_is_valid_idx.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** Returns whether an ECC idx is valid or not + @param n The idx number to check + @return 1 if valid, 0 if not +*/ +int ltc_ecc_is_valid_idx(int n) +{ + int x; + + for (x = 0; ltc_ecc_sets[x].size != 0; x++); + /* -1 is a valid index --- indicating that the domain params were supplied by the user */ + if ((n >= -1) && (n < x)) { + return 1; + } + return 0; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_map.c b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_map.c new file mode 100644 index 0000000..7f5447a --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_map.c @@ -0,0 +1,102 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_map.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Map a projective jacbobian point back to affine space + @param P [in/out] The point to map + @param modulus The modulus of the field the ECC curve is in + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success +*/ +int ltc_ecc_map(ecc_point *P, void *modulus, void *mp) +{ + void *t1, *t2; + int err; + + LTC_ARGCHK(P != NULL); + LTC_ARGCHK(modulus != NULL); + LTC_ARGCHK(mp != NULL); + + if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* first map z back to normal */ + if ((err = mp_montgomery_reduce(P->z, modulus, mp)) != CRYPT_OK) { goto done; } + + /* get 1/z */ + if ((err = mp_invmod(P->z, modulus, t1)) != CRYPT_OK) { goto done; } + + /* get 1/z^2 and 1/z^3 */ + if ((err = mp_sqr(t1, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_mod(t2, modulus, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_mul(t1, t2, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_mod(t1, modulus, t1)) != CRYPT_OK) { goto done; } + + /* multiply against x/y */ + if ((err = mp_mul(P->x, t2, P->x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(P->x, modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = mp_mul(P->y, t1, P->y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(P->y, modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = mp_set(P->z, 1)) != CRYPT_OK) { goto done; } + + err = CRYPT_OK; +done: + mp_clear_multi(t1, t2, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_map.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c new file mode 100644 index 0000000..dc4cb6b --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c @@ -0,0 +1,234 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_mul2add.c + ECC Crypto, Shamir's Trick, Tom St Denis +*/ + +#ifdef LTC_MECC + +#ifdef LTC_ECC_SHAMIR + +/** Computes kA*A + kB*B = C using Shamir's Trick + @param A First point to multiply + @param kA What to multiple A by + @param B Second point to multiply + @param kB What to multiple B by + @param C [out] Destination point (can overlap with A or B + @param modulus Modulus for curve + @return CRYPT_OK on success +*/ +int ltc_ecc_mul2add(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, + void *modulus) +{ + ecc_point *precomp[16]; + unsigned bitbufA, bitbufB, lenA, lenB, len, x, y, nA, nB, nibble; + unsigned char *tA, *tB; + int err, first; + void *mp, *mu; + + /* argchks */ + LTC_ARGCHK(A != NULL); + LTC_ARGCHK(B != NULL); + LTC_ARGCHK(C != NULL); + LTC_ARGCHK(kA != NULL); + LTC_ARGCHK(kB != NULL); + LTC_ARGCHK(modulus != NULL); + + /* allocate memory */ + tA = XCALLOC(1, ECC_BUF_SIZE); + if (tA == NULL) { + return CRYPT_MEM; + } + tB = XCALLOC(1, ECC_BUF_SIZE); + if (tB == NULL) { + XFREE(tA); + return CRYPT_MEM; + } + + /* get sizes */ + lenA = mp_unsigned_bin_size(kA); + lenB = mp_unsigned_bin_size(kB); + len = MAX(lenA, lenB); + + /* sanity check */ + if ((lenA > ECC_BUF_SIZE) || (lenB > ECC_BUF_SIZE)) { + err = CRYPT_INVALID_ARG; + goto ERR_T; + } + + /* extract and justify kA */ + mp_to_unsigned_bin(kA, (len - lenA) + tA); + + /* extract and justify kB */ + mp_to_unsigned_bin(kB, (len - lenB) + tB); + + /* allocate the table */ + for (x = 0; x < 16; x++) { + precomp[x] = ltc_ecc_new_point(); + if (precomp[x] == NULL) { + for (y = 0; y < x; ++y) { + ltc_ecc_del_point(precomp[y]); + } + err = CRYPT_MEM; + goto ERR_T; + } + } + + /* init montgomery reduction */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + goto ERR_P; + } + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto ERR_MP; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto ERR_MU; + } + + /* copy ones ... */ + if ((err = mp_mulmod(A->x, mu, modulus, precomp[1]->x)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_mulmod(A->y, mu, modulus, precomp[1]->y)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_mulmod(A->z, mu, modulus, precomp[1]->z)) != CRYPT_OK) { goto ERR_MU; } + + if ((err = mp_mulmod(B->x, mu, modulus, precomp[1<<2]->x)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_mulmod(B->y, mu, modulus, precomp[1<<2]->y)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_mulmod(B->z, mu, modulus, precomp[1<<2]->z)) != CRYPT_OK) { goto ERR_MU; } + + /* precomp [i,0](A + B) table */ + if ((err = ltc_mp.ecc_ptdbl(precomp[1], precomp[2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + if ((err = ltc_mp.ecc_ptadd(precomp[1], precomp[2], precomp[3], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + + /* precomp [0,i](A + B) table */ + if ((err = ltc_mp.ecc_ptdbl(precomp[1<<2], precomp[2<<2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + if ((err = ltc_mp.ecc_ptadd(precomp[1<<2], precomp[2<<2], precomp[3<<2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + + /* precomp [i,j](A + B) table (i != 0, j != 0) */ + for (x = 1; x < 4; x++) { + for (y = 1; y < 4; y++) { + if ((err = ltc_mp.ecc_ptadd(precomp[x], precomp[(y<<2)], precomp[x+(y<<2)], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + } + } + + nibble = 3; + first = 1; + bitbufA = tA[0]; + bitbufB = tB[0]; + + /* for every byte of the multiplicands */ + for (x = -1;; ) { + /* grab a nibble */ + if (++nibble == 4) { + ++x; if (x == len) break; + bitbufA = tA[x]; + bitbufB = tB[x]; + nibble = 0; + } + + /* extract two bits from both, shift/update */ + nA = (bitbufA >> 6) & 0x03; + nB = (bitbufB >> 6) & 0x03; + bitbufA = (bitbufA << 2) & 0xFF; + bitbufB = (bitbufB << 2) & 0xFF; + + /* if both zero, if first, continue */ + if ((nA == 0) && (nB == 0) && (first == 1)) { + continue; + } + + /* double twice, only if this isn't the first */ + if (first == 0) { + /* double twice */ + if ((err = ltc_mp.ecc_ptdbl(C, C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + if ((err = ltc_mp.ecc_ptdbl(C, C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + } + + /* if not both zero */ + if ((nA != 0) || (nB != 0)) { + if (first == 1) { + /* if first, copy from table */ + first = 0; + if ((err = mp_copy(precomp[nA + (nB<<2)]->x, C->x)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_copy(precomp[nA + (nB<<2)]->y, C->y)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_copy(precomp[nA + (nB<<2)]->z, C->z)) != CRYPT_OK) { goto ERR_MU; } + } else { + /* if not first, add from table */ + if ((err = ltc_mp.ecc_ptadd(C, precomp[nA + (nB<<2)], C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + } + } + } + + /* reduce to affine */ + err = ltc_ecc_map(C, modulus, mp); + + /* clean up */ +ERR_MU: + mp_clear(mu); +ERR_MP: + mp_montgomery_free(mp); +ERR_P: + for (x = 0; x < 16; x++) { + ltc_ecc_del_point(precomp[x]); + } +ERR_T: +#ifdef LTC_CLEAN_STACK + zeromem(tA, ECC_BUF_SIZE); + zeromem(tB, ECC_BUF_SIZE); +#endif + XFREE(tA); + XFREE(tB); + + return err; +} + +#endif +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c new file mode 100644 index 0000000..dfd59aa --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c @@ -0,0 +1,251 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_mulmod.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC +#ifndef LTC_ECC_TIMING_RESISTANT + +/* size of sliding window, don't change this! MUST BE A POWER OF TWO */ +#define WINSIZE 4 +#define WINVARS (1 << (WINSIZE - 1)) + +/** + Perform a point multiplication + @param k The scalar to multiply by + @param G The base point + @param R [out] Destination for kG + @param modulus The modulus of the field the ECC curve is in + @param map Boolean whether to map back to affine or not (1==map, 0 == leave in projective) + @return CRYPT_OK on success +*/ +int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) +{ + ecc_point *tG, *M[WINVARS]; + int i, j, err; + void *mu, *mp; + ltc_mp_digit buf; + int first, bitbuf, bitcpy, bitcnt, mode, digidx; + + LTC_ARGCHK(k != NULL); + LTC_ARGCHK(G != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + + /* init montgomery reduction */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + return err; + } + if ((err = mp_init(&mu)) != CRYPT_OK) { + mp_montgomery_free(mp); + return err; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + mp_montgomery_free(mp); + mp_clear(mu); + return err; + } + + /* alloc ram for window temps */ + for (i = 0; i < WINVARS; i++) { + M[i] = ltc_ecc_new_point(); + if (M[i] == NULL) { + for (j = 0; j < i; j++) { + ltc_ecc_del_point(M[j]); + } + mp_montgomery_free(mp); + mp_clear(mu); + return CRYPT_MEM; + } + } + + /* make a copy of G incase R==G */ + tG = ltc_ecc_new_point(); + if (tG == NULL) { err = CRYPT_MEM; goto done; } + + /* tG = G and convert to montgomery */ + if (mp_cmp_d(mu, 1) == LTC_MP_EQ) { + if ((err = mp_copy(G->x, tG->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(G->y, tG->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(G->z, tG->z)) != CRYPT_OK) { goto done; } + } else { + if ((err = mp_mulmod(G->x, mu, modulus, tG->x)) != CRYPT_OK) { goto done; } + if ((err = mp_mulmod(G->y, mu, modulus, tG->y)) != CRYPT_OK) { goto done; } + if ((err = mp_mulmod(G->z, mu, modulus, tG->z)) != CRYPT_OK) { goto done; } + } + mp_clear(mu); + mu = NULL; + + /* calc the M tab, which holds kG for k==8..15 */ + /* M[0] == [WINVARS].G */ + if ((err = ltc_mp.ecc_ptdbl(tG, M[0], modulus, mp)) != CRYPT_OK) { goto done; } + for (j = 1; j < (WINSIZE-1); ++j) { + if ((err = ltc_mp.ecc_ptdbl(M[0], M[0], modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* now find (WINVARS+k)G for k=1..(WINVARS-1) */ + for (j = (WINVARS + 1); j < (2*WINVARS); j++) { + if ((err = ltc_mp.ecc_ptadd(M[j-(WINVARS + 1)], tG, M[j-WINVARS], modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* setup sliding window */ + mode = 0; + bitcnt = 1; + buf = 0; + digidx = mp_get_digit_count(k) - 1; + bitcpy = bitbuf = 0; + first = 1; + + /* perform ops */ + for (;;) { + /* grab next digit as required */ + if (--bitcnt == 0) { + if (digidx == -1) { + break; + } + buf = mp_get_digit(k, digidx); + bitcnt = (int) ltc_mp.bits_per_digit; + --digidx; + } + + /* grab the next msb from the ltiplicand */ + i = (buf >> (ltc_mp.bits_per_digit - 1)) & 1; + buf <<= 1; + + /* skip leading zero bits */ + if (mode == 0 && i == 0) { + continue; + } + + /* if the bit is zero and mode == 1 then we double */ + if (mode == 1 && i == 0) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } + continue; + } + + /* else we add it to the window */ + bitbuf |= (i << (WINSIZE - ++bitcpy)); + mode = 2; + + if (bitcpy == WINSIZE) { + /* if this is the first window we do a simple copy */ + if (first == 1) { + /* R = kG [k = first window] */ + if ((err = mp_copy(M[bitbuf-WINVARS]->x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(M[bitbuf-WINVARS]->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(M[bitbuf-WINVARS]->z, R->z)) != CRYPT_OK) { goto done; } + first = 0; + } else { + /* normal window */ + /* ok window is filled so double as required and add */ + /* double first */ + for (j = 0; j < WINSIZE; j++) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* then add, bitbuf will be WINVARS..(2*WINVARS - 1) guaranteed */ + if ((err = ltc_mp.ecc_ptadd(R, M[bitbuf-WINVARS], R, modulus, mp)) != CRYPT_OK) { goto done; } + } + /* empty window and reset */ + bitcpy = bitbuf = 0; + mode = 1; + } + } + + /* if bits remain then double/add */ + if (mode == 2 && bitcpy > 0) { + /* double then add */ + for (j = 0; j < bitcpy; j++) { + /* only double if we have had at least one add first */ + if (first == 0) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } + } + + bitbuf <<= 1; + if ((bitbuf & (1 << WINSIZE)) != 0) { + if (first == 1){ + /* first add, so copy */ + if ((err = mp_copy(tG->x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(tG->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(tG->z, R->z)) != CRYPT_OK) { goto done; } + first = 0; + } else { + /* then add */ + if ((err = ltc_mp.ecc_ptadd(R, tG, R, modulus, mp)) != CRYPT_OK) { goto done; } + } + } + } + } + + /* map R back from projective space */ + if (map) { + err = ltc_ecc_map(R, modulus, mp); + } else { + err = CRYPT_OK; + } +done: + if (mu != NULL) { + mp_clear(mu); + } + mp_montgomery_free(mp); + ltc_ecc_del_point(tG); + for (i = 0; i < WINVARS; i++) { + ltc_ecc_del_point(M[i]); + } + return err; +} + +#endif + +#undef WINSIZE + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c,v $ */ +/* $Revision: 1.26 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c new file mode 100644 index 0000000..38af150 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c @@ -0,0 +1,191 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_mulmod_timing.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +#ifdef LTC_ECC_TIMING_RESISTANT + +/** + Perform a point multiplication (timing resistant) + @param k The scalar to multiply by + @param G The base point + @param R [out] Destination for kG + @param modulus The modulus of the field the ECC curve is in + @param map Boolean whether to map back to affine or not (1==map, 0 == leave in projective) + @return CRYPT_OK on success +*/ +int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) +{ + ecc_point *tG, *M[3]; + int i, j, err; + void *mu, *mp; + ltc_mp_digit buf; + int bitcnt, mode, digidx; + + LTC_ARGCHK(k != NULL); + LTC_ARGCHK(G != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + + /* init montgomery reduction */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + return err; + } + if ((err = mp_init(&mu)) != CRYPT_OK) { + mp_montgomery_free(mp); + return err; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + mp_clear(mu); + mp_montgomery_free(mp); + return err; + } + + /* alloc ram for window temps */ + for (i = 0; i < 3; i++) { + M[i] = ltc_ecc_new_point(); + if (M[i] == NULL) { + for (j = 0; j < i; j++) { + ltc_ecc_del_point(M[j]); + } + mp_clear(mu); + mp_montgomery_free(mp); + return CRYPT_MEM; + } + } + + /* make a copy of G incase R==G */ + tG = ltc_ecc_new_point(); + if (tG == NULL) { err = CRYPT_MEM; goto done; } + + /* tG = G and convert to montgomery */ + if ((err = mp_mulmod(G->x, mu, modulus, tG->x)) != CRYPT_OK) { goto done; } + if ((err = mp_mulmod(G->y, mu, modulus, tG->y)) != CRYPT_OK) { goto done; } + if ((err = mp_mulmod(G->z, mu, modulus, tG->z)) != CRYPT_OK) { goto done; } + mp_clear(mu); + mu = NULL; + + /* calc the M tab */ + /* M[0] == G */ + if ((err = mp_copy(tG->x, M[0]->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(tG->y, M[0]->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(tG->z, M[0]->z)) != CRYPT_OK) { goto done; } + /* M[1] == 2G */ + if ((err = ltc_mp.ecc_ptdbl(tG, M[1], modulus, mp)) != CRYPT_OK) { goto done; } + + /* setup sliding window */ + mode = 0; + bitcnt = 1; + buf = 0; + digidx = mp_get_digit_count(k) - 1; + + /* perform ops */ + for (;;) { + /* grab next digit as required */ + if (--bitcnt == 0) { + if (digidx == -1) { + break; + } + buf = mp_get_digit(k, digidx); + bitcnt = (int) MP_DIGIT_BIT; + --digidx; + } + + /* grab the next msb from the ltiplicand */ + i = (buf >> (MP_DIGIT_BIT - 1)) & 1; + buf <<= 1; + + if (mode == 0 && i == 0) { + /* dummy operations */ + if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptdbl(M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } + continue; + } + + if (mode == 0 && i == 1) { + mode = 1; + /* dummy operations */ + if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptdbl(M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } + continue; + } + + if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[i^1], modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptdbl(M[i], M[i], modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* copy result out */ + if ((err = mp_copy(M[0]->x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(M[0]->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(M[0]->z, R->z)) != CRYPT_OK) { goto done; } + + /* map R back from projective space */ + if (map) { + err = ltc_ecc_map(R, modulus, mp); + } else { + err = CRYPT_OK; + } +done: + if (mu != NULL) { + mp_clear(mu); + } + mp_montgomery_free(mp); + ltc_ecc_del_point(tG); + for (i = 0; i < 3; i++) { + ltc_ecc_del_point(M[i]); + } + return err; +} + +#endif +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_points.c b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_points.c new file mode 100644 index 0000000..1f4a002 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_points.c @@ -0,0 +1,87 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_points.c + ECC Crypto, Tom St Denis +*/ + +#ifdef LTC_MECC + +/** + Allocate a new ECC point + @return A newly allocated point or NULL on error +*/ +ecc_point *ltc_ecc_new_point(void) +{ + ecc_point *p; + p = XCALLOC(1, sizeof(*p)); + if (p == NULL) { + return NULL; + } + if (mp_init_multi_size(LTC_MAX_ECC * 2, + &p->x, &p->y, &p->z, NULL) != CRYPT_OK) { + XFREE(p); + return NULL; + } + return p; +} + +/** Free an ECC point from memory + @param p The point to free +*/ +void ltc_ecc_del_point(ecc_point *p) +{ + /* prevents free'ing null arguments */ + if (p != NULL) { + mp_clear_multi(p->x, p->y, p->z, NULL); /* note: p->z may be NULL but that's ok with this function anyways */ + XFREE(p); + } +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_points.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c new file mode 100644 index 0000000..7c89a89 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c @@ -0,0 +1,222 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_projective_add_point.c + ECC Crypto, Tom St Denis +*/ + +#if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_DESC)) + +/** + Add two ECC points + @param P The point to add + @param Q The point to add + @param R [out] The destination of the double + @param modulus The modulus of the field the ECC curve is in + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success +*/ +int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp) +{ + void *t1, *t2, *x, *y, *z; + int err; + + LTC_ARGCHK(P != NULL); + LTC_ARGCHK(Q != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + LTC_ARGCHK(mp != NULL); + + if ((err = mp_init_multi(&t1, &t2, &x, &y, &z, NULL)) != CRYPT_OK) { + return err; + } + + /* should we dbl instead? */ + if ((err = mp_sub(modulus, Q->y, t1)) != CRYPT_OK) { goto done; } + + if ( (mp_cmp(P->x, Q->x) == LTC_MP_EQ) && + (Q->z != NULL && mp_cmp(P->z, Q->z) == LTC_MP_EQ) && + (mp_cmp(P->y, Q->y) == LTC_MP_EQ || mp_cmp(P->y, t1) == LTC_MP_EQ)) { + mp_clear_multi(t1, t2, x, y, z, NULL); + return ltc_ecc_projective_dbl_point(P, R, modulus, mp); + } + + if ((err = mp_copy(P->x, x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(P->y, y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(P->z, z)) != CRYPT_OK) { goto done; } + + /* if Z is one then these are no-operations */ + if (Q->z != NULL) { + /* T1 = Z' * Z' */ + if ((err = mp_sqr(Q->z, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* X = X * T1 */ + if ((err = mp_mul(t1, x, x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = Z' * T1 */ + if ((err = mp_mul(Q->z, t1, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* Y = Y * T1 */ + if ((err = mp_mul(t1, y, y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(y, modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* T1 = Z*Z */ + if ((err = mp_sqr(z, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* T2 = X' * T1 */ + if ((err = mp_mul(Q->x, t1, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = Z * T1 */ + if ((err = mp_mul(z, t1, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = Y' * T1 */ + if ((err = mp_mul(Q->y, t1, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + + /* Y = Y - T1 */ + if ((err = mp_sub(y, t1, y)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(y, 0) == LTC_MP_LT) { + if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } + } + /* T1 = 2T1 */ + if ((err = mp_add(t1, t1, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + /* T1 = Y + T1 */ + if ((err = mp_add(t1, y, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + /* X = X - T2 */ + if ((err = mp_sub(x, t2, x)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(x, 0) == LTC_MP_LT) { + if ((err = mp_add(x, modulus, x)) != CRYPT_OK) { goto done; } + } + /* T2 = 2T2 */ + if ((err = mp_add(t2, t2, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp(t2, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + /* T2 = X + T2 */ + if ((err = mp_add(t2, x, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp(t2, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + + /* if Z' != 1 */ + if (Q->z != NULL) { + /* Z = Z * Z' */ + if ((err = mp_mul(z, Q->z, z)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(z, modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* Z = Z * X */ + if ((err = mp_mul(z, x, z)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(z, modulus, mp)) != CRYPT_OK) { goto done; } + + /* T1 = T1 * X */ + if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* X = X * X */ + if ((err = mp_sqr(x, x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } + /* T2 = T2 * x */ + if ((err = mp_mul(t2, x, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = T1 * X */ + if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + + /* X = Y*Y */ + if ((err = mp_sqr(y, x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } + /* X = X - T2 */ + if ((err = mp_sub(x, t2, x)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(x, 0) == LTC_MP_LT) { + if ((err = mp_add(x, modulus, x)) != CRYPT_OK) { goto done; } + } + + /* T2 = T2 - X */ + if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(t2, 0) == LTC_MP_LT) { + if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + /* T2 = T2 - X */ + if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(t2, 0) == LTC_MP_LT) { + if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + /* T2 = T2 * Y */ + if ((err = mp_mul(t2, y, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* Y = T2 - T1 */ + if ((err = mp_sub(t2, t1, y)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(y, 0) == LTC_MP_LT) { + if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } + } + /* Y = Y/2 */ + if (mp_isodd(y)) { + if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } + } + if ((err = mp_div_2(y, y)) != CRYPT_OK) { goto done; } + + if ((err = mp_copy(x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(z, R->z)) != CRYPT_OK) { goto done; } + + err = CRYPT_OK; +done: + mp_clear_multi(t1, t2, x, y, z, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c,v $ */ +/* $Revision: 1.16 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c new file mode 100644 index 0000000..6cd0da9 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c @@ -0,0 +1,173 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_projective_dbl_point.c + ECC Crypto, Tom St Denis +*/ + +#if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_DESC)) + +/** + Double an ECC point + @param P The point to double + @param R [out] The destination of the double + @param modulus The modulus of the field the ECC curve is in + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success +*/ +int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *mp) +{ + void *t1, *t2; + int err; + + LTC_ARGCHK(P != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + LTC_ARGCHK(mp != NULL); + + if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { + return err; + } + + if (P != R) { + if ((err = mp_copy(P->x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(P->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(P->z, R->z)) != CRYPT_OK) { goto done; } + } + + /* t1 = Z * Z */ + if ((err = mp_sqr(R->z, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* Z = Y * Z */ + if ((err = mp_mul(R->z, R->y, R->z)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->z, modulus, mp)) != CRYPT_OK) { goto done; } + /* Z = 2Z */ + if ((err = mp_add(R->z, R->z, R->z)) != CRYPT_OK) { goto done; } + if (mp_cmp(R->z, modulus) != LTC_MP_LT) { + if ((err = mp_sub(R->z, modulus, R->z)) != CRYPT_OK) { goto done; } + } + + /* T2 = X - T1 */ + if ((err = mp_sub(R->x, t1, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(t2, 0) == LTC_MP_LT) { + if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + /* T1 = X + T1 */ + if ((err = mp_add(t1, R->x, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + /* T2 = T1 * T2 */ + if ((err = mp_mul(t1, t2, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = 2T2 */ + if ((err = mp_add(t2, t2, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + /* T1 = T1 + T2 */ + if ((err = mp_add(t1, t2, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + + /* Y = 2Y */ + if ((err = mp_add(R->y, R->y, R->y)) != CRYPT_OK) { goto done; } + if (mp_cmp(R->y, modulus) != LTC_MP_LT) { + if ((err = mp_sub(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } + } + /* Y = Y * Y */ + if ((err = mp_sqr(R->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } + /* T2 = Y * Y */ + if ((err = mp_sqr(R->y, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* T2 = T2/2 */ + if (mp_isodd(t2)) { + if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + if ((err = mp_div_2(t2, t2)) != CRYPT_OK) { goto done; } + /* Y = Y * X */ + if ((err = mp_mul(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } + + /* X = T1 * T1 */ + if ((err = mp_sqr(t1, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->x, modulus, mp)) != CRYPT_OK) { goto done; } + /* X = X - Y */ + if ((err = mp_sub(R->x, R->y, R->x)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { + if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } + } + /* X = X - Y */ + if ((err = mp_sub(R->x, R->y, R->x)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { + if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } + } + + /* Y = Y - X */ + if ((err = mp_sub(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { + if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } + } + /* Y = Y * T1 */ + if ((err = mp_mul(R->y, t1, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } + /* Y = Y - T2 */ + if ((err = mp_sub(R->y, t2, R->y)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { + if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } + } + + err = CRYPT_OK; +done: + mp_clear_multi(t1, t2, NULL); + return err; +} +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/ecc/sub.mk b/core/lib/libtomcrypt/src/pk/ecc/sub.mk new file mode 100644 index 0000000..6d38dbc --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/ecc/sub.mk @@ -0,0 +1,14 @@ +srcs-y += ecc.c +srcs-y += ecc_free.c +srcs-y += ecc_make_key.c +srcs-y += ecc_shared_secret.c +srcs-y += ecc_sign_hash.c +srcs-y += ecc_verify_hash.c +srcs-y += ltc_ecc_is_valid_idx.c +srcs-y += ltc_ecc_map.c +srcs-y += ltc_ecc_mulmod.c +srcs-y += ltc_ecc_mulmod_timing.c +srcs-y += ltc_ecc_mul2add.c +srcs-y += ltc_ecc_points.c +srcs-y += ltc_ecc_projective_add_point.c +srcs-y += ltc_ecc_projective_dbl_point.c diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c new file mode 100644 index 0000000..5e40bcb --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c @@ -0,0 +1,78 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_i2osp.c + Integer to Octet I2OSP, Tom St Denis +*/ + +#ifdef LTC_PKCS_1 + +/* always stores the same # of bytes, pads with leading zero bytes + as required + */ + +/** + LTC_PKCS #1 Integer to binary + @param n The integer to store + @param modulus_len The length of the RSA modulus + @param out [out] The destination for the integer + @return CRYPT_OK if successful +*/ +int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out) +{ + unsigned long size; + + size = mp_unsigned_bin_size(n); + + if (size > modulus_len) { + return CRYPT_BUFFER_OVERFLOW; + } + + /* store it */ + zeromem(out, modulus_len); + return mp_to_unsigned_bin(n, out+(modulus_len-size)); +} + +#endif /* LTC_PKCS_1 */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c new file mode 100644 index 0000000..393e146 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c @@ -0,0 +1,135 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_mgf1.c + The Mask Generation Function (MGF1) for PKCS #1, Tom St Denis +*/ + +#ifdef LTC_PKCS_1 + +/** + Perform PKCS #1 MGF1 (internal) + @param seed The seed for MGF1 + @param seedlen The length of the seed + @param hash_idx The index of the hash desired + @param mask [out] The destination + @param masklen The length of the mask desired + @return CRYPT_OK if successful +*/ +int pkcs_1_mgf1(int hash_idx, + const unsigned char *seed, unsigned long seedlen, + unsigned char *mask, unsigned long masklen) +{ + unsigned long hLen, x; + ulong32 counter; + int err; + hash_state *md; + unsigned char *buf; + + LTC_ARGCHK(seed != NULL); + LTC_ARGCHK(mask != NULL); + + /* ensure valid hash */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + /* get hash output size */ + hLen = hash_descriptor[hash_idx]->hashsize; + + /* allocate memory */ + md = XMALLOC(sizeof(hash_state)); + buf = XMALLOC(hLen); + if (md == NULL || buf == NULL) { + if (md != NULL) { + XFREE(md); + } + if (buf != NULL) { + XFREE(buf); + } + return CRYPT_MEM; + } + + /* start counter */ + counter = 0; + + while (masklen > 0) { + /* handle counter */ + STORE32H(counter, buf); + ++counter; + + /* get hash of seed || counter */ + if ((err = hash_descriptor[hash_idx]->init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->process(md, seed, seedlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->process(md, buf, 4)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->done(md, buf)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* store it */ + for (x = 0; x < hLen && masklen > 0; x++, masklen--) { + *mask++ = buf[x]; + } + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf, hLen); + zeromem(md, sizeof(hash_state)); +#endif + + XFREE(buf); + XFREE(md); + + return err; +} + +#endif /* LTC_PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c new file mode 100644 index 0000000..f5e1d98 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c @@ -0,0 +1,215 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_oaep_decode.c + OAEP Padding for PKCS #1, Tom St Denis +*/ + +#ifdef LTC_PKCS_1 + +/** + PKCS #1 v2.00 OAEP decode + @param msg The encoded data to decode + @param msglen The length of the encoded data (octets) + @param lparam The session or system data (can be NULL) + @param lparamlen The length of the lparam + @param modulus_bitlen The bit length of the RSA modulus + @param hash_idx The index of the hash desired + @param out [out] Destination of decoding + @param outlen [in/out] The max size and resulting size of the decoding + @param res [out] Result of decoding, 1==valid, 0==invalid + @return CRYPT_OK if successful +*/ +int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, + const unsigned char *lparam, unsigned long lparamlen, + unsigned long modulus_bitlen, int hash_idx, + unsigned char *out, unsigned long *outlen, + int *res) +{ + unsigned char *DB, *seed, *mask; + unsigned long hLen, x, y, modulus_len; + int err, ret; + + LTC_ARGCHK(msg != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(res != NULL); + + /* default to invalid packet */ + *res = 0; + + /* test valid hash */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + hLen = hash_descriptor[hash_idx]->hashsize; + modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); + + /* test hash/message size */ + if ((2*hLen >= (modulus_len - 2)) || (msglen != modulus_len)) { + return CRYPT_PK_INVALID_SIZE; + } + + /* allocate ram for DB/mask/salt of size modulus_len */ + DB = XMALLOC(modulus_len); + mask = XMALLOC(modulus_len); + seed = XMALLOC(hLen); + if (DB == NULL || mask == NULL || seed == NULL) { + if (DB != NULL) { + XFREE(DB); + } + if (mask != NULL) { + XFREE(mask); + } + if (seed != NULL) { + XFREE(seed); + } + return CRYPT_MEM; + } + + /* ok so it's now in the form + + 0x00 || maskedseed || maskedDB + + 1 || hLen || modulus_len - hLen - 1 + + */ + + ret = CRYPT_OK; + + /* must have leading 0x00 byte */ + if (msg[0] != 0x00) { + ret = CRYPT_INVALID_PACKET; + } + + /* now read the masked seed */ + x = 1; + XMEMCPY(seed, msg + x, hLen); + x += hLen; + + /* now read the masked DB */ + XMEMCPY(DB, msg + x, modulus_len - hLen - 1); + x += modulus_len - hLen - 1; + + /* compute MGF1 of maskedDB (hLen) */ + if ((err = pkcs_1_mgf1(hash_idx, DB, modulus_len - hLen - 1, mask, hLen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* XOR against seed */ + for (y = 0; y < hLen; y++) { + seed[y] ^= mask[y]; + } + + /* compute MGF1 of seed (k - hlen - 1) */ + if ((err = pkcs_1_mgf1(hash_idx, seed, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* xor against DB */ + for (y = 0; y < (modulus_len - hLen - 1); y++) { + DB[y] ^= mask[y]; + } + + /* now DB == lhash || PS || 0x01 || M, PS == k - mlen - 2hlen - 2 zeroes */ + + /* compute lhash and store it in seed [reuse temps!] */ + x = modulus_len; + if (lparam != NULL) { + if ((err = hash_memory(hash_idx, lparam, lparamlen, seed, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } else { + /* can't pass hash_memory a NULL so use DB with zero length */ + if ((err = hash_memory(hash_idx, DB, 0, seed, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* compare the lhash'es */ + if (XMEM_NEQ(seed, DB, hLen) != 0) { + ret = CRYPT_INVALID_PACKET; + } + + /* now zeroes before a 0x01 */ + for (x = hLen; x < (modulus_len - hLen - 1) && DB[x] == 0x00; x++) { + /* step... */ + } + + /* error if wasn't 0x01 */ + if (x == (modulus_len - hLen - 1) || DB[x] != 0x01) { + ret = CRYPT_INVALID_PACKET; + } + + /* rest is the message (and skip 0x01) */ + if ((modulus_len - hLen - 1 - ++x) > *outlen) { + ret = CRYPT_INVALID_PACKET; + } + + if (ret == CRYPT_OK) { + /* copy message */ + *outlen = modulus_len - hLen - 1 - x; + XMEMCPY(out, DB + x, modulus_len - hLen - 1 - x); + x += modulus_len - hLen - 1; + + /* valid packet */ + *res = 1; + } + err = ret; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(DB, modulus_len); + zeromem(seed, hLen); + zeromem(mask, modulus_len); +#endif + + XFREE(seed); + XFREE(mask); + XFREE(DB); + + return err; +} + +#endif /* LTC_PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c new file mode 100644 index 0000000..6bd3e1f --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c @@ -0,0 +1,200 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_oaep_encode.c + OAEP Padding for PKCS #1, Tom St Denis +*/ + +#ifdef LTC_PKCS_1 + +/** + PKCS #1 v2.00 OAEP encode + @param msg The data to encode + @param msglen The length of the data to encode (octets) + @param lparam A session or system parameter (can be NULL) + @param lparamlen The length of the lparam data + @param modulus_bitlen The bit length of the RSA modulus + @param prng An active PRNG state + @param prng_idx The index of the PRNG desired + @param hash_idx The index of the hash desired + @param out [out] The destination for the encoded data + @param outlen [in/out] The max size and resulting size of the encoded data + @return CRYPT_OK if successful +*/ +int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, + const unsigned char *lparam, unsigned long lparamlen, + unsigned long modulus_bitlen, prng_state *prng, + int prng_idx, int hash_idx, + unsigned char *out, unsigned long *outlen) +{ + unsigned char *DB, *seed, *mask; + unsigned long hLen, x, y, modulus_len; + int err; + + LTC_ARGCHK(msg != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* test valid hash */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + /* valid prng */ + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + + hLen = hash_descriptor[hash_idx]->hashsize; + modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); + + /* test message size */ + if ((2*hLen >= (modulus_len - 2)) || (msglen > (modulus_len - 2*hLen - 2))) { + return CRYPT_PK_INVALID_SIZE; + } + + /* allocate ram for DB/mask/salt of size modulus_len */ + DB = XMALLOC(modulus_len); + mask = XMALLOC(modulus_len); + seed = XMALLOC(hLen); + if (DB == NULL || mask == NULL || seed == NULL) { + if (DB != NULL) { + XFREE(DB); + } + if (mask != NULL) { + XFREE(mask); + } + if (seed != NULL) { + XFREE(seed); + } + return CRYPT_MEM; + } + + /* get lhash */ + /* DB == lhash || PS || 0x01 || M, PS == k - mlen - 2hlen - 2 zeroes */ + x = modulus_len; + if (lparam != NULL) { + if ((err = hash_memory(hash_idx, lparam, lparamlen, DB, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } else { + /* can't pass hash_memory a NULL so use DB with zero length */ + if ((err = hash_memory(hash_idx, DB, 0, DB, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* append PS then 0x01 (to lhash) */ + x = hLen; + y = modulus_len - msglen - 2*hLen - 2; + XMEMSET(DB+x, 0, y); + x += y; + + /* 0x01 byte */ + DB[x++] = 0x01; + + /* message (length = msglen) */ + XMEMCPY(DB+x, msg, msglen); + x += msglen; + + /* now choose a random seed */ + if (prng_descriptor[prng_idx]->read(seed, hLen, prng) != hLen) { + err = CRYPT_ERROR_READPRNG; + goto LBL_ERR; + } + + /* compute MGF1 of seed (k - hlen - 1) */ + if ((err = pkcs_1_mgf1(hash_idx, seed, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* xor against DB */ + for (y = 0; y < (modulus_len - hLen - 1); y++) { + DB[y] ^= mask[y]; + } + + /* compute MGF1 of maskedDB (hLen) */ + if ((err = pkcs_1_mgf1(hash_idx, DB, modulus_len - hLen - 1, mask, hLen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* XOR against seed */ + for (y = 0; y < hLen; y++) { + seed[y] ^= mask[y]; + } + + /* create string of length modulus_len */ + if (*outlen < modulus_len) { + *outlen = modulus_len; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* start output which is 0x00 || maskedSeed || maskedDB */ + x = 0; + out[x++] = 0x00; + XMEMCPY(out+x, seed, hLen); + x += hLen; + XMEMCPY(out+x, DB, modulus_len - hLen - 1); + x += modulus_len - hLen - 1; + + *outlen = x; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(DB, modulus_len); + zeromem(seed, hLen); + zeromem(mask, modulus_len); +#endif + + XFREE(seed); + XFREE(mask); + XFREE(DB); + + return err; +} + +#endif /* LTC_PKCS_1 */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c new file mode 100644 index 0000000..ee4d947 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_os2ip.c + Octet to Integer OS2IP, Tom St Denis +*/ +#ifdef LTC_PKCS_1 + +/** + Read a binary string into an mp_int + @param n [out] The mp_int destination + @param in The binary string to read + @param inlen The length of the binary string + @return CRYPT_OK if successful +*/ +int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen) +{ + return mp_read_unsigned_bin(n, in, inlen); +} + +#endif /* LTC_PKCS_1 */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c new file mode 100644 index 0000000..f79f79e --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c @@ -0,0 +1,205 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_pss_decode.c + PKCS #1 PSS Signature Padding, Tom St Denis +*/ + +#ifdef LTC_PKCS_1 + +/** + PKCS #1 v2.00 PSS decode + @param msghash The hash to verify + @param msghashlen The length of the hash (octets) + @param sig The signature data (encoded data) + @param siglen The length of the signature data (octets) + @param saltlen The length of the salt used (octets) + @param hash_idx The index of the hash desired + @param modulus_bitlen The bit length of the RSA modulus + @param res [out] The result of the comparison, 1==valid, 0==invalid + @return CRYPT_OK if successful (even if the comparison failed) +*/ +int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, + const unsigned char *sig, unsigned long siglen, + unsigned long saltlen, int hash_idx, + unsigned long modulus_bitlen, int *res) +{ + unsigned char *DB, *mask, *salt, *hash; + unsigned long x, y, hLen, modulus_len; + int err; + hash_state md; + + LTC_ARGCHK(msghash != NULL); + LTC_ARGCHK(res != NULL); + + /* default to invalid */ + *res = 0; + + /* ensure hash is valid */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + hLen = hash_descriptor[hash_idx]->hashsize; + modulus_bitlen--; + modulus_len = (modulus_bitlen>>3) + (modulus_bitlen & 7 ? 1 : 0); + + /* check sizes */ + if ((saltlen > modulus_len) || + (modulus_len < hLen + saltlen + 2)) { + return CRYPT_PK_INVALID_SIZE; + } + + /* allocate ram for DB/mask/salt/hash of size modulus_len */ + DB = XMALLOC(modulus_len); + mask = XMALLOC(modulus_len); + salt = XMALLOC(modulus_len); + hash = XMALLOC(modulus_len); + if (DB == NULL || mask == NULL || salt == NULL || hash == NULL) { + if (DB != NULL) { + XFREE(DB); + } + if (mask != NULL) { + XFREE(mask); + } + if (salt != NULL) { + XFREE(salt); + } + if (hash != NULL) { + XFREE(hash); + } + return CRYPT_MEM; + } + + /* ensure the 0xBC byte */ + if (sig[siglen-1] != 0xBC) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* copy out the DB */ + x = 0; + XMEMCPY(DB, sig + x, modulus_len - hLen - 1); + x += modulus_len - hLen - 1; + + /* copy out the hash */ + XMEMCPY(hash, sig + x, hLen); + /* x += hLen; */ + + /* check the MSB */ + if ((sig[0] & ~(0xFF >> ((modulus_len<<3) - (modulus_bitlen)))) != 0) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* generate mask of length modulus_len - hLen - 1 from hash */ + if ((err = pkcs_1_mgf1(hash_idx, hash, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* xor against DB */ + for (y = 0; y < (modulus_len - hLen - 1); y++) { + DB[y] ^= mask[y]; + } + + /* now clear the first byte [make sure smaller than modulus] */ + DB[0] &= 0xFF >> ((modulus_len<<3) - (modulus_bitlen)); + + /* DB = PS || 0x01 || salt, PS == modulus_len - saltlen - hLen - 2 zero bytes */ + + /* check for zeroes and 0x01 */ + for (x = 0; x < modulus_len - saltlen - hLen - 2; x++) { + if (DB[x] != 0x00) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + } + + /* check for the 0x01 */ + if (DB[x++] != 0x01) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* M = (eight) 0x00 || msghash || salt, mask = H(M) */ + if ((err = hash_descriptor[hash_idx]->init(&md)) != CRYPT_OK) { + goto LBL_ERR; + } + zeromem(mask, 8); + if ((err = hash_descriptor[hash_idx]->process(&md, mask, 8)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->process(&md, msghash, msghashlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->process(&md, DB+x, saltlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->done(&md, mask)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* mask == hash means valid signature */ + if (XMEM_NEQ(mask, hash, hLen) == 0) { + *res = 1; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(DB, modulus_len); + zeromem(mask, modulus_len); + zeromem(salt, modulus_len); + zeromem(hash, modulus_len); +#endif + + XFREE(hash); + XFREE(salt); + XFREE(mask); + XFREE(DB); + + return err; +} + +#endif /* LTC_PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c new file mode 100644 index 0000000..b975213 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c @@ -0,0 +1,203 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_pss_encode.c + PKCS #1 PSS Signature Padding, Tom St Denis +*/ + +#ifdef LTC_PKCS_1 + +/** + PKCS #1 v2.00 Signature Encoding + @param msghash The hash to encode + @param msghashlen The length of the hash (octets) + @param saltlen The length of the salt desired (octets) + @param prng An active PRNG context + @param prng_idx The index of the PRNG desired + @param hash_idx The index of the hash desired + @param modulus_bitlen The bit length of the RSA modulus + @param out [out] The destination of the encoding + @param outlen [in/out] The max size and resulting size of the encoded data + @return CRYPT_OK if successful +*/ +int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, + unsigned long saltlen, prng_state *prng, + int prng_idx, int hash_idx, + unsigned long modulus_bitlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned char *DB, *mask, *salt, *hash; + unsigned long x, y, hLen, modulus_len; + int err; + hash_state md; + + LTC_ARGCHK(msghash != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* ensure hash and PRNG are valid */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + + hLen = hash_descriptor[hash_idx]->hashsize; + modulus_bitlen--; + modulus_len = (modulus_bitlen>>3) + (modulus_bitlen & 7 ? 1 : 0); + + /* check sizes */ + if ((saltlen > modulus_len) || (modulus_len < hLen + saltlen + 2)) { + return CRYPT_PK_INVALID_SIZE; + } + + /* allocate ram for DB/mask/salt/hash of size modulus_len */ + DB = XMALLOC(modulus_len); + mask = XMALLOC(modulus_len); + salt = XMALLOC(modulus_len); + hash = XMALLOC(modulus_len); + if (DB == NULL || mask == NULL || salt == NULL || hash == NULL) { + if (DB != NULL) { + XFREE(DB); + } + if (mask != NULL) { + XFREE(mask); + } + if (salt != NULL) { + XFREE(salt); + } + if (hash != NULL) { + XFREE(hash); + } + return CRYPT_MEM; + } + + + /* generate random salt */ + if (saltlen > 0) { + if (prng_descriptor[prng_idx]->read(salt, saltlen, prng) != saltlen) { + err = CRYPT_ERROR_READPRNG; + goto LBL_ERR; + } + } + + /* M = (eight) 0x00 || msghash || salt, hash = H(M) */ + if ((err = hash_descriptor[hash_idx]->init(&md)) != CRYPT_OK) { + goto LBL_ERR; + } + zeromem(DB, 8); + if ((err = hash_descriptor[hash_idx]->process(&md, DB, 8)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->process(&md, msghash, msghashlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->process(&md, salt, saltlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx]->done(&md, hash)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* generate DB = PS || 0x01 || salt, PS == modulus_len - saltlen - hLen - 2 zero bytes */ + x = 0; + XMEMSET(DB + x, 0, modulus_len - saltlen - hLen - 2); + x += modulus_len - saltlen - hLen - 2; + DB[x++] = 0x01; + XMEMCPY(DB + x, salt, saltlen); + /* x += saltlen; */ + + /* generate mask of length modulus_len - hLen - 1 from hash */ + if ((err = pkcs_1_mgf1(hash_idx, hash, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* xor against DB */ + for (y = 0; y < (modulus_len - hLen - 1); y++) { + DB[y] ^= mask[y]; + } + + /* output is DB || hash || 0xBC */ + if (*outlen < modulus_len) { + *outlen = modulus_len; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* DB len = modulus_len - hLen - 1 */ + y = 0; + XMEMCPY(out + y, DB, modulus_len - hLen - 1); + y += modulus_len - hLen - 1; + + /* hash */ + XMEMCPY(out + y, hash, hLen); + y += hLen; + + /* 0xBC */ + out[y] = 0xBC; + + /* now clear the 8*modulus_len - modulus_bitlen most significant bits */ + out[0] &= 0xFF >> ((modulus_len<<3) - modulus_bitlen); + + /* store output size */ + *outlen = modulus_len; + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(DB, modulus_len); + zeromem(mask, modulus_len); + zeromem(salt, modulus_len); + zeromem(hash, modulus_len); +#endif + + XFREE(hash); + XFREE(salt); + XFREE(mask); + XFREE(DB); + + return err; +} + +#endif /* LTC_PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c new file mode 100644 index 0000000..3f5eff7 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c @@ -0,0 +1,141 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** @file pkcs_1_v1_5_decode.c + * + * PKCS #1 v1.5 Padding. (Andreas Lange) + */ + +#ifdef LTC_PKCS_1 + +/** @brief PKCS #1 v1.5 decode. + * + * @param msg The encoded data to decode + * @param msglen The length of the encoded data (octets) + * @param block_type Block type to use in padding (\sa ltc_pkcs_1_v1_5_blocks) + * @param modulus_bitlen The bit length of the RSA modulus + * @param out [out] Destination of decoding + * @param outlen [in/out] The max size and resulting size of the decoding + * @param is_valid [out] Boolean whether the padding was valid + * + * @return CRYPT_OK if successful + */ +int pkcs_1_v1_5_decode(const unsigned char *msg, + unsigned long msglen, + int block_type, + unsigned long modulus_bitlen, + unsigned char *out, + unsigned long *outlen, + int *is_valid) +{ + unsigned long modulus_len, ps_len, i; + int result; + + /* default to invalid packet */ + *is_valid = 0; + + modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); + + /* test message size */ + + if ((msglen > modulus_len) || (modulus_len < 11)) { + return CRYPT_PK_INVALID_SIZE; + } + + result = CRYPT_OK; + + /* separate encoded message */ + + if ((msg[0] != 0x00) || (msg[1] != (unsigned char)block_type)) { + result = CRYPT_INVALID_PACKET; + } + + if (block_type == LTC_PKCS_1_EME) { + for (i = 2; i < modulus_len; i++) { + /* separator */ + if (msg[i] == 0x00) { break; } + } + ps_len = i++ - 2; + + if (i >= modulus_len) { + /* There was no octet with hexadecimal value 0x00 to separate ps from m. + */ + result = CRYPT_INVALID_PACKET; + } + } else { + for (i = 2; i < modulus_len - 1; i++) { + if (msg[i] != 0xFF) { break; } + } + + /* separator check */ + if (msg[i] != 0) { + /* There was no octet with hexadecimal value 0x00 to separate ps from m. */ + result = CRYPT_INVALID_PACKET; + } + + ps_len = i - 2; + } + + if (ps_len < 8) + { + /* The length of ps is less than 8 octets. + */ + result = CRYPT_INVALID_PACKET; + } + + if (*outlen < (msglen - (2 + ps_len + 1))) { + result = CRYPT_INVALID_PACKET; + } + + if (result == CRYPT_OK) { + *outlen = (msglen - (2 + ps_len + 1)); + XMEMCPY(out, &msg[2 + ps_len + 1], *outlen); + + /* valid packet */ + *is_valid = 1; + } + + return result; +} /* pkcs_1_v1_5_decode */ + +#endif /* #ifdef LTC_PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c new file mode 100644 index 0000000..0b1dde3 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c @@ -0,0 +1,138 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/*! \file pkcs_1_v1_5_encode.c + * + * PKCS #1 v1.5 Padding (Andreas Lange) + */ + +#ifdef LTC_PKCS_1 + +/*! \brief PKCS #1 v1.5 encode. + * + * \param msg The data to encode + * \param msglen The length of the data to encode (octets) + * \param block_type Block type to use in padding (\sa ltc_pkcs_1_v1_5_blocks) + * \param modulus_bitlen The bit length of the RSA modulus + * \param prng An active PRNG state (only for LTC_PKCS_1_EME) + * \param prng_idx The index of the PRNG desired (only for LTC_PKCS_1_EME) + * \param out [out] The destination for the encoded data + * \param outlen [in/out] The max size and resulting size of the encoded data + * + * \return CRYPT_OK if successful + */ +int pkcs_1_v1_5_encode(const unsigned char *msg, + unsigned long msglen, + int block_type, + unsigned long modulus_bitlen, + prng_state *prng, + int prng_idx, + unsigned char *out, + unsigned long *outlen) +{ + unsigned long modulus_len, ps_len, i; + unsigned char *ps; + int result; + + /* valid block_type? */ + if ((block_type != LTC_PKCS_1_EMSA) && + (block_type != LTC_PKCS_1_EME)) { + return CRYPT_PK_INVALID_PADDING; + } + + if (block_type == LTC_PKCS_1_EME) { /* encryption padding, we need a valid PRNG */ + if ((result = prng_is_valid(prng_idx)) != CRYPT_OK) { + return result; + } + } + + modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); + + /* test message size */ + if ((msglen + 11) > modulus_len) { + return CRYPT_PK_INVALID_SIZE; + } + + if (*outlen < modulus_len) { + *outlen = modulus_len; + result = CRYPT_BUFFER_OVERFLOW; + goto bail; + } + + /* generate an octets string PS */ + ps = &out[2]; + ps_len = modulus_len - msglen - 3; + + if (block_type == LTC_PKCS_1_EME) { + /* now choose a random ps */ + if (prng_descriptor[prng_idx]->read(ps, ps_len, prng) != ps_len) { + result = CRYPT_ERROR_READPRNG; + goto bail; + } + + /* transform zero bytes (if any) to non-zero random bytes */ + for (i = 0; i < ps_len; i++) { + while (ps[i] == 0) { + if (prng_descriptor[prng_idx]->read(&ps[i], 1, prng) != 1) { + result = CRYPT_ERROR_READPRNG; + goto bail; + } + } + } + } else { + XMEMSET(ps, 0xFF, ps_len); + } + + /* create string of length modulus_len */ + out[0] = 0x00; + out[1] = (unsigned char)block_type; /* block_type 1 or 2 */ + out[2 + ps_len] = 0x00; + XMEMCPY(&out[2 + ps_len + 1], msg, msglen); + *outlen = modulus_len; + + result = CRYPT_OK; +bail: + return result; +} /* pkcs_1_v1_5_encode */ + +#endif /* #ifdef LTC_PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/pkcs1/sub.mk b/core/lib/libtomcrypt/src/pk/pkcs1/sub.mk new file mode 100644 index 0000000..43f96b9 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/pkcs1/sub.mk @@ -0,0 +1,9 @@ +srcs-y += pkcs_1_i2osp.c +srcs-y += pkcs_1_mgf1.c +srcs-y += pkcs_1_oaep_decode.c +srcs-y += pkcs_1_oaep_encode.c +srcs-y += pkcs_1_os2ip.c +srcs-y += pkcs_1_pss_decode.c +srcs-y += pkcs_1_pss_encode.c +srcs-y += pkcs_1_v1_5_decode.c +srcs-y += pkcs_1_v1_5_encode.c diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c new file mode 100644 index 0000000..f83e047 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c @@ -0,0 +1,132 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rsa_decrypt_key.c + RSA PKCS #1 Decryption, Tom St Denis and Andreas Lange +*/ + +#ifdef LTC_MRSA + +/** + PKCS #1 decrypt then v1.5 or OAEP depad + @param in The ciphertext + @param inlen The length of the ciphertext (octets) + @param out [out] The plaintext + @param outlen [in/out] The max size and resulting size of the plaintext (octets) + @param lparam The system "lparam" value + @param lparamlen The length of the lparam value (octets) + @param hash_idx The index of the hash desired + @param padding Type of padding (LTC_PKCS_1_OAEP or LTC_PKCS_1_V1_5) + @param stat [out] Result of the decryption, 1==valid, 0==invalid + @param key The corresponding private RSA key + @return CRYPT_OK if succcessul (even if invalid) +*/ +int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + int hash_idx, int padding, + int *stat, rsa_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x; + int err; + unsigned char *tmp; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(stat != NULL); + + /* default to invalid */ + *stat = 0; + + /* valid padding? */ + + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_OAEP)) { + return CRYPT_PK_INVALID_PADDING; + } + + if (padding == LTC_PKCS_1_OAEP) { + /* valid hash ? */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits( (key->N)); + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size( (key->N)); + if (modulus_bytelen != inlen) { + return CRYPT_INVALID_PACKET; + } + + /* allocate ram */ + tmp = XMALLOC(inlen); + if (tmp == NULL) { + return CRYPT_MEM; + } + + /* rsa decode the packet */ + x = inlen; + if ((err = ltc_mp.rsa_me(in, inlen, tmp, &x, PK_PRIVATE, key)) != CRYPT_OK) { + XFREE(tmp); + return err; + } + + if (padding == LTC_PKCS_1_OAEP) { + /* now OAEP decode the packet */ + err = pkcs_1_oaep_decode(tmp, x, lparam, lparamlen, modulus_bitlen, hash_idx, + out, outlen, stat); + } else { + /* now PKCS #1 v1.5 depad the packet */ + err = pkcs_1_v1_5_decode(tmp, x, LTC_PKCS_1_EME, modulus_bitlen, out, outlen, stat); + } + + XFREE(tmp); + return err; +} + +#endif /* LTC_MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c new file mode 100644 index 0000000..d01e5b6 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c @@ -0,0 +1,129 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rsa_encrypt_key.c + RSA PKCS #1 encryption, Tom St Denis and Andreas Lange +*/ + +#ifdef LTC_MRSA + +/** + (PKCS #1 v2.0) OAEP pad then encrypt + @param in The plaintext + @param inlen The length of the plaintext (octets) + @param out [out] The ciphertext + @param outlen [in/out] The max size and resulting size of the ciphertext + @param lparam The system "lparam" for the encryption + @param lparamlen The length of lparam (octets) + @param prng An active PRNG + @param prng_idx The index of the desired prng + @param hash_idx The index of the desired hash + @param padding Type of padding (LTC_PKCS_1_OAEP or LTC_PKCS_1_V1_5) + @param key The RSA key to encrypt to + @return CRYPT_OK if successful +*/ +int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + prng_state *prng, int prng_idx, int hash_idx, int padding, rsa_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* valid padding? */ + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_OAEP)) { + return CRYPT_PK_INVALID_PADDING; + } + + /* valid prng? */ + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + + if (padding == LTC_PKCS_1_OAEP) { + /* valid hash? */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits( (key->N)); + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size( (key->N)); + if (modulus_bytelen > *outlen) { + *outlen = modulus_bytelen; + return CRYPT_BUFFER_OVERFLOW; + } + + if (padding == LTC_PKCS_1_OAEP) { + /* OAEP pad the key */ + x = *outlen; + if ((err = pkcs_1_oaep_encode(in, inlen, lparam, + lparamlen, modulus_bitlen, prng, prng_idx, hash_idx, + out, &x)) != CRYPT_OK) { + return err; + } + } else { + /* PKCS #1 v1.5 pad the key */ + x = *outlen; + if ((err = pkcs_1_v1_5_encode(in, inlen, LTC_PKCS_1_EME, + modulus_bitlen, prng, prng_idx, + out, &x)) != CRYPT_OK) { + return err; + } + } + + /* rsa exptmod the OAEP or PKCS #1 v1.5 pad */ + return ltc_mp.rsa_me(out, x, out, outlen, PK_PUBLIC, key); +} + +#endif /* LTC_MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_export.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_export.c new file mode 100644 index 0000000..6ef370a --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_export.c @@ -0,0 +1,126 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rsa_export.c + Export RSA PKCS keys, Tom St Denis +*/ + +#ifdef LTC_MRSA + +/** + This will export either an RSAPublicKey or RSAPrivateKey [defined in PKCS #1 v2.1] + @param out [out] Destination of the packet + @param outlen [in/out] The max size and resulting size of the packet + @param type The type of exported key (PK_PRIVATE or PK_PUBLIC) + @param key The RSA key to export + @return CRYPT_OK if successful +*/ +int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key) +{ + unsigned long zero=0; + int err; + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* type valid? */ + if (!(key->type == PK_PRIVATE) && (type == PK_PRIVATE)) { + return CRYPT_PK_INVALID_TYPE; + } + + if (type == PK_PRIVATE) { + /* private key */ + /* output is + Version, n, e, d, p, q, d mod (p-1), d mod (q - 1), 1/q mod p + */ + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->dP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_EOL, 0UL, NULL); + } else { + /* public key */ + unsigned long tmplen, *ptmplen; + unsigned char* tmp = NULL; + + if (type & PK_STD) { + tmplen = (mp_count_bits(key->N)/8)*2+8; + tmp = XMALLOC(tmplen); + ptmplen = &tmplen; + if (tmp == NULL) { + return CRYPT_MEM; + } + } + else { + tmp = out; + ptmplen = outlen; + } + + err = der_encode_sequence_multi(tmp, ptmplen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_EOL, 0UL, NULL); + + if ((err != CRYPT_OK) || !(type & PK_STD)) { + goto finish; + } + + err = der_encode_subject_public_key_info(out, outlen, + PKA_RSA, tmp, tmplen, LTC_ASN1_NULL, NULL, 0); + +finish: + if (tmp != out) + XFREE(tmp); + return err; + + } +} + +#endif /* LTC_MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_export.c,v $ */ +/* $Revision: 1.17 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_exptmod.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_exptmod.c new file mode 100644 index 0000000..1f533fa --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_exptmod.c @@ -0,0 +1,221 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + * + * Added RSA blinding --nmav + */ +#include "tomcrypt.h" + +/** + @file rsa_exptmod.c + RSA PKCS exptmod, Tom St Denis +*/ + +#ifdef LTC_MRSA + +/** + Compute an RSA modular exponentiation + @param in The input data to send into RSA + @param inlen The length of the input (octets) + @param out [out] The destination + @param outlen [in/out] The max size and resulting size of the output + @param which Which exponent to use, e.g. PK_PRIVATE or PK_PUBLIC + @param key The RSA key to use + @return CRYPT_OK if successful +*/ +int rsa_exptmod(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + rsa_key *key) +{ + void *tmp, *tmpa, *tmpb; +#ifdef LTC_RSA_BLINDING + void *rnd, *rndi /* inverse of rnd */; +#endif + unsigned long x; + int err, no_crt; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* is the key of the right type for the operation? */ + if (which == PK_PRIVATE && (key->type != PK_PRIVATE)) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* must be a private or public operation */ + if (which != PK_PRIVATE && which != PK_PUBLIC) { + return CRYPT_PK_INVALID_TYPE; + } + + /* init and copy into tmp */ + if ((err = mp_init_multi(&tmp, &tmpa, &tmpb, +#ifdef LTC_RSA_BLINDING + &rnd, &rndi, +#endif /* LTC_RSA_BLINDING */ + NULL)) != CRYPT_OK) + { return err; } + if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, (int)inlen)) != CRYPT_OK) + { goto error; } + + /* sanity check on the input */ + if (mp_cmp(key->N, tmp) == LTC_MP_LT) { + err = CRYPT_PK_INVALID_SIZE; + goto error; + } + + /* are we using the private exponent and is the key optimized? */ +#ifdef LTC_LINARO_FIX_RSAWITHOUTCRT + if ((which == PK_PRIVATE) && (key->dP == NULL)) { + /* + * Fix when CRT optimization parameters are not there + * In such a case, we directly use the private key + */ + LTC_ARGCHK(key->dQ == NULL); + LTC_ARGCHK(key->qP == NULL); + LTC_ARGCHK(key->p == NULL); + LTC_ARGCHK(key->q == NULL); + /* exptmod it */ + if ((err = mp_exptmod(tmp, key->d, key->N, tmp)) != CRYPT_OK) { goto error; } + } else +#endif + if (which == PK_PRIVATE) { +#ifdef LTC_RSA_BLINDING + /* do blinding */ + err = mp_rand(rnd, mp_get_digit_count(key->N)); + if (err != CRYPT_OK) { + goto error; + } + + /* rndi = 1/rnd mod N */ + err = mp_invmod(rnd, key->N, rndi); + if (err != CRYPT_OK) { + goto error; + } + + /* rnd = rnd^e */ + err = mp_exptmod( rnd, key->e, key->N, rnd); + if (err != CRYPT_OK) { + goto error; + } + + /* tmp = tmp*rnd mod N */ + err = mp_mulmod( tmp, rnd, key->N, tmp); + if (err != CRYPT_OK) { + goto error; + } +#endif /* LTC_RSA_BLINDING */ + + no_crt = (key->dP == NULL) || (mp_get_digit_count(key->dP) == 0); + + if (no_crt) { + /* + * In case CRT optimization parameters are not provided, + * the private key is directly used to exptmod it + */ + if ((err = mp_exptmod(tmp, key->d, key->N, tmp)) != CRYPT_OK) { goto error; } + } else { + /* tmpa = tmp^dP mod p */ + if ((err = mp_exptmod(tmp, key->dP, key->p, tmpa)) != CRYPT_OK) { goto error; } + + /* tmpb = tmp^dQ mod q */ + if ((err = mp_exptmod(tmp, key->dQ, key->q, tmpb)) != CRYPT_OK) { goto error; } + + /* tmp = (tmpa - tmpb) * qInv (mod p) */ + if ((err = mp_sub(tmpa, tmpb, tmp)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(tmp, key->qP, key->p, tmp)) != CRYPT_OK) { goto error; } + + /* tmp = tmpb + q * tmp */ + if ((err = mp_mul(tmp, key->q, tmp)) != CRYPT_OK) { goto error; } + if ((err = mp_add(tmp, tmpb, tmp)) != CRYPT_OK) { goto error; } + } + + #ifdef LTC_RSA_BLINDING + /* unblind */ + err = mp_mulmod( tmp, rndi, key->N, tmp); + if (err != CRYPT_OK) { + goto error; + } + #endif + + #ifdef LTC_RSA_CRT_HARDENING + if (!no_crt) { + if ((err = mp_exptmod(tmp, key->e, key->N, tmpa)) != CRYPT_OK) { goto error; } + if ((err = mp_read_unsigned_bin(tmpb, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto error; } + if (mp_cmp(tmpa, tmpb) != LTC_MP_EQ) { err = CRYPT_ERROR; goto error; } + } + #endif + } else { + /* exptmod it */ + if ((err = mp_exptmod(tmp, key->e, key->N, tmp)) != CRYPT_OK) { goto error; } + } + + /* read it back */ + x = (unsigned long)mp_unsigned_bin_size(key->N); + if (x > *outlen) { + *outlen = x; + err = CRYPT_BUFFER_OVERFLOW; + goto error; + } + + /* this should never happen ... */ + if (mp_unsigned_bin_size(tmp) > mp_unsigned_bin_size(key->N)) { + err = CRYPT_ERROR; + goto error; + } + *outlen = x; + + /* convert it */ + zeromem(out, x); + if ((err = mp_to_unsigned_bin(tmp, out+(x-mp_unsigned_bin_size(tmp)))) != CRYPT_OK) { goto error; } + + /* clean up and return */ + err = CRYPT_OK; +error: + mp_clear_multi( +#ifdef LTC_RSA_BLINDING + rndi, rnd, +#endif /* LTC_RSA_BLINDING */ + tmpb, tmpa, tmp, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_exptmod.c,v $ */ +/* $Revision: 1.18 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_free.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_free.c new file mode 100644 index 0000000..cfc617c --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_free.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rsa_free.c + Free an RSA key, Tom St Denis +*/ + +#ifdef LTC_MRSA + +/** + Free an RSA key from memory + @param key The RSA key to free +*/ +void rsa_free(rsa_key *key) +{ + LTC_ARGCHKVD(key != NULL); + mp_clear_multi(key->e, key->d, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_free.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_import.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_import.c new file mode 100644 index 0000000..7975d2a --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_import.c @@ -0,0 +1,157 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rsa_import.c + Import a PKCS RSA key, Tom St Denis +*/ + +#ifdef LTC_MRSA + +/** + Import an RSAPublicKey or RSAPrivateKey [two-prime only, only support >= 1024-bit keys, defined in PKCS #1 v2.1] + @param in The packet to import from + @param inlen It's length (octets) + @param key [out] Destination for newly imported key + @return CRYPT_OK if successful, upon error allocated memory is freed +*/ +int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key) +{ + int err; + void *zero; + unsigned char *tmpbuf=NULL; + unsigned long tmpbuf_len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, + &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { + return err; + } + + /* see if the OpenSSL DER format RSA public key will work */ + tmpbuf_len = MAX_RSA_SIZE * 8; + tmpbuf = XCALLOC(1, tmpbuf_len); + if (tmpbuf == NULL) { + err = CRYPT_MEM; + goto LBL_ERR; + } + + err = der_decode_subject_public_key_info(in, inlen, + PKA_RSA, tmpbuf, &tmpbuf_len, + LTC_ASN1_NULL, NULL, 0); + + if (err == CRYPT_OK) { /* SubjectPublicKeyInfo format */ + + /* now it should be SEQUENCE { INTEGER, INTEGER } */ + if ((err = der_decode_sequence_multi(tmpbuf, tmpbuf_len, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PUBLIC; + err = CRYPT_OK; + goto LBL_FREE; + } + + /* not SSL public key, try to match against PKCS #1 standards */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + + if (mp_cmp_d(key->N, 0) == LTC_MP_EQ) { + if ((err = mp_init(&zero)) != CRYPT_OK) { + goto LBL_ERR; + } + /* it's a private key */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->dP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + mp_clear(zero); + goto LBL_ERR; + } + mp_clear(zero); + key->type = PK_PRIVATE; + } else if (mp_cmp_d(key->N, 1) == LTC_MP_EQ) { + /* we don't support multi-prime RSA */ + err = CRYPT_PK_INVALID_TYPE; + goto LBL_ERR; + } else { + /* it's a public key and we lack e */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PUBLIC; + } + err = CRYPT_OK; + goto LBL_FREE; + +LBL_ERR: + mp_clear_multi(key->d, key->e, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); + +LBL_FREE: + if (tmpbuf != NULL) + XFREE(tmpbuf); + + return err; +} + +#endif /* LTC_MRSA */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_import.c,v $ */ +/* $Revision: 1.23 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_make_key.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_make_key.c new file mode 100644 index 0000000..163f643 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_make_key.c @@ -0,0 +1,139 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rsa_make_key.c + RSA key generation, Tom St Denis +*/ + +#ifdef LTC_MRSA + +/** + Create an RSA key + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param size The size of the modulus (key size) desired (octets) + @param e The "e" value (public key). e==65537 is a good choice + @param key [out] Destination of a newly created private key pair + @return CRYPT_OK if successful, upon error all allocated ram is freed +*/ +int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key) +{ + void *p, *q, *tmp1, *tmp2, *tmp3; + int err; + + LTC_ARGCHK(ltc_mp.name != NULL); + LTC_ARGCHK(key != NULL); + + if ((size < (MIN_RSA_SIZE/8)) || (size > (MAX_RSA_SIZE/8))) { + return CRYPT_INVALID_KEYSIZE; + } + + if ((e < 3) || ((e & 1) == 0)) { + return CRYPT_INVALID_ARG; + } + + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if ((err = mp_init_multi(&p, &q, &tmp1, &tmp2, &tmp3, NULL)) != CRYPT_OK) { + return err; + } + + /* make primes p and q (optimization provided by Wayne Scott) */ + if ((err = mp_set_int(tmp3, e)) != CRYPT_OK) { goto cleanup; } /* tmp3 = e */ + + /* make prime "p" */ + do { + if ((err = rand_prime( p, size/2, prng, wprng)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto cleanup; } /* tmp1 = p-1 */ + if ((err = mp_gcd( tmp1, tmp3, tmp2)) != CRYPT_OK) { goto cleanup; } /* tmp2 = gcd(p-1, e) */ + } while (mp_cmp_d( tmp2, 1) != 0); /* while e divides p-1 */ + + /* make prime "q" */ + do { + if ((err = rand_prime( q, size/2, prng, wprng)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_sub_d( q, 1, tmp1)) != CRYPT_OK) { goto cleanup; } /* tmp1 = q-1 */ + if ((err = mp_gcd( tmp1, tmp3, tmp2)) != CRYPT_OK) { goto cleanup; } /* tmp2 = gcd(q-1, e) */ + } while (mp_cmp_d( tmp2, 1) != 0); /* while e divides q-1 */ + + /* tmp1 = lcm(p-1, q-1) */ + if ((err = mp_sub_d( p, 1, tmp2)) != CRYPT_OK) { goto cleanup; } /* tmp2 = p-1 */ + /* tmp1 = q-1 (previous do/while loop) */ + if ((err = mp_lcm( tmp1, tmp2, tmp1)) != CRYPT_OK) { goto cleanup; } /* tmp1 = lcm(p-1, q-1) */ + + /* make key */ + if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { + goto errkey; + } + + if ((err = mp_set_int( key->e, e)) != CRYPT_OK) { goto errkey; } /* key->e = e */ + if ((err = mp_invmod( key->e, tmp1, key->d)) != CRYPT_OK) { goto errkey; } /* key->d = 1/e mod lcm(p-1,q-1) */ + if ((err = mp_mul( p, q, key->N)) != CRYPT_OK) { goto errkey; } /* key->N = pq */ + + /* optimize for CRT now */ + /* find d mod q-1 and d mod p-1 */ + if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = q-1 */ + if ((err = mp_sub_d( q, 1, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = p-1 */ + if ((err = mp_mod( key->d, tmp1, key->dP)) != CRYPT_OK) { goto errkey; } /* dP = d mod p-1 */ + if ((err = mp_mod( key->d, tmp2, key->dQ)) != CRYPT_OK) { goto errkey; } /* dQ = d mod q-1 */ + if ((err = mp_invmod( q, p, key->qP)) != CRYPT_OK) { goto errkey; } /* qP = 1/q mod p */ + + if ((err = mp_copy( p, key->p)) != CRYPT_OK) { goto errkey; } + if ((err = mp_copy( q, key->q)) != CRYPT_OK) { goto errkey; } + + /* set key type (in this case it's CRT optimized) */ + key->type = PK_PRIVATE; + + /* return ok and free temps */ + err = CRYPT_OK; + goto cleanup; +errkey: + mp_clear_multi(key->q, key->p, key->qP, key->dP, key->dQ, key->N, key->d, key->e, NULL); +cleanup: + mp_clear_multi(tmp3, tmp2, tmp1, q, p, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_make_key.c,v $ */ +/* $Revision: 1.16 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_sign_hash.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_sign_hash.c new file mode 100644 index 0000000..257ddec --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_sign_hash.c @@ -0,0 +1,161 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rsa_sign_hash.c + RSA PKCS #1 v1.5 and v2 PSS sign hash, Tom St Denis and Andreas Lange +*/ + +#ifdef LTC_MRSA + +/** + PKCS #1 pad then sign + @param in The hash to sign + @param inlen The length of the hash to sign (octets) + @param out [out] The signature + @param outlen [in/out] The max size and resulting size of the signature + @param padding Type of padding (LTC_PKCS_1_PSS or LTC_PKCS_1_V1_5) + @param prng An active PRNG state + @param prng_idx The index of the PRNG desired + @param hash_idx The index of the hash desired + @param saltlen The length of the salt desired (octets) + @param key The private RSA key to use + @return CRYPT_OK if successful +*/ +int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + int padding, + prng_state *prng, int prng_idx, + int hash_idx, unsigned long saltlen, + rsa_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x, y; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* valid padding? */ + if ((padding != LTC_PKCS_1_V1_5) && (padding != LTC_PKCS_1_PSS)) { + return CRYPT_PK_INVALID_PADDING; + } + + if (padding == LTC_PKCS_1_PSS) { + /* valid prng and hash ? */ + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits((key->N)); + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size((key->N)); + if (modulus_bytelen > *outlen) { + *outlen = modulus_bytelen; + return CRYPT_BUFFER_OVERFLOW; + } + + if (padding == LTC_PKCS_1_PSS) { + /* PSS pad the key */ + x = *outlen; + if ((err = pkcs_1_pss_encode(in, inlen, saltlen, prng, prng_idx, + hash_idx, modulus_bitlen, out, &x)) != CRYPT_OK) { + return err; + } + } else { + /* PKCS #1 v1.5 pad the hash */ + unsigned char *tmpin; + ltc_asn1_list digestinfo[2], siginfo[2]; + + /* not all hashes have OIDs... so sad */ + if (hash_descriptor[hash_idx]->OIDlen == 0) { + return CRYPT_INVALID_ARG; + } + + /* construct the SEQUENCE + SEQUENCE { + SEQUENCE {hashoid OID + blah NULL + } + hash OCTET STRING + } + */ + LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash_idx]->OID, hash_descriptor[hash_idx]->OIDlen); + LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); + LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); + LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, in, inlen); + + /* allocate memory for the encoding */ + y = mp_unsigned_bin_size(key->N); + tmpin = XMALLOC(y); + if (tmpin == NULL) { + return CRYPT_MEM; + } + + if ((err = der_encode_sequence(siginfo, 2, tmpin, &y)) != CRYPT_OK) { + XFREE(tmpin); + return err; + } + + x = *outlen; + if ((err = pkcs_1_v1_5_encode(tmpin, y, LTC_PKCS_1_EMSA, + modulus_bitlen, NULL, 0, + out, &x)) != CRYPT_OK) { + XFREE(tmpin); + return err; + } + XFREE(tmpin); + } + + /* RSA encode it */ + return ltc_mp.rsa_me(out, x, out, outlen, PK_PRIVATE, key); +} + +#endif /* LTC_MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_sign_hash.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/rsa_verify_hash.c b/core/lib/libtomcrypt/src/pk/rsa/rsa_verify_hash.c new file mode 100644 index 0000000..a3c86d3 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/rsa_verify_hash.c @@ -0,0 +1,207 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rsa_verify_hash.c + RSA PKCS #1 v1.5 or v2 PSS signature verification, Tom St Denis and Andreas Lange +*/ + +#ifdef LTC_MRSA + +/** + PKCS #1 de-sign then v1.5 or PSS depad + @param sig The signature data + @param siglen The length of the signature data (octets) + @param hash The hash of the message that was signed + @param hashlen The length of the hash of the message that was signed (octets) + @param padding Type of padding (LTC_PKCS_1_PSS or LTC_PKCS_1_V1_5) + @param hash_idx The index of the desired hash + @param saltlen The length of the salt used during signature + @param stat [out] The result of the signature comparison, 1==valid, 0==invalid + @param key The public RSA key corresponding to the key that performed the signature + @return CRYPT_OK on success (even if the signature is invalid) +*/ +int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int padding, + int hash_idx, unsigned long saltlen, + int *stat, rsa_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x; + int err; + unsigned char *tmpbuf; + + LTC_ARGCHK(hash != NULL); + LTC_ARGCHK(sig != NULL); + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + + /* default to invalid */ + *stat = 0; + + /* valid padding? */ + + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_PSS)) { + return CRYPT_PK_INVALID_PADDING; + } + + if (padding == LTC_PKCS_1_PSS) { + /* valid hash ? */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits( (key->N)); + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size( (key->N)); + if (modulus_bytelen != siglen) { + return CRYPT_INVALID_PACKET; + } + + /* allocate temp buffer for decoded sig */ + tmpbuf = XMALLOC(siglen); + if (tmpbuf == NULL) { + return CRYPT_MEM; + } + + /* RSA decode it */ + x = siglen; + if ((err = ltc_mp.rsa_me(sig, siglen, tmpbuf, &x, PK_PUBLIC, key)) != CRYPT_OK) { + XFREE(tmpbuf); + return err; + } + + /* make sure the output is the right size */ + if (x != siglen) { + XFREE(tmpbuf); + return CRYPT_INVALID_PACKET; + } + + if (padding == LTC_PKCS_1_PSS) { + /* PSS decode and verify it */ + + if(modulus_bitlen%8 == 1){ + err = pkcs_1_pss_decode(hash, hashlen, tmpbuf+1, x-1, saltlen, hash_idx, modulus_bitlen, stat); + } + else{ + err = pkcs_1_pss_decode(hash, hashlen, tmpbuf, x, saltlen, hash_idx, modulus_bitlen, stat); + } + + } else { + /* PKCS #1 v1.5 decode it */ + unsigned char *out; + unsigned long outlen, loid[16], reallen; + int decoded; + ltc_asn1_list digestinfo[2], siginfo[2]; + + /* not all hashes have OIDs... so sad */ + if (hash_descriptor[hash_idx]->OIDlen == 0) { + err = CRYPT_INVALID_ARG; + goto bail_2; + } + + /* allocate temp buffer for decoded hash */ + outlen = ((modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0)) - 3; + out = XMALLOC(outlen); + if (out == NULL) { + err = CRYPT_MEM; + goto bail_2; + } + + if ((err = pkcs_1_v1_5_decode(tmpbuf, x, LTC_PKCS_1_EMSA, modulus_bitlen, out, &outlen, &decoded)) != CRYPT_OK) { + XFREE(out); + goto bail_2; + } + + /* now we must decode out[0...outlen-1] using ASN.1, test the OID and then test the hash */ + /* construct the SEQUENCE + SEQUENCE { + SEQUENCE {hashoid OID + blah NULL + } + hash OCTET STRING + } + */ + LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, loid, sizeof(loid)/sizeof(loid[0])); + LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); + LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); + LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, tmpbuf, siglen); + + if ((err = der_decode_sequence(out, outlen, siginfo, 2)) != CRYPT_OK) { + XFREE(out); + goto bail_2; + } + + if ((err = der_length_sequence(siginfo, 2, &reallen)) != CRYPT_OK) { + XFREE(out); + goto bail_2; + } + + /* test OID */ + if ((reallen == outlen) && + (digestinfo[0].size == hash_descriptor[hash_idx]->OIDlen) && + (XMEM_NEQ(digestinfo[0].data, hash_descriptor[hash_idx]->OID, sizeof(unsigned long) * hash_descriptor[hash_idx]->OIDlen) == 0) && + (siginfo[1].size == hashlen) && + (XMEM_NEQ(siginfo[1].data, hash, hashlen) == 0)) { + *stat = 1; + } + +#ifdef LTC_CLEAN_STACK + zeromem(out, outlen); +#endif + XFREE(out); + } + +bail_2: +#ifdef LTC_CLEAN_STACK + zeromem(tmpbuf, siglen); +#endif + XFREE(tmpbuf); + return err; +} + +#endif /* LTC_MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_verify_hash.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/pk/rsa/sub.mk b/core/lib/libtomcrypt/src/pk/rsa/sub.mk new file mode 100644 index 0000000..b72a7c0 --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/rsa/sub.mk @@ -0,0 +1,9 @@ +srcs-y += rsa_decrypt_key.c +srcs-y += rsa_encrypt_key.c +srcs-y += rsa_export.c +srcs-y += rsa_exptmod.c +srcs-y += rsa_free.c +srcs-y += rsa_import.c +srcs-y += rsa_make_key.c +srcs-y += rsa_sign_hash.c +srcs-y += rsa_verify_hash.c diff --git a/core/lib/libtomcrypt/src/pk/sub.mk b/core/lib/libtomcrypt/src/pk/sub.mk new file mode 100644 index 0000000..562642c --- /dev/null +++ b/core/lib/libtomcrypt/src/pk/sub.mk @@ -0,0 +1,7 @@ +subdirs-$(_CFG_CRYPTO_WITH_ASN1) += asn1 +subdirs-$(CFG_CRYPTO_DSA) += dsa +# PKCS1 paddings are used with RSA only +subdirs-$(CFG_CRYPTO_RSA) += pkcs1 +subdirs-$(CFG_CRYPTO_RSA) += rsa +subdirs-$(CFG_CRYPTO_DH) += dh +subdirs-$(CFG_CRYPTO_ECC) += ecc diff --git a/core/lib/libtomcrypt/src/prngs/fortuna.c b/core/lib/libtomcrypt/src/prngs/fortuna.c new file mode 100644 index 0000000..173deea --- /dev/null +++ b/core/lib/libtomcrypt/src/prngs/fortuna.c @@ -0,0 +1,430 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file fortuna.c + Fortuna PRNG, Tom St Denis +*/ + +/* Implementation of Fortuna by Tom St Denis + +We deviate slightly here for reasons of simplicity [and to fit in the API]. First all "sources" +in the AddEntropy function are fixed to 0. Second since no reliable timer is provided +we reseed automatically when len(pool0) >= 64 or every LTC_FORTUNA_WD calls to the read function */ + +#ifdef LTC_FORTUNA + +/* requries LTC_SHA256 and AES */ +#if !(defined(LTC_RIJNDAEL) && defined(LTC_SHA256)) + #error LTC_FORTUNA requires LTC_SHA256 and LTC_RIJNDAEL (AES) +#endif + +#ifndef LTC_FORTUNA_POOLS + #warning LTC_FORTUNA_POOLS was not previously defined (old headers?) + #define LTC_FORTUNA_POOLS 32 +#endif + +#if LTC_FORTUNA_POOLS < 4 || LTC_FORTUNA_POOLS > 32 + #error LTC_FORTUNA_POOLS must be in [4..32] +#endif + +const struct ltc_prng_descriptor fortuna_desc = { + "fortuna", 1024, + &fortuna_start, + &fortuna_add_entropy, + &fortuna_ready, + &fortuna_read, + &fortuna_done, + &fortuna_export, + &fortuna_import, + &fortuna_test +}; + +/* update the IV */ +static void fortuna_update_iv(prng_state *prng) +{ + int x; + unsigned char *IV; + /* update IV */ + IV = prng->fortuna.IV; + for (x = 0; x < 16; x++) { + IV[x] = (IV[x] + 1) & 255; + if (IV[x] != 0) break; + } +} + +/* reseed the PRNG */ +static int fortuna_reseed(prng_state *prng) +{ + unsigned char tmp[MAXBLOCKSIZE]; + hash_state md; + int err, x; + + ++prng->fortuna.reset_cnt; + + /* new K == LTC_SHA256(K || s) where s == LTC_SHA256(P0) || LTC_SHA256(P1) ... */ + sha256_init(&md); + if ((err = sha256_process(&md, prng->fortuna.K, 32)) != CRYPT_OK) { + sha256_done(&md, tmp); + return err; + } + + for (x = 0; x < LTC_FORTUNA_POOLS; x++) { + if (x == 0 || ((prng->fortuna.reset_cnt >> (x-1)) & 1) == 0) { + /* terminate this hash */ + if ((err = sha256_done(&prng->fortuna.pool[x], tmp)) != CRYPT_OK) { + sha256_done(&md, tmp); + return err; + } + /* add it to the string */ + if ((err = sha256_process(&md, tmp, 32)) != CRYPT_OK) { + sha256_done(&md, tmp); + return err; + } + /* reset this pool */ + if ((err = sha256_init(&prng->fortuna.pool[x])) != CRYPT_OK) { + sha256_done(&md, tmp); + return err; + } + } else { + break; + } + } + + /* finish key */ + if ((err = sha256_done(&md, prng->fortuna.K)) != CRYPT_OK) { + return err; + } + if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) { + return err; + } + fortuna_update_iv(prng); + + /* reset pool len */ + prng->fortuna.pool0_len = 0; + prng->fortuna.wd = 0; + + +#ifdef LTC_CLEAN_STACK + zeromem(&md, sizeof(md)); + zeromem(tmp, sizeof(tmp)); +#endif + + return CRYPT_OK; +} + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int fortuna_start(prng_state *prng) +{ + int err, x, y; + unsigned char tmp[MAXBLOCKSIZE]; + + LTC_ARGCHK(prng != NULL); + + /* initialize the pools */ + for (x = 0; x < LTC_FORTUNA_POOLS; x++) { + if ((err = sha256_init(&prng->fortuna.pool[x])) != CRYPT_OK) { + for (y = 0; y < x; y++) { + sha256_done(&prng->fortuna.pool[y], tmp); + } + return err; + } + } + prng->fortuna.pool_idx = prng->fortuna.pool0_len = prng->fortuna.wd = 0; + prng->fortuna.reset_cnt = 0; + + /* reset bufs */ + zeromem(prng->fortuna.K, 32); + if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) { + for (x = 0; x < LTC_FORTUNA_POOLS; x++) { + sha256_done(&prng->fortuna.pool[x], tmp); + } + return err; + } + zeromem(prng->fortuna.IV, 16); + + LTC_MUTEX_INIT(&prng->fortuna.prng_lock) + + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + unsigned char tmp[2]; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + /* ensure inlen <= 32 */ + if (inlen > 32) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return CRYPT_INVALID_ARG; + } + + /* add s || length(in) || in to pool[pool_idx] */ + tmp[0] = 0; + tmp[1] = (unsigned char)inlen; + if ((err = sha256_process(&prng->fortuna.pool[prng->fortuna.pool_idx], tmp, 2)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return err; + } + if ((err = sha256_process(&prng->fortuna.pool[prng->fortuna.pool_idx], in, inlen)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return err; + } + if (prng->fortuna.pool_idx == 0) { + prng->fortuna.pool0_len += inlen; + } + if (++(prng->fortuna.pool_idx) == LTC_FORTUNA_POOLS) { + prng->fortuna.pool_idx = 0; + } + + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return CRYPT_OK; +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int fortuna_ready(prng_state *prng) +{ + return fortuna_reseed(prng); +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + unsigned char tmp[16]; + unsigned long tlen; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + /* do we have to reseed? */ + if (++prng->fortuna.wd == LTC_FORTUNA_WD || prng->fortuna.pool0_len >= 64) { + if (fortuna_reseed(prng) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return 0; + } + } + + /* now generate the blocks required */ + tlen = outlen; + + /* handle whole blocks without the extra XMEMCPY */ + while (outlen >= 16) { + /* encrypt the IV and store it */ + rijndael_ecb_encrypt(prng->fortuna.IV, out, &prng->fortuna.skey); + out += 16; + outlen -= 16; + fortuna_update_iv(prng); + } + + /* left over bytes? */ + if (outlen > 0) { + rijndael_ecb_encrypt(prng->fortuna.IV, tmp, &prng->fortuna.skey); + XMEMCPY(out, tmp, outlen); + fortuna_update_iv(prng); + } + + /* generate new key */ + rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K , &prng->fortuna.skey); + fortuna_update_iv(prng); + + rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K+16, &prng->fortuna.skey); + fortuna_update_iv(prng); + + if (rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return 0; + } + +#ifdef LTC_CLEAN_STACK + zeromem(tmp, sizeof(tmp)); +#endif + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return tlen; +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int fortuna_done(prng_state *prng) +{ + int err, x; + unsigned char tmp[32]; + + LTC_ARGCHK(prng != NULL); + LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + /* terminate all the hashes */ + for (x = 0; x < LTC_FORTUNA_POOLS; x++) { + if ((err = sha256_done(&(prng->fortuna.pool[x]), tmp)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return err; + } + } + /* call cipher done when we invent one ;-) */ + +#ifdef LTC_CLEAN_STACK + zeromem(tmp, sizeof(tmp)); +#endif + + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return CRYPT_OK; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + int x, err; + hash_state *md; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + /* we'll write bytes for s&g's */ + if (*outlen < 32*LTC_FORTUNA_POOLS) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + *outlen = 32*LTC_FORTUNA_POOLS; + return CRYPT_BUFFER_OVERFLOW; + } + + md = XMALLOC(sizeof(hash_state)); + if (md == NULL) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return CRYPT_MEM; + } + + /* to emit the state we copy each pool, terminate it then hash it again so + * an attacker who sees the state can't determine the current state of the PRNG + */ + for (x = 0; x < LTC_FORTUNA_POOLS; x++) { + /* copy the PRNG */ + XMEMCPY(md, &(prng->fortuna.pool[x]), sizeof(*md)); + + /* terminate it */ + if ((err = sha256_done(md, out+x*32)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* now hash it */ + if ((err = sha256_init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = sha256_process(md, out+x*32, 32)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = sha256_done(md, out+x*32)) != CRYPT_OK) { + goto LBL_ERR; + } + } + *outlen = 32*LTC_FORTUNA_POOLS; + err = CRYPT_OK; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(*md)); +#endif + XFREE(md); + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return err; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + int err, x; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + if (inlen != 32*LTC_FORTUNA_POOLS) { + return CRYPT_INVALID_ARG; + } + + if ((err = fortuna_start(prng)) != CRYPT_OK) { + return err; + } + for (x = 0; x < LTC_FORTUNA_POOLS; x++) { + if ((err = fortuna_add_entropy(in+x*32, 32, prng)) != CRYPT_OK) { + return err; + } + } + return err; +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int fortuna_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + int err; + + if ((err = sha256_test()) != CRYPT_OK) { + return err; + } + return rijndael_test(); +#endif +} + +#endif + + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/prngs/rc4.c b/core/lib/libtomcrypt/src/prngs/rc4.c new file mode 100644 index 0000000..2583451 --- /dev/null +++ b/core/lib/libtomcrypt/src/prngs/rc4.c @@ -0,0 +1,269 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rc4.c + LTC_RC4 PRNG, Tom St Denis +*/ + +#ifdef LTC_RC4 + +const struct ltc_prng_descriptor rc4_desc = +{ + "rc4", 32, + &rc4_start, + &rc4_add_entropy, + &rc4_ready, + &rc4_read, + &rc4_done, + &rc4_export, + &rc4_import, + &rc4_test +}; + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int rc4_start(prng_state *prng) +{ + LTC_ARGCHK(prng != NULL); + + /* set keysize to zero */ + prng->rc4.x = 0; + + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + /* trim as required */ + if (prng->rc4.x + inlen > 256) { + if (prng->rc4.x == 256) { + /* I can't possibly accept another byte, ok maybe a mint wafer... */ + return CRYPT_OK; + } else { + /* only accept part of it */ + inlen = 256 - prng->rc4.x; + } + } + + while (inlen--) { + prng->rc4.buf[prng->rc4.x++] = *in++; + } + + return CRYPT_OK; + +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int rc4_ready(prng_state *prng) +{ + unsigned char key[256], tmp, *s; + int keylen, x, y, j; + + LTC_ARGCHK(prng != NULL); + + /* extract the key */ + s = prng->rc4.buf; + XMEMCPY(key, s, 256); + keylen = prng->rc4.x; + + /* make LTC_RC4 perm and shuffle */ + for (x = 0; x < 256; x++) { + s[x] = x; + } + + for (j = x = y = 0; x < 256; x++) { + y = (y + prng->rc4.buf[x] + key[j++]) & 255; + if (j == keylen) { + j = 0; + } + tmp = s[x]; s[x] = s[y]; s[y] = tmp; + } + prng->rc4.x = 0; + prng->rc4.y = 0; + +#ifdef LTC_CLEAN_STACK + zeromem(key, sizeof(key)); +#endif + + return CRYPT_OK; +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + unsigned char x, y, *s, tmp; + unsigned long n; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + +#ifdef LTC_VALGRIND + zeromem(out, outlen); +#endif + + n = outlen; + x = prng->rc4.x; + y = prng->rc4.y; + s = prng->rc4.buf; + while (outlen--) { + x = (x + 1) & 255; + y = (y + s[x]) & 255; + tmp = s[x]; s[x] = s[y]; s[y] = tmp; + tmp = (s[x] + s[y]) & 255; + *out++ ^= s[tmp]; + } + prng->rc4.x = x; + prng->rc4.y = y; + return n; +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int rc4_done(prng_state *prng) +{ + LTC_ARGCHK(prng != NULL); + return CRYPT_OK; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + + if (*outlen < 32) { + *outlen = 32; + return CRYPT_BUFFER_OVERFLOW; + } + + if (rc4_read(out, 32, prng) != 32) { + return CRYPT_ERROR_READPRNG; + } + *outlen = 32; + + return CRYPT_OK; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + int err; + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + if (inlen != 32) { + return CRYPT_INVALID_ARG; + } + + if ((err = rc4_start(prng)) != CRYPT_OK) { + return err; + } + return rc4_add_entropy(in, 32, prng); +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int rc4_test(void) +{ +#if !defined(LTC_TEST) || defined(LTC_VALGRIND) + return CRYPT_NOP; +#else + static const struct { + unsigned char key[8], pt[8], ct[8]; + } tests[] = { +{ + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef }, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef }, + { 0x75, 0xb7, 0x87, 0x80, 0x99, 0xe0, 0xc5, 0x96 } +} +}; + prng_state prng; + unsigned char dst[8]; + int err, x; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + if ((err = rc4_start(&prng)) != CRYPT_OK) { + return err; + } + if ((err = rc4_add_entropy(tests[x].key, 8, &prng)) != CRYPT_OK) { + return err; + } + if ((err = rc4_ready(&prng)) != CRYPT_OK) { + return err; + } + XMEMCPY(dst, tests[x].pt, 8); + if (rc4_read(dst, 8, &prng) != 8) { + return CRYPT_ERROR_READPRNG; + } + rc4_done(&prng); + if (XMEMCMP(dst, tests[x].ct, 8)) { +#if 0 + int y; + printf("\n\nLTC_RC4 failed, I got:\n"); + for (y = 0; y < 8; y++) printf("%02x ", dst[y]); + printf("\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source$ */ +/* $Revision$ */ +/* $Date$ */ diff --git a/core/lib/libtomcrypt/src/prngs/rng_get_bytes.c b/core/lib/libtomcrypt/src/prngs/rng_get_bytes.c new file mode 100644 index 0000000..f0e591d --- /dev/null +++ b/core/lib/libtomcrypt/src/prngs/rng_get_bytes.c @@ -0,0 +1,184 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rng_get_bytes.c + portable way to get secure random bits to feed a PRNG (Tom St Denis) +*/ + +#ifdef LTC_DEVRANDOM +/* on *NIX read /dev/random */ +static unsigned long rng_nix(unsigned char *buf, unsigned long len, + void (*callback)(void)) +{ +#ifdef LTC_NO_FILE + LTC_UNUSED_PARAM(callback); + LTC_UNUSED_PARAM(buf); + LTC_UNUSED_PARAM(len); + return 0; +#else + FILE *f; + unsigned long x; + LTC_UNUSED_PARAM(callback); +#ifdef LTC_TRY_URANDOM_FIRST + f = fopen("/dev/urandom", "rb"); + if (f == NULL) +#endif /* LTC_TRY_URANDOM_FIRST */ + f = fopen("/dev/random", "rb"); + + if (f == NULL) { + return 0; + } + + /* disable buffering */ + if (setvbuf(f, NULL, _IONBF, 0) != 0) { + fclose(f); + return 0; + } + + x = (unsigned long)fread(buf, 1, (size_t)len, f); + fclose(f); + return x; +#endif /* LTC_NO_FILE */ +} + +#endif /* LTC_DEVRANDOM */ + +/* on ANSI C platforms with 100 < CLOCKS_PER_SEC < 10000 */ +#if defined(CLOCKS_PER_SEC) && !defined(WINCE) + +#define ANSI_RNG + +static unsigned long rng_ansic(unsigned char *buf, unsigned long len, + void (*callback)(void)) +{ + clock_t t1; + int l, acc, bits, a, b; + + if (XCLOCKS_PER_SEC < 100 || XCLOCKS_PER_SEC > 10000) { + return 0; + } + + l = len; + bits = 8; + acc = a = b = 0; + while (len--) { + if (callback != NULL) callback(); + while (bits--) { + do { + t1 = XCLOCK(); while (t1 == XCLOCK()) a ^= 1; + t1 = XCLOCK(); while (t1 == XCLOCK()) b ^= 1; + } while (a == b); + acc = (acc << 1) | a; + } + *buf++ = acc; + acc = 0; + bits = 8; + } + acc = bits = a = b = 0; + return l; +} + +#endif + +/* Try the Microsoft CSP */ +#if defined(WIN32) || defined(_WIN32) || defined(WINCE) +#ifndef _WIN32_WINNT + #define _WIN32_WINNT 0x0400 +#endif +#ifdef WINCE + #define UNDER_CE + #define ARM +#endif + +#define WIN32_LEAN_AND_MEAN +#include <windows.h> +#include <wincrypt.h> + +static unsigned long rng_win32(unsigned char *buf, unsigned long len, + void (*callback)(void)) +{ + HCRYPTPROV hProv = 0; + LTC_UNUSED_PARAM(callback); + if (!CryptAcquireContext(&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, + (CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET)) && + !CryptAcquireContext (&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, + CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET | CRYPT_NEWKEYSET)) + return 0; + + if (CryptGenRandom(hProv, len, buf) == TRUE) { + CryptReleaseContext(hProv, 0); + return len; + } else { + CryptReleaseContext(hProv, 0); + return 0; + } +} + +#endif /* WIN32 */ + +/** + Read the system RNG + @param out Destination + @param outlen Length desired (octets) + @param callback Pointer to void function to act as "callback" when RNG is slow. This can be NULL + @return Number of octets read +*/ +unsigned long rng_get_bytes(unsigned char *out, unsigned long outlen, + void (*callback)(void)) +{ + unsigned long x; + + LTC_ARGCHK(out != NULL); + +#if defined(LTC_DEVRANDOM) + x = rng_nix(out, outlen, callback); if (x != 0) { return x; } +#endif +#if defined(WIN32) || defined(_WIN32) || defined(WINCE) + x = rng_win32(out, outlen, callback); if (x != 0) { return x; } +#endif +#ifdef ANSI_RNG + x = rng_ansic(out, outlen, callback); if (x != 0) { return x; } +#endif + return 0; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/rng_get_bytes.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/prngs/rng_make_prng.c b/core/lib/libtomcrypt/src/prngs/rng_make_prng.c new file mode 100644 index 0000000..3d67ba9 --- /dev/null +++ b/core/lib/libtomcrypt/src/prngs/rng_make_prng.c @@ -0,0 +1,96 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file rng_make_prng.c + portable way to get secure random bits to feed a PRNG (Tom St Denis) +*/ + +/** + Create a PRNG from a RNG + @param bits Number of bits of entropy desired (64 ... 1024) + @param wprng Index of which PRNG to setup + @param prng [out] PRNG state to initialize + @param callback A pointer to a void function for when the RNG is slow, this can be NULL + @return CRYPT_OK if successful +*/ +int rng_make_prng(int bits, int wprng, prng_state *prng, + void (*callback)(void)) +{ + unsigned char buf[256]; + int err; + + LTC_ARGCHK(prng != NULL); + + /* check parameter */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if (bits < 64 || bits > 1024) { + return CRYPT_INVALID_PRNGSIZE; + } + + if ((err = prng_descriptor[wprng]->start(prng)) != CRYPT_OK) { + return err; + } + + bits = ((bits/8)+((bits&7)!=0?1:0)) * 2; + if (rng_get_bytes(buf, (unsigned long)bits, callback) != (unsigned long)bits) { + return CRYPT_ERROR_READPRNG; + } + + if ((err = prng_descriptor[wprng]->add_entropy(buf, (unsigned long)bits, prng)) != CRYPT_OK) { + return err; + } + + if ((err = prng_descriptor[wprng]->ready(prng)) != CRYPT_OK) { + return err; + } + + #ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); + #endif + return CRYPT_OK; +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/rng_make_prng.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/28 01:27:24 $ */ diff --git a/core/lib/libtomcrypt/src/prngs/sprng.c b/core/lib/libtomcrypt/src/prngs/sprng.c new file mode 100644 index 0000000..7244407 --- /dev/null +++ b/core/lib/libtomcrypt/src/prngs/sprng.c @@ -0,0 +1,175 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file sprng.c + Secure PRNG, Tom St Denis +*/ + +/* A secure PRNG using the RNG functions. Basically this is a + * wrapper that allows you to use a secure RNG as a PRNG + * in the various other functions. + */ + +#ifdef LTC_SPRNG + +const struct ltc_prng_descriptor sprng_desc = +{ + "sprng", 0, + &sprng_start, + &sprng_add_entropy, + &sprng_ready, + &sprng_read, + &sprng_done, + &sprng_export, + &sprng_import, + &sprng_test +}; + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int sprng_start(prng_state *prng) +{ + LTC_UNUSED_PARAM(prng); + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + LTC_UNUSED_PARAM(in); + LTC_UNUSED_PARAM(inlen); + LTC_UNUSED_PARAM(prng); + return CRYPT_OK; +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int sprng_ready(prng_state *prng) +{ + LTC_UNUSED_PARAM(prng); + return CRYPT_OK; +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + LTC_ARGCHK(out != NULL); + LTC_UNUSED_PARAM(prng); + return rng_get_bytes(out, outlen, NULL); +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int sprng_done(prng_state *prng) +{ + LTC_UNUSED_PARAM(prng); + return CRYPT_OK; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int sprng_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + LTC_ARGCHK(outlen != NULL); + LTC_UNUSED_PARAM(out); + LTC_UNUSED_PARAM(prng); + + *outlen = 0; + return CRYPT_OK; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int sprng_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + LTC_UNUSED_PARAM(in); + LTC_UNUSED_PARAM(inlen); + LTC_UNUSED_PARAM(prng); + return CRYPT_OK; +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int sprng_test(void) +{ + return CRYPT_OK; +} + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/sprng.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/prngs/sub.mk b/core/lib/libtomcrypt/src/prngs/sub.mk new file mode 100644 index 0000000..6aeaa77 --- /dev/null +++ b/core/lib/libtomcrypt/src/prngs/sub.mk @@ -0,0 +1,7 @@ +cflags-y += -Wno-unused-parameter -Wno-unused-variable + +srcs-y += rng_get_bytes.c +srcs-y += rng_make_prng.c +srcs-y += sprng.c +srcs-y += rc4.c +srcs-$(_CFG_CRYPTO_WITH_FORTUNA_PRNG) += fortuna.c diff --git a/core/lib/libtomcrypt/src/prngs/yarrow.c b/core/lib/libtomcrypt/src/prngs/yarrow.c new file mode 100644 index 0000000..f245cde --- /dev/null +++ b/core/lib/libtomcrypt/src/prngs/yarrow.c @@ -0,0 +1,391 @@ +/* + * Copyright (c) 2001-2007, Tom St Denis + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtom.org + */ +#include "tomcrypt.h" + +/** + @file yarrow.c + Yarrow PRNG, Tom St Denis +*/ + +#ifdef LTC_YARROW + +const struct ltc_prng_descriptor yarrow_desc = +{ + "yarrow", 64, + &yarrow_start, + &yarrow_add_entropy, + &yarrow_ready, + &yarrow_read, + &yarrow_done, + &yarrow_export, + &yarrow_import, + &yarrow_test +}; + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int yarrow_start(prng_state *prng) +{ + int err; + + LTC_ARGCHK(prng != NULL); + + /* these are the default hash/cipher combo used */ +#ifdef LTC_RIJNDAEL +#if LTC_YARROW_AES==0 + prng->yarrow.cipher = register_cipher(&rijndael_enc_desc); +#elif LTC_YARROW_AES==1 + prng->yarrow.cipher = register_cipher(&aes_enc_desc); +#elif LTC_YARROW_AES==2 + prng->yarrow.cipher = register_cipher(&rijndael_desc); +#elif LTC_YARROW_AES==3 + prng->yarrow.cipher = register_cipher(&aes_desc); +#endif +#elif defined(LTC_BLOWFISH) + prng->yarrow.cipher = register_cipher(&blowfish_desc); +#elif defined(LTC_TWOFISH) + prng->yarrow.cipher = register_cipher(&twofish_desc); +#elif defined(LTC_RC6) + prng->yarrow.cipher = register_cipher(&rc6_desc); +#elif defined(LTC_RC5) + prng->yarrow.cipher = register_cipher(&rc5_desc); +#elif defined(LTC_SAFERP) + prng->yarrow.cipher = register_cipher(&saferp_desc); +#elif defined(LTC_RC2) + prng->yarrow.cipher = register_cipher(&rc2_desc); +#elif defined(LTC_NOEKEON) + prng->yarrow.cipher = register_cipher(&noekeon_desc); +#elif defined(LTC_ANUBIS) + prng->yarrow.cipher = register_cipher(&anubis_desc); +#elif defined(LTC_KSEED) + prng->yarrow.cipher = register_cipher(&kseed_desc); +#elif defined(LTC_KHAZAD) + prng->yarrow.cipher = register_cipher(&khazad_desc); +#elif defined(LTC_CAST5) + prng->yarrow.cipher = register_cipher(&cast5_desc); +#elif defined(LTC_XTEA) + prng->yarrow.cipher = register_cipher(&xtea_desc); +#elif defined(LTC_SAFER) + prng->yarrow.cipher = register_cipher(&safer_sk128_desc); +#elif defined(LTC_DES) + prng->yarrow.cipher = register_cipher(&des3_desc); +#else + #error LTC_YARROW needs at least one CIPHER +#endif + if ((err = cipher_is_valid(prng->yarrow.cipher)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_SHA256 + prng->yarrow.hash = register_hash(&sha256_desc); +#elif defined(LTC_SHA512) + prng->yarrow.hash = register_hash(&sha512_desc); +#elif defined(LTC_TIGER) + prng->yarrow.hash = register_hash(&tiger_desc); +#elif defined(LTC_SHA1) + prng->yarrow.hash = register_hash(&sha1_desc); +#elif defined(LTC_RIPEMD320) + prng->yarrow.hash = register_hash(&rmd320_desc); +#elif defined(LTC_RIPEMD256) + prng->yarrow.hash = register_hash(&rmd256_desc); +#elif defined(LTC_RIPEMD160) + prng->yarrow.hash = register_hash(&rmd160_desc); +#elif defined(LTC_RIPEMD128) + prng->yarrow.hash = register_hash(&rmd128_desc); +#elif defined(LTC_MD5) + prng->yarrow.hash = register_hash(&md5_desc); +#elif defined(LTC_MD4) + prng->yarrow.hash = register_hash(&md4_desc); +#elif defined(LTC_MD2) + prng->yarrow.hash = register_hash(&md2_desc); +#elif defined(LTC_WHIRLPOOL) + prng->yarrow.hash = register_hash(&whirlpool_desc); +#else + #error LTC_YARROW needs at least one HASH +#endif + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + return err; + } + + /* zero the memory used */ + zeromem(prng->yarrow.pool, sizeof(prng->yarrow.pool)); + LTC_MUTEX_INIT(&prng->yarrow.prng_lock) + + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int yarrow_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + hash_state md; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* start the hash */ + if ((err = hash_descriptor[prng->yarrow.hash].init(&md)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* hash the current pool */ + if ((err = hash_descriptor[prng->yarrow.hash].process(&md, prng->yarrow.pool, + hash_descriptor[prng->yarrow.hash].hashsize)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* add the new entropy */ + if ((err = hash_descriptor[prng->yarrow.hash].process(&md, in, inlen)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* store result */ + if ((err = hash_descriptor[prng->yarrow.hash].done(&md, prng->yarrow.pool)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return CRYPT_OK; +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int yarrow_ready(prng_state *prng) +{ + int ks, err; + + LTC_ARGCHK(prng != NULL); + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + if ((err = cipher_is_valid(prng->yarrow.cipher)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* setup CTR mode using the "pool" as the key */ + ks = (int)hash_descriptor[prng->yarrow.hash].hashsize; + if ((err = cipher_descriptor[prng->yarrow.cipher].keysize(&ks)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + if ((err = ctr_start(prng->yarrow.cipher, /* what cipher to use */ + prng->yarrow.pool, /* IV */ + prng->yarrow.pool, ks, /* KEY and key size */ + 0, /* number of rounds */ + CTR_COUNTER_LITTLE_ENDIAN, /* little endian counter */ + &prng->yarrow.ctr)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return CRYPT_OK; +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long yarrow_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + /* put out in predictable state first */ + zeromem(out, outlen); + + /* now randomize it */ + if (ctr_encrypt(out, out, outlen, &prng->yarrow.ctr) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return 0; + } + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return outlen; +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int yarrow_done(prng_state *prng) +{ + int err; + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + /* call cipher done when we invent one ;-) */ + + /* we invented one */ + err = ctr_done(&prng->yarrow.ctr); + + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int yarrow_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + /* we'll write 64 bytes for s&g's */ + if (*outlen < 64) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + *outlen = 64; + return CRYPT_BUFFER_OVERFLOW; + } + + if (yarrow_read(out, 64, prng) != 64) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return CRYPT_ERROR_READPRNG; + } + *outlen = 64; + + return CRYPT_OK; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int yarrow_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + if (inlen != 64) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return CRYPT_INVALID_ARG; + } + + if ((err = yarrow_start(prng)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + err = yarrow_add_entropy(in, 64, prng); + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int yarrow_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + int err; + prng_state prng; + + if ((err = yarrow_start(&prng)) != CRYPT_OK) { + return err; + } + + /* now let's test the hash/cipher that was chosen */ + if (cipher_descriptor[prng.yarrow.cipher].test && + ((err = cipher_descriptor[prng.yarrow.cipher].test()) != CRYPT_OK)) { + return err; + } + if (hash_descriptor[prng.yarrow.hash].test && + ((err = hash_descriptor[prng.yarrow.hash].test()) != CRYPT_OK)) { + return err; + } + + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/yarrow.c,v $ */ +/* $Revision: 1.16 $ */ +/* $Date: 2007/05/12 14:32:35 $ */ diff --git a/core/lib/libtomcrypt/src/sub.mk b/core/lib/libtomcrypt/src/sub.mk new file mode 100644 index 0000000..89e74bd --- /dev/null +++ b/core/lib/libtomcrypt/src/sub.mk @@ -0,0 +1,19 @@ +ifdef _CFG_CRYPTO_WITH_ACIPHER +srcs-y += mpa_desc.c +# Get mpa.h which normally is an internal .h file +cppflags-mpa_desc.c-y += -Ilib/libmpa +cflags-mpa_desc.c-y += -Wno-declaration-after-statement +cflags-mpa_desc.c-y += -Wno-unused-parameter +endif + +srcs-y += tee_ltc_provider.c + +subdirs-$(_CFG_CRYPTO_WITH_CIPHER) += ciphers +subdirs-$(_CFG_CRYPTO_WITH_AUTHENC) += encauth +subdirs-y += hashes +subdirs-$(_CFG_CRYPTO_WITH_MAC) += mac +subdirs-$(_CFG_CRYPTO_WITH_ACIPHER) += math +subdirs-y += misc +subdirs-y += modes +subdirs-$(_CFG_CRYPTO_WITH_ACIPHER) += pk +subdirs-$(CFG_WITH_SOFTWARE_PRNG) += prngs diff --git a/core/lib/libtomcrypt/src/tee_ltc_provider.c b/core/lib/libtomcrypt/src/tee_ltc_provider.c new file mode 100644 index 0000000..06dc983 --- /dev/null +++ b/core/lib/libtomcrypt/src/tee_ltc_provider.c @@ -0,0 +1,3116 @@ +/* + * Copyright (c) 2014, Linaro Limited + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <assert.h> +#include <tee/tee_cryp_provider.h> +#include <tee/tee_cryp_utl.h> + +#include <tomcrypt.h> +#include <mpalib.h> +#include <stdlib.h> +#include <string.h> +#include <utee_defines.h> +#include <trace.h> +#include <tee_api_types.h> +#include <string_ext.h> +#include <util.h> +#include <kernel/panic.h> +#include "tomcrypt_mpa.h" + +#if defined(CFG_WITH_VFP) +#include <tomcrypt_arm_neon.h> +#include <kernel/thread.h> +#endif + +#if !defined(CFG_WITH_SOFTWARE_PRNG) + +/* Random generator */ +static int prng_mpa_start(union Prng_state *prng __unused) +{ + return CRYPT_OK; +} + +static int prng_mpa_add_entropy(const unsigned char *in __unused, + unsigned long inlen __unused, + union Prng_state *prng __unused) +{ + /* No entropy is required */ + return CRYPT_OK; +} + +static int prng_mpa_ready(union Prng_state *prng __unused) +{ + return CRYPT_OK; +} + +static unsigned long prng_mpa_read(unsigned char *out, unsigned long outlen, + union Prng_state *prng __unused) +{ + if (TEE_SUCCESS == get_rng_array(out, outlen)) + return outlen; + else + return 0; +} + +static int prng_mpa_done(union Prng_state *prng __unused) +{ + return CRYPT_OK; +} + +static int prng_mpa_export(unsigned char *out __unused, + unsigned long *outlen __unused, + union Prng_state *prng __unused) +{ + return CRYPT_OK; +} + +static int prng_mpa_import(const unsigned char *in __unused, + unsigned long inlen __unused, + union Prng_state *prng __unused) +{ + return CRYPT_OK; +} + +static int prng_mpa_test(void) +{ + return CRYPT_OK; +} + +static const struct ltc_prng_descriptor prng_mpa_desc = { + .name = "prng_mpa", + .export_size = 64, + .start = &prng_mpa_start, + .add_entropy = &prng_mpa_add_entropy, + .ready = &prng_mpa_ready, + .read = &prng_mpa_read, + .done = &prng_mpa_done, + .pexport = &prng_mpa_export, + .pimport = &prng_mpa_import, + .test = &prng_mpa_test, +}; + +#endif /* !CFG_WITH_SOFTWARE_PRNG */ + +struct tee_ltc_prng { + int index; + const char *name; + prng_state state; + bool inited; +}; + +static struct tee_ltc_prng _tee_ltc_prng = +#if defined(CFG_WITH_SOFTWARE_PRNG) + { +#if defined(_CFG_CRYPTO_WITH_FORTUNA_PRNG) + .name = "fortuna", +#else + /* + * we need AES and SHA256 for fortuna PRNG, + * if the system configuration can't provide those, + * fallback to RC4 + */ + .name = "rc4", +#endif + }; +#else + { + .name = "prng_mpa", + }; +#endif + +static struct tee_ltc_prng *tee_ltc_get_prng(void) +{ + return &_tee_ltc_prng; +} + +static TEE_Result tee_ltc_prng_init(struct tee_ltc_prng *prng) +{ + int res; + int prng_index; + + assert(prng); + + prng_index = find_prng(prng->name); + if (prng_index == -1) + return TEE_ERROR_BAD_PARAMETERS; + + if (!prng->inited) { + res = prng_descriptor[prng_index]->start(&prng->state); + if (res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + + res = prng_descriptor[prng_index]->ready(&prng->state); + if (res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + prng->inited = true; + } + + prng->index = prng_index; + + plat_prng_add_jitter_entropy(); + + return TEE_SUCCESS; +} + +/* + * tee_ltc_reg_algs(): Registers + * - algorithms + * - hash + * - prng (pseudo random generator) + */ + +static void tee_ltc_reg_algs(void) +{ +#if defined(CFG_CRYPTO_AES) + register_cipher(&aes_desc); +#endif +#if defined(CFG_CRYPTO_DES) + register_cipher(&des_desc); + register_cipher(&des3_desc); +#endif +#if defined(CFG_CRYPTO_MD5) + register_hash(&md5_desc); +#endif +#if defined(CFG_CRYPTO_SHA1) + register_hash(&sha1_desc); +#endif +#if defined(CFG_CRYPTO_SHA224) + register_hash(&sha224_desc); +#endif +#if defined(CFG_CRYPTO_SHA256) + register_hash(&sha256_desc); +#endif +#if defined(CFG_CRYPTO_SHA384) + register_hash(&sha384_desc); +#endif +#if defined(CFG_CRYPTO_SHA512) + register_hash(&sha512_desc); +#endif + +#if defined(CFG_WITH_SOFTWARE_PRNG) +#if defined(_CFG_CRYPTO_WITH_FORTUNA_PRNG) + register_prng(&fortuna_desc); +#else + register_prng(&rc4_desc); +#endif +#else + register_prng(&prng_mpa_desc); +#endif +} + + +#if defined(_CFG_CRYPTO_WITH_HASH) || defined(CFG_CRYPTO_RSA) || \ + defined(CFG_CRYPTO_HMAC) + +/* + * Compute the LibTomCrypt "hashindex" given a TEE Algorithm "algo" + * Return + * - TEE_SUCCESS in case of success, + * - TEE_ERROR_BAD_PARAMETERS in case algo is not a valid algo + * - TEE_ERROR_NOT_SUPPORTED in case algo is not supported by LTC + * Return -1 in case of error + */ +static TEE_Result tee_algo_to_ltc_hashindex(uint32_t algo, int *ltc_hashindex) +{ + switch (algo) { +#if defined(CFG_CRYPTO_SHA1) + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA1: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA1: + case TEE_ALG_RSAES_PKCS1_OAEP_MGF1_SHA1: + case TEE_ALG_SHA1: + case TEE_ALG_DSA_SHA1: + case TEE_ALG_HMAC_SHA1: + *ltc_hashindex = find_hash("sha1"); + break; +#endif +#if defined(CFG_CRYPTO_MD5) + case TEE_ALG_RSASSA_PKCS1_V1_5_MD5: + case TEE_ALG_MD5: + case TEE_ALG_HMAC_MD5: + *ltc_hashindex = find_hash("md5"); + break; +#endif +#if defined(CFG_CRYPTO_SHA224) + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA224: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA224: + case TEE_ALG_RSAES_PKCS1_OAEP_MGF1_SHA224: + case TEE_ALG_SHA224: + case TEE_ALG_DSA_SHA224: + case TEE_ALG_HMAC_SHA224: + *ltc_hashindex = find_hash("sha224"); + break; +#endif +#if defined(CFG_CRYPTO_SHA256) + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA256: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA256: + case TEE_ALG_RSAES_PKCS1_OAEP_MGF1_SHA256: + case TEE_ALG_SHA256: + case TEE_ALG_DSA_SHA256: + case TEE_ALG_HMAC_SHA256: + *ltc_hashindex = find_hash("sha256"); + break; +#endif +#if defined(CFG_CRYPTO_SHA384) + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA384: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA384: + case TEE_ALG_RSAES_PKCS1_OAEP_MGF1_SHA384: + case TEE_ALG_SHA384: + case TEE_ALG_HMAC_SHA384: + *ltc_hashindex = find_hash("sha384"); + break; +#endif +#if defined(CFG_CRYPTO_SHA512) + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA512: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA512: + case TEE_ALG_RSAES_PKCS1_OAEP_MGF1_SHA512: + case TEE_ALG_SHA512: + case TEE_ALG_HMAC_SHA512: + *ltc_hashindex = find_hash("sha512"); + break; +#endif + case TEE_ALG_RSAES_PKCS1_V1_5: + /* invalid one. but it should not be used anyway */ + *ltc_hashindex = -1; + return TEE_SUCCESS; + + default: + return TEE_ERROR_BAD_PARAMETERS; + } + + if (*ltc_hashindex < 0) + return TEE_ERROR_NOT_SUPPORTED; + else + return TEE_SUCCESS; +} +#endif /* defined(_CFG_CRYPTO_WITH_HASH) || + defined(_CFG_CRYPTO_WITH_ACIPHER) || defined(_CFG_CRYPTO_WITH_MAC) */ + +#if defined(_CFG_CRYPTO_WITH_CIPHER) || defined(_CFG_CRYPTO_WITH_MAC) || \ + defined(_CFG_CRYPTO_WITH_AUTHENC) +/* + * Compute the LibTomCrypt "cipherindex" given a TEE Algorithm "algo" + * Return + * - TEE_SUCCESS in case of success, + * - TEE_ERROR_BAD_PARAMETERS in case algo is not a valid algo + * - TEE_ERROR_NOT_SUPPORTED in case algo is not supported by LTC + * Return -1 in case of error + */ +static TEE_Result tee_algo_to_ltc_cipherindex(uint32_t algo, + int *ltc_cipherindex) +{ + switch (algo) { +#if defined(CFG_CRYPTO_AES) + case TEE_ALG_AES_CBC_MAC_NOPAD: + case TEE_ALG_AES_CBC_MAC_PKCS5: + case TEE_ALG_AES_CMAC: + case TEE_ALG_AES_ECB_NOPAD: + case TEE_ALG_AES_CBC_NOPAD: + case TEE_ALG_AES_CTR: + case TEE_ALG_AES_CTS: + case TEE_ALG_AES_XTS: + case TEE_ALG_AES_CCM: + case TEE_ALG_AES_GCM: + *ltc_cipherindex = find_cipher("aes"); + break; +#endif +#if defined(CFG_CRYPTO_DES) + case TEE_ALG_DES_CBC_MAC_NOPAD: + case TEE_ALG_DES_CBC_MAC_PKCS5: + case TEE_ALG_DES_ECB_NOPAD: + case TEE_ALG_DES_CBC_NOPAD: + *ltc_cipherindex = find_cipher("des"); + break; + + case TEE_ALG_DES3_CBC_MAC_NOPAD: + case TEE_ALG_DES3_CBC_MAC_PKCS5: + case TEE_ALG_DES3_ECB_NOPAD: + case TEE_ALG_DES3_CBC_NOPAD: + *ltc_cipherindex = find_cipher("3des"); + break; +#endif + default: + return TEE_ERROR_BAD_PARAMETERS; + } + + if (*ltc_cipherindex < 0) + return TEE_ERROR_NOT_SUPPORTED; + else + return TEE_SUCCESS; +} +#endif /* defined(_CFG_CRYPTO_WITH_CIPHER) || + defined(_CFG_CRYPTO_WITH_HASH) || defined(_CFG_CRYPTO_WITH_AUTHENC) */ + +/****************************************************************************** + * Message digest functions + ******************************************************************************/ + +#if defined(_CFG_CRYPTO_WITH_HASH) + +static TEE_Result hash_get_ctx_size(uint32_t algo, size_t *size) +{ + switch (algo) { +#if defined(CFG_CRYPTO_MD5) + case TEE_ALG_MD5: +#endif +#if defined(CFG_CRYPTO_SHA1) + case TEE_ALG_SHA1: +#endif +#if defined(CFG_CRYPTO_SHA224) + case TEE_ALG_SHA224: +#endif +#if defined(CFG_CRYPTO_SHA256) + case TEE_ALG_SHA256: +#endif +#if defined(CFG_CRYPTO_SHA384) + case TEE_ALG_SHA384: +#endif +#if defined(CFG_CRYPTO_SHA512) + case TEE_ALG_SHA512: +#endif + *size = sizeof(hash_state); + break; + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result hash_init(void *ctx, uint32_t algo) +{ + int ltc_res; + int ltc_hashindex; + + ltc_res = tee_algo_to_ltc_hashindex(algo, <c_hashindex); + if (ltc_res != TEE_SUCCESS) + return TEE_ERROR_NOT_SUPPORTED; + + if (hash_descriptor[ltc_hashindex]->init(ctx) == CRYPT_OK) + return TEE_SUCCESS; + else + return TEE_ERROR_BAD_STATE; +} + +static TEE_Result hash_update(void *ctx, uint32_t algo, + const uint8_t *data, size_t len) +{ + int ltc_res; + int ltc_hashindex; + + ltc_res = tee_algo_to_ltc_hashindex(algo, <c_hashindex); + if (ltc_res != TEE_SUCCESS) + return TEE_ERROR_NOT_SUPPORTED; + + if (hash_descriptor[ltc_hashindex]->process(ctx, data, len) == CRYPT_OK) + return TEE_SUCCESS; + else + return TEE_ERROR_BAD_STATE; +} + +static TEE_Result hash_final(void *ctx, uint32_t algo, uint8_t *digest, + size_t len) +{ + int ltc_res; + int ltc_hashindex; + size_t hash_size; + uint8_t block_digest[TEE_MAX_HASH_SIZE]; + uint8_t *tmp_digest; + + ltc_res = tee_algo_to_ltc_hashindex(algo, <c_hashindex); + if (ltc_res != TEE_SUCCESS) + return TEE_ERROR_NOT_SUPPORTED; + + if (len == 0) + return TEE_ERROR_BAD_PARAMETERS; + + hash_size = hash_descriptor[ltc_hashindex]->hashsize; + + if (hash_size > len) { + if (hash_size > sizeof(block_digest)) + return TEE_ERROR_BAD_STATE; + tmp_digest = block_digest; /* use a tempory buffer */ + } else { + tmp_digest = digest; + } + if (hash_descriptor[ltc_hashindex]->done(ctx, tmp_digest) == CRYPT_OK) { + if (hash_size > len) + memcpy(digest, tmp_digest, len); + } else { + return TEE_ERROR_BAD_STATE; + } + + return TEE_SUCCESS; +} + +#endif /* _CFG_CRYPTO_WITH_HASH */ + +/****************************************************************************** + * Asymmetric algorithms + ******************************************************************************/ + +#if defined(_CFG_CRYPTO_WITH_ACIPHER) + +#define LTC_MAX_BITS_PER_VARIABLE (4096) +#define LTC_VARIABLE_NUMBER (50) + +#define LTC_MEMPOOL_U32_SIZE \ + mpa_scratch_mem_size_in_U32(LTC_VARIABLE_NUMBER, \ + LTC_MAX_BITS_PER_VARIABLE) + +#if defined(CFG_WITH_PAGER) +#include <mm/tee_pager.h> +#include <util.h> +#include <mm/core_mmu.h> + +static uint32_t *_ltc_mempool_u32; + +/* allocate pageable_zi vmem for mpa scratch memory pool */ +static mpa_scratch_mem get_mpa_scratch_memory_pool(size_t *size_pool) +{ + void *pool; + + *size_pool = ROUNDUP((LTC_MEMPOOL_U32_SIZE * sizeof(uint32_t)), + SMALL_PAGE_SIZE); + _ltc_mempool_u32 = tee_pager_alloc(*size_pool, 0); + if (!_ltc_mempool_u32) + panic(); + pool = (void *)_ltc_mempool_u32; + return (mpa_scratch_mem)pool; +} + +/* release unused pageable_zi vmem */ +static void release_unused_mpa_scratch_memory(void) +{ + mpa_scratch_mem pool = (mpa_scratch_mem)_ltc_mempool_u32; + struct mpa_scratch_item *item; + vaddr_t start; + vaddr_t end; + + /* we never free the header */ + if (pool->last_offset) { + item = (struct mpa_scratch_item *) + ((vaddr_t)pool + pool->last_offset); + start = (vaddr_t)item + item->size; + } else { + start = (vaddr_t)pool + sizeof(struct mpa_scratch_mem_struct); + } + end = (vaddr_t)pool + pool->size; + start = ROUNDUP(start, SMALL_PAGE_SIZE); + end = ROUNDDOWN(end, SMALL_PAGE_SIZE); + + if (start < end) + tee_pager_release_phys((void *)start, end - start); +} +#else /* CFG_WITH_PAGER */ + +static uint32_t _ltc_mempool_u32[LTC_MEMPOOL_U32_SIZE] + __aligned(__alignof__(mpa_scratch_mem_base)); + +static mpa_scratch_mem get_mpa_scratch_memory_pool(size_t *size_pool) +{ + void *pool = (void *)_ltc_mempool_u32; + + *size_pool = sizeof(_ltc_mempool_u32); + return (mpa_scratch_mem)pool; +} + +static void release_unused_mpa_scratch_memory(void) +{ + /* nothing to do in non-pager mode */ +} + +#endif + +static void pool_postactions(void) +{ + mpa_scratch_mem pool = (void *)_ltc_mempool_u32; + + if (pool->last_offset) + panic("release issue in mpa scratch memory"); + release_unused_mpa_scratch_memory(); +} + +#if defined(CFG_LTC_OPTEE_THREAD) +#include <kernel/thread.h> +static struct mpa_scratch_mem_sync { + struct mutex mu; + struct condvar cv; + size_t count; + int owner; +} pool_sync = { + .mu = MUTEX_INITIALIZER, + .cv = CONDVAR_INITIALIZER, + .owner = THREAD_ID_INVALID, +}; +#elif defined(LTC_PTHREAD) +#error NOT SUPPORTED +#else +static struct mpa_scratch_mem_sync { + size_t count; +} pool_sync; +#endif + +/* Get exclusive access to scratch memory pool */ +#if defined(CFG_LTC_OPTEE_THREAD) +static void get_pool(struct mpa_scratch_mem_sync *sync) +{ + mutex_lock(&sync->mu); + + if (sync->owner != thread_get_id()) { + /* Wait until the pool is available */ + while (sync->owner != THREAD_ID_INVALID) + condvar_wait(&sync->cv, &sync->mu); + + sync->owner = thread_get_id(); + assert(sync->count == 0); + } + + sync->count++; + + mutex_unlock(&sync->mu); +} + +/* Put (release) exclusive access to scratch memory pool */ +static void put_pool(struct mpa_scratch_mem_sync *sync) +{ + mutex_lock(&sync->mu); + + assert(sync->owner == thread_get_id()); + assert(sync->count > 0); + + sync->count--; + if (!sync->count) { + sync->owner = THREAD_ID_INVALID; + condvar_signal(&sync->cv); + pool_postactions(); + } + + mutex_unlock(&sync->mu); +} +#elif defined(LTC_PTHREAD) +#error NOT SUPPORTED +#else +static void get_pool(struct mpa_scratch_mem_sync *sync) +{ + sync->count++; +} + +/* Put (release) exclusive access to scratch memory pool */ +static void put_pool(struct mpa_scratch_mem_sync *sync) +{ + sync->count--; + if (!sync->count) + pool_postactions(); +} +#endif + +static void tee_ltc_alloc_mpa(void) +{ + mpa_scratch_mem pool; + size_t size_pool; + + pool = get_mpa_scratch_memory_pool(&size_pool); + init_mpa_tomcrypt(pool); + mpa_init_scratch_mem_sync(pool, size_pool, LTC_MAX_BITS_PER_VARIABLE, + get_pool, put_pool, &pool_sync); + + mpa_set_random_generator(crypto_ops.prng.read); +} + +static size_t num_bytes(struct bignum *a) +{ + return mp_unsigned_bin_size(a); +} + +static size_t num_bits(struct bignum *a) +{ + return mp_count_bits(a); +} + +static int32_t compare(struct bignum *a, struct bignum *b) +{ + return mp_cmp(a, b); +} + +static void bn2bin(const struct bignum *from, uint8_t *to) +{ + mp_to_unsigned_bin((struct bignum *)from, to); +} + +static TEE_Result bin2bn(const uint8_t *from, size_t fromsize, + struct bignum *to) +{ + if (mp_read_unsigned_bin(to, (uint8_t *)from, fromsize) != CRYPT_OK) + return TEE_ERROR_BAD_PARAMETERS; + return TEE_SUCCESS; +} + +static void copy(struct bignum *to, const struct bignum *from) +{ + mp_copy((void *)from, to); +} + +static struct bignum *bn_allocate(size_t size_bits) +{ + size_t sz = mpa_StaticVarSizeInU32(size_bits) * sizeof(uint32_t); + struct mpa_numbase_struct *bn = calloc(1, sz); + + if (!bn) + return NULL; + bn->alloc = sz - MPA_NUMBASE_METADATA_SIZE_IN_U32 * sizeof(uint32_t); + return (struct bignum *)bn; +} + +static void bn_free(struct bignum *s) +{ + free(s); +} + +static void bn_clear(struct bignum *s) +{ + struct mpa_numbase_struct *bn = (struct mpa_numbase_struct *)s; + + /* despite mpa_numbase_struct description, 'alloc' field a byte size */ + memset(bn->d, 0, bn->alloc); +} + +static bool bn_alloc_max(struct bignum **s) +{ + size_t sz = mpa_StaticVarSizeInU32(LTC_MAX_BITS_PER_VARIABLE) * + sizeof(uint32_t) * 8; + + *s = bn_allocate(sz); + return !!(*s); +} + +#if defined(CFG_CRYPTO_RSA) + +static TEE_Result alloc_rsa_keypair(struct rsa_keypair *s, + size_t key_size_bits __unused) +{ + memset(s, 0, sizeof(*s)); + if (!bn_alloc_max(&s->e)) { + return TEE_ERROR_OUT_OF_MEMORY; + } + if (!bn_alloc_max(&s->d)) + goto err; + if (!bn_alloc_max(&s->n)) + goto err; + if (!bn_alloc_max(&s->p)) + goto err; + if (!bn_alloc_max(&s->q)) + goto err; + if (!bn_alloc_max(&s->qp)) + goto err; + if (!bn_alloc_max(&s->dp)) + goto err; + if (!bn_alloc_max(&s->dq)) + goto err; + + return TEE_SUCCESS; +err: + bn_free(s->e); + bn_free(s->d); + bn_free(s->n); + bn_free(s->p); + bn_free(s->q); + bn_free(s->qp); + bn_free(s->dp); + + return TEE_ERROR_OUT_OF_MEMORY; +} + +static TEE_Result alloc_rsa_public_key(struct rsa_public_key *s, + size_t key_size_bits __unused) +{ + memset(s, 0, sizeof(*s)); + if (!bn_alloc_max(&s->e)) { + return TEE_ERROR_OUT_OF_MEMORY; + } + if (!bn_alloc_max(&s->n)) + goto err; + return TEE_SUCCESS; +err: + bn_free(s->e); + return TEE_ERROR_OUT_OF_MEMORY; +} + +static void free_rsa_public_key(struct rsa_public_key *s) +{ + if (!s) + return; + bn_free(s->n); + bn_free(s->e); +} + +static TEE_Result gen_rsa_key(struct rsa_keypair *key, size_t key_size) +{ + TEE_Result res; + rsa_key ltc_tmp_key; + int ltc_res; + long e; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + /* get the public exponent */ + e = mp_get_int(key->e); + + /* Generate a temporary RSA key */ + ltc_res = rsa_make_key(&prng->state, prng->index, key_size/8, e, + <c_tmp_key); + if (ltc_res != CRYPT_OK) { + res = TEE_ERROR_BAD_PARAMETERS; + } else if ((size_t)mp_count_bits(ltc_tmp_key.N) != key_size) { + rsa_free(<c_tmp_key); + res = TEE_ERROR_BAD_PARAMETERS; + } else { + /* Copy the key */ + ltc_mp.copy(ltc_tmp_key.e, key->e); + ltc_mp.copy(ltc_tmp_key.d, key->d); + ltc_mp.copy(ltc_tmp_key.N, key->n); + ltc_mp.copy(ltc_tmp_key.p, key->p); + ltc_mp.copy(ltc_tmp_key.q, key->q); + ltc_mp.copy(ltc_tmp_key.qP, key->qp); + ltc_mp.copy(ltc_tmp_key.dP, key->dp); + ltc_mp.copy(ltc_tmp_key.dQ, key->dq); + + /* Free the temporary key */ + rsa_free(<c_tmp_key); + res = TEE_SUCCESS; + } + + return res; +} + + +static TEE_Result rsadorep(rsa_key *ltc_key, const uint8_t *src, + size_t src_len, uint8_t *dst, size_t *dst_len) +{ + TEE_Result res = TEE_SUCCESS; + uint8_t *buf = NULL; + unsigned long blen, offset; + int ltc_res; + + /* + * Use a temporary buffer since we don't know exactly how large the + * required size of the out buffer without doing a partial decrypt. + * We know the upper bound though. + */ + blen = (mpa_StaticTempVarSizeInU32(LTC_MAX_BITS_PER_VARIABLE)) * + sizeof(uint32_t); + buf = malloc(blen); + if (!buf) { + res = TEE_ERROR_OUT_OF_MEMORY; + goto out; + } + + ltc_res = rsa_exptmod(src, src_len, buf, &blen, ltc_key->type, + ltc_key); + switch (ltc_res) { + case CRYPT_PK_NOT_PRIVATE: + case CRYPT_PK_INVALID_TYPE: + case CRYPT_PK_INVALID_SIZE: + case CRYPT_INVALID_PACKET: + EMSG("rsa_exptmod() returned %d\n", ltc_res); + res = TEE_ERROR_BAD_PARAMETERS; + goto out; + case CRYPT_OK: + break; + default: + /* This will result in a panic */ + EMSG("rsa_exptmod() returned %d\n", ltc_res); + res = TEE_ERROR_GENERIC; + goto out; + } + + /* Remove the zero-padding (leave one zero if buff is all zeroes) */ + offset = 0; + while ((offset < blen - 1) && (buf[offset] == 0)) + offset++; + + if (*dst_len < blen - offset) { + *dst_len = blen - offset; + res = TEE_ERROR_SHORT_BUFFER; + goto out; + } + + res = TEE_SUCCESS; + *dst_len = blen - offset; + memcpy(dst, (char *)buf + offset, *dst_len); + +out: + if (buf) + free(buf); + + return res; +} + +static TEE_Result rsanopad_encrypt(struct rsa_public_key *key, + const uint8_t *src, size_t src_len, + uint8_t *dst, size_t *dst_len) +{ + TEE_Result res; + rsa_key ltc_key = { 0, }; + + ltc_key.type = PK_PUBLIC; + ltc_key.e = key->e; + ltc_key.N = key->n; + + res = rsadorep(<c_key, src, src_len, dst, dst_len); + return res; +} + +static TEE_Result rsanopad_decrypt(struct rsa_keypair *key, + const uint8_t *src, size_t src_len, + uint8_t *dst, size_t *dst_len) +{ + TEE_Result res; + rsa_key ltc_key = { 0, }; + + ltc_key.type = PK_PRIVATE; + ltc_key.e = key->e; + ltc_key.N = key->n; + ltc_key.d = key->d; + if (key->p && num_bytes(key->p)) { + ltc_key.p = key->p; + ltc_key.q = key->q; + ltc_key.qP = key->qp; + ltc_key.dP = key->dp; + ltc_key.dQ = key->dq; + } + + res = rsadorep(<c_key, src, src_len, dst, dst_len); + return res; +} + +static TEE_Result rsaes_decrypt(uint32_t algo, struct rsa_keypair *key, + const uint8_t *label, size_t label_len, + const uint8_t *src, size_t src_len, + uint8_t *dst, size_t *dst_len) +{ + TEE_Result res = TEE_SUCCESS; + void *buf = NULL; + unsigned long blen; + int ltc_hashindex, ltc_res, ltc_stat, ltc_rsa_algo; + size_t mod_size; + rsa_key ltc_key = { 0, }; + + ltc_key.type = PK_PRIVATE; + ltc_key.e = key->e; + ltc_key.d = key->d; + ltc_key.N = key->n; + if (key->p && num_bytes(key->p)) { + ltc_key.p = key->p; + ltc_key.q = key->q; + ltc_key.qP = key->qp; + ltc_key.dP = key->dp; + ltc_key.dQ = key->dq; + } + + /* Get the algorithm */ + res = tee_algo_to_ltc_hashindex(algo, <c_hashindex); + if (res != TEE_SUCCESS) { + EMSG("tee_algo_to_ltc_hashindex() returned %d\n", (int)res); + goto out; + } + + /* + * Use a temporary buffer since we don't know exactly how large + * the required size of the out buffer without doing a partial + * decrypt. We know the upper bound though. + */ + if (algo == TEE_ALG_RSAES_PKCS1_V1_5) { + mod_size = ltc_mp.unsigned_size((void *)(ltc_key.N)); + blen = mod_size - 11; + ltc_rsa_algo = LTC_PKCS_1_V1_5; + } else { + /* Decoded message is always shorter than encrypted message */ + blen = src_len; + ltc_rsa_algo = LTC_PKCS_1_OAEP; + } + + buf = malloc(blen); + if (!buf) { + res = TEE_ERROR_OUT_OF_MEMORY; + goto out; + } + + ltc_res = rsa_decrypt_key_ex(src, src_len, buf, &blen, + ((label_len == 0) ? 0 : label), label_len, + ltc_hashindex, ltc_rsa_algo, <c_stat, + <c_key); + switch (ltc_res) { + case CRYPT_PK_INVALID_PADDING: + case CRYPT_INVALID_PACKET: + case CRYPT_PK_INVALID_SIZE: + EMSG("rsa_decrypt_key_ex() returned %d\n", ltc_res); + res = TEE_ERROR_BAD_PARAMETERS; + goto out; + case CRYPT_OK: + break; + default: + /* This will result in a panic */ + EMSG("rsa_decrypt_key_ex() returned %d\n", ltc_res); + res = TEE_ERROR_GENERIC; + goto out; + } + if (ltc_stat != 1) { + /* This will result in a panic */ + EMSG("rsa_decrypt_key_ex() returned %d and %d\n", + ltc_res, ltc_stat); + res = TEE_ERROR_GENERIC; + goto out; + } + + if (*dst_len < blen) { + *dst_len = blen; + res = TEE_ERROR_SHORT_BUFFER; + goto out; + } + + res = TEE_SUCCESS; + *dst_len = blen; + memcpy(dst, buf, blen); + +out: + if (buf) + free(buf); + + return res; +} + +static TEE_Result rsaes_encrypt(uint32_t algo, struct rsa_public_key *key, + const uint8_t *label, size_t label_len, + const uint8_t *src, size_t src_len, + uint8_t *dst, size_t *dst_len) +{ + TEE_Result res; + uint32_t mod_size; + int ltc_hashindex, ltc_res, ltc_rsa_algo; + rsa_key ltc_key = { + .type = PK_PUBLIC, + .e = key->e, + .N = key->n + }; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + mod_size = ltc_mp.unsigned_size((void *)(ltc_key.N)); + if (*dst_len < mod_size) { + *dst_len = mod_size; + res = TEE_ERROR_SHORT_BUFFER; + goto out; + } + *dst_len = mod_size; + + /* Get the algorithm */ + res = tee_algo_to_ltc_hashindex(algo, <c_hashindex); + if (res != TEE_SUCCESS) + goto out; + + if (algo == TEE_ALG_RSAES_PKCS1_V1_5) + ltc_rsa_algo = LTC_PKCS_1_V1_5; + else + ltc_rsa_algo = LTC_PKCS_1_OAEP; + + ltc_res = rsa_encrypt_key_ex(src, src_len, dst, + (unsigned long *)(dst_len), label, + label_len, &prng->state, prng->index, + ltc_hashindex, ltc_rsa_algo, <c_key); + switch (ltc_res) { + case CRYPT_PK_INVALID_PADDING: + case CRYPT_INVALID_PACKET: + case CRYPT_PK_INVALID_SIZE: + EMSG("rsa_encrypt_key_ex() returned %d\n", ltc_res); + res = TEE_ERROR_BAD_PARAMETERS; + goto out; + case CRYPT_OK: + break; + default: + /* This will result in a panic */ + res = TEE_ERROR_GENERIC; + goto out; + } + res = TEE_SUCCESS; + +out: + return res; +} + +static TEE_Result rsassa_sign(uint32_t algo, struct rsa_keypair *key, + int salt_len, const uint8_t *msg, + size_t msg_len, uint8_t *sig, + size_t *sig_len) +{ + TEE_Result res; + size_t hash_size, mod_size; + int ltc_res, ltc_rsa_algo, ltc_hashindex; + unsigned long ltc_sig_len; + rsa_key ltc_key = { 0, }; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + ltc_key.type = PK_PRIVATE; + ltc_key.e = key->e; + ltc_key.N = key->n; + ltc_key.d = key->d; + if (key->p && num_bytes(key->p)) { + ltc_key.p = key->p; + ltc_key.q = key->q; + ltc_key.qP = key->qp; + ltc_key.dP = key->dp; + ltc_key.dQ = key->dq; + } + + switch (algo) { + case TEE_ALG_RSASSA_PKCS1_V1_5_MD5: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA1: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA224: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA256: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA384: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA512: + ltc_rsa_algo = LTC_PKCS_1_V1_5; + break; + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA1: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA224: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA256: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA384: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA512: + ltc_rsa_algo = LTC_PKCS_1_PSS; + break; + default: + res = TEE_ERROR_BAD_PARAMETERS; + goto err; + } + + ltc_res = tee_algo_to_ltc_hashindex(algo, <c_hashindex); + if (ltc_res != CRYPT_OK) { + res = TEE_ERROR_BAD_PARAMETERS; + goto err; + } + + res = tee_hash_get_digest_size(TEE_DIGEST_HASH_TO_ALGO(algo), + &hash_size); + if (res != TEE_SUCCESS) + goto err; + + if (msg_len != hash_size) { + res = TEE_ERROR_BAD_PARAMETERS; + goto err; + } + + mod_size = ltc_mp.unsigned_size((void *)(ltc_key.N)); + + if (*sig_len < mod_size) { + *sig_len = mod_size; + res = TEE_ERROR_SHORT_BUFFER; + goto err; + } + + ltc_sig_len = mod_size; + + ltc_res = rsa_sign_hash_ex(msg, msg_len, sig, <c_sig_len, + ltc_rsa_algo, &prng->state, prng->index, + ltc_hashindex, salt_len, <c_key); + + *sig_len = ltc_sig_len; + + if (ltc_res != CRYPT_OK) { + res = TEE_ERROR_BAD_PARAMETERS; + goto err; + } + res = TEE_SUCCESS; + +err: + return res; +} + +static TEE_Result rsassa_verify(uint32_t algo, struct rsa_public_key *key, + int salt_len, const uint8_t *msg, + size_t msg_len, const uint8_t *sig, + size_t sig_len) +{ + TEE_Result res; + uint32_t bigint_size; + size_t hash_size; + int stat, ltc_hashindex, ltc_res, ltc_rsa_algo; + rsa_key ltc_key = { + .type = PK_PUBLIC, + .e = key->e, + .N = key->n + }; + + res = tee_hash_get_digest_size(TEE_DIGEST_HASH_TO_ALGO(algo), + &hash_size); + if (res != TEE_SUCCESS) + goto err; + + if (msg_len != hash_size) { + res = TEE_ERROR_BAD_PARAMETERS; + goto err; + } + + bigint_size = ltc_mp.unsigned_size(ltc_key.N); + if (sig_len < bigint_size) { + res = TEE_ERROR_SIGNATURE_INVALID; + goto err; + } + + /* Get the algorithm */ + res = tee_algo_to_ltc_hashindex(algo, <c_hashindex); + if (res != TEE_SUCCESS) + goto err; + + switch (algo) { + case TEE_ALG_RSASSA_PKCS1_V1_5_MD5: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA1: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA224: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA256: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA384: + case TEE_ALG_RSASSA_PKCS1_V1_5_SHA512: + ltc_rsa_algo = LTC_PKCS_1_V1_5; + break; + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA1: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA224: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA256: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA384: + case TEE_ALG_RSASSA_PKCS1_PSS_MGF1_SHA512: + ltc_rsa_algo = LTC_PKCS_1_PSS; + break; + default: + res = TEE_ERROR_BAD_PARAMETERS; + goto err; + } + + ltc_res = rsa_verify_hash_ex(sig, sig_len, msg, msg_len, ltc_rsa_algo, + ltc_hashindex, salt_len, &stat, <c_key); + if ((ltc_res != CRYPT_OK) || (stat != 1)) { + res = TEE_ERROR_SIGNATURE_INVALID; + goto err; + } + res = TEE_SUCCESS; + +err: + return res; +} + +#endif /* CFG_CRYPTO_RSA */ + +#if defined(CFG_CRYPTO_DSA) + +static TEE_Result alloc_dsa_keypair(struct dsa_keypair *s, + size_t key_size_bits __unused) +{ + memset(s, 0, sizeof(*s)); + if (!bn_alloc_max(&s->g)) { + return TEE_ERROR_OUT_OF_MEMORY; + } + + if (!bn_alloc_max(&s->p)) + goto err; + if (!bn_alloc_max(&s->q)) + goto err; + if (!bn_alloc_max(&s->y)) + goto err; + if (!bn_alloc_max(&s->x)) + goto err; + return TEE_SUCCESS; +err: + bn_free(s->g); + bn_free(s->p); + bn_free(s->q); + bn_free(s->y); + return TEE_ERROR_OUT_OF_MEMORY; +} + +static TEE_Result alloc_dsa_public_key(struct dsa_public_key *s, + size_t key_size_bits __unused) +{ + memset(s, 0, sizeof(*s)); + if (!bn_alloc_max(&s->g)) { + return TEE_ERROR_OUT_OF_MEMORY; + } + + if (!bn_alloc_max(&s->p)) + goto err; + if (!bn_alloc_max(&s->q)) + goto err; + if (!bn_alloc_max(&s->y)) + goto err; + return TEE_SUCCESS; +err: + bn_free(s->g); + bn_free(s->p); + bn_free(s->q); + return TEE_ERROR_OUT_OF_MEMORY; +} + +static TEE_Result gen_dsa_key(struct dsa_keypair *key, size_t key_size) +{ + TEE_Result res; + dsa_key ltc_tmp_key; + size_t group_size, modulus_size = key_size/8; + int ltc_res; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + if (modulus_size <= 128) + group_size = 20; + else if (modulus_size <= 256) + group_size = 30; + else if (modulus_size <= 384) + group_size = 35; + else + group_size = 40; + + /* Generate the DSA key */ + ltc_res = dsa_make_key(&prng->state, prng->index, group_size, + modulus_size, <c_tmp_key); + if (ltc_res != CRYPT_OK) { + res = TEE_ERROR_BAD_PARAMETERS; + } else if ((size_t)mp_count_bits(ltc_tmp_key.p) != key_size) { + dsa_free(<c_tmp_key); + res = TEE_ERROR_BAD_PARAMETERS; + } else { + /* Copy the key */ + ltc_mp.copy(ltc_tmp_key.g, key->g); + ltc_mp.copy(ltc_tmp_key.p, key->p); + ltc_mp.copy(ltc_tmp_key.q, key->q); + ltc_mp.copy(ltc_tmp_key.y, key->y); + ltc_mp.copy(ltc_tmp_key.x, key->x); + + /* Free the tempory key */ + dsa_free(<c_tmp_key); + res = TEE_SUCCESS; + } + return res; +} + +static TEE_Result dsa_sign(uint32_t algo, struct dsa_keypair *key, + const uint8_t *msg, size_t msg_len, uint8_t *sig, + size_t *sig_len) +{ + TEE_Result res; + size_t hash_size; + int ltc_res; + void *r, *s; + dsa_key ltc_key = { + .type = PK_PRIVATE, + .qord = mp_unsigned_bin_size(key->g), + .g = key->g, + .p = key->p, + .q = key->q, + .y = key->y, + .x = key->x, + }; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + if (algo != TEE_ALG_DSA_SHA1 && + algo != TEE_ALG_DSA_SHA224 && + algo != TEE_ALG_DSA_SHA256) { + res = TEE_ERROR_NOT_IMPLEMENTED; + goto err; + } + + res = tee_hash_get_digest_size(TEE_DIGEST_HASH_TO_ALGO(algo), + &hash_size); + if (res != TEE_SUCCESS) + goto err; + if (mp_unsigned_bin_size(ltc_key.q) < hash_size) + hash_size = mp_unsigned_bin_size(ltc_key.q); + if (msg_len != hash_size) { + res = TEE_ERROR_SECURITY; + goto err; + } + + if (*sig_len < 2 * mp_unsigned_bin_size(ltc_key.q)) { + *sig_len = 2 * mp_unsigned_bin_size(ltc_key.q); + res = TEE_ERROR_SHORT_BUFFER; + goto err; + } + + ltc_res = mp_init_multi(&r, &s, NULL); + if (ltc_res != CRYPT_OK) { + res = TEE_ERROR_OUT_OF_MEMORY; + goto err; + } + + ltc_res = dsa_sign_hash_raw(msg, msg_len, r, s, &prng->state, + prng->index, <c_key); + + if (ltc_res == CRYPT_OK) { + *sig_len = 2 * mp_unsigned_bin_size(ltc_key.q); + memset(sig, 0, *sig_len); + mp_to_unsigned_bin(r, (uint8_t *)sig + *sig_len/2 - + mp_unsigned_bin_size(r)); + mp_to_unsigned_bin(s, (uint8_t *)sig + *sig_len - + mp_unsigned_bin_size(s)); + res = TEE_SUCCESS; + } else { + res = TEE_ERROR_GENERIC; + } + + mp_clear_multi(r, s, NULL); + +err: + return res; +} + +static TEE_Result dsa_verify(uint32_t algo, struct dsa_public_key *key, + const uint8_t *msg, size_t msg_len, + const uint8_t *sig, size_t sig_len) +{ + TEE_Result res; + int ltc_stat, ltc_res; + void *r, *s; + dsa_key ltc_key = { + .type = PK_PUBLIC, + .qord = mp_unsigned_bin_size(key->g), + .g = key->g, + .p = key->p, + .q = key->q, + .y = key->y + }; + + if (algo != TEE_ALG_DSA_SHA1 && + algo != TEE_ALG_DSA_SHA224 && + algo != TEE_ALG_DSA_SHA256) { + res = TEE_ERROR_NOT_IMPLEMENTED; + goto err; + } + + ltc_res = mp_init_multi(&r, &s, NULL); + if (ltc_res != CRYPT_OK) { + res = TEE_ERROR_OUT_OF_MEMORY; + goto err; + } + mp_read_unsigned_bin(r, (uint8_t *)sig, sig_len/2); + mp_read_unsigned_bin(s, (uint8_t *)sig + sig_len/2, sig_len/2); + ltc_res = dsa_verify_hash_raw(r, s, msg, msg_len, <c_stat, <c_key); + mp_clear_multi(r, s, NULL); + + if ((ltc_res == CRYPT_OK) && (ltc_stat == 1)) + res = TEE_SUCCESS; + else + res = TEE_ERROR_GENERIC; + +err: + return res; +} + +#endif /* CFG_CRYPTO_DSA */ + +#if defined(CFG_CRYPTO_DH) + +static TEE_Result alloc_dh_keypair(struct dh_keypair *s, + size_t key_size_bits __unused) +{ + memset(s, 0, sizeof(*s)); + if (!bn_alloc_max(&s->g)) { + return TEE_ERROR_OUT_OF_MEMORY; + } + + if (!bn_alloc_max(&s->p)) + goto err; + if (!bn_alloc_max(&s->y)) + goto err; + if (!bn_alloc_max(&s->x)) + goto err; + if (!bn_alloc_max(&s->q)) + goto err; + return TEE_SUCCESS; +err: + bn_free(s->g); + bn_free(s->p); + bn_free(s->y); + bn_free(s->x); + return TEE_ERROR_OUT_OF_MEMORY; +} + +static TEE_Result gen_dh_key(struct dh_keypair *key, struct bignum *q, + size_t xbits) +{ + TEE_Result res; + dh_key ltc_tmp_key; + int ltc_res; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + /* Generate the DH key */ + ltc_tmp_key.g = key->g; + ltc_tmp_key.p = key->p; + ltc_res = dh_make_key(&prng->state, prng->index, q, xbits, + <c_tmp_key); + if (ltc_res != CRYPT_OK) { + res = TEE_ERROR_BAD_PARAMETERS; + } else { + ltc_mp.copy(ltc_tmp_key.y, key->y); + ltc_mp.copy(ltc_tmp_key.x, key->x); + + /* Free the tempory key */ + dh_free(<c_tmp_key); + res = TEE_SUCCESS; + } + return res; +} + +static TEE_Result do_dh_shared_secret(struct dh_keypair *private_key, + struct bignum *public_key, + struct bignum *secret) +{ + int err; + dh_key pk = { + .type = PK_PRIVATE, + .g = private_key->g, + .p = private_key->p, + .y = private_key->y, + .x = private_key->x + }; + + err = dh_shared_secret(&pk, public_key, secret); + return ((err == CRYPT_OK) ? TEE_SUCCESS : TEE_ERROR_BAD_PARAMETERS); +} + +#endif /* CFG_CRYPTO_DH */ + +#if defined(CFG_CRYPTO_ECC) + +static TEE_Result alloc_ecc_keypair(struct ecc_keypair *s, + size_t key_size_bits __unused) +{ + memset(s, 0, sizeof(*s)); + if (!bn_alloc_max(&s->d)) + goto err; + if (!bn_alloc_max(&s->x)) + goto err; + if (!bn_alloc_max(&s->y)) + goto err; + return TEE_SUCCESS; +err: + bn_free(s->d); + bn_free(s->x); + bn_free(s->y); + return TEE_ERROR_OUT_OF_MEMORY; +} + +static TEE_Result alloc_ecc_public_key(struct ecc_public_key *s, + size_t key_size_bits __unused) +{ + memset(s, 0, sizeof(*s)); + if (!bn_alloc_max(&s->x)) + goto err; + if (!bn_alloc_max(&s->y)) + goto err; + return TEE_SUCCESS; +err: + bn_free(s->x); + bn_free(s->y); + return TEE_ERROR_OUT_OF_MEMORY; +} + +static void free_ecc_public_key(struct ecc_public_key *s) +{ + if (!s) + return; + + bn_free(s->x); + bn_free(s->y); +} + +/* + * curve is part of TEE_ECC_CURVE_NIST_P192,... + * algo is part of TEE_ALG_ECDSA_P192,..., and 0 if we do not have it + */ +static TEE_Result ecc_get_keysize(uint32_t curve, uint32_t algo, + size_t *key_size_bytes, size_t *key_size_bits) +{ + /* + * Excerpt of libtomcrypt documentation: + * ecc_make_key(... key_size ...): The keysize is the size of the + * modulus in bytes desired. Currently directly supported values + * are 12, 16, 20, 24, 28, 32, 48, and 65 bytes which correspond + * to key sizes of 112, 128, 160, 192, 224, 256, 384, and 521 bits + * respectively. + */ + + /* + * Note GPv1.1 indicates TEE_ALG_ECDH_NIST_P192_DERIVE_SHARED_SECRET + * but defines TEE_ALG_ECDH_P192 + */ + + switch (curve) { + case TEE_ECC_CURVE_NIST_P192: + *key_size_bits = 192; + *key_size_bytes = 24; + if ((algo != 0) && (algo != TEE_ALG_ECDSA_P192) && + (algo != TEE_ALG_ECDH_P192)) + return TEE_ERROR_BAD_PARAMETERS; + break; + case TEE_ECC_CURVE_NIST_P224: + *key_size_bits = 224; + *key_size_bytes = 28; + if ((algo != 0) && (algo != TEE_ALG_ECDSA_P224) && + (algo != TEE_ALG_ECDH_P224)) + return TEE_ERROR_BAD_PARAMETERS; + break; + case TEE_ECC_CURVE_NIST_P256: + *key_size_bits = 256; + *key_size_bytes = 32; + if ((algo != 0) && (algo != TEE_ALG_ECDSA_P256) && + (algo != TEE_ALG_ECDH_P256)) + return TEE_ERROR_BAD_PARAMETERS; + break; + case TEE_ECC_CURVE_NIST_P384: + *key_size_bits = 384; + *key_size_bytes = 48; + if ((algo != 0) && (algo != TEE_ALG_ECDSA_P384) && + (algo != TEE_ALG_ECDH_P384)) + return TEE_ERROR_BAD_PARAMETERS; + break; + case TEE_ECC_CURVE_NIST_P521: + *key_size_bits = 521; + /* + * set 66 instead of 65 wrt to Libtomcrypt documentation as + * if it the real key size + */ + *key_size_bytes = 66; + if ((algo != 0) && (algo != TEE_ALG_ECDSA_P521) && + (algo != TEE_ALG_ECDH_P521)) + return TEE_ERROR_BAD_PARAMETERS; + break; + default: + *key_size_bits = 0; + *key_size_bytes = 0; + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result gen_ecc_key(struct ecc_keypair *key) +{ + TEE_Result res; + ecc_key ltc_tmp_key; + int ltc_res; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + size_t key_size_bytes = 0; + size_t key_size_bits = 0; + + res = ecc_get_keysize(key->curve, 0, &key_size_bytes, &key_size_bits); + if (res != TEE_SUCCESS) { + return res; + } + + /* Generate the ECC key */ + ltc_res = ecc_make_key(&prng->state, prng->index, + key_size_bytes, <c_tmp_key); + if (ltc_res != CRYPT_OK) { + return TEE_ERROR_BAD_PARAMETERS; + } + + /* check the size of the keys */ + if (((size_t)mp_count_bits(ltc_tmp_key.pubkey.x) > key_size_bits) || + ((size_t)mp_count_bits(ltc_tmp_key.pubkey.y) > key_size_bits) || + ((size_t)mp_count_bits(ltc_tmp_key.k) > key_size_bits)) { + res = TEE_ERROR_BAD_PARAMETERS; + goto exit; + } + + /* check LTC is returning z==1 */ + if (mp_count_bits(ltc_tmp_key.pubkey.z) != 1) { + res = TEE_ERROR_BAD_PARAMETERS; + goto exit; + } + + /* Copy the key */ + ltc_mp.copy(ltc_tmp_key.k, key->d); + ltc_mp.copy(ltc_tmp_key.pubkey.x, key->x); + ltc_mp.copy(ltc_tmp_key.pubkey.y, key->y); + + res = TEE_SUCCESS; + +exit: + ecc_free(<c_tmp_key); /* Free the temporary key */ + return res; +} + +static TEE_Result ecc_compute_key_idx(ecc_key *ltc_key, size_t keysize) +{ + size_t x; + + for (x = 0; ((int)keysize > ltc_ecc_sets[x].size) && + (ltc_ecc_sets[x].size != 0); + x++) + ; + keysize = (size_t)ltc_ecc_sets[x].size; + + if ((keysize > ECC_MAXSIZE) || (ltc_ecc_sets[x].size == 0)) + return TEE_ERROR_BAD_PARAMETERS; + + ltc_key->idx = -1; + ltc_key->dp = <c_ecc_sets[x]; + + return TEE_SUCCESS; +} + +/* + * Given a keypair "key", populate the Libtomcrypt private key "ltc_key" + * It also returns the key size, in bytes + */ +static TEE_Result ecc_populate_ltc_private_key(ecc_key *ltc_key, + struct ecc_keypair *key, + uint32_t algo, + size_t *key_size_bytes) +{ + TEE_Result res; + size_t key_size_bits; + + memset(ltc_key, 0, sizeof(*ltc_key)); + ltc_key->type = PK_PRIVATE; + ltc_key->k = key->d; + + /* compute the index of the ecc curve */ + res = ecc_get_keysize(key->curve, algo, + key_size_bytes, &key_size_bits); + if (res != TEE_SUCCESS) + return res; + + return ecc_compute_key_idx(ltc_key, *key_size_bytes); +} + +/* + * Given a public "key", populate the Libtomcrypt public key "ltc_key" + * It also returns the key size, in bytes + */ +static TEE_Result ecc_populate_ltc_public_key(ecc_key *ltc_key, + struct ecc_public_key *key, + void *key_z, + uint32_t algo, + size_t *key_size_bytes) +{ + TEE_Result res; + size_t key_size_bits; + uint8_t one[1] = { 1 }; + + + memset(ltc_key, 0, sizeof(*ltc_key)); + ltc_key->type = PK_PUBLIC; + ltc_key->pubkey.x = key->x; + ltc_key->pubkey.y = key->y; + ltc_key->pubkey.z = key_z; + mp_read_unsigned_bin(ltc_key->pubkey.z, one, sizeof(one)); + + /* compute the index of the ecc curve */ + res = ecc_get_keysize(key->curve, algo, + key_size_bytes, &key_size_bits); + if (res != TEE_SUCCESS) + return res; + + return ecc_compute_key_idx(ltc_key, *key_size_bytes); +} + +static TEE_Result ecc_sign(uint32_t algo, struct ecc_keypair *key, + const uint8_t *msg, size_t msg_len, uint8_t *sig, + size_t *sig_len) +{ + TEE_Result res; + int ltc_res; + void *r, *s; + size_t key_size_bytes; + ecc_key ltc_key; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + if (algo == 0) { + res = TEE_ERROR_BAD_PARAMETERS; + goto err; + } + + res = ecc_populate_ltc_private_key(<c_key, key, algo, + &key_size_bytes); + if (res != TEE_SUCCESS) + goto err; + + if (*sig_len < 2 * key_size_bytes) { + *sig_len = 2 * key_size_bytes; + res = TEE_ERROR_SHORT_BUFFER; + goto err; + } + + ltc_res = mp_init_multi(&r, &s, NULL); + if (ltc_res != CRYPT_OK) { + res = TEE_ERROR_OUT_OF_MEMORY; + goto err; + } + + ltc_res = ecc_sign_hash_raw(msg, msg_len, r, s, + &prng->state, prng->index, <c_key); + + if (ltc_res == CRYPT_OK) { + *sig_len = 2 * key_size_bytes; + memset(sig, 0, *sig_len); + mp_to_unsigned_bin(r, (uint8_t *)sig + *sig_len/2 - + mp_unsigned_bin_size(r)); + mp_to_unsigned_bin(s, (uint8_t *)sig + *sig_len - + mp_unsigned_bin_size(s)); + res = TEE_SUCCESS; + } else { + res = TEE_ERROR_GENERIC; + } + + mp_clear_multi(r, s, NULL); + +err: + return res; +} + +static TEE_Result ecc_verify(uint32_t algo, struct ecc_public_key *key, + const uint8_t *msg, size_t msg_len, + const uint8_t *sig, size_t sig_len) +{ + TEE_Result res; + int ltc_stat; + int ltc_res; + void *r; + void *s; + void *key_z; + size_t key_size_bytes; + ecc_key ltc_key; + + if (algo == 0) { + return TEE_ERROR_BAD_PARAMETERS; + } + + ltc_res = mp_init_multi(&key_z, &r, &s, NULL); + if (ltc_res != CRYPT_OK) { + return TEE_ERROR_OUT_OF_MEMORY; + } + + res = ecc_populate_ltc_public_key(<c_key, key, key_z, algo, + &key_size_bytes); + if (res != TEE_SUCCESS) + goto out; + + /* check keysize vs sig_len */ + if ((key_size_bytes * 2) != sig_len) { + res = TEE_ERROR_BAD_PARAMETERS; + goto out; + } + + mp_read_unsigned_bin(r, (uint8_t *)sig, sig_len/2); + mp_read_unsigned_bin(s, (uint8_t *)sig + sig_len/2, sig_len/2); + + ltc_res = ecc_verify_hash_raw(r, s, msg, msg_len, <c_stat, <c_key); + if ((ltc_res == CRYPT_OK) && (ltc_stat == 1)) + res = TEE_SUCCESS; + else + res = TEE_ERROR_GENERIC; + +out: + mp_clear_multi(key_z, r, s, NULL); + return res; +} + +static TEE_Result do_ecc_shared_secret(struct ecc_keypair *private_key, + struct ecc_public_key *public_key, + void *secret, unsigned long *secret_len) +{ + TEE_Result res; + int ltc_res; + ecc_key ltc_private_key; + ecc_key ltc_public_key; + size_t key_size_bytes; + void *key_z; + + /* Check the curves are the same */ + if (private_key->curve != public_key->curve) { + return TEE_ERROR_BAD_PARAMETERS; + } + + ltc_res = mp_init_multi(&key_z, NULL); + if (ltc_res != CRYPT_OK) { + return TEE_ERROR_OUT_OF_MEMORY; + } + + res = ecc_populate_ltc_private_key(<c_private_key, private_key, + 0, &key_size_bytes); + if (res != TEE_SUCCESS) + goto out; + res = ecc_populate_ltc_public_key(<c_public_key, public_key, key_z, + 0, &key_size_bytes); + if (res != TEE_SUCCESS) + goto out; + + ltc_res = ecc_shared_secret(<c_private_key, <c_public_key, + secret, secret_len); + if (ltc_res == CRYPT_OK) + res = TEE_SUCCESS; + else + res = TEE_ERROR_BAD_PARAMETERS; + +out: + mp_clear_multi(key_z, NULL); + return res; +} +#endif /* CFG_CRYPTO_ECC */ + +#endif /* _CFG_CRYPTO_WITH_ACIPHER */ + +/****************************************************************************** + * Symmetric ciphers + ******************************************************************************/ + +#if defined(_CFG_CRYPTO_WITH_CIPHER) +/* From libtomcrypt doc: + * Ciphertext stealing is a method of dealing with messages + * in CBC mode which are not a multiple of the block + * length. This is accomplished by encrypting the last + * ciphertext block in ECB mode, and XOR'ing the output + * against the last partial block of plaintext. LibTomCrypt + * does not support this mode directly but it is fairly + * easy to emulate with a call to the cipher's + * ecb encrypt() callback function. + * The more sane way to deal with partial blocks is to pad + * them with zeroes, and then use CBC normally + */ + +/* + * From Global Platform: CTS = CBC-CS3 + */ + +#if defined(CFG_CRYPTO_CTS) +struct tee_symmetric_cts { + symmetric_ECB ecb; + symmetric_CBC cbc; +}; +#endif + +#if defined(CFG_CRYPTO_XTS) +#define XTS_TWEAK_SIZE 16 +struct tee_symmetric_xts { + symmetric_xts ctx; + uint8_t tweak[XTS_TWEAK_SIZE]; +}; +#endif + +static TEE_Result cipher_get_block_size(uint32_t algo, size_t *size) +{ + TEE_Result res; + int ltc_cipherindex; + + res = tee_algo_to_ltc_cipherindex(algo, <c_cipherindex); + if (res != TEE_SUCCESS) + return TEE_ERROR_NOT_SUPPORTED; + + *size = cipher_descriptor[ltc_cipherindex]->block_length; + return TEE_SUCCESS; +} + +static TEE_Result cipher_get_ctx_size(uint32_t algo, size_t *size) +{ + switch (algo) { +#if defined(CFG_CRYPTO_AES) +#if defined(CFG_CRYPTO_ECB) + case TEE_ALG_AES_ECB_NOPAD: + *size = sizeof(symmetric_ECB); + break; +#endif +#if defined(CFG_CRYPTO_CBC) + case TEE_ALG_AES_CBC_NOPAD: + *size = sizeof(symmetric_CBC); + break; +#endif +#if defined(CFG_CRYPTO_CTR) + case TEE_ALG_AES_CTR: + *size = sizeof(symmetric_CTR); + break; +#endif +#if defined(CFG_CRYPTO_CTS) + case TEE_ALG_AES_CTS: + *size = sizeof(struct tee_symmetric_cts); + break; +#endif +#if defined(CFG_CRYPTO_XTS) + case TEE_ALG_AES_XTS: + *size = sizeof(struct tee_symmetric_xts); + break; +#endif +#endif +#if defined(CFG_CRYPTO_DES) +#if defined(CFG_CRYPTO_ECB) + case TEE_ALG_DES_ECB_NOPAD: + *size = sizeof(symmetric_ECB); + break; + case TEE_ALG_DES3_ECB_NOPAD: + *size = sizeof(symmetric_ECB); + break; +#endif +#if defined(CFG_CRYPTO_CBC) + case TEE_ALG_DES_CBC_NOPAD: + *size = sizeof(symmetric_CBC); + break; + case TEE_ALG_DES3_CBC_NOPAD: + *size = sizeof(symmetric_CBC); + break; +#endif +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static void get_des2_key(const uint8_t *key, size_t key_len, + uint8_t *key_intermediate, + uint8_t **real_key, size_t *real_key_len) +{ + if (key_len == 16) { + /* + * This corresponds to a 2DES key. The 2DES encryption + * algorithm is similar to 3DES. Both perform and + * encryption step, then a decryption step, followed + * by another encryption step (EDE). However 2DES uses + * the same key for both of the encryption (E) steps. + */ + memcpy(key_intermediate, key, 16); + memcpy(key_intermediate+16, key, 8); + *real_key = key_intermediate; + *real_key_len = 24; + } else { + *real_key = (uint8_t *)key; + *real_key_len = key_len; + } +} + +static TEE_Result cipher_init(void *ctx, uint32_t algo, + TEE_OperationMode mode __maybe_unused, + const uint8_t *key1, size_t key1_len, + const uint8_t *key2 __maybe_unused, + size_t key2_len __maybe_unused, + const uint8_t *iv __maybe_unused, + size_t iv_len __maybe_unused) +{ + TEE_Result res; + int ltc_res, ltc_cipherindex; + uint8_t *real_key, key_array[24]; + size_t real_key_len; +#if defined(CFG_CRYPTO_CTS) + struct tee_symmetric_cts *cts; +#endif +#if defined(CFG_CRYPTO_XTS) + struct tee_symmetric_xts *xts; +#endif + + res = tee_algo_to_ltc_cipherindex(algo, <c_cipherindex); + if (res != TEE_SUCCESS) + return TEE_ERROR_NOT_SUPPORTED; + + switch (algo) { +#if defined(CFG_CRYPTO_ECB) + case TEE_ALG_AES_ECB_NOPAD: + case TEE_ALG_DES_ECB_NOPAD: + ltc_res = ecb_start( + ltc_cipherindex, key1, key1_len, + 0, (symmetric_ECB *)ctx); + break; + + case TEE_ALG_DES3_ECB_NOPAD: + /* either des3 or des2, depending on the size of the key */ + get_des2_key(key1, key1_len, key_array, + &real_key, &real_key_len); + ltc_res = ecb_start( + ltc_cipherindex, real_key, real_key_len, + 0, (symmetric_ECB *)ctx); + break; +#endif +#if defined(CFG_CRYPTO_CBC) + case TEE_ALG_AES_CBC_NOPAD: + case TEE_ALG_DES_CBC_NOPAD: + if (iv_len != + (size_t)cipher_descriptor[ltc_cipherindex]->block_length) + return TEE_ERROR_BAD_PARAMETERS; + ltc_res = cbc_start( + ltc_cipherindex, iv, key1, key1_len, + 0, (symmetric_CBC *)ctx); + break; + + case TEE_ALG_DES3_CBC_NOPAD: + /* either des3 or des2, depending on the size of the key */ + get_des2_key(key1, key1_len, key_array, + &real_key, &real_key_len); + if (iv_len != + (size_t)cipher_descriptor[ltc_cipherindex]->block_length) + return TEE_ERROR_BAD_PARAMETERS; + ltc_res = cbc_start( + ltc_cipherindex, iv, real_key, real_key_len, + 0, (symmetric_CBC *)ctx); + break; +#endif +#if defined(CFG_CRYPTO_CTR) + case TEE_ALG_AES_CTR: + if (iv_len != + (size_t)cipher_descriptor[ltc_cipherindex]->block_length) + return TEE_ERROR_BAD_PARAMETERS; + ltc_res = ctr_start( + ltc_cipherindex, iv, key1, key1_len, + 0, CTR_COUNTER_BIG_ENDIAN, (symmetric_CTR *)ctx); + break; +#endif +#if defined(CFG_CRYPTO_CTS) + case TEE_ALG_AES_CTS: + cts = ctx; + res = cipher_init((void *)(&(cts->ecb)), + TEE_ALG_AES_ECB_NOPAD, mode, key1, + key1_len, key2, key2_len, iv, + iv_len); + if (res != TEE_SUCCESS) + return res; + res = cipher_init((void *)(&(cts->cbc)), + TEE_ALG_AES_CBC_NOPAD, mode, key1, + key1_len, key2, key2_len, iv, + iv_len); + if (res != TEE_SUCCESS) + return res; + ltc_res = CRYPT_OK; + break; +#endif +#if defined(CFG_CRYPTO_XTS) + case TEE_ALG_AES_XTS: + xts = ctx; + if (key1_len != key2_len) + return TEE_ERROR_BAD_PARAMETERS; + if (iv) { + if (iv_len != XTS_TWEAK_SIZE) + return TEE_ERROR_BAD_PARAMETERS; + memcpy(xts->tweak, iv, iv_len); + } else { + memset(xts->tweak, 0, XTS_TWEAK_SIZE); + } + ltc_res = xts_start( + ltc_cipherindex, key1, key2, key1_len, + 0, &xts->ctx); + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + if (ltc_res == CRYPT_OK) + return TEE_SUCCESS; + else + return TEE_ERROR_BAD_STATE; +} + +static TEE_Result cipher_update(void *ctx, uint32_t algo, + TEE_OperationMode mode, + bool last_block __maybe_unused, + const uint8_t *data, size_t len, uint8_t *dst) +{ + int ltc_res = CRYPT_OK; +#if defined(CFG_CRYPTO_CTS) + struct tee_symmetric_cts *cts; +#endif +#if defined(CFG_CRYPTO_XTS) + struct tee_symmetric_xts *xts; +#endif + + switch (algo) { +#if defined(CFG_CRYPTO_ECB) + case TEE_ALG_AES_ECB_NOPAD: + case TEE_ALG_DES_ECB_NOPAD: + case TEE_ALG_DES3_ECB_NOPAD: + if (mode == TEE_MODE_ENCRYPT) + ltc_res = ecb_encrypt(data, dst, len, ctx); + else + ltc_res = ecb_decrypt(data, dst, len, ctx); + break; +#endif +#if defined(CFG_CRYPTO_CBC) + case TEE_ALG_AES_CBC_NOPAD: + case TEE_ALG_DES_CBC_NOPAD: + case TEE_ALG_DES3_CBC_NOPAD: + if (mode == TEE_MODE_ENCRYPT) + ltc_res = cbc_encrypt(data, dst, len, ctx); + else + ltc_res = cbc_decrypt(data, dst, len, ctx); + break; +#endif +#if defined(CFG_CRYPTO_CTR) + case TEE_ALG_AES_CTR: + if (mode == TEE_MODE_ENCRYPT) + ltc_res = ctr_encrypt(data, dst, len, ctx); + else + ltc_res = ctr_decrypt(data, dst, len, ctx); + break; +#endif +#if defined(CFG_CRYPTO_XTS) + case TEE_ALG_AES_XTS: + xts = ctx; + if (mode == TEE_MODE_ENCRYPT) + ltc_res = xts_encrypt(data, len, dst, xts->tweak, + &xts->ctx); + else + ltc_res = xts_decrypt(data, len, dst, xts->tweak, + &xts->ctx); + break; +#endif +#if defined(CFG_CRYPTO_CTS) + case TEE_ALG_AES_CTS: + cts = ctx; + return tee_aes_cbc_cts_update(&cts->cbc, &cts->ecb, mode, + last_block, data, len, dst); +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + if (ltc_res == CRYPT_OK) + return TEE_SUCCESS; + else + return TEE_ERROR_BAD_STATE; +} + +static void cipher_final(void *ctx, uint32_t algo) +{ + switch (algo) { +#if defined(CFG_CRYPTO_ECB) + case TEE_ALG_AES_ECB_NOPAD: + case TEE_ALG_DES_ECB_NOPAD: + case TEE_ALG_DES3_ECB_NOPAD: + ecb_done(ctx); + break; +#endif +#if defined(CFG_CRYPTO_CBC) + case TEE_ALG_AES_CBC_NOPAD: + case TEE_ALG_DES_CBC_NOPAD: + case TEE_ALG_DES3_CBC_NOPAD: + case TEE_ALG_AES_CBC_MAC_NOPAD: + case TEE_ALG_AES_CBC_MAC_PKCS5: + case TEE_ALG_DES_CBC_MAC_NOPAD: + case TEE_ALG_DES_CBC_MAC_PKCS5: + case TEE_ALG_DES3_CBC_MAC_NOPAD: + case TEE_ALG_DES3_CBC_MAC_PKCS5: + cbc_done(ctx); + break; +#endif +#if defined(CFG_CRYPTO_CTR) + case TEE_ALG_AES_CTR: + ctr_done(ctx); + break; +#endif +#if defined(CFG_CRYPTO_XTS) + case TEE_ALG_AES_XTS: + xts_done(&(((struct tee_symmetric_xts *)ctx)->ctx)); + break; +#endif +#if defined(CFG_CRYPTO_CTS) + case TEE_ALG_AES_CTS: + cbc_done(&(((struct tee_symmetric_cts *)ctx)->cbc)); + ecb_done(&(((struct tee_symmetric_cts *)ctx)->ecb)); + break; +#endif + default: + assert(!"Unhandled algo"); + break; + } +} +#endif /* _CFG_CRYPTO_WITH_CIPHER */ + +/***************************************************************************** + * Message Authentication Code functions + *****************************************************************************/ + +#if defined(_CFG_CRYPTO_WITH_MAC) + +#if defined(CFG_CRYPTO_CBC_MAC) +/* + * CBC-MAC is not implemented in Libtomcrypt + * This is implemented here as being the plain text which is encoded with IV=0. + * Result of the CBC-MAC is the last 16-bytes cipher. + */ + +#define CBCMAC_MAX_BLOCK_LEN 16 +struct cbc_state { + symmetric_CBC cbc; + uint8_t block[CBCMAC_MAX_BLOCK_LEN]; + uint8_t digest[CBCMAC_MAX_BLOCK_LEN]; + size_t current_block_len, block_len; + int is_computed; +}; +#endif + +static TEE_Result mac_get_ctx_size(uint32_t algo, size_t *size) +{ + switch (algo) { +#if defined(CFG_CRYPTO_HMAC) + case TEE_ALG_HMAC_MD5: + case TEE_ALG_HMAC_SHA224: + case TEE_ALG_HMAC_SHA1: + case TEE_ALG_HMAC_SHA256: + case TEE_ALG_HMAC_SHA384: + case TEE_ALG_HMAC_SHA512: + *size = sizeof(hmac_state); + break; +#endif +#if defined(CFG_CRYPTO_CBC_MAC) + case TEE_ALG_AES_CBC_MAC_NOPAD: + case TEE_ALG_AES_CBC_MAC_PKCS5: + case TEE_ALG_DES_CBC_MAC_NOPAD: + case TEE_ALG_DES_CBC_MAC_PKCS5: + case TEE_ALG_DES3_CBC_MAC_NOPAD: + case TEE_ALG_DES3_CBC_MAC_PKCS5: + *size = sizeof(struct cbc_state); + break; +#endif +#if defined(CFG_CRYPTO_CMAC) + case TEE_ALG_AES_CMAC: + *size = sizeof(omac_state); + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result mac_init(void *ctx, uint32_t algo, const uint8_t *key, + size_t len) +{ + TEE_Result res; +#if defined(CFG_CRYPTO_HMAC) + int ltc_hashindex; +#endif +#if defined(CFG_CRYPTO_CBC_MAC) || defined(CFG_CRYPTO_CMAC) + int ltc_cipherindex; +#endif +#if defined(CFG_CRYPTO_CBC_MAC) + uint8_t *real_key; + uint8_t key_array[24]; + size_t real_key_len; + uint8_t iv[CBCMAC_MAX_BLOCK_LEN]; + struct cbc_state *cbc; +#endif + + switch (algo) { +#if defined(CFG_CRYPTO_HMAC) + case TEE_ALG_HMAC_MD5: + case TEE_ALG_HMAC_SHA224: + case TEE_ALG_HMAC_SHA1: + case TEE_ALG_HMAC_SHA256: + case TEE_ALG_HMAC_SHA384: + case TEE_ALG_HMAC_SHA512: + res = tee_algo_to_ltc_hashindex(algo, <c_hashindex); + if (res != TEE_SUCCESS) + return res; + if (CRYPT_OK != + hmac_init((hmac_state *)ctx, ltc_hashindex, key, len)) + return TEE_ERROR_BAD_STATE; + break; +#endif +#if defined(CFG_CRYPTO_CBC_MAC) + case TEE_ALG_AES_CBC_MAC_NOPAD: + case TEE_ALG_AES_CBC_MAC_PKCS5: + case TEE_ALG_DES_CBC_MAC_NOPAD: + case TEE_ALG_DES_CBC_MAC_PKCS5: + case TEE_ALG_DES3_CBC_MAC_NOPAD: + case TEE_ALG_DES3_CBC_MAC_PKCS5: + cbc = (struct cbc_state *)ctx; + + res = tee_algo_to_ltc_cipherindex(algo, <c_cipherindex); + if (res != TEE_SUCCESS) + return res; + + cbc->block_len = + cipher_descriptor[ltc_cipherindex]->block_length; + if (CBCMAC_MAX_BLOCK_LEN < cbc->block_len) + return TEE_ERROR_BAD_PARAMETERS; + memset(iv, 0, cbc->block_len); + + if (algo == TEE_ALG_DES3_CBC_MAC_NOPAD || + algo == TEE_ALG_DES3_CBC_MAC_PKCS5) { + get_des2_key(key, len, key_array, + &real_key, &real_key_len); + key = real_key; + len = real_key_len; + } + if (CRYPT_OK != cbc_start( + ltc_cipherindex, iv, key, len, 0, &cbc->cbc)) + return TEE_ERROR_BAD_STATE; + cbc->is_computed = 0; + cbc->current_block_len = 0; + break; +#endif +#if defined(CFG_CRYPTO_CMAC) + case TEE_ALG_AES_CMAC: + res = tee_algo_to_ltc_cipherindex(algo, <c_cipherindex); + if (res != TEE_SUCCESS) + return res; + if (CRYPT_OK != omac_init((omac_state *)ctx, ltc_cipherindex, + key, len)) + return TEE_ERROR_BAD_STATE; + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result mac_update(void *ctx, uint32_t algo, const uint8_t *data, + size_t len) +{ +#if defined(CFG_CRYPTO_CBC_MAC) + int ltc_res; + struct cbc_state *cbc; + size_t pad_len; +#endif + + if (!data || !len) + return TEE_SUCCESS; + + switch (algo) { +#if defined(CFG_CRYPTO_HMAC) + case TEE_ALG_HMAC_MD5: + case TEE_ALG_HMAC_SHA224: + case TEE_ALG_HMAC_SHA1: + case TEE_ALG_HMAC_SHA256: + case TEE_ALG_HMAC_SHA384: + case TEE_ALG_HMAC_SHA512: + if (CRYPT_OK != hmac_process((hmac_state *)ctx, data, len)) + return TEE_ERROR_BAD_STATE; + break; +#endif +#if defined(CFG_CRYPTO_CBC_MAC) + case TEE_ALG_AES_CBC_MAC_NOPAD: + case TEE_ALG_AES_CBC_MAC_PKCS5: + case TEE_ALG_DES_CBC_MAC_NOPAD: + case TEE_ALG_DES_CBC_MAC_PKCS5: + case TEE_ALG_DES3_CBC_MAC_NOPAD: + case TEE_ALG_DES3_CBC_MAC_PKCS5: + cbc = ctx; + + if ((cbc->current_block_len > 0) && + (len + cbc->current_block_len >= cbc->block_len)) { + pad_len = cbc->block_len - cbc->current_block_len; + memcpy(cbc->block + cbc->current_block_len, + data, pad_len); + data += pad_len; + len -= pad_len; + ltc_res = cbc_encrypt(cbc->block, cbc->digest, + cbc->block_len, &cbc->cbc); + if (CRYPT_OK != ltc_res) + return TEE_ERROR_BAD_STATE; + cbc->is_computed = 1; + } + + while (len >= cbc->block_len) { + ltc_res = cbc_encrypt(data, cbc->digest, + cbc->block_len, &cbc->cbc); + if (CRYPT_OK != ltc_res) + return TEE_ERROR_BAD_STATE; + cbc->is_computed = 1; + data += cbc->block_len; + len -= cbc->block_len; + } + + if (len > 0) + memcpy(cbc->block, data, len); + cbc->current_block_len = len; + break; +#endif +#if defined(CFG_CRYPTO_CMAC) + case TEE_ALG_AES_CMAC: + if (CRYPT_OK != omac_process((omac_state *)ctx, data, len)) + return TEE_ERROR_BAD_STATE; + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result mac_final(void *ctx, uint32_t algo, uint8_t *digest, + size_t digest_len) +{ +#if defined(CFG_CRYPTO_CBC_MAC) + struct cbc_state *cbc; + size_t pad_len; +#endif + unsigned long ltc_digest_len = digest_len; + + switch (algo) { +#if defined(CFG_CRYPTO_HMAC) + case TEE_ALG_HMAC_MD5: + case TEE_ALG_HMAC_SHA224: + case TEE_ALG_HMAC_SHA1: + case TEE_ALG_HMAC_SHA256: + case TEE_ALG_HMAC_SHA384: + case TEE_ALG_HMAC_SHA512: + if (CRYPT_OK != hmac_done((hmac_state *)ctx, digest, + <c_digest_len)) + return TEE_ERROR_BAD_STATE; + break; +#endif +#if defined(CFG_CRYPTO_CBC_MAC) + case TEE_ALG_AES_CBC_MAC_NOPAD: + case TEE_ALG_AES_CBC_MAC_PKCS5: + case TEE_ALG_DES_CBC_MAC_NOPAD: + case TEE_ALG_DES_CBC_MAC_PKCS5: + case TEE_ALG_DES3_CBC_MAC_NOPAD: + case TEE_ALG_DES3_CBC_MAC_PKCS5: + cbc = (struct cbc_state *)ctx; + + /* Padding is required */ + switch (algo) { + case TEE_ALG_AES_CBC_MAC_PKCS5: + case TEE_ALG_DES_CBC_MAC_PKCS5: + case TEE_ALG_DES3_CBC_MAC_PKCS5: + /* + * Padding is in whole bytes. The value of each added + * byte is the number of bytes that are added, i.e. N + * bytes, each of value N are added + */ + pad_len = cbc->block_len - cbc->current_block_len; + memset(cbc->block+cbc->current_block_len, + pad_len, pad_len); + cbc->current_block_len = 0; + if (TEE_SUCCESS != mac_update( + ctx, algo, cbc->block, cbc->block_len)) + return TEE_ERROR_BAD_STATE; + break; + default: + /* nothing to do */ + break; + } + + if ((!cbc->is_computed) || (cbc->current_block_len != 0)) + return TEE_ERROR_BAD_STATE; + + memcpy(digest, cbc->digest, MIN(ltc_digest_len, + cbc->block_len)); + cipher_final(&cbc->cbc, algo); + break; +#endif +#if defined(CFG_CRYPTO_CMAC) + case TEE_ALG_AES_CMAC: + if (CRYPT_OK != omac_done((omac_state *)ctx, digest, + <c_digest_len)) + return TEE_ERROR_BAD_STATE; + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} +#endif /* _CFG_CRYPTO_WITH_MAC */ + +/****************************************************************************** + * Authenticated encryption + ******************************************************************************/ + +#if defined(_CFG_CRYPTO_WITH_AUTHENC) + +#define TEE_CCM_KEY_MAX_LENGTH 32 +#define TEE_CCM_NONCE_MAX_LENGTH 13 +#define TEE_CCM_TAG_MAX_LENGTH 16 +#define TEE_GCM_TAG_MAX_LENGTH 16 +#define TEE_xCM_TAG_MAX_LENGTH 16 + +#if defined(CFG_CRYPTO_CCM) +struct tee_ccm_state { + ccm_state ctx; /* the ccm state as defined by LTC */ + size_t tag_len; /* tag length */ +}; +#endif + +#if defined(CFG_CRYPTO_GCM) +struct tee_gcm_state { + gcm_state ctx; /* the gcm state as defined by LTC */ + size_t tag_len; /* tag length */ +}; +#endif + +static TEE_Result authenc_get_ctx_size(uint32_t algo, size_t *size) +{ + switch (algo) { +#if defined(CFG_CRYPTO_CCM) + case TEE_ALG_AES_CCM: + *size = sizeof(struct tee_ccm_state); + break; +#endif +#if defined(CFG_CRYPTO_GCM) + case TEE_ALG_AES_GCM: + *size = sizeof(struct tee_gcm_state); + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + return TEE_SUCCESS; +} + +static TEE_Result authenc_init(void *ctx, uint32_t algo, + TEE_OperationMode mode __unused, + const uint8_t *key, size_t key_len, + const uint8_t *nonce, size_t nonce_len, + size_t tag_len, size_t aad_len __maybe_unused, + size_t payload_len __maybe_unused) +{ + TEE_Result res; + int ltc_res; + int ltc_cipherindex; +#if defined(CFG_CRYPTO_CCM) + struct tee_ccm_state *ccm; +#endif +#if defined(CFG_CRYPTO_GCM) + struct tee_gcm_state *gcm; +#endif + + res = tee_algo_to_ltc_cipherindex(algo, <c_cipherindex); + if (res != TEE_SUCCESS) + return TEE_ERROR_NOT_SUPPORTED; + switch (algo) { +#if defined(CFG_CRYPTO_CCM) + case TEE_ALG_AES_CCM: + /* reset the state */ + ccm = ctx; + memset(ccm, 0, sizeof(struct tee_ccm_state)); + ccm->tag_len = tag_len; + + /* Check the key length */ + if ((!key) || (key_len > TEE_CCM_KEY_MAX_LENGTH)) + return TEE_ERROR_BAD_PARAMETERS; + + /* check the nonce */ + if (nonce_len > TEE_CCM_NONCE_MAX_LENGTH) + return TEE_ERROR_BAD_PARAMETERS; + + /* check the tag len */ + if ((tag_len < 4) || + (tag_len > TEE_CCM_TAG_MAX_LENGTH) || + (tag_len % 2 != 0)) + return TEE_ERROR_NOT_SUPPORTED; + + ltc_res = ccm_init(&ccm->ctx, ltc_cipherindex, key, key_len, + payload_len, tag_len, aad_len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + + /* Add the IV */ + ltc_res = ccm_add_nonce(&ccm->ctx, nonce, nonce_len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + break; +#endif +#if defined(CFG_CRYPTO_GCM) + case TEE_ALG_AES_GCM: + /* reset the state */ + gcm = ctx; + memset(gcm, 0, sizeof(struct tee_gcm_state)); + gcm->tag_len = tag_len; + + ltc_res = gcm_init(&gcm->ctx, ltc_cipherindex, key, key_len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + + /* Add the IV */ + ltc_res = gcm_add_iv(&gcm->ctx, nonce, nonce_len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result authenc_update_aad(void *ctx, uint32_t algo, + TEE_OperationMode mode __unused, + const uint8_t *data, size_t len) +{ +#if defined(CFG_CRYPTO_CCM) + struct tee_ccm_state *ccm; +#endif +#if defined(CFG_CRYPTO_GCM) + struct tee_gcm_state *gcm; +#endif + int ltc_res; + + switch (algo) { +#if defined(CFG_CRYPTO_CCM) + case TEE_ALG_AES_CCM: + /* Add the AAD (note: aad can be NULL if aadlen == 0) */ + ccm = ctx; + ltc_res = ccm_add_aad(&ccm->ctx, data, len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + break; +#endif +#if defined(CFG_CRYPTO_GCM) + case TEE_ALG_AES_GCM: + /* Add the AAD (note: aad can be NULL if aadlen == 0) */ + gcm = ctx; + ltc_res = gcm_add_aad(&gcm->ctx, data, len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result authenc_update_payload(void *ctx, uint32_t algo, + TEE_OperationMode mode, + const uint8_t *src_data, + size_t src_len, + uint8_t *dst_data, + size_t *dst_len) +{ +#if defined(CFG_CRYPTO_GCM) + TEE_Result res; +#endif + int ltc_res, dir; +#if defined(CFG_CRYPTO_CCM) + struct tee_ccm_state *ccm; +#endif +#if defined(CFG_CRYPTO_GCM) + struct tee_gcm_state *gcm; +#endif + unsigned char *pt, *ct; /* the plain and the cipher text */ + + if (mode == TEE_MODE_ENCRYPT) { + pt = (unsigned char *)src_data; + ct = dst_data; + } else { + pt = dst_data; + ct = (unsigned char *)src_data; + } + + switch (algo) { +#if defined(CFG_CRYPTO_CCM) + case TEE_ALG_AES_CCM: + ccm = ctx; + dir = (mode == TEE_MODE_ENCRYPT ? CCM_ENCRYPT : CCM_DECRYPT); + ltc_res = ccm_process(&ccm->ctx, pt, src_len, ct, dir); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + *dst_len = src_len; + break; +#endif +#if defined(CFG_CRYPTO_GCM) + case TEE_ALG_AES_GCM: + /* aad is optional ==> add one without length */ + gcm = ctx; + if (gcm->ctx.mode == LTC_GCM_MODE_IV) { + res = authenc_update_aad(gcm, algo, mode, 0, 0); + if (res != TEE_SUCCESS) + return res; + } + + /* process the data */ + dir = (mode == TEE_MODE_ENCRYPT ? GCM_ENCRYPT : GCM_DECRYPT); + ltc_res = gcm_process(&gcm->ctx, pt, src_len, ct, dir); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + *dst_len = src_len; + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result authenc_enc_final(void *ctx, uint32_t algo, + const uint8_t *src_data, + size_t src_len, uint8_t *dst_data, + size_t *dst_len, uint8_t *dst_tag, + size_t *dst_tag_len) +{ + TEE_Result res; +#if defined(CFG_CRYPTO_CCM) + struct tee_ccm_state *ccm; +#endif +#if defined(CFG_CRYPTO_GCM) + struct tee_gcm_state *gcm; +#endif + size_t digest_size; + int ltc_res; + + /* Check the resulting buffer is not too short */ + res = cipher_get_block_size(algo, &digest_size); + if (res != TEE_SUCCESS) + return res; + + /* Finalize the remaining buffer */ + res = authenc_update_payload(ctx, algo, TEE_MODE_ENCRYPT, src_data, + src_len, dst_data, dst_len); + if (res != TEE_SUCCESS) + return res; + + switch (algo) { +#if defined(CFG_CRYPTO_CCM) + case TEE_ALG_AES_CCM: + /* Check the tag length */ + ccm = ctx; + if (*dst_tag_len < ccm->tag_len) { + *dst_tag_len = ccm->tag_len; + return TEE_ERROR_SHORT_BUFFER; + } + *dst_tag_len = ccm->tag_len; + + /* Compute the tag */ + ltc_res = ccm_done(&ccm->ctx, dst_tag, + (unsigned long *)dst_tag_len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + break; +#endif +#if defined(CFG_CRYPTO_GCM) + case TEE_ALG_AES_GCM: + /* Check the tag length */ + gcm = ctx; + if (*dst_tag_len < gcm->tag_len) { + *dst_tag_len = gcm->tag_len; + return TEE_ERROR_SHORT_BUFFER; + } + *dst_tag_len = gcm->tag_len; + + /* Compute the tag */ + ltc_res = gcm_done(&gcm->ctx, dst_tag, + (unsigned long *)dst_tag_len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + return TEE_SUCCESS; +} + +static TEE_Result authenc_dec_final(void *ctx, uint32_t algo, + const uint8_t *src_data, size_t src_len, + uint8_t *dst_data, size_t *dst_len, + const uint8_t *tag, size_t tag_len) +{ + TEE_Result res = TEE_ERROR_BAD_STATE; +#if defined(CFG_CRYPTO_CCM) + struct tee_ccm_state *ccm; +#endif +#if defined(CFG_CRYPTO_GCM) + struct tee_gcm_state *gcm; +#endif + int ltc_res; + uint8_t dst_tag[TEE_xCM_TAG_MAX_LENGTH]; + unsigned long ltc_tag_len = tag_len; + + if (tag_len == 0) + return TEE_ERROR_SHORT_BUFFER; + if (tag_len > TEE_xCM_TAG_MAX_LENGTH) + return TEE_ERROR_BAD_STATE; + + /* Process the last buffer, if any */ + res = authenc_update_payload(ctx, algo, TEE_MODE_DECRYPT, src_data, + src_len, dst_data, dst_len); + if (res != TEE_SUCCESS) + return res; + + switch (algo) { +#if defined(CFG_CRYPTO_CCM) + case TEE_ALG_AES_CCM: + /* Finalize the authentication */ + ccm = ctx; + ltc_res = ccm_done(&ccm->ctx, dst_tag, <c_tag_len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + break; +#endif +#if defined(CFG_CRYPTO_GCM) + case TEE_ALG_AES_GCM: + /* Finalize the authentication */ + gcm = ctx; + ltc_res = gcm_done(&gcm->ctx, dst_tag, <c_tag_len); + if (ltc_res != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + break; +#endif + default: + return TEE_ERROR_NOT_SUPPORTED; + } + + if (buf_compare_ct(dst_tag, tag, tag_len) != 0) + res = TEE_ERROR_MAC_INVALID; + else + res = TEE_SUCCESS; + return res; +} + +static void authenc_final(void *ctx, uint32_t algo) +{ +#if defined(CFG_CRYPTO_CCM) + struct tee_ccm_state *ccm; +#endif +#if defined(CFG_CRYPTO_GCM) + struct tee_gcm_state *gcm; +#endif + + switch (algo) { +#if defined(CFG_CRYPTO_CCM) + case TEE_ALG_AES_CCM: + ccm = ctx; + ccm_reset(&ccm->ctx); + break; +#endif +#if defined(CFG_CRYPTO_GCM) + case TEE_ALG_AES_GCM: + gcm = ctx; + gcm_reset(&gcm->ctx); + break; +#endif + default: + break; + } +} +#endif /* _CFG_CRYPTO_WITH_AUTHENC */ + +/****************************************************************************** + * Pseudo Random Number Generator + ******************************************************************************/ +static TEE_Result prng_read(void *buf, size_t blen) +{ + int err; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + err = prng_is_valid(prng->index); + + if (err != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + + if (prng_descriptor[prng->index]->read(buf, blen, &prng->state) != + (unsigned long)blen) + return TEE_ERROR_BAD_STATE; + + return TEE_SUCCESS; +} + +static TEE_Result prng_add_entropy(const uint8_t *inbuf, size_t len) +{ + int err; + struct tee_ltc_prng *prng = tee_ltc_get_prng(); + + err = prng_is_valid(prng->index); + + if (err != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + + err = prng_descriptor[prng->index]->add_entropy( + inbuf, len, &prng->state); + + if (err != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + + return TEE_SUCCESS; +} + +static TEE_Result tee_ltc_init(void) +{ +#if defined(_CFG_CRYPTO_WITH_ACIPHER) + tee_ltc_alloc_mpa(); +#endif + tee_ltc_reg_algs(); + + return tee_ltc_prng_init(tee_ltc_get_prng()); +} + +const struct crypto_ops crypto_ops = { + .name = "LibTomCrypt provider", + .init = tee_ltc_init, +#if defined(_CFG_CRYPTO_WITH_HASH) + .hash = { + .get_ctx_size = hash_get_ctx_size, + .init = hash_init, + .update = hash_update, + .final = hash_final, + }, +#endif +#if defined(_CFG_CRYPTO_WITH_CIPHER) + .cipher = { + .final = cipher_final, + .get_block_size = cipher_get_block_size, + .get_ctx_size = cipher_get_ctx_size, + .init = cipher_init, + .update = cipher_update, + }, +#endif +#if defined(_CFG_CRYPTO_WITH_MAC) + .mac = { + .get_ctx_size = mac_get_ctx_size, + .init = mac_init, + .update = mac_update, + .final = mac_final, + }, +#endif +#if defined(_CFG_CRYPTO_WITH_AUTHENC) + .authenc = { + .dec_final = authenc_dec_final, + .enc_final = authenc_enc_final, + .final = authenc_final, + .get_ctx_size = authenc_get_ctx_size, + .init = authenc_init, + .update_aad = authenc_update_aad, + .update_payload = authenc_update_payload, + }, +#endif +#if defined(_CFG_CRYPTO_WITH_ACIPHER) + .acipher = { +#if defined(CFG_CRYPTO_RSA) + .alloc_rsa_keypair = alloc_rsa_keypair, + .alloc_rsa_public_key = alloc_rsa_public_key, + .free_rsa_public_key = free_rsa_public_key, + .gen_rsa_key = gen_rsa_key, + .rsaes_decrypt = rsaes_decrypt, + .rsaes_encrypt = rsaes_encrypt, + .rsanopad_decrypt = rsanopad_decrypt, + .rsanopad_encrypt = rsanopad_encrypt, + .rsassa_sign = rsassa_sign, + .rsassa_verify = rsassa_verify, +#endif +#if defined(CFG_CRYPTO_DH) + .alloc_dh_keypair = alloc_dh_keypair, + .gen_dh_key = gen_dh_key, + .dh_shared_secret = do_dh_shared_secret, +#endif +#if defined(CFG_CRYPTO_DSA) + .alloc_dsa_keypair = alloc_dsa_keypair, + .alloc_dsa_public_key = alloc_dsa_public_key, + .gen_dsa_key = gen_dsa_key, + .dsa_sign = dsa_sign, + .dsa_verify = dsa_verify, +#endif +#if defined(CFG_CRYPTO_ECC) + /* ECDSA and ECDH */ + .alloc_ecc_keypair = alloc_ecc_keypair, + .alloc_ecc_public_key = alloc_ecc_public_key, + .gen_ecc_key = gen_ecc_key, + .free_ecc_public_key = free_ecc_public_key, + + /* ECDSA only */ + .ecc_sign = ecc_sign, + .ecc_verify = ecc_verify, + /* ECDH only */ + .ecc_shared_secret = do_ecc_shared_secret, +#endif + }, + .bignum = { + .allocate = bn_allocate, + .num_bytes = num_bytes, + .num_bits = num_bits, + .compare = compare, + .bn2bin = bn2bin, + .bin2bn = bin2bn, + .copy = copy, + .free = bn_free, + .clear = bn_clear + }, +#endif /* _CFG_CRYPTO_WITH_ACIPHER */ + .prng = { + .add_entropy = prng_add_entropy, + .read = prng_read, + } +}; + +#if defined(CFG_WITH_VFP) +void tomcrypt_arm_neon_enable(struct tomcrypt_arm_neon_state *state) +{ + state->state = thread_kernel_enable_vfp(); +} + +void tomcrypt_arm_neon_disable(struct tomcrypt_arm_neon_state *state) +{ + thread_kernel_disable_vfp(state->state); +} +#endif + +#if defined(CFG_CRYPTO_SHA256) +TEE_Result hash_sha256_check(const uint8_t *hash, const uint8_t *data, + size_t data_size) +{ + hash_state hs; + uint8_t digest[TEE_SHA256_HASH_SIZE]; + + if (sha256_init(&hs) != CRYPT_OK) + return TEE_ERROR_GENERIC; + if (sha256_process(&hs, data, data_size) != CRYPT_OK) + return TEE_ERROR_GENERIC; + if (sha256_done(&hs, digest) != CRYPT_OK) + return TEE_ERROR_GENERIC; + if (buf_compare_ct(digest, hash, sizeof(digest)) != 0) + return TEE_ERROR_SECURITY; + return TEE_SUCCESS; +} +#endif + +TEE_Result rng_generate(void *buffer, size_t len) +{ +#if defined(CFG_WITH_SOFTWARE_PRNG) +#ifdef _CFG_CRYPTO_WITH_FORTUNA_PRNG + int (*start)(prng_state *) = fortuna_start; + int (*ready)(prng_state *) = fortuna_ready; + unsigned long (*read)(unsigned char *, unsigned long, prng_state *) = + fortuna_read; +#else + int (*start)(prng_state *) = rc4_start; + int (*ready)(prng_state *) = rc4_ready; + unsigned long (*read)(unsigned char *, unsigned long, prng_state *) = + rc4_read; +#endif + + if (!_tee_ltc_prng.inited) { + if (start(&_tee_ltc_prng.state) != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + if (ready(&_tee_ltc_prng.state) != CRYPT_OK) + return TEE_ERROR_BAD_STATE; + _tee_ltc_prng.inited = true; + } + if (read(buffer, len, &_tee_ltc_prng.state) != len) + return TEE_ERROR_BAD_STATE; + return TEE_SUCCESS; + + +#else + return get_rng_array(buffer, len); +#endif +} diff --git a/core/lib/libtomcrypt/sub.mk b/core/lib/libtomcrypt/sub.mk new file mode 100644 index 0000000..e1cfa65 --- /dev/null +++ b/core/lib/libtomcrypt/sub.mk @@ -0,0 +1,128 @@ +CFG_CRYPTO ?= y +CFG_CRYPTO_SIZE_OPTIMIZATION ?= y + +ifeq (y,$(CFG_CRYPTO)) + +# Ciphers +CFG_CRYPTO_AES ?= y +CFG_CRYPTO_DES ?= y + +# Cipher block modes +CFG_CRYPTO_ECB ?= y +CFG_CRYPTO_CBC ?= y +CFG_CRYPTO_CTR ?= y +CFG_CRYPTO_CTS ?= y +CFG_CRYPTO_XTS ?= y + +# Message authentication codes +CFG_CRYPTO_HMAC ?= y +CFG_CRYPTO_CMAC ?= y +CFG_CRYPTO_CBC_MAC ?= y + +# Hashes +CFG_CRYPTO_MD5 ?= y +CFG_CRYPTO_SHA1 ?= y +CFG_CRYPTO_SHA224 ?= y +CFG_CRYPTO_SHA256 ?= y +CFG_CRYPTO_SHA384 ?= y +CFG_CRYPTO_SHA512 ?= y + +# Asymmetric ciphers +CFG_CRYPTO_DSA ?= y +CFG_CRYPTO_RSA ?= y +CFG_CRYPTO_DH ?= y +CFG_CRYPTO_ECC ?= y + +# Authenticated encryption +CFG_CRYPTO_CCM ?= y +CFG_CRYPTO_GCM ?= y + +endif + +ifeq ($(CFG_WITH_PAGER),y) +ifneq ($(CFG_CRYPTO_SHA256),y) +$(warning Warning: Enabling CFG_CRYPTO_SHA256 [required by CFG_WITH_PAGER]) +CFG_CRYPTO_SHA256:=y +endif +endif + +ifeq ($(CFG_CRYPTO_WITH_CE),y) +ifeq ($(CFG_ARM32_core),y) +CFG_CRYPTO_AES_ARM32_CE ?= $(CFG_CRYPTO_AES) +CFG_CRYPTO_SHA1_ARM32_CE ?= $(CFG_CRYPTO_SHA1) +CFG_CRYPTO_SHA256_ARM32_CE ?= $(CFG_CRYPTO_SHA256) +endif +ifeq ($(CFG_ARM64_core),y) +CFG_CRYPTO_AES_ARM64_CE ?= $(CFG_CRYPTO_AES) +CFG_CRYPTO_SHA1_ARM64_CE ?= $(CFG_CRYPTO_SHA1) +CFG_CRYPTO_SHA256_ARM64_CE ?= $(CFG_CRYPTO_SHA256) +endif +endif + +# Cryptographic extensions can only be used safely when OP-TEE knows how to +# preserve the VFP context +ifeq ($(CFG_CRYPTO_SHA256_ARM32_CE),y) +$(call force,CFG_WITH_VFP,y,required by CFG_CRYPTO_SHA256_ARM32_CE) +endif +ifeq ($(CFG_CRYPTO_SHA256_ARM64_CE),y) +$(call force,CFG_WITH_VFP,y,required by CFG_CRYPTO_SHA256_ARM64_CE) +endif +ifeq ($(CFG_CRYPTO_SHA1_ARM32_CE),y) +$(call force,CFG_WITH_VFP,y,required by CFG_CRYPTO_SHA1_ARM32_CE) +endif +ifeq ($(CFG_CRYPTO_SHA1_ARM64_CE),y) +$(call force,CFG_WITH_VFP,y,required by CFG_CRYPTO_SHA1_ARM64_CE) +endif +ifeq ($(CFG_CRYPTO_AES_ARM64_CE),y) +$(call force,CFG_WITH_VFP,y,required by CFG_CRYPTO_AES_ARM64_CE) +endif + +cryp-enable-all-depends = $(call cfg-enable-all-depends,$(strip $(1)),$(foreach v,$(2),CFG_CRYPTO_$(v))) +$(eval $(call cryp-enable-all-depends,CFG_REE_FS, AES ECB CTR HMAC SHA256 GCM)) +$(eval $(call cryp-enable-all-depends,CFG_SQL_FS, AES ECB CTR HMAC SHA256 GCM)) +$(eval $(call cryp-enable-all-depends,CFG_RPMB_FS, AES ECB CTR HMAC SHA256 GCM)) + +# Dependency checks: warn and disable some features if dependencies are not met + +cryp-dep-one = $(call cfg-depends-one,CFG_CRYPTO_$(strip $(1)),$(patsubst %, CFG_CRYPTO_%,$(strip $(2)))) +cryp-dep-all = $(call cfg-depends-all,CFG_CRYPTO_$(strip $(1)),$(patsubst %, CFG_CRYPTO_%,$(strip $(2)))) + +$(eval $(call cryp-dep-one, ECB, AES DES)) +$(eval $(call cryp-dep-one, CBC, AES DES)) +$(eval $(call cryp-dep-one, CTR, AES)) +# CTS is implemented with ECB and CBC +$(eval $(call cryp-dep-all, CTS, AES ECB CBC)) +$(eval $(call cryp-dep-one, XTS, AES)) +$(eval $(call cryp-dep-one, HMAC, AES DES)) +$(eval $(call cryp-dep-one, HMAC, MD5 SHA1 SHA224 SHA256 SHA384 SHA512)) +$(eval $(call cryp-dep-one, CMAC, AES)) +$(eval $(call cryp-dep-one, CBC_MAC, AES DES)) +$(eval $(call cryp-dep-one, CCM, AES)) +$(eval $(call cryp-dep-one, GCM, AES)) +# If no AES cipher mode is left, disable AES +$(eval $(call cryp-dep-one, AES, ECB CBC CTR CTS XTS)) +# If no DES cipher mode is left, disable DES +$(eval $(call cryp-dep-one, DES, ECB CBC)) + +# dsa_make_params() needs all three SHA-2 algorithms. +# Disable DSA if any is missing. +$(eval $(call cryp-dep-all, DSA, SHA256 SHA384 SHA512)) + +cryp-one-enabled = $(call cfg-one-enabled,$(foreach v,$(1),CFG_CRYPTO_$(v))) +cryp-all-enabled = $(call cfg-all-enabled,$(foreach v,$(1),CFG_CRYPTO_$(v))) + +_CFG_CRYPTO_WITH_ACIPHER := $(call cryp-one-enabled, RSA DSA DH ECC) +_CFG_CRYPTO_WITH_AUTHENC := $(and $(filter y,$(CFG_CRYPTO_AES)), $(call cryp-one-enabled, CCM GCM)) +_CFG_CRYPTO_WITH_CIPHER := $(call cryp-one-enabled, AES DES) +_CFG_CRYPTO_WITH_HASH := $(call cryp-one-enabled, MD5 SHA1 SHA224 SHA256 SHA384 SHA512) +_CFG_CRYPTO_WITH_MAC := $(call cryp-one-enabled, HMAC CMAC CBC_MAC) +_CFG_CRYPTO_WITH_CBC := $(call cryp-one-enabled, CBC CBC_MAC) +_CFG_CRYPTO_WITH_ASN1 := $(call cryp-one-enabled, RSA DSA ECC) +_CFG_CRYPTO_WITH_FORTUNA_PRNG := $(call cryp-all-enabled, AES SHA256) + +cppflags-lib-$(CFG_CRYPTO_SIZE_OPTIMIZATION) += -DLTC_SMALL_CODE +cflags-lib-$(CFG_CRYPTO_SIZE_OPTIMIZATION) += -Os + +global-incdirs-y += include + +subdirs-y += src |